| shared_writable_dirs: | |
| - /labs/tiles | |
| - /lib/staticmaplite/cache | |
| php_extensions: [pgsql, pdo, pdo_pgsql, curl] | |
| /labs/tiles/12 | |
| /labs/tiles/13 | |
| /labs/tiles/14 | |
| /labs/tiles/15 | |
| /labs/tiles/16 | |
| /labs/tiles/17 | |
| /labs/tiles/19 | |
| /nbproject/private/ |
| <?php | <?php |
| /* | |
| * Copyright 2010,2011 Alexander Sadleir | |
| Licensed under the Apache License, Version 2.0 (the "License"); | |
| you may not use this file except in compliance with the License. | |
| You may obtain a copy of the License at | |
| http://www.apache.org/licenses/LICENSE-2.0 | |
| Unless required by applicable law or agreed to in writing, software | |
| distributed under the License is distributed on an "AS IS" BASIS, | |
| WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. | |
| See the License for the specific language governing permissions and | |
| limitations under the License. | |
| */ | |
| include ('include/common.inc.php'); | include ('include/common.inc.php'); |
| include_header("About", "about") | include_header("About", "about") |
| ?> | ?> |
| <p> | <p> |
| Busness Time - An ACT bus timetable webapp<br /> | Busness Time - An ACT bus timetable webapp<br /> |
| Based on the maxious-canberra-transit-feed (<a | Based on the maxious-canberra-transit-feed (<a |
| href="http://s3-ap-southeast-1.amazonaws.com/busresources/cbrfeed.zip">download</a>, | href="http://s3-ap-southeast-1.amazonaws.com/busresources/cbrfeed.zip">download</a>, |
| last updated <?php | last updated <?php echo date("F d Y.", @filemtime('cbrfeed.zip')); ?>)<br /> |
| echo date("F d Y.", @filemtime('cbrfeed.zip')); ?>)<br /> | Source code for the <a |
| Source code for the <a | href="https://github.com/maxious/ACTBus-data">transit |
| href="https://github.com/maxious/ACTBus-data">transit | feed</a> and <a href="https://github.com/maxious/ACTBus-ui">this |
| feed</a> and <a href="https://github.com/maxious/ACTBus-ui">this | site</a> available from github.<br /> |
| site</a> available from github.<br /> | Uses jQuery Mobile, PHP, PostgreSQL, OpenTripPlanner, OpenLayers, OpenStreetMap, Cloudmade Geocoder and Tile Service<br /> |
| Uses jQuery Mobile, PHP, PostgreSQL, OpenTripPlanner, OpenLayers, OpenStreetMap, Cloudmade Geocoder and Tile Service<br /> | Suburb Geocoding Based on <A href="http://www.abs.gov.au/AUSSTATS/abs@.nsf/Lookup/1270.0.55.003Main+Features1July%202011?OpenDocument">Australian Bureau of Statistics data.</a><br /> |
| <br /> | Street geocoding based on work by OpenStreetMap contributors<br> |
| Feedback encouraged; contact maxious@lambdacomplex.org<br /> | |
| <br /> | <br /> |
| Some icons by Joseph Wain / glyphish.com<br /> | Feedback encouraged; contact maxious@lambdacomplex.org<br /> |
| <br /> | <br /> |
| <small>Disclaimer: The content of this website is of a general and informative nature. Please check with printed timetables or those available on http://action.act.gov.au before your trip. | Some icons by Joseph Wain / glyphish.com<br /> |
| Whilst every effort has been made to ensure the high quality and accuracy of the Site, the Author makes no warranty, | Native clients also available for iPhone(<a href="http://itunes.apple.com/au/app/cbrtimetable/id444287349?mt=8">cbrTimetable by Sandor Kolotenko</a> |
| express or implied concerning the topicality, correctness, completeness or quality of the information, which is provided | , <a href="http://itunes.apple.com/au/app/act-buses/id376634797?mt=8">ACT Buses by David Sullivan</a>) |
| "as is". The Author expressly disclaims all warranties, including but not limited to warranties of fitness for a particular purpose and warranties of merchantability. | and Android (<a href="https://market.android.com/details?id=com.action">MyBus 2.0 by Imagine Team</a>) |
| All offers are not binding and without obligation. The Author expressly reserves the right, in his discretion, to suspend, | <br /> |
| change, modify, add or remove portions of the Site and to restrict or terminate the use and accessibility of the Site | GTFS-realtime API: |
| without prior notice. </small> | Alerts and Trip Updates (but only Cancelled or Stop Skipped) |
| <?php | Default format binary Protocol Buffer but can get JSON by adding ?ascii=yes |
| include_footer(); | <br /> |
| ?> | <br /> |
| <small>Disclaimer: The content of this website is of a general and informative nature. Please check with printed timetables or those available on http://action.act.gov.au before your trip. | |
| Whilst every effort has been made to ensure the high quality and accuracy of the Site, the Author makes no warranty, | |
| express or implied concerning the topicality, correctness, completeness or quality of the information, which is provided | |
| "as is". The Author expressly disclaims all warranties, including but not limited to warranties of fitness for a particular purpose and warranties of merchantability. | |
| All offers are not binding and without obligation. The Author expressly reserves the right, in his discretion, to suspend, | |
| change, modify, add or remove portions of the Site and to restrict or terminate the use and accessibility of the Site | |
| without prior notice. </small> | |
| <?php | |
| include_footer(); | |
| ?> | |
| #!/bin/bash | #!/bin/bash |
| #this script should be run from a fresh git checkout from github | #this script should be run from a fresh git checkout from github |
| #ami base must have yum install lighttpd-fastcgi, git, tomcat6 | #ami base must have yum install lighttpd-fastcgi, git, tomcat6 |
| #php-cli php-gd tomcat6-webapps tomcat6-admin-webapps svn maven2 | #php-cli php-gd tomcat6-webapps tomcat6-admin-webapps svn maven2 |
| #postgres postgres-server php-pg | #postgres postgres-server php-pg |
| #http://www.how2forge.org/installing-lighttpd-with-php5-and-mysql-support-on-fedora-12 | #http://www.how2forge.org/installing-lighttpd-with-php5-and-mysql-support-on-fedora-12 |
| cp /root/aws.php /tmp/ | sh busuiphp.sh |
| mkdir /var/www/lib/staticmaplite/cache | sh busuidb.sh |
| chcon -h system_u:object_r:httpd_sys_content_t /var/www | sh busuiotp.sh |
| chcon -R -h root:object_r:httpd_sys_content_t /var/www/* | |
| chcon -R -t httpd_sys_content_rw_t /var/www/lib/staticmaplite/cache | |
| chmod -R 777 /var/www/lib/staticmaplite/cache | |
| chcon -R -t httpd_sys_content_rw_t /var/www/labs/tiles | |
| chmod -R 777 /var/www/labs/tiles | |
| wget http://s3-ap-southeast-1.amazonaws.com/busresources/cbrfeed.zip \ | |
| -O /var/www/cbrfeed.zip | |
| createdb transitdata | |
| createlang -d transitdata plpgsql | |
| psql -d transitdata -f /var/www/lib/postgis.sql | |
| # curl https://github.com/maxious/ACTBus-ui/raw/master/transitdata.cbrfeed.sql.gz -o transitdata.cbrfeed.sql.gz | |
| #made with pg_dump transitdata | gzip -c > transitdata.cbrfeed.sql.gz | |
| gunzip /var/www/transitdata.cbrfeed.sql.gz | |
| psql -d transitdata -f /var/www/transitdata.cbrfeed.sql | |
| #createuser transitdata -SDRP | |
| #password transitdata | |
| #psql -d transitdata -c \"GRANT SELECT ON TABLE agency,calendar,calendar_dates,routes,stop_times,stops,trips TO transitdata;\" | |
| php /var/www/updatedb.php | |
| wget http://s3-ap-southeast-1.amazonaws.com/busresources/Graph.obj \ | |
| -O /tmp/Graph.obj | |
| rm -rfv /usr/share/tomcat6/webapps/opentripplanner* | |
| wget http://s3-ap-southeast-1.amazonaws.com/busresources/opentripplanner-webapp.war \ | |
| -O /usr/share/tomcat6/webapps/opentripplanner-webapp.war | |
| wget http://s3-ap-southeast-1.amazonaws.com/busresources/opentripplanner-api-webapp.war \ | |
| -O /usr/share/tomcat6/webapps/opentripplanner-api-webapp.war | |
| /etc/init.d/tomcat6 restart | |
| createdb transitdata | |
| createlang -d transitdata plpgsql | |
| psql -d transitdata -f /var/www/lib/postgis.sql | |
| # curl https://github.com/maxious/ACTBus-ui/raw/master/transitdata.cbrfeed.sql.gz -o transitdata.cbrfeed.sql.gz | |
| #made with pg_dump transitdata | gzip -c > transitdata.cbrfeed.sql.gz | |
| gunzip /var/www/transitdata.cbrfeed.sql.gz | |
| psql -d transitdata -f /var/www/transitdata.cbrfeed.sql | |
| #createuser transitdata -SDRP | |
| #password transitdata | |
| #psql -d transitdata -c "GRANT SELECT ON TABLE agency,calendar,calendar_dates,routes,stop_times,stops,trips TO transitdata;" | |
| #psql -d transitdata -c "GRANT SELECT,INSERT ON TABLE myway_observations,myway_routes,myway_stops,myway_timingdeltas TO transitdata;" | |
| #psql -d transitdata -c "GRANT SELECT,INSERT,UPDATE ON TABLE myway_routes,myway_stops TO transitdata;" | |
| ##psql -d transitdata -c "GRANT SELECT ON ALL TABLES IN SCHEMA public TO transitdata;" | |
| php /var/www/updatedb.php |
| wget http://s3-ap-southeast-1.amazonaws.com/busresources/Graph.obj \ | |
| -O /tmp/Graph.obj | |
| /etc/init.d/tomcat6 stop | |
| rm -rfv /usr/share/tomcat6/webapps/opentripplanner* | |
| wget http://s3-ap-southeast-1.amazonaws.com/busresources/opentripplanner-webapp.war \ | |
| -O /usr/share/tomcat6/webapps/opentripplanner-webapp.war | |
| wget http://s3-ap-southeast-1.amazonaws.com/busresources/opentripplanner-api-webapp.war \ | |
| -O /usr/share/tomcat6/webapps/opentripplanner-api-webapp.war | |
| /etc/init.d/tomcat6 restart | |
| wget http://s3-ap-southeast-1.amazonaws.com/busresources/testing/Graph.obj \ | |
| -O /tmp/Graph.obj | |
| /etc/init.d/tomcat6 stop | |
| rm -rfv /usr/share/tomcat6/webapps/opentripplanner* | |
| wget http://s3-ap-southeast-1.amazonaws.com/busresources/testing/opentripplanner-webapp.war \ | |
| -O /usr/share/tomcat6/webapps/opentripplanner-webapp.war | |
| wget http://s3-ap-southeast-1.amazonaws.com/busresources/testing/opentripplanner-api-webapp.war \ | |
| -O /usr/share/tomcat6/webapps/opentripplanner-api-webapp.war | |
| /etc/init.d/tomcat6 restart | |
| cp /root/aws.php /tmp/ | |
| chmod 777 /var/cache/lighttpd/compress/ | |
| chcon -h system_u:object_r:httpd_sys_content_t /var/www | |
| chcon -R -h root:object_r:httpd_sys_content_t /var/www/* | |
| chcon -R -t httpd_sys_content_rw_t /var/www/labs/tiles | |
| chmod -R 777 /var/www/labs/tiles | |
| wget http://s3-ap-southeast-1.amazonaws.com/busresources/cbrfeed.zip \ | |
| -O /var/www/cbrfeed.zip | |
| <?xml version="1.0" encoding="UTF-8"?> | |
| <beans xmlns="http://www.springframework.org/schema/beans" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" | |
| xsi:schemaLocation="http://www.springframework.org/schema/beans http://www.springframework.org/schema/beans/spring-beans-2.5.xsd"> | |
| <!-- Single graph --> | |
| <import resource="classpath:org/opentripplanner/api/application-context.xml" /> | |
| <bean id="graphBundle" class="org.opentripplanner.model.GraphBundle"> | |
| <property name="path" value="/tmp/" /> | |
| </bean> | |
| </beans> | |
| -- | |
| -- PostgreSQL database dump | |
| -- | |
| -- Dumped from database version 9.0.4 | |
| -- Dumped by pg_dump version 9.0.4 | |
| -- Started on 2011-10-10 16:28:13 | |
| SET statement_timeout = 0; | |
| SET client_encoding = 'UTF8'; | |
| SET standard_conforming_strings = off; | |
| SET check_function_bodies = false; | |
| SET client_min_messages = warning; | |
| SET escape_string_warning = off; | |
| -- | |
| -- TOC entry 2766 (class 1262 OID 18349) | |
| -- Name: transitdata; Type: DATABASE; Schema: -; Owner: postgres | |
| -- | |
| CREATE DATABASE transitdata WITH TEMPLATE = template0 ENCODING = 'UTF8' LC_COLLATE = 'English_Australia.1252' LC_CTYPE = 'English_Australia.1252'; | |
| ALTER DATABASE transitdata OWNER TO postgres; | |
| \connect transitdata | |
| SET statement_timeout = 0; | |
| SET client_encoding = 'UTF8'; | |
| SET standard_conforming_strings = off; | |
| SET check_function_bodies = false; | |
| SET client_min_messages = warning; | |
| SET escape_string_warning = off; | |
| -- | |
| -- TOC entry 1167 (class 2612 OID 11574) | |
| -- Name: plpgsql; Type: PROCEDURAL LANGUAGE; Schema: -; Owner: postgres | |
| -- | |
| CREATE OR REPLACE PROCEDURAL LANGUAGE plpgsql; | |
| ALTER PROCEDURAL LANGUAGE plpgsql OWNER TO postgres; | |
| SET search_path = public, pg_catalog; | |
| -- | |
| -- TOC entry 1088 (class 0 OID 0) | |
| -- Name: box2d; Type: SHELL TYPE; Schema: public; Owner: postgres | |
| -- | |
| CREATE TYPE box2d; | |
| -- | |
| -- TOC entry 15 (class 1255 OID 18351) | |
| -- Dependencies: 6 1088 | |
| -- Name: box2d_in(cstring); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION box2d_in(cstring) RETURNS box2d | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'BOX2DFLOAT4_in'; | |
| ALTER FUNCTION public.box2d_in(cstring) OWNER TO postgres; | |
| -- | |
| -- TOC entry 19 (class 1255 OID 18352) | |
| -- Dependencies: 6 1088 | |
| -- Name: box2d_out(box2d); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION box2d_out(box2d) RETURNS cstring | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'BOX2DFLOAT4_out'; | |
| ALTER FUNCTION public.box2d_out(box2d) OWNER TO postgres; | |
| -- | |
| -- TOC entry 1087 (class 1247 OID 18350) | |
| -- Dependencies: 19 6 15 | |
| -- Name: box2d; Type: TYPE; Schema: public; Owner: postgres | |
| -- | |
| CREATE TYPE box2d ( | |
| INTERNALLENGTH = 16, | |
| INPUT = box2d_in, | |
| OUTPUT = box2d_out, | |
| ALIGNMENT = int4, | |
| STORAGE = plain | |
| ); | |
| ALTER TYPE public.box2d OWNER TO postgres; | |
| -- | |
| -- TOC entry 1091 (class 0 OID 0) | |
| -- Name: box3d; Type: SHELL TYPE; Schema: public; Owner: postgres | |
| -- | |
| CREATE TYPE box3d; | |
| -- | |
| -- TOC entry 20 (class 1255 OID 18355) | |
| -- Dependencies: 6 1091 | |
| -- Name: box3d_in(cstring); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION box3d_in(cstring) RETURNS box3d | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'BOX3D_in'; | |
| ALTER FUNCTION public.box3d_in(cstring) OWNER TO postgres; | |
| -- | |
| -- TOC entry 21 (class 1255 OID 18356) | |
| -- Dependencies: 6 1091 | |
| -- Name: box3d_out(box3d); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION box3d_out(box3d) RETURNS cstring | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'BOX3D_out'; | |
| ALTER FUNCTION public.box3d_out(box3d) OWNER TO postgres; | |
| -- | |
| -- TOC entry 1090 (class 1247 OID 18354) | |
| -- Dependencies: 20 6 21 | |
| -- Name: box3d; Type: TYPE; Schema: public; Owner: postgres | |
| -- | |
| CREATE TYPE box3d ( | |
| INTERNALLENGTH = 48, | |
| INPUT = box3d_in, | |
| OUTPUT = box3d_out, | |
| ALIGNMENT = double, | |
| STORAGE = plain | |
| ); | |
| ALTER TYPE public.box3d OWNER TO postgres; | |
| -- | |
| -- TOC entry 1094 (class 0 OID 0) | |
| -- Name: box3d_extent; Type: SHELL TYPE; Schema: public; Owner: postgres | |
| -- | |
| CREATE TYPE box3d_extent; | |
| -- | |
| -- TOC entry 22 (class 1255 OID 18359) | |
| -- Dependencies: 6 1094 | |
| -- Name: box3d_extent_in(cstring); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION box3d_extent_in(cstring) RETURNS box3d_extent | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'BOX3D_in'; | |
| ALTER FUNCTION public.box3d_extent_in(cstring) OWNER TO postgres; | |
| -- | |
| -- TOC entry 23 (class 1255 OID 18360) | |
| -- Dependencies: 6 1094 | |
| -- Name: box3d_extent_out(box3d_extent); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION box3d_extent_out(box3d_extent) RETURNS cstring | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'BOX3D_extent_out'; | |
| ALTER FUNCTION public.box3d_extent_out(box3d_extent) OWNER TO postgres; | |
| -- | |
| -- TOC entry 1093 (class 1247 OID 18358) | |
| -- Dependencies: 6 22 23 | |
| -- Name: box3d_extent; Type: TYPE; Schema: public; Owner: postgres | |
| -- | |
| CREATE TYPE box3d_extent ( | |
| INTERNALLENGTH = 48, | |
| INPUT = box3d_extent_in, | |
| OUTPUT = box3d_extent_out, | |
| ALIGNMENT = double, | |
| STORAGE = plain | |
| ); | |
| ALTER TYPE public.box3d_extent OWNER TO postgres; | |
| -- | |
| -- TOC entry 1097 (class 0 OID 0) | |
| -- Name: chip; Type: SHELL TYPE; Schema: public; Owner: postgres | |
| -- | |
| CREATE TYPE chip; | |
| -- | |
| -- TOC entry 24 (class 1255 OID 18363) | |
| -- Dependencies: 6 1097 | |
| -- Name: chip_in(cstring); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION chip_in(cstring) RETURNS chip | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'CHIP_in'; | |
| ALTER FUNCTION public.chip_in(cstring) OWNER TO postgres; | |
| -- | |
| -- TOC entry 25 (class 1255 OID 18364) | |
| -- Dependencies: 6 1097 | |
| -- Name: chip_out(chip); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION chip_out(chip) RETURNS cstring | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'CHIP_out'; | |
| ALTER FUNCTION public.chip_out(chip) OWNER TO postgres; | |
| -- | |
| -- TOC entry 1096 (class 1247 OID 18362) | |
| -- Dependencies: 6 25 24 | |
| -- Name: chip; Type: TYPE; Schema: public; Owner: postgres | |
| -- | |
| CREATE TYPE chip ( | |
| INTERNALLENGTH = variable, | |
| INPUT = chip_in, | |
| OUTPUT = chip_out, | |
| ALIGNMENT = double, | |
| STORAGE = extended | |
| ); | |
| ALTER TYPE public.chip OWNER TO postgres; | |
| -- | |
| -- TOC entry 1100 (class 0 OID 0) | |
| -- Name: geography; Type: SHELL TYPE; Schema: public; Owner: postgres | |
| -- | |
| CREATE TYPE geography; | |
| -- | |
| -- TOC entry 26 (class 1255 OID 18367) | |
| -- Dependencies: 6 | |
| -- Name: geography_analyze(internal); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geography_analyze(internal) RETURNS boolean | |
| LANGUAGE c STRICT | |
| AS '$libdir/postgis-1.5', 'geography_analyze'; | |
| ALTER FUNCTION public.geography_analyze(internal) OWNER TO postgres; | |
| -- | |
| -- TOC entry 27 (class 1255 OID 18368) | |
| -- Dependencies: 6 1100 | |
| -- Name: geography_in(cstring, oid, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geography_in(cstring, oid, integer) RETURNS geography | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'geography_in'; | |
| ALTER FUNCTION public.geography_in(cstring, oid, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 28 (class 1255 OID 18369) | |
| -- Dependencies: 6 1100 | |
| -- Name: geography_out(geography); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geography_out(geography) RETURNS cstring | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'geography_out'; | |
| ALTER FUNCTION public.geography_out(geography) OWNER TO postgres; | |
| -- | |
| -- TOC entry 29 (class 1255 OID 18370) | |
| -- Dependencies: 6 | |
| -- Name: geography_typmod_in(cstring[]); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geography_typmod_in(cstring[]) RETURNS integer | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'geography_typmod_in'; | |
| ALTER FUNCTION public.geography_typmod_in(cstring[]) OWNER TO postgres; | |
| -- | |
| -- TOC entry 30 (class 1255 OID 18371) | |
| -- Dependencies: 6 | |
| -- Name: geography_typmod_out(integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geography_typmod_out(integer) RETURNS cstring | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'geography_typmod_out'; | |
| ALTER FUNCTION public.geography_typmod_out(integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 1099 (class 1247 OID 18366) | |
| -- Dependencies: 30 29 26 6 27 28 | |
| -- Name: geography; Type: TYPE; Schema: public; Owner: postgres | |
| -- | |
| CREATE TYPE geography ( | |
| INTERNALLENGTH = variable, | |
| INPUT = geography_in, | |
| OUTPUT = geography_out, | |
| TYPMOD_IN = geography_typmod_in, | |
| TYPMOD_OUT = geography_typmod_out, | |
| ANALYZE = geography_analyze, | |
| ALIGNMENT = double, | |
| STORAGE = main | |
| ); | |
| ALTER TYPE public.geography OWNER TO postgres; | |
| -- | |
| -- TOC entry 1103 (class 0 OID 0) | |
| -- Name: geometry; Type: SHELL TYPE; Schema: public; Owner: postgres | |
| -- | |
| CREATE TYPE geometry; | |
| -- | |
| -- TOC entry 31 (class 1255 OID 18374) | |
| -- Dependencies: 6 | |
| -- Name: geometry_analyze(internal); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geometry_analyze(internal) RETURNS boolean | |
| LANGUAGE c STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_analyze'; | |
| ALTER FUNCTION public.geometry_analyze(internal) OWNER TO postgres; | |
| -- | |
| -- TOC entry 32 (class 1255 OID 18375) | |
| -- Dependencies: 6 1103 | |
| -- Name: geometry_in(cstring); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geometry_in(cstring) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_in'; | |
| ALTER FUNCTION public.geometry_in(cstring) OWNER TO postgres; | |
| -- | |
| -- TOC entry 33 (class 1255 OID 18376) | |
| -- Dependencies: 6 1103 | |
| -- Name: geometry_out(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geometry_out(geometry) RETURNS cstring | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_out'; | |
| ALTER FUNCTION public.geometry_out(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 34 (class 1255 OID 18377) | |
| -- Dependencies: 6 1103 | |
| -- Name: geometry_recv(internal); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geometry_recv(internal) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_recv'; | |
| ALTER FUNCTION public.geometry_recv(internal) OWNER TO postgres; | |
| -- | |
| -- TOC entry 35 (class 1255 OID 18378) | |
| -- Dependencies: 6 1103 | |
| -- Name: geometry_send(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geometry_send(geometry) RETURNS bytea | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_send'; | |
| ALTER FUNCTION public.geometry_send(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 1102 (class 1247 OID 18373) | |
| -- Dependencies: 6 31 35 34 33 32 | |
| -- Name: geometry; Type: TYPE; Schema: public; Owner: postgres | |
| -- | |
| CREATE TYPE geometry ( | |
| INTERNALLENGTH = variable, | |
| INPUT = geometry_in, | |
| OUTPUT = geometry_out, | |
| RECEIVE = geometry_recv, | |
| SEND = geometry_send, | |
| ANALYZE = geometry_analyze, | |
| DELIMITER = ':', | |
| ALIGNMENT = int4, | |
| STORAGE = main | |
| ); | |
| ALTER TYPE public.geometry OWNER TO postgres; | |
| -- | |
| -- TOC entry 1105 (class 1247 OID 18382) | |
| -- Dependencies: 6 2407 | |
| -- Name: geometry_dump; Type: TYPE; Schema: public; Owner: postgres | |
| -- | |
| CREATE TYPE geometry_dump AS ( | |
| path integer[], | |
| geom geometry | |
| ); | |
| ALTER TYPE public.geometry_dump OWNER TO postgres; | |
| -- | |
| -- TOC entry 1108 (class 0 OID 0) | |
| -- Name: gidx; Type: SHELL TYPE; Schema: public; Owner: postgres | |
| -- | |
| CREATE TYPE gidx; | |
| -- | |
| -- TOC entry 36 (class 1255 OID 18384) | |
| -- Dependencies: 6 1108 | |
| -- Name: gidx_in(cstring); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION gidx_in(cstring) RETURNS gidx | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'gidx_in'; | |
| ALTER FUNCTION public.gidx_in(cstring) OWNER TO postgres; | |
| -- | |
| -- TOC entry 37 (class 1255 OID 18385) | |
| -- Dependencies: 6 1108 | |
| -- Name: gidx_out(gidx); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION gidx_out(gidx) RETURNS cstring | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'gidx_out'; | |
| ALTER FUNCTION public.gidx_out(gidx) OWNER TO postgres; | |
| -- | |
| -- TOC entry 1107 (class 1247 OID 18383) | |
| -- Dependencies: 37 6 36 | |
| -- Name: gidx; Type: TYPE; Schema: public; Owner: postgres | |
| -- | |
| CREATE TYPE gidx ( | |
| INTERNALLENGTH = variable, | |
| INPUT = gidx_in, | |
| OUTPUT = gidx_out, | |
| ALIGNMENT = double, | |
| STORAGE = plain | |
| ); | |
| ALTER TYPE public.gidx OWNER TO postgres; | |
| -- | |
| -- TOC entry 1111 (class 0 OID 0) | |
| -- Name: pgis_abs; Type: SHELL TYPE; Schema: public; Owner: postgres | |
| -- | |
| CREATE TYPE pgis_abs; | |
| -- | |
| -- TOC entry 38 (class 1255 OID 18388) | |
| -- Dependencies: 6 1111 | |
| -- Name: pgis_abs_in(cstring); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION pgis_abs_in(cstring) RETURNS pgis_abs | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'pgis_abs_in'; | |
| ALTER FUNCTION public.pgis_abs_in(cstring) OWNER TO postgres; | |
| -- | |
| -- TOC entry 39 (class 1255 OID 18389) | |
| -- Dependencies: 6 1111 | |
| -- Name: pgis_abs_out(pgis_abs); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION pgis_abs_out(pgis_abs) RETURNS cstring | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'pgis_abs_out'; | |
| ALTER FUNCTION public.pgis_abs_out(pgis_abs) OWNER TO postgres; | |
| -- | |
| -- TOC entry 1110 (class 1247 OID 18387) | |
| -- Dependencies: 39 38 6 | |
| -- Name: pgis_abs; Type: TYPE; Schema: public; Owner: postgres | |
| -- | |
| CREATE TYPE pgis_abs ( | |
| INTERNALLENGTH = 8, | |
| INPUT = pgis_abs_in, | |
| OUTPUT = pgis_abs_out, | |
| ALIGNMENT = double, | |
| STORAGE = plain | |
| ); | |
| ALTER TYPE public.pgis_abs OWNER TO postgres; | |
| -- | |
| -- TOC entry 1114 (class 0 OID 0) | |
| -- Name: spheroid; Type: SHELL TYPE; Schema: public; Owner: postgres | |
| -- | |
| CREATE TYPE spheroid; | |
| -- | |
| -- TOC entry 40 (class 1255 OID 18392) | |
| -- Dependencies: 6 1114 | |
| -- Name: spheroid_in(cstring); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION spheroid_in(cstring) RETURNS spheroid | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'ellipsoid_in'; | |
| ALTER FUNCTION public.spheroid_in(cstring) OWNER TO postgres; | |
| -- | |
| -- TOC entry 41 (class 1255 OID 18393) | |
| -- Dependencies: 6 1114 | |
| -- Name: spheroid_out(spheroid); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION spheroid_out(spheroid) RETURNS cstring | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'ellipsoid_out'; | |
| ALTER FUNCTION public.spheroid_out(spheroid) OWNER TO postgres; | |
| -- | |
| -- TOC entry 1113 (class 1247 OID 18391) | |
| -- Dependencies: 41 6 40 | |
| -- Name: spheroid; Type: TYPE; Schema: public; Owner: postgres | |
| -- | |
| CREATE TYPE spheroid ( | |
| INTERNALLENGTH = 65, | |
| INPUT = spheroid_in, | |
| OUTPUT = spheroid_out, | |
| ALIGNMENT = double, | |
| STORAGE = plain | |
| ); | |
| ALTER TYPE public.spheroid OWNER TO postgres; | |
| -- | |
| -- TOC entry 42 (class 1255 OID 18395) | |
| -- Dependencies: 6 1102 | |
| -- Name: _st_asgeojson(integer, geometry, integer, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION _st_asgeojson(integer, geometry, integer, integer) RETURNS text | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_asGeoJson'; | |
| ALTER FUNCTION public._st_asgeojson(integer, geometry, integer, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 43 (class 1255 OID 18396) | |
| -- Dependencies: 6 1099 | |
| -- Name: _st_asgeojson(integer, geography, integer, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION _st_asgeojson(integer, geography, integer, integer) RETURNS text | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'geography_as_geojson'; | |
| ALTER FUNCTION public._st_asgeojson(integer, geography, integer, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 44 (class 1255 OID 18397) | |
| -- Dependencies: 1102 6 | |
| -- Name: _st_asgml(integer, geometry, integer, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION _st_asgml(integer, geometry, integer, integer) RETURNS text | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_asGML'; | |
| ALTER FUNCTION public._st_asgml(integer, geometry, integer, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 45 (class 1255 OID 18398) | |
| -- Dependencies: 6 1099 | |
| -- Name: _st_asgml(integer, geography, integer, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION _st_asgml(integer, geography, integer, integer) RETURNS text | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'geography_as_gml'; | |
| ALTER FUNCTION public._st_asgml(integer, geography, integer, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 46 (class 1255 OID 18399) | |
| -- Dependencies: 6 1102 | |
| -- Name: _st_askml(integer, geometry, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION _st_askml(integer, geometry, integer) RETURNS text | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_asKML'; | |
| ALTER FUNCTION public._st_askml(integer, geometry, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 47 (class 1255 OID 18400) | |
| -- Dependencies: 6 1099 | |
| -- Name: _st_askml(integer, geography, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION _st_askml(integer, geography, integer) RETURNS text | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'geography_as_kml'; | |
| ALTER FUNCTION public._st_askml(integer, geography, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 49 (class 1255 OID 18402) | |
| -- Dependencies: 6 1099 | |
| -- Name: _st_bestsrid(geography); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION _st_bestsrid(geography) RETURNS integer | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT _ST_BestSRID($1,$1)$_$; | |
| ALTER FUNCTION public._st_bestsrid(geography) OWNER TO postgres; | |
| -- | |
| -- TOC entry 48 (class 1255 OID 18401) | |
| -- Dependencies: 1099 6 1099 | |
| -- Name: _st_bestsrid(geography, geography); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION _st_bestsrid(geography, geography) RETURNS integer | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'geography_bestsrid'; | |
| ALTER FUNCTION public._st_bestsrid(geography, geography) OWNER TO postgres; | |
| -- | |
| -- TOC entry 50 (class 1255 OID 18403) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: _st_buffer(geometry, double precision, cstring); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION _st_buffer(geometry, double precision, cstring) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT COST 100 | |
| AS '$libdir/postgis-1.5', 'buffer'; | |
| ALTER FUNCTION public._st_buffer(geometry, double precision, cstring) OWNER TO postgres; | |
| -- | |
| -- TOC entry 51 (class 1255 OID 18404) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: _st_contains(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION _st_contains(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT COST 100 | |
| AS '$libdir/postgis-1.5', 'contains'; | |
| ALTER FUNCTION public._st_contains(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 52 (class 1255 OID 18405) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: _st_containsproperly(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION _st_containsproperly(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT COST 100 | |
| AS '$libdir/postgis-1.5', 'containsproperly'; | |
| ALTER FUNCTION public._st_containsproperly(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 53 (class 1255 OID 18406) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: _st_coveredby(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION _st_coveredby(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT COST 100 | |
| AS '$libdir/postgis-1.5', 'coveredby'; | |
| ALTER FUNCTION public._st_coveredby(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 54 (class 1255 OID 18407) | |
| -- Dependencies: 1102 1102 6 | |
| -- Name: _st_covers(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION _st_covers(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT COST 100 | |
| AS '$libdir/postgis-1.5', 'covers'; | |
| ALTER FUNCTION public._st_covers(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 55 (class 1255 OID 18408) | |
| -- Dependencies: 1099 1099 6 | |
| -- Name: _st_covers(geography, geography); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION _st_covers(geography, geography) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT COST 100 | |
| AS '$libdir/postgis-1.5', 'geography_covers'; | |
| ALTER FUNCTION public._st_covers(geography, geography) OWNER TO postgres; | |
| -- | |
| -- TOC entry 56 (class 1255 OID 18409) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: _st_crosses(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION _st_crosses(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT COST 100 | |
| AS '$libdir/postgis-1.5', 'crosses'; | |
| ALTER FUNCTION public._st_crosses(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 57 (class 1255 OID 18410) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: _st_dfullywithin(geometry, geometry, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION _st_dfullywithin(geometry, geometry, double precision) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_dfullywithin'; | |
| ALTER FUNCTION public._st_dfullywithin(geometry, geometry, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 58 (class 1255 OID 18411) | |
| -- Dependencies: 1099 1099 6 | |
| -- Name: _st_distance(geography, geography, double precision, boolean); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION _st_distance(geography, geography, double precision, boolean) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT COST 100 | |
| AS '$libdir/postgis-1.5', 'geography_distance'; | |
| ALTER FUNCTION public._st_distance(geography, geography, double precision, boolean) OWNER TO postgres; | |
| -- | |
| -- TOC entry 59 (class 1255 OID 18412) | |
| -- Dependencies: 1102 6 1167 1105 | |
| -- Name: _st_dumppoints(geometry, integer[]); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION _st_dumppoints(the_geom geometry, cur_path integer[]) RETURNS SETOF geometry_dump | |
| LANGUAGE plpgsql | |
| AS $$ | |
| DECLARE | |
| tmp geometry_dump; | |
| tmp2 geometry_dump; | |
| nb_points integer; | |
| nb_geom integer; | |
| i integer; | |
| j integer; | |
| g geometry; | |
| BEGIN | |
| RAISE DEBUG '%,%', cur_path, ST_GeometryType(the_geom); | |
| -- Special case (MULTI* OR GEOMETRYCOLLECTION) : iterate and return the DumpPoints of the geometries | |
| SELECT ST_NumGeometries(the_geom) INTO nb_geom; | |
| IF (nb_geom IS NOT NULL) THEN | |
| i = 1; | |
| FOR tmp2 IN SELECT (ST_Dump(the_geom)).* LOOP | |
| FOR tmp IN SELECT * FROM _ST_DumpPoints(tmp2.geom, cur_path || tmp2.path) LOOP | |
| RETURN NEXT tmp; | |
| END LOOP; | |
| i = i + 1; | |
| END LOOP; | |
| RETURN; | |
| END IF; | |
| -- Special case (POLYGON) : return the points of the rings of a polygon | |
| IF (ST_GeometryType(the_geom) = 'ST_Polygon') THEN | |
| FOR tmp IN SELECT * FROM _ST_DumpPoints(ST_ExteriorRing(the_geom), cur_path || ARRAY[1]) LOOP | |
| RETURN NEXT tmp; | |
| END LOOP; | |
| j := ST_NumInteriorRings(the_geom); | |
| FOR i IN 1..j LOOP | |
| FOR tmp IN SELECT * FROM _ST_DumpPoints(ST_InteriorRingN(the_geom, i), cur_path || ARRAY[i+1]) LOOP | |
| RETURN NEXT tmp; | |
| END LOOP; | |
| END LOOP; | |
| RETURN; | |
| END IF; | |
| -- Special case (POINT) : return the point | |
| IF (ST_GeometryType(the_geom) = 'ST_Point') THEN | |
| tmp.path = cur_path || ARRAY[1]; | |
| tmp.geom = the_geom; | |
| RETURN NEXT tmp; | |
| RETURN; | |
| END IF; | |
| -- Use ST_NumPoints rather than ST_NPoints to have a NULL value if the_geom isn't | |
| -- a LINESTRING or CIRCULARSTRING. | |
| SELECT ST_NumPoints(the_geom) INTO nb_points; | |
| -- This should never happen | |
| IF (nb_points IS NULL) THEN | |
| RAISE EXCEPTION 'Unexpected error while dumping geometry %', ST_AsText(the_geom); | |
| END IF; | |
| FOR i IN 1..nb_points LOOP | |
| tmp.path = cur_path || ARRAY[i]; | |
| tmp.geom := ST_PointN(the_geom, i); | |
| RETURN NEXT tmp; | |
| END LOOP; | |
| END | |
| $$; | |
| ALTER FUNCTION public._st_dumppoints(the_geom geometry, cur_path integer[]) OWNER TO postgres; | |
| -- | |
| -- TOC entry 60 (class 1255 OID 18413) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: _st_dwithin(geometry, geometry, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION _st_dwithin(geometry, geometry, double precision) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT COST 100 | |
| AS '$libdir/postgis-1.5', 'LWGEOM_dwithin'; | |
| ALTER FUNCTION public._st_dwithin(geometry, geometry, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 61 (class 1255 OID 18414) | |
| -- Dependencies: 1099 6 1099 | |
| -- Name: _st_dwithin(geography, geography, double precision, boolean); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION _st_dwithin(geography, geography, double precision, boolean) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT COST 100 | |
| AS '$libdir/postgis-1.5', 'geography_dwithin'; | |
| ALTER FUNCTION public._st_dwithin(geography, geography, double precision, boolean) OWNER TO postgres; | |
| -- | |
| -- TOC entry 62 (class 1255 OID 18415) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: _st_equals(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION _st_equals(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT COST 100 | |
| AS '$libdir/postgis-1.5', 'geomequals'; | |
| ALTER FUNCTION public._st_equals(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 63 (class 1255 OID 18416) | |
| -- Dependencies: 6 1099 1099 | |
| -- Name: _st_expand(geography, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION _st_expand(geography, double precision) RETURNS geography | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'geography_expand'; | |
| ALTER FUNCTION public._st_expand(geography, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 64 (class 1255 OID 18417) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: _st_intersects(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION _st_intersects(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT COST 100 | |
| AS '$libdir/postgis-1.5', 'intersects'; | |
| ALTER FUNCTION public._st_intersects(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 65 (class 1255 OID 18418) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: _st_linecrossingdirection(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION _st_linecrossingdirection(geometry, geometry) RETURNS integer | |
| LANGUAGE c IMMUTABLE STRICT COST 100 | |
| AS '$libdir/postgis-1.5', 'ST_LineCrossingDirection'; | |
| ALTER FUNCTION public._st_linecrossingdirection(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 66 (class 1255 OID 18419) | |
| -- Dependencies: 1102 1102 1102 6 | |
| -- Name: _st_longestline(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION _st_longestline(geometry, geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_longestline2d'; | |
| ALTER FUNCTION public._st_longestline(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 67 (class 1255 OID 18420) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: _st_maxdistance(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION _st_maxdistance(geometry, geometry) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_maxdistance2d_linestring'; | |
| ALTER FUNCTION public._st_maxdistance(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 68 (class 1255 OID 18421) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: _st_orderingequals(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION _st_orderingequals(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT COST 100 | |
| AS '$libdir/postgis-1.5', 'LWGEOM_same'; | |
| ALTER FUNCTION public._st_orderingequals(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 69 (class 1255 OID 18422) | |
| -- Dependencies: 1102 1102 6 | |
| -- Name: _st_overlaps(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION _st_overlaps(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT COST 100 | |
| AS '$libdir/postgis-1.5', 'overlaps'; | |
| ALTER FUNCTION public._st_overlaps(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 70 (class 1255 OID 18423) | |
| -- Dependencies: 1099 6 1099 | |
| -- Name: _st_pointoutside(geography); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION _st_pointoutside(geography) RETURNS geography | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'geography_point_outside'; | |
| ALTER FUNCTION public._st_pointoutside(geography) OWNER TO postgres; | |
| -- | |
| -- TOC entry 71 (class 1255 OID 18424) | |
| -- Dependencies: 1102 1102 6 | |
| -- Name: _st_touches(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION _st_touches(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT COST 100 | |
| AS '$libdir/postgis-1.5', 'touches'; | |
| ALTER FUNCTION public._st_touches(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 72 (class 1255 OID 18425) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: _st_within(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION _st_within(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT COST 100 | |
| AS '$libdir/postgis-1.5', 'within'; | |
| ALTER FUNCTION public._st_within(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 73 (class 1255 OID 18426) | |
| -- Dependencies: 1167 6 | |
| -- Name: addauth(text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION addauth(text) RETURNS boolean | |
| LANGUAGE plpgsql | |
| AS $_$ | |
| DECLARE | |
| lockid alias for $1; | |
| okay boolean; | |
| myrec record; | |
| BEGIN | |
| -- check to see if table exists | |
| -- if not, CREATE TEMP TABLE mylock (transid xid, lockcode text) | |
| okay := 'f'; | |
| FOR myrec IN SELECT * FROM pg_class WHERE relname = 'temp_lock_have_table' LOOP | |
| okay := 't'; | |
| END LOOP; | |
| IF (okay <> 't') THEN | |
| CREATE TEMP TABLE temp_lock_have_table (transid xid, lockcode text); | |
| -- this will only work from pgsql7.4 up | |
| -- ON COMMIT DELETE ROWS; | |
| END IF; | |
| -- INSERT INTO mylock VALUES ( $1) | |
| -- EXECUTE 'INSERT INTO temp_lock_have_table VALUES ( '|| | |
| -- quote_literal(getTransactionID()) || ',' || | |
| -- quote_literal(lockid) ||')'; | |
| INSERT INTO temp_lock_have_table VALUES (getTransactionID(), lockid); | |
| RETURN true::boolean; | |
| END; | |
| $_$; | |
| ALTER FUNCTION public.addauth(text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 74 (class 1255 OID 18427) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: addbbox(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION addbbox(geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_addBBOX'; | |
| ALTER FUNCTION public.addbbox(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 79 (class 1255 OID 18430) | |
| -- Dependencies: 1167 6 | |
| -- Name: addgeometrycolumn(character varying, character varying, integer, character varying, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION addgeometrycolumn(character varying, character varying, integer, character varying, integer) RETURNS text | |
| LANGUAGE plpgsql STRICT | |
| AS $_$ | |
| DECLARE | |
| ret text; | |
| BEGIN | |
| SELECT AddGeometryColumn('','',$1,$2,$3,$4,$5) into ret; | |
| RETURN ret; | |
| END; | |
| $_$; | |
| ALTER FUNCTION public.addgeometrycolumn(character varying, character varying, integer, character varying, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 78 (class 1255 OID 18429) | |
| -- Dependencies: 6 1167 | |
| -- Name: addgeometrycolumn(character varying, character varying, character varying, integer, character varying, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION addgeometrycolumn(character varying, character varying, character varying, integer, character varying, integer) RETURNS text | |
| LANGUAGE plpgsql STABLE STRICT | |
| AS $_$ | |
| DECLARE | |
| ret text; | |
| BEGIN | |
| SELECT AddGeometryColumn('',$1,$2,$3,$4,$5,$6) into ret; | |
| RETURN ret; | |
| END; | |
| $_$; | |
| ALTER FUNCTION public.addgeometrycolumn(character varying, character varying, character varying, integer, character varying, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 77 (class 1255 OID 18428) | |
| -- Dependencies: 6 1167 | |
| -- Name: addgeometrycolumn(character varying, character varying, character varying, character varying, integer, character varying, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION addgeometrycolumn(character varying, character varying, character varying, character varying, integer, character varying, integer) RETURNS text | |
| LANGUAGE plpgsql STRICT | |
| AS $_$ | |
| DECLARE | |
| catalog_name alias for $1; | |
| schema_name alias for $2; | |
| table_name alias for $3; | |
| column_name alias for $4; | |
| new_srid alias for $5; | |
| new_type alias for $6; | |
| new_dim alias for $7; | |
| rec RECORD; | |
| sr varchar; | |
| real_schema name; | |
| sql text; | |
| BEGIN | |
| -- Verify geometry type | |
| IF ( NOT ( (new_type = 'GEOMETRY') OR | |
| (new_type = 'GEOMETRYCOLLECTION') OR | |
| (new_type = 'POINT') OR | |
| (new_type = 'MULTIPOINT') OR | |
| (new_type = 'POLYGON') OR | |
| (new_type = 'MULTIPOLYGON') OR | |
| (new_type = 'LINESTRING') OR | |
| (new_type = 'MULTILINESTRING') OR | |
| (new_type = 'GEOMETRYCOLLECTIONM') OR | |
| (new_type = 'POINTM') OR | |
| (new_type = 'MULTIPOINTM') OR | |
| (new_type = 'POLYGONM') OR | |
| (new_type = 'MULTIPOLYGONM') OR | |
| (new_type = 'LINESTRINGM') OR | |
| (new_type = 'MULTILINESTRINGM') OR | |
| (new_type = 'CIRCULARSTRING') OR | |
| (new_type = 'CIRCULARSTRINGM') OR | |
| (new_type = 'COMPOUNDCURVE') OR | |
| (new_type = 'COMPOUNDCURVEM') OR | |
| (new_type = 'CURVEPOLYGON') OR | |
| (new_type = 'CURVEPOLYGONM') OR | |
| (new_type = 'MULTICURVE') OR | |
| (new_type = 'MULTICURVEM') OR | |
| (new_type = 'MULTISURFACE') OR | |
| (new_type = 'MULTISURFACEM')) ) | |
| THEN | |
| RAISE EXCEPTION 'Invalid type name - valid ones are: | |
| POINT, MULTIPOINT, | |
| LINESTRING, MULTILINESTRING, | |
| POLYGON, MULTIPOLYGON, | |
| CIRCULARSTRING, COMPOUNDCURVE, MULTICURVE, | |
| CURVEPOLYGON, MULTISURFACE, | |
| GEOMETRY, GEOMETRYCOLLECTION, | |
| POINTM, MULTIPOINTM, | |
| LINESTRINGM, MULTILINESTRINGM, | |
| POLYGONM, MULTIPOLYGONM, | |
| CIRCULARSTRINGM, COMPOUNDCURVEM, MULTICURVEM | |
| CURVEPOLYGONM, MULTISURFACEM, | |
| or GEOMETRYCOLLECTIONM'; | |
| RETURN 'fail'; | |
| END IF; | |
| -- Verify dimension | |
| IF ( (new_dim >4) OR (new_dim <0) ) THEN | |
| RAISE EXCEPTION 'invalid dimension'; | |
| RETURN 'fail'; | |
| END IF; | |
| IF ( (new_type LIKE '%M') AND (new_dim!=3) ) THEN | |
| RAISE EXCEPTION 'TypeM needs 3 dimensions'; | |
| RETURN 'fail'; | |
| END IF; | |
| -- Verify SRID | |
| IF ( new_srid != -1 ) THEN | |
| SELECT SRID INTO sr FROM spatial_ref_sys WHERE SRID = new_srid; | |
| IF NOT FOUND THEN | |
| RAISE EXCEPTION 'AddGeometryColumns() - invalid SRID'; | |
| RETURN 'fail'; | |
| END IF; | |
| END IF; | |
| -- Verify schema | |
| IF ( schema_name IS NOT NULL AND schema_name != '' ) THEN | |
| sql := 'SELECT nspname FROM pg_namespace ' || | |
| 'WHERE text(nspname) = ' || quote_literal(schema_name) || | |
| 'LIMIT 1'; | |
| RAISE DEBUG '%', sql; | |
| EXECUTE sql INTO real_schema; | |
| IF ( real_schema IS NULL ) THEN | |
| RAISE EXCEPTION 'Schema % is not a valid schemaname', quote_literal(schema_name); | |
| RETURN 'fail'; | |
| END IF; | |
| END IF; | |
| IF ( real_schema IS NULL ) THEN | |
| RAISE DEBUG 'Detecting schema'; | |
| sql := 'SELECT n.nspname AS schemaname ' || | |
| 'FROM pg_catalog.pg_class c ' || | |
| 'JOIN pg_catalog.pg_namespace n ON n.oid = c.relnamespace ' || | |
| 'WHERE c.relkind = ' || quote_literal('r') || | |
| ' AND n.nspname NOT IN (' || quote_literal('pg_catalog') || ', ' || quote_literal('pg_toast') || ')' || | |
| ' AND pg_catalog.pg_table_is_visible(c.oid)' || | |
| ' AND c.relname = ' || quote_literal(table_name); | |
| RAISE DEBUG '%', sql; | |
| EXECUTE sql INTO real_schema; | |
| IF ( real_schema IS NULL ) THEN | |
| RAISE EXCEPTION 'Table % does not occur in the search_path', quote_literal(table_name); | |
| RETURN 'fail'; | |
| END IF; | |
| END IF; | |
| -- Add geometry column to table | |
| sql := 'ALTER TABLE ' || | |
| quote_ident(real_schema) || '.' || quote_ident(table_name) | |
| || ' ADD COLUMN ' || quote_ident(column_name) || | |
| ' geometry '; | |
| RAISE DEBUG '%', sql; | |
| EXECUTE sql; | |
| -- Delete stale record in geometry_columns (if any) | |
| sql := 'DELETE FROM geometry_columns WHERE | |
| f_table_catalog = ' || quote_literal('') || | |
| ' AND f_table_schema = ' || | |
| quote_literal(real_schema) || | |
| ' AND f_table_name = ' || quote_literal(table_name) || | |
| ' AND f_geometry_column = ' || quote_literal(column_name); | |
| RAISE DEBUG '%', sql; | |
| EXECUTE sql; | |
| -- Add record in geometry_columns | |
| sql := 'INSERT INTO geometry_columns (f_table_catalog,f_table_schema,f_table_name,' || | |
| 'f_geometry_column,coord_dimension,srid,type)' || | |
| ' VALUES (' || | |
| quote_literal('') || ',' || | |
| quote_literal(real_schema) || ',' || | |
| quote_literal(table_name) || ',' || | |
| quote_literal(column_name) || ',' || | |
| new_dim::text || ',' || | |
| new_srid::text || ',' || | |
| quote_literal(new_type) || ')'; | |
| RAISE DEBUG '%', sql; | |
| EXECUTE sql; | |
| -- Add table CHECKs | |
| sql := 'ALTER TABLE ' || | |
| quote_ident(real_schema) || '.' || quote_ident(table_name) | |
| || ' ADD CONSTRAINT ' | |
| || quote_ident('enforce_srid_' || column_name) | |
| || ' CHECK (ST_SRID(' || quote_ident(column_name) || | |
| ') = ' || new_srid::text || ')' ; | |
| RAISE DEBUG '%', sql; | |
| EXECUTE sql; | |
| sql := 'ALTER TABLE ' || | |
| quote_ident(real_schema) || '.' || quote_ident(table_name) | |
| || ' ADD CONSTRAINT ' | |
| || quote_ident('enforce_dims_' || column_name) | |
| || ' CHECK (ST_NDims(' || quote_ident(column_name) || | |
| ') = ' || new_dim::text || ')' ; | |
| RAISE DEBUG '%', sql; | |
| EXECUTE sql; | |
| IF ( NOT (new_type = 'GEOMETRY')) THEN | |
| sql := 'ALTER TABLE ' || | |
| quote_ident(real_schema) || '.' || quote_ident(table_name) || ' ADD CONSTRAINT ' || | |
| quote_ident('enforce_geotype_' || column_name) || | |
| ' CHECK (GeometryType(' || | |
| quote_ident(column_name) || ')=' || | |
| quote_literal(new_type) || ' OR (' || | |
| quote_ident(column_name) || ') is null)'; | |
| RAISE DEBUG '%', sql; | |
| EXECUTE sql; | |
| END IF; | |
| RETURN | |
| real_schema || '.' || | |
| table_name || '.' || column_name || | |
| ' SRID:' || new_srid::text || | |
| ' TYPE:' || new_type || | |
| ' DIMS:' || new_dim::text || ' '; | |
| END; | |
| $_$; | |
| ALTER FUNCTION public.addgeometrycolumn(character varying, character varying, character varying, character varying, integer, character varying, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 80 (class 1255 OID 18431) | |
| -- Dependencies: 1102 6 1102 1102 | |
| -- Name: addpoint(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION addpoint(geometry, geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_addpoint'; | |
| ALTER FUNCTION public.addpoint(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 81 (class 1255 OID 18432) | |
| -- Dependencies: 1102 1102 1102 6 | |
| -- Name: addpoint(geometry, geometry, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION addpoint(geometry, geometry, integer) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_addpoint'; | |
| ALTER FUNCTION public.addpoint(geometry, geometry, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 83 (class 1255 OID 18434) | |
| -- Dependencies: 1102 1102 6 | |
| -- Name: affine(geometry, double precision, double precision, double precision, double precision, double precision, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION affine(geometry, double precision, double precision, double precision, double precision, double precision, double precision) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT affine($1, $2, $3, 0, $4, $5, 0, 0, 0, 1, $6, $7, 0)$_$; | |
| ALTER FUNCTION public.affine(geometry, double precision, double precision, double precision, double precision, double precision, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 82 (class 1255 OID 18433) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: affine(geometry, double precision, double precision, double precision, double precision, double precision, double precision, double precision, double precision, double precision, double precision, double precision, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION affine(geometry, double precision, double precision, double precision, double precision, double precision, double precision, double precision, double precision, double precision, double precision, double precision, double precision) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_affine'; | |
| ALTER FUNCTION public.affine(geometry, double precision, double precision, double precision, double precision, double precision, double precision, double precision, double precision, double precision, double precision, double precision, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 84 (class 1255 OID 18435) | |
| -- Dependencies: 1102 6 | |
| -- Name: area(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION area(geometry) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_area_polygon'; | |
| ALTER FUNCTION public.area(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 85 (class 1255 OID 18436) | |
| -- Dependencies: 1102 6 | |
| -- Name: area2d(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION area2d(geometry) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_area_polygon'; | |
| ALTER FUNCTION public.area2d(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 86 (class 1255 OID 18437) | |
| -- Dependencies: 6 1102 | |
| -- Name: asbinary(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION asbinary(geometry) RETURNS bytea | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_asBinary'; | |
| ALTER FUNCTION public.asbinary(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 87 (class 1255 OID 18438) | |
| -- Dependencies: 6 1102 | |
| -- Name: asbinary(geometry, text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION asbinary(geometry, text) RETURNS bytea | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_asBinary'; | |
| ALTER FUNCTION public.asbinary(geometry, text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 88 (class 1255 OID 18439) | |
| -- Dependencies: 1102 6 | |
| -- Name: asewkb(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION asewkb(geometry) RETURNS bytea | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'WKBFromLWGEOM'; | |
| ALTER FUNCTION public.asewkb(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 89 (class 1255 OID 18440) | |
| -- Dependencies: 1102 6 | |
| -- Name: asewkb(geometry, text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION asewkb(geometry, text) RETURNS bytea | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'WKBFromLWGEOM'; | |
| ALTER FUNCTION public.asewkb(geometry, text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 90 (class 1255 OID 18441) | |
| -- Dependencies: 1102 6 | |
| -- Name: asewkt(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION asewkt(geometry) RETURNS text | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_asEWKT'; | |
| ALTER FUNCTION public.asewkt(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 92 (class 1255 OID 18443) | |
| -- Dependencies: 1102 6 | |
| -- Name: asgml(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION asgml(geometry) RETURNS text | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT _ST_AsGML(2, $1, 15, 0)$_$; | |
| ALTER FUNCTION public.asgml(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 91 (class 1255 OID 18442) | |
| -- Dependencies: 6 1102 | |
| -- Name: asgml(geometry, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION asgml(geometry, integer) RETURNS text | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT _ST_AsGML(2, $1, $2, 0)$_$; | |
| ALTER FUNCTION public.asgml(geometry, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 93 (class 1255 OID 18444) | |
| -- Dependencies: 6 1102 | |
| -- Name: ashexewkb(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION ashexewkb(geometry) RETURNS text | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_asHEXEWKB'; | |
| ALTER FUNCTION public.ashexewkb(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 94 (class 1255 OID 18445) | |
| -- Dependencies: 6 1102 | |
| -- Name: ashexewkb(geometry, text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION ashexewkb(geometry, text) RETURNS text | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_asHEXEWKB'; | |
| ALTER FUNCTION public.ashexewkb(geometry, text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 96 (class 1255 OID 18447) | |
| -- Dependencies: 6 1102 | |
| -- Name: askml(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION askml(geometry) RETURNS text | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT _ST_AsKML(2, transform($1,4326), 15)$_$; | |
| ALTER FUNCTION public.askml(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 95 (class 1255 OID 18446) | |
| -- Dependencies: 6 1102 | |
| -- Name: askml(geometry, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION askml(geometry, integer) RETURNS text | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT _ST_AsKML(2, transform($1,4326), $2)$_$; | |
| ALTER FUNCTION public.askml(geometry, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 97 (class 1255 OID 18448) | |
| -- Dependencies: 6 1102 | |
| -- Name: askml(integer, geometry, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION askml(integer, geometry, integer) RETURNS text | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT _ST_AsKML($1, transform($2,4326), $3)$_$; | |
| ALTER FUNCTION public.askml(integer, geometry, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 100 (class 1255 OID 18451) | |
| -- Dependencies: 6 1102 | |
| -- Name: assvg(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION assvg(geometry) RETURNS text | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'assvg_geometry'; | |
| ALTER FUNCTION public.assvg(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 99 (class 1255 OID 18450) | |
| -- Dependencies: 6 1102 | |
| -- Name: assvg(geometry, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION assvg(geometry, integer) RETURNS text | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'assvg_geometry'; | |
| ALTER FUNCTION public.assvg(geometry, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 98 (class 1255 OID 18449) | |
| -- Dependencies: 1102 6 | |
| -- Name: assvg(geometry, integer, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION assvg(geometry, integer, integer) RETURNS text | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'assvg_geometry'; | |
| ALTER FUNCTION public.assvg(geometry, integer, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 101 (class 1255 OID 18452) | |
| -- Dependencies: 1102 6 | |
| -- Name: astext(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION astext(geometry) RETURNS text | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_asText'; | |
| ALTER FUNCTION public.astext(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 102 (class 1255 OID 18453) | |
| -- Dependencies: 1102 1102 6 | |
| -- Name: azimuth(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION azimuth(geometry, geometry) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_azimuth'; | |
| ALTER FUNCTION public.azimuth(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 103 (class 1255 OID 18454) | |
| -- Dependencies: 1102 1167 6 | |
| -- Name: bdmpolyfromtext(text, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION bdmpolyfromtext(text, integer) RETURNS geometry | |
| LANGUAGE plpgsql IMMUTABLE STRICT | |
| AS $_$ | |
| DECLARE | |
| geomtext alias for $1; | |
| srid alias for $2; | |
| mline geometry; | |
| geom geometry; | |
| BEGIN | |
| mline := MultiLineStringFromText(geomtext, srid); | |
| IF mline IS NULL | |
| THEN | |
| RAISE EXCEPTION 'Input is not a MultiLinestring'; | |
| END IF; | |
| geom := multi(BuildArea(mline)); | |
| RETURN geom; | |
| END; | |
| $_$; | |
| ALTER FUNCTION public.bdmpolyfromtext(text, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 75 (class 1255 OID 18455) | |
| -- Dependencies: 6 1102 1167 | |
| -- Name: bdpolyfromtext(text, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION bdpolyfromtext(text, integer) RETURNS geometry | |
| LANGUAGE plpgsql IMMUTABLE STRICT | |
| AS $_$ | |
| DECLARE | |
| geomtext alias for $1; | |
| srid alias for $2; | |
| mline geometry; | |
| geom geometry; | |
| BEGIN | |
| mline := MultiLineStringFromText(geomtext, srid); | |
| IF mline IS NULL | |
| THEN | |
| RAISE EXCEPTION 'Input is not a MultiLinestring'; | |
| END IF; | |
| geom := BuildArea(mline); | |
| IF GeometryType(geom) != 'POLYGON' | |
| THEN | |
| RAISE EXCEPTION 'Input returns more then a single polygon, try using BdMPolyFromText instead'; | |
| END IF; | |
| RETURN geom; | |
| END; | |
| $_$; | |
| ALTER FUNCTION public.bdpolyfromtext(text, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 76 (class 1255 OID 18456) | |
| -- Dependencies: 1102 1102 6 | |
| -- Name: boundary(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION boundary(geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'boundary'; | |
| ALTER FUNCTION public.boundary(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 104 (class 1255 OID 18457) | |
| -- Dependencies: 1102 6 | |
| -- Name: box(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION box(geometry) RETURNS box | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_to_BOX'; | |
| ALTER FUNCTION public.box(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 105 (class 1255 OID 18458) | |
| -- Dependencies: 1090 6 | |
| -- Name: box(box3d); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION box(box3d) RETURNS box | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'BOX3D_to_BOX'; | |
| ALTER FUNCTION public.box(box3d) OWNER TO postgres; | |
| -- | |
| -- TOC entry 106 (class 1255 OID 18459) | |
| -- Dependencies: 6 1093 1087 | |
| -- Name: box2d(box3d_extent); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION box2d(box3d_extent) RETURNS box2d | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'BOX3D_to_BOX2DFLOAT4'; | |
| ALTER FUNCTION public.box2d(box3d_extent) OWNER TO postgres; | |
| -- | |
| -- TOC entry 107 (class 1255 OID 18460) | |
| -- Dependencies: 1087 6 1102 | |
| -- Name: box2d(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION box2d(geometry) RETURNS box2d | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_to_BOX2DFLOAT4'; | |
| ALTER FUNCTION public.box2d(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 108 (class 1255 OID 18461) | |
| -- Dependencies: 1087 1090 6 | |
| -- Name: box2d(box3d); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION box2d(box3d) RETURNS box2d | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'BOX3D_to_BOX2DFLOAT4'; | |
| ALTER FUNCTION public.box2d(box3d) OWNER TO postgres; | |
| -- | |
| -- TOC entry 109 (class 1255 OID 18462) | |
| -- Dependencies: 6 1102 1090 | |
| -- Name: box3d(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION box3d(geometry) RETURNS box3d | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_to_BOX3D'; | |
| ALTER FUNCTION public.box3d(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 110 (class 1255 OID 18463) | |
| -- Dependencies: 1087 1090 6 | |
| -- Name: box3d(box2d); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION box3d(box2d) RETURNS box3d | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'BOX2DFLOAT4_to_BOX3D'; | |
| ALTER FUNCTION public.box3d(box2d) OWNER TO postgres; | |
| -- | |
| -- TOC entry 111 (class 1255 OID 18464) | |
| -- Dependencies: 1093 1090 6 | |
| -- Name: box3d_extent(box3d_extent); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION box3d_extent(box3d_extent) RETURNS box3d | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'BOX3D_extent_to_BOX3D'; | |
| ALTER FUNCTION public.box3d_extent(box3d_extent) OWNER TO postgres; | |
| -- | |
| -- TOC entry 112 (class 1255 OID 18465) | |
| -- Dependencies: 1090 6 | |
| -- Name: box3dtobox(box3d); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION box3dtobox(box3d) RETURNS box | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT box($1)$_$; | |
| ALTER FUNCTION public.box3dtobox(box3d) OWNER TO postgres; | |
| -- | |
| -- TOC entry 113 (class 1255 OID 18466) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: buffer(geometry, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION buffer(geometry, double precision) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT COST 100 | |
| AS '$libdir/postgis-1.5', 'buffer'; | |
| ALTER FUNCTION public.buffer(geometry, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 114 (class 1255 OID 18467) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: buffer(geometry, double precision, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION buffer(geometry, double precision, integer) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT ST_Buffer($1, $2, $3)$_$; | |
| ALTER FUNCTION public.buffer(geometry, double precision, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 115 (class 1255 OID 18468) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: buildarea(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION buildarea(geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT COST 100 | |
| AS '$libdir/postgis-1.5', 'LWGEOM_buildarea'; | |
| ALTER FUNCTION public.buildarea(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 116 (class 1255 OID 18469) | |
| -- Dependencies: 1102 6 | |
| -- Name: bytea(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION bytea(geometry) RETURNS bytea | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_to_bytea'; | |
| ALTER FUNCTION public.bytea(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 117 (class 1255 OID 18470) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: centroid(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION centroid(geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'centroid'; | |
| ALTER FUNCTION public.centroid(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 119 (class 1255 OID 18472) | |
| -- Dependencies: 6 | |
| -- Name: checkauth(text, text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION checkauth(text, text) RETURNS integer | |
| LANGUAGE sql | |
| AS $_$ SELECT CheckAuth('', $1, $2) $_$; | |
| ALTER FUNCTION public.checkauth(text, text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 118 (class 1255 OID 18471) | |
| -- Dependencies: 1167 6 | |
| -- Name: checkauth(text, text, text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION checkauth(text, text, text) RETURNS integer | |
| LANGUAGE plpgsql | |
| AS $_$ | |
| DECLARE | |
| schema text; | |
| BEGIN | |
| IF NOT LongTransactionsEnabled() THEN | |
| RAISE EXCEPTION 'Long transaction support disabled, use EnableLongTransaction() to enable.'; | |
| END IF; | |
| if ( $1 != '' ) THEN | |
| schema = $1; | |
| ELSE | |
| SELECT current_schema() into schema; | |
| END IF; | |
| -- TODO: check for an already existing trigger ? | |
| EXECUTE 'CREATE TRIGGER check_auth BEFORE UPDATE OR DELETE ON ' | |
| || quote_ident(schema) || '.' || quote_ident($2) | |
| ||' FOR EACH ROW EXECUTE PROCEDURE CheckAuthTrigger(' | |
| || quote_literal($3) || ')'; | |
| RETURN 0; | |
| END; | |
| $_$; | |
| ALTER FUNCTION public.checkauth(text, text, text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 120 (class 1255 OID 18473) | |
| -- Dependencies: 6 | |
| -- Name: checkauthtrigger(); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION checkauthtrigger() RETURNS trigger | |
| LANGUAGE c | |
| AS '$libdir/postgis-1.5', 'check_authorization'; | |
| ALTER FUNCTION public.checkauthtrigger() OWNER TO postgres; | |
| -- | |
| -- TOC entry 121 (class 1255 OID 18474) | |
| -- Dependencies: 6 1102 1102 1102 | |
| -- Name: collect(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION collect(geometry, geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE | |
| AS '$libdir/postgis-1.5', 'LWGEOM_collect'; | |
| ALTER FUNCTION public.collect(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 122 (class 1255 OID 18475) | |
| -- Dependencies: 1087 6 1087 1102 | |
| -- Name: combine_bbox(box2d, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION combine_bbox(box2d, geometry) RETURNS box2d | |
| LANGUAGE c IMMUTABLE | |
| AS '$libdir/postgis-1.5', 'BOX2DFLOAT4_combine'; | |
| ALTER FUNCTION public.combine_bbox(box2d, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 123 (class 1255 OID 18476) | |
| -- Dependencies: 6 1093 1093 1102 | |
| -- Name: combine_bbox(box3d_extent, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION combine_bbox(box3d_extent, geometry) RETURNS box3d_extent | |
| LANGUAGE c IMMUTABLE | |
| AS '$libdir/postgis-1.5', 'BOX3D_combine'; | |
| ALTER FUNCTION public.combine_bbox(box3d_extent, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 124 (class 1255 OID 18477) | |
| -- Dependencies: 6 1090 1090 1102 | |
| -- Name: combine_bbox(box3d, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION combine_bbox(box3d, geometry) RETURNS box3d | |
| LANGUAGE c IMMUTABLE | |
| AS '$libdir/postgis-1.5', 'BOX3D_combine'; | |
| ALTER FUNCTION public.combine_bbox(box3d, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 125 (class 1255 OID 18478) | |
| -- Dependencies: 6 1096 | |
| -- Name: compression(chip); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION compression(chip) RETURNS integer | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'CHIP_getCompression'; | |
| ALTER FUNCTION public.compression(chip) OWNER TO postgres; | |
| -- | |
| -- TOC entry 126 (class 1255 OID 18479) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: contains(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION contains(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'contains'; | |
| ALTER FUNCTION public.contains(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 127 (class 1255 OID 18480) | |
| -- Dependencies: 1102 1102 6 | |
| -- Name: convexhull(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION convexhull(geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT COST 100 | |
| AS '$libdir/postgis-1.5', 'convexhull'; | |
| ALTER FUNCTION public.convexhull(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 128 (class 1255 OID 18481) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: crosses(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION crosses(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'crosses'; | |
| ALTER FUNCTION public.crosses(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 129 (class 1255 OID 18482) | |
| -- Dependencies: 1096 6 | |
| -- Name: datatype(chip); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION datatype(chip) RETURNS integer | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'CHIP_getDatatype'; | |
| ALTER FUNCTION public.datatype(chip) OWNER TO postgres; | |
| -- | |
| -- TOC entry 130 (class 1255 OID 18483) | |
| -- Dependencies: 1102 1102 1102 6 | |
| -- Name: difference(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION difference(geometry, geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'difference'; | |
| ALTER FUNCTION public.difference(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 131 (class 1255 OID 18484) | |
| -- Dependencies: 1102 6 | |
| -- Name: dimension(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION dimension(geometry) RETURNS integer | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_dimension'; | |
| ALTER FUNCTION public.dimension(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 132 (class 1255 OID 18485) | |
| -- Dependencies: 1167 6 | |
| -- Name: disablelongtransactions(); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION disablelongtransactions() RETURNS text | |
| LANGUAGE plpgsql | |
| AS $$ | |
| DECLARE | |
| rec RECORD; | |
| BEGIN | |
| -- | |
| -- Drop all triggers applied by CheckAuth() | |
| -- | |
| FOR rec IN | |
| SELECT c.relname, t.tgname, t.tgargs FROM pg_trigger t, pg_class c, pg_proc p | |
| WHERE p.proname = 'checkauthtrigger' and t.tgfoid = p.oid and t.tgrelid = c.oid | |
| LOOP | |
| EXECUTE 'DROP TRIGGER ' || quote_ident(rec.tgname) || | |
| ' ON ' || quote_ident(rec.relname); | |
| END LOOP; | |
| -- | |
| -- Drop the authorization_table table | |
| -- | |
| FOR rec IN SELECT * FROM pg_class WHERE relname = 'authorization_table' LOOP | |
| DROP TABLE authorization_table; | |
| END LOOP; | |
| -- | |
| -- Drop the authorized_tables view | |
| -- | |
| FOR rec IN SELECT * FROM pg_class WHERE relname = 'authorized_tables' LOOP | |
| DROP VIEW authorized_tables; | |
| END LOOP; | |
| RETURN 'Long transactions support disabled'; | |
| END; | |
| $$; | |
| ALTER FUNCTION public.disablelongtransactions() OWNER TO postgres; | |
| -- | |
| -- TOC entry 133 (class 1255 OID 18486) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: disjoint(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION disjoint(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'disjoint'; | |
| ALTER FUNCTION public.disjoint(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 134 (class 1255 OID 18487) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: distance(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION distance(geometry, geometry) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT COST 100 | |
| AS '$libdir/postgis-1.5', 'LWGEOM_mindistance2d'; | |
| ALTER FUNCTION public.distance(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 135 (class 1255 OID 18488) | |
| -- Dependencies: 1102 1102 6 | |
| -- Name: distance_sphere(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION distance_sphere(geometry, geometry) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT COST 100 | |
| AS '$libdir/postgis-1.5', 'LWGEOM_distance_sphere'; | |
| ALTER FUNCTION public.distance_sphere(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 136 (class 1255 OID 18489) | |
| -- Dependencies: 1102 6 1113 1102 | |
| -- Name: distance_spheroid(geometry, geometry, spheroid); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION distance_spheroid(geometry, geometry, spheroid) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT COST 100 | |
| AS '$libdir/postgis-1.5', 'LWGEOM_distance_ellipsoid'; | |
| ALTER FUNCTION public.distance_spheroid(geometry, geometry, spheroid) OWNER TO postgres; | |
| -- | |
| -- TOC entry 137 (class 1255 OID 18490) | |
| -- Dependencies: 1102 1102 6 | |
| -- Name: dropbbox(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION dropbbox(geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_dropBBOX'; | |
| ALTER FUNCTION public.dropbbox(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 140 (class 1255 OID 18493) | |
| -- Dependencies: 1167 6 | |
| -- Name: dropgeometrycolumn(character varying, character varying); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION dropgeometrycolumn(character varying, character varying) RETURNS text | |
| LANGUAGE plpgsql STRICT | |
| AS $_$ | |
| DECLARE | |
| ret text; | |
| BEGIN | |
| SELECT DropGeometryColumn('','',$1,$2) into ret; | |
| RETURN ret; | |
| END; | |
| $_$; | |
| ALTER FUNCTION public.dropgeometrycolumn(character varying, character varying) OWNER TO postgres; | |
| -- | |
| -- TOC entry 139 (class 1255 OID 18492) | |
| -- Dependencies: 1167 6 | |
| -- Name: dropgeometrycolumn(character varying, character varying, character varying); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION dropgeometrycolumn(character varying, character varying, character varying) RETURNS text | |
| LANGUAGE plpgsql STRICT | |
| AS $_$ | |
| DECLARE | |
| ret text; | |
| BEGIN | |
| SELECT DropGeometryColumn('',$1,$2,$3) into ret; | |
| RETURN ret; | |
| END; | |
| $_$; | |
| ALTER FUNCTION public.dropgeometrycolumn(character varying, character varying, character varying) OWNER TO postgres; | |
| -- | |
| -- TOC entry 138 (class 1255 OID 18491) | |
| -- Dependencies: 1167 6 | |
| -- Name: dropgeometrycolumn(character varying, character varying, character varying, character varying); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION dropgeometrycolumn(character varying, character varying, character varying, character varying) RETURNS text | |
| LANGUAGE plpgsql STRICT | |
| AS $_$ | |
| DECLARE | |
| catalog_name alias for $1; | |
| schema_name alias for $2; | |
| table_name alias for $3; | |
| column_name alias for $4; | |
| myrec RECORD; | |
| okay boolean; | |
| real_schema name; | |
| BEGIN | |
| -- Find, check or fix schema_name | |
| IF ( schema_name != '' ) THEN | |
| okay = 'f'; | |
| FOR myrec IN SELECT nspname FROM pg_namespace WHERE text(nspname) = schema_name LOOP | |
| okay := 't'; | |
| END LOOP; | |
| IF ( okay <> 't' ) THEN | |
| RAISE NOTICE 'Invalid schema name - using current_schema()'; | |
| SELECT current_schema() into real_schema; | |
| ELSE | |
| real_schema = schema_name; | |
| END IF; | |
| ELSE | |
| SELECT current_schema() into real_schema; | |
| END IF; | |
| -- Find out if the column is in the geometry_columns table | |
| okay = 'f'; | |
| FOR myrec IN SELECT * from geometry_columns where f_table_schema = text(real_schema) and f_table_name = table_name and f_geometry_column = column_name LOOP | |
| okay := 't'; | |
| END LOOP; | |
| IF (okay <> 't') THEN | |
| RAISE EXCEPTION 'column not found in geometry_columns table'; | |
| RETURN 'f'; | |
| END IF; | |
| -- Remove ref from geometry_columns table | |
| EXECUTE 'delete from geometry_columns where f_table_schema = ' || | |
| quote_literal(real_schema) || ' and f_table_name = ' || | |
| quote_literal(table_name) || ' and f_geometry_column = ' || | |
| quote_literal(column_name); | |
| -- Remove table column | |
| EXECUTE 'ALTER TABLE ' || quote_ident(real_schema) || '.' || | |
| quote_ident(table_name) || ' DROP COLUMN ' || | |
| quote_ident(column_name); | |
| RETURN real_schema || '.' || table_name || '.' || column_name ||' effectively removed.'; | |
| END; | |
| $_$; | |
| ALTER FUNCTION public.dropgeometrycolumn(character varying, character varying, character varying, character varying) OWNER TO postgres; | |
| -- | |
| -- TOC entry 143 (class 1255 OID 18496) | |
| -- Dependencies: 6 | |
| -- Name: dropgeometrytable(character varying); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION dropgeometrytable(character varying) RETURNS text | |
| LANGUAGE sql STRICT | |
| AS $_$ SELECT DropGeometryTable('','',$1) $_$; | |
| ALTER FUNCTION public.dropgeometrytable(character varying) OWNER TO postgres; | |
| -- | |
| -- TOC entry 142 (class 1255 OID 18495) | |
| -- Dependencies: 6 | |
| -- Name: dropgeometrytable(character varying, character varying); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION dropgeometrytable(character varying, character varying) RETURNS text | |
| LANGUAGE sql STRICT | |
| AS $_$ SELECT DropGeometryTable('',$1,$2) $_$; | |
| ALTER FUNCTION public.dropgeometrytable(character varying, character varying) OWNER TO postgres; | |
| -- | |
| -- TOC entry 141 (class 1255 OID 18494) | |
| -- Dependencies: 6 1167 | |
| -- Name: dropgeometrytable(character varying, character varying, character varying); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION dropgeometrytable(character varying, character varying, character varying) RETURNS text | |
| LANGUAGE plpgsql STRICT | |
| AS $_$ | |
| DECLARE | |
| catalog_name alias for $1; | |
| schema_name alias for $2; | |
| table_name alias for $3; | |
| real_schema name; | |
| BEGIN | |
| IF ( schema_name = '' ) THEN | |
| SELECT current_schema() into real_schema; | |
| ELSE | |
| real_schema = schema_name; | |
| END IF; | |
| -- Remove refs from geometry_columns table | |
| EXECUTE 'DELETE FROM geometry_columns WHERE ' || | |
| 'f_table_schema = ' || quote_literal(real_schema) || | |
| ' AND ' || | |
| ' f_table_name = ' || quote_literal(table_name); | |
| -- Remove table | |
| EXECUTE 'DROP TABLE ' | |
| || quote_ident(real_schema) || '.' || | |
| quote_ident(table_name); | |
| RETURN | |
| real_schema || '.' || | |
| table_name ||' dropped.'; | |
| END; | |
| $_$; | |
| ALTER FUNCTION public.dropgeometrytable(character varying, character varying, character varying) OWNER TO postgres; | |
| -- | |
| -- TOC entry 144 (class 1255 OID 18497) | |
| -- Dependencies: 1102 6 1105 | |
| -- Name: dump(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION dump(geometry) RETURNS SETOF geometry_dump | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_dump'; | |
| ALTER FUNCTION public.dump(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 145 (class 1255 OID 18498) | |
| -- Dependencies: 6 1105 1102 | |
| -- Name: dumprings(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION dumprings(geometry) RETURNS SETOF geometry_dump | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_dump_rings'; | |
| ALTER FUNCTION public.dumprings(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 146 (class 1255 OID 18499) | |
| -- Dependencies: 1167 6 | |
| -- Name: enablelongtransactions(); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION enablelongtransactions() RETURNS text | |
| LANGUAGE plpgsql | |
| AS $$ | |
| DECLARE | |
| "query" text; | |
| exists bool; | |
| rec RECORD; | |
| BEGIN | |
| exists = 'f'; | |
| FOR rec IN SELECT * FROM pg_class WHERE relname = 'authorization_table' | |
| LOOP | |
| exists = 't'; | |
| END LOOP; | |
| IF NOT exists | |
| THEN | |
| "query" = 'CREATE TABLE authorization_table ( | |
| toid oid, -- table oid | |
| rid text, -- row id | |
| expires timestamp, | |
| authid text | |
| )'; | |
| EXECUTE "query"; | |
| END IF; | |
| exists = 'f'; | |
| FOR rec IN SELECT * FROM pg_class WHERE relname = 'authorized_tables' | |
| LOOP | |
| exists = 't'; | |
| END LOOP; | |
| IF NOT exists THEN | |
| "query" = 'CREATE VIEW authorized_tables AS ' || | |
| 'SELECT ' || | |
| 'n.nspname as schema, ' || | |
| 'c.relname as table, trim(' || | |
| quote_literal(chr(92) || '000') || | |
| ' from t.tgargs) as id_column ' || | |
| 'FROM pg_trigger t, pg_class c, pg_proc p ' || | |
| ', pg_namespace n ' || | |
| 'WHERE p.proname = ' || quote_literal('checkauthtrigger') || | |
| ' AND c.relnamespace = n.oid' || | |
| ' AND t.tgfoid = p.oid and t.tgrelid = c.oid'; | |
| EXECUTE "query"; | |
| END IF; | |
| RETURN 'Long transactions support enabled'; | |
| END; | |
| $$; | |
| ALTER FUNCTION public.enablelongtransactions() OWNER TO postgres; | |
| -- | |
| -- TOC entry 147 (class 1255 OID 18500) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: endpoint(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION endpoint(geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_endpoint_linestring'; | |
| ALTER FUNCTION public.endpoint(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 148 (class 1255 OID 18501) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: envelope(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION envelope(geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_envelope'; | |
| ALTER FUNCTION public.envelope(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 149 (class 1255 OID 18502) | |
| -- Dependencies: 1102 1102 6 | |
| -- Name: equals(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION equals(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'geomequals'; | |
| ALTER FUNCTION public.equals(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 151 (class 1255 OID 18504) | |
| -- Dependencies: 6 1087 | |
| -- Name: estimated_extent(text, text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION estimated_extent(text, text) RETURNS box2d | |
| LANGUAGE c IMMUTABLE STRICT SECURITY DEFINER | |
| AS '$libdir/postgis-1.5', 'LWGEOM_estimated_extent'; | |
| ALTER FUNCTION public.estimated_extent(text, text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 150 (class 1255 OID 18503) | |
| -- Dependencies: 1087 6 | |
| -- Name: estimated_extent(text, text, text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION estimated_extent(text, text, text) RETURNS box2d | |
| LANGUAGE c IMMUTABLE STRICT SECURITY DEFINER | |
| AS '$libdir/postgis-1.5', 'LWGEOM_estimated_extent'; | |
| ALTER FUNCTION public.estimated_extent(text, text, text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 152 (class 1255 OID 18505) | |
| -- Dependencies: 6 1090 1090 | |
| -- Name: expand(box3d, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION expand(box3d, double precision) RETURNS box3d | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'BOX3D_expand'; | |
| ALTER FUNCTION public.expand(box3d, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 153 (class 1255 OID 18506) | |
| -- Dependencies: 1087 6 1087 | |
| -- Name: expand(box2d, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION expand(box2d, double precision) RETURNS box2d | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'BOX2DFLOAT4_expand'; | |
| ALTER FUNCTION public.expand(box2d, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 154 (class 1255 OID 18507) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: expand(geometry, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION expand(geometry, double precision) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_expand'; | |
| ALTER FUNCTION public.expand(geometry, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 155 (class 1255 OID 18508) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: exteriorring(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION exteriorring(geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_exteriorring_polygon'; | |
| ALTER FUNCTION public.exteriorring(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 156 (class 1255 OID 18509) | |
| -- Dependencies: 1096 6 | |
| -- Name: factor(chip); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION factor(chip) RETURNS real | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'CHIP_getFactor'; | |
| ALTER FUNCTION public.factor(chip) OWNER TO postgres; | |
| -- | |
| -- TOC entry 158 (class 1255 OID 18511) | |
| -- Dependencies: 1087 1167 6 | |
| -- Name: find_extent(text, text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION find_extent(text, text) RETURNS box2d | |
| LANGUAGE plpgsql IMMUTABLE STRICT | |
| AS $_$ | |
| DECLARE | |
| tablename alias for $1; | |
| columnname alias for $2; | |
| myrec RECORD; | |
| BEGIN | |
| FOR myrec IN EXECUTE 'SELECT extent("' || columnname || '") FROM "' || tablename || '"' LOOP | |
| return myrec.extent; | |
| END LOOP; | |
| END; | |
| $_$; | |
| ALTER FUNCTION public.find_extent(text, text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 157 (class 1255 OID 18510) | |
| -- Dependencies: 1087 1167 6 | |
| -- Name: find_extent(text, text, text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION find_extent(text, text, text) RETURNS box2d | |
| LANGUAGE plpgsql IMMUTABLE STRICT | |
| AS $_$ | |
| DECLARE | |
| schemaname alias for $1; | |
| tablename alias for $2; | |
| columnname alias for $3; | |
| myrec RECORD; | |
| BEGIN | |
| FOR myrec IN EXECUTE 'SELECT extent("' || columnname || '") FROM "' || schemaname || '"."' || tablename || '"' LOOP | |
| return myrec.extent; | |
| END LOOP; | |
| END; | |
| $_$; | |
| ALTER FUNCTION public.find_extent(text, text, text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 159 (class 1255 OID 18512) | |
| -- Dependencies: 6 1167 | |
| -- Name: find_srid(character varying, character varying, character varying); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION find_srid(character varying, character varying, character varying) RETURNS integer | |
| LANGUAGE plpgsql IMMUTABLE STRICT | |
| AS $_$ | |
| DECLARE | |
| schem text; | |
| tabl text; | |
| sr int4; | |
| BEGIN | |
| IF $1 IS NULL THEN | |
| RAISE EXCEPTION 'find_srid() - schema is NULL!'; | |
| END IF; | |
| IF $2 IS NULL THEN | |
| RAISE EXCEPTION 'find_srid() - table name is NULL!'; | |
| END IF; | |
| IF $3 IS NULL THEN | |
| RAISE EXCEPTION 'find_srid() - column name is NULL!'; | |
| END IF; | |
| schem = $1; | |
| tabl = $2; | |
| -- if the table contains a . and the schema is empty | |
| -- split the table into a schema and a table | |
| -- otherwise drop through to default behavior | |
| IF ( schem = '' and tabl LIKE '%.%' ) THEN | |
| schem = substr(tabl,1,strpos(tabl,'.')-1); | |
| tabl = substr(tabl,length(schem)+2); | |
| ELSE | |
| schem = schem || '%'; | |
| END IF; | |
| select SRID into sr from geometry_columns where f_table_schema like schem and f_table_name = tabl and f_geometry_column = $3; | |
| IF NOT FOUND THEN | |
| RAISE EXCEPTION 'find_srid() - couldnt find the corresponding SRID - is the geometry registered in the GEOMETRY_COLUMNS table? Is there an uppercase/lowercase missmatch?'; | |
| END IF; | |
| return sr; | |
| END; | |
| $_$; | |
| ALTER FUNCTION public.find_srid(character varying, character varying, character varying) OWNER TO postgres; | |
| -- | |
| -- TOC entry 160 (class 1255 OID 18513) | |
| -- Dependencies: 6 1167 | |
| -- Name: fix_geometry_columns(); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION fix_geometry_columns() RETURNS text | |
| LANGUAGE plpgsql | |
| AS $$ | |
| DECLARE | |
| mislinked record; | |
| result text; | |
| linked integer; | |
| deleted integer; | |
| foundschema integer; | |
| BEGIN | |
| -- Since 7.3 schema support has been added. | |
| -- Previous postgis versions used to put the database name in | |
| -- the schema column. This needs to be fixed, so we try to | |
| -- set the correct schema for each geometry_colums record | |
| -- looking at table, column, type and srid. | |
| UPDATE geometry_columns SET f_table_schema = n.nspname | |
| FROM pg_namespace n, pg_class c, pg_attribute a, | |
| pg_constraint sridcheck, pg_constraint typecheck | |
| WHERE ( f_table_schema is NULL | |
| OR f_table_schema = '' | |
| OR f_table_schema NOT IN ( | |
| SELECT nspname::varchar | |
| FROM pg_namespace nn, pg_class cc, pg_attribute aa | |
| WHERE cc.relnamespace = nn.oid | |
| AND cc.relname = f_table_name::name | |
| AND aa.attrelid = cc.oid | |
| AND aa.attname = f_geometry_column::name)) | |
| AND f_table_name::name = c.relname | |
| AND c.oid = a.attrelid | |
| AND c.relnamespace = n.oid | |
| AND f_geometry_column::name = a.attname | |
| AND sridcheck.conrelid = c.oid | |
| AND sridcheck.consrc LIKE '(srid(% = %)' | |
| AND sridcheck.consrc ~ textcat(' = ', srid::text) | |
| AND typecheck.conrelid = c.oid | |
| AND typecheck.consrc LIKE | |
| '((geometrytype(%) = ''%''::text) OR (% IS NULL))' | |
| AND typecheck.consrc ~ textcat(' = ''', type::text) | |
| AND NOT EXISTS ( | |
| SELECT oid FROM geometry_columns gc | |
| WHERE c.relname::varchar = gc.f_table_name | |
| AND n.nspname::varchar = gc.f_table_schema | |
| AND a.attname::varchar = gc.f_geometry_column | |
| ); | |
| GET DIAGNOSTICS foundschema = ROW_COUNT; | |
| -- no linkage to system table needed | |
| return 'fixed:'||foundschema::text; | |
| END; | |
| $$; | |
| ALTER FUNCTION public.fix_geometry_columns() OWNER TO postgres; | |
| -- | |
| -- TOC entry 161 (class 1255 OID 18514) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: force_2d(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION force_2d(geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_force_2d'; | |
| ALTER FUNCTION public.force_2d(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 162 (class 1255 OID 18515) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: force_3d(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION force_3d(geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_force_3dz'; | |
| ALTER FUNCTION public.force_3d(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 163 (class 1255 OID 18516) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: force_3dm(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION force_3dm(geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_force_3dm'; | |
| ALTER FUNCTION public.force_3dm(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 164 (class 1255 OID 18517) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: force_3dz(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION force_3dz(geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_force_3dz'; | |
| ALTER FUNCTION public.force_3dz(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 165 (class 1255 OID 18518) | |
| -- Dependencies: 1102 1102 6 | |
| -- Name: force_4d(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION force_4d(geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_force_4d'; | |
| ALTER FUNCTION public.force_4d(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 166 (class 1255 OID 18519) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: force_collection(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION force_collection(geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_force_collection'; | |
| ALTER FUNCTION public.force_collection(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 167 (class 1255 OID 18520) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: forcerhr(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION forcerhr(geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_forceRHR_poly'; | |
| ALTER FUNCTION public.forcerhr(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 169 (class 1255 OID 18522) | |
| -- Dependencies: 6 1102 1099 | |
| -- Name: geography(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geography(geometry) RETURNS geography | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'geography_from_geometry'; | |
| ALTER FUNCTION public.geography(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 168 (class 1255 OID 18521) | |
| -- Dependencies: 6 1099 1099 | |
| -- Name: geography(geography, integer, boolean); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geography(geography, integer, boolean) RETURNS geography | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'geography_enforce_typmod'; | |
| ALTER FUNCTION public.geography(geography, integer, boolean) OWNER TO postgres; | |
| -- | |
| -- TOC entry 170 (class 1255 OID 18523) | |
| -- Dependencies: 1099 1099 6 | |
| -- Name: geography_cmp(geography, geography); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geography_cmp(geography, geography) RETURNS integer | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'geography_cmp'; | |
| ALTER FUNCTION public.geography_cmp(geography, geography) OWNER TO postgres; | |
| -- | |
| -- TOC entry 171 (class 1255 OID 18524) | |
| -- Dependencies: 1099 6 1099 | |
| -- Name: geography_eq(geography, geography); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geography_eq(geography, geography) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'geography_eq'; | |
| ALTER FUNCTION public.geography_eq(geography, geography) OWNER TO postgres; | |
| -- | |
| -- TOC entry 172 (class 1255 OID 18525) | |
| -- Dependencies: 6 1099 1099 | |
| -- Name: geography_ge(geography, geography); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geography_ge(geography, geography) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'geography_ge'; | |
| ALTER FUNCTION public.geography_ge(geography, geography) OWNER TO postgres; | |
| -- | |
| -- TOC entry 173 (class 1255 OID 18526) | |
| -- Dependencies: 6 | |
| -- Name: geography_gist_compress(internal); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geography_gist_compress(internal) RETURNS internal | |
| LANGUAGE c | |
| AS '$libdir/postgis-1.5', 'geography_gist_compress'; | |
| ALTER FUNCTION public.geography_gist_compress(internal) OWNER TO postgres; | |
| -- | |
| -- TOC entry 174 (class 1255 OID 18527) | |
| -- Dependencies: 6 1102 | |
| -- Name: geography_gist_consistent(internal, geometry, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geography_gist_consistent(internal, geometry, integer) RETURNS boolean | |
| LANGUAGE c | |
| AS '$libdir/postgis-1.5', 'geography_gist_consistent'; | |
| ALTER FUNCTION public.geography_gist_consistent(internal, geometry, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 175 (class 1255 OID 18528) | |
| -- Dependencies: 6 | |
| -- Name: geography_gist_decompress(internal); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geography_gist_decompress(internal) RETURNS internal | |
| LANGUAGE c | |
| AS '$libdir/postgis-1.5', 'geography_gist_decompress'; | |
| ALTER FUNCTION public.geography_gist_decompress(internal) OWNER TO postgres; | |
| -- | |
| -- TOC entry 176 (class 1255 OID 18529) | |
| -- Dependencies: 6 | |
| -- Name: geography_gist_join_selectivity(internal, oid, internal, smallint); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geography_gist_join_selectivity(internal, oid, internal, smallint) RETURNS double precision | |
| LANGUAGE c | |
| AS '$libdir/postgis-1.5', 'geography_gist_join_selectivity'; | |
| ALTER FUNCTION public.geography_gist_join_selectivity(internal, oid, internal, smallint) OWNER TO postgres; | |
| -- | |
| -- TOC entry 177 (class 1255 OID 18530) | |
| -- Dependencies: 6 | |
| -- Name: geography_gist_penalty(internal, internal, internal); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geography_gist_penalty(internal, internal, internal) RETURNS internal | |
| LANGUAGE c | |
| AS '$libdir/postgis-1.5', 'geography_gist_penalty'; | |
| ALTER FUNCTION public.geography_gist_penalty(internal, internal, internal) OWNER TO postgres; | |
| -- | |
| -- TOC entry 178 (class 1255 OID 18531) | |
| -- Dependencies: 6 | |
| -- Name: geography_gist_picksplit(internal, internal); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geography_gist_picksplit(internal, internal) RETURNS internal | |
| LANGUAGE c | |
| AS '$libdir/postgis-1.5', 'geography_gist_picksplit'; | |
| ALTER FUNCTION public.geography_gist_picksplit(internal, internal) OWNER TO postgres; | |
| -- | |
| -- TOC entry 179 (class 1255 OID 18532) | |
| -- Dependencies: 1087 6 1087 | |
| -- Name: geography_gist_same(box2d, box2d, internal); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geography_gist_same(box2d, box2d, internal) RETURNS internal | |
| LANGUAGE c | |
| AS '$libdir/postgis-1.5', 'geography_gist_same'; | |
| ALTER FUNCTION public.geography_gist_same(box2d, box2d, internal) OWNER TO postgres; | |
| -- | |
| -- TOC entry 180 (class 1255 OID 18533) | |
| -- Dependencies: 6 | |
| -- Name: geography_gist_selectivity(internal, oid, internal, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geography_gist_selectivity(internal, oid, internal, integer) RETURNS double precision | |
| LANGUAGE c | |
| AS '$libdir/postgis-1.5', 'geography_gist_selectivity'; | |
| ALTER FUNCTION public.geography_gist_selectivity(internal, oid, internal, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 181 (class 1255 OID 18534) | |
| -- Dependencies: 6 | |
| -- Name: geography_gist_union(bytea, internal); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geography_gist_union(bytea, internal) RETURNS internal | |
| LANGUAGE c | |
| AS '$libdir/postgis-1.5', 'geography_gist_union'; | |
| ALTER FUNCTION public.geography_gist_union(bytea, internal) OWNER TO postgres; | |
| -- | |
| -- TOC entry 182 (class 1255 OID 18535) | |
| -- Dependencies: 6 1099 1099 | |
| -- Name: geography_gt(geography, geography); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geography_gt(geography, geography) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'geography_gt'; | |
| ALTER FUNCTION public.geography_gt(geography, geography) OWNER TO postgres; | |
| -- | |
| -- TOC entry 183 (class 1255 OID 18536) | |
| -- Dependencies: 6 1099 1099 | |
| -- Name: geography_le(geography, geography); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geography_le(geography, geography) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'geography_le'; | |
| ALTER FUNCTION public.geography_le(geography, geography) OWNER TO postgres; | |
| -- | |
| -- TOC entry 184 (class 1255 OID 18537) | |
| -- Dependencies: 6 1099 1099 | |
| -- Name: geography_lt(geography, geography); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geography_lt(geography, geography) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'geography_lt'; | |
| ALTER FUNCTION public.geography_lt(geography, geography) OWNER TO postgres; | |
| -- | |
| -- TOC entry 185 (class 1255 OID 18538) | |
| -- Dependencies: 6 1099 1099 | |
| -- Name: geography_overlaps(geography, geography); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geography_overlaps(geography, geography) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'geography_overlaps'; | |
| ALTER FUNCTION public.geography_overlaps(geography, geography) OWNER TO postgres; | |
| -- | |
| -- TOC entry 186 (class 1255 OID 18539) | |
| -- Dependencies: 6 | |
| -- Name: geography_typmod_dims(integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geography_typmod_dims(integer) RETURNS integer | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'geography_typmod_dims'; | |
| ALTER FUNCTION public.geography_typmod_dims(integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 187 (class 1255 OID 18540) | |
| -- Dependencies: 6 | |
| -- Name: geography_typmod_srid(integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geography_typmod_srid(integer) RETURNS integer | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'geography_typmod_srid'; | |
| ALTER FUNCTION public.geography_typmod_srid(integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 188 (class 1255 OID 18541) | |
| -- Dependencies: 6 | |
| -- Name: geography_typmod_type(integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geography_typmod_type(integer) RETURNS text | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'geography_typmod_type'; | |
| ALTER FUNCTION public.geography_typmod_type(integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 190 (class 1255 OID 18543) | |
| -- Dependencies: 6 1102 | |
| -- Name: geomcollfromtext(text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geomcollfromtext(text) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE | |
| WHEN geometrytype(GeomFromText($1)) = 'GEOMETRYCOLLECTION' | |
| THEN GeomFromText($1) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.geomcollfromtext(text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 189 (class 1255 OID 18542) | |
| -- Dependencies: 6 1102 | |
| -- Name: geomcollfromtext(text, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geomcollfromtext(text, integer) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE | |
| WHEN geometrytype(GeomFromText($1, $2)) = 'GEOMETRYCOLLECTION' | |
| THEN GeomFromText($1,$2) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.geomcollfromtext(text, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 192 (class 1255 OID 18545) | |
| -- Dependencies: 6 1102 | |
| -- Name: geomcollfromwkb(bytea); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geomcollfromwkb(bytea) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE | |
| WHEN geometrytype(GeomFromWKB($1)) = 'GEOMETRYCOLLECTION' | |
| THEN GeomFromWKB($1) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.geomcollfromwkb(bytea) OWNER TO postgres; | |
| -- | |
| -- TOC entry 191 (class 1255 OID 18544) | |
| -- Dependencies: 6 1102 | |
| -- Name: geomcollfromwkb(bytea, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geomcollfromwkb(bytea, integer) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE | |
| WHEN geometrytype(GeomFromWKB($1, $2)) = 'GEOMETRYCOLLECTION' | |
| THEN GeomFromWKB($1, $2) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.geomcollfromwkb(bytea, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 193 (class 1255 OID 18546) | |
| -- Dependencies: 6 1102 1093 | |
| -- Name: geometry(box3d_extent); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geometry(box3d_extent) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'BOX3D_to_LWGEOM'; | |
| ALTER FUNCTION public.geometry(box3d_extent) OWNER TO postgres; | |
| -- | |
| -- TOC entry 194 (class 1255 OID 18547) | |
| -- Dependencies: 6 1102 1087 | |
| -- Name: geometry(box2d); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geometry(box2d) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'BOX2DFLOAT4_to_LWGEOM'; | |
| ALTER FUNCTION public.geometry(box2d) OWNER TO postgres; | |
| -- | |
| -- TOC entry 195 (class 1255 OID 18548) | |
| -- Dependencies: 6 1102 1090 | |
| -- Name: geometry(box3d); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geometry(box3d) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'BOX3D_to_LWGEOM'; | |
| ALTER FUNCTION public.geometry(box3d) OWNER TO postgres; | |
| -- | |
| -- TOC entry 196 (class 1255 OID 18549) | |
| -- Dependencies: 6 1102 | |
| -- Name: geometry(text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geometry(text) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'parse_WKT_lwgeom'; | |
| ALTER FUNCTION public.geometry(text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 197 (class 1255 OID 18550) | |
| -- Dependencies: 6 1102 1096 | |
| -- Name: geometry(chip); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geometry(chip) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'CHIP_to_LWGEOM'; | |
| ALTER FUNCTION public.geometry(chip) OWNER TO postgres; | |
| -- | |
| -- TOC entry 198 (class 1255 OID 18551) | |
| -- Dependencies: 6 1102 | |
| -- Name: geometry(bytea); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geometry(bytea) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_from_bytea'; | |
| ALTER FUNCTION public.geometry(bytea) OWNER TO postgres; | |
| -- | |
| -- TOC entry 199 (class 1255 OID 18552) | |
| -- Dependencies: 6 1102 1099 | |
| -- Name: geometry(geography); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geometry(geography) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'geometry_from_geography'; | |
| ALTER FUNCTION public.geometry(geography) OWNER TO postgres; | |
| -- | |
| -- TOC entry 200 (class 1255 OID 18553) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: geometry_above(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geometry_above(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_above'; | |
| ALTER FUNCTION public.geometry_above(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 201 (class 1255 OID 18554) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: geometry_below(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geometry_below(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_below'; | |
| ALTER FUNCTION public.geometry_below(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 202 (class 1255 OID 18555) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: geometry_cmp(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geometry_cmp(geometry, geometry) RETURNS integer | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'lwgeom_cmp'; | |
| ALTER FUNCTION public.geometry_cmp(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 203 (class 1255 OID 18556) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: geometry_contain(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geometry_contain(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_contain'; | |
| ALTER FUNCTION public.geometry_contain(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 204 (class 1255 OID 18557) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: geometry_contained(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geometry_contained(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_contained'; | |
| ALTER FUNCTION public.geometry_contained(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 205 (class 1255 OID 18558) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: geometry_eq(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geometry_eq(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'lwgeom_eq'; | |
| ALTER FUNCTION public.geometry_eq(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 206 (class 1255 OID 18559) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: geometry_ge(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geometry_ge(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'lwgeom_ge'; | |
| ALTER FUNCTION public.geometry_ge(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 207 (class 1255 OID 18560) | |
| -- Dependencies: 6 | |
| -- Name: geometry_gist_joinsel(internal, oid, internal, smallint); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geometry_gist_joinsel(internal, oid, internal, smallint) RETURNS double precision | |
| LANGUAGE c | |
| AS '$libdir/postgis-1.5', 'LWGEOM_gist_joinsel'; | |
| ALTER FUNCTION public.geometry_gist_joinsel(internal, oid, internal, smallint) OWNER TO postgres; | |
| -- | |
| -- TOC entry 208 (class 1255 OID 18561) | |
| -- Dependencies: 6 | |
| -- Name: geometry_gist_sel(internal, oid, internal, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geometry_gist_sel(internal, oid, internal, integer) RETURNS double precision | |
| LANGUAGE c | |
| AS '$libdir/postgis-1.5', 'LWGEOM_gist_sel'; | |
| ALTER FUNCTION public.geometry_gist_sel(internal, oid, internal, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 209 (class 1255 OID 18562) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: geometry_gt(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geometry_gt(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'lwgeom_gt'; | |
| ALTER FUNCTION public.geometry_gt(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 210 (class 1255 OID 18563) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: geometry_le(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geometry_le(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'lwgeom_le'; | |
| ALTER FUNCTION public.geometry_le(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 211 (class 1255 OID 18564) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: geometry_left(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geometry_left(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_left'; | |
| ALTER FUNCTION public.geometry_left(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 212 (class 1255 OID 18565) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: geometry_lt(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geometry_lt(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'lwgeom_lt'; | |
| ALTER FUNCTION public.geometry_lt(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 213 (class 1255 OID 18566) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: geometry_overabove(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geometry_overabove(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_overabove'; | |
| ALTER FUNCTION public.geometry_overabove(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 214 (class 1255 OID 18567) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: geometry_overbelow(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geometry_overbelow(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_overbelow'; | |
| ALTER FUNCTION public.geometry_overbelow(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 215 (class 1255 OID 18568) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: geometry_overlap(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geometry_overlap(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_overlap'; | |
| ALTER FUNCTION public.geometry_overlap(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 216 (class 1255 OID 18569) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: geometry_overleft(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geometry_overleft(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_overleft'; | |
| ALTER FUNCTION public.geometry_overleft(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 217 (class 1255 OID 18570) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: geometry_overright(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geometry_overright(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_overright'; | |
| ALTER FUNCTION public.geometry_overright(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 218 (class 1255 OID 18571) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: geometry_right(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geometry_right(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_right'; | |
| ALTER FUNCTION public.geometry_right(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 219 (class 1255 OID 18572) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: geometry_same(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geometry_same(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_samebox'; | |
| ALTER FUNCTION public.geometry_same(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 220 (class 1255 OID 18573) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: geometry_samebox(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geometry_samebox(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_samebox'; | |
| ALTER FUNCTION public.geometry_samebox(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 221 (class 1255 OID 18574) | |
| -- Dependencies: 6 1102 | |
| -- Name: geometryfromtext(text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geometryfromtext(text) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_from_text'; | |
| ALTER FUNCTION public.geometryfromtext(text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 222 (class 1255 OID 18575) | |
| -- Dependencies: 1102 6 | |
| -- Name: geometryfromtext(text, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geometryfromtext(text, integer) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_from_text'; | |
| ALTER FUNCTION public.geometryfromtext(text, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 223 (class 1255 OID 18576) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: geometryn(geometry, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geometryn(geometry, integer) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_geometryn_collection'; | |
| ALTER FUNCTION public.geometryn(geometry, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 224 (class 1255 OID 18577) | |
| -- Dependencies: 1102 6 | |
| -- Name: geometrytype(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geometrytype(geometry) RETURNS text | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_getTYPE'; | |
| ALTER FUNCTION public.geometrytype(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 225 (class 1255 OID 18578) | |
| -- Dependencies: 6 1102 | |
| -- Name: geomfromewkb(bytea); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geomfromewkb(bytea) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOMFromWKB'; | |
| ALTER FUNCTION public.geomfromewkb(bytea) OWNER TO postgres; | |
| -- | |
| -- TOC entry 226 (class 1255 OID 18579) | |
| -- Dependencies: 6 1102 | |
| -- Name: geomfromewkt(text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geomfromewkt(text) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'parse_WKT_lwgeom'; | |
| ALTER FUNCTION public.geomfromewkt(text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 227 (class 1255 OID 18580) | |
| -- Dependencies: 6 1102 | |
| -- Name: geomfromtext(text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geomfromtext(text) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT geometryfromtext($1)$_$; | |
| ALTER FUNCTION public.geomfromtext(text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 228 (class 1255 OID 18581) | |
| -- Dependencies: 6 1102 | |
| -- Name: geomfromtext(text, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geomfromtext(text, integer) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT geometryfromtext($1, $2)$_$; | |
| ALTER FUNCTION public.geomfromtext(text, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 229 (class 1255 OID 18582) | |
| -- Dependencies: 6 1102 | |
| -- Name: geomfromwkb(bytea); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geomfromwkb(bytea) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_from_WKB'; | |
| ALTER FUNCTION public.geomfromwkb(bytea) OWNER TO postgres; | |
| -- | |
| -- TOC entry 230 (class 1255 OID 18583) | |
| -- Dependencies: 6 1102 | |
| -- Name: geomfromwkb(bytea, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geomfromwkb(bytea, integer) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT setSRID(GeomFromWKB($1), $2)$_$; | |
| ALTER FUNCTION public.geomfromwkb(bytea, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 231 (class 1255 OID 18584) | |
| -- Dependencies: 1102 6 1102 1102 | |
| -- Name: geomunion(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION geomunion(geometry, geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'geomunion'; | |
| ALTER FUNCTION public.geomunion(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 232 (class 1255 OID 18585) | |
| -- Dependencies: 6 1167 | |
| -- Name: get_proj4_from_srid(integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION get_proj4_from_srid(integer) RETURNS text | |
| LANGUAGE plpgsql IMMUTABLE STRICT | |
| AS $_$ | |
| BEGIN | |
| RETURN proj4text::text FROM spatial_ref_sys WHERE srid= $1; | |
| END; | |
| $_$; | |
| ALTER FUNCTION public.get_proj4_from_srid(integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 233 (class 1255 OID 18586) | |
| -- Dependencies: 1087 6 1102 | |
| -- Name: getbbox(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION getbbox(geometry) RETURNS box2d | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_to_BOX2DFLOAT4'; | |
| ALTER FUNCTION public.getbbox(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 234 (class 1255 OID 18587) | |
| -- Dependencies: 1102 6 | |
| -- Name: getsrid(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION getsrid(geometry) RETURNS integer | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_getSRID'; | |
| ALTER FUNCTION public.getsrid(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 235 (class 1255 OID 18588) | |
| -- Dependencies: 6 | |
| -- Name: gettransactionid(); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION gettransactionid() RETURNS xid | |
| LANGUAGE c | |
| AS '$libdir/postgis-1.5', 'getTransactionID'; | |
| ALTER FUNCTION public.gettransactionid() OWNER TO postgres; | |
| -- | |
| -- TOC entry 236 (class 1255 OID 18589) | |
| -- Dependencies: 1102 6 | |
| -- Name: hasbbox(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION hasbbox(geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_hasBBOX'; | |
| ALTER FUNCTION public.hasbbox(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 237 (class 1255 OID 18590) | |
| -- Dependencies: 6 1096 | |
| -- Name: height(chip); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION height(chip) RETURNS integer | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'CHIP_getHeight'; | |
| ALTER FUNCTION public.height(chip) OWNER TO postgres; | |
| -- | |
| -- TOC entry 238 (class 1255 OID 18591) | |
| -- Dependencies: 1102 1102 6 | |
| -- Name: interiorringn(geometry, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION interiorringn(geometry, integer) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_interiorringn_polygon'; | |
| ALTER FUNCTION public.interiorringn(geometry, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 239 (class 1255 OID 18592) | |
| -- Dependencies: 1102 6 1102 1102 | |
| -- Name: intersection(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION intersection(geometry, geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'intersection'; | |
| ALTER FUNCTION public.intersection(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 240 (class 1255 OID 18593) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: intersects(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION intersects(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'intersects'; | |
| ALTER FUNCTION public.intersects(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 241 (class 1255 OID 18594) | |
| -- Dependencies: 6 1102 | |
| -- Name: isclosed(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION isclosed(geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_isclosed_linestring'; | |
| ALTER FUNCTION public.isclosed(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 242 (class 1255 OID 18595) | |
| -- Dependencies: 6 1102 | |
| -- Name: isempty(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION isempty(geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_isempty'; | |
| ALTER FUNCTION public.isempty(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 243 (class 1255 OID 18596) | |
| -- Dependencies: 1102 6 | |
| -- Name: isring(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION isring(geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'isring'; | |
| ALTER FUNCTION public.isring(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 244 (class 1255 OID 18597) | |
| -- Dependencies: 6 1102 | |
| -- Name: issimple(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION issimple(geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'issimple'; | |
| ALTER FUNCTION public.issimple(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 245 (class 1255 OID 18598) | |
| -- Dependencies: 6 1102 | |
| -- Name: isvalid(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION isvalid(geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT COST 100 | |
| AS '$libdir/postgis-1.5', 'isvalid'; | |
| ALTER FUNCTION public.isvalid(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 246 (class 1255 OID 18599) | |
| -- Dependencies: 1102 6 | |
| -- Name: length(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION length(geometry) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_length_linestring'; | |
| ALTER FUNCTION public.length(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 247 (class 1255 OID 18600) | |
| -- Dependencies: 6 1102 | |
| -- Name: length2d(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION length2d(geometry) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_length2d_linestring'; | |
| ALTER FUNCTION public.length2d(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 248 (class 1255 OID 18601) | |
| -- Dependencies: 6 1102 1113 | |
| -- Name: length2d_spheroid(geometry, spheroid); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION length2d_spheroid(geometry, spheroid) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT COST 100 | |
| AS '$libdir/postgis-1.5', 'LWGEOM_length2d_ellipsoid'; | |
| ALTER FUNCTION public.length2d_spheroid(geometry, spheroid) OWNER TO postgres; | |
| -- | |
| -- TOC entry 249 (class 1255 OID 18602) | |
| -- Dependencies: 6 1102 | |
| -- Name: length3d(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION length3d(geometry) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_length_linestring'; | |
| ALTER FUNCTION public.length3d(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 250 (class 1255 OID 18603) | |
| -- Dependencies: 6 1102 1113 | |
| -- Name: length3d_spheroid(geometry, spheroid); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION length3d_spheroid(geometry, spheroid) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_length_ellipsoid_linestring'; | |
| ALTER FUNCTION public.length3d_spheroid(geometry, spheroid) OWNER TO postgres; | |
| -- | |
| -- TOC entry 251 (class 1255 OID 18604) | |
| -- Dependencies: 1113 6 1102 | |
| -- Name: length_spheroid(geometry, spheroid); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION length_spheroid(geometry, spheroid) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT COST 100 | |
| AS '$libdir/postgis-1.5', 'LWGEOM_length_ellipsoid_linestring'; | |
| ALTER FUNCTION public.length_spheroid(geometry, spheroid) OWNER TO postgres; | |
| -- | |
| -- TOC entry 252 (class 1255 OID 18605) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: line_interpolate_point(geometry, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION line_interpolate_point(geometry, double precision) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_line_interpolate_point'; | |
| ALTER FUNCTION public.line_interpolate_point(geometry, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 253 (class 1255 OID 18606) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: line_locate_point(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION line_locate_point(geometry, geometry) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_line_locate_point'; | |
| ALTER FUNCTION public.line_locate_point(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 254 (class 1255 OID 18607) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: line_substring(geometry, double precision, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION line_substring(geometry, double precision, double precision) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_line_substring'; | |
| ALTER FUNCTION public.line_substring(geometry, double precision, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 255 (class 1255 OID 18608) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: linefrommultipoint(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION linefrommultipoint(geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_line_from_mpoint'; | |
| ALTER FUNCTION public.linefrommultipoint(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 256 (class 1255 OID 18609) | |
| -- Dependencies: 6 1102 | |
| -- Name: linefromtext(text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION linefromtext(text) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(GeomFromText($1)) = 'LINESTRING' | |
| THEN GeomFromText($1) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.linefromtext(text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 257 (class 1255 OID 18610) | |
| -- Dependencies: 6 1102 | |
| -- Name: linefromtext(text, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION linefromtext(text, integer) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(GeomFromText($1, $2)) = 'LINESTRING' | |
| THEN GeomFromText($1,$2) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.linefromtext(text, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 259 (class 1255 OID 18612) | |
| -- Dependencies: 6 1102 | |
| -- Name: linefromwkb(bytea); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION linefromwkb(bytea) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(GeomFromWKB($1)) = 'LINESTRING' | |
| THEN GeomFromWKB($1) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.linefromwkb(bytea) OWNER TO postgres; | |
| -- | |
| -- TOC entry 258 (class 1255 OID 18611) | |
| -- Dependencies: 6 1102 | |
| -- Name: linefromwkb(bytea, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION linefromwkb(bytea, integer) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(GeomFromWKB($1, $2)) = 'LINESTRING' | |
| THEN GeomFromWKB($1, $2) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.linefromwkb(bytea, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 260 (class 1255 OID 18613) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: linemerge(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION linemerge(geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT COST 100 | |
| AS '$libdir/postgis-1.5', 'linemerge'; | |
| ALTER FUNCTION public.linemerge(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 261 (class 1255 OID 18614) | |
| -- Dependencies: 6 1102 | |
| -- Name: linestringfromtext(text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION linestringfromtext(text) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT LineFromText($1)$_$; | |
| ALTER FUNCTION public.linestringfromtext(text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 262 (class 1255 OID 18615) | |
| -- Dependencies: 6 1102 | |
| -- Name: linestringfromtext(text, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION linestringfromtext(text, integer) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT LineFromText($1, $2)$_$; | |
| ALTER FUNCTION public.linestringfromtext(text, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 264 (class 1255 OID 18617) | |
| -- Dependencies: 6 1102 | |
| -- Name: linestringfromwkb(bytea); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION linestringfromwkb(bytea) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(GeomFromWKB($1)) = 'LINESTRING' | |
| THEN GeomFromWKB($1) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.linestringfromwkb(bytea) OWNER TO postgres; | |
| -- | |
| -- TOC entry 263 (class 1255 OID 18616) | |
| -- Dependencies: 6 1102 | |
| -- Name: linestringfromwkb(bytea, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION linestringfromwkb(bytea, integer) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(GeomFromWKB($1, $2)) = 'LINESTRING' | |
| THEN GeomFromWKB($1, $2) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.linestringfromwkb(bytea, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 265 (class 1255 OID 18618) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: locate_along_measure(geometry, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION locate_along_measure(geometry, double precision) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ SELECT locate_between_measures($1, $2, $2) $_$; | |
| ALTER FUNCTION public.locate_along_measure(geometry, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 266 (class 1255 OID 18619) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: locate_between_measures(geometry, double precision, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION locate_between_measures(geometry, double precision, double precision) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_locate_between_m'; | |
| ALTER FUNCTION public.locate_between_measures(geometry, double precision, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 269 (class 1255 OID 18622) | |
| -- Dependencies: 6 | |
| -- Name: lockrow(text, text, text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION lockrow(text, text, text) RETURNS integer | |
| LANGUAGE sql STRICT | |
| AS $_$ SELECT LockRow(current_schema(), $1, $2, $3, now()::timestamp+'1:00'); $_$; | |
| ALTER FUNCTION public.lockrow(text, text, text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 268 (class 1255 OID 18621) | |
| -- Dependencies: 6 | |
| -- Name: lockrow(text, text, text, text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION lockrow(text, text, text, text) RETURNS integer | |
| LANGUAGE sql STRICT | |
| AS $_$ SELECT LockRow($1, $2, $3, $4, now()::timestamp+'1:00'); $_$; | |
| ALTER FUNCTION public.lockrow(text, text, text, text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 270 (class 1255 OID 18623) | |
| -- Dependencies: 6 | |
| -- Name: lockrow(text, text, text, timestamp without time zone); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION lockrow(text, text, text, timestamp without time zone) RETURNS integer | |
| LANGUAGE sql STRICT | |
| AS $_$ SELECT LockRow(current_schema(), $1, $2, $3, $4); $_$; | |
| ALTER FUNCTION public.lockrow(text, text, text, timestamp without time zone) OWNER TO postgres; | |
| -- | |
| -- TOC entry 267 (class 1255 OID 18620) | |
| -- Dependencies: 1167 6 | |
| -- Name: lockrow(text, text, text, text, timestamp without time zone); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION lockrow(text, text, text, text, timestamp without time zone) RETURNS integer | |
| LANGUAGE plpgsql STRICT | |
| AS $_$ | |
| DECLARE | |
| myschema alias for $1; | |
| mytable alias for $2; | |
| myrid alias for $3; | |
| authid alias for $4; | |
| expires alias for $5; | |
| ret int; | |
| mytoid oid; | |
| myrec RECORD; | |
| BEGIN | |
| IF NOT LongTransactionsEnabled() THEN | |
| RAISE EXCEPTION 'Long transaction support disabled, use EnableLongTransaction() to enable.'; | |
| END IF; | |
| EXECUTE 'DELETE FROM authorization_table WHERE expires < now()'; | |
| SELECT c.oid INTO mytoid FROM pg_class c, pg_namespace n | |
| WHERE c.relname = mytable | |
| AND c.relnamespace = n.oid | |
| AND n.nspname = myschema; | |
| -- RAISE NOTICE 'toid: %', mytoid; | |
| FOR myrec IN SELECT * FROM authorization_table WHERE | |
| toid = mytoid AND rid = myrid | |
| LOOP | |
| IF myrec.authid != authid THEN | |
| RETURN 0; | |
| ELSE | |
| RETURN 1; | |
| END IF; | |
| END LOOP; | |
| EXECUTE 'INSERT INTO authorization_table VALUES ('|| | |
| quote_literal(mytoid::text)||','||quote_literal(myrid)|| | |
| ','||quote_literal(expires::text)|| | |
| ','||quote_literal(authid) ||')'; | |
| GET DIAGNOSTICS ret = ROW_COUNT; | |
| RETURN ret; | |
| END; | |
| $_$; | |
| ALTER FUNCTION public.lockrow(text, text, text, text, timestamp without time zone) OWNER TO postgres; | |
| -- | |
| -- TOC entry 271 (class 1255 OID 18624) | |
| -- Dependencies: 1167 6 | |
| -- Name: longtransactionsenabled(); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION longtransactionsenabled() RETURNS boolean | |
| LANGUAGE plpgsql | |
| AS $$ | |
| DECLARE | |
| rec RECORD; | |
| BEGIN | |
| FOR rec IN SELECT oid FROM pg_class WHERE relname = 'authorized_tables' | |
| LOOP | |
| return 't'; | |
| END LOOP; | |
| return 'f'; | |
| END; | |
| $$; | |
| ALTER FUNCTION public.longtransactionsenabled() OWNER TO postgres; | |
| -- | |
| -- TOC entry 272 (class 1255 OID 18625) | |
| -- Dependencies: 6 | |
| -- Name: lwgeom_gist_compress(internal); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION lwgeom_gist_compress(internal) RETURNS internal | |
| LANGUAGE c | |
| AS '$libdir/postgis-1.5', 'LWGEOM_gist_compress'; | |
| ALTER FUNCTION public.lwgeom_gist_compress(internal) OWNER TO postgres; | |
| -- | |
| -- TOC entry 273 (class 1255 OID 18626) | |
| -- Dependencies: 1102 6 | |
| -- Name: lwgeom_gist_consistent(internal, geometry, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION lwgeom_gist_consistent(internal, geometry, integer) RETURNS boolean | |
| LANGUAGE c | |
| AS '$libdir/postgis-1.5', 'LWGEOM_gist_consistent'; | |
| ALTER FUNCTION public.lwgeom_gist_consistent(internal, geometry, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 274 (class 1255 OID 18627) | |
| -- Dependencies: 6 | |
| -- Name: lwgeom_gist_decompress(internal); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION lwgeom_gist_decompress(internal) RETURNS internal | |
| LANGUAGE c | |
| AS '$libdir/postgis-1.5', 'LWGEOM_gist_decompress'; | |
| ALTER FUNCTION public.lwgeom_gist_decompress(internal) OWNER TO postgres; | |
| -- | |
| -- TOC entry 275 (class 1255 OID 18628) | |
| -- Dependencies: 6 | |
| -- Name: lwgeom_gist_penalty(internal, internal, internal); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION lwgeom_gist_penalty(internal, internal, internal) RETURNS internal | |
| LANGUAGE c | |
| AS '$libdir/postgis-1.5', 'LWGEOM_gist_penalty'; | |
| ALTER FUNCTION public.lwgeom_gist_penalty(internal, internal, internal) OWNER TO postgres; | |
| -- | |
| -- TOC entry 276 (class 1255 OID 18629) | |
| -- Dependencies: 6 | |
| -- Name: lwgeom_gist_picksplit(internal, internal); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION lwgeom_gist_picksplit(internal, internal) RETURNS internal | |
| LANGUAGE c | |
| AS '$libdir/postgis-1.5', 'LWGEOM_gist_picksplit'; | |
| ALTER FUNCTION public.lwgeom_gist_picksplit(internal, internal) OWNER TO postgres; | |
| -- | |
| -- TOC entry 277 (class 1255 OID 18630) | |
| -- Dependencies: 1087 6 1087 | |
| -- Name: lwgeom_gist_same(box2d, box2d, internal); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION lwgeom_gist_same(box2d, box2d, internal) RETURNS internal | |
| LANGUAGE c | |
| AS '$libdir/postgis-1.5', 'LWGEOM_gist_same'; | |
| ALTER FUNCTION public.lwgeom_gist_same(box2d, box2d, internal) OWNER TO postgres; | |
| -- | |
| -- TOC entry 278 (class 1255 OID 18631) | |
| -- Dependencies: 6 | |
| -- Name: lwgeom_gist_union(bytea, internal); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION lwgeom_gist_union(bytea, internal) RETURNS internal | |
| LANGUAGE c | |
| AS '$libdir/postgis-1.5', 'LWGEOM_gist_union'; | |
| ALTER FUNCTION public.lwgeom_gist_union(bytea, internal) OWNER TO postgres; | |
| -- | |
| -- TOC entry 279 (class 1255 OID 18632) | |
| -- Dependencies: 1102 6 | |
| -- Name: m(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION m(geometry) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_m_point'; | |
| ALTER FUNCTION public.m(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 280 (class 1255 OID 18633) | |
| -- Dependencies: 1087 6 1102 1102 | |
| -- Name: makebox2d(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION makebox2d(geometry, geometry) RETURNS box2d | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'BOX2DFLOAT4_construct'; | |
| ALTER FUNCTION public.makebox2d(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 281 (class 1255 OID 18634) | |
| -- Dependencies: 1102 6 1102 1090 | |
| -- Name: makebox3d(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION makebox3d(geometry, geometry) RETURNS box3d | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'BOX3D_construct'; | |
| ALTER FUNCTION public.makebox3d(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 282 (class 1255 OID 18635) | |
| -- Dependencies: 1102 6 1102 1102 | |
| -- Name: makeline(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION makeline(geometry, geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_makeline'; | |
| ALTER FUNCTION public.makeline(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 283 (class 1255 OID 18636) | |
| -- Dependencies: 6 1102 1104 | |
| -- Name: makeline_garray(geometry[]); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION makeline_garray(geometry[]) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_makeline_garray'; | |
| ALTER FUNCTION public.makeline_garray(geometry[]) OWNER TO postgres; | |
| -- | |
| -- TOC entry 284 (class 1255 OID 18637) | |
| -- Dependencies: 6 1102 | |
| -- Name: makepoint(double precision, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION makepoint(double precision, double precision) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_makepoint'; | |
| ALTER FUNCTION public.makepoint(double precision, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 285 (class 1255 OID 18638) | |
| -- Dependencies: 6 1102 | |
| -- Name: makepoint(double precision, double precision, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION makepoint(double precision, double precision, double precision) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_makepoint'; | |
| ALTER FUNCTION public.makepoint(double precision, double precision, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 286 (class 1255 OID 18639) | |
| -- Dependencies: 6 1102 | |
| -- Name: makepoint(double precision, double precision, double precision, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION makepoint(double precision, double precision, double precision, double precision) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_makepoint'; | |
| ALTER FUNCTION public.makepoint(double precision, double precision, double precision, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 287 (class 1255 OID 18640) | |
| -- Dependencies: 6 1102 | |
| -- Name: makepointm(double precision, double precision, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION makepointm(double precision, double precision, double precision) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_makepoint3dm'; | |
| ALTER FUNCTION public.makepointm(double precision, double precision, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 289 (class 1255 OID 18642) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: makepolygon(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION makepolygon(geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_makepoly'; | |
| ALTER FUNCTION public.makepolygon(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 288 (class 1255 OID 18641) | |
| -- Dependencies: 6 1104 1102 1102 | |
| -- Name: makepolygon(geometry, geometry[]); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION makepolygon(geometry, geometry[]) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_makepoly'; | |
| ALTER FUNCTION public.makepolygon(geometry, geometry[]) OWNER TO postgres; | |
| -- | |
| -- TOC entry 290 (class 1255 OID 18643) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: max_distance(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION max_distance(geometry, geometry) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_maxdistance2d_linestring'; | |
| ALTER FUNCTION public.max_distance(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 291 (class 1255 OID 18644) | |
| -- Dependencies: 1102 6 | |
| -- Name: mem_size(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION mem_size(geometry) RETURNS integer | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_mem_size'; | |
| ALTER FUNCTION public.mem_size(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 293 (class 1255 OID 18646) | |
| -- Dependencies: 6 1102 | |
| -- Name: mlinefromtext(text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION mlinefromtext(text) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(GeomFromText($1)) = 'MULTILINESTRING' | |
| THEN GeomFromText($1) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.mlinefromtext(text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 292 (class 1255 OID 18645) | |
| -- Dependencies: 1102 6 | |
| -- Name: mlinefromtext(text, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION mlinefromtext(text, integer) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE | |
| WHEN geometrytype(GeomFromText($1, $2)) = 'MULTILINESTRING' | |
| THEN GeomFromText($1,$2) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.mlinefromtext(text, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 295 (class 1255 OID 18648) | |
| -- Dependencies: 1102 6 | |
| -- Name: mlinefromwkb(bytea); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION mlinefromwkb(bytea) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(GeomFromWKB($1)) = 'MULTILINESTRING' | |
| THEN GeomFromWKB($1) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.mlinefromwkb(bytea) OWNER TO postgres; | |
| -- | |
| -- TOC entry 294 (class 1255 OID 18647) | |
| -- Dependencies: 6 1102 | |
| -- Name: mlinefromwkb(bytea, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION mlinefromwkb(bytea, integer) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(GeomFromWKB($1, $2)) = 'MULTILINESTRING' | |
| THEN GeomFromWKB($1, $2) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.mlinefromwkb(bytea, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 297 (class 1255 OID 18650) | |
| -- Dependencies: 6 1102 | |
| -- Name: mpointfromtext(text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION mpointfromtext(text) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(GeomFromText($1)) = 'MULTIPOINT' | |
| THEN GeomFromText($1) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.mpointfromtext(text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 296 (class 1255 OID 18649) | |
| -- Dependencies: 1102 6 | |
| -- Name: mpointfromtext(text, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION mpointfromtext(text, integer) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(GeomFromText($1,$2)) = 'MULTIPOINT' | |
| THEN GeomFromText($1,$2) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.mpointfromtext(text, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 299 (class 1255 OID 18652) | |
| -- Dependencies: 6 1102 | |
| -- Name: mpointfromwkb(bytea); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION mpointfromwkb(bytea) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(GeomFromWKB($1)) = 'MULTIPOINT' | |
| THEN GeomFromWKB($1) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.mpointfromwkb(bytea) OWNER TO postgres; | |
| -- | |
| -- TOC entry 298 (class 1255 OID 18651) | |
| -- Dependencies: 1102 6 | |
| -- Name: mpointfromwkb(bytea, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION mpointfromwkb(bytea, integer) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(GeomFromWKB($1,$2)) = 'MULTIPOINT' | |
| THEN GeomFromWKB($1, $2) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.mpointfromwkb(bytea, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 301 (class 1255 OID 18654) | |
| -- Dependencies: 1102 6 | |
| -- Name: mpolyfromtext(text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION mpolyfromtext(text) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(GeomFromText($1)) = 'MULTIPOLYGON' | |
| THEN GeomFromText($1) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.mpolyfromtext(text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 300 (class 1255 OID 18653) | |
| -- Dependencies: 6 1102 | |
| -- Name: mpolyfromtext(text, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION mpolyfromtext(text, integer) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(GeomFromText($1, $2)) = 'MULTIPOLYGON' | |
| THEN GeomFromText($1,$2) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.mpolyfromtext(text, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 303 (class 1255 OID 18656) | |
| -- Dependencies: 6 1102 | |
| -- Name: mpolyfromwkb(bytea); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION mpolyfromwkb(bytea) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(GeomFromWKB($1)) = 'MULTIPOLYGON' | |
| THEN GeomFromWKB($1) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.mpolyfromwkb(bytea) OWNER TO postgres; | |
| -- | |
| -- TOC entry 302 (class 1255 OID 18655) | |
| -- Dependencies: 1102 6 | |
| -- Name: mpolyfromwkb(bytea, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION mpolyfromwkb(bytea, integer) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(GeomFromWKB($1, $2)) = 'MULTIPOLYGON' | |
| THEN GeomFromWKB($1, $2) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.mpolyfromwkb(bytea, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 304 (class 1255 OID 18657) | |
| -- Dependencies: 1102 1102 6 | |
| -- Name: multi(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION multi(geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_force_multi'; | |
| ALTER FUNCTION public.multi(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 306 (class 1255 OID 18659) | |
| -- Dependencies: 1102 6 | |
| -- Name: multilinefromwkb(bytea); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION multilinefromwkb(bytea) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(GeomFromWKB($1)) = 'MULTILINESTRING' | |
| THEN GeomFromWKB($1) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.multilinefromwkb(bytea) OWNER TO postgres; | |
| -- | |
| -- TOC entry 305 (class 1255 OID 18658) | |
| -- Dependencies: 1102 6 | |
| -- Name: multilinefromwkb(bytea, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION multilinefromwkb(bytea, integer) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(GeomFromWKB($1, $2)) = 'MULTILINESTRING' | |
| THEN GeomFromWKB($1, $2) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.multilinefromwkb(bytea, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 307 (class 1255 OID 18660) | |
| -- Dependencies: 1102 6 | |
| -- Name: multilinestringfromtext(text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION multilinestringfromtext(text) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT ST_MLineFromText($1)$_$; | |
| ALTER FUNCTION public.multilinestringfromtext(text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 308 (class 1255 OID 18661) | |
| -- Dependencies: 1102 6 | |
| -- Name: multilinestringfromtext(text, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION multilinestringfromtext(text, integer) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT MLineFromText($1, $2)$_$; | |
| ALTER FUNCTION public.multilinestringfromtext(text, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 310 (class 1255 OID 18663) | |
| -- Dependencies: 1102 6 | |
| -- Name: multipointfromtext(text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION multipointfromtext(text) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT MPointFromText($1)$_$; | |
| ALTER FUNCTION public.multipointfromtext(text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 309 (class 1255 OID 18662) | |
| -- Dependencies: 6 1102 | |
| -- Name: multipointfromtext(text, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION multipointfromtext(text, integer) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT MPointFromText($1, $2)$_$; | |
| ALTER FUNCTION public.multipointfromtext(text, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 312 (class 1255 OID 18665) | |
| -- Dependencies: 6 1102 | |
| -- Name: multipointfromwkb(bytea); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION multipointfromwkb(bytea) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(GeomFromWKB($1)) = 'MULTIPOINT' | |
| THEN GeomFromWKB($1) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.multipointfromwkb(bytea) OWNER TO postgres; | |
| -- | |
| -- TOC entry 311 (class 1255 OID 18664) | |
| -- Dependencies: 6 1102 | |
| -- Name: multipointfromwkb(bytea, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION multipointfromwkb(bytea, integer) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(GeomFromWKB($1,$2)) = 'MULTIPOINT' | |
| THEN GeomFromWKB($1, $2) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.multipointfromwkb(bytea, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 314 (class 1255 OID 18667) | |
| -- Dependencies: 1102 6 | |
| -- Name: multipolyfromwkb(bytea); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION multipolyfromwkb(bytea) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(GeomFromWKB($1)) = 'MULTIPOLYGON' | |
| THEN GeomFromWKB($1) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.multipolyfromwkb(bytea) OWNER TO postgres; | |
| -- | |
| -- TOC entry 313 (class 1255 OID 18666) | |
| -- Dependencies: 6 1102 | |
| -- Name: multipolyfromwkb(bytea, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION multipolyfromwkb(bytea, integer) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(GeomFromWKB($1, $2)) = 'MULTIPOLYGON' | |
| THEN GeomFromWKB($1, $2) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.multipolyfromwkb(bytea, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 316 (class 1255 OID 18669) | |
| -- Dependencies: 6 1102 | |
| -- Name: multipolygonfromtext(text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION multipolygonfromtext(text) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT MPolyFromText($1)$_$; | |
| ALTER FUNCTION public.multipolygonfromtext(text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 315 (class 1255 OID 18668) | |
| -- Dependencies: 6 1102 | |
| -- Name: multipolygonfromtext(text, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION multipolygonfromtext(text, integer) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT MPolyFromText($1, $2)$_$; | |
| ALTER FUNCTION public.multipolygonfromtext(text, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 317 (class 1255 OID 18670) | |
| -- Dependencies: 6 1102 | |
| -- Name: ndims(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION ndims(geometry) RETURNS smallint | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_ndims'; | |
| ALTER FUNCTION public.ndims(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 318 (class 1255 OID 18671) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: noop(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION noop(geometry) RETURNS geometry | |
| LANGUAGE c STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_noop'; | |
| ALTER FUNCTION public.noop(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 319 (class 1255 OID 18672) | |
| -- Dependencies: 6 1102 | |
| -- Name: npoints(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION npoints(geometry) RETURNS integer | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_npoints'; | |
| ALTER FUNCTION public.npoints(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 320 (class 1255 OID 18673) | |
| -- Dependencies: 6 1102 | |
| -- Name: nrings(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION nrings(geometry) RETURNS integer | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_nrings'; | |
| ALTER FUNCTION public.nrings(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 321 (class 1255 OID 18674) | |
| -- Dependencies: 6 1102 | |
| -- Name: numgeometries(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION numgeometries(geometry) RETURNS integer | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_numgeometries_collection'; | |
| ALTER FUNCTION public.numgeometries(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 322 (class 1255 OID 18675) | |
| -- Dependencies: 6 1102 | |
| -- Name: numinteriorring(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION numinteriorring(geometry) RETURNS integer | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_numinteriorrings_polygon'; | |
| ALTER FUNCTION public.numinteriorring(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 323 (class 1255 OID 18676) | |
| -- Dependencies: 6 1102 | |
| -- Name: numinteriorrings(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION numinteriorrings(geometry) RETURNS integer | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_numinteriorrings_polygon'; | |
| ALTER FUNCTION public.numinteriorrings(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 324 (class 1255 OID 18677) | |
| -- Dependencies: 6 1102 | |
| -- Name: numpoints(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION numpoints(geometry) RETURNS integer | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_numpoints_linestring'; | |
| ALTER FUNCTION public.numpoints(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 325 (class 1255 OID 18678) | |
| -- Dependencies: 1102 1102 6 | |
| -- Name: overlaps(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION "overlaps"(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'overlaps'; | |
| ALTER FUNCTION public."overlaps"(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 326 (class 1255 OID 18679) | |
| -- Dependencies: 6 1102 | |
| -- Name: perimeter(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION perimeter(geometry) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_perimeter_poly'; | |
| ALTER FUNCTION public.perimeter(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 327 (class 1255 OID 18680) | |
| -- Dependencies: 6 1102 | |
| -- Name: perimeter2d(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION perimeter2d(geometry) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_perimeter2d_poly'; | |
| ALTER FUNCTION public.perimeter2d(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 328 (class 1255 OID 18681) | |
| -- Dependencies: 1102 6 | |
| -- Name: perimeter3d(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION perimeter3d(geometry) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_perimeter_poly'; | |
| ALTER FUNCTION public.perimeter3d(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 329 (class 1255 OID 18682) | |
| -- Dependencies: 1104 6 1110 | |
| -- Name: pgis_geometry_accum_finalfn(pgis_abs); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION pgis_geometry_accum_finalfn(pgis_abs) RETURNS geometry[] | |
| LANGUAGE c | |
| AS '$libdir/postgis-1.5', 'pgis_geometry_accum_finalfn'; | |
| ALTER FUNCTION public.pgis_geometry_accum_finalfn(pgis_abs) OWNER TO postgres; | |
| -- | |
| -- TOC entry 330 (class 1255 OID 18683) | |
| -- Dependencies: 1110 6 1110 1102 | |
| -- Name: pgis_geometry_accum_transfn(pgis_abs, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION pgis_geometry_accum_transfn(pgis_abs, geometry) RETURNS pgis_abs | |
| LANGUAGE c | |
| AS '$libdir/postgis-1.5', 'pgis_geometry_accum_transfn'; | |
| ALTER FUNCTION public.pgis_geometry_accum_transfn(pgis_abs, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 331 (class 1255 OID 18684) | |
| -- Dependencies: 1110 6 1102 | |
| -- Name: pgis_geometry_collect_finalfn(pgis_abs); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION pgis_geometry_collect_finalfn(pgis_abs) RETURNS geometry | |
| LANGUAGE c | |
| AS '$libdir/postgis-1.5', 'pgis_geometry_collect_finalfn'; | |
| ALTER FUNCTION public.pgis_geometry_collect_finalfn(pgis_abs) OWNER TO postgres; | |
| -- | |
| -- TOC entry 332 (class 1255 OID 18685) | |
| -- Dependencies: 6 1102 1110 | |
| -- Name: pgis_geometry_makeline_finalfn(pgis_abs); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION pgis_geometry_makeline_finalfn(pgis_abs) RETURNS geometry | |
| LANGUAGE c | |
| AS '$libdir/postgis-1.5', 'pgis_geometry_makeline_finalfn'; | |
| ALTER FUNCTION public.pgis_geometry_makeline_finalfn(pgis_abs) OWNER TO postgres; | |
| -- | |
| -- TOC entry 333 (class 1255 OID 18686) | |
| -- Dependencies: 1110 6 1102 | |
| -- Name: pgis_geometry_polygonize_finalfn(pgis_abs); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION pgis_geometry_polygonize_finalfn(pgis_abs) RETURNS geometry | |
| LANGUAGE c | |
| AS '$libdir/postgis-1.5', 'pgis_geometry_polygonize_finalfn'; | |
| ALTER FUNCTION public.pgis_geometry_polygonize_finalfn(pgis_abs) OWNER TO postgres; | |
| -- | |
| -- TOC entry 334 (class 1255 OID 18687) | |
| -- Dependencies: 1102 6 1110 | |
| -- Name: pgis_geometry_union_finalfn(pgis_abs); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION pgis_geometry_union_finalfn(pgis_abs) RETURNS geometry | |
| LANGUAGE c | |
| AS '$libdir/postgis-1.5', 'pgis_geometry_union_finalfn'; | |
| ALTER FUNCTION public.pgis_geometry_union_finalfn(pgis_abs) OWNER TO postgres; | |
| -- | |
| -- TOC entry 335 (class 1255 OID 18688) | |
| -- Dependencies: 6 1102 | |
| -- Name: point_inside_circle(geometry, double precision, double precision, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION point_inside_circle(geometry, double precision, double precision, double precision) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_inside_circle_point'; | |
| ALTER FUNCTION public.point_inside_circle(geometry, double precision, double precision, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 336 (class 1255 OID 18689) | |
| -- Dependencies: 6 1102 | |
| -- Name: pointfromtext(text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION pointfromtext(text) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(GeomFromText($1)) = 'POINT' | |
| THEN GeomFromText($1) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.pointfromtext(text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 337 (class 1255 OID 18690) | |
| -- Dependencies: 6 1102 | |
| -- Name: pointfromtext(text, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION pointfromtext(text, integer) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(GeomFromText($1, $2)) = 'POINT' | |
| THEN GeomFromText($1,$2) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.pointfromtext(text, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 339 (class 1255 OID 18692) | |
| -- Dependencies: 1102 6 | |
| -- Name: pointfromwkb(bytea); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION pointfromwkb(bytea) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(GeomFromWKB($1)) = 'POINT' | |
| THEN GeomFromWKB($1) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.pointfromwkb(bytea) OWNER TO postgres; | |
| -- | |
| -- TOC entry 338 (class 1255 OID 18691) | |
| -- Dependencies: 6 1102 | |
| -- Name: pointfromwkb(bytea, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION pointfromwkb(bytea, integer) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(GeomFromWKB($1, $2)) = 'POINT' | |
| THEN GeomFromWKB($1, $2) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.pointfromwkb(bytea, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 340 (class 1255 OID 18693) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: pointn(geometry, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION pointn(geometry, integer) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_pointn_linestring'; | |
| ALTER FUNCTION public.pointn(geometry, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 341 (class 1255 OID 18694) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: pointonsurface(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION pointonsurface(geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'pointonsurface'; | |
| ALTER FUNCTION public.pointonsurface(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 342 (class 1255 OID 18695) | |
| -- Dependencies: 6 1102 | |
| -- Name: polyfromtext(text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION polyfromtext(text) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(GeomFromText($1)) = 'POLYGON' | |
| THEN GeomFromText($1) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.polyfromtext(text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 343 (class 1255 OID 18696) | |
| -- Dependencies: 6 1102 | |
| -- Name: polyfromtext(text, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION polyfromtext(text, integer) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(GeomFromText($1, $2)) = 'POLYGON' | |
| THEN GeomFromText($1,$2) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.polyfromtext(text, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 345 (class 1255 OID 18698) | |
| -- Dependencies: 6 1102 | |
| -- Name: polyfromwkb(bytea); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION polyfromwkb(bytea) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(GeomFromWKB($1)) = 'POLYGON' | |
| THEN GeomFromWKB($1) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.polyfromwkb(bytea) OWNER TO postgres; | |
| -- | |
| -- TOC entry 344 (class 1255 OID 18697) | |
| -- Dependencies: 6 1102 | |
| -- Name: polyfromwkb(bytea, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION polyfromwkb(bytea, integer) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(GeomFromWKB($1, $2)) = 'POLYGON' | |
| THEN GeomFromWKB($1, $2) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.polyfromwkb(bytea, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 347 (class 1255 OID 18700) | |
| -- Dependencies: 6 1102 | |
| -- Name: polygonfromtext(text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION polygonfromtext(text) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT PolyFromText($1)$_$; | |
| ALTER FUNCTION public.polygonfromtext(text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 346 (class 1255 OID 18699) | |
| -- Dependencies: 6 1102 | |
| -- Name: polygonfromtext(text, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION polygonfromtext(text, integer) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT PolyFromText($1, $2)$_$; | |
| ALTER FUNCTION public.polygonfromtext(text, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 349 (class 1255 OID 18702) | |
| -- Dependencies: 6 1102 | |
| -- Name: polygonfromwkb(bytea); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION polygonfromwkb(bytea) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(GeomFromWKB($1)) = 'POLYGON' | |
| THEN GeomFromWKB($1) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.polygonfromwkb(bytea) OWNER TO postgres; | |
| -- | |
| -- TOC entry 348 (class 1255 OID 18701) | |
| -- Dependencies: 6 1102 | |
| -- Name: polygonfromwkb(bytea, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION polygonfromwkb(bytea, integer) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(GeomFromWKB($1,$2)) = 'POLYGON' | |
| THEN GeomFromWKB($1, $2) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.polygonfromwkb(bytea, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 350 (class 1255 OID 18703) | |
| -- Dependencies: 6 1102 1104 | |
| -- Name: polygonize_garray(geometry[]); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION polygonize_garray(geometry[]) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT COST 100 | |
| AS '$libdir/postgis-1.5', 'polygonize_garray'; | |
| ALTER FUNCTION public.polygonize_garray(geometry[]) OWNER TO postgres; | |
| -- | |
| -- TOC entry 351 (class 1255 OID 18704) | |
| -- Dependencies: 6 1167 | |
| -- Name: populate_geometry_columns(); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION populate_geometry_columns() RETURNS text | |
| LANGUAGE plpgsql | |
| AS $$ | |
| DECLARE | |
| inserted integer; | |
| oldcount integer; | |
| probed integer; | |
| stale integer; | |
| gcs RECORD; | |
| gc RECORD; | |
| gsrid integer; | |
| gndims integer; | |
| gtype text; | |
| query text; | |
| gc_is_valid boolean; | |
| BEGIN | |
| SELECT count(*) INTO oldcount FROM geometry_columns; | |
| inserted := 0; | |
| EXECUTE 'TRUNCATE geometry_columns'; | |
| -- Count the number of geometry columns in all tables and views | |
| SELECT count(DISTINCT c.oid) INTO probed | |
| FROM pg_class c, | |
| pg_attribute a, | |
| pg_type t, | |
| pg_namespace n | |
| WHERE (c.relkind = 'r' OR c.relkind = 'v') | |
| AND t.typname = 'geometry' | |
| AND a.attisdropped = false | |
| AND a.atttypid = t.oid | |
| AND a.attrelid = c.oid | |
| AND c.relnamespace = n.oid | |
| AND n.nspname NOT ILIKE 'pg_temp%'; | |
| -- Iterate through all non-dropped geometry columns | |
| RAISE DEBUG 'Processing Tables.....'; | |
| FOR gcs IN | |
| SELECT DISTINCT ON (c.oid) c.oid, n.nspname, c.relname | |
| FROM pg_class c, | |
| pg_attribute a, | |
| pg_type t, | |
| pg_namespace n | |
| WHERE c.relkind = 'r' | |
| AND t.typname = 'geometry' | |
| AND a.attisdropped = false | |
| AND a.atttypid = t.oid | |
| AND a.attrelid = c.oid | |
| AND c.relnamespace = n.oid | |
| AND n.nspname NOT ILIKE 'pg_temp%' | |
| LOOP | |
| inserted := inserted + populate_geometry_columns(gcs.oid); | |
| END LOOP; | |
| -- Add views to geometry columns table | |
| RAISE DEBUG 'Processing Views.....'; | |
| FOR gcs IN | |
| SELECT DISTINCT ON (c.oid) c.oid, n.nspname, c.relname | |
| FROM pg_class c, | |
| pg_attribute a, | |
| pg_type t, | |
| pg_namespace n | |
| WHERE c.relkind = 'v' | |
| AND t.typname = 'geometry' | |
| AND a.attisdropped = false | |
| AND a.atttypid = t.oid | |
| AND a.attrelid = c.oid | |
| AND c.relnamespace = n.oid | |
| LOOP | |
| inserted := inserted + populate_geometry_columns(gcs.oid); | |
| END LOOP; | |
| IF oldcount > inserted THEN | |
| stale = oldcount-inserted; | |
| ELSE | |
| stale = 0; | |
| END IF; | |
| RETURN 'probed:' ||probed|| ' inserted:'||inserted|| ' conflicts:'||probed-inserted|| ' deleted:'||stale; | |
| END | |
| $$; | |
| ALTER FUNCTION public.populate_geometry_columns() OWNER TO postgres; | |
| -- | |
| -- TOC entry 352 (class 1255 OID 18705) | |
| -- Dependencies: 6 1167 | |
| -- Name: populate_geometry_columns(oid); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION populate_geometry_columns(tbl_oid oid) RETURNS integer | |
| LANGUAGE plpgsql | |
| AS $$ | |
| DECLARE | |
| gcs RECORD; | |
| gc RECORD; | |
| gsrid integer; | |
| gndims integer; | |
| gtype text; | |
| query text; | |
| gc_is_valid boolean; | |
| inserted integer; | |
| BEGIN | |
| inserted := 0; | |
| -- Iterate through all geometry columns in this table | |
| FOR gcs IN | |
| SELECT n.nspname, c.relname, a.attname | |
| FROM pg_class c, | |
| pg_attribute a, | |
| pg_type t, | |
| pg_namespace n | |
| WHERE c.relkind = 'r' | |
| AND t.typname = 'geometry' | |
| AND a.attisdropped = false | |
| AND a.atttypid = t.oid | |
| AND a.attrelid = c.oid | |
| AND c.relnamespace = n.oid | |
| AND n.nspname NOT ILIKE 'pg_temp%' | |
| AND c.oid = tbl_oid | |
| LOOP | |
| RAISE DEBUG 'Processing table %.%.%', gcs.nspname, gcs.relname, gcs.attname; | |
| DELETE FROM geometry_columns | |
| WHERE f_table_schema = quote_ident(gcs.nspname) | |
| AND f_table_name = quote_ident(gcs.relname) | |
| AND f_geometry_column = quote_ident(gcs.attname); | |
| gc_is_valid := true; | |
| -- Try to find srid check from system tables (pg_constraint) | |
| gsrid := | |
| (SELECT replace(replace(split_part(s.consrc, ' = ', 2), ')', ''), '(', '') | |
| FROM pg_class c, pg_namespace n, pg_attribute a, pg_constraint s | |
| WHERE n.nspname = gcs.nspname | |
| AND c.relname = gcs.relname | |
| AND a.attname = gcs.attname | |
| AND a.attrelid = c.oid | |
| AND s.connamespace = n.oid | |
| AND s.conrelid = c.oid | |
| AND a.attnum = ANY (s.conkey) | |
| AND s.consrc LIKE '%srid(% = %'); | |
| IF (gsrid IS NULL) THEN | |
| -- Try to find srid from the geometry itself | |
| EXECUTE 'SELECT srid(' || quote_ident(gcs.attname) || ') | |
| FROM ONLY ' || quote_ident(gcs.nspname) || '.' || quote_ident(gcs.relname) || ' | |
| WHERE ' || quote_ident(gcs.attname) || ' IS NOT NULL LIMIT 1' | |
| INTO gc; | |
| gsrid := gc.srid; | |
| -- Try to apply srid check to column | |
| IF (gsrid IS NOT NULL) THEN | |
| BEGIN | |
| EXECUTE 'ALTER TABLE ONLY ' || quote_ident(gcs.nspname) || '.' || quote_ident(gcs.relname) || ' | |
| ADD CONSTRAINT ' || quote_ident('enforce_srid_' || gcs.attname) || ' | |
| CHECK (srid(' || quote_ident(gcs.attname) || ') = ' || gsrid || ')'; | |
| EXCEPTION | |
| WHEN check_violation THEN | |
| RAISE WARNING 'Not inserting ''%'' in ''%.%'' into geometry_columns: could not apply constraint CHECK (srid(%) = %)', quote_ident(gcs.attname), quote_ident(gcs.nspname), quote_ident(gcs.relname), quote_ident(gcs.attname), gsrid; | |
| gc_is_valid := false; | |
| END; | |
| END IF; | |
| END IF; | |
| -- Try to find ndims check from system tables (pg_constraint) | |
| gndims := | |
| (SELECT replace(split_part(s.consrc, ' = ', 2), ')', '') | |
| FROM pg_class c, pg_namespace n, pg_attribute a, pg_constraint s | |
| WHERE n.nspname = gcs.nspname | |
| AND c.relname = gcs.relname | |
| AND a.attname = gcs.attname | |
| AND a.attrelid = c.oid | |
| AND s.connamespace = n.oid | |
| AND s.conrelid = c.oid | |
| AND a.attnum = ANY (s.conkey) | |
| AND s.consrc LIKE '%ndims(% = %'); | |
| IF (gndims IS NULL) THEN | |
| -- Try to find ndims from the geometry itself | |
| EXECUTE 'SELECT ndims(' || quote_ident(gcs.attname) || ') | |
| FROM ONLY ' || quote_ident(gcs.nspname) || '.' || quote_ident(gcs.relname) || ' | |
| WHERE ' || quote_ident(gcs.attname) || ' IS NOT NULL LIMIT 1' | |
| INTO gc; | |
| gndims := gc.ndims; | |
| -- Try to apply ndims check to column | |
| IF (gndims IS NOT NULL) THEN | |
| BEGIN | |
| EXECUTE 'ALTER TABLE ONLY ' || quote_ident(gcs.nspname) || '.' || quote_ident(gcs.relname) || ' | |
| ADD CONSTRAINT ' || quote_ident('enforce_dims_' || gcs.attname) || ' | |
| CHECK (ndims(' || quote_ident(gcs.attname) || ') = '||gndims||')'; | |
| EXCEPTION | |
| WHEN check_violation THEN | |
| RAISE WARNING 'Not inserting ''%'' in ''%.%'' into geometry_columns: could not apply constraint CHECK (ndims(%) = %)', quote_ident(gcs.attname), quote_ident(gcs.nspname), quote_ident(gcs.relname), quote_ident(gcs.attname), gndims; | |
| gc_is_valid := false; | |
| END; | |
| END IF; | |
| END IF; | |
| -- Try to find geotype check from system tables (pg_constraint) | |
| gtype := | |
| (SELECT replace(split_part(s.consrc, '''', 2), ')', '') | |
| FROM pg_class c, pg_namespace n, pg_attribute a, pg_constraint s | |
| WHERE n.nspname = gcs.nspname | |
| AND c.relname = gcs.relname | |
| AND a.attname = gcs.attname | |
| AND a.attrelid = c.oid | |
| AND s.connamespace = n.oid | |
| AND s.conrelid = c.oid | |
| AND a.attnum = ANY (s.conkey) | |
| AND s.consrc LIKE '%geometrytype(% = %'); | |
| IF (gtype IS NULL) THEN | |
| -- Try to find geotype from the geometry itself | |
| EXECUTE 'SELECT geometrytype(' || quote_ident(gcs.attname) || ') | |
| FROM ONLY ' || quote_ident(gcs.nspname) || '.' || quote_ident(gcs.relname) || ' | |
| WHERE ' || quote_ident(gcs.attname) || ' IS NOT NULL LIMIT 1' | |
| INTO gc; | |
| gtype := gc.geometrytype; | |
| --IF (gtype IS NULL) THEN | |
| -- gtype := 'GEOMETRY'; | |
| --END IF; | |
| -- Try to apply geometrytype check to column | |
| IF (gtype IS NOT NULL) THEN | |
| BEGIN | |
| EXECUTE 'ALTER TABLE ONLY ' || quote_ident(gcs.nspname) || '.' || quote_ident(gcs.relname) || ' | |
| ADD CONSTRAINT ' || quote_ident('enforce_geotype_' || gcs.attname) || ' | |
| CHECK ((geometrytype(' || quote_ident(gcs.attname) || ') = ' || quote_literal(gtype) || ') OR (' || quote_ident(gcs.attname) || ' IS NULL))'; | |
| EXCEPTION | |
| WHEN check_violation THEN | |
| -- No geometry check can be applied. This column contains a number of geometry types. | |
| RAISE WARNING 'Could not add geometry type check (%) to table column: %.%.%', gtype, quote_ident(gcs.nspname),quote_ident(gcs.relname),quote_ident(gcs.attname); | |
| END; | |
| END IF; | |
| END IF; | |
| IF (gsrid IS NULL) THEN | |
| RAISE WARNING 'Not inserting ''%'' in ''%.%'' into geometry_columns: could not determine the srid', quote_ident(gcs.attname), quote_ident(gcs.nspname), quote_ident(gcs.relname); | |
| ELSIF (gndims IS NULL) THEN | |
| RAISE WARNING 'Not inserting ''%'' in ''%.%'' into geometry_columns: could not determine the number of dimensions', quote_ident(gcs.attname), quote_ident(gcs.nspname), quote_ident(gcs.relname); | |
| ELSIF (gtype IS NULL) THEN | |
| RAISE WARNING 'Not inserting ''%'' in ''%.%'' into geometry_columns: could not determine the geometry type', quote_ident(gcs.attname), quote_ident(gcs.nspname), quote_ident(gcs.relname); | |
| ELSE | |
| -- Only insert into geometry_columns if table constraints could be applied. | |
| IF (gc_is_valid) THEN | |
| INSERT INTO geometry_columns (f_table_catalog,f_table_schema, f_table_name, f_geometry_column, coord_dimension, srid, type) | |
| VALUES ('', gcs.nspname, gcs.relname, gcs.attname, gndims, gsrid, gtype); | |
| inserted := inserted + 1; | |
| END IF; | |
| END IF; | |
| END LOOP; | |
| -- Add views to geometry columns table | |
| FOR gcs IN | |
| SELECT n.nspname, c.relname, a.attname | |
| FROM pg_class c, | |
| pg_attribute a, | |
| pg_type t, | |
| pg_namespace n | |
| WHERE c.relkind = 'v' | |
| AND t.typname = 'geometry' | |
| AND a.attisdropped = false | |
| AND a.atttypid = t.oid | |
| AND a.attrelid = c.oid | |
| AND c.relnamespace = n.oid | |
| AND n.nspname NOT ILIKE 'pg_temp%' | |
| AND c.oid = tbl_oid | |
| LOOP | |
| RAISE DEBUG 'Processing view %.%.%', gcs.nspname, gcs.relname, gcs.attname; | |
| EXECUTE 'SELECT ndims(' || quote_ident(gcs.attname) || ') | |
| FROM ' || quote_ident(gcs.nspname) || '.' || quote_ident(gcs.relname) || ' | |
| WHERE ' || quote_ident(gcs.attname) || ' IS NOT NULL LIMIT 1' | |
| INTO gc; | |
| gndims := gc.ndims; | |
| EXECUTE 'SELECT srid(' || quote_ident(gcs.attname) || ') | |
| FROM ' || quote_ident(gcs.nspname) || '.' || quote_ident(gcs.relname) || ' | |
| WHERE ' || quote_ident(gcs.attname) || ' IS NOT NULL LIMIT 1' | |
| INTO gc; | |
| gsrid := gc.srid; | |
| EXECUTE 'SELECT geometrytype(' || quote_ident(gcs.attname) || ') | |
| FROM ' || quote_ident(gcs.nspname) || '.' || quote_ident(gcs.relname) || ' | |
| WHERE ' || quote_ident(gcs.attname) || ' IS NOT NULL LIMIT 1' | |
| INTO gc; | |
| gtype := gc.geometrytype; | |
| IF (gndims IS NULL) THEN | |
| RAISE WARNING 'Not inserting ''%'' in ''%.%'' into geometry_columns: could not determine ndims', quote_ident(gcs.attname), quote_ident(gcs.nspname), quote_ident(gcs.relname); | |
| ELSIF (gsrid IS NULL) THEN | |
| RAISE WARNING 'Not inserting ''%'' in ''%.%'' into geometry_columns: could not determine srid', quote_ident(gcs.attname), quote_ident(gcs.nspname), quote_ident(gcs.relname); | |
| ELSIF (gtype IS NULL) THEN | |
| RAISE WARNING 'Not inserting ''%'' in ''%.%'' into geometry_columns: could not determine gtype', quote_ident(gcs.attname), quote_ident(gcs.nspname), quote_ident(gcs.relname); | |
| ELSE | |
| query := 'INSERT INTO geometry_columns (f_table_catalog,f_table_schema, f_table_name, f_geometry_column, coord_dimension, srid, type) ' || | |
| 'VALUES ('''', ' || quote_literal(gcs.nspname) || ',' || quote_literal(gcs.relname) || ',' || quote_literal(gcs.attname) || ',' || gndims || ',' || gsrid || ',' || quote_literal(gtype) || ')'; | |
| EXECUTE query; | |
| inserted := inserted + 1; | |
| END IF; | |
| END LOOP; | |
| RETURN inserted; | |
| END | |
| $$; | |
| ALTER FUNCTION public.populate_geometry_columns(tbl_oid oid) OWNER TO postgres; | |
| -- | |
| -- TOC entry 353 (class 1255 OID 18707) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: postgis_addbbox(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION postgis_addbbox(geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_addBBOX'; | |
| ALTER FUNCTION public.postgis_addbbox(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 354 (class 1255 OID 18708) | |
| -- Dependencies: 6 | |
| -- Name: postgis_cache_bbox(); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION postgis_cache_bbox() RETURNS trigger | |
| LANGUAGE c | |
| AS '$libdir/postgis-1.5', 'cache_bbox'; | |
| ALTER FUNCTION public.postgis_cache_bbox() OWNER TO postgres; | |
| -- | |
| -- TOC entry 355 (class 1255 OID 18709) | |
| -- Dependencies: 1102 1102 6 | |
| -- Name: postgis_dropbbox(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION postgis_dropbbox(geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_dropBBOX'; | |
| ALTER FUNCTION public.postgis_dropbbox(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 356 (class 1255 OID 18710) | |
| -- Dependencies: 6 1167 | |
| -- Name: postgis_full_version(); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION postgis_full_version() RETURNS text | |
| LANGUAGE plpgsql IMMUTABLE | |
| AS $$ | |
| DECLARE | |
| libver text; | |
| projver text; | |
| geosver text; | |
| libxmlver text; | |
| usestats bool; | |
| dbproc text; | |
| relproc text; | |
| fullver text; | |
| BEGIN | |
| SELECT postgis_lib_version() INTO libver; | |
| SELECT postgis_proj_version() INTO projver; | |
| SELECT postgis_geos_version() INTO geosver; | |
| SELECT postgis_libxml_version() INTO libxmlver; | |
| SELECT postgis_uses_stats() INTO usestats; | |
| SELECT postgis_scripts_installed() INTO dbproc; | |
| SELECT postgis_scripts_released() INTO relproc; | |
| fullver = 'POSTGIS="' || libver || '"'; | |
| IF geosver IS NOT NULL THEN | |
| fullver = fullver || ' GEOS="' || geosver || '"'; | |
| END IF; | |
| IF projver IS NOT NULL THEN | |
| fullver = fullver || ' PROJ="' || projver || '"'; | |
| END IF; | |
| IF libxmlver IS NOT NULL THEN | |
| fullver = fullver || ' LIBXML="' || libxmlver || '"'; | |
| END IF; | |
| IF usestats THEN | |
| fullver = fullver || ' USE_STATS'; | |
| END IF; | |
| -- fullver = fullver || ' DBPROC="' || dbproc || '"'; | |
| -- fullver = fullver || ' RELPROC="' || relproc || '"'; | |
| IF dbproc != relproc THEN | |
| fullver = fullver || ' (procs from ' || dbproc || ' need upgrade)'; | |
| END IF; | |
| RETURN fullver; | |
| END | |
| $$; | |
| ALTER FUNCTION public.postgis_full_version() OWNER TO postgres; | |
| -- | |
| -- TOC entry 357 (class 1255 OID 18711) | |
| -- Dependencies: 6 | |
| -- Name: postgis_geos_version(); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION postgis_geos_version() RETURNS text | |
| LANGUAGE c IMMUTABLE | |
| AS '$libdir/postgis-1.5', 'postgis_geos_version'; | |
| ALTER FUNCTION public.postgis_geos_version() OWNER TO postgres; | |
| -- | |
| -- TOC entry 358 (class 1255 OID 18712) | |
| -- Dependencies: 1102 6 1087 | |
| -- Name: postgis_getbbox(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION postgis_getbbox(geometry) RETURNS box2d | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_to_BOX2DFLOAT4'; | |
| ALTER FUNCTION public.postgis_getbbox(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 359 (class 1255 OID 18713) | |
| -- Dependencies: 6 | |
| -- Name: postgis_gist_joinsel(internal, oid, internal, smallint); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION postgis_gist_joinsel(internal, oid, internal, smallint) RETURNS double precision | |
| LANGUAGE c | |
| AS '$libdir/postgis-1.5', 'LWGEOM_gist_joinsel'; | |
| ALTER FUNCTION public.postgis_gist_joinsel(internal, oid, internal, smallint) OWNER TO postgres; | |
| -- | |
| -- TOC entry 360 (class 1255 OID 18714) | |
| -- Dependencies: 6 | |
| -- Name: postgis_gist_sel(internal, oid, internal, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION postgis_gist_sel(internal, oid, internal, integer) RETURNS double precision | |
| LANGUAGE c | |
| AS '$libdir/postgis-1.5', 'LWGEOM_gist_sel'; | |
| ALTER FUNCTION public.postgis_gist_sel(internal, oid, internal, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 361 (class 1255 OID 18715) | |
| -- Dependencies: 1102 6 | |
| -- Name: postgis_hasbbox(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION postgis_hasbbox(geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_hasBBOX'; | |
| ALTER FUNCTION public.postgis_hasbbox(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 362 (class 1255 OID 18716) | |
| -- Dependencies: 6 | |
| -- Name: postgis_lib_build_date(); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION postgis_lib_build_date() RETURNS text | |
| LANGUAGE c IMMUTABLE | |
| AS '$libdir/postgis-1.5', 'postgis_lib_build_date'; | |
| ALTER FUNCTION public.postgis_lib_build_date() OWNER TO postgres; | |
| -- | |
| -- TOC entry 363 (class 1255 OID 18717) | |
| -- Dependencies: 6 | |
| -- Name: postgis_lib_version(); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION postgis_lib_version() RETURNS text | |
| LANGUAGE c IMMUTABLE | |
| AS '$libdir/postgis-1.5', 'postgis_lib_version'; | |
| ALTER FUNCTION public.postgis_lib_version() OWNER TO postgres; | |
| -- | |
| -- TOC entry 364 (class 1255 OID 18718) | |
| -- Dependencies: 6 | |
| -- Name: postgis_libxml_version(); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION postgis_libxml_version() RETURNS text | |
| LANGUAGE c IMMUTABLE | |
| AS '$libdir/postgis-1.5', 'postgis_libxml_version'; | |
| ALTER FUNCTION public.postgis_libxml_version() OWNER TO postgres; | |
| -- | |
| -- TOC entry 365 (class 1255 OID 18719) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: postgis_noop(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION postgis_noop(geometry) RETURNS geometry | |
| LANGUAGE c STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_noop'; | |
| ALTER FUNCTION public.postgis_noop(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 366 (class 1255 OID 18720) | |
| -- Dependencies: 6 | |
| -- Name: postgis_proj_version(); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION postgis_proj_version() RETURNS text | |
| LANGUAGE c IMMUTABLE | |
| AS '$libdir/postgis-1.5', 'postgis_proj_version'; | |
| ALTER FUNCTION public.postgis_proj_version() OWNER TO postgres; | |
| -- | |
| -- TOC entry 367 (class 1255 OID 18721) | |
| -- Dependencies: 6 | |
| -- Name: postgis_scripts_build_date(); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION postgis_scripts_build_date() RETURNS text | |
| LANGUAGE sql IMMUTABLE | |
| AS $$SELECT '2010-03-11 19:15:17'::text AS version$$; | |
| ALTER FUNCTION public.postgis_scripts_build_date() OWNER TO postgres; | |
| -- | |
| -- TOC entry 368 (class 1255 OID 18722) | |
| -- Dependencies: 6 | |
| -- Name: postgis_scripts_installed(); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION postgis_scripts_installed() RETURNS text | |
| LANGUAGE sql IMMUTABLE | |
| AS $$SELECT '1.5 r5385'::text AS version$$; | |
| ALTER FUNCTION public.postgis_scripts_installed() OWNER TO postgres; | |
| -- | |
| -- TOC entry 369 (class 1255 OID 18723) | |
| -- Dependencies: 6 | |
| -- Name: postgis_scripts_released(); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION postgis_scripts_released() RETURNS text | |
| LANGUAGE c IMMUTABLE | |
| AS '$libdir/postgis-1.5', 'postgis_scripts_released'; | |
| ALTER FUNCTION public.postgis_scripts_released() OWNER TO postgres; | |
| -- | |
| -- TOC entry 370 (class 1255 OID 18724) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: postgis_transform_geometry(geometry, text, text, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION postgis_transform_geometry(geometry, text, text, integer) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'transform_geom'; | |
| ALTER FUNCTION public.postgis_transform_geometry(geometry, text, text, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 371 (class 1255 OID 18725) | |
| -- Dependencies: 6 | |
| -- Name: postgis_uses_stats(); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION postgis_uses_stats() RETURNS boolean | |
| LANGUAGE c IMMUTABLE | |
| AS '$libdir/postgis-1.5', 'postgis_uses_stats'; | |
| ALTER FUNCTION public.postgis_uses_stats() OWNER TO postgres; | |
| -- | |
| -- TOC entry 372 (class 1255 OID 18726) | |
| -- Dependencies: 6 | |
| -- Name: postgis_version(); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION postgis_version() RETURNS text | |
| LANGUAGE c IMMUTABLE | |
| AS '$libdir/postgis-1.5', 'postgis_version'; | |
| ALTER FUNCTION public.postgis_version() OWNER TO postgres; | |
| -- | |
| -- TOC entry 373 (class 1255 OID 18727) | |
| -- Dependencies: 6 1167 | |
| -- Name: probe_geometry_columns(); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION probe_geometry_columns() RETURNS text | |
| LANGUAGE plpgsql | |
| AS $$ | |
| DECLARE | |
| inserted integer; | |
| oldcount integer; | |
| probed integer; | |
| stale integer; | |
| BEGIN | |
| SELECT count(*) INTO oldcount FROM geometry_columns; | |
| SELECT count(*) INTO probed | |
| FROM pg_class c, pg_attribute a, pg_type t, | |
| pg_namespace n, | |
| pg_constraint sridcheck, pg_constraint typecheck | |
| WHERE t.typname = 'geometry' | |
| AND a.atttypid = t.oid | |
| AND a.attrelid = c.oid | |
| AND c.relnamespace = n.oid | |
| AND sridcheck.connamespace = n.oid | |
| AND typecheck.connamespace = n.oid | |
| AND sridcheck.conrelid = c.oid | |
| AND sridcheck.consrc LIKE '(srid('||a.attname||') = %)' | |
| AND typecheck.conrelid = c.oid | |
| AND typecheck.consrc LIKE | |
| '((geometrytype('||a.attname||') = ''%''::text) OR (% IS NULL))' | |
| ; | |
| INSERT INTO geometry_columns SELECT | |
| ''::varchar as f_table_catalogue, | |
| n.nspname::varchar as f_table_schema, | |
| c.relname::varchar as f_table_name, | |
| a.attname::varchar as f_geometry_column, | |
| 2 as coord_dimension, | |
| trim(both ' =)' from | |
| replace(replace(split_part( | |
| sridcheck.consrc, ' = ', 2), ')', ''), '(', ''))::integer AS srid, | |
| trim(both ' =)''' from substr(typecheck.consrc, | |
| strpos(typecheck.consrc, '='), | |
| strpos(typecheck.consrc, '::')- | |
| strpos(typecheck.consrc, '=') | |
| ))::varchar as type | |
| FROM pg_class c, pg_attribute a, pg_type t, | |
| pg_namespace n, | |
| pg_constraint sridcheck, pg_constraint typecheck | |
| WHERE t.typname = 'geometry' | |
| AND a.atttypid = t.oid | |
| AND a.attrelid = c.oid | |
| AND c.relnamespace = n.oid | |
| AND sridcheck.connamespace = n.oid | |
| AND typecheck.connamespace = n.oid | |
| AND sridcheck.conrelid = c.oid | |
| AND sridcheck.consrc LIKE '(st_srid('||a.attname||') = %)' | |
| AND typecheck.conrelid = c.oid | |
| AND typecheck.consrc LIKE | |
| '((geometrytype('||a.attname||') = ''%''::text) OR (% IS NULL))' | |
| AND NOT EXISTS ( | |
| SELECT oid FROM geometry_columns gc | |
| WHERE c.relname::varchar = gc.f_table_name | |
| AND n.nspname::varchar = gc.f_table_schema | |
| AND a.attname::varchar = gc.f_geometry_column | |
| ); | |
| GET DIAGNOSTICS inserted = ROW_COUNT; | |
| IF oldcount > probed THEN | |
| stale = oldcount-probed; | |
| ELSE | |
| stale = 0; | |
| END IF; | |
| RETURN 'probed:'||probed::text|| | |
| ' inserted:'||inserted::text|| | |
| ' conflicts:'||(probed-inserted)::text|| | |
| ' stale:'||stale::text; | |
| END | |
| $$; | |
| ALTER FUNCTION public.probe_geometry_columns() OWNER TO postgres; | |
| -- | |
| -- TOC entry 374 (class 1255 OID 18728) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: relate(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION relate(geometry, geometry) RETURNS text | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'relate_full'; | |
| ALTER FUNCTION public.relate(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 375 (class 1255 OID 18729) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: relate(geometry, geometry, text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION relate(geometry, geometry, text) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'relate_pattern'; | |
| ALTER FUNCTION public.relate(geometry, geometry, text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 376 (class 1255 OID 18730) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: removepoint(geometry, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION removepoint(geometry, integer) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_removepoint'; | |
| ALTER FUNCTION public.removepoint(geometry, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 377 (class 1255 OID 18731) | |
| -- Dependencies: 6 | |
| -- Name: rename_geometry_table_constraints(); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION rename_geometry_table_constraints() RETURNS text | |
| LANGUAGE sql IMMUTABLE | |
| AS $$ | |
| SELECT 'rename_geometry_table_constraint() is obsoleted'::text | |
| $$; | |
| ALTER FUNCTION public.rename_geometry_table_constraints() OWNER TO postgres; | |
| -- | |
| -- TOC entry 378 (class 1255 OID 18732) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: reverse(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION reverse(geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_reverse'; | |
| ALTER FUNCTION public.reverse(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 379 (class 1255 OID 18733) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: rotate(geometry, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION rotate(geometry, double precision) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT rotateZ($1, $2)$_$; | |
| ALTER FUNCTION public.rotate(geometry, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 380 (class 1255 OID 18734) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: rotatex(geometry, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION rotatex(geometry, double precision) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT affine($1, 1, 0, 0, 0, cos($2), -sin($2), 0, sin($2), cos($2), 0, 0, 0)$_$; | |
| ALTER FUNCTION public.rotatex(geometry, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 381 (class 1255 OID 18735) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: rotatey(geometry, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION rotatey(geometry, double precision) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT affine($1, cos($2), 0, sin($2), 0, 1, 0, -sin($2), 0, cos($2), 0, 0, 0)$_$; | |
| ALTER FUNCTION public.rotatey(geometry, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 382 (class 1255 OID 18736) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: rotatez(geometry, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION rotatez(geometry, double precision) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT affine($1, cos($2), -sin($2), 0, sin($2), cos($2), 0, 0, 0, 1, 0, 0, 0)$_$; | |
| ALTER FUNCTION public.rotatez(geometry, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 384 (class 1255 OID 18738) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: scale(geometry, double precision, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION scale(geometry, double precision, double precision) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT scale($1, $2, $3, 1)$_$; | |
| ALTER FUNCTION public.scale(geometry, double precision, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 383 (class 1255 OID 18737) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: scale(geometry, double precision, double precision, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION scale(geometry, double precision, double precision, double precision) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT affine($1, $2, 0, 0, 0, $3, 0, 0, 0, $4, 0, 0, 0)$_$; | |
| ALTER FUNCTION public.scale(geometry, double precision, double precision, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 385 (class 1255 OID 18739) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: se_envelopesintersect(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION se_envelopesintersect(geometry, geometry) RETURNS boolean | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT $1 && $2 | |
| $_$; | |
| ALTER FUNCTION public.se_envelopesintersect(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 386 (class 1255 OID 18740) | |
| -- Dependencies: 6 1102 | |
| -- Name: se_is3d(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION se_is3d(geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_hasz'; | |
| ALTER FUNCTION public.se_is3d(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 387 (class 1255 OID 18741) | |
| -- Dependencies: 6 1102 | |
| -- Name: se_ismeasured(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION se_ismeasured(geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_hasm'; | |
| ALTER FUNCTION public.se_ismeasured(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 388 (class 1255 OID 18742) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: se_locatealong(geometry, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION se_locatealong(geometry, double precision) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ SELECT locate_between_measures($1, $2, $2) $_$; | |
| ALTER FUNCTION public.se_locatealong(geometry, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 389 (class 1255 OID 18743) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: se_locatebetween(geometry, double precision, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION se_locatebetween(geometry, double precision, double precision) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_locate_between_m'; | |
| ALTER FUNCTION public.se_locatebetween(geometry, double precision, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 390 (class 1255 OID 18744) | |
| -- Dependencies: 6 1102 | |
| -- Name: se_m(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION se_m(geometry) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_m_point'; | |
| ALTER FUNCTION public.se_m(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 391 (class 1255 OID 18745) | |
| -- Dependencies: 6 1102 | |
| -- Name: se_z(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION se_z(geometry) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_z_point'; | |
| ALTER FUNCTION public.se_z(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 392 (class 1255 OID 18746) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: segmentize(geometry, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION segmentize(geometry, double precision) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_segmentize2d'; | |
| ALTER FUNCTION public.segmentize(geometry, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 393 (class 1255 OID 18747) | |
| -- Dependencies: 1096 6 1096 | |
| -- Name: setfactor(chip, real); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION setfactor(chip, real) RETURNS chip | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'CHIP_setFactor'; | |
| ALTER FUNCTION public.setfactor(chip, real) OWNER TO postgres; | |
| -- | |
| -- TOC entry 394 (class 1255 OID 18748) | |
| -- Dependencies: 1102 6 1102 1102 | |
| -- Name: setpoint(geometry, integer, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION setpoint(geometry, integer, geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_setpoint_linestring'; | |
| ALTER FUNCTION public.setpoint(geometry, integer, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 395 (class 1255 OID 18749) | |
| -- Dependencies: 1096 6 1096 | |
| -- Name: setsrid(chip, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION setsrid(chip, integer) RETURNS chip | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'CHIP_setSRID'; | |
| ALTER FUNCTION public.setsrid(chip, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 396 (class 1255 OID 18750) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: setsrid(geometry, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION setsrid(geometry, integer) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_setSRID'; | |
| ALTER FUNCTION public.setsrid(geometry, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 397 (class 1255 OID 18751) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: shift_longitude(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION shift_longitude(geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_longitude_shift'; | |
| ALTER FUNCTION public.shift_longitude(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 398 (class 1255 OID 18752) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: simplify(geometry, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION simplify(geometry, double precision) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_simplify2d'; | |
| ALTER FUNCTION public.simplify(geometry, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 401 (class 1255 OID 18755) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: snaptogrid(geometry, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION snaptogrid(geometry, double precision) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT SnapToGrid($1, 0, 0, $2, $2)$_$; | |
| ALTER FUNCTION public.snaptogrid(geometry, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 400 (class 1255 OID 18754) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: snaptogrid(geometry, double precision, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION snaptogrid(geometry, double precision, double precision) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT SnapToGrid($1, 0, 0, $2, $3)$_$; | |
| ALTER FUNCTION public.snaptogrid(geometry, double precision, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 399 (class 1255 OID 18753) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: snaptogrid(geometry, double precision, double precision, double precision, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION snaptogrid(geometry, double precision, double precision, double precision, double precision) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_snaptogrid'; | |
| ALTER FUNCTION public.snaptogrid(geometry, double precision, double precision, double precision, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 402 (class 1255 OID 18756) | |
| -- Dependencies: 1102 6 1102 1102 | |
| -- Name: snaptogrid(geometry, geometry, double precision, double precision, double precision, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION snaptogrid(geometry, geometry, double precision, double precision, double precision, double precision) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_snaptogrid_pointoff'; | |
| ALTER FUNCTION public.snaptogrid(geometry, geometry, double precision, double precision, double precision, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 403 (class 1255 OID 18757) | |
| -- Dependencies: 6 1096 | |
| -- Name: srid(chip); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION srid(chip) RETURNS integer | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'CHIP_getSRID'; | |
| ALTER FUNCTION public.srid(chip) OWNER TO postgres; | |
| -- | |
| -- TOC entry 404 (class 1255 OID 18758) | |
| -- Dependencies: 6 1102 | |
| -- Name: srid(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION srid(geometry) RETURNS integer | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_getSRID'; | |
| ALTER FUNCTION public.srid(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 405 (class 1255 OID 18759) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_addmeasure(geometry, double precision, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_addmeasure(geometry, double precision, double precision) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'ST_AddMeasure'; | |
| ALTER FUNCTION public.st_addmeasure(geometry, double precision, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 406 (class 1255 OID 18760) | |
| -- Dependencies: 6 1102 1102 1102 | |
| -- Name: st_addpoint(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_addpoint(geometry, geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_addpoint'; | |
| ALTER FUNCTION public.st_addpoint(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 407 (class 1255 OID 18761) | |
| -- Dependencies: 6 1102 1102 1102 | |
| -- Name: st_addpoint(geometry, geometry, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_addpoint(geometry, geometry, integer) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_addpoint'; | |
| ALTER FUNCTION public.st_addpoint(geometry, geometry, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 409 (class 1255 OID 18763) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_affine(geometry, double precision, double precision, double precision, double precision, double precision, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_affine(geometry, double precision, double precision, double precision, double precision, double precision, double precision) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT affine($1, $2, $3, 0, $4, $5, 0, 0, 0, 1, $6, $7, 0)$_$; | |
| ALTER FUNCTION public.st_affine(geometry, double precision, double precision, double precision, double precision, double precision, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 408 (class 1255 OID 18762) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_affine(geometry, double precision, double precision, double precision, double precision, double precision, double precision, double precision, double precision, double precision, double precision, double precision, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_affine(geometry, double precision, double precision, double precision, double precision, double precision, double precision, double precision, double precision, double precision, double precision, double precision, double precision) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_affine'; | |
| ALTER FUNCTION public.st_affine(geometry, double precision, double precision, double precision, double precision, double precision, double precision, double precision, double precision, double precision, double precision, double precision, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 410 (class 1255 OID 18764) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_area(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_area(geometry) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_area_polygon'; | |
| ALTER FUNCTION public.st_area(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 412 (class 1255 OID 18766) | |
| -- Dependencies: 6 1099 | |
| -- Name: st_area(geography); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_area(geography) RETURNS double precision | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT ST_Area($1, true)$_$; | |
| ALTER FUNCTION public.st_area(geography) OWNER TO postgres; | |
| -- | |
| -- TOC entry 413 (class 1255 OID 18767) | |
| -- Dependencies: 6 | |
| -- Name: st_area(text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_area(text) RETURNS double precision | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ SELECT ST_Area($1::geometry); $_$; | |
| ALTER FUNCTION public.st_area(text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 411 (class 1255 OID 18765) | |
| -- Dependencies: 6 1099 | |
| -- Name: st_area(geography, boolean); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_area(geography, boolean) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT COST 100 | |
| AS '$libdir/postgis-1.5', 'geography_area'; | |
| ALTER FUNCTION public.st_area(geography, boolean) OWNER TO postgres; | |
| -- | |
| -- TOC entry 414 (class 1255 OID 18768) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_area2d(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_area2d(geometry) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_area_polygon'; | |
| ALTER FUNCTION public.st_area2d(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 415 (class 1255 OID 18769) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_asbinary(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_asbinary(geometry) RETURNS bytea | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_asBinary'; | |
| ALTER FUNCTION public.st_asbinary(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 417 (class 1255 OID 18771) | |
| -- Dependencies: 6 1099 | |
| -- Name: st_asbinary(geography); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_asbinary(geography) RETURNS bytea | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'geography_as_binary'; | |
| ALTER FUNCTION public.st_asbinary(geography) OWNER TO postgres; | |
| -- | |
| -- TOC entry 418 (class 1255 OID 18772) | |
| -- Dependencies: 6 | |
| -- Name: st_asbinary(text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_asbinary(text) RETURNS bytea | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ SELECT ST_AsBinary($1::geometry); $_$; | |
| ALTER FUNCTION public.st_asbinary(text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 416 (class 1255 OID 18770) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_asbinary(geometry, text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_asbinary(geometry, text) RETURNS bytea | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_asBinary'; | |
| ALTER FUNCTION public.st_asbinary(geometry, text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 419 (class 1255 OID 18773) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_asewkb(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_asewkb(geometry) RETURNS bytea | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'WKBFromLWGEOM'; | |
| ALTER FUNCTION public.st_asewkb(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 420 (class 1255 OID 18774) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_asewkb(geometry, text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_asewkb(geometry, text) RETURNS bytea | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'WKBFromLWGEOM'; | |
| ALTER FUNCTION public.st_asewkb(geometry, text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 421 (class 1255 OID 18775) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_asewkt(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_asewkt(geometry) RETURNS text | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_asEWKT'; | |
| ALTER FUNCTION public.st_asewkt(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 423 (class 1255 OID 18777) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_asgeojson(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_asgeojson(geometry) RETURNS text | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT _ST_AsGeoJson(1, $1, 15, 0)$_$; | |
| ALTER FUNCTION public.st_asgeojson(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 429 (class 1255 OID 18783) | |
| -- Dependencies: 6 1099 | |
| -- Name: st_asgeojson(geography); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_asgeojson(geography) RETURNS text | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT _ST_AsGeoJson(1, $1, 15, 0)$_$; | |
| ALTER FUNCTION public.st_asgeojson(geography) OWNER TO postgres; | |
| -- | |
| -- TOC entry 430 (class 1255 OID 18784) | |
| -- Dependencies: 6 | |
| -- Name: st_asgeojson(text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_asgeojson(text) RETURNS text | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ SELECT ST_AsGeoJson($1::geometry); $_$; | |
| ALTER FUNCTION public.st_asgeojson(text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 422 (class 1255 OID 18776) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_asgeojson(geometry, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_asgeojson(geometry, integer) RETURNS text | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT _ST_AsGeoJson(1, $1, $2, 0)$_$; | |
| ALTER FUNCTION public.st_asgeojson(geometry, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 424 (class 1255 OID 18778) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_asgeojson(integer, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_asgeojson(integer, geometry) RETURNS text | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT _ST_AsGeoJson($1, $2, 15, 0)$_$; | |
| ALTER FUNCTION public.st_asgeojson(integer, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 428 (class 1255 OID 18782) | |
| -- Dependencies: 6 1099 | |
| -- Name: st_asgeojson(geography, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_asgeojson(geography, integer) RETURNS text | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT _ST_AsGeoJson(1, $1, $2, 0)$_$; | |
| ALTER FUNCTION public.st_asgeojson(geography, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 431 (class 1255 OID 18785) | |
| -- Dependencies: 6 1099 | |
| -- Name: st_asgeojson(integer, geography); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_asgeojson(integer, geography) RETURNS text | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT _ST_AsGeoJson($1, $2, 15, 0)$_$; | |
| ALTER FUNCTION public.st_asgeojson(integer, geography) OWNER TO postgres; | |
| -- | |
| -- TOC entry 425 (class 1255 OID 18779) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_asgeojson(integer, geometry, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_asgeojson(integer, geometry, integer) RETURNS text | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT _ST_AsGeoJson($1, $2, $3, 0)$_$; | |
| ALTER FUNCTION public.st_asgeojson(integer, geometry, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 426 (class 1255 OID 18780) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_asgeojson(geometry, integer, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_asgeojson(geometry, integer, integer) RETURNS text | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT _ST_AsGeoJson(1, $1, $2, $3)$_$; | |
| ALTER FUNCTION public.st_asgeojson(geometry, integer, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 432 (class 1255 OID 18786) | |
| -- Dependencies: 6 1099 | |
| -- Name: st_asgeojson(integer, geography, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_asgeojson(integer, geography, integer) RETURNS text | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT _ST_AsGeoJson($1, $2, $3, 0)$_$; | |
| ALTER FUNCTION public.st_asgeojson(integer, geography, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 433 (class 1255 OID 18787) | |
| -- Dependencies: 6 1099 | |
| -- Name: st_asgeojson(geography, integer, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_asgeojson(geography, integer, integer) RETURNS text | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT _ST_AsGeoJson(1, $1, $2, $3)$_$; | |
| ALTER FUNCTION public.st_asgeojson(geography, integer, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 427 (class 1255 OID 18781) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_asgeojson(integer, geometry, integer, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_asgeojson(integer, geometry, integer, integer) RETURNS text | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT _ST_AsGeoJson($1, $2, $3, $4)$_$; | |
| ALTER FUNCTION public.st_asgeojson(integer, geometry, integer, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 434 (class 1255 OID 18788) | |
| -- Dependencies: 6 1099 | |
| -- Name: st_asgeojson(integer, geography, integer, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_asgeojson(integer, geography, integer, integer) RETURNS text | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT _ST_AsGeoJson($1, $2, $3, $4)$_$; | |
| ALTER FUNCTION public.st_asgeojson(integer, geography, integer, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 436 (class 1255 OID 18790) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_asgml(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_asgml(geometry) RETURNS text | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT _ST_AsGML(2, $1, 15, 0)$_$; | |
| ALTER FUNCTION public.st_asgml(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 442 (class 1255 OID 18796) | |
| -- Dependencies: 6 1099 | |
| -- Name: st_asgml(geography); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_asgml(geography) RETURNS text | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT _ST_AsGML(2, $1, 15, 0)$_$; | |
| ALTER FUNCTION public.st_asgml(geography) OWNER TO postgres; | |
| -- | |
| -- TOC entry 443 (class 1255 OID 18797) | |
| -- Dependencies: 6 | |
| -- Name: st_asgml(text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_asgml(text) RETURNS text | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ SELECT ST_AsGML($1::geometry); $_$; | |
| ALTER FUNCTION public.st_asgml(text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 435 (class 1255 OID 18789) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_asgml(geometry, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_asgml(geometry, integer) RETURNS text | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT _ST_AsGML(2, $1, $2, 0)$_$; | |
| ALTER FUNCTION public.st_asgml(geometry, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 437 (class 1255 OID 18791) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_asgml(integer, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_asgml(integer, geometry) RETURNS text | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT _ST_AsGML($1, $2, 15, 0)$_$; | |
| ALTER FUNCTION public.st_asgml(integer, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 441 (class 1255 OID 18795) | |
| -- Dependencies: 6 1099 | |
| -- Name: st_asgml(geography, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_asgml(geography, integer) RETURNS text | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT _ST_AsGML(2, $1, $2, 0)$_$; | |
| ALTER FUNCTION public.st_asgml(geography, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 444 (class 1255 OID 18798) | |
| -- Dependencies: 6 1099 | |
| -- Name: st_asgml(integer, geography); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_asgml(integer, geography) RETURNS text | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT _ST_AsGML($1, $2, 15, 0)$_$; | |
| ALTER FUNCTION public.st_asgml(integer, geography) OWNER TO postgres; | |
| -- | |
| -- TOC entry 438 (class 1255 OID 18792) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_asgml(integer, geometry, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_asgml(integer, geometry, integer) RETURNS text | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT _ST_AsGML($1, $2, $3, 0)$_$; | |
| ALTER FUNCTION public.st_asgml(integer, geometry, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 439 (class 1255 OID 18793) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_asgml(geometry, integer, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_asgml(geometry, integer, integer) RETURNS text | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT _ST_AsGML(2, $1, $2, $3)$_$; | |
| ALTER FUNCTION public.st_asgml(geometry, integer, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 445 (class 1255 OID 18799) | |
| -- Dependencies: 6 1099 | |
| -- Name: st_asgml(integer, geography, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_asgml(integer, geography, integer) RETURNS text | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT _ST_AsGML($1, $2, $3, 0)$_$; | |
| ALTER FUNCTION public.st_asgml(integer, geography, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 446 (class 1255 OID 18800) | |
| -- Dependencies: 6 1099 | |
| -- Name: st_asgml(geography, integer, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_asgml(geography, integer, integer) RETURNS text | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT _ST_AsGML(2, $1, $2, $3)$_$; | |
| ALTER FUNCTION public.st_asgml(geography, integer, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 440 (class 1255 OID 18794) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_asgml(integer, geometry, integer, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_asgml(integer, geometry, integer, integer) RETURNS text | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT _ST_AsGML($1, $2, $3, $4)$_$; | |
| ALTER FUNCTION public.st_asgml(integer, geometry, integer, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 447 (class 1255 OID 18801) | |
| -- Dependencies: 6 1099 | |
| -- Name: st_asgml(integer, geography, integer, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_asgml(integer, geography, integer, integer) RETURNS text | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT _ST_AsGML($1, $2, $3, $4)$_$; | |
| ALTER FUNCTION public.st_asgml(integer, geography, integer, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 448 (class 1255 OID 18802) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_ashexewkb(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_ashexewkb(geometry) RETURNS text | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_asHEXEWKB'; | |
| ALTER FUNCTION public.st_ashexewkb(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 449 (class 1255 OID 18803) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_ashexewkb(geometry, text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_ashexewkb(geometry, text) RETURNS text | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_asHEXEWKB'; | |
| ALTER FUNCTION public.st_ashexewkb(geometry, text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 451 (class 1255 OID 18805) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_askml(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_askml(geometry) RETURNS text | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT _ST_AsKML(2, ST_Transform($1,4326), 15)$_$; | |
| ALTER FUNCTION public.st_askml(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 455 (class 1255 OID 18809) | |
| -- Dependencies: 6 1099 | |
| -- Name: st_askml(geography); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_askml(geography) RETURNS text | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT _ST_AsKML(2, $1, 15)$_$; | |
| ALTER FUNCTION public.st_askml(geography) OWNER TO postgres; | |
| -- | |
| -- TOC entry 456 (class 1255 OID 18810) | |
| -- Dependencies: 6 | |
| -- Name: st_askml(text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_askml(text) RETURNS text | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ SELECT ST_AsKML($1::geometry); $_$; | |
| ALTER FUNCTION public.st_askml(text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 450 (class 1255 OID 18804) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_askml(geometry, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_askml(geometry, integer) RETURNS text | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT _ST_AsKML(2, ST_Transform($1,4326), $2)$_$; | |
| ALTER FUNCTION public.st_askml(geometry, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 452 (class 1255 OID 18806) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_askml(integer, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_askml(integer, geometry) RETURNS text | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT _ST_AsKML($1, ST_Transform($2,4326), 15)$_$; | |
| ALTER FUNCTION public.st_askml(integer, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 454 (class 1255 OID 18808) | |
| -- Dependencies: 1099 6 | |
| -- Name: st_askml(geography, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_askml(geography, integer) RETURNS text | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT _ST_AsKML(2, $1, $2)$_$; | |
| ALTER FUNCTION public.st_askml(geography, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 457 (class 1255 OID 18811) | |
| -- Dependencies: 6 1099 | |
| -- Name: st_askml(integer, geography); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_askml(integer, geography) RETURNS text | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT _ST_AsKML($1, $2, 15)$_$; | |
| ALTER FUNCTION public.st_askml(integer, geography) OWNER TO postgres; | |
| -- | |
| -- TOC entry 453 (class 1255 OID 18807) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_askml(integer, geometry, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_askml(integer, geometry, integer) RETURNS text | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT _ST_AsKML($1, ST_Transform($2,4326), $3)$_$; | |
| ALTER FUNCTION public.st_askml(integer, geometry, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 458 (class 1255 OID 18812) | |
| -- Dependencies: 6 1099 | |
| -- Name: st_askml(integer, geography, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_askml(integer, geography, integer) RETURNS text | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT _ST_AsKML($1, $2, $3)$_$; | |
| ALTER FUNCTION public.st_askml(integer, geography, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 461 (class 1255 OID 18815) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_assvg(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_assvg(geometry) RETURNS text | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'assvg_geometry'; | |
| ALTER FUNCTION public.st_assvg(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 464 (class 1255 OID 18818) | |
| -- Dependencies: 6 1099 | |
| -- Name: st_assvg(geography); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_assvg(geography) RETURNS text | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'geography_as_svg'; | |
| ALTER FUNCTION public.st_assvg(geography) OWNER TO postgres; | |
| -- | |
| -- TOC entry 465 (class 1255 OID 18819) | |
| -- Dependencies: 6 | |
| -- Name: st_assvg(text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_assvg(text) RETURNS text | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ SELECT ST_AsSVG($1::geometry); $_$; | |
| ALTER FUNCTION public.st_assvg(text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 460 (class 1255 OID 18814) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_assvg(geometry, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_assvg(geometry, integer) RETURNS text | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'assvg_geometry'; | |
| ALTER FUNCTION public.st_assvg(geometry, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 463 (class 1255 OID 18817) | |
| -- Dependencies: 6 1099 | |
| -- Name: st_assvg(geography, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_assvg(geography, integer) RETURNS text | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'geography_as_svg'; | |
| ALTER FUNCTION public.st_assvg(geography, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 459 (class 1255 OID 18813) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_assvg(geometry, integer, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_assvg(geometry, integer, integer) RETURNS text | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'assvg_geometry'; | |
| ALTER FUNCTION public.st_assvg(geometry, integer, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 462 (class 1255 OID 18816) | |
| -- Dependencies: 6 1099 | |
| -- Name: st_assvg(geography, integer, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_assvg(geography, integer, integer) RETURNS text | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'geography_as_svg'; | |
| ALTER FUNCTION public.st_assvg(geography, integer, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 466 (class 1255 OID 18820) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_astext(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_astext(geometry) RETURNS text | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_asText'; | |
| ALTER FUNCTION public.st_astext(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 467 (class 1255 OID 18821) | |
| -- Dependencies: 6 1099 | |
| -- Name: st_astext(geography); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_astext(geography) RETURNS text | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'geography_as_text'; | |
| ALTER FUNCTION public.st_astext(geography) OWNER TO postgres; | |
| -- | |
| -- TOC entry 468 (class 1255 OID 18822) | |
| -- Dependencies: 6 | |
| -- Name: st_astext(text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_astext(text) RETURNS text | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ SELECT ST_AsText($1::geometry); $_$; | |
| ALTER FUNCTION public.st_astext(text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 469 (class 1255 OID 18823) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_azimuth(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_azimuth(geometry, geometry) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_azimuth'; | |
| ALTER FUNCTION public.st_azimuth(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 470 (class 1255 OID 18824) | |
| -- Dependencies: 6 1167 1102 | |
| -- Name: st_bdmpolyfromtext(text, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_bdmpolyfromtext(text, integer) RETURNS geometry | |
| LANGUAGE plpgsql IMMUTABLE STRICT | |
| AS $_$ | |
| DECLARE | |
| geomtext alias for $1; | |
| srid alias for $2; | |
| mline geometry; | |
| geom geometry; | |
| BEGIN | |
| mline := ST_MultiLineStringFromText(geomtext, srid); | |
| IF mline IS NULL | |
| THEN | |
| RAISE EXCEPTION 'Input is not a MultiLinestring'; | |
| END IF; | |
| geom := multi(ST_BuildArea(mline)); | |
| RETURN geom; | |
| END; | |
| $_$; | |
| ALTER FUNCTION public.st_bdmpolyfromtext(text, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 471 (class 1255 OID 18825) | |
| -- Dependencies: 6 1167 1102 | |
| -- Name: st_bdpolyfromtext(text, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_bdpolyfromtext(text, integer) RETURNS geometry | |
| LANGUAGE plpgsql IMMUTABLE STRICT | |
| AS $_$ | |
| DECLARE | |
| geomtext alias for $1; | |
| srid alias for $2; | |
| mline geometry; | |
| geom geometry; | |
| BEGIN | |
| mline := ST_MultiLineStringFromText(geomtext, srid); | |
| IF mline IS NULL | |
| THEN | |
| RAISE EXCEPTION 'Input is not a MultiLinestring'; | |
| END IF; | |
| geom := ST_BuildArea(mline); | |
| IF GeometryType(geom) != 'POLYGON' | |
| THEN | |
| RAISE EXCEPTION 'Input returns more then a single polygon, try using BdMPolyFromText instead'; | |
| END IF; | |
| RETURN geom; | |
| END; | |
| $_$; | |
| ALTER FUNCTION public.st_bdpolyfromtext(text, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 472 (class 1255 OID 18826) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_boundary(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_boundary(geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'boundary'; | |
| ALTER FUNCTION public.st_boundary(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 473 (class 1255 OID 18827) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_box(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_box(geometry) RETURNS box | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_to_BOX'; | |
| ALTER FUNCTION public.st_box(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 474 (class 1255 OID 18828) | |
| -- Dependencies: 6 1090 | |
| -- Name: st_box(box3d); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_box(box3d) RETURNS box | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'BOX3D_to_BOX'; | |
| ALTER FUNCTION public.st_box(box3d) OWNER TO postgres; | |
| -- | |
| -- TOC entry 475 (class 1255 OID 18829) | |
| -- Dependencies: 6 1087 1102 | |
| -- Name: st_box2d(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_box2d(geometry) RETURNS box2d | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_to_BOX2DFLOAT4'; | |
| ALTER FUNCTION public.st_box2d(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 476 (class 1255 OID 18830) | |
| -- Dependencies: 6 1087 1090 | |
| -- Name: st_box2d(box3d); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_box2d(box3d) RETURNS box2d | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'BOX3D_to_BOX2DFLOAT4'; | |
| ALTER FUNCTION public.st_box2d(box3d) OWNER TO postgres; | |
| -- | |
| -- TOC entry 477 (class 1255 OID 18831) | |
| -- Dependencies: 6 1087 1093 | |
| -- Name: st_box2d(box3d_extent); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_box2d(box3d_extent) RETURNS box2d | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'BOX3D_to_BOX2DFLOAT4'; | |
| ALTER FUNCTION public.st_box2d(box3d_extent) OWNER TO postgres; | |
| -- | |
| -- TOC entry 478 (class 1255 OID 18832) | |
| -- Dependencies: 6 1087 | |
| -- Name: st_box2d_in(cstring); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_box2d_in(cstring) RETURNS box2d | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'BOX2DFLOAT4_in'; | |
| ALTER FUNCTION public.st_box2d_in(cstring) OWNER TO postgres; | |
| -- | |
| -- TOC entry 479 (class 1255 OID 18833) | |
| -- Dependencies: 6 1087 | |
| -- Name: st_box2d_out(box2d); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_box2d_out(box2d) RETURNS cstring | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'BOX2DFLOAT4_out'; | |
| ALTER FUNCTION public.st_box2d_out(box2d) OWNER TO postgres; | |
| -- | |
| -- TOC entry 480 (class 1255 OID 18834) | |
| -- Dependencies: 6 1090 1102 | |
| -- Name: st_box3d(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_box3d(geometry) RETURNS box3d | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_to_BOX3D'; | |
| ALTER FUNCTION public.st_box3d(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 481 (class 1255 OID 18835) | |
| -- Dependencies: 6 1090 1087 | |
| -- Name: st_box3d(box2d); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_box3d(box2d) RETURNS box3d | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'BOX2DFLOAT4_to_BOX3D'; | |
| ALTER FUNCTION public.st_box3d(box2d) OWNER TO postgres; | |
| -- | |
| -- TOC entry 482 (class 1255 OID 18836) | |
| -- Dependencies: 6 1090 1093 | |
| -- Name: st_box3d_extent(box3d_extent); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_box3d_extent(box3d_extent) RETURNS box3d | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'BOX3D_extent_to_BOX3D'; | |
| ALTER FUNCTION public.st_box3d_extent(box3d_extent) OWNER TO postgres; | |
| -- | |
| -- TOC entry 483 (class 1255 OID 18837) | |
| -- Dependencies: 6 1090 | |
| -- Name: st_box3d_in(cstring); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_box3d_in(cstring) RETURNS box3d | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'BOX3D_in'; | |
| ALTER FUNCTION public.st_box3d_in(cstring) OWNER TO postgres; | |
| -- | |
| -- TOC entry 484 (class 1255 OID 18838) | |
| -- Dependencies: 6 1090 | |
| -- Name: st_box3d_out(box3d); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_box3d_out(box3d) RETURNS cstring | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'BOX3D_out'; | |
| ALTER FUNCTION public.st_box3d_out(box3d) OWNER TO postgres; | |
| -- | |
| -- TOC entry 485 (class 1255 OID 18839) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_buffer(geometry, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_buffer(geometry, double precision) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT COST 100 | |
| AS '$libdir/postgis-1.5', 'buffer'; | |
| ALTER FUNCTION public.st_buffer(geometry, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 488 (class 1255 OID 18842) | |
| -- Dependencies: 6 1099 1099 | |
| -- Name: st_buffer(geography, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_buffer(geography, double precision) RETURNS geography | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT geography(ST_Transform(ST_Buffer(ST_Transform(geometry($1), _ST_BestSRID($1)), $2), 4326))$_$; | |
| ALTER FUNCTION public.st_buffer(geography, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 489 (class 1255 OID 18843) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_buffer(text, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_buffer(text, double precision) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ SELECT ST_Buffer($1::geometry, $2); $_$; | |
| ALTER FUNCTION public.st_buffer(text, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 486 (class 1255 OID 18840) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_buffer(geometry, double precision, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_buffer(geometry, double precision, integer) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ SELECT _ST_Buffer($1, $2, | |
| CAST('quad_segs='||CAST($3 AS text) as cstring)) | |
| $_$; | |
| ALTER FUNCTION public.st_buffer(geometry, double precision, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 487 (class 1255 OID 18841) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_buffer(geometry, double precision, text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_buffer(geometry, double precision, text) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ SELECT _ST_Buffer($1, $2, | |
| CAST( regexp_replace($3, '^[0123456789]+$', | |
| 'quad_segs='||$3) AS cstring) | |
| ) | |
| $_$; | |
| ALTER FUNCTION public.st_buffer(geometry, double precision, text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 490 (class 1255 OID 18844) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_buildarea(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_buildarea(geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT COST 100 | |
| AS '$libdir/postgis-1.5', 'LWGEOM_buildarea'; | |
| ALTER FUNCTION public.st_buildarea(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 491 (class 1255 OID 18845) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_bytea(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_bytea(geometry) RETURNS bytea | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_to_bytea'; | |
| ALTER FUNCTION public.st_bytea(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 492 (class 1255 OID 18846) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_centroid(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_centroid(geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'centroid'; | |
| ALTER FUNCTION public.st_centroid(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 493 (class 1255 OID 18847) | |
| -- Dependencies: 6 1096 | |
| -- Name: st_chip_in(cstring); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_chip_in(cstring) RETURNS chip | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'CHIP_in'; | |
| ALTER FUNCTION public.st_chip_in(cstring) OWNER TO postgres; | |
| -- | |
| -- TOC entry 494 (class 1255 OID 18848) | |
| -- Dependencies: 6 1096 | |
| -- Name: st_chip_out(chip); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_chip_out(chip) RETURNS cstring | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'CHIP_out'; | |
| ALTER FUNCTION public.st_chip_out(chip) OWNER TO postgres; | |
| -- | |
| -- TOC entry 495 (class 1255 OID 18849) | |
| -- Dependencies: 6 1102 1102 1102 | |
| -- Name: st_closestpoint(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_closestpoint(geometry, geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_closestpoint'; | |
| ALTER FUNCTION public.st_closestpoint(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 497 (class 1255 OID 18851) | |
| -- Dependencies: 6 1102 1104 | |
| -- Name: st_collect(geometry[]); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_collect(geometry[]) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_collect_garray'; | |
| ALTER FUNCTION public.st_collect(geometry[]) OWNER TO postgres; | |
| -- | |
| -- TOC entry 496 (class 1255 OID 18850) | |
| -- Dependencies: 6 1102 1102 1102 | |
| -- Name: st_collect(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_collect(geometry, geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE | |
| AS '$libdir/postgis-1.5', 'LWGEOM_collect'; | |
| ALTER FUNCTION public.st_collect(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 498 (class 1255 OID 18852) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_collectionextract(geometry, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_collectionextract(geometry, integer) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'ST_CollectionExtract'; | |
| ALTER FUNCTION public.st_collectionextract(geometry, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 499 (class 1255 OID 18853) | |
| -- Dependencies: 6 1087 1087 1102 | |
| -- Name: st_combine_bbox(box2d, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_combine_bbox(box2d, geometry) RETURNS box2d | |
| LANGUAGE c IMMUTABLE | |
| AS '$libdir/postgis-1.5', 'BOX2DFLOAT4_combine'; | |
| ALTER FUNCTION public.st_combine_bbox(box2d, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 500 (class 1255 OID 18854) | |
| -- Dependencies: 6 1093 1093 1102 | |
| -- Name: st_combine_bbox(box3d_extent, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_combine_bbox(box3d_extent, geometry) RETURNS box3d_extent | |
| LANGUAGE c IMMUTABLE | |
| AS '$libdir/postgis-1.5', 'BOX3D_combine'; | |
| ALTER FUNCTION public.st_combine_bbox(box3d_extent, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 501 (class 1255 OID 18855) | |
| -- Dependencies: 6 1090 1090 1102 | |
| -- Name: st_combine_bbox(box3d, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_combine_bbox(box3d, geometry) RETURNS box3d | |
| LANGUAGE c IMMUTABLE | |
| AS '$libdir/postgis-1.5', 'BOX3D_combine'; | |
| ALTER FUNCTION public.st_combine_bbox(box3d, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 502 (class 1255 OID 18856) | |
| -- Dependencies: 6 1096 | |
| -- Name: st_compression(chip); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_compression(chip) RETURNS integer | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'CHIP_getCompression'; | |
| ALTER FUNCTION public.st_compression(chip) OWNER TO postgres; | |
| -- | |
| -- TOC entry 503 (class 1255 OID 18857) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_contains(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_contains(geometry, geometry) RETURNS boolean | |
| LANGUAGE sql IMMUTABLE | |
| AS $_$SELECT $1 && $2 AND _ST_Contains($1,$2)$_$; | |
| ALTER FUNCTION public.st_contains(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 504 (class 1255 OID 18858) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_containsproperly(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_containsproperly(geometry, geometry) RETURNS boolean | |
| LANGUAGE sql IMMUTABLE | |
| AS $_$SELECT $1 && $2 AND _ST_ContainsProperly($1,$2)$_$; | |
| ALTER FUNCTION public.st_containsproperly(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 505 (class 1255 OID 18859) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_convexhull(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_convexhull(geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT COST 100 | |
| AS '$libdir/postgis-1.5', 'convexhull'; | |
| ALTER FUNCTION public.st_convexhull(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 506 (class 1255 OID 18860) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_coorddim(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_coorddim(geometry) RETURNS smallint | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_ndims'; | |
| ALTER FUNCTION public.st_coorddim(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 507 (class 1255 OID 18861) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_coveredby(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_coveredby(geometry, geometry) RETURNS boolean | |
| LANGUAGE sql IMMUTABLE | |
| AS $_$SELECT $1 && $2 AND _ST_CoveredBy($1,$2)$_$; | |
| ALTER FUNCTION public.st_coveredby(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 508 (class 1255 OID 18862) | |
| -- Dependencies: 6 1099 1099 | |
| -- Name: st_coveredby(geography, geography); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_coveredby(geography, geography) RETURNS boolean | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT $1 && $2 AND _ST_Covers($2, $1)$_$; | |
| ALTER FUNCTION public.st_coveredby(geography, geography) OWNER TO postgres; | |
| -- | |
| -- TOC entry 509 (class 1255 OID 18863) | |
| -- Dependencies: 6 | |
| -- Name: st_coveredby(text, text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_coveredby(text, text) RETURNS boolean | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ SELECT ST_CoveredBy($1::geometry, $2::geometry); $_$; | |
| ALTER FUNCTION public.st_coveredby(text, text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 510 (class 1255 OID 18864) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_covers(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_covers(geometry, geometry) RETURNS boolean | |
| LANGUAGE sql IMMUTABLE | |
| AS $_$SELECT $1 && $2 AND _ST_Covers($1,$2)$_$; | |
| ALTER FUNCTION public.st_covers(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 511 (class 1255 OID 18865) | |
| -- Dependencies: 6 1099 1099 | |
| -- Name: st_covers(geography, geography); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_covers(geography, geography) RETURNS boolean | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT $1 && $2 AND _ST_Covers($1, $2)$_$; | |
| ALTER FUNCTION public.st_covers(geography, geography) OWNER TO postgres; | |
| -- | |
| -- TOC entry 512 (class 1255 OID 18866) | |
| -- Dependencies: 6 | |
| -- Name: st_covers(text, text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_covers(text, text) RETURNS boolean | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ SELECT ST_Covers($1::geometry, $2::geometry); $_$; | |
| ALTER FUNCTION public.st_covers(text, text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 513 (class 1255 OID 18867) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_crosses(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_crosses(geometry, geometry) RETURNS boolean | |
| LANGUAGE sql IMMUTABLE | |
| AS $_$SELECT $1 && $2 AND _ST_Crosses($1,$2)$_$; | |
| ALTER FUNCTION public.st_crosses(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 515 (class 1255 OID 18869) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_curvetoline(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_curvetoline(geometry) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT ST_CurveToLine($1, 32)$_$; | |
| ALTER FUNCTION public.st_curvetoline(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 514 (class 1255 OID 18868) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_curvetoline(geometry, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_curvetoline(geometry, integer) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_curve_segmentize'; | |
| ALTER FUNCTION public.st_curvetoline(geometry, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 516 (class 1255 OID 18870) | |
| -- Dependencies: 6 1096 | |
| -- Name: st_datatype(chip); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_datatype(chip) RETURNS integer | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'CHIP_getDatatype'; | |
| ALTER FUNCTION public.st_datatype(chip) OWNER TO postgres; | |
| -- | |
| -- TOC entry 517 (class 1255 OID 18871) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_dfullywithin(geometry, geometry, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_dfullywithin(geometry, geometry, double precision) RETURNS boolean | |
| LANGUAGE sql IMMUTABLE | |
| AS $_$SELECT $1 && ST_Expand($2,$3) AND $2 && ST_Expand($1,$3) AND _ST_DFullyWithin(ST_ConvexHull($1), ST_ConvexHull($2), $3)$_$; | |
| ALTER FUNCTION public.st_dfullywithin(geometry, geometry, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 518 (class 1255 OID 18872) | |
| -- Dependencies: 6 1102 1102 1102 | |
| -- Name: st_difference(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_difference(geometry, geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'difference'; | |
| ALTER FUNCTION public.st_difference(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 519 (class 1255 OID 18873) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_dimension(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_dimension(geometry) RETURNS integer | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_dimension'; | |
| ALTER FUNCTION public.st_dimension(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 520 (class 1255 OID 18874) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_disjoint(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_disjoint(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'disjoint'; | |
| ALTER FUNCTION public.st_disjoint(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 521 (class 1255 OID 18875) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_distance(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_distance(geometry, geometry) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT COST 100 | |
| AS '$libdir/postgis-1.5', 'LWGEOM_mindistance2d'; | |
| ALTER FUNCTION public.st_distance(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 523 (class 1255 OID 18877) | |
| -- Dependencies: 6 1099 1099 | |
| -- Name: st_distance(geography, geography); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_distance(geography, geography) RETURNS double precision | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT _ST_Distance($1, $2, 0.0, true)$_$; | |
| ALTER FUNCTION public.st_distance(geography, geography) OWNER TO postgres; | |
| -- | |
| -- TOC entry 524 (class 1255 OID 18878) | |
| -- Dependencies: 6 | |
| -- Name: st_distance(text, text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_distance(text, text) RETURNS double precision | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ SELECT ST_Distance($1::geometry, $2::geometry); $_$; | |
| ALTER FUNCTION public.st_distance(text, text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 522 (class 1255 OID 18876) | |
| -- Dependencies: 6 1099 1099 | |
| -- Name: st_distance(geography, geography, boolean); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_distance(geography, geography, boolean) RETURNS double precision | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT _ST_Distance($1, $2, 0.0, $3)$_$; | |
| ALTER FUNCTION public.st_distance(geography, geography, boolean) OWNER TO postgres; | |
| -- | |
| -- TOC entry 525 (class 1255 OID 18879) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_distance_sphere(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_distance_sphere(geometry, geometry) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT COST 100 | |
| AS '$libdir/postgis-1.5', 'LWGEOM_distance_sphere'; | |
| ALTER FUNCTION public.st_distance_sphere(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 526 (class 1255 OID 18880) | |
| -- Dependencies: 6 1102 1102 1113 | |
| -- Name: st_distance_spheroid(geometry, geometry, spheroid); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_distance_spheroid(geometry, geometry, spheroid) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT COST 100 | |
| AS '$libdir/postgis-1.5', 'LWGEOM_distance_ellipsoid'; | |
| ALTER FUNCTION public.st_distance_spheroid(geometry, geometry, spheroid) OWNER TO postgres; | |
| -- | |
| -- TOC entry 527 (class 1255 OID 18881) | |
| -- Dependencies: 6 1105 1102 | |
| -- Name: st_dump(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_dump(geometry) RETURNS SETOF geometry_dump | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_dump'; | |
| ALTER FUNCTION public.st_dump(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 528 (class 1255 OID 18882) | |
| -- Dependencies: 6 1105 1102 | |
| -- Name: st_dumppoints(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_dumppoints(geometry) RETURNS SETOF geometry_dump | |
| LANGUAGE sql | |
| AS $_$ | |
| SELECT * FROM _ST_DumpPoints($1, NULL); | |
| $_$; | |
| ALTER FUNCTION public.st_dumppoints(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 529 (class 1255 OID 18883) | |
| -- Dependencies: 6 1105 1102 | |
| -- Name: st_dumprings(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_dumprings(geometry) RETURNS SETOF geometry_dump | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_dump_rings'; | |
| ALTER FUNCTION public.st_dumprings(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 530 (class 1255 OID 18884) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_dwithin(geometry, geometry, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_dwithin(geometry, geometry, double precision) RETURNS boolean | |
| LANGUAGE sql IMMUTABLE | |
| AS $_$SELECT $1 && ST_Expand($2,$3) AND $2 && ST_Expand($1,$3) AND _ST_DWithin($1, $2, $3)$_$; | |
| ALTER FUNCTION public.st_dwithin(geometry, geometry, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 532 (class 1255 OID 18886) | |
| -- Dependencies: 6 1099 1099 | |
| -- Name: st_dwithin(geography, geography, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_dwithin(geography, geography, double precision) RETURNS boolean | |
| LANGUAGE sql IMMUTABLE | |
| AS $_$SELECT $1 && _ST_Expand($2,$3) AND $2 && _ST_Expand($1,$3) AND _ST_DWithin($1, $2, $3, true)$_$; | |
| ALTER FUNCTION public.st_dwithin(geography, geography, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 533 (class 1255 OID 18887) | |
| -- Dependencies: 6 | |
| -- Name: st_dwithin(text, text, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_dwithin(text, text, double precision) RETURNS boolean | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ SELECT ST_DWithin($1::geometry, $2::geometry, $3); $_$; | |
| ALTER FUNCTION public.st_dwithin(text, text, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 531 (class 1255 OID 18885) | |
| -- Dependencies: 6 1099 1099 | |
| -- Name: st_dwithin(geography, geography, double precision, boolean); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_dwithin(geography, geography, double precision, boolean) RETURNS boolean | |
| LANGUAGE sql IMMUTABLE | |
| AS $_$SELECT $1 && _ST_Expand($2,$3) AND $2 && _ST_Expand($1,$3) AND _ST_DWithin($1, $2, $3, $4)$_$; | |
| ALTER FUNCTION public.st_dwithin(geography, geography, double precision, boolean) OWNER TO postgres; | |
| -- | |
| -- TOC entry 534 (class 1255 OID 18888) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_endpoint(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_endpoint(geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_endpoint_linestring'; | |
| ALTER FUNCTION public.st_endpoint(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 535 (class 1255 OID 18889) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_envelope(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_envelope(geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_envelope'; | |
| ALTER FUNCTION public.st_envelope(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 536 (class 1255 OID 18890) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_equals(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_equals(geometry, geometry) RETURNS boolean | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT $1 && $2 AND _ST_Equals($1,$2)$_$; | |
| ALTER FUNCTION public.st_equals(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 538 (class 1255 OID 18892) | |
| -- Dependencies: 1087 6 | |
| -- Name: st_estimated_extent(text, text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_estimated_extent(text, text) RETURNS box2d | |
| LANGUAGE c IMMUTABLE STRICT SECURITY DEFINER | |
| AS '$libdir/postgis-1.5', 'LWGEOM_estimated_extent'; | |
| ALTER FUNCTION public.st_estimated_extent(text, text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 537 (class 1255 OID 18891) | |
| -- Dependencies: 6 1087 | |
| -- Name: st_estimated_extent(text, text, text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_estimated_extent(text, text, text) RETURNS box2d | |
| LANGUAGE c IMMUTABLE STRICT SECURITY DEFINER | |
| AS '$libdir/postgis-1.5', 'LWGEOM_estimated_extent'; | |
| ALTER FUNCTION public.st_estimated_extent(text, text, text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 539 (class 1255 OID 18893) | |
| -- Dependencies: 1090 1090 6 | |
| -- Name: st_expand(box3d, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_expand(box3d, double precision) RETURNS box3d | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'BOX3D_expand'; | |
| ALTER FUNCTION public.st_expand(box3d, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 540 (class 1255 OID 18896) | |
| -- Dependencies: 1087 1087 6 | |
| -- Name: st_expand(box2d, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_expand(box2d, double precision) RETURNS box2d | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'BOX2DFLOAT4_expand'; | |
| ALTER FUNCTION public.st_expand(box2d, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 541 (class 1255 OID 18897) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_expand(geometry, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_expand(geometry, double precision) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_expand'; | |
| ALTER FUNCTION public.st_expand(geometry, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 542 (class 1255 OID 18898) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_exteriorring(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_exteriorring(geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_exteriorring_polygon'; | |
| ALTER FUNCTION public.st_exteriorring(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 543 (class 1255 OID 18899) | |
| -- Dependencies: 1096 6 | |
| -- Name: st_factor(chip); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_factor(chip) RETURNS real | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'CHIP_getFactor'; | |
| ALTER FUNCTION public.st_factor(chip) OWNER TO postgres; | |
| -- | |
| -- TOC entry 545 (class 1255 OID 18901) | |
| -- Dependencies: 1167 1087 6 | |
| -- Name: st_find_extent(text, text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_find_extent(text, text) RETURNS box2d | |
| LANGUAGE plpgsql IMMUTABLE STRICT | |
| AS $_$ | |
| DECLARE | |
| tablename alias for $1; | |
| columnname alias for $2; | |
| myrec RECORD; | |
| BEGIN | |
| FOR myrec IN EXECUTE 'SELECT extent("' || columnname || '") FROM "' || tablename || '"' LOOP | |
| return myrec.extent; | |
| END LOOP; | |
| END; | |
| $_$; | |
| ALTER FUNCTION public.st_find_extent(text, text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 544 (class 1255 OID 18900) | |
| -- Dependencies: 1167 6 1087 | |
| -- Name: st_find_extent(text, text, text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_find_extent(text, text, text) RETURNS box2d | |
| LANGUAGE plpgsql IMMUTABLE STRICT | |
| AS $_$ | |
| DECLARE | |
| schemaname alias for $1; | |
| tablename alias for $2; | |
| columnname alias for $3; | |
| myrec RECORD; | |
| BEGIN | |
| FOR myrec IN EXECUTE 'SELECT extent("' || columnname || '") FROM "' || schemaname || '"."' || tablename || '"' LOOP | |
| return myrec.extent; | |
| END LOOP; | |
| END; | |
| $_$; | |
| ALTER FUNCTION public.st_find_extent(text, text, text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 546 (class 1255 OID 18902) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: st_force_2d(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_force_2d(geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_force_2d'; | |
| ALTER FUNCTION public.st_force_2d(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 547 (class 1255 OID 18903) | |
| -- Dependencies: 1102 1102 6 | |
| -- Name: st_force_3d(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_force_3d(geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_force_3dz'; | |
| ALTER FUNCTION public.st_force_3d(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 548 (class 1255 OID 18904) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_force_3dm(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_force_3dm(geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_force_3dm'; | |
| ALTER FUNCTION public.st_force_3dm(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 549 (class 1255 OID 18905) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: st_force_3dz(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_force_3dz(geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_force_3dz'; | |
| ALTER FUNCTION public.st_force_3dz(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 550 (class 1255 OID 18906) | |
| -- Dependencies: 1102 1102 6 | |
| -- Name: st_force_4d(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_force_4d(geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_force_4d'; | |
| ALTER FUNCTION public.st_force_4d(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 551 (class 1255 OID 18907) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_force_collection(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_force_collection(geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_force_collection'; | |
| ALTER FUNCTION public.st_force_collection(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 552 (class 1255 OID 18908) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_forcerhr(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_forcerhr(geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_forceRHR_poly'; | |
| ALTER FUNCTION public.st_forcerhr(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 553 (class 1255 OID 18909) | |
| -- Dependencies: 6 1099 | |
| -- Name: st_geogfromtext(text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_geogfromtext(text) RETURNS geography | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'geography_from_text'; | |
| ALTER FUNCTION public.st_geogfromtext(text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 554 (class 1255 OID 18910) | |
| -- Dependencies: 1099 6 | |
| -- Name: st_geogfromwkb(bytea); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_geogfromwkb(bytea) RETURNS geography | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'geography_from_binary'; | |
| ALTER FUNCTION public.st_geogfromwkb(bytea) OWNER TO postgres; | |
| -- | |
| -- TOC entry 555 (class 1255 OID 18911) | |
| -- Dependencies: 1099 6 | |
| -- Name: st_geographyfromtext(text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_geographyfromtext(text) RETURNS geography | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'geography_from_text'; | |
| ALTER FUNCTION public.st_geographyfromtext(text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 557 (class 1255 OID 18913) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_geohash(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_geohash(geometry) RETURNS text | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT ST_GeoHash($1, 0)$_$; | |
| ALTER FUNCTION public.st_geohash(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 556 (class 1255 OID 18912) | |
| -- Dependencies: 1102 6 | |
| -- Name: st_geohash(geometry, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_geohash(geometry, integer) RETURNS text | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'ST_GeoHash'; | |
| ALTER FUNCTION public.st_geohash(geometry, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 559 (class 1255 OID 18915) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_geomcollfromtext(text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_geomcollfromtext(text) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE | |
| WHEN geometrytype(ST_GeomFromText($1)) = 'GEOMETRYCOLLECTION' | |
| THEN ST_GeomFromText($1) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.st_geomcollfromtext(text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 558 (class 1255 OID 18914) | |
| -- Dependencies: 1102 6 | |
| -- Name: st_geomcollfromtext(text, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_geomcollfromtext(text, integer) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE | |
| WHEN geometrytype(ST_GeomFromText($1, $2)) = 'GEOMETRYCOLLECTION' | |
| THEN ST_GeomFromText($1,$2) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.st_geomcollfromtext(text, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 561 (class 1255 OID 18917) | |
| -- Dependencies: 1102 6 | |
| -- Name: st_geomcollfromwkb(bytea); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_geomcollfromwkb(bytea) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE | |
| WHEN geometrytype(ST_GeomFromWKB($1)) = 'GEOMETRYCOLLECTION' | |
| THEN ST_GeomFromWKB($1) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.st_geomcollfromwkb(bytea) OWNER TO postgres; | |
| -- | |
| -- TOC entry 560 (class 1255 OID 18916) | |
| -- Dependencies: 1102 6 | |
| -- Name: st_geomcollfromwkb(bytea, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_geomcollfromwkb(bytea, integer) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE | |
| WHEN geometrytype(GeomFromWKB($1, $2)) = 'GEOMETRYCOLLECTION' | |
| THEN GeomFromWKB($1, $2) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.st_geomcollfromwkb(bytea, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 562 (class 1255 OID 18918) | |
| -- Dependencies: 1087 1102 6 | |
| -- Name: st_geometry(box2d); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_geometry(box2d) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'BOX2DFLOAT4_to_LWGEOM'; | |
| ALTER FUNCTION public.st_geometry(box2d) OWNER TO postgres; | |
| -- | |
| -- TOC entry 563 (class 1255 OID 18919) | |
| -- Dependencies: 1102 6 1090 | |
| -- Name: st_geometry(box3d); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_geometry(box3d) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'BOX3D_to_LWGEOM'; | |
| ALTER FUNCTION public.st_geometry(box3d) OWNER TO postgres; | |
| -- | |
| -- TOC entry 564 (class 1255 OID 18920) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_geometry(text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_geometry(text) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'parse_WKT_lwgeom'; | |
| ALTER FUNCTION public.st_geometry(text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 565 (class 1255 OID 18921) | |
| -- Dependencies: 6 1096 1102 | |
| -- Name: st_geometry(chip); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_geometry(chip) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'CHIP_to_LWGEOM'; | |
| ALTER FUNCTION public.st_geometry(chip) OWNER TO postgres; | |
| -- | |
| -- TOC entry 566 (class 1255 OID 18922) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_geometry(bytea); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_geometry(bytea) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_from_bytea'; | |
| ALTER FUNCTION public.st_geometry(bytea) OWNER TO postgres; | |
| -- | |
| -- TOC entry 567 (class 1255 OID 18923) | |
| -- Dependencies: 1102 6 1093 | |
| -- Name: st_geometry(box3d_extent); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_geometry(box3d_extent) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'BOX3D_to_LWGEOM'; | |
| ALTER FUNCTION public.st_geometry(box3d_extent) OWNER TO postgres; | |
| -- | |
| -- TOC entry 568 (class 1255 OID 18924) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_geometry_above(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_geometry_above(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_above'; | |
| ALTER FUNCTION public.st_geometry_above(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 569 (class 1255 OID 18925) | |
| -- Dependencies: 6 | |
| -- Name: st_geometry_analyze(internal); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_geometry_analyze(internal) RETURNS boolean | |
| LANGUAGE c STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_analyze'; | |
| ALTER FUNCTION public.st_geometry_analyze(internal) OWNER TO postgres; | |
| -- | |
| -- TOC entry 570 (class 1255 OID 18926) | |
| -- Dependencies: 1102 1102 6 | |
| -- Name: st_geometry_below(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_geometry_below(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_below'; | |
| ALTER FUNCTION public.st_geometry_below(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 571 (class 1255 OID 18927) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: st_geometry_cmp(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_geometry_cmp(geometry, geometry) RETURNS integer | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'lwgeom_cmp'; | |
| ALTER FUNCTION public.st_geometry_cmp(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 572 (class 1255 OID 18928) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: st_geometry_contain(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_geometry_contain(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_contain'; | |
| ALTER FUNCTION public.st_geometry_contain(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 573 (class 1255 OID 18929) | |
| -- Dependencies: 1102 1102 6 | |
| -- Name: st_geometry_contained(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_geometry_contained(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_contained'; | |
| ALTER FUNCTION public.st_geometry_contained(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 574 (class 1255 OID 18930) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_geometry_eq(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_geometry_eq(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'lwgeom_eq'; | |
| ALTER FUNCTION public.st_geometry_eq(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 575 (class 1255 OID 18931) | |
| -- Dependencies: 1102 1102 6 | |
| -- Name: st_geometry_ge(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_geometry_ge(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'lwgeom_ge'; | |
| ALTER FUNCTION public.st_geometry_ge(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 576 (class 1255 OID 18932) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: st_geometry_gt(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_geometry_gt(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'lwgeom_gt'; | |
| ALTER FUNCTION public.st_geometry_gt(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 577 (class 1255 OID 18933) | |
| -- Dependencies: 1102 6 | |
| -- Name: st_geometry_in(cstring); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_geometry_in(cstring) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_in'; | |
| ALTER FUNCTION public.st_geometry_in(cstring) OWNER TO postgres; | |
| -- | |
| -- TOC entry 578 (class 1255 OID 18934) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: st_geometry_le(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_geometry_le(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'lwgeom_le'; | |
| ALTER FUNCTION public.st_geometry_le(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 579 (class 1255 OID 18935) | |
| -- Dependencies: 1102 1102 6 | |
| -- Name: st_geometry_left(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_geometry_left(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_left'; | |
| ALTER FUNCTION public.st_geometry_left(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 580 (class 1255 OID 18936) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_geometry_lt(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_geometry_lt(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'lwgeom_lt'; | |
| ALTER FUNCTION public.st_geometry_lt(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 581 (class 1255 OID 18937) | |
| -- Dependencies: 1102 6 | |
| -- Name: st_geometry_out(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_geometry_out(geometry) RETURNS cstring | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_out'; | |
| ALTER FUNCTION public.st_geometry_out(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 582 (class 1255 OID 18938) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: st_geometry_overabove(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_geometry_overabove(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_overabove'; | |
| ALTER FUNCTION public.st_geometry_overabove(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 583 (class 1255 OID 18939) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: st_geometry_overbelow(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_geometry_overbelow(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_overbelow'; | |
| ALTER FUNCTION public.st_geometry_overbelow(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 584 (class 1255 OID 18940) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: st_geometry_overlap(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_geometry_overlap(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_overlap'; | |
| ALTER FUNCTION public.st_geometry_overlap(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 585 (class 1255 OID 18941) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: st_geometry_overleft(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_geometry_overleft(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_overleft'; | |
| ALTER FUNCTION public.st_geometry_overleft(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 586 (class 1255 OID 18942) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: st_geometry_overright(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_geometry_overright(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_overright'; | |
| ALTER FUNCTION public.st_geometry_overright(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 587 (class 1255 OID 18943) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_geometry_recv(internal); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_geometry_recv(internal) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_recv'; | |
| ALTER FUNCTION public.st_geometry_recv(internal) OWNER TO postgres; | |
| -- | |
| -- TOC entry 588 (class 1255 OID 18944) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_geometry_right(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_geometry_right(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_right'; | |
| ALTER FUNCTION public.st_geometry_right(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 589 (class 1255 OID 18945) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: st_geometry_same(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_geometry_same(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_samebox'; | |
| ALTER FUNCTION public.st_geometry_same(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 590 (class 1255 OID 18946) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_geometry_send(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_geometry_send(geometry) RETURNS bytea | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_send'; | |
| ALTER FUNCTION public.st_geometry_send(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 591 (class 1255 OID 18947) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_geometryfromtext(text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_geometryfromtext(text) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_from_text'; | |
| ALTER FUNCTION public.st_geometryfromtext(text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 592 (class 1255 OID 18948) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_geometryfromtext(text, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_geometryfromtext(text, integer) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_from_text'; | |
| ALTER FUNCTION public.st_geometryfromtext(text, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 593 (class 1255 OID 18949) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: st_geometryn(geometry, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_geometryn(geometry, integer) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_geometryn_collection'; | |
| ALTER FUNCTION public.st_geometryn(geometry, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 594 (class 1255 OID 18950) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_geometrytype(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_geometrytype(geometry) RETURNS text | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'geometry_geometrytype'; | |
| ALTER FUNCTION public.st_geometrytype(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 595 (class 1255 OID 18951) | |
| -- Dependencies: 1102 6 | |
| -- Name: st_geomfromewkb(bytea); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_geomfromewkb(bytea) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOMFromWKB'; | |
| ALTER FUNCTION public.st_geomfromewkb(bytea) OWNER TO postgres; | |
| -- | |
| -- TOC entry 596 (class 1255 OID 18952) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_geomfromewkt(text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_geomfromewkt(text) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'parse_WKT_lwgeom'; | |
| ALTER FUNCTION public.st_geomfromewkt(text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 597 (class 1255 OID 18953) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_geomfromgml(text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_geomfromgml(text) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'geom_from_gml'; | |
| ALTER FUNCTION public.st_geomfromgml(text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 598 (class 1255 OID 18954) | |
| -- Dependencies: 1102 6 | |
| -- Name: st_geomfromkml(text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_geomfromkml(text) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'geom_from_kml'; | |
| ALTER FUNCTION public.st_geomfromkml(text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 599 (class 1255 OID 18955) | |
| -- Dependencies: 1102 6 | |
| -- Name: st_geomfromtext(text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_geomfromtext(text) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_from_text'; | |
| ALTER FUNCTION public.st_geomfromtext(text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 600 (class 1255 OID 18956) | |
| -- Dependencies: 1102 6 | |
| -- Name: st_geomfromtext(text, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_geomfromtext(text, integer) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_from_text'; | |
| ALTER FUNCTION public.st_geomfromtext(text, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 601 (class 1255 OID 18957) | |
| -- Dependencies: 1102 6 | |
| -- Name: st_geomfromwkb(bytea); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_geomfromwkb(bytea) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_from_WKB'; | |
| ALTER FUNCTION public.st_geomfromwkb(bytea) OWNER TO postgres; | |
| -- | |
| -- TOC entry 602 (class 1255 OID 18958) | |
| -- Dependencies: 1102 6 | |
| -- Name: st_geomfromwkb(bytea, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_geomfromwkb(bytea, integer) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT ST_SetSRID(ST_GeomFromWKB($1), $2)$_$; | |
| ALTER FUNCTION public.st_geomfromwkb(bytea, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 603 (class 1255 OID 18959) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_gmltosql(text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_gmltosql(text) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'geom_from_gml'; | |
| ALTER FUNCTION public.st_gmltosql(text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 604 (class 1255 OID 18960) | |
| -- Dependencies: 1102 6 | |
| -- Name: st_hasarc(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_hasarc(geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_has_arc'; | |
| ALTER FUNCTION public.st_hasarc(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 605 (class 1255 OID 18961) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_hausdorffdistance(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_hausdorffdistance(geometry, geometry) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT COST 100 | |
| AS '$libdir/postgis-1.5', 'hausdorffdistance'; | |
| ALTER FUNCTION public.st_hausdorffdistance(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 606 (class 1255 OID 18962) | |
| -- Dependencies: 1102 1102 6 | |
| -- Name: st_hausdorffdistance(geometry, geometry, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_hausdorffdistance(geometry, geometry, double precision) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT COST 100 | |
| AS '$libdir/postgis-1.5', 'hausdorffdistancedensify'; | |
| ALTER FUNCTION public.st_hausdorffdistance(geometry, geometry, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 607 (class 1255 OID 18963) | |
| -- Dependencies: 6 1096 | |
| -- Name: st_height(chip); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_height(chip) RETURNS integer | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'CHIP_getHeight'; | |
| ALTER FUNCTION public.st_height(chip) OWNER TO postgres; | |
| -- | |
| -- TOC entry 608 (class 1255 OID 18964) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_interiorringn(geometry, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_interiorringn(geometry, integer) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_interiorringn_polygon'; | |
| ALTER FUNCTION public.st_interiorringn(geometry, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 609 (class 1255 OID 18965) | |
| -- Dependencies: 6 1102 1102 1102 | |
| -- Name: st_intersection(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_intersection(geometry, geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT COST 100 | |
| AS '$libdir/postgis-1.5', 'intersection'; | |
| ALTER FUNCTION public.st_intersection(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 610 (class 1255 OID 18966) | |
| -- Dependencies: 6 1099 1099 1099 | |
| -- Name: st_intersection(geography, geography); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_intersection(geography, geography) RETURNS geography | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT geography(ST_Transform(ST_Intersection(ST_Transform(geometry($1), _ST_BestSRID($1, $2)), ST_Transform(geometry($2), _ST_BestSRID($1, $2))), 4326))$_$; | |
| ALTER FUNCTION public.st_intersection(geography, geography) OWNER TO postgres; | |
| -- | |
| -- TOC entry 611 (class 1255 OID 18967) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_intersection(text, text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_intersection(text, text) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ SELECT ST_Intersection($1::geometry, $2::geometry); $_$; | |
| ALTER FUNCTION public.st_intersection(text, text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 612 (class 1255 OID 18968) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_intersects(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_intersects(geometry, geometry) RETURNS boolean | |
| LANGUAGE sql IMMUTABLE | |
| AS $_$SELECT $1 && $2 AND _ST_Intersects($1,$2)$_$; | |
| ALTER FUNCTION public.st_intersects(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 613 (class 1255 OID 18969) | |
| -- Dependencies: 6 1099 1099 | |
| -- Name: st_intersects(geography, geography); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_intersects(geography, geography) RETURNS boolean | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT $1 && $2 AND _ST_Distance($1, $2, 0.0, false) < 0.00001$_$; | |
| ALTER FUNCTION public.st_intersects(geography, geography) OWNER TO postgres; | |
| -- | |
| -- TOC entry 614 (class 1255 OID 18970) | |
| -- Dependencies: 6 | |
| -- Name: st_intersects(text, text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_intersects(text, text) RETURNS boolean | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ SELECT ST_Intersects($1::geometry, $2::geometry); $_$; | |
| ALTER FUNCTION public.st_intersects(text, text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 615 (class 1255 OID 18971) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_isclosed(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_isclosed(geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_isclosed_linestring'; | |
| ALTER FUNCTION public.st_isclosed(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 616 (class 1255 OID 18972) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_isempty(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_isempty(geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_isempty'; | |
| ALTER FUNCTION public.st_isempty(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 617 (class 1255 OID 18973) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_isring(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_isring(geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'isring'; | |
| ALTER FUNCTION public.st_isring(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 618 (class 1255 OID 18974) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_issimple(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_issimple(geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'issimple'; | |
| ALTER FUNCTION public.st_issimple(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 619 (class 1255 OID 18975) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_isvalid(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_isvalid(geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT COST 100 | |
| AS '$libdir/postgis-1.5', 'isvalid'; | |
| ALTER FUNCTION public.st_isvalid(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 620 (class 1255 OID 18976) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_isvalidreason(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_isvalidreason(geometry) RETURNS text | |
| LANGUAGE c IMMUTABLE STRICT COST 100 | |
| AS '$libdir/postgis-1.5', 'isvalidreason'; | |
| ALTER FUNCTION public.st_isvalidreason(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 621 (class 1255 OID 18977) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_length(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_length(geometry) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_length2d_linestring'; | |
| ALTER FUNCTION public.st_length(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 623 (class 1255 OID 18979) | |
| -- Dependencies: 6 1099 | |
| -- Name: st_length(geography); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_length(geography) RETURNS double precision | |
| LANGUAGE sql IMMUTABLE | |
| AS $_$SELECT ST_Length($1, true)$_$; | |
| ALTER FUNCTION public.st_length(geography) OWNER TO postgres; | |
| -- | |
| -- TOC entry 624 (class 1255 OID 18980) | |
| -- Dependencies: 6 | |
| -- Name: st_length(text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_length(text) RETURNS double precision | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ SELECT ST_Length($1::geometry); $_$; | |
| ALTER FUNCTION public.st_length(text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 622 (class 1255 OID 18978) | |
| -- Dependencies: 6 1099 | |
| -- Name: st_length(geography, boolean); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_length(geography, boolean) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT COST 100 | |
| AS '$libdir/postgis-1.5', 'geography_length'; | |
| ALTER FUNCTION public.st_length(geography, boolean) OWNER TO postgres; | |
| -- | |
| -- TOC entry 625 (class 1255 OID 18981) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_length2d(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_length2d(geometry) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_length2d_linestring'; | |
| ALTER FUNCTION public.st_length2d(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 626 (class 1255 OID 18982) | |
| -- Dependencies: 6 1102 1113 | |
| -- Name: st_length2d_spheroid(geometry, spheroid); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_length2d_spheroid(geometry, spheroid) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT COST 100 | |
| AS '$libdir/postgis-1.5', 'LWGEOM_length2d_ellipsoid'; | |
| ALTER FUNCTION public.st_length2d_spheroid(geometry, spheroid) OWNER TO postgres; | |
| -- | |
| -- TOC entry 627 (class 1255 OID 18983) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_length3d(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_length3d(geometry) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_length_linestring'; | |
| ALTER FUNCTION public.st_length3d(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 628 (class 1255 OID 18984) | |
| -- Dependencies: 6 1102 1113 | |
| -- Name: st_length3d_spheroid(geometry, spheroid); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_length3d_spheroid(geometry, spheroid) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT COST 100 | |
| AS '$libdir/postgis-1.5', 'LWGEOM_length_ellipsoid_linestring'; | |
| ALTER FUNCTION public.st_length3d_spheroid(geometry, spheroid) OWNER TO postgres; | |
| -- | |
| -- TOC entry 629 (class 1255 OID 18985) | |
| -- Dependencies: 6 1102 1113 | |
| -- Name: st_length_spheroid(geometry, spheroid); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_length_spheroid(geometry, spheroid) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT COST 100 | |
| AS '$libdir/postgis-1.5', 'LWGEOM_length_ellipsoid_linestring'; | |
| ALTER FUNCTION public.st_length_spheroid(geometry, spheroid) OWNER TO postgres; | |
| -- | |
| -- TOC entry 630 (class 1255 OID 18986) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_line_interpolate_point(geometry, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_line_interpolate_point(geometry, double precision) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_line_interpolate_point'; | |
| ALTER FUNCTION public.st_line_interpolate_point(geometry, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 631 (class 1255 OID 18987) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_line_locate_point(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_line_locate_point(geometry, geometry) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_line_locate_point'; | |
| ALTER FUNCTION public.st_line_locate_point(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 632 (class 1255 OID 18988) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_line_substring(geometry, double precision, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_line_substring(geometry, double precision, double precision) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_line_substring'; | |
| ALTER FUNCTION public.st_line_substring(geometry, double precision, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 633 (class 1255 OID 18989) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_linecrossingdirection(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_linecrossingdirection(geometry, geometry) RETURNS integer | |
| LANGUAGE sql IMMUTABLE | |
| AS $_$ SELECT CASE WHEN NOT $1 && $2 THEN 0 ELSE _ST_LineCrossingDirection($1,$2) END $_$; | |
| ALTER FUNCTION public.st_linecrossingdirection(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 634 (class 1255 OID 18990) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_linefrommultipoint(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_linefrommultipoint(geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_line_from_mpoint'; | |
| ALTER FUNCTION public.st_linefrommultipoint(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 635 (class 1255 OID 18991) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_linefromtext(text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_linefromtext(text) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(ST_GeomFromText($1)) = 'LINESTRING' | |
| THEN ST_GeomFromText($1) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.st_linefromtext(text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 636 (class 1255 OID 18992) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_linefromtext(text, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_linefromtext(text, integer) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(GeomFromText($1, $2)) = 'LINESTRING' | |
| THEN GeomFromText($1,$2) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.st_linefromtext(text, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 638 (class 1255 OID 18994) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_linefromwkb(bytea); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_linefromwkb(bytea) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(ST_GeomFromWKB($1)) = 'LINESTRING' | |
| THEN ST_GeomFromWKB($1) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.st_linefromwkb(bytea) OWNER TO postgres; | |
| -- | |
| -- TOC entry 637 (class 1255 OID 18993) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_linefromwkb(bytea, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_linefromwkb(bytea, integer) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(ST_GeomFromWKB($1, $2)) = 'LINESTRING' | |
| THEN ST_GeomFromWKB($1, $2) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.st_linefromwkb(bytea, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 639 (class 1255 OID 18995) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_linemerge(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_linemerge(geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT COST 100 | |
| AS '$libdir/postgis-1.5', 'linemerge'; | |
| ALTER FUNCTION public.st_linemerge(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 641 (class 1255 OID 18997) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_linestringfromwkb(bytea); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_linestringfromwkb(bytea) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(GeomFromWKB($1)) = 'LINESTRING' | |
| THEN GeomFromWKB($1) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.st_linestringfromwkb(bytea) OWNER TO postgres; | |
| -- | |
| -- TOC entry 640 (class 1255 OID 18996) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_linestringfromwkb(bytea, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_linestringfromwkb(bytea, integer) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(ST_GeomFromWKB($1, $2)) = 'LINESTRING' | |
| THEN ST_GeomFromWKB($1, $2) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.st_linestringfromwkb(bytea, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 642 (class 1255 OID 18998) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_linetocurve(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_linetocurve(geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_line_desegmentize'; | |
| ALTER FUNCTION public.st_linetocurve(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 643 (class 1255 OID 18999) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_locate_along_measure(geometry, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_locate_along_measure(geometry, double precision) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ SELECT locate_between_measures($1, $2, $2) $_$; | |
| ALTER FUNCTION public.st_locate_along_measure(geometry, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 644 (class 1255 OID 19000) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_locate_between_measures(geometry, double precision, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_locate_between_measures(geometry, double precision, double precision) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_locate_between_m'; | |
| ALTER FUNCTION public.st_locate_between_measures(geometry, double precision, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 645 (class 1255 OID 19001) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_locatebetweenelevations(geometry, double precision, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_locatebetweenelevations(geometry, double precision, double precision) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'ST_LocateBetweenElevations'; | |
| ALTER FUNCTION public.st_locatebetweenelevations(geometry, double precision, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 646 (class 1255 OID 19002) | |
| -- Dependencies: 6 1102 1102 1102 | |
| -- Name: st_longestline(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_longestline(geometry, geometry) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT _ST_LongestLine(ST_ConvexHull($1), ST_ConvexHull($2))$_$; | |
| ALTER FUNCTION public.st_longestline(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 647 (class 1255 OID 19003) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_m(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_m(geometry) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_m_point'; | |
| ALTER FUNCTION public.st_m(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 648 (class 1255 OID 19004) | |
| -- Dependencies: 6 1087 1102 1102 | |
| -- Name: st_makebox2d(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_makebox2d(geometry, geometry) RETURNS box2d | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'BOX2DFLOAT4_construct'; | |
| ALTER FUNCTION public.st_makebox2d(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 649 (class 1255 OID 19005) | |
| -- Dependencies: 6 1090 1102 1102 | |
| -- Name: st_makebox3d(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_makebox3d(geometry, geometry) RETURNS box3d | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'BOX3D_construct'; | |
| ALTER FUNCTION public.st_makebox3d(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 650 (class 1255 OID 19006) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_makeenvelope(double precision, double precision, double precision, double precision, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_makeenvelope(double precision, double precision, double precision, double precision, integer) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'ST_MakeEnvelope'; | |
| ALTER FUNCTION public.st_makeenvelope(double precision, double precision, double precision, double precision, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 651 (class 1255 OID 19007) | |
| -- Dependencies: 6 1102 1104 | |
| -- Name: st_makeline(geometry[]); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_makeline(geometry[]) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_makeline_garray'; | |
| ALTER FUNCTION public.st_makeline(geometry[]) OWNER TO postgres; | |
| -- | |
| -- TOC entry 652 (class 1255 OID 19008) | |
| -- Dependencies: 6 1102 1102 1102 | |
| -- Name: st_makeline(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_makeline(geometry, geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_makeline'; | |
| ALTER FUNCTION public.st_makeline(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 653 (class 1255 OID 19009) | |
| -- Dependencies: 1102 6 1104 | |
| -- Name: st_makeline_garray(geometry[]); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_makeline_garray(geometry[]) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_makeline_garray'; | |
| ALTER FUNCTION public.st_makeline_garray(geometry[]) OWNER TO postgres; | |
| -- | |
| -- TOC entry 654 (class 1255 OID 19010) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_makepoint(double precision, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_makepoint(double precision, double precision) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_makepoint'; | |
| ALTER FUNCTION public.st_makepoint(double precision, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 655 (class 1255 OID 19011) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_makepoint(double precision, double precision, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_makepoint(double precision, double precision, double precision) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_makepoint'; | |
| ALTER FUNCTION public.st_makepoint(double precision, double precision, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 656 (class 1255 OID 19012) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_makepoint(double precision, double precision, double precision, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_makepoint(double precision, double precision, double precision, double precision) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_makepoint'; | |
| ALTER FUNCTION public.st_makepoint(double precision, double precision, double precision, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 657 (class 1255 OID 19013) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_makepointm(double precision, double precision, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_makepointm(double precision, double precision, double precision) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_makepoint3dm'; | |
| ALTER FUNCTION public.st_makepointm(double precision, double precision, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 659 (class 1255 OID 19015) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_makepolygon(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_makepolygon(geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_makepoly'; | |
| ALTER FUNCTION public.st_makepolygon(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 658 (class 1255 OID 19014) | |
| -- Dependencies: 6 1102 1102 1104 | |
| -- Name: st_makepolygon(geometry, geometry[]); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_makepolygon(geometry, geometry[]) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_makepoly'; | |
| ALTER FUNCTION public.st_makepolygon(geometry, geometry[]) OWNER TO postgres; | |
| -- | |
| -- TOC entry 660 (class 1255 OID 19016) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_maxdistance(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_maxdistance(geometry, geometry) RETURNS double precision | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT _ST_MaxDistance(ST_ConvexHull($1), ST_ConvexHull($2))$_$; | |
| ALTER FUNCTION public.st_maxdistance(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 661 (class 1255 OID 19017) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_mem_size(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_mem_size(geometry) RETURNS integer | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_mem_size'; | |
| ALTER FUNCTION public.st_mem_size(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 663 (class 1255 OID 19020) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_minimumboundingcircle(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_minimumboundingcircle(geometry) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT ST_MinimumBoundingCircle($1, 48)$_$; | |
| ALTER FUNCTION public.st_minimumboundingcircle(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 662 (class 1255 OID 19018) | |
| -- Dependencies: 6 1167 1102 1102 | |
| -- Name: st_minimumboundingcircle(geometry, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_minimumboundingcircle(inputgeom geometry, segs_per_quarter integer) RETURNS geometry | |
| LANGUAGE plpgsql IMMUTABLE STRICT | |
| AS $$ | |
| DECLARE | |
| hull GEOMETRY; | |
| ring GEOMETRY; | |
| center GEOMETRY; | |
| radius DOUBLE PRECISION; | |
| dist DOUBLE PRECISION; | |
| d DOUBLE PRECISION; | |
| idx1 integer; | |
| idx2 integer; | |
| l1 GEOMETRY; | |
| l2 GEOMETRY; | |
| p1 GEOMETRY; | |
| p2 GEOMETRY; | |
| a1 DOUBLE PRECISION; | |
| a2 DOUBLE PRECISION; | |
| BEGIN | |
| -- First compute the ConvexHull of the geometry | |
| hull = ST_ConvexHull(inputgeom); | |
| --A point really has no MBC | |
| IF ST_GeometryType(hull) = 'ST_Point' THEN | |
| RETURN hull; | |
| END IF; | |
| -- convert the hull perimeter to a linestring so we can manipulate individual points | |
| --If its already a linestring force it to a closed linestring | |
| ring = CASE WHEN ST_GeometryType(hull) = 'ST_LineString' THEN ST_AddPoint(hull, ST_StartPoint(hull)) ELSE ST_ExteriorRing(hull) END; | |
| dist = 0; | |
| -- Brute Force - check every pair | |
| FOR i in 1 .. (ST_NumPoints(ring)-2) | |
| LOOP | |
| FOR j in i .. (ST_NumPoints(ring)-1) | |
| LOOP | |
| d = ST_Distance(ST_PointN(ring,i),ST_PointN(ring,j)); | |
| -- Check the distance and update if larger | |
| IF (d > dist) THEN | |
| dist = d; | |
| idx1 = i; | |
| idx2 = j; | |
| END IF; | |
| END LOOP; | |
| END LOOP; | |
| -- We now have the diameter of the convex hull. The following line returns it if desired. | |
| -- RETURN MakeLine(PointN(ring,idx1),PointN(ring,idx2)); | |
| -- Now for the Minimum Bounding Circle. Since we know the two points furthest from each | |
| -- other, the MBC must go through those two points. Start with those points as a diameter of a circle. | |
| -- The radius is half the distance between them and the center is midway between them | |
| radius = ST_Distance(ST_PointN(ring,idx1),ST_PointN(ring,idx2)) / 2.0; | |
| center = ST_Line_interpolate_point(ST_MakeLine(ST_PointN(ring,idx1),ST_PointN(ring,idx2)),0.5); | |
| -- Loop through each vertex and check if the distance from the center to the point | |
| -- is greater than the current radius. | |
| FOR k in 1 .. (ST_NumPoints(ring)-1) | |
| LOOP | |
| IF(k <> idx1 and k <> idx2) THEN | |
| dist = ST_Distance(center,ST_PointN(ring,k)); | |
| IF (dist > radius) THEN | |
| -- We have to expand the circle. The new circle must pass trhough | |
| -- three points - the two original diameters and this point. | |
| -- Draw a line from the first diameter to this point | |
| l1 = ST_Makeline(ST_PointN(ring,idx1),ST_PointN(ring,k)); | |
| -- Compute the midpoint | |
| p1 = ST_line_interpolate_point(l1,0.5); | |
| -- Rotate the line 90 degrees around the midpoint (perpendicular bisector) | |
| l1 = ST_Translate(ST_Rotate(ST_Translate(l1,-X(p1),-Y(p1)),pi()/2),X(p1),Y(p1)); | |
| -- Compute the azimuth of the bisector | |
| a1 = ST_Azimuth(ST_PointN(l1,1),ST_PointN(l1,2)); | |
| -- Extend the line in each direction the new computed distance to insure they will intersect | |
| l1 = ST_AddPoint(l1,ST_Makepoint(X(ST_PointN(l1,2))+sin(a1)*dist,Y(ST_PointN(l1,2))+cos(a1)*dist),-1); | |
| l1 = ST_AddPoint(l1,ST_Makepoint(X(ST_PointN(l1,1))-sin(a1)*dist,Y(ST_PointN(l1,1))-cos(a1)*dist),0); | |
| -- Repeat for the line from the point to the other diameter point | |
| l2 = ST_Makeline(ST_PointN(ring,idx2),ST_PointN(ring,k)); | |
| p2 = ST_Line_interpolate_point(l2,0.5); | |
| l2 = ST_Translate(ST_Rotate(ST_Translate(l2,-X(p2),-Y(p2)),pi()/2),X(p2),Y(p2)); | |
| a2 = ST_Azimuth(ST_PointN(l2,1),ST_PointN(l2,2)); | |
| l2 = ST_AddPoint(l2,ST_Makepoint(X(ST_PointN(l2,2))+sin(a2)*dist,Y(ST_PointN(l2,2))+cos(a2)*dist),-1); | |
| l2 = ST_AddPoint(l2,ST_Makepoint(X(ST_PointN(l2,1))-sin(a2)*dist,Y(ST_PointN(l2,1))-cos(a2)*dist),0); | |
| -- The new center is the intersection of the two bisectors | |
| center = ST_Intersection(l1,l2); | |
| -- The new radius is the distance to any of the three points | |
| radius = ST_Distance(center,ST_PointN(ring,idx1)); | |
| END IF; | |
| END IF; | |
| END LOOP; | |
| --DONE!! Return the MBC via the buffer command | |
| RETURN ST_Buffer(center,radius,segs_per_quarter); | |
| END; | |
| $$; | |
| ALTER FUNCTION public.st_minimumboundingcircle(inputgeom geometry, segs_per_quarter integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 665 (class 1255 OID 19022) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_mlinefromtext(text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_mlinefromtext(text) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(ST_GeomFromText($1)) = 'MULTILINESTRING' | |
| THEN ST_GeomFromText($1) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.st_mlinefromtext(text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 664 (class 1255 OID 19021) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_mlinefromtext(text, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_mlinefromtext(text, integer) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE | |
| WHEN geometrytype(GeomFromText($1, $2)) = 'MULTILINESTRING' | |
| THEN GeomFromText($1,$2) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.st_mlinefromtext(text, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 667 (class 1255 OID 19024) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_mlinefromwkb(bytea); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_mlinefromwkb(bytea) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(ST_GeomFromWKB($1)) = 'MULTILINESTRING' | |
| THEN ST_GeomFromWKB($1) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.st_mlinefromwkb(bytea) OWNER TO postgres; | |
| -- | |
| -- TOC entry 666 (class 1255 OID 19023) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_mlinefromwkb(bytea, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_mlinefromwkb(bytea, integer) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(ST_GeomFromWKB($1, $2)) = 'MULTILINESTRING' | |
| THEN ST_GeomFromWKB($1, $2) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.st_mlinefromwkb(bytea, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 669 (class 1255 OID 19026) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_mpointfromtext(text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_mpointfromtext(text) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(ST_GeomFromText($1)) = 'MULTIPOINT' | |
| THEN ST_GeomFromText($1) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.st_mpointfromtext(text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 668 (class 1255 OID 19025) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_mpointfromtext(text, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_mpointfromtext(text, integer) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(GeomFromText($1, $2)) = 'MULTIPOINT' | |
| THEN GeomFromText($1, $2) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.st_mpointfromtext(text, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 672 (class 1255 OID 19028) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_mpointfromwkb(bytea); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_mpointfromwkb(bytea) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(ST_GeomFromWKB($1)) = 'MULTIPOINT' | |
| THEN ST_GeomFromWKB($1) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.st_mpointfromwkb(bytea) OWNER TO postgres; | |
| -- | |
| -- TOC entry 671 (class 1255 OID 19027) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_mpointfromwkb(bytea, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_mpointfromwkb(bytea, integer) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(GeomFromWKB($1, $2)) = 'MULTIPOINT' | |
| THEN GeomFromWKB($1, $2) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.st_mpointfromwkb(bytea, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 674 (class 1255 OID 19030) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_mpolyfromtext(text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_mpolyfromtext(text) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(ST_GeomFromText($1)) = 'MULTIPOLYGON' | |
| THEN ST_GeomFromText($1) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.st_mpolyfromtext(text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 673 (class 1255 OID 19029) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_mpolyfromtext(text, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_mpolyfromtext(text, integer) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(ST_GeomFromText($1, $2)) = 'MULTIPOLYGON' | |
| THEN ST_GeomFromText($1,$2) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.st_mpolyfromtext(text, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 676 (class 1255 OID 19032) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_mpolyfromwkb(bytea); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_mpolyfromwkb(bytea) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(ST_GeomFromWKB($1)) = 'MULTIPOLYGON' | |
| THEN ST_GeomFromWKB($1) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.st_mpolyfromwkb(bytea) OWNER TO postgres; | |
| -- | |
| -- TOC entry 675 (class 1255 OID 19031) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_mpolyfromwkb(bytea, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_mpolyfromwkb(bytea, integer) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(ST_GeomFromWKB($1, $2)) = 'MULTIPOLYGON' | |
| THEN ST_GeomFromWKB($1, $2) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.st_mpolyfromwkb(bytea, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 677 (class 1255 OID 19033) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_multi(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_multi(geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_force_multi'; | |
| ALTER FUNCTION public.st_multi(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 678 (class 1255 OID 19034) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_multilinefromwkb(bytea); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_multilinefromwkb(bytea) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(ST_GeomFromWKB($1)) = 'MULTILINESTRING' | |
| THEN ST_GeomFromWKB($1) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.st_multilinefromwkb(bytea) OWNER TO postgres; | |
| -- | |
| -- TOC entry 679 (class 1255 OID 19035) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_multilinestringfromtext(text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_multilinestringfromtext(text) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT ST_MLineFromText($1)$_$; | |
| ALTER FUNCTION public.st_multilinestringfromtext(text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 680 (class 1255 OID 19036) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_multilinestringfromtext(text, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_multilinestringfromtext(text, integer) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT MLineFromText($1, $2)$_$; | |
| ALTER FUNCTION public.st_multilinestringfromtext(text, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 681 (class 1255 OID 19037) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_multipointfromtext(text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_multipointfromtext(text) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT MPointFromText($1)$_$; | |
| ALTER FUNCTION public.st_multipointfromtext(text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 683 (class 1255 OID 19039) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_multipointfromwkb(bytea); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_multipointfromwkb(bytea) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(ST_GeomFromWKB($1)) = 'MULTIPOINT' | |
| THEN ST_GeomFromWKB($1) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.st_multipointfromwkb(bytea) OWNER TO postgres; | |
| -- | |
| -- TOC entry 682 (class 1255 OID 19038) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_multipointfromwkb(bytea, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_multipointfromwkb(bytea, integer) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(ST_GeomFromWKB($1,$2)) = 'MULTIPOINT' | |
| THEN ST_GeomFromWKB($1, $2) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.st_multipointfromwkb(bytea, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 685 (class 1255 OID 19041) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_multipolyfromwkb(bytea); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_multipolyfromwkb(bytea) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(ST_GeomFromWKB($1)) = 'MULTIPOLYGON' | |
| THEN ST_GeomFromWKB($1) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.st_multipolyfromwkb(bytea) OWNER TO postgres; | |
| -- | |
| -- TOC entry 684 (class 1255 OID 19040) | |
| -- Dependencies: 1102 6 | |
| -- Name: st_multipolyfromwkb(bytea, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_multipolyfromwkb(bytea, integer) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(ST_GeomFromWKB($1, $2)) = 'MULTIPOLYGON' | |
| THEN ST_GeomFromWKB($1, $2) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.st_multipolyfromwkb(bytea, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 687 (class 1255 OID 19043) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_multipolygonfromtext(text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_multipolygonfromtext(text) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT MPolyFromText($1)$_$; | |
| ALTER FUNCTION public.st_multipolygonfromtext(text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 686 (class 1255 OID 19042) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_multipolygonfromtext(text, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_multipolygonfromtext(text, integer) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT MPolyFromText($1, $2)$_$; | |
| ALTER FUNCTION public.st_multipolygonfromtext(text, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 688 (class 1255 OID 19044) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_ndims(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_ndims(geometry) RETURNS smallint | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_ndims'; | |
| ALTER FUNCTION public.st_ndims(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 689 (class 1255 OID 19045) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_npoints(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_npoints(geometry) RETURNS integer | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_npoints'; | |
| ALTER FUNCTION public.st_npoints(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 690 (class 1255 OID 19046) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_nrings(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_nrings(geometry) RETURNS integer | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_nrings'; | |
| ALTER FUNCTION public.st_nrings(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 691 (class 1255 OID 19047) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_numgeometries(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_numgeometries(geometry) RETURNS integer | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_numgeometries_collection'; | |
| ALTER FUNCTION public.st_numgeometries(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 692 (class 1255 OID 19048) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_numinteriorring(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_numinteriorring(geometry) RETURNS integer | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_numinteriorrings_polygon'; | |
| ALTER FUNCTION public.st_numinteriorring(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 693 (class 1255 OID 19049) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_numinteriorrings(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_numinteriorrings(geometry) RETURNS integer | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_numinteriorrings_polygon'; | |
| ALTER FUNCTION public.st_numinteriorrings(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 694 (class 1255 OID 19050) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_numpoints(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_numpoints(geometry) RETURNS integer | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_numpoints_linestring'; | |
| ALTER FUNCTION public.st_numpoints(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 695 (class 1255 OID 19051) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_orderingequals(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_orderingequals(geometry, geometry) RETURNS boolean | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT $1 ~= $2 AND _ST_OrderingEquals($1, $2) | |
| $_$; | |
| ALTER FUNCTION public.st_orderingequals(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 696 (class 1255 OID 19052) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_overlaps(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_overlaps(geometry, geometry) RETURNS boolean | |
| LANGUAGE sql IMMUTABLE | |
| AS $_$SELECT $1 && $2 AND _ST_Overlaps($1,$2)$_$; | |
| ALTER FUNCTION public.st_overlaps(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 697 (class 1255 OID 19053) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_perimeter(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_perimeter(geometry) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_perimeter2d_poly'; | |
| ALTER FUNCTION public.st_perimeter(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 698 (class 1255 OID 19054) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_perimeter2d(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_perimeter2d(geometry) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_perimeter2d_poly'; | |
| ALTER FUNCTION public.st_perimeter2d(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 699 (class 1255 OID 19055) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_perimeter3d(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_perimeter3d(geometry) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_perimeter_poly'; | |
| ALTER FUNCTION public.st_perimeter3d(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 700 (class 1255 OID 19056) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_point(double precision, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_point(double precision, double precision) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_makepoint'; | |
| ALTER FUNCTION public.st_point(double precision, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 701 (class 1255 OID 19057) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_point_inside_circle(geometry, double precision, double precision, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_point_inside_circle(geometry, double precision, double precision, double precision) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_inside_circle_point'; | |
| ALTER FUNCTION public.st_point_inside_circle(geometry, double precision, double precision, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 702 (class 1255 OID 19058) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_pointfromtext(text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_pointfromtext(text) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(ST_GeomFromText($1)) = 'POINT' | |
| THEN ST_GeomFromText($1) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.st_pointfromtext(text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 703 (class 1255 OID 19059) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_pointfromtext(text, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_pointfromtext(text, integer) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(ST_GeomFromText($1, $2)) = 'POINT' | |
| THEN ST_GeomFromText($1, $2) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.st_pointfromtext(text, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 706 (class 1255 OID 19061) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_pointfromwkb(bytea); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_pointfromwkb(bytea) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(ST_GeomFromWKB($1)) = 'POINT' | |
| THEN ST_GeomFromWKB($1) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.st_pointfromwkb(bytea) OWNER TO postgres; | |
| -- | |
| -- TOC entry 705 (class 1255 OID 19060) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_pointfromwkb(bytea, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_pointfromwkb(bytea, integer) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(ST_GeomFromWKB($1, $2)) = 'POINT' | |
| THEN ST_GeomFromWKB($1, $2) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.st_pointfromwkb(bytea, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 707 (class 1255 OID 19062) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_pointn(geometry, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_pointn(geometry, integer) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_pointn_linestring'; | |
| ALTER FUNCTION public.st_pointn(geometry, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 708 (class 1255 OID 19063) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_pointonsurface(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_pointonsurface(geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT COST 100 | |
| AS '$libdir/postgis-1.5', 'pointonsurface'; | |
| ALTER FUNCTION public.st_pointonsurface(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 709 (class 1255 OID 19064) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_polyfromtext(text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_polyfromtext(text) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(ST_GeomFromText($1)) = 'POLYGON' | |
| THEN ST_GeomFromText($1) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.st_polyfromtext(text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 710 (class 1255 OID 19065) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_polyfromtext(text, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_polyfromtext(text, integer) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(ST_GeomFromText($1, $2)) = 'POLYGON' | |
| THEN ST_GeomFromText($1, $2) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.st_polyfromtext(text, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 712 (class 1255 OID 19067) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_polyfromwkb(bytea); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_polyfromwkb(bytea) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(ST_GeomFromWKB($1)) = 'POLYGON' | |
| THEN ST_GeomFromWKB($1) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.st_polyfromwkb(bytea) OWNER TO postgres; | |
| -- | |
| -- TOC entry 711 (class 1255 OID 19066) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_polyfromwkb(bytea, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_polyfromwkb(bytea, integer) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(ST_GeomFromWKB($1, $2)) = 'POLYGON' | |
| THEN ST_GeomFromWKB($1, $2) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.st_polyfromwkb(bytea, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 713 (class 1255 OID 19068) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_polygon(geometry, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_polygon(geometry, integer) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT setSRID(makepolygon($1), $2) | |
| $_$; | |
| ALTER FUNCTION public.st_polygon(geometry, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 715 (class 1255 OID 19070) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_polygonfromtext(text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_polygonfromtext(text) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT ST_PolyFromText($1)$_$; | |
| ALTER FUNCTION public.st_polygonfromtext(text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 714 (class 1255 OID 19069) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_polygonfromtext(text, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_polygonfromtext(text, integer) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT PolyFromText($1, $2)$_$; | |
| ALTER FUNCTION public.st_polygonfromtext(text, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 717 (class 1255 OID 19072) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_polygonfromwkb(bytea); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_polygonfromwkb(bytea) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(GeomFromWKB($1)) = 'POLYGON' | |
| THEN GeomFromWKB($1) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.st_polygonfromwkb(bytea) OWNER TO postgres; | |
| -- | |
| -- TOC entry 716 (class 1255 OID 19071) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_polygonfromwkb(bytea, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_polygonfromwkb(bytea, integer) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$ | |
| SELECT CASE WHEN geometrytype(ST_GeomFromWKB($1,$2)) = 'POLYGON' | |
| THEN ST_GeomFromWKB($1, $2) | |
| ELSE NULL END | |
| $_$; | |
| ALTER FUNCTION public.st_polygonfromwkb(bytea, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 718 (class 1255 OID 19073) | |
| -- Dependencies: 6 1102 1104 | |
| -- Name: st_polygonize(geometry[]); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_polygonize(geometry[]) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT COST 100 | |
| AS '$libdir/postgis-1.5', 'polygonize_garray'; | |
| ALTER FUNCTION public.st_polygonize(geometry[]) OWNER TO postgres; | |
| -- | |
| -- TOC entry 719 (class 1255 OID 19074) | |
| -- Dependencies: 6 1104 1102 | |
| -- Name: st_polygonize_garray(geometry[]); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_polygonize_garray(geometry[]) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT COST 100 | |
| AS '$libdir/postgis-1.5', 'polygonize_garray'; | |
| ALTER FUNCTION public.st_polygonize_garray(geometry[]) OWNER TO postgres; | |
| -- | |
| -- TOC entry 720 (class 1255 OID 19075) | |
| -- Dependencies: 6 | |
| -- Name: st_postgis_gist_joinsel(internal, oid, internal, smallint); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_postgis_gist_joinsel(internal, oid, internal, smallint) RETURNS double precision | |
| LANGUAGE c | |
| AS '$libdir/postgis-1.5', 'LWGEOM_gist_joinsel'; | |
| ALTER FUNCTION public.st_postgis_gist_joinsel(internal, oid, internal, smallint) OWNER TO postgres; | |
| -- | |
| -- TOC entry 721 (class 1255 OID 19076) | |
| -- Dependencies: 6 | |
| -- Name: st_postgis_gist_sel(internal, oid, internal, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_postgis_gist_sel(internal, oid, internal, integer) RETURNS double precision | |
| LANGUAGE c | |
| AS '$libdir/postgis-1.5', 'LWGEOM_gist_sel'; | |
| ALTER FUNCTION public.st_postgis_gist_sel(internal, oid, internal, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 722 (class 1255 OID 19077) | |
| -- Dependencies: 1102 1102 6 | |
| -- Name: st_relate(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_relate(geometry, geometry) RETURNS text | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'relate_full'; | |
| ALTER FUNCTION public.st_relate(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 723 (class 1255 OID 19078) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: st_relate(geometry, geometry, text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_relate(geometry, geometry, text) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'relate_pattern'; | |
| ALTER FUNCTION public.st_relate(geometry, geometry, text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 724 (class 1255 OID 19079) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_removepoint(geometry, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_removepoint(geometry, integer) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_removepoint'; | |
| ALTER FUNCTION public.st_removepoint(geometry, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 725 (class 1255 OID 19080) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: st_reverse(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_reverse(geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_reverse'; | |
| ALTER FUNCTION public.st_reverse(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 726 (class 1255 OID 19081) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_rotate(geometry, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_rotate(geometry, double precision) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT rotateZ($1, $2)$_$; | |
| ALTER FUNCTION public.st_rotate(geometry, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 727 (class 1255 OID 19082) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_rotatex(geometry, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_rotatex(geometry, double precision) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT affine($1, 1, 0, 0, 0, cos($2), -sin($2), 0, sin($2), cos($2), 0, 0, 0)$_$; | |
| ALTER FUNCTION public.st_rotatex(geometry, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 728 (class 1255 OID 19083) | |
| -- Dependencies: 1102 1102 6 | |
| -- Name: st_rotatey(geometry, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_rotatey(geometry, double precision) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT affine($1, cos($2), 0, sin($2), 0, 1, 0, -sin($2), 0, cos($2), 0, 0, 0)$_$; | |
| ALTER FUNCTION public.st_rotatey(geometry, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 729 (class 1255 OID 19084) | |
| -- Dependencies: 1102 1102 6 | |
| -- Name: st_rotatez(geometry, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_rotatez(geometry, double precision) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT affine($1, cos($2), -sin($2), 0, sin($2), cos($2), 0, 0, 0, 1, 0, 0, 0)$_$; | |
| ALTER FUNCTION public.st_rotatez(geometry, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 731 (class 1255 OID 19086) | |
| -- Dependencies: 1102 1102 6 | |
| -- Name: st_scale(geometry, double precision, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_scale(geometry, double precision, double precision) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT scale($1, $2, $3, 1)$_$; | |
| ALTER FUNCTION public.st_scale(geometry, double precision, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 730 (class 1255 OID 19085) | |
| -- Dependencies: 1102 1102 6 | |
| -- Name: st_scale(geometry, double precision, double precision, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_scale(geometry, double precision, double precision, double precision) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT affine($1, $2, 0, 0, 0, $3, 0, 0, 0, $4, 0, 0, 0)$_$; | |
| ALTER FUNCTION public.st_scale(geometry, double precision, double precision, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 732 (class 1255 OID 19087) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: st_segmentize(geometry, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_segmentize(geometry, double precision) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_segmentize2d'; | |
| ALTER FUNCTION public.st_segmentize(geometry, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 733 (class 1255 OID 19088) | |
| -- Dependencies: 1096 1096 6 | |
| -- Name: st_setfactor(chip, real); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_setfactor(chip, real) RETURNS chip | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'CHIP_setFactor'; | |
| ALTER FUNCTION public.st_setfactor(chip, real) OWNER TO postgres; | |
| -- | |
| -- TOC entry 734 (class 1255 OID 19089) | |
| -- Dependencies: 6 1102 1102 1102 | |
| -- Name: st_setpoint(geometry, integer, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_setpoint(geometry, integer, geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_setpoint_linestring'; | |
| ALTER FUNCTION public.st_setpoint(geometry, integer, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 735 (class 1255 OID 19090) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: st_setsrid(geometry, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_setsrid(geometry, integer) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_setSRID'; | |
| ALTER FUNCTION public.st_setsrid(geometry, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 736 (class 1255 OID 19091) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: st_shift_longitude(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_shift_longitude(geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_longitude_shift'; | |
| ALTER FUNCTION public.st_shift_longitude(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 737 (class 1255 OID 19092) | |
| -- Dependencies: 1102 6 1102 1102 | |
| -- Name: st_shortestline(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_shortestline(geometry, geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_shortestline2d'; | |
| ALTER FUNCTION public.st_shortestline(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 738 (class 1255 OID 19093) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_simplify(geometry, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_simplify(geometry, double precision) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_simplify2d'; | |
| ALTER FUNCTION public.st_simplify(geometry, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 739 (class 1255 OID 19094) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: st_simplifypreservetopology(geometry, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_simplifypreservetopology(geometry, double precision) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT COST 100 | |
| AS '$libdir/postgis-1.5', 'topologypreservesimplify'; | |
| ALTER FUNCTION public.st_simplifypreservetopology(geometry, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 740 (class 1255 OID 19097) | |
| -- Dependencies: 1102 1102 6 | |
| -- Name: st_snaptogrid(geometry, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_snaptogrid(geometry, double precision) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT ST_SnapToGrid($1, 0, 0, $2, $2)$_$; | |
| ALTER FUNCTION public.st_snaptogrid(geometry, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 704 (class 1255 OID 19096) | |
| -- Dependencies: 1102 1102 6 | |
| -- Name: st_snaptogrid(geometry, double precision, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_snaptogrid(geometry, double precision, double precision) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT ST_SnapToGrid($1, 0, 0, $2, $3)$_$; | |
| ALTER FUNCTION public.st_snaptogrid(geometry, double precision, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 670 (class 1255 OID 19095) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: st_snaptogrid(geometry, double precision, double precision, double precision, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_snaptogrid(geometry, double precision, double precision, double precision, double precision) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_snaptogrid'; | |
| ALTER FUNCTION public.st_snaptogrid(geometry, double precision, double precision, double precision, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 741 (class 1255 OID 19098) | |
| -- Dependencies: 6 1102 1102 1102 | |
| -- Name: st_snaptogrid(geometry, geometry, double precision, double precision, double precision, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_snaptogrid(geometry, geometry, double precision, double precision, double precision, double precision) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_snaptogrid_pointoff'; | |
| ALTER FUNCTION public.st_snaptogrid(geometry, geometry, double precision, double precision, double precision, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 742 (class 1255 OID 19099) | |
| -- Dependencies: 6 1113 | |
| -- Name: st_spheroid_in(cstring); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_spheroid_in(cstring) RETURNS spheroid | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'ellipsoid_in'; | |
| ALTER FUNCTION public.st_spheroid_in(cstring) OWNER TO postgres; | |
| -- | |
| -- TOC entry 743 (class 1255 OID 19100) | |
| -- Dependencies: 1113 6 | |
| -- Name: st_spheroid_out(spheroid); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_spheroid_out(spheroid) RETURNS cstring | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'ellipsoid_out'; | |
| ALTER FUNCTION public.st_spheroid_out(spheroid) OWNER TO postgres; | |
| -- | |
| -- TOC entry 744 (class 1255 OID 19101) | |
| -- Dependencies: 1096 6 | |
| -- Name: st_srid(chip); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_srid(chip) RETURNS integer | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'CHIP_getSRID'; | |
| ALTER FUNCTION public.st_srid(chip) OWNER TO postgres; | |
| -- | |
| -- TOC entry 745 (class 1255 OID 19102) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_srid(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_srid(geometry) RETURNS integer | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_getSRID'; | |
| ALTER FUNCTION public.st_srid(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 746 (class 1255 OID 19103) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_startpoint(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_startpoint(geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_startpoint_linestring'; | |
| ALTER FUNCTION public.st_startpoint(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 747 (class 1255 OID 19104) | |
| -- Dependencies: 1102 6 | |
| -- Name: st_summary(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_summary(geometry) RETURNS text | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_summary'; | |
| ALTER FUNCTION public.st_summary(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 748 (class 1255 OID 19105) | |
| -- Dependencies: 1102 6 1102 1102 | |
| -- Name: st_symdifference(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_symdifference(geometry, geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'symdifference'; | |
| ALTER FUNCTION public.st_symdifference(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 749 (class 1255 OID 19106) | |
| -- Dependencies: 1102 6 1102 1102 | |
| -- Name: st_symmetricdifference(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_symmetricdifference(geometry, geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'symdifference'; | |
| ALTER FUNCTION public.st_symmetricdifference(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 750 (class 1255 OID 19107) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_text(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_text(geometry) RETURNS text | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_to_text'; | |
| ALTER FUNCTION public.st_text(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 751 (class 1255 OID 19108) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: st_touches(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_touches(geometry, geometry) RETURNS boolean | |
| LANGUAGE sql IMMUTABLE | |
| AS $_$SELECT $1 && $2 AND _ST_Touches($1,$2)$_$; | |
| ALTER FUNCTION public.st_touches(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 752 (class 1255 OID 19109) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: st_transform(geometry, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_transform(geometry, integer) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'transform'; | |
| ALTER FUNCTION public.st_transform(geometry, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 754 (class 1255 OID 19111) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: st_translate(geometry, double precision, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_translate(geometry, double precision, double precision) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT translate($1, $2, $3, 0)$_$; | |
| ALTER FUNCTION public.st_translate(geometry, double precision, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 753 (class 1255 OID 19110) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: st_translate(geometry, double precision, double precision, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_translate(geometry, double precision, double precision, double precision) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT affine($1, 1, 0, 0, 0, 1, 0, 0, 0, 1, $2, $3, $4)$_$; | |
| ALTER FUNCTION public.st_translate(geometry, double precision, double precision, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 755 (class 1255 OID 19112) | |
| -- Dependencies: 1102 1102 6 | |
| -- Name: st_transscale(geometry, double precision, double precision, double precision, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_transscale(geometry, double precision, double precision, double precision, double precision) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT affine($1, $4, 0, 0, 0, $5, 0, | |
| 0, 0, 1, $2 * $4, $3 * $5, 0)$_$; | |
| ALTER FUNCTION public.st_transscale(geometry, double precision, double precision, double precision, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 757 (class 1255 OID 19114) | |
| -- Dependencies: 6 1104 1102 | |
| -- Name: st_union(geometry[]); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_union(geometry[]) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'pgis_union_geometry_array'; | |
| ALTER FUNCTION public.st_union(geometry[]) OWNER TO postgres; | |
| -- | |
| -- TOC entry 756 (class 1255 OID 19113) | |
| -- Dependencies: 1102 6 1102 1102 | |
| -- Name: st_union(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_union(geometry, geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'geomunion'; | |
| ALTER FUNCTION public.st_union(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 758 (class 1255 OID 19115) | |
| -- Dependencies: 6 1104 1102 | |
| -- Name: st_unite_garray(geometry[]); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_unite_garray(geometry[]) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'pgis_union_geometry_array'; | |
| ALTER FUNCTION public.st_unite_garray(geometry[]) OWNER TO postgres; | |
| -- | |
| -- TOC entry 759 (class 1255 OID 19116) | |
| -- Dependencies: 1096 6 | |
| -- Name: st_width(chip); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_width(chip) RETURNS integer | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'CHIP_getWidth'; | |
| ALTER FUNCTION public.st_width(chip) OWNER TO postgres; | |
| -- | |
| -- TOC entry 760 (class 1255 OID 19117) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: st_within(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_within(geometry, geometry) RETURNS boolean | |
| LANGUAGE sql IMMUTABLE | |
| AS $_$SELECT $1 && $2 AND _ST_Within($1,$2)$_$; | |
| ALTER FUNCTION public.st_within(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 761 (class 1255 OID 19118) | |
| -- Dependencies: 1102 6 | |
| -- Name: st_wkbtosql(bytea); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_wkbtosql(bytea) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_from_WKB'; | |
| ALTER FUNCTION public.st_wkbtosql(bytea) OWNER TO postgres; | |
| -- | |
| -- TOC entry 762 (class 1255 OID 19119) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_wkttosql(text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_wkttosql(text) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_from_text'; | |
| ALTER FUNCTION public.st_wkttosql(text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 763 (class 1255 OID 19120) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_x(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_x(geometry) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_x_point'; | |
| ALTER FUNCTION public.st_x(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 764 (class 1255 OID 19121) | |
| -- Dependencies: 6 1090 | |
| -- Name: st_xmax(box3d); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_xmax(box3d) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'BOX3D_xmax'; | |
| ALTER FUNCTION public.st_xmax(box3d) OWNER TO postgres; | |
| -- | |
| -- TOC entry 765 (class 1255 OID 19122) | |
| -- Dependencies: 1090 6 | |
| -- Name: st_xmin(box3d); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_xmin(box3d) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'BOX3D_xmin'; | |
| ALTER FUNCTION public.st_xmin(box3d) OWNER TO postgres; | |
| -- | |
| -- TOC entry 766 (class 1255 OID 19123) | |
| -- Dependencies: 1102 6 | |
| -- Name: st_y(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_y(geometry) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_y_point'; | |
| ALTER FUNCTION public.st_y(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 767 (class 1255 OID 19124) | |
| -- Dependencies: 1090 6 | |
| -- Name: st_ymax(box3d); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_ymax(box3d) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'BOX3D_ymax'; | |
| ALTER FUNCTION public.st_ymax(box3d) OWNER TO postgres; | |
| -- | |
| -- TOC entry 768 (class 1255 OID 19125) | |
| -- Dependencies: 6 1090 | |
| -- Name: st_ymin(box3d); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_ymin(box3d) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'BOX3D_ymin'; | |
| ALTER FUNCTION public.st_ymin(box3d) OWNER TO postgres; | |
| -- | |
| -- TOC entry 769 (class 1255 OID 19126) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_z(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_z(geometry) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_z_point'; | |
| ALTER FUNCTION public.st_z(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 770 (class 1255 OID 19127) | |
| -- Dependencies: 6 1090 | |
| -- Name: st_zmax(box3d); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_zmax(box3d) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'BOX3D_zmax'; | |
| ALTER FUNCTION public.st_zmax(box3d) OWNER TO postgres; | |
| -- | |
| -- TOC entry 771 (class 1255 OID 19128) | |
| -- Dependencies: 6 1102 | |
| -- Name: st_zmflag(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_zmflag(geometry) RETURNS smallint | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_zmflag'; | |
| ALTER FUNCTION public.st_zmflag(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 772 (class 1255 OID 19129) | |
| -- Dependencies: 6 1090 | |
| -- Name: st_zmin(box3d); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION st_zmin(box3d) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'BOX3D_zmin'; | |
| ALTER FUNCTION public.st_zmin(box3d) OWNER TO postgres; | |
| -- | |
| -- TOC entry 773 (class 1255 OID 19130) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: startpoint(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION startpoint(geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_startpoint_linestring'; | |
| ALTER FUNCTION public.startpoint(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 774 (class 1255 OID 19131) | |
| -- Dependencies: 1102 6 | |
| -- Name: summary(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION summary(geometry) RETURNS text | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_summary'; | |
| ALTER FUNCTION public.summary(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 775 (class 1255 OID 19132) | |
| -- Dependencies: 1102 6 1102 1102 | |
| -- Name: symdifference(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION symdifference(geometry, geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'symdifference'; | |
| ALTER FUNCTION public.symdifference(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 776 (class 1255 OID 19133) | |
| -- Dependencies: 1102 6 1102 1102 | |
| -- Name: symmetricdifference(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION symmetricdifference(geometry, geometry) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'symdifference'; | |
| ALTER FUNCTION public.symmetricdifference(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 777 (class 1255 OID 19134) | |
| -- Dependencies: 6 1102 | |
| -- Name: text(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION text(geometry) RETURNS text | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_to_text'; | |
| ALTER FUNCTION public.text(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 778 (class 1255 OID 19135) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: touches(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION touches(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'touches'; | |
| ALTER FUNCTION public.touches(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 779 (class 1255 OID 19136) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: transform(geometry, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION transform(geometry, integer) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'transform'; | |
| ALTER FUNCTION public.transform(geometry, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 781 (class 1255 OID 19138) | |
| -- Dependencies: 6 1102 1102 | |
| -- Name: translate(geometry, double precision, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION translate(geometry, double precision, double precision) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT translate($1, $2, $3, 0)$_$; | |
| ALTER FUNCTION public.translate(geometry, double precision, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 780 (class 1255 OID 19137) | |
| -- Dependencies: 1102 1102 6 | |
| -- Name: translate(geometry, double precision, double precision, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION translate(geometry, double precision, double precision, double precision) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT affine($1, 1, 0, 0, 0, 1, 0, 0, 0, 1, $2, $3, $4)$_$; | |
| ALTER FUNCTION public.translate(geometry, double precision, double precision, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 782 (class 1255 OID 19139) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: transscale(geometry, double precision, double precision, double precision, double precision); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION transscale(geometry, double precision, double precision, double precision, double precision) RETURNS geometry | |
| LANGUAGE sql IMMUTABLE STRICT | |
| AS $_$SELECT affine($1, $4, 0, 0, 0, $5, 0, | |
| 0, 0, 1, $2 * $4, $3 * $5, 0)$_$; | |
| ALTER FUNCTION public.transscale(geometry, double precision, double precision, double precision, double precision) OWNER TO postgres; | |
| -- | |
| -- TOC entry 783 (class 1255 OID 19140) | |
| -- Dependencies: 1102 6 1104 | |
| -- Name: unite_garray(geometry[]); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION unite_garray(geometry[]) RETURNS geometry | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'pgis_union_geometry_array'; | |
| ALTER FUNCTION public.unite_garray(geometry[]) OWNER TO postgres; | |
| -- | |
| -- TOC entry 784 (class 1255 OID 19141) | |
| -- Dependencies: 1167 6 | |
| -- Name: unlockrows(text); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION unlockrows(text) RETURNS integer | |
| LANGUAGE plpgsql STRICT | |
| AS $_$ | |
| DECLARE | |
| ret int; | |
| BEGIN | |
| IF NOT LongTransactionsEnabled() THEN | |
| RAISE EXCEPTION 'Long transaction support disabled, use EnableLongTransaction() to enable.'; | |
| END IF; | |
| EXECUTE 'DELETE FROM authorization_table where authid = ' || | |
| quote_literal($1); | |
| GET DIAGNOSTICS ret = ROW_COUNT; | |
| RETURN ret; | |
| END; | |
| $_$; | |
| ALTER FUNCTION public.unlockrows(text) OWNER TO postgres; | |
| -- | |
| -- TOC entry 787 (class 1255 OID 19144) | |
| -- Dependencies: 1167 6 | |
| -- Name: updategeometrysrid(character varying, character varying, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION updategeometrysrid(character varying, character varying, integer) RETURNS text | |
| LANGUAGE plpgsql STRICT | |
| AS $_$ | |
| DECLARE | |
| ret text; | |
| BEGIN | |
| SELECT UpdateGeometrySRID('','',$1,$2,$3) into ret; | |
| RETURN ret; | |
| END; | |
| $_$; | |
| ALTER FUNCTION public.updategeometrysrid(character varying, character varying, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 786 (class 1255 OID 19143) | |
| -- Dependencies: 6 1167 | |
| -- Name: updategeometrysrid(character varying, character varying, character varying, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION updategeometrysrid(character varying, character varying, character varying, integer) RETURNS text | |
| LANGUAGE plpgsql STRICT | |
| AS $_$ | |
| DECLARE | |
| ret text; | |
| BEGIN | |
| SELECT UpdateGeometrySRID('',$1,$2,$3,$4) into ret; | |
| RETURN ret; | |
| END; | |
| $_$; | |
| ALTER FUNCTION public.updategeometrysrid(character varying, character varying, character varying, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 785 (class 1255 OID 19142) | |
| -- Dependencies: 1167 6 | |
| -- Name: updategeometrysrid(character varying, character varying, character varying, character varying, integer); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION updategeometrysrid(character varying, character varying, character varying, character varying, integer) RETURNS text | |
| LANGUAGE plpgsql STRICT | |
| AS $_$ | |
| DECLARE | |
| catalog_name alias for $1; | |
| schema_name alias for $2; | |
| table_name alias for $3; | |
| column_name alias for $4; | |
| new_srid alias for $5; | |
| myrec RECORD; | |
| okay boolean; | |
| cname varchar; | |
| real_schema name; | |
| BEGIN | |
| -- Find, check or fix schema_name | |
| IF ( schema_name != '' ) THEN | |
| okay = 'f'; | |
| FOR myrec IN SELECT nspname FROM pg_namespace WHERE text(nspname) = schema_name LOOP | |
| okay := 't'; | |
| END LOOP; | |
| IF ( okay <> 't' ) THEN | |
| RAISE EXCEPTION 'Invalid schema name'; | |
| ELSE | |
| real_schema = schema_name; | |
| END IF; | |
| ELSE | |
| SELECT INTO real_schema current_schema()::text; | |
| END IF; | |
| -- Find out if the column is in the geometry_columns table | |
| okay = 'f'; | |
| FOR myrec IN SELECT * from geometry_columns where f_table_schema = text(real_schema) and f_table_name = table_name and f_geometry_column = column_name LOOP | |
| okay := 't'; | |
| END LOOP; | |
| IF (okay <> 't') THEN | |
| RAISE EXCEPTION 'column not found in geometry_columns table'; | |
| RETURN 'f'; | |
| END IF; | |
| -- Update ref from geometry_columns table | |
| EXECUTE 'UPDATE geometry_columns SET SRID = ' || new_srid::text || | |
| ' where f_table_schema = ' || | |
| quote_literal(real_schema) || ' and f_table_name = ' || | |
| quote_literal(table_name) || ' and f_geometry_column = ' || | |
| quote_literal(column_name); | |
| -- Make up constraint name | |
| cname = 'enforce_srid_' || column_name; | |
| -- Drop enforce_srid constraint | |
| EXECUTE 'ALTER TABLE ' || quote_ident(real_schema) || | |
| '.' || quote_ident(table_name) || | |
| ' DROP constraint ' || quote_ident(cname); | |
| -- Update geometries SRID | |
| EXECUTE 'UPDATE ' || quote_ident(real_schema) || | |
| '.' || quote_ident(table_name) || | |
| ' SET ' || quote_ident(column_name) || | |
| ' = setSRID(' || quote_ident(column_name) || | |
| ', ' || new_srid::text || ')'; | |
| -- Reset enforce_srid constraint | |
| EXECUTE 'ALTER TABLE ' || quote_ident(real_schema) || | |
| '.' || quote_ident(table_name) || | |
| ' ADD constraint ' || quote_ident(cname) || | |
| ' CHECK (srid(' || quote_ident(column_name) || | |
| ') = ' || new_srid::text || ')'; | |
| RETURN real_schema || '.' || table_name || '.' || column_name ||' SRID changed to ' || new_srid::text; | |
| END; | |
| $_$; | |
| ALTER FUNCTION public.updategeometrysrid(character varying, character varying, character varying, character varying, integer) OWNER TO postgres; | |
| -- | |
| -- TOC entry 788 (class 1255 OID 19145) | |
| -- Dependencies: 1096 6 | |
| -- Name: width(chip); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION width(chip) RETURNS integer | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'CHIP_getWidth'; | |
| ALTER FUNCTION public.width(chip) OWNER TO postgres; | |
| -- | |
| -- TOC entry 789 (class 1255 OID 19146) | |
| -- Dependencies: 1102 6 1102 | |
| -- Name: within(geometry, geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION within(geometry, geometry) RETURNS boolean | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'within'; | |
| ALTER FUNCTION public.within(geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 790 (class 1255 OID 19147) | |
| -- Dependencies: 1102 6 | |
| -- Name: x(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION x(geometry) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_x_point'; | |
| ALTER FUNCTION public.x(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 791 (class 1255 OID 19148) | |
| -- Dependencies: 6 1090 | |
| -- Name: xmax(box3d); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION xmax(box3d) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'BOX3D_xmax'; | |
| ALTER FUNCTION public.xmax(box3d) OWNER TO postgres; | |
| -- | |
| -- TOC entry 792 (class 1255 OID 19149) | |
| -- Dependencies: 1090 6 | |
| -- Name: xmin(box3d); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION xmin(box3d) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'BOX3D_xmin'; | |
| ALTER FUNCTION public.xmin(box3d) OWNER TO postgres; | |
| -- | |
| -- TOC entry 793 (class 1255 OID 19150) | |
| -- Dependencies: 1102 6 | |
| -- Name: y(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION y(geometry) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_y_point'; | |
| ALTER FUNCTION public.y(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 794 (class 1255 OID 19151) | |
| -- Dependencies: 6 1090 | |
| -- Name: ymax(box3d); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION ymax(box3d) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'BOX3D_ymax'; | |
| ALTER FUNCTION public.ymax(box3d) OWNER TO postgres; | |
| -- | |
| -- TOC entry 795 (class 1255 OID 19152) | |
| -- Dependencies: 1090 6 | |
| -- Name: ymin(box3d); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION ymin(box3d) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'BOX3D_ymin'; | |
| ALTER FUNCTION public.ymin(box3d) OWNER TO postgres; | |
| -- | |
| -- TOC entry 796 (class 1255 OID 19153) | |
| -- Dependencies: 1102 6 | |
| -- Name: z(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION z(geometry) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_z_point'; | |
| ALTER FUNCTION public.z(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 797 (class 1255 OID 19154) | |
| -- Dependencies: 1090 6 | |
| -- Name: zmax(box3d); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION zmax(box3d) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'BOX3D_zmax'; | |
| ALTER FUNCTION public.zmax(box3d) OWNER TO postgres; | |
| -- | |
| -- TOC entry 798 (class 1255 OID 19155) | |
| -- Dependencies: 1102 6 | |
| -- Name: zmflag(geometry); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION zmflag(geometry) RETURNS smallint | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'LWGEOM_zmflag'; | |
| ALTER FUNCTION public.zmflag(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 799 (class 1255 OID 19156) | |
| -- Dependencies: 1090 6 | |
| -- Name: zmin(box3d); Type: FUNCTION; Schema: public; Owner: postgres | |
| -- | |
| CREATE FUNCTION zmin(box3d) RETURNS double precision | |
| LANGUAGE c IMMUTABLE STRICT | |
| AS '$libdir/postgis-1.5', 'BOX3D_zmin'; | |
| ALTER FUNCTION public.zmin(box3d) OWNER TO postgres; | |
| -- | |
| -- TOC entry 1172 (class 1255 OID 19157) | |
| -- Dependencies: 1104 1102 330 329 6 | |
| -- Name: accum(geometry); Type: AGGREGATE; Schema: public; Owner: postgres | |
| -- | |
| CREATE AGGREGATE accum(geometry) ( | |
| SFUNC = pgis_geometry_accum_transfn, | |
| STYPE = pgis_abs, | |
| FINALFUNC = pgis_geometry_accum_finalfn | |
| ); | |
| ALTER AGGREGATE public.accum(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 1173 (class 1255 OID 19158) | |
| -- Dependencies: 331 6 1102 1102 330 | |
| -- Name: collect(geometry); Type: AGGREGATE; Schema: public; Owner: postgres | |
| -- | |
| CREATE AGGREGATE collect(geometry) ( | |
| SFUNC = pgis_geometry_accum_transfn, | |
| STYPE = pgis_abs, | |
| FINALFUNC = pgis_geometry_collect_finalfn | |
| ); | |
| ALTER AGGREGATE public.collect(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 1174 (class 1255 OID 19159) | |
| -- Dependencies: 6 1102 500 1093 | |
| -- Name: extent(geometry); Type: AGGREGATE; Schema: public; Owner: postgres | |
| -- | |
| CREATE AGGREGATE extent(geometry) ( | |
| SFUNC = public.st_combine_bbox, | |
| STYPE = box3d_extent | |
| ); | |
| ALTER AGGREGATE public.extent(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 1175 (class 1255 OID 19160) | |
| -- Dependencies: 124 1102 1090 6 | |
| -- Name: extent3d(geometry); Type: AGGREGATE; Schema: public; Owner: postgres | |
| -- | |
| CREATE AGGREGATE extent3d(geometry) ( | |
| SFUNC = public.combine_bbox, | |
| STYPE = box3d | |
| ); | |
| ALTER AGGREGATE public.extent3d(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 1176 (class 1255 OID 19161) | |
| -- Dependencies: 1102 1102 330 6 332 | |
| -- Name: makeline(geometry); Type: AGGREGATE; Schema: public; Owner: postgres | |
| -- | |
| CREATE AGGREGATE makeline(geometry) ( | |
| SFUNC = pgis_geometry_accum_transfn, | |
| STYPE = pgis_abs, | |
| FINALFUNC = pgis_geometry_makeline_finalfn | |
| ); | |
| ALTER AGGREGATE public.makeline(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 1177 (class 1255 OID 19162) | |
| -- Dependencies: 1102 496 1102 6 | |
| -- Name: memcollect(geometry); Type: AGGREGATE; Schema: public; Owner: postgres | |
| -- | |
| CREATE AGGREGATE memcollect(geometry) ( | |
| SFUNC = public.st_collect, | |
| STYPE = geometry | |
| ); | |
| ALTER AGGREGATE public.memcollect(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 1178 (class 1255 OID 19163) | |
| -- Dependencies: 231 1102 1102 6 | |
| -- Name: memgeomunion(geometry); Type: AGGREGATE; Schema: public; Owner: postgres | |
| -- | |
| CREATE AGGREGATE memgeomunion(geometry) ( | |
| SFUNC = geomunion, | |
| STYPE = geometry | |
| ); | |
| ALTER AGGREGATE public.memgeomunion(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 1179 (class 1255 OID 19164) | |
| -- Dependencies: 6 333 330 1102 1102 | |
| -- Name: polygonize(geometry); Type: AGGREGATE; Schema: public; Owner: postgres | |
| -- | |
| CREATE AGGREGATE polygonize(geometry) ( | |
| SFUNC = pgis_geometry_accum_transfn, | |
| STYPE = pgis_abs, | |
| FINALFUNC = pgis_geometry_polygonize_finalfn | |
| ); | |
| ALTER AGGREGATE public.polygonize(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 1180 (class 1255 OID 19165) | |
| -- Dependencies: 329 330 1102 1104 6 | |
| -- Name: st_accum(geometry); Type: AGGREGATE; Schema: public; Owner: postgres | |
| -- | |
| CREATE AGGREGATE st_accum(geometry) ( | |
| SFUNC = pgis_geometry_accum_transfn, | |
| STYPE = pgis_abs, | |
| FINALFUNC = pgis_geometry_accum_finalfn | |
| ); | |
| ALTER AGGREGATE public.st_accum(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 1181 (class 1255 OID 19166) | |
| -- Dependencies: 331 330 1102 1102 6 | |
| -- Name: st_collect(geometry); Type: AGGREGATE; Schema: public; Owner: postgres | |
| -- | |
| CREATE AGGREGATE st_collect(geometry) ( | |
| SFUNC = pgis_geometry_accum_transfn, | |
| STYPE = pgis_abs, | |
| FINALFUNC = pgis_geometry_collect_finalfn | |
| ); | |
| ALTER AGGREGATE public.st_collect(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 1182 (class 1255 OID 19167) | |
| -- Dependencies: 500 1102 1093 6 | |
| -- Name: st_extent(geometry); Type: AGGREGATE; Schema: public; Owner: postgres | |
| -- | |
| CREATE AGGREGATE st_extent(geometry) ( | |
| SFUNC = public.st_combine_bbox, | |
| STYPE = box3d_extent | |
| ); | |
| ALTER AGGREGATE public.st_extent(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 1168 (class 1255 OID 19168) | |
| -- Dependencies: 501 1102 1090 6 | |
| -- Name: st_extent3d(geometry); Type: AGGREGATE; Schema: public; Owner: postgres | |
| -- | |
| CREATE AGGREGATE st_extent3d(geometry) ( | |
| SFUNC = public.st_combine_bbox, | |
| STYPE = box3d | |
| ); | |
| ALTER AGGREGATE public.st_extent3d(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 1169 (class 1255 OID 19169) | |
| -- Dependencies: 1102 6 330 332 1102 | |
| -- Name: st_makeline(geometry); Type: AGGREGATE; Schema: public; Owner: postgres | |
| -- | |
| CREATE AGGREGATE st_makeline(geometry) ( | |
| SFUNC = pgis_geometry_accum_transfn, | |
| STYPE = pgis_abs, | |
| FINALFUNC = pgis_geometry_makeline_finalfn | |
| ); | |
| ALTER AGGREGATE public.st_makeline(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 1170 (class 1255 OID 19170) | |
| -- Dependencies: 6 496 1102 1102 | |
| -- Name: st_memcollect(geometry); Type: AGGREGATE; Schema: public; Owner: postgres | |
| -- | |
| CREATE AGGREGATE st_memcollect(geometry) ( | |
| SFUNC = public.st_collect, | |
| STYPE = geometry | |
| ); | |
| ALTER AGGREGATE public.st_memcollect(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 1171 (class 1255 OID 19171) | |
| -- Dependencies: 756 1102 6 1102 | |
| -- Name: st_memunion(geometry); Type: AGGREGATE; Schema: public; Owner: postgres | |
| -- | |
| CREATE AGGREGATE st_memunion(geometry) ( | |
| SFUNC = public.st_union, | |
| STYPE = geometry | |
| ); | |
| ALTER AGGREGATE public.st_memunion(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 1183 (class 1255 OID 19172) | |
| -- Dependencies: 6 1102 330 1102 333 | |
| -- Name: st_polygonize(geometry); Type: AGGREGATE; Schema: public; Owner: postgres | |
| -- | |
| CREATE AGGREGATE st_polygonize(geometry) ( | |
| SFUNC = pgis_geometry_accum_transfn, | |
| STYPE = pgis_abs, | |
| FINALFUNC = pgis_geometry_polygonize_finalfn | |
| ); | |
| ALTER AGGREGATE public.st_polygonize(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 1184 (class 1255 OID 19173) | |
| -- Dependencies: 6 330 334 1102 1102 | |
| -- Name: st_union(geometry); Type: AGGREGATE; Schema: public; Owner: postgres | |
| -- | |
| CREATE AGGREGATE st_union(geometry) ( | |
| SFUNC = pgis_geometry_accum_transfn, | |
| STYPE = pgis_abs, | |
| FINALFUNC = pgis_geometry_union_finalfn | |
| ); | |
| ALTER AGGREGATE public.st_union(geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 1890 (class 2617 OID 19174) | |
| -- Dependencies: 208 207 6 1102 1102 215 | |
| -- Name: &&; Type: OPERATOR; Schema: public; Owner: postgres | |
| -- | |
| CREATE OPERATOR && ( | |
| PROCEDURE = geometry_overlap, | |
| LEFTARG = geometry, | |
| RIGHTARG = geometry, | |
| COMMUTATOR = &&, | |
| RESTRICT = geometry_gist_sel, | |
| JOIN = geometry_gist_joinsel | |
| ); | |
| ALTER OPERATOR public.&& (geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 1891 (class 2617 OID 19175) | |
| -- Dependencies: 180 185 1099 1099 6 176 | |
| -- Name: &&; Type: OPERATOR; Schema: public; Owner: postgres | |
| -- | |
| CREATE OPERATOR && ( | |
| PROCEDURE = geography_overlaps, | |
| LEFTARG = geography, | |
| RIGHTARG = geography, | |
| COMMUTATOR = &&, | |
| RESTRICT = geography_gist_selectivity, | |
| JOIN = geography_gist_join_selectivity | |
| ); | |
| ALTER OPERATOR public.&& (geography, geography) OWNER TO postgres; | |
| -- | |
| -- TOC entry 1892 (class 2617 OID 19177) | |
| -- Dependencies: 216 6 1102 1102 | |
| -- Name: &<; Type: OPERATOR; Schema: public; Owner: postgres | |
| -- | |
| CREATE OPERATOR &< ( | |
| PROCEDURE = geometry_overleft, | |
| LEFTARG = geometry, | |
| RIGHTARG = geometry, | |
| COMMUTATOR = &>, | |
| RESTRICT = positionsel, | |
| JOIN = positionjoinsel | |
| ); | |
| ALTER OPERATOR public.&< (geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 1893 (class 2617 OID 19179) | |
| -- Dependencies: 1102 214 1102 6 | |
| -- Name: &<|; Type: OPERATOR; Schema: public; Owner: postgres | |
| -- | |
| CREATE OPERATOR &<| ( | |
| PROCEDURE = geometry_overbelow, | |
| LEFTARG = geometry, | |
| RIGHTARG = geometry, | |
| COMMUTATOR = |&>, | |
| RESTRICT = positionsel, | |
| JOIN = positionjoinsel | |
| ); | |
| ALTER OPERATOR public.&<| (geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 1894 (class 2617 OID 19176) | |
| -- Dependencies: 1102 1102 217 6 | |
| -- Name: &>; Type: OPERATOR; Schema: public; Owner: postgres | |
| -- | |
| CREATE OPERATOR &> ( | |
| PROCEDURE = geometry_overright, | |
| LEFTARG = geometry, | |
| RIGHTARG = geometry, | |
| COMMUTATOR = &<, | |
| RESTRICT = positionsel, | |
| JOIN = positionjoinsel | |
| ); | |
| ALTER OPERATOR public.&> (geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 1895 (class 2617 OID 19182) | |
| -- Dependencies: 6 1102 212 1102 | |
| -- Name: <; Type: OPERATOR; Schema: public; Owner: postgres | |
| -- | |
| CREATE OPERATOR < ( | |
| PROCEDURE = geometry_lt, | |
| LEFTARG = geometry, | |
| RIGHTARG = geometry, | |
| COMMUTATOR = >, | |
| NEGATOR = >=, | |
| RESTRICT = contsel, | |
| JOIN = contjoinsel | |
| ); | |
| ALTER OPERATOR public.< (geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 1898 (class 2617 OID 19185) | |
| -- Dependencies: 184 1099 6 1099 | |
| -- Name: <; Type: OPERATOR; Schema: public; Owner: postgres | |
| -- | |
| CREATE OPERATOR < ( | |
| PROCEDURE = geography_lt, | |
| LEFTARG = geography, | |
| RIGHTARG = geography, | |
| COMMUTATOR = >, | |
| NEGATOR = >=, | |
| RESTRICT = contsel, | |
| JOIN = contjoinsel | |
| ); | |
| ALTER OPERATOR public.< (geography, geography) OWNER TO postgres; | |
| -- | |
| -- TOC entry 1899 (class 2617 OID 19187) | |
| -- Dependencies: 1102 6 211 1102 | |
| -- Name: <<; Type: OPERATOR; Schema: public; Owner: postgres | |
| -- | |
| CREATE OPERATOR << ( | |
| PROCEDURE = geometry_left, | |
| LEFTARG = geometry, | |
| RIGHTARG = geometry, | |
| COMMUTATOR = >>, | |
| RESTRICT = positionsel, | |
| JOIN = positionjoinsel | |
| ); | |
| ALTER OPERATOR public.<< (geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 1900 (class 2617 OID 19189) | |
| -- Dependencies: 201 1102 6 1102 | |
| -- Name: <<|; Type: OPERATOR; Schema: public; Owner: postgres | |
| -- | |
| CREATE OPERATOR <<| ( | |
| PROCEDURE = geometry_below, | |
| LEFTARG = geometry, | |
| RIGHTARG = geometry, | |
| COMMUTATOR = |>>, | |
| RESTRICT = positionsel, | |
| JOIN = positionjoinsel | |
| ); | |
| ALTER OPERATOR public.<<| (geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 1901 (class 2617 OID 19190) | |
| -- Dependencies: 1102 210 6 1102 | |
| -- Name: <=; Type: OPERATOR; Schema: public; Owner: postgres | |
| -- | |
| CREATE OPERATOR <= ( | |
| PROCEDURE = geometry_le, | |
| LEFTARG = geometry, | |
| RIGHTARG = geometry, | |
| COMMUTATOR = >=, | |
| NEGATOR = >, | |
| RESTRICT = contsel, | |
| JOIN = contjoinsel | |
| ); | |
| ALTER OPERATOR public.<= (geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 1902 (class 2617 OID 19191) | |
| -- Dependencies: 1099 6 183 1099 | |
| -- Name: <=; Type: OPERATOR; Schema: public; Owner: postgres | |
| -- | |
| CREATE OPERATOR <= ( | |
| PROCEDURE = geography_le, | |
| LEFTARG = geography, | |
| RIGHTARG = geography, | |
| COMMUTATOR = >=, | |
| NEGATOR = >, | |
| RESTRICT = contsel, | |
| JOIN = contjoinsel | |
| ); | |
| ALTER OPERATOR public.<= (geography, geography) OWNER TO postgres; | |
| -- | |
| -- TOC entry 1903 (class 2617 OID 19192) | |
| -- Dependencies: 205 1102 6 1102 | |
| -- Name: =; Type: OPERATOR; Schema: public; Owner: postgres | |
| -- | |
| CREATE OPERATOR = ( | |
| PROCEDURE = geometry_eq, | |
| LEFTARG = geometry, | |
| RIGHTARG = geometry, | |
| COMMUTATOR = =, | |
| RESTRICT = contsel, | |
| JOIN = contjoinsel | |
| ); | |
| ALTER OPERATOR public.= (geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 1904 (class 2617 OID 19193) | |
| -- Dependencies: 1099 6 171 1099 | |
| -- Name: =; Type: OPERATOR; Schema: public; Owner: postgres | |
| -- | |
| CREATE OPERATOR = ( | |
| PROCEDURE = geography_eq, | |
| LEFTARG = geography, | |
| RIGHTARG = geography, | |
| COMMUTATOR = =, | |
| RESTRICT = contsel, | |
| JOIN = contjoinsel | |
| ); | |
| ALTER OPERATOR public.= (geography, geography) OWNER TO postgres; | |
| -- | |
| -- TOC entry 1896 (class 2617 OID 19180) | |
| -- Dependencies: 1102 6 1102 209 | |
| -- Name: >; Type: OPERATOR; Schema: public; Owner: postgres | |
| -- | |
| CREATE OPERATOR > ( | |
| PROCEDURE = geometry_gt, | |
| LEFTARG = geometry, | |
| RIGHTARG = geometry, | |
| COMMUTATOR = <, | |
| NEGATOR = <=, | |
| RESTRICT = contsel, | |
| JOIN = contjoinsel | |
| ); | |
| ALTER OPERATOR public.> (geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 1905 (class 2617 OID 19183) | |
| -- Dependencies: 1099 6 182 1099 | |
| -- Name: >; Type: OPERATOR; Schema: public; Owner: postgres | |
| -- | |
| CREATE OPERATOR > ( | |
| PROCEDURE = geography_gt, | |
| LEFTARG = geography, | |
| RIGHTARG = geography, | |
| COMMUTATOR = <, | |
| NEGATOR = <=, | |
| RESTRICT = contsel, | |
| JOIN = contjoinsel | |
| ); | |
| ALTER OPERATOR public.> (geography, geography) OWNER TO postgres; | |
| -- | |
| -- TOC entry 1906 (class 2617 OID 19181) | |
| -- Dependencies: 1102 1102 6 206 | |
| -- Name: >=; Type: OPERATOR; Schema: public; Owner: postgres | |
| -- | |
| CREATE OPERATOR >= ( | |
| PROCEDURE = geometry_ge, | |
| LEFTARG = geometry, | |
| RIGHTARG = geometry, | |
| COMMUTATOR = <=, | |
| NEGATOR = <, | |
| RESTRICT = contsel, | |
| JOIN = contjoinsel | |
| ); | |
| ALTER OPERATOR public.>= (geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 1907 (class 2617 OID 19184) | |
| -- Dependencies: 1099 172 1099 6 | |
| -- Name: >=; Type: OPERATOR; Schema: public; Owner: postgres | |
| -- | |
| CREATE OPERATOR >= ( | |
| PROCEDURE = geography_ge, | |
| LEFTARG = geography, | |
| RIGHTARG = geography, | |
| COMMUTATOR = <=, | |
| NEGATOR = <, | |
| RESTRICT = contsel, | |
| JOIN = contjoinsel | |
| ); | |
| ALTER OPERATOR public.>= (geography, geography) OWNER TO postgres; | |
| -- | |
| -- TOC entry 1908 (class 2617 OID 19186) | |
| -- Dependencies: 6 218 1102 1102 | |
| -- Name: >>; Type: OPERATOR; Schema: public; Owner: postgres | |
| -- | |
| CREATE OPERATOR >> ( | |
| PROCEDURE = geometry_right, | |
| LEFTARG = geometry, | |
| RIGHTARG = geometry, | |
| COMMUTATOR = <<, | |
| RESTRICT = positionsel, | |
| JOIN = positionjoinsel | |
| ); | |
| ALTER OPERATOR public.>> (geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 1909 (class 2617 OID 19195) | |
| -- Dependencies: 1102 6 1102 204 | |
| -- Name: @; Type: OPERATOR; Schema: public; Owner: postgres | |
| -- | |
| CREATE OPERATOR @ ( | |
| PROCEDURE = geometry_contained, | |
| LEFTARG = geometry, | |
| RIGHTARG = geometry, | |
| COMMUTATOR = ~, | |
| RESTRICT = contsel, | |
| JOIN = contjoinsel | |
| ); | |
| ALTER OPERATOR public.@ (geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 1897 (class 2617 OID 19178) | |
| -- Dependencies: 1102 6 213 1102 | |
| -- Name: |&>; Type: OPERATOR; Schema: public; Owner: postgres | |
| -- | |
| CREATE OPERATOR |&> ( | |
| PROCEDURE = geometry_overabove, | |
| LEFTARG = geometry, | |
| RIGHTARG = geometry, | |
| COMMUTATOR = &<|, | |
| RESTRICT = positionsel, | |
| JOIN = positionjoinsel | |
| ); | |
| ALTER OPERATOR public.|&> (geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 1910 (class 2617 OID 19188) | |
| -- Dependencies: 1102 6 1102 200 | |
| -- Name: |>>; Type: OPERATOR; Schema: public; Owner: postgres | |
| -- | |
| CREATE OPERATOR |>> ( | |
| PROCEDURE = geometry_above, | |
| LEFTARG = geometry, | |
| RIGHTARG = geometry, | |
| COMMUTATOR = <<|, | |
| RESTRICT = positionsel, | |
| JOIN = positionjoinsel | |
| ); | |
| ALTER OPERATOR public.|>> (geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 1911 (class 2617 OID 19194) | |
| -- Dependencies: 6 1102 1102 203 | |
| -- Name: ~; Type: OPERATOR; Schema: public; Owner: postgres | |
| -- | |
| CREATE OPERATOR ~ ( | |
| PROCEDURE = geometry_contain, | |
| LEFTARG = geometry, | |
| RIGHTARG = geometry, | |
| COMMUTATOR = @, | |
| RESTRICT = contsel, | |
| JOIN = contjoinsel | |
| ); | |
| ALTER OPERATOR public.~ (geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 1912 (class 2617 OID 19196) | |
| -- Dependencies: 1102 220 1102 6 | |
| -- Name: ~=; Type: OPERATOR; Schema: public; Owner: postgres | |
| -- | |
| CREATE OPERATOR ~= ( | |
| PROCEDURE = geometry_samebox, | |
| LEFTARG = geometry, | |
| RIGHTARG = geometry, | |
| COMMUTATOR = ~=, | |
| RESTRICT = eqsel, | |
| JOIN = eqjoinsel | |
| ); | |
| ALTER OPERATOR public.~= (geometry, geometry) OWNER TO postgres; | |
| -- | |
| -- TOC entry 2025 (class 2616 OID 19198) | |
| -- Dependencies: 1099 2136 6 | |
| -- Name: btree_geography_ops; Type: OPERATOR CLASS; Schema: public; Owner: postgres | |
| -- | |
| CREATE OPERATOR CLASS btree_geography_ops | |
| DEFAULT FOR TYPE geography USING btree AS | |
| OPERATOR 1 <(geography,geography) , | |
| OPERATOR 2 <=(geography,geography) , | |
| OPERATOR 3 =(geography,geography) , | |
| OPERATOR 4 >=(geography,geography) , | |
| OPERATOR 5 >(geography,geography) , | |
| FUNCTION 1 geography_cmp(geography,geography); | |
| ALTER OPERATOR CLASS public.btree_geography_ops USING btree OWNER TO postgres; | |
| -- | |
| -- TOC entry 2026 (class 2616 OID 19206) | |
| -- Dependencies: 6 1102 2137 | |
| -- Name: btree_geometry_ops; Type: OPERATOR CLASS; Schema: public; Owner: postgres | |
| -- | |
| CREATE OPERATOR CLASS btree_geometry_ops | |
| DEFAULT FOR TYPE geometry USING btree AS | |
| OPERATOR 1 <(geometry,geometry) , | |
| OPERATOR 2 <=(geometry,geometry) , | |
| OPERATOR 3 =(geometry,geometry) , | |
| OPERATOR 4 >=(geometry,geometry) , | |
| OPERATOR 5 >(geometry,geometry) , | |
| FUNCTION 1 geometry_cmp(geometry,geometry); | |
| ALTER OPERATOR CLASS public.btree_geometry_ops USING btree OWNER TO postgres; | |
| -- | |
| -- TOC entry 2027 (class 2616 OID 19214) | |
| -- Dependencies: 2138 6 1099 1107 | |
| -- Name: gist_geography_ops; Type: OPERATOR CLASS; Schema: public; Owner: postgres | |
| -- | |
| CREATE OPERATOR CLASS gist_geography_ops | |
| DEFAULT FOR TYPE geography USING gist AS | |
| STORAGE gidx , | |
| OPERATOR 3 &&(geography,geography) , | |
| FUNCTION 1 geography_gist_consistent(internal,geometry,integer) , | |
| FUNCTION 2 geography_gist_union(bytea,internal) , | |
| FUNCTION 3 geography_gist_compress(internal) , | |
| FUNCTION 4 geography_gist_decompress(internal) , | |
| FUNCTION 5 geography_gist_penalty(internal,internal,internal) , | |
| FUNCTION 6 geography_gist_picksplit(internal,internal) , | |
| FUNCTION 7 geography_gist_same(box2d,box2d,internal); | |
| ALTER OPERATOR CLASS public.gist_geography_ops USING gist OWNER TO postgres; | |
| -- | |
| -- TOC entry 2028 (class 2616 OID 19224) | |
| -- Dependencies: 6 1087 1102 2139 | |
| -- Name: gist_geometry_ops; Type: OPERATOR CLASS; Schema: public; Owner: postgres | |
| -- | |
| CREATE OPERATOR CLASS gist_geometry_ops | |
| DEFAULT FOR TYPE geometry USING gist AS | |
| STORAGE box2d , | |
| OPERATOR 1 <<(geometry,geometry) , | |
| OPERATOR 2 &<(geometry,geometry) , | |
| OPERATOR 3 &&(geometry,geometry) , | |
| OPERATOR 4 &>(geometry,geometry) , | |
| OPERATOR 5 >>(geometry,geometry) , | |
| OPERATOR 6 ~=(geometry,geometry) , | |
| OPERATOR 7 ~(geometry,geometry) , | |
| OPERATOR 8 @(geometry,geometry) , | |
| OPERATOR 9 &<|(geometry,geometry) , | |
| OPERATOR 10 <<|(geometry,geometry) , | |
| OPERATOR 11 |>>(geometry,geometry) , | |
| OPERATOR 12 |&>(geometry,geometry) , | |
| FUNCTION 1 lwgeom_gist_consistent(internal,geometry,integer) , | |
| FUNCTION 2 lwgeom_gist_union(bytea,internal) , | |
| FUNCTION 3 lwgeom_gist_compress(internal) , | |
| FUNCTION 4 lwgeom_gist_decompress(internal) , | |
| FUNCTION 5 lwgeom_gist_penalty(internal,internal,internal) , | |
| FUNCTION 6 lwgeom_gist_picksplit(internal,internal) , | |
| FUNCTION 7 lwgeom_gist_same(box2d,box2d,internal); | |
| ALTER OPERATOR CLASS public.gist_geometry_ops USING gist OWNER TO postgres; | |
| SET search_path = pg_catalog; | |
| -- | |
| -- TOC entry 2708 (class 2605 OID 19244) | |
| -- Dependencies: 110 1090 1087 110 | |
| -- Name: CAST (public.box2d AS public.box3d); Type: CAST; Schema: pg_catalog; Owner: | |
| -- | |
| CREATE CAST (public.box2d AS public.box3d) WITH FUNCTION public.box3d(public.box2d) AS IMPLICIT; | |
| -- | |
| -- TOC entry 2709 (class 2605 OID 19245) | |
| -- Dependencies: 194 1087 1102 194 | |
| -- Name: CAST (public.box2d AS public.geometry); Type: CAST; Schema: pg_catalog; Owner: | |
| -- | |
| CREATE CAST (public.box2d AS public.geometry) WITH FUNCTION public.geometry(public.box2d) AS IMPLICIT; | |
| -- | |
| -- TOC entry 2710 (class 2605 OID 19246) | |
| -- Dependencies: 105 105 1090 | |
| -- Name: CAST (public.box3d AS box); Type: CAST; Schema: pg_catalog; Owner: | |
| -- | |
| CREATE CAST (public.box3d AS box) WITH FUNCTION public.box(public.box3d) AS IMPLICIT; | |
| -- | |
| -- TOC entry 2711 (class 2605 OID 19247) | |
| -- Dependencies: 108 1087 1090 108 | |
| -- Name: CAST (public.box3d AS public.box2d); Type: CAST; Schema: pg_catalog; Owner: | |
| -- | |
| CREATE CAST (public.box3d AS public.box2d) WITH FUNCTION public.box2d(public.box3d) AS IMPLICIT; | |
| -- | |
| -- TOC entry 2712 (class 2605 OID 19248) | |
| -- Dependencies: 195 195 1102 1090 | |
| -- Name: CAST (public.box3d AS public.geometry); Type: CAST; Schema: pg_catalog; Owner: | |
| -- | |
| CREATE CAST (public.box3d AS public.geometry) WITH FUNCTION public.geometry(public.box3d) AS IMPLICIT; | |
| -- | |
| -- TOC entry 2713 (class 2605 OID 19249) | |
| -- Dependencies: 106 1087 1093 106 | |
| -- Name: CAST (public.box3d_extent AS public.box2d); Type: CAST; Schema: pg_catalog; Owner: | |
| -- | |
| CREATE CAST (public.box3d_extent AS public.box2d) WITH FUNCTION public.box2d(public.box3d_extent) AS IMPLICIT; | |
| -- | |
| -- TOC entry 2714 (class 2605 OID 19250) | |
| -- Dependencies: 111 1090 1093 111 | |
| -- Name: CAST (public.box3d_extent AS public.box3d); Type: CAST; Schema: pg_catalog; Owner: | |
| -- | |
| CREATE CAST (public.box3d_extent AS public.box3d) WITH FUNCTION public.box3d_extent(public.box3d_extent) AS IMPLICIT; | |
| -- | |
| -- TOC entry 2715 (class 2605 OID 19251) | |
| -- Dependencies: 193 1102 193 1093 | |
| -- Name: CAST (public.box3d_extent AS public.geometry); Type: CAST; Schema: pg_catalog; Owner: | |
| -- | |
| CREATE CAST (public.box3d_extent AS public.geometry) WITH FUNCTION public.geometry(public.box3d_extent) AS IMPLICIT; | |
| -- | |
| -- TOC entry 2519 (class 2605 OID 19252) | |
| -- Dependencies: 198 198 1102 | |
| -- Name: CAST (bytea AS public.geometry); Type: CAST; Schema: pg_catalog; Owner: | |
| -- | |
| CREATE CAST (bytea AS public.geometry) WITH FUNCTION public.geometry(bytea) AS IMPLICIT; | |
| -- | |
| -- TOC entry 2716 (class 2605 OID 19253) | |
| -- Dependencies: 197 1102 197 1096 | |
| -- Name: CAST (public.chip AS public.geometry); Type: CAST; Schema: pg_catalog; Owner: | |
| -- | |
| CREATE CAST (public.chip AS public.geometry) WITH FUNCTION public.geometry(public.chip) AS IMPLICIT; | |
| -- | |
| -- TOC entry 2717 (class 2605 OID 19254) | |
| -- Dependencies: 168 1099 168 1099 | |
| -- Name: CAST (public.geography AS public.geography); Type: CAST; Schema: pg_catalog; Owner: | |
| -- | |
| CREATE CAST (public.geography AS public.geography) WITH FUNCTION public.geography(public.geography, integer, boolean) AS IMPLICIT; | |
| -- | |
| -- TOC entry 2718 (class 2605 OID 19255) | |
| -- Dependencies: 199 1102 199 1099 | |
| -- Name: CAST (public.geography AS public.geometry); Type: CAST; Schema: pg_catalog; Owner: | |
| -- | |
| CREATE CAST (public.geography AS public.geometry) WITH FUNCTION public.geometry(public.geography); | |
| -- | |
| -- TOC entry 2721 (class 2605 OID 19256) | |
| -- Dependencies: 104 104 1102 | |
| -- Name: CAST (public.geometry AS box); Type: CAST; Schema: pg_catalog; Owner: | |
| -- | |
| CREATE CAST (public.geometry AS box) WITH FUNCTION public.box(public.geometry) AS IMPLICIT; | |
| -- | |
| -- TOC entry 2722 (class 2605 OID 19257) | |
| -- Dependencies: 107 107 1102 1087 | |
| -- Name: CAST (public.geometry AS public.box2d); Type: CAST; Schema: pg_catalog; Owner: | |
| -- | |
| CREATE CAST (public.geometry AS public.box2d) WITH FUNCTION public.box2d(public.geometry) AS IMPLICIT; | |
| -- | |
| -- TOC entry 2723 (class 2605 OID 19258) | |
| -- Dependencies: 109 1090 1102 109 | |
| -- Name: CAST (public.geometry AS public.box3d); Type: CAST; Schema: pg_catalog; Owner: | |
| -- | |
| CREATE CAST (public.geometry AS public.box3d) WITH FUNCTION public.box3d(public.geometry) AS IMPLICIT; | |
| -- | |
| -- TOC entry 2719 (class 2605 OID 19259) | |
| -- Dependencies: 116 1102 116 | |
| -- Name: CAST (public.geometry AS bytea); Type: CAST; Schema: pg_catalog; Owner: | |
| -- | |
| CREATE CAST (public.geometry AS bytea) WITH FUNCTION public.bytea(public.geometry) AS IMPLICIT; | |
| -- | |
| -- TOC entry 2724 (class 2605 OID 19260) | |
| -- Dependencies: 169 1099 1102 169 | |
| -- Name: CAST (public.geometry AS public.geography); Type: CAST; Schema: pg_catalog; Owner: | |
| -- | |
| CREATE CAST (public.geometry AS public.geography) WITH FUNCTION public.geography(public.geometry) AS IMPLICIT; | |
| -- | |
| -- TOC entry 2720 (class 2605 OID 19261) | |
| -- Dependencies: 777 777 1102 | |
| -- Name: CAST (public.geometry AS text); Type: CAST; Schema: pg_catalog; Owner: | |
| -- | |
| CREATE CAST (public.geometry AS text) WITH FUNCTION public.text(public.geometry) AS IMPLICIT; | |
| -- | |
| -- TOC entry 2585 (class 2605 OID 19262) | |
| -- Dependencies: 196 196 1102 | |
| -- Name: CAST (text AS public.geometry); Type: CAST; Schema: pg_catalog; Owner: | |
| -- | |
| CREATE CAST (text AS public.geometry) WITH FUNCTION public.geometry(text) AS IMPLICIT; | |
| SET search_path = public, pg_catalog; | |
| SET default_tablespace = ''; | |
| SET default_with_oids = false; | |
| -- | |
| -- TOC entry 2427 (class 1259 OID 40481) | |
| -- Dependencies: 6 | |
| -- Name: agency; Type: TABLE; Schema: public; Owner: postgres; Tablespace: | |
| -- | |
| CREATE TABLE agency ( | |
| agency_name text NOT NULL, | |
| agency_url text, | |
| agency_timezone text, | |
| agency_lang text, | |
| agency_phone text | |
| ); | |
| ALTER TABLE public.agency OWNER TO postgres; | |
| -- | |
| -- TOC entry 2408 (class 1259 OID 19269) | |
| -- Dependencies: 6 | |
| -- Name: calendar; Type: TABLE; Schema: public; Owner: postgres; Tablespace: | |
| -- | |
| CREATE TABLE calendar ( | |
| service_id text NOT NULL, | |
| start_date text, | |
| end_date text, | |
| monday integer, | |
| tuesday integer, | |
| wednesday integer, | |
| thursday integer, | |
| friday integer, | |
| saturday integer, | |
| sunday integer | |
| ); | |
| ALTER TABLE public.calendar OWNER TO postgres; | |
| -- | |
| -- TOC entry 2409 (class 1259 OID 19275) | |
| -- Dependencies: 6 | |
| -- Name: calendar_dates; Type: TABLE; Schema: public; Owner: postgres; Tablespace: | |
| -- | |
| CREATE TABLE calendar_dates ( | |
| service_id text NOT NULL, | |
| date text NOT NULL, | |
| exception_type text | |
| ); | |
| ALTER TABLE public.calendar_dates OWNER TO postgres; | |
| -- | |
| -- TOC entry 2410 (class 1259 OID 19281) | |
| -- Dependencies: 2514 6 | |
| -- Name: geography_columns; Type: VIEW; Schema: public; Owner: postgres | |
| -- | |
| CREATE VIEW geography_columns AS | |
| SELECT current_database() AS f_table_catalog, n.nspname AS f_table_schema, c.relname AS f_table_name, a.attname AS f_geography_column, geography_typmod_dims(a.atttypmod) AS coord_dimension, geography_typmod_srid(a.atttypmod) AS srid, geography_typmod_type(a.atttypmod) AS type FROM pg_class c, pg_attribute a, pg_type t, pg_namespace n WHERE ((((((c.relkind = ANY (ARRAY['r'::"char", 'v'::"char"])) AND (t.typname = 'geography'::name)) AND (a.attisdropped = false)) AND (a.atttypid = t.oid)) AND (a.attrelid = c.oid)) AND (c.relnamespace = n.oid)); | |
| ALTER TABLE public.geography_columns OWNER TO postgres; | |
| SET default_with_oids = true; | |
| -- | |
| -- TOC entry 2411 (class 1259 OID 19286) | |
| -- Dependencies: 6 | |
| -- Name: geometry_columns; Type: TABLE; Schema: public; Owner: postgres; Tablespace: | |
| -- | |
| CREATE TABLE geometry_columns ( | |
| f_table_catalog character varying(256) NOT NULL, | |
| f_table_schema character varying(256) NOT NULL, | |
| f_table_name character varying(256) NOT NULL, | |
| f_geometry_column character varying(256) NOT NULL, | |
| coord_dimension integer NOT NULL, | |
| srid integer NOT NULL, | |
| type character varying(30) NOT NULL | |
| ); | |
| ALTER TABLE public.geometry_columns OWNER TO postgres; | |
| SET default_with_oids = false; | |
| -- | |
| -- TOC entry 2412 (class 1259 OID 19292) | |
| -- Dependencies: 6 | |
| -- Name: myway_observations; Type: TABLE; Schema: public; Owner: postgres; Tablespace: | |
| -- | |
| CREATE TABLE myway_observations ( | |
| observation_id text NOT NULL, | |
| myway_stop text, | |
| "time" timestamp with time zone, | |
| myway_route text | |
| ); | |
| ALTER TABLE public.myway_observations OWNER TO postgres; | |
| -- | |
| -- TOC entry 2413 (class 1259 OID 19298) | |
| -- Dependencies: 6 | |
| -- Name: myway_routes; Type: TABLE; Schema: public; Owner: postgres; Tablespace: | |
| -- | |
| CREATE TABLE myway_routes ( | |
| myway_route text NOT NULL, | |
| route_full_name text | |
| ); | |
| ALTER TABLE public.myway_routes OWNER TO postgres; | |
| -- | |
| -- TOC entry 2414 (class 1259 OID 19304) | |
| -- Dependencies: 2413 6 | |
| -- Name: myway_routes_myway_route_seq; Type: SEQUENCE; Schema: public; Owner: postgres | |
| -- | |
| CREATE SEQUENCE myway_routes_myway_route_seq | |
| START WITH 1 | |
| INCREMENT BY 1 | |
| NO MINVALUE | |
| NO MAXVALUE | |
| CACHE 1; | |
| ALTER TABLE public.myway_routes_myway_route_seq OWNER TO postgres; | |
| -- | |
| -- TOC entry 2769 (class 0 OID 0) | |
| -- Dependencies: 2414 | |
| -- Name: myway_routes_myway_route_seq; Type: SEQUENCE OWNED BY; Schema: public; Owner: postgres | |
| -- | |
| ALTER SEQUENCE myway_routes_myway_route_seq OWNED BY myway_routes.myway_route; | |
| -- | |
| -- TOC entry 2415 (class 1259 OID 19306) | |
| -- Dependencies: 2413 6 | |
| -- Name: myway_routes_route_full_name_seq; Type: SEQUENCE; Schema: public; Owner: postgres | |
| -- | |
| CREATE SEQUENCE myway_routes_route_full_name_seq | |
| START WITH 1 | |
| INCREMENT BY 1 | |
| NO MINVALUE | |
| NO MAXVALUE | |
| CACHE 1; | |
| ALTER TABLE public.myway_routes_route_full_name_seq OWNER TO postgres; | |
| -- | |
| -- TOC entry 2770 (class 0 OID 0) | |
| -- Dependencies: 2415 | |
| -- Name: myway_routes_route_full_name_seq; Type: SEQUENCE OWNED BY; Schema: public; Owner: postgres | |
| -- | |
| ALTER SEQUENCE myway_routes_route_full_name_seq OWNED BY myway_routes.route_full_name; | |
| -- | |
| -- TOC entry 2416 (class 1259 OID 19314) | |
| -- Dependencies: 6 | |
| -- Name: myway_timingdeltas; Type: TABLE; Schema: public; Owner: postgres; Tablespace: | |
| -- | |
| CREATE TABLE myway_timingdeltas ( | |
| observation_id text NOT NULL, | |
| route_full_name text, | |
| stop_code text, | |
| timing_delta integer, | |
| "time" time with time zone, | |
| date date, | |
| timing_period text, | |
| stop_sequence integer | |
| ); | |
| ALTER TABLE public.myway_timingdeltas OWNER TO postgres; | |
| -- | |
| -- TOC entry 2417 (class 1259 OID 19320) | |
| -- Dependencies: 6 2416 | |
| -- Name: myway_timingdeltas_timing_period_seq; Type: SEQUENCE; Schema: public; Owner: postgres | |
| -- | |
| CREATE SEQUENCE myway_timingdeltas_timing_period_seq | |
| START WITH 1 | |
| INCREMENT BY 1 | |
| NO MINVALUE | |
| NO MAXVALUE | |
| CACHE 1; | |
| ALTER TABLE public.myway_timingdeltas_timing_period_seq OWNER TO postgres; | |
| -- | |
| -- TOC entry 2771 (class 0 OID 0) | |
| -- Dependencies: 2417 | |
| -- Name: myway_timingdeltas_timing_period_seq; Type: SEQUENCE OWNED BY; Schema: public; Owner: postgres | |
| -- | |
| ALTER SEQUENCE myway_timingdeltas_timing_period_seq OWNED BY myway_timingdeltas.timing_period; | |
| -- | |
| -- TOC entry 2424 (class 1259 OID 40443) | |
| -- Dependencies: 6 | |
| -- Name: routes; Type: TABLE; Schema: public; Owner: postgres; Tablespace: | |
| -- | |
| CREATE TABLE routes ( | |
| route_id text NOT NULL, | |
| route_short_name text, | |
| route_long_name text, | |
| route_desc text, | |
| route_type integer, | |
| route_url text, | |
| route_text_color text, | |
| route_color text | |
| ); | |
| ALTER TABLE public.routes OWNER TO postgres; | |
| -- | |
| -- TOC entry 2418 (class 1259 OID 19328) | |
| -- Dependencies: 6 | |
| -- Name: servicealerts_alerts; Type: TABLE; Schema: public; Owner: postgres; Tablespace: | |
| -- | |
| CREATE TABLE servicealerts_alerts ( | |
| id integer NOT NULL, | |
| url text, | |
| description text, | |
| start timestamp with time zone, | |
| "end" timestamp with time zone | |
| ); | |
| ALTER TABLE public.servicealerts_alerts OWNER TO postgres; | |
| -- | |
| -- TOC entry 2419 (class 1259 OID 19334) | |
| -- Dependencies: 6 2418 | |
| -- Name: servicealerts_alerts_id_seq; Type: SEQUENCE; Schema: public; Owner: postgres | |
| -- | |
| CREATE SEQUENCE servicealerts_alerts_id_seq | |
| START WITH 1 | |
| INCREMENT BY 1 | |
| NO MINVALUE | |
| NO MAXVALUE | |
| CACHE 1; | |
| ALTER TABLE public.servicealerts_alerts_id_seq OWNER TO postgres; | |
| -- | |
| -- TOC entry 2772 (class 0 OID 0) | |
| -- Dependencies: 2419 | |
| -- Name: servicealerts_alerts_id_seq; Type: SEQUENCE OWNED BY; Schema: public; Owner: postgres | |
| -- | |
| ALTER SEQUENCE servicealerts_alerts_id_seq OWNED BY servicealerts_alerts.id; | |
| -- | |
| -- TOC entry 2420 (class 1259 OID 19336) | |
| -- Dependencies: 6 | |
| -- Name: servicealerts_informed; Type: TABLE; Schema: public; Owner: postgres; Tablespace: | |
| -- | |
| CREATE TABLE servicealerts_informed ( | |
| servicealert_id integer NOT NULL, | |
| informed_class text NOT NULL, | |
| informed_id text NOT NULL, | |
| informed_action text | |
| ); | |
| ALTER TABLE public.servicealerts_informed OWNER TO postgres; | |
| -- | |
| -- TOC entry 2421 (class 1259 OID 19342) | |
| -- Dependencies: 6 | |
| -- Name: shapes; Type: TABLE; Schema: public; Owner: postgres; Tablespace: | |
| -- | |
| CREATE TABLE shapes ( | |
| shape_id text NOT NULL, | |
| shape_pt_lat double precision, | |
| shape_pt_lon double precision, | |
| shape_pt_sequence integer NOT NULL, | |
| shape_dist_traveled integer | |
| ); | |
| ALTER TABLE public.shapes OWNER TO postgres; | |
| -- | |
| -- TOC entry 2422 (class 1259 OID 19348) | |
| -- Dependencies: 6 | |
| -- Name: spatial_ref_sys; Type: TABLE; Schema: public; Owner: postgres; Tablespace: | |
| -- | |
| CREATE TABLE spatial_ref_sys ( | |
| srid integer NOT NULL, | |
| auth_name character varying(256), | |
| auth_srid integer, | |
| srtext character varying(2048), | |
| proj4text character varying(2048) | |
| ); | |
| ALTER TABLE public.spatial_ref_sys OWNER TO postgres; | |
| -- | |
| -- TOC entry 2423 (class 1259 OID 20682) | |
| -- Dependencies: 6 | |
| -- Name: stop_times; Type: TABLE; Schema: public; Owner: postgres; Tablespace: | |
| -- | |
| CREATE TABLE stop_times ( | |
| trip_id text NOT NULL, | |
| arrival_time time without time zone, | |
| departure_time time without time zone, | |
| stop_id text, | |
| stop_sequence integer NOT NULL, | |
| stop_headsign text, | |
| pickup_type text, | |
| drop_off_type text, | |
| shape_dist_travelled text | |
| ); | |
| ALTER TABLE public.stop_times OWNER TO postgres; | |
| -- | |
| -- TOC entry 2425 (class 1259 OID 40452) | |
| -- Dependencies: 1099 6 | |
| -- Name: stops; Type: TABLE; Schema: public; Owner: postgres; Tablespace: | |
| -- | |
| CREATE TABLE stops ( | |
| stop_id text NOT NULL, | |
| stop_code text, | |
| stop_name text, | |
| stop_desc text, | |
| stop_lat double precision, | |
| stop_lon double precision, | |
| zone_id text, | |
| stop_url text, | |
| location_type integer, | |
| "position" geography | |
| ); | |
| ALTER TABLE public.stops OWNER TO postgres; | |
| -- | |
| -- TOC entry 2426 (class 1259 OID 40466) | |
| -- Dependencies: 6 | |
| -- Name: trips; Type: TABLE; Schema: public; Owner: postgres; Tablespace: | |
| -- | |
| CREATE TABLE trips ( | |
| route_id text, | |
| service_id text, | |
| trip_id text NOT NULL, | |
| trip_headsign text, | |
| direction_id text, | |
| block_id text, | |
| shape_id text | |
| ); | |
| ALTER TABLE public.trips OWNER TO postgres; | |
| -- | |
| -- TOC entry 2725 (class 2604 OID 19372) | |
| -- Dependencies: 2419 2418 | |
| -- Name: id; Type: DEFAULT; Schema: public; Owner: postgres | |
| -- | |
| ALTER TABLE servicealerts_alerts ALTER COLUMN id SET DEFAULT nextval('servicealerts_alerts_id_seq'::regclass); | |
| -- | |
| -- TOC entry 2762 (class 2606 OID 40488) | |
| -- Dependencies: 2427 2427 | |
| -- Name: agency_pkey; Type: CONSTRAINT; Schema: public; Owner: postgres; Tablespace: | |
| -- | |
| ALTER TABLE ONLY agency | |
| ADD CONSTRAINT agency_pkey PRIMARY KEY (agency_name); | |
| -- | |
| -- TOC entry 2729 (class 2606 OID 19376) | |
| -- Dependencies: 2409 2409 2409 | |
| -- Name: calendar_dates_pkey; Type: CONSTRAINT; Schema: public; Owner: postgres; Tablespace: | |
| -- | |
| ALTER TABLE ONLY calendar_dates | |
| ADD CONSTRAINT calendar_dates_pkey PRIMARY KEY (service_id, date); | |
| -- | |
| -- TOC entry 2727 (class 2606 OID 19378) | |
| -- Dependencies: 2408 2408 | |
| -- Name: calendar_pkey; Type: CONSTRAINT; Schema: public; Owner: postgres; Tablespace: | |
| -- | |
| ALTER TABLE ONLY calendar | |
| ADD CONSTRAINT calendar_pkey PRIMARY KEY (service_id); | |
| -- | |
| -- TOC entry 2731 (class 2606 OID 19380) | |
| -- Dependencies: 2411 2411 2411 2411 2411 | |
| -- Name: geometry_columns_pk; Type: CONSTRAINT; Schema: public; Owner: postgres; Tablespace: | |
| -- | |
| ALTER TABLE ONLY geometry_columns | |
| ADD CONSTRAINT geometry_columns_pk PRIMARY KEY (f_table_catalog, f_table_schema, f_table_name, f_geometry_column); | |
| -- | |
| -- TOC entry 2733 (class 2606 OID 19382) | |
| -- Dependencies: 2412 2412 | |
| -- Name: myway_observations_pkey; Type: CONSTRAINT; Schema: public; Owner: postgres; Tablespace: | |
| -- | |
| ALTER TABLE ONLY myway_observations | |
| ADD CONSTRAINT myway_observations_pkey PRIMARY KEY (observation_id); | |
| -- | |
| -- TOC entry 2735 (class 2606 OID 19384) | |
| -- Dependencies: 2413 2413 | |
| -- Name: myway_routes_pkey; Type: CONSTRAINT; Schema: public; Owner: postgres; Tablespace: | |
| -- | |
| ALTER TABLE ONLY myway_routes | |
| ADD CONSTRAINT myway_routes_pkey PRIMARY KEY (myway_route); | |
| -- | |
| -- TOC entry 2737 (class 2606 OID 19386) | |
| -- Dependencies: 2416 2416 | |
| -- Name: myway_timingdeltas_pkey; Type: CONSTRAINT; Schema: public; Owner: postgres; Tablespace: | |
| -- | |
| ALTER TABLE ONLY myway_timingdeltas | |
| ADD CONSTRAINT myway_timingdeltas_pkey PRIMARY KEY (observation_id); | |
| -- | |
| -- TOC entry 2753 (class 2606 OID 40450) | |
| -- Dependencies: 2424 2424 | |
| -- Name: routes_pkey; Type: CONSTRAINT; Schema: public; Owner: postgres; Tablespace: | |
| -- | |
| ALTER TABLE ONLY routes | |
| ADD CONSTRAINT routes_pkey PRIMARY KEY (route_id); | |
| -- | |
| -- TOC entry 2739 (class 2606 OID 19392) | |
| -- Dependencies: 2418 2418 | |
| -- Name: servicealerts_alerts_pkey; Type: CONSTRAINT; Schema: public; Owner: postgres; Tablespace: | |
| -- | |
| ALTER TABLE ONLY servicealerts_alerts | |
| ADD CONSTRAINT servicealerts_alerts_pkey PRIMARY KEY (id); | |
| -- | |
| -- TOC entry 2741 (class 2606 OID 19394) | |
| -- Dependencies: 2420 2420 2420 2420 | |
| -- Name: servicealerts_informed_pkey; Type: CONSTRAINT; Schema: public; Owner: postgres; Tablespace: | |
| -- | |
| ALTER TABLE ONLY servicealerts_informed | |
| ADD CONSTRAINT servicealerts_informed_pkey PRIMARY KEY (servicealert_id, informed_class, informed_id); | |
| -- | |
| -- TOC entry 2743 (class 2606 OID 19396) | |
| -- Dependencies: 2421 2421 2421 | |
| -- Name: shapes_pkey; Type: CONSTRAINT; Schema: public; Owner: postgres; Tablespace: | |
| -- | |
| ALTER TABLE ONLY shapes | |
| ADD CONSTRAINT shapes_pkey PRIMARY KEY (shape_id, shape_pt_sequence); | |
| -- | |
| -- TOC entry 2745 (class 2606 OID 19398) | |
| -- Dependencies: 2422 2422 | |
| -- Name: spatial_ref_sys_pkey; Type: CONSTRAINT; Schema: public; Owner: postgres; Tablespace: | |
| -- | |
| ALTER TABLE ONLY spatial_ref_sys | |
| ADD CONSTRAINT spatial_ref_sys_pkey PRIMARY KEY (srid); | |
| -- | |
| -- TOC entry 2748 (class 2606 OID 40421) | |
| -- Dependencies: 2423 2423 2423 | |
| -- Name: stop_times_pkey; Type: CONSTRAINT; Schema: public; Owner: postgres; Tablespace: | |
| -- | |
| ALTER TABLE ONLY stop_times | |
| ADD CONSTRAINT stop_times_pkey PRIMARY KEY (trip_id, stop_sequence); | |
| -- | |
| -- TOC entry 2755 (class 2606 OID 40459) | |
| -- Dependencies: 2425 2425 | |
| -- Name: stops_pkey; Type: CONSTRAINT; Schema: public; Owner: postgres; Tablespace: | |
| -- | |
| ALTER TABLE ONLY stops | |
| ADD CONSTRAINT stops_pkey PRIMARY KEY (stop_id); | |
| -- | |
| -- TOC entry 2757 (class 2606 OID 40461) | |
| -- Dependencies: 2425 2425 | |
| -- Name: stops_stop_code_key; Type: CONSTRAINT; Schema: public; Owner: postgres; Tablespace: | |
| -- | |
| ALTER TABLE ONLY stops | |
| ADD CONSTRAINT stops_stop_code_key UNIQUE (stop_code); | |
| -- | |
| -- TOC entry 2760 (class 2606 OID 40473) | |
| -- Dependencies: 2426 2426 | |
| -- Name: trips_pkey; Type: CONSTRAINT; Schema: public; Owner: postgres; Tablespace: | |
| -- | |
| ALTER TABLE ONLY trips | |
| ADD CONSTRAINT trips_pkey PRIMARY KEY (trip_id); | |
| -- | |
| -- TOC entry 2751 (class 1259 OID 40451) | |
| -- Dependencies: 2424 | |
| -- Name: routenumber; Type: INDEX; Schema: public; Owner: postgres; Tablespace: | |
| -- | |
| CREATE INDEX routenumber ON routes USING btree (route_short_name); | |
| -- | |
| -- TOC entry 2758 (class 1259 OID 40474) | |
| -- Dependencies: 2426 | |
| -- Name: routetrips; Type: INDEX; Schema: public; Owner: postgres; Tablespace: | |
| -- | |
| CREATE INDEX routetrips ON trips USING btree (route_id); | |
| -- | |
| -- TOC entry 2746 (class 1259 OID 40418) | |
| -- Dependencies: 2423 2423 2423 | |
| -- Name: starttime; Type: INDEX; Schema: public; Owner: postgres; Tablespace: | |
| -- | |
| CREATE UNIQUE INDEX starttime ON stop_times USING btree (trip_id, stop_id, stop_sequence); | |
| -- | |
| -- TOC entry 2749 (class 1259 OID 40406) | |
| -- Dependencies: 2423 2423 | |
| -- Name: stoptimes; Type: INDEX; Schema: public; Owner: postgres; Tablespace: | |
| -- | |
| CREATE INDEX stoptimes ON stop_times USING btree (arrival_time, stop_id); | |
| -- | |
| -- TOC entry 2750 (class 1259 OID 40419) | |
| -- Dependencies: 2423 2423 | |
| -- Name: triptimes; Type: INDEX; Schema: public; Owner: postgres; Tablespace: | |
| -- | |
| CREATE INDEX triptimes ON stop_times USING btree (trip_id, arrival_time); | |
| -- | |
| -- TOC entry 2763 (class 2606 OID 19412) | |
| -- Dependencies: 2418 2420 2738 | |
| -- Name: servicealerts_alertid; Type: FK CONSTRAINT; Schema: public; Owner: postgres | |
| -- | |
| ALTER TABLE ONLY servicealerts_informed | |
| ADD CONSTRAINT servicealerts_alertid FOREIGN KEY (servicealert_id) REFERENCES servicealerts_alerts(id); | |
| -- | |
| -- TOC entry 2768 (class 0 OID 0) | |
| -- Dependencies: 6 | |
| -- Name: public; Type: ACL; Schema: -; Owner: postgres | |
| -- | |
| REVOKE ALL ON SCHEMA public FROM PUBLIC; | |
| REVOKE ALL ON SCHEMA public FROM postgres; | |
| GRANT ALL ON SCHEMA public TO postgres; | |
| GRANT ALL ON SCHEMA public TO PUBLIC; | |
| -- Completed on 2011-10-10 16:28:14 | |
| -- | |
| -- PostgreSQL database dump complete | |
| -- | |
| /*! | |
| * jQuery Mobile v1.0b1 | |
| * http://jquerymobile.com/ | |
| * | |
| * Copyright 2010, jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| /* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses. | |
| * Note: Code is in draft form and is subject to change | |
| */ | |
| /* A | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-bar-a { | |
| border: 1px solid #2A2A2A; | |
| background: #111111; | |
| color: #ffffff; | |
| font-weight: bold; | |
| text-shadow: 0 -1px 1px #000000; | |
| background-image: -moz-linear-gradient(top, | |
| #3c3c3c, | |
| #111111); | |
| background-image: -webkit-gradient(linear,left top,left bottom, | |
| color-stop(0, #3c3c3c), | |
| color-stop(1, #111111)); | |
| -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#3c3c3c', EndColorStr='#111111')"; | |
| } | |
| .ui-bar-a, | |
| .ui-bar-a input, | |
| .ui-bar-a select, | |
| .ui-bar-a textarea, | |
| .ui-bar-a button { | |
| font-family: Helvetica, Arial, sans-serif; | |
| } | |
| .ui-bar-a .ui-link-inherit { | |
| color: #fff; | |
| } | |
| .ui-bar-a .ui-link { | |
| color: #7cc4e7; | |
| font-weight: bold; | |
| } | |
| .ui-body-a { | |
| border: 1px solid #2A2A2A; | |
| background: #222222; | |
| color: #fff; | |
| text-shadow: 0 1px 0 #000; | |
| font-weight: normal; | |
| background-image: -moz-linear-gradient(top, | |
| #666666, | |
| #222222); | |
| background-image: -webkit-gradient(linear,left top,left bottom, | |
| color-stop(0, #666666), | |
| color-stop(1, #222222)); | |
| -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#666666', EndColorStr='#222222)')"; | |
| } | |
| .ui-body-a, | |
| .ui-body-a input, | |
| .ui-body-a select, | |
| .ui-body-a textarea, | |
| .ui-body-a button { | |
| font-family: Helvetica, Arial, sans-serif; | |
| } | |
| .ui-body-a .ui-link-inherit { | |
| color: #fff; | |
| } | |
| .ui-body-a .ui-link { | |
| color: #2489CE; | |
| font-weight: bold; | |
| } | |
| .ui-br { | |
| border-bottom: rgb(130,130,130); | |
| border-bottom: rgba(130,130,130,.3); | |
| border-bottom-width: 1px; | |
| border-bottom-style: solid; | |
| } | |
| .ui-btn-up-a { | |
| border: 1px solid #222; | |
| background: #333333; | |
| font-weight: bold; | |
| color: #fff; | |
| text-shadow: 0 -1px 1px #000; | |
| background-image: -moz-linear-gradient(top, | |
| #555555, | |
| #333333); | |
| background-image: -webkit-gradient(linear,left top,left bottom, | |
| color-stop(0, #555555), | |
| color-stop(1, #333333)); | |
| -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#555555', EndColorStr='#333333')"; | |
| } | |
| .ui-btn-up-a a.ui-link-inherit { | |
| color: #fff; | |
| } | |
| .ui-btn-hover-a { | |
| border: 1px solid #000; | |
| background: #444444; | |
| font-weight: bold; | |
| color: #fff; | |
| text-shadow: 0 -1px 1px #000; | |
| background-image: -moz-linear-gradient(top, | |
| #666666, | |
| #444444); | |
| background-image: -webkit-gradient(linear,left top,left bottom, | |
| color-stop(0, #666666), | |
| color-stop(1, #444444)); | |
| -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#666666', EndColorStr='#444444')"; | |
| } | |
| .ui-btn-hover-a a.ui-link-inherit { | |
| color: #fff; | |
| } | |
| .ui-btn-down-a { | |
| border: 1px solid #000; | |
| background: #3d3d3d; | |
| font-weight: bold; | |
| color: #fff; | |
| text-shadow: 0 -1px 1px #000; | |
| background-image: -moz-linear-gradient(top, | |
| #333333, | |
| #5a5a5a); | |
| background-image: -webkit-gradient(linear,left top,left bottom, | |
| color-stop(0, #333333), | |
| color-stop(1, #5a5a5a)); | |
| -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#333333', EndColorStr='#5a5a5a')"; | |
| } | |
| .ui-btn-down-a a.ui-link-inherit { | |
| color: #fff; | |
| } | |
| .ui-btn-up-a, | |
| .ui-btn-hover-a, | |
| .ui-btn-down-a { | |
| font-family: Helvetica, Arial, sans-serif; | |
| text-decoration: none; | |
| } | |
| /* B | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-bar-b { | |
| border: 1px solid #456f9a; | |
| background: #5e87b0; | |
| color: #fff; | |
| font-weight: bold; | |
| text-shadow: 0 -1px 1px #254f7a; | |
| background-image: -moz-linear-gradient(top, | |
| #81a8ce, | |
| #5e87b0); | |
| background-image: -webkit-gradient(linear,left top,left bottom, | |
| color-stop(0, #81a8ce), | |
| color-stop(1, #5e87b0)); | |
| -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#81a8ce', EndColorStr='#5e87b0')"; | |
| } | |
| .ui-bar-b, | |
| .ui-bar-b input, | |
| .ui-bar-b select, | |
| .ui-bar-b textarea, | |
| .ui-bar-b button { | |
| font-family: Helvetica, Arial, sans-serif; | |
| } | |
| .ui-bar-b .ui-link-inherit { | |
| color: #fff; | |
| } | |
| .ui-bar-b .ui-link { | |
| color: #7cc4e7; | |
| font-weight: bold; | |
| } | |
| .ui-body-b { | |
| border: 1px solid #C6C6C6; | |
| background: #cccccc; | |
| color: #333333; | |
| text-shadow: 0 1px 0 #fff; | |
| font-weight: normal; | |
| background-image: -moz-linear-gradient(top, | |
| #e6e6e6, | |
| #cccccc); | |
| background-image: -webkit-gradient(linear,left top,left bottom, | |
| color-stop(0, #e6e6e6), | |
| color-stop(1, #cccccc)); | |
| -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#e6e6e6', EndColorStr='#cccccc')"; | |
| } | |
| .ui-body-b, | |
| .ui-body-b input, | |
| .ui-body-b select, | |
| .ui-body-b textarea, | |
| .ui-body-b button { | |
| font-family: Helvetica, Arial, sans-serif; | |
| } | |
| .ui-body-b .ui-link-inherit { | |
| color: #333333; | |
| } | |
| .ui-body-b .ui-link { | |
| color: #2489CE; | |
| font-weight: bold; | |
| } | |
| .ui-btn-up-b { | |
| border: 1px solid #145072; | |
| background: #2567ab; | |
| font-weight: bold; | |
| color: #fff; | |
| text-shadow: 0 -1px 1px #145072; | |
| background-image: -moz-linear-gradient(top, | |
| #4e89c5, | |
| #2567ab); | |
| background-image: -webkit-gradient(linear,left top,left bottom, | |
| color-stop(0, #5f9cc5), | |
| color-stop(1, #396b9e)); | |
| -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#4e89c5', EndColorStr='#2567ab')"; | |
| } | |
| .ui-btn-up-b a.ui-link-inherit { | |
| color: #fff; | |
| } | |
| .ui-btn-hover-b { | |
| border: 1px solid #00516e; | |
| background: #4b88b6; | |
| font-weight: bold; | |
| color: #fff; | |
| text-shadow: 0 -1px 1px #014D68; | |
| background-image: -moz-linear-gradient(top, | |
| #72b0d4, | |
| #4b88b6); | |
| background-image: -webkit-gradient(linear,left top,left bottom, | |
| color-stop(0, #72b0d4), | |
| color-stop(1, #4b88b6)); | |
| -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#72b0d4', EndColorStr='#4b88b6')"; | |
| } | |
| .ui-btn-hover-b a.ui-link-inherit { | |
| color: #fff; | |
| } | |
| .ui-btn-down-b { | |
| border: 1px solid #225377; | |
| background: #4e89c5; | |
| font-weight: bold; | |
| color: #fff; | |
| text-shadow: 0 -1px 1px #225377; | |
| background-image: -moz-linear-gradient(top, | |
| #396b9e, | |
| #4e89c5); | |
| background-image: -webkit-gradient(linear,left top,left bottom, | |
| color-stop(0, #396b9e), | |
| color-stop(1, #4e89c5)); | |
| -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#396b9e', EndColorStr='#4e89c5')"; | |
| } | |
| .ui-btn-down-b a.ui-link-inherit { | |
| color: #fff; | |
| } | |
| .ui-btn-up-b, | |
| .ui-btn-hover-b, | |
| .ui-btn-down-b { | |
| font-family: Helvetica, Arial, sans-serif; | |
| text-decoration: none; | |
| } | |
| /* C | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-bar-c { | |
| border: 1px solid #B3B3B3; | |
| background: #e9eaeb; | |
| color: #3E3E3E; | |
| font-weight: bold; | |
| text-shadow: 0 1px 1px #fff; | |
| background-image: -moz-linear-gradient(top, | |
| #f0f0f0, | |
| #e9eaeb); | |
| background-image: -webkit-gradient(linear,left top,left bottom, | |
| color-stop(0, #f0f0f0), | |
| color-stop(1, #e9eaeb)); | |
| -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#f0f0f0', EndColorStr='#e9eaeb')"; | |
| } | |
| .ui-bar-c, | |
| .ui-bar-c input, | |
| .ui-bar-c select, | |
| .ui-bar-c textarea, | |
| .ui-bar-c button { | |
| font-family: Helvetica, Arial, sans-serif; | |
| } | |
| .ui-body-c { | |
| border: 1px solid #B3B3B3; | |
| color: #333333; | |
| text-shadow: 0 1px 0 #fff; | |
| background: #f0f0f0; | |
| background-image: -moz-linear-gradient(top, | |
| #eeeeee, | |
| #dddddd); | |
| background-image: -webkit-gradient(linear,left top,left bottom, | |
| color-stop(0, #eeeeee), | |
| color-stop(1, #dddddd)); | |
| -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#eeeeee', EndColorStr='#dddddd')"; | |
| } | |
| .ui-body-c, | |
| .ui-body-c input, | |
| .ui-body-c select, | |
| .ui-body-c textarea, | |
| .ui-body-c button { | |
| font-family: Helvetica, Arial, sans-serif; | |
| } | |
| .ui-body-c .ui-link-inherit { | |
| color: #333333; | |
| } | |
| .ui-body-c .ui-link { | |
| color: #2489CE; | |
| font-weight: bold; | |
| } | |
| .ui-btn-up-c { | |
| border: 1px solid #ccc; | |
| background: #eee; | |
| font-weight: bold; | |
| color: #444; | |
| text-shadow: 0 1px 1px #f6f6f6; | |
| background-image: -moz-linear-gradient(top, | |
| #fefefe, | |
| #eeeeee); | |
| background-image: -webkit-gradient(linear,left top,left bottom, | |
| color-stop(0, #fdfdfd), | |
| color-stop(1, #eeeeee)); | |
| -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#fdfdfd', EndColorStr='#eeeeee')"; | |
| } | |
| .ui-btn-up-c a.ui-link-inherit { | |
| color: #2F3E46; | |
| } | |
| .ui-btn-hover-c { | |
| border: 1px solid #bbb; | |
| background: #dadada; | |
| font-weight: bold; | |
| color: #101010; | |
| text-shadow: 0 1px 1px #fff; | |
| background-image: -moz-linear-gradient(top, | |
| #ededed, | |
| #dadada); | |
| background-image: -webkit-gradient(linear,left top,left bottom, | |
| color-stop(0, #ededed), | |
| color-stop(1, #dadada)); | |
| -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#ededed', EndColorStr='#dadada')"; | |
| } | |
| .ui-btn-hover-c a.ui-link-inherit { | |
| color: #2F3E46; | |
| } | |
| .ui-btn-down-c { | |
| border: 1px solid #808080; | |
| background: #fdfdfd; | |
| font-weight: bold; | |
| color: #111111; | |
| text-shadow: 0 1px 1px #ffffff; | |
| background-image: -moz-linear-gradient(top, | |
| #eeeeee, | |
| #fdfdfd); | |
| background-image: -webkit-gradient(linear,left top,left bottom, | |
| color-stop(0, #eeeeee), | |
| color-stop(1, #fdfdfd)); | |
| -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#eeeeee', EndColorStr='#fdfdfd')"; | |
| } | |
| .ui-btn-down-c a.ui-link-inherit { | |
| color: #2F3E46; | |
| } | |
| .ui-btn-up-c, | |
| .ui-btn-hover-c, | |
| .ui-btn-down-c { | |
| font-family: Helvetica, Arial, sans-serif; | |
| text-decoration: none; | |
| } | |
| /* D | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-bar-d { | |
| border: 1px solid #ccc; | |
| background: #bbb; | |
| color: #333; | |
| text-shadow: 0 1px 0 #eee; | |
| background-image: -moz-linear-gradient(top, | |
| #ddd, | |
| #bbb); | |
| background-image: -webkit-gradient(linear,left top,left bottom, | |
| color-stop(0, #ddd), | |
| color-stop(1, #bbb)); | |
| -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#dddddd', EndColorStr='#bbbbbb')"; | |
| } | |
| .ui-bar-d, | |
| .ui-bar-d input, | |
| .ui-bar-d select, | |
| .ui-bar-d textarea, | |
| .ui-bar-d button { | |
| font-family: Helvetica, Arial, sans-serif; | |
| } | |
| .ui-bar-d .ui-link-inherit { | |
| color: #333; | |
| } | |
| .ui-bar-d .ui-link { | |
| color: #2489CE; | |
| font-weight: bold; | |
| } | |
| .ui-body-d { | |
| border: 1px solid #ccc; | |
| color: #333333; | |
| text-shadow: 0 1px 0 #fff; | |
| background: #ffffff; | |
| } | |
| .ui-body-d, | |
| .ui-body-d input, | |
| .ui-body-d select, | |
| .ui-body-d textarea, | |
| .ui-body-d button { | |
| font-family: Helvetica, Arial, sans-serif; | |
| } | |
| .ui-body-d .ui-link-inherit { | |
| color: #333333; | |
| } | |
| .ui-body-d .ui-link { | |
| color: #2489CE; | |
| font-weight: bold; | |
| } | |
| .ui-btn-up-d { | |
| border: 1px solid #ccc; | |
| background: #fff; | |
| font-weight: bold; | |
| color: #444; | |
| text-shadow: 0 1px 1px #fff; | |
| } | |
| .ui-btn-up-d a.ui-link-inherit { | |
| color: #333; | |
| } | |
| .ui-btn-hover-d { | |
| border: 1px solid #aaa; | |
| background: #eeeeee; | |
| font-weight: bold; | |
| color: #222; | |
| cursor: pointer; | |
| text-shadow: 0 1px 1px #fff; | |
| background-image: -moz-linear-gradient(top, | |
| #fdfdfd, | |
| #eeeeee); | |
| background-image: -webkit-gradient(linear,left top,left bottom, | |
| color-stop(0, #fdfdfd), | |
| color-stop(1, #eeeeee)); | |
| -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#fdfdfd', EndColorStr='#eeeeee')"; | |
| } | |
| .ui-btn-hover-d a.ui-link-inherit { | |
| color: #222; | |
| } | |
| .ui-btn-down-d { | |
| border: 1px solid #aaaaaa; | |
| background: #ffffff; | |
| font-weight: bold; | |
| color: #111; | |
| text-shadow: 0 1px 1px #ffffff; | |
| background-image: -moz-linear-gradient(top, | |
| #eeeeee, | |
| #ffffff); | |
| background-image: -webkit-gradient(linear,left top,left bottom, | |
| color-stop(0, #eeeeee), | |
| color-stop(1, #ffffff)); | |
| -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#eeeeee', EndColorStr='#ffffff')"; | |
| } | |
| .ui-btn-down-d a.ui-link-inherit { | |
| color: #111; | |
| } | |
| .ui-btn-up-d, | |
| .ui-btn-hover-d, | |
| .ui-btn-down-d { | |
| font-family: Helvetica, Arial, sans-serif; | |
| text-decoration: none; | |
| } | |
| /* E | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-bar-e { | |
| border: 1px solid #F7C942; | |
| background: #fadb4e; | |
| color: #333; | |
| text-shadow: 0 1px 0 #fff; | |
| background-image: -moz-linear-gradient(top, | |
| #fceda7, | |
| #fadb4e); | |
| background-image: -webkit-gradient(linear,left top,left bottom, | |
| color-stop(0, #fceda7), | |
| color-stop(1, #fadb4e)); | |
| -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#fceda7', EndColorStr='#fadb4e')"; | |
| } | |
| .ui-bar-e, | |
| .ui-bar-e input, | |
| .ui-bar-e select, | |
| .ui-bar-e textarea, | |
| .ui-bar-d button { | |
| font-family: Helvetica, Arial, sans-serif; | |
| } | |
| .ui-bar-e .ui-link-inherit { | |
| color: #333; | |
| } | |
| .ui-bar-e .ui-link { | |
| color: #2489CE; | |
| font-weight: bold; | |
| } | |
| .ui-body-e { | |
| border: 1px solid #F7C942; | |
| color: #333333; | |
| text-shadow: 0 1px 0 #fff; | |
| background: #faeb9e; | |
| background-image: -moz-linear-gradient(top, | |
| #fff, | |
| #faeb9e); | |
| background-image: -webkit-gradient(linear,left top,left bottom, | |
| color-stop(0, #fff), | |
| color-stop(1, #faeb9e)); | |
| -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#ffffff', EndColorStr='#faeb9e')"; | |
| } | |
| .ui-body-e, | |
| .ui-body-e input, | |
| .ui-body-e select, | |
| .ui-body-e textarea, | |
| .ui-body-e button { | |
| font-family: Helvetica, Arial, sans-serif; | |
| } | |
| .ui-body-e .ui-link-inherit { | |
| color: #333333; | |
| } | |
| .ui-body-e .ui-link { | |
| color: #2489CE; | |
| font-weight: bold; | |
| } | |
| .ui-btn-up-e { | |
| border: 1px solid #F7C942; | |
| background: #fadb4e; | |
| font-weight: bold; | |
| color: #333; | |
| text-shadow: 0 1px 0 #fff; | |
| background-image: -moz-linear-gradient(top, | |
| #fceda7, | |
| #fadb4e); | |
| background-image: -webkit-gradient(linear,left top,left bottom, | |
| color-stop(0, #fceda7), | |
| color-stop(1, #fadb4e)); | |
| -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#fceda7', EndColorStr='#fadb4e')"; | |
| } | |
| .ui-btn-up-e a.ui-link-inherit { | |
| color: #333; | |
| } | |
| .ui-btn-hover-e { | |
| border: 1px solid #e79952; | |
| background: #fbe26f; | |
| font-weight: bold; | |
| color: #111; | |
| text-shadow: 0 1px 1px #fff; | |
| background-image: -moz-linear-gradient(top, | |
| #fcf0b5, | |
| #fbe26f); | |
| background-image: -webkit-gradient(linear,left top,left bottom, | |
| color-stop(0, #fcf0b5), | |
| color-stop(1, #fbe26f)); | |
| -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#fcf0b5', EndColorStr='#fbe26f')"; | |
| } | |
| .ui-btn-hover-e a.ui-link-inherit { | |
| color: #333; | |
| } | |
| .ui-btn-down-e { | |
| border: 1px solid #F7C942; | |
| background: #fceda7; | |
| font-weight: bold; | |
| color: #111; | |
| text-shadow: 0 1px 1px #ffffff; | |
| background-image: -moz-linear-gradient(top, | |
| #fadb4e, | |
| #fceda7); | |
| background-image: -webkit-gradient(linear,left top,left bottom, | |
| color-stop(0, #fadb4e), | |
| color-stop(1, #fceda7)); | |
| -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#fadb4e', EndColorStr='#fceda7')"; | |
| } | |
| .ui-btn-down-e a.ui-link-inherit { | |
| color: #333; | |
| } | |
| .ui-btn-up-e, | |
| .ui-btn-hover-e, | |
| .ui-btn-down-e { | |
| font-family: Helvetica, Arial, sans-serif; | |
| text-decoration: none; | |
| } | |
| /* links within "buttons" | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| a.ui-link-inherit { | |
| text-decoration: none !important; | |
| } | |
| /* Active class used as the "on" state across all themes | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-btn-active { | |
| border: 1px solid #155678; | |
| background: #4596ce; | |
| font-weight: bold; | |
| color: #fff; | |
| cursor: pointer; | |
| text-shadow: 0 -1px 1px #145072; | |
| text-decoration: none; | |
| background-image: -moz-linear-gradient(top, | |
| #85bae4, | |
| #5393c5); | |
| background-image: -webkit-gradient(linear,left top,left bottom, | |
| color-stop(0, #85bae4), | |
| color-stop(1, #5393c5)); | |
| -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#85bae4', EndColorStr='#5393c5')"; | |
| outline: none; | |
| } | |
| .ui-btn-active a.ui-link-inherit { | |
| color: #fff; | |
| } | |
| /* button inner top highlight | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-btn-inner { | |
| border-top: 1px solid #fff; | |
| border-color: rgba(255,255,255,.3); | |
| } | |
| /* corner rounding classes | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-corner-tl { | |
| -moz-border-radius-topleft: .6em; | |
| -webkit-border-top-left-radius: .6em; | |
| border-top-left-radius: .6em; | |
| } | |
| .ui-corner-tr { | |
| -moz-border-radius-topright: .6em; | |
| -webkit-border-top-right-radius: .6em; | |
| border-top-right-radius: .6em; | |
| } | |
| .ui-corner-bl { | |
| -moz-border-radius-bottomleft: .6em; | |
| -webkit-border-bottom-left-radius: .6em; | |
| border-bottom-left-radius: .6em; | |
| } | |
| .ui-corner-br { | |
| -moz-border-radius-bottomright: .6em; | |
| -webkit-border-bottom-right-radius: .6em; | |
| border-bottom-right-radius: .6em; | |
| } | |
| .ui-corner-top { | |
| -moz-border-radius-topleft: .6em; | |
| -webkit-border-top-left-radius: .6em; | |
| border-top-left-radius: .6em; | |
| -moz-border-radius-topright: .6em; | |
| -webkit-border-top-right-radius: .6em; | |
| border-top-right-radius: .6em; | |
| } | |
| .ui-corner-bottom { | |
| -moz-border-radius-bottomleft: .6em; | |
| -webkit-border-bottom-left-radius: .6em; | |
| border-bottom-left-radius: .6em; | |
| -moz-border-radius-bottomright: .6em; | |
| -webkit-border-bottom-right-radius: .6em; | |
| border-bottom-right-radius: .6em; | |
| } | |
| .ui-corner-right { | |
| -moz-border-radius-topright: .6em; | |
| -webkit-border-top-right-radius: .6em; | |
| border-top-right-radius: .6em; | |
| -moz-border-radius-bottomright: .6em; | |
| -webkit-border-bottom-right-radius: .6em; | |
| border-bottom-right-radius: .6em; | |
| } | |
| .ui-corner-left { | |
| -moz-border-radius-topleft: .6em; | |
| -webkit-border-top-left-radius: .6em; | |
| border-top-left-radius: .6em; | |
| -moz-border-radius-bottomleft: .6em; | |
| -webkit-border-bottom-left-radius: .6em; | |
| border-bottom-left-radius: .6em; | |
| } | |
| .ui-corner-all { | |
| -moz-border-radius: .6em; | |
| -webkit-border-radius: .6em; | |
| border-radius: .6em; | |
| } | |
| /* Interaction cues | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-disabled { | |
| opacity: .3; | |
| } | |
| .ui-disabled, | |
| .ui-disabled a { | |
| cursor: default; | |
| } | |
| /* Icons | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-icon { | |
| background: #666; | |
| background: rgba(0,0,0,.4); | |
| background-image: url(images/icons-18-white.png); | |
| background-repeat: no-repeat; | |
| -moz-border-radius: 9px; | |
| -webkit-border-radius: 9px; | |
| border-radius: 9px; | |
| } | |
| /* Alt icon color | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-icon-alt { | |
| background: #fff; | |
| background: rgba(255,255,255,.3); | |
| background-image: url(images/icons-18-black.png); | |
| background-repeat: no-repeat; | |
| } | |
| /* HD/"retina" sprite | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| @media only screen and (-webkit-min-device-pixel-ratio: 1.5), | |
| only screen and (min--moz-device-pixel-ratio: 1.5), | |
| only screen and (min-resolution: 240dpi) { | |
| .ui-icon-plus, .ui-icon-minus, .ui-icon-delete, .ui-icon-arrow-r, | |
| .ui-icon-arrow-l, .ui-icon-arrow-u, .ui-icon-arrow-d, .ui-icon-check, | |
| .ui-icon-gear, .ui-icon-refresh, .ui-icon-forward, .ui-icon-back, | |
| .ui-icon-grid, .ui-icon-star, .ui-icon-alert, .ui-icon-info, .ui-icon-home, .ui-icon-search, | |
| .ui-icon-checkbox-off, .ui-icon-checkbox-on, .ui-icon-radio-off, .ui-icon-radio-on { | |
| background-image: url(images/icons-36-white.png); | |
| -moz-background-size: 776px 18px; | |
| -o-background-size: 776px 18px; | |
| -webkit-background-size: 776px 18px; | |
| background-size: 776px 18px; | |
| } | |
| .ui-icon-alt { | |
| background-image: url(images/icons-36-black.png); | |
| } | |
| } | |
| /* plus minus */ | |
| .ui-icon-plus { | |
| background-position: -0 50%; | |
| } | |
| .ui-icon-minus { | |
| background-position: -36px 50%; | |
| } | |
| /* delete/close */ | |
| .ui-icon-delete { | |
| background-position: -72px 50%; | |
| } | |
| /* arrows */ | |
| .ui-icon-arrow-r { | |
| background-position: -108px 50%; | |
| } | |
| .ui-icon-arrow-l { | |
| background-position: -144px 50%; | |
| } | |
| .ui-icon-arrow-u { | |
| background-position: -180px 50%; | |
| } | |
| .ui-icon-arrow-d { | |
| background-position: -216px 50%; | |
| } | |
| /* misc */ | |
| .ui-icon-check { | |
| background-position: -252px 50%; | |
| } | |
| .ui-icon-gear { | |
| background-position: -288px 50%; | |
| } | |
| .ui-icon-refresh { | |
| background-position: -324px 50%; | |
| } | |
| .ui-icon-forward { | |
| background-position: -360px 50%; | |
| } | |
| .ui-icon-back { | |
| background-position: -396px 50%; | |
| } | |
| .ui-icon-grid { | |
| background-position: -432px 50%; | |
| } | |
| .ui-icon-star { | |
| background-position: -468px 50%; | |
| } | |
| .ui-icon-alert { | |
| background-position: -504px 50%; | |
| } | |
| .ui-icon-info { | |
| background-position: -540px 50%; | |
| } | |
| .ui-icon-home { | |
| background-position: -576px 50%; | |
| } | |
| .ui-icon-search { | |
| background-position: -612px 50%; | |
| } | |
| .ui-icon-checkbox-off { | |
| background-position: -684px 50%; | |
| } | |
| .ui-icon-checkbox-on { | |
| background-position: -648px 50%; | |
| } | |
| .ui-icon-radio-off { | |
| background-position: -756px 50%; | |
| } | |
| .ui-icon-radio-on { | |
| background-position: -720px 50%; | |
| } | |
| /* checks,radios */ | |
| .ui-icon-checkbox-off, | |
| .ui-icon-checkbox-on, | |
| .ui-icon-radio-off, | |
| .ui-icon-radio-on { | |
| background-color: transparent; | |
| -moz-border-radius: 0; | |
| -webkit-border-radius: 0; | |
| border-radius: 0; | |
| } | |
| .ui-icon-searchfield { | |
| background-image: url(images/icon-search-black.png); | |
| background-size: 16px 16px; | |
| } | |
| /* loading icon */ | |
| .ui-icon-loading { | |
| background-image: url(images/ajax-loader.png); | |
| width: 40px; | |
| height: 40px; | |
| -moz-border-radius: 20px; | |
| -webkit-border-radius: 20px; | |
| border-radius: 20px; | |
| background-size: 35px 35px; | |
| } | |
| /* Button corner classes | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-btn-corner-tl { | |
| -moz-border-radius-topleft: 1em; | |
| -webkit-border-top-left-radius: 1em; | |
| border-top-left-radius: 1em; | |
| } | |
| .ui-btn-corner-tr { | |
| -moz-border-radius-topright: 1em; | |
| -webkit-border-top-right-radius: 1em; | |
| border-top-right-radius: 1em; | |
| } | |
| .ui-btn-corner-bl { | |
| -moz-border-radius-bottomleft: 1em; | |
| -webkit-border-bottom-left-radius: 1em; | |
| border-bottom-left-radius: 1em; | |
| } | |
| .ui-btn-corner-br { | |
| -moz-border-radius-bottomright: 1em; | |
| -webkit-border-bottom-right-radius: 1em; | |
| border-bottom-right-radius: 1em; | |
| } | |
| .ui-btn-corner-top { | |
| -moz-border-radius-topleft: 1em; | |
| -webkit-border-top-left-radius: 1em; | |
| border-top-left-radius: 1em; | |
| -moz-border-radius-topright: 1em; | |
| -webkit-border-top-right-radius: 1em; | |
| border-top-right-radius: 1em; | |
| } | |
| .ui-btn-corner-bottom { | |
| -moz-border-radius-bottomleft: 1em; | |
| -webkit-border-bottom-left-radius: 1em; | |
| border-bottom-left-radius: 1em; | |
| -moz-border-radius-bottomright: 1em; | |
| -webkit-border-bottom-right-radius: 1em; | |
| border-bottom-right-radius: 1em; | |
| } | |
| .ui-btn-corner-right { | |
| -moz-border-radius-topright: 1em; | |
| -webkit-border-top-right-radius: 1em; | |
| border-top-right-radius: 1em; | |
| -moz-border-radius-bottomright: 1em; | |
| -webkit-border-bottom-right-radius: 1em; | |
| border-bottom-right-radius: 1em; | |
| } | |
| .ui-btn-corner-left { | |
| -moz-border-radius-topleft: 1em; | |
| -webkit-border-top-left-radius: 1em; | |
| border-top-left-radius: 1em; | |
| -moz-border-radius-bottomleft: 1em; | |
| -webkit-border-bottom-left-radius: 1em; | |
| border-bottom-left-radius: 1em; | |
| } | |
| .ui-btn-corner-all { | |
| -moz-border-radius: 1em; | |
| -webkit-border-radius: 1em; | |
| border-radius: 1em; | |
| } | |
| /* radius clip workaround for cleaning up corner trapping */ | |
| .ui-corner-tl, | |
| .ui-corner-tr, | |
| .ui-corner-bl, | |
| .ui-corner-br, | |
| .ui-corner-top, | |
| .ui-corner-bottom, | |
| .ui-corner-right, | |
| .ui-corner-left, | |
| .ui-corner-all, | |
| .ui-btn-corner-tl, | |
| .ui-btn-corner-tr, | |
| .ui-btn-corner-bl, | |
| .ui-btn-corner-br, | |
| .ui-btn-corner-top, | |
| .ui-btn-corner-bottom, | |
| .ui-btn-corner-right, | |
| .ui-btn-corner-left, | |
| .ui-btn-corner-all { | |
| -webkit-background-clip: padding-box; | |
| -moz-background-clip: padding-box; | |
| background-clip: padding-box; | |
| } | |
| /* Overlay / modal | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-overlay { | |
| background: #666; | |
| opacity: .5; | |
| filter: Alpha(Opacity=50); | |
| position: absolute; | |
| width: 100%; | |
| height: 100%; | |
| } | |
| .ui-overlay-shadow { | |
| -moz-box-shadow: 0px 0px 12px rgba(0,0,0,.6); | |
| -webkit-box-shadow: 0px 0px 12px rgba(0,0,0,.6); | |
| box-shadow: 0px 0px 12px rgba(0,0,0,.6); | |
| } | |
| .ui-shadow { | |
| -moz-box-shadow: 0px 1px 4px rgba(0,0,0,.3); | |
| -webkit-box-shadow: 0px 1px 4px rgba(0,0,0,.3); | |
| box-shadow: 0px 1px 4px rgba(0,0,0,.3); | |
| } | |
| .ui-bar-a .ui-shadow, | |
| .ui-bar-b .ui-shadow , | |
| .ui-bar-c .ui-shadow { | |
| -moz-box-shadow: 0px 1px 0 rgba(255,255,255,.3); | |
| -webkit-box-shadow: 0px 1px 0 rgba(255,255,255,.3); | |
| box-shadow: 0px 1px 0 rgba(255,255,255,.3); | |
| } | |
| .ui-shadow-inset { | |
| -moz-box-shadow: inset 0px 1px 4px rgba(0,0,0,.2); | |
| -webkit-box-shadow: inset 0px 1px 4px rgba(0,0,0,.2); | |
| box-shadow: inset 0px 1px 4px rgba(0,0,0,.2); | |
| } | |
| .ui-icon-shadow { | |
| -moz-box-shadow: 0px 1px 0 rgba(255,255,255,.4); | |
| -webkit-box-shadow: 0px 1px 0 rgba(255,255,255,.4); | |
| box-shadow: 0px 1px 0 rgba(255,255,255,.4); | |
| } | |
| /* Focus state - set here for specificity | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-focus { | |
| -moz-box-shadow: 0px 0px 12px #387bbe; | |
| -webkit-box-shadow: 0px 0px 12px #387bbe; | |
| box-shadow: 0px 0px 12px #387bbe; | |
| } | |
| /* unset box shadow in browsers that don't do it right | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-mobile-nosupport-boxshadow * { | |
| -moz-box-shadow: none !important; | |
| -webkit-box-shadow: none !important; | |
| box-shadow: none !important; | |
| } | |
| /* ...and bring back focus */ | |
| .ui-mobile-nosupport-boxshadow .ui-focus { | |
| outline-width: 2px; | |
| }/* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses. | |
| * Note: Code is in draft form and is subject to change | |
| */ | |
| /* some unsets - more probably needed */ | |
| .ui-mobile, .ui-mobile body { height: 100%; } | |
| .ui-mobile fieldset, .ui-page { padding: 0; margin: 0; } | |
| .ui-mobile a img, .ui-mobile fieldset { border: 0; } | |
| /* responsive page widths */ | |
| .ui-mobile-viewport { margin: 0; overflow-x: hidden; -webkit-text-size-adjust: none; -ms-text-size-adjust:none; -webkit-tap-highlight-color: rgba(0, 0, 0, 0); } | |
| /* "page" containers - full-screen views, one should always be in view post-pageload */ | |
| .ui-mobile [data-role=page], .ui-mobile [data-role=dialog], .ui-page { top: 0; left: 0; width: 100%; min-height: 100%; position: absolute; display: none; border: 0; } | |
| .ui-mobile .ui-page-active { display: block; overflow: visible; } | |
| /*orientations from js are available */ | |
| .portrait, | |
| .portrait .ui-page { min-height: 420px; } | |
| .landscape, | |
| .landscape .ui-page { min-height: 300px; } | |
| /* loading screen */ | |
| .ui-loading .ui-mobile-viewport { overflow: hidden !important; } | |
| .ui-loading .ui-loader { display: block; } | |
| .ui-loading .ui-page { overflow: hidden; } | |
| .ui-loader { display: none; position: absolute; opacity: .85; z-index: 100; left: 50%; width: 200px; margin-left: -130px; margin-top: -35px; padding: 10px 30px; } | |
| .ui-loader h1 { font-size: 15px; text-align: center; } | |
| .ui-loader .ui-icon { position: static; display: block; opacity: .9; margin: 0 auto; width: 35px; height: 35px; background-color: transparent; } | |
| /*fouc*/ | |
| .ui-mobile-rendering > * { visibility: hidden; } | |
| /*headers, content panels*/ | |
| .ui-bar, .ui-body { position: relative; padding: .4em 15px; overflow: hidden; display: block; clear:both; } | |
| .ui-bar { font-size: 16px; margin: 0; } | |
| .ui-bar h1, .ui-bar h2, .ui-bar h3, .ui-bar h4, .ui-bar h5, .ui-bar h6 { margin: 0; padding: 0; font-size: 16px; display: inline-block; } | |
| .ui-header, .ui-footer { display: block; } | |
| .ui-page .ui-header, .ui-page .ui-footer { position: relative; } | |
| .ui-header .ui-btn-left { position: absolute; left: 10px; top: .4em; } | |
| .ui-header .ui-btn-right { position: absolute; right: 10px; top: .4em; } | |
| .ui-header .ui-title, .ui-footer .ui-title { min-height: 1.1em; text-align: center; font-size: 16px; display: block; margin: .6em 90px .8em; padding: 0; text-overflow: ellipsis; overflow: hidden; white-space: nowrap; outline: 0 !important; } | |
| /*content area*/ | |
| .ui-content { border-width: 0; overflow: visible; overflow-x: hidden; padding: 15px; } | |
| .ui-page-fullscreen .ui-content { padding:0; } | |
| /* icons sizing */ | |
| .ui-icon { width: 18px; height: 18px; } | |
| /* fullscreen class on ui-content div */ | |
| .ui-fullscreen { } | |
| .ui-fullscreen img { max-width: 100%; } | |
| /* non-js content hiding */ | |
| .ui-nojs { position: absolute; left: -9999px; } | |
| /* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| .spin { | |
| -webkit-transform: rotate(360deg); | |
| -webkit-animation-name: spin; | |
| -webkit-animation-duration: 1s; | |
| -webkit-animation-iteration-count: infinite; | |
| } | |
| @-webkit-keyframes spin { | |
| from {-webkit-transform: rotate(0deg);} | |
| to {-webkit-transform: rotate(360deg);} | |
| } | |
| /* Transitions from jQtouch (with small modifications): http://www.jqtouch.com/ | |
| Built by David Kaneda and maintained by Jonathan Stark. | |
| */ | |
| .in, .out { | |
| -webkit-animation-timing-function: ease-in-out; | |
| -webkit-animation-duration: 350ms; | |
| } | |
| .slide.in { | |
| -webkit-transform: translateX(0); | |
| -webkit-animation-name: slideinfromright; | |
| } | |
| .slide.out { | |
| -webkit-transform: translateX(-100%); | |
| -webkit-animation-name: slideouttoleft; | |
| } | |
| .slide.in.reverse { | |
| -webkit-transform: translateX(0); | |
| -webkit-animation-name: slideinfromleft; | |
| } | |
| .slide.out.reverse { | |
| -webkit-transform: translateX(100%); | |
| -webkit-animation-name: slideouttoright; | |
| } | |
| .slideup.in { | |
| -webkit-transform: translateY(0); | |
| -webkit-animation-name: slideinfrombottom; | |
| z-index: 10; | |
| } | |
| .slideup.out { | |
| -webkit-animation-name: dontmove; | |
| z-index: 0; | |
| } | |
| .slideup.out.reverse { | |
| -webkit-transform: translateY(100%); | |
| z-index: 10; | |
| -webkit-animation-name: slideouttobottom; | |
| } | |
| .slideup.in.reverse { | |
| z-index: 0; | |
| -webkit-animation-name: dontmove; | |
| } | |
| .slidedown.in { | |
| -webkit-transform: translateY(0); | |
| -webkit-animation-name: slideinfromtop; | |
| z-index: 10; | |
| } | |
| .slidedown.out { | |
| -webkit-animation-name: dontmove; | |
| z-index: 0; | |
| } | |
| .slidedown.out.reverse { | |
| -webkit-transform: translateY(-100%); | |
| z-index: 10; | |
| -webkit-animation-name: slideouttotop; | |
| } | |
| .slidedown.in.reverse { | |
| z-index: 0; | |
| -webkit-animation-name: dontmove; | |
| } | |
| @-webkit-keyframes slideinfromright { | |
| from { -webkit-transform: translateX(100%); } | |
| to { -webkit-transform: translateX(0); } | |
| } | |
| @-webkit-keyframes slideinfromleft { | |
| from { -webkit-transform: translateX(-100%); } | |
| to { -webkit-transform: translateX(0); } | |
| } | |
| @-webkit-keyframes slideouttoleft { | |
| from { -webkit-transform: translateX(0); } | |
| to { -webkit-transform: translateX(-100%); } | |
| } | |
| @-webkit-keyframes slideouttoright { | |
| from { -webkit-transform: translateX(0); } | |
| to { -webkit-transform: translateX(100%); } | |
| } | |
| @-webkit-keyframes slideinfromtop { | |
| from { -webkit-transform: translateY(-100%); } | |
| to { -webkit-transform: translateY(0); } | |
| } | |
| @-webkit-keyframes slideinfrombottom { | |
| from { -webkit-transform: translateY(100%); } | |
| to { -webkit-transform: translateY(0); } | |
| } | |
| @-webkit-keyframes slideouttobottom { | |
| from { -webkit-transform: translateY(0); } | |
| to { -webkit-transform: translateY(100%); } | |
| } | |
| @-webkit-keyframes slideouttotop { | |
| from { -webkit-transform: translateY(0); } | |
| to { -webkit-transform: translateY(-100%); } | |
| } | |
| @-webkit-keyframes fadein { | |
| from { opacity: 0; } | |
| to { opacity: 1; } | |
| } | |
| @-webkit-keyframes fadeout { | |
| from { opacity: 1; } | |
| to { opacity: 0; } | |
| } | |
| .fade.in { | |
| opacity: 1; | |
| z-index: 10; | |
| -webkit-animation-name: fadein; | |
| } | |
| .fade.out { | |
| z-index: 0; | |
| -webkit-animation-name: fadeout; | |
| } | |
| /* The properties in this rule are only necessary for the 'flip' transition. | |
| * We need specify the perspective to create a projection matrix. This will add | |
| * some depth as the element flips. The depth number represents the distance of | |
| * the viewer from the z-plane. According to the CSS3 spec, 1000 is a moderate | |
| * value. | |
| */ | |
| .viewport-flip { | |
| -webkit-perspective: 1000; | |
| position: absolute; | |
| } | |
| .ui-mobile-viewport-transitioning, | |
| .ui-mobile-viewport-transitioning .ui-page { | |
| width: 100%; | |
| height: 100%; | |
| overflow: hidden; | |
| } | |
| .flip { | |
| -webkit-animation-duration: .65s; | |
| -webkit-backface-visibility:hidden; | |
| -webkit-transform:translateX(0); /* Needed to work around an iOS 3.1 bug that causes listview thumbs to disappear when -webkit-visibility:hidden is used. */ | |
| } | |
| .flip.in { | |
| -webkit-transform: rotateY(0) scale(1); | |
| -webkit-animation-name: flipinfromleft; | |
| } | |
| .flip.out { | |
| -webkit-transform: rotateY(-180deg) scale(.8); | |
| -webkit-animation-name: flipouttoleft; | |
| } | |
| /* Shake it all about */ | |
| .flip.in.reverse { | |
| -webkit-transform: rotateY(0) scale(1); | |
| -webkit-animation-name: flipinfromright; | |
| } | |
| .flip.out.reverse { | |
| -webkit-transform: rotateY(180deg) scale(.8); | |
| -webkit-animation-name: flipouttoright; | |
| } | |
| @-webkit-keyframes flipinfromright { | |
| from { -webkit-transform: rotateY(-180deg) scale(.8); } | |
| to { -webkit-transform: rotateY(0) scale(1); } | |
| } | |
| @-webkit-keyframes flipinfromleft { | |
| from { -webkit-transform: rotateY(180deg) scale(.8); } | |
| to { -webkit-transform: rotateY(0) scale(1); } | |
| } | |
| @-webkit-keyframes flipouttoleft { | |
| from { -webkit-transform: rotateY(0) scale(1); } | |
| to { -webkit-transform: rotateY(-180deg) scale(.8); } | |
| } | |
| @-webkit-keyframes flipouttoright { | |
| from { -webkit-transform: rotateY(0) scale(1); } | |
| to { -webkit-transform: rotateY(180deg) scale(.8); } | |
| } | |
| /* Hackish, but reliable. */ | |
| @-webkit-keyframes dontmove { | |
| from { opacity: 1; } | |
| to { opacity: 1; } | |
| } | |
| .pop { | |
| -webkit-transform-origin: 50% 50%; | |
| } | |
| .pop.in { | |
| -webkit-transform: scale(1); | |
| opacity: 1; | |
| -webkit-animation-name: popin; | |
| z-index: 10; | |
| } | |
| .pop.out.reverse { | |
| -webkit-transform: scale(.2); | |
| opacity: 0; | |
| -webkit-animation-name: popout; | |
| z-index: 10; | |
| } | |
| .pop.in.reverse { | |
| z-index: 0; | |
| -webkit-animation-name: dontmove; | |
| } | |
| @-webkit-keyframes popin { | |
| from { | |
| -webkit-transform: scale(.2); | |
| opacity: 0; | |
| } | |
| to { | |
| -webkit-transform: scale(1); | |
| opacity: 1; | |
| } | |
| } | |
| @-webkit-keyframes popout { | |
| from { | |
| -webkit-transform: scale(1); | |
| opacity: 1; | |
| } | |
| to { | |
| -webkit-transform: scale(.2); | |
| opacity: 0; | |
| } | |
| }/* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| /* content configurations. */ | |
| .ui-grid-a, .ui-grid-b, .ui-grid-c, .ui-grid-d { overflow: hidden; } | |
| .ui-block-a, .ui-block-b, .ui-block-c, .ui-block-d, .ui-block-e { margin: 0; padding: 0; border: 0; float: left; min-height:1px;} | |
| /* grid solo: 100 - single item fallback */ | |
| .ui-grid-solo .ui-block-a { width: 100%; float: none; } | |
| /* grid a: 50/50 */ | |
| .ui-grid-a .ui-block-a, .ui-grid-a .ui-block-b { width: 50%; } | |
| .ui-grid-a .ui-block-a { clear: left; } | |
| /* grid b: 33/33/33 */ | |
| .ui-grid-b .ui-block-a, .ui-grid-b .ui-block-b, .ui-grid-b .ui-block-c { width: 33.333%; } | |
| .ui-grid-b .ui-block-a { clear: left; } | |
| /* grid c: 25/25/25/25 */ | |
| .ui-grid-c .ui-block-a, .ui-grid-c .ui-block-b, .ui-grid-c .ui-block-c, .ui-grid-c .ui-block-d { width: 25%; } | |
| .ui-grid-c .ui-block-a { clear: left; } | |
| /* grid d: 20/20/20/20/20 */ | |
| .ui-grid-d .ui-block-a, .ui-grid-d .ui-block-b, .ui-grid-d .ui-block-c, .ui-grid-d .ui-block-d, .ui-grid-d .ui-block-e { width: 20%; } | |
| .ui-grid-d .ui-block-a { clear: left; } | |
| /* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| /* fixed page header & footer configuration */ | |
| .ui-header, .ui-footer, .ui-page-fullscreen .ui-header, .ui-page-fullscreen .ui-footer { position: absolute; overflow: hidden; width: 100%; border-left-width: 0; border-right-width: 0; } | |
| .ui-header-fixed, .ui-footer-fixed { | |
| z-index: 1000; | |
| -webkit-transform: translateZ(0); /* Force header/footer rendering to go through the same rendering pipeline as native page scrolling. */ | |
| } | |
| .ui-footer-duplicate, .ui-page-fullscreen .ui-fixed-inline { display: none; } | |
| .ui-page-fullscreen .ui-header, .ui-page-fullscreen .ui-footer { opacity: .9; } | |
| /* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| .ui-navbar { overflow: hidden; } | |
| .ui-navbar ul, .ui-navbar-expanded ul { list-style:none; padding: 0; margin: 0; position: relative; display: block; border: 0;} | |
| .ui-navbar-collapsed ul { float: left; width: 75%; margin-right: -2px; } | |
| .ui-navbar-collapsed .ui-navbar-toggle { float: left; width: 25%; } | |
| .ui-navbar li.ui-navbar-truncate { position: absolute; left: -9999px; top: -9999px; } | |
| .ui-navbar li .ui-btn, .ui-navbar .ui-navbar-toggle .ui-btn { display: block; font-size: 12px; text-align: center; margin: 0; border-right-width: 0; } | |
| .ui-navbar li .ui-btn { margin-right: -1px; } | |
| .ui-navbar li .ui-btn:last-child { margin-right: 0; } | |
| .ui-header .ui-navbar li .ui-btn, .ui-header .ui-navbar .ui-navbar-toggle .ui-btn, | |
| .ui-footer .ui-navbar li .ui-btn, .ui-footer .ui-navbar .ui-navbar-toggle .ui-btn { border-top-width: 0; border-bottom-width: 0; } | |
| .ui-navbar .ui-btn-inner { padding-left: 2px; padding-right: 2px; } | |
| .ui-navbar-noicons li .ui-btn .ui-btn-inner, .ui-navbar-noicons .ui-navbar-toggle .ui-btn-inner { padding-top: .8em; padding-bottom: .9em; } | |
| /*expanded page styles*/ | |
| .ui-navbar-expanded .ui-btn { margin: 0; font-size: 14px; } | |
| .ui-navbar-expanded .ui-btn-inner { padding-left: 5px; padding-right: 5px; } | |
| .ui-navbar-expanded .ui-btn-icon-top .ui-btn-inner { padding: 45px 5px 15px; text-align: center; } | |
| .ui-navbar-expanded .ui-btn-icon-top .ui-icon { top: 15px; } | |
| .ui-navbar-expanded .ui-btn-icon-bottom .ui-btn-inner { padding: 15px 5px 45px; text-align: center; } | |
| .ui-navbar-expanded .ui-btn-icon-bottom .ui-icon { bottom: 15px; } | |
| .ui-navbar-expanded li .ui-btn .ui-btn-inner { min-height: 2.5em; } | |
| .ui-navbar-expanded .ui-navbar-noicons .ui-btn .ui-btn-inner { padding-top: 1.8em; padding-bottom: 1.9em; } | |
| /* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| .ui-btn { display: block; text-align: center; cursor:pointer; position: relative; margin: .5em 5px; padding: 0; } | |
| .ui-btn:focus, .ui-btn:active { outline: none; } | |
| .ui-header .ui-btn, .ui-footer .ui-btn, .ui-bar .ui-btn { display: inline-block; font-size: 13px; margin: 0; } | |
| .ui-btn-inline { display: inline-block; } | |
| .ui-btn-inner { padding: .6em 25px; display: block; text-overflow: ellipsis; overflow: hidden; white-space: nowrap; position: relative; } | |
| .ui-header .ui-btn-inner, .ui-footer .ui-btn-inner, .ui-bar .ui-btn-inner { padding: .4em 8px .5em; } | |
| .ui-btn-icon-notext { display: inline-block; width: 20px; height: 20px; padding: 2px 1px 2px 3px; text-indent: -9999px; } | |
| .ui-btn-icon-notext .ui-btn-inner { padding: 0; } | |
| .ui-btn-icon-notext .ui-btn-text { position: absolute; left: -999px; } | |
| .ui-btn-icon-left .ui-btn-inner { padding-left: 33px; } | |
| .ui-header .ui-btn-icon-left .ui-btn-inner, | |
| .ui-footer .ui-btn-icon-left .ui-btn-inner, | |
| .ui-bar .ui-btn-icon-left .ui-btn-inner { padding-left: 27px; } | |
| .ui-btn-icon-right .ui-btn-inner { padding-right: 33px; } | |
| .ui-header .ui-btn-icon-right .ui-btn-inner, | |
| .ui-footer .ui-btn-icon-right .ui-btn-inner, | |
| .ui-bar .ui-btn-icon-right .ui-btn-inner { padding-right: 27px; } | |
| .ui-btn-icon-top .ui-btn-inner { padding-top: 33px; } | |
| .ui-header .ui-btn-icon-top .ui-btn-inner, | |
| .ui-footer .ui-btn-icon-top .ui-btn-inner, | |
| .ui-bar .ui-btn-icon-top .ui-btn-inner { padding-top: 27px; } | |
| .ui-btn-icon-bottom .ui-btn-inner { padding-bottom: 33px; } | |
| .ui-header .ui-btn-icon-bottom .ui-btn-inner, | |
| .ui-footer .ui-btn-icon-bottom .ui-btn-inner, | |
| .ui-bar .ui-btn-icon-bottom .ui-btn-inner { padding-bottom: 27px; } | |
| /*btn icon positioning*/ | |
| .ui-btn-icon-notext .ui-icon { display: block; } | |
| .ui-btn-icon-left .ui-icon, .ui-btn-icon-right .ui-icon { position: absolute; top: 50%; margin-top: -9px; } | |
| .ui-btn-icon-top .ui-icon, .ui-btn-icon-bottom .ui-icon { position: absolute; left: 50%; margin-left: -9px; } | |
| .ui-btn-icon-left .ui-icon { left: 10px; } | |
| .ui-btn-icon-right .ui-icon {right: 10px; } | |
| .ui-header .ui-btn-icon-left .ui-icon, | |
| .ui-footer .ui-btn-icon-left .ui-icon, | |
| .ui-bar .ui-btn-icon-left .ui-icon { left: 4px; } | |
| .ui-header .ui-btn-icon-right .ui-icon, | |
| .ui-footer .ui-btn-icon-right .ui-icon, | |
| .ui-bar .ui-btn-icon-right .ui-icon { right: 4px; } | |
| .ui-header .ui-btn-icon-top .ui-icon, | |
| .ui-footer .ui-btn-icon-top .ui-icon, | |
| .ui-bar .ui-btn-icon-top .ui-icon { top: 4px; } | |
| .ui-header .ui-btn-icon-bottom .ui-icon, | |
| .ui-footer .ui-btn-icon-bottom .ui-icon, | |
| .ui-bar .ui-btn-icon-bottom .ui-icon { bottom: 4px; } | |
| .ui-btn-icon-top .ui-icon { top: 5px; } | |
| .ui-btn-icon-bottom .ui-icon { bottom: 5px; } | |
| /*hiding native button,inputs */ | |
| .ui-btn-hidden { position: absolute; top: 0; left: 0; width: 100%; height: 100%; -webkit-appearance: button; opacity: 0; cursor: pointer; -ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=0)"; filter: alpha(opacity=0); background: transparent; } | |
| /* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| .ui-collapsible-contain { margin: .5em 0; } | |
| .ui-collapsible-heading { font-size: 16px; display: block; margin: 0 -8px; padding: 0; border-width: 0 0 1px 0; position: relative; } | |
| .ui-collapsible-heading a { text-align: left; margin: 0; } | |
| .ui-collapsible-heading a .ui-btn-inner { padding-left: 40px; } | |
| .ui-collapsible-heading a span.ui-btn { position: absolute; left: 6px; top: 50%; margin: -12px 0 0 0; width: 20px; height: 20px; padding: 1px 0px 1px 2px; text-indent: -9999px; } | |
| .ui-collapsible-heading a span.ui-btn .ui-btn-inner { padding: 10px 0; } | |
| .ui-collapsible-heading a span.ui-btn .ui-icon { left: 0; margin-top: -10px; } | |
| .ui-collapsible-heading-status { position:absolute; left:-9999px; } | |
| .ui-collapsible-content { display: block; padding: 10px 0 10px 8px; } | |
| .ui-collapsible-content-collapsed { display: none; } | |
| .ui-collapsible-set { margin: .5em 0; } | |
| .ui-collapsible-set .ui-collapsible-contain { margin: -1px 0 0; } | |
| /* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| .ui-controlgroup, fieldset.ui-controlgroup { padding: 0; margin: .5em 0 1em; } | |
| .ui-bar .ui-controlgroup { margin: 0 .3em; } | |
| .ui-controlgroup-label { font-size: 16px; line-height: 1.4; font-weight: normal; margin: 0 0 .3em; } | |
| .ui-controlgroup-controls { display: block; width: 95%;} | |
| .ui-controlgroup li { list-style: none; } | |
| .ui-controlgroup-vertical .ui-btn, | |
| .ui-controlgroup-vertical .ui-checkbox, .ui-controlgroup-vertical .ui-radio { margin: 0; border-bottom-width: 0; } | |
| .ui-controlgroup-vertical .ui-controlgroup-last { border-bottom-width: 1px; } | |
| .ui-controlgroup-horizontal { padding: 0; } | |
| .ui-controlgroup-horizontal .ui-btn, | |
| .ui-controlgroup-horizontal .ui-checkbox, .ui-controlgroup-horizontal .ui-radio { display: inline-block; margin: 0 -5px 0 0; } | |
| .ui-controlgroup-horizontal .ui-checkbox, .ui-controlgroup-horizontal .ui-radio { display: inline; } | |
| .ui-controlgroup-horizontal .ui-checkbox .ui-btn, .ui-controlgroup-horizontal .ui-radio .ui-btn, | |
| .ui-controlgroup-horizontal .ui-checkbox:last-child, .ui-controlgroup-horizontal .ui-radio:last-child { margin-right: 0; } | |
| .ui-controlgroup-horizontal .ui-controlgroup-last { margin-right: 0; } | |
| .ui-controlgroup .ui-checkbox label, .ui-controlgroup .ui-radio label { font-size: 16px; } | |
| /* conflicts with listview.. | |
| .ui-controlgroup .ui-btn-icon-notext { width: 30px; height: 30px; text-indent: -9999px; } | |
| .ui-controlgroup .ui-btn-icon-notext .ui-btn-inner { padding: 5px 6px 5px 5px; } | |
| */ | |
| @media all and (min-width: 450px){ | |
| .ui-controlgroup-label { vertical-align: top; display: inline-block; width: 20%; margin: 0 2% 0 0; } | |
| .ui-controlgroup-controls { width: 60%; display: inline-block; } | |
| } /* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| .ui-dialog { min-height: 480px; } | |
| .ui-dialog .ui-header, .ui-dialog .ui-content, .ui-dialog .ui-footer { margin: 15px; position: relative; } | |
| .ui-dialog .ui-header, .ui-dialog .ui-footer { z-index: 10; width: auto; } | |
| .ui-dialog .ui-content, .ui-dialog .ui-footer { margin-top: -15px; }/* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| .ui-checkbox, .ui-radio { position:relative; margin: .2em 0 .5em; z-index: 1; } | |
| .ui-checkbox .ui-btn, .ui-radio .ui-btn { margin: 0; text-align: left; z-index: 2; } | |
| .ui-checkbox .ui-btn-inner, .ui-radio .ui-btn-inner { white-space: normal; } | |
| .ui-checkbox .ui-btn-icon-left .ui-btn-inner,.ui-radio .ui-btn-icon-left .ui-btn-inner { padding-left: 45px; } | |
| .ui-checkbox .ui-btn-icon-right .ui-btn-inner, .ui-radio .ui-btn-icon-right .ui-btn-inner { padding-right: 45px; } | |
| .ui-checkbox .ui-icon, .ui-radio .ui-icon { top: 1.1em; } | |
| .ui-checkbox .ui-btn-icon-left .ui-icon, .ui-radio .ui-btn-icon-left .ui-icon {left: 15px; } | |
| .ui-checkbox .ui-btn-icon-right .ui-icon, .ui-radio .ui-btn-icon-right .ui-icon {right: 15px; } | |
| /* input, label positioning */ | |
| .ui-checkbox input,.ui-radio input { position:absolute; left:20px; top:50%; width: 10px; height: 10px; margin:-5px 0 0 0; outline: 0 !important; z-index: 1; }/* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| .ui-field-contain { background: none; padding: 1.5em 0; margin: 0; border-bottom-width: 1px; overflow: visible; } | |
| .ui-field-contain:first-child { border-top-width: 0; } | |
| @media all and (min-width: 450px){ | |
| .ui-field-contain { border-width: 0; padding: 0; margin: 1em 0; } | |
| } /* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| .ui-select { display: block; position: relative; } | |
| .ui-select select { position: absolute; left: -9999px; top: -9999px; } | |
| .ui-select .ui-btn { overflow: hidden; } | |
| .ui-select .ui-btn select { cursor: pointer; -webkit-appearance: button; left: 0; top:0; width: 100%; height: 100%; opacity: 0; -ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=0)"; filter: alpha(opacity=0); } | |
| @-moz-document url-prefix() {.ui-select .ui-btn select { opacity: 0.0001; }} | |
| .ui-select .ui-btn select.ui-select-nativeonly { opacity: 1; text-indent: 0; } | |
| .ui-select .ui-btn-icon-right .ui-btn-inner { padding-right: 45px; } | |
| .ui-select .ui-btn-icon-right .ui-icon { right: 15px; } | |
| /* labels */ | |
| label.ui-select { font-size: 16px; line-height: 1.4; font-weight: normal; margin: 0 0 .3em; display: block; } | |
| /*listbox*/ | |
| .ui-select .ui-btn-text, .ui-selectmenu .ui-btn-text { display: inline-block; min-height: 1em; } | |
| .ui-select .ui-btn-text { text-overflow: ellipsis; overflow: hidden; display: block;} | |
| .ui-selectmenu { position: absolute; padding: 0; z-index: 100 !important; width: 80%; max-width: 350px; padding: 6px; } | |
| .ui-selectmenu .ui-listview { margin: 0; } | |
| .ui-selectmenu .ui-btn.ui-li-divider { cursor: default; } | |
| .ui-selectmenu-hidden { top: -9999px; left: -9999px; } | |
| .ui-selectmenu-screen { position: absolute; top: 0; left: 0; width: 100%; height: 100%; z-index: 99; } | |
| .ui-screen-hidden, .ui-selectmenu-list .ui-li .ui-icon { display: none; } | |
| .ui-selectmenu-list .ui-li .ui-icon { display: block; } | |
| .ui-li.ui-selectmenu-placeholder { display: none; } | |
| .ui-selectmenu .ui-header .ui-title { margin: 0.6em 46px 0.8em; } | |
| @media all and (min-width: 450px){ | |
| label.ui-select { display: inline-block; width: 20%; margin: 0 2% 0 0; } | |
| .ui-select { width: 60%; display: inline-block; } | |
| } | |
| /* when no placeholder is defined in a multiple select, the header height doesn't even extend past the close button. this shim's content in there */ | |
| .ui-selectmenu .ui-header h1:after { content: '.'; visibility: hidden; }/* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| label.ui-input-text { font-size: 16px; line-height: 1.4; display: block; font-weight: normal; margin: 0 0 .3em; } | |
| input.ui-input-text, textarea.ui-input-text { background-image: none; padding: .4em; line-height: 1.4; font-size: 16px; display: block; width: 95%; } | |
| input.ui-input-text { -webkit-appearance: none; } | |
| textarea.ui-input-text { height: 50px; -webkit-transition: height 200ms linear; -moz-transition: height 200ms linear; -o-transition: height 200ms linear; transition: height 200ms linear; } | |
| .ui-input-search { padding: 0 30px; width: 77%; background-position: 8px 50%; background-repeat: no-repeat; position: relative; } | |
| .ui-input-search input.ui-input-text { border: none; width: 98%; padding: .4em 0; margin: 0; display: block; background: transparent none; outline: 0 !important; } | |
| .ui-input-search .ui-input-clear { position: absolute; right: 0; top: 50%; margin-top: -14px; } | |
| .ui-input-search .ui-input-clear-hidden { display: none; } | |
| /* orientation adjustments - incomplete!*/ | |
| @media all and (min-width: 450px){ | |
| label.ui-input-text { vertical-align: top; display: inline-block; width: 20%; margin: 0 2% 0 0 } | |
| input.ui-input-text, | |
| textarea.ui-input-text, | |
| .ui-input-search { width: 60%; display: inline-block; } | |
| .ui-input-search { width: 50%; } | |
| .ui-input-search input.ui-input-text { width: 98%; /*echos rule from above*/ } | |
| }/* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| .ui-listview { margin: 0; counter-reset: listnumbering; } | |
| .ui-content .ui-listview { margin: -15px; } | |
| .ui-content .ui-listview-inset { margin: 1em 0; } | |
| .ui-listview, .ui-li { list-style:none; padding:0; } | |
| .ui-li, .ui-li.ui-field-contain { display: block; margin:0; position: relative; overflow: visible; text-align: left; border-width: 0; border-top-width: 1px; } | |
| .ui-li .ui-btn-text a.ui-link-inherit { text-overflow: ellipsis; overflow: hidden; white-space: nowrap; } | |
| .ui-li-divider, .ui-li-static { padding: .5em 15px; font-size: 14px; font-weight: bold; } | |
| .ui-li-divider { counter-reset: listnumbering; } | |
| ol.ui-listview .ui-link-inherit:before, ol.ui-listview .ui-li-static:before, .ui-li-dec { font-size: .8em; display: inline-block; padding-right: .3em; font-weight: normal;counter-increment: listnumbering; content: counter(listnumbering) ". "; } | |
| ol.ui-listview .ui-li-jsnumbering:before { content: "" !important; } /* to avoid chance of duplication */ | |
| .ui-listview-inset .ui-li { border-right-width: 1px; border-left-width: 1px; } | |
| .ui-li:last-child, .ui-li.ui-field-contain:last-child { border-bottom-width: 1px; } | |
| .ui-li>.ui-btn-inner { display: block; position: relative; padding: 0; } | |
| .ui-li .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li { padding: .7em 75px .7em 15px; display: block; } | |
| .ui-li-has-thumb .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li-has-thumb { min-height: 60px; padding-left: 100px; } | |
| .ui-li-has-icon .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li-has-icon { min-height: 20px; padding-left: 40px; } | |
| .ui-li-heading { font-size: 16px; font-weight: bold; display: block; margin: .6em 0; text-overflow: ellipsis; overflow: hidden; white-space: nowrap; } | |
| .ui-li-desc { font-size: 12px; font-weight: normal; display: block; margin: -.5em 0 .6em; text-overflow: ellipsis; overflow: hidden; white-space: nowrap; } | |
| .ui-li-thumb, .ui-li-icon { position: absolute; left: 1px; top: 0; max-height: 80px; max-width: 80px; } | |
| .ui-li-icon { max-height: 40px; max-width: 40px; left: 10px; top: .9em; } | |
| .ui-li-thumb, .ui-li-icon, .ui-li-content { float: left; margin-right: 10px; } | |
| .ui-li-aside { float: right; width: 50%; text-align: right; margin: .3em 0; } | |
| @media all and (min-width: 480px){ | |
| .ui-li-aside { width: 45%; } | |
| } | |
| .ui-li-divider { cursor: default; } | |
| .ui-li-has-alt .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li-has-alt { padding-right: 95px; } | |
| .ui-li-count { position: absolute; font-size: 11px; font-weight: bold; padding: .2em .5em; top: 50%; margin-top: -.9em; right: 38px; } | |
| .ui-li-divider .ui-li-count, .ui-li-static .ui-li-count { right: 10px; } | |
| .ui-li-has-alt .ui-li-count { right: 55px; } | |
| .ui-li-link-alt { position: absolute; width: 40px; height: 100%; border-width: 0; border-left-width: 1px; top: 0; right: 0; margin: 0; padding: 0; } | |
| .ui-li-link-alt .ui-btn { overflow: hidden; position: absolute; right: 8px; top: 50%; margin: -11px 0 0 0; border-bottom-width: 1px; } | |
| .ui-li-link-alt .ui-btn-inner { padding: 0; position: static; } | |
| .ui-li-link-alt .ui-btn .ui-icon { right: 50%; margin-right: -9px; } | |
| .ui-listview-filter { border-width: 0; overflow: hidden; margin: -15px -15px 15px -15px } | |
| .ui-listview-filter .ui-input-search { margin: 5px; width: auto; display: block; } | |
| .ui-listview-filter-inset { margin: -15px -5px -15px -5px; background: transparent; } | |
| .ui-li.ui-screen-hidden{display:none;} | |
| /* Odd iPad positioning issue. */ | |
| @media only screen and (min-device-width: 768px) and (max-device-width: 1024px) { | |
| .ui-li .ui-btn-text { overflow: visible; } | |
| }/* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| label.ui-slider { display: block; } | |
| input.ui-slider-input { display: inline-block; width: 50px; } | |
| select.ui-slider-switch { display: none; } | |
| div.ui-slider { position: relative; display: inline-block; overflow: visible; height: 15px; padding: 0; margin: 0 2% 0 20px; top: 4px; width: 66%; } | |
| a.ui-slider-handle { position: absolute; z-index: 10; top: 50%; width: 28px; height: 28px; margin-top: -15px; margin-left: -15px; } | |
| a.ui-slider-handle .ui-btn-inner { padding-left: 0; padding-right: 0; } | |
| @media all and (min-width: 480px){ | |
| label.ui-slider { display: inline-block; width: 20%; margin: 0 2% 0 0; } | |
| div.ui-slider { width: 45%; } | |
| } | |
| div.ui-slider-switch { height: 32px; overflow: hidden; margin-left: 0; } | |
| div.ui-slider-inneroffset { margin-left: 50%; position: absolute; top: 1px; height: 100%; width: 50%; } | |
| div.ui-slider-handle-snapping { -webkit-transition: left 100ms linear; } | |
| div.ui-slider-labelbg { position: absolute; top:0; margin: 0; border-width: 0; } | |
| div.ui-slider-switch div.ui-slider-labelbg-a { width: 60%; height: 100%; left: 0; } | |
| div.ui-slider-switch div.ui-slider-labelbg-b { width: 60%; height: 100%; right: 0; } | |
| .ui-slider-switch-a div.ui-slider-labelbg-a, .ui-slider-switch-b div.ui-slider-labelbg-b { z-index: -1; } | |
| .ui-slider-switch-a div.ui-slider-labelbg-b, .ui-slider-switch-b div.ui-slider-labelbg-a { z-index: 0; } | |
| div.ui-slider-switch a.ui-slider-handle { z-index: 20; width: 101%; height: 32px; margin-top: -18px; margin-left: -101%; } | |
| span.ui-slider-label { width: 100%; position: absolute;height: 32px; font-size: 16px; text-align: center; line-height: 2; background: none; border-color: transparent; } | |
| span.ui-slider-label-a { left: -100%; margin-right: -1px } | |
| span.ui-slider-label-b { right: -100%; margin-left: -1px } | |
| /*! | |
| * jQuery Mobile v1.0rc1 | |
| * http://jquerymobile.com/ | |
| * | |
| * Copyright 2010, jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| /*! | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| /* Swatches */ | |
| /* A | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-bar-a { | |
| border: 1px solid #2A2A2A /*{a-bar-border}*/; | |
| background: #111111 /*{a-bar-background-color}*/; | |
| color: #ffffff /*{a-bar-color}*/; | |
| font-weight: bold; | |
| text-shadow: 0 /*{a-bar-shadow-x}*/ -1px /*{a-bar-shadow-y}*/ 1px /*{a-bar-shadow-radius}*/ #000000 /*{a-bar-shadow-color}*/; | |
| background-image: -webkit-gradient(linear, left top, left bottom, from(#3c3c3c /*{a-bar-background-start}*/), to(#111 /*{a-bar-background-end}*/)); /* Saf4+, Chrome */ | |
| background-image: -webkit-linear-gradient(top, #3c3c3c /*{a-bar-background-start}*/, #111 /*{a-bar-background-end}*/); /* Chrome 10+, Saf5.1+ */ | |
| background-image: -moz-linear-gradient(top, #3c3c3c /*{a-bar-background-start}*/, #111 /*{a-bar-background-end}*/); /* FF3.6 */ | |
| background-image: -ms-linear-gradient(top, #3c3c3c /*{a-bar-background-start}*/, #111 /*{a-bar-background-end}*/); /* IE10 */ | |
| background-image: -o-linear-gradient(top, #3c3c3c /*{a-bar-background-start}*/, #111 /*{a-bar-background-end}*/); /* Opera 11.10+ */ | |
| background-image: linear-gradient(top, #3c3c3c /*{a-bar-background-start}*/, #111 /*{a-bar-background-end}*/); | |
| } | |
| .ui-bar-a, | |
| .ui-bar-a input, | |
| .ui-bar-a select, | |
| .ui-bar-a textarea, | |
| .ui-bar-a button { | |
| font-family: Helvetica, Arial, sans-serif /*{a-bar-font}*/; | |
| } | |
| .ui-bar-a .ui-link-inherit { | |
| color: #fff /*{a-bar-color}*/; | |
| } | |
| .ui-bar-a .ui-link { | |
| color: #7cc4e7 /*{global-link-color}*/; | |
| font-weight: bold; | |
| } | |
| .ui-body-a { | |
| border: 1px solid #2A2A2A /*{a-body-border}*/; | |
| background: #222222 /*{a-body-background-color}*/; | |
| color: #fff /*{a-body-color}*/; | |
| text-shadow: 0 /*{a-body-shadow-x}*/ 1px /*{a-body-shadow-y}*/ 0 /*{a-body-shadow-radius}*/ #000 /*{a-body-shadow-color}*/; | |
| font-weight: normal; | |
| background-image: -webkit-gradient(linear, left top, left bottom, from(#666 /*{a-body-background-start}*/), to(#222 /*{a-body-background-end}*/)); /* Saf4+, Chrome */ | |
| background-image: -webkit-linear-gradient(top, #666 /*{a-body-background-start}*/, #222 /*{a-body-background-end}*/); /* Chrome 10+, Saf5.1+ */ | |
| background-image: -moz-linear-gradient(top, #666 /*{a-body-background-start}*/, #222 /*{a-body-background-end}*/); /* FF3.6 */ | |
| background-image: -ms-linear-gradient(top, #666 /*{a-body-background-start}*/, #222 /*{a-body-background-end}*/); /* IE10 */ | |
| background-image: -o-linear-gradient(top, #666 /*{a-body-background-start}*/, #222 /*{a-body-background-end}*/); /* Opera 11.10+ */ | |
| background-image: linear-gradient(top, #666 /*{a-body-background-start}*/, #222 /*{a-body-background-end}*/); | |
| } | |
| .ui-body-a, | |
| .ui-body-a input, | |
| .ui-body-a select, | |
| .ui-body-a textarea, | |
| .ui-body-a button { | |
| font-family: Helvetica, Arial, sans-serif /*{a-body-font}*/; | |
| } | |
| .ui-body-a .ui-link-inherit { | |
| color: #fff /*{a-body-color}*/; | |
| } | |
| .ui-body-a .ui-link { | |
| color: #2489CE /*{global-link-color}*/; | |
| font-weight: bold; | |
| } | |
| .ui-br { | |
| border-bottom: rgb(130,130,130); | |
| border-bottom: rgba(130,130,130,.3); | |
| border-bottom-width: 1px; | |
| border-bottom-style: solid; | |
| } | |
| .ui-btn-up-a { | |
| border: 1px solid #222 /*{a-bup-border}*/; | |
| background: #333333 /*{a-bup-background-color}*/; | |
| font-weight: bold; | |
| color: #fff /*{a-bup-color}*/; | |
| text-shadow: 0 /*{a-bup-shadow-x}*/ -1px /*{a-bup-shadow-y}*/ 1px /*{a-bup-shadow-radius}*/ #000 /*{a-bup-shadow-color}*/; | |
| background-image: -webkit-gradient(linear, left top, left bottom, from(#555 /*{a-bup-background-start}*/), to(#333 /*{a-bup-background-end}*/)); /* Saf4+, Chrome */ | |
| background-image: -webkit-linear-gradient(top, #555 /*{a-bup-background-start}*/, #333 /*{a-bup-background-end}*/); /* Chrome 10+, Saf5.1+ */ | |
| background-image: -moz-linear-gradient(top, #555 /*{a-bup-background-start}*/, #333 /*{a-bup-background-end}*/); /* FF3.6 */ | |
| background-image: -ms-linear-gradient(top, #555 /*{a-bup-background-start}*/, #333 /*{a-bup-background-end}*/); /* IE10 */ | |
| background-image: -o-linear-gradient(top, #555 /*{a-bup-background-start}*/, #333 /*{a-bup-background-end}*/); /* Opera 11.10+ */ | |
| background-image: linear-gradient(top, #555 /*{a-bup-background-start}*/, #333 /*{a-bup-background-end}*/); | |
| } | |
| .ui-btn-up-a a.ui-link-inherit { | |
| color: #fff /*{a-bup-color}*/; | |
| } | |
| .ui-btn-hover-a { | |
| border: 1px solid #000 /*{a-bhover-border}*/; | |
| background: #444444 /*{a-bhover-background-color}*/; | |
| font-weight: bold; | |
| color: #fff /*{a-bhover-color}*/; | |
| text-shadow: 0 /*{a-bhover-shadow-x}*/ -1px /*{a-bhover-shadow-y}*/ 1px /*{a-bhover-shadow-radius}*/ #000 /*{a-bhover-shadow-color}*/; | |
| background-image: -webkit-gradient(linear, left top, left bottom, from(#666 /*{a-bhover-background-start}*/), to(#444 /*{a-bhover-background-end}*/)); /* Saf4+, Chrome */ | |
| background-image: -webkit-linear-gradient(top, #666 /*{a-bhover-background-start}*/, #444 /*{a-bhover-background-end}*/); /* Chrome 10+, Saf5.1+ */ | |
| background-image: -moz-linear-gradient(top, #666 /*{a-bhover-background-start}*/, #444 /*{a-bhover-background-end}*/); /* FF3.6 */ | |
| background-image: -ms-linear-gradient(top, #666 /*{a-bhover-background-start}*/, #444 /*{a-bhover-background-end}*/); /* IE10 */ | |
| background-image: -o-linear-gradient(top, #666 /*{a-bhover-background-start}*/, #444 /*{a-bhover-background-end}*/); /* Opera 11.10+ */ | |
| background-image: linear-gradient(top, #666 /*{a-bhover-background-start}*/, #444 /*{a-bhover-background-end}*/); | |
| } | |
| .ui-btn-hover-a a.ui-link-inherit { | |
| color: #fff /*{a-bhover-color}*/; | |
| } | |
| .ui-btn-down-a { | |
| border: 1px solid #000 /*{a-bdown-border}*/; | |
| background: #3d3d3d /*{a-bdown-background-color}*/; | |
| font-weight: bold; | |
| color: #fff /*{a-bdown-color}*/; | |
| text-shadow: 0 /*{a-bdown-shadow-x}*/ -1px /*{a-bdown-shadow-y}*/ 1px /*{a-bdown-shadow-radius}*/ #000 /*{a-bdown-shadow-color}*/; | |
| background-image: -webkit-gradient(linear, left top, left bottom, from(#333 /*{a-bdown-background-start}*/), to(#5a5a5a /*{a-bdown-background-end}*/)); /* Saf4+, Chrome */ | |
| background-image: -webkit-linear-gradient(top, #333 /*{a-bdown-background-start}*/, #5a5a5a /*{a-bdown-background-end}*/); /* Chrome 10+, Saf5.1+ */ | |
| background-image: -moz-linear-gradient(top, #333 /*{a-bdown-background-start}*/, #5a5a5a /*{a-bdown-background-end}*/); /* FF3.6 */ | |
| background-image: -ms-linear-gradient(top, #333 /*{a-bdown-background-start}*/, #5a5a5a /*{a-bdown-background-end}*/); /* IE10 */ | |
| background-image: -o-linear-gradient(top, #333 /*{a-bdown-background-start}*/, #5a5a5a /*{a-bdown-background-end}*/); /* Opera 11.10+ */ | |
| background-image: linear-gradient(top, #333 /*{a-bdown-background-start}*/, #5a5a5a /*{a-bdown-background-end}*/); | |
| } | |
| .ui-btn-down-a a.ui-link-inherit { | |
| color: #fff /*{a-bdown-color}*/; | |
| } | |
| .ui-btn-up-a, | |
| .ui-btn-hover-a, | |
| .ui-btn-down-a { | |
| font-family: Helvetica, Arial, sans-serif /*{a-button-font}*/; | |
| text-decoration: none; | |
| } | |
| /* B | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-bar-b { | |
| border: 1px solid #456f9a /*{b-bar-border}*/; | |
| background: #5e87b0 /*{b-bar-background-color}*/; | |
| color: #fff /*{b-bar-color}*/; | |
| font-weight: bold; | |
| text-shadow: 0 /*{b-bar-shadow-x}*/ -1px /*{b-bar-shadow-y}*/ 1px /*{b-bar-shadow-radius}*/ #254f7a /*{b-bar-shadow-color}*/; | |
| background-image: -webkit-gradient(linear, left top, left bottom, from(#81a8ce /*{b-bar-background-start}*/), to(#5e87b0 /*{b-bar-background-end}*/)); /* Saf4+, Chrome */ | |
| background-image: -webkit-linear-gradient(top, #81a8ce /*{b-bar-background-start}*/, #5e87b0 /*{b-bar-background-end}*/); /* Chrome 10+, Saf5.1+ */ | |
| background-image: -moz-linear-gradient(top, #81a8ce /*{b-bar-background-start}*/, #5e87b0 /*{b-bar-background-end}*/); /* FF3.6 */ | |
| background-image: -ms-linear-gradient(top, #81a8ce /*{b-bar-background-start}*/, #5e87b0 /*{b-bar-background-end}*/); /* IE10 */ | |
| background-image: -o-linear-gradient(top, #81a8ce /*{b-bar-background-start}*/, #5e87b0 /*{b-bar-background-end}*/); /* Opera 11.10+ */ | |
| background-image: linear-gradient(top, #81a8ce /*{b-bar-background-start}*/, #5e87b0 /*{b-bar-background-end}*/); | |
| } | |
| .ui-bar-b, | |
| .ui-bar-b input, | |
| .ui-bar-b select, | |
| .ui-bar-b textarea, | |
| .ui-bar-b button { | |
| font-family: Helvetica, Arial, sans-serif /*{b-bar-font}*/; | |
| } | |
| .ui-bar-b .ui-link-inherit { | |
| color: #fff /*{b-bar-color}*/; | |
| } | |
| .ui-bar-b .ui-link { | |
| color: #7cc4e7 /*{global-link-color}*/; | |
| font-weight: bold; | |
| } | |
| .ui-body-b { | |
| border: 1px solid #C6C6C6 /*{b-body-border}*/; | |
| background: #cccccc /*{b-body-background-color}*/; | |
| color: #333333 /*{b-body-color}*/; | |
| text-shadow: 0 /*{b-body-shadow-x}*/ 1px /*{b-body-shadow-y}*/ 0 /*{b-body-shadow-radius}*/ #fff /*{b-body-shadow-color}*/; | |
| font-weight: normal; | |
| background-image: -webkit-gradient(linear, left top, left bottom, from(#e6e6e6 /*{b-body-background-start}*/), to(#ccc /*{b-body-background-end}*/)); /* Saf4+, Chrome */ | |
| background-image: -webkit-linear-gradient(top, #e6e6e6 /*{b-body-background-start}*/, #ccc /*{b-body-background-end}*/); /* Chrome 10+, Saf5.1+ */ | |
| background-image: -moz-linear-gradient(top, #e6e6e6 /*{b-body-background-start}*/, #ccc /*{b-body-background-end}*/); /* FF3.6 */ | |
| background-image: -ms-linear-gradient(top, #e6e6e6 /*{b-body-background-start}*/, #ccc /*{b-body-background-end}*/); /* IE10 */ | |
| background-image: -o-linear-gradient(top, #e6e6e6 /*{b-body-background-start}*/, #ccc /*{b-body-background-end}*/); /* Opera 11.10+ */ | |
| background-image: linear-gradient(top, #e6e6e6 /*{b-body-background-start}*/, #ccc /*{b-body-background-end}*/); | |
| } | |
| .ui-body-b, | |
| .ui-body-b input, | |
| .ui-body-b select, | |
| .ui-body-b textarea, | |
| .ui-body-b button { | |
| font-family: Helvetica, Arial, sans-serif /*{b-body-font}*/; | |
| } | |
| .ui-body-b .ui-link-inherit { | |
| color: #333333 /*{b-body-color}*/; | |
| } | |
| .ui-body-b .ui-link { | |
| color: #2489CE /*{global-link-color}*/; | |
| font-weight: bold; | |
| } | |
| .ui-btn-up-b { | |
| border: 1px solid #145072 /*{b-bup-border}*/; | |
| background: #2567ab /*{b-bup-background-color}*/; | |
| font-weight: bold; | |
| color: #fff /*{b-bup-color}*/; | |
| text-shadow: 0 /*{b-bup-shadow-x}*/ -1px /*{b-bup-shadow-y}*/ 1px /*{b-bup-shadow-radius}*/ #145072 /*{b-bup-shadow-color}*/; | |
| background-image: -webkit-gradient(linear, left top, left bottom, from(#5f9cc5 /*{b-bup-background-start}*/), to(#396b9e /*{b-bup-background-end}*/)); /* Saf4+, Chrome */ | |
| background-image: -webkit-linear-gradient(top, #5f9cc5 /*{b-bup-background-start}*/, #396b9e /*{b-bup-background-end}*/); /* Chrome 10+, Saf5.1+ */ | |
| background-image: -moz-linear-gradient(top, #5f9cc5 /*{b-bup-background-start}*/, #396b9e /*{b-bup-background-end}*/); /* FF3.6 */ | |
| background-image: -ms-linear-gradient(top, #5f9cc5 /*{b-bup-background-start}*/, #396b9e /*{b-bup-background-end}*/); /* IE10 */ | |
| background-image: -o-linear-gradient(top, #5f9cc5 /*{b-bup-background-start}*/, #396b9e /*{b-bup-background-end}*/); /* Opera 11.10+ */ | |
| background-image: linear-gradient(top, #5f9cc5 /*{b-bup-background-start}*/, #396b9e /*{b-bup-background-end}*/); | |
| } | |
| .ui-btn-up-b a.ui-link-inherit { | |
| color: #fff /*{b-bup-color}*/; | |
| } | |
| .ui-btn-hover-b { | |
| border: 1px solid #00516e /*{b-bhover-border}*/; | |
| background: #4b88b6 /*{b-bhover-background-color}*/; | |
| font-weight: bold; | |
| color: #fff /*{b-bhover-color}*/; | |
| text-shadow: 0 /*{b-bhover-shadow-x}*/ -1px /*{b-bhover-shadow-y}*/ 1px /*{b-bhover-shadow-radius}*/ #014D68 /*{b-bhover-shadow-color}*/; | |
| background-image: -webkit-gradient(linear, left top, left bottom, from(#72b0d4 /*{b-bhover-background-start}*/), to(#4b88b6 /*{b-bhover-background-end}*/)); /* Saf4+, Chrome */ | |
| background-image: -webkit-linear-gradient(top, #72b0d4 /*{b-bhover-background-start}*/, #4b88b6 /*{b-bhover-background-end}*/); /* Chrome 10+, Saf5.1+ */ | |
| background-image: -moz-linear-gradient(top, #72b0d4 /*{b-bhover-background-start}*/, #4b88b6 /*{b-bhover-background-end}*/); /* FF3.6 */ | |
| background-image: -ms-linear-gradient(top, #72b0d4 /*{b-bhover-background-start}*/, #4b88b6 /*{b-bhover-background-end}*/); /* IE10 */ | |
| background-image: -o-linear-gradient(top, #72b0d4 /*{b-bhover-background-start}*/, #4b88b6 /*{b-bhover-background-end}*/); /* Opera 11.10+ */ | |
| background-image: linear-gradient(top, #72b0d4 /*{b-bhover-background-start}*/, #4b88b6 /*{b-bhover-background-end}*/); | |
| } | |
| .ui-btn-hover-b a.ui-link-inherit { | |
| color: #fff /*{b-bhover-color}*/; | |
| } | |
| .ui-btn-down-b { | |
| border: 1px solid #225377 /*{b-bdown-border}*/; | |
| background: #4e89c5 /*{b-bdown-background-color}*/; | |
| font-weight: bold; | |
| color: #fff /*{b-bdown-color}*/; | |
| text-shadow: 0 /*{b-bdown-shadow-x}*/ -1px /*{b-bdown-shadow-y}*/ 1px /*{b-bdown-shadow-radius}*/ #225377 /*{b-bdown-shadow-color}*/; | |
| background-image: -webkit-gradient(linear, left top, left bottom, from(#396b9e /*{b-bdown-background-start}*/), to(#4e89c5 /*{b-bdown-background-end}*/)); /* Saf4+, Chrome */ | |
| background-image: -webkit-linear-gradient(top, #396b9e /*{b-bdown-background-start}*/, #4e89c5 /*{b-bdown-background-end}*/); /* Chrome 10+, Saf5.1+ */ | |
| background-image: -moz-linear-gradient(top, #396b9e /*{b-bdown-background-start}*/, #4e89c5 /*{b-bdown-background-end}*/); /* FF3.6 */ | |
| background-image: -ms-linear-gradient(top, #396b9e /*{b-bdown-background-start}*/, #4e89c5 /*{b-bdown-background-end}*/); /* IE10 */ | |
| background-image: -o-linear-gradient(top, #396b9e /*{b-bdown-background-start}*/, #4e89c5 /*{b-bdown-background-end}*/); /* Opera 11.10+ */ | |
| background-image: linear-gradient(top, #396b9e /*{b-bdown-background-start}*/, #4e89c5 /*{b-bdown-background-end}*/); | |
| } | |
| .ui-btn-down-b a.ui-link-inherit { | |
| color: #fff /*{b-bdown-color}*/; | |
| } | |
| .ui-btn-up-b, | |
| .ui-btn-hover-b, | |
| .ui-btn-down-b { | |
| font-family: Helvetica, Arial, sans-serif /*{b-button-font}*/; | |
| text-decoration: none; | |
| } | |
| /* C | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-bar-c { | |
| border: 1px solid #B3B3B3 /*{c-bar-border}*/; | |
| background: #e9eaeb /*{c-bar-background-color}*/; | |
| color: #3E3E3E /*{c-bar-color}*/; | |
| font-weight: bold; | |
| text-shadow: 0 /*{c-bar-shadow-x}*/ 1px /*{c-bar-shadow-y}*/ 1px /*{c-bar-shadow-radius}*/ #fff /*{c-bar-shadow-color}*/; | |
| background-image: -webkit-gradient(linear, left top, left bottom, from(#f0f0f0 /*{c-bar-background-start}*/), to(#e9eaeb /*{c-bar-background-end}*/)); /* Saf4+, Chrome */ | |
| background-image: -webkit-linear-gradient(top, #f0f0f0 /*{c-bar-background-start}*/, #e9eaeb /*{c-bar-background-end}*/); /* Chrome 10+, Saf5.1+ */ | |
| background-image: -moz-linear-gradient(top, #f0f0f0 /*{c-bar-background-start}*/, #e9eaeb /*{c-bar-background-end}*/); /* FF3.6 */ | |
| background-image: -ms-linear-gradient(top, #f0f0f0 /*{c-bar-background-start}*/, #e9eaeb /*{c-bar-background-end}*/); /* IE10 */ | |
| background-image: -o-linear-gradient(top, #f0f0f0 /*{c-bar-background-start}*/, #e9eaeb /*{c-bar-background-end}*/); /* Opera 11.10+ */ | |
| background-image: linear-gradient(top, #f0f0f0 /*{c-bar-background-start}*/, #e9eaeb /*{c-bar-background-end}*/); | |
| } | |
| .ui-bar-c .ui-link { | |
| color: #2489CE /*{global-link-color}*/; | |
| font-weight: bold; | |
| } | |
| .ui-bar-c, | |
| .ui-bar-c input, | |
| .ui-bar-c select, | |
| .ui-bar-c textarea, | |
| .ui-bar-c button { | |
| font-family: Helvetica, Arial, sans-serif /*{c-bar-font}*/; | |
| } | |
| .ui-body-c { | |
| border: 1px solid #B3B3B3 /*{c-body-border}*/; | |
| color: #333333 /*{c-body-color}*/; | |
| text-shadow: 0 /*{c-body-shadow-x}*/ 1px /*{c-body-shadow-y}*/ 0 /*{c-body-shadow-radius}*/ #fff /*{c-body-shadow-color}*/; | |
| background: #f0f0f0 /*{c-body-background-color}*/; | |
| background-image: -webkit-gradient(linear, left top, left bottom, from(#eee /*{c-body-background-start}*/), to(#ddd /*{c-body-background-end}*/)); /* Saf4+, Chrome */ | |
| background-image: -webkit-linear-gradient(top, #eee /*{c-body-background-start}*/, #ddd /*{c-body-background-end}*/); /* Chrome 10+, Saf5.1+ */ | |
| background-image: -moz-linear-gradient(top, #eee /*{c-body-background-start}*/, #ddd /*{c-body-background-end}*/); /* FF3.6 */ | |
| background-image: -ms-linear-gradient(top, #eee /*{c-body-background-start}*/, #ddd /*{c-body-background-end}*/); /* IE10 */ | |
| background-image: -o-linear-gradient(top, #eee /*{c-body-background-start}*/, #ddd /*{c-body-background-end}*/); /* Opera 11.10+ */ | |
| background-image: linear-gradient(top, #eee /*{c-body-background-start}*/, #ddd /*{c-body-background-end}*/); | |
| } | |
| .ui-body-c, | |
| .ui-body-c input, | |
| .ui-body-c select, | |
| .ui-body-c textarea, | |
| .ui-body-c button { | |
| font-family: Helvetica, Arial, sans-serif /*{c-body-font}*/; | |
| } | |
| .ui-body-c .ui-link-inherit { | |
| color: #333333 /*{c-body-color}*/; | |
| } | |
| .ui-body-c .ui-link { | |
| color: #2489CE /*{global-link-color}*/; | |
| font-weight: bold; | |
| } | |
| .ui-btn-up-c { | |
| border: 1px solid #ccc /*{c-bup-border}*/; | |
| background: #eee /*{c-bup-background-color}*/; | |
| font-weight: bold; | |
| color: #444 /*{c-bup-color}*/; | |
| text-shadow: 0 /*{c-bup-shadow-x}*/ 1px /*{c-bup-shadow-y}*/ 1px /*{c-bup-shadow-radius}*/ #f6f6f6 /*{c-bup-shadow-color}*/; | |
| background-image: -webkit-gradient(linear, left top, left bottom, from(#fdfdfd /*{c-bup-background-start}*/), to(#eee /*{c-bup-background-end}*/)); /* Saf4+, Chrome */ | |
| background-image: -webkit-linear-gradient(top, #fdfdfd /*{c-bup-background-start}*/, #eee /*{c-bup-background-end}*/); /* Chrome 10+, Saf5.1+ */ | |
| background-image: -moz-linear-gradient(top, #fdfdfd /*{c-bup-background-start}*/, #eee /*{c-bup-background-end}*/); /* FF3.6 */ | |
| background-image: -ms-linear-gradient(top, #fdfdfd /*{c-bup-background-start}*/, #eee /*{c-bup-background-end}*/); /* IE10 */ | |
| background-image: -o-linear-gradient(top, #fdfdfd /*{c-bup-background-start}*/, #eee /*{c-bup-background-end}*/); /* Opera 11.10+ */ | |
| background-image: linear-gradient(top, #fdfdfd /*{c-bup-background-start}*/, #eee /*{c-bup-background-end}*/); | |
| } | |
| .ui-btn-up-c a.ui-link-inherit { | |
| color: #2F3E46 /*{c-bup-color}*/; | |
| } | |
| .ui-btn-hover-c { | |
| border: 1px solid #bbb /*{c-bhover-border}*/; | |
| background: #dadada /*{c-bhover-background-color}*/; | |
| font-weight: bold; | |
| color: #101010 /*{c-bhover-color}*/; | |
| text-shadow: 0 /*{c-bhover-shadow-x}*/ 1px /*{c-bhover-shadow-y}*/ 1px /*{c-bhover-shadow-radius}*/ #fff /*{c-bhover-shadow-color}*/; | |
| background-image: -webkit-gradient(linear, left top, left bottom, from(#ededed /*{c-bhover-background-start}*/), to(#dadada /*{c-bhover-background-end}*/)); /* Saf4+, Chrome */ | |
| background-image: -webkit-linear-gradient(top, #ededed /*{c-bhover-background-start}*/, #dadada /*{c-bhover-background-end}*/); /* Chrome 10+, Saf5.1+ */ | |
| background-image: -moz-linear-gradient(top, #ededed /*{c-bhover-background-start}*/, #dadada /*{c-bhover-background-end}*/); /* FF3.6 */ | |
| background-image: -ms-linear-gradient(top, #ededed /*{c-bhover-background-start}*/, #dadada /*{c-bhover-background-end}*/); /* IE10 */ | |
| background-image: -o-linear-gradient(top, #ededed /*{c-bhover-background-start}*/, #dadada /*{c-bhover-background-end}*/); /* Opera 11.10+ */ | |
| background-image: linear-gradient(top, #ededed /*{c-bhover-background-start}*/, #dadada /*{c-bhover-background-end}*/); | |
| } | |
| .ui-btn-hover-c a.ui-link-inherit { | |
| color: #2F3E46 /*{c-bhover-color}*/; | |
| } | |
| .ui-btn-down-c { | |
| border: 1px solid #808080 /*{c-bdown-border}*/; | |
| background: #fdfdfd /*{c-bdown-background-color}*/; | |
| font-weight: bold; | |
| color: #111111 /*{c-bdown-color}*/; | |
| text-shadow: 0 /*{c-bdown-shadow-x}*/ 1px /*{c-bdown-shadow-y}*/ 1px /*{c-bdown-shadow-radius}*/ #ffffff /*{c-bdown-shadow-color}*/; | |
| background-image: -webkit-gradient(linear, left top, left bottom, from(#eee /*{c-bdown-background-start}*/), to(#fdfdfd /*{c-bdown-background-end}*/)); /* Saf4+, Chrome */ | |
| background-image: -webkit-linear-gradient(top, #eee /*{c-bdown-background-start}*/, #fdfdfd /*{c-bdown-background-end}*/); /* Chrome 10+, Saf5.1+ */ | |
| background-image: -moz-linear-gradient(top, #eee /*{c-bdown-background-start}*/, #fdfdfd /*{c-bdown-background-end}*/); /* FF3.6 */ | |
| background-image: -ms-linear-gradient(top, #eee /*{c-bdown-background-start}*/, #fdfdfd /*{c-bdown-background-end}*/); /* IE10 */ | |
| background-image: -o-linear-gradient(top, #eee /*{c-bdown-background-start}*/, #fdfdfd /*{c-bdown-background-end}*/); /* Opera 11.10+ */ | |
| background-image: linear-gradient(top, #eee /*{c-bdown-background-start}*/, #fdfdfd /*{c-bdown-background-end}*/); | |
| } | |
| .ui-btn-down-c a.ui-link-inherit { | |
| color: #2F3E46 /*{c-bdown-color}*/; | |
| } | |
| .ui-btn-up-c, | |
| .ui-btn-hover-c, | |
| .ui-btn-down-c { | |
| font-family: Helvetica, Arial, sans-serif /*{c-button-font}*/; | |
| text-decoration: none; | |
| } | |
| /* D | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-bar-d { | |
| border: 1px solid #ccc /*{d-bar-border}*/; | |
| background: #bbb /*{d-bar-background-color}*/; | |
| color: #333 /*{d-bar-color}*/; | |
| text-shadow: 0 /*{d-bar-shadow-x}*/ 1px /*{d-bar-shadow-y}*/ 0 /*{d-bar-shadow-radius}*/ #eee /*{d-bar-shadow-color}*/; | |
| background-image: -webkit-gradient(linear, left top, left bottom, from(#ddd /*{d-bar-background-start}*/), to(#bbb /*{d-bar-background-end}*/)); /* Saf4+, Chrome */ | |
| background-image: -webkit-linear-gradient(top, #ddd /*{d-bar-background-start}*/, #bbb /*{d-bar-background-end}*/); /* Chrome 10+, Saf5.1+ */ | |
| background-image: -moz-linear-gradient(top, #ddd /*{d-bar-background-start}*/, #bbb /*{d-bar-background-end}*/); /* FF3.6 */ | |
| background-image: -ms-linear-gradient(top, #ddd /*{d-bar-background-start}*/, #bbb /*{d-bar-background-end}*/); /* IE10 */ | |
| background-image: -o-linear-gradient(top, #ddd /*{d-bar-background-start}*/, #bbb /*{d-bar-background-end}*/); /* Opera 11.10+ */ | |
| background-image: linear-gradient(top, #ddd /*{d-bar-background-start}*/, #bbb /*{d-bar-background-end}*/); | |
| } | |
| .ui-bar-d, | |
| .ui-bar-d input, | |
| .ui-bar-d select, | |
| .ui-bar-d textarea, | |
| .ui-bar-d button { | |
| font-family: Helvetica, Arial, sans-serif /*{d-bar-font}*/; | |
| } | |
| .ui-bar-d .ui-link-inherit { | |
| color: #333 /*{d-bar-color}*/; | |
| } | |
| .ui-bar-d .ui-link { | |
| color: #2489CE /*{global-link-color}*/; | |
| font-weight: bold; | |
| } | |
| .ui-body-d { | |
| border: 1px solid #ccc /*{d-body-border}*/; | |
| color: #333333 /*{d-body-color}*/; | |
| text-shadow: 0 /*{d-body-shadow-x}*/ 1px /*{d-body-shadow-y}*/ 0 /*{d-body-shadow-radius}*/ #fff /*{d-body-shadow-color}*/; | |
| background: #ffffff /*{d-body-background-color}*/; | |
| background-image: -webkit-gradient(linear, left top, left bottom, from(#fff), to(#fff /*{d-body-background-end}*/)); /* Saf4+, Chrome */ | |
| background-image: -webkit-linear-gradient(top, #fff /*{d-body-background-start}*/, #fff /*{d-body-background-end}*/); /* Chrome 10+, Saf5.1+ */ | |
| background-image: -moz-linear-gradient(top, #fff /*{d-body-background-start}*/, #fff /*{d-body-background-end}*/); /* FF3.6 */ | |
| background-image: -ms-linear-gradient(top, #fff /*{d-body-background-start}*/, #fff /*{d-body-background-end}*/); /* IE10 */ | |
| background-image: -o-linear-gradient(top, #fff /*{d-body-background-start}*/, #fff /*{d-body-background-end}*/); /* Opera 11.10+ */ | |
| background-image: linear-gradient(top, #fff /*{d-body-background-start}*/, #fff /*{d-body-background-end}*/); | |
| } | |
| .ui-body-d, | |
| .ui-body-d input, | |
| .ui-body-d select, | |
| .ui-body-d textarea, | |
| .ui-body-d button { | |
| font-family: Helvetica, Arial, sans-serif /*{d-body-font}*/; | |
| } | |
| .ui-body-d .ui-link-inherit { | |
| color: #333333 /*{d-body-color}*/; | |
| } | |
| .ui-body-d .ui-link { | |
| color: #2489CE /*{global-link-color}*/; | |
| font-weight: bold; | |
| } | |
| .ui-btn-up-d { | |
| border: 1px solid #ccc /*{d-bup-border}*/; | |
| background: #fff /*{d-bup-background-color}*/; | |
| font-weight: bold; | |
| color: #444 /*{d-bup-color}*/; | |
| text-shadow: 0 /*{d-bup-shadow-x}*/ 1px /*{d-bup-shadow-y}*/ 1px /*{d-bup-shadow-radius}*/ #fff /*{d-bup-shadow-color}*/; | |
| background-image: -webkit-gradient(linear, left top, left bottom, from(#fff), to(#fff /*{d-bup-background-end}*/)); /* Saf4+, Chrome */ | |
| background-image: -webkit-linear-gradient(top, #fff /*{d-bup-background-start}*/, #fff /*{d-bup-background-end}*/); /* Chrome 10+, Saf5.1+ */ | |
| background-image: -moz-linear-gradient(top, #fff /*{d-bup-background-start}*/, #fff /*{d-bup-background-end}*/); /* FF3.6 */ | |
| background-image: -ms-linear-gradient(top, #fff /*{d-bup-background-start}*/, #fff /*{d-bup-background-end}*/); /* IE10 */ | |
| background-image: -o-linear-gradient(top, #fff /*{d-bup-background-start}*/, #fff /*{d-bup-background-end}*/); /* Opera 11.10+ */ | |
| background-image: linear-gradient(top, #fff /*{d-bup-background-start}*/, #fff /*{d-bup-background-end}*/); | |
| } | |
| .ui-btn-up-d a.ui-link-inherit { | |
| color: #333 /*{d-bup-color}*/; | |
| } | |
| .ui-btn-hover-d { | |
| border: 1px solid #aaa /*{d-bhover-border}*/; | |
| background: #eeeeee /*{d-bhover-background-color}*/; | |
| font-weight: bold; | |
| color: #222 /*{d-bhover-color}*/; | |
| cursor: pointer; | |
| text-shadow: 0 /*{d-bhover-shadow-x}*/ 1px /*{d-bhover-shadow-y}*/ 1px /*{d-bhover-shadow-radius}*/ #fff /*{d-bhover-shadow-color}*/; | |
| background-image: -webkit-gradient(linear, left top, left bottom, from(#fdfdfd), to(#eee /*{d-bhover-background-end}*/)); /* Saf4+, Chrome */ | |
| background-image: -webkit-linear-gradient(top, #fdfdfd /*{d-bhover-background-start}*/, #eee /*{d-bhover-background-end}*/); /* Chrome 10+, Saf5.1+ */ | |
| background-image: -moz-linear-gradient(top, #fdfdfd /*{d-bhover-background-start}*/, #eee /*{d-bhover-background-end}*/); /* FF3.6 */ | |
| background-image: -ms-linear-gradient(top, #fdfdfd /*{d-bhover-background-start}*/, #eee /*{d-bhover-background-end}*/); /* IE10 */ | |
| background-image: -o-linear-gradient(top, #fdfdfd /*{d-bhover-background-start}*/, #eee /*{d-bhover-background-end}*/); /* Opera 11.10+ */ | |
| background-image: linear-gradient(top, #fdfdfd /*{d-bhover-background-start}*/, #eee /*{d-bhover-background-end}*/); | |
| } | |
| .ui-btn-hover-d a.ui-link-inherit { | |
| color: #222 /*{d-bhover-color}*/; | |
| } | |
| .ui-btn-down-d { | |
| border: 1px solid #aaaaaa /*{d-bdown-border}*/; | |
| background: #ffffff /*{d-bdown-background-color}*/; | |
| font-weight: bold; | |
| color: #111 /*{d-bdown-color}*/; | |
| text-shadow: 0 /*{d-bdown-shadow-x}*/ 1px /*{d-bdown-shadow-y}*/ 1px /*{d-bdown-shadow-radius}*/ #ffffff /*{d-bdown-shadow-color}*/; | |
| background-image: -webkit-gradient(linear, left top, left bottom, from(#eee /*{d-bdown-background-start}*/), to(#fff /*{d-bdown-background-end}*/)); /* Saf4+, Chrome */ | |
| background-image: -webkit-linear-gradient(top, #eee /*{d-bdown-background-start}*/, #fff /*{d-bdown-background-end}*/); /* Chrome 10+, Saf5.1+ */ | |
| background-image: -moz-linear-gradient(top, #eee /*{d-bdown-background-start}*/, #fff /*{d-bdown-background-end}*/); /* FF3.6 */ | |
| background-image: -ms-linear-gradient(top, #eee /*{d-bdown-background-start}*/, #fff /*{d-bdown-background-end}*/); /* IE10 */ | |
| background-image: -o-linear-gradient(top, #eee /*{d-bdown-background-start}*/, #fff /*{d-bdown-background-end}*/); /* Opera 11.10+ */ | |
| background-image: linear-gradient(top, #eee /*{d-bdown-background-start}*/, #fff /*{d-bdown-background-end}*/); | |
| } | |
| .ui-btn-down-d a.ui-link-inherit { | |
| color: #111 /*{d-bdown-color}*/; | |
| } | |
| .ui-btn-up-d, | |
| .ui-btn-hover-d, | |
| .ui-btn-down-d { | |
| font-family: Helvetica, Arial, sans-serif /*{d-button-font}*/; | |
| text-decoration: none; | |
| } | |
| /* E | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-bar-e { | |
| border: 1px solid #F7C942 /*{e-bar-border}*/; | |
| background: #fadb4e /*{e-bar-background-color}*/; | |
| color: #333 /*{e-bar-color}*/; | |
| text-shadow: 0 /*{e-bar-shadow-x}*/ 1px /*{e-bar-shadow-y}*/ 0 /*{e-bar-shadow-radius}*/ #fff /*{e-bar-shadow-color}*/; | |
| background-image: -webkit-gradient(linear, left top, left bottom, from(#fceda7 /*{e-bar-background-start}*/), to(#fadb4e /*{e-bar-background-end}*/)); /* Saf4+, Chrome */ | |
| background-image: -webkit-linear-gradient(top, #fceda7 /*{e-bar-background-start}*/, #fadb4e /*{e-bar-background-end}*/); /* Chrome 10+, Saf5.1+ */ | |
| background-image: -moz-linear-gradient(top, #fceda7 /*{e-bar-background-start}*/, #fadb4e /*{e-bar-background-end}*/); /* FF3.6 */ | |
| background-image: -ms-linear-gradient(top, #fceda7 /*{e-bar-background-start}*/, #fadb4e /*{e-bar-background-end}*/); /* IE10 */ | |
| background-image: -o-linear-gradient(top, #fceda7 /*{e-bar-background-start}*/, #fadb4e /*{e-bar-background-end}*/); /* Opera 11.10+ */ | |
| background-image: linear-gradient(top, #fceda7 /*{e-bar-background-start}*/, #fadb4e /*{e-bar-background-end}*/); | |
| } | |
| .ui-bar-e, | |
| .ui-bar-e input, | |
| .ui-bar-e select, | |
| .ui-bar-e textarea, | |
| .ui-bar-e button { | |
| font-family: Helvetica, Arial, sans-serif /*{e-bar-font}*/; | |
| } | |
| .ui-bar-e .ui-link-inherit { | |
| color: #333 /*{e-bar-color}*/; | |
| } | |
| .ui-bar-e .ui-link { | |
| color: #2489CE /*{global-link-color}*/; | |
| font-weight: bold; | |
| } | |
| .ui-body-e { | |
| border: 1px solid #F7C942 /*{e-body-border}*/; | |
| color: #333333 /*{e-body-color}*/; | |
| text-shadow: 0 /*{e-body-shadow-x}*/ 1px /*{e-body-shadow-y}*/ 0 /*{e-body-shadow-radius}*/ #fff /*{e-body-shadow-color}*/; | |
| background: #faeb9e /*{e-body-background-color}*/; | |
| background-image: -webkit-gradient(linear, left top, left bottom, from(#fff /*{e-body-background-start}*/), to(#faeb9e /*{e-body-background-end}*/)); /* Saf4+, Chrome */ | |
| background-image: -webkit-linear-gradient(top, #fff /*{e-body-background-start}*/, #faeb9e /*{e-body-background-end}*/); /* Chrome 10+, Saf5.1+ */ | |
| background-image: -moz-linear-gradient(top, #fff /*{e-body-background-start}*/, #faeb9e /*{e-body-background-end}*/); /* FF3.6 */ | |
| background-image: -ms-linear-gradient(top, #fff /*{e-body-background-start}*/, #faeb9e /*{e-body-background-end}*/); /* IE10 */ | |
| background-image: -o-linear-gradient(top, #fff /*{e-body-background-start}*/, #faeb9e /*{e-body-background-end}*/); /* Opera 11.10+ */ | |
| background-image: linear-gradient(top, #fff /*{e-body-background-start}*/, #faeb9e /*{e-body-background-end}*/); | |
| } | |
| .ui-body-e, | |
| .ui-body-e input, | |
| .ui-body-e select, | |
| .ui-body-e textarea, | |
| .ui-body-e button { | |
| font-family: Helvetica, Arial, sans-serif /*{e-body-font}*/; | |
| } | |
| .ui-body-e .ui-link-inherit { | |
| color: #333333 /*{e-body-color}*/; | |
| } | |
| .ui-body-e .ui-link { | |
| color: #2489CE /*{global-link-color}*/; | |
| font-weight: bold; | |
| } | |
| .ui-btn-up-e { | |
| border: 1px solid #F7C942 /*{e-bup-border}*/; | |
| background: #fadb4e /*{e-bup-background-color}*/; | |
| font-weight: bold; | |
| color: #333 /*{e-bup-color}*/; | |
| text-shadow: 0 /*{e-bup-shadow-x}*/ 1px /*{e-bup-shadow-y}*/ 0 /*{e-bup-shadow-radius}*/ #fff /*{e-bup-shadow-color}*/; | |
| background-image: -webkit-gradient(linear, left top, left bottom, from(#fceda7 /*{e-bup-background-start}*/), to(#fadb4e /*{e-bup-background-end}*/)); /* Saf4+, Chrome */ | |
| background-image: -webkit-linear-gradient(top, #fceda7 /*{e-bup-background-start}*/, #fadb4e /*{e-bup-background-end}*/); /* Chrome 10+, Saf5.1+ */ | |
| background-image: -moz-linear-gradient(top, #fceda7 /*{e-bup-background-start}*/, #fadb4e /*{e-bup-background-end}*/); /* FF3.6 */ | |
| background-image: -ms-linear-gradient(top, #fceda7 /*{e-bup-background-start}*/, #fadb4e /*{e-bup-background-end}*/); /* IE10 */ | |
| background-image: -o-linear-gradient(top, #fceda7 /*{e-bup-background-start}*/, #fadb4e /*{e-bup-background-end}*/); /* Opera 11.10+ */ | |
| background-image: linear-gradient(top, #fceda7 /*{e-bup-background-start}*/, #fadb4e /*{e-bup-background-end}*/); | |
| } | |
| .ui-btn-up-e a.ui-link-inherit { | |
| color: #333 /*{e-bup-color}*/; | |
| } | |
| .ui-btn-hover-e { | |
| border: 1px solid #e79952 /*{e-bhover-border}*/; | |
| background: #fbe26f /*{e-bhover-background-color}*/; | |
| font-weight: bold; | |
| color: #111 /*{e-bhover-color}*/; | |
| text-shadow: 0 /*{e-bhover-shadow-x}*/ 1px /*{e-bhover-shadow-y}*/ 1px /*{e-bhover-shadow-radius}*/ #fff /*{e-bhover-shadow-color}*/; | |
| background-image: -webkit-gradient(linear, left top, left bottom, from(#fcf0b5 /*{e-bhover-background-start}*/), to(#fbe26f /*{e-bhover-background-end}*/)); /* Saf4+, Chrome */ | |
| background-image: -webkit-linear-gradient(top, #fcf0b5 /*{e-bhover-background-start}*/, #fbe26f /*{e-bhover-background-end}*/); /* Chrome 10+, Saf5.1+ */ | |
| background-image: -moz-linear-gradient(top, #fcf0b5 /*{e-bhover-background-start}*/, #fbe26f /*{e-bhover-background-end}*/); /* FF3.6 */ | |
| background-image: -ms-linear-gradient(top, #fcf0b5 /*{e-bhover-background-start}*/, #fbe26f /*{e-bhover-background-end}*/); /* IE10 */ | |
| background-image: -o-linear-gradient(top, #fcf0b5 /*{e-bhover-background-start}*/, #fbe26f /*{e-bhover-background-end}*/); /* Opera 11.10+ */ | |
| background-image: linear-gradient(top, #fcf0b5 /*{e-bhover-background-start}*/, #fbe26f /*{e-bhover-background-end}*/); | |
| } | |
| .ui-btn-hover-e a.ui-link-inherit { | |
| color: #333 /*{e-bhover-color}*/; | |
| } | |
| .ui-btn-down-e { | |
| border: 1px solid #F7C942 /*{e-bdown-border}*/; | |
| background: #fceda7 /*{e-bdown-background-color}*/; | |
| font-weight: bold; | |
| color: #111 /*{e-bdown-color}*/; | |
| text-shadow: 0 /*{e-bdown-shadow-x}*/ 1px /*{e-bdown-shadow-y}*/ 1px /*{e-bdown-shadow-radius}*/ #ffffff /*{e-bdown-shadow-color}*/; | |
| background-image: -webkit-gradient(linear, left top, left bottom, from(#fadb4e /*{e-bdown-background-start}*/), to(#fceda7 /*{e-bdown-background-end}*/)); /* Saf4+, Chrome */ | |
| background-image: -webkit-linear-gradient(top, #fadb4e /*{e-bdown-background-start}*/, #fceda7 /*{e-bdown-background-end}*/); /* Chrome 10+, Saf5.1+ */ | |
| background-image: -moz-linear-gradient(top, #fadb4e /*{e-bdown-background-start}*/, #fceda7 /*{e-bdown-background-end}*/); /* FF3.6 */ | |
| background-image: -ms-linear-gradient(top, #fadb4e /*{e-bdown-background-start}*/, #fceda7 /*{e-bdown-background-end}*/); /* IE10 */ | |
| background-image: -o-linear-gradient(top, #fadb4e /*{e-bdown-background-start}*/, #fceda7 /*{e-bdown-background-end}*/); /* Opera 11.10+ */ | |
| background-image: linear-gradient(top, #fadb4e /*{e-bdown-background-start}*/, #fceda7 /*{e-bdown-background-end}*/); | |
| } | |
| .ui-btn-down-e a.ui-link-inherit { | |
| color: #333 /*{e-bdown-color}*/; | |
| } | |
| .ui-btn-up-e, | |
| .ui-btn-hover-e, | |
| .ui-btn-down-e { | |
| font-family: Helvetica, Arial, sans-serif /*{e-button-font}*/; | |
| text-decoration: none; | |
| } | |
| /* Structure */ | |
| /* links within "buttons" | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| a.ui-link-inherit { | |
| text-decoration: none !important; | |
| } | |
| /* links and their different states | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-link{ | |
| color: #2489CE /*{global-link-color}*/ | |
| } | |
| .ui-link:hover{ | |
| color: #2489CE /*{global-link-hover}*/ | |
| } | |
| .ui-link:active{ | |
| color: #2489CE /*{global-link-active}*/ | |
| } | |
| .ui-link:visited{ | |
| color: #2489CE /*{global-link-visited}*/ | |
| } | |
| /* Active class used as the "on" state across all themes | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-btn-active { | |
| border: 1px solid #155678 /*{global-active-border}*/; | |
| background: #4596ce /*{global-active-background-color}*/; | |
| font-weight: bold; | |
| color: #fff /*{global-active-color}*/; | |
| cursor: pointer; | |
| text-shadow: 0 /*{global-active-shadow-x}*/ -1px /*{global-active-shadow-y}*/ 1px /*{global-active-shadow-radius}*/ #145072 /*{global-active-shadow-color}*/; | |
| text-decoration: none; | |
| background-image: -webkit-gradient(linear, left top, left bottom, from(#85bae4 /*{global-active-background-start}*/), to(#5393c5 /*{global-active-background-end}*/)); /* Saf4+, Chrome */ | |
| background-image: -webkit-linear-gradient(top, #85bae4 /*{global-active-background-start}*/, #5393c5 /*{global-active-background-end}*/); /* Chrome 10+, Saf5.1+ */ | |
| background-image: -moz-linear-gradient(top, #85bae4 /*{global-active-background-start}*/, #5393c5 /*{global-active-background-end}*/); /* FF3.6 */ | |
| background-image: -ms-linear-gradient(top, #85bae4 /*{global-active-background-start}*/, #5393c5 /*{global-active-background-end}*/); /* IE10 */ | |
| background-image: -o-linear-gradient(top, #85bae4 /*{global-active-background-start}*/, #5393c5 /*{global-active-background-end}*/); /* Opera 11.10+ */ | |
| background-image: linear-gradient(top, #85bae4 /*{global-active-background-start}*/, #5393c5 /*{global-active-background-end}*/); | |
| outline: none; | |
| font-family: Helvetica, Arial, sans-serif /*{global-active-font}*/; | |
| } | |
| .ui-btn-active a.ui-link-inherit { | |
| color: #fff /*{global-active-color}*/; | |
| } | |
| /* button inner top highlight | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-btn-inner { | |
| border-top: 1px solid #fff; | |
| border-color: rgba(255,255,255,.3); | |
| } | |
| /* corner rounding classes | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-corner-tl { | |
| -moz-border-radius-topleft: .6em /*{global-radii-blocks}*/; | |
| -webkit-border-top-left-radius: .6em /*{global-radii-blocks}*/; | |
| border-top-left-radius: .6em /*{global-radii-blocks}*/; | |
| } | |
| .ui-corner-tr { | |
| -moz-border-radius-topright: .6em /*{global-radii-blocks}*/; | |
| -webkit-border-top-right-radius: .6em /*{global-radii-blocks}*/; | |
| border-top-right-radius: .6em /*{global-radii-blocks}*/; | |
| } | |
| .ui-corner-bl { | |
| -moz-border-radius-bottomleft: .6em /*{global-radii-blocks}*/; | |
| -webkit-border-bottom-left-radius: .6em /*{global-radii-blocks}*/; | |
| border-bottom-left-radius: .6em /*{global-radii-blocks}*/; | |
| } | |
| .ui-corner-br { | |
| -moz-border-radius-bottomright: .6em /*{global-radii-blocks}*/; | |
| -webkit-border-bottom-right-radius: .6em /*{global-radii-blocks}*/; | |
| border-bottom-right-radius: .6em /*{global-radii-blocks}*/; | |
| } | |
| .ui-corner-top { | |
| -moz-border-radius-topleft: .6em /*{global-radii-blocks}*/; | |
| -webkit-border-top-left-radius: .6em /*{global-radii-blocks}*/; | |
| border-top-left-radius: .6em /*{global-radii-blocks}*/; | |
| -moz-border-radius-topright: .6em /*{global-radii-blocks}*/; | |
| -webkit-border-top-right-radius: .6em /*{global-radii-blocks}*/; | |
| border-top-right-radius: .6em /*{global-radii-blocks}*/; | |
| } | |
| .ui-corner-bottom { | |
| -moz-border-radius-bottomleft: .6em /*{global-radii-blocks}*/; | |
| -webkit-border-bottom-left-radius: .6em /*{global-radii-blocks}*/; | |
| border-bottom-left-radius: .6em /*{global-radii-blocks}*/; | |
| -moz-border-radius-bottomright: .6em /*{global-radii-blocks}*/; | |
| -webkit-border-bottom-right-radius: .6em /*{global-radii-blocks}*/; | |
| border-bottom-right-radius: .6em /*{global-radii-blocks}*/; | |
| } | |
| .ui-corner-right { | |
| -moz-border-radius-topright: .6em /*{global-radii-blocks}*/; | |
| -webkit-border-top-right-radius: .6em /*{global-radii-blocks}*/; | |
| border-top-right-radius: .6em /*{global-radii-blocks}*/; | |
| -moz-border-radius-bottomright: .6em /*{global-radii-blocks}*/; | |
| -webkit-border-bottom-right-radius: .6em /*{global-radii-blocks}*/; | |
| border-bottom-right-radius: .6em /*{global-radii-blocks}*/; | |
| } | |
| .ui-corner-left { | |
| -moz-border-radius-topleft: .6em /*{global-radii-blocks}*/; | |
| -webkit-border-top-left-radius: .6em /*{global-radii-blocks}*/; | |
| border-top-left-radius: .6em /*{global-radii-blocks}*/; | |
| -moz-border-radius-bottomleft: .6em /*{global-radii-blocks}*/; | |
| -webkit-border-bottom-left-radius: .6em /*{global-radii-blocks}*/; | |
| border-bottom-left-radius: .6em /*{global-radii-blocks}*/; | |
| } | |
| .ui-corner-all { | |
| -moz-border-radius: .6em /*{global-radii-blocks}*/; | |
| -webkit-border-radius: .6em /*{global-radii-blocks}*/; | |
| border-radius: .6em /*{global-radii-blocks}*/; | |
| } | |
| .ui-corner-none { | |
| -moz-border-radius: 0; | |
| -webkit-border-radius: 0; | |
| border-radius: 0; | |
| } | |
| /* Interaction cues | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-disabled { | |
| opacity: .3; | |
| } | |
| .ui-disabled, | |
| .ui-disabled a { | |
| cursor: default; | |
| } | |
| /* Icons | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-icon, | |
| .ui-icon-searchfield:after { | |
| background: #666 /*{global-icon-color}*/; | |
| background: rgba(0,0,0,.4) /*{global-icon-disc}*/; | |
| background-image: url(images/icons-18-white.png) /*{global-icon-set}*/; | |
| background-repeat: no-repeat; | |
| -moz-border-radius: 9px; | |
| -webkit-border-radius: 9px; | |
| border-radius: 9px; | |
| } | |
| /* Alt icon color | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-icon-alt { | |
| background: #fff; | |
| background: rgba(255,255,255,.3); | |
| background-image: url(images/icons-18-black.png); | |
| background-repeat: no-repeat; | |
| } | |
| /* HD/"retina" sprite | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| @media only screen and (-webkit-min-device-pixel-ratio: 1.5), | |
| only screen and (min--moz-device-pixel-ratio: 1.5), | |
| only screen and (min-resolution: 240dpi) { | |
| .ui-icon-plus, .ui-icon-minus, .ui-icon-delete, .ui-icon-arrow-r, | |
| .ui-icon-arrow-l, .ui-icon-arrow-u, .ui-icon-arrow-d, .ui-icon-check, | |
| .ui-icon-gear, .ui-icon-refresh, .ui-icon-forward, .ui-icon-back, | |
| .ui-icon-grid, .ui-icon-star, .ui-icon-alert, .ui-icon-info, .ui-icon-home, .ui-icon-search, .ui-icon-searchfield:after, | |
| .ui-icon-checkbox-off, .ui-icon-checkbox-on, .ui-icon-radio-off, .ui-icon-radio-on { | |
| background-image: url(images/icons-36-white.png); | |
| -moz-background-size: 776px 18px; | |
| -o-background-size: 776px 18px; | |
| -webkit-background-size: 776px 18px; | |
| background-size: 776px 18px; | |
| } | |
| .ui-icon-alt { | |
| background-image: url(images/icons-36-black.png); | |
| } | |
| } | |
| /* plus minus */ | |
| .ui-icon-plus { | |
| background-position: -0 50%; | |
| } | |
| .ui-icon-minus { | |
| background-position: -36px 50%; | |
| } | |
| /* delete/close */ | |
| .ui-icon-delete { | |
| background-position: -72px 50%; | |
| } | |
| /* arrows */ | |
| .ui-icon-arrow-r { | |
| background-position: -108px 50%; | |
| } | |
| .ui-icon-arrow-l { | |
| background-position: -144px 50%; | |
| } | |
| .ui-icon-arrow-u { | |
| background-position: -180px 50%; | |
| } | |
| .ui-icon-arrow-d { | |
| background-position: -216px 50%; | |
| } | |
| /* misc */ | |
| .ui-icon-check { | |
| background-position: -252px 50%; | |
| } | |
| .ui-icon-gear { | |
| background-position: -288px 50%; | |
| } | |
| .ui-icon-refresh { | |
| background-position: -324px 50%; | |
| } | |
| .ui-icon-forward { | |
| background-position: -360px 50%; | |
| } | |
| .ui-icon-back { | |
| background-position: -396px 50%; | |
| } | |
| .ui-icon-grid { | |
| background-position: -432px 50%; | |
| } | |
| .ui-icon-star { | |
| background-position: -468px 50%; | |
| } | |
| .ui-icon-alert { | |
| background-position: -504px 50%; | |
| } | |
| .ui-icon-info { | |
| background-position: -540px 50%; | |
| } | |
| .ui-icon-home { | |
| background-position: -576px 50%; | |
| } | |
| .ui-icon-search, | |
| .ui-icon-searchfield:after { | |
| background-position: -612px 50%; | |
| } | |
| .ui-icon-checkbox-off { | |
| background-position: -684px 50%; | |
| } | |
| .ui-icon-checkbox-on { | |
| background-position: -648px 50%; | |
| } | |
| .ui-icon-radio-off { | |
| background-position: -756px 50%; | |
| } | |
| .ui-icon-radio-on { | |
| background-position: -720px 50%; | |
| } | |
| /* checks,radios */ | |
| .ui-checkbox .ui-icon { | |
| -moz-border-radius: 3px; | |
| -webkit-border-radius: 3px; | |
| border-radius: 3px; | |
| } | |
| .ui-icon-checkbox-off, | |
| .ui-icon-radio-off { | |
| background-color: transparent; | |
| } | |
| .ui-checkbox-on .ui-icon, | |
| .ui-radio-on .ui-icon { | |
| background-color: #4596ce /*{global-active-background-color}*/; /* NOTE: this hex should match the active state color. It's repeated here for cascade */ | |
| } | |
| /* loading icon */ | |
| .ui-icon-loading { | |
| background-image: url(images/ajax-loader.png); | |
| width: 40px; | |
| height: 40px; | |
| -moz-border-radius: 20px; | |
| -webkit-border-radius: 20px; | |
| border-radius: 20px; | |
| background-size: 35px 35px; | |
| } | |
| /* Button corner classes | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-btn-corner-tl { | |
| -moz-border-radius-topleft: 1em /*{global-radii-buttons}*/; | |
| -webkit-border-top-left-radius: 1em /*{global-radii-buttons}*/; | |
| border-top-left-radius: 1em /*{global-radii-buttons}*/; | |
| } | |
| .ui-btn-corner-tr { | |
| -moz-border-radius-topright: 1em /*{global-radii-buttons}*/; | |
| -webkit-border-top-right-radius: 1em /*{global-radii-buttons}*/; | |
| border-top-right-radius: 1em /*{global-radii-buttons}*/; | |
| } | |
| .ui-btn-corner-bl { | |
| -moz-border-radius-bottomleft: 1em /*{global-radii-buttons}*/; | |
| -webkit-border-bottom-left-radius: 1em /*{global-radii-buttons}*/; | |
| border-bottom-left-radius: 1em /*{global-radii-buttons}*/; | |
| } | |
| .ui-btn-corner-br { | |
| -moz-border-radius-bottomright: 1em /*{global-radii-buttons}*/; | |
| -webkit-border-bottom-right-radius: 1em /*{global-radii-buttons}*/; | |
| border-bottom-right-radius: 1em /*{global-radii-buttons}*/; | |
| } | |
| .ui-btn-corner-top { | |
| -moz-border-radius-topleft: 1em /*{global-radii-buttons}*/; | |
| -webkit-border-top-left-radius: 1em /*{global-radii-buttons}*/; | |
| border-top-left-radius: 1em /*{global-radii-buttons}*/; | |
| -moz-border-radius-topright: 1em /*{global-radii-buttons}*/; | |
| -webkit-border-top-right-radius: 1em /*{global-radii-buttons}*/; | |
| border-top-right-radius: 1em /*{global-radii-buttons}*/; | |
| } | |
| .ui-btn-corner-bottom { | |
| -moz-border-radius-bottomleft: 1em /*{global-radii-buttons}*/; | |
| -webkit-border-bottom-left-radius: 1em /*{global-radii-buttons}*/; | |
| border-bottom-left-radius: 1em /*{global-radii-buttons}*/; | |
| -moz-border-radius-bottomright: 1em /*{global-radii-buttons}*/; | |
| -webkit-border-bottom-right-radius: 1em /*{global-radii-buttons}*/; | |
| border-bottom-right-radius: 1em /*{global-radii-buttons}*/; | |
| } | |
| .ui-btn-corner-right { | |
| -moz-border-radius-topright: 1em /*{global-radii-buttons}*/; | |
| -webkit-border-top-right-radius: 1em /*{global-radii-buttons}*/; | |
| border-top-right-radius: 1em /*{global-radii-buttons}*/; | |
| -moz-border-radius-bottomright: 1em /*{global-radii-buttons}*/; | |
| -webkit-border-bottom-right-radius: 1em /*{global-radii-buttons}*/; | |
| border-bottom-right-radius: 1em /*{global-radii-buttons}*/; | |
| } | |
| .ui-btn-corner-left { | |
| -moz-border-radius-topleft: 1em /*{global-radii-buttons}*/; | |
| -webkit-border-top-left-radius: 1em /*{global-radii-buttons}*/; | |
| border-top-left-radius: 1em /*{global-radii-buttons}*/; | |
| -moz-border-radius-bottomleft: 1em /*{global-radii-buttons}*/; | |
| -webkit-border-bottom-left-radius: 1em /*{global-radii-buttons}*/; | |
| border-bottom-left-radius: 1em /*{global-radii-buttons}*/; | |
| } | |
| .ui-btn-corner-all { | |
| -moz-border-radius: 1em /*{global-radii-buttons}*/; | |
| -webkit-border-radius: 1em /*{global-radii-buttons}*/; | |
| border-radius: 1em /*{global-radii-buttons}*/; | |
| } | |
| /* radius clip workaround for cleaning up corner trapping */ | |
| .ui-corner-tl, | |
| .ui-corner-tr, | |
| .ui-corner-bl, | |
| .ui-corner-br, | |
| .ui-corner-top, | |
| .ui-corner-bottom, | |
| .ui-corner-right, | |
| .ui-corner-left, | |
| .ui-corner-all, | |
| .ui-btn-corner-tl, | |
| .ui-btn-corner-tr, | |
| .ui-btn-corner-bl, | |
| .ui-btn-corner-br, | |
| .ui-btn-corner-top, | |
| .ui-btn-corner-bottom, | |
| .ui-btn-corner-right, | |
| .ui-btn-corner-left, | |
| .ui-btn-corner-all { | |
| -webkit-background-clip: padding-box; | |
| -moz-background-clip: padding; | |
| background-clip: padding-box; | |
| } | |
| /* Overlay / modal | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-overlay { | |
| background: #666; | |
| opacity: .5; | |
| filter: Alpha(Opacity=50); | |
| position: absolute; | |
| width: 100%; | |
| height: 100%; | |
| } | |
| .ui-overlay-shadow { | |
| -moz-box-shadow: 0px 0px 12px rgba(0,0,0,.6); | |
| -webkit-box-shadow: 0px 0px 12px rgba(0,0,0,.6); | |
| box-shadow: 0px 0px 12px rgba(0,0,0,.6); | |
| } | |
| .ui-shadow { | |
| -moz-box-shadow: 0px 1px 4px /*{global-box-shadow-size}*/ rgba(0,0,0,.3) /*{global-box-shadow-color}*/; | |
| -webkit-box-shadow: 0px 1px 4px /*{global-box-shadow-size}*/ rgba(0,0,0,.3) /*{global-box-shadow-color}*/; | |
| box-shadow: 0px 1px 4px /*{global-box-shadow-size}*/ rgba(0,0,0,.3) /*{global-box-shadow-color}*/; | |
| } | |
| .ui-bar-a .ui-shadow, | |
| .ui-bar-b .ui-shadow , | |
| .ui-bar-c .ui-shadow { | |
| -moz-box-shadow: 0px 1px 0 rgba(255,255,255,.3); | |
| -webkit-box-shadow: 0px 1px 0 rgba(255,255,255,.3); | |
| box-shadow: 0px 1px 0 rgba(255,255,255,.3); | |
| } | |
| .ui-shadow-inset { | |
| -moz-box-shadow: inset 0px 1px 4px rgba(0,0,0,.2); | |
| -webkit-box-shadow: inset 0px 1px 4px rgba(0,0,0,.2); | |
| box-shadow: inset 0px 1px 4px rgba(0,0,0,.2); | |
| } | |
| .ui-icon-shadow { | |
| -moz-box-shadow: 0px 1px 0 rgba(255,255,255,.4); | |
| -webkit-box-shadow: 0px 1px 0 rgba(255,255,255,.4); | |
| box-shadow: 0px 1px 0 rgba(255,255,255,.4); | |
| } | |
| /* Focus state - set here for specificity | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-focus { | |
| -moz-box-shadow: 0px 0px 12px #387bbe /*{global-active-background-color}*/; | |
| -webkit-box-shadow: 0px 0px 12px #387bbe /*{global-active-background-color}*/; | |
| box-shadow: 0px 0px 12px #387bbe /*{global-active-background-color}*/; | |
| } | |
| /* unset box shadow in browsers that don't do it right | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-mobile-nosupport-boxshadow * { | |
| -moz-box-shadow: none !important; | |
| -webkit-box-shadow: none !important; | |
| box-shadow: none !important; | |
| } | |
| /* ...and bring back focus */ | |
| .ui-mobile-nosupport-boxshadow .ui-focus { | |
| outline-width: 2px; | |
| }/* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| /* some unsets - more probably needed */ | |
| .ui-mobile, .ui-mobile body { height: 100%; } | |
| .ui-mobile fieldset, .ui-page { padding: 0; margin: 0; } | |
| .ui-mobile a img, .ui-mobile fieldset { border: 0; } | |
| /* responsive page widths */ | |
| .ui-mobile-viewport { margin: 0; overflow-x: hidden; -webkit-text-size-adjust: none; -ms-text-size-adjust:none; -webkit-tap-highlight-color: rgba(0, 0, 0, 0); } | |
| /* "page" containers - full-screen views, one should always be in view post-pageload */ | |
| .ui-mobile [data-role=page], .ui-mobile [data-role=dialog], .ui-page { top: 0; left: 0; width: 100%; min-height: 100%; position: absolute; display: none; border: 0; } | |
| .ui-mobile .ui-page-active { display: block; overflow: visible; } | |
| /* on ios4, setting focus on the page element causes flashing during transitions when there is an outline, so we turn off outlines */ | |
| .ui-page { outline: none; } | |
| /* native overflow scrolling */ | |
| .ui-page.ui-mobile-touch-overflow, | |
| .ui-mobile-touch-overflow.ui-native-fixed .ui-content { | |
| overflow: auto; | |
| height: 100%; | |
| -webkit-overflow-scrolling: touch; | |
| -moz-overflow-scrolling: touch; | |
| -o-overflow-scrolling: touch; | |
| -ms-overflow-scrolling: touch; | |
| overflow-scrolling: touch; | |
| } | |
| .ui-page.ui-mobile-touch-overflow, | |
| .ui-page.ui-mobile-touch-overflow * { | |
| /* some level of transform keeps elements from blinking out of visibility on iOS */ | |
| -webkit-transform: rotateY(0); | |
| } | |
| .ui-page.ui-mobile-pre-transition { | |
| display: block; | |
| } | |
| /* loading screen */ | |
| .ui-loading .ui-mobile-viewport { overflow: hidden !important; } | |
| .ui-loading .ui-loader { display: block; } | |
| .ui-loading .ui-page { overflow: hidden; } | |
| .ui-loader { display: none; position: absolute; opacity: .85; z-index: 100; left: 50%; width: 200px; margin-left: -130px; margin-top: -35px; padding: 10px 30px; } | |
| .ui-loader h1 { font-size: 15px; text-align: center; } | |
| .ui-loader .ui-icon { position: static; display: block; opacity: .9; margin: 0 auto; width: 35px; height: 35px; background-color: transparent; } | |
| /*fouc*/ | |
| .ui-mobile-rendering > * { visibility: hidden; } | |
| /*headers, content panels*/ | |
| .ui-bar, .ui-body { position: relative; padding: .4em 15px; overflow: hidden; display: block; clear:both; } | |
| .ui-bar { font-size: 16px; margin: 0; } | |
| .ui-bar h1, .ui-bar h2, .ui-bar h3, .ui-bar h4, .ui-bar h5, .ui-bar h6 { margin: 0; padding: 0; font-size: 16px; display: inline-block; } | |
| .ui-header, .ui-footer { display: block; } | |
| .ui-page .ui-header, .ui-page .ui-footer { position: relative; } | |
| .ui-header .ui-btn-left { position: absolute; left: 10px; top: .4em; } | |
| .ui-header .ui-btn-right { position: absolute; right: 10px; top: .4em; } | |
| .ui-header .ui-title, .ui-footer .ui-title { min-height: 1.1em; text-align: center; font-size: 16px; display: block; margin: .6em 90px .8em; padding: 0; text-overflow: ellipsis; overflow: hidden; white-space: nowrap; outline: 0 !important; } | |
| /*content area*/ | |
| .ui-content { border-width: 0; overflow: visible; overflow-x: hidden; padding: 15px; } | |
| .ui-page-fullscreen .ui-content { padding:0; } | |
| /* native fixed headers and footers */ | |
| .ui-mobile-touch-overflow.ui-page.ui-native-fixed, | |
| .ui-mobile-touch-overflow.ui-page.ui-native-fullscreen { | |
| overflow: visible; | |
| } | |
| .ui-mobile-touch-overflow.ui-native-fixed .ui-header, | |
| .ui-mobile-touch-overflow.ui-native-fixed .ui-footer { | |
| position: fixed; | |
| left: 0; | |
| right: 0; | |
| top: 0; | |
| z-index: 200; | |
| } | |
| .ui-mobile-touch-overflow.ui-page.ui-native-fixed .ui-footer { | |
| top: auto; | |
| bottom: 0; | |
| } | |
| .ui-mobile-touch-overflow.ui-native-fixed .ui-content { | |
| padding-top: 2.5em; | |
| padding-bottom: 3em; | |
| top: 0; | |
| bottom: 0; | |
| height: auto; | |
| position: absolute; | |
| } | |
| .ui-mobile-touch-overflow.ui-native-fullscreen .ui-content { | |
| padding-top: 0; | |
| padding-bottom: 0; | |
| } | |
| .ui-mobile-touch-overflow.ui-native-fullscreen .ui-header, | |
| .ui-mobile-touch-overflow.ui-native-fullscreen .ui-footer { | |
| opacity: .9; | |
| } | |
| .ui-native-bars-hidden { | |
| display: none; | |
| } | |
| /* icons sizing */ | |
| .ui-icon { width: 18px; height: 18px; } | |
| /* fullscreen class on ui-content div */ | |
| .ui-fullscreen { } | |
| .ui-fullscreen img { max-width: 100%; } | |
| /* non-js content hiding */ | |
| .ui-nojs { position: absolute; left: -9999px; } | |
| /* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| .spin { | |
| -webkit-transform: rotate(360deg); | |
| -webkit-animation-name: spin; | |
| -webkit-animation-duration: 1s; | |
| -webkit-animation-iteration-count: infinite; | |
| -webkit-animation-timing-function: linear; | |
| } | |
| @-webkit-keyframes spin { | |
| from {-webkit-transform: rotate(0deg);} | |
| to {-webkit-transform: rotate(360deg);} | |
| } | |
| /* Transitions from jQtouch (with small modifications): http://www.jqtouch.com/ | |
| Built by David Kaneda and maintained by Jonathan Stark. | |
| */ | |
| .in, .out { | |
| -webkit-animation-timing-function: ease-in-out; | |
| -webkit-animation-duration: 350ms; | |
| } | |
| .slide.out { | |
| -webkit-transform: translateX(-100%); | |
| -webkit-animation-name: slideouttoleft; | |
| } | |
| .slide.in { | |
| -webkit-transform: translateX(0); | |
| -webkit-animation-name: slideinfromright; | |
| } | |
| .slide.out.reverse { | |
| -webkit-transform: translateX(100%); | |
| -webkit-animation-name: slideouttoright; | |
| } | |
| .slide.in.reverse { | |
| -webkit-transform: translateX(0); | |
| -webkit-animation-name: slideinfromleft; | |
| } | |
| .slideup.out { | |
| -webkit-animation-name: dontmove; | |
| z-index: 0; | |
| } | |
| .slideup.in { | |
| -webkit-transform: translateY(0); | |
| -webkit-animation-name: slideinfrombottom; | |
| z-index: 10; | |
| } | |
| .slideup.in.reverse { | |
| z-index: 0; | |
| -webkit-animation-name: dontmove; | |
| } | |
| .slideup.out.reverse { | |
| -webkit-transform: translateY(100%); | |
| z-index: 10; | |
| -webkit-animation-name: slideouttobottom; | |
| } | |
| .slidedown.out { | |
| -webkit-animation-name: dontmove; | |
| z-index: 0; | |
| } | |
| .slidedown.in { | |
| -webkit-transform: translateY(0); | |
| -webkit-animation-name: slideinfromtop; | |
| z-index: 10; | |
| } | |
| .slidedown.in.reverse { | |
| z-index: 0; | |
| -webkit-animation-name: dontmove; | |
| } | |
| .slidedown.out.reverse { | |
| -webkit-transform: translateY(-100%); | |
| z-index: 10; | |
| -webkit-animation-name: slideouttotop; | |
| } | |
| @-webkit-keyframes slideinfromright { | |
| from { -webkit-transform: translateX(100%); } | |
| to { -webkit-transform: translateX(0); } | |
| } | |
| @-webkit-keyframes slideinfromleft { | |
| from { -webkit-transform: translateX(-100%); } | |
| to { -webkit-transform: translateX(0); } | |
| } | |
| @-webkit-keyframes slideouttoleft { | |
| from { -webkit-transform: translateX(0); } | |
| to { -webkit-transform: translateX(-100%); } | |
| } | |
| @-webkit-keyframes slideouttoright { | |
| from { -webkit-transform: translateX(0); } | |
| to { -webkit-transform: translateX(100%); } | |
| } | |
| @-webkit-keyframes slideinfromtop { | |
| from { -webkit-transform: translateY(-100%); } | |
| to { -webkit-transform: translateY(0); } | |
| } | |
| @-webkit-keyframes slideinfrombottom { | |
| from { -webkit-transform: translateY(100%); } | |
| to { -webkit-transform: translateY(0); } | |
| } | |
| @-webkit-keyframes slideouttobottom { | |
| from { -webkit-transform: translateY(0); } | |
| to { -webkit-transform: translateY(100%); } | |
| } | |
| @-webkit-keyframes slideouttotop { | |
| from { -webkit-transform: translateY(0); } | |
| to { -webkit-transform: translateY(-100%); } | |
| } | |
| @-webkit-keyframes fadein { | |
| from { opacity: 0; } | |
| to { opacity: 1; } | |
| } | |
| @-webkit-keyframes fadeout { | |
| from { opacity: 1; } | |
| to { opacity: 0; } | |
| } | |
| .fade.out { | |
| z-index: 0; | |
| -webkit-animation-name: fadeout; | |
| } | |
| .fade.in { | |
| opacity: 1; | |
| z-index: 10; | |
| -webkit-animation-name: fadein; | |
| } | |
| /* The properties in this rule are only necessary for the 'flip' transition. | |
| * We need specify the perspective to create a projection matrix. This will add | |
| * some depth as the element flips. The depth number represents the distance of | |
| * the viewer from the z-plane. According to the CSS3 spec, 1000 is a moderate | |
| * value. | |
| */ | |
| .viewport-flip { | |
| -webkit-perspective: 1000; | |
| position: absolute; | |
| } | |
| .ui-mobile-viewport-transitioning, | |
| .ui-mobile-viewport-transitioning .ui-page { | |
| width: 100%; | |
| height: 100%; | |
| overflow: hidden; | |
| } | |
| .flip { | |
| -webkit-animation-duration: .65s; | |
| -webkit-backface-visibility:hidden; | |
| -webkit-transform:translateX(0); /* Needed to work around an iOS 3.1 bug that causes listview thumbs to disappear when -webkit-visibility:hidden is used. */ | |
| } | |
| .flip.out { | |
| -webkit-transform: rotateY(-180deg) scale(.8); | |
| -webkit-animation-name: flipouttoleft; | |
| } | |
| .flip.in { | |
| -webkit-transform: rotateY(0) scale(1); | |
| -webkit-animation-name: flipinfromleft; | |
| } | |
| /* Shake it all about */ | |
| .flip.out.reverse { | |
| -webkit-transform: rotateY(180deg) scale(.8); | |
| -webkit-animation-name: flipouttoright; | |
| } | |
| .flip.in.reverse { | |
| -webkit-transform: rotateY(0) scale(1); | |
| -webkit-animation-name: flipinfromright; | |
| } | |
| @-webkit-keyframes flipinfromright { | |
| from { -webkit-transform: rotateY(-180deg) scale(.8); } | |
| to { -webkit-transform: rotateY(0) scale(1); } | |
| } | |
| @-webkit-keyframes flipinfromleft { | |
| from { -webkit-transform: rotateY(180deg) scale(.8); } | |
| to { -webkit-transform: rotateY(0) scale(1); } | |
| } | |
| @-webkit-keyframes flipouttoleft { | |
| from { -webkit-transform: rotateY(0) scale(1); } | |
| to { -webkit-transform: rotateY(-180deg) scale(.8); } | |
| } | |
| @-webkit-keyframes flipouttoright { | |
| from { -webkit-transform: rotateY(0) scale(1); } | |
| to { -webkit-transform: rotateY(180deg) scale(.8); } | |
| } | |
| /* Hackish, but reliable. */ | |
| @-webkit-keyframes dontmove { | |
| from { opacity: 1; } | |
| to { opacity: 1; } | |
| } | |
| .pop { | |
| -webkit-transform-origin: 50% 50%; | |
| } | |
| .pop.in { | |
| -webkit-transform: scale(1); | |
| opacity: 1; | |
| -webkit-animation-name: popin; | |
| z-index: 10; | |
| } | |
| .pop.in.reverse { | |
| z-index: 0; | |
| -webkit-animation-name: dontmove; | |
| } | |
| .pop.out.reverse { | |
| -webkit-transform: scale(.2); | |
| opacity: 0; | |
| -webkit-animation-name: popout; | |
| z-index: 10; | |
| } | |
| @-webkit-keyframes popin { | |
| from { | |
| -webkit-transform: scale(.2); | |
| opacity: 0; | |
| } | |
| to { | |
| -webkit-transform: scale(1); | |
| opacity: 1; | |
| } | |
| } | |
| @-webkit-keyframes popout { | |
| from { | |
| -webkit-transform: scale(1); | |
| opacity: 1; | |
| } | |
| to { | |
| -webkit-transform: scale(.2); | |
| opacity: 0; | |
| } | |
| }/* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| /* content configurations. */ | |
| .ui-grid-a, .ui-grid-b, .ui-grid-c, .ui-grid-d { overflow: hidden; } | |
| .ui-block-a, .ui-block-b, .ui-block-c, .ui-block-d, .ui-block-e { margin: 0; padding: 0; border: 0; float: left; min-height:1px;} | |
| /* grid solo: 100 - single item fallback */ | |
| .ui-grid-solo .ui-block-a { width: 100%; float: none; } | |
| /* grid a: 50/50 */ | |
| .ui-grid-a .ui-block-a, .ui-grid-a .ui-block-b { width: 50%; } | |
| .ui-grid-a .ui-block-a { clear: left; } | |
| /* grid b: 33/33/33 */ | |
| .ui-grid-b .ui-block-a, .ui-grid-b .ui-block-b, .ui-grid-b .ui-block-c { width: 33.333%; } | |
| .ui-grid-b .ui-block-a { clear: left; } | |
| /* grid c: 25/25/25/25 */ | |
| .ui-grid-c .ui-block-a, .ui-grid-c .ui-block-b, .ui-grid-c .ui-block-c, .ui-grid-c .ui-block-d { width: 25%; } | |
| .ui-grid-c .ui-block-a { clear: left; } | |
| /* grid d: 20/20/20/20/20 */ | |
| .ui-grid-d .ui-block-a, .ui-grid-d .ui-block-b, .ui-grid-d .ui-block-c, .ui-grid-d .ui-block-d, .ui-grid-d .ui-block-e { width: 20%; } | |
| .ui-grid-d .ui-block-a { clear: left; } | |
| /* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| /* fixed page header & footer configuration */ | |
| .ui-header, .ui-footer, .ui-page-fullscreen .ui-header, .ui-page-fullscreen .ui-footer { position: absolute; overflow: hidden; width: 100%; border-left-width: 0; border-right-width: 0; } | |
| .ui-header-fixed, .ui-footer-fixed { | |
| z-index: 1000; | |
| -webkit-transform: translateZ(0); /* Force header/footer rendering to go through the same rendering pipeline as native page scrolling. */ | |
| } | |
| .ui-footer-duplicate, .ui-page-fullscreen .ui-fixed-inline { display: none; } | |
| .ui-page-fullscreen .ui-header, .ui-page-fullscreen .ui-footer { opacity: .9; } | |
| /* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| .ui-navbar { overflow: hidden; } | |
| .ui-navbar ul, .ui-navbar-expanded ul { list-style:none; padding: 0; margin: 0; position: relative; display: block; border: 0;} | |
| .ui-navbar-collapsed ul { float: left; width: 75%; margin-right: -2px; } | |
| .ui-navbar-collapsed .ui-navbar-toggle { float: left; width: 25%; } | |
| .ui-navbar li.ui-navbar-truncate { position: absolute; left: -9999px; top: -9999px; } | |
| .ui-navbar li .ui-btn, .ui-navbar .ui-navbar-toggle .ui-btn { display: block; font-size: 12px; text-align: center; margin: 0; border-right-width: 0; } | |
| .ui-navbar li .ui-btn { margin-right: -1px; } | |
| .ui-navbar li .ui-btn:last-child { margin-right: 0; } | |
| .ui-header .ui-navbar li .ui-btn, .ui-header .ui-navbar .ui-navbar-toggle .ui-btn, | |
| .ui-footer .ui-navbar li .ui-btn, .ui-footer .ui-navbar .ui-navbar-toggle .ui-btn { border-top-width: 0; border-bottom-width: 0; } | |
| .ui-navbar .ui-btn-inner { padding-left: 2px; padding-right: 2px; } | |
| .ui-navbar-noicons li .ui-btn .ui-btn-inner, .ui-navbar-noicons .ui-navbar-toggle .ui-btn-inner { padding-top: .8em; padding-bottom: .9em; } | |
| /*expanded page styles*/ | |
| .ui-navbar-expanded .ui-btn { margin: 0; font-size: 14px; } | |
| .ui-navbar-expanded .ui-btn-inner { padding-left: 5px; padding-right: 5px; } | |
| .ui-navbar-expanded .ui-btn-icon-top .ui-btn-inner { padding: 45px 5px 15px; text-align: center; } | |
| .ui-navbar-expanded .ui-btn-icon-top .ui-icon { top: 15px; } | |
| .ui-navbar-expanded .ui-btn-icon-bottom .ui-btn-inner { padding: 15px 5px 45px; text-align: center; } | |
| .ui-navbar-expanded .ui-btn-icon-bottom .ui-icon { bottom: 15px; } | |
| .ui-navbar-expanded li .ui-btn .ui-btn-inner { min-height: 2.5em; } | |
| .ui-navbar-expanded .ui-navbar-noicons .ui-btn .ui-btn-inner { padding-top: 1.8em; padding-bottom: 1.9em; } | |
| /* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| .ui-btn { display: block; text-align: center; cursor:pointer; position: relative; margin: .5em 5px; padding: 0; } | |
| .ui-btn:focus, .ui-btn:active { outline: none; } | |
| .ui-header .ui-btn, .ui-footer .ui-btn, .ui-bar .ui-btn { display: inline-block; font-size: 13px; margin: 0; } | |
| .ui-btn-inline { display: inline-block; } | |
| .ui-btn-inner { padding: .6em 25px; display: block; text-overflow: ellipsis; overflow: hidden; white-space: nowrap; position: relative; zoom: 1; } | |
| .ui-header .ui-btn-inner, .ui-footer .ui-btn-inner, .ui-bar .ui-btn-inner { padding: .4em 8px .5em; } | |
| .ui-btn-icon-notext { width: 24px; height: 24px; } | |
| .ui-btn-icon-notext .ui-btn-inner { padding: 2px 1px 2px 3px; } | |
| .ui-btn-icon-notext .ui-btn-text { position: absolute; left: -999px; } | |
| .ui-btn-icon-left .ui-btn-inner { padding-left: 33px; } | |
| .ui-header .ui-btn-icon-left .ui-btn-inner, | |
| .ui-footer .ui-btn-icon-left .ui-btn-inner, | |
| .ui-bar .ui-btn-icon-left .ui-btn-inner { padding-left: 27px; } | |
| .ui-btn-icon-right .ui-btn-inner { padding-right: 33px; } | |
| .ui-header .ui-btn-icon-right .ui-btn-inner, | |
| .ui-footer .ui-btn-icon-right .ui-btn-inner, | |
| .ui-bar .ui-btn-icon-right .ui-btn-inner { padding-right: 27px; } | |
| .ui-btn-icon-top .ui-btn-inner { padding-top: 33px; } | |
| .ui-header .ui-btn-icon-top .ui-btn-inner, | |
| .ui-footer .ui-btn-icon-top .ui-btn-inner, | |
| .ui-bar .ui-btn-icon-top .ui-btn-inner { padding-top: 27px; } | |
| .ui-btn-icon-bottom .ui-btn-inner { padding-bottom: 33px; } | |
| .ui-header .ui-btn-icon-bottom .ui-btn-inner, | |
| .ui-footer .ui-btn-icon-bottom .ui-btn-inner, | |
| .ui-bar .ui-btn-icon-bottom .ui-btn-inner { padding-bottom: 27px; } | |
| /*btn icon positioning*/ | |
| .ui-btn-icon-notext .ui-icon { display: block; } | |
| .ui-btn-icon-left .ui-icon, .ui-btn-icon-right .ui-icon { position: absolute; top: 50%; margin-top: -9px; } | |
| .ui-btn-icon-top .ui-icon, .ui-btn-icon-bottom .ui-icon { position: absolute; left: 50%; margin-left: -9px; } | |
| .ui-btn-icon-left .ui-icon { left: 10px; } | |
| .ui-btn-icon-right .ui-icon { right: 10px; } | |
| .ui-btn-icon-top .ui-icon { top: 10px; } | |
| .ui-btn-icon-bottom .ui-icon { bottom: 10px; } | |
| .ui-header .ui-btn-icon-left .ui-icon, | |
| .ui-footer .ui-btn-icon-left .ui-icon, | |
| .ui-bar .ui-btn-icon-left .ui-icon { left: 4px; } | |
| .ui-header .ui-btn-icon-right .ui-icon, | |
| .ui-footer .ui-btn-icon-right .ui-icon, | |
| .ui-bar .ui-btn-icon-right .ui-icon { right: 4px; } | |
| .ui-header .ui-btn-icon-top .ui-icon, | |
| .ui-footer .ui-btn-icon-top .ui-icon, | |
| .ui-bar .ui-btn-icon-top .ui-icon { top: 4px; } | |
| .ui-header .ui-btn-icon-bottom .ui-icon, | |
| .ui-footer .ui-btn-icon-bottom .ui-icon, | |
| .ui-bar .ui-btn-icon-bottom .ui-icon { bottom: 4px; } | |
| /*hiding native button,inputs */ | |
| .ui-btn-hidden { position: absolute; top: 0; left: 0; width: 100%; height: 100%; -webkit-appearance: button; opacity: .1; cursor: pointer; background: transparent; font-size: 1px; border: none; line-height: 999px; } | |
| /* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| .ui-collapsible { margin: .5em 0; } | |
| .ui-collapsible-heading { font-size: 16px; display: block; margin: 0 -8px; padding: 0; border-width: 0 0 1px 0; position: relative; } | |
| .ui-collapsible-heading a { text-align: left; margin: 0; } | |
| .ui-collapsible-heading a .ui-btn-inner { padding-left: 40px; } | |
| .ui-collapsible-heading a span.ui-btn { position: absolute; left: 6px; top: 50%; margin: -12px 0 0 0; width: 20px; height: 20px; padding: 1px 0px 1px 2px; text-indent: -9999px; } | |
| .ui-collapsible-heading a span.ui-btn .ui-btn-inner { padding: 10px 0; } | |
| .ui-collapsible-heading a span.ui-btn .ui-icon { left: 0; margin-top: -10px; } | |
| .ui-collapsible-heading-status { position:absolute; left:-9999px; } | |
| .ui-collapsible-content { | |
| display: block; | |
| margin: 0 -8px; | |
| padding: 10px 16px; | |
| border-top: none; /* Overrides ui-btn-up-* */ | |
| background-image: none; /* Overrides ui-btn-up-* */ | |
| font-weight: normal; /* Overrides ui-btn-up-* */ | |
| } | |
| .ui-collapsible-content-collapsed { display: none; } | |
| .ui-collapsible-set { margin: .5em 0; } | |
| .ui-collapsible-set .ui-collapsible { margin: -1px 0 0; } | |
| /* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| .ui-controlgroup, fieldset.ui-controlgroup { padding: 0; margin: .5em 0 1em; } | |
| .ui-bar .ui-controlgroup { margin: 0 .3em; } | |
| .ui-controlgroup-label { font-size: 16px; line-height: 1.4; font-weight: normal; margin: 0 0 .3em; } | |
| .ui-controlgroup-controls { display: block; width: 95%;} | |
| .ui-controlgroup li { list-style: none; } | |
| .ui-controlgroup-vertical .ui-btn, | |
| .ui-controlgroup-vertical .ui-checkbox, .ui-controlgroup-vertical .ui-radio { margin: 0; border-bottom-width: 0; } | |
| .ui-controlgroup-vertical .ui-controlgroup-last { border-bottom-width: 1px; } | |
| .ui-controlgroup-horizontal { padding: 0; } | |
| .ui-controlgroup-horizontal .ui-btn { display: inline-block; margin: 0 -5px 0 0; } | |
| .ui-controlgroup-horizontal .ui-checkbox, .ui-controlgroup-horizontal .ui-radio { float: left; margin: 0 -1px 0 0; } | |
| .ui-controlgroup-horizontal .ui-checkbox .ui-btn, .ui-controlgroup-horizontal .ui-radio .ui-btn, | |
| .ui-controlgroup-horizontal .ui-checkbox:last-child, .ui-controlgroup-horizontal .ui-radio:last-child { margin-right: 0; } | |
| .ui-controlgroup-horizontal .ui-controlgroup-last { margin-right: 0; } | |
| .ui-controlgroup .ui-checkbox label, .ui-controlgroup .ui-radio label { font-size: 16px; } | |
| /* conflicts with listview.. | |
| .ui-controlgroup .ui-btn-icon-notext { width: 30px; height: 30px; text-indent: -9999px; } | |
| .ui-controlgroup .ui-btn-icon-notext .ui-btn-inner { padding: 5px 6px 5px 5px; } | |
| */ | |
| @media all and (min-width: 450px){ | |
| .ui-controlgroup-label { vertical-align: top; display: inline-block; width: 20%; margin: 0 2% 0 0; } | |
| .ui-controlgroup-controls { width: 60%; display: inline-block; } | |
| } /* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| .ui-dialog { min-height: 480px; } | |
| .ui-dialog .ui-header, .ui-dialog .ui-content, .ui-dialog .ui-footer { margin: 15px; position: relative; } | |
| .ui-dialog .ui-header, .ui-dialog .ui-footer { z-index: 10; width: auto; } | |
| .ui-dialog .ui-content, .ui-dialog .ui-footer { margin-top: -15px; }/* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| .ui-checkbox, .ui-radio { position:relative; margin: .2em 0 .5em; z-index: 1; } | |
| .ui-checkbox .ui-btn, .ui-radio .ui-btn { margin: 0; text-align: left; z-index: 2; } | |
| .ui-checkbox .ui-btn-inner, .ui-radio .ui-btn-inner { white-space: normal; } | |
| .ui-checkbox .ui-btn-icon-left .ui-btn-inner,.ui-radio .ui-btn-icon-left .ui-btn-inner { padding-left: 45px; } | |
| .ui-checkbox .ui-btn-icon-right .ui-btn-inner, .ui-radio .ui-btn-icon-right .ui-btn-inner { padding-right: 45px; } | |
| .ui-checkbox .ui-icon, .ui-radio .ui-icon { top: 1.1em; } | |
| .ui-checkbox .ui-btn-icon-left .ui-icon, .ui-radio .ui-btn-icon-left .ui-icon {left: 15px; } | |
| .ui-checkbox .ui-btn-icon-right .ui-icon, .ui-radio .ui-btn-icon-right .ui-icon {right: 15px; } | |
| /* input, label positioning */ | |
| .ui-checkbox input,.ui-radio input { position:absolute; left:20px; top:50%; width: 10px; height: 10px; margin:-5px 0 0 0; outline: 0 !important; z-index: 1; }/* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| .ui-field-contain { padding: 1.5em 0; margin: 0; border-bottom-width: 1px; overflow: visible; } | |
| .ui-field-contain:first-child { border-top-width: 0; } | |
| @media all and (min-width: 450px){ | |
| .ui-field-contain { border-width: 0; padding: 0; margin: 1em 0; } | |
| } /* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| .ui-select { display: block; position: relative; } | |
| .ui-select select { position: absolute; left: -9999px; top: -9999px; } | |
| .ui-select .ui-btn { overflow: hidden; } | |
| .ui-select .ui-btn select { cursor: pointer; -webkit-appearance: button; left: 0; top:0; width: 100%; min-height: 1.5em; min-height: 100%; height: 3em; max-height: 100%; opacity: 0; -ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=0)"; filter: alpha(opacity=0); z-index: 2; } | |
| @-moz-document url-prefix() {.ui-select .ui-btn select { opacity: 0.0001; }} | |
| .ui-select .ui-btn select.ui-select-nativeonly { opacity: 1; text-indent: 0; } | |
| .ui-select .ui-btn-icon-right .ui-btn-inner { padding-right: 45px; } | |
| .ui-select .ui-btn-icon-right .ui-icon { right: 15px; } | |
| /* labels */ | |
| label.ui-select { font-size: 16px; line-height: 1.4; font-weight: normal; margin: 0 0 .3em; display: block; } | |
| /*listbox*/ | |
| .ui-select .ui-btn-text, .ui-selectmenu .ui-btn-text { display: block; min-height: 1em; } | |
| .ui-select .ui-btn-text { text-overflow: ellipsis; overflow: hidden;} | |
| .ui-selectmenu { position: absolute; padding: 0; z-index: 100 !important; width: 80%; max-width: 350px; padding: 6px; } | |
| .ui-selectmenu .ui-listview { margin: 0; } | |
| .ui-selectmenu .ui-btn.ui-li-divider { cursor: default; } | |
| .ui-selectmenu-hidden { top: -9999px; left: -9999px; } | |
| .ui-selectmenu-screen { position: absolute; top: 0; left: 0; width: 100%; height: 100%; z-index: 99; } | |
| .ui-screen-hidden, .ui-selectmenu-list .ui-li .ui-icon { display: none; } | |
| .ui-selectmenu-list .ui-li .ui-icon { display: block; } | |
| .ui-li.ui-selectmenu-placeholder { display: none; } | |
| .ui-selectmenu .ui-header .ui-title { margin: 0.6em 46px 0.8em; } | |
| @media all and (min-width: 450px){ | |
| label.ui-select { vertical-align: top; display: inline-block; width: 20%; margin: 0 2% 0 0; } | |
| .ui-select { width: 60%; display: inline-block; } | |
| } | |
| /* when no placeholder is defined in a multiple select, the header height doesn't even extend past the close button. this shim's content in there */ | |
| .ui-selectmenu .ui-header h1:after { content: '.'; visibility: hidden; }/* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| label.ui-input-text { font-size: 16px; line-height: 1.4; display: block; font-weight: normal; margin: 0 0 .3em; } | |
| input.ui-input-text, textarea.ui-input-text { background-image: none; padding: .4em; line-height: 1.4; font-size: 16px; display: block; width: 95%; } | |
| input.ui-input-text { -webkit-appearance: none; } | |
| textarea.ui-input-text { height: 50px; -webkit-transition: height 200ms linear; -moz-transition: height 200ms linear; -o-transition: height 200ms linear; transition: height 200ms linear; } | |
| .ui-input-search { padding: 0 30px; width: 77%; background-image: none; position: relative; } | |
| .ui-icon-searchfield:after { position: absolute; left: 7px; top: 50%; margin-top: -9px; content: ""; width: 18px; height: 18px; opacity: .5; } | |
| .ui-input-search input.ui-input-text { border: none; width: 98%; padding: .4em 0; margin: 0; display: block; background: transparent none; outline: 0 !important; } | |
| .ui-input-search .ui-input-clear { position: absolute; right: 0; top: 50%; margin-top: -14px; } | |
| .ui-input-search .ui-input-clear-hidden { display: none; } | |
| /* orientation adjustments - incomplete!*/ | |
| @media all and (min-width: 450px){ | |
| label.ui-input-text { vertical-align: top; display: inline-block; width: 20%; margin: 0 2% 0 0 } | |
| input.ui-input-text, | |
| textarea.ui-input-text, | |
| .ui-input-search { width: 60%; display: inline-block; } | |
| .ui-input-search { width: 50%; } | |
| .ui-input-search input.ui-input-text { width: 98%; /*echos rule from above*/ } | |
| }/* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| .ui-listview { margin: 0; counter-reset: listnumbering; } | |
| .ui-content .ui-listview { margin: -15px; } | |
| .ui-content .ui-listview-inset { margin: 1em 0; } | |
| .ui-listview, .ui-li { list-style:none; padding:0; } | |
| .ui-li, .ui-li.ui-field-contain { display: block; margin:0; position: relative; overflow: visible; text-align: left; border-width: 0; border-top-width: 1px; } | |
| .ui-li .ui-btn-text { position: relative; z-index: 1; } | |
| .ui-li .ui-btn-text a.ui-link-inherit { text-overflow: ellipsis; overflow: hidden; white-space: nowrap; } | |
| .ui-li-divider, .ui-li-static { padding: .5em 15px; font-size: 14px; font-weight: bold; } | |
| .ui-li-divider { counter-reset: listnumbering; } | |
| ol.ui-listview .ui-link-inherit:before, ol.ui-listview .ui-li-static:before, .ui-li-dec { font-size: .8em; display: inline-block; padding-right: .3em; font-weight: normal;counter-increment: listnumbering; content: counter(listnumbering) ". "; } | |
| ol.ui-listview .ui-li-jsnumbering:before { content: "" !important; } /* to avoid chance of duplication */ | |
| .ui-listview-inset .ui-li { border-right-width: 1px; border-left-width: 1px; } | |
| .ui-li:last-child, .ui-li.ui-field-contain:last-child { border-bottom-width: 1px; } | |
| .ui-li>.ui-btn-inner { display: block; position: relative; padding: 0; } | |
| .ui-li .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li { padding: .7em 15px .7em 15px; display: block; } | |
| .ui-li-has-thumb .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li-has-thumb { min-height: 60px; padding-left: 100px; } | |
| .ui-li-has-icon .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li-has-icon { min-height: 20px; padding-left: 40px; } | |
| .ui-li-has-count .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li-has-count { padding-right: 45px; } | |
| .ui-li-has-arrow .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li-has-arrow { padding-right: 30px; } | |
| .ui-li-has-arrow.ui-li-has-count .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li-has-arrow.ui-li-has-count { padding-right: 75px; } | |
| .ui-li-heading { font-size: 16px; font-weight: bold; display: block; margin: .6em 0; text-overflow: ellipsis; overflow: hidden; white-space: nowrap; } | |
| .ui-li-desc { font-size: 12px; font-weight: normal; display: block; margin: -.5em 0 .6em; text-overflow: ellipsis; overflow: hidden; white-space: nowrap; } | |
| .ui-li-thumb, .ui-li-icon { position: absolute; left: 1px; top: 0; max-height: 80px; max-width: 80px; } | |
| .ui-li-icon { max-height: 40px; max-width: 40px; left: 10px; top: .9em; } | |
| .ui-li-thumb, .ui-li-icon, .ui-li-content { float: left; margin-right: 10px; } | |
| .ui-li-aside { float: right; width: 50%; text-align: right; margin: .3em 0; } | |
| @media all and (min-width: 480px){ | |
| .ui-li-aside { width: 45%; } | |
| } | |
| .ui-li-divider { cursor: default; } | |
| .ui-li-has-alt .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li-has-alt { padding-right: 95px; } | |
| .ui-li-has-count .ui-li-count { position: absolute; font-size: 11px; font-weight: bold; padding: .2em .5em; top: 50%; margin-top: -.9em; right: 38px; } | |
| .ui-li-divider .ui-li-count, .ui-li-static .ui-li-count { right: 10px; } | |
| .ui-li-has-alt .ui-li-count { right: 55px; } | |
| .ui-li-link-alt { position: absolute; width: 40px; height: 100%; border-width: 0; border-left-width: 1px; top: 0; right: 0; margin: 0; padding: 0; z-index: 2; } | |
| .ui-li-link-alt .ui-btn { overflow: hidden; position: absolute; right: 8px; top: 50%; margin: -11px 0 0 0; border-bottom-width: 1px; z-index: -1;} | |
| .ui-li-link-alt .ui-btn-inner { padding: 0; height: 100%; position: absolute; width: 100%; top: 0; left: 0;} | |
| .ui-li-link-alt .ui-btn .ui-icon { right: 50%; margin-right: -9px; } | |
| .ui-listview * .ui-btn-inner > .ui-btn > .ui-btn-inner { border-top: 0px; } | |
| .ui-listview-filter { border-width: 0; overflow: hidden; margin: -15px -15px 15px -15px } | |
| .ui-listview-filter .ui-input-search { margin: 5px; width: auto; display: block; } | |
| .ui-listview-filter-inset { margin: -15px -5px -15px -5px; background: transparent; } | |
| .ui-li.ui-screen-hidden{display:none;} | |
| /* Odd iPad positioning issue. */ | |
| @media only screen and (min-device-width: 768px) and (max-device-width: 1024px) { | |
| .ui-li .ui-btn-text { overflow: visible; } | |
| }/* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| label.ui-slider { display: block; } | |
| input.ui-slider-input { display: inline-block; width: 50px; } | |
| select.ui-slider-switch { display: none; } | |
| div.ui-slider { position: relative; display: inline-block; overflow: visible; height: 15px; padding: 0; margin: 0 2% 0 20px; top: 4px; width: 66%; } | |
| a.ui-slider-handle { position: absolute; z-index: 10; top: 50%; width: 28px; height: 28px; margin-top: -15px; margin-left: -15px; } | |
| a.ui-slider-handle .ui-btn-inner { padding-left: 0; padding-right: 0; } | |
| @media all and (min-width: 480px){ | |
| label.ui-slider { vertical-align: top; display: inline-block; width: 20%; margin: 0 2% 0 0; } | |
| div.ui-slider { width: 45%; } | |
| } | |
| div.ui-slider-switch { height: 32px; overflow: hidden; margin-left: 0; } | |
| div.ui-slider-inneroffset { margin-left: 50%; position: absolute; top: 1px; height: 100%; width: 50%; } | |
| a.ui-slider-handle-snapping { -webkit-transition: left 100ms linear; } | |
| div.ui-slider-labelbg { position: absolute; top:0; margin: 0; border-width: 0; } | |
| div.ui-slider-switch div.ui-slider-labelbg-a { width: 60%; height: 100%; left: 0; } | |
| div.ui-slider-switch div.ui-slider-labelbg-b { width: 60%; height: 100%; right: 0; } | |
| .ui-slider-switch-a div.ui-slider-labelbg-a, .ui-slider-switch-b div.ui-slider-labelbg-b { z-index: -1; } | |
| .ui-slider-switch-a div.ui-slider-labelbg-b, .ui-slider-switch-b div.ui-slider-labelbg-a { z-index: 0; } | |
| div.ui-slider-switch a.ui-slider-handle { z-index: 20; width: 101%; height: 32px; margin-top: -18px; margin-left: -101%; } | |
| span.ui-slider-label { width: 100%; position: absolute;height: 32px; font-size: 16px; text-align: center; line-height: 2; background: none; border-color: transparent; } | |
| span.ui-slider-label-a { left: -100%; margin-right: -1px } | |
| span.ui-slider-label-b { right: -100%; margin-left: -1px } | |
| <?php | |
| header('Content-type: text/css'); | |
| ob_start("compress"); | |
| function compress($buffer) { | |
| /* remove comments */ | |
| $buffer = preg_replace('!/\*[^*]*\*+([^/][^*]*\*+)*/!', '', $buffer); | |
| /* remove tabs, spaces, newlines, etc. */ | |
| $buffer = str_replace(array("\r\n", "\r", "\n", "\t", ' ', ' ', ' '), '', $buffer); | |
| return $buffer; | |
| } | |
| echo ' | |
| .ui-li-thumb, .ui-li-icon { position: relative; } | |
| .ui-navbar { | |
| width: 100%; | |
| } | |
| .ui-btn-inner { | |
| white-space: normal !important; | |
| } | |
| .ui-li-heading { | |
| white-space: normal !important; | |
| } | |
| .ui-listview-filter { | |
| margin: 0 !important; | |
| } | |
| .ui-icon-navigation { | |
| background-image: url(images/113-navigation.png); | |
| background-position: 1px 0; | |
| } | |
| .ui-icon-beaker { | |
| background-image: url(images/91-beaker-2.png); | |
| background-position: 1px 0; | |
| } | |
| #footer { | |
| text-size: 0.75em; | |
| text-align: center; | |
| } | |
| body { | |
| background-color: #F0F0F0; | |
| } | |
| #jqm-homeheader { | |
| text-align: center; | |
| } | |
| .viaPoints { | |
| display: none; | |
| text-size: 0.2em; | |
| } | |
| .min-width-480px .viaPoints { | |
| display: inline; | |
| } | |
| #extrainfo { | |
| visibility: hidden; | |
| display: none; | |
| } | |
| #servicewarning { | |
| padding: 1em; | |
| margin-bottom: 0.5em; | |
| text-size: 0.2em; | |
| background-color: #FF9; | |
| -moz-border-radius: 15px; | |
| border-radius: 15px; | |
| } | |
| #footer { | |
| clear:both; | |
| text-align:center; | |
| } | |
| // source http://webaim.org/techniques/skipnav/ | |
| #skip a, #skip a:hover, #skip a:visited | |
| { | |
| position:absolute; | |
| left:0px; | |
| top:-500px; | |
| width:1px; | |
| height:1px; | |
| overflow:hidden; | |
| } | |
| #skip a:active, #skip a:focus | |
| { | |
| position:static; | |
| width:auto; | |
| height:auto; | |
| }'; | |
| //if (false) | |
| echo ' | |
| // adaptive layout from jQuery Mobile docs site | |
| .type-interior .content-secondary { | |
| border-right: 0; | |
| border-left: 0; | |
| margin: 10px -15px 0; | |
| background: #fff; | |
| border-top: 1px solid #ccc; | |
| } | |
| .type-home .ui-content { | |
| margin-top: 5px; | |
| } | |
| .type-interior .ui-content { | |
| padding-bottom: 0; | |
| } | |
| .content-secondary .ui-collapsible-contain { | |
| padding: 10px 15px; | |
| } | |
| .content-secondary .ui-collapsible-heading { | |
| margin: 0 0 30px; | |
| } | |
| .content-secondary .ui-collapsible-heading-collapsed, | |
| .content-secondary .ui-collapsible-content { | |
| padding:0; | |
| margin: 0; | |
| } | |
| /* hires ahoy */ | |
| @media all and (min-width: 650px){ | |
| .content-secondary { | |
| text-align: left; | |
| float: left; | |
| width: 45%; | |
| background: none; | |
| border-top: 0; | |
| } | |
| .content-secondary, | |
| .type-interior .content-secondary { | |
| margin: 30px 0 20px 2%; | |
| padding: 20px 4% 0 0; | |
| background: none; | |
| } | |
| .type-index .content-secondary { | |
| padding: 0; | |
| } | |
| .type-index .content-secondary .ui-listview { | |
| margin: 0; | |
| } | |
| .content-primary { | |
| width: 45%; | |
| float: right; | |
| margin-top: 30px; | |
| margin-right: 1%; | |
| padding-right: 1%; | |
| } | |
| .content-primary ul:first-child { | |
| margin-top: 0; | |
| } | |
| .type-interior .content-primary { | |
| padding: 1.5em 6% 3em 0; | |
| margin: 0; | |
| } | |
| /* fix up the collapsibles - expanded on desktop */ | |
| .content-secondary .ui-collapsible-heading { | |
| display: none; | |
| } | |
| .content-secondary .ui-collapsible-contain { | |
| margin:0; | |
| } | |
| .content-secondary .ui-collapsible-content { | |
| display: block; | |
| margin: 0; | |
| padding: 0; | |
| } | |
| .type-interior .content-secondary .ui-li-divider { | |
| padding-top: 1em; | |
| padding-bottom: 1em; | |
| } | |
| .type-interior .content-secondary { | |
| margin: 0; | |
| padding: 0; | |
| } | |
| } | |
| @media all and (min-width: 750px){ | |
| .type-home .ui-content, | |
| .type-interior .ui-content { | |
| background-position: 39%; | |
| } | |
| .content-secondary { | |
| width: 34%; | |
| } | |
| .content-primary { | |
| width: 56%; | |
| padding-right: 1%; | |
| } | |
| .type-interior .ui-content { | |
| background-position: 34%; | |
| } | |
| } | |
| @media all and (min-width: 1200px){ | |
| .type-home .ui-content{ | |
| background-position: 38.5%; | |
| } | |
| .type-interior .ui-content { | |
| background-position: 30%; | |
| } | |
| .content-secondary { | |
| width: 30%; | |
| padding-right:6%; | |
| margin: 30px 0 20px 5%; | |
| } | |
| .type-interior .content-secondary { | |
| margin: 0; | |
| padding: 0; | |
| } | |
| .content-primary { | |
| width: 50%; | |
| margin-right: 5%; | |
| padding-right: 3%; | |
| } | |
| .type-interior .content-primary { | |
| width: 60%; | |
| } | |
| } | |
| '; | |
| ob_end_flush(); | |
| ?> | |
| #!/bin/bash | #!/bin/bash |
| #dotcloud postinstall | #dotcloud postinstall |
| curl http://s3-ap-southeast-1.amazonaws.com/busresources/cbrfeed.zip \ | curl http://s3-ap-southeast-1.amazonaws.com/busresources/cbrfeed.zip \ |
| -o /home/dotcloud/current/cbrfeed.zip | -o /home/dotcloud/current/cbrfeed.zip |
| wget http://s3-ap-southeast-1.amazonaws.com/busresources/Graph.obj \ | curl http://s3-ap-southeast-1.amazonaws.com/busresources/Graph.obj \ |
| -O /tmp/Graph.obj | -o /tmp/Graph.obj |
| #db setup | #db setup |
| #curl https://github.com/maxious/ACTBus-ui/raw/master/transitdata.cbrfeed.sql.gz -o transitdata.cbrfeed.sql.gz | #curl https://github.com/maxious/ACTBus-ui/raw/master/transitdata.cbrfeed.sql.gz -o transitdata.cbrfeed.sql.gz |
| #curl https://github.com/maxious/ACTBus-ui/raw/master/lib/postgis.sql -o postgis.sql | #curl https://github.com/maxious/ACTBus-ui/raw/master/lib/postgis.sql -o postgis.sql |
| #createlang -d transitdata plpgsql | #createlang -d transitdata plpgsql |
| #psql -d transitdata -f postgis.sql | #psql -d transitdata -f postgis.sql |
| #gunzip /var/www/transitdata.cbrfeed.sql.gz | #gunzip /var/www/transitdata.cbrfeed.sql.gz |
| #psql -d transitdata -f transitdata.cbrfeed.sql | #psql -d transitdata -f transitdata.cbrfeed.sql |
| #createuser transitdata -SDRP | #createuser transitdata -SDRP |
| #password transitdata | #password transitdata |
| #psql -c \"GRANT SELECT ON TABLE agency,calendar,calendar_dates,routes,stop_times,stops,trips TO transitdata;\" | #psql -c \"GRANT SELECT ON TABLE agency,calendar,calendar_dates,routes,stop_times,stops,trips TO transitdata;\" |
| <?php | <?php |
| header('Content-Type: application/vnd.google-earth.kml+xml'); | header('Content-Type: application/vnd.google-earth.kml+xml'); |
| include ('../include/common.inc.php'); | include ('../include/common.inc.php'); |
| echo '<?xml version="1.0" encoding="UTF-8"?> | echo '<?xml version="1.0" encoding="UTF-8"?> |
| <kml xmlns="http://www.opengis.net/kml/2.2" xmlns:atom="http://www.w3.org/2005/Atom"><Document>'; | <kml xmlns="http://www.opengis.net/kml/2.2" xmlns:atom="http://www.w3.org/2005/Atom"><Document>'; |
| echo ' | echo ' |
| <Style id="yellowLineGreenPoly"> | <Style id="yellowLineGreenPoly"> |
| <LineStyle> | <LineStyle> |
| <color>7f00ff00</color> | <color>7f00ff00</color> |
| <width>4</width> | <width>4</width> |
| </LineStyle> | </LineStyle> |
| <PolyStyle> | <PolyStyle> |
| <color>7f00ffff</color> | <color>7f00ffff</color> |
| </PolyStyle> | </PolyStyle> |
| </Style>'; | </Style>'; |
| $route = getRoute($routeid); | $route = getRoute($routeid); |
| echo "\n<Placemark>\n"; | echo "\n<Placemark>\n"; |
| $link = curPageURL()."/../trip.php?routeid=".htmlspecialchars ($route["route_id"]); | $link = curPageURL()."/../trip.php?routeid=".htmlspecialchars ($route["route_id"]); |
| echo "<name>".$route['route_short_name']."</name>"; | echo "<name>".$route['route_short_name']."</name>"; |
| echo '<atom:link href="'.$link.'"/>'; | echo '<atom:link href="'.$link.'"/>'; |
| echo '<description><![CDATA[ <a href="'.$link.'">'.$route['route_short_name']." ".$route['route_long_name']."</a>]]> </description>"; | echo '<description><![CDATA[ <a href="'.$link.'">'.$route['route_short_name']." ".$route['route_long_name']."</a>]]> </description>"; |
| echo "<styleUrl>#yellowLineGreenPoly</styleUrl>"; | echo "<styleUrl>#yellowLineGreenPoly</styleUrl>"; |
| $trips = getRouteTrips($routeid); | $trips = getRouteTrips($routeid); |
| echo getTripShape($trips[0]['trip_id']); | echo getTripShape($trips[0]['trip_id']); |
| echo "</Placemark>\n</Document></kml>\n"; | echo "</Placemark>\n</Document></kml>\n"; |
| ?> | ?> |
| <?php | <?php |
| include ('../include/common.inc.php'); | |
| header('Content-type: application/vnd.google-earth.kml+xml'); | header('Content-type: application/vnd.google-earth.kml+xml'); |
| //http://wiki.openstreetmap.org/wiki/OpenLayers_Dynamic_KML | //http://wiki.openstreetmap.org/wiki/OpenLayers_Dynamic_KML |
| // Creates the KML/XML Document. | // Creates the KML/XML Document. |
| $dom = new DOMDocument('1.0', 'UTF-8'); | $dom = new DOMDocument('1.0', 'UTF-8'); |
| // Creates the root KML element and appends it to the root document. | // Creates the root KML element and appends it to the root document. |
| $node = $dom->createElementNS('http://earth.google.com/kml/2.1', 'kml'); | $node = $dom->createElementNS('http://earth.google.com/kml/2.1', 'kml'); |
| $parNode = $dom->appendChild($node); | $parNode = $dom->appendChild($node); |
| // Creates a KML Document element and append it to the KML element. | // Creates a KML Document element and append it to the KML element. |
| $dnode = $dom->createElement('Document'); | $dnode = $dom->createElement('Document'); |
| $docNode = $parNode->appendChild($dnode); | $docNode = $parNode->appendChild($dnode); |
| if ($suburb != "") $result_stops = getStopsBySuburb($suburb); | if ($suburb != "") $result_stops = getStopsBySuburb($suburb); |
| else $result_stops = getStops(); | else $result_stops = getStops(); |
| foreach ($result_stops as $stop) { | foreach ($result_stops as $stop) { |
| $description = 'http://bus.lambdacomplex.org/' . 'stop.php?stopid=' . $stop['stop_id'] . " <br>"; | $description = 'http://bus.lambdacomplex.org/' . 'stop.php?stopid=' . $stop['stop_id'] . " <br>"; |
| // Creates a Placemark and append it to the Document. | // Creates a Placemark and append it to the Document. |
| $node = $dom->createElement('Placemark'); | $node = $dom->createElement('Placemark'); |
| $placeNode = $docNode->appendChild($node); | $placeNode = $docNode->appendChild($node); |
| // Creates an id attribute and assign it the value of id column. | // Creates an id attribute and assign it the value of id column. |
| $placeNode->setAttribute('id', 'placemark' . $stop['stop_id']); | $placeNode->setAttribute('id', 'placemark' . $stop['stop_id']); |
| // Create name, and description elements and assigns them the values of the name and address columns from the results. | // Create name, and description elements and assigns them the values of the name and address columns from the results. |
| $nameNode = $dom->createElement('name', htmlentities($stop['stop_name'])); | $nameNode = $dom->createElement('name', htmlentities($stop['stop_name'])); |
| $descriptionNode = $dom->createElement('description', $description); | $descriptionNode = $dom->createElement('description', $description); |
| $placeNode->appendChild($nameNode); | $placeNode->appendChild($nameNode); |
| $placeNode->appendChild($descriptionNode); | $placeNode->appendChild($descriptionNode); |
| // Creates a Point element. | // Creates a Point element. |
| $pointNode = $dom->createElement('Point'); | $pointNode = $dom->createElement('Point'); |
| $placeNode->appendChild($pointNode); | $placeNode->appendChild($pointNode); |
| // Creates a coordinates element and gives it the value of the lng and lat columns from the results. | // Creates a coordinates element and gives it the value of the lng and lat columns from the results. |
| $coorStr = $stop['stop_lon'] . ',' . $stop['stop_lat']; | $coorStr = $stop['stop_lon'] . ',' . $stop['stop_lat']; |
| $coorNode = $dom->createElement('coordinates', $coorStr); | $coorNode = $dom->createElement('coordinates', $coorStr); |
| $pointNode->appendChild($coorNode); | $pointNode->appendChild($coorNode); |
| } | } |
| $kmlOutput = $dom->saveXML(); | $kmlOutput = $dom->saveXML(); |
| echo $kmlOutput; | echo $kmlOutput; |
| ?> | ?> |
| <?php | |
| require $basePath.'lib/openid.php'; | |
| $openid = new LightOpenID($_SERVER['HTTP_HOST']); | |
| function login() | |
| { | |
| global $openid; | |
| if(!$openid->mode) { | |
| $openid->required = array('contact/email'); | |
| $openid->identity = 'https://www.google.com/accounts/o8/id'; | |
| header('Location: ' . $openid->authUrl()); | |
| } | |
| } | |
| function auth() | |
| { | |
| if ($_SESSION['authed'] == true) return true; | |
| global $openid; | |
| if($openid->mode) { | |
| $attr = $openid->getAttributes(); | |
| if ($attr["contact/email"] != "maxious@gmail.com") { | |
| die("Access Denied"); | |
| } else { | |
| $_SESSION['authed'] = true; | |
| } | |
| } else { | |
| login(); | |
| } | |
| } | |
| ?> |
| <?php | <?php |
| /* | |
| * Copyright 2010,2011 Alexander Sadleir | |
| Licensed under the Apache License, Version 2.0 (the "License"); | |
| you may not use this file except in compliance with the License. | |
| You may obtain a copy of the License at | |
| http://www.apache.org/licenses/LICENSE-2.0 | |
| Unless required by applicable law or agreed to in writing, software | |
| distributed under the License is distributed on an "AS IS" BASIS, | |
| WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. | |
| See the License for the specific language governing permissions and | |
| limitations under the License. | |
| */ | |
| if (php_uname('n') == "actbus-www") { | if (php_uname('n') == "actbus-www") { |
| $conn = new PDO("pgsql:dbname=transitdata;user=transitdata;password=transitdata;host=bus-main.lambdacomplex.org"); | $conn = new PDO("pgsql:dbname=transitdata;user=transitdata;password=transitdata;host=bus-main.lambdacomplex.org"); |
| } | } else if (isDebugServer()) { |
| else if (isDebugServer()) { | $conn = new PDO("pgsql:dbname=transitdata;user=postgres;password=snmc;host=localhost"); |
| $conn = new PDO("pgsql:dbname=transitdata;user=postgres;password=snmc;host=localhost"); | } else { |
| } | $conn = new PDO("pgsql:dbname=transitdata;user=transitdata;password=transitdata;host=localhost"); |
| else { | |
| $conn = new PDO("pgsql:dbname=transitdata;user=transitdata;password=transitdata;host=localhost"); | |
| } | } |
| if (!$conn) { | if (!$conn) { |
| die("A database error occurred.\n"); | die("A database error occurred.\n"); |
| } | } |
| if (isDebug()) { | |
| $conn->setAttribute(PDO::ATTR_ERRMODE, PDO::ERRMODE_EXCEPTION); | function databaseError($errMsg) { |
| die($errMsg); | |
| } | } |
| function databaseError($errMsg) | |
| { | |
| die($errMsg); | |
| } | |
| include ('db/route-dao.inc.php'); | include ('db/route-dao.inc.php'); |
| include ('db/trip-dao.inc.php'); | include ('db/trip-dao.inc.php'); |
| include ('db/stop-dao.inc.php'); | include ('db/stop-dao.inc.php'); |
| include ('db/servicealert-dao.inc.php'); | include ('db/servicealert-dao.inc.php'); |
| ?> | ?> |
| <?php | <?php |
| /* | |
| * Copyright 2010,2011 Alexander Sadleir | |
| Licensed under the Apache License, Version 2.0 (the "License"); | |
| you may not use this file except in compliance with the License. | |
| You may obtain a copy of the License at | |
| http://www.apache.org/licenses/LICENSE-2.0 | |
| Unless required by applicable law or agreed to in writing, software | |
| distributed under the License is distributed on an "AS IS" BASIS, | |
| WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. | |
| See the License for the specific language governing permissions and | |
| limitations under the License. | |
| */ | |
| // SELECT array_to_string(array(SELECT REPLACE(name_2006, ',', '\,') as name FROM suburbs order by name), ',') | // SELECT array_to_string(array(SELECT REPLACE(name_2006, ',', '\,') as name FROM suburbs order by name), ',') |
| $suburbs = explode(",", "Acton,Ainslie,Amaroo,Aranda,Banks,Barton,Belconnen,Bonner,Bonython,Braddon,Bruce,Calwell,Campbell,Chapman,Charnwood,Chifley,Chisholm,City,Conder,Cook,Curtin,Deakin,Dickson,Downer,Duffy,Dunlop,Evatt,Fadden,Farrer,Fisher,Florey,Flynn,Forrest,Franklin,Fraser,Fyshwick,Garran,Gilmore,Giralang,Gordon,Gowrie,Greenway,Griffith,Gungahlin,Hackett,Hall,Harrison,Hawker,Higgins,Holder,Holt,Hughes,Hume,Isaacs,Isabella Plains,Kaleen,Kambah,Kingston,Latham,Lawson,Lyneham,Lyons,Macarthur,Macgregor,Macquarie,Mawson,McKellar,Melba,Mitchell,Monash,Narrabundah,Ngunnawal,Nicholls,Oaks Estate,O'Connor,O'Malley,Oxley,Page,Palmerston,Parkes,Pearce,Phillip,Pialligo,Red Hill,Reid,Richardson,Rivett,Russell,Scullin,Spence,Stirling,Symonston,Tharwa,Theodore,Torrens,Turner,Wanniassa,Waramanga,Watson,Weetangera,Weston,Yarralumla"); | $suburbs = explode(",", "Acton,Ainslie,Amaroo,Aranda,Banks,Barton,Belconnen,Bonner,Bonython,Braddon,Bruce,Calwell,Campbell,Chapman,Charnwood,Chifley,Chisholm,City,Conder,Cook,Curtin,Deakin,Dickson,Downer,Duffy,Dunlop,Evatt,Fadden,Farrer,Fisher,Florey,Flynn,Forrest,Franklin,Fraser,Fyshwick,Garran,Gilmore,Giralang,Gordon,Gowrie,Greenway,Griffith,Gungahlin,Hackett,Hall,Harrison,Hawker,Higgins,Holder,Holt,Hughes,Hume,Isaacs,Isabella Plains,Kaleen,Kambah,Kingston,Latham,Lawson,Lyneham,Lyons,Macarthur,Macgregor,Macquarie,Mawson,McKellar,Melba,Mitchell,Monash,Narrabundah,Ngunnawal,Nicholls,Oaks Estate,O'Connor,O'Malley,Oxley,Page,Palmerston,Parkes,Pearce,Phillip,Pialligo,Red Hill,Reid,Richardson,Rivett,Russell,Scullin,Spence,Stirling,Symonston,Tharwa,Theodore,Torrens,Turner,Wanniassa,Waramanga,Watson,Weetangera,Weston,Yarralumla"); |
| function staticmap($mapPoints, $zoom = 0, $markerImage = "iconb", $collapsible = true) | |
| { | function staticmap($mapPoints, $collapsible = true, $twotone = false, $path = false, $numbered = false) { |
| global $labsPath; | |
| $width = 300; | $markers = ""; |
| $height = 300; | $height = 300; |
| $metersperpixel[9] = 305.492 * $width; | $width = $height; |
| $metersperpixel[10] = 152.746 * $width; | $index = 0; |
| $metersperpixel[11] = 76.373 * $width; | if (sizeof($mapPoints) < 1) |
| $metersperpixel[12] = 38.187 * $width; | return "map error"; |
| $metersperpixel[13] = 19.093 * $width; | if (sizeof($mapPoints) === 1) { |
| $metersperpixel[14] = 9.547 * $width; | $markers = "markers={$mapPoints[0][0]},{$mapPoints[0][1]}"; |
| $metersperpixel[15] = 4.773 * $width; | } else { |
| $metersperpixel[16] = 2.387 * $width; | if (!$numbered) { |
| // $metersperpixel[17]=1.193*$width; | $markers = "markers="; |
| $center = ""; | } |
| $markers = ""; | if ($path) { |
| $minlat = 999; | $markers.= "markers={$mapPoints[0][0]},{$mapPoints[0][1]}&path="; |
| $minlon = 999; | } |
| $maxlat = 0; | foreach ($mapPoints as $index => $mapPoint) { |
| $maxlon = 0; | if ($twotone && $index == 0) { |
| if (sizeof($mapPoints) < 1) return "map error"; | $markers = "markerd=color:red|".$mapPoint[0] . "," . $mapPoint[1]."&markers="; |
| if (sizeof($mapPoints) === 1) { | } else { |
| if ($zoom == 0) $zoom = 14; | if ($numbered) { |
| $markers.= "{$mapPoints[0][0]},{$mapPoints[0][1]},$markerimage"; | $label = ($index > 9 ? 9 : $index); |
| $center = "{$mapPoints[0][0]},{$mapPoints[0][1]}"; | $markers.= "markers=label:$label|" . $mapPoint[0] . "," . $mapPoint[1]; |
| } | if ($index + 1 != sizeof($mapPoints)) { |
| else { | $markers.= "&"; |
| foreach ($mapPoints as $index => $mapPoint) { | } |
| $markers.= $mapPoint[0] . "," . $mapPoint[1] . "," . $markerImage . ($index + 1); | } else { |
| if ($index + 1 != sizeof($mapPoints)) $markers.= "|"; | $markers.= $mapPoint[0] . "," . $mapPoint[1]; |
| if ($mapPoint[0] < $minlat) $minlat = $mapPoint[0]; | if ($index + 1 != sizeof($mapPoints)) { |
| if ($mapPoint[0] > $maxlat) $maxlat = $mapPoint[0]; | $markers.= "|"; |
| if ($mapPoint[1] < $minlon) $minlon = $mapPoint[1]; | } |
| if ($mapPoint[1] > $maxlon) $maxlon = $mapPoint[1]; | } |
| $totalLat+= $mapPoint[0]; | $index++; |
| $totalLon+= $mapPoint[1]; | } |
| } | } |
| if ($zoom == 0) { | } |
| $mapwidthinmeters = distance($minlat, $minlon, $minlat, $maxlon); | $output = ""; |
| foreach (array_reverse($metersperpixel, true) as $zoomLevel => $maxdistance) { | if ($collapsible) |
| if ($zoom == 0 && $mapwidthinmeters < ($maxdistance + 50)) $zoom = $zoomLevel; | $output.= '<div class="map" data-role="collapsible" data-collapsed="true"><h3>Open Map...</h3>'; |
| } | if (isIOSDevice()) $output.= '<img class="hiresmap" src="http://maps.googleapis.com/maps/api/staticmap?size=' . $width . 'x' . $height . '&' . $markers . '&scale=2&sensor=true" width=' . $width . ' height=' . $height . '>'; |
| } | else $output.= '<img class="lowresmap" src="http://maps.googleapis.com/maps/api/staticmap?size=' . $width . 'x' . $height . '&' . $markers . '&scale=1&format=jpg&sensor=true" width=' . $width . ' height=' . $height . '>'; |
| $center = $totalLat / sizeof($mapPoints) . "," . $totalLon / sizeof($mapPoints); | |
| } | if ($collapsible) |
| $output = ""; | $output.= '</div>'; |
| if ($collapsible) $output.= '<div class="map" data-role="collapsible" data-collapsed="true"><h3>Open Map...</h3>'; | return $output; |
| $output.= '<img class="map" src="' . curPageURL() . '/'. $labsPath. '/lib/staticmaplite/staticmap.php?center=' . $center . '&zoom=' . $zoom . '&size=' . $width . 'x' . $height . '&markers=' . | |
| $markers . '" width=' . $width . ' height=' . $height . '>'; | |
| if ($collapsible) $output.= '</div>'; | |
| return $output; | |
| } | |
| function distance($lat1, $lng1, $lat2, $lng2, $roundLargeValues = false) | |
| { | |
| $pi80 = M_PI / 180; | |
| $lat1*= $pi80; | |
| $lng1*= $pi80; | |
| $lat2*= $pi80; | |
| $lng2*= $pi80; | |
| $r = 6372.797; // mean radius of Earth in km | |
| $dlat = $lat2 - $lat1; | |
| $dlng = $lng2 - $lng1; | |
| $a = sin($dlat / 2) * sin($dlat / 2) + cos($lat1) * cos($lat2) * sin($dlng / 2) * sin($dlng / 2); | |
| $c = 2 * atan2(sqrt($a) , sqrt(1 - $a)); | |
| $km = $r * $c; | |
| if ($roundLargeValues) { | |
| if ($km < 1) return floor($km * 1000); | |
| else return round($km,2)."k"; | |
| } else return floor($km * 1000); | |
| } | } |
| function decodePolylineToArray($encoded) | function distance($lat1, $lng1, $lat2, $lng2, $roundLargeValues = false) { |
| { | $pi80 = M_PI / 180; |
| // source: http://latlongeeks.com/forum/viewtopic.php?f=4&t=5 | $lat1*= $pi80; |
| $length = strlen($encoded); | $lng1*= $pi80; |
| $index = 0; | $lat2*= $pi80; |
| $points = array(); | $lng2*= $pi80; |
| $lat = 0; | $r = 6372.797; // mean radius of Earth in km |
| $lng = 0; | $dlat = $lat2 - $lat1; |
| while ($index < $length) { | $dlng = $lng2 - $lng1; |
| // Temporary variable to hold each ASCII byte. | $a = sin($dlat / 2) * sin($dlat / 2) + cos($lat1) * cos($lat2) * sin($dlng / 2) * sin($dlng / 2); |
| $b = 0; | $c = 2 * atan2(sqrt($a), sqrt(1 - $a)); |
| // The encoded polyline consists of a latitude value followed by a | $km = $r * $c; |
| // longitude value. They should always come in pairs. Read the | if ($roundLargeValues) { |
| // latitude value first. | if ($km < 1) |
| $shift = 0; | return floor($km * 1000); |
| $result = 0; | else |
| do { | return round($km, 2) . "k"; |
| // The `ord(substr($encoded, $index++))` statement returns the ASCII | } |
| // code for the character at $index. Subtract 63 to get the original | else |
| // value. (63 was added to ensure proper ASCII characters are displayed | return floor($km * 1000); |
| // in the encoded polyline string, which is `human` readable) | |
| $b = ord(substr($encoded, $index++)) - 63; | |
| // AND the bits of the byte with 0x1f to get the original 5-bit `chunk. | |
| // Then left shift the bits by the required amount, which increases | |
| // by 5 bits each time. | |
| // OR the value into $results, which sums up the individual 5-bit chunks | |
| // into the original value. Since the 5-bit chunks were reversed in | |
| // order during encoding, reading them in this way ensures proper | |
| // summation. | |
| $result|= ($b & 0x1f) << $shift; | |
| $shift+= 5; | |
| } | |
| // Continue while the read byte is >= 0x20 since the last `chunk` | |
| // was not OR'd with 0x20 during the conversion process. (Signals the end) | |
| while ($b >= 0x20); | |
| // Check if negative, and convert. (All negative values have the last bit | |
| // set) | |
| $dlat = (($result & 1) ? ~($result >> 1) : ($result >> 1)); | |
| // Compute actual latitude since value is offset from previous value. | |
| $lat+= $dlat; | |
| // The next values will correspond to the longitude for this point. | |
| $shift = 0; | |
| $result = 0; | |
| do { | |
| $b = ord(substr($encoded, $index++)) - 63; | |
| $result|= ($b & 0x1f) << $shift; | |
| $shift+= 5; | |
| } while ($b >= 0x20); | |
| $dlng = (($result & 1) ? ~($result >> 1) : ($result >> 1)); | |
| $lng+= $dlng; | |
| // The actual latitude and longitude values were multiplied by | |
| // 1e5 before encoding so that they could be converted to a 32-bit | |
| // integer representation. (With a decimal accuracy of 5 places) | |
| // Convert back to original values. | |
| $points[] = array( | |
| $lat * 1e-5, | |
| $lng * 1e-5 | |
| ); | |
| } | |
| return $points; | |
| } | } |
| function geocode($query, $giveOptions) | |
| { | function decodePolylineToArray($encoded) { |
| global $cloudmadeAPIkey; | // source: http://latlongeeks.com/forum/viewtopic.php?f=4&t=5 |
| $url = "http://geocoding.cloudmade.com/$cloudmadeAPIkey/geocoding/v2/find.js?query=" . urlencode($query) . "&bbox=-35.5,149.00,-35.15,149.1930&return_location=true&bbox_only=true"; | $length = strlen($encoded); |
| $contents = json_decode(getPage($url)); | $index = 0; |
| if ($giveOptions) return $contents->features; | $points = array(); |
| elseif (isset($contents->features[0]->centroid)) return $contents->features[0]->centroid->coordinates[0] . "," . $contents->features[0]->centroid->coordinates[1]; | $lat = 0; |
| else return ""; | $lng = 0; |
| while ($index < $length) { | |
| // Temporary variable to hold each ASCII byte. | |
| $b = 0; | |
| // The encoded polyline consists of a latitude value followed by a | |
| // longitude value. They should always come in pairs. Read the | |
| // latitude value first. | |
| $shift = 0; | |
| $result = 0; | |
| do { | |
| // The `ord(substr($encoded, $index++))` statement returns the ASCII | |
| // code for the character at $index. Subtract 63 to get the original | |
| // value. (63 was added to ensure proper ASCII characters are displayed | |
| // in the encoded polyline string, which is `human` readable) | |
| $b = ord(substr($encoded, $index++)) - 63; | |
| // AND the bits of the byte with 0x1f to get the original 5-bit `chunk. | |
| // Then left shift the bits by the required amount, which increases | |
| // by 5 bits each time. | |
| // OR the value into $results, which sums up the individual 5-bit chunks | |
| // into the original value. Since the 5-bit chunks were reversed in | |
| // order during encoding, reading them in this way ensures proper | |
| // summation. | |
| $result|= ($b & 0x1f) << $shift; | |
| $shift+= 5; | |
| } | |
| // Continue while the read byte is >= 0x20 since the last `chunk` | |
| // was not OR'd with 0x20 during the conversion process. (Signals the end) | |
| while ($b >= 0x20); | |
| // Check if negative, and convert. (All negative values have the last bit | |
| // set) | |
| $dlat = (($result & 1) ? ~($result >> 1) : ($result >> 1)); | |
| // Compute actual latitude since value is offset from previous value. | |
| $lat+= $dlat; | |
| // The next values will correspond to the longitude for this point. | |
| $shift = 0; | |
| $result = 0; | |
| do { | |
| $b = ord(substr($encoded, $index++)) - 63; | |
| $result|= ($b & 0x1f) << $shift; | |
| $shift+= 5; | |
| } while ($b >= 0x20); | |
| $dlng = (($result & 1) ? ~($result >> 1) : ($result >> 1)); | |
| $lng+= $dlng; | |
| // The actual latitude and longitude values were multiplied by | |
| // 1e5 before encoding so that they could be converted to a 32-bit | |
| // integer representation. (With a decimal accuracy of 5 places) | |
| // Convert back to original values. | |
| $points[] = array( | |
| $lat * 1e-5, | |
| $lng * 1e-5 | |
| ); | |
| } | |
| return $points; | |
| } | } |
| function reverseGeocode($lat, $lng) | |
| { | function geocode($query, $giveOptions) { |
| global $cloudmadeAPIkey; | global $cloudmadeAPIkey; |
| $url = "http://geocoding.cloudmade.com/$cloudmadeAPIkey/geocoding/v2/find.js?around=" . $lat . "," . $lng . "&distance=closest&object_type=road"; | $url = "http://geocoding.cloudmade.com/$cloudmadeAPIkey/geocoding/v2/find.js?query=" . urlencode($query) . "&bbox=-35.5,149.00,-35.15,149.1930&return_location=true&bbox_only=true"; |
| $contents = json_decode(getPage($url)); | $contents = json_decode(getPage($url)); |
| return $contents->features[0]->properties->name; | if ($giveOptions) |
| return $contents->features; | |
| elseif (isset($contents->features[0]->centroid)) | |
| return $contents->features[0]->centroid->coordinates[0] . "," . $contents->features[0]->centroid->coordinates[1]; | |
| else | |
| return ""; | |
| } | } |
| function reverseGeocode($lat, $lng) { | |
| global $cloudmadeAPIkey; | |
| $url = "http://geocoding.cloudmade.com/$cloudmadeAPIkey/geocoding/v2/find.js?around=" . $lat . "," . $lng . "&distance=closest&object_type=road"; | |
| $contents = json_decode(getPage($url)); | |
| return $contents->features[0]->properties->name; | |
| } | |
| ?> | ?> |
| <?php | <?php |
| function getPage($url) | |
| { | /* |
| debug($url, "json"); | * Copyright 2010,2011 Alexander Sadleir |
| $ch = curl_init($url); | |
| curl_setopt($ch, CURLOPT_RETURNTRANSFER, 1); | Licensed under the Apache License, Version 2.0 (the "License"); |
| curl_setopt($ch, CURLOPT_HEADER, 0); | you may not use this file except in compliance with the License. |
| curl_setopt($ch, CURLOPT_TIMEOUT, 45); | You may obtain a copy of the License at |
| $page = curl_exec($ch); | |
| if (curl_errno($ch)) { | http://www.apache.org/licenses/LICENSE-2.0 |
| echo "<font color=red> Database temporarily unavailable: "; | |
| echo curl_errno($ch) . " " . curl_error($ch); | Unless required by applicable law or agreed to in writing, software |
| if (isDebug()) { | distributed under the License is distributed on an "AS IS" BASIS, |
| echo $url; | WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. |
| } | See the License for the specific language governing permissions and |
| echo "</font><br>"; | limitations under the License. |
| } | */ |
| curl_close($ch); | |
| debug(print_r($page,true),"json"); | function getPage($url) { |
| return $page; | debug($url, "json"); |
| $ch = curl_init($url); | |
| curl_setopt($ch, CURLOPT_RETURNTRANSFER, 1); | |
| curl_setopt($ch, CURLOPT_HEADER, 0); | |
| curl_setopt($ch, CURLOPT_TIMEOUT, 45); | |
| $page = curl_exec($ch); | |
| if (curl_errno($ch)) { | |
| echo "<font color=red> Database temporarily unavailable: "; | |
| echo curl_errno($ch) . " " . curl_error($ch); | |
| if (isDebug()) { | |
| echo $url; | |
| } | |
| echo "</font><br>"; | |
| } | |
| curl_close($ch); | |
| debug(print_r($page, true), "json"); | |
| return $page; | |
| } | } |
| function curPageURL() | |
| { | function curPageURL() { |
| $isHTTPS = (isset($_SERVER["HTTPS"]) && $_SERVER["HTTPS"] == "on"); | $isHTTPS = (isset($_SERVER["HTTPS"]) && $_SERVER["HTTPS"] == "on"); |
| $port = (isset($_SERVER["SERVER_PORT"]) && ((!$isHTTPS && $_SERVER["SERVER_PORT"] != "80") || ($isHTTPS && $_SERVER["SERVER_PORT"] != "443"))); | $port = (isset($_SERVER["SERVER_PORT"]) && ((!$isHTTPS && $_SERVER["SERVER_PORT"] != "80") || ($isHTTPS && $_SERVER["SERVER_PORT"] != "443"))); |
| $port = ($port) ? ':' . $_SERVER["SERVER_PORT"] : ''; | $port = ($port) ? ':' . $_SERVER["SERVER_PORT"] : ''; |
| $url = ($isHTTPS ? 'https://' : 'http://') . $_SERVER["SERVER_NAME"] . $port . htmlentities(dirname($_SERVER['PHP_SELF']) , ENT_QUOTES); | $url = ($isHTTPS ? 'https://' : 'http://') . $_SERVER["SERVER_NAME"] . $port . htmlentities(dirname($_SERVER['PHP_SELF']), ENT_QUOTES); |
| return $url; | return $url; |
| } | } |
| ?> | ?> |
| <?php | <?php |
| /* | |
| * Copyright 2010,2011 Alexander Sadleir | |
| Licensed under the Apache License, Version 2.0 (the "License"); | |
| you may not use this file except in compliance with the License. | |
| You may obtain a copy of the License at | |
| http://www.apache.org/licenses/LICENSE-2.0 | |
| Unless required by applicable law or agreed to in writing, software | |
| distributed under the License is distributed on an "AS IS" BASIS, | |
| WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. | |
| See the License for the specific language governing permissions and | |
| limitations under the License. | |
| */ | |
| if (isset($_REQUEST['firstLetter'])) { | if (isset($_REQUEST['firstLetter'])) { |
| $firstLetter = filter_var($_REQUEST['firstLetter'], FILTER_SANITIZE_STRING); | $firstLetter = filter_var($_REQUEST['firstLetter'], FILTER_SANITIZE_STRING); |
| } | } |
| if (isset($_REQUEST['bysuburbs'])) { | if (isset($_REQUEST['bysuburbs'])) { |
| $bysuburbs = true; | $bysuburbs = true; |
| } | } |
| if (isset($_REQUEST['bynumber'])) { | if (isset($_REQUEST['bynumber'])) { |
| $bynumber = true; | $bynumber = true; |
| } | } |
| if (isset($_REQUEST['allstops'])) { | if (isset($_REQUEST['allstops'])) { |
| $allstops = true; | $allstops = true; |
| } | } |
| if (isset($_REQUEST['nearby'])) { | if (isset($_REQUEST['nearby'])) { |
| $nearby = true; | $nearby = true; |
| } | } |
| if (isset($_REQUEST['suburb'])) { | if (isset($_REQUEST['suburb'])) { |
| $suburb = filter_var($_REQUEST['suburb'], FILTER_SANITIZE_STRING); | $suburb = $_REQUEST['suburb']; |
| } | } |
| $pageKey = filter_var($_REQUEST['pageKey'], FILTER_SANITIZE_NUMBER_INT); | if (isset($_REQUEST['pageKey'])) { |
| $lat = filter_var($_REQUEST['lat'], FILTER_SANITIZE_NUMBER_FLOAT, FILTER_FLAG_ALLOW_FRACTION); | $pageKey = filter_var($_REQUEST['pageKey'], FILTER_SANITIZE_NUMBER_INT); |
| $lon = filter_var($_REQUEST['lon'], FILTER_SANITIZE_NUMBER_FLOAT, FILTER_FLAG_ALLOW_FRACTION); | } |
| $max_distance = filter_var($_REQUEST['radius'], FILTER_SANITIZE_NUMBER_INT); | if (isset($_REQUEST['lat'])) { |
| $lat = filter_var($_REQUEST['lat'], FILTER_SANITIZE_NUMBER_FLOAT, FILTER_FLAG_ALLOW_FRACTION); | |
| } | |
| if (isset($_REQUEST['lon'])) { | |
| $lon = filter_var($_REQUEST['lon'], FILTER_SANITIZE_NUMBER_FLOAT, FILTER_FLAG_ALLOW_FRACTION); | |
| } | |
| if (isset($_REQUEST['radius'])) { | |
| $max_distance = filter_var($_REQUEST['radius'], FILTER_SANITIZE_NUMBER_INT); | |
| } | |
| if (isset($_REQUEST['numberSeries'])) { | if (isset($_REQUEST['numberSeries'])) { |
| $numberSeries = filter_var($_REQUEST['numberSeries'], FILTER_SANITIZE_NUMBER_INT); | $numberSeries = filter_var($_REQUEST['numberSeries'], FILTER_SANITIZE_NUMBER_INT); |
| } | } |
| if (isset($_REQUEST['routeDestination'])) { | if (isset($_REQUEST['routeDestination'])) { |
| $routeDestination = urldecode(filter_var($_REQUEST['routeDestination'], FILTER_SANITIZE_ENCODED)); | $routeDestination = urldecode(filter_var($_REQUEST['routeDestination'], FILTER_SANITIZE_ENCODED)); |
| } | } |
| if (isset($_REQUEST['stopcode'])) { | if (isset($_REQUEST['stopcode'])) { |
| $stopcode = filter_var($_REQUEST['stopcode'], FILTER_SANITIZE_STRING); | $stopcode = filter_var($_REQUEST['stopcode'], FILTER_SANITIZE_STRING); |
| } | } |
| if (isset($_REQUEST['stopids'])) { | if (isset($_REQUEST['stopids'])) { |
| $stopids = explode(",", filter_var($_REQUEST['stopids'], FILTER_SANITIZE_STRING)); | $stopids = explode(",", filter_var($_REQUEST['stopids'], FILTER_SANITIZE_STRING)); |
| } | } |
| if (isset($_REQUEST['tripid'])) { | if (isset($_REQUEST['tripid'])) { |
| $tripid = filter_var($_REQUEST['tripid'], FILTER_SANITIZE_NUMBER_INT); | $tripid = filter_var($_REQUEST['tripid'], FILTER_SANITIZE_NUMBER_INT); |
| } | } |
| if (isset($_REQUEST['stopid'])) { | if (isset($_REQUEST['stopid'])) { |
| $stopid = filter_var($_REQUEST['stopid'], FILTER_SANITIZE_NUMBER_INT); | $stopid = filter_var($_REQUEST['stopid'], FILTER_SANITIZE_NUMBER_INT); |
| } | } |
| if (isset($_REQUEST['routeid'])) { | if (isset($_REQUEST['routeid'])) { |
| $routeid = filter_var($_REQUEST['routeid'], FILTER_SANITIZE_NUMBER_INT); | $routeid = filter_var($_REQUEST['routeid'], FILTER_SANITIZE_NUMBER_INT); |
| } | } |
| if (isset($_REQUEST['geolocate'])) { | if (isset($_REQUEST['geolocate'])) { |
| $geolocate = filter_var($_REQUEST['geolocate'], FILTER_SANITIZE_URL); | $geolocate = filter_var($_REQUEST['geolocate'], FILTER_SANITIZE_URL); |
| } | } |
| ?> | ?> |
| <?php | <?php |
| /* | |
| * Copyright 2010,2011 Alexander Sadleir | |
| Licensed under the Apache License, Version 2.0 (the "License"); | |
| you may not use this file except in compliance with the License. | |
| You may obtain a copy of the License at | |
| http://www.apache.org/licenses/LICENSE-2.0 | |
| Unless required by applicable law or agreed to in writing, software | |
| distributed under the License is distributed on an "AS IS" BASIS, | |
| WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. | |
| See the License for the specific language governing permissions and | |
| limitations under the License. | |
| */ | |
| // you have to open the session to be able to modify or remove it | // you have to open the session to be able to modify or remove it |
| session_start(); | session_start(); |
| if (isset($_REQUEST['service_period'])) { | if (isset($_REQUEST['service_period'])) { |
| $_SESSION['service_period'] = filter_var($_REQUEST['service_period'], FILTER_SANITIZE_STRING); | $_SESSION['service_period'] = filter_var($_REQUEST['service_period'], FILTER_SANITIZE_STRING); |
| sessionUpdated(); | sessionUpdated(); |
| } | } |
| if (isset($_REQUEST['time'])) { | if (isset($_REQUEST['time'])) { |
| $_SESSION['time'] = filter_var($_REQUEST['time'], FILTER_SANITIZE_STRING); | $_SESSION['time'] = filter_var($_REQUEST['time'], FILTER_SANITIZE_STRING); |
| sessionUpdated(); | sessionUpdated(); |
| } | } |
| if (isset($_REQUEST['geolocate']) && $_REQUEST['geolocate'] != "Enter co-ordinates or address here") { | if (isset($_REQUEST['geolocate']) && $_REQUEST['geolocate'] != "Enter co-ordinates or address here") { |
| $geocoded = false; | $geocoded = false; |
| if (isset($_REQUEST['lat']) && isset($_REQUEST['lon'])) { | if (isset($_REQUEST['lat']) && isset($_REQUEST['lon'])) { |
| $_SESSION['lat'] = trim(filter_var($_REQUEST['lat'], FILTER_SANITIZE_NUMBER_FLOAT, FILTER_FLAG_ALLOW_FRACTION)); | $_SESSION['lat'] = trim(filter_var($_REQUEST['lat'], FILTER_SANITIZE_NUMBER_FLOAT, FILTER_FLAG_ALLOW_FRACTION)); |
| $_SESSION['lon'] = trim(filter_var($_REQUEST['lon'], FILTER_SANITIZE_NUMBER_FLOAT, FILTER_FLAG_ALLOW_FRACTION)); | $_SESSION['lon'] = trim(filter_var($_REQUEST['lon'], FILTER_SANITIZE_NUMBER_FLOAT, FILTER_FLAG_ALLOW_FRACTION)); |
| } | } else { |
| else { | if (startsWith($geolocate, "-")) { |
| if (startsWith($geolocate, "-")) { | $locateparts = explode(",", $geolocate); |
| $locateparts = explode(",", $geolocate); | $_SESSION['lat'] = $locateparts[0]; |
| $_SESSION['lat'] = $locateparts[0]; | $_SESSION['lon'] = $locateparts[1]; |
| $_SESSION['lon'] = $locateparts[1]; | } else if (strpos($geolocate, "(") !== false) { |
| } | $geoParts = explode("(", $geolocate); |
| else if (strpos($geolocate, "(") !== false) { | $locateparts = explode(",", str_replace(")", "", $geoParts[1])); |
| $geoParts = explode("(", $geolocate); | $_SESSION['lat'] = $locateparts[0]; |
| $locateparts = explode(",", str_replace(")", "",$geoParts[1])); | $_SESSION['lon'] = $locateparts[1]; |
| $_SESSION['lat'] = $locateparts[0]; | } else { |
| $_SESSION['lon'] = $locateparts[1]; | $contents = geocode($geolocate, true); |
| } | print_r($contents); |
| else { | if (isset($contents[0]->centroid)) { |
| $contents = geocode($geolocate, true); | $geocoded = true; |
| print_r($contents); | $_SESSION['lat'] = $contents[0]->centroid->coordinates[0]; |
| if (isset($contents[0]->centroid)) { | $_SESSION['lon'] = $contents[0]->centroid->coordinates[1]; |
| $geocoded = true; | } else { |
| $_SESSION['lat'] = $contents[0]->centroid->coordinates[0]; | $_SESSION['lat'] = ""; |
| $_SESSION['lon'] = $contents[0]->centroid->coordinates[1]; | $_SESSION['lon'] = ""; |
| } | } |
| else { | } |
| $_SESSION['lat'] = ""; | } |
| $_SESSION['lon'] = ""; | sessionUpdated(); |
| } | |
| } | |
| } | |
| sessionUpdated(); | |
| } | } |
| function sessionUpdated() | |
| { | function sessionUpdated() { |
| $_SESSION['lastUpdated'] = time(); | $_SESSION['lastUpdated'] = time(); |
| } | } |
| // timeoutSession | // timeoutSession |
| $TIMEOUT_LIMIT = 60 * 5; // 5 minutes | $TIMEOUT_LIMIT = 60 * 5; // 5 minutes |
| if (isset($_SESSION['lastUpdated']) && $_SESSION['lastUpdated'] + $TIMEOUT_LIMIT < time()) { | if (isset($_SESSION['lastUpdated']) && $_SESSION['lastUpdated'] + $TIMEOUT_LIMIT < time()) { |
| debug("Session timeout " . ($_SESSION['lastUpdated'] + $TIMEOUT_LIMIT) . ">" . time() , "session"); | debug("Session timeout " . ($_SESSION['lastUpdated'] + $TIMEOUT_LIMIT) . ">" . time(), "session"); |
| session_destroy(); | session_destroy(); |
| session_start(); | session_start(); |
| } | } |
| //debug(print_r($_SESSION, true) , "session"); | //debug(print_r($_SESSION, true) , "session"); |
| function current_time() | function current_time() { |
| { | return ($_SESSION['time'] ? $_SESSION['time'] : date("H:i:s")); |
| return ($_SESSION['time'] ? $_SESSION['time'] : date("H:i:s")); | |
| } | } |
| ?> | ?> |
| <?php | <?php |
| /* | |
| * Copyright 2010,2011 Alexander Sadleir | |
| Licensed under the Apache License, Version 2.0 (the "License"); | |
| you may not use this file except in compliance with the License. | |
| You may obtain a copy of the License at | |
| http://www.apache.org/licenses/LICENSE-2.0 | |
| Unless required by applicable law or agreed to in writing, software | |
| distributed under the License is distributed on an "AS IS" BASIS, | |
| WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. | |
| See the License for the specific language governing permissions and | |
| limitations under the License. | |
| */ | |
| // Copyright 2009 Google Inc. All Rights Reserved. | // Copyright 2009 Google Inc. All Rights Reserved. |
| $GA_ACCOUNT = "MO-22173039-1"; | $GA_ACCOUNT = "MO-22173039-1"; |
| $GA_PIXEL = "/lib/ga.php"; | $GA_PIXEL = "/lib/ga.php"; |
| function googleAnalyticsGetImageUrl() | |
| { | function googleAnalyticsGetImageUrl() { |
| global $GA_ACCOUNT, $GA_PIXEL; | global $GA_ACCOUNT, $GA_PIXEL; |
| //if (stristr($_SERVER['HTTP_USER_AGENT'], 'Googlebot') return ""; | //if (stristr($_SERVER['HTTP_USER_AGENT'], 'Googlebot') return ""; |
| $url = ""; | $url = ""; |
| $url.= $GA_PIXEL . "?"; | $url.= $GA_PIXEL . "?"; |
| $url.= "utmac=" . $GA_ACCOUNT; | $url.= "utmac=" . $GA_ACCOUNT; |
| $url.= "&utmn=" . rand(0, 0x7fffffff); | $url.= "&utmn=" . rand(0, 0x7fffffff); |
| $referer = $_SERVER["HTTP_REFERER"]; | $referer = $_SERVER["HTTP_REFERER"]; |
| $query = $_SERVER["QUERY_STRING"]; | $query = $_SERVER["QUERY_STRING"]; |
| $path = $_SERVER["REQUEST_URI"]; | $path = $_SERVER["REQUEST_URI"]; |
| if (empty($referer)) { | if (empty($referer)) { |
| $referer = "-"; | $referer = "-"; |
| } | } |
| $url.= "&utmr=" . urlencode($referer); | $url.= "&utmr=" . urlencode($referer); |
| if (!empty($path)) { | if (!empty($path)) { |
| $url.= "&utmp=" . urlencode($path); | $url.= "&utmp=" . urlencode($path); |
| } | } |
| $url.= "&guid=ON"; | $url.= "&guid=ON"; |
| return str_replace("&", "&", $url); | return str_replace("&", "&", $url); |
| } | } |
| function include_header($pageTitle, $pageType, $opendiv = true, $geolocate = false, $datepicker = false) | function include_header($pageTitle, $pageType, $opendiv = true, $geolocate = false, $datepicker = false) { |
| { | global $basePath, $GTFSREnabled; |
| global $labsPath; | echo ' |
| echo ' | |
| <!DOCTYPE html> | <!DOCTYPE html> |
| <html lang="en"> | <html lang="en"> |
| <head> | <head> |
| <meta charset="UTF-8"> | <meta charset="UTF-8"> |
| <title>' . $pageTitle . '</title> | <meta name="viewport" content="width=device-width, initial-scale=1"> |
| <meta name="google-site-verification" | <title>' . $pageTitle . ' - Canberra Bus Timetable</title> |
| content="-53T5Qn4TB_de1NyfR_ZZkEVdUNcNFSaYKSFkWKx-sY" /> | <meta name="google-site-verification" content="-53T5Qn4TB_de1NyfR_ZZkEVdUNcNFSaYKSFkWKx-sY" /> |
| <link rel="stylesheet" href="'.$labsPath.'css/jquery-ui-1.8.12.custom.css" />'; | <link rel="dns-prefetch" href="//code.jquery.com"> |
| if (isDebugServer()) { | <link rel="dns-prefetch" href="//ajax.googleapis.com"> |
| echo '<link rel="stylesheet" href="'.$labsPath.'css/jquery.mobile-1.0b1.css" /> | <link rel="stylesheet" href="' . $basePath . 'css/jquery-ui-1.8.12.custom.css" />'; |
| $jqmVersion = "1.0rc1"; | |
| <script type="text/javascript" src="'.$labsPath.'js/jquery-1.6.1.min.js"></script> | if (isDebugServer()) { |
| <script>$(document).bind("mobileinit", function(){ | $jqmcss = $basePath . "css/jquery.mobile-$jqmVersion.css"; |
| $jqjs = $basePath . "js/jquery-1.6.2.min.js"; | |
| $jqmjs = $basePath . "js/jquery.mobile-$jqmVersion.js"; | |
| } else { | |
| $jqmcss = "//code.jquery.com/mobile/$jqmVersion/jquery.mobile-$jqmVersion.min.css"; | |
| $jqjs = "//ajax.googleapis.com/ajax/libs/jquery/1.6.2/jquery.min.js"; | |
| $jqmjs = "//code.jquery.com/mobile/$jqmVersion/jquery.mobile-$jqmVersion.min.js"; | |
| } | |
| echo '<link rel="stylesheet" href="' . $jqmcss . '" /> | |
| <script src="' . $jqjs . '"></script> | |
| <script>$(document).bind("mobileinit", function(){ | |
| $.mobile.ajaxEnabled = false; | $.mobile.ajaxEnabled = false; |
| }); | }); |
| </script> | </script> |
| <script type="text/javascript" src="'.$labsPath.'js/jquery.mobile-1.0b1.js"></script>'; | <script src="' . $jqmjs . '"></script> |
| } | |
| else { | <script src="' . $basePath . 'js/jquery.ui.core.min.js"></script> |
| echo '<link rel="stylesheet" href="http://code.jquery.com/mobile/1.0b1/jquery.mobile-1.0b1.min.css" /> | <script src="' . $basePath . 'js/jquery.ui.position.min.js"></script> |
| <script type="text/javascript" src="http://ajax.googleapis.com/ajax/libs/jquery/1.6.1/jquery.min.js"></script> | <script src="' . $basePath . 'js/jquery.ui.widget.min.js"></script> |
| <script>$(document).bind("mobileinit", function(){ | <script src="' . $basePath . 'js/jquery.ui.autocomplete.min.js"></script> |
| $.mobile.ajaxEnabled = false; | |
| }); | |
| </script> | |
| <script type="text/javascript" src="http://code.jquery.com/mobile/1.0b1/jquery.mobile-1.0b1.min.js"></script>'; | |
| } | |
| echo ' | |
| <script src="'.$labsPath.'js/jquery.ui.autocomplete.min.js"></script> | |
| <script src="'.$labsPath.'js/jquery.ui.core.min.js"></script> | |
| <script src="'.$labsPath.'js/jquery.ui.position.min.js"></script> | |
| <script src="'.$labsPath.'js/jquery.ui.widget.min.js"></script> | |
| <script> | <script> |
| $(function() { | $(function() { |
| $( "#geolocate" ).autocomplete({ | $( "#geolocate" ).autocomplete({ |
| source: "lib/autocomplete.php", | source: "lib/autocomplete.php", |
| minLength: 2 | minLength: 2 |
| }); | }); |
| $( "#from" ).autocomplete({ | $( "#from" ).autocomplete({ |
| source: "lib/autocomplete.php", | source: "lib/autocomplete.php", |
| minLength: 2 | minLength: 2 |
| }); | }); |
| $( "#to" ).autocomplete({ | $( "#to" ).autocomplete({ |
| source: "lib/autocomplete.php", | source: "lib/autocomplete.php", |
| minLength: 2 | minLength: 2 |
| }); | }); |
| }); | }); |
| </script> | </script>'; |
| '; | echo '<style type="text/css">'; |
| echo '<style type="text/css"> | if (strstr($_SERVER['HTTP_USER_AGENT'], 'Android')) |
| .ui-li-thumb, .ui-li-icon { position: relative; }'; | echo '.ui-shadow,.ui-btn-up-a,.ui-btn-hover-a,.ui-btn-down-a,.ui-body-b,.ui-btn-up-b,.ui-btn-hover-b, |
| if (strstr($_SERVER['HTTP_USER_AGENT'], 'Android')) echo '.ui-shadow,.ui-btn-up-a,.ui-btn-hover-a,.ui-btn-down-a,.ui-body-b,.ui-btn-up-b,.ui-btn-hover-b, | |
| .ui-btn-down-b,.ui-bar-c,.ui-body-c,.ui-btn-up-c,.ui-btn-hover-c,.ui-btn-down-c,.ui-bar-c,.ui-body-d, | .ui-btn-down-b,.ui-bar-c,.ui-body-c,.ui-btn-up-c,.ui-btn-hover-c,.ui-btn-down-c,.ui-bar-c,.ui-body-d, |
| .ui-btn-up-d,.ui-btn-hover-d,.ui-btn-down-d,.ui-bar-d,.ui-body-e,.ui-btn-up-e,.ui-btn-hover-e, | .ui-btn-up-d,.ui-btn-hover-d,.ui-btn-down-d,.ui-bar-d,.ui-body-e,.ui-btn-up-e,.ui-btn-hover-e, |
| .ui-btn-down-e,.ui-bar-e,.ui-overlay-shadow,.ui-shadow,.ui-btn-active,.ui-body-a,.ui-bar-a { | .ui-btn-down-e,.ui-bar-e,.ui-overlay-shadow,.ui-shadow,.ui-btn-active,.ui-body-a,.ui-bar-a { |
| text-shadow: none; | text-shadow: none; |
| box-shadow: none; | box-shadow: none; |
| -webkit-box-shadow: none; | -webkit-box-shadow: none; |
| }'; | }'; |
| echo ' | echo '</style>'; |
| .ui-navbar { | echo '<link rel="stylesheet" href="' . $basePath . 'css/local.css.php" />'; |
| width: 100%; | if (isIOSDevice()){ |
| } | echo '<meta name="apple-mobile-web-app-capable" content="yes" /> |
| .ui-btn-inner { | |
| white-space: normal !important; | |
| } | |
| .ui-li-heading { | |
| white-space: normal !important; | |
| } | |
| .ui-listview-filter { | |
| margin: 0 !important; | |
| } | |
| .ui-icon-navigation { | |
| background-image: url('.$labsPath.'css/images/113-navigation.png); | |
| background-position: 1px 0; | |
| } | |
| .ui-icon-beaker { | |
| background-image: url('.$labsPath.'css/images/91-beaker-2.png); | |
| background-position: 1px 0; | |
| } | |
| #footer { | |
| text-size: 0.75em; | |
| text-align: center; | |
| } | |
| body { | |
| background-color: #F0F0F0; | |
| } | |
| #jqm-homeheader { | |
| text-align: center; | |
| } | |
| .viaPoints { | |
| display: none; | |
| text-size: 0.2em; | |
| } | |
| .min-width-480px .viaPoints { | |
| display: inline; | |
| } | |
| #extrainfo { | |
| visibility: hidden; | |
| display: none; | |
| } | |
| #servicewarning { | |
| padding: 1em; | |
| margin-bottom: 0.5em; | |
| text-size: 0.2em; | |
| background-color: #FF9; | |
| -moz-border-radius: 15px; | |
| border-radius: 15px; | |
| } | |
| /*#leftcolumn { | |
| float: none; | |
| } | |
| .min-width-768px #leftcolumn { | |
| float: left; | |
| width: 30%; | |
| } | |
| #rightcolumn { | |
| float: none; | |
| } | |
| .min-width-768px #rightcolumn { | |
| float: right; | |
| width: 68%; | |
| }*/ | |
| #footer { | |
| clear:both; | |
| text-align:center; | |
| } | |
| // source http://webaim.org/techniques/skipnav/ | |
| #skip a, #skip a:hover, #skip a:visited | |
| { | |
| position:absolute; | |
| left:0px; | |
| top:-500px; | |
| width:1px; | |
| height:1px; | |
| overflow:hidden; | |
| } | |
| #skip a:active, #skip a:focus | |
| { | |
| position:static; | |
| width:auto; | |
| height:auto; | |
| } | |
| </style>'; | |
| if (strstr($_SERVER['HTTP_USER_AGENT'], 'iPhone') || strstr($_SERVER['HTTP_USER_AGENT'], 'iPod') || strstr($_SERVER['HTTP_USER_AGENT'], 'iPad')) { | |
| echo '<meta name="apple-mobile-web-app-capable" content="yes" /> | |
| <meta name="apple-mobile-web-app-status-bar-style" content="black" /> | <meta name="apple-mobile-web-app-status-bar-style" content="black" /> |
| <link rel="apple-touch-startup-image" href="startup.png" /> | <link rel="apple-touch-startup-image" href="startup.png" /> |
| <link rel="apple-touch-icon" href="apple-touch-icon.png" />'; | <link rel="apple-touch-icon" href="apple-touch-icon.png" />'; |
| } | } |
| if ($geolocate) { | if ($geolocate) { |
| echo "<script> | echo "<script> |
| function success(position) { | function success(position) { |
| $('#error').val('Location now detected. Please wait for data to load.'); | $('#error').val('Location now detected. Please wait for data to load.'); |
| $('#geolocate').val(position.coords.latitude+','+position.coords.longitude); | $('#geolocate').val(position.coords.latitude+','+position.coords.longitude); |
| $.ajax({ url: \"include/common.inc.php?geolocate=yes&lat=\"+position.coords.latitude+\"&lon=\"+position.coords.longitude }); | $.ajax({ async: false, |
| location.reload(true); | success: function(){ |
| location.reload(true); | |
| }, | |
| url: \"include/common.inc.php?geolocate=yes&lat=\"+position.coords.latitude+\"&lon=\"+position.coords.longitude }); | |
| } | } |
| function error(msg) { | function error(msg) { |
| $('#error').val('Error: '+msg); | $('#error').val('Error: '+msg); |
| } | } |
| function geolocate() { | function geolocate() { |
| if (navigator.geolocation) { | if (navigator.geolocation) { |
| var options = { | var options = { |
| enableHighAccuracy: true, | enableHighAccuracy: true, |
| timeout: 60000, | timeout: 60000, |
| maximumAge: 10000 | maximumAge: 10000 |
| } | } |
| navigator.geolocation.getCurrentPosition(success, error, options); | navigator.geolocation.getCurrentPosition(success, error, options); |
| } | } |
| } | } |
| $(document).ready(function() { | $(document).ready(function() { |
| $('#here').click(function(event) { $('#geolocate').val(geolocate()); return false;}); | $('#here').click(function(event) { $('#geolocate').val(geolocate()); return false;}); |
| $('#here').show(); | $('#here').show(); |
| /*if ($.mobile.media('screen and (min-width: 768px)')) { | |
| $('map a:first').click(); | |
| $('#settings a:first').click(); | |
| }*/ | |
| }); | }); |
| "; | "; |
| if (!isset($_SESSION['lat']) || $_SESSION['lat'] == "") echo "geolocate();"; | if (!isset($_SESSION['lat']) || $_SESSION['lat'] == "") |
| echo "</script> "; | echo "geolocate();"; |
| } | echo "</script> "; |
| if (isAnalyticsOn()) echo ' | } |
| if (isAnalyticsOn()) | |
| echo ' | |
| <script type="text/javascript">' . " | <script type="text/javascript">' . " |
| var _gaq = _gaq || []; | var _gaq = _gaq || []; |
| _gaq.push(['_setAccount', 'UA-22173039-1']); | _gaq.push(['_setAccount', 'UA-22173039-1']); |
| _gaq.push(['_trackPageview']); | _gaq.push(['_trackPageview']); |
| _gaq.push(['_trackPageLoadTime']); | _gaq.push(['_trackPageLoadTime']); |
| </script>"; | </script>"; |
| echo '</head> | echo '</head> |
| <body> | <body> |
| <div id="skip"> | <div id="skip"> |
| <a href="#maincontent">Skip to content</a> | <a href="#maincontent">Skip to content</a> |
| </div> | </div> |
| '; | '; |
| if ($opendiv) { | if ($opendiv) { |
| echo '<div data-role="page"> | echo '<div data-role="page"> |
| <div data-role="header" data-position="inline"> | <div data-role="header" data-position="inline"> |
| <a href="' . (isset($_SERVER["HTTP_REFERER"]) ? $_SERVER["HTTP_REFERER"] : "javascript:history.go(-1)") . '" data-icon="arrow-l" data-rel="back" class="ui-btn-left">Back</a> | <a href="' . (isset($_SERVER["HTTP_REFERER"]) ? $_SERVER["HTTP_REFERER"] : "javascript:history.go(-1)") . '" data-icon="arrow-l" data-rel="back" class="ui-btn-left">Back</a> |
| <h1>' . $pageTitle . '</h1> | <h1>' . $pageTitle . '</h1> |
| <a href="'.$labsPath.'/index.php" data-icon="home" class="ui-btn-right">Home</a> | <a href="' . $basePath . '/index.php" data-icon="home" class="ui-btn-right">Home</a> |
| </div><!-- /header --> | </div><!-- /header --> |
| <a name="maincontent" id="maincontent"></a> | <a name="maincontent" id="maincontent"></a> |
| <div data-role="content"> '; | <div data-role="content"> '; |
| $overrides = getServiceOverride(); | $overrides = getServiceOverride(); |
| if ($overrides['service_id']) { | if ($overrides['service_id']) { |
| if ($overrides['service_id'] == "noservice") { | if ($overrides['service_id'] == "noservice") { |
| echo '<div id="servicewarning">Buses are <strong>not running today</strong> due to industrial action/public holiday. See <a | echo '<div id="servicewarning">Buses are <strong>not running today</strong> due to industrial action/public holiday. See <a |
| href="http://www.action.act.gov.au">http://www.action.act.gov.au</a> for details.</div>'; | href="http://www.action.act.gov.au">http://www.action.act.gov.au</a> for details.</div>'; |
| } | } else { |
| else { | echo '<div id="servicewarning">Buses are running on an altered timetable today due to industrial action/public holiday. See <a href="http://www.action.act.gov.au">http://www.action.act.gov.au</a> for details.</div>'; |
| echo '<div id="servicewarning">Buses are running on an altered timetable today due to industrial action/public holiday. See <a href="http://www.action.act.gov.au">http://www.action.act.gov.au</a> for details.</div>'; | } |
| } | } |
| } | if ($GTFSREnabled) { |
| } | $serviceAlerts = getServiceAlertsAsArray("agency", "0"); |
| if (isset($serviceAlerts['entity']) && sizeof($serviceAlerts['entity']) > 0) { | |
| } | foreach ($serviceAlerts['entity'] as $entity) { |
| function include_footer() | echo "<div id='servicewarning'>" . date("F j, g:i a", strtotime($entity['alert']['active_period'][0]['start'])) . " to " . date("F j, g:i a", strtotime($entity['alert']['active_period'][0]['end'])) . "{$entity['alert']['header_text']['translation'][0]['text']}<br>Warning: {$entity['alert']['description_text']['translation'][0]['text']} |
| { | <br><a href='{$entity['alert']['url']['translation'][0]['text']}'>Source</a> </div>"; |
| } | |
| global $labsPath; | } |
| echo '<div id="footer"><a href="'.$labsPath.'about.php">About/Contact Us</a> <a href="'.$labsPath.'feedback.php">Feedback/Bug Report</a> <a href="'.$labsPath.'privacy.php">Privacy Policy</a>'; | } |
| echo '</div>'; | } |
| if (isAnalyticsOn()) { | } |
| echo "<script> (function() { | |
| function include_footer() { | |
| global $basePath; | |
| echo '<div id="footer"><a href="' . $basePath . 'about.php">About/Contact Us</a> <a href="' . $basePath . 'feedback.php">Feedback/Bug Report</a> <a href="' . $basePath . 'privacy.php">Privacy Policy</a>'; | |
| echo '</div>'; | |
| if (isAnalyticsOn()) { | |
| echo "<script> (function() { | |
| var ga = document.createElement('script'); ga.type = | var ga = document.createElement('script'); ga.type = |
| 'text/javascript'; ga.async = true; | 'text/javascript'; ga.async = true; |
| ga.src = ('https:' == document.location.protocol ? | ga.src = ('https:' == document.location.protocol ? |
| 'https://ssl' : 'http://www') + '.google-analytics.com/ga.js'; | 'https://ssl' : 'http://www') + '.google-analytics.com/ga.js'; |
| var s = document.getElementsByTagName('script')[0]; | var s = document.getElementsByTagName('script')[0]; |
| s.parentNode.insertBefore(ga, s); | s.parentNode.insertBefore(ga, s); |
| })();</script>"; | })();</script>"; |
| $googleAnalyticsImageUrl = googleAnalyticsGetImageUrl(); | $googleAnalyticsImageUrl = googleAnalyticsGetImageUrl(); |
| echo '<noscript><img src="' . $googleAnalyticsImageUrl . '" /></noscript>'; | echo '<noscript><img src="' . $googleAnalyticsImageUrl . '" /></noscript>'; |
| } | |
| } | echo "\n</div></div></body></html>"; |
| echo "\n</div></div></body></html>"; | } |
| } | |
| function timePlaceSettings($geolocate = false) | function placeSettings() { |
| { | global $service_periods; |
| global $service_periods; | $geoerror = false; |
| $geoerror = false; | $geoerror = !isset($_SESSION['lat']) || !isset($_SESSION['lat']) || $_SESSION['lat'] == "" || $_SESSION['lon'] == ""; |
| if ($geolocate == true) { | |
| $geoerror = !isset($_SESSION['lat']) || !isset($_SESSION['lat']) || $_SESSION['lat'] == "" || $_SESSION['lon'] == ""; | echo '<div id="error">'; |
| } | if ($geoerror) { |
| echo '<div id="error">'; | echo 'Sorry, but your location could not currently be detected. |
| if ($geoerror) { | |
| echo 'Sorry, but your location could not currently be detected. | |
| Please allow location permission, wait for your location to be detected, | Please allow location permission, wait for your location to be detected, |
| or enter an address/co-ordinates in the box below.'; | or enter an address/co-ordinates in the box below.'; |
| } | } |
| echo '</div>'; | echo '</div>'; |
| echo '<div id="settings" data-role="collapsible" data-collapsed="' . !$geoerror . '"> | echo '<div id="settings" data-role="collapsible" data-collapsed="' . !$geoerror . '"> |
| <h3>Change Time/Place (' . (isset($_SESSION['time']) ? $_SESSION['time'] : "Current Time,") . ' ' . ucwords(service_period()) . ')...</h3> | <h3>Change Location...</h3> |
| <form action="' . basename($_SERVER['PHP_SELF']) . "?" . $_SERVER['QUERY_STRING'] . '" method="post"> | <form action="' . basename($_SERVER['PHP_SELF']) . "?" . $_SERVER['QUERY_STRING'] . '" method="post"> |
| <div class="ui-body"> | <div class="ui-body"> |
| <div data-role="fieldcontain"> | <div data-role="fieldcontain"> |
| <label for="geolocate"> Current Location: </label> | <label for="geolocate"> Current Location: </label> |
| <input type="text" id="geolocate" name="geolocate" value="' . (isset($_SESSION['lat']) && isset($_SESSION['lon']) ? $_SESSION['lat'] . "," . $_SESSION['lon'] : "Enter co-ordinates or address here") . '"/> <a href="#" style="display:none" name="here" id="here">Here?</a> | <input type="text" id="geolocate" name="geolocate" value="' . (isset($_SESSION['lat']) && isset($_SESSION['lon']) ? $_SESSION['lat'] . "," . $_SESSION['lon'] : "Enter co-ordinates or address here") . '"/> <a href="#" style="display:none" name="here" id="here">Here?</a> |
| </div> | </div> |
| <div data-role="fieldcontain"> | |
| <label for="time"> Time: </label> | |
| <input type="time" name="time" id="time" value="' . (isset($_SESSION['time']) ? $_SESSION['time'] : date("H:i")) . '"/> | |
| <a href="#" name="currentTime" id="currentTime" onClick="var d = new Date();' . "$('#time').val(d.getHours() +':'+ (d.getMinutes().toString().length == 1 ? '0'+ d.getMinutes(): d.getMinutes()));" . '">Current Time?</a> | |
| </div> | |
| <div data-role="fieldcontain"> | |
| <label for="service_period"> Service Period: </label> | |
| <select name="service_period" id="service_period">'; | |
| foreach ($service_periods as $service_period) { | |
| echo "<option value=\"$service_period\"" . (service_period() === $service_period ? " SELECTED" : "") . '>' . ucwords($service_period) . '</option>'; | |
| } | |
| echo '</select> | |
| <a href="#" style="display:none" name="currentPeriod" id="currentPeriod">Current Period?</a> | |
| </div> | |
| <input type="submit" value="Update"/> | <input type="submit" value="Update"/> |
| </div></form> | </div></form> |
| </div>'; | </div>'; |
| } | } |
| function trackEvent($category, $action, $label = "", $value = - 1) | |
| { | function trackEvent($category, $action, $label = "", $value = - 1) { |
| if (isAnalyticsOn()) { | if (isAnalyticsOn()) { |
| echo "\n<script> _gaq.push(['_trackEvent', '$category', '$action'" . ($label != "" ? ", '$label'" : "") . ($value != - 1 ? ", $value" : "") . "]);</script>"; | echo "\n<script> _gaq.push(['_trackEvent', '$category', '$action'" . ($label != "" ? ", '$label'" : "") . ($value != - 1 ? ", $value" : "") . "]);</script>"; |
| } | } |
| } | } |
| ?> | ?> |
| <?php | <?php |
| /* | |
| * Copyright 2010,2011 Alexander Sadleir | |
| Licensed under the Apache License, Version 2.0 (the "License"); | |
| you may not use this file except in compliance with the License. | |
| You may obtain a copy of the License at | |
| http://www.apache.org/licenses/LICENSE-2.0 | |
| Unless required by applicable law or agreed to in writing, software | |
| distributed under the License is distributed on an "AS IS" BASIS, | |
| WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. | |
| See the License for the specific language governing permissions and | |
| limitations under the License. | |
| */ | |
| $service_periods = Array( | $service_periods = Array( |
| 'sunday', | 'sunday', |
| 'saturday', | 'saturday', |
| 'weekday' | 'weekday' |
| ); | ); |
| function service_period($date = "") | function service_period($date = "") { |
| { | |
| if (isset($_SESSION['service_period'])) | |
| if (isset($_SESSION['service_period'])) return $_SESSION['service_period']; | return $_SESSION['service_period']; |
| $override = getServiceOverride($date); | $override = getServiceOverride($date); |
| if ($override['service_id']){ | if ($override['service_id']) { |
| return $override['service_id']; | return $override['service_id']; |
| } | } |
| switch (date('w',($date != "" ? $date : time()))) { | switch (date('w', ($date != "" ? $date : time()))) { |
| case 0: | case 0: |
| return 'sunday'; | return 'sunday'; |
| case 6: | case 6: |
| return 'saturday'; | return 'saturday'; |
| default: | default: |
| return 'weekday'; | return 'weekday'; |
| } | } |
| } | } |
| function midnight_seconds() | |
| { | function midnight_seconds($time = "") { |
| // from http://www.perturb.org/display/Perlfunc__Seconds_Since_Midnight.html | // from http://www.perturb.org/display/Perlfunc__Seconds_Since_Midnight.html |
| if (isset($_SESSION['time'])) { | if ($time != "") { |
| $time = strtotime($_SESSION['time']); | return (date("G", $time) * 3600) + (date("i", $time) * 60) + date("s", $time); |
| return (date("G", $time) * 3600) + (date("i", $time) * 60) + date("s", $time); | } |
| } | if (isset($_SESSION['time'])) { |
| return (date("G") * 3600) + (date("i") * 60) + date("s"); | $time = strtotime($_SESSION['time']); |
| } | return (date("G", $time) * 3600) + (date("i", $time) * 60) + date("s", $time); |
| function midnight_seconds_to_time($seconds) | } |
| { | return (date("G") * 3600) + (date("i") * 60) + date("s"); |
| if ($seconds > 0) { | } |
| $midnight = mktime(0, 0, 0, date("n") , date("j") , date("Y")); | |
| return date("h:ia", $midnight + $seconds); | function midnight_seconds_to_time($seconds) { |
| } | if ($seconds > 0) { |
| else { | $midnight = mktime(0, 0, 0, date("n"), date("j"), date("Y")); |
| return ""; | return date("h:ia", $midnight + $seconds); |
| } | } else { |
| return ""; | |
| } | |
| } | |
| if ($GTFSREnabled) { | |
| $serviceAlertCause = Array( | |
| "UNKNOWN_CAUSE" => "Unknown cause", | |
| "OTHER_CAUSE" => "Other cause", | |
| "TECHNICAL_PROBLEM" => "Technical problem", | |
| "STRIKE" => "Strike", | |
| "DEMONSTRATION" => "Demonstration", | |
| "ACCIDENT" => "Accident", | |
| "HOLIDAY" => "Holiday", | |
| "WEATHER" => "Weather", | |
| "MAINTENANCE" => "Maintenance", | |
| "CONSTRUCTION" => "Construction", | |
| "POLICE_ACTIVITY" => "Police activity", | |
| "MEDICAL_EMERGENCY" => "Medical emergency" | |
| ); | |
| $serviceAlertEffect = Array( | |
| "NO_SERVICE" => "No service", | |
| "REDUCED_SERVICE" => "Reduced service", | |
| "SIGNIFICANT_DELAYS" => "Significant delays", | |
| "DETOUR" => "Detour", | |
| "ADDITIONAL_SERVICE" => "Additional service", | |
| "MODIFIED_SERVICE" => "Modified service", | |
| "OTHER_EFFECT" => "Other effect", | |
| "UNKNOWN_EFFECT" => "Unknown effect", | |
| "STOP_MOVED" => "Stop moved"); | |
| set_include_path(get_include_path() . PATH_SEPARATOR . ($basePath . "lib/Protobuf-PHP/library/DrSlump/")); | |
| include_once("Protobuf.php"); | |
| include_once("Protobuf/Message.php"); | |
| include_once("Protobuf/Registry.php"); | |
| include_once("Protobuf/Descriptor.php"); | |
| include_once("Protobuf/Field.php"); | |
| include_once($basePath . "lib/Protobuf-PHP/gtfs-realtime.php"); | |
| include_once("Protobuf/CodecInterface.php"); | |
| include_once("Protobuf/Codec/PhpArray.php"); | |
| include_once("Protobuf/Codec/Binary.php"); | |
| include_once("Protobuf/Codec/Binary/Writer.php"); | |
| include_once("Protobuf/Codec/Json.php"); | |
| function getServiceAlerts($filter_class = "", $filter_id = "") { | |
| /* | |
| also need last modified epoch of client gtfs | |
| - add,remove,patch,inform (null) | |
| - stop | |
| - trip | |
| - network | |
| - classes (WHERE=) | |
| - route (short_name or route_id) | |
| - street | |
| - stop | |
| - trip | |
| Currently support: | |
| network inform | |
| trip patch: stop remove | |
| street inform: route inform, trip inform, stop inform | |
| route patch: trip remove | |
| */ | |
| $fm = new transit_realtime\FeedMessage(); | |
| $fh = new transit_realtime\FeedHeader(); | |
| $fh->setGtfsRealtimeVersion(1); | |
| $fh->setTimestamp(time()); | |
| $fm->setHeader($fh); | |
| foreach (getCurrentAlerts() as $alert) { | |
| $fe = new transit_realtime\FeedEntity(); | |
| $fe->setId($alert['id']); | |
| $fe->setIsDeleted(false); | |
| $alert = new transit_realtime\Alert(); | |
| $tr = new transit_realtime\TimeRange(); | |
| $tr->setStart($alert['start']); | |
| $tr->setEnd($alert['end']); | |
| $alert->addActivePeriod($tr); | |
| $informedEntities = getInformedAlerts($alert['id'], $_REQUEST['filter_class'], $_REQUEST['filter_id']); | |
| if (sizeof($informedEntities) > 0) { | |
| $informed = Array(); | |
| $es = new transit_realtime\EntitySelector(); | |
| if ($informedEntity['informed_class'] == "agency") { | |
| $es->setAgencyId($informedEntity['informed_id']); | |
| } | |
| if ($informedEntity['informed_class'] == "stop") { | |
| $es->setStopId($informedEntity['informed_id']); | |
| } | |
| if ($informedEntity['informed_class'] == "route") { | |
| $es->setRouteId($informedEntity['informed_id']); | |
| } | |
| if ($informedEntity['informed_class'] == "trip") { | |
| $td = new transit_realtime\TripDescriptor(); | |
| $td->setTripId($informedEntity['informed_id']); | |
| $es->setTrip($td); | |
| } | |
| $alert->addInformedEntity($es); | |
| } | |
| $alert->setCause(constant("transit_realtime\Alert\Cause::" . $alert['cause'])); | |
| $alert->setEffect(constant("transit_realtime\Alert\Effect::" . $alert['effect'])); | |
| $tsUrl = new transit_realtime\TranslatedString(); | |
| $tUrl = new transit_realtime\TranslatedString\Translation(); | |
| $tUrl->setText($alert['url']); | |
| $tUrl->setLanguage("en"); | |
| $tsUrl->addTranslation($tUrl); | |
| $alert->setUrl($tsUrl); | |
| $tsHeaderText = new transit_realtime\TranslatedString(); | |
| $tHeaderText = new transit_realtime\TranslatedString\Translation(); | |
| $tHeaderText->setText($alert['header']); | |
| $tHeaderText->setLanguage("en"); | |
| $tsHeaderText->addTranslation($tHeaderText); | |
| $alert->setHeaderText($tsHeaderText); | |
| $tsDescriptionText = new transit_realtime\TranslatedString(); | |
| $tDescriptionText = new transit_realtime\TranslatedString\Translation(); | |
| $tDescriptionText->setText($alert['description']); | |
| $tDescriptionText->setLanguage("en"); | |
| $tsDescriptionText->addTranslation($tDescriptionText); | |
| $alert->setDescriptionText($tsDescriptionText); | |
| $fe->setAlert($alert); | |
| $fm->addEntity($fe); | |
| } | |
| return $fm; | |
| } | |
| function getServiceAlertsAsArray($filter_class = "", $filter_id = "") { | |
| $codec = new DrSlump\Protobuf\Codec\PhpArray(); | |
| return $codec->encode(getServiceAlerts($filter_class, $filter_id)); | |
| } | |
| function getServiceAlertsAsBinary($filter_class = "", $filter_id = "") { | |
| $codec = new DrSlump\Protobuf\Codec\Binary(); | |
| return $codec->encode(getServiceAlerts($filter_class, $filter_id)); | |
| } | |
| function getServiceAlertsAsJSON($filter_class = "", $filter_id = "") { | |
| $codec = new DrSlump\Protobuf\Codec\Json(); | |
| return $codec->encode(getServiceAlerts($filter_class, $filter_id)); | |
| } | |
| function getServiceAlertsByClass() { | |
| $return = Array(); | |
| $alerts = getServiceAlertsAsArray("", ""); | |
| foreach ($alerts['entities'] as $entity) { | |
| foreach ($entity['informed'] as $informed) { | |
| foreach ($informed as $key => $value) { | |
| if (strpos("_id", $key) > 0) { | |
| $parts = explode($key); | |
| $class = $parts[0]; | |
| $id = $value; | |
| } | |
| } | |
| $return[$class][$id][] = $entity; | |
| } | |
| } | |
| } | |
| function getTripUpdates($filter_class = "", $filter_id = "") { | |
| $fm = new transit_realtime\FeedMessage(); | |
| $fh = new transit_realtime\FeedHeader(); | |
| $fh->setGtfsRealtimeVersion(1); | |
| $fh->setTimestamp(time()); | |
| $fm->setHeader($fh); | |
| foreach (getCurrentAlerts() as $alert) { | |
| $informedEntities = getInformedAlerts($alert['id'], $_REQUEST['filter_class'], $_REQUEST['filter_id']); | |
| $stops = Array(); | |
| $routestrips = Array(); | |
| if (sizeof($informedEntities) > 0) { | |
| if ($informedEntity['informed_class'] == "stop" && $informed["x-action"] == "remove") { | |
| $stops[] = $informedEntity['informed_id']; | |
| } | |
| if (($informedEntity['informed_class'] == "route" || $informedEntity['informed_class'] == "trip") && $informed["x-action"] == "patch") { | |
| $routestrips[] = Array("id" => $informedEntity['informed_id'], | |
| "type" => $informedEntity['informed_class']); | |
| } | |
| } | |
| foreach ($routestrips as $routetrip) { | |
| $fe = new transit_realtime\FeedEntity(); | |
| $fe->setId($alert['id'] . $routetrip['id']); | |
| $fe->setIsDeleted(false); | |
| $tu = new transit_realtime\TripUpdate(); | |
| $td = new transit_realtime\TripDescriptor(); | |
| if ($routetrip['type'] == "route") { | |
| $td->setRouteId($routetrip['id']); | |
| } else if ($routetrip['type'] == "trip") { | |
| $td->setTripId($routetrip['id']); | |
| } | |
| $tu->setTrip($td); | |
| foreach ($stops as $stop) { | |
| $stu = new transit_realtime\TripUpdate\StopTimeUpdate(); | |
| $stu->setStopId($stop); | |
| $stu->setScheduleRelationship(transit_realtime\TripUpdate\StopTimeUpdate\ScheduleRelationship::SKIPPED); | |
| $tu->addStopTimeUpdate($stu); | |
| } | |
| $fe->setTripUpdate($tu); | |
| $fm->addEntity($fe); | |
| } | |
| } | |
| return $fm; | |
| } | |
| function getTripUpdatesAsArray($filter_class = "", $filter_id = "") { | |
| $codec = new DrSlump\Protobuf\Codec\PhpArray(); | |
| return $codec->encode(getTripUpdates($filter_class, $filter_id)); | |
| } | |
| function getTripUpdatesAsBinary($filter_class = "", $filter_id = "") { | |
| $codec = new DrSlump\Protobuf\Codec\Binary(); | |
| return $codec->encode(getTripUpdates($filter_class, $filter_id)); | |
| } | |
| function getTripUpdatesAsJSON($filter_class = "", $filter_id = "") { | |
| $codec = new DrSlump\Protobuf\Codec\Json(); | |
| return $codec->encode(getTripUpdates($filter_class, $filter_id)); | |
| } | |
| } | } |
| ?> | ?> |
| <?php | <?php |
| /* | |
| * Copyright 2010,2011 Alexander Sadleir | |
| Licensed under the Apache License, Version 2.0 (the "License"); | |
| you may not use this file except in compliance with the License. | |
| You may obtain a copy of the License at | |
| http://www.apache.org/licenses/LICENSE-2.0 | |
| Unless required by applicable law or agreed to in writing, software | |
| distributed under the License is distributed on an "AS IS" BASIS, | |
| WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. | |
| See the License for the specific language governing permissions and | |
| limitations under the License. | |
| */ | |
| date_default_timezone_set('Australia/ACT'); | date_default_timezone_set('Australia/ACT'); |
| $debugOkay = Array( | $debugOkay = Array( |
| "session", | "session", |
| "json", | "json", |
| "phperror", | "phperror", |
| "awsotp", | "awsotp", |
| //"squallotp", | //"squallotp", |
| "vanilleotp", | //"vanilleotp", |
| "database", | "database", |
| "other" | "other" |
| ); | ); |
| $GTFSREnabled = true; | |
| $cloudmadeAPIkey = "daa03470bb8740298d4b10e3f03d63e6"; | $cloudmadeAPIkey = "daa03470bb8740298d4b10e3f03d63e6"; |
| $googleMapsAPIkey = "ABQIAAAA95XYXN0cki3Yj_Sb71CFvBTPaLd08ONybQDjcH_VdYtHHLgZvRTw2INzI_m17_IoOUqH3RNNmlTk1Q"; | $googleMapsAPIkey = "ABQIAAAA95XYXN0cki3Yj_Sb71CFvBTPaLd08ONybQDjcH_VdYtHHLgZvRTw2INzI_m17_IoOUqH3RNNmlTk1Q"; |
| $otpAPIurl = 'http://localhost:8080/opentripplanner-api-webapp/'; | $otpAPIurl = 'http://localhost:8080/opentripplanner-api-webapp/'; |
| if (isDebug("awsotp") || php_uname('n') == "maxious.xen.prgmr.com") { | if (isDebug("awsotp") || php_uname('n') == "maxious.xen.prgmr.com") { |
| $otpAPIurl = 'http://bus-main.lambdacomplex.org:8080/opentripplanner-api-webapp/'; | $otpAPIurl = 'http://bus-main.lambdacomplex.org:8080/opentripplanner-api-webapp/'; |
| } | } |
| if (isDebug("dotcloudotp") || php_uname('n') == "actbus-www") { | if (isDebug("dotcloudotp") || php_uname('n') == "actbus-www") { |
| $otpAPIurl = 'http://otp.actbus.dotcloud.com/opentripplanner-api-webapp/'; | $otpAPIurl = 'http://otp.actbus.dotcloud.com/opentripplanner-api-webapp/'; |
| } | } |
| if (isDebug("squallotp")) { | if (isDebug("squallotp")) { |
| $otpAPIurl = 'http://10.0.1.108:5080/opentripplanner-api-webapp/'; | $otpAPIurl = 'http://10.0.1.108:5080/opentripplanner-api-webapp/'; |
| } | } |
| if (isDebug("vanilleotp")) { | if (isDebug("vanilleotp")) { |
| $otpAPIurl = 'http://10.0.1.135:8080/opentripplanner-api-webapp/'; | $otpAPIurl = 'http://10.0.1.135:8080/opentripplanner-api-webapp/'; |
| } | } |
| if (isDebug("phperror")) error_reporting(E_ALL ^ E_NOTICE); | if (isDebug("phperror")) |
| $labsPath = ""; | error_reporting(E_ALL ^ E_NOTICE); |
| if (strstr($_SERVER['PHP_SELF'],"labs")) $labsPath = "../"; | $basePath = ""; |
| if (strstr($_SERVER['PHP_SELF'], "labs/") | |
| || strstr($_SERVER['PHP_SELF'], "myway/") | |
| || strstr($_SERVER['PHP_SELF'], "lib/") | |
| || strstr($_SERVER['PHP_SELF'], "geo/") | |
| || strstr($_SERVER['PHP_SELF'], "include/") | |
| || strstr($_SERVER['PHP_SELF'], "servicealerts/")) | |
| $basePath = "../"; | |
| function isDebugServer() { | |
| return php_sapi_name() == "cli" || isset($_SERVER['SERVER_NAME']) && ( $_SERVER['SERVER_NAME'] == "azusa" || $_SERVER['SERVER_NAME'] == "vanille" | |
| || $_SERVER['SERVER_NAME'] == "localhost" || $_SERVER['SERVER_NAME'] == "127.0.0.1"); | |
| } | |
| include_once ("common-geo.inc.php"); | include_once ("common-geo.inc.php"); |
| include_once ("common-net.inc.php"); | include_once ("common-net.inc.php"); |
| include_once ("common-transit.inc.php"); | include_once ("common-transit.inc.php"); |
| include_once ("common-db.inc.php"); | include_once ("common-db.inc.php"); |
| include_once ("common-request.inc.php"); | include_once ("common-request.inc.php"); |
| include_once ("common-session.inc.php"); | include_once ("common-session.inc.php"); |
| include_once ("common-auth.inc.php"); | |
| include_once ("common-template.inc.php"); | include_once ("common-template.inc.php"); |
| function isDebugServer() | function isAnalyticsOn() { |
| { | $user_agent = $_SERVER['HTTP_USER_AGENT']; |
| return $_SERVER['SERVER_NAME'] == "10.0.1.154" || $_SERVER['SERVER_NAME'] == "localhost" || $_SERVER['SERVER_NAME'] == "127.0.0.1" || !$_SERVER['SERVER_NAME']; | return!isDebugServer() && !preg_match('/cloudkick/i', $user_agent) && !preg_match('/googlebot/i', $user_agent) && |
| } | !preg_match('/baidu/i', $user_agent); |
| function isAnalyticsOn() | } |
| { | |
| return !isDebugServer(); | function isDebug($debugReason = "other") { |
| } | global $debugOkay; |
| function isDebug($debugReason = "other") | return in_array($debugReason, $debugOkay, false) && isDebugServer(); |
| { | } |
| global $debugOkay; | |
| return in_array($debugReason, $debugOkay, false) && isDebugServer(); | function debug($msg, $debugReason = "other") { |
| } | if (isDebug($debugReason)) |
| function debug($msg, $debugReason = "other") | echo "\n<!-- " . date(DATE_RFC822) . "\n $msg -->\n"; |
| { | } |
| if (isDebug($debugReason)) echo "\n<!-- " . date(DATE_RFC822) . "\n $msg -->\n"; | function isIOSDevice() { |
| } | return strstr($_SERVER['HTTP_USER_AGENT'], 'iPhone') || strstr($_SERVER['HTTP_USER_AGENT'], 'iPod') || strstr($_SERVER['HTTP_USER_AGENT'], 'iPad'); |
| function isJQueryMobileDevice() | } |
| { | function isJQueryMobileDevice() { |
| // http://forum.jquery.com/topic/what-is-the-best-way-to-detect-all-useragents-which-can-handle-jquery-mobile#14737000002087897 | // http://forum.jquery.com/topic/what-is-the-best-way-to-detect-all-useragents-which-can-handle-jquery-mobile#14737000002087897 |
| $user_agent = $_SERVER['HTTP_USER_AGENT']; | $user_agent = $_SERVER['HTTP_USER_AGENT']; |
| return preg_match('/iphone/i', $user_agent) || preg_match('/android/i', $user_agent) || preg_match('/webos/i', $user_agent) || preg_match('/ios/i', $user_agent) || preg_match('/bada/i', $user_agent) || preg_match('/maemo/i', $user_agent) || preg_match('/meego/i', $user_agent) || preg_match('/fennec/i', $user_agent) || (preg_match('/symbian/i', $user_agent) && preg_match('/s60/i', $user_agent) && $browser['majorver'] >= 5) || (preg_match('/symbian/i', $user_agent) && preg_match('/platform/i', $user_agent) && $browser['majorver'] >= 3) || (preg_match('/blackberry/i', $user_agent) && $browser['majorver'] >= 5) || (preg_match('/opera mobile/i', $user_agent) && $browser['majorver'] >= 10) || (preg_match('/opera mini/i', $user_agent) && $browser['majorver'] >= 5); | return preg_match('/iphone/i', $user_agent) || preg_match('/android/i', $user_agent) || preg_match('/webos/i', $user_agent) || preg_match('/ios/i', $user_agent) || preg_match('/bada/i', $user_agent) || preg_match('/maemo/i', $user_agent) || preg_match('/meego/i', $user_agent) || preg_match('/fennec/i', $user_agent) || (preg_match('/symbian/i', $user_agent) && preg_match('/s60/i', $user_agent) && $browser['majorver'] >= 5) || (preg_match('/symbian/i', $user_agent) && preg_match('/platform/i', $user_agent) && $browser['majorver'] >= 3) || (preg_match('/blackberry/i', $user_agent) && $browser['majorver'] >= 5) || (preg_match('/opera mobile/i', $user_agent) && $browser['majorver'] >= 10) || (preg_match('/opera mini/i', $user_agent) && $browser['majorver'] >= 5); |
| } | } |
| function isFastDevice() | |
| { | |
| $ua = $_SERVER['HTTP_USER_AGENT']; | function array_flatten($a, $f = array()) { |
| $fastDevices = Array( | if (!$a || !is_array($a)) |
| "Mozilla/5.0 (X11;", | return ''; |
| "Mozilla/5.0 (Windows;", | foreach ($a as $k => $v) { |
| "Mozilla/5.0 (iP", | if (is_array($v)) |
| "Mozilla/5.0 (Linux; U; Android", | $f = array_flatten($v, $f); |
| "Mozilla/4.0 (compatible; MSIE" | else |
| ); | $f[$k] = $v; |
| $slowDevices = Array( | } |
| "J2ME", | return $f; |
| "MIDP", | } |
| "Opera/", | |
| "Mozilla/2.0 (compatible;", | function remove_spaces($string) { |
| "Mozilla/3.0 (compatible;" | return str_replace(' ', '', $string); |
| ); | } |
| return true; | |
| } | function object2array($object) { |
| function array_flatten($a, $f = array()) | if (is_object($object)) { |
| { | foreach ($object as $key => $value) { |
| if (!$a || !is_array($a)) return ''; | $array[$key] = $value; |
| foreach ($a as $k => $v) { | } |
| if (is_array($v)) $f = array_flatten($v, $f); | } else { |
| else $f[$k] = $v; | $array = $object; |
| } | } |
| return $f; | return $array; |
| } | } |
| function remove_spaces($string) | |
| { | function startsWith($haystack, $needle, $case = true) { |
| return str_replace(' ', '', $string); | if ($case) { |
| } | return (strcmp(substr($haystack, 0, strlen($needle)), $needle) === 0); |
| function object2array($object) | } |
| { | return (strcasecmp(substr($haystack, 0, strlen($needle)), $needle) === 0); |
| if (is_object($object)) { | } |
| foreach ($object as $key => $value) { | |
| $array[$key] = $value; | function endsWith($haystack, $needle, $case = true) { |
| } | if ($case) { |
| } | return (strcmp(substr($haystack, strlen($haystack) - strlen($needle)), $needle) === 0); |
| else { | } |
| $array = $object; | return (strcasecmp(substr($haystack, strlen($haystack) - strlen($needle)), $needle) === 0); |
| } | } |
| return $array; | |
| } | function bracketsMeanNewLine($input) { |
| function startsWith($haystack, $needle, $case = true) | return str_replace(")", "</small>", str_replace("(", "<br><small>", $input)); |
| { | } |
| if ($case) { | |
| return (strcmp(substr($haystack, 0, strlen($needle)) , $needle) === 0); | function sksort(&$array, $subkey = "id", $sort_ascending = false) { |
| } | if (count($array)) |
| return (strcasecmp(substr($haystack, 0, strlen($needle)) , $needle) === 0); | $temp_array[key($array)] = array_shift($array); |
| } | foreach ($array as $key => $val) { |
| $offset = 0; | |
| function endsWith($haystack, $needle, $case = true) | $found = false; |
| { | foreach ($temp_array as $tmp_key => $tmp_val) { |
| if ($case) { | if (!$found and strtolower($val[$subkey]) > strtolower($tmp_val[$subkey])) { |
| return (strcmp(substr($haystack, strlen($haystack) - strlen($needle)) , $needle) === 0); | $temp_array = array_merge((array) array_slice($temp_array, 0, $offset), array( |
| } | $key => $val |
| return (strcasecmp(substr($haystack, strlen($haystack) - strlen($needle)) , $needle) === 0); | ), array_slice($temp_array, $offset)); |
| } | $found = true; |
| function bracketsMeanNewLine($input) | } |
| { | $offset++; |
| return str_replace(")", "</small>", str_replace("(", "<br><small>", $input)); | } |
| } | if (!$found) |
| function sksort(&$array, $subkey = "id", $sort_ascending = false) | $temp_array = array_merge($temp_array, array( |
| { | $key => $val |
| if (count($array)) $temp_array[key($array) ] = array_shift($array); | )); |
| foreach ($array as $key => $val) { | } |
| $offset = 0; | if ($sort_ascending) |
| $found = false; | $array = array_reverse($temp_array); |
| foreach ($temp_array as $tmp_key => $tmp_val) { | else |
| if (!$found and strtolower($val[$subkey]) > strtolower($tmp_val[$subkey])) { | $array = $temp_array; |
| $temp_array = array_merge((array)array_slice($temp_array, 0, $offset) , array( | } |
| $key => $val | |
| ) , array_slice($temp_array, $offset)); | function sktimesort(&$array, $subkey = "id", $sort_ascending = false) { |
| $found = true; | if (count($array)) |
| } | $temp_array[key($array)] = array_shift($array); |
| $offset++; | foreach ($array as $key => $val) { |
| } | $offset = 0; |
| if (!$found) $temp_array = array_merge($temp_array, array( | $found = false; |
| $key => $val | foreach ($temp_array as $tmp_key => $tmp_val) { |
| )); | if (!$found and strtotime($val[$subkey]) > strtotime($tmp_val[$subkey])) { |
| } | $temp_array = array_merge((array) array_slice($temp_array, 0, $offset), array( |
| if ($sort_ascending) $array = array_reverse($temp_array); | $key => $val |
| else $array = $temp_array; | ), array_slice($temp_array, $offset)); |
| } | $found = true; |
| function sktimesort(&$array, $subkey = "id", $sort_ascending = false) | } |
| { | $offset++; |
| if (count($array)) $temp_array[key($array) ] = array_shift($array); | } |
| foreach ($array as $key => $val) { | if (!$found) |
| $offset = 0; | $temp_array = array_merge($temp_array, array( |
| $found = false; | $key => $val |
| foreach ($temp_array as $tmp_key => $tmp_val) { | )); |
| if (!$found and strtotime($val[$subkey]) > strtotime($tmp_val[$subkey])) { | } |
| $temp_array = array_merge((array)array_slice($temp_array, 0, $offset) , array( | if ($sort_ascending && isset($temp_array)) |
| $key => $val | $array = array_reverse($temp_array); |
| ) , array_slice($temp_array, $offset)); | else |
| $found = true; | $array = $temp_array; |
| } | } |
| $offset++; | |
| } | function r_implode($glue, $pieces) { |
| if (!$found) $temp_array = array_merge($temp_array, array( | foreach ($pieces as $r_pieces) { |
| $key => $val | if (is_array($r_pieces)) { |
| )); | $retVal[] = r_implode($glue, $r_pieces); |
| } | } else { |
| if ($sort_ascending && isset($temp_array)) $array = array_reverse($temp_array); | $retVal[] = $r_pieces; |
| else $array = $temp_array; | } |
| } | } |
| function r_implode( $glue, $pieces ) | return implode($glue, $retVal); |
| { | } |
| foreach( $pieces as $r_pieces ) | |
| { | |
| if( is_array( $r_pieces ) ) | |
| { | |
| $retVal[] = r_implode( $glue, $r_pieces ); | |
| } | |
| else | |
| { | |
| $retVal[] = $r_pieces; | |
| } | |
| } | |
| return implode( $glue, $retVal ); | |
| } | |
| ?> | ?> |
| <?php | <?php |
| function getRoute($routeID) | |
| { | /* |
| global $conn; | * Copyright 2010,2011 Alexander Sadleir |
| $query = "Select * from routes where route_id = :routeID LIMIT 1"; | |
| debug($query, "database"); | Licensed under the Apache License, Version 2.0 (the "License"); |
| $query = $conn->prepare($query); | you may not use this file except in compliance with the License. |
| $query->bindParam(":routeID", $routeID); | You may obtain a copy of the License at |
| $query->execute(); | |
| if (!$query) { | http://www.apache.org/licenses/LICENSE-2.0 |
| databaseError($conn->errorInfo()); | |
| return Array(); | Unless required by applicable law or agreed to in writing, software |
| } | distributed under the License is distributed on an "AS IS" BASIS, |
| return $query->fetch(PDO::FETCH_ASSOC); | WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. |
| } | See the License for the specific language governing permissions and |
| limitations under the License. | |
| function getRouteByFullName($routeFullName) | */ |
| { | |
| global $conn; | function getRoute($routeID) { |
| $query = "Select * from routes where route_short_name||route_long_name = :routeFullName LIMIT 1"; | global $conn; |
| debug($query, "database"); | $query = "Select * from routes where route_id = :routeID LIMIT 1"; |
| $query = $conn->prepare($query); | debug($query, "database"); |
| $query->bindParam(":routeFullName", $routeFullName); | $query = $conn->prepare($query); |
| $query->execute(); | $query->bindParam(":routeID", $routeID); |
| if (!$query) { | $query->execute(); |
| databaseError($conn->errorInfo()); | if (!$query) { |
| return Array(); | databaseError($conn->errorInfo()); |
| } | return Array(); |
| return $query->fetch(PDO::FETCH_ASSOC); | } |
| } | return $query->fetch(PDO :: FETCH_ASSOC); |
| } | |
| function getRoutes() | |
| { | function getRouteByFullName($routeFullName) { |
| global $conn; | global $conn; |
| $query = "Select * from routes order by route_short_name;"; | $query = "Select * from routes where route_short_name||route_long_name = :routeFullName LIMIT 1"; |
| debug($query, "database"); | debug($query, "database"); |
| $query = $conn->prepare($query); | $query = $conn->prepare($query); |
| $query->execute(); | $query->bindParam(":routeFullName", $routeFullName); |
| if (!$query) { | $query->execute(); |
| databaseError($conn->errorInfo()); | if (!$query) { |
| return Array(); | databaseError($conn->errorInfo()); |
| } | return Array(); |
| return $query->fetchAll(); | } |
| } | return $query->fetch(PDO :: FETCH_ASSOC); |
| function getRoutesByNumber($routeNumber = "") | } |
| { | |
| global $conn; | function getRoutes() { |
| if ($routeNumber != "") { | global $conn; |
| $query = "Select distinct routes.route_id,routes.route_short_name,routes.route_long_name,service_id from routes join trips on trips.route_id = | $query = "Select * from routes order by route_short_name;"; |
| debug($query, "database"); | |
| $query = $conn->prepare($query); | |
| $query->execute(); | |
| if (!$query) { | |
| databaseError($conn->errorInfo()); | |
| return Array(); | |
| } | |
| return $query->fetchAll(); | |
| } | |
| function getRoutesByNumber($routeNumber = "") { | |
| global $conn; | |
| if ($routeNumber != "") { | |
| $query = "Select distinct routes.route_id,routes.route_short_name,routes.route_long_name,service_id from routes join trips on trips.route_id = | |
| routes.route_id join stop_times on stop_times.trip_id = trips.trip_id | routes.route_id join stop_times on stop_times.trip_id = trips.trip_id |
| where route_short_name = :routeNumber OR route_short_name LIKE :routeNumber2 order by route_short_name;"; | where route_short_name = :routeNumber OR route_short_name LIKE :routeNumber2 order by route_short_name;"; |
| } | } else { |
| else { | $query = "SELECT DISTINCT route_short_name from routes order by route_short_name"; |
| $query = "SELECT DISTINCT route_short_name from routes order by route_short_name"; | } |
| } | debug($query, "database"); |
| debug($query, "database"); | $query = $conn->prepare($query); |
| $query = $conn->prepare($query); | if ($routeNumber != "") { |
| if ($routeNumber != "") { | $query->bindParam(":routeNumber", $routeNumber); |
| $query->bindParam(":routeNumber", $routeNumber); | $routeNumber2 = "% " . $routeNumber; |
| $routeNumber2 = "% ".$routeNumber; | $query->bindParam(":routeNumber2", $routeNumber2); |
| $query->bindParam(":routeNumber2", $routeNumber2); | } |
| } | $query->execute(); |
| $query->execute(); | if (!$query) { |
| if (!$query) { | databaseError($conn->errorInfo()); |
| databaseError($conn->errorInfo()); | return Array(); |
| return Array(); | } |
| } | return $query->fetchAll(); |
| return $query->fetchAll(); | } |
| } | |
| function getRoutesByNumberSeries($routeNumberSeries = "") | function getRoutesByNumberSeries($routeNumberSeries = "") { |
| { | global $conn; |
| global $conn; | if (strlen($routeNumberSeries) == 1) { |
| if (strlen($routeNumberSeries) == 1) { | return getRoutesByNumber($routeNumberSeries); |
| return getRoutesByNumber($routeNumberSeries); | } |
| } | $seriesMin = substr($routeNumberSeries, 0, -1) . "0"; |
| $seriesMin = substr($routeNumberSeries, 0, -1) . "0"; | $seriesMax = substr($routeNumberSeries, 0, -1) . "9"; |
| $seriesMax = substr($routeNumberSeries, 0, -1) . "9"; | $query = "Select distinct routes.route_id,routes.route_short_name,routes.route_long_name,service_id from routes join trips on trips.route_id = |
| $query = "Select distinct routes.route_id,routes.route_short_name,routes.route_long_name,service_id from routes join trips on trips.route_id = | |
| routes.route_id join stop_times on stop_times.trip_id = trips.trip_id where to_number(route_short_name, 'FM999') between :seriesMin and :seriesMax OR route_short_name LIKE :routeNumberSeries order by route_short_name;"; | routes.route_id join stop_times on stop_times.trip_id = trips.trip_id where to_number(route_short_name, 'FM999') between :seriesMin and :seriesMax OR route_short_name LIKE :routeNumberSeries order by route_short_name;"; |
| debug($query, "database"); | debug($query, "database"); |
| $query = $conn->prepare($query); | $query = $conn->prepare($query); |
| $query->bindParam(":seriesMin", $seriesMin); | $query->bindParam(":seriesMin", $seriesMin); |
| $query->bindParam(":seriesMax", $seriesMax); | $query->bindParam(":seriesMax", $seriesMax); |
| $routeNumberSeries = "% ".substr($routeNumberSeries, 0, -1)."%"; | $routeNumberSeries = "% " . substr($routeNumberSeries, 0, -1) . "%"; |
| $query->bindParam(":routeNumberSeries", $routeNumberSeries); | $query->bindParam(":routeNumberSeries", $routeNumberSeries); |
| $query->execute(); | $query->execute(); |
| if (!$query) { | if (!$query) { |
| databaseError($conn->errorInfo()); | databaseError($conn->errorInfo()); |
| return Array(); | return Array(); |
| } | } |
| return $query->fetchAll(); | return $query->fetchAll(); |
| } | } |
| function getRouteNextTrip($routeID) | |
| { | function getRouteNextTrip($routeID) { |
| global $conn; | global $conn; |
| $query = "select * from routes join trips on trips.route_id = routes.route_id | $query = "select * from routes join trips on trips.route_id = routes.route_id |
| join stop_times on stop_times.trip_id = trips.trip_id where | join stop_times on stop_times.trip_id = trips.trip_id where |
| arrival_time > :currentTime and routes.route_id = :routeID order by | arrival_time > :currentTime and routes.route_id = :routeID order by |
| arrival_time limit 1"; | arrival_time limit 1"; |
| debug($query, "database"); | debug($query, "database"); |
| $query = $conn->prepare($query); | $query = $conn->prepare($query); |
| $query->bindParam(":currentTime", current_time()); | $query->bindParam(":currentTime", current_time()); |
| $query->bindParam(":routeID", $routeID); | $query->bindParam(":routeID", $routeID); |
| $query->execute(); | $query->execute(); |
| if (!$query) { | if (!$query) { |
| databaseError($conn->errorInfo()); | databaseError($conn->errorInfo()); |
| return Array(); | return Array(); |
| } | } |
| $r = $query->fetch(PDO::FETCH_ASSOC); | $r = $query->fetch(PDO :: FETCH_ASSOC); |
| // past last trip of the day special case | // past last trip of the day special case |
| if (sizeof($r) < 16) { | if (sizeof($r) < 16) { |
| $query = "select * from routes join trips on trips.route_id = routes.route_id | $query = "select * from routes join trips on trips.route_id = routes.route_id |
| join stop_times on stop_times.trip_id = trips.trip_id where routes.route_id = :routeID order by | join stop_times on stop_times.trip_id = trips.trip_id where routes.route_id = :routeID order by |
| arrival_time DESC limit 1"; | arrival_time DESC limit 1"; |
| debug($query, "database"); | debug($query, "database"); |
| $query = $conn->prepare($query); | $query = $conn->prepare($query); |
| $query->bindParam(":routeID", $routeID); | $query->bindParam(":routeID", $routeID); |
| $query->execute(); | $query->execute(); |
| if (!$query) { | if (!$query) { |
| databaseError($conn->errorInfo()); | databaseError($conn->errorInfo()); |
| return Array(); | return Array(); |
| } | } |
| $r = $query->fetch(PDO::FETCH_ASSOC); | $r = $query->fetch(PDO :: FETCH_ASSOC); |
| } | } |
| return $r; | return $r; |
| } | } |
| function getTimeInterpolatedRouteAtStop($routeID, $stop_id) | |
| { | function getTimeInterpolatedRouteAtStop($routeID, $stop_id) { |
| $nextTrip = getRouteNextTrip($routeID); | $nextTrip = getRouteNextTrip($routeID); |
| if ($nextTrip['trip_id']) { | if ($nextTrip['trip_id']) { |
| foreach (getTimeInterpolatedTrip($nextTrip['trip_id']) as $tripStop) { | foreach (getTimeInterpolatedTrip($nextTrip['trip_id']) as $tripStop) { |
| if ($tripStop['stop_id'] == $stop_id) return $tripStop; | if ($tripStop['stop_id'] == $stop_id) |
| } | return $tripStop; |
| } | } |
| return Array(); | } |
| } | return Array(); |
| function getRouteTrips($routeID) | } |
| { | |
| global $conn; | function getRouteTrips($routeID) { |
| $query = "select routes.route_id,trips.trip_id,service_id,arrival_time, stop_id, stop_sequence from routes join trips on trips.route_id = routes.route_id | global $conn; |
| $query = "select routes.route_id,trips.trip_id,service_id,arrival_time, stop_id, stop_sequence from routes join trips on trips.route_id = routes.route_id | |
| join stop_times on stop_times.trip_id = trips.trip_id where routes.route_id = :routeID and stop_sequence = '1' order by | join stop_times on stop_times.trip_id = trips.trip_id where routes.route_id = :routeID and stop_sequence = '1' order by |
| arrival_time "; | arrival_time "; |
| debug($query, "database"); | debug($query, "database"); |
| $query = $conn->prepare($query); | $query = $conn->prepare($query); |
| $query->bindParam(":routeID", $routeID); | $query->bindParam(":routeID", $routeID); |
| $query->execute(); | $query->execute(); |
| if (!$query) { | if (!$query) { |
| databaseError($conn->errorInfo()); | databaseError($conn->errorInfo()); |
| return Array(); | return Array(); |
| } | } |
| return $query->fetchAll(); | return $query->fetchAll(); |
| } | } |
| function getRoutesByDestination($destination = "", $service_period = "") | |
| { | function getRoutesByDestination($destination = "", $service_period = "") { |
| global $conn; | global $conn; |
| if ($service_period == "") $service_period = service_period(); | if ($service_period == "") |
| if ($destination != "") { | $service_period = service_period(); |
| $query = "SELECT DISTINCT trips.route_id,route_short_name,route_long_name, service_id | if ($destination != "") { |
| $query = "SELECT DISTINCT trips.route_id,route_short_name,route_long_name, service_id | |
| FROM stop_times join trips on trips.trip_id = | FROM stop_times join trips on trips.trip_id = |
| stop_times.trip_id join routes on trips.route_id = routes.route_id | stop_times.trip_id join routes on trips.route_id = routes.route_id |
| WHERE route_long_name = :destination AND service_id=:service_period order by route_short_name"; | WHERE route_long_name = :destination AND service_id=:service_period order by route_short_name"; |
| } | } else { |
| else { | $query = "SELECT DISTINCT route_long_name |
| $query = "SELECT DISTINCT route_long_name | |
| FROM stop_times join trips on trips.trip_id = | FROM stop_times join trips on trips.trip_id = |
| stop_times.trip_id join routes on trips.route_id = routes.route_id | stop_times.trip_id join routes on trips.route_id = routes.route_id |
| WHERE service_id= :service_period order by route_long_name"; | WHERE service_id= :service_period order by route_long_name"; |
| } | } |
| debug($query, "database"); | debug($query, "database"); |
| $query = $conn->prepare($query); | $query = $conn->prepare($query); |
| $query->bindParam(":service_period", $service_period); | $query->bindParam(":service_period", $service_period); |
| if ($destination != "") $query->bindParam(":destination", $destination); | if ($destination != "") |
| $query->execute(); | $query->bindParam(":destination", $destination); |
| if (!$query) { | $query->execute(); |
| databaseError($conn->errorInfo()); | if (!$query) { |
| return Array(); | databaseError($conn->errorInfo()); |
| } | return Array(); |
| return $query->fetchAll(); | } |
| } | return $query->fetchAll(); |
| function getRoutesBySuburb($suburb, $service_period = "") | } |
| { | |
| if ($service_period == "") $service_period = service_period(); | function getRoutesBySuburb($suburb, $service_period = "") { |
| global $conn; | if ($service_period == "") |
| $query = "SELECT DISTINCT service_id,trips.route_id,route_short_name,route_long_name | $service_period = service_period(); |
| global $conn; | |
| $query = "SELECT DISTINCT service_id,trips.route_id,route_short_name,route_long_name | |
| FROM stop_times join trips on trips.trip_id = stop_times.trip_id | FROM stop_times join trips on trips.trip_id = stop_times.trip_id |
| join routes on trips.route_id = routes.route_id | join routes on trips.route_id = routes.route_id |
| join stops on stops.stop_id = stop_times.stop_id | join stops on stops.stop_id = stop_times.stop_id |
| WHERE zone_id LIKE ':suburb AND service_id=:service_period ORDER BY route_short_name"; | WHERE zone_id LIKE ':suburb AND service_id=:service_period ORDER BY route_short_name"; |
| debug($query, "database"); | debug($query, "database"); |
| $query = $conn->prepare($query); | $query = $conn->prepare($query); |
| $query->bindParam(":service_period", $service_period); | $query->bindParam(":service_period", $service_period); |
| $suburb = "%" . $suburb . ";%"; | $suburb = "%" . $suburb . ";%"; |
| $query->bindParam(":suburb", $suburb); | $query->bindParam(":suburb", $suburb); |
| $query->execute(); | $query->execute(); |
| if (!$query) { | if (!$query) { |
| databaseError($conn->errorInfo()); | databaseError($conn->errorInfo()); |
| return Array(); | return Array(); |
| } | } |
| return $query->fetchAll(); | return $query->fetchAll(); |
| } | } |
| function getRoutesNearby($lat, $lng, $limit = "", $distance = 500) | |
| { | function getRoutesNearby($lat, $lng, $limit = "", $distance = 500) { |
| if ($service_period == "") $service_period = service_period(); | if ($service_period == "") |
| if ($limit != "") $limitSQL = " LIMIT :limit "; | $service_period = service_period(); |
| global $conn; | if ($limit != "") |
| $query = "SELECT service_id,trips.route_id,route_short_name,route_long_name,min(stops.stop_id) as stop_id, | $limitSQL = " LIMIT :limit "; |
| global $conn; | |
| $query = "SELECT service_id,trips.route_id,route_short_name,route_long_name,min(stops.stop_id) as stop_id, | |
| min(ST_Distance(position, ST_GeographyFromText('SRID=4326;POINT($lng $lat)'), FALSE)) as distance | min(ST_Distance(position, ST_GeographyFromText('SRID=4326;POINT($lng $lat)'), FALSE)) as distance |
| FROM stop_times | FROM stop_times |
| join trips on trips.trip_id = stop_times.trip_id | join trips on trips.trip_id = stop_times.trip_id |
| join routes on trips.route_id = routes.route_id | join routes on trips.route_id = routes.route_id |
| join stops on stops.stop_id = stop_times.stop_id | join stops on stops.stop_id = stop_times.stop_id |
| WHERE service_id=:service_period | WHERE service_id=:service_period |
| AND ST_DWithin(position, ST_GeographyFromText('SRID=4326;POINT($lng $lat)'), :distance, FALSE) | AND ST_DWithin(position, ST_GeographyFromText('SRID=4326;POINT($lng $lat)'), :distance, FALSE) |
| group by service_id,trips.route_id,route_short_name,route_long_name | group by service_id,trips.route_id,route_short_name,route_long_name |
| order by distance $limitSQL"; | order by distance $limitSQL"; |
| debug($query, "database"); | debug($query, "database"); |
| $query = $conn->prepare($query); | $query = $conn->prepare($query); |
| $query->bindParam(":service_period", $service_period); | $query->bindParam(":service_period", $service_period); |
| $query->bindParam(":distance", $distance); | $query->bindParam(":distance", $distance); |
| if ($limit != "") $query->bindParam(":limit", $limit); | if ($limit != "") |
| $query->execute(); | $query->bindParam(":limit", $limit); |
| if (!$query) { | $query->execute(); |
| databaseError($conn->errorInfo()); | if (!$query) { |
| return Array(); | databaseError($conn->errorInfo()); |
| } | return Array(); |
| return $query->fetchAll(); | } |
| } | return $query->fetchAll(); |
| } | |
| ?> | ?> |
| <?php | <?php |
| function getServiceOverride($date="") { | |
| global $conn; | /* |
| $query = "Select * from calendar_dates where date = :date and exception_type = '1' LIMIT 1"; | * Copyright 2010,2011 Alexander Sadleir |
| debug($query,"database"); | |
| $query = $conn->prepare($query); // Create a prepared statement | Licensed under the Apache License, Version 2.0 (the "License"); |
| $query->bindParam(":date", date("Ymd",($date != "" ? $date : time()))); | you may not use this file except in compliance with the License. |
| $query->execute(); | You may obtain a copy of the License at |
| if (!$query) { | |
| databaseError($conn->errorInfo()); | http://www.apache.org/licenses/LICENSE-2.0 |
| return Array(); | |
| } | Unless required by applicable law or agreed to in writing, software |
| return $query->fetch(PDO::FETCH_ASSOC); | distributed under the License is distributed on an "AS IS" BASIS, |
| WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. | |
| See the License for the specific language governing permissions and | |
| limitations under the License. | |
| */ | |
| function getServiceOverride($date = "") { | |
| global $conn; | |
| $query = "Select * from calendar_dates where date = :date and exception_type = '1' LIMIT 1"; | |
| // debug($query,"database"); | |
| $query = $conn->prepare($query); // Create a prepared statement | |
| $query->bindParam(":date", date("Ymd", ($date != "" ? $date : time()))); | |
| $query->execute(); | |
| if (!$query) { | |
| databaseError($conn->errorInfo()); | |
| return Array(); | |
| } | |
| return $query->fetch(PDO :: FETCH_ASSOC); | |
| } | } |
| function getServiceAlert($alertID) { | |
| global $conn; | |
| $query = "SELECT id,extract('epoch' from start) as start, extract('epoch' from \"end\") as \"end\",cause,effect,header,description,url from servicealerts_alerts where id = :servicealert_id"; | |
| debug($query, "database"); | |
| $query = $conn->prepare($query); | |
| $query->bindParam(":servicealert_id", $alertID); | |
| $query->execute(); | |
| if (!$query) { | |
| databaseError($conn->errorInfo()); | |
| return Array(); | |
| } | |
| return $query->fetch(PDO :: FETCH_ASSOC); | |
| } | |
| function updateServiceAlert($alertID, $start, $end, $header, $description, $url) { | |
| global $conn; | |
| $query = 'update servicealerts_alerts set start=:start, "end"=:end, header=:header, description=:description, url=:url where id = :servicealert_id'; | |
| debug($query, "database"); | |
| $query = $conn->prepare($query); | |
| $query->bindParam(":servicealert_id", $alertID); | |
| $query->bindParam(":start", $start); | |
| $query->bindParam(":end", $end); | |
| $query->bindParam(":header", $header); | |
| $query->bindParam(":description", $description); | |
| $query->bindParam(":url", $url); | |
| $query->execute(); | |
| print_r($conn->errorInfo()); | |
| if (!$query) { | |
| databaseError($conn->errorInfo()); | |
| return Array(); | |
| } | |
| return $query->fetch(PDO :: FETCH_ASSOC); | |
| } | |
| function addServiceAlert($start, $end, $header, $description, $url) { | |
| global $conn; | |
| $query = 'INSERT INTO servicealerts_alerts (start, "end", header, description, url) VALUES (:start, :end, :header, :description, :url) '; | |
| debug($query, "database"); | |
| $query = $conn->prepare($query); | |
| $query->bindParam(":start", $start); | |
| $query->bindParam(":end", $end); | |
| $query->bindParam(":header", $header); | |
| $query->bindParam(":description", $description); | |
| $query->bindParam(":url", $url); | |
| $query->execute(); | |
| print_r($conn->errorInfo()); | |
| if (!$query) { | |
| databaseError($conn->errorInfo()); | |
| return Array(); | |
| } | |
| return $query->fetch(PDO :: FETCH_ASSOC); | |
| } | |
| function getCurrentAlerts() { | |
| global $conn; | |
| $query = "SELECT id,extract('epoch' from start) as start, extract('epoch' from \"end\") as \"end\",cause,effect,header,description,url from servicealerts_alerts where NOW() > start and NOW() < \"end\""; | |
| // debug($query, "database"); | |
| $query = $conn->prepare($query); | |
| $query->execute(); | |
| if (!$query) { | |
| databaseError($conn->errorInfo()); | |
| return Array(); | |
| } | |
| return $query->fetchAll(); | |
| } | |
| function getFutureAlerts() { | |
| global $conn; | |
| $query = "SELECT id,extract('epoch' from start) as start, extract('epoch' from \"end\") as \"end\",cause,effect,header,description,url from servicealerts_alerts where NOW() > start or NOW() < \"end\""; | |
| // debug($query, "database"); | |
| $query = $conn->prepare($query); | |
| $query->execute(); | |
| if (!$query) { | |
| databaseError($conn->errorInfo()); | |
| return Array(); | |
| } | |
| return $query->fetchAll(); | |
| } | |
| function getInformedAlerts($id, $filter_class, $filter_id) { | |
| global $conn; | |
| $query = "SELECT * from servicealerts_informed where servicealert_id = :servicealert_id"; | |
| if ($filter_class != "") { | |
| $query .= " AND informed_class = :informed_class "; | |
| } | |
| if ($filter_id != "") { | |
| $query .= " AND informed_id = :informed_id "; | |
| } | |
| // debug($query, "database"); | |
| $query = $conn->prepare($query); | |
| if ($filter_class != "") { | |
| $query->bindParam(":informed_class", $filter_class); | |
| } | |
| if ($filter_id != "") { | |
| $query->bindParam(":informed_id", $filter_id); | |
| } | |
| $query->bindParam(":servicealert_id", $id); | |
| $query->execute(); | |
| if (!$query) { | |
| databaseError($conn->errorInfo()); | |
| return Array(); | |
| } | |
| return $query->fetchAll(); | |
| } | |
| function deleteInformedAlert($serviceAlertID, $class, $id) { | |
| global $conn; | |
| $query = 'DELETE from servicealerts_informed where servicealert_id = :servicealert_id and informed_class = :informed_class AND informed_id = :informed_id'; | |
| debug($query, "database"); | |
| $query = $conn->prepare($query); | |
| $query->bindParam(":servicealert_id", $serviceAlertID); | |
| $query->bindParam(":informed_class", $class); | |
| $query->bindParam(":informed_id", $id); | |
| $query->execute(); | |
| print_r($conn->errorInfo()); | |
| if (!$query) { | |
| databaseError($conn->errorInfo()); | |
| return Array(); | |
| } | |
| return null; | |
| } | |
| function addInformedAlert($serviceAlertID, $class, $id, $action) { | |
| global $conn; | |
| $query = 'INSERT INTO servicealerts_informed (servicealert_id , informed_class , informed_id) VALUES(:servicealert_id ,:informed_class, :informed_id)'; | |
| debug($query, "database"); | |
| $query = $conn->prepare($query); | |
| $query->bindParam(":servicealert_id", $serviceAlertID); | |
| $query->bindParam(":informed_class", $class); | |
| $query->bindParam(":informed_id", $id); | |
| $query->execute(); | |
| print_r($conn->errorInfo()); | |
| if (!$query) { | |
| databaseError($conn->errorInfo()); | |
| return Array(); | |
| } | |
| return null; | |
| } | |
| ?> | ?> |
| <?php | <?php |
| function getStop($stopID) | |
| { | /* |
| global $conn; | * Copyright 2010,2011 Alexander Sadleir |
| $query = "Select * from stops where stop_id = :stopID LIMIT 1"; | |
| debug($query, "database"); | Licensed under the Apache License, Version 2.0 (the "License"); |
| $query = $conn->prepare($query); | you may not use this file except in compliance with the License. |
| $query->bindParam(":stopID", $stopID); | You may obtain a copy of the License at |
| $query->execute(); | |
| if (!$query) { | http://www.apache.org/licenses/LICENSE-2.0 |
| databaseError($conn->errorInfo()); | |
| return Array(); | Unless required by applicable law or agreed to in writing, software |
| } | distributed under the License is distributed on an "AS IS" BASIS, |
| return $query->fetch(PDO::FETCH_ASSOC); | WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. |
| } | See the License for the specific language governing permissions and |
| function getStops($timingPointsOnly = false, $firstLetter = "", $startsWith = "") | limitations under the License. |
| { | */ |
| global $conn; | |
| $conditions = Array(); | function getStop($stopID) { |
| if ($timingPointsOnly) $conditions[] = "substr(stop_code,1,2) != 'Wj'"; | global $conn; |
| if ($firstLetter != "") $conditions[] = "substr(stop_name,1,1) = :firstLetter"; | $query = "Select * from stops where stop_id = :stopID LIMIT 1"; |
| if ($startsWith != "") $conditions[] = "stop_name like :startsWith"; | debug($query, "database"); |
| $query = "Select * from stops"; | $query = $conn->prepare($query); |
| if (sizeof($conditions) > 0) { | $query->bindParam(":stopID", $stopID); |
| if (sizeof($conditions) > 1) { | $query->execute(); |
| $query.= " Where " . implode(" AND ", $conditions) . " "; | if (!$query) { |
| } | databaseError($conn->errorInfo()); |
| else { | return Array(); |
| $query.= " Where " . $conditions[0] . " "; | } |
| } | return $query->fetch(PDO :: FETCH_ASSOC); |
| } | } |
| $query.= " order by stop_name;"; | |
| $query = $conn->prepare($query); | function getStops($timingPointsOnly = false, $firstLetter = "", $startsWith = "") { |
| if ($firstLetter != "") $query->bindParam(":firstLetter", $firstLetter); | global $conn; |
| $conditions = Array(); | |
| if ($startsWith != "") { | if ($timingPointsOnly) |
| $startsWith = $startsWith."%"; | $conditions[] = "substr(stop_code,1,2) != 'Wj'"; |
| $query->bindParam(":startsWith", $startsWith); | if ($firstLetter != "") |
| $conditions[] = "substr(stop_name,1,1) = :firstLetter"; | |
| if ($startsWith != "") | |
| $conditions[] = "stop_name like :startsWith"; | |
| $query = "Select * from stops"; | |
| if (sizeof($conditions) > 0) { | |
| if (sizeof($conditions) > 1) { | |
| $query .= " Where " . implode(" AND ", $conditions) . " "; | |
| } else { | |
| $query .= " Where " . $conditions[0] . " "; | |
| } | } |
| $query->execute(); | } |
| if (!$query) { | $query .= " order by stop_name;"; |
| databaseError($conn->errorInfo()); | $query = $conn->prepare($query); |
| return Array(); | if ($firstLetter != "") |
| } | $query->bindParam(":firstLetter", $firstLetter); |
| return $query->fetchAll(); | |
| } | if ($startsWith != "") { |
| function getNearbyStops($lat, $lng, $limit = "", $distance = 1000) | $startsWith = $startsWith . "%"; |
| { | $query->bindParam(":startsWith", $startsWith); |
| if ($lat == null || $lng == null) return Array(); | } |
| if ($limit != "") $limitSQL = " LIMIT :limit "; | $query->execute(); |
| global $conn; | if (!$query) { |
| $query = "Select *, ST_Distance(position, ST_GeographyFromText('SRID=4326;POINT($lng $lat)'), FALSE) as distance | databaseError($conn->errorInfo()); |
| return Array(); | |
| } | |
| return $query->fetchAll(); | |
| } | |
| function getNearbyStops($lat, $lng, $limit = "", $distance = 1000) { | |
| if ($lat == null || $lng == null) | |
| return Array(); | |
| if ($limit != "") | |
| $limitSQL = " LIMIT :limit "; | |
| global $conn; | |
| $query = "Select *, ST_Distance(position, ST_GeographyFromText('SRID=4326;POINT($lng $lat)'), FALSE) as distance | |
| from stops WHERE ST_DWithin(position, ST_GeographyFromText('SRID=4326;POINT($lng $lat)'), :distance, FALSE) | from stops WHERE ST_DWithin(position, ST_GeographyFromText('SRID=4326;POINT($lng $lat)'), :distance, FALSE) |
| order by distance $limitSQL;"; | order by distance $limitSQL;"; |
| debug($query, "database"); | debug($query, "database"); |
| $query = $conn->prepare($query); | $query = $conn->prepare($query); |
| $query->bindParam(":distance", $distance); | $query->bindParam(":distance", $distance); |
| $query->bindParam(":limit", $limit); | $query->bindParam(":limit", $limit); |
| $query->execute(); | $query->execute(); |
| if (!$query) { | if (!$query) { |
| databaseError($conn->errorInfo()); | databaseError($conn->errorInfo()); |
| return Array(); | return Array(); |
| } | } |
| return $query->fetchAll(); | return $query->fetchAll(); |
| } | } |
| function getStopsBySuburb($suburb) | |
| { | function getStopsByName($name) { |
| global $conn; | global $conn; |
| $query = "Select * from stops where zone_id LIKE :suburb order by stop_name;"; | $query = "Select * from stops where stop_name LIKE :name;"; |
| debug($query, "database"); | debug($query, "database"); |
| $query = $conn->prepare($query); | $query = $conn->prepare($query); |
| $suburb = "%" . $suburb . ";%"; | $name = "%" . $name . ";%"; |
| $query->bindParam(":suburb", $suburb); | $query->bindParam(":name", $name); |
| $query->execute(); | $query->execute(); |
| if (!$query) { | if (!$query) { |
| databaseError($conn->errorInfo()); | databaseError($conn->errorInfo()); |
| return Array(); | return Array(); |
| } | } |
| return $query->fetchAll(); | return $query->fetchAll(); |
| } | } |
| function getStopsByStopCode($stop_code,$startsWith = "") | |
| { | function getStopsBySuburb($suburb) { |
| global $conn; | global $conn; |
| $query = "Select * from stops where stop_code = :stop_code OR stop_code LIKE :stop_code2"; | $query = "Select * from stops where zone_id LIKE :suburb order by stop_name;"; |
| if ($startsWith != "") $query .= " AND stop_name like :startsWith"; | debug($query, "database"); |
| $query = $conn->prepare($query); | |
| debug($query, "database"); | $suburb = "%" . $suburb . ";%"; |
| $query = $conn->prepare($query); | $query->bindParam(":suburb", $suburb); |
| $query->execute(); | |
| $query->bindParam(":stop_code", $stop_code); | if (!$query) { |
| $stop_code2 = $stop_code . "%"; | databaseError($conn->errorInfo()); |
| $query->bindParam(":stop_code2", $stop_code2); | return Array(); |
| if ($startsWith != "") { | } |
| $startsWith = $startsWith."%"; | return $query->fetchAll(); |
| $query->bindParam(":startsWith", $startsWith); | } |
| } | |
| $query->execute(); | function getStopsByStopCode($stop_code, $startsWith = "") { |
| if (!$query) { | global $conn; |
| databaseError($conn->errorInfo()); | $query = "Select * from stops where (stop_code = :stop_code OR stop_code LIKE :stop_code2)"; |
| return Array(); | if ($startsWith != "") |
| } | $query .= " AND stop_name like :startsWith"; |
| return $query->fetchAll(); | |
| } | debug($query, "database"); |
| function getStopRoutes($stopID, $service_period) | $query = $conn->prepare($query); |
| { | |
| if ($service_period == "") $service_period = service_period(); | $query->bindParam(":stop_code", $stop_code); |
| global $conn; | $stop_code2 = $stop_code . "%"; |
| $query = "SELECT service_id,trips.route_id,route_short_name,route_long_name | $query->bindParam(":stop_code2", $stop_code2); |
| if ($startsWith != "") { | |
| $startsWith = $startsWith . "%"; | |
| $query->bindParam(":startsWith", $startsWith); | |
| } | |
| $query->execute(); | |
| if (!$query) { | |
| databaseError($conn->errorInfo()); | |
| return Array(); | |
| } | |
| return $query->fetchAll(); | |
| } | |
| function getStopRoutes($stopID, $service_period) { | |
| if ($service_period == "") | |
| $service_period = service_period(); | |
| global $conn; | |
| $query = "SELECT distinct service_id,trips.route_id,route_short_name,route_long_name | |
| FROM stop_times join trips on trips.trip_id = | FROM stop_times join trips on trips.trip_id = |
| stop_times.trip_id join routes on trips.route_id = routes.route_id WHERE stop_id = :stopID AND service_id=:service_period"; | stop_times.trip_id join routes on trips.route_id = routes.route_id WHERE stop_id = :stopID AND service_id=:service_period"; |
| debug($query, "database"); | debug($query, "database"); |
| $query = $conn->prepare($query); | $query = $conn->prepare($query); |
| $query->bindParam(":service_period", $service_period); | $query->bindParam(":service_period", $service_period); |
| $query->bindParam(":stopID", $stopID); | $query->bindParam(":stopID", $stopID); |
| $query->execute(); | $query->execute(); |
| if (!$query) { | if (!$query) { |
| databaseError($conn->errorInfo()); | databaseError($conn->errorInfo()); |
| return Array(); | return Array(); |
| } | } |
| return $query->fetchAll(); | return $query->fetchAll(); |
| } | } |
| function getStopTrips($stopID, $service_period = "", $afterTime = "", $limit = "") | |
| { | function getStopTrips($stopID, $service_period = "", $afterTime = "", $limit = "") { |
| if ($service_period == "") $service_period = service_period(); | if ($service_period == "") |
| if ($limit != "") $limitSQL = " LIMIT :limit "; | $service_period = service_period(); |
| global $conn; | if ($limit != "") |
| if ($afterTime != "") { | $limitSQL = " LIMIT :limit "; |
| $query = " SELECT stop_times.trip_id,stop_times.arrival_time,stop_times.stop_id,stop_sequence,service_id,trips.route_id,route_short_name,route_long_name, end_times.arrival_time as end_time | global $conn; |
| if ($afterTime != "") { | |
| $query = " SELECT stop_times.trip_id,stop_times.arrival_time,stop_times.stop_id,stop_sequence,service_id,trips.route_id,route_short_name,route_long_name, end_times.arrival_time as end_time | |
| FROM stop_times | FROM stop_times |
| join trips on trips.trip_id = | join trips on trips.trip_id = |
| stop_times.trip_id | stop_times.trip_id |
| join routes on trips.route_id = routes.route_id , (SELECT trip_id,max(arrival_time) as arrival_time from stop_times | join routes on trips.route_id = routes.route_id , (SELECT trip_id,max(arrival_time) as arrival_time from stop_times |
| WHERE stop_times.arrival_time IS NOT NULL group by trip_id) as end_times | WHERE stop_times.arrival_time IS NOT NULL group by trip_id) as end_times |
| WHERE stop_times.stop_id = :stopID | WHERE stop_times.stop_id = :stopID |
| AND stop_times.trip_id = end_times.trip_id | AND stop_times.trip_id = end_times.trip_id |
| AND service_id=:service_period | AND service_id=:service_period |
| AND end_times.arrival_time > :afterTime | AND end_times.arrival_time > :afterTime |
| ORDER BY end_time $limitSQL"; | ORDER BY end_time $limitSQL"; |
| } | } else { |
| else { | $query = "SELECT stop_times.trip_id,arrival_time,stop_times.stop_id,stop_sequence,service_id,trips.route_id,route_short_name,route_long_name |
| $query = "SELECT stop_times.trip_id,arrival_time,stop_times.stop_id,stop_sequence,service_id,trips.route_id,route_short_name,route_long_name | |
| FROM stop_times | FROM stop_times |
| join trips on trips.trip_id = | join trips on trips.trip_id = |
| stop_times.trip_id | stop_times.trip_id |
| join routes on trips.route_id = routes.route_id | join routes on trips.route_id = routes.route_id |
| WHERE stop_times.stop_id = :stopID | WHERE stop_times.stop_id = :stopID |
| AND service_id=:service_period | AND service_id=:service_period |
| ORDER BY arrival_time $limitSQL"; | ORDER BY arrival_time $limitSQL"; |
| } | } |
| debug($query, "database"); | debug($query, "database"); |
| $query = $conn->prepare($query); | $query = $conn->prepare($query); |
| $query->bindParam(":service_period", $service_period); | $query->bindParam(":service_period", $service_period); |
| $query->bindParam(":stopID", $stopID); | $query->bindParam(":stopID", $stopID); |
| if ($limit != "") $query->bindParam(":limit", $limit); | if ($limit != "") |
| if ($afterTime != "") $query->bindParam(":afterTime", $afterTime); | $query->bindParam(":limit", $limit); |
| $query->execute(); | if ($afterTime != "") |
| if (!$query) { | $query->bindParam(":afterTime", $afterTime); |
| databaseError($conn->errorInfo()); | $query->execute(); |
| return Array(); | if (!$query) { |
| } | databaseError($conn->errorInfo()); |
| return $query->fetchAll(); | return Array(); |
| } | } |
| function getStopTripsWithTimes($stopID, $time = "", $service_period = "", $time_range = "", $limit = "") | return $query->fetchAll(); |
| { | } |
| if ($service_period == "") $service_period = service_period(); | |
| if ($time_range == "") $time_range = (24 * 60 * 60); | function getStopTripsWithTimes($stopID, $time = "", $service_period = "", $time_range = "", $limit = "") { |
| if ($time == "") $time = current_time(); | if ($service_period == "") |
| if ($limit == "") $limit = 10; | $service_period = service_period(); |
| $trips = getStopTrips($stopID, $service_period, $time); | if ($time_range == "") |
| $timedTrips = Array(); | $time_range = (24 * 60 * 60); |
| if ($trips && sizeof($trips) > 0) { | if ($time == "") |
| foreach ($trips as $trip) { | $time = current_time(); |
| if ($trip['arrival_time'] != "") { | if ($limit == "") |
| if (strtotime($trip['arrival_time']) > strtotime($time) and strtotime($trip['arrival_time']) < (strtotime($time) + $time_range)) { | $limit = 10; |
| $timedTrips[] = $trip; | $trips = getStopTrips($stopID, $service_period, $time); |
| } | $timedTrips = Array(); |
| } | if ($trips && sizeof($trips) > 0) { |
| else { | foreach ($trips as $trip) { |
| $timedTrip = getTimeInterpolatedTripAtStop($trip['trip_id'], $trip['stop_sequence']); | if ($trip['arrival_time'] != "") { |
| if ($timedTrip['arrival_time'] > $time and strtotime($timedTrip['arrival_time']) < (strtotime($time) + $time_range)) { | if (strtotime($trip['arrival_time']) > strtotime($time) and strtotime($trip['arrival_time']) < (strtotime($time) + $time_range)) { |
| $timedTrips[] = $timedTrip; | $timedTrips[] = $trip; |
| } | } |
| } | } else { |
| if (sizeof($timedTrips) > $limit) break; | $timedTrip = getTimeInterpolatedTripAtStop($trip['trip_id'], $trip['stop_sequence']); |
| } | if ($timedTrip['arrival_time'] > $time and strtotime($timedTrip['arrival_time']) < (strtotime($time) + $time_range)) { |
| sktimesort($timedTrips, "arrival_time", true); | $timedTrips[] = $timedTrip; |
| } | |
| } | |
| if (sizeof($timedTrips) > $limit) | |
| break; | |
| } | } |
| return $timedTrips; | sktimesort($timedTrips, "arrival_time", true); |
| } | } |
| return $timedTrips; | |
| } | |
| ?> | ?> |
| <?php | <?php |
| function getTrip($tripID) | |
| { | /* |
| global $conn; | * Copyright 2010,2011 Alexander Sadleir |
| $query = "Select * from trips | |
| Licensed under the Apache License, Version 2.0 (the "License"); | |
| you may not use this file except in compliance with the License. | |
| You may obtain a copy of the License at | |
| http://www.apache.org/licenses/LICENSE-2.0 | |
| Unless required by applicable law or agreed to in writing, software | |
| distributed under the License is distributed on an "AS IS" BASIS, | |
| WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. | |
| See the License for the specific language governing permissions and | |
| limitations under the License. | |
| */ | |
| function getTrip($tripID) { | |
| global $conn; | |
| $query = "Select * from trips | |
| join routes on trips.route_id = routes.route_id | join routes on trips.route_id = routes.route_id |
| where trip_id = :tripID | where trip_id = :tripID |
| LIMIT 1"; | LIMIT 1"; |
| debug($query, "database"); | debug($query, "database"); |
| $query = $conn->prepare($query); | $query = $conn->prepare($query); |
| $query->bindParam(":tripID", $tripID); | $query->bindParam(":tripID", $tripID); |
| $query->execute(); | $query->execute(); |
| if (!$query) { | if (!$query) { |
| databaseError($conn->errorInfo()); | databaseError($conn->errorInfo()); |
| return Array(); | return Array(); |
| } | } |
| return $query->fetch(PDO::FETCH_ASSOC); | return $query->fetch(PDO :: FETCH_ASSOC); |
| } | } |
| function getTripShape($tripID) | |
| { | function getTripShape($tripID) { |
| global $conn; | global $conn; |
| $query = "SELECT ST_AsKML(ST_MakeLine(geometry(a.position))) as the_route | $query = "SELECT ST_AsKML(ST_MakeLine(geometry(a.position))) as the_route |
| FROM (SELECT position, | FROM (SELECT position, |
| stop_sequence, trips.trip_id | stop_sequence, trips.trip_id |
| FROM stop_times | FROM stop_times |
| join trips on trips.trip_id = stop_times.trip_id | join trips on trips.trip_id = stop_times.trip_id |
| join stops on stops.stop_id = stop_times.stop_id | join stops on stops.stop_id = stop_times.stop_id |
| WHERE trips.trip_id = :tripID ORDER BY stop_sequence) as a group by a.trip_id"; | WHERE trips.trip_id = :tripID ORDER BY stop_sequence) as a group by a.trip_id"; |
| debug($query, "database"); | debug($query, "database"); |
| $query = $conn->prepare($query); | $query = $conn->prepare($query); |
| $query->bindParam(":tripID", $tripID); | $query->bindParam(":tripID", $tripID); |
| $query->execute(); | $query->execute(); |
| if (!$query) { | if (!$query) { |
| databaseError($conn->errorInfo()); | databaseError($conn->errorInfo()); |
| return Array(); | return Array(); |
| } | } |
| return $query->fetchColumn(0); | return $query->fetchColumn(0); |
| } | } |
| function getTimeInterpolatedTrip($tripID, $range = "") | |
| { | function getTimeInterpolatedTrip($tripID, $range = "") { |
| global $conn; | global $conn; |
| $query = "SELECT stop_times.trip_id,arrival_time,stop_times.stop_id,stop_lat,stop_lon,stop_name,stop_code, | $query = "SELECT stop_times.trip_id,arrival_time,stop_times.stop_id,stop_lat,stop_lon,stop_name,stop_code, |
| stop_sequence,service_id,trips.route_id,route_short_name,route_long_name | stop_sequence,service_id,trips.route_id,route_short_name,route_long_name |
| FROM stop_times | FROM stop_times |
| join trips on trips.trip_id = stop_times.trip_id | join trips on trips.trip_id = stop_times.trip_id |
| join routes on trips.route_id = routes.route_id | join routes on trips.route_id = routes.route_id |
| join stops on stops.stop_id = stop_times.stop_id | join stops on stops.stop_id = stop_times.stop_id |
| WHERE trips.trip_id = :tripID $range ORDER BY stop_sequence"; | WHERE trips.trip_id = :tripID $range ORDER BY stop_sequence"; |
| debug($query, "database"); | debug($query, "database"); |
| $query = $conn->prepare($query); | $query = $conn->prepare($query); |
| $query->bindParam(":tripID", $tripID); | $query->bindParam(":tripID", $tripID); |
| $query->execute(); | $query->execute(); |
| if (!$query) { | if (!$query) { |
| databaseError($conn->errorInfo()); | databaseError($conn->errorInfo()); |
| return Array(); | return Array(); |
| } | } |
| $stopTimes = $query->fetchAll(); | $stopTimes = $query->fetchAll(); |
| $cur_timepoint = Array(); | $cur_timepoint = Array(); |
| $next_timepoint = Array(); | $next_timepoint = Array(); |
| $distance_between_timepoints = 0.0; | $distance_between_timepoints = 0.0; |
| $distance_traveled_between_timepoints = 0.0; | $distance_traveled_between_timepoints = 0.0; |
| $rv = Array(); | $rv = Array(); |
| foreach ($stopTimes as $i => $stopTime) { | foreach ($stopTimes as $i => $stopTime) { |
| if ($stopTime['arrival_time'] != "") { | if ($stopTime['arrival_time'] != "") { |
| // is timepoint | // is timepoint |
| $cur_timepoint = $stopTime; | $cur_timepoint = $stopTime; |
| $distance_between_timepoints = 0.0; | $distance_between_timepoints = 0.0; |
| $distance_traveled_between_timepoints = 0.0; | $distance_traveled_between_timepoints = 0.0; |
| if ($i + 1 < sizeof($stopTimes)) { | if ($i + 1 < sizeof($stopTimes)) { |
| $k = $i + 1; | $k = $i + 1; |
| $distance_between_timepoints+= distance($stopTimes[$k - 1]["stop_lat"], $stopTimes[$k - 1]["stop_lon"], $stopTimes[$k]["stop_lat"], $stopTimes[$k]["stop_lon"]); | $distance_between_timepoints += distance($stopTimes[$k - 1]["stop_lat"], $stopTimes[$k - 1]["stop_lon"], $stopTimes[$k]["stop_lat"], $stopTimes[$k]["stop_lon"]); |
| while ($stopTimes[$k]["arrival_time"] == "" && $k + 1 < sizeof($stopTimes)) { | while ($stopTimes[$k]["arrival_time"] == "" && $k + 1 < sizeof($stopTimes)) { |
| $k+= 1; | $k += 1; |
| //echo "k".$k; | // echo "k".$k; |
| $distance_between_timepoints+= distance($stopTimes[$k - 1]["stop_lat"], $stopTimes[$k - 1]["stop_lon"], $stopTimes[$k]["stop_lat"], $stopTimes[$k]["stop_lon"]); | $distance_between_timepoints += distance($stopTimes[$k - 1]["stop_lat"], $stopTimes[$k - 1]["stop_lon"], $stopTimes[$k]["stop_lat"], $stopTimes[$k]["stop_lon"]); |
| } | } |
| $next_timepoint = $stopTimes[$k]; | $next_timepoint = $stopTimes[$k]; |
| $rv[] = $stopTime; | } |
| } | $rv[] = $stopTime; |
| } | } else { |
| else { | // is untimed point |
| // is untimed point | // echo "i".$i; |
| //echo "i".$i; | $distance_traveled_between_timepoints += distance($stopTimes[$i - 1]["stop_lat"], $stopTimes[$i - 1]["stop_lon"], $stopTimes[$i]["stop_lat"], $stopTimes[$i]["stop_lon"]); |
| $distance_traveled_between_timepoints+= distance($stopTimes[$i - 1]["stop_lat"], $stopTimes[$i - 1]["stop_lon"], $stopTimes[$i]["stop_lat"], $stopTimes[$i]["stop_lon"]); | // echo "$distance_traveled_between_timepoints / $distance_between_timepoints<br>"; |
| //echo "$distance_traveled_between_timepoints / $distance_between_timepoints<br>"; | $distance_percent = $distance_traveled_between_timepoints / $distance_between_timepoints; |
| $distance_percent = $distance_traveled_between_timepoints / $distance_between_timepoints; | if ($next_timepoint["arrival_time"] != "") { |
| if ($next_timepoint["arrival_time"] != "") { | $total_time = strtotime($next_timepoint["arrival_time"]) - strtotime($cur_timepoint["arrival_time"]); |
| $total_time = strtotime($next_timepoint["arrival_time"]) - strtotime($cur_timepoint["arrival_time"]); | // echo strtotime($next_timepoint["arrival_time"])." - ".strtotime($cur_timepoint["arrival_time"])."<br>"; |
| //echo strtotime($next_timepoint["arrival_time"])." - ".strtotime($cur_timepoint["arrival_time"])."<br>"; | $time_estimate = ($distance_percent * $total_time) + strtotime($cur_timepoint["arrival_time"]); |
| $time_estimate = ($distance_percent * $total_time) + strtotime($cur_timepoint["arrival_time"]); | $stopTime["arrival_time"] = date("H:i:s", $time_estimate); |
| $stopTime["arrival_time"] = date("H:i:s", $time_estimate); | } else { |
| } | $stopTime["arrival_time"] = $cur_timepoint["arrival_time"]; |
| else { | } |
| $stopTime["arrival_time"] = $cur_timepoint["arrival_time"]; | $rv[] = $stopTime; |
| } | } |
| $rv[] = $stopTime; | } |
| //var_dump($rv); | // var_dump($rv); |
| return $rv; | |
| } | } |
| } | |
| return $rv; | function getTripPreviousTimePoint($tripID, $stop_sequence) { |
| } | global $conn; |
| function getTripPreviousTimePoint($tripID, $stop_sequence) | $query = " SELECT trip_id,stop_id, |
| { | |
| global $conn; | |
| $query = " SELECT trip_id,stop_id, | |
| stop_sequence | stop_sequence |
| FROM stop_times | FROM stop_times |
| WHERE trip_id = :tripID and stop_sequence < :stop_sequence | WHERE trip_id = :tripID and stop_sequence < :stop_sequence |
| and stop_times.arrival_time IS NOT NULL ORDER BY stop_sequence DESC LIMIT 1"; | and stop_times.arrival_time IS NOT NULL ORDER BY stop_sequence DESC LIMIT 1"; |
| debug($query, "database"); | debug($query, "database"); |
| $query = $conn->prepare($query); | $query = $conn->prepare($query); |
| $query->bindParam(":tripID", $tripID); | $query->bindParam(":tripID", $tripID); |
| $query->bindParam(":stop_sequence", $stop_sequence); | $query->bindParam(":stop_sequence", $stop_sequence); |
| $query->execute(); | $query->execute(); |
| if (!$query) { | if (!$query) { |
| databaseError($conn->errorInfo()); | databaseError($conn->errorInfo()); |
| return Array(); | return Array(); |
| } | } |
| return $query->fetch(PDO::FETCH_ASSOC); | return $query->fetch(PDO :: FETCH_ASSOC); |
| } | } |
| function getTripNextTimePoint($tripID, $stop_sequence) | |
| { | function getTripNextTimePoint($tripID, $stop_sequence) { |
| global $conn; | global $conn; |
| $query = " SELECT trip_id,stop_id, | $query = " SELECT trip_id,stop_id, |
| stop_sequence | stop_sequence |
| FROM stop_times | FROM stop_times |
| WHERE trip_id = :tripID and stop_sequence > :stop_sequence | WHERE trip_id = :tripID and stop_sequence > :stop_sequence |
| and stop_times.arrival_time IS NOT NULL ORDER BY stop_sequence LIMIT 1"; | and stop_times.arrival_time IS NOT NULL ORDER BY stop_sequence LIMIT 1"; |
| debug($query, "database"); | debug($query, "database"); |
| $query = $conn->prepare($query); | $query = $conn->prepare($query); |
| $query->bindParam(":tripID", $tripID); | $query->bindParam(":tripID", $tripID); |
| $query->bindParam(":stop_sequence", $stop_sequence); | $query->bindParam(":stop_sequence", $stop_sequence); |
| $query->execute(); | $query->execute(); |
| if (!$query) { | if (!$query) { |
| databaseError($conn->errorInfo()); | databaseError($conn->errorInfo()); |
| return Array(); | return Array(); |
| } | } |
| return $query->fetch(PDO::FETCH_ASSOC); | return $query->fetch(PDO :: FETCH_ASSOC); |
| } | } |
| function getTimeInterpolatedTripAtStop($tripID, $stop_sequence) | |
| { | function getTimeInterpolatedTripAtStop($tripID, $stop_sequence) { |
| global $conn; | global $conn; |
| // limit interpolation to between nearest actual points. | // limit interpolation to between nearest actual points. |
| $prevTimePoint = getTripPreviousTimePoint($tripID, $stop_sequence); | $prevTimePoint = getTripPreviousTimePoint($tripID, $stop_sequence); |
| $nextTimePoint = getTripNextTimePoint($tripID, $stop_sequence); | $nextTimePoint = getTripNextTimePoint($tripID, $stop_sequence); |
| //echo " prev {$lowestDelta['stop_sequence']} next {$nextTimePoint['stop_sequence']} "; | // echo " prev {$lowestDelta['stop_sequence']} next {$nextTimePoint['stop_sequence']} "; |
| $range = ""; | $range = ""; |
| if ($prevTimePoint != "") $range .= " AND stop_sequence >= '{$prevTimePoint['stop_sequence']}'"; | if ($prevTimePoint != "") |
| if ($nextTimePoint != "") $range .= " AND stop_sequence <= '{$nextTimePoint['stop_sequence']}'"; | $range .= " AND stop_sequence >= '{$prevTimePoint['stop_sequence']}'"; |
| foreach (getTimeInterpolatedTrip($tripID, $range) as $tripStop) { | if ($nextTimePoint != "") |
| if ($tripStop['stop_sequence'] == $stop_sequence) return $tripStop; | $range .= " AND stop_sequence <= '{$nextTimePoint['stop_sequence']}'"; |
| } | foreach (getTimeInterpolatedTrip($tripID, $range) as $tripStop) { |
| return Array(); | if ($tripStop['stop_sequence'] == $stop_sequence) |
| } | return $tripStop; |
| function getTripStartTime($tripID) | } |
| { | return Array(); |
| global $conn; | } |
| $query = "Select * from stop_times | |
| function getTripStartTime($tripID) { | |
| global $conn; | |
| $query = "Select * from stop_times | |
| where trip_id = :tripID | where trip_id = :tripID |
| AND arrival_time IS NOT NULL | AND arrival_time IS NOT NULL |
| AND stop_sequence = '1'"; | AND stop_sequence = '1'"; |
| debug($query, "database"); | debug($query, "database"); |
| $query = $conn->prepare($query); | $query = $conn->prepare($query); |
| $query->bindParam(":tripID", $tripID); | $query->bindParam(":tripID", $tripID); |
| $query->execute(); | $query->execute(); |
| if (!$query) { | if (!$query) { |
| databaseError($conn->errorInfo()); | databaseError($conn->errorInfo()); |
| return Array(); | return Array(); |
| } | } |
| $r = $query->fetch(PDO::FETCH_ASSOC); | $r = $query->fetch(PDO :: FETCH_ASSOC); |
| return $r['arrival_time']; | return $r['arrival_time']; |
| } | } |
| function getActiveTrips($time) | |
| { | function getTripEndTime($tripID) { |
| global $conn; | global $conn; |
| if ($time == "") $time = current_time(); | $query = "SELECT trip_id,max(arrival_time) as arrival_time from stop_times |
| $query = "Select distinct stop_times.trip_id, start_times.arrival_time as start_time, end_times.arrival_time as end_time from stop_times, (SELECT trip_id,arrival_time from stop_times WHERE stop_times.arrival_time IS NOT NULL | WHERE stop_times.arrival_time IS NOT NULL and trip_id = :tripID group by trip_id"; |
| debug($query, "database"); | |
| $query = $conn->prepare($query); | |
| $query->bindParam(":tripID", $tripID); | |
| $query->execute(); | |
| if (!$query) { | |
| databaseError($conn->errorInfo()); | |
| return Array(); | |
| } | |
| $r = $query->fetch(PDO :: FETCH_ASSOC); | |
| return $r['arrival_time']; | |
| } | |
| function getActiveTrips($time) { | |
| global $conn; | |
| if ($time == "") | |
| $time = current_time(); | |
| $query = "Select distinct stop_times.trip_id, start_times.arrival_time as start_time, end_times.arrival_time as end_time from stop_times, (SELECT trip_id,arrival_time from stop_times WHERE stop_times.arrival_time IS NOT NULL | |
| AND stop_sequence = '1') as start_times, (SELECT trip_id,max(arrival_time) as arrival_time from stop_times WHERE stop_times.arrival_time IS NOT NULL group by trip_id) as end_times | AND stop_sequence = '1') as start_times, (SELECT trip_id,max(arrival_time) as arrival_time from stop_times WHERE stop_times.arrival_time IS NOT NULL group by trip_id) as end_times |
| WHERE start_times.trip_id = end_times.trip_id AND stop_times.trip_id = end_times.trip_id AND :time > start_times.arrival_time AND :time < end_times.arrival_time"; | WHERE start_times.trip_id = end_times.trip_id AND stop_times.trip_id = end_times.trip_id AND :time > start_times.arrival_time AND :time < end_times.arrival_time"; |
| debug($query, "database"); | debug($query, "database"); |
| $query = $conn->prepare($query); | $query = $conn->prepare($query); |
| $query->bindParam(":time", $time); | $query->bindParam(":time", $time); |
| $query->execute(); | $query->execute(); |
| if (!$query) { | if (!$query) { |
| databaseError($conn->errorInfo()); | databaseError($conn->errorInfo()); |
| return Array(); | return Array(); |
| } | } |
| return $query->fetchAll(); | return $query->fetchAll(); |
| } | } |
| function viaPoints($tripID, $stop_sequence = "") | |
| { | function viaPoints($tripID, $stop_sequence = "", $timing_points_only = true) { |
| global $conn; | global $conn; |
| $query = "SELECT stops.stop_id, stop_name, arrival_time | $query = "SELECT stops.stop_id, stop_name, arrival_time |
| FROM stop_times join stops on stops.stop_id = stop_times.stop_id | FROM stop_times join stops on stops.stop_id = stop_times.stop_id |
| WHERE stop_times.trip_id = :tripID | WHERE stop_times.trip_id = :tripID |
| " . ($stop_sequence != "" ? " AND stop_sequence > :stop_sequence " : "") . "AND substr(stop_code,1,2) != 'Wj' ORDER BY stop_sequence"; | " . ($stop_sequence != "" ? " AND stop_sequence > :stop_sequence " : "") . ($timing_points_only ? "AND substr(stop_code,1,2) != 'Wj' " : "") . " ORDER BY stop_sequence"; |
| debug($query, "database"); | debug($query, "database"); |
| $query = $conn->prepare($query); | $query = $conn->prepare($query); |
| if ($stop_sequence != "") $query->bindParam(":stop_sequence", $stop_sequence); | if ($stop_sequence != "") |
| $query->bindParam(":tripID", $tripID); | $query->bindParam(":stop_sequence", $stop_sequence); |
| $query->execute(); | $query->bindParam(":tripID", $tripID); |
| if (!$query) { | $query->execute(); |
| databaseError($conn->errorInfo()); | if (!$query) { |
| return Array(); | databaseError($conn->errorInfo()); |
| } | return Array(); |
| return $query->fetchAll(); | } |
| } | return $query->fetchAll(); |
| function viaPointNames($tripid, $stop_sequence = "") | } |
| { | |
| $viaPointNames = Array(); | function viaPointNames($tripid, $stop_sequence = "") { |
| foreach (viaPoints($tripid, $stop_sequence) as $point) { | $viaPointNames = Array(); |
| $viaPointNames[] = $point['stop_name']; | foreach (viaPoints($tripid, $stop_sequence) as $point) { |
| } | $viaPointNames[] = $point['stop_name']; |
| if (sizeof($viaPointNames) > 0) { | } |
| return r_implode(", ", $viaPointNames); | if (sizeof($viaPointNames) > 0) { |
| } | return r_implode(", ", $viaPointNames); |
| else { | } else { |
| return ""; | return ""; |
| } | } |
| } | } |
| ?> | ?> |
| <?php | <?php |
| /* | |
| * Copyright 2010,2011 Alexander Sadleir | |
| Licensed under the Apache License, Version 2.0 (the "License"); | |
| you may not use this file except in compliance with the License. | |
| You may obtain a copy of the License at | |
| http://www.apache.org/licenses/LICENSE-2.0 | |
| Unless required by applicable law or agreed to in writing, software | |
| distributed under the License is distributed on an "AS IS" BASIS, | |
| WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. | |
| See the License for the specific language governing permissions and | |
| limitations under the License. | |
| */ | |
| include ('include/common.inc.php'); | include ('include/common.inc.php'); |
| include_header("bus.lambdacomplex.org", "index", false) | include_header("bus.lambdacomplex.org", "index", false) |
| ?> | ?> |
| <div data-role="page"> | <div data-role="page"> |
| <div data-role="content"> | <div data-role="content"> |
| <div id="jqm-homeheader"> | <div id="jqm-homeheader"> |
| <h1>busness time</h1><br><small>Canberra Bus Timetables and Trip Planner</small> | <h1>busness time</h1><br><small>Canberra Bus Timetables and Trip Planner</small> |
| </div> | </div> |
| <a name="maincontent" id="maincontent"></a> | <a name="maincontent" id="maincontent"></a> |
| <a href="tripPlanner.php" data-role="button" data-icon="navigation">Launch Trip Planner...</a> | <a href="tripPlanner.php" data-role="button" data-icon="navigation">Launch Trip Planner...</a> |
| <ul data-role="listview" data-inset="true" data-theme="c" data-dividertheme="b"> | <ul data-role="listview" data-inset="true" data-theme="c" data-dividertheme="b"> |
| <li data-role="list-divider">Timetables - Stops</li> | <li data-role="list-divider">Timetables - Stops</li> |
| <li><a href="stopList.php">Major (Timing Point) Stops</a></li> | <li><a href="stopList.php">Major (Timing Point) Stops</a></li> |
| <li><a href="stopList.php?allstops=yes">All Stops</a></li> | <li><a href="stopList.php?allstops=yes">All Stops</a></li> |
| <li><a href="stopList.php?bysuburbs=yes">Stops By Suburb</a></li> | <li><a href="stopList.php?bysuburbs=yes">Stops By Suburb</a></li> |
| <li><a class="nearby" href="stopList.php?nearby=yes">Nearby Stops</a></li> | <li><a class="nearby" href="stopList.php?nearby=yes">Nearby Stops</a></li> |
| </ul> | </ul> |
| <ul data-role="listview" data-inset="true" data-theme="c" data-dividertheme="b"> | <ul data-role="listview" data-inset="true" data-theme="c" data-dividertheme="b"> |
| <li data-role="list-divider">Timetables - Routes</li> | <li data-role="list-divider">Timetables - Routes</li> |
| <li><a href="routeList.php">Routes By Final Destination</a></li> | <li><a href="routeList.php">Routes By Final Destination</a></li> |
| <li><a href="routeList.php?bynumber=yes">Routes By Number</a></li> | <li><a href="routeList.php?bynumber=yes">Routes By Number</a></li> |
| <li><a href="routeList.php?bysuburbs=yes">Routes By Suburb</a></li> | <li><a href="routeList.php?bysuburbs=yes">Routes By Suburb</a></li> |
| <li><a class="nearby" href="routeList.php?nearby=yes">Nearby Routes</a></li> | <li><a class="nearby" href="routeList.php?nearby=yes">Nearby Routes</a></li> |
| </ul> | </ul> |
| <?php | <?php |
| echo timePlaceSettings(); | echo ' <a href="labs/index.php" data-role="button" data-icon="beaker">Busness R&D</a>'; |
| echo ' <a href="labs/index.php" data-role="button" data-icon="beaker">Busness R&D</a>'; | echo ' <a href="myway/index.php" data-role="button">MyWay Balance and Timeliness Survey Results</a>'; |
| include_footer(true) | include_footer(true) |
| ?> | ?> |
| /*! LAB.js (LABjs :: Loading And Blocking JavaScript) | |
| v2.0.1 (c) Kyle Simpson | |
| MIT License | |
| */ | |
| (function(o){var K=o.$LAB,y="UseLocalXHR",z="AlwaysPreserveOrder",u="AllowDuplicates",A="CacheBust",B="BasePath",C=/^[^?#]*\//.exec(location.href)[0],D=/^\w+\:\/\/\/?[^\/]+/.exec(C)[0],i=document.head||document.getElementsByTagName("head"),L=(o.opera&&Object.prototype.toString.call(o.opera)=="[object Opera]")||("MozAppearance"in document.documentElement.style),q=document.createElement("script"),E=typeof q.preload=="boolean",r=E||(q.readyState&&q.readyState=="uninitialized"),F=!r&&q.async===true,M=!r&&!F&&!L;function G(a){return Object.prototype.toString.call(a)=="[object Function]"}function H(a){return Object.prototype.toString.call(a)=="[object Array]"}function N(a,c){var b=/^\w+\:\/\//;if(/^\/\/\/?/.test(a)){a=location.protocol+a}else if(!b.test(a)&&a.charAt(0)!="/"){a=(c||"")+a}return b.test(a)?a:((a.charAt(0)=="/"?D:C)+a)}function s(a,c){for(var b in a){if(a.hasOwnProperty(b)){c[b]=a[b]}}return c}function O(a){var c=false;for(var b=0;b<a.scripts.length;b++){if(a.scripts[b].ready&&a.scripts[b].exec_trigger){c=true;a.scripts[b].exec_trigger();a.scripts[b].exec_trigger=null}}return c}function t(a,c,b,d){a.onload=a.onreadystatechange=function(){if((a.readyState&&a.readyState!="complete"&&a.readyState!="loaded")||c[b])return;a.onload=a.onreadystatechange=null;d()}}function I(a){a.ready=a.finished=true;for(var c=0;c<a.finished_listeners.length;c++){setTimeout(a.finished_listeners[c],0)}a.ready_listeners=[];a.finished_listeners=[]}function P(d,f,e,g,h){setTimeout(function(){var a,c=f.real_src,b;if("item"in i){if(!i[0]){setTimeout(arguments.callee,25);return}i=i[0]}a=document.createElement("script");if(f.type)a.type=f.type;if(f.charset)a.charset=f.charset;if(h){if(r){e.elem=a;if(E){a.preload=true;a.onpreload=g}else{a.onreadystatechange=function(){if(a.readyState=="loaded")g();a.onreadystatechange=null}}a.src=c}else if(h&&c.indexOf(D)==0&&d[y]){b=new XMLHttpRequest();b.onreadystatechange=function(){if(b.readyState==4){b.onreadystatechange=function(){};e.text=b.responseText+"\n//@ sourceURL="+c;g()}};b.open("GET",c);b.send()}else{a.type="text/cache-script";t(a,e,"ready",function(){i.removeChild(a);g()});a.src=c;i.insertBefore(a,i.firstChild)}}else if(F){a.async=false;t(a,e,"finished",g);a.src=c;i.insertBefore(a,i.firstChild)}else{t(a,e,"finished",g);a.src=c;i.insertBefore(a,i.firstChild)}},0)}function J(){var l={},Q=r||M,n=[],p={},m;l[y]=true;l[z]=false;l[u]=false;l[A]=false;l[B]="";function R(a,c,b){var d;function f(){if(d!=null){I(b);d=null}}if(p[c.src].finished)return;if(!a[u])p[c.src].finished=true;d=b.elem||document.createElement("script");if(c.type)d.type=c.type;if(c.charset)d.charset=c.charset;t(d,b,"finished",f);if(b.elem){b.elem=null}else if(b.text){d.onload=d.onreadystatechange=null;d.text=b.text}else{d.src=c.real_src}i.insertBefore(d,i.firstChild);if(b.text){f()}}function S(c,b,d,f){var e,g,h=function(){b.ready_cb(b,function(){R(c,b,e)})},j=function(){b.finished_cb(b,d)};b.src=N(b.src,c[B]);b.real_src=b.src+(c[A]?((/\?.*$/.test(b.src)?"&_":"?_")+~~(Math.random()*1E9)+"="):"");if(!p[b.src])p[b.src]={items:[],finished:false};g=p[b.src].items;if(c[u]||g.length==0){e=g[g.length]={ready:false,finished:false,ready_listeners:[h],finished_listeners:[j]};P(c,b,e,((f)?function(){e.ready=true;for(var a=0;a<e.ready_listeners.length;a++){setTimeout(e.ready_listeners[a],0)}e.ready_listeners=[]}:function(){I(e)}),f)}else{e=g[0];if(e.finished){setTimeout(j,0)}else{e.finished_listeners.push(j)}}}function v(){var e,g=s(l,{}),h=[],j=0,w=false,k;function T(a,c){a.ready=true;a.exec_trigger=c;x()}function U(a,c){a.ready=a.finished=true;a.exec_trigger=null;for(var b=0;b<c.scripts.length;b++){if(!c.scripts[b].finished)return}c.finished=true;x()}function x(){while(j<h.length){if(G(h[j])){try{h[j]()}catch(err){}}else if(!h[j].finished){if(O(h[j]))continue;break}j++}if(j==h.length){w=false;k=false}}function V(){if(!k||!k.scripts){h.push(k={scripts:[],finished:true})}}e={script:function(){for(var f=0;f<arguments.length;f++){(function(a,c){var b;if(!H(a)){c=[a]}for(var d=0;d<c.length;d++){V();a=c[d];if(G(a))a=a();if(!a)continue;if(H(a)){b=[].slice.call(a);b.push(d,1);c.splice.call(c,b);d--;continue}if(typeof a=="string")a={src:a};a=s(a,{ready:false,ready_cb:T,finished:false,finished_cb:U});k.finished=false;k.scripts.push(a);S(g,a,k,(Q&&w));w=true;if(g[z])e.wait()}})(arguments[f],arguments[f])}return e},wait:function(){if(arguments.length>0){for(var a=0;a<arguments.length;a++){h.push(arguments[a])}k=h[h.length-1]}else k=false;x();return e}};return{script:e.script,wait:e.wait,setOptions:function(a){s(a,g);return e}}}m={setGlobalDefaults:function(a){s(a,l);return m},setOptions:function(){return v().setOptions.apply(null,arguments)},script:function(){return v().script.apply(null,arguments)},wait:function(){return v().wait.apply(null,arguments)},queueScript:function(){n[n.length]={type:"script",args:[].slice.call(arguments)};return m},queueWait:function(){n[n.length]={type:"wait",args:[].slice.call(arguments)};return m},runQueue:function(){var a=m,c=n.length,b=c,d;for(;--b>=0;){d=n.shift();a=a[d.type].apply(null,d.args)}return a},noConflict:function(){o.$LAB=K;return m},sandbox:function(){return J()}};return m}o.$LAB=J();(function(a,c,b){if(document.readyState==null&&document[a]){document.readyState="loading";document[a](c,b=function(){document.removeEventListener(c,b,false);document.readyState="complete"},false)}})("addEventListener","DOMContentLoaded")})(this); |
| // Copyright 2006 Google Inc. | |
| // | |
| // Licensed under the Apache License, Version 2.0 (the "License"); | |
| // you may not use this file except in compliance with the License. | |
| // You may obtain a copy of the License at | |
| // | |
| // http://www.apache.org/licenses/LICENSE-2.0 | |
| // | |
| // Unless required by applicable law or agreed to in writing, software | |
| // distributed under the License is distributed on an "AS IS" BASIS, | |
| // WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. | |
| // See the License for the specific language governing permissions and | |
| // limitations under the License. | |
| // Known Issues: | |
| // | |
| // * Patterns only support repeat. | |
| // * Radial gradient are not implemented. The VML version of these look very | |
| // different from the canvas one. | |
| // * Clipping paths are not implemented. | |
| // * Coordsize. The width and height attribute have higher priority than the | |
| // width and height style values which isn't correct. | |
| // * Painting mode isn't implemented. | |
| // * Canvas width/height should is using content-box by default. IE in | |
| // Quirks mode will draw the canvas using border-box. Either change your | |
| // doctype to HTML5 | |
| // (http://www.whatwg.org/specs/web-apps/current-work/#the-doctype) | |
| // or use Box Sizing Behavior from WebFX | |
| // (http://webfx.eae.net/dhtml/boxsizing/boxsizing.html) | |
| // * Non uniform scaling does not correctly scale strokes. | |
| // * Filling very large shapes (above 5000 points) is buggy. | |
| // * Optimize. There is always room for speed improvements. | |
| // Only add this code if we do not already have a canvas implementation | |
| if (!document.createElement('canvas').getContext) { | |
| (function() { | |
| // alias some functions to make (compiled) code shorter | |
| var m = Math; | |
| var mr = m.round; | |
| var ms = m.sin; | |
| var mc = m.cos; | |
| var abs = m.abs; | |
| var sqrt = m.sqrt; | |
| // this is used for sub pixel precision | |
| var Z = 10; | |
| var Z2 = Z / 2; | |
| /** | |
| * This funtion is assigned to the <canvas> elements as element.getContext(). | |
| * @this {HTMLElement} | |
| * @return {CanvasRenderingContext2D_} | |
| */ | |
| function getContext() { | |
| return this.context_ || | |
| (this.context_ = new CanvasRenderingContext2D_(this)); | |
| } | |
| var slice = Array.prototype.slice; | |
| /** | |
| * Binds a function to an object. The returned function will always use the | |
| * passed in {@code obj} as {@code this}. | |
| * | |
| * Example: | |
| * | |
| * g = bind(f, obj, a, b) | |
| * g(c, d) // will do f.call(obj, a, b, c, d) | |
| * | |
| * @param {Function} f The function to bind the object to | |
| * @param {Object} obj The object that should act as this when the function | |
| * is called | |
| * @param {*} var_args Rest arguments that will be used as the initial | |
| * arguments when the function is called | |
| * @return {Function} A new function that has bound this | |
| */ | |
| function bind(f, obj, var_args) { | |
| var a = slice.call(arguments, 2); | |
| return function() { | |
| return f.apply(obj, a.concat(slice.call(arguments))); | |
| }; | |
| } | |
| function encodeHtmlAttribute(s) { | |
| return String(s).replace(/&/g, '&').replace(/"/g, '"'); | |
| } | |
| function addNamespacesAndStylesheet(doc) { | |
| // create xmlns | |
| if (!doc.namespaces['g_vml_']) { | |
| doc.namespaces.add('g_vml_', 'urn:schemas-microsoft-com:vml', | |
| '#default#VML'); | |
| } | |
| if (!doc.namespaces['g_o_']) { | |
| doc.namespaces.add('g_o_', 'urn:schemas-microsoft-com:office:office', | |
| '#default#VML'); | |
| } | |
| // Setup default CSS. Only add one style sheet per document | |
| if (!doc.styleSheets['ex_canvas_']) { | |
| var ss = doc.createStyleSheet(); | |
| ss.owningElement.id = 'ex_canvas_'; | |
| ss.cssText = 'canvas{display:inline-block;overflow:hidden;' + | |
| // default size is 300x150 in Gecko and Opera | |
| 'text-align:left;width:300px;height:150px}'; | |
| } | |
| } | |
| // Add namespaces and stylesheet at startup. | |
| addNamespacesAndStylesheet(document); | |
| var G_vmlCanvasManager_ = { | |
| init: function(opt_doc) { | |
| if (/MSIE/.test(navigator.userAgent) && !window.opera) { | |
| var doc = opt_doc || document; | |
| // Create a dummy element so that IE will allow canvas elements to be | |
| // recognized. | |
| doc.createElement('canvas'); | |
| doc.attachEvent('onreadystatechange', bind(this.init_, this, doc)); | |
| } | |
| }, | |
| init_: function(doc) { | |
| // find all canvas elements | |
| var els = doc.getElementsByTagName('canvas'); | |
| for (var i = 0; i < els.length; i++) { | |
| this.initElement(els[i]); | |
| } | |
| }, | |
| /** | |
| * Public initializes a canvas element so that it can be used as canvas | |
| * element from now on. This is called automatically before the page is | |
| * loaded but if you are creating elements using createElement you need to | |
| * make sure this is called on the element. | |
| * @param {HTMLElement} el The canvas element to initialize. | |
| * @return {HTMLElement} the element that was created. | |
| */ | |
| initElement: function(el) { | |
| if (!el.getContext) { | |
| el.getContext = getContext; | |
| // Add namespaces and stylesheet to document of the element. | |
| addNamespacesAndStylesheet(el.ownerDocument); | |
| // Remove fallback content. There is no way to hide text nodes so we | |
| // just remove all childNodes. We could hide all elements and remove | |
| // text nodes but who really cares about the fallback content. | |
| el.innerHTML = ''; | |
| // do not use inline function because that will leak memory | |
| el.attachEvent('onpropertychange', onPropertyChange); | |
| el.attachEvent('onresize', onResize); | |
| var attrs = el.attributes; | |
| if (attrs.width && attrs.width.specified) { | |
| // TODO: use runtimeStyle and coordsize | |
| // el.getContext().setWidth_(attrs.width.nodeValue); | |
| el.style.width = attrs.width.nodeValue + 'px'; | |
| } else { | |
| el.width = el.clientWidth; | |
| } | |
| if (attrs.height && attrs.height.specified) { | |
| // TODO: use runtimeStyle and coordsize | |
| // el.getContext().setHeight_(attrs.height.nodeValue); | |
| el.style.height = attrs.height.nodeValue + 'px'; | |
| } else { | |
| el.height = el.clientHeight; | |
| } | |
| //el.getContext().setCoordsize_() | |
| } | |
| return el; | |
| } | |
| }; | |
| function onPropertyChange(e) { | |
| var el = e.srcElement; | |
| switch (e.propertyName) { | |
| case 'width': | |
| el.getContext().clearRect(); | |
| el.style.width = el.attributes.width.nodeValue + 'px'; | |
| // In IE8 this does not trigger onresize. | |
| el.firstChild.style.width = el.clientWidth + 'px'; | |
| break; | |
| case 'height': | |
| el.getContext().clearRect(); | |
| el.style.height = el.attributes.height.nodeValue + 'px'; | |
| el.firstChild.style.height = el.clientHeight + 'px'; | |
| break; | |
| } | |
| } | |
| function onResize(e) { | |
| var el = e.srcElement; | |
| if (el.firstChild) { | |
| el.firstChild.style.width = el.clientWidth + 'px'; | |
| el.firstChild.style.height = el.clientHeight + 'px'; | |
| } | |
| } | |
| G_vmlCanvasManager_.init(); | |
| // precompute "00" to "FF" | |
| var decToHex = []; | |
| for (var i = 0; i < 16; i++) { | |
| for (var j = 0; j < 16; j++) { | |
| decToHex[i * 16 + j] = i.toString(16) + j.toString(16); | |
| } | |
| } | |
| function createMatrixIdentity() { | |
| return [ | |
| [1, 0, 0], | |
| [0, 1, 0], | |
| [0, 0, 1] | |
| ]; | |
| } | |
| function matrixMultiply(m1, m2) { | |
| var result = createMatrixIdentity(); | |
| for (var x = 0; x < 3; x++) { | |
| for (var y = 0; y < 3; y++) { | |
| var sum = 0; | |
| for (var z = 0; z < 3; z++) { | |
| sum += m1[x][z] * m2[z][y]; | |
| } | |
| result[x][y] = sum; | |
| } | |
| } | |
| return result; | |
| } | |
| function copyState(o1, o2) { | |
| o2.fillStyle = o1.fillStyle; | |
| o2.lineCap = o1.lineCap; | |
| o2.lineJoin = o1.lineJoin; | |
| o2.lineWidth = o1.lineWidth; | |
| o2.miterLimit = o1.miterLimit; | |
| o2.shadowBlur = o1.shadowBlur; | |
| o2.shadowColor = o1.shadowColor; | |
| o2.shadowOffsetX = o1.shadowOffsetX; | |
| o2.shadowOffsetY = o1.shadowOffsetY; | |
| o2.strokeStyle = o1.strokeStyle; | |
| o2.globalAlpha = o1.globalAlpha; | |
| o2.font = o1.font; | |
| o2.textAlign = o1.textAlign; | |
| o2.textBaseline = o1.textBaseline; | |
| o2.arcScaleX_ = o1.arcScaleX_; | |
| o2.arcScaleY_ = o1.arcScaleY_; | |
| o2.lineScale_ = o1.lineScale_; | |
| } | |
| var colorData = { | |
| aliceblue: '#F0F8FF', | |
| antiquewhite: '#FAEBD7', | |
| aquamarine: '#7FFFD4', | |
| azure: '#F0FFFF', | |
| beige: '#F5F5DC', | |
| bisque: '#FFE4C4', | |
| black: '#000000', | |
| blanchedalmond: '#FFEBCD', | |
| blueviolet: '#8A2BE2', | |
| brown: '#A52A2A', | |
| burlywood: '#DEB887', | |
| cadetblue: '#5F9EA0', | |
| chartreuse: '#7FFF00', | |
| chocolate: '#D2691E', | |
| coral: '#FF7F50', | |
| cornflowerblue: '#6495ED', | |
| cornsilk: '#FFF8DC', | |
| crimson: '#DC143C', | |
| cyan: '#00FFFF', | |
| darkblue: '#00008B', | |
| darkcyan: '#008B8B', | |
| darkgoldenrod: '#B8860B', | |
| darkgray: '#A9A9A9', | |
| darkgreen: '#006400', | |
| darkgrey: '#A9A9A9', | |
| darkkhaki: '#BDB76B', | |
| darkmagenta: '#8B008B', | |
| darkolivegreen: '#556B2F', | |
| darkorange: '#FF8C00', | |
| darkorchid: '#9932CC', | |
| darkred: '#8B0000', | |
| darksalmon: '#E9967A', | |
| darkseagreen: '#8FBC8F', | |
| darkslateblue: '#483D8B', | |
| darkslategray: '#2F4F4F', | |
| darkslategrey: '#2F4F4F', | |
| darkturquoise: '#00CED1', | |
| darkviolet: '#9400D3', | |
| deeppink: '#FF1493', | |
| deepskyblue: '#00BFFF', | |
| dimgray: '#696969', | |
| dimgrey: '#696969', | |
| dodgerblue: '#1E90FF', | |
| firebrick: '#B22222', | |
| floralwhite: '#FFFAF0', | |
| forestgreen: '#228B22', | |
| gainsboro: '#DCDCDC', | |
| ghostwhite: '#F8F8FF', | |
| gold: '#FFD700', | |
| goldenrod: '#DAA520', | |
| grey: '#808080', | |
| greenyellow: '#ADFF2F', | |
| honeydew: '#F0FFF0', | |
| hotpink: '#FF69B4', | |
| indianred: '#CD5C5C', | |
| indigo: '#4B0082', | |
| ivory: '#FFFFF0', | |
| khaki: '#F0E68C', | |
| lavender: '#E6E6FA', | |
| lavenderblush: '#FFF0F5', | |
| lawngreen: '#7CFC00', | |
| lemonchiffon: '#FFFACD', | |
| lightblue: '#ADD8E6', | |
| lightcoral: '#F08080', | |
| lightcyan: '#E0FFFF', | |
| lightgoldenrodyellow: '#FAFAD2', | |
| lightgreen: '#90EE90', | |
| lightgrey: '#D3D3D3', | |
| lightpink: '#FFB6C1', | |
| lightsalmon: '#FFA07A', | |
| lightseagreen: '#20B2AA', | |
| lightskyblue: '#87CEFA', | |
| lightslategray: '#778899', | |
| lightslategrey: '#778899', | |
| lightsteelblue: '#B0C4DE', | |
| lightyellow: '#FFFFE0', | |
| limegreen: '#32CD32', | |
| linen: '#FAF0E6', | |
| magenta: '#FF00FF', | |
| mediumaquamarine: '#66CDAA', | |
| mediumblue: '#0000CD', | |
| mediumorchid: '#BA55D3', | |
| mediumpurple: '#9370DB', | |
| mediumseagreen: '#3CB371', | |
| mediumslateblue: '#7B68EE', | |
| mediumspringgreen: '#00FA9A', | |
| mediumturquoise: '#48D1CC', | |
| mediumvioletred: '#C71585', | |
| midnightblue: '#191970', | |
| mintcream: '#F5FFFA', | |
| mistyrose: '#FFE4E1', | |
| moccasin: '#FFE4B5', | |
| navajowhite: '#FFDEAD', | |
| oldlace: '#FDF5E6', | |
| olivedrab: '#6B8E23', | |
| orange: '#FFA500', | |
| orangered: '#FF4500', | |
| orchid: '#DA70D6', | |
| palegoldenrod: '#EEE8AA', | |
| palegreen: '#98FB98', | |
| paleturquoise: '#AFEEEE', | |
| palevioletred: '#DB7093', | |
| papayawhip: '#FFEFD5', | |
| peachpuff: '#FFDAB9', | |
| peru: '#CD853F', | |
| pink: '#FFC0CB', | |
| plum: '#DDA0DD', | |
| powderblue: '#B0E0E6', | |
| rosybrown: '#BC8F8F', | |
| royalblue: '#4169E1', | |
| saddlebrown: '#8B4513', | |
| salmon: '#FA8072', | |
| sandybrown: '#F4A460', | |
| seagreen: '#2E8B57', | |
| seashell: '#FFF5EE', | |
| sienna: '#A0522D', | |
| skyblue: '#87CEEB', | |
| slateblue: '#6A5ACD', | |
| slategray: '#708090', | |
| slategrey: '#708090', | |
| snow: '#FFFAFA', | |
| springgreen: '#00FF7F', | |
| steelblue: '#4682B4', | |
| tan: '#D2B48C', | |
| thistle: '#D8BFD8', | |
| tomato: '#FF6347', | |
| turquoise: '#40E0D0', | |
| violet: '#EE82EE', | |
| wheat: '#F5DEB3', | |
| whitesmoke: '#F5F5F5', | |
| yellowgreen: '#9ACD32' | |
| }; | |
| function getRgbHslContent(styleString) { | |
| var start = styleString.indexOf('(', 3); | |
| var end = styleString.indexOf(')', start + 1); | |
| var parts = styleString.substring(start + 1, end).split(','); | |
| // add alpha if needed | |
| if (parts.length == 4 && styleString.substr(3, 1) == 'a') { | |
| alpha = Number(parts[3]); | |
| } else { | |
| parts[3] = 1; | |
| } | |
| return parts; | |
| } | |
| function percent(s) { | |
| return parseFloat(s) / 100; | |
| } | |
| function clamp(v, min, max) { | |
| return Math.min(max, Math.max(min, v)); | |
| } | |
| function hslToRgb(parts){ | |
| var r, g, b; | |
| h = parseFloat(parts[0]) / 360 % 360; | |
| if (h < 0) | |
| h++; | |
| s = clamp(percent(parts[1]), 0, 1); | |
| l = clamp(percent(parts[2]), 0, 1); | |
| if (s == 0) { | |
| r = g = b = l; // achromatic | |
| } else { | |
| var q = l < 0.5 ? l * (1 + s) : l + s - l * s; | |
| var p = 2 * l - q; | |
| r = hueToRgb(p, q, h + 1 / 3); | |
| g = hueToRgb(p, q, h); | |
| b = hueToRgb(p, q, h - 1 / 3); | |
| } | |
| return '#' + decToHex[Math.floor(r * 255)] + | |
| decToHex[Math.floor(g * 255)] + | |
| decToHex[Math.floor(b * 255)]; | |
| } | |
| function hueToRgb(m1, m2, h) { | |
| if (h < 0) | |
| h++; | |
| if (h > 1) | |
| h--; | |
| if (6 * h < 1) | |
| return m1 + (m2 - m1) * 6 * h; | |
| else if (2 * h < 1) | |
| return m2; | |
| else if (3 * h < 2) | |
| return m1 + (m2 - m1) * (2 / 3 - h) * 6; | |
| else | |
| return m1; | |
| } | |
| function processStyle(styleString) { | |
| var str, alpha = 1; | |
| styleString = String(styleString); | |
| if (styleString.charAt(0) == '#') { | |
| str = styleString; | |
| } else if (/^rgb/.test(styleString)) { | |
| var parts = getRgbHslContent(styleString); | |
| var str = '#', n; | |
| for (var i = 0; i < 3; i++) { | |
| if (parts[i].indexOf('%') != -1) { | |
| n = Math.floor(percent(parts[i]) * 255); | |
| } else { | |
| n = Number(parts[i]); | |
| } | |
| str += decToHex[clamp(n, 0, 255)]; | |
| } | |
| alpha = parts[3]; | |
| } else if (/^hsl/.test(styleString)) { | |
| var parts = getRgbHslContent(styleString); | |
| str = hslToRgb(parts); | |
| alpha = parts[3]; | |
| } else { | |
| str = colorData[styleString] || styleString; | |
| } | |
| return {color: str, alpha: alpha}; | |
| } | |
| var DEFAULT_STYLE = { | |
| style: 'normal', | |
| variant: 'normal', | |
| weight: 'normal', | |
| size: 10, | |
| family: 'sans-serif' | |
| }; | |
| // Internal text style cache | |
| var fontStyleCache = {}; | |
| function processFontStyle(styleString) { | |
| if (fontStyleCache[styleString]) { | |
| return fontStyleCache[styleString]; | |
| } | |
| var el = document.createElement('div'); | |
| var style = el.style; | |
| try { | |
| style.font = styleString; | |
| } catch (ex) { | |
| // Ignore failures to set to invalid font. | |
| } | |
| return fontStyleCache[styleString] = { | |
| style: style.fontStyle || DEFAULT_STYLE.style, | |
| variant: style.fontVariant || DEFAULT_STYLE.variant, | |
| weight: style.fontWeight || DEFAULT_STYLE.weight, | |
| size: style.fontSize || DEFAULT_STYLE.size, | |
| family: style.fontFamily || DEFAULT_STYLE.family | |
| }; | |
| } | |
| function getComputedStyle(style, element) { | |
| var computedStyle = {}; | |
| for (var p in style) { | |
| computedStyle[p] = style[p]; | |
| } | |
| // Compute the size | |
| var canvasFontSize = parseFloat(element.currentStyle.fontSize), | |
| fontSize = parseFloat(style.size); | |
| if (typeof style.size == 'number') { | |
| computedStyle.size = style.size; | |
| } else if (style.size.indexOf('px') != -1) { | |
| computedStyle.size = fontSize; | |
| } else if (style.size.indexOf('em') != -1) { | |
| computedStyle.size = canvasFontSize * fontSize; | |
| } else if(style.size.indexOf('%') != -1) { | |
| computedStyle.size = (canvasFontSize / 100) * fontSize; | |
| } else if (style.size.indexOf('pt') != -1) { | |
| computedStyle.size = fontSize / .75; | |
| } else { | |
| computedStyle.size = canvasFontSize; | |
| } | |
| // Different scaling between normal text and VML text. This was found using | |
| // trial and error to get the same size as non VML text. | |
| computedStyle.size *= 0.981; | |
| return computedStyle; | |
| } | |
| function buildStyle(style) { | |
| return style.style + ' ' + style.variant + ' ' + style.weight + ' ' + | |
| style.size + 'px ' + style.family; | |
| } | |
| function processLineCap(lineCap) { | |
| switch (lineCap) { | |
| case 'butt': | |
| return 'flat'; | |
| case 'round': | |
| return 'round'; | |
| case 'square': | |
| default: | |
| return 'square'; | |
| } | |
| } | |
| /** | |
| * This class implements CanvasRenderingContext2D interface as described by | |
| * the WHATWG. | |
| * @param {HTMLElement} surfaceElement The element that the 2D context should | |
| * be associated with | |
| */ | |
| function CanvasRenderingContext2D_(surfaceElement) { | |
| this.m_ = createMatrixIdentity(); | |
| this.mStack_ = []; | |
| this.aStack_ = []; | |
| this.currentPath_ = []; | |
| // Canvas context properties | |
| this.strokeStyle = '#000'; | |
| this.fillStyle = '#000'; | |
| this.lineWidth = 1; | |
| this.lineJoin = 'miter'; | |
| this.lineCap = 'butt'; | |
| this.miterLimit = Z * 1; | |
| this.globalAlpha = 1; | |
| this.font = '10px sans-serif'; | |
| this.textAlign = 'left'; | |
| this.textBaseline = 'alphabetic'; | |
| this.canvas = surfaceElement; | |
| var el = surfaceElement.ownerDocument.createElement('div'); | |
| el.style.width = surfaceElement.clientWidth + 'px'; | |
| el.style.height = surfaceElement.clientHeight + 'px'; | |
| el.style.overflow = 'hidden'; | |
| el.style.position = 'absolute'; | |
| surfaceElement.appendChild(el); | |
| this.element_ = el; | |
| this.arcScaleX_ = 1; | |
| this.arcScaleY_ = 1; | |
| this.lineScale_ = 1; | |
| } | |
| var contextPrototype = CanvasRenderingContext2D_.prototype; | |
| contextPrototype.clearRect = function() { | |
| if (this.textMeasureEl_) { | |
| this.textMeasureEl_.removeNode(true); | |
| this.textMeasureEl_ = null; | |
| } | |
| this.element_.innerHTML = ''; | |
| }; | |
| contextPrototype.beginPath = function() { | |
| // TODO: Branch current matrix so that save/restore has no effect | |
| // as per safari docs. | |
| this.currentPath_ = []; | |
| }; | |
| contextPrototype.moveTo = function(aX, aY) { | |
| var p = this.getCoords_(aX, aY); | |
| this.currentPath_.push({type: 'moveTo', x: p.x, y: p.y}); | |
| this.currentX_ = p.x; | |
| this.currentY_ = p.y; | |
| }; | |
| contextPrototype.lineTo = function(aX, aY) { | |
| var p = this.getCoords_(aX, aY); | |
| this.currentPath_.push({type: 'lineTo', x: p.x, y: p.y}); | |
| this.currentX_ = p.x; | |
| this.currentY_ = p.y; | |
| }; | |
| contextPrototype.bezierCurveTo = function(aCP1x, aCP1y, | |
| aCP2x, aCP2y, | |
| aX, aY) { | |
| var p = this.getCoords_(aX, aY); | |
| var cp1 = this.getCoords_(aCP1x, aCP1y); | |
| var cp2 = this.getCoords_(aCP2x, aCP2y); | |
| bezierCurveTo(this, cp1, cp2, p); | |
| }; | |
| // Helper function that takes the already fixed cordinates. | |
| function bezierCurveTo(self, cp1, cp2, p) { | |
| self.currentPath_.push({ | |
| type: 'bezierCurveTo', | |
| cp1x: cp1.x, | |
| cp1y: cp1.y, | |
| cp2x: cp2.x, | |
| cp2y: cp2.y, | |
| x: p.x, | |
| y: p.y | |
| }); | |
| self.currentX_ = p.x; | |
| self.currentY_ = p.y; | |
| } | |
| contextPrototype.quadraticCurveTo = function(aCPx, aCPy, aX, aY) { | |
| // the following is lifted almost directly from | |
| // http://developer.mozilla.org/en/docs/Canvas_tutorial:Drawing_shapes | |
| var cp = this.getCoords_(aCPx, aCPy); | |
| var p = this.getCoords_(aX, aY); | |
| var cp1 = { | |
| x: this.currentX_ + 2.0 / 3.0 * (cp.x - this.currentX_), | |
| y: this.currentY_ + 2.0 / 3.0 * (cp.y - this.currentY_) | |
| }; | |
| var cp2 = { | |
| x: cp1.x + (p.x - this.currentX_) / 3.0, | |
| y: cp1.y + (p.y - this.currentY_) / 3.0 | |
| }; | |
| bezierCurveTo(this, cp1, cp2, p); | |
| }; | |
| contextPrototype.arc = function(aX, aY, aRadius, | |
| aStartAngle, aEndAngle, aClockwise) { | |
| aRadius *= Z; | |
| var arcType = aClockwise ? 'at' : 'wa'; | |
| var xStart = aX + mc(aStartAngle) * aRadius - Z2; | |
| var yStart = aY + ms(aStartAngle) * aRadius - Z2; | |
| var xEnd = aX + mc(aEndAngle) * aRadius - Z2; | |
| var yEnd = aY + ms(aEndAngle) * aRadius - Z2; | |
| // IE won't render arches drawn counter clockwise if xStart == xEnd. | |
| if (xStart == xEnd && !aClockwise) { | |
| xStart += 0.125; // Offset xStart by 1/80 of a pixel. Use something | |
| // that can be represented in binary | |
| } | |
| var p = this.getCoords_(aX, aY); | |
| var pStart = this.getCoords_(xStart, yStart); | |
| var pEnd = this.getCoords_(xEnd, yEnd); | |
| this.currentPath_.push({type: arcType, | |
| x: p.x, | |
| y: p.y, | |
| radius: aRadius, | |
| xStart: pStart.x, | |
| yStart: pStart.y, | |
| xEnd: pEnd.x, | |
| yEnd: pEnd.y}); | |
| }; | |
| contextPrototype.rect = function(aX, aY, aWidth, aHeight) { | |
| this.moveTo(aX, aY); | |
| this.lineTo(aX + aWidth, aY); | |
| this.lineTo(aX + aWidth, aY + aHeight); | |
| this.lineTo(aX, aY + aHeight); | |
| this.closePath(); | |
| }; | |
| contextPrototype.strokeRect = function(aX, aY, aWidth, aHeight) { | |
| var oldPath = this.currentPath_; | |
| this.beginPath(); | |
| this.moveTo(aX, aY); | |
| this.lineTo(aX + aWidth, aY); | |
| this.lineTo(aX + aWidth, aY + aHeight); | |
| this.lineTo(aX, aY + aHeight); | |
| this.closePath(); | |
| this.stroke(); | |
| this.currentPath_ = oldPath; | |
| }; | |
| contextPrototype.fillRect = function(aX, aY, aWidth, aHeight) { | |
| var oldPath = this.currentPath_; | |
| this.beginPath(); | |
| this.moveTo(aX, aY); | |
| this.lineTo(aX + aWidth, aY); | |
| this.lineTo(aX + aWidth, aY + aHeight); | |
| this.lineTo(aX, aY + aHeight); | |
| this.closePath(); | |
| this.fill(); | |
| this.currentPath_ = oldPath; | |
| }; | |
| contextPrototype.createLinearGradient = function(aX0, aY0, aX1, aY1) { | |
| var gradient = new CanvasGradient_('gradient'); | |
| gradient.x0_ = aX0; | |
| gradient.y0_ = aY0; | |
| gradient.x1_ = aX1; | |
| gradient.y1_ = aY1; | |
| return gradient; | |
| }; | |
| contextPrototype.createRadialGradient = function(aX0, aY0, aR0, | |
| aX1, aY1, aR1) { | |
| var gradient = new CanvasGradient_('gradientradial'); | |
| gradient.x0_ = aX0; | |
| gradient.y0_ = aY0; | |
| gradient.r0_ = aR0; | |
| gradient.x1_ = aX1; | |
| gradient.y1_ = aY1; | |
| gradient.r1_ = aR1; | |
| return gradient; | |
| }; | |
| contextPrototype.drawImage = function(image, var_args) { | |
| var dx, dy, dw, dh, sx, sy, sw, sh; | |
| // to find the original width we overide the width and height | |
| var oldRuntimeWidth = image.runtimeStyle.width; | |
| var oldRuntimeHeight = image.runtimeStyle.height; | |
| image.runtimeStyle.width = 'auto'; | |
| image.runtimeStyle.height = 'auto'; | |
| // get the original size | |
| var w = image.width; | |
| var h = image.height; | |
| // and remove overides | |
| image.runtimeStyle.width = oldRuntimeWidth; | |
| image.runtimeStyle.height = oldRuntimeHeight; | |
| if (arguments.length == 3) { | |
| dx = arguments[1]; | |
| dy = arguments[2]; | |
| sx = sy = 0; | |
| sw = dw = w; | |
| sh = dh = h; | |
| } else if (arguments.length == 5) { | |
| dx = arguments[1]; | |
| dy = arguments[2]; | |
| dw = arguments[3]; | |
| dh = arguments[4]; | |
| sx = sy = 0; | |
| sw = w; | |
| sh = h; | |
| } else if (arguments.length == 9) { | |
| sx = arguments[1]; | |
| sy = arguments[2]; | |
| sw = arguments[3]; | |
| sh = arguments[4]; | |
| dx = arguments[5]; | |
| dy = arguments[6]; | |
| dw = arguments[7]; | |
| dh = arguments[8]; | |
| } else { | |
| throw Error('Invalid number of arguments'); | |
| } | |
| var d = this.getCoords_(dx, dy); | |
| var w2 = sw / 2; | |
| var h2 = sh / 2; | |
| var vmlStr = []; | |
| var W = 10; | |
| var H = 10; | |
| // For some reason that I've now forgotten, using divs didn't work | |
| vmlStr.push(' <g_vml_:group', | |
| ' coordsize="', Z * W, ',', Z * H, '"', | |
| ' coordorigin="0,0"' , | |
| ' style="width:', W, 'px;height:', H, 'px;position:absolute;'); | |
| // If filters are necessary (rotation exists), create them | |
| // filters are bog-slow, so only create them if abbsolutely necessary | |
| // The following check doesn't account for skews (which don't exist | |
| // in the canvas spec (yet) anyway. | |
| if (this.m_[0][0] != 1 || this.m_[0][1] || | |
| this.m_[1][1] != 1 || this.m_[1][0]) { | |
| var filter = []; | |
| // Note the 12/21 reversal | |
| filter.push('M11=', this.m_[0][0], ',', | |
| 'M12=', this.m_[1][0], ',', | |
| 'M21=', this.m_[0][1], ',', | |
| 'M22=', this.m_[1][1], ',', | |
| 'Dx=', mr(d.x / Z), ',', | |
| 'Dy=', mr(d.y / Z), ''); | |
| // Bounding box calculation (need to minimize displayed area so that | |
| // filters don't waste time on unused pixels. | |
| var max = d; | |
| var c2 = this.getCoords_(dx + dw, dy); | |
| var c3 = this.getCoords_(dx, dy + dh); | |
| var c4 = this.getCoords_(dx + dw, dy + dh); | |
| max.x = m.max(max.x, c2.x, c3.x, c4.x); | |
| max.y = m.max(max.y, c2.y, c3.y, c4.y); | |
| vmlStr.push('padding:0 ', mr(max.x / Z), 'px ', mr(max.y / Z), | |
| 'px 0;filter:progid:DXImageTransform.Microsoft.Matrix(', | |
| filter.join(''), ", sizingmethod='clip');"); | |
| } else { | |
| vmlStr.push('top:', mr(d.y / Z), 'px;left:', mr(d.x / Z), 'px;'); | |
| } | |
| vmlStr.push(' ">' , | |
| '<g_vml_:image src="', image.src, '"', | |
| ' style="width:', Z * dw, 'px;', | |
| ' height:', Z * dh, 'px"', | |
| ' cropleft="', sx / w, '"', | |
| ' croptop="', sy / h, '"', | |
| ' cropright="', (w - sx - sw) / w, '"', | |
| ' cropbottom="', (h - sy - sh) / h, '"', | |
| ' />', | |
| '</g_vml_:group>'); | |
| this.element_.insertAdjacentHTML('BeforeEnd', vmlStr.join('')); | |
| }; | |
| contextPrototype.stroke = function(aFill) { | |
| var W = 10; | |
| var H = 10; | |
| // Divide the shape into chunks if it's too long because IE has a limit | |
| // somewhere for how long a VML shape can be. This simple division does | |
| // not work with fills, only strokes, unfortunately. | |
| var chunkSize = 5000; | |
| var min = {x: null, y: null}; | |
| var max = {x: null, y: null}; | |
| for (var j = 0; j < this.currentPath_.length; j += chunkSize) { | |
| var lineStr = []; | |
| var lineOpen = false; | |
| lineStr.push('<g_vml_:shape', | |
| ' filled="', !!aFill, '"', | |
| ' style="position:absolute;width:', W, 'px;height:', H, 'px;"', | |
| ' coordorigin="0,0"', | |
| ' coordsize="', Z * W, ',', Z * H, '"', | |
| ' stroked="', !aFill, '"', | |
| ' path="'); | |
| var newSeq = false; | |
| for (var i = j; i < Math.min(j + chunkSize, this.currentPath_.length); i++) { | |
| if (i % chunkSize == 0 && i > 0) { // move into position for next chunk | |
| lineStr.push(' m ', mr(this.currentPath_[i-1].x), ',', mr(this.currentPath_[i-1].y)); | |
| } | |
| var p = this.currentPath_[i]; | |
| var c; | |
| switch (p.type) { | |
| case 'moveTo': | |
| c = p; | |
| lineStr.push(' m ', mr(p.x), ',', mr(p.y)); | |
| break; | |
| case 'lineTo': | |
| lineStr.push(' l ', mr(p.x), ',', mr(p.y)); | |
| break; | |
| case 'close': | |
| lineStr.push(' x '); | |
| p = null; | |
| break; | |
| case 'bezierCurveTo': | |
| lineStr.push(' c ', | |
| mr(p.cp1x), ',', mr(p.cp1y), ',', | |
| mr(p.cp2x), ',', mr(p.cp2y), ',', | |
| mr(p.x), ',', mr(p.y)); | |
| break; | |
| case 'at': | |
| case 'wa': | |
| lineStr.push(' ', p.type, ' ', | |
| mr(p.x - this.arcScaleX_ * p.radius), ',', | |
| mr(p.y - this.arcScaleY_ * p.radius), ' ', | |
| mr(p.x + this.arcScaleX_ * p.radius), ',', | |
| mr(p.y + this.arcScaleY_ * p.radius), ' ', | |
| mr(p.xStart), ',', mr(p.yStart), ' ', | |
| mr(p.xEnd), ',', mr(p.yEnd)); | |
| break; | |
| } | |
| // TODO: Following is broken for curves due to | |
| // move to proper paths. | |
| // Figure out dimensions so we can do gradient fills | |
| // properly | |
| if (p) { | |
| if (min.x == null || p.x < min.x) { | |
| min.x = p.x; | |
| } | |
| if (max.x == null || p.x > max.x) { | |
| max.x = p.x; | |
| } | |
| if (min.y == null || p.y < min.y) { | |
| min.y = p.y; | |
| } | |
| if (max.y == null || p.y > max.y) { | |
| max.y = p.y; | |
| } | |
| } | |
| } | |
| lineStr.push(' ">'); | |
| if (!aFill) { | |
| appendStroke(this, lineStr); | |
| } else { | |
| appendFill(this, lineStr, min, max); | |
| } | |
| lineStr.push('</g_vml_:shape>'); | |
| this.element_.insertAdjacentHTML('beforeEnd', lineStr.join('')); | |
| } | |
| }; | |
| function appendStroke(ctx, lineStr) { | |
| var a = processStyle(ctx.strokeStyle); | |
| var color = a.color; | |
| var opacity = a.alpha * ctx.globalAlpha; | |
| var lineWidth = ctx.lineScale_ * ctx.lineWidth; | |
| // VML cannot correctly render a line if the width is less than 1px. | |
| // In that case, we dilute the color to make the line look thinner. | |
| if (lineWidth < 1) { | |
| opacity *= lineWidth; | |
| } | |
| lineStr.push( | |
| '<g_vml_:stroke', | |
| ' opacity="', opacity, '"', | |
| ' joinstyle="', ctx.lineJoin, '"', | |
| ' miterlimit="', ctx.miterLimit, '"', | |
| ' endcap="', processLineCap(ctx.lineCap), '"', | |
| ' weight="', lineWidth, 'px"', | |
| ' color="', color, '" />' | |
| ); | |
| } | |
| function appendFill(ctx, lineStr, min, max) { | |
| var fillStyle = ctx.fillStyle; | |
| var arcScaleX = ctx.arcScaleX_; | |
| var arcScaleY = ctx.arcScaleY_; | |
| var width = max.x - min.x; | |
| var height = max.y - min.y; | |
| if (fillStyle instanceof CanvasGradient_) { | |
| // TODO: Gradients transformed with the transformation matrix. | |
| var angle = 0; | |
| var focus = {x: 0, y: 0}; | |
| // additional offset | |
| var shift = 0; | |
| // scale factor for offset | |
| var expansion = 1; | |
| if (fillStyle.type_ == 'gradient') { | |
| var x0 = fillStyle.x0_ / arcScaleX; | |
| var y0 = fillStyle.y0_ / arcScaleY; | |
| var x1 = fillStyle.x1_ / arcScaleX; | |
| var y1 = fillStyle.y1_ / arcScaleY; | |
| var p0 = ctx.getCoords_(x0, y0); | |
| var p1 = ctx.getCoords_(x1, y1); | |
| var dx = p1.x - p0.x; | |
| var dy = p1.y - p0.y; | |
| angle = Math.atan2(dx, dy) * 180 / Math.PI; | |
| // The angle should be a non-negative number. | |
| if (angle < 0) { | |
| angle += 360; | |
| } | |
| // Very small angles produce an unexpected result because they are | |
| // converted to a scientific notation string. | |
| if (angle < 1e-6) { | |
| angle = 0; | |
| } | |
| } else { | |
| var p0 = ctx.getCoords_(fillStyle.x0_, fillStyle.y0_); | |
| focus = { | |
| x: (p0.x - min.x) / width, | |
| y: (p0.y - min.y) / height | |
| }; | |
| width /= arcScaleX * Z; | |
| height /= arcScaleY * Z; | |
| var dimension = m.max(width, height); | |
| shift = 2 * fillStyle.r0_ / dimension; | |
| expansion = 2 * fillStyle.r1_ / dimension - shift; | |
| } | |
| // We need to sort the color stops in ascending order by offset, | |
| // otherwise IE won't interpret it correctly. | |
| var stops = fillStyle.colors_; | |
| stops.sort(function(cs1, cs2) { | |
| return cs1.offset - cs2.offset; | |
| }); | |
| var length = stops.length; | |
| var color1 = stops[0].color; | |
| var color2 = stops[length - 1].color; | |
| var opacity1 = stops[0].alpha * ctx.globalAlpha; | |
| var opacity2 = stops[length - 1].alpha * ctx.globalAlpha; | |
| var colors = []; | |
| for (var i = 0; i < length; i++) { | |
| var stop = stops[i]; | |
| colors.push(stop.offset * expansion + shift + ' ' + stop.color); | |
| } | |
| // When colors attribute is used, the meanings of opacity and o:opacity2 | |
| // are reversed. | |
| lineStr.push('<g_vml_:fill type="', fillStyle.type_, '"', | |
| ' method="none" focus="100%"', | |
| ' color="', color1, '"', | |
| ' color2="', color2, '"', | |
| ' colors="', colors.join(','), '"', | |
| ' opacity="', opacity2, '"', | |
| ' g_o_:opacity2="', opacity1, '"', | |
| ' angle="', angle, '"', | |
| ' focusposition="', focus.x, ',', focus.y, '" />'); | |
| } else if (fillStyle instanceof CanvasPattern_) { | |
| if (width && height) { | |
| var deltaLeft = -min.x; | |
| var deltaTop = -min.y; | |
| lineStr.push('<g_vml_:fill', | |
| ' position="', | |
| deltaLeft / width * arcScaleX * arcScaleX, ',', | |
| deltaTop / height * arcScaleY * arcScaleY, '"', | |
| ' type="tile"', | |
| // TODO: Figure out the correct size to fit the scale. | |
| //' size="', w, 'px ', h, 'px"', | |
| ' src="', fillStyle.src_, '" />'); | |
| } | |
| } else { | |
| var a = processStyle(ctx.fillStyle); | |
| var color = a.color; | |
| var opacity = a.alpha * ctx.globalAlpha; | |
| lineStr.push('<g_vml_:fill color="', color, '" opacity="', opacity, | |
| '" />'); | |
| } | |
| } | |
| contextPrototype.fill = function() { | |
| this.stroke(true); | |
| }; | |
| contextPrototype.closePath = function() { | |
| this.currentPath_.push({type: 'close'}); | |
| }; | |
| /** | |
| * @private | |
| */ | |
| contextPrototype.getCoords_ = function(aX, aY) { | |
| var m = this.m_; | |
| return { | |
| x: Z * (aX * m[0][0] + aY * m[1][0] + m[2][0]) - Z2, | |
| y: Z * (aX * m[0][1] + aY * m[1][1] + m[2][1]) - Z2 | |
| }; | |
| }; | |
| contextPrototype.save = function() { | |
| var o = {}; | |
| copyState(this, o); | |
| this.aStack_.push(o); | |
| this.mStack_.push(this.m_); | |
| this.m_ = matrixMultiply(createMatrixIdentity(), this.m_); | |
| }; | |
| contextPrototype.restore = function() { | |
| if (this.aStack_.length) { | |
| copyState(this.aStack_.pop(), this); | |
| this.m_ = this.mStack_.pop(); | |
| } | |
| }; | |
| function matrixIsFinite(m) { | |
| return isFinite(m[0][0]) && isFinite(m[0][1]) && | |
| isFinite(m[1][0]) && isFinite(m[1][1]) && | |
| isFinite(m[2][0]) && isFinite(m[2][1]); | |
| } | |
| function setM(ctx, m, updateLineScale) { | |
| if (!matrixIsFinite(m)) { | |
| return; | |
| } | |
| ctx.m_ = m; | |
| if (updateLineScale) { | |
| // Get the line scale. | |
| // Determinant of this.m_ means how much the area is enlarged by the | |
| // transformation. So its square root can be used as a scale factor | |
| // for width. | |
| var det = m[0][0] * m[1][1] - m[0][1] * m[1][0]; | |
| ctx.lineScale_ = sqrt(abs(det)); | |
| } | |
| } | |
| contextPrototype.translate = function(aX, aY) { | |
| var m1 = [ | |
| [1, 0, 0], | |
| [0, 1, 0], | |
| [aX, aY, 1] | |
| ]; | |
| setM(this, matrixMultiply(m1, this.m_), false); | |
| }; | |
| contextPrototype.rotate = function(aRot) { | |
| var c = mc(aRot); | |
| var s = ms(aRot); | |
| var m1 = [ | |
| [c, s, 0], | |
| [-s, c, 0], | |
| [0, 0, 1] | |
| ]; | |
| setM(this, matrixMultiply(m1, this.m_), false); | |
| }; | |
| contextPrototype.scale = function(aX, aY) { | |
| this.arcScaleX_ *= aX; | |
| this.arcScaleY_ *= aY; | |
| var m1 = [ | |
| [aX, 0, 0], | |
| [0, aY, 0], | |
| [0, 0, 1] | |
| ]; | |
| setM(this, matrixMultiply(m1, this.m_), true); | |
| }; | |
| contextPrototype.transform = function(m11, m12, m21, m22, dx, dy) { | |
| var m1 = [ | |
| [m11, m12, 0], | |
| [m21, m22, 0], | |
| [dx, dy, 1] | |
| ]; | |
| setM(this, matrixMultiply(m1, this.m_), true); | |
| }; | |
| contextPrototype.setTransform = function(m11, m12, m21, m22, dx, dy) { | |
| var m = [ | |
| [m11, m12, 0], | |
| [m21, m22, 0], | |
| [dx, dy, 1] | |
| ]; | |
| setM(this, m, true); | |
| }; | |
| /** | |
| * The text drawing function. | |
| * The maxWidth argument isn't taken in account, since no browser supports | |
| * it yet. | |
| */ | |
| contextPrototype.drawText_ = function(text, x, y, maxWidth, stroke) { | |
| var m = this.m_, | |
| delta = 1000, | |
| left = 0, | |
| right = delta, | |
| offset = {x: 0, y: 0}, | |
| lineStr = []; | |
| var fontStyle = getComputedStyle(processFontStyle(this.font), | |
| this.element_); | |
| var fontStyleString = buildStyle(fontStyle); | |
| var elementStyle = this.element_.currentStyle; | |
| var textAlign = this.textAlign.toLowerCase(); | |
| switch (textAlign) { | |
| case 'left': | |
| case 'center': | |
| case 'right': | |
| break; | |
| case 'end': | |
| textAlign = elementStyle.direction == 'ltr' ? 'right' : 'left'; | |
| break; | |
| case 'start': | |
| textAlign = elementStyle.direction == 'rtl' ? 'right' : 'left'; | |
| break; | |
| default: | |
| textAlign = 'left'; | |
| } | |
| // 1.75 is an arbitrary number, as there is no info about the text baseline | |
| switch (this.textBaseline) { | |
| case 'hanging': | |
| case 'top': | |
| offset.y = fontStyle.size / 1.75; | |
| break; | |
| case 'middle': | |
| break; | |
| default: | |
| case null: | |
| case 'alphabetic': | |
| case 'ideographic': | |
| case 'bottom': | |
| offset.y = -fontStyle.size / 2.25; | |
| break; | |
| } | |
| switch(textAlign) { | |
| case 'right': | |
| left = delta; | |
| right = 0.05; | |
| break; | |
| case 'center': | |
| left = right = delta / 2; | |
| break; | |
| } | |
| var d = this.getCoords_(x + offset.x, y + offset.y); | |
| lineStr.push('<g_vml_:line from="', -left ,' 0" to="', right ,' 0.05" ', | |
| ' coordsize="100 100" coordorigin="0 0"', | |
| ' filled="', !stroke, '" stroked="', !!stroke, | |
| '" style="position:absolute;width:1px;height:1px;">'); | |
| if (stroke) { | |
| appendStroke(this, lineStr); | |
| } else { | |
| // TODO: Fix the min and max params. | |
| appendFill(this, lineStr, {x: -left, y: 0}, | |
| {x: right, y: fontStyle.size}); | |
| } | |
| var skewM = m[0][0].toFixed(3) + ',' + m[1][0].toFixed(3) + ',' + | |
| m[0][1].toFixed(3) + ',' + m[1][1].toFixed(3) + ',0,0'; | |
| var skewOffset = mr(d.x / Z) + ',' + mr(d.y / Z); | |
| lineStr.push('<g_vml_:skew on="t" matrix="', skewM ,'" ', | |
| ' offset="', skewOffset, '" origin="', left ,' 0" />', | |
| '<g_vml_:path textpathok="true" />', | |
| '<g_vml_:textpath on="true" string="', | |
| encodeHtmlAttribute(text), | |
| '" style="v-text-align:', textAlign, | |
| ';font:', encodeHtmlAttribute(fontStyleString), | |
| '" /></g_vml_:line>'); | |
| this.element_.insertAdjacentHTML('beforeEnd', lineStr.join('')); | |
| }; | |
| contextPrototype.fillText = function(text, x, y, maxWidth) { | |
| this.drawText_(text, x, y, maxWidth, false); | |
| }; | |
| contextPrototype.strokeText = function(text, x, y, maxWidth) { | |
| this.drawText_(text, x, y, maxWidth, true); | |
| }; | |
| contextPrototype.measureText = function(text) { | |
| if (!this.textMeasureEl_) { | |
| var s = '<span style="position:absolute;' + | |
| 'top:-20000px;left:0;padding:0;margin:0;border:none;' + | |
| 'white-space:pre;"></span>'; | |
| this.element_.insertAdjacentHTML('beforeEnd', s); | |
| this.textMeasureEl_ = this.element_.lastChild; | |
| } | |
| var doc = this.element_.ownerDocument; | |
| this.textMeasureEl_.innerHTML = ''; | |
| this.textMeasureEl_.style.font = this.font; | |
| // Don't use innerHTML or innerText because they allow markup/whitespace. | |
| this.textMeasureEl_.appendChild(doc.createTextNode(text)); | |
| return {width: this.textMeasureEl_.offsetWidth}; | |
| }; | |
| /******** STUBS ********/ | |
| contextPrototype.clip = function() { | |
| // TODO: Implement | |
| }; | |
| contextPrototype.arcTo = function() { | |
| // TODO: Implement | |
| }; | |
| contextPrototype.createPattern = function(image, repetition) { | |
| return new CanvasPattern_(image, repetition); | |
| }; | |
| // Gradient / Pattern Stubs | |
| function CanvasGradient_(aType) { | |
| this.type_ = aType; | |
| this.x0_ = 0; | |
| this.y0_ = 0; | |
| this.r0_ = 0; | |
| this.x1_ = 0; | |
| this.y1_ = 0; | |
| this.r1_ = 0; | |
| this.colors_ = []; | |
| } | |
| CanvasGradient_.prototype.addColorStop = function(aOffset, aColor) { | |
| aColor = processStyle(aColor); | |
| this.colors_.push({offset: aOffset, | |
| color: aColor.color, | |
| alpha: aColor.alpha}); | |
| }; | |
| function CanvasPattern_(image, repetition) { | |
| assertImageIsValid(image); | |
| switch (repetition) { | |
| case 'repeat': | |
| case null: | |
| case '': | |
| this.repetition_ = 'repeat'; | |
| break | |
| case 'repeat-x': | |
| case 'repeat-y': | |
| case 'no-repeat': | |
| this.repetition_ = repetition; | |
| break; | |
| default: | |
| throwException('SYNTAX_ERR'); | |
| } | |
| this.src_ = image.src; | |
| this.width_ = image.width; | |
| this.height_ = image.height; | |
| } | |
| function throwException(s) { | |
| throw new DOMException_(s); | |
| } | |
| function assertImageIsValid(img) { | |
| if (!img || img.nodeType != 1 || img.tagName != 'IMG') { | |
| throwException('TYPE_MISMATCH_ERR'); | |
| } | |
| if (img.readyState != 'complete') { | |
| throwException('INVALID_STATE_ERR'); | |
| } | |
| } | |
| function DOMException_(s) { | |
| this.code = this[s]; | |
| this.message = s +': DOM Exception ' + this.code; | |
| } | |
| var p = DOMException_.prototype = new Error; | |
| p.INDEX_SIZE_ERR = 1; | |
| p.DOMSTRING_SIZE_ERR = 2; | |
| p.HIERARCHY_REQUEST_ERR = 3; | |
| p.WRONG_DOCUMENT_ERR = 4; | |
| p.INVALID_CHARACTER_ERR = 5; | |
| p.NO_DATA_ALLOWED_ERR = 6; | |
| p.NO_MODIFICATION_ALLOWED_ERR = 7; | |
| p.NOT_FOUND_ERR = 8; | |
| p.NOT_SUPPORTED_ERR = 9; | |
| p.INUSE_ATTRIBUTE_ERR = 10; | |
| p.INVALID_STATE_ERR = 11; | |
| p.SYNTAX_ERR = 12; | |
| p.INVALID_MODIFICATION_ERR = 13; | |
| p.NAMESPACE_ERR = 14; | |
| p.INVALID_ACCESS_ERR = 15; | |
| p.VALIDATION_ERR = 16; | |
| p.TYPE_MISMATCH_ERR = 17; | |
| // set up externs | |
| G_vmlCanvasManager = G_vmlCanvasManager_; | |
| CanvasRenderingContext2D = CanvasRenderingContext2D_; | |
| CanvasGradient = CanvasGradient_; | |
| CanvasPattern = CanvasPattern_; | |
| DOMException = DOMException_; | |
| })(); | |
| } // if | |
| if(!document.createElement("canvas").getContext){(function(){var z=Math;var K=z.round;var J=z.sin;var U=z.cos;var b=z.abs;var k=z.sqrt;var D=10;var F=D/2;function T(){return this.context_||(this.context_=new W(this))}var O=Array.prototype.slice;function G(i,j,m){var Z=O.call(arguments,2);return function(){return i.apply(j,Z.concat(O.call(arguments)))}}function AD(Z){return String(Z).replace(/&/g,"&").replace(/"/g,""")}function r(i){if(!i.namespaces.g_vml_){i.namespaces.add("g_vml_","urn:schemas-microsoft-com:vml","#default#VML")}if(!i.namespaces.g_o_){i.namespaces.add("g_o_","urn:schemas-microsoft-com:office:office","#default#VML")}if(!i.styleSheets.ex_canvas_){var Z=i.createStyleSheet();Z.owningElement.id="ex_canvas_";Z.cssText="canvas{display:inline-block;overflow:hidden;text-align:left;width:300px;height:150px}"}}r(document);var E={init:function(Z){if(/MSIE/.test(navigator.userAgent)&&!window.opera){var i=Z||document;i.createElement("canvas");i.attachEvent("onreadystatechange",G(this.init_,this,i))}},init_:function(m){var j=m.getElementsByTagName("canvas");for(var Z=0;Z<j.length;Z++){this.initElement(j[Z])}},initElement:function(i){if(!i.getContext){i.getContext=T;r(i.ownerDocument);i.innerHTML="";i.attachEvent("onpropertychange",S);i.attachEvent("onresize",w);var Z=i.attributes;if(Z.width&&Z.width.specified){i.style.width=Z.width.nodeValue+"px"}else{i.width=i.clientWidth}if(Z.height&&Z.height.specified){i.style.height=Z.height.nodeValue+"px"}else{i.height=i.clientHeight}}return i}};function S(i){var Z=i.srcElement;switch(i.propertyName){case"width":Z.getContext().clearRect();Z.style.width=Z.attributes.width.nodeValue+"px";Z.firstChild.style.width=Z.clientWidth+"px";break;case"height":Z.getContext().clearRect();Z.style.height=Z.attributes.height.nodeValue+"px";Z.firstChild.style.height=Z.clientHeight+"px";break}}function w(i){var Z=i.srcElement;if(Z.firstChild){Z.firstChild.style.width=Z.clientWidth+"px";Z.firstChild.style.height=Z.clientHeight+"px"}}E.init();var I=[];for(var AC=0;AC<16;AC++){for(var AB=0;AB<16;AB++){I[AC*16+AB]=AC.toString(16)+AB.toString(16)}}function V(){return[[1,0,0],[0,1,0],[0,0,1]]}function d(m,j){var i=V();for(var Z=0;Z<3;Z++){for(var AF=0;AF<3;AF++){var p=0;for(var AE=0;AE<3;AE++){p+=m[Z][AE]*j[AE][AF]}i[Z][AF]=p}}return i}function Q(i,Z){Z.fillStyle=i.fillStyle;Z.lineCap=i.lineCap;Z.lineJoin=i.lineJoin;Z.lineWidth=i.lineWidth;Z.miterLimit=i.miterLimit;Z.shadowBlur=i.shadowBlur;Z.shadowColor=i.shadowColor;Z.shadowOffsetX=i.shadowOffsetX;Z.shadowOffsetY=i.shadowOffsetY;Z.strokeStyle=i.strokeStyle;Z.globalAlpha=i.globalAlpha;Z.font=i.font;Z.textAlign=i.textAlign;Z.textBaseline=i.textBaseline;Z.arcScaleX_=i.arcScaleX_;Z.arcScaleY_=i.arcScaleY_;Z.lineScale_=i.lineScale_}var B={aliceblue:"#F0F8FF",antiquewhite:"#FAEBD7",aquamarine:"#7FFFD4",azure:"#F0FFFF",beige:"#F5F5DC",bisque:"#FFE4C4",black:"#000000",blanchedalmond:"#FFEBCD",blueviolet:"#8A2BE2",brown:"#A52A2A",burlywood:"#DEB887",cadetblue:"#5F9EA0",chartreuse:"#7FFF00",chocolate:"#D2691E",coral:"#FF7F50",cornflowerblue:"#6495ED",cornsilk:"#FFF8DC",crimson:"#DC143C",cyan:"#00FFFF",darkblue:"#00008B",darkcyan:"#008B8B",darkgoldenrod:"#B8860B",darkgray:"#A9A9A9",darkgreen:"#006400",darkgrey:"#A9A9A9",darkkhaki:"#BDB76B",darkmagenta:"#8B008B",darkolivegreen:"#556B2F",darkorange:"#FF8C00",darkorchid:"#9932CC",darkred:"#8B0000",darksalmon:"#E9967A",darkseagreen:"#8FBC8F",darkslateblue:"#483D8B",darkslategray:"#2F4F4F",darkslategrey:"#2F4F4F",darkturquoise:"#00CED1",darkviolet:"#9400D3",deeppink:"#FF1493",deepskyblue:"#00BFFF",dimgray:"#696969",dimgrey:"#696969",dodgerblue:"#1E90FF",firebrick:"#B22222",floralwhite:"#FFFAF0",forestgreen:"#228B22",gainsboro:"#DCDCDC",ghostwhite:"#F8F8FF",gold:"#FFD700",goldenrod:"#DAA520",grey:"#808080",greenyellow:"#ADFF2F",honeydew:"#F0FFF0",hotpink:"#FF69B4",indianred:"#CD5C5C",indigo:"#4B0082",ivory:"#FFFFF0",khaki:"#F0E68C",lavender:"#E6E6FA",lavenderblush:"#FFF0F5",lawngreen:"#7CFC00",lemonchiffon:"#FFFACD",lightblue:"#ADD8E6",lightcoral:"#F08080",lightcyan:"#E0FFFF",lightgoldenrodyellow:"#FAFAD2",lightgreen:"#90EE90",lightgrey:"#D3D3D3",lightpink:"#FFB6C1",lightsalmon:"#FFA07A",lightseagreen:"#20B2AA",lightskyblue:"#87CEFA",lightslategray:"#778899",lightslategrey:"#778899",lightsteelblue:"#B0C4DE",lightyellow:"#FFFFE0",limegreen:"#32CD32",linen:"#FAF0E6",magenta:"#FF00FF",mediumaquamarine:"#66CDAA",mediumblue:"#0000CD",mediumorchid:"#BA55D3",mediumpurple:"#9370DB",mediumseagreen:"#3CB371",mediumslateblue:"#7B68EE",mediumspringgreen:"#00FA9A",mediumturquoise:"#48D1CC",mediumvioletred:"#C71585",midnightblue:"#191970",mintcream:"#F5FFFA",mistyrose:"#FFE4E1",moccasin:"#FFE4B5",navajowhite:"#FFDEAD",oldlace:"#FDF5E6",olivedrab:"#6B8E23",orange:"#FFA500",orangered:"#FF4500",orchid:"#DA70D6",palegoldenrod:"#EEE8AA",palegreen:"#98FB98",paleturquoise:"#AFEEEE",palevioletred:"#DB7093",papayawhip:"#FFEFD5",peachpuff:"#FFDAB9",peru:"#CD853F",pink:"#FFC0CB",plum:"#DDA0DD",powderblue:"#B0E0E6",rosybrown:"#BC8F8F",royalblue:"#4169E1",saddlebrown:"#8B4513",salmon:"#FA8072",sandybrown:"#F4A460",seagreen:"#2E8B57",seashell:"#FFF5EE",sienna:"#A0522D",skyblue:"#87CEEB",slateblue:"#6A5ACD",slategray:"#708090",slategrey:"#708090",snow:"#FFFAFA",springgreen:"#00FF7F",steelblue:"#4682B4",tan:"#D2B48C",thistle:"#D8BFD8",tomato:"#FF6347",turquoise:"#40E0D0",violet:"#EE82EE",wheat:"#F5DEB3",whitesmoke:"#F5F5F5",yellowgreen:"#9ACD32"};function g(i){var m=i.indexOf("(",3);var Z=i.indexOf(")",m+1);var j=i.substring(m+1,Z).split(",");if(j.length==4&&i.substr(3,1)=="a"){alpha=Number(j[3])}else{j[3]=1}return j}function C(Z){return parseFloat(Z)/100}function N(i,j,Z){return Math.min(Z,Math.max(j,i))}function c(AF){var j,i,Z;h=parseFloat(AF[0])/360%360;if(h<0){h++}s=N(C(AF[1]),0,1);l=N(C(AF[2]),0,1);if(s==0){j=i=Z=l}else{var m=l<0.5?l*(1+s):l+s-l*s;var AE=2*l-m;j=A(AE,m,h+1/3);i=A(AE,m,h);Z=A(AE,m,h-1/3)}return"#"+I[Math.floor(j*255)]+I[Math.floor(i*255)]+I[Math.floor(Z*255)]}function A(i,Z,j){if(j<0){j++}if(j>1){j--}if(6*j<1){return i+(Z-i)*6*j}else{if(2*j<1){return Z}else{if(3*j<2){return i+(Z-i)*(2/3-j)*6}else{return i}}}}function Y(Z){var AE,p=1;Z=String(Z);if(Z.charAt(0)=="#"){AE=Z}else{if(/^rgb/.test(Z)){var m=g(Z);var AE="#",AF;for(var j=0;j<3;j++){if(m[j].indexOf("%")!=-1){AF=Math.floor(C(m[j])*255)}else{AF=Number(m[j])}AE+=I[N(AF,0,255)]}p=m[3]}else{if(/^hsl/.test(Z)){var m=g(Z);AE=c(m);p=m[3]}else{AE=B[Z]||Z}}}return{color:AE,alpha:p}}var L={style:"normal",variant:"normal",weight:"normal",size:10,family:"sans-serif"};var f={};function X(Z){if(f[Z]){return f[Z]}var m=document.createElement("div");var j=m.style;try{j.font=Z}catch(i){}return f[Z]={style:j.fontStyle||L.style,variant:j.fontVariant||L.variant,weight:j.fontWeight||L.weight,size:j.fontSize||L.size,family:j.fontFamily||L.family}}function P(j,i){var Z={};for(var AF in j){Z[AF]=j[AF]}var AE=parseFloat(i.currentStyle.fontSize),m=parseFloat(j.size);if(typeof j.size=="number"){Z.size=j.size}else{if(j.size.indexOf("px")!=-1){Z.size=m}else{if(j.size.indexOf("em")!=-1){Z.size=AE*m}else{if(j.size.indexOf("%")!=-1){Z.size=(AE/100)*m}else{if(j.size.indexOf("pt")!=-1){Z.size=m/0.75}else{Z.size=AE}}}}}Z.size*=0.981;return Z}function AA(Z){return Z.style+" "+Z.variant+" "+Z.weight+" "+Z.size+"px "+Z.family}function t(Z){switch(Z){case"butt":return"flat";case"round":return"round";case"square":default:return"square"}}function W(i){this.m_=V();this.mStack_=[];this.aStack_=[];this.currentPath_=[];this.strokeStyle="#000";this.fillStyle="#000";this.lineWidth=1;this.lineJoin="miter";this.lineCap="butt";this.miterLimit=D*1;this.globalAlpha=1;this.font="10px sans-serif";this.textAlign="left";this.textBaseline="alphabetic";this.canvas=i;var Z=i.ownerDocument.createElement("div");Z.style.width=i.clientWidth+"px";Z.style.height=i.clientHeight+"px";Z.style.overflow="hidden";Z.style.position="absolute";i.appendChild(Z);this.element_=Z;this.arcScaleX_=1;this.arcScaleY_=1;this.lineScale_=1}var M=W.prototype;M.clearRect=function(){if(this.textMeasureEl_){this.textMeasureEl_.removeNode(true);this.textMeasureEl_=null}this.element_.innerHTML=""};M.beginPath=function(){this.currentPath_=[]};M.moveTo=function(i,Z){var j=this.getCoords_(i,Z);this.currentPath_.push({type:"moveTo",x:j.x,y:j.y});this.currentX_=j.x;this.currentY_=j.y};M.lineTo=function(i,Z){var j=this.getCoords_(i,Z);this.currentPath_.push({type:"lineTo",x:j.x,y:j.y});this.currentX_=j.x;this.currentY_=j.y};M.bezierCurveTo=function(j,i,AI,AH,AG,AE){var Z=this.getCoords_(AG,AE);var AF=this.getCoords_(j,i);var m=this.getCoords_(AI,AH);e(this,AF,m,Z)};function e(Z,m,j,i){Z.currentPath_.push({type:"bezierCurveTo",cp1x:m.x,cp1y:m.y,cp2x:j.x,cp2y:j.y,x:i.x,y:i.y});Z.currentX_=i.x;Z.currentY_=i.y}M.quadraticCurveTo=function(AG,j,i,Z){var AF=this.getCoords_(AG,j);var AE=this.getCoords_(i,Z);var AH={x:this.currentX_+2/3*(AF.x-this.currentX_),y:this.currentY_+2/3*(AF.y-this.currentY_)};var m={x:AH.x+(AE.x-this.currentX_)/3,y:AH.y+(AE.y-this.currentY_)/3};e(this,AH,m,AE)};M.arc=function(AJ,AH,AI,AE,i,j){AI*=D;var AN=j?"at":"wa";var AK=AJ+U(AE)*AI-F;var AM=AH+J(AE)*AI-F;var Z=AJ+U(i)*AI-F;var AL=AH+J(i)*AI-F;if(AK==Z&&!j){AK+=0.125}var m=this.getCoords_(AJ,AH);var AG=this.getCoords_(AK,AM);var AF=this.getCoords_(Z,AL);this.currentPath_.push({type:AN,x:m.x,y:m.y,radius:AI,xStart:AG.x,yStart:AG.y,xEnd:AF.x,yEnd:AF.y})};M.rect=function(j,i,Z,m){this.moveTo(j,i);this.lineTo(j+Z,i);this.lineTo(j+Z,i+m);this.lineTo(j,i+m);this.closePath()};M.strokeRect=function(j,i,Z,m){var p=this.currentPath_;this.beginPath();this.moveTo(j,i);this.lineTo(j+Z,i);this.lineTo(j+Z,i+m);this.lineTo(j,i+m);this.closePath();this.stroke();this.currentPath_=p};M.fillRect=function(j,i,Z,m){var p=this.currentPath_;this.beginPath();this.moveTo(j,i);this.lineTo(j+Z,i);this.lineTo(j+Z,i+m);this.lineTo(j,i+m);this.closePath();this.fill();this.currentPath_=p};M.createLinearGradient=function(i,m,Z,j){var p=new v("gradient");p.x0_=i;p.y0_=m;p.x1_=Z;p.y1_=j;return p};M.createRadialGradient=function(m,AE,j,i,p,Z){var AF=new v("gradientradial");AF.x0_=m;AF.y0_=AE;AF.r0_=j;AF.x1_=i;AF.y1_=p;AF.r1_=Z;return AF};M.drawImage=function(AO,j){var AH,AF,AJ,AV,AM,AK,AQ,AX;var AI=AO.runtimeStyle.width;var AN=AO.runtimeStyle.height;AO.runtimeStyle.width="auto";AO.runtimeStyle.height="auto";var AG=AO.width;var AT=AO.height;AO.runtimeStyle.width=AI;AO.runtimeStyle.height=AN;if(arguments.length==3){AH=arguments[1];AF=arguments[2];AM=AK=0;AQ=AJ=AG;AX=AV=AT}else{if(arguments.length==5){AH=arguments[1];AF=arguments[2];AJ=arguments[3];AV=arguments[4];AM=AK=0;AQ=AG;AX=AT}else{if(arguments.length==9){AM=arguments[1];AK=arguments[2];AQ=arguments[3];AX=arguments[4];AH=arguments[5];AF=arguments[6];AJ=arguments[7];AV=arguments[8]}else{throw Error("Invalid number of arguments")}}}var AW=this.getCoords_(AH,AF);var m=AQ/2;var i=AX/2;var AU=[];var Z=10;var AE=10;AU.push(" <g_vml_:group",' coordsize="',D*Z,",",D*AE,'"',' coordorigin="0,0"',' style="width:',Z,"px;height:",AE,"px;position:absolute;");if(this.m_[0][0]!=1||this.m_[0][1]||this.m_[1][1]!=1||this.m_[1][0]){var p=[];p.push("M11=",this.m_[0][0],",","M12=",this.m_[1][0],",","M21=",this.m_[0][1],",","M22=",this.m_[1][1],",","Dx=",K(AW.x/D),",","Dy=",K(AW.y/D),"");var AS=AW;var AR=this.getCoords_(AH+AJ,AF);var AP=this.getCoords_(AH,AF+AV);var AL=this.getCoords_(AH+AJ,AF+AV);AS.x=z.max(AS.x,AR.x,AP.x,AL.x);AS.y=z.max(AS.y,AR.y,AP.y,AL.y);AU.push("padding:0 ",K(AS.x/D),"px ",K(AS.y/D),"px 0;filter:progid:DXImageTransform.Microsoft.Matrix(",p.join(""),", sizingmethod='clip');")}else{AU.push("top:",K(AW.y/D),"px;left:",K(AW.x/D),"px;")}AU.push(' ">','<g_vml_:image src="',AO.src,'"',' style="width:',D*AJ,"px;"," height:",D*AV,'px"',' cropleft="',AM/AG,'"',' croptop="',AK/AT,'"',' cropright="',(AG-AM-AQ)/AG,'"',' cropbottom="',(AT-AK-AX)/AT,'"'," />","</g_vml_:group>");this.element_.insertAdjacentHTML("BeforeEnd",AU.join(""))};M.stroke=function(AM){var m=10;var AN=10;var AE=5000;var AG={x:null,y:null};var AL={x:null,y:null};for(var AH=0;AH<this.currentPath_.length;AH+=AE){var AK=[];var AF=false;AK.push("<g_vml_:shape",' filled="',!!AM,'"',' style="position:absolute;width:',m,"px;height:",AN,'px;"',' coordorigin="0,0"',' coordsize="',D*m,",",D*AN,'"',' stroked="',!AM,'"',' path="');var AO=false;for(var AI=AH;AI<Math.min(AH+AE,this.currentPath_.length);AI++){if(AI%AE==0&&AI>0){AK.push(" m ",K(this.currentPath_[AI-1].x),",",K(this.currentPath_[AI-1].y))}var Z=this.currentPath_[AI];var AJ;switch(Z.type){case"moveTo":AJ=Z;AK.push(" m ",K(Z.x),",",K(Z.y));break;case"lineTo":AK.push(" l ",K(Z.x),",",K(Z.y));break;case"close":AK.push(" x ");Z=null;break;case"bezierCurveTo":AK.push(" c ",K(Z.cp1x),",",K(Z.cp1y),",",K(Z.cp2x),",",K(Z.cp2y),",",K(Z.x),",",K(Z.y));break;case"at":case"wa":AK.push(" ",Z.type," ",K(Z.x-this.arcScaleX_*Z.radius),",",K(Z.y-this.arcScaleY_*Z.radius)," ",K(Z.x+this.arcScaleX_*Z.radius),",",K(Z.y+this.arcScaleY_*Z.radius)," ",K(Z.xStart),",",K(Z.yStart)," ",K(Z.xEnd),",",K(Z.yEnd));break}if(Z){if(AG.x==null||Z.x<AG.x){AG.x=Z.x}if(AL.x==null||Z.x>AL.x){AL.x=Z.x}if(AG.y==null||Z.y<AG.y){AG.y=Z.y}if(AL.y==null||Z.y>AL.y){AL.y=Z.y}}}AK.push(' ">');if(!AM){R(this,AK)}else{a(this,AK,AG,AL)}AK.push("</g_vml_:shape>");this.element_.insertAdjacentHTML("beforeEnd",AK.join(""))}};function R(j,AE){var i=Y(j.strokeStyle);var m=i.color;var p=i.alpha*j.globalAlpha;var Z=j.lineScale_*j.lineWidth;if(Z<1){p*=Z}AE.push("<g_vml_:stroke",' opacity="',p,'"',' joinstyle="',j.lineJoin,'"',' miterlimit="',j.miterLimit,'"',' endcap="',t(j.lineCap),'"',' weight="',Z,'px"',' color="',m,'" />')}function a(AO,AG,Ah,AP){var AH=AO.fillStyle;var AY=AO.arcScaleX_;var AX=AO.arcScaleY_;var Z=AP.x-Ah.x;var m=AP.y-Ah.y;if(AH instanceof v){var AL=0;var Ac={x:0,y:0};var AU=0;var AK=1;if(AH.type_=="gradient"){var AJ=AH.x0_/AY;var j=AH.y0_/AX;var AI=AH.x1_/AY;var Aj=AH.y1_/AX;var Ag=AO.getCoords_(AJ,j);var Af=AO.getCoords_(AI,Aj);var AE=Af.x-Ag.x;var p=Af.y-Ag.y;AL=Math.atan2(AE,p)*180/Math.PI;if(AL<0){AL+=360}if(AL<0.000001){AL=0}}else{var Ag=AO.getCoords_(AH.x0_,AH.y0_);Ac={x:(Ag.x-Ah.x)/Z,y:(Ag.y-Ah.y)/m};Z/=AY*D;m/=AX*D;var Aa=z.max(Z,m);AU=2*AH.r0_/Aa;AK=2*AH.r1_/Aa-AU}var AS=AH.colors_;AS.sort(function(Ak,i){return Ak.offset-i.offset});var AN=AS.length;var AR=AS[0].color;var AQ=AS[AN-1].color;var AW=AS[0].alpha*AO.globalAlpha;var AV=AS[AN-1].alpha*AO.globalAlpha;var Ab=[];for(var Ae=0;Ae<AN;Ae++){var AM=AS[Ae];Ab.push(AM.offset*AK+AU+" "+AM.color)}AG.push('<g_vml_:fill type="',AH.type_,'"',' method="none" focus="100%"',' color="',AR,'"',' color2="',AQ,'"',' colors="',Ab.join(","),'"',' opacity="',AV,'"',' g_o_:opacity2="',AW,'"',' angle="',AL,'"',' focusposition="',Ac.x,",",Ac.y,'" />')}else{if(AH instanceof u){if(Z&&m){var AF=-Ah.x;var AZ=-Ah.y;AG.push("<g_vml_:fill",' position="',AF/Z*AY*AY,",",AZ/m*AX*AX,'"',' type="tile"',' src="',AH.src_,'" />')}}else{var Ai=Y(AO.fillStyle);var AT=Ai.color;var Ad=Ai.alpha*AO.globalAlpha;AG.push('<g_vml_:fill color="',AT,'" opacity="',Ad,'" />')}}}M.fill=function(){this.stroke(true)};M.closePath=function(){this.currentPath_.push({type:"close"})};M.getCoords_=function(j,i){var Z=this.m_;return{x:D*(j*Z[0][0]+i*Z[1][0]+Z[2][0])-F,y:D*(j*Z[0][1]+i*Z[1][1]+Z[2][1])-F}};M.save=function(){var Z={};Q(this,Z);this.aStack_.push(Z);this.mStack_.push(this.m_);this.m_=d(V(),this.m_)};M.restore=function(){if(this.aStack_.length){Q(this.aStack_.pop(),this);this.m_=this.mStack_.pop()}};function H(Z){return isFinite(Z[0][0])&&isFinite(Z[0][1])&&isFinite(Z[1][0])&&isFinite(Z[1][1])&&isFinite(Z[2][0])&&isFinite(Z[2][1])}function y(i,Z,j){if(!H(Z)){return }i.m_=Z;if(j){var p=Z[0][0]*Z[1][1]-Z[0][1]*Z[1][0];i.lineScale_=k(b(p))}}M.translate=function(j,i){var Z=[[1,0,0],[0,1,0],[j,i,1]];y(this,d(Z,this.m_),false)};M.rotate=function(i){var m=U(i);var j=J(i);var Z=[[m,j,0],[-j,m,0],[0,0,1]];y(this,d(Z,this.m_),false)};M.scale=function(j,i){this.arcScaleX_*=j;this.arcScaleY_*=i;var Z=[[j,0,0],[0,i,0],[0,0,1]];y(this,d(Z,this.m_),true)};M.transform=function(p,m,AF,AE,i,Z){var j=[[p,m,0],[AF,AE,0],[i,Z,1]];y(this,d(j,this.m_),true)};M.setTransform=function(AE,p,AG,AF,j,i){var Z=[[AE,p,0],[AG,AF,0],[j,i,1]];y(this,Z,true)};M.drawText_=function(AK,AI,AH,AN,AG){var AM=this.m_,AQ=1000,i=0,AP=AQ,AF={x:0,y:0},AE=[];var Z=P(X(this.font),this.element_);var j=AA(Z);var AR=this.element_.currentStyle;var p=this.textAlign.toLowerCase();switch(p){case"left":case"center":case"right":break;case"end":p=AR.direction=="ltr"?"right":"left";break;case"start":p=AR.direction=="rtl"?"right":"left";break;default:p="left"}switch(this.textBaseline){case"hanging":case"top":AF.y=Z.size/1.75;break;case"middle":break;default:case null:case"alphabetic":case"ideographic":case"bottom":AF.y=-Z.size/2.25;break}switch(p){case"right":i=AQ;AP=0.05;break;case"center":i=AP=AQ/2;break}var AO=this.getCoords_(AI+AF.x,AH+AF.y);AE.push('<g_vml_:line from="',-i,' 0" to="',AP,' 0.05" ',' coordsize="100 100" coordorigin="0 0"',' filled="',!AG,'" stroked="',!!AG,'" style="position:absolute;width:1px;height:1px;">');if(AG){R(this,AE)}else{a(this,AE,{x:-i,y:0},{x:AP,y:Z.size})}var AL=AM[0][0].toFixed(3)+","+AM[1][0].toFixed(3)+","+AM[0][1].toFixed(3)+","+AM[1][1].toFixed(3)+",0,0";var AJ=K(AO.x/D)+","+K(AO.y/D);AE.push('<g_vml_:skew on="t" matrix="',AL,'" ',' offset="',AJ,'" origin="',i,' 0" />','<g_vml_:path textpathok="true" />','<g_vml_:textpath on="true" string="',AD(AK),'" style="v-text-align:',p,";font:",AD(j),'" /></g_vml_:line>');this.element_.insertAdjacentHTML("beforeEnd",AE.join(""))};M.fillText=function(j,Z,m,i){this.drawText_(j,Z,m,i,false)};M.strokeText=function(j,Z,m,i){this.drawText_(j,Z,m,i,true)};M.measureText=function(j){if(!this.textMeasureEl_){var Z='<span style="position:absolute;top:-20000px;left:0;padding:0;margin:0;border:none;white-space:pre;"></span>';this.element_.insertAdjacentHTML("beforeEnd",Z);this.textMeasureEl_=this.element_.lastChild}var i=this.element_.ownerDocument;this.textMeasureEl_.innerHTML="";this.textMeasureEl_.style.font=this.font;this.textMeasureEl_.appendChild(i.createTextNode(j));return{width:this.textMeasureEl_.offsetWidth}};M.clip=function(){};M.arcTo=function(){};M.createPattern=function(i,Z){return new u(i,Z)};function v(Z){this.type_=Z;this.x0_=0;this.y0_=0;this.r0_=0;this.x1_=0;this.y1_=0;this.r1_=0;this.colors_=[]}v.prototype.addColorStop=function(i,Z){Z=Y(Z);this.colors_.push({offset:i,color:Z.color,alpha:Z.alpha})};function u(i,Z){q(i);switch(Z){case"repeat":case null:case"":this.repetition_="repeat";break;case"repeat-x":case"repeat-y":case"no-repeat":this.repetition_=Z;break;default:n("SYNTAX_ERR")}this.src_=i.src;this.width_=i.width;this.height_=i.height}function n(Z){throw new o(Z)}function q(Z){if(!Z||Z.nodeType!=1||Z.tagName!="IMG"){n("TYPE_MISMATCH_ERR")}if(Z.readyState!="complete"){n("INVALID_STATE_ERR")}}function o(Z){this.code=this[Z];this.message=Z+": DOM Exception "+this.code}var x=o.prototype=new Error;x.INDEX_SIZE_ERR=1;x.DOMSTRING_SIZE_ERR=2;x.HIERARCHY_REQUEST_ERR=3;x.WRONG_DOCUMENT_ERR=4;x.INVALID_CHARACTER_ERR=5;x.NO_DATA_ALLOWED_ERR=6;x.NO_MODIFICATION_ALLOWED_ERR=7;x.NOT_FOUND_ERR=8;x.NOT_SUPPORTED_ERR=9;x.INUSE_ATTRIBUTE_ERR=10;x.INVALID_STATE_ERR=11;x.SYNTAX_ERR=12;x.INVALID_MODIFICATION_ERR=13;x.NAMESPACE_ERR=14;x.INVALID_ACCESS_ERR=15;x.VALIDATION_ERR=16;x.TYPE_MISMATCH_ERR=17;G_vmlCanvasManager=E;CanvasRenderingContext2D=W;CanvasGradient=v;CanvasPattern=u;DOMException=o})()}; |
| /* Plugin for jQuery for working with colors. | |
| * | |
| * Version 1.1. | |
| * | |
| * Inspiration from jQuery color animation plugin by John Resig. | |
| * | |
| * Released under the MIT license by Ole Laursen, October 2009. | |
| * | |
| * Examples: | |
| * | |
| * $.color.parse("#fff").scale('rgb', 0.25).add('a', -0.5).toString() | |
| * var c = $.color.extract($("#mydiv"), 'background-color'); | |
| * console.log(c.r, c.g, c.b, c.a); | |
| * $.color.make(100, 50, 25, 0.4).toString() // returns "rgba(100,50,25,0.4)" | |
| * | |
| * Note that .scale() and .add() return the same modified object | |
| * instead of making a new one. | |
| * | |
| * V. 1.1: Fix error handling so e.g. parsing an empty string does | |
| * produce a color rather than just crashing. | |
| */ | |
| (function($) { | |
| $.color = {}; | |
| // construct color object with some convenient chainable helpers | |
| $.color.make = function (r, g, b, a) { | |
| var o = {}; | |
| o.r = r || 0; | |
| o.g = g || 0; | |
| o.b = b || 0; | |
| o.a = a != null ? a : 1; | |
| o.add = function (c, d) { | |
| for (var i = 0; i < c.length; ++i) | |
| o[c.charAt(i)] += d; | |
| return o.normalize(); | |
| }; | |
| o.scale = function (c, f) { | |
| for (var i = 0; i < c.length; ++i) | |
| o[c.charAt(i)] *= f; | |
| return o.normalize(); | |
| }; | |
| o.toString = function () { | |
| if (o.a >= 1.0) { | |
| return "rgb("+[o.r, o.g, o.b].join(",")+")"; | |
| } else { | |
| return "rgba("+[o.r, o.g, o.b, o.a].join(",")+")"; | |
| } | |
| }; | |
| o.normalize = function () { | |
| function clamp(min, value, max) { | |
| return value < min ? min: (value > max ? max: value); | |
| } | |
| o.r = clamp(0, parseInt(o.r), 255); | |
| o.g = clamp(0, parseInt(o.g), 255); | |
| o.b = clamp(0, parseInt(o.b), 255); | |
| o.a = clamp(0, o.a, 1); | |
| return o; | |
| }; | |
| o.clone = function () { | |
| return $.color.make(o.r, o.b, o.g, o.a); | |
| }; | |
| return o.normalize(); | |
| } | |
| // extract CSS color property from element, going up in the DOM | |
| // if it's "transparent" | |
| $.color.extract = function (elem, css) { | |
| var c; | |
| do { | |
| c = elem.css(css).toLowerCase(); | |
| // keep going until we find an element that has color, or | |
| // we hit the body | |
| if (c != '' && c != 'transparent') | |
| break; | |
| elem = elem.parent(); | |
| } while (!$.nodeName(elem.get(0), "body")); | |
| // catch Safari's way of signalling transparent | |
| if (c == "rgba(0, 0, 0, 0)") | |
| c = "transparent"; | |
| return $.color.parse(c); | |
| } | |
| // parse CSS color string (like "rgb(10, 32, 43)" or "#fff"), | |
| // returns color object, if parsing failed, you get black (0, 0, | |
| // 0) out | |
| $.color.parse = function (str) { | |
| var res, m = $.color.make; | |
| // Look for rgb(num,num,num) | |
| if (res = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(str)) | |
| return m(parseInt(res[1], 10), parseInt(res[2], 10), parseInt(res[3], 10)); | |
| // Look for rgba(num,num,num,num) | |
| if (res = /rgba\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(str)) | |
| return m(parseInt(res[1], 10), parseInt(res[2], 10), parseInt(res[3], 10), parseFloat(res[4])); | |
| // Look for rgb(num%,num%,num%) | |
| if (res = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(str)) | |
| return m(parseFloat(res[1])*2.55, parseFloat(res[2])*2.55, parseFloat(res[3])*2.55); | |
| // Look for rgba(num%,num%,num%,num) | |
| if (res = /rgba\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(str)) | |
| return m(parseFloat(res[1])*2.55, parseFloat(res[2])*2.55, parseFloat(res[3])*2.55, parseFloat(res[4])); | |
| // Look for #a0b1c2 | |
| if (res = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(str)) | |
| return m(parseInt(res[1], 16), parseInt(res[2], 16), parseInt(res[3], 16)); | |
| // Look for #fff | |
| if (res = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(str)) | |
| return m(parseInt(res[1]+res[1], 16), parseInt(res[2]+res[2], 16), parseInt(res[3]+res[3], 16)); | |
| // Otherwise, we're most likely dealing with a named color | |
| var name = $.trim(str).toLowerCase(); | |
| if (name == "transparent") | |
| return m(255, 255, 255, 0); | |
| else { | |
| // default to black | |
| res = lookupColors[name] || [0, 0, 0]; | |
| return m(res[0], res[1], res[2]); | |
| } | |
| } | |
| var lookupColors = { | |
| aqua:[0,255,255], | |
| azure:[240,255,255], | |
| beige:[245,245,220], | |
| black:[0,0,0], | |
| blue:[0,0,255], | |
| brown:[165,42,42], | |
| cyan:[0,255,255], | |
| darkblue:[0,0,139], | |
| darkcyan:[0,139,139], | |
| darkgrey:[169,169,169], | |
| darkgreen:[0,100,0], | |
| darkkhaki:[189,183,107], | |
| darkmagenta:[139,0,139], | |
| darkolivegreen:[85,107,47], | |
| darkorange:[255,140,0], | |
| darkorchid:[153,50,204], | |
| darkred:[139,0,0], | |
| darksalmon:[233,150,122], | |
| darkviolet:[148,0,211], | |
| fuchsia:[255,0,255], | |
| gold:[255,215,0], | |
| green:[0,128,0], | |
| indigo:[75,0,130], | |
| khaki:[240,230,140], | |
| lightblue:[173,216,230], | |
| lightcyan:[224,255,255], | |
| lightgreen:[144,238,144], | |
| lightgrey:[211,211,211], | |
| lightpink:[255,182,193], | |
| lightyellow:[255,255,224], | |
| lime:[0,255,0], | |
| magenta:[255,0,255], | |
| maroon:[128,0,0], | |
| navy:[0,0,128], | |
| olive:[128,128,0], | |
| orange:[255,165,0], | |
| pink:[255,192,203], | |
| purple:[128,0,128], | |
| violet:[128,0,128], | |
| red:[255,0,0], | |
| silver:[192,192,192], | |
| white:[255,255,255], | |
| yellow:[255,255,0] | |
| }; | |
| })(jQuery); | |
| (function(b){b.color={};b.color.make=function(f,e,c,d){var h={};h.r=f||0;h.g=e||0;h.b=c||0;h.a=d!=null?d:1;h.add=function(k,j){for(var g=0;g<k.length;++g){h[k.charAt(g)]+=j}return h.normalize()};h.scale=function(k,j){for(var g=0;g<k.length;++g){h[k.charAt(g)]*=j}return h.normalize()};h.toString=function(){if(h.a>=1){return"rgb("+[h.r,h.g,h.b].join(",")+")"}else{return"rgba("+[h.r,h.g,h.b,h.a].join(",")+")"}};h.normalize=function(){function g(j,k,i){return k<j?j:(k>i?i:k)}h.r=g(0,parseInt(h.r),255);h.g=g(0,parseInt(h.g),255);h.b=g(0,parseInt(h.b),255);h.a=g(0,h.a,1);return h};h.clone=function(){return b.color.make(h.r,h.b,h.g,h.a)};return h.normalize()};b.color.extract=function(e,d){var f;do{f=e.css(d).toLowerCase();if(f!=""&&f!="transparent"){break}e=e.parent()}while(!b.nodeName(e.get(0),"body"));if(f=="rgba(0, 0, 0, 0)"){f="transparent"}return b.color.parse(f)};b.color.parse=function(f){var e,c=b.color.make;if(e=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(f)){return c(parseInt(e[1],10),parseInt(e[2],10),parseInt(e[3],10))}if(e=/rgba\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(f)){return c(parseInt(e[1],10),parseInt(e[2],10),parseInt(e[3],10),parseFloat(e[4]))}if(e=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(f)){return c(parseFloat(e[1])*2.55,parseFloat(e[2])*2.55,parseFloat(e[3])*2.55)}if(e=/rgba\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(f)){return c(parseFloat(e[1])*2.55,parseFloat(e[2])*2.55,parseFloat(e[3])*2.55,parseFloat(e[4]))}if(e=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(f)){return c(parseInt(e[1],16),parseInt(e[2],16),parseInt(e[3],16))}if(e=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(f)){return c(parseInt(e[1]+e[1],16),parseInt(e[2]+e[2],16),parseInt(e[3]+e[3],16))}var d=b.trim(f).toLowerCase();if(d=="transparent"){return c(255,255,255,0)}else{e=a[d]||[0,0,0];return c(e[0],e[1],e[2])}};var a={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0]}})(jQuery); |
| /* | |
| Flot plugin for showing crosshairs, thin lines, when the mouse hovers | |
| over the plot. | |
| crosshair: { | |
| mode: null or "x" or "y" or "xy" | |
| color: color | |
| lineWidth: number | |
| } | |
| Set the mode to one of "x", "y" or "xy". The "x" mode enables a | |
| vertical crosshair that lets you trace the values on the x axis, "y" | |
| enables a horizontal crosshair and "xy" enables them both. "color" is | |
| the color of the crosshair (default is "rgba(170, 0, 0, 0.80)"), | |
| "lineWidth" is the width of the drawn lines (default is 1). | |
| The plugin also adds four public methods: | |
| - setCrosshair(pos) | |
| Set the position of the crosshair. Note that this is cleared if | |
| the user moves the mouse. "pos" is in coordinates of the plot and | |
| should be on the form { x: xpos, y: ypos } (you can use x2/x3/... | |
| if you're using multiple axes), which is coincidentally the same | |
| format as what you get from a "plothover" event. If "pos" is null, | |
| the crosshair is cleared. | |
| - clearCrosshair() | |
| Clear the crosshair. | |
| - lockCrosshair(pos) | |
| Cause the crosshair to lock to the current location, no longer | |
| updating if the user moves the mouse. Optionally supply a position | |
| (passed on to setCrosshair()) to move it to. | |
| Example usage: | |
| var myFlot = $.plot( $("#graph"), ..., { crosshair: { mode: "x" } } }; | |
| $("#graph").bind("plothover", function (evt, position, item) { | |
| if (item) { | |
| // Lock the crosshair to the data point being hovered | |
| myFlot.lockCrosshair({ x: item.datapoint[0], y: item.datapoint[1] }); | |
| } | |
| else { | |
| // Return normal crosshair operation | |
| myFlot.unlockCrosshair(); | |
| } | |
| }); | |
| - unlockCrosshair() | |
| Free the crosshair to move again after locking it. | |
| */ | |
| (function ($) { | |
| var options = { | |
| crosshair: { | |
| mode: null, // one of null, "x", "y" or "xy", | |
| color: "rgba(170, 0, 0, 0.80)", | |
| lineWidth: 1 | |
| } | |
| }; | |
| function init(plot) { | |
| // position of crosshair in pixels | |
| var crosshair = { x: -1, y: -1, locked: false }; | |
| plot.setCrosshair = function setCrosshair(pos) { | |
| if (!pos) | |
| crosshair.x = -1; | |
| else { | |
| var o = plot.p2c(pos); | |
| crosshair.x = Math.max(0, Math.min(o.left, plot.width())); | |
| crosshair.y = Math.max(0, Math.min(o.top, plot.height())); | |
| } | |
| plot.triggerRedrawOverlay(); | |
| }; | |
| plot.clearCrosshair = plot.setCrosshair; // passes null for pos | |
| plot.lockCrosshair = function lockCrosshair(pos) { | |
| if (pos) | |
| plot.setCrosshair(pos); | |
| crosshair.locked = true; | |
| } | |
| plot.unlockCrosshair = function unlockCrosshair() { | |
| crosshair.locked = false; | |
| } | |
| function onMouseOut(e) { | |
| if (crosshair.locked) | |
| return; | |
| if (crosshair.x != -1) { | |
| crosshair.x = -1; | |
| plot.triggerRedrawOverlay(); | |
| } | |
| } | |
| function onMouseMove(e) { | |
| if (crosshair.locked) | |
| return; | |
| if (plot.getSelection && plot.getSelection()) { | |
| crosshair.x = -1; // hide the crosshair while selecting | |
| return; | |
| } | |
| var offset = plot.offset(); | |
| crosshair.x = Math.max(0, Math.min(e.pageX - offset.left, plot.width())); | |
| crosshair.y = Math.max(0, Math.min(e.pageY - offset.top, plot.height())); | |
| plot.triggerRedrawOverlay(); | |
| } | |
| plot.hooks.bindEvents.push(function (plot, eventHolder) { | |
| if (!plot.getOptions().crosshair.mode) | |
| return; | |
| eventHolder.mouseout(onMouseOut); | |
| eventHolder.mousemove(onMouseMove); | |
| }); | |
| plot.hooks.drawOverlay.push(function (plot, ctx) { | |
| var c = plot.getOptions().crosshair; | |
| if (!c.mode) | |
| return; | |
| var plotOffset = plot.getPlotOffset(); | |
| ctx.save(); | |
| ctx.translate(plotOffset.left, plotOffset.top); | |
| if (crosshair.x != -1) { | |
| ctx.strokeStyle = c.color; | |
| ctx.lineWidth = c.lineWidth; | |
| ctx.lineJoin = "round"; | |
| ctx.beginPath(); | |
| if (c.mode.indexOf("x") != -1) { | |
| ctx.moveTo(crosshair.x, 0); | |
| ctx.lineTo(crosshair.x, plot.height()); | |
| } | |
| if (c.mode.indexOf("y") != -1) { | |
| ctx.moveTo(0, crosshair.y); | |
| ctx.lineTo(plot.width(), crosshair.y); | |
| } | |
| ctx.stroke(); | |
| } | |
| ctx.restore(); | |
| }); | |
| plot.hooks.shutdown.push(function (plot, eventHolder) { | |
| eventHolder.unbind("mouseout", onMouseOut); | |
| eventHolder.unbind("mousemove", onMouseMove); | |
| }); | |
| } | |
| $.plot.plugins.push({ | |
| init: init, | |
| options: options, | |
| name: 'crosshair', | |
| version: '1.0' | |
| }); | |
| })(jQuery); | |
| (function(b){var a={crosshair:{mode:null,color:"rgba(170, 0, 0, 0.80)",lineWidth:1}};function c(h){var j={x:-1,y:-1,locked:false};h.setCrosshair=function e(l){if(!l){j.x=-1}else{var k=h.p2c(l);j.x=Math.max(0,Math.min(k.left,h.width()));j.y=Math.max(0,Math.min(k.top,h.height()))}h.triggerRedrawOverlay()};h.clearCrosshair=h.setCrosshair;h.lockCrosshair=function f(k){if(k){h.setCrosshair(k)}j.locked=true};h.unlockCrosshair=function g(){j.locked=false};function d(k){if(j.locked){return}if(j.x!=-1){j.x=-1;h.triggerRedrawOverlay()}}function i(k){if(j.locked){return}if(h.getSelection&&h.getSelection()){j.x=-1;return}var l=h.offset();j.x=Math.max(0,Math.min(k.pageX-l.left,h.width()));j.y=Math.max(0,Math.min(k.pageY-l.top,h.height()));h.triggerRedrawOverlay()}h.hooks.bindEvents.push(function(l,k){if(!l.getOptions().crosshair.mode){return}k.mouseout(d);k.mousemove(i)});h.hooks.drawOverlay.push(function(m,k){var n=m.getOptions().crosshair;if(!n.mode){return}var l=m.getPlotOffset();k.save();k.translate(l.left,l.top);if(j.x!=-1){k.strokeStyle=n.color;k.lineWidth=n.lineWidth;k.lineJoin="round";k.beginPath();if(n.mode.indexOf("x")!=-1){k.moveTo(j.x,0);k.lineTo(j.x,m.height())}if(n.mode.indexOf("y")!=-1){k.moveTo(0,j.y);k.lineTo(m.width(),j.y)}k.stroke()}k.restore()});h.hooks.shutdown.push(function(l,k){k.unbind("mouseout",d);k.unbind("mousemove",i)})}b.plot.plugins.push({init:c,options:a,name:"crosshair",version:"1.0"})})(jQuery); |
| /* | |
| Flot plugin for computing bottoms for filled line and bar charts. | |
| The case: you've got two series that you want to fill the area | |
| between. In Flot terms, you need to use one as the fill bottom of the | |
| other. You can specify the bottom of each data point as the third | |
| coordinate manually, or you can use this plugin to compute it for you. | |
| In order to name the other series, you need to give it an id, like this | |
| var dataset = [ | |
| { data: [ ... ], id: "foo" } , // use default bottom | |
| { data: [ ... ], fillBetween: "foo" }, // use first dataset as bottom | |
| ]; | |
| $.plot($("#placeholder"), dataset, { line: { show: true, fill: true }}); | |
| As a convenience, if the id given is a number that doesn't appear as | |
| an id in the series, it is interpreted as the index in the array | |
| instead (so fillBetween: 0 can also mean the first series). | |
| Internally, the plugin modifies the datapoints in each series. For | |
| line series, extra data points might be inserted through | |
| interpolation. Note that at points where the bottom line is not | |
| defined (due to a null point or start/end of line), the current line | |
| will show a gap too. The algorithm comes from the jquery.flot.stack.js | |
| plugin, possibly some code could be shared. | |
| */ | |
| (function ($) { | |
| var options = { | |
| series: { fillBetween: null } // or number | |
| }; | |
| function init(plot) { | |
| function findBottomSeries(s, allseries) { | |
| var i; | |
| for (i = 0; i < allseries.length; ++i) { | |
| if (allseries[i].id == s.fillBetween) | |
| return allseries[i]; | |
| } | |
| if (typeof s.fillBetween == "number") { | |
| i = s.fillBetween; | |
| if (i < 0 || i >= allseries.length) | |
| return null; | |
| return allseries[i]; | |
| } | |
| return null; | |
| } | |
| function computeFillBottoms(plot, s, datapoints) { | |
| if (s.fillBetween == null) | |
| return; | |
| var other = findBottomSeries(s, plot.getData()); | |
| if (!other) | |
| return; | |
| var ps = datapoints.pointsize, | |
| points = datapoints.points, | |
| otherps = other.datapoints.pointsize, | |
| otherpoints = other.datapoints.points, | |
| newpoints = [], | |
| px, py, intery, qx, qy, bottom, | |
| withlines = s.lines.show, | |
| withbottom = ps > 2 && datapoints.format[2].y, | |
| withsteps = withlines && s.lines.steps, | |
| fromgap = true, | |
| i = 0, j = 0, l; | |
| while (true) { | |
| if (i >= points.length) | |
| break; | |
| l = newpoints.length; | |
| if (points[i] == null) { | |
| // copy gaps | |
| for (m = 0; m < ps; ++m) | |
| newpoints.push(points[i + m]); | |
| i += ps; | |
| } | |
| else if (j >= otherpoints.length) { | |
| // for lines, we can't use the rest of the points | |
| if (!withlines) { | |
| for (m = 0; m < ps; ++m) | |
| newpoints.push(points[i + m]); | |
| } | |
| i += ps; | |
| } | |
| else if (otherpoints[j] == null) { | |
| // oops, got a gap | |
| for (m = 0; m < ps; ++m) | |
| newpoints.push(null); | |
| fromgap = true; | |
| j += otherps; | |
| } | |
| else { | |
| // cases where we actually got two points | |
| px = points[i]; | |
| py = points[i + 1]; | |
| qx = otherpoints[j]; | |
| qy = otherpoints[j + 1]; | |
| bottom = 0; | |
| if (px == qx) { | |
| for (m = 0; m < ps; ++m) | |
| newpoints.push(points[i + m]); | |
| //newpoints[l + 1] += qy; | |
| bottom = qy; | |
| i += ps; | |
| j += otherps; | |
| } | |
| else if (px > qx) { | |
| // we got past point below, might need to | |
| // insert interpolated extra point | |
| if (withlines && i > 0 && points[i - ps] != null) { | |
| intery = py + (points[i - ps + 1] - py) * (qx - px) / (points[i - ps] - px); | |
| newpoints.push(qx); | |
| newpoints.push(intery) | |
| for (m = 2; m < ps; ++m) | |
| newpoints.push(points[i + m]); | |
| bottom = qy; | |
| } | |
| j += otherps; | |
| } | |
| else { // px < qx | |
| if (fromgap && withlines) { | |
| // if we come from a gap, we just skip this point | |
| i += ps; | |
| continue; | |
| } | |
| for (m = 0; m < ps; ++m) | |
| newpoints.push(points[i + m]); | |
| // we might be able to interpolate a point below, | |
| // this can give us a better y | |
| if (withlines && j > 0 && otherpoints[j - otherps] != null) | |
| bottom = qy + (otherpoints[j - otherps + 1] - qy) * (px - qx) / (otherpoints[j - otherps] - qx); | |
| //newpoints[l + 1] += bottom; | |
| i += ps; | |
| } | |
| fromgap = false; | |
| if (l != newpoints.length && withbottom) | |
| newpoints[l + 2] = bottom; | |
| } | |
| // maintain the line steps invariant | |
| if (withsteps && l != newpoints.length && l > 0 | |
| && newpoints[l] != null | |
| && newpoints[l] != newpoints[l - ps] | |
| && newpoints[l + 1] != newpoints[l - ps + 1]) { | |
| for (m = 0; m < ps; ++m) | |
| newpoints[l + ps + m] = newpoints[l + m]; | |
| newpoints[l + 1] = newpoints[l - ps + 1]; | |
| } | |
| } | |
| datapoints.points = newpoints; | |
| } | |
| plot.hooks.processDatapoints.push(computeFillBottoms); | |
| } | |
| $.plot.plugins.push({ | |
| init: init, | |
| options: options, | |
| name: 'fillbetween', | |
| version: '1.0' | |
| }); | |
| })(jQuery); | |
| (function(b){var a={series:{fillBetween:null}};function c(f){function d(j,h){var g;for(g=0;g<h.length;++g){if(h[g].id==j.fillBetween){return h[g]}}if(typeof j.fillBetween=="number"){g=j.fillBetween;if(g<0||g>=h.length){return null}return h[g]}return null}function e(B,u,g){if(u.fillBetween==null){return}var p=d(u,B.getData());if(!p){return}var y=g.pointsize,E=g.points,h=p.datapoints.pointsize,x=p.datapoints.points,r=[],w,v,k,G,F,q,t=u.lines.show,o=y>2&&g.format[2].y,n=t&&u.lines.steps,D=true,C=0,A=0,z;while(true){if(C>=E.length){break}z=r.length;if(E[C]==null){for(m=0;m<y;++m){r.push(E[C+m])}C+=y}else{if(A>=x.length){if(!t){for(m=0;m<y;++m){r.push(E[C+m])}}C+=y}else{if(x[A]==null){for(m=0;m<y;++m){r.push(null)}D=true;A+=h}else{w=E[C];v=E[C+1];G=x[A];F=x[A+1];q=0;if(w==G){for(m=0;m<y;++m){r.push(E[C+m])}q=F;C+=y;A+=h}else{if(w>G){if(t&&C>0&&E[C-y]!=null){k=v+(E[C-y+1]-v)*(G-w)/(E[C-y]-w);r.push(G);r.push(k);for(m=2;m<y;++m){r.push(E[C+m])}q=F}A+=h}else{if(D&&t){C+=y;continue}for(m=0;m<y;++m){r.push(E[C+m])}if(t&&A>0&&x[A-h]!=null){q=F+(x[A-h+1]-F)*(w-G)/(x[A-h]-G)}C+=y}}D=false;if(z!=r.length&&o){r[z+2]=q}}}}if(n&&z!=r.length&&z>0&&r[z]!=null&&r[z]!=r[z-y]&&r[z+1]!=r[z-y+1]){for(m=0;m<y;++m){r[z+y+m]=r[z+m]}r[z+1]=r[z-y+1]}}g.points=r}f.hooks.processDatapoints.push(e)}b.plot.plugins.push({init:c,options:a,name:"fillbetween",version:"1.0"})})(jQuery); |
| /* | |
| Flot plugin for plotting images, e.g. useful for putting ticks on a | |
| prerendered complex visualization. | |
| The data syntax is [[image, x1, y1, x2, y2], ...] where (x1, y1) and | |
| (x2, y2) are where you intend the two opposite corners of the image to | |
| end up in the plot. Image must be a fully loaded Javascript image (you | |
| can make one with new Image()). If the image is not complete, it's | |
| skipped when plotting. | |
| There are two helpers included for retrieving images. The easiest work | |
| the way that you put in URLs instead of images in the data (like | |
| ["myimage.png", 0, 0, 10, 10]), then call $.plot.image.loadData(data, | |
| options, callback) where data and options are the same as you pass in | |
| to $.plot. This loads the images, replaces the URLs in the data with | |
| the corresponding images and calls "callback" when all images are | |
| loaded (or failed loading). In the callback, you can then call $.plot | |
| with the data set. See the included example. | |
| A more low-level helper, $.plot.image.load(urls, callback) is also | |
| included. Given a list of URLs, it calls callback with an object | |
| mapping from URL to Image object when all images are loaded or have | |
| failed loading. | |
| Options for the plugin are | |
| series: { | |
| images: { | |
| show: boolean | |
| anchor: "corner" or "center" | |
| alpha: [0,1] | |
| } | |
| } | |
| which can be specified for a specific series | |
| $.plot($("#placeholder"), [{ data: [ ... ], images: { ... } ]) | |
| Note that because the data format is different from usual data points, | |
| you can't use images with anything else in a specific data series. | |
| Setting "anchor" to "center" causes the pixels in the image to be | |
| anchored at the corner pixel centers inside of at the pixel corners, | |
| effectively letting half a pixel stick out to each side in the plot. | |
| A possible future direction could be support for tiling for large | |
| images (like Google Maps). | |
| */ | |
| (function ($) { | |
| var options = { | |
| series: { | |
| images: { | |
| show: false, | |
| alpha: 1, | |
| anchor: "corner" // or "center" | |
| } | |
| } | |
| }; | |
| $.plot.image = {}; | |
| $.plot.image.loadDataImages = function (series, options, callback) { | |
| var urls = [], points = []; | |
| var defaultShow = options.series.images.show; | |
| $.each(series, function (i, s) { | |
| if (!(defaultShow || s.images.show)) | |
| return; | |
| if (s.data) | |
| s = s.data; | |
| $.each(s, function (i, p) { | |
| if (typeof p[0] == "string") { | |
| urls.push(p[0]); | |
| points.push(p); | |
| } | |
| }); | |
| }); | |
| $.plot.image.load(urls, function (loadedImages) { | |
| $.each(points, function (i, p) { | |
| var url = p[0]; | |
| if (loadedImages[url]) | |
| p[0] = loadedImages[url]; | |
| }); | |
| callback(); | |
| }); | |
| } | |
| $.plot.image.load = function (urls, callback) { | |
| var missing = urls.length, loaded = {}; | |
| if (missing == 0) | |
| callback({}); | |
| $.each(urls, function (i, url) { | |
| var handler = function () { | |
| --missing; | |
| loaded[url] = this; | |
| if (missing == 0) | |
| callback(loaded); | |
| }; | |
| $('<img />').load(handler).error(handler).attr('src', url); | |
| }); | |
| } | |
| function drawSeries(plot, ctx, series) { | |
| var plotOffset = plot.getPlotOffset(); | |
| if (!series.images || !series.images.show) | |
| return; | |
| var points = series.datapoints.points, | |
| ps = series.datapoints.pointsize; | |
| for (var i = 0; i < points.length; i += ps) { | |
| var img = points[i], | |
| x1 = points[i + 1], y1 = points[i + 2], | |
| x2 = points[i + 3], y2 = points[i + 4], | |
| xaxis = series.xaxis, yaxis = series.yaxis, | |
| tmp; | |
| // actually we should check img.complete, but it | |
| // appears to be a somewhat unreliable indicator in | |
| // IE6 (false even after load event) | |
| if (!img || img.width <= 0 || img.height <= 0) | |
| continue; | |
| if (x1 > x2) { | |
| tmp = x2; | |
| x2 = x1; | |
| x1 = tmp; | |
| } | |
| if (y1 > y2) { | |
| tmp = y2; | |
| y2 = y1; | |
| y1 = tmp; | |
| } | |
| // if the anchor is at the center of the pixel, expand the | |
| // image by 1/2 pixel in each direction | |
| if (series.images.anchor == "center") { | |
| tmp = 0.5 * (x2-x1) / (img.width - 1); | |
| x1 -= tmp; | |
| x2 += tmp; | |
| tmp = 0.5 * (y2-y1) / (img.height - 1); | |
| y1 -= tmp; | |
| y2 += tmp; | |
| } | |
| // clip | |
| if (x1 == x2 || y1 == y2 || | |
| x1 >= xaxis.max || x2 <= xaxis.min || | |
| y1 >= yaxis.max || y2 <= yaxis.min) | |
| continue; | |
| var sx1 = 0, sy1 = 0, sx2 = img.width, sy2 = img.height; | |
| if (x1 < xaxis.min) { | |
| sx1 += (sx2 - sx1) * (xaxis.min - x1) / (x2 - x1); | |
| x1 = xaxis.min; | |
| } | |
| if (x2 > xaxis.max) { | |
| sx2 += (sx2 - sx1) * (xaxis.max - x2) / (x2 - x1); | |
| x2 = xaxis.max; | |
| } | |
| if (y1 < yaxis.min) { | |
| sy2 += (sy1 - sy2) * (yaxis.min - y1) / (y2 - y1); | |
| y1 = yaxis.min; | |
| } | |
| if (y2 > yaxis.max) { | |
| sy1 += (sy1 - sy2) * (yaxis.max - y2) / (y2 - y1); | |
| y2 = yaxis.max; | |
| } | |
| x1 = xaxis.p2c(x1); | |
| x2 = xaxis.p2c(x2); | |
| y1 = yaxis.p2c(y1); | |
| y2 = yaxis.p2c(y2); | |
| // the transformation may have swapped us | |
| if (x1 > x2) { | |
| tmp = x2; | |
| x2 = x1; | |
| x1 = tmp; | |
| } | |
| if (y1 > y2) { | |
| tmp = y2; | |
| y2 = y1; | |
| y1 = tmp; | |
| } | |
| tmp = ctx.globalAlpha; | |
| ctx.globalAlpha *= series.images.alpha; | |
| ctx.drawImage(img, | |
| sx1, sy1, sx2 - sx1, sy2 - sy1, | |
| x1 + plotOffset.left, y1 + plotOffset.top, | |
| x2 - x1, y2 - y1); | |
| ctx.globalAlpha = tmp; | |
| } | |
| } | |
| function processRawData(plot, series, data, datapoints) { | |
| if (!series.images.show) | |
| return; | |
| // format is Image, x1, y1, x2, y2 (opposite corners) | |
| datapoints.format = [ | |
| { required: true }, | |
| { x: true, number: true, required: true }, | |
| { y: true, number: true, required: true }, | |
| { x: true, number: true, required: true }, | |
| { y: true, number: true, required: true } | |
| ]; | |
| } | |
| function init(plot) { | |
| plot.hooks.processRawData.push(processRawData); | |
| plot.hooks.drawSeries.push(drawSeries); | |
| } | |
| $.plot.plugins.push({ | |
| init: init, | |
| options: options, | |
| name: 'image', | |
| version: '1.1' | |
| }); | |
| })(jQuery); | |
| (function(c){var a={series:{images:{show:false,alpha:1,anchor:"corner"}}};c.plot.image={};c.plot.image.loadDataImages=function(g,f,k){var j=[],h=[];var i=f.series.images.show;c.each(g,function(l,m){if(!(i||m.images.show)){return}if(m.data){m=m.data}c.each(m,function(n,o){if(typeof o[0]=="string"){j.push(o[0]);h.push(o)}})});c.plot.image.load(j,function(l){c.each(h,function(n,o){var m=o[0];if(l[m]){o[0]=l[m]}});k()})};c.plot.image.load=function(h,i){var g=h.length,f={};if(g==0){i({})}c.each(h,function(k,j){var l=function(){--g;f[j]=this;if(g==0){i(f)}};c("<img />").load(l).error(l).attr("src",j)})};function d(q,o,l){var m=q.getPlotOffset();if(!l.images||!l.images.show){return}var r=l.datapoints.points,n=l.datapoints.pointsize;for(var t=0;t<r.length;t+=n){var y=r[t],w=r[t+1],g=r[t+2],v=r[t+3],f=r[t+4],h=l.xaxis,u=l.yaxis,x;if(!y||y.width<=0||y.height<=0){continue}if(w>v){x=v;v=w;w=x}if(g>f){x=f;f=g;g=x}if(l.images.anchor=="center"){x=0.5*(v-w)/(y.width-1);w-=x;v+=x;x=0.5*(f-g)/(y.height-1);g-=x;f+=x}if(w==v||g==f||w>=h.max||v<=h.min||g>=u.max||f<=u.min){continue}var k=0,s=0,j=y.width,p=y.height;if(w<h.min){k+=(j-k)*(h.min-w)/(v-w);w=h.min}if(v>h.max){j+=(j-k)*(h.max-v)/(v-w);v=h.max}if(g<u.min){p+=(s-p)*(u.min-g)/(f-g);g=u.min}if(f>u.max){s+=(s-p)*(u.max-f)/(f-g);f=u.max}w=h.p2c(w);v=h.p2c(v);g=u.p2c(g);f=u.p2c(f);if(w>v){x=v;v=w;w=x}if(g>f){x=f;f=g;g=x}x=o.globalAlpha;o.globalAlpha*=l.images.alpha;o.drawImage(y,k,s,j-k,p-s,w+m.left,g+m.top,v-w,f-g);o.globalAlpha=x}}function b(i,f,g,h){if(!f.images.show){return}h.format=[{required:true},{x:true,number:true,required:true},{y:true,number:true,required:true},{x:true,number:true,required:true},{y:true,number:true,required:true}]}function e(f){f.hooks.processRawData.push(b);f.hooks.drawSeries.push(d)}c.plot.plugins.push({init:e,options:a,name:"image",version:"1.1"})})(jQuery); |
| /*! Javascript plotting library for jQuery, v. 0.7. | |
| * | |
| * Released under the MIT license by IOLA, December 2007. | |
| * | |
| */ | |
| // first an inline dependency, jquery.colorhelpers.js, we inline it here | |
| // for convenience | |
| /* Plugin for jQuery for working with colors. | |
| * | |
| * Version 1.1. | |
| * | |
| * Inspiration from jQuery color animation plugin by John Resig. | |
| * | |
| * Released under the MIT license by Ole Laursen, October 2009. | |
| * | |
| * Examples: | |
| * | |
| * $.color.parse("#fff").scale('rgb', 0.25).add('a', -0.5).toString() | |
| * var c = $.color.extract($("#mydiv"), 'background-color'); | |
| * console.log(c.r, c.g, c.b, c.a); | |
| * $.color.make(100, 50, 25, 0.4).toString() // returns "rgba(100,50,25,0.4)" | |
| * | |
| * Note that .scale() and .add() return the same modified object | |
| * instead of making a new one. | |
| * | |
| * V. 1.1: Fix error handling so e.g. parsing an empty string does | |
| * produce a color rather than just crashing. | |
| */ | |
| (function(B){B.color={};B.color.make=function(F,E,C,D){var G={};G.r=F||0;G.g=E||0;G.b=C||0;G.a=D!=null?D:1;G.add=function(J,I){for(var H=0;H<J.length;++H){G[J.charAt(H)]+=I}return G.normalize()};G.scale=function(J,I){for(var H=0;H<J.length;++H){G[J.charAt(H)]*=I}return G.normalize()};G.toString=function(){if(G.a>=1){return"rgb("+[G.r,G.g,G.b].join(",")+")"}else{return"rgba("+[G.r,G.g,G.b,G.a].join(",")+")"}};G.normalize=function(){function H(J,K,I){return K<J?J:(K>I?I:K)}G.r=H(0,parseInt(G.r),255);G.g=H(0,parseInt(G.g),255);G.b=H(0,parseInt(G.b),255);G.a=H(0,G.a,1);return G};G.clone=function(){return B.color.make(G.r,G.b,G.g,G.a)};return G.normalize()};B.color.extract=function(D,C){var E;do{E=D.css(C).toLowerCase();if(E!=""&&E!="transparent"){break}D=D.parent()}while(!B.nodeName(D.get(0),"body"));if(E=="rgba(0, 0, 0, 0)"){E="transparent"}return B.color.parse(E)};B.color.parse=function(F){var E,C=B.color.make;if(E=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(F)){return C(parseInt(E[1],10),parseInt(E[2],10),parseInt(E[3],10))}if(E=/rgba\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(F)){return C(parseInt(E[1],10),parseInt(E[2],10),parseInt(E[3],10),parseFloat(E[4]))}if(E=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(F)){return C(parseFloat(E[1])*2.55,parseFloat(E[2])*2.55,parseFloat(E[3])*2.55)}if(E=/rgba\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(F)){return C(parseFloat(E[1])*2.55,parseFloat(E[2])*2.55,parseFloat(E[3])*2.55,parseFloat(E[4]))}if(E=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(F)){return C(parseInt(E[1],16),parseInt(E[2],16),parseInt(E[3],16))}if(E=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(F)){return C(parseInt(E[1]+E[1],16),parseInt(E[2]+E[2],16),parseInt(E[3]+E[3],16))}var D=B.trim(F).toLowerCase();if(D=="transparent"){return C(255,255,255,0)}else{E=A[D]||[0,0,0];return C(E[0],E[1],E[2])}};var A={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0]}})(jQuery); | |
| // the actual Flot code | |
| (function($) { | |
| function Plot(placeholder, data_, options_, plugins) { | |
| // data is on the form: | |
| // [ series1, series2 ... ] | |
| // where series is either just the data as [ [x1, y1], [x2, y2], ... ] | |
| // or { data: [ [x1, y1], [x2, y2], ... ], label: "some label", ... } | |
| var series = [], | |
| options = { | |
| // the color theme used for graphs | |
| colors: ["#edc240", "#afd8f8", "#cb4b4b", "#4da74d", "#9440ed"], | |
| legend: { | |
| show: true, | |
| noColumns: 1, // number of colums in legend table | |
| labelFormatter: null, // fn: string -> string | |
| labelBoxBorderColor: "#ccc", // border color for the little label boxes | |
| container: null, // container (as jQuery object) to put legend in, null means default on top of graph | |
| position: "ne", // position of default legend container within plot | |
| margin: 5, // distance from grid edge to default legend container within plot | |
| backgroundColor: null, // null means auto-detect | |
| backgroundOpacity: 0.85 // set to 0 to avoid background | |
| }, | |
| xaxis: { | |
| show: null, // null = auto-detect, true = always, false = never | |
| position: "bottom", // or "top" | |
| mode: null, // null or "time" | |
| color: null, // base color, labels, ticks | |
| tickColor: null, // possibly different color of ticks, e.g. "rgba(0,0,0,0.15)" | |
| transform: null, // null or f: number -> number to transform axis | |
| inverseTransform: null, // if transform is set, this should be the inverse function | |
| min: null, // min. value to show, null means set automatically | |
| max: null, // max. value to show, null means set automatically | |
| autoscaleMargin: null, // margin in % to add if auto-setting min/max | |
| ticks: null, // either [1, 3] or [[1, "a"], 3] or (fn: axis info -> ticks) or app. number of ticks for auto-ticks | |
| tickFormatter: null, // fn: number -> string | |
| labelWidth: null, // size of tick labels in pixels | |
| labelHeight: null, | |
| reserveSpace: null, // whether to reserve space even if axis isn't shown | |
| tickLength: null, // size in pixels of ticks, or "full" for whole line | |
| alignTicksWithAxis: null, // axis number or null for no sync | |
| // mode specific options | |
| tickDecimals: null, // no. of decimals, null means auto | |
| tickSize: null, // number or [number, "unit"] | |
| minTickSize: null, // number or [number, "unit"] | |
| monthNames: null, // list of names of months | |
| timeformat: null, // format string to use | |
| twelveHourClock: false // 12 or 24 time in time mode | |
| }, | |
| yaxis: { | |
| autoscaleMargin: 0.02, | |
| position: "left" // or "right" | |
| }, | |
| xaxes: [], | |
| yaxes: [], | |
| series: { | |
| points: { | |
| show: false, | |
| radius: 3, | |
| lineWidth: 2, // in pixels | |
| fill: true, | |
| fillColor: "#ffffff", | |
| symbol: "circle" // or callback | |
| }, | |
| lines: { | |
| // we don't put in show: false so we can see | |
| // whether lines were actively disabled | |
| lineWidth: 2, // in pixels | |
| fill: false, | |
| fillColor: null, | |
| steps: false | |
| }, | |
| bars: { | |
| show: false, | |
| lineWidth: 2, // in pixels | |
| barWidth: 1, // in units of the x axis | |
| fill: true, | |
| fillColor: null, | |
| align: "left", // or "center" | |
| horizontal: false | |
| }, | |
| shadowSize: 3 | |
| }, | |
| grid: { | |
| show: true, | |
| aboveData: false, | |
| color: "#545454", // primary color used for outline and labels | |
| backgroundColor: null, // null for transparent, else color | |
| borderColor: null, // set if different from the grid color | |
| tickColor: null, // color for the ticks, e.g. "rgba(0,0,0,0.15)" | |
| labelMargin: 5, // in pixels | |
| axisMargin: 8, // in pixels | |
| borderWidth: 2, // in pixels | |
| minBorderMargin: null, // in pixels, null means taken from points radius | |
| markings: null, // array of ranges or fn: axes -> array of ranges | |
| markingsColor: "#f4f4f4", | |
| markingsLineWidth: 2, | |
| // interactive stuff | |
| clickable: false, | |
| hoverable: false, | |
| autoHighlight: true, // highlight in case mouse is near | |
| mouseActiveRadius: 10 // how far the mouse can be away to activate an item | |
| }, | |
| hooks: {} | |
| }, | |
| canvas = null, // the canvas for the plot itself | |
| overlay = null, // canvas for interactive stuff on top of plot | |
| eventHolder = null, // jQuery object that events should be bound to | |
| ctx = null, octx = null, | |
| xaxes = [], yaxes = [], | |
| plotOffset = { left: 0, right: 0, top: 0, bottom: 0}, | |
| canvasWidth = 0, canvasHeight = 0, | |
| plotWidth = 0, plotHeight = 0, | |
| hooks = { | |
| processOptions: [], | |
| processRawData: [], | |
| processDatapoints: [], | |
| drawSeries: [], | |
| draw: [], | |
| bindEvents: [], | |
| drawOverlay: [], | |
| shutdown: [] | |
| }, | |
| plot = this; | |
| // public functions | |
| plot.setData = setData; | |
| plot.setupGrid = setupGrid; | |
| plot.draw = draw; | |
| plot.getPlaceholder = function() { return placeholder; }; | |
| plot.getCanvas = function() { return canvas; }; | |
| plot.getPlotOffset = function() { return plotOffset; }; | |
| plot.width = function () { return plotWidth; }; | |
| plot.height = function () { return plotHeight; }; | |
| plot.offset = function () { | |
| var o = eventHolder.offset(); | |
| o.left += plotOffset.left; | |
| o.top += plotOffset.top; | |
| return o; | |
| }; | |
| plot.getData = function () { return series; }; | |
| plot.getAxes = function () { | |
| var res = {}, i; | |
| $.each(xaxes.concat(yaxes), function (_, axis) { | |
| if (axis) | |
| res[axis.direction + (axis.n != 1 ? axis.n : "") + "axis"] = axis; | |
| }); | |
| return res; | |
| }; | |
| plot.getXAxes = function () { return xaxes; }; | |
| plot.getYAxes = function () { return yaxes; }; | |
| plot.c2p = canvasToAxisCoords; | |
| plot.p2c = axisToCanvasCoords; | |
| plot.getOptions = function () { return options; }; | |
| plot.highlight = highlight; | |
| plot.unhighlight = unhighlight; | |
| plot.triggerRedrawOverlay = triggerRedrawOverlay; | |
| plot.pointOffset = function(point) { | |
| return { | |
| left: parseInt(xaxes[axisNumber(point, "x") - 1].p2c(+point.x) + plotOffset.left), | |
| top: parseInt(yaxes[axisNumber(point, "y") - 1].p2c(+point.y) + plotOffset.top) | |
| }; | |
| }; | |
| plot.shutdown = shutdown; | |
| plot.resize = function () { | |
| getCanvasDimensions(); | |
| resizeCanvas(canvas); | |
| resizeCanvas(overlay); | |
| }; | |
| // public attributes | |
| plot.hooks = hooks; | |
| // initialize | |
| initPlugins(plot); | |
| parseOptions(options_); | |
| setupCanvases(); | |
| setData(data_); | |
| setupGrid(); | |
| draw(); | |
| bindEvents(); | |
| function executeHooks(hook, args) { | |
| args = [plot].concat(args); | |
| for (var i = 0; i < hook.length; ++i) | |
| hook[i].apply(this, args); | |
| } | |
| function initPlugins() { | |
| for (var i = 0; i < plugins.length; ++i) { | |
| var p = plugins[i]; | |
| p.init(plot); | |
| if (p.options) | |
| $.extend(true, options, p.options); | |
| } | |
| } | |
| function parseOptions(opts) { | |
| var i; | |
| $.extend(true, options, opts); | |
| if (options.xaxis.color == null) | |
| options.xaxis.color = options.grid.color; | |
| if (options.yaxis.color == null) | |
| options.yaxis.color = options.grid.color; | |
| if (options.xaxis.tickColor == null) // backwards-compatibility | |
| options.xaxis.tickColor = options.grid.tickColor; | |
| if (options.yaxis.tickColor == null) // backwards-compatibility | |
| options.yaxis.tickColor = options.grid.tickColor; | |
| if (options.grid.borderColor == null) | |
| options.grid.borderColor = options.grid.color; | |
| if (options.grid.tickColor == null) | |
| options.grid.tickColor = $.color.parse(options.grid.color).scale('a', 0.22).toString(); | |
| // fill in defaults in axes, copy at least always the | |
| // first as the rest of the code assumes it'll be there | |
| for (i = 0; i < Math.max(1, options.xaxes.length); ++i) | |
| options.xaxes[i] = $.extend(true, {}, options.xaxis, options.xaxes[i]); | |
| for (i = 0; i < Math.max(1, options.yaxes.length); ++i) | |
| options.yaxes[i] = $.extend(true, {}, options.yaxis, options.yaxes[i]); | |
| // backwards compatibility, to be removed in future | |
| if (options.xaxis.noTicks && options.xaxis.ticks == null) | |
| options.xaxis.ticks = options.xaxis.noTicks; | |
| if (options.yaxis.noTicks && options.yaxis.ticks == null) | |
| options.yaxis.ticks = options.yaxis.noTicks; | |
| if (options.x2axis) { | |
| options.xaxes[1] = $.extend(true, {}, options.xaxis, options.x2axis); | |
| options.xaxes[1].position = "top"; | |
| } | |
| if (options.y2axis) { | |
| options.yaxes[1] = $.extend(true, {}, options.yaxis, options.y2axis); | |
| options.yaxes[1].position = "right"; | |
| } | |
| if (options.grid.coloredAreas) | |
| options.grid.markings = options.grid.coloredAreas; | |
| if (options.grid.coloredAreasColor) | |
| options.grid.markingsColor = options.grid.coloredAreasColor; | |
| if (options.lines) | |
| $.extend(true, options.series.lines, options.lines); | |
| if (options.points) | |
| $.extend(true, options.series.points, options.points); | |
| if (options.bars) | |
| $.extend(true, options.series.bars, options.bars); | |
| if (options.shadowSize != null) | |
| options.series.shadowSize = options.shadowSize; | |
| // save options on axes for future reference | |
| for (i = 0; i < options.xaxes.length; ++i) | |
| getOrCreateAxis(xaxes, i + 1).options = options.xaxes[i]; | |
| for (i = 0; i < options.yaxes.length; ++i) | |
| getOrCreateAxis(yaxes, i + 1).options = options.yaxes[i]; | |
| // add hooks from options | |
| for (var n in hooks) | |
| if (options.hooks[n] && options.hooks[n].length) | |
| hooks[n] = hooks[n].concat(options.hooks[n]); | |
| executeHooks(hooks.processOptions, [options]); | |
| } | |
| function setData(d) { | |
| series = parseData(d); | |
| fillInSeriesOptions(); | |
| processData(); | |
| } | |
| function parseData(d) { | |
| var res = []; | |
| for (var i = 0; i < d.length; ++i) { | |
| var s = $.extend(true, {}, options.series); | |
| if (d[i].data != null) { | |
| s.data = d[i].data; // move the data instead of deep-copy | |
| delete d[i].data; | |
| $.extend(true, s, d[i]); | |
| d[i].data = s.data; | |
| } | |
| else | |
| s.data = d[i]; | |
| res.push(s); | |
| } | |
| return res; | |
| } | |
| function axisNumber(obj, coord) { | |
| var a = obj[coord + "axis"]; | |
| if (typeof a == "object") // if we got a real axis, extract number | |
| a = a.n; | |
| if (typeof a != "number") | |
| a = 1; // default to first axis | |
| return a; | |
| } | |
| function allAxes() { | |
| // return flat array without annoying null entries | |
| return $.grep(xaxes.concat(yaxes), function (a) { return a; }); | |
| } | |
| function canvasToAxisCoords(pos) { | |
| // return an object with x/y corresponding to all used axes | |
| var res = {}, i, axis; | |
| for (i = 0; i < xaxes.length; ++i) { | |
| axis = xaxes[i]; | |
| if (axis && axis.used) | |
| res["x" + axis.n] = axis.c2p(pos.left); | |
| } | |
| for (i = 0; i < yaxes.length; ++i) { | |
| axis = yaxes[i]; | |
| if (axis && axis.used) | |
| res["y" + axis.n] = axis.c2p(pos.top); | |
| } | |
| if (res.x1 !== undefined) | |
| res.x = res.x1; | |
| if (res.y1 !== undefined) | |
| res.y = res.y1; | |
| return res; | |
| } | |
| function axisToCanvasCoords(pos) { | |
| // get canvas coords from the first pair of x/y found in pos | |
| var res = {}, i, axis, key; | |
| for (i = 0; i < xaxes.length; ++i) { | |
| axis = xaxes[i]; | |
| if (axis && axis.used) { | |
| key = "x" + axis.n; | |
| if (pos[key] == null && axis.n == 1) | |
| key = "x"; | |
| if (pos[key] != null) { | |
| res.left = axis.p2c(pos[key]); | |
| break; | |
| } | |
| } | |
| } | |
| for (i = 0; i < yaxes.length; ++i) { | |
| axis = yaxes[i]; | |
| if (axis && axis.used) { | |
| key = "y" + axis.n; | |
| if (pos[key] == null && axis.n == 1) | |
| key = "y"; | |
| if (pos[key] != null) { | |
| res.top = axis.p2c(pos[key]); | |
| break; | |
| } | |
| } | |
| } | |
| return res; | |
| } | |
| function getOrCreateAxis(axes, number) { | |
| if (!axes[number - 1]) | |
| axes[number - 1] = { | |
| n: number, // save the number for future reference | |
| direction: axes == xaxes ? "x" : "y", | |
| options: $.extend(true, {}, axes == xaxes ? options.xaxis : options.yaxis) | |
| }; | |
| return axes[number - 1]; | |
| } | |
| function fillInSeriesOptions() { | |
| var i; | |
| // collect what we already got of colors | |
| var neededColors = series.length, | |
| usedColors = [], | |
| assignedColors = []; | |
| for (i = 0; i < series.length; ++i) { | |
| var sc = series[i].color; | |
| if (sc != null) { | |
| --neededColors; | |
| if (typeof sc == "number") | |
| assignedColors.push(sc); | |
| else | |
| usedColors.push($.color.parse(series[i].color)); | |
| } | |
| } | |
| // we might need to generate more colors if higher indices | |
| // are assigned | |
| for (i = 0; i < assignedColors.length; ++i) { | |
| neededColors = Math.max(neededColors, assignedColors[i] + 1); | |
| } | |
| // produce colors as needed | |
| var colors = [], variation = 0; | |
| i = 0; | |
| while (colors.length < neededColors) { | |
| var c; | |
| if (options.colors.length == i) // check degenerate case | |
| c = $.color.make(100, 100, 100); | |
| else | |
| c = $.color.parse(options.colors[i]); | |
| // vary color if needed | |
| var sign = variation % 2 == 1 ? -1 : 1; | |
| c.scale('rgb', 1 + sign * Math.ceil(variation / 2) * 0.2) | |
| // FIXME: if we're getting to close to something else, | |
| // we should probably skip this one | |
| colors.push(c); | |
| ++i; | |
| if (i >= options.colors.length) { | |
| i = 0; | |
| ++variation; | |
| } | |
| } | |
| // fill in the options | |
| var colori = 0, s; | |
| for (i = 0; i < series.length; ++i) { | |
| s = series[i]; | |
| // assign colors | |
| if (s.color == null) { | |
| s.color = colors[colori].toString(); | |
| ++colori; | |
| } | |
| else if (typeof s.color == "number") | |
| s.color = colors[s.color].toString(); | |
| // turn on lines automatically in case nothing is set | |
| if (s.lines.show == null) { | |
| var v, show = true; | |
| for (v in s) | |
| if (s[v] && s[v].show) { | |
| show = false; | |
| break; | |
| } | |
| if (show) | |
| s.lines.show = true; | |
| } | |
| // setup axes | |
| s.xaxis = getOrCreateAxis(xaxes, axisNumber(s, "x")); | |
| s.yaxis = getOrCreateAxis(yaxes, axisNumber(s, "y")); | |
| } | |
| } | |
| function processData() { | |
| var topSentry = Number.POSITIVE_INFINITY, | |
| bottomSentry = Number.NEGATIVE_INFINITY, | |
| fakeInfinity = Number.MAX_VALUE, | |
| i, j, k, m, length, | |
| s, points, ps, x, y, axis, val, f, p; | |
| function updateAxis(axis, min, max) { | |
| if (min < axis.datamin && min != -fakeInfinity) | |
| axis.datamin = min; | |
| if (max > axis.datamax && max != fakeInfinity) | |
| axis.datamax = max; | |
| } | |
| $.each(allAxes(), function (_, axis) { | |
| // init axis | |
| axis.datamin = topSentry; | |
| axis.datamax = bottomSentry; | |
| axis.used = false; | |
| }); | |
| for (i = 0; i < series.length; ++i) { | |
| s = series[i]; | |
| s.datapoints = { points: [] }; | |
| executeHooks(hooks.processRawData, [ s, s.data, s.datapoints ]); | |
| } | |
| // first pass: clean and copy data | |
| for (i = 0; i < series.length; ++i) { | |
| s = series[i]; | |
| var data = s.data, format = s.datapoints.format; | |
| if (!format) { | |
| format = []; | |
| // find out how to copy | |
| format.push({ x: true, number: true, required: true }); | |
| format.push({ y: true, number: true, required: true }); | |
| if (s.bars.show || (s.lines.show && s.lines.fill)) { | |
| format.push({ y: true, number: true, required: false, defaultValue: 0 }); | |
| if (s.bars.horizontal) { | |
| delete format[format.length - 1].y; | |
| format[format.length - 1].x = true; | |
| } | |
| } | |
| s.datapoints.format = format; | |
| } | |
| if (s.datapoints.pointsize != null) | |
| continue; // already filled in | |
| s.datapoints.pointsize = format.length; | |
| ps = s.datapoints.pointsize; | |
| points = s.datapoints.points; | |
| insertSteps = s.lines.show && s.lines.steps; | |
| s.xaxis.used = s.yaxis.used = true; | |
| for (j = k = 0; j < data.length; ++j, k += ps) { | |
| p = data[j]; | |
| var nullify = p == null; | |
| if (!nullify) { | |
| for (m = 0; m < ps; ++m) { | |
| val = p[m]; | |
| f = format[m]; | |
| if (f) { | |
| if (f.number && val != null) { | |
| val = +val; // convert to number | |
| if (isNaN(val)) | |
| val = null; | |
| else if (val == Infinity) | |
| val = fakeInfinity; | |
| else if (val == -Infinity) | |
| val = -fakeInfinity; | |
| } | |
| if (val == null) { | |
| if (f.required) | |
| nullify = true; | |
| if (f.defaultValue != null) | |
| val = f.defaultValue; | |
| } | |
| } | |
| points[k + m] = val; | |
| } | |
| } | |
| if (nullify) { | |
| for (m = 0; m < ps; ++m) { | |
| val = points[k + m]; | |
| if (val != null) { | |
| f = format[m]; | |
| // extract min/max info | |
| if (f.x) | |
| updateAxis(s.xaxis, val, val); | |
| if (f.y) | |
| updateAxis(s.yaxis, val, val); | |
| } | |
| points[k + m] = null; | |
| } | |
| } | |
| else { | |
| // a little bit of line specific stuff that | |
| // perhaps shouldn't be here, but lacking | |
| // better means... | |
| if (insertSteps && k > 0 | |
| && points[k - ps] != null | |
| && points[k - ps] != points[k] | |
| && points[k - ps + 1] != points[k + 1]) { | |
| // copy the point to make room for a middle point | |
| for (m = 0; m < ps; ++m) | |
| points[k + ps + m] = points[k + m]; | |
| // middle point has same y | |
| points[k + 1] = points[k - ps + 1]; | |
| // we've added a point, better reflect that | |
| k += ps; | |
| } | |
| } | |
| } | |
| } | |
| // give the hooks a chance to run | |
| for (i = 0; i < series.length; ++i) { | |
| s = series[i]; | |
| executeHooks(hooks.processDatapoints, [ s, s.datapoints]); | |
| } | |
| // second pass: find datamax/datamin for auto-scaling | |
| for (i = 0; i < series.length; ++i) { | |
| s = series[i]; | |
| points = s.datapoints.points, | |
| ps = s.datapoints.pointsize; | |
| var xmin = topSentry, ymin = topSentry, | |
| xmax = bottomSentry, ymax = bottomSentry; | |
| for (j = 0; j < points.length; j += ps) { | |
| if (points[j] == null) | |
| continue; | |
| for (m = 0; m < ps; ++m) { | |
| val = points[j + m]; | |
| f = format[m]; | |
| if (!f || val == fakeInfinity || val == -fakeInfinity) | |
| continue; | |
| if (f.x) { | |
| if (val < xmin) | |
| xmin = val; | |
| if (val > xmax) | |
| xmax = val; | |
| } | |
| if (f.y) { | |
| if (val < ymin) | |
| ymin = val; | |
| if (val > ymax) | |
| ymax = val; | |
| } | |
| } | |
| } | |
| if (s.bars.show) { | |
| // make sure we got room for the bar on the dancing floor | |
| var delta = s.bars.align == "left" ? 0 : -s.bars.barWidth/2; | |
| if (s.bars.horizontal) { | |
| ymin += delta; | |
| ymax += delta + s.bars.barWidth; | |
| } | |
| else { | |
| xmin += delta; | |
| xmax += delta + s.bars.barWidth; | |
| } | |
| } | |
| updateAxis(s.xaxis, xmin, xmax); | |
| updateAxis(s.yaxis, ymin, ymax); | |
| } | |
| $.each(allAxes(), function (_, axis) { | |
| if (axis.datamin == topSentry) | |
| axis.datamin = null; | |
| if (axis.datamax == bottomSentry) | |
| axis.datamax = null; | |
| }); | |
| } | |
| function makeCanvas(skipPositioning, cls) { | |
| var c = document.createElement('canvas'); | |
| c.className = cls; | |
| c.width = canvasWidth; | |
| c.height = canvasHeight; | |
| if (!skipPositioning) | |
| $(c).css({ position: 'absolute', left: 0, top: 0 }); | |
| $(c).appendTo(placeholder); | |
| if (!c.getContext) // excanvas hack | |
| c = window.G_vmlCanvasManager.initElement(c); | |
| // used for resetting in case we get replotted | |
| c.getContext("2d").save(); | |
| return c; | |
| } | |
| function getCanvasDimensions() { | |
| canvasWidth = placeholder.width(); | |
| canvasHeight = placeholder.height(); | |
| if (canvasWidth <= 0 || canvasHeight <= 0) | |
| throw "Invalid dimensions for plot, width = " + canvasWidth + ", height = " + canvasHeight; | |
| } | |
| function resizeCanvas(c) { | |
| // resizing should reset the state (excanvas seems to be | |
| // buggy though) | |
| if (c.width != canvasWidth) | |
| c.width = canvasWidth; | |
| if (c.height != canvasHeight) | |
| c.height = canvasHeight; | |
| // so try to get back to the initial state (even if it's | |
| // gone now, this should be safe according to the spec) | |
| var cctx = c.getContext("2d"); | |
| cctx.restore(); | |
| // and save again | |
| cctx.save(); | |
| } | |
| function setupCanvases() { | |
| var reused, | |
| existingCanvas = placeholder.children("canvas.base"), | |
| existingOverlay = placeholder.children("canvas.overlay"); | |
| if (existingCanvas.length == 0 || existingOverlay == 0) { | |
| // init everything | |
| placeholder.html(""); // make sure placeholder is clear | |
| placeholder.css({ padding: 0 }); // padding messes up the positioning | |
| if (placeholder.css("position") == 'static') | |
| placeholder.css("position", "relative"); // for positioning labels and overlay | |
| getCanvasDimensions(); | |
| canvas = makeCanvas(true, "base"); | |
| overlay = makeCanvas(false, "overlay"); // overlay canvas for interactive features | |
| reused = false; | |
| } | |
| else { | |
| // reuse existing elements | |
| canvas = existingCanvas.get(0); | |
| overlay = existingOverlay.get(0); | |
| reused = true; | |
| } | |
| ctx = canvas.getContext("2d"); | |
| octx = overlay.getContext("2d"); | |
| // we include the canvas in the event holder too, because IE 7 | |
| // sometimes has trouble with the stacking order | |
| eventHolder = $([overlay, canvas]); | |
| if (reused) { | |
| // run shutdown in the old plot object | |
| placeholder.data("plot").shutdown(); | |
| // reset reused canvases | |
| plot.resize(); | |
| // make sure overlay pixels are cleared (canvas is cleared when we redraw) | |
| octx.clearRect(0, 0, canvasWidth, canvasHeight); | |
| // then whack any remaining obvious garbage left | |
| eventHolder.unbind(); | |
| placeholder.children().not([canvas, overlay]).remove(); | |
| } | |
| // save in case we get replotted | |
| placeholder.data("plot", plot); | |
| } | |
| function bindEvents() { | |
| // bind events | |
| if (options.grid.hoverable) { | |
| eventHolder.mousemove(onMouseMove); | |
| eventHolder.mouseleave(onMouseLeave); | |
| } | |
| if (options.grid.clickable) | |
| eventHolder.click(onClick); | |
| executeHooks(hooks.bindEvents, [eventHolder]); | |
| } | |
| function shutdown() { | |
| if (redrawTimeout) | |
| clearTimeout(redrawTimeout); | |
| eventHolder.unbind("mousemove", onMouseMove); | |
| eventHolder.unbind("mouseleave", onMouseLeave); | |
| eventHolder.unbind("click", onClick); | |
| executeHooks(hooks.shutdown, [eventHolder]); | |
| } | |
| function setTransformationHelpers(axis) { | |
| // set helper functions on the axis, assumes plot area | |
| // has been computed already | |
| function identity(x) { return x; } | |
| var s, m, t = axis.options.transform || identity, | |
| it = axis.options.inverseTransform; | |
| // precompute how much the axis is scaling a point | |
| // in canvas space | |
| if (axis.direction == "x") { | |
| s = axis.scale = plotWidth / Math.abs(t(axis.max) - t(axis.min)); | |
| m = Math.min(t(axis.max), t(axis.min)); | |
| } | |
| else { | |
| s = axis.scale = plotHeight / Math.abs(t(axis.max) - t(axis.min)); | |
| s = -s; | |
| m = Math.max(t(axis.max), t(axis.min)); | |
| } | |
| // data point to canvas coordinate | |
| if (t == identity) // slight optimization | |
| axis.p2c = function (p) { return (p - m) * s; }; | |
| else | |
| axis.p2c = function (p) { return (t(p) - m) * s; }; | |
| // canvas coordinate to data point | |
| if (!it) | |
| axis.c2p = function (c) { return m + c / s; }; | |
| else | |
| axis.c2p = function (c) { return it(m + c / s); }; | |
| } | |
| function measureTickLabels(axis) { | |
| var opts = axis.options, i, ticks = axis.ticks || [], labels = [], | |
| l, w = opts.labelWidth, h = opts.labelHeight, dummyDiv; | |
| function makeDummyDiv(labels, width) { | |
| return $('<div style="position:absolute;top:-10000px;' + width + 'font-size:smaller">' + | |
| '<div class="' + axis.direction + 'Axis ' + axis.direction + axis.n + 'Axis">' | |
| + labels.join("") + '</div></div>') | |
| .appendTo(placeholder); | |
| } | |
| if (axis.direction == "x") { | |
| // to avoid measuring the widths of the labels (it's slow), we | |
| // construct fixed-size boxes and put the labels inside | |
| // them, we don't need the exact figures and the | |
| // fixed-size box content is easy to center | |
| if (w == null) | |
| w = Math.floor(canvasWidth / (ticks.length > 0 ? ticks.length : 1)); | |
| // measure x label heights | |
| if (h == null) { | |
| labels = []; | |
| for (i = 0; i < ticks.length; ++i) { | |
| l = ticks[i].label; | |
| if (l) | |
| labels.push('<div class="tickLabel" style="float:left;width:' + w + 'px">' + l + '</div>'); | |
| } | |
| if (labels.length > 0) { | |
| // stick them all in the same div and measure | |
| // collective height | |
| labels.push('<div style="clear:left"></div>'); | |
| dummyDiv = makeDummyDiv(labels, "width:10000px;"); | |
| h = dummyDiv.height(); | |
| dummyDiv.remove(); | |
| } | |
| } | |
| } | |
| else if (w == null || h == null) { | |
| // calculate y label dimensions | |
| for (i = 0; i < ticks.length; ++i) { | |
| l = ticks[i].label; | |
| if (l) | |
| labels.push('<div class="tickLabel">' + l + '</div>'); | |
| } | |
| if (labels.length > 0) { | |
| dummyDiv = makeDummyDiv(labels, ""); | |
| if (w == null) | |
| w = dummyDiv.children().width(); | |
| if (h == null) | |
| h = dummyDiv.find("div.tickLabel").height(); | |
| dummyDiv.remove(); | |
| } | |
| } | |
| if (w == null) | |
| w = 0; | |
| if (h == null) | |
| h = 0; | |
| axis.labelWidth = w; | |
| axis.labelHeight = h; | |
| } | |
| function allocateAxisBoxFirstPhase(axis) { | |
| // find the bounding box of the axis by looking at label | |
| // widths/heights and ticks, make room by diminishing the | |
| // plotOffset | |
| var lw = axis.labelWidth, | |
| lh = axis.labelHeight, | |
| pos = axis.options.position, | |
| tickLength = axis.options.tickLength, | |
| axismargin = options.grid.axisMargin, | |
| padding = options.grid.labelMargin, | |
| all = axis.direction == "x" ? xaxes : yaxes, | |
| index; | |
| // determine axis margin | |
| var samePosition = $.grep(all, function (a) { | |
| return a && a.options.position == pos && a.reserveSpace; | |
| }); | |
| if ($.inArray(axis, samePosition) == samePosition.length - 1) | |
| axismargin = 0; // outermost | |
| // determine tick length - if we're innermost, we can use "full" | |
| if (tickLength == null) | |
| tickLength = "full"; | |
| var sameDirection = $.grep(all, function (a) { | |
| return a && a.reserveSpace; | |
| }); | |
| var innermost = $.inArray(axis, sameDirection) == 0; | |
| if (!innermost && tickLength == "full") | |
| tickLength = 5; | |
| if (!isNaN(+tickLength)) | |
| padding += +tickLength; | |
| // compute box | |
| if (axis.direction == "x") { | |
| lh += padding; | |
| if (pos == "bottom") { | |
| plotOffset.bottom += lh + axismargin; | |
| axis.box = { top: canvasHeight - plotOffset.bottom, height: lh }; | |
| } | |
| else { | |
| axis.box = { top: plotOffset.top + axismargin, height: lh }; | |
| plotOffset.top += lh + axismargin; | |
| } | |
| } | |
| else { | |
| lw += padding; | |
| if (pos == "left") { | |
| axis.box = { left: plotOffset.left + axismargin, width: lw }; | |
| plotOffset.left += lw + axismargin; | |
| } | |
| else { | |
| plotOffset.right += lw + axismargin; | |
| axis.box = { left: canvasWidth - plotOffset.right, width: lw }; | |
| } | |
| } | |
| // save for future reference | |
| axis.position = pos; | |
| axis.tickLength = tickLength; | |
| axis.box.padding = padding; | |
| axis.innermost = innermost; | |
| } | |
| function allocateAxisBoxSecondPhase(axis) { | |
| // set remaining bounding box coordinates | |
| if (axis.direction == "x") { | |
| axis.box.left = plotOffset.left; | |
| axis.box.width = plotWidth; | |
| } | |
| else { | |
| axis.box.top = plotOffset.top; | |
| axis.box.height = plotHeight; | |
| } | |
| } | |
| function setupGrid() { | |
| var i, axes = allAxes(); | |
| // first calculate the plot and axis box dimensions | |
| $.each(axes, function (_, axis) { | |
| axis.show = axis.options.show; | |
| if (axis.show == null) | |
| axis.show = axis.used; // by default an axis is visible if it's got data | |
| axis.reserveSpace = axis.show || axis.options.reserveSpace; | |
| setRange(axis); | |
| }); | |
| allocatedAxes = $.grep(axes, function (axis) { return axis.reserveSpace; }); | |
| plotOffset.left = plotOffset.right = plotOffset.top = plotOffset.bottom = 0; | |
| if (options.grid.show) { | |
| $.each(allocatedAxes, function (_, axis) { | |
| // make the ticks | |
| setupTickGeneration(axis); | |
| setTicks(axis); | |
| snapRangeToTicks(axis, axis.ticks); | |
| // find labelWidth/Height for axis | |
| measureTickLabels(axis); | |
| }); | |
| // with all dimensions in house, we can compute the | |
| // axis boxes, start from the outside (reverse order) | |
| for (i = allocatedAxes.length - 1; i >= 0; --i) | |
| allocateAxisBoxFirstPhase(allocatedAxes[i]); | |
| // make sure we've got enough space for things that | |
| // might stick out | |
| var minMargin = options.grid.minBorderMargin; | |
| if (minMargin == null) { | |
| minMargin = 0; | |
| for (i = 0; i < series.length; ++i) | |
| minMargin = Math.max(minMargin, series[i].points.radius + series[i].points.lineWidth/2); | |
| } | |
| for (var a in plotOffset) { | |
| plotOffset[a] += options.grid.borderWidth; | |
| plotOffset[a] = Math.max(minMargin, plotOffset[a]); | |
| } | |
| } | |
| plotWidth = canvasWidth - plotOffset.left - plotOffset.right; | |
| plotHeight = canvasHeight - plotOffset.bottom - plotOffset.top; | |
| // now we got the proper plotWidth/Height, we can compute the scaling | |
| $.each(axes, function (_, axis) { | |
| setTransformationHelpers(axis); | |
| }); | |
| if (options.grid.show) { | |
| $.each(allocatedAxes, function (_, axis) { | |
| allocateAxisBoxSecondPhase(axis); | |
| }); | |
| insertAxisLabels(); | |
| } | |
| insertLegend(); | |
| } | |
| function setRange(axis) { | |
| var opts = axis.options, | |
| min = +(opts.min != null ? opts.min : axis.datamin), | |
| max = +(opts.max != null ? opts.max : axis.datamax), | |
| delta = max - min; | |
| if (delta == 0.0) { | |
| // degenerate case | |
| var widen = max == 0 ? 1 : 0.01; | |
| if (opts.min == null) | |
| min -= widen; | |
| // always widen max if we couldn't widen min to ensure we | |
| // don't fall into min == max which doesn't work | |
| if (opts.max == null || opts.min != null) | |
| max += widen; | |
| } | |
| else { | |
| // consider autoscaling | |
| var margin = opts.autoscaleMargin; | |
| if (margin != null) { | |
| if (opts.min == null) { | |
| min -= delta * margin; | |
| // make sure we don't go below zero if all values | |
| // are positive | |
| if (min < 0 && axis.datamin != null && axis.datamin >= 0) | |
| min = 0; | |
| } | |
| if (opts.max == null) { | |
| max += delta * margin; | |
| if (max > 0 && axis.datamax != null && axis.datamax <= 0) | |
| max = 0; | |
| } | |
| } | |
| } | |
| axis.min = min; | |
| axis.max = max; | |
| } | |
| function setupTickGeneration(axis) { | |
| var opts = axis.options; | |
| // estimate number of ticks | |
| var noTicks; | |
| if (typeof opts.ticks == "number" && opts.ticks > 0) | |
| noTicks = opts.ticks; | |
| else | |
| // heuristic based on the model a*sqrt(x) fitted to | |
| // some data points that seemed reasonable | |
| noTicks = 0.3 * Math.sqrt(axis.direction == "x" ? canvasWidth : canvasHeight); | |
| var delta = (axis.max - axis.min) / noTicks, | |
| size, generator, unit, formatter, i, magn, norm; | |
| if (opts.mode == "time") { | |
| // pretty handling of time | |
| // map of app. size of time units in milliseconds | |
| var timeUnitSize = { | |
| "second": 1000, | |
| "minute": 60 * 1000, | |
| "hour": 60 * 60 * 1000, | |
| "day": 24 * 60 * 60 * 1000, | |
| "month": 30 * 24 * 60 * 60 * 1000, | |
| "year": 365.2425 * 24 * 60 * 60 * 1000 | |
| }; | |
| // the allowed tick sizes, after 1 year we use | |
| // an integer algorithm | |
| var spec = [ | |
| [1, "second"], [2, "second"], [5, "second"], [10, "second"], | |
| [30, "second"], | |
| [1, "minute"], [2, "minute"], [5, "minute"], [10, "minute"], | |
| [30, "minute"], | |
| [1, "hour"], [2, "hour"], [4, "hour"], | |
| [8, "hour"], [12, "hour"], | |
| [1, "day"], [2, "day"], [3, "day"], | |
| [0.25, "month"], [0.5, "month"], [1, "month"], | |
| [2, "month"], [3, "month"], [6, "month"], | |
| [1, "year"] | |
| ]; | |
| var minSize = 0; | |
| if (opts.minTickSize != null) { | |
| if (typeof opts.tickSize == "number") | |
| minSize = opts.tickSize; | |
| else | |
| minSize = opts.minTickSize[0] * timeUnitSize[opts.minTickSize[1]]; | |
| } | |
| for (var i = 0; i < spec.length - 1; ++i) | |
| if (delta < (spec[i][0] * timeUnitSize[spec[i][1]] | |
| + spec[i + 1][0] * timeUnitSize[spec[i + 1][1]]) / 2 | |
| && spec[i][0] * timeUnitSize[spec[i][1]] >= minSize) | |
| break; | |
| size = spec[i][0]; | |
| unit = spec[i][1]; | |
| // special-case the possibility of several years | |
| if (unit == "year") { | |
| magn = Math.pow(10, Math.floor(Math.log(delta / timeUnitSize.year) / Math.LN10)); | |
| norm = (delta / timeUnitSize.year) / magn; | |
| if (norm < 1.5) | |
| size = 1; | |
| else if (norm < 3) | |
| size = 2; | |
| else if (norm < 7.5) | |
| size = 5; | |
| else | |
| size = 10; | |
| size *= magn; | |
| } | |
| axis.tickSize = opts.tickSize || [size, unit]; | |
| generator = function(axis) { | |
| var ticks = [], | |
| tickSize = axis.tickSize[0], unit = axis.tickSize[1], | |
| d = new Date(axis.min); | |
| var step = tickSize * timeUnitSize[unit]; | |
| if (unit == "second") | |
| d.setUTCSeconds(floorInBase(d.getUTCSeconds(), tickSize)); | |
| if (unit == "minute") | |
| d.setUTCMinutes(floorInBase(d.getUTCMinutes(), tickSize)); | |
| if (unit == "hour") | |
| d.setUTCHours(floorInBase(d.getUTCHours(), tickSize)); | |
| if (unit == "month") | |
| d.setUTCMonth(floorInBase(d.getUTCMonth(), tickSize)); | |
| if (unit == "year") | |
| d.setUTCFullYear(floorInBase(d.getUTCFullYear(), tickSize)); | |
| // reset smaller components | |
| d.setUTCMilliseconds(0); | |
| if (step >= timeUnitSize.minute) | |
| d.setUTCSeconds(0); | |
| if (step >= timeUnitSize.hour) | |
| d.setUTCMinutes(0); | |
| if (step >= timeUnitSize.day) | |
| d.setUTCHours(0); | |
| if (step >= timeUnitSize.day * 4) | |
| d.setUTCDate(1); | |
| if (step >= timeUnitSize.year) | |
| d.setUTCMonth(0); | |
| var carry = 0, v = Number.NaN, prev; | |
| do { | |
| prev = v; | |
| v = d.getTime(); | |
| ticks.push(v); | |
| if (unit == "month") { | |
| if (tickSize < 1) { | |
| // a bit complicated - we'll divide the month | |
| // up but we need to take care of fractions | |
| // so we don't end up in the middle of a day | |
| d.setUTCDate(1); | |
| var start = d.getTime(); | |
| d.setUTCMonth(d.getUTCMonth() + 1); | |
| var end = d.getTime(); | |
| d.setTime(v + carry * timeUnitSize.hour + (end - start) * tickSize); | |
| carry = d.getUTCHours(); | |
| d.setUTCHours(0); | |
| } | |
| else | |
| d.setUTCMonth(d.getUTCMonth() + tickSize); | |
| } | |
| else if (unit == "year") { | |
| d.setUTCFullYear(d.getUTCFullYear() + tickSize); | |
| } | |
| else | |
| d.setTime(v + step); | |
| } while (v < axis.max && v != prev); | |
| return ticks; | |
| }; | |
| formatter = function (v, axis) { | |
| var d = new Date(v); | |
| // first check global format | |
| if (opts.timeformat != null) | |
| return $.plot.formatDate(d, opts.timeformat, opts.monthNames); | |
| var t = axis.tickSize[0] * timeUnitSize[axis.tickSize[1]]; | |
| var span = axis.max - axis.min; | |
| var suffix = (opts.twelveHourClock) ? " %p" : ""; | |
| if (t < timeUnitSize.minute) | |
| fmt = "%h:%M:%S" + suffix; | |
| else if (t < timeUnitSize.day) { | |
| if (span < 2 * timeUnitSize.day) | |
| fmt = "%h:%M" + suffix; | |
| else | |
| fmt = "%b %d %h:%M" + suffix; | |
| } | |
| else if (t < timeUnitSize.month) | |
| fmt = "%b %d"; | |
| else if (t < timeUnitSize.year) { | |
| if (span < timeUnitSize.year) | |
| fmt = "%b"; | |
| else | |
| fmt = "%b %y"; | |
| } | |
| else | |
| fmt = "%y"; | |
| return $.plot.formatDate(d, fmt, opts.monthNames); | |
| }; | |
| } | |
| else { | |
| // pretty rounding of base-10 numbers | |
| var maxDec = opts.tickDecimals; | |
| var dec = -Math.floor(Math.log(delta) / Math.LN10); | |
| if (maxDec != null && dec > maxDec) | |
| dec = maxDec; | |
| magn = Math.pow(10, -dec); | |
| norm = delta / magn; // norm is between 1.0 and 10.0 | |
| if (norm < 1.5) | |
| size = 1; | |
| else if (norm < 3) { | |
| size = 2; | |
| // special case for 2.5, requires an extra decimal | |
| if (norm > 2.25 && (maxDec == null || dec + 1 <= maxDec)) { | |
| size = 2.5; | |
| ++dec; | |
| } | |
| } | |
| else if (norm < 7.5) | |
| size = 5; | |
| else | |
| size = 10; | |
| size *= magn; | |
| if (opts.minTickSize != null && size < opts.minTickSize) | |
| size = opts.minTickSize; | |
| axis.tickDecimals = Math.max(0, maxDec != null ? maxDec : dec); | |
| axis.tickSize = opts.tickSize || size; | |
| generator = function (axis) { | |
| var ticks = []; | |
| // spew out all possible ticks | |
| var start = floorInBase(axis.min, axis.tickSize), | |
| i = 0, v = Number.NaN, prev; | |
| do { | |
| prev = v; | |
| v = start + i * axis.tickSize; | |
| ticks.push(v); | |
| ++i; | |
| } while (v < axis.max && v != prev); | |
| return ticks; | |
| }; | |
| formatter = function (v, axis) { | |
| return v.toFixed(axis.tickDecimals); | |
| }; | |
| } | |
| if (opts.alignTicksWithAxis != null) { | |
| var otherAxis = (axis.direction == "x" ? xaxes : yaxes)[opts.alignTicksWithAxis - 1]; | |
| if (otherAxis && otherAxis.used && otherAxis != axis) { | |
| // consider snapping min/max to outermost nice ticks | |
| var niceTicks = generator(axis); | |
| if (niceTicks.length > 0) { | |
| if (opts.min == null) | |
| axis.min = Math.min(axis.min, niceTicks[0]); | |
| if (opts.max == null && niceTicks.length > 1) | |
| axis.max = Math.max(axis.max, niceTicks[niceTicks.length - 1]); | |
| } | |
| generator = function (axis) { | |
| // copy ticks, scaled to this axis | |
| var ticks = [], v, i; | |
| for (i = 0; i < otherAxis.ticks.length; ++i) { | |
| v = (otherAxis.ticks[i].v - otherAxis.min) / (otherAxis.max - otherAxis.min); | |
| v = axis.min + v * (axis.max - axis.min); | |
| ticks.push(v); | |
| } | |
| return ticks; | |
| }; | |
| // we might need an extra decimal since forced | |
| // ticks don't necessarily fit naturally | |
| if (axis.mode != "time" && opts.tickDecimals == null) { | |
| var extraDec = Math.max(0, -Math.floor(Math.log(delta) / Math.LN10) + 1), | |
| ts = generator(axis); | |
| // only proceed if the tick interval rounded | |
| // with an extra decimal doesn't give us a | |
| // zero at end | |
| if (!(ts.length > 1 && /\..*0$/.test((ts[1] - ts[0]).toFixed(extraDec)))) | |
| axis.tickDecimals = extraDec; | |
| } | |
| } | |
| } | |
| axis.tickGenerator = generator; | |
| if ($.isFunction(opts.tickFormatter)) | |
| axis.tickFormatter = function (v, axis) { return "" + opts.tickFormatter(v, axis); }; | |
| else | |
| axis.tickFormatter = formatter; | |
| } | |
| function setTicks(axis) { | |
| var oticks = axis.options.ticks, ticks = []; | |
| if (oticks == null || (typeof oticks == "number" && oticks > 0)) | |
| ticks = axis.tickGenerator(axis); | |
| else if (oticks) { | |
| if ($.isFunction(oticks)) | |
| // generate the ticks | |
| ticks = oticks({ min: axis.min, max: axis.max }); | |
| else | |
| ticks = oticks; | |
| } | |
| // clean up/labelify the supplied ticks, copy them over | |
| var i, v; | |
| axis.ticks = []; | |
| for (i = 0; i < ticks.length; ++i) { | |
| var label = null; | |
| var t = ticks[i]; | |
| if (typeof t == "object") { | |
| v = +t[0]; | |
| if (t.length > 1) | |
| label = t[1]; | |
| } | |
| else | |
| v = +t; | |
| if (label == null) | |
| label = axis.tickFormatter(v, axis); | |
| if (!isNaN(v)) | |
| axis.ticks.push({ v: v, label: label }); | |
| } | |
| } | |
| function snapRangeToTicks(axis, ticks) { | |
| if (axis.options.autoscaleMargin && ticks.length > 0) { | |
| // snap to ticks | |
| if (axis.options.min == null) | |
| axis.min = Math.min(axis.min, ticks[0].v); | |
| if (axis.options.max == null && ticks.length > 1) | |
| axis.max = Math.max(axis.max, ticks[ticks.length - 1].v); | |
| } | |
| } | |
| function draw() { | |
| ctx.clearRect(0, 0, canvasWidth, canvasHeight); | |
| var grid = options.grid; | |
| // draw background, if any | |
| if (grid.show && grid.backgroundColor) | |
| drawBackground(); | |
| if (grid.show && !grid.aboveData) | |
| drawGrid(); | |
| for (var i = 0; i < series.length; ++i) { | |
| executeHooks(hooks.drawSeries, [ctx, series[i]]); | |
| drawSeries(series[i]); | |
| } | |
| executeHooks(hooks.draw, [ctx]); | |
| if (grid.show && grid.aboveData) | |
| drawGrid(); | |
| } | |
| function extractRange(ranges, coord) { | |
| var axis, from, to, key, axes = allAxes(); | |
| for (i = 0; i < axes.length; ++i) { | |
| axis = axes[i]; | |
| if (axis.direction == coord) { | |
| key = coord + axis.n + "axis"; | |
| if (!ranges[key] && axis.n == 1) | |
| key = coord + "axis"; // support x1axis as xaxis | |
| if (ranges[key]) { | |
| from = ranges[key].from; | |
| to = ranges[key].to; | |
| break; | |
| } | |
| } | |
| } | |
| // backwards-compat stuff - to be removed in future | |
| if (!ranges[key]) { | |
| axis = coord == "x" ? xaxes[0] : yaxes[0]; | |
| from = ranges[coord + "1"]; | |
| to = ranges[coord + "2"]; | |
| } | |
| // auto-reverse as an added bonus | |
| if (from != null && to != null && from > to) { | |
| var tmp = from; | |
| from = to; | |
| to = tmp; | |
| } | |
| return { from: from, to: to, axis: axis }; | |
| } | |
| function drawBackground() { | |
| ctx.save(); | |
| ctx.translate(plotOffset.left, plotOffset.top); | |
| ctx.fillStyle = getColorOrGradient(options.grid.backgroundColor, plotHeight, 0, "rgba(255, 255, 255, 0)"); | |
| ctx.fillRect(0, 0, plotWidth, plotHeight); | |
| ctx.restore(); | |
| } | |
| function drawGrid() { | |
| var i; | |
| ctx.save(); | |
| ctx.translate(plotOffset.left, plotOffset.top); | |
| // draw markings | |
| var markings = options.grid.markings; | |
| if (markings) { | |
| if ($.isFunction(markings)) { | |
| var axes = plot.getAxes(); | |
| // xmin etc. is backwards compatibility, to be | |
| // removed in the future | |
| axes.xmin = axes.xaxis.min; | |
| axes.xmax = axes.xaxis.max; | |
| axes.ymin = axes.yaxis.min; | |
| axes.ymax = axes.yaxis.max; | |
| markings = markings(axes); | |
| } | |
| for (i = 0; i < markings.length; ++i) { | |
| var m = markings[i], | |
| xrange = extractRange(m, "x"), | |
| yrange = extractRange(m, "y"); | |
| // fill in missing | |
| if (xrange.from == null) | |
| xrange.from = xrange.axis.min; | |
| if (xrange.to == null) | |
| xrange.to = xrange.axis.max; | |
| if (yrange.from == null) | |
| yrange.from = yrange.axis.min; | |
| if (yrange.to == null) | |
| yrange.to = yrange.axis.max; | |
| // clip | |
| if (xrange.to < xrange.axis.min || xrange.from > xrange.axis.max || | |
| yrange.to < yrange.axis.min || yrange.from > yrange.axis.max) | |
| continue; | |
| xrange.from = Math.max(xrange.from, xrange.axis.min); | |
| xrange.to = Math.min(xrange.to, xrange.axis.max); | |
| yrange.from = Math.max(yrange.from, yrange.axis.min); | |
| yrange.to = Math.min(yrange.to, yrange.axis.max); | |
| if (xrange.from == xrange.to && yrange.from == yrange.to) | |
| continue; | |
| // then draw | |
| xrange.from = xrange.axis.p2c(xrange.from); | |
| xrange.to = xrange.axis.p2c(xrange.to); | |
| yrange.from = yrange.axis.p2c(yrange.from); | |
| yrange.to = yrange.axis.p2c(yrange.to); | |
| if (xrange.from == xrange.to || yrange.from == yrange.to) { | |
| // draw line | |
| ctx.beginPath(); | |
| ctx.strokeStyle = m.color || options.grid.markingsColor; | |
| ctx.lineWidth = m.lineWidth || options.grid.markingsLineWidth; | |
| ctx.moveTo(xrange.from, yrange.from); | |
| ctx.lineTo(xrange.to, yrange.to); | |
| ctx.stroke(); | |
| } | |
| else { | |
| // fill area | |
| ctx.fillStyle = m.color || options.grid.markingsColor; | |
| ctx.fillRect(xrange.from, yrange.to, | |
| xrange.to - xrange.from, | |
| yrange.from - yrange.to); | |
| } | |
| } | |
| } | |
| // draw the ticks | |
| var axes = allAxes(), bw = options.grid.borderWidth; | |
| for (var j = 0; j < axes.length; ++j) { | |
| var axis = axes[j], box = axis.box, | |
| t = axis.tickLength, x, y, xoff, yoff; | |
| if (!axis.show || axis.ticks.length == 0) | |
| continue | |
| ctx.strokeStyle = axis.options.tickColor || $.color.parse(axis.options.color).scale('a', 0.22).toString(); | |
| ctx.lineWidth = 1; | |
| // find the edges | |
| if (axis.direction == "x") { | |
| x = 0; | |
| if (t == "full") | |
| y = (axis.position == "top" ? 0 : plotHeight); | |
| else | |
| y = box.top - plotOffset.top + (axis.position == "top" ? box.height : 0); | |
| } | |
| else { | |
| y = 0; | |
| if (t == "full") | |
| x = (axis.position == "left" ? 0 : plotWidth); | |
| else | |
| x = box.left - plotOffset.left + (axis.position == "left" ? box.width : 0); | |
| } | |
| // draw tick bar | |
| if (!axis.innermost) { | |
| ctx.beginPath(); | |
| xoff = yoff = 0; | |
| if (axis.direction == "x") | |
| xoff = plotWidth; | |
| else | |
| yoff = plotHeight; | |
| if (ctx.lineWidth == 1) { | |
| x = Math.floor(x) + 0.5; | |
| y = Math.floor(y) + 0.5; | |
| } | |
| ctx.moveTo(x, y); | |
| ctx.lineTo(x + xoff, y + yoff); | |
| ctx.stroke(); | |
| } | |
| // draw ticks | |
| ctx.beginPath(); | |
| for (i = 0; i < axis.ticks.length; ++i) { | |
| var v = axis.ticks[i].v; | |
| xoff = yoff = 0; | |
| if (v < axis.min || v > axis.max | |
| // skip those lying on the axes if we got a border | |
| || (t == "full" && bw > 0 | |
| && (v == axis.min || v == axis.max))) | |
| continue; | |
| if (axis.direction == "x") { | |
| x = axis.p2c(v); | |
| yoff = t == "full" ? -plotHeight : t; | |
| if (axis.position == "top") | |
| yoff = -yoff; | |
| } | |
| else { | |
| y = axis.p2c(v); | |
| xoff = t == "full" ? -plotWidth : t; | |
| if (axis.position == "left") | |
| xoff = -xoff; | |
| } | |
| if (ctx.lineWidth == 1) { | |
| if (axis.direction == "x") | |
| x = Math.floor(x) + 0.5; | |
| else | |
| y = Math.floor(y) + 0.5; | |
| } | |
| ctx.moveTo(x, y); | |
| ctx.lineTo(x + xoff, y + yoff); | |
| } | |
| ctx.stroke(); | |
| } | |
| // draw border | |
| if (bw) { | |
| ctx.lineWidth = bw; | |
| ctx.strokeStyle = options.grid.borderColor; | |
| ctx.strokeRect(-bw/2, -bw/2, plotWidth + bw, plotHeight + bw); | |
| } | |
| ctx.restore(); | |
| } | |
| function insertAxisLabels() { | |
| placeholder.find(".tickLabels").remove(); | |
| var html = ['<div class="tickLabels" style="font-size:smaller">']; | |
| var axes = allAxes(); | |
| for (var j = 0; j < axes.length; ++j) { | |
| var axis = axes[j], box = axis.box; | |
| if (!axis.show) | |
| continue; | |
| //debug: html.push('<div style="position:absolute;opacity:0.10;background-color:red;left:' + box.left + 'px;top:' + box.top + 'px;width:' + box.width + 'px;height:' + box.height + 'px"></div>') | |
| html.push('<div class="' + axis.direction + 'Axis ' + axis.direction + axis.n + 'Axis" style="color:' + axis.options.color + '">'); | |
| for (var i = 0; i < axis.ticks.length; ++i) { | |
| var tick = axis.ticks[i]; | |
| if (!tick.label || tick.v < axis.min || tick.v > axis.max) | |
| continue; | |
| var pos = {}, align; | |
| if (axis.direction == "x") { | |
| align = "center"; | |
| pos.left = Math.round(plotOffset.left + axis.p2c(tick.v) - axis.labelWidth/2); | |
| if (axis.position == "bottom") | |
| pos.top = box.top + box.padding; | |
| else | |
| pos.bottom = canvasHeight - (box.top + box.height - box.padding); | |
| } | |
| else { | |
| pos.top = Math.round(plotOffset.top + axis.p2c(tick.v) - axis.labelHeight/2); | |
| if (axis.position == "left") { | |
| pos.right = canvasWidth - (box.left + box.width - box.padding) | |
| align = "right"; | |
| } | |
| else { | |
| pos.left = box.left + box.padding; | |
| align = "left"; | |
| } | |
| } | |
| pos.width = axis.labelWidth; | |
| var style = ["position:absolute", "text-align:" + align ]; | |
| for (var a in pos) | |
| style.push(a + ":" + pos[a] + "px") | |
| html.push('<div class="tickLabel" style="' + style.join(';') + '">' + tick.label + '</div>'); | |
| } | |
| html.push('</div>'); | |
| } | |
| html.push('</div>'); | |
| placeholder.append(html.join("")); | |
| } | |
| function drawSeries(series) { | |
| if (series.lines.show) | |
| drawSeriesLines(series); | |
| if (series.bars.show) | |
| drawSeriesBars(series); | |
| if (series.points.show) | |
| drawSeriesPoints(series); | |
| } | |
| function drawSeriesLines(series) { | |
| function plotLine(datapoints, xoffset, yoffset, axisx, axisy) { | |
| var points = datapoints.points, | |
| ps = datapoints.pointsize, | |
| prevx = null, prevy = null; | |
| ctx.beginPath(); | |
| for (var i = ps; i < points.length; i += ps) { | |
| var x1 = points[i - ps], y1 = points[i - ps + 1], | |
| x2 = points[i], y2 = points[i + 1]; | |
| if (x1 == null || x2 == null) | |
| continue; | |
| // clip with ymin | |
| if (y1 <= y2 && y1 < axisy.min) { | |
| if (y2 < axisy.min) | |
| continue; // line segment is outside | |
| // compute new intersection point | |
| x1 = (axisy.min - y1) / (y2 - y1) * (x2 - x1) + x1; | |
| y1 = axisy.min; | |
| } | |
| else if (y2 <= y1 && y2 < axisy.min) { | |
| if (y1 < axisy.min) | |
| continue; | |
| x2 = (axisy.min - y1) / (y2 - y1) * (x2 - x1) + x1; | |
| y2 = axisy.min; | |
| } | |
| // clip with ymax | |
| if (y1 >= y2 && y1 > axisy.max) { | |
| if (y2 > axisy.max) | |
| continue; | |
| x1 = (axisy.max - y1) / (y2 - y1) * (x2 - x1) + x1; | |
| y1 = axisy.max; | |
| } | |
| else if (y2 >= y1 && y2 > axisy.max) { | |
| if (y1 > axisy.max) | |
| continue; | |
| x2 = (axisy.max - y1) / (y2 - y1) * (x2 - x1) + x1; | |
| y2 = axisy.max; | |
| } | |
| // clip with xmin | |
| if (x1 <= x2 && x1 < axisx.min) { | |
| if (x2 < axisx.min) | |
| continue; | |
| y1 = (axisx.min - x1) / (x2 - x1) * (y2 - y1) + y1; | |
| x1 = axisx.min; | |
| } | |
| else if (x2 <= x1 && x2 < axisx.min) { | |
| if (x1 < axisx.min) | |
| continue; | |
| y2 = (axisx.min - x1) / (x2 - x1) * (y2 - y1) + y1; | |
| x2 = axisx.min; | |
| } | |
| // clip with xmax | |
| if (x1 >= x2 && x1 > axisx.max) { | |
| if (x2 > axisx.max) | |
| continue; | |
| y1 = (axisx.max - x1) / (x2 - x1) * (y2 - y1) + y1; | |
| x1 = axisx.max; | |
| } | |
| else if (x2 >= x1 && x2 > axisx.max) { | |
| if (x1 > axisx.max) | |
| continue; | |
| y2 = (axisx.max - x1) / (x2 - x1) * (y2 - y1) + y1; | |
| x2 = axisx.max; | |
| } | |
| if (x1 != prevx || y1 != prevy) | |
| ctx.moveTo(axisx.p2c(x1) + xoffset, axisy.p2c(y1) + yoffset); | |
| prevx = x2; | |
| prevy = y2; | |
| ctx.lineTo(axisx.p2c(x2) + xoffset, axisy.p2c(y2) + yoffset); | |
| } | |
| ctx.stroke(); | |
| } | |
| function plotLineArea(datapoints, axisx, axisy) { | |
| var points = datapoints.points, | |
| ps = datapoints.pointsize, | |
| bottom = Math.min(Math.max(0, axisy.min), axisy.max), | |
| i = 0, top, areaOpen = false, | |
| ypos = 1, segmentStart = 0, segmentEnd = 0; | |
| // we process each segment in two turns, first forward | |
| // direction to sketch out top, then once we hit the | |
| // end we go backwards to sketch the bottom | |
| while (true) { | |
| if (ps > 0 && i > points.length + ps) | |
| break; | |
| i += ps; // ps is negative if going backwards | |
| var x1 = points[i - ps], | |
| y1 = points[i - ps + ypos], | |
| x2 = points[i], y2 = points[i + ypos]; | |
| if (areaOpen) { | |
| if (ps > 0 && x1 != null && x2 == null) { | |
| // at turning point | |
| segmentEnd = i; | |
| ps = -ps; | |
| ypos = 2; | |
| continue; | |
| } | |
| if (ps < 0 && i == segmentStart + ps) { | |
| // done with the reverse sweep | |
| ctx.fill(); | |
| areaOpen = false; | |
| ps = -ps; | |
| ypos = 1; | |
| i = segmentStart = segmentEnd + ps; | |
| continue; | |
| } | |
| } | |
| if (x1 == null || x2 == null) | |
| continue; | |
| // clip x values | |
| // clip with xmin | |
| if (x1 <= x2 && x1 < axisx.min) { | |
| if (x2 < axisx.min) | |
| continue; | |
| y1 = (axisx.min - x1) / (x2 - x1) * (y2 - y1) + y1; | |
| x1 = axisx.min; | |
| } | |
| else if (x2 <= x1 && x2 < axisx.min) { | |
| if (x1 < axisx.min) | |
| continue; | |
| y2 = (axisx.min - x1) / (x2 - x1) * (y2 - y1) + y1; | |
| x2 = axisx.min; | |
| } | |
| // clip with xmax | |
| if (x1 >= x2 && x1 > axisx.max) { | |
| if (x2 > axisx.max) | |
| continue; | |
| y1 = (axisx.max - x1) / (x2 - x1) * (y2 - y1) + y1; | |
| x1 = axisx.max; | |
| } | |
| else if (x2 >= x1 && x2 > axisx.max) { | |
| if (x1 > axisx.max) | |
| continue; | |
| y2 = (axisx.max - x1) / (x2 - x1) * (y2 - y1) + y1; | |
| x2 = axisx.max; | |
| } | |
| if (!areaOpen) { | |
| // open area | |
| ctx.beginPath(); | |
| ctx.moveTo(axisx.p2c(x1), axisy.p2c(bottom)); | |
| areaOpen = true; | |
| } | |
| // now first check the case where both is outside | |
| if (y1 >= axisy.max && y2 >= axisy.max) { | |
| ctx.lineTo(axisx.p2c(x1), axisy.p2c(axisy.max)); | |
| ctx.lineTo(axisx.p2c(x2), axisy.p2c(axisy.max)); | |
| continue; | |
| } | |
| else if (y1 <= axisy.min && y2 <= axisy.min) { | |
| ctx.lineTo(axisx.p2c(x1), axisy.p2c(axisy.min)); | |
| ctx.lineTo(axisx.p2c(x2), axisy.p2c(axisy.min)); | |
| continue; | |
| } | |
| // else it's a bit more complicated, there might | |
| // be a flat maxed out rectangle first, then a | |
| // triangular cutout or reverse; to find these | |
| // keep track of the current x values | |
| var x1old = x1, x2old = x2; | |
| // clip the y values, without shortcutting, we | |
| // go through all cases in turn | |
| // clip with ymin | |
| if (y1 <= y2 && y1 < axisy.min && y2 >= axisy.min) { | |
| x1 = (axisy.min - y1) / (y2 - y1) * (x2 - x1) + x1; | |
| y1 = axisy.min; | |
| } | |
| else if (y2 <= y1 && y2 < axisy.min && y1 >= axisy.min) { | |
| x2 = (axisy.min - y1) / (y2 - y1) * (x2 - x1) + x1; | |
| y2 = axisy.min; | |
| } | |
| // clip with ymax | |
| if (y1 >= y2 && y1 > axisy.max && y2 <= axisy.max) { | |
| x1 = (axisy.max - y1) / (y2 - y1) * (x2 - x1) + x1; | |
| y1 = axisy.max; | |
| } | |
| else if (y2 >= y1 && y2 > axisy.max && y1 <= axisy.max) { | |
| x2 = (axisy.max - y1) / (y2 - y1) * (x2 - x1) + x1; | |
| y2 = axisy.max; | |
| } | |
| // if the x value was changed we got a rectangle | |
| // to fill | |
| if (x1 != x1old) { | |
| ctx.lineTo(axisx.p2c(x1old), axisy.p2c(y1)); | |
| // it goes to (x1, y1), but we fill that below | |
| } | |
| // fill triangular section, this sometimes result | |
| // in redundant points if (x1, y1) hasn't changed | |
| // from previous line to, but we just ignore that | |
| ctx.lineTo(axisx.p2c(x1), axisy.p2c(y1)); | |
| ctx.lineTo(axisx.p2c(x2), axisy.p2c(y2)); | |
| // fill the other rectangle if it's there | |
| if (x2 != x2old) { | |
| ctx.lineTo(axisx.p2c(x2), axisy.p2c(y2)); | |
| ctx.lineTo(axisx.p2c(x2old), axisy.p2c(y2)); | |
| } | |
| } | |
| } | |
| ctx.save(); | |
| ctx.translate(plotOffset.left, plotOffset.top); | |
| ctx.lineJoin = "round"; | |
| var lw = series.lines.lineWidth, | |
| sw = series.shadowSize; | |
| // FIXME: consider another form of shadow when filling is turned on | |
| if (lw > 0 && sw > 0) { | |
| // draw shadow as a thick and thin line with transparency | |
| ctx.lineWidth = sw; | |
| ctx.strokeStyle = "rgba(0,0,0,0.1)"; | |
| // position shadow at angle from the mid of line | |
| var angle = Math.PI/18; | |
| plotLine(series.datapoints, Math.sin(angle) * (lw/2 + sw/2), Math.cos(angle) * (lw/2 + sw/2), series.xaxis, series.yaxis); | |
| ctx.lineWidth = sw/2; | |
| plotLine(series.datapoints, Math.sin(angle) * (lw/2 + sw/4), Math.cos(angle) * (lw/2 + sw/4), series.xaxis, series.yaxis); | |
| } | |
| ctx.lineWidth = lw; | |
| ctx.strokeStyle = series.color; | |
| var fillStyle = getFillStyle(series.lines, series.color, 0, plotHeight); | |
| if (fillStyle) { | |
| ctx.fillStyle = fillStyle; | |
| plotLineArea(series.datapoints, series.xaxis, series.yaxis); | |
| } | |
| if (lw > 0) | |
| plotLine(series.datapoints, 0, 0, series.xaxis, series.yaxis); | |
| ctx.restore(); | |
| } | |
| function drawSeriesPoints(series) { | |
| function plotPoints(datapoints, radius, fillStyle, offset, shadow, axisx, axisy, symbol) { | |
| var points = datapoints.points, ps = datapoints.pointsize; | |
| for (var i = 0; i < points.length; i += ps) { | |
| var x = points[i], y = points[i + 1]; | |
| if (x == null || x < axisx.min || x > axisx.max || y < axisy.min || y > axisy.max) | |
| continue; | |
| ctx.beginPath(); | |
| x = axisx.p2c(x); | |
| y = axisy.p2c(y) + offset; | |
| if (symbol == "circle") | |
| ctx.arc(x, y, radius, 0, shadow ? Math.PI : Math.PI * 2, false); | |
| else | |
| symbol(ctx, x, y, radius, shadow); | |
| ctx.closePath(); | |
| if (fillStyle) { | |
| ctx.fillStyle = fillStyle; | |
| ctx.fill(); | |
| } | |
| ctx.stroke(); | |
| } | |
| } | |
| ctx.save(); | |
| ctx.translate(plotOffset.left, plotOffset.top); | |
| var lw = series.points.lineWidth, | |
| sw = series.shadowSize, | |
| radius = series.points.radius, | |
| symbol = series.points.symbol; | |
| if (lw > 0 && sw > 0) { | |
| // draw shadow in two steps | |
| var w = sw / 2; | |
| ctx.lineWidth = w; | |
| ctx.strokeStyle = "rgba(0,0,0,0.1)"; | |
| plotPoints(series.datapoints, radius, null, w + w/2, true, | |
| series.xaxis, series.yaxis, symbol); | |
| ctx.strokeStyle = "rgba(0,0,0,0.2)"; | |
| plotPoints(series.datapoints, radius, null, w/2, true, | |
| series.xaxis, series.yaxis, symbol); | |
| } | |
| ctx.lineWidth = lw; | |
| ctx.strokeStyle = series.color; | |
| plotPoints(series.datapoints, radius, | |
| getFillStyle(series.points, series.color), 0, false, | |
| series.xaxis, series.yaxis, symbol); | |
| ctx.restore(); | |
| } | |
| function drawBar(x, y, b, barLeft, barRight, offset, fillStyleCallback, axisx, axisy, c, horizontal, lineWidth) { | |
| var left, right, bottom, top, | |
| drawLeft, drawRight, drawTop, drawBottom, | |
| tmp; | |
| // in horizontal mode, we start the bar from the left | |
| // instead of from the bottom so it appears to be | |
| // horizontal rather than vertical | |
| if (horizontal) { | |
| drawBottom = drawRight = drawTop = true; | |
| drawLeft = false; | |
| left = b; | |
| right = x; | |
| top = y + barLeft; | |
| bottom = y + barRight; | |
| // account for negative bars | |
| if (right < left) { | |
| tmp = right; | |
| right = left; | |
| left = tmp; | |
| drawLeft = true; | |
| drawRight = false; | |
| } | |
| } | |
| else { | |
| drawLeft = drawRight = drawTop = true; | |
| drawBottom = false; | |
| left = x + barLeft; | |
| right = x + barRight; | |
| bottom = b; | |
| top = y; | |
| // account for negative bars | |
| if (top < bottom) { | |
| tmp = top; | |
| top = bottom; | |
| bottom = tmp; | |
| drawBottom = true; | |
| drawTop = false; | |
| } | |
| } | |
| // clip | |
| if (right < axisx.min || left > axisx.max || | |
| top < axisy.min || bottom > axisy.max) | |
| return; | |
| if (left < axisx.min) { | |
| left = axisx.min; | |
| drawLeft = false; | |
| } | |
| if (right > axisx.max) { | |
| right = axisx.max; | |
| drawRight = false; | |
| } | |
| if (bottom < axisy.min) { | |
| bottom = axisy.min; | |
| drawBottom = false; | |
| } | |
| if (top > axisy.max) { | |
| top = axisy.max; | |
| drawTop = false; | |
| } | |
| left = axisx.p2c(left); | |
| bottom = axisy.p2c(bottom); | |
| right = axisx.p2c(right); | |
| top = axisy.p2c(top); | |
| // fill the bar | |
| if (fillStyleCallback) { | |
| c.beginPath(); | |
| c.moveTo(left, bottom); | |
| c.lineTo(left, top); | |
| c.lineTo(right, top); | |
| c.lineTo(right, bottom); | |
| c.fillStyle = fillStyleCallback(bottom, top); | |
| c.fill(); | |
| } | |
| // draw outline | |
| if (lineWidth > 0 && (drawLeft || drawRight || drawTop || drawBottom)) { | |
| c.beginPath(); | |
| // FIXME: inline moveTo is buggy with excanvas | |
| c.moveTo(left, bottom + offset); | |
| if (drawLeft) | |
| c.lineTo(left, top + offset); | |
| else | |
| c.moveTo(left, top + offset); | |
| if (drawTop) | |
| c.lineTo(right, top + offset); | |
| else | |
| c.moveTo(right, top + offset); | |
| if (drawRight) | |
| c.lineTo(right, bottom + offset); | |
| else | |
| c.moveTo(right, bottom + offset); | |
| if (drawBottom) | |
| c.lineTo(left, bottom + offset); | |
| else | |
| c.moveTo(left, bottom + offset); | |
| c.stroke(); | |
| } | |
| } | |
| function drawSeriesBars(series) { | |
| function plotBars(datapoints, barLeft, barRight, offset, fillStyleCallback, axisx, axisy) { | |
| var points = datapoints.points, ps = datapoints.pointsize; | |
| for (var i = 0; i < points.length; i += ps) { | |
| if (points[i] == null) | |
| continue; | |
| drawBar(points[i], points[i + 1], points[i + 2], barLeft, barRight, offset, fillStyleCallback, axisx, axisy, ctx, series.bars.horizontal, series.bars.lineWidth); | |
| } | |
| } | |
| ctx.save(); | |
| ctx.translate(plotOffset.left, plotOffset.top); | |
| // FIXME: figure out a way to add shadows (for instance along the right edge) | |
| ctx.lineWidth = series.bars.lineWidth; | |
| ctx.strokeStyle = series.color; | |
| var barLeft = series.bars.align == "left" ? 0 : -series.bars.barWidth/2; | |
| var fillStyleCallback = series.bars.fill ? function (bottom, top) { return getFillStyle(series.bars, series.color, bottom, top); } : null; | |
| plotBars(series.datapoints, barLeft, barLeft + series.bars.barWidth, 0, fillStyleCallback, series.xaxis, series.yaxis); | |
| ctx.restore(); | |
| } | |
| function getFillStyle(filloptions, seriesColor, bottom, top) { | |
| var fill = filloptions.fill; | |
| if (!fill) | |
| return null; | |
| if (filloptions.fillColor) | |
| return getColorOrGradient(filloptions.fillColor, bottom, top, seriesColor); | |
| var c = $.color.parse(seriesColor); | |
| c.a = typeof fill == "number" ? fill : 0.4; | |
| c.normalize(); | |
| return c.toString(); | |
| } | |
| function insertLegend() { | |
| placeholder.find(".legend").remove(); | |
| if (!options.legend.show) | |
| return; | |
| var fragments = [], rowStarted = false, | |
| lf = options.legend.labelFormatter, s, label; | |
| for (var i = 0; i < series.length; ++i) { | |
| s = series[i]; | |
| label = s.label; | |
| if (!label) | |
| continue; | |
| if (i % options.legend.noColumns == 0) { | |
| if (rowStarted) | |
| fragments.push('</tr>'); | |
| fragments.push('<tr>'); | |
| rowStarted = true; | |
| } | |
| if (lf) | |
| label = lf(label, s); | |
| fragments.push( | |
| '<td class="legendColorBox"><div style="border:1px solid ' + options.legend.labelBoxBorderColor + ';padding:1px"><div style="width:4px;height:0;border:5px solid ' + s.color + ';overflow:hidden"></div></div></td>' + | |
| '<td class="legendLabel">' + label + '</td>'); | |
| } | |
| if (rowStarted) | |
| fragments.push('</tr>'); | |
| if (fragments.length == 0) | |
| return; | |
| var table = '<table style="font-size:smaller;color:' + options.grid.color + '">' + fragments.join("") + '</table>'; | |
| if (options.legend.container != null) | |
| $(options.legend.container).html(table); | |
| else { | |
| var pos = "", | |
| p = options.legend.position, | |
| m = options.legend.margin; | |
| if (m[0] == null) | |
| m = [m, m]; | |
| if (p.charAt(0) == "n") | |
| pos += 'top:' + (m[1] + plotOffset.top) + 'px;'; | |
| else if (p.charAt(0) == "s") | |
| pos += 'bottom:' + (m[1] + plotOffset.bottom) + 'px;'; | |
| if (p.charAt(1) == "e") | |
| pos += 'right:' + (m[0] + plotOffset.right) + 'px;'; | |
| else if (p.charAt(1) == "w") | |
| pos += 'left:' + (m[0] + plotOffset.left) + 'px;'; | |
| var legend = $('<div class="legend">' + table.replace('style="', 'style="position:absolute;' + pos +';') + '</div>').appendTo(placeholder); | |
| if (options.legend.backgroundOpacity != 0.0) { | |
| // put in the transparent background | |
| // separately to avoid blended labels and | |
| // label boxes | |
| var c = options.legend.backgroundColor; | |
| if (c == null) { | |
| c = options.grid.backgroundColor; | |
| if (c && typeof c == "string") | |
| c = $.color.parse(c); | |
| else | |
| c = $.color.extract(legend, 'background-color'); | |
| c.a = 1; | |
| c = c.toString(); | |
| } | |
| var div = legend.children(); | |
| $('<div style="position:absolute;width:' + div.width() + 'px;height:' + div.height() + 'px;' + pos +'background-color:' + c + ';"> </div>').prependTo(legend).css('opacity', options.legend.backgroundOpacity); | |
| } | |
| } | |
| } | |
| // interactive features | |
| var highlights = [], | |
| redrawTimeout = null; | |
| // returns the data item the mouse is over, or null if none is found | |
| function findNearbyItem(mouseX, mouseY, seriesFilter) { | |
| var maxDistance = options.grid.mouseActiveRadius, | |
| smallestDistance = maxDistance * maxDistance + 1, | |
| item = null, foundPoint = false, i, j; | |
| for (i = series.length - 1; i >= 0; --i) { | |
| if (!seriesFilter(series[i])) | |
| continue; | |
| var s = series[i], | |
| axisx = s.xaxis, | |
| axisy = s.yaxis, | |
| points = s.datapoints.points, | |
| ps = s.datapoints.pointsize, | |
| mx = axisx.c2p(mouseX), // precompute some stuff to make the loop faster | |
| my = axisy.c2p(mouseY), | |
| maxx = maxDistance / axisx.scale, | |
| maxy = maxDistance / axisy.scale; | |
| // with inverse transforms, we can't use the maxx/maxy | |
| // optimization, sadly | |
| if (axisx.options.inverseTransform) | |
| maxx = Number.MAX_VALUE; | |
| if (axisy.options.inverseTransform) | |
| maxy = Number.MAX_VALUE; | |
| if (s.lines.show || s.points.show) { | |
| for (j = 0; j < points.length; j += ps) { | |
| var x = points[j], y = points[j + 1]; | |
| if (x == null) | |
| continue; | |
| // For points and lines, the cursor must be within a | |
| // certain distance to the data point | |
| if (x - mx > maxx || x - mx < -maxx || | |
| y - my > maxy || y - my < -maxy) | |
| continue; | |
| // We have to calculate distances in pixels, not in | |
| // data units, because the scales of the axes may be different | |
| var dx = Math.abs(axisx.p2c(x) - mouseX), | |
| dy = Math.abs(axisy.p2c(y) - mouseY), | |
| dist = dx * dx + dy * dy; // we save the sqrt | |
| // use <= to ensure last point takes precedence | |
| // (last generally means on top of) | |
| if (dist < smallestDistance) { | |
| smallestDistance = dist; | |
| item = [i, j / ps]; | |
| } | |
| } | |
| } | |
| if (s.bars.show && !item) { // no other point can be nearby | |
| var barLeft = s.bars.align == "left" ? 0 : -s.bars.barWidth/2, | |
| barRight = barLeft + s.bars.barWidth; | |
| for (j = 0; j < points.length; j += ps) { | |
| var x = points[j], y = points[j + 1], b = points[j + 2]; | |
| if (x == null) | |
| continue; | |
| // for a bar graph, the cursor must be inside the bar | |
| if (series[i].bars.horizontal ? | |
| (mx <= Math.max(b, x) && mx >= Math.min(b, x) && | |
| my >= y + barLeft && my <= y + barRight) : | |
| (mx >= x + barLeft && mx <= x + barRight && | |
| my >= Math.min(b, y) && my <= Math.max(b, y))) | |
| item = [i, j / ps]; | |
| } | |
| } | |
| } | |
| if (item) { | |
| i = item[0]; | |
| j = item[1]; | |
| ps = series[i].datapoints.pointsize; | |
| return { datapoint: series[i].datapoints.points.slice(j * ps, (j + 1) * ps), | |
| dataIndex: j, | |
| series: series[i], | |
| seriesIndex: i }; | |
| } | |
| return null; | |
| } | |
| function onMouseMove(e) { | |
| if (options.grid.hoverable) | |
| triggerClickHoverEvent("plothover", e, | |
| function (s) { return s["hoverable"] != false; }); | |
| } | |
| function onMouseLeave(e) { | |
| if (options.grid.hoverable) | |
| triggerClickHoverEvent("plothover", e, | |
| function (s) { return false; }); | |
| } | |
| function onClick(e) { | |
| triggerClickHoverEvent("plotclick", e, | |
| function (s) { return s["clickable"] != false; }); | |
| } | |
| // trigger click or hover event (they send the same parameters | |
| // so we share their code) | |
| function triggerClickHoverEvent(eventname, event, seriesFilter) { | |
| var offset = eventHolder.offset(), | |
| canvasX = event.pageX - offset.left - plotOffset.left, | |
| canvasY = event.pageY - offset.top - plotOffset.top, | |
| pos = canvasToAxisCoords({ left: canvasX, top: canvasY }); | |
| pos.pageX = event.pageX; | |
| pos.pageY = event.pageY; | |
| var item = findNearbyItem(canvasX, canvasY, seriesFilter); | |
| if (item) { | |
| // fill in mouse pos for any listeners out there | |
| item.pageX = parseInt(item.series.xaxis.p2c(item.datapoint[0]) + offset.left + plotOffset.left); | |
| item.pageY = parseInt(item.series.yaxis.p2c(item.datapoint[1]) + offset.top + plotOffset.top); | |
| } | |
| if (options.grid.autoHighlight) { | |
| // clear auto-highlights | |
| for (var i = 0; i < highlights.length; ++i) { | |
| var h = highlights[i]; | |
| if (h.auto == eventname && | |
| !(item && h.series == item.series && | |
| h.point[0] == item.datapoint[0] && | |
| h.point[1] == item.datapoint[1])) | |
| unhighlight(h.series, h.point); | |
| } | |
| if (item) | |
| highlight(item.series, item.datapoint, eventname); | |
| } | |
| placeholder.trigger(eventname, [ pos, item ]); | |
| } | |
| function triggerRedrawOverlay() { | |
| if (!redrawTimeout) | |
| redrawTimeout = setTimeout(drawOverlay, 30); | |
| } | |
| function drawOverlay() { | |
| redrawTimeout = null; | |
| // draw highlights | |
| octx.save(); | |
| octx.clearRect(0, 0, canvasWidth, canvasHeight); | |
| octx.translate(plotOffset.left, plotOffset.top); | |
| var i, hi; | |
| for (i = 0; i < highlights.length; ++i) { | |
| hi = highlights[i]; | |
| if (hi.series.bars.show) | |
| drawBarHighlight(hi.series, hi.point); | |
| else | |
| drawPointHighlight(hi.series, hi.point); | |
| } | |
| octx.restore(); | |
| executeHooks(hooks.drawOverlay, [octx]); | |
| } | |
| function highlight(s, point, auto) { | |
| if (typeof s == "number") | |
| s = series[s]; | |
| if (typeof point == "number") { | |
| var ps = s.datapoints.pointsize; | |
| point = s.datapoints.points.slice(ps * point, ps * (point + 1)); | |
| } | |
| var i = indexOfHighlight(s, point); | |
| if (i == -1) { | |
| highlights.push({ series: s, point: point, auto: auto }); | |
| triggerRedrawOverlay(); | |
| } | |
| else if (!auto) | |
| highlights[i].auto = false; | |
| } | |
| function unhighlight(s, point) { | |
| if (s == null && point == null) { | |
| highlights = []; | |
| triggerRedrawOverlay(); | |
| } | |
| if (typeof s == "number") | |
| s = series[s]; | |
| if (typeof point == "number") | |
| point = s.data[point]; | |
| var i = indexOfHighlight(s, point); | |
| if (i != -1) { | |
| highlights.splice(i, 1); | |
| triggerRedrawOverlay(); | |
| } | |
| } | |
| function indexOfHighlight(s, p) { | |
| for (var i = 0; i < highlights.length; ++i) { | |
| var h = highlights[i]; | |
| if (h.series == s && h.point[0] == p[0] | |
| && h.point[1] == p[1]) | |
| return i; | |
| } | |
| return -1; | |
| } | |
| function drawPointHighlight(series, point) { | |
| var x = point[0], y = point[1], | |
| axisx = series.xaxis, axisy = series.yaxis; | |
| if (x < axisx.min || x > axisx.max || y < axisy.min || y > axisy.max) | |
| return; | |
| var pointRadius = series.points.radius + series.points.lineWidth / 2; | |
| octx.lineWidth = pointRadius; | |
| octx.strokeStyle = $.color.parse(series.color).scale('a', 0.5).toString(); | |
| var radius = 1.5 * pointRadius, | |
| x = axisx.p2c(x), | |
| y = axisy.p2c(y); | |
| octx.beginPath(); | |
| if (series.points.symbol == "circle") | |
| octx.arc(x, y, radius, 0, 2 * Math.PI, false); | |
| else | |
| series.points.symbol(octx, x, y, radius, false); | |
| octx.closePath(); | |
| octx.stroke(); | |
| } | |
| function drawBarHighlight(series, point) { | |
| octx.lineWidth = series.bars.lineWidth; | |
| octx.strokeStyle = $.color.parse(series.color).scale('a', 0.5).toString(); | |
| var fillStyle = $.color.parse(series.color).scale('a', 0.5).toString(); | |
| var barLeft = series.bars.align == "left" ? 0 : -series.bars.barWidth/2; | |
| drawBar(point[0], point[1], point[2] || 0, barLeft, barLeft + series.bars.barWidth, | |
| 0, function () { return fillStyle; }, series.xaxis, series.yaxis, octx, series.bars.horizontal, series.bars.lineWidth); | |
| } | |
| function getColorOrGradient(spec, bottom, top, defaultColor) { | |
| if (typeof spec == "string") | |
| return spec; | |
| else { | |
| // assume this is a gradient spec; IE currently only | |
| // supports a simple vertical gradient properly, so that's | |
| // what we support too | |
| var gradient = ctx.createLinearGradient(0, top, 0, bottom); | |
| for (var i = 0, l = spec.colors.length; i < l; ++i) { | |
| var c = spec.colors[i]; | |
| if (typeof c != "string") { | |
| var co = $.color.parse(defaultColor); | |
| if (c.brightness != null) | |
| co = co.scale('rgb', c.brightness) | |
| if (c.opacity != null) | |
| co.a *= c.opacity; | |
| c = co.toString(); | |
| } | |
| gradient.addColorStop(i / (l - 1), c); | |
| } | |
| return gradient; | |
| } | |
| } | |
| } | |
| $.plot = function(placeholder, data, options) { | |
| //var t0 = new Date(); | |
| var plot = new Plot($(placeholder), data, options, $.plot.plugins); | |
| //(window.console ? console.log : alert)("time used (msecs): " + ((new Date()).getTime() - t0.getTime())); | |
| return plot; | |
| }; | |
| $.plot.version = "0.7"; | |
| $.plot.plugins = []; | |
| // returns a string with the date d formatted according to fmt | |
| $.plot.formatDate = function(d, fmt, monthNames) { | |
| var leftPad = function(n) { | |
| n = "" + n; | |
| return n.length == 1 ? "0" + n : n; | |
| }; | |
| var r = []; | |
| var escape = false, padNext = false; | |
| var hours = d.getUTCHours(); | |
| var isAM = hours < 12; | |
| if (monthNames == null) | |
| monthNames = ["Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug", "Sep", "Oct", "Nov", "Dec"]; | |
| if (fmt.search(/%p|%P/) != -1) { | |
| if (hours > 12) { | |
| hours = hours - 12; | |
| } else if (hours == 0) { | |
| hours = 12; | |
| } | |
| } | |
| for (var i = 0; i < fmt.length; ++i) { | |
| var c = fmt.charAt(i); | |
| if (escape) { | |
| switch (c) { | |
| case 'h': c = "" + hours; break; | |
| case 'H': c = leftPad(hours); break; | |
| case 'M': c = leftPad(d.getUTCMinutes()); break; | |
| case 'S': c = leftPad(d.getUTCSeconds()); break; | |
| case 'd': c = "" + d.getUTCDate(); break; | |
| case 'm': c = "" + (d.getUTCMonth() + 1); break; | |
| case 'y': c = "" + d.getUTCFullYear(); break; | |
| case 'b': c = "" + monthNames[d.getUTCMonth()]; break; | |
| case 'p': c = (isAM) ? ("" + "am") : ("" + "pm"); break; | |
| case 'P': c = (isAM) ? ("" + "AM") : ("" + "PM"); break; | |
| case '0': c = ""; padNext = true; break; | |
| } | |
| if (c && padNext) { | |
| c = leftPad(c); | |
| padNext = false; | |
| } | |
| r.push(c); | |
| if (!padNext) | |
| escape = false; | |
| } | |
| else { | |
| if (c == "%") | |
| escape = true; | |
| else | |
| r.push(c); | |
| } | |
| } | |
| return r.join(""); | |
| }; | |
| // round to nearby lower multiple of base | |
| function floorInBase(n, base) { | |
| return base * Math.floor(n / base); | |
| } | |
| })(jQuery); | |
| /* Javascript plotting library for jQuery, v. 0.7. | |
| * | |
| * Released under the MIT license by IOLA, December 2007. | |
| * | |
| */ | |
| (function(b){b.color={};b.color.make=function(d,e,g,f){var c={};c.r=d||0;c.g=e||0;c.b=g||0;c.a=f!=null?f:1;c.add=function(h,j){for(var k=0;k<h.length;++k){c[h.charAt(k)]+=j}return c.normalize()};c.scale=function(h,j){for(var k=0;k<h.length;++k){c[h.charAt(k)]*=j}return c.normalize()};c.toString=function(){if(c.a>=1){return"rgb("+[c.r,c.g,c.b].join(",")+")"}else{return"rgba("+[c.r,c.g,c.b,c.a].join(",")+")"}};c.normalize=function(){function h(k,j,l){return j<k?k:(j>l?l:j)}c.r=h(0,parseInt(c.r),255);c.g=h(0,parseInt(c.g),255);c.b=h(0,parseInt(c.b),255);c.a=h(0,c.a,1);return c};c.clone=function(){return b.color.make(c.r,c.b,c.g,c.a)};return c.normalize()};b.color.extract=function(d,e){var c;do{c=d.css(e).toLowerCase();if(c!=""&&c!="transparent"){break}d=d.parent()}while(!b.nodeName(d.get(0),"body"));if(c=="rgba(0, 0, 0, 0)"){c="transparent"}return b.color.parse(c)};b.color.parse=function(c){var d,f=b.color.make;if(d=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(c)){return f(parseInt(d[1],10),parseInt(d[2],10),parseInt(d[3],10))}if(d=/rgba\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(c)){return f(parseInt(d[1],10),parseInt(d[2],10),parseInt(d[3],10),parseFloat(d[4]))}if(d=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(c)){return f(parseFloat(d[1])*2.55,parseFloat(d[2])*2.55,parseFloat(d[3])*2.55)}if(d=/rgba\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(c)){return f(parseFloat(d[1])*2.55,parseFloat(d[2])*2.55,parseFloat(d[3])*2.55,parseFloat(d[4]))}if(d=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(c)){return f(parseInt(d[1],16),parseInt(d[2],16),parseInt(d[3],16))}if(d=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(c)){return f(parseInt(d[1]+d[1],16),parseInt(d[2]+d[2],16),parseInt(d[3]+d[3],16))}var e=b.trim(c).toLowerCase();if(e=="transparent"){return f(255,255,255,0)}else{d=a[e]||[0,0,0];return f(d[0],d[1],d[2])}};var a={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0]}})(jQuery);(function(c){function b(av,ai,J,af){var Q=[],O={colors:["#edc240","#afd8f8","#cb4b4b","#4da74d","#9440ed"],legend:{show:true,noColumns:1,labelFormatter:null,labelBoxBorderColor:"#ccc",container:null,position:"ne",margin:5,backgroundColor:null,backgroundOpacity:0.85},xaxis:{show:null,position:"bottom",mode:null,color:null,tickColor:null,transform:null,inverseTransform:null,min:null,max:null,autoscaleMargin:null,ticks:null,tickFormatter:null,labelWidth:null,labelHeight:null,reserveSpace:null,tickLength:null,alignTicksWithAxis:null,tickDecimals:null,tickSize:null,minTickSize:null,monthNames:null,timeformat:null,twelveHourClock:false},yaxis:{autoscaleMargin:0.02,position:"left"},xaxes:[],yaxes:[],series:{points:{show:false,radius:3,lineWidth:2,fill:true,fillColor:"#ffffff",symbol:"circle"},lines:{lineWidth:2,fill:false,fillColor:null,steps:false},bars:{show:false,lineWidth:2,barWidth:1,fill:true,fillColor:null,align:"left",horizontal:false},shadowSize:3},grid:{show:true,aboveData:false,color:"#545454",backgroundColor:null,borderColor:null,tickColor:null,labelMargin:5,axisMargin:8,borderWidth:2,minBorderMargin:null,markings:null,markingsColor:"#f4f4f4",markingsLineWidth:2,clickable:false,hoverable:false,autoHighlight:true,mouseActiveRadius:10},hooks:{}},az=null,ad=null,y=null,H=null,A=null,p=[],aw=[],q={left:0,right:0,top:0,bottom:0},G=0,I=0,h=0,w=0,ak={processOptions:[],processRawData:[],processDatapoints:[],drawSeries:[],draw:[],bindEvents:[],drawOverlay:[],shutdown:[]},aq=this;aq.setData=aj;aq.setupGrid=t;aq.draw=W;aq.getPlaceholder=function(){return av};aq.getCanvas=function(){return az};aq.getPlotOffset=function(){return q};aq.width=function(){return h};aq.height=function(){return w};aq.offset=function(){var aB=y.offset();aB.left+=q.left;aB.top+=q.top;return aB};aq.getData=function(){return Q};aq.getAxes=function(){var aC={},aB;c.each(p.concat(aw),function(aD,aE){if(aE){aC[aE.direction+(aE.n!=1?aE.n:"")+"axis"]=aE}});return aC};aq.getXAxes=function(){return p};aq.getYAxes=function(){return aw};aq.c2p=C;aq.p2c=ar;aq.getOptions=function(){return O};aq.highlight=x;aq.unhighlight=T;aq.triggerRedrawOverlay=f;aq.pointOffset=function(aB){return{left:parseInt(p[aA(aB,"x")-1].p2c(+aB.x)+q.left),top:parseInt(aw[aA(aB,"y")-1].p2c(+aB.y)+q.top)}};aq.shutdown=ag;aq.resize=function(){B();g(az);g(ad)};aq.hooks=ak;F(aq);Z(J);X();aj(ai);t();W();ah();function an(aD,aB){aB=[aq].concat(aB);for(var aC=0;aC<aD.length;++aC){aD[aC].apply(this,aB)}}function F(){for(var aB=0;aB<af.length;++aB){var aC=af[aB];aC.init(aq);if(aC.options){c.extend(true,O,aC.options)}}}function Z(aC){var aB;c.extend(true,O,aC);if(O.xaxis.color==null){O.xaxis.color=O.grid.color}if(O.yaxis.color==null){O.yaxis.color=O.grid.color}if(O.xaxis.tickColor==null){O.xaxis.tickColor=O.grid.tickColor}if(O.yaxis.tickColor==null){O.yaxis.tickColor=O.grid.tickColor}if(O.grid.borderColor==null){O.grid.borderColor=O.grid.color}if(O.grid.tickColor==null){O.grid.tickColor=c.color.parse(O.grid.color).scale("a",0.22).toString()}for(aB=0;aB<Math.max(1,O.xaxes.length);++aB){O.xaxes[aB]=c.extend(true,{},O.xaxis,O.xaxes[aB])}for(aB=0;aB<Math.max(1,O.yaxes.length);++aB){O.yaxes[aB]=c.extend(true,{},O.yaxis,O.yaxes[aB])}if(O.xaxis.noTicks&&O.xaxis.ticks==null){O.xaxis.ticks=O.xaxis.noTicks}if(O.yaxis.noTicks&&O.yaxis.ticks==null){O.yaxis.ticks=O.yaxis.noTicks}if(O.x2axis){O.xaxes[1]=c.extend(true,{},O.xaxis,O.x2axis);O.xaxes[1].position="top"}if(O.y2axis){O.yaxes[1]=c.extend(true,{},O.yaxis,O.y2axis);O.yaxes[1].position="right"}if(O.grid.coloredAreas){O.grid.markings=O.grid.coloredAreas}if(O.grid.coloredAreasColor){O.grid.markingsColor=O.grid.coloredAreasColor}if(O.lines){c.extend(true,O.series.lines,O.lines)}if(O.points){c.extend(true,O.series.points,O.points)}if(O.bars){c.extend(true,O.series.bars,O.bars)}if(O.shadowSize!=null){O.series.shadowSize=O.shadowSize}for(aB=0;aB<O.xaxes.length;++aB){V(p,aB+1).options=O.xaxes[aB]}for(aB=0;aB<O.yaxes.length;++aB){V(aw,aB+1).options=O.yaxes[aB]}for(var aD in ak){if(O.hooks[aD]&&O.hooks[aD].length){ak[aD]=ak[aD].concat(O.hooks[aD])}}an(ak.processOptions,[O])}function aj(aB){Q=Y(aB);ax();z()}function Y(aE){var aC=[];for(var aB=0;aB<aE.length;++aB){var aD=c.extend(true,{},O.series);if(aE[aB].data!=null){aD.data=aE[aB].data;delete aE[aB].data;c.extend(true,aD,aE[aB]);aE[aB].data=aD.data}else{aD.data=aE[aB]}aC.push(aD)}return aC}function aA(aC,aD){var aB=aC[aD+"axis"];if(typeof aB=="object"){aB=aB.n}if(typeof aB!="number"){aB=1}return aB}function m(){return c.grep(p.concat(aw),function(aB){return aB})}function C(aE){var aC={},aB,aD;for(aB=0;aB<p.length;++aB){aD=p[aB];if(aD&&aD.used){aC["x"+aD.n]=aD.c2p(aE.left)}}for(aB=0;aB<aw.length;++aB){aD=aw[aB];if(aD&&aD.used){aC["y"+aD.n]=aD.c2p(aE.top)}}if(aC.x1!==undefined){aC.x=aC.x1}if(aC.y1!==undefined){aC.y=aC.y1}return aC}function ar(aF){var aD={},aC,aE,aB;for(aC=0;aC<p.length;++aC){aE=p[aC];if(aE&&aE.used){aB="x"+aE.n;if(aF[aB]==null&&aE.n==1){aB="x"}if(aF[aB]!=null){aD.left=aE.p2c(aF[aB]);break}}}for(aC=0;aC<aw.length;++aC){aE=aw[aC];if(aE&&aE.used){aB="y"+aE.n;if(aF[aB]==null&&aE.n==1){aB="y"}if(aF[aB]!=null){aD.top=aE.p2c(aF[aB]);break}}}return aD}function V(aC,aB){if(!aC[aB-1]){aC[aB-1]={n:aB,direction:aC==p?"x":"y",options:c.extend(true,{},aC==p?O.xaxis:O.yaxis)}}return aC[aB-1]}function ax(){var aG;var aM=Q.length,aB=[],aE=[];for(aG=0;aG<Q.length;++aG){var aJ=Q[aG].color;if(aJ!=null){--aM;if(typeof aJ=="number"){aE.push(aJ)}else{aB.push(c.color.parse(Q[aG].color))}}}for(aG=0;aG<aE.length;++aG){aM=Math.max(aM,aE[aG]+1)}var aC=[],aF=0;aG=0;while(aC.length<aM){var aI;if(O.colors.length==aG){aI=c.color.make(100,100,100)}else{aI=c.color.parse(O.colors[aG])}var aD=aF%2==1?-1:1;aI.scale("rgb",1+aD*Math.ceil(aF/2)*0.2);aC.push(aI);++aG;if(aG>=O.colors.length){aG=0;++aF}}var aH=0,aN;for(aG=0;aG<Q.length;++aG){aN=Q[aG];if(aN.color==null){aN.color=aC[aH].toString();++aH}else{if(typeof aN.color=="number"){aN.color=aC[aN.color].toString()}}if(aN.lines.show==null){var aL,aK=true;for(aL in aN){if(aN[aL]&&aN[aL].show){aK=false;break}}if(aK){aN.lines.show=true}}aN.xaxis=V(p,aA(aN,"x"));aN.yaxis=V(aw,aA(aN,"y"))}}function z(){var aO=Number.POSITIVE_INFINITY,aI=Number.NEGATIVE_INFINITY,aB=Number.MAX_VALUE,aU,aS,aR,aN,aD,aJ,aT,aP,aH,aG,aC,a0,aX,aL;function aF(a3,a2,a1){if(a2<a3.datamin&&a2!=-aB){a3.datamin=a2}if(a1>a3.datamax&&a1!=aB){a3.datamax=a1}}c.each(m(),function(a1,a2){a2.datamin=aO;a2.datamax=aI;a2.used=false});for(aU=0;aU<Q.length;++aU){aJ=Q[aU];aJ.datapoints={points:[]};an(ak.processRawData,[aJ,aJ.data,aJ.datapoints])}for(aU=0;aU<Q.length;++aU){aJ=Q[aU];var aZ=aJ.data,aW=aJ.datapoints.format;if(!aW){aW=[];aW.push({x:true,number:true,required:true});aW.push({y:true,number:true,required:true});if(aJ.bars.show||(aJ.lines.show&&aJ.lines.fill)){aW.push({y:true,number:true,required:false,defaultValue:0});if(aJ.bars.horizontal){delete aW[aW.length-1].y;aW[aW.length-1].x=true}}aJ.datapoints.format=aW}if(aJ.datapoints.pointsize!=null){continue}aJ.datapoints.pointsize=aW.length;aP=aJ.datapoints.pointsize;aT=aJ.datapoints.points;insertSteps=aJ.lines.show&&aJ.lines.steps;aJ.xaxis.used=aJ.yaxis.used=true;for(aS=aR=0;aS<aZ.length;++aS,aR+=aP){aL=aZ[aS];var aE=aL==null;if(!aE){for(aN=0;aN<aP;++aN){a0=aL[aN];aX=aW[aN];if(aX){if(aX.number&&a0!=null){a0=+a0;if(isNaN(a0)){a0=null}else{if(a0==Infinity){a0=aB}else{if(a0==-Infinity){a0=-aB}}}}if(a0==null){if(aX.required){aE=true}if(aX.defaultValue!=null){a0=aX.defaultValue}}}aT[aR+aN]=a0}}if(aE){for(aN=0;aN<aP;++aN){a0=aT[aR+aN];if(a0!=null){aX=aW[aN];if(aX.x){aF(aJ.xaxis,a0,a0)}if(aX.y){aF(aJ.yaxis,a0,a0)}}aT[aR+aN]=null}}else{if(insertSteps&&aR>0&&aT[aR-aP]!=null&&aT[aR-aP]!=aT[aR]&&aT[aR-aP+1]!=aT[aR+1]){for(aN=0;aN<aP;++aN){aT[aR+aP+aN]=aT[aR+aN]}aT[aR+1]=aT[aR-aP+1];aR+=aP}}}}for(aU=0;aU<Q.length;++aU){aJ=Q[aU];an(ak.processDatapoints,[aJ,aJ.datapoints])}for(aU=0;aU<Q.length;++aU){aJ=Q[aU];aT=aJ.datapoints.points,aP=aJ.datapoints.pointsize;var aK=aO,aQ=aO,aM=aI,aV=aI;for(aS=0;aS<aT.length;aS+=aP){if(aT[aS]==null){continue}for(aN=0;aN<aP;++aN){a0=aT[aS+aN];aX=aW[aN];if(!aX||a0==aB||a0==-aB){continue}if(aX.x){if(a0<aK){aK=a0}if(a0>aM){aM=a0}}if(aX.y){if(a0<aQ){aQ=a0}if(a0>aV){aV=a0}}}}if(aJ.bars.show){var aY=aJ.bars.align=="left"?0:-aJ.bars.barWidth/2;if(aJ.bars.horizontal){aQ+=aY;aV+=aY+aJ.bars.barWidth}else{aK+=aY;aM+=aY+aJ.bars.barWidth}}aF(aJ.xaxis,aK,aM);aF(aJ.yaxis,aQ,aV)}c.each(m(),function(a1,a2){if(a2.datamin==aO){a2.datamin=null}if(a2.datamax==aI){a2.datamax=null}})}function j(aB,aC){var aD=document.createElement("canvas");aD.className=aC;aD.width=G;aD.height=I;if(!aB){c(aD).css({position:"absolute",left:0,top:0})}c(aD).appendTo(av);if(!aD.getContext){aD=window.G_vmlCanvasManager.initElement(aD)}aD.getContext("2d").save();return aD}function B(){G=av.width();I=av.height();if(G<=0||I<=0){throw"Invalid dimensions for plot, width = "+G+", height = "+I}}function g(aC){if(aC.width!=G){aC.width=G}if(aC.height!=I){aC.height=I}var aB=aC.getContext("2d");aB.restore();aB.save()}function X(){var aC,aB=av.children("canvas.base"),aD=av.children("canvas.overlay");if(aB.length==0||aD==0){av.html("");av.css({padding:0});if(av.css("position")=="static"){av.css("position","relative")}B();az=j(true,"base");ad=j(false,"overlay");aC=false}else{az=aB.get(0);ad=aD.get(0);aC=true}H=az.getContext("2d");A=ad.getContext("2d");y=c([ad,az]);if(aC){av.data("plot").shutdown();aq.resize();A.clearRect(0,0,G,I);y.unbind();av.children().not([az,ad]).remove()}av.data("plot",aq)}function ah(){if(O.grid.hoverable){y.mousemove(aa);y.mouseleave(l)}if(O.grid.clickable){y.click(R)}an(ak.bindEvents,[y])}function ag(){if(M){clearTimeout(M)}y.unbind("mousemove",aa);y.unbind("mouseleave",l);y.unbind("click",R);an(ak.shutdown,[y])}function r(aG){function aC(aH){return aH}var aF,aB,aD=aG.options.transform||aC,aE=aG.options.inverseTransform;if(aG.direction=="x"){aF=aG.scale=h/Math.abs(aD(aG.max)-aD(aG.min));aB=Math.min(aD(aG.max),aD(aG.min))}else{aF=aG.scale=w/Math.abs(aD(aG.max)-aD(aG.min));aF=-aF;aB=Math.max(aD(aG.max),aD(aG.min))}if(aD==aC){aG.p2c=function(aH){return(aH-aB)*aF}}else{aG.p2c=function(aH){return(aD(aH)-aB)*aF}}if(!aE){aG.c2p=function(aH){return aB+aH/aF}}else{aG.c2p=function(aH){return aE(aB+aH/aF)}}}function L(aD){var aB=aD.options,aF,aJ=aD.ticks||[],aI=[],aE,aK=aB.labelWidth,aG=aB.labelHeight,aC;function aH(aM,aL){return c('<div style="position:absolute;top:-10000px;'+aL+'font-size:smaller"><div class="'+aD.direction+"Axis "+aD.direction+aD.n+'Axis">'+aM.join("")+"</div></div>").appendTo(av)}if(aD.direction=="x"){if(aK==null){aK=Math.floor(G/(aJ.length>0?aJ.length:1))}if(aG==null){aI=[];for(aF=0;aF<aJ.length;++aF){aE=aJ[aF].label;if(aE){aI.push('<div class="tickLabel" style="float:left;width:'+aK+'px">'+aE+"</div>")}}if(aI.length>0){aI.push('<div style="clear:left"></div>');aC=aH(aI,"width:10000px;");aG=aC.height();aC.remove()}}}else{if(aK==null||aG==null){for(aF=0;aF<aJ.length;++aF){aE=aJ[aF].label;if(aE){aI.push('<div class="tickLabel">'+aE+"</div>")}}if(aI.length>0){aC=aH(aI,"");if(aK==null){aK=aC.children().width()}if(aG==null){aG=aC.find("div.tickLabel").height()}aC.remove()}}}if(aK==null){aK=0}if(aG==null){aG=0}aD.labelWidth=aK;aD.labelHeight=aG}function au(aD){var aC=aD.labelWidth,aL=aD.labelHeight,aH=aD.options.position,aF=aD.options.tickLength,aG=O.grid.axisMargin,aJ=O.grid.labelMargin,aK=aD.direction=="x"?p:aw,aE;var aB=c.grep(aK,function(aN){return aN&&aN.options.position==aH&&aN.reserveSpace});if(c.inArray(aD,aB)==aB.length-1){aG=0}if(aF==null){aF="full"}var aI=c.grep(aK,function(aN){return aN&&aN.reserveSpace});var aM=c.inArray(aD,aI)==0;if(!aM&&aF=="full"){aF=5}if(!isNaN(+aF)){aJ+=+aF}if(aD.direction=="x"){aL+=aJ;if(aH=="bottom"){q.bottom+=aL+aG;aD.box={top:I-q.bottom,height:aL}}else{aD.box={top:q.top+aG,height:aL};q.top+=aL+aG}}else{aC+=aJ;if(aH=="left"){aD.box={left:q.left+aG,width:aC};q.left+=aC+aG}else{q.right+=aC+aG;aD.box={left:G-q.right,width:aC}}}aD.position=aH;aD.tickLength=aF;aD.box.padding=aJ;aD.innermost=aM}function U(aB){if(aB.direction=="x"){aB.box.left=q.left;aB.box.width=h}else{aB.box.top=q.top;aB.box.height=w}}function t(){var aC,aE=m();c.each(aE,function(aF,aG){aG.show=aG.options.show;if(aG.show==null){aG.show=aG.used}aG.reserveSpace=aG.show||aG.options.reserveSpace;n(aG)});allocatedAxes=c.grep(aE,function(aF){return aF.reserveSpace});q.left=q.right=q.top=q.bottom=0;if(O.grid.show){c.each(allocatedAxes,function(aF,aG){S(aG);P(aG);ap(aG,aG.ticks);L(aG)});for(aC=allocatedAxes.length-1;aC>=0;--aC){au(allocatedAxes[aC])}var aD=O.grid.minBorderMargin;if(aD==null){aD=0;for(aC=0;aC<Q.length;++aC){aD=Math.max(aD,Q[aC].points.radius+Q[aC].points.lineWidth/2)}}for(var aB in q){q[aB]+=O.grid.borderWidth;q[aB]=Math.max(aD,q[aB])}}h=G-q.left-q.right;w=I-q.bottom-q.top;c.each(aE,function(aF,aG){r(aG)});if(O.grid.show){c.each(allocatedAxes,function(aF,aG){U(aG)});k()}o()}function n(aE){var aF=aE.options,aD=+(aF.min!=null?aF.min:aE.datamin),aB=+(aF.max!=null?aF.max:aE.datamax),aH=aB-aD;if(aH==0){var aC=aB==0?1:0.01;if(aF.min==null){aD-=aC}if(aF.max==null||aF.min!=null){aB+=aC}}else{var aG=aF.autoscaleMargin;if(aG!=null){if(aF.min==null){aD-=aH*aG;if(aD<0&&aE.datamin!=null&&aE.datamin>=0){aD=0}}if(aF.max==null){aB+=aH*aG;if(aB>0&&aE.datamax!=null&&aE.datamax<=0){aB=0}}}}aE.min=aD;aE.max=aB}function S(aG){var aM=aG.options;var aH;if(typeof aM.ticks=="number"&&aM.ticks>0){aH=aM.ticks}else{aH=0.3*Math.sqrt(aG.direction=="x"?G:I)}var aT=(aG.max-aG.min)/aH,aO,aB,aN,aR,aS,aQ,aI;if(aM.mode=="time"){var aJ={second:1000,minute:60*1000,hour:60*60*1000,day:24*60*60*1000,month:30*24*60*60*1000,year:365.2425*24*60*60*1000};var aK=[[1,"second"],[2,"second"],[5,"second"],[10,"second"],[30,"second"],[1,"minute"],[2,"minute"],[5,"minute"],[10,"minute"],[30,"minute"],[1,"hour"],[2,"hour"],[4,"hour"],[8,"hour"],[12,"hour"],[1,"day"],[2,"day"],[3,"day"],[0.25,"month"],[0.5,"month"],[1,"month"],[2,"month"],[3,"month"],[6,"month"],[1,"year"]];var aC=0;if(aM.minTickSize!=null){if(typeof aM.tickSize=="number"){aC=aM.tickSize}else{aC=aM.minTickSize[0]*aJ[aM.minTickSize[1]]}}for(var aS=0;aS<aK.length-1;++aS){if(aT<(aK[aS][0]*aJ[aK[aS][1]]+aK[aS+1][0]*aJ[aK[aS+1][1]])/2&&aK[aS][0]*aJ[aK[aS][1]]>=aC){break}}aO=aK[aS][0];aN=aK[aS][1];if(aN=="year"){aQ=Math.pow(10,Math.floor(Math.log(aT/aJ.year)/Math.LN10));aI=(aT/aJ.year)/aQ;if(aI<1.5){aO=1}else{if(aI<3){aO=2}else{if(aI<7.5){aO=5}else{aO=10}}}aO*=aQ}aG.tickSize=aM.tickSize||[aO,aN];aB=function(aX){var a2=[],a0=aX.tickSize[0],a3=aX.tickSize[1],a1=new Date(aX.min);var aW=a0*aJ[a3];if(a3=="second"){a1.setUTCSeconds(a(a1.getUTCSeconds(),a0))}if(a3=="minute"){a1.setUTCMinutes(a(a1.getUTCMinutes(),a0))}if(a3=="hour"){a1.setUTCHours(a(a1.getUTCHours(),a0))}if(a3=="month"){a1.setUTCMonth(a(a1.getUTCMonth(),a0))}if(a3=="year"){a1.setUTCFullYear(a(a1.getUTCFullYear(),a0))}a1.setUTCMilliseconds(0);if(aW>=aJ.minute){a1.setUTCSeconds(0)}if(aW>=aJ.hour){a1.setUTCMinutes(0)}if(aW>=aJ.day){a1.setUTCHours(0)}if(aW>=aJ.day*4){a1.setUTCDate(1)}if(aW>=aJ.year){a1.setUTCMonth(0)}var a5=0,a4=Number.NaN,aY;do{aY=a4;a4=a1.getTime();a2.push(a4);if(a3=="month"){if(a0<1){a1.setUTCDate(1);var aV=a1.getTime();a1.setUTCMonth(a1.getUTCMonth()+1);var aZ=a1.getTime();a1.setTime(a4+a5*aJ.hour+(aZ-aV)*a0);a5=a1.getUTCHours();a1.setUTCHours(0)}else{a1.setUTCMonth(a1.getUTCMonth()+a0)}}else{if(a3=="year"){a1.setUTCFullYear(a1.getUTCFullYear()+a0)}else{a1.setTime(a4+aW)}}}while(a4<aX.max&&a4!=aY);return a2};aR=function(aV,aY){var a0=new Date(aV);if(aM.timeformat!=null){return c.plot.formatDate(a0,aM.timeformat,aM.monthNames)}var aW=aY.tickSize[0]*aJ[aY.tickSize[1]];var aX=aY.max-aY.min;var aZ=(aM.twelveHourClock)?" %p":"";if(aW<aJ.minute){fmt="%h:%M:%S"+aZ}else{if(aW<aJ.day){if(aX<2*aJ.day){fmt="%h:%M"+aZ}else{fmt="%b %d %h:%M"+aZ}}else{if(aW<aJ.month){fmt="%b %d"}else{if(aW<aJ.year){if(aX<aJ.year){fmt="%b"}else{fmt="%b %y"}}else{fmt="%y"}}}}return c.plot.formatDate(a0,fmt,aM.monthNames)}}else{var aU=aM.tickDecimals;var aP=-Math.floor(Math.log(aT)/Math.LN10);if(aU!=null&&aP>aU){aP=aU}aQ=Math.pow(10,-aP);aI=aT/aQ;if(aI<1.5){aO=1}else{if(aI<3){aO=2;if(aI>2.25&&(aU==null||aP+1<=aU)){aO=2.5;++aP}}else{if(aI<7.5){aO=5}else{aO=10}}}aO*=aQ;if(aM.minTickSize!=null&&aO<aM.minTickSize){aO=aM.minTickSize}aG.tickDecimals=Math.max(0,aU!=null?aU:aP);aG.tickSize=aM.tickSize||aO;aB=function(aX){var aZ=[];var a0=a(aX.min,aX.tickSize),aW=0,aV=Number.NaN,aY;do{aY=aV;aV=a0+aW*aX.tickSize;aZ.push(aV);++aW}while(aV<aX.max&&aV!=aY);return aZ};aR=function(aV,aW){return aV.toFixed(aW.tickDecimals)}}if(aM.alignTicksWithAxis!=null){var aF=(aG.direction=="x"?p:aw)[aM.alignTicksWithAxis-1];if(aF&&aF.used&&aF!=aG){var aL=aB(aG);if(aL.length>0){if(aM.min==null){aG.min=Math.min(aG.min,aL[0])}if(aM.max==null&&aL.length>1){aG.max=Math.max(aG.max,aL[aL.length-1])}}aB=function(aX){var aY=[],aV,aW;for(aW=0;aW<aF.ticks.length;++aW){aV=(aF.ticks[aW].v-aF.min)/(aF.max-aF.min);aV=aX.min+aV*(aX.max-aX.min);aY.push(aV)}return aY};if(aG.mode!="time"&&aM.tickDecimals==null){var aE=Math.max(0,-Math.floor(Math.log(aT)/Math.LN10)+1),aD=aB(aG);if(!(aD.length>1&&/\..*0$/.test((aD[1]-aD[0]).toFixed(aE)))){aG.tickDecimals=aE}}}}aG.tickGenerator=aB;if(c.isFunction(aM.tickFormatter)){aG.tickFormatter=function(aV,aW){return""+aM.tickFormatter(aV,aW)}}else{aG.tickFormatter=aR}}function P(aF){var aH=aF.options.ticks,aG=[];if(aH==null||(typeof aH=="number"&&aH>0)){aG=aF.tickGenerator(aF)}else{if(aH){if(c.isFunction(aH)){aG=aH({min:aF.min,max:aF.max})}else{aG=aH}}}var aE,aB;aF.ticks=[];for(aE=0;aE<aG.length;++aE){var aC=null;var aD=aG[aE];if(typeof aD=="object"){aB=+aD[0];if(aD.length>1){aC=aD[1]}}else{aB=+aD}if(aC==null){aC=aF.tickFormatter(aB,aF)}if(!isNaN(aB)){aF.ticks.push({v:aB,label:aC})}}}function ap(aB,aC){if(aB.options.autoscaleMargin&&aC.length>0){if(aB.options.min==null){aB.min=Math.min(aB.min,aC[0].v)}if(aB.options.max==null&&aC.length>1){aB.max=Math.max(aB.max,aC[aC.length-1].v)}}}function W(){H.clearRect(0,0,G,I);var aC=O.grid;if(aC.show&&aC.backgroundColor){N()}if(aC.show&&!aC.aboveData){ac()}for(var aB=0;aB<Q.length;++aB){an(ak.drawSeries,[H,Q[aB]]);d(Q[aB])}an(ak.draw,[H]);if(aC.show&&aC.aboveData){ac()}}function D(aB,aI){var aE,aH,aG,aD,aF=m();for(i=0;i<aF.length;++i){aE=aF[i];if(aE.direction==aI){aD=aI+aE.n+"axis";if(!aB[aD]&&aE.n==1){aD=aI+"axis"}if(aB[aD]){aH=aB[aD].from;aG=aB[aD].to;break}}}if(!aB[aD]){aE=aI=="x"?p[0]:aw[0];aH=aB[aI+"1"];aG=aB[aI+"2"]}if(aH!=null&&aG!=null&&aH>aG){var aC=aH;aH=aG;aG=aC}return{from:aH,to:aG,axis:aE}}function N(){H.save();H.translate(q.left,q.top);H.fillStyle=am(O.grid.backgroundColor,w,0,"rgba(255, 255, 255, 0)");H.fillRect(0,0,h,w);H.restore()}function ac(){var aF;H.save();H.translate(q.left,q.top);var aH=O.grid.markings;if(aH){if(c.isFunction(aH)){var aK=aq.getAxes();aK.xmin=aK.xaxis.min;aK.xmax=aK.xaxis.max;aK.ymin=aK.yaxis.min;aK.ymax=aK.yaxis.max;aH=aH(aK)}for(aF=0;aF<aH.length;++aF){var aD=aH[aF],aC=D(aD,"x"),aI=D(aD,"y");if(aC.from==null){aC.from=aC.axis.min}if(aC.to==null){aC.to=aC.axis.max}if(aI.from==null){aI.from=aI.axis.min}if(aI.to==null){aI.to=aI.axis.max}if(aC.to<aC.axis.min||aC.from>aC.axis.max||aI.to<aI.axis.min||aI.from>aI.axis.max){continue}aC.from=Math.max(aC.from,aC.axis.min);aC.to=Math.min(aC.to,aC.axis.max);aI.from=Math.max(aI.from,aI.axis.min);aI.to=Math.min(aI.to,aI.axis.max);if(aC.from==aC.to&&aI.from==aI.to){continue}aC.from=aC.axis.p2c(aC.from);aC.to=aC.axis.p2c(aC.to);aI.from=aI.axis.p2c(aI.from);aI.to=aI.axis.p2c(aI.to);if(aC.from==aC.to||aI.from==aI.to){H.beginPath();H.strokeStyle=aD.color||O.grid.markingsColor;H.lineWidth=aD.lineWidth||O.grid.markingsLineWidth;H.moveTo(aC.from,aI.from);H.lineTo(aC.to,aI.to);H.stroke()}else{H.fillStyle=aD.color||O.grid.markingsColor;H.fillRect(aC.from,aI.to,aC.to-aC.from,aI.from-aI.to)}}}var aK=m(),aM=O.grid.borderWidth;for(var aE=0;aE<aK.length;++aE){var aB=aK[aE],aG=aB.box,aQ=aB.tickLength,aN,aL,aP,aJ;if(!aB.show||aB.ticks.length==0){continue}H.strokeStyle=aB.options.tickColor||c.color.parse(aB.options.color).scale("a",0.22).toString();H.lineWidth=1;if(aB.direction=="x"){aN=0;if(aQ=="full"){aL=(aB.position=="top"?0:w)}else{aL=aG.top-q.top+(aB.position=="top"?aG.height:0)}}else{aL=0;if(aQ=="full"){aN=(aB.position=="left"?0:h)}else{aN=aG.left-q.left+(aB.position=="left"?aG.width:0)}}if(!aB.innermost){H.beginPath();aP=aJ=0;if(aB.direction=="x"){aP=h}else{aJ=w}if(H.lineWidth==1){aN=Math.floor(aN)+0.5;aL=Math.floor(aL)+0.5}H.moveTo(aN,aL);H.lineTo(aN+aP,aL+aJ);H.stroke()}H.beginPath();for(aF=0;aF<aB.ticks.length;++aF){var aO=aB.ticks[aF].v;aP=aJ=0;if(aO<aB.min||aO>aB.max||(aQ=="full"&&aM>0&&(aO==aB.min||aO==aB.max))){continue}if(aB.direction=="x"){aN=aB.p2c(aO);aJ=aQ=="full"?-w:aQ;if(aB.position=="top"){aJ=-aJ}}else{aL=aB.p2c(aO);aP=aQ=="full"?-h:aQ;if(aB.position=="left"){aP=-aP}}if(H.lineWidth==1){if(aB.direction=="x"){aN=Math.floor(aN)+0.5}else{aL=Math.floor(aL)+0.5}}H.moveTo(aN,aL);H.lineTo(aN+aP,aL+aJ)}H.stroke()}if(aM){H.lineWidth=aM;H.strokeStyle=O.grid.borderColor;H.strokeRect(-aM/2,-aM/2,h+aM,w+aM)}H.restore()}function k(){av.find(".tickLabels").remove();var aG=['<div class="tickLabels" style="font-size:smaller">'];var aJ=m();for(var aD=0;aD<aJ.length;++aD){var aC=aJ[aD],aF=aC.box;if(!aC.show){continue}aG.push('<div class="'+aC.direction+"Axis "+aC.direction+aC.n+'Axis" style="color:'+aC.options.color+'">');for(var aE=0;aE<aC.ticks.length;++aE){var aH=aC.ticks[aE];if(!aH.label||aH.v<aC.min||aH.v>aC.max){continue}var aK={},aI;if(aC.direction=="x"){aI="center";aK.left=Math.round(q.left+aC.p2c(aH.v)-aC.labelWidth/2);if(aC.position=="bottom"){aK.top=aF.top+aF.padding}else{aK.bottom=I-(aF.top+aF.height-aF.padding)}}else{aK.top=Math.round(q.top+aC.p2c(aH.v)-aC.labelHeight/2);if(aC.position=="left"){aK.right=G-(aF.left+aF.width-aF.padding);aI="right"}else{aK.left=aF.left+aF.padding;aI="left"}}aK.width=aC.labelWidth;var aB=["position:absolute","text-align:"+aI];for(var aL in aK){aB.push(aL+":"+aK[aL]+"px")}aG.push('<div class="tickLabel" style="'+aB.join(";")+'">'+aH.label+"</div>")}aG.push("</div>")}aG.push("</div>");av.append(aG.join(""))}function d(aB){if(aB.lines.show){at(aB)}if(aB.bars.show){e(aB)}if(aB.points.show){ao(aB)}}function at(aE){function aD(aP,aQ,aI,aU,aT){var aV=aP.points,aJ=aP.pointsize,aN=null,aM=null;H.beginPath();for(var aO=aJ;aO<aV.length;aO+=aJ){var aL=aV[aO-aJ],aS=aV[aO-aJ+1],aK=aV[aO],aR=aV[aO+1];if(aL==null||aK==null){continue}if(aS<=aR&&aS<aT.min){if(aR<aT.min){continue}aL=(aT.min-aS)/(aR-aS)*(aK-aL)+aL;aS=aT.min}else{if(aR<=aS&&aR<aT.min){if(aS<aT.min){continue}aK=(aT.min-aS)/(aR-aS)*(aK-aL)+aL;aR=aT.min}}if(aS>=aR&&aS>aT.max){if(aR>aT.max){continue}aL=(aT.max-aS)/(aR-aS)*(aK-aL)+aL;aS=aT.max}else{if(aR>=aS&&aR>aT.max){if(aS>aT.max){continue}aK=(aT.max-aS)/(aR-aS)*(aK-aL)+aL;aR=aT.max}}if(aL<=aK&&aL<aU.min){if(aK<aU.min){continue}aS=(aU.min-aL)/(aK-aL)*(aR-aS)+aS;aL=aU.min}else{if(aK<=aL&&aK<aU.min){if(aL<aU.min){continue}aR=(aU.min-aL)/(aK-aL)*(aR-aS)+aS;aK=aU.min}}if(aL>=aK&&aL>aU.max){if(aK>aU.max){continue}aS=(aU.max-aL)/(aK-aL)*(aR-aS)+aS;aL=aU.max}else{if(aK>=aL&&aK>aU.max){if(aL>aU.max){continue}aR=(aU.max-aL)/(aK-aL)*(aR-aS)+aS;aK=aU.max}}if(aL!=aN||aS!=aM){H.moveTo(aU.p2c(aL)+aQ,aT.p2c(aS)+aI)}aN=aK;aM=aR;H.lineTo(aU.p2c(aK)+aQ,aT.p2c(aR)+aI)}H.stroke()}function aF(aI,aQ,aP){var aW=aI.points,aV=aI.pointsize,aN=Math.min(Math.max(0,aP.min),aP.max),aX=0,aU,aT=false,aM=1,aL=0,aR=0;while(true){if(aV>0&&aX>aW.length+aV){break}aX+=aV;var aZ=aW[aX-aV],aK=aW[aX-aV+aM],aY=aW[aX],aJ=aW[aX+aM];if(aT){if(aV>0&&aZ!=null&&aY==null){aR=aX;aV=-aV;aM=2;continue}if(aV<0&&aX==aL+aV){H.fill();aT=false;aV=-aV;aM=1;aX=aL=aR+aV;continue}}if(aZ==null||aY==null){continue}if(aZ<=aY&&aZ<aQ.min){if(aY<aQ.min){continue}aK=(aQ.min-aZ)/(aY-aZ)*(aJ-aK)+aK;aZ=aQ.min}else{if(aY<=aZ&&aY<aQ.min){if(aZ<aQ.min){continue}aJ=(aQ.min-aZ)/(aY-aZ)*(aJ-aK)+aK;aY=aQ.min}}if(aZ>=aY&&aZ>aQ.max){if(aY>aQ.max){continue}aK=(aQ.max-aZ)/(aY-aZ)*(aJ-aK)+aK;aZ=aQ.max}else{if(aY>=aZ&&aY>aQ.max){if(aZ>aQ.max){continue}aJ=(aQ.max-aZ)/(aY-aZ)*(aJ-aK)+aK;aY=aQ.max}}if(!aT){H.beginPath();H.moveTo(aQ.p2c(aZ),aP.p2c(aN));aT=true}if(aK>=aP.max&&aJ>=aP.max){H.lineTo(aQ.p2c(aZ),aP.p2c(aP.max));H.lineTo(aQ.p2c(aY),aP.p2c(aP.max));continue}else{if(aK<=aP.min&&aJ<=aP.min){H.lineTo(aQ.p2c(aZ),aP.p2c(aP.min));H.lineTo(aQ.p2c(aY),aP.p2c(aP.min));continue}}var aO=aZ,aS=aY;if(aK<=aJ&&aK<aP.min&&aJ>=aP.min){aZ=(aP.min-aK)/(aJ-aK)*(aY-aZ)+aZ;aK=aP.min}else{if(aJ<=aK&&aJ<aP.min&&aK>=aP.min){aY=(aP.min-aK)/(aJ-aK)*(aY-aZ)+aZ;aJ=aP.min}}if(aK>=aJ&&aK>aP.max&&aJ<=aP.max){aZ=(aP.max-aK)/(aJ-aK)*(aY-aZ)+aZ;aK=aP.max}else{if(aJ>=aK&&aJ>aP.max&&aK<=aP.max){aY=(aP.max-aK)/(aJ-aK)*(aY-aZ)+aZ;aJ=aP.max}}if(aZ!=aO){H.lineTo(aQ.p2c(aO),aP.p2c(aK))}H.lineTo(aQ.p2c(aZ),aP.p2c(aK));H.lineTo(aQ.p2c(aY),aP.p2c(aJ));if(aY!=aS){H.lineTo(aQ.p2c(aY),aP.p2c(aJ));H.lineTo(aQ.p2c(aS),aP.p2c(aJ))}}}H.save();H.translate(q.left,q.top);H.lineJoin="round";var aG=aE.lines.lineWidth,aB=aE.shadowSize;if(aG>0&&aB>0){H.lineWidth=aB;H.strokeStyle="rgba(0,0,0,0.1)";var aH=Math.PI/18;aD(aE.datapoints,Math.sin(aH)*(aG/2+aB/2),Math.cos(aH)*(aG/2+aB/2),aE.xaxis,aE.yaxis);H.lineWidth=aB/2;aD(aE.datapoints,Math.sin(aH)*(aG/2+aB/4),Math.cos(aH)*(aG/2+aB/4),aE.xaxis,aE.yaxis)}H.lineWidth=aG;H.strokeStyle=aE.color;var aC=ae(aE.lines,aE.color,0,w);if(aC){H.fillStyle=aC;aF(aE.datapoints,aE.xaxis,aE.yaxis)}if(aG>0){aD(aE.datapoints,0,0,aE.xaxis,aE.yaxis)}H.restore()}function ao(aE){function aH(aN,aM,aU,aK,aS,aT,aQ,aJ){var aR=aN.points,aI=aN.pointsize;for(var aL=0;aL<aR.length;aL+=aI){var aP=aR[aL],aO=aR[aL+1];if(aP==null||aP<aT.min||aP>aT.max||aO<aQ.min||aO>aQ.max){continue}H.beginPath();aP=aT.p2c(aP);aO=aQ.p2c(aO)+aK;if(aJ=="circle"){H.arc(aP,aO,aM,0,aS?Math.PI:Math.PI*2,false)}else{aJ(H,aP,aO,aM,aS)}H.closePath();if(aU){H.fillStyle=aU;H.fill()}H.stroke()}}H.save();H.translate(q.left,q.top);var aG=aE.points.lineWidth,aC=aE.shadowSize,aB=aE.points.radius,aF=aE.points.symbol;if(aG>0&&aC>0){var aD=aC/2;H.lineWidth=aD;H.strokeStyle="rgba(0,0,0,0.1)";aH(aE.datapoints,aB,null,aD+aD/2,true,aE.xaxis,aE.yaxis,aF);H.strokeStyle="rgba(0,0,0,0.2)";aH(aE.datapoints,aB,null,aD/2,true,aE.xaxis,aE.yaxis,aF)}H.lineWidth=aG;H.strokeStyle=aE.color;aH(aE.datapoints,aB,ae(aE.points,aE.color),0,false,aE.xaxis,aE.yaxis,aF);H.restore()}function E(aN,aM,aV,aI,aQ,aF,aD,aL,aK,aU,aR,aC){var aE,aT,aJ,aP,aG,aB,aO,aH,aS;if(aR){aH=aB=aO=true;aG=false;aE=aV;aT=aN;aP=aM+aI;aJ=aM+aQ;if(aT<aE){aS=aT;aT=aE;aE=aS;aG=true;aB=false}}else{aG=aB=aO=true;aH=false;aE=aN+aI;aT=aN+aQ;aJ=aV;aP=aM;if(aP<aJ){aS=aP;aP=aJ;aJ=aS;aH=true;aO=false}}if(aT<aL.min||aE>aL.max||aP<aK.min||aJ>aK.max){return}if(aE<aL.min){aE=aL.min;aG=false}if(aT>aL.max){aT=aL.max;aB=false}if(aJ<aK.min){aJ=aK.min;aH=false}if(aP>aK.max){aP=aK.max;aO=false}aE=aL.p2c(aE);aJ=aK.p2c(aJ);aT=aL.p2c(aT);aP=aK.p2c(aP);if(aD){aU.beginPath();aU.moveTo(aE,aJ);aU.lineTo(aE,aP);aU.lineTo(aT,aP);aU.lineTo(aT,aJ);aU.fillStyle=aD(aJ,aP);aU.fill()}if(aC>0&&(aG||aB||aO||aH)){aU.beginPath();aU.moveTo(aE,aJ+aF);if(aG){aU.lineTo(aE,aP+aF)}else{aU.moveTo(aE,aP+aF)}if(aO){aU.lineTo(aT,aP+aF)}else{aU.moveTo(aT,aP+aF)}if(aB){aU.lineTo(aT,aJ+aF)}else{aU.moveTo(aT,aJ+aF)}if(aH){aU.lineTo(aE,aJ+aF)}else{aU.moveTo(aE,aJ+aF)}aU.stroke()}}function e(aD){function aC(aJ,aI,aL,aG,aK,aN,aM){var aO=aJ.points,aF=aJ.pointsize;for(var aH=0;aH<aO.length;aH+=aF){if(aO[aH]==null){continue}E(aO[aH],aO[aH+1],aO[aH+2],aI,aL,aG,aK,aN,aM,H,aD.bars.horizontal,aD.bars.lineWidth)}}H.save();H.translate(q.left,q.top);H.lineWidth=aD.bars.lineWidth;H.strokeStyle=aD.color;var aB=aD.bars.align=="left"?0:-aD.bars.barWidth/2;var aE=aD.bars.fill?function(aF,aG){return ae(aD.bars,aD.color,aF,aG)}:null;aC(aD.datapoints,aB,aB+aD.bars.barWidth,0,aE,aD.xaxis,aD.yaxis);H.restore()}function ae(aD,aB,aC,aF){var aE=aD.fill;if(!aE){return null}if(aD.fillColor){return am(aD.fillColor,aC,aF,aB)}var aG=c.color.parse(aB);aG.a=typeof aE=="number"?aE:0.4;aG.normalize();return aG.toString()}function o(){av.find(".legend").remove();if(!O.legend.show){return}var aH=[],aF=false,aN=O.legend.labelFormatter,aM,aJ;for(var aE=0;aE<Q.length;++aE){aM=Q[aE];aJ=aM.label;if(!aJ){continue}if(aE%O.legend.noColumns==0){if(aF){aH.push("</tr>")}aH.push("<tr>");aF=true}if(aN){aJ=aN(aJ,aM)}aH.push('<td class="legendColorBox"><div style="border:1px solid '+O.legend.labelBoxBorderColor+';padding:1px"><div style="width:4px;height:0;border:5px solid '+aM.color+';overflow:hidden"></div></div></td><td class="legendLabel">'+aJ+"</td>")}if(aF){aH.push("</tr>")}if(aH.length==0){return}var aL='<table style="font-size:smaller;color:'+O.grid.color+'">'+aH.join("")+"</table>";if(O.legend.container!=null){c(O.legend.container).html(aL)}else{var aI="",aC=O.legend.position,aD=O.legend.margin;if(aD[0]==null){aD=[aD,aD]}if(aC.charAt(0)=="n"){aI+="top:"+(aD[1]+q.top)+"px;"}else{if(aC.charAt(0)=="s"){aI+="bottom:"+(aD[1]+q.bottom)+"px;"}}if(aC.charAt(1)=="e"){aI+="right:"+(aD[0]+q.right)+"px;"}else{if(aC.charAt(1)=="w"){aI+="left:"+(aD[0]+q.left)+"px;"}}var aK=c('<div class="legend">'+aL.replace('style="','style="position:absolute;'+aI+";")+"</div>").appendTo(av);if(O.legend.backgroundOpacity!=0){var aG=O.legend.backgroundColor;if(aG==null){aG=O.grid.backgroundColor;if(aG&&typeof aG=="string"){aG=c.color.parse(aG)}else{aG=c.color.extract(aK,"background-color")}aG.a=1;aG=aG.toString()}var aB=aK.children();c('<div style="position:absolute;width:'+aB.width()+"px;height:"+aB.height()+"px;"+aI+"background-color:"+aG+';"> </div>').prependTo(aK).css("opacity",O.legend.backgroundOpacity)}}}var ab=[],M=null;function K(aI,aG,aD){var aO=O.grid.mouseActiveRadius,a0=aO*aO+1,aY=null,aR=false,aW,aU;for(aW=Q.length-1;aW>=0;--aW){if(!aD(Q[aW])){continue}var aP=Q[aW],aH=aP.xaxis,aF=aP.yaxis,aV=aP.datapoints.points,aT=aP.datapoints.pointsize,aQ=aH.c2p(aI),aN=aF.c2p(aG),aC=aO/aH.scale,aB=aO/aF.scale;if(aH.options.inverseTransform){aC=Number.MAX_VALUE}if(aF.options.inverseTransform){aB=Number.MAX_VALUE}if(aP.lines.show||aP.points.show){for(aU=0;aU<aV.length;aU+=aT){var aK=aV[aU],aJ=aV[aU+1];if(aK==null){continue}if(aK-aQ>aC||aK-aQ<-aC||aJ-aN>aB||aJ-aN<-aB){continue}var aM=Math.abs(aH.p2c(aK)-aI),aL=Math.abs(aF.p2c(aJ)-aG),aS=aM*aM+aL*aL;if(aS<a0){a0=aS;aY=[aW,aU/aT]}}}if(aP.bars.show&&!aY){var aE=aP.bars.align=="left"?0:-aP.bars.barWidth/2,aX=aE+aP.bars.barWidth;for(aU=0;aU<aV.length;aU+=aT){var aK=aV[aU],aJ=aV[aU+1],aZ=aV[aU+2];if(aK==null){continue}if(Q[aW].bars.horizontal?(aQ<=Math.max(aZ,aK)&&aQ>=Math.min(aZ,aK)&&aN>=aJ+aE&&aN<=aJ+aX):(aQ>=aK+aE&&aQ<=aK+aX&&aN>=Math.min(aZ,aJ)&&aN<=Math.max(aZ,aJ))){aY=[aW,aU/aT]}}}}if(aY){aW=aY[0];aU=aY[1];aT=Q[aW].datapoints.pointsize;return{datapoint:Q[aW].datapoints.points.slice(aU*aT,(aU+1)*aT),dataIndex:aU,series:Q[aW],seriesIndex:aW}}return null}function aa(aB){if(O.grid.hoverable){u("plothover",aB,function(aC){return aC.hoverable!=false})}}function l(aB){if(O.grid.hoverable){u("plothover",aB,function(aC){return false})}}function R(aB){u("plotclick",aB,function(aC){return aC.clickable!=false})}function u(aC,aB,aD){var aE=y.offset(),aH=aB.pageX-aE.left-q.left,aF=aB.pageY-aE.top-q.top,aJ=C({left:aH,top:aF});aJ.pageX=aB.pageX;aJ.pageY=aB.pageY;var aK=K(aH,aF,aD);if(aK){aK.pageX=parseInt(aK.series.xaxis.p2c(aK.datapoint[0])+aE.left+q.left);aK.pageY=parseInt(aK.series.yaxis.p2c(aK.datapoint[1])+aE.top+q.top)}if(O.grid.autoHighlight){for(var aG=0;aG<ab.length;++aG){var aI=ab[aG];if(aI.auto==aC&&!(aK&&aI.series==aK.series&&aI.point[0]==aK.datapoint[0]&&aI.point[1]==aK.datapoint[1])){T(aI.series,aI.point)}}if(aK){x(aK.series,aK.datapoint,aC)}}av.trigger(aC,[aJ,aK])}function f(){if(!M){M=setTimeout(s,30)}}function s(){M=null;A.save();A.clearRect(0,0,G,I);A.translate(q.left,q.top);var aC,aB;for(aC=0;aC<ab.length;++aC){aB=ab[aC];if(aB.series.bars.show){v(aB.series,aB.point)}else{ay(aB.series,aB.point)}}A.restore();an(ak.drawOverlay,[A])}function x(aD,aB,aF){if(typeof aD=="number"){aD=Q[aD]}if(typeof aB=="number"){var aE=aD.datapoints.pointsize;aB=aD.datapoints.points.slice(aE*aB,aE*(aB+1))}var aC=al(aD,aB);if(aC==-1){ab.push({series:aD,point:aB,auto:aF});f()}else{if(!aF){ab[aC].auto=false}}}function T(aD,aB){if(aD==null&&aB==null){ab=[];f()}if(typeof aD=="number"){aD=Q[aD]}if(typeof aB=="number"){aB=aD.data[aB]}var aC=al(aD,aB);if(aC!=-1){ab.splice(aC,1);f()}}function al(aD,aE){for(var aB=0;aB<ab.length;++aB){var aC=ab[aB];if(aC.series==aD&&aC.point[0]==aE[0]&&aC.point[1]==aE[1]){return aB}}return -1}function ay(aE,aD){var aC=aD[0],aI=aD[1],aH=aE.xaxis,aG=aE.yaxis;if(aC<aH.min||aC>aH.max||aI<aG.min||aI>aG.max){return}var aF=aE.points.radius+aE.points.lineWidth/2;A.lineWidth=aF;A.strokeStyle=c.color.parse(aE.color).scale("a",0.5).toString();var aB=1.5*aF,aC=aH.p2c(aC),aI=aG.p2c(aI);A.beginPath();if(aE.points.symbol=="circle"){A.arc(aC,aI,aB,0,2*Math.PI,false)}else{aE.points.symbol(A,aC,aI,aB,false)}A.closePath();A.stroke()}function v(aE,aB){A.lineWidth=aE.bars.lineWidth;A.strokeStyle=c.color.parse(aE.color).scale("a",0.5).toString();var aD=c.color.parse(aE.color).scale("a",0.5).toString();var aC=aE.bars.align=="left"?0:-aE.bars.barWidth/2;E(aB[0],aB[1],aB[2]||0,aC,aC+aE.bars.barWidth,0,function(){return aD},aE.xaxis,aE.yaxis,A,aE.bars.horizontal,aE.bars.lineWidth)}function am(aJ,aB,aH,aC){if(typeof aJ=="string"){return aJ}else{var aI=H.createLinearGradient(0,aH,0,aB);for(var aE=0,aD=aJ.colors.length;aE<aD;++aE){var aF=aJ.colors[aE];if(typeof aF!="string"){var aG=c.color.parse(aC);if(aF.brightness!=null){aG=aG.scale("rgb",aF.brightness)}if(aF.opacity!=null){aG.a*=aF.opacity}aF=aG.toString()}aI.addColorStop(aE/(aD-1),aF)}return aI}}}c.plot=function(g,e,d){var f=new b(c(g),e,d,c.plot.plugins);return f};c.plot.version="0.7";c.plot.plugins=[];c.plot.formatDate=function(l,f,h){var o=function(d){d=""+d;return d.length==1?"0"+d:d};var e=[];var p=false,j=false;var n=l.getUTCHours();var k=n<12;if(h==null){h=["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"]}if(f.search(/%p|%P/)!=-1){if(n>12){n=n-12}else{if(n==0){n=12}}}for(var g=0;g<f.length;++g){var m=f.charAt(g);if(p){switch(m){case"h":m=""+n;break;case"H":m=o(n);break;case"M":m=o(l.getUTCMinutes());break;case"S":m=o(l.getUTCSeconds());break;case"d":m=""+l.getUTCDate();break;case"m":m=""+(l.getUTCMonth()+1);break;case"y":m=""+l.getUTCFullYear();break;case"b":m=""+h[l.getUTCMonth()];break;case"p":m=(k)?("am"):("pm");break;case"P":m=(k)?("AM"):("PM");break;case"0":m="";j=true;break}if(m&&j){m=o(m);j=false}e.push(m);if(!j){p=false}}else{if(m=="%"){p=true}else{e.push(m)}}}return e.join("")};function a(e,d){return d*Math.floor(e/d)}})(jQuery); |
| /* | |
| Flot plugin for adding panning and zooming capabilities to a plot. | |
| The default behaviour is double click and scrollwheel up/down to zoom | |
| in, drag to pan. The plugin defines plot.zoom({ center }), | |
| plot.zoomOut() and plot.pan(offset) so you easily can add custom | |
| controls. It also fires a "plotpan" and "plotzoom" event when | |
| something happens, useful for synchronizing plots. | |
| Options: | |
| zoom: { | |
| interactive: false | |
| trigger: "dblclick" // or "click" for single click | |
| amount: 1.5 // 2 = 200% (zoom in), 0.5 = 50% (zoom out) | |
| } | |
| pan: { | |
| interactive: false | |
| cursor: "move" // CSS mouse cursor value used when dragging, e.g. "pointer" | |
| frameRate: 20 | |
| } | |
| xaxis, yaxis, x2axis, y2axis: { | |
| zoomRange: null // or [number, number] (min range, max range) or false | |
| panRange: null // or [number, number] (min, max) or false | |
| } | |
| "interactive" enables the built-in drag/click behaviour. If you enable | |
| interactive for pan, then you'll have a basic plot that supports | |
| moving around; the same for zoom. | |
| "amount" specifies the default amount to zoom in (so 1.5 = 150%) | |
| relative to the current viewport. | |
| "cursor" is a standard CSS mouse cursor string used for visual | |
| feedback to the user when dragging. | |
| "frameRate" specifies the maximum number of times per second the plot | |
| will update itself while the user is panning around on it (set to null | |
| to disable intermediate pans, the plot will then not update until the | |
| mouse button is released). | |
| "zoomRange" is the interval in which zooming can happen, e.g. with | |
| zoomRange: [1, 100] the zoom will never scale the axis so that the | |
| difference between min and max is smaller than 1 or larger than 100. | |
| You can set either end to null to ignore, e.g. [1, null]. If you set | |
| zoomRange to false, zooming on that axis will be disabled. | |
| "panRange" confines the panning to stay within a range, e.g. with | |
| panRange: [-10, 20] panning stops at -10 in one end and at 20 in the | |
| other. Either can be null, e.g. [-10, null]. If you set | |
| panRange to false, panning on that axis will be disabled. | |
| Example API usage: | |
| plot = $.plot(...); | |
| // zoom default amount in on the pixel (10, 20) | |
| plot.zoom({ center: { left: 10, top: 20 } }); | |
| // zoom out again | |
| plot.zoomOut({ center: { left: 10, top: 20 } }); | |
| // zoom 200% in on the pixel (10, 20) | |
| plot.zoom({ amount: 2, center: { left: 10, top: 20 } }); | |
| // pan 100 pixels to the left and 20 down | |
| plot.pan({ left: -100, top: 20 }) | |
| Here, "center" specifies where the center of the zooming should | |
| happen. Note that this is defined in pixel space, not the space of the | |
| data points (you can use the p2c helpers on the axes in Flot to help | |
| you convert between these). | |
| "amount" is the amount to zoom the viewport relative to the current | |
| range, so 1 is 100% (i.e. no change), 1.5 is 150% (zoom in), 0.7 is | |
| 70% (zoom out). You can set the default in the options. | |
| */ | |
| // First two dependencies, jquery.event.drag.js and | |
| // jquery.mousewheel.js, we put them inline here to save people the | |
| // effort of downloading them. | |
| /* | |
| jquery.event.drag.js ~ v1.5 ~ Copyright (c) 2008, Three Dub Media (http://threedubmedia.com) | |
| Licensed under the MIT License ~ http://threedubmedia.googlecode.com/files/MIT-LICENSE.txt | |
| */ | |
| (function(E){E.fn.drag=function(L,K,J){if(K){this.bind("dragstart",L)}if(J){this.bind("dragend",J)}return !L?this.trigger("drag"):this.bind("drag",K?K:L)};var A=E.event,B=A.special,F=B.drag={not:":input",distance:0,which:1,dragging:false,setup:function(J){J=E.extend({distance:F.distance,which:F.which,not:F.not},J||{});J.distance=I(J.distance);A.add(this,"mousedown",H,J);if(this.attachEvent){this.attachEvent("ondragstart",D)}},teardown:function(){A.remove(this,"mousedown",H);if(this===F.dragging){F.dragging=F.proxy=false}G(this,true);if(this.detachEvent){this.detachEvent("ondragstart",D)}}};B.dragstart=B.dragend={setup:function(){},teardown:function(){}};function H(L){var K=this,J,M=L.data||{};if(M.elem){K=L.dragTarget=M.elem;L.dragProxy=F.proxy||K;L.cursorOffsetX=M.pageX-M.left;L.cursorOffsetY=M.pageY-M.top;L.offsetX=L.pageX-L.cursorOffsetX;L.offsetY=L.pageY-L.cursorOffsetY}else{if(F.dragging||(M.which>0&&L.which!=M.which)||E(L.target).is(M.not)){return }}switch(L.type){case"mousedown":E.extend(M,E(K).offset(),{elem:K,target:L.target,pageX:L.pageX,pageY:L.pageY});A.add(document,"mousemove mouseup",H,M);G(K,false);F.dragging=null;return false;case !F.dragging&&"mousemove":if(I(L.pageX-M.pageX)+I(L.pageY-M.pageY)<M.distance){break}L.target=M.target;J=C(L,"dragstart",K);if(J!==false){F.dragging=K;F.proxy=L.dragProxy=E(J||K)[0]}case"mousemove":if(F.dragging){J=C(L,"drag",K);if(B.drop){B.drop.allowed=(J!==false);B.drop.handler(L)}if(J!==false){break}L.type="mouseup"}case"mouseup":A.remove(document,"mousemove mouseup",H);if(F.dragging){if(B.drop){B.drop.handler(L)}C(L,"dragend",K)}G(K,true);F.dragging=F.proxy=M.elem=false;break}return true}function C(M,K,L){M.type=K;var J=E.event.handle.call(L,M);return J===false?false:J||M.result}function I(J){return Math.pow(J,2)}function D(){return(F.dragging===false)}function G(K,J){if(!K){return }K.unselectable=J?"off":"on";K.onselectstart=function(){return J};if(K.style){K.style.MozUserSelect=J?"":"none"}}})(jQuery); | |
| /* jquery.mousewheel.min.js | |
| * Copyright (c) 2009 Brandon Aaron (http://brandonaaron.net) | |
| * Dual licensed under the MIT (http://www.opensource.org/licenses/mit-license.php) | |
| * and GPL (http://www.opensource.org/licenses/gpl-license.php) licenses. | |
| * Thanks to: http://adomas.org/javascript-mouse-wheel/ for some pointers. | |
| * Thanks to: Mathias Bank(http://www.mathias-bank.de) for a scope bug fix. | |
| * | |
| * Version: 3.0.2 | |
| * | |
| * Requires: 1.2.2+ | |
| */ | |
| (function(c){var a=["DOMMouseScroll","mousewheel"];c.event.special.mousewheel={setup:function(){if(this.addEventListener){for(var d=a.length;d;){this.addEventListener(a[--d],b,false)}}else{this.onmousewheel=b}},teardown:function(){if(this.removeEventListener){for(var d=a.length;d;){this.removeEventListener(a[--d],b,false)}}else{this.onmousewheel=null}}};c.fn.extend({mousewheel:function(d){return d?this.bind("mousewheel",d):this.trigger("mousewheel")},unmousewheel:function(d){return this.unbind("mousewheel",d)}});function b(f){var d=[].slice.call(arguments,1),g=0,e=true;f=c.event.fix(f||window.event);f.type="mousewheel";if(f.wheelDelta){g=f.wheelDelta/120}if(f.detail){g=-f.detail/3}d.unshift(f,g);return c.event.handle.apply(this,d)}})(jQuery); | |
| (function ($) { | |
| var options = { | |
| xaxis: { | |
| zoomRange: null, // or [number, number] (min range, max range) | |
| panRange: null // or [number, number] (min, max) | |
| }, | |
| zoom: { | |
| interactive: false, | |
| trigger: "dblclick", // or "click" for single click | |
| amount: 1.5 // how much to zoom relative to current position, 2 = 200% (zoom in), 0.5 = 50% (zoom out) | |
| }, | |
| pan: { | |
| interactive: false, | |
| cursor: "move", | |
| frameRate: 20 | |
| } | |
| }; | |
| function init(plot) { | |
| function onZoomClick(e, zoomOut) { | |
| var c = plot.offset(); | |
| c.left = e.pageX - c.left; | |
| c.top = e.pageY - c.top; | |
| if (zoomOut) | |
| plot.zoomOut({ center: c }); | |
| else | |
| plot.zoom({ center: c }); | |
| } | |
| function onMouseWheel(e, delta) { | |
| onZoomClick(e, delta < 0); | |
| return false; | |
| } | |
| var prevCursor = 'default', prevPageX = 0, prevPageY = 0, | |
| panTimeout = null; | |
| function onDragStart(e) { | |
| if (e.which != 1) // only accept left-click | |
| return false; | |
| var c = plot.getPlaceholder().css('cursor'); | |
| if (c) | |
| prevCursor = c; | |
| plot.getPlaceholder().css('cursor', plot.getOptions().pan.cursor); | |
| prevPageX = e.pageX; | |
| prevPageY = e.pageY; | |
| } | |
| function onDrag(e) { | |
| var frameRate = plot.getOptions().pan.frameRate; | |
| if (panTimeout || !frameRate) | |
| return; | |
| panTimeout = setTimeout(function () { | |
| plot.pan({ left: prevPageX - e.pageX, | |
| top: prevPageY - e.pageY }); | |
| prevPageX = e.pageX; | |
| prevPageY = e.pageY; | |
| panTimeout = null; | |
| }, 1 / frameRate * 1000); | |
| } | |
| function onDragEnd(e) { | |
| if (panTimeout) { | |
| clearTimeout(panTimeout); | |
| panTimeout = null; | |
| } | |
| plot.getPlaceholder().css('cursor', prevCursor); | |
| plot.pan({ left: prevPageX - e.pageX, | |
| top: prevPageY - e.pageY }); | |
| } | |
| function bindEvents(plot, eventHolder) { | |
| var o = plot.getOptions(); | |
| if (o.zoom.interactive) { | |
| eventHolder[o.zoom.trigger](onZoomClick); | |
| eventHolder.mousewheel(onMouseWheel); | |
| } | |
| if (o.pan.interactive) { | |
| eventHolder.bind("dragstart", { distance: 10 }, onDragStart); | |
| eventHolder.bind("drag", onDrag); | |
| eventHolder.bind("dragend", onDragEnd); | |
| } | |
| } | |
| plot.zoomOut = function (args) { | |
| if (!args) | |
| args = {}; | |
| if (!args.amount) | |
| args.amount = plot.getOptions().zoom.amount | |
| args.amount = 1 / args.amount; | |
| plot.zoom(args); | |
| } | |
| plot.zoom = function (args) { | |
| if (!args) | |
| args = {}; | |
| var c = args.center, | |
| amount = args.amount || plot.getOptions().zoom.amount, | |
| w = plot.width(), h = plot.height(); | |
| if (!c) | |
| c = { left: w / 2, top: h / 2 }; | |
| var xf = c.left / w, | |
| yf = c.top / h, | |
| minmax = { | |
| x: { | |
| min: c.left - xf * w / amount, | |
| max: c.left + (1 - xf) * w / amount | |
| }, | |
| y: { | |
| min: c.top - yf * h / amount, | |
| max: c.top + (1 - yf) * h / amount | |
| } | |
| }; | |
| $.each(plot.getAxes(), function(_, axis) { | |
| var opts = axis.options, | |
| min = minmax[axis.direction].min, | |
| max = minmax[axis.direction].max, | |
| zr = opts.zoomRange; | |
| if (zr === false) // no zooming on this axis | |
| return; | |
| min = axis.c2p(min); | |
| max = axis.c2p(max); | |
| if (min > max) { | |
| // make sure min < max | |
| var tmp = min; | |
| min = max; | |
| max = tmp; | |
| } | |
| var range = max - min; | |
| if (zr && | |
| ((zr[0] != null && range < zr[0]) || | |
| (zr[1] != null && range > zr[1]))) | |
| return; | |
| opts.min = min; | |
| opts.max = max; | |
| }); | |
| plot.setupGrid(); | |
| plot.draw(); | |
| if (!args.preventEvent) | |
| plot.getPlaceholder().trigger("plotzoom", [ plot ]); | |
| } | |
| plot.pan = function (args) { | |
| var delta = { | |
| x: +args.left, | |
| y: +args.top | |
| }; | |
| if (isNaN(delta.x)) | |
| delta.x = 0; | |
| if (isNaN(delta.y)) | |
| delta.y = 0; | |
| $.each(plot.getAxes(), function (_, axis) { | |
| var opts = axis.options, | |
| min, max, d = delta[axis.direction]; | |
| min = axis.c2p(axis.p2c(axis.min) + d), | |
| max = axis.c2p(axis.p2c(axis.max) + d); | |
| var pr = opts.panRange; | |
| if (pr === false) // no panning on this axis | |
| return; | |
| if (pr) { | |
| // check whether we hit the wall | |
| if (pr[0] != null && pr[0] > min) { | |
| d = pr[0] - min; | |
| min += d; | |
| max += d; | |
| } | |
| if (pr[1] != null && pr[1] < max) { | |
| d = pr[1] - max; | |
| min += d; | |
| max += d; | |
| } | |
| } | |
| opts.min = min; | |
| opts.max = max; | |
| }); | |
| plot.setupGrid(); | |
| plot.draw(); | |
| if (!args.preventEvent) | |
| plot.getPlaceholder().trigger("plotpan", [ plot ]); | |
| } | |
| function shutdown(plot, eventHolder) { | |
| eventHolder.unbind(plot.getOptions().zoom.trigger, onZoomClick); | |
| eventHolder.unbind("mousewheel", onMouseWheel); | |
| eventHolder.unbind("dragstart", onDragStart); | |
| eventHolder.unbind("drag", onDrag); | |
| eventHolder.unbind("dragend", onDragEnd); | |
| if (panTimeout) | |
| clearTimeout(panTimeout); | |
| } | |
| plot.hooks.bindEvents.push(bindEvents); | |
| plot.hooks.shutdown.push(shutdown); | |
| } | |
| $.plot.plugins.push({ | |
| init: init, | |
| options: options, | |
| name: 'navigate', | |
| version: '1.3' | |
| }); | |
| })(jQuery); | |
| (function(i){i.fn.drag=function(j,k,l){if(k){this.bind("dragstart",j)}if(l){this.bind("dragend",l)}return !j?this.trigger("drag"):this.bind("drag",k?k:j)};var d=i.event,c=d.special,h=c.drag={not:":input",distance:0,which:1,dragging:false,setup:function(j){j=i.extend({distance:h.distance,which:h.which,not:h.not},j||{});j.distance=e(j.distance);d.add(this,"mousedown",f,j);if(this.attachEvent){this.attachEvent("ondragstart",a)}},teardown:function(){d.remove(this,"mousedown",f);if(this===h.dragging){h.dragging=h.proxy=false}g(this,true);if(this.detachEvent){this.detachEvent("ondragstart",a)}}};c.dragstart=c.dragend={setup:function(){},teardown:function(){}};function f(j){var k=this,l,m=j.data||{};if(m.elem){k=j.dragTarget=m.elem;j.dragProxy=h.proxy||k;j.cursorOffsetX=m.pageX-m.left;j.cursorOffsetY=m.pageY-m.top;j.offsetX=j.pageX-j.cursorOffsetX;j.offsetY=j.pageY-j.cursorOffsetY}else{if(h.dragging||(m.which>0&&j.which!=m.which)||i(j.target).is(m.not)){return}}switch(j.type){case"mousedown":i.extend(m,i(k).offset(),{elem:k,target:j.target,pageX:j.pageX,pageY:j.pageY});d.add(document,"mousemove mouseup",f,m);g(k,false);h.dragging=null;return false;case !h.dragging&&"mousemove":if(e(j.pageX-m.pageX)+e(j.pageY-m.pageY)<m.distance){break}j.target=m.target;l=b(j,"dragstart",k);if(l!==false){h.dragging=k;h.proxy=j.dragProxy=i(l||k)[0]}case"mousemove":if(h.dragging){l=b(j,"drag",k);if(c.drop){c.drop.allowed=(l!==false);c.drop.handler(j)}if(l!==false){break}j.type="mouseup"}case"mouseup":d.remove(document,"mousemove mouseup",f);if(h.dragging){if(c.drop){c.drop.handler(j)}b(j,"dragend",k)}g(k,true);h.dragging=h.proxy=m.elem=false;break}return true}function b(m,k,j){m.type=k;var l=i.event.handle.call(j,m);return l===false?false:l||m.result}function e(j){return Math.pow(j,2)}function a(){return(h.dragging===false)}function g(j,k){if(!j){return}j.unselectable=k?"off":"on";j.onselectstart=function(){return k};if(j.style){j.style.MozUserSelect=k?"":"none"}}})(jQuery);(function(f){var e=["DOMMouseScroll","mousewheel"];f.event.special.mousewheel={setup:function(){if(this.addEventListener){for(var a=e.length;a;){this.addEventListener(e[--a],d,false)}}else{this.onmousewheel=d}},teardown:function(){if(this.removeEventListener){for(var a=e.length;a;){this.removeEventListener(e[--a],d,false)}}else{this.onmousewheel=null}}};f.fn.extend({mousewheel:function(a){return a?this.bind("mousewheel",a):this.trigger("mousewheel")},unmousewheel:function(a){return this.unbind("mousewheel",a)}});function d(b){var h=[].slice.call(arguments,1),a=0,c=true;b=f.event.fix(b||window.event);b.type="mousewheel";if(b.wheelDelta){a=b.wheelDelta/120}if(b.detail){a=-b.detail/3}h.unshift(b,a);return f.event.handle.apply(this,h)}})(jQuery);(function(b){var a={xaxis:{zoomRange:null,panRange:null},zoom:{interactive:false,trigger:"dblclick",amount:1.5},pan:{interactive:false,cursor:"move",frameRate:20}};function c(o){function m(q,p){var r=o.offset();r.left=q.pageX-r.left;r.top=q.pageY-r.top;if(p){o.zoomOut({center:r})}else{o.zoom({center:r})}}function d(p,q){m(p,q<0);return false}var i="default",g=0,e=0,n=null;function f(p){if(p.which!=1){return false}var q=o.getPlaceholder().css("cursor");if(q){i=q}o.getPlaceholder().css("cursor",o.getOptions().pan.cursor);g=p.pageX;e=p.pageY}function j(q){var p=o.getOptions().pan.frameRate;if(n||!p){return}n=setTimeout(function(){o.pan({left:g-q.pageX,top:e-q.pageY});g=q.pageX;e=q.pageY;n=null},1/p*1000)}function h(p){if(n){clearTimeout(n);n=null}o.getPlaceholder().css("cursor",i);o.pan({left:g-p.pageX,top:e-p.pageY})}function l(q,p){var r=q.getOptions();if(r.zoom.interactive){p[r.zoom.trigger](m);p.mousewheel(d)}if(r.pan.interactive){p.bind("dragstart",{distance:10},f);p.bind("drag",j);p.bind("dragend",h)}}o.zoomOut=function(p){if(!p){p={}}if(!p.amount){p.amount=o.getOptions().zoom.amount}p.amount=1/p.amount;o.zoom(p)};o.zoom=function(q){if(!q){q={}}var x=q.center,r=q.amount||o.getOptions().zoom.amount,p=o.width(),t=o.height();if(!x){x={left:p/2,top:t/2}}var s=x.left/p,v=x.top/t,u={x:{min:x.left-s*p/r,max:x.left+(1-s)*p/r},y:{min:x.top-v*t/r,max:x.top+(1-v)*t/r}};b.each(o.getAxes(),function(z,C){var D=C.options,B=u[C.direction].min,w=u[C.direction].max,E=D.zoomRange;if(E===false){return}B=C.c2p(B);w=C.c2p(w);if(B>w){var A=B;B=w;w=A}var y=w-B;if(E&&((E[0]!=null&&y<E[0])||(E[1]!=null&&y>E[1]))){return}D.min=B;D.max=w});o.setupGrid();o.draw();if(!q.preventEvent){o.getPlaceholder().trigger("plotzoom",[o])}};o.pan=function(p){var q={x:+p.left,y:+p.top};if(isNaN(q.x)){q.x=0}if(isNaN(q.y)){q.y=0}b.each(o.getAxes(),function(s,u){var v=u.options,t,r,w=q[u.direction];t=u.c2p(u.p2c(u.min)+w),r=u.c2p(u.p2c(u.max)+w);var x=v.panRange;if(x===false){return}if(x){if(x[0]!=null&&x[0]>t){w=x[0]-t;t+=w;r+=w}if(x[1]!=null&&x[1]<r){w=x[1]-r;t+=w;r+=w}}v.min=t;v.max=r});o.setupGrid();o.draw();if(!p.preventEvent){o.getPlaceholder().trigger("plotpan",[o])}};function k(q,p){p.unbind(q.getOptions().zoom.trigger,m);p.unbind("mousewheel",d);p.unbind("dragstart",f);p.unbind("drag",j);p.unbind("dragend",h);if(n){clearTimeout(n)}}o.hooks.bindEvents.push(l);o.hooks.shutdown.push(k)}b.plot.plugins.push({init:c,options:a,name:"navigate",version:"1.3"})})(jQuery); |
| /* | |
| Flot plugin for rendering pie charts. The plugin assumes the data is | |
| coming is as a single data value for each series, and each of those | |
| values is a positive value or zero (negative numbers don't make | |
| any sense and will cause strange effects). The data values do | |
| NOT need to be passed in as percentage values because it | |
| internally calculates the total and percentages. | |
| * Created by Brian Medendorp, June 2009 | |
| * Updated November 2009 with contributions from: btburnett3, Anthony Aragues and Xavi Ivars | |
| * Changes: | |
| 2009-10-22: lineJoin set to round | |
| 2009-10-23: IE full circle fix, donut | |
| 2009-11-11: Added basic hover from btburnett3 - does not work in IE, and center is off in Chrome and Opera | |
| 2009-11-17: Added IE hover capability submitted by Anthony Aragues | |
| 2009-11-18: Added bug fix submitted by Xavi Ivars (issues with arrays when other JS libraries are included as well) | |
| Available options are: | |
| series: { | |
| pie: { | |
| show: true/false | |
| radius: 0-1 for percentage of fullsize, or a specified pixel length, or 'auto' | |
| innerRadius: 0-1 for percentage of fullsize or a specified pixel length, for creating a donut effect | |
| startAngle: 0-2 factor of PI used for starting angle (in radians) i.e 3/2 starts at the top, 0 and 2 have the same result | |
| tilt: 0-1 for percentage to tilt the pie, where 1 is no tilt, and 0 is completely flat (nothing will show) | |
| offset: { | |
| top: integer value to move the pie up or down | |
| left: integer value to move the pie left or right, or 'auto' | |
| }, | |
| stroke: { | |
| color: any hexidecimal color value (other formats may or may not work, so best to stick with something like '#FFF') | |
| width: integer pixel width of the stroke | |
| }, | |
| label: { | |
| show: true/false, or 'auto' | |
| formatter: a user-defined function that modifies the text/style of the label text | |
| radius: 0-1 for percentage of fullsize, or a specified pixel length | |
| background: { | |
| color: any hexidecimal color value (other formats may or may not work, so best to stick with something like '#000') | |
| opacity: 0-1 | |
| }, | |
| threshold: 0-1 for the percentage value at which to hide labels (if they're too small) | |
| }, | |
| combine: { | |
| threshold: 0-1 for the percentage value at which to combine slices (if they're too small) | |
| color: any hexidecimal color value (other formats may or may not work, so best to stick with something like '#CCC'), if null, the plugin will automatically use the color of the first slice to be combined | |
| label: any text value of what the combined slice should be labeled | |
| } | |
| highlight: { | |
| opacity: 0-1 | |
| } | |
| } | |
| } | |
| More detail and specific examples can be found in the included HTML file. | |
| */ | |
| (function ($) | |
| { | |
| function init(plot) // this is the "body" of the plugin | |
| { | |
| var canvas = null; | |
| var target = null; | |
| var maxRadius = null; | |
| var centerLeft = null; | |
| var centerTop = null; | |
| var total = 0; | |
| var redraw = true; | |
| var redrawAttempts = 10; | |
| var shrink = 0.95; | |
| var legendWidth = 0; | |
| var processed = false; | |
| var raw = false; | |
| // interactive variables | |
| var highlights = []; | |
| // add hook to determine if pie plugin in enabled, and then perform necessary operations | |
| plot.hooks.processOptions.push(checkPieEnabled); | |
| plot.hooks.bindEvents.push(bindEvents); | |
| // check to see if the pie plugin is enabled | |
| function checkPieEnabled(plot, options) | |
| { | |
| if (options.series.pie.show) | |
| { | |
| //disable grid | |
| options.grid.show = false; | |
| // set labels.show | |
| if (options.series.pie.label.show=='auto') | |
| if (options.legend.show) | |
| options.series.pie.label.show = false; | |
| else | |
| options.series.pie.label.show = true; | |
| // set radius | |
| if (options.series.pie.radius=='auto') | |
| if (options.series.pie.label.show) | |
| options.series.pie.radius = 3/4; | |
| else | |
| options.series.pie.radius = 1; | |
| // ensure sane tilt | |
| if (options.series.pie.tilt>1) | |
| options.series.pie.tilt=1; | |
| if (options.series.pie.tilt<0) | |
| options.series.pie.tilt=0; | |
| // add processData hook to do transformations on the data | |
| plot.hooks.processDatapoints.push(processDatapoints); | |
| plot.hooks.drawOverlay.push(drawOverlay); | |
| // add draw hook | |
| plot.hooks.draw.push(draw); | |
| } | |
| } | |
| // bind hoverable events | |
| function bindEvents(plot, eventHolder) | |
| { | |
| var options = plot.getOptions(); | |
| if (options.series.pie.show && options.grid.hoverable) | |
| eventHolder.unbind('mousemove').mousemove(onMouseMove); | |
| if (options.series.pie.show && options.grid.clickable) | |
| eventHolder.unbind('click').click(onClick); | |
| } | |
| // debugging function that prints out an object | |
| function alertObject(obj) | |
| { | |
| var msg = ''; | |
| function traverse(obj, depth) | |
| { | |
| if (!depth) | |
| depth = 0; | |
| for (var i = 0; i < obj.length; ++i) | |
| { | |
| for (var j=0; j<depth; j++) | |
| msg += '\t'; | |
| if( typeof obj[i] == "object") | |
| { // its an object | |
| msg += ''+i+':\n'; | |
| traverse(obj[i], depth+1); | |
| } | |
| else | |
| { // its a value | |
| msg += ''+i+': '+obj[i]+'\n'; | |
| } | |
| } | |
| } | |
| traverse(obj); | |
| alert(msg); | |
| } | |
| function calcTotal(data) | |
| { | |
| for (var i = 0; i < data.length; ++i) | |
| { | |
| var item = parseFloat(data[i].data[0][1]); | |
| if (item) | |
| total += item; | |
| } | |
| } | |
| function processDatapoints(plot, series, data, datapoints) | |
| { | |
| if (!processed) | |
| { | |
| processed = true; | |
| canvas = plot.getCanvas(); | |
| target = $(canvas).parent(); | |
| options = plot.getOptions(); | |
| plot.setData(combine(plot.getData())); | |
| } | |
| } | |
| function setupPie() | |
| { | |
| legendWidth = target.children().filter('.legend').children().width(); | |
| // calculate maximum radius and center point | |
| maxRadius = Math.min(canvas.width,(canvas.height/options.series.pie.tilt))/2; | |
| centerTop = (canvas.height/2)+options.series.pie.offset.top; | |
| centerLeft = (canvas.width/2); | |
| if (options.series.pie.offset.left=='auto') | |
| if (options.legend.position.match('w')) | |
| centerLeft += legendWidth/2; | |
| else | |
| centerLeft -= legendWidth/2; | |
| else | |
| centerLeft += options.series.pie.offset.left; | |
| if (centerLeft<maxRadius) | |
| centerLeft = maxRadius; | |
| else if (centerLeft>canvas.width-maxRadius) | |
| centerLeft = canvas.width-maxRadius; | |
| } | |
| function fixData(data) | |
| { | |
| for (var i = 0; i < data.length; ++i) | |
| { | |
| if (typeof(data[i].data)=='number') | |
| data[i].data = [[1,data[i].data]]; | |
| else if (typeof(data[i].data)=='undefined' || typeof(data[i].data[0])=='undefined') | |
| { | |
| if (typeof(data[i].data)!='undefined' && typeof(data[i].data.label)!='undefined') | |
| data[i].label = data[i].data.label; // fix weirdness coming from flot | |
| data[i].data = [[1,0]]; | |
| } | |
| } | |
| return data; | |
| } | |
| function combine(data) | |
| { | |
| data = fixData(data); | |
| calcTotal(data); | |
| var combined = 0; | |
| var numCombined = 0; | |
| var color = options.series.pie.combine.color; | |
| var newdata = []; | |
| for (var i = 0; i < data.length; ++i) | |
| { | |
| // make sure its a number | |
| data[i].data[0][1] = parseFloat(data[i].data[0][1]); | |
| if (!data[i].data[0][1]) | |
| data[i].data[0][1] = 0; | |
| if (data[i].data[0][1]/total<=options.series.pie.combine.threshold) | |
| { | |
| combined += data[i].data[0][1]; | |
| numCombined++; | |
| if (!color) | |
| color = data[i].color; | |
| } | |
| else | |
| { | |
| newdata.push({ | |
| data: [[1,data[i].data[0][1]]], | |
| color: data[i].color, | |
| label: data[i].label, | |
| angle: (data[i].data[0][1]*(Math.PI*2))/total, | |
| percent: (data[i].data[0][1]/total*100) | |
| }); | |
| } | |
| } | |
| if (numCombined>0) | |
| newdata.push({ | |
| data: [[1,combined]], | |
| color: color, | |
| label: options.series.pie.combine.label, | |
| angle: (combined*(Math.PI*2))/total, | |
| percent: (combined/total*100) | |
| }); | |
| return newdata; | |
| } | |
| function draw(plot, newCtx) | |
| { | |
| if (!target) return; // if no series were passed | |
| ctx = newCtx; | |
| setupPie(); | |
| var slices = plot.getData(); | |
| var attempts = 0; | |
| while (redraw && attempts<redrawAttempts) | |
| { | |
| redraw = false; | |
| if (attempts>0) | |
| maxRadius *= shrink; | |
| attempts += 1; | |
| clear(); | |
| if (options.series.pie.tilt<=0.8) | |
| drawShadow(); | |
| drawPie(); | |
| } | |
| if (attempts >= redrawAttempts) { | |
| clear(); | |
| target.prepend('<div class="error">Could not draw pie with labels contained inside canvas</div>'); | |
| } | |
| if ( plot.setSeries && plot.insertLegend ) | |
| { | |
| plot.setSeries(slices); | |
| plot.insertLegend(); | |
| } | |
| // we're actually done at this point, just defining internal functions at this point | |
| function clear() | |
| { | |
| ctx.clearRect(0,0,canvas.width,canvas.height); | |
| target.children().filter('.pieLabel, .pieLabelBackground').remove(); | |
| } | |
| function drawShadow() | |
| { | |
| var shadowLeft = 5; | |
| var shadowTop = 15; | |
| var edge = 10; | |
| var alpha = 0.02; | |
| // set radius | |
| if (options.series.pie.radius>1) | |
| var radius = options.series.pie.radius; | |
| else | |
| var radius = maxRadius * options.series.pie.radius; | |
| if (radius>=(canvas.width/2)-shadowLeft || radius*options.series.pie.tilt>=(canvas.height/2)-shadowTop || radius<=edge) | |
| return; // shadow would be outside canvas, so don't draw it | |
| ctx.save(); | |
| ctx.translate(shadowLeft,shadowTop); | |
| ctx.globalAlpha = alpha; | |
| ctx.fillStyle = '#000'; | |
| // center and rotate to starting position | |
| ctx.translate(centerLeft,centerTop); | |
| ctx.scale(1, options.series.pie.tilt); | |
| //radius -= edge; | |
| for (var i=1; i<=edge; i++) | |
| { | |
| ctx.beginPath(); | |
| ctx.arc(0,0,radius,0,Math.PI*2,false); | |
| ctx.fill(); | |
| radius -= i; | |
| } | |
| ctx.restore(); | |
| } | |
| function drawPie() | |
| { | |
| startAngle = Math.PI*options.series.pie.startAngle; | |
| // set radius | |
| if (options.series.pie.radius>1) | |
| var radius = options.series.pie.radius; | |
| else | |
| var radius = maxRadius * options.series.pie.radius; | |
| // center and rotate to starting position | |
| ctx.save(); | |
| ctx.translate(centerLeft,centerTop); | |
| ctx.scale(1, options.series.pie.tilt); | |
| //ctx.rotate(startAngle); // start at top; -- This doesn't work properly in Opera | |
| // draw slices | |
| ctx.save(); | |
| var currentAngle = startAngle; | |
| for (var i = 0; i < slices.length; ++i) | |
| { | |
| slices[i].startAngle = currentAngle; | |
| drawSlice(slices[i].angle, slices[i].color, true); | |
| } | |
| ctx.restore(); | |
| // draw slice outlines | |
| ctx.save(); | |
| ctx.lineWidth = options.series.pie.stroke.width; | |
| currentAngle = startAngle; | |
| for (var i = 0; i < slices.length; ++i) | |
| drawSlice(slices[i].angle, options.series.pie.stroke.color, false); | |
| ctx.restore(); | |
| // draw donut hole | |
| drawDonutHole(ctx); | |
| // draw labels | |
| if (options.series.pie.label.show) | |
| drawLabels(); | |
| // restore to original state | |
| ctx.restore(); | |
| function drawSlice(angle, color, fill) | |
| { | |
| if (angle<=0) | |
| return; | |
| if (fill) | |
| ctx.fillStyle = color; | |
| else | |
| { | |
| ctx.strokeStyle = color; | |
| ctx.lineJoin = 'round'; | |
| } | |
| ctx.beginPath(); | |
| if (Math.abs(angle - Math.PI*2) > 0.000000001) | |
| ctx.moveTo(0,0); // Center of the pie | |
| else if ($.browser.msie) | |
| angle -= 0.0001; | |
| //ctx.arc(0,0,radius,0,angle,false); // This doesn't work properly in Opera | |
| ctx.arc(0,0,radius,currentAngle,currentAngle+angle,false); | |
| ctx.closePath(); | |
| //ctx.rotate(angle); // This doesn't work properly in Opera | |
| currentAngle += angle; | |
| if (fill) | |
| ctx.fill(); | |
| else | |
| ctx.stroke(); | |
| } | |
| function drawLabels() | |
| { | |
| var currentAngle = startAngle; | |
| // set radius | |
| if (options.series.pie.label.radius>1) | |
| var radius = options.series.pie.label.radius; | |
| else | |
| var radius = maxRadius * options.series.pie.label.radius; | |
| for (var i = 0; i < slices.length; ++i) | |
| { | |
| if (slices[i].percent >= options.series.pie.label.threshold*100) | |
| drawLabel(slices[i], currentAngle, i); | |
| currentAngle += slices[i].angle; | |
| } | |
| function drawLabel(slice, startAngle, index) | |
| { | |
| if (slice.data[0][1]==0) | |
| return; | |
| // format label text | |
| var lf = options.legend.labelFormatter, text, plf = options.series.pie.label.formatter; | |
| if (lf) | |
| text = lf(slice.label, slice); | |
| else | |
| text = slice.label; | |
| if (plf) | |
| text = plf(text, slice); | |
| var halfAngle = ((startAngle+slice.angle) + startAngle)/2; | |
| var x = centerLeft + Math.round(Math.cos(halfAngle) * radius); | |
| var y = centerTop + Math.round(Math.sin(halfAngle) * radius) * options.series.pie.tilt; | |
| var html = '<span class="pieLabel" id="pieLabel'+index+'" style="position:absolute;top:' + y + 'px;left:' + x + 'px;">' + text + "</span>"; | |
| target.append(html); | |
| var label = target.children('#pieLabel'+index); | |
| var labelTop = (y - label.height()/2); | |
| var labelLeft = (x - label.width()/2); | |
| label.css('top', labelTop); | |
| label.css('left', labelLeft); | |
| // check to make sure that the label is not outside the canvas | |
| if (0-labelTop>0 || 0-labelLeft>0 || canvas.height-(labelTop+label.height())<0 || canvas.width-(labelLeft+label.width())<0) | |
| redraw = true; | |
| if (options.series.pie.label.background.opacity != 0) { | |
| // put in the transparent background separately to avoid blended labels and label boxes | |
| var c = options.series.pie.label.background.color; | |
| if (c == null) { | |
| c = slice.color; | |
| } | |
| var pos = 'top:'+labelTop+'px;left:'+labelLeft+'px;'; | |
| $('<div class="pieLabelBackground" style="position:absolute;width:' + label.width() + 'px;height:' + label.height() + 'px;' + pos +'background-color:' + c + ';"> </div>').insertBefore(label).css('opacity', options.series.pie.label.background.opacity); | |
| } | |
| } // end individual label function | |
| } // end drawLabels function | |
| } // end drawPie function | |
| } // end draw function | |
| // Placed here because it needs to be accessed from multiple locations | |
| function drawDonutHole(layer) | |
| { | |
| // draw donut hole | |
| if(options.series.pie.innerRadius > 0) | |
| { | |
| // subtract the center | |
| layer.save(); | |
| innerRadius = options.series.pie.innerRadius > 1 ? options.series.pie.innerRadius : maxRadius * options.series.pie.innerRadius; | |
| layer.globalCompositeOperation = 'destination-out'; // this does not work with excanvas, but it will fall back to using the stroke color | |
| layer.beginPath(); | |
| layer.fillStyle = options.series.pie.stroke.color; | |
| layer.arc(0,0,innerRadius,0,Math.PI*2,false); | |
| layer.fill(); | |
| layer.closePath(); | |
| layer.restore(); | |
| // add inner stroke | |
| layer.save(); | |
| layer.beginPath(); | |
| layer.strokeStyle = options.series.pie.stroke.color; | |
| layer.arc(0,0,innerRadius,0,Math.PI*2,false); | |
| layer.stroke(); | |
| layer.closePath(); | |
| layer.restore(); | |
| // TODO: add extra shadow inside hole (with a mask) if the pie is tilted. | |
| } | |
| } | |
| //-- Additional Interactive related functions -- | |
| function isPointInPoly(poly, pt) | |
| { | |
| for(var c = false, i = -1, l = poly.length, j = l - 1; ++i < l; j = i) | |
| ((poly[i][1] <= pt[1] && pt[1] < poly[j][1]) || (poly[j][1] <= pt[1] && pt[1]< poly[i][1])) | |
| && (pt[0] < (poly[j][0] - poly[i][0]) * (pt[1] - poly[i][1]) / (poly[j][1] - poly[i][1]) + poly[i][0]) | |
| && (c = !c); | |
| return c; | |
| } | |
| function findNearbySlice(mouseX, mouseY) | |
| { | |
| var slices = plot.getData(), | |
| options = plot.getOptions(), | |
| radius = options.series.pie.radius > 1 ? options.series.pie.radius : maxRadius * options.series.pie.radius; | |
| for (var i = 0; i < slices.length; ++i) | |
| { | |
| var s = slices[i]; | |
| if(s.pie.show) | |
| { | |
| ctx.save(); | |
| ctx.beginPath(); | |
| ctx.moveTo(0,0); // Center of the pie | |
| //ctx.scale(1, options.series.pie.tilt); // this actually seems to break everything when here. | |
| ctx.arc(0,0,radius,s.startAngle,s.startAngle+s.angle,false); | |
| ctx.closePath(); | |
| x = mouseX-centerLeft; | |
| y = mouseY-centerTop; | |
| if(ctx.isPointInPath) | |
| { | |
| if (ctx.isPointInPath(mouseX-centerLeft, mouseY-centerTop)) | |
| { | |
| //alert('found slice!'); | |
| ctx.restore(); | |
| return {datapoint: [s.percent, s.data], dataIndex: 0, series: s, seriesIndex: i}; | |
| } | |
| } | |
| else | |
| { | |
| // excanvas for IE doesn;t support isPointInPath, this is a workaround. | |
| p1X = (radius * Math.cos(s.startAngle)); | |
| p1Y = (radius * Math.sin(s.startAngle)); | |
| p2X = (radius * Math.cos(s.startAngle+(s.angle/4))); | |
| p2Y = (radius * Math.sin(s.startAngle+(s.angle/4))); | |
| p3X = (radius * Math.cos(s.startAngle+(s.angle/2))); | |
| p3Y = (radius * Math.sin(s.startAngle+(s.angle/2))); | |
| p4X = (radius * Math.cos(s.startAngle+(s.angle/1.5))); | |
| p4Y = (radius * Math.sin(s.startAngle+(s.angle/1.5))); | |
| p5X = (radius * Math.cos(s.startAngle+s.angle)); | |
| p5Y = (radius * Math.sin(s.startAngle+s.angle)); | |
| arrPoly = [[0,0],[p1X,p1Y],[p2X,p2Y],[p3X,p3Y],[p4X,p4Y],[p5X,p5Y]]; | |
| arrPoint = [x,y]; | |
| // TODO: perhaps do some mathmatical trickery here with the Y-coordinate to compensate for pie tilt? | |
| if(isPointInPoly(arrPoly, arrPoint)) | |
| { | |
| ctx.restore(); | |
| return {datapoint: [s.percent, s.data], dataIndex: 0, series: s, seriesIndex: i}; | |
| } | |
| } | |
| ctx.restore(); | |
| } | |
| } | |
| return null; | |
| } | |
| function onMouseMove(e) | |
| { | |
| triggerClickHoverEvent('plothover', e); | |
| } | |
| function onClick(e) | |
| { | |
| triggerClickHoverEvent('plotclick', e); | |
| } | |
| // trigger click or hover event (they send the same parameters so we share their code) | |
| function triggerClickHoverEvent(eventname, e) | |
| { | |
| var offset = plot.offset(), | |
| canvasX = parseInt(e.pageX - offset.left), | |
| canvasY = parseInt(e.pageY - offset.top), | |
| item = findNearbySlice(canvasX, canvasY); | |
| if (options.grid.autoHighlight) | |
| { | |
| // clear auto-highlights | |
| for (var i = 0; i < highlights.length; ++i) | |
| { | |
| var h = highlights[i]; | |
| if (h.auto == eventname && !(item && h.series == item.series)) | |
| unhighlight(h.series); | |
| } | |
| } | |
| // highlight the slice | |
| if (item) | |
| highlight(item.series, eventname); | |
| // trigger any hover bind events | |
| var pos = { pageX: e.pageX, pageY: e.pageY }; | |
| target.trigger(eventname, [ pos, item ]); | |
| } | |
| function highlight(s, auto) | |
| { | |
| if (typeof s == "number") | |
| s = series[s]; | |
| var i = indexOfHighlight(s); | |
| if (i == -1) | |
| { | |
| highlights.push({ series: s, auto: auto }); | |
| plot.triggerRedrawOverlay(); | |
| } | |
| else if (!auto) | |
| highlights[i].auto = false; | |
| } | |
| function unhighlight(s) | |
| { | |
| if (s == null) | |
| { | |
| highlights = []; | |
| plot.triggerRedrawOverlay(); | |
| } | |
| if (typeof s == "number") | |
| s = series[s]; | |
| var i = indexOfHighlight(s); | |
| if (i != -1) | |
| { | |
| highlights.splice(i, 1); | |
| plot.triggerRedrawOverlay(); | |
| } | |
| } | |
| function indexOfHighlight(s) | |
| { | |
| for (var i = 0; i < highlights.length; ++i) | |
| { | |
| var h = highlights[i]; | |
| if (h.series == s) | |
| return i; | |
| } | |
| return -1; | |
| } | |
| function drawOverlay(plot, octx) | |
| { | |
| //alert(options.series.pie.radius); | |
| var options = plot.getOptions(); | |
| //alert(options.series.pie.radius); | |
| var radius = options.series.pie.radius > 1 ? options.series.pie.radius : maxRadius * options.series.pie.radius; | |
| octx.save(); | |
| octx.translate(centerLeft, centerTop); | |
| octx.scale(1, options.series.pie.tilt); | |
| for (i = 0; i < highlights.length; ++i) | |
| drawHighlight(highlights[i].series); | |
| drawDonutHole(octx); | |
| octx.restore(); | |
| function drawHighlight(series) | |
| { | |
| if (series.angle < 0) return; | |
| //octx.fillStyle = parseColor(options.series.pie.highlight.color).scale(null, null, null, options.series.pie.highlight.opacity).toString(); | |
| octx.fillStyle = "rgba(255, 255, 255, "+options.series.pie.highlight.opacity+")"; // this is temporary until we have access to parseColor | |
| octx.beginPath(); | |
| if (Math.abs(series.angle - Math.PI*2) > 0.000000001) | |
| octx.moveTo(0,0); // Center of the pie | |
| octx.arc(0,0,radius,series.startAngle,series.startAngle+series.angle,false); | |
| octx.closePath(); | |
| octx.fill(); | |
| } | |
| } | |
| } // end init (plugin body) | |
| // define pie specific options and their default values | |
| var options = { | |
| series: { | |
| pie: { | |
| show: false, | |
| radius: 'auto', // actual radius of the visible pie (based on full calculated radius if <=1, or hard pixel value) | |
| innerRadius:0, /* for donut */ | |
| startAngle: 3/2, | |
| tilt: 1, | |
| offset: { | |
| top: 0, | |
| left: 'auto' | |
| }, | |
| stroke: { | |
| color: '#FFF', | |
| width: 1 | |
| }, | |
| label: { | |
| show: 'auto', | |
| formatter: function(label, slice){ | |
| return '<div style="font-size:x-small;text-align:center;padding:2px;color:'+slice.color+';">'+label+'<br/>'+Math.round(slice.percent)+'%</div>'; | |
| }, // formatter function | |
| radius: 1, // radius at which to place the labels (based on full calculated radius if <=1, or hard pixel value) | |
| background: { | |
| color: null, | |
| opacity: 0 | |
| }, | |
| threshold: 0 // percentage at which to hide the label (i.e. the slice is too narrow) | |
| }, | |
| combine: { | |
| threshold: -1, // percentage at which to combine little slices into one larger slice | |
| color: null, // color to give the new slice (auto-generated if null) | |
| label: 'Other' // label to give the new slice | |
| }, | |
| highlight: { | |
| //color: '#FFF', // will add this functionality once parseColor is available | |
| opacity: 0.5 | |
| } | |
| } | |
| } | |
| }; | |
| $.plot.plugins.push({ | |
| init: init, | |
| options: options, | |
| name: "pie", | |
| version: "1.0" | |
| }); | |
| })(jQuery); | |
| (function(b){function c(D){var h=null;var L=null;var n=null;var B=null;var p=null;var M=0;var F=true;var o=10;var w=0.95;var A=0;var d=false;var z=false;var j=[];D.hooks.processOptions.push(g);D.hooks.bindEvents.push(e);function g(O,N){if(N.series.pie.show){N.grid.show=false;if(N.series.pie.label.show=="auto"){if(N.legend.show){N.series.pie.label.show=false}else{N.series.pie.label.show=true}}if(N.series.pie.radius=="auto"){if(N.series.pie.label.show){N.series.pie.radius=3/4}else{N.series.pie.radius=1}}if(N.series.pie.tilt>1){N.series.pie.tilt=1}if(N.series.pie.tilt<0){N.series.pie.tilt=0}O.hooks.processDatapoints.push(E);O.hooks.drawOverlay.push(H);O.hooks.draw.push(r)}}function e(P,N){var O=P.getOptions();if(O.series.pie.show&&O.grid.hoverable){N.unbind("mousemove").mousemove(t)}if(O.series.pie.show&&O.grid.clickable){N.unbind("click").click(l)}}function G(O){var P="";function N(S,T){if(!T){T=0}for(var R=0;R<S.length;++R){for(var Q=0;Q<T;Q++){P+="\t"}if(typeof S[R]=="object"){P+=""+R+":\n";N(S[R],T+1)}else{P+=""+R+": "+S[R]+"\n"}}}N(O);alert(P)}function q(P){for(var N=0;N<P.length;++N){var O=parseFloat(P[N].data[0][1]);if(O){M+=O}}}function E(Q,N,O,P){if(!d){d=true;h=Q.getCanvas();L=b(h).parent();a=Q.getOptions();Q.setData(K(Q.getData()))}}function I(){A=L.children().filter(".legend").children().width();n=Math.min(h.width,(h.height/a.series.pie.tilt))/2;p=(h.height/2)+a.series.pie.offset.top;B=(h.width/2);if(a.series.pie.offset.left=="auto"){if(a.legend.position.match("w")){B+=A/2}else{B-=A/2}}else{B+=a.series.pie.offset.left}if(B<n){B=n}else{if(B>h.width-n){B=h.width-n}}}function v(O){for(var N=0;N<O.length;++N){if(typeof(O[N].data)=="number"){O[N].data=[[1,O[N].data]]}else{if(typeof(O[N].data)=="undefined"||typeof(O[N].data[0])=="undefined"){if(typeof(O[N].data)!="undefined"&&typeof(O[N].data.label)!="undefined"){O[N].label=O[N].data.label}O[N].data=[[1,0]]}}}return O}function K(Q){Q=v(Q);q(Q);var P=0;var S=0;var N=a.series.pie.combine.color;var R=[];for(var O=0;O<Q.length;++O){Q[O].data[0][1]=parseFloat(Q[O].data[0][1]);if(!Q[O].data[0][1]){Q[O].data[0][1]=0}if(Q[O].data[0][1]/M<=a.series.pie.combine.threshold){P+=Q[O].data[0][1];S++;if(!N){N=Q[O].color}}else{R.push({data:[[1,Q[O].data[0][1]]],color:Q[O].color,label:Q[O].label,angle:(Q[O].data[0][1]*(Math.PI*2))/M,percent:(Q[O].data[0][1]/M*100)})}}if(S>0){R.push({data:[[1,P]],color:N,label:a.series.pie.combine.label,angle:(P*(Math.PI*2))/M,percent:(P/M*100)})}return R}function r(S,Q){if(!L){return}ctx=Q;I();var T=S.getData();var P=0;while(F&&P<o){F=false;if(P>0){n*=w}P+=1;N();if(a.series.pie.tilt<=0.8){O()}R()}if(P>=o){N();L.prepend('<div class="error">Could not draw pie with labels contained inside canvas</div>')}if(S.setSeries&&S.insertLegend){S.setSeries(T);S.insertLegend()}function N(){ctx.clearRect(0,0,h.width,h.height);L.children().filter(".pieLabel, .pieLabelBackground").remove()}function O(){var Z=5;var Y=15;var W=10;var X=0.02;if(a.series.pie.radius>1){var U=a.series.pie.radius}else{var U=n*a.series.pie.radius}if(U>=(h.width/2)-Z||U*a.series.pie.tilt>=(h.height/2)-Y||U<=W){return}ctx.save();ctx.translate(Z,Y);ctx.globalAlpha=X;ctx.fillStyle="#000";ctx.translate(B,p);ctx.scale(1,a.series.pie.tilt);for(var V=1;V<=W;V++){ctx.beginPath();ctx.arc(0,0,U,0,Math.PI*2,false);ctx.fill();U-=V}ctx.restore()}function R(){startAngle=Math.PI*a.series.pie.startAngle;if(a.series.pie.radius>1){var U=a.series.pie.radius}else{var U=n*a.series.pie.radius}ctx.save();ctx.translate(B,p);ctx.scale(1,a.series.pie.tilt);ctx.save();var Y=startAngle;for(var W=0;W<T.length;++W){T[W].startAngle=Y;X(T[W].angle,T[W].color,true)}ctx.restore();ctx.save();ctx.lineWidth=a.series.pie.stroke.width;Y=startAngle;for(var W=0;W<T.length;++W){X(T[W].angle,a.series.pie.stroke.color,false)}ctx.restore();J(ctx);if(a.series.pie.label.show){V()}ctx.restore();function X(ab,Z,aa){if(ab<=0){return}if(aa){ctx.fillStyle=Z}else{ctx.strokeStyle=Z;ctx.lineJoin="round"}ctx.beginPath();if(Math.abs(ab-Math.PI*2)>1e-9){ctx.moveTo(0,0)}else{if(b.browser.msie){ab-=0.0001}}ctx.arc(0,0,U,Y,Y+ab,false);ctx.closePath();Y+=ab;if(aa){ctx.fill()}else{ctx.stroke()}}function V(){var ac=startAngle;if(a.series.pie.label.radius>1){var Z=a.series.pie.label.radius}else{var Z=n*a.series.pie.label.radius}for(var ab=0;ab<T.length;++ab){if(T[ab].percent>=a.series.pie.label.threshold*100){aa(T[ab],ac,ab)}ac+=T[ab].angle}function aa(ap,ai,ag){if(ap.data[0][1]==0){return}var ar=a.legend.labelFormatter,aq,ae=a.series.pie.label.formatter;if(ar){aq=ar(ap.label,ap)}else{aq=ap.label}if(ae){aq=ae(aq,ap)}var aj=((ai+ap.angle)+ai)/2;var ao=B+Math.round(Math.cos(aj)*Z);var am=p+Math.round(Math.sin(aj)*Z)*a.series.pie.tilt;var af='<span class="pieLabel" id="pieLabel'+ag+'" style="position:absolute;top:'+am+"px;left:"+ao+'px;">'+aq+"</span>";L.append(af);var an=L.children("#pieLabel"+ag);var ad=(am-an.height()/2);var ah=(ao-an.width()/2);an.css("top",ad);an.css("left",ah);if(0-ad>0||0-ah>0||h.height-(ad+an.height())<0||h.width-(ah+an.width())<0){F=true}if(a.series.pie.label.background.opacity!=0){var ak=a.series.pie.label.background.color;if(ak==null){ak=ap.color}var al="top:"+ad+"px;left:"+ah+"px;";b('<div class="pieLabelBackground" style="position:absolute;width:'+an.width()+"px;height:"+an.height()+"px;"+al+"background-color:"+ak+';"> </div>').insertBefore(an).css("opacity",a.series.pie.label.background.opacity)}}}}}function J(N){if(a.series.pie.innerRadius>0){N.save();innerRadius=a.series.pie.innerRadius>1?a.series.pie.innerRadius:n*a.series.pie.innerRadius;N.globalCompositeOperation="destination-out";N.beginPath();N.fillStyle=a.series.pie.stroke.color;N.arc(0,0,innerRadius,0,Math.PI*2,false);N.fill();N.closePath();N.restore();N.save();N.beginPath();N.strokeStyle=a.series.pie.stroke.color;N.arc(0,0,innerRadius,0,Math.PI*2,false);N.stroke();N.closePath();N.restore()}}function s(Q,R){for(var S=false,P=-1,N=Q.length,O=N-1;++P<N;O=P){((Q[P][1]<=R[1]&&R[1]<Q[O][1])||(Q[O][1]<=R[1]&&R[1]<Q[P][1]))&&(R[0]<(Q[O][0]-Q[P][0])*(R[1]-Q[P][1])/(Q[O][1]-Q[P][1])+Q[P][0])&&(S=!S)}return S}function u(R,P){var T=D.getData(),O=D.getOptions(),N=O.series.pie.radius>1?O.series.pie.radius:n*O.series.pie.radius;for(var Q=0;Q<T.length;++Q){var S=T[Q];if(S.pie.show){ctx.save();ctx.beginPath();ctx.moveTo(0,0);ctx.arc(0,0,N,S.startAngle,S.startAngle+S.angle,false);ctx.closePath();x=R-B;y=P-p;if(ctx.isPointInPath){if(ctx.isPointInPath(R-B,P-p)){ctx.restore();return{datapoint:[S.percent,S.data],dataIndex:0,series:S,seriesIndex:Q}}}else{p1X=(N*Math.cos(S.startAngle));p1Y=(N*Math.sin(S.startAngle));p2X=(N*Math.cos(S.startAngle+(S.angle/4)));p2Y=(N*Math.sin(S.startAngle+(S.angle/4)));p3X=(N*Math.cos(S.startAngle+(S.angle/2)));p3Y=(N*Math.sin(S.startAngle+(S.angle/2)));p4X=(N*Math.cos(S.startAngle+(S.angle/1.5)));p4Y=(N*Math.sin(S.startAngle+(S.angle/1.5)));p5X=(N*Math.cos(S.startAngle+S.angle));p5Y=(N*Math.sin(S.startAngle+S.angle));arrPoly=[[0,0],[p1X,p1Y],[p2X,p2Y],[p3X,p3Y],[p4X,p4Y],[p5X,p5Y]];arrPoint=[x,y];if(s(arrPoly,arrPoint)){ctx.restore();return{datapoint:[S.percent,S.data],dataIndex:0,series:S,seriesIndex:Q}}}ctx.restore()}}return null}function t(N){m("plothover",N)}function l(N){m("plotclick",N)}function m(N,T){var O=D.offset(),R=parseInt(T.pageX-O.left),P=parseInt(T.pageY-O.top),V=u(R,P);if(a.grid.autoHighlight){for(var Q=0;Q<j.length;++Q){var S=j[Q];if(S.auto==N&&!(V&&S.series==V.series)){f(S.series)}}}if(V){k(V.series,N)}var U={pageX:T.pageX,pageY:T.pageY};L.trigger(N,[U,V])}function k(O,P){if(typeof O=="number"){O=series[O]}var N=C(O);if(N==-1){j.push({series:O,auto:P});D.triggerRedrawOverlay()}else{if(!P){j[N].auto=false}}}function f(O){if(O==null){j=[];D.triggerRedrawOverlay()}if(typeof O=="number"){O=series[O]}var N=C(O);if(N!=-1){j.splice(N,1);D.triggerRedrawOverlay()}}function C(P){for(var N=0;N<j.length;++N){var O=j[N];if(O.series==P){return N}}return -1}function H(Q,R){var P=Q.getOptions();var N=P.series.pie.radius>1?P.series.pie.radius:n*P.series.pie.radius;R.save();R.translate(B,p);R.scale(1,P.series.pie.tilt);for(i=0;i<j.length;++i){O(j[i].series)}J(R);R.restore();function O(S){if(S.angle<0){return}R.fillStyle="rgba(255, 255, 255, "+P.series.pie.highlight.opacity+")";R.beginPath();if(Math.abs(S.angle-Math.PI*2)>1e-9){R.moveTo(0,0)}R.arc(0,0,N,S.startAngle,S.startAngle+S.angle,false);R.closePath();R.fill()}}}var a={series:{pie:{show:false,radius:"auto",innerRadius:0,startAngle:3/2,tilt:1,offset:{top:0,left:"auto"},stroke:{color:"#FFF",width:1},label:{show:"auto",formatter:function(d,e){return'<div style="font-size:x-small;text-align:center;padding:2px;color:'+e.color+';">'+d+"<br/>"+Math.round(e.percent)+"%</div>"},radius:1,background:{color:null,opacity:0},threshold:0},combine:{threshold:-1,color:null,label:"Other"},highlight:{opacity:0.5}}}};b.plot.plugins.push({init:c,options:a,name:"pie",version:"1.0"})})(jQuery); |
| /* | |
| Flot plugin for automatically redrawing plots when the placeholder | |
| size changes, e.g. on window resizes. | |
| It works by listening for changes on the placeholder div (through the | |
| jQuery resize event plugin) - if the size changes, it will redraw the | |
| plot. | |
| There are no options. If you need to disable the plugin for some | |
| plots, you can just fix the size of their placeholders. | |
| */ | |
| /* Inline dependency: | |
| * jQuery resize event - v1.1 - 3/14/2010 | |
| * http://benalman.com/projects/jquery-resize-plugin/ | |
| * | |
| * Copyright (c) 2010 "Cowboy" Ben Alman | |
| * Dual licensed under the MIT and GPL licenses. | |
| * http://benalman.com/about/license/ | |
| */ | |
| (function($,h,c){var a=$([]),e=$.resize=$.extend($.resize,{}),i,k="setTimeout",j="resize",d=j+"-special-event",b="delay",f="throttleWindow";e[b]=250;e[f]=true;$.event.special[j]={setup:function(){if(!e[f]&&this[k]){return false}var l=$(this);a=a.add(l);$.data(this,d,{w:l.width(),h:l.height()});if(a.length===1){g()}},teardown:function(){if(!e[f]&&this[k]){return false}var l=$(this);a=a.not(l);l.removeData(d);if(!a.length){clearTimeout(i)}},add:function(l){if(!e[f]&&this[k]){return false}var n;function m(s,o,p){var q=$(this),r=$.data(this,d);r.w=o!==c?o:q.width();r.h=p!==c?p:q.height();n.apply(this,arguments)}if($.isFunction(l)){n=l;return m}else{n=l.handler;l.handler=m}}};function g(){i=h[k](function(){a.each(function(){var n=$(this),m=n.width(),l=n.height(),o=$.data(this,d);if(m!==o.w||l!==o.h){n.trigger(j,[o.w=m,o.h=l])}});g()},e[b])}})(jQuery,this); | |
| (function ($) { | |
| var options = { }; // no options | |
| function init(plot) { | |
| function onResize() { | |
| var placeholder = plot.getPlaceholder(); | |
| // somebody might have hidden us and we can't plot | |
| // when we don't have the dimensions | |
| if (placeholder.width() == 0 || placeholder.height() == 0) | |
| return; | |
| plot.resize(); | |
| plot.setupGrid(); | |
| plot.draw(); | |
| } | |
| function bindEvents(plot, eventHolder) { | |
| plot.getPlaceholder().resize(onResize); | |
| } | |
| function shutdown(plot, eventHolder) { | |
| plot.getPlaceholder().unbind("resize", onResize); | |
| } | |
| plot.hooks.bindEvents.push(bindEvents); | |
| plot.hooks.shutdown.push(shutdown); | |
| } | |
| $.plot.plugins.push({ | |
| init: init, | |
| options: options, | |
| name: 'resize', | |
| version: '1.0' | |
| }); | |
| })(jQuery); | |
| (function(n,p,u){var w=n([]),s=n.resize=n.extend(n.resize,{}),o,l="setTimeout",m="resize",t=m+"-special-event",v="delay",r="throttleWindow";s[v]=250;s[r]=true;n.event.special[m]={setup:function(){if(!s[r]&&this[l]){return false}var a=n(this);w=w.add(a);n.data(this,t,{w:a.width(),h:a.height()});if(w.length===1){q()}},teardown:function(){if(!s[r]&&this[l]){return false}var a=n(this);w=w.not(a);a.removeData(t);if(!w.length){clearTimeout(o)}},add:function(b){if(!s[r]&&this[l]){return false}var c;function a(d,h,g){var f=n(this),e=n.data(this,t);e.w=h!==u?h:f.width();e.h=g!==u?g:f.height();c.apply(this,arguments)}if(n.isFunction(b)){c=b;return a}else{c=b.handler;b.handler=a}}};function q(){o=p[l](function(){w.each(function(){var d=n(this),a=d.width(),b=d.height(),c=n.data(this,t);if(a!==c.w||b!==c.h){d.trigger(m,[c.w=a,c.h=b])}});q()},s[v])}})(jQuery,this);(function(b){var a={};function c(f){function e(){var h=f.getPlaceholder();if(h.width()==0||h.height()==0){return}f.resize();f.setupGrid();f.draw()}function g(i,h){i.getPlaceholder().resize(e)}function d(i,h){i.getPlaceholder().unbind("resize",e)}f.hooks.bindEvents.push(g);f.hooks.shutdown.push(d)}b.plot.plugins.push({init:c,options:a,name:"resize",version:"1.0"})})(jQuery); |
| /* | |
| Flot plugin for selecting regions. | |
| The plugin defines the following options: | |
| selection: { | |
| mode: null or "x" or "y" or "xy", | |
| color: color | |
| } | |
| Selection support is enabled by setting the mode to one of "x", "y" or | |
| "xy". In "x" mode, the user will only be able to specify the x range, | |
| similarly for "y" mode. For "xy", the selection becomes a rectangle | |
| where both ranges can be specified. "color" is color of the selection | |
| (if you need to change the color later on, you can get to it with | |
| plot.getOptions().selection.color). | |
| When selection support is enabled, a "plotselected" event will be | |
| emitted on the DOM element you passed into the plot function. The | |
| event handler gets a parameter with the ranges selected on the axes, | |
| like this: | |
| placeholder.bind("plotselected", function(event, ranges) { | |
| alert("You selected " + ranges.xaxis.from + " to " + ranges.xaxis.to) | |
| // similar for yaxis - with multiple axes, the extra ones are in | |
| // x2axis, x3axis, ... | |
| }); | |
| The "plotselected" event is only fired when the user has finished | |
| making the selection. A "plotselecting" event is fired during the | |
| process with the same parameters as the "plotselected" event, in case | |
| you want to know what's happening while it's happening, | |
| A "plotunselected" event with no arguments is emitted when the user | |
| clicks the mouse to remove the selection. | |
| The plugin allso adds the following methods to the plot object: | |
| - setSelection(ranges, preventEvent) | |
| Set the selection rectangle. The passed in ranges is on the same | |
| form as returned in the "plotselected" event. If the selection mode | |
| is "x", you should put in either an xaxis range, if the mode is "y" | |
| you need to put in an yaxis range and both xaxis and yaxis if the | |
| selection mode is "xy", like this: | |
| setSelection({ xaxis: { from: 0, to: 10 }, yaxis: { from: 40, to: 60 } }); | |
| setSelection will trigger the "plotselected" event when called. If | |
| you don't want that to happen, e.g. if you're inside a | |
| "plotselected" handler, pass true as the second parameter. If you | |
| are using multiple axes, you can specify the ranges on any of those, | |
| e.g. as x2axis/x3axis/... instead of xaxis, the plugin picks the | |
| first one it sees. | |
| - clearSelection(preventEvent) | |
| Clear the selection rectangle. Pass in true to avoid getting a | |
| "plotunselected" event. | |
| - getSelection() | |
| Returns the current selection in the same format as the | |
| "plotselected" event. If there's currently no selection, the | |
| function returns null. | |
| */ | |
| (function ($) { | |
| function init(plot) { | |
| var selection = { | |
| first: { x: -1, y: -1}, second: { x: -1, y: -1}, | |
| show: false, | |
| active: false | |
| }; | |
| // FIXME: The drag handling implemented here should be | |
| // abstracted out, there's some similar code from a library in | |
| // the navigation plugin, this should be massaged a bit to fit | |
| // the Flot cases here better and reused. Doing this would | |
| // make this plugin much slimmer. | |
| var savedhandlers = {}; | |
| var mouseUpHandler = null; | |
| function onMouseMove(e) { | |
| if (selection.active) { | |
| updateSelection(e); | |
| plot.getPlaceholder().trigger("plotselecting", [ getSelection() ]); | |
| } | |
| } | |
| function onMouseDown(e) { | |
| if (e.which != 1) // only accept left-click | |
| return; | |
| // cancel out any text selections | |
| document.body.focus(); | |
| // prevent text selection and drag in old-school browsers | |
| if (document.onselectstart !== undefined && savedhandlers.onselectstart == null) { | |
| savedhandlers.onselectstart = document.onselectstart; | |
| document.onselectstart = function () { return false; }; | |
| } | |
| if (document.ondrag !== undefined && savedhandlers.ondrag == null) { | |
| savedhandlers.ondrag = document.ondrag; | |
| document.ondrag = function () { return false; }; | |
| } | |
| setSelectionPos(selection.first, e); | |
| selection.active = true; | |
| // this is a bit silly, but we have to use a closure to be | |
| // able to whack the same handler again | |
| mouseUpHandler = function (e) { onMouseUp(e); }; | |
| $(document).one("mouseup", mouseUpHandler); | |
| } | |
| function onMouseUp(e) { | |
| mouseUpHandler = null; | |
| // revert drag stuff for old-school browsers | |
| if (document.onselectstart !== undefined) | |
| document.onselectstart = savedhandlers.onselectstart; | |
| if (document.ondrag !== undefined) | |
| document.ondrag = savedhandlers.ondrag; | |
| // no more dragging | |
| selection.active = false; | |
| updateSelection(e); | |
| if (selectionIsSane()) | |
| triggerSelectedEvent(); | |
| else { | |
| // this counts as a clear | |
| plot.getPlaceholder().trigger("plotunselected", [ ]); | |
| plot.getPlaceholder().trigger("plotselecting", [ null ]); | |
| } | |
| return false; | |
| } | |
| function getSelection() { | |
| if (!selectionIsSane()) | |
| return null; | |
| var r = {}, c1 = selection.first, c2 = selection.second; | |
| $.each(plot.getAxes(), function (name, axis) { | |
| if (axis.used) { | |
| var p1 = axis.c2p(c1[axis.direction]), p2 = axis.c2p(c2[axis.direction]); | |
| r[name] = { from: Math.min(p1, p2), to: Math.max(p1, p2) }; | |
| } | |
| }); | |
| return r; | |
| } | |
| function triggerSelectedEvent() { | |
| var r = getSelection(); | |
| plot.getPlaceholder().trigger("plotselected", [ r ]); | |
| // backwards-compat stuff, to be removed in future | |
| if (r.xaxis && r.yaxis) | |
| plot.getPlaceholder().trigger("selected", [ { x1: r.xaxis.from, y1: r.yaxis.from, x2: r.xaxis.to, y2: r.yaxis.to } ]); | |
| } | |
| function clamp(min, value, max) { | |
| return value < min ? min: (value > max ? max: value); | |
| } | |
| function setSelectionPos(pos, e) { | |
| var o = plot.getOptions(); | |
| var offset = plot.getPlaceholder().offset(); | |
| var plotOffset = plot.getPlotOffset(); | |
| pos.x = clamp(0, e.pageX - offset.left - plotOffset.left, plot.width()); | |
| pos.y = clamp(0, e.pageY - offset.top - plotOffset.top, plot.height()); | |
| if (o.selection.mode == "y") | |
| pos.x = pos == selection.first ? 0 : plot.width(); | |
| if (o.selection.mode == "x") | |
| pos.y = pos == selection.first ? 0 : plot.height(); | |
| } | |
| function updateSelection(pos) { | |
| if (pos.pageX == null) | |
| return; | |
| setSelectionPos(selection.second, pos); | |
| if (selectionIsSane()) { | |
| selection.show = true; | |
| plot.triggerRedrawOverlay(); | |
| } | |
| else | |
| clearSelection(true); | |
| } | |
| function clearSelection(preventEvent) { | |
| if (selection.show) { | |
| selection.show = false; | |
| plot.triggerRedrawOverlay(); | |
| if (!preventEvent) | |
| plot.getPlaceholder().trigger("plotunselected", [ ]); | |
| } | |
| } | |
| // function taken from markings support in Flot | |
| function extractRange(ranges, coord) { | |
| var axis, from, to, key, axes = plot.getAxes(); | |
| for (var k in axes) { | |
| axis = axes[k]; | |
| if (axis.direction == coord) { | |
| key = coord + axis.n + "axis"; | |
| if (!ranges[key] && axis.n == 1) | |
| key = coord + "axis"; // support x1axis as xaxis | |
| if (ranges[key]) { | |
| from = ranges[key].from; | |
| to = ranges[key].to; | |
| break; | |
| } | |
| } | |
| } | |
| // backwards-compat stuff - to be removed in future | |
| if (!ranges[key]) { | |
| axis = coord == "x" ? plot.getXAxes()[0] : plot.getYAxes()[0]; | |
| from = ranges[coord + "1"]; | |
| to = ranges[coord + "2"]; | |
| } | |
| // auto-reverse as an added bonus | |
| if (from != null && to != null && from > to) { | |
| var tmp = from; | |
| from = to; | |
| to = tmp; | |
| } | |
| return { from: from, to: to, axis: axis }; | |
| } | |
| function setSelection(ranges, preventEvent) { | |
| var axis, range, o = plot.getOptions(); | |
| if (o.selection.mode == "y") { | |
| selection.first.x = 0; | |
| selection.second.x = plot.width(); | |
| } | |
| else { | |
| range = extractRange(ranges, "x"); | |
| selection.first.x = range.axis.p2c(range.from); | |
| selection.second.x = range.axis.p2c(range.to); | |
| } | |
| if (o.selection.mode == "x") { | |
| selection.first.y = 0; | |
| selection.second.y = plot.height(); | |
| } | |
| else { | |
| range = extractRange(ranges, "y"); | |
| selection.first.y = range.axis.p2c(range.from); | |
| selection.second.y = range.axis.p2c(range.to); | |
| } | |
| selection.show = true; | |
| plot.triggerRedrawOverlay(); | |
| if (!preventEvent && selectionIsSane()) | |
| triggerSelectedEvent(); | |
| } | |
| function selectionIsSane() { | |
| var minSize = 5; | |
| return Math.abs(selection.second.x - selection.first.x) >= minSize && | |
| Math.abs(selection.second.y - selection.first.y) >= minSize; | |
| } | |
| plot.clearSelection = clearSelection; | |
| plot.setSelection = setSelection; | |
| plot.getSelection = getSelection; | |
| plot.hooks.bindEvents.push(function(plot, eventHolder) { | |
| var o = plot.getOptions(); | |
| if (o.selection.mode != null) { | |
| eventHolder.mousemove(onMouseMove); | |
| eventHolder.mousedown(onMouseDown); | |
| } | |
| }); | |
| plot.hooks.drawOverlay.push(function (plot, ctx) { | |
| // draw selection | |
| if (selection.show && selectionIsSane()) { | |
| var plotOffset = plot.getPlotOffset(); | |
| var o = plot.getOptions(); | |
| ctx.save(); | |
| ctx.translate(plotOffset.left, plotOffset.top); | |
| var c = $.color.parse(o.selection.color); | |
| ctx.strokeStyle = c.scale('a', 0.8).toString(); | |
| ctx.lineWidth = 1; | |
| ctx.lineJoin = "round"; | |
| ctx.fillStyle = c.scale('a', 0.4).toString(); | |
| var x = Math.min(selection.first.x, selection.second.x), | |
| y = Math.min(selection.first.y, selection.second.y), | |
| w = Math.abs(selection.second.x - selection.first.x), | |
| h = Math.abs(selection.second.y - selection.first.y); | |
| ctx.fillRect(x, y, w, h); | |
| ctx.strokeRect(x, y, w, h); | |
| ctx.restore(); | |
| } | |
| }); | |
| plot.hooks.shutdown.push(function (plot, eventHolder) { | |
| eventHolder.unbind("mousemove", onMouseMove); | |
| eventHolder.unbind("mousedown", onMouseDown); | |
| if (mouseUpHandler) | |
| $(document).unbind("mouseup", mouseUpHandler); | |
| }); | |
| } | |
| $.plot.plugins.push({ | |
| init: init, | |
| options: { | |
| selection: { | |
| mode: null, // one of null, "x", "y" or "xy" | |
| color: "#e8cfac" | |
| } | |
| }, | |
| name: 'selection', | |
| version: '1.1' | |
| }); | |
| })(jQuery); | |
| (function(a){function b(k){var p={first:{x:-1,y:-1},second:{x:-1,y:-1},show:false,active:false};var m={};var r=null;function e(s){if(p.active){l(s);k.getPlaceholder().trigger("plotselecting",[g()])}}function n(s){if(s.which!=1){return}document.body.focus();if(document.onselectstart!==undefined&&m.onselectstart==null){m.onselectstart=document.onselectstart;document.onselectstart=function(){return false}}if(document.ondrag!==undefined&&m.ondrag==null){m.ondrag=document.ondrag;document.ondrag=function(){return false}}d(p.first,s);p.active=true;r=function(t){j(t)};a(document).one("mouseup",r)}function j(s){r=null;if(document.onselectstart!==undefined){document.onselectstart=m.onselectstart}if(document.ondrag!==undefined){document.ondrag=m.ondrag}p.active=false;l(s);if(f()){i()}else{k.getPlaceholder().trigger("plotunselected",[]);k.getPlaceholder().trigger("plotselecting",[null])}return false}function g(){if(!f()){return null}var u={},t=p.first,s=p.second;a.each(k.getAxes(),function(v,w){if(w.used){var y=w.c2p(t[w.direction]),x=w.c2p(s[w.direction]);u[v]={from:Math.min(y,x),to:Math.max(y,x)}}});return u}function i(){var s=g();k.getPlaceholder().trigger("plotselected",[s]);if(s.xaxis&&s.yaxis){k.getPlaceholder().trigger("selected",[{x1:s.xaxis.from,y1:s.yaxis.from,x2:s.xaxis.to,y2:s.yaxis.to}])}}function h(t,u,s){return u<t?t:(u>s?s:u)}function d(w,t){var v=k.getOptions();var u=k.getPlaceholder().offset();var s=k.getPlotOffset();w.x=h(0,t.pageX-u.left-s.left,k.width());w.y=h(0,t.pageY-u.top-s.top,k.height());if(v.selection.mode=="y"){w.x=w==p.first?0:k.width()}if(v.selection.mode=="x"){w.y=w==p.first?0:k.height()}}function l(s){if(s.pageX==null){return}d(p.second,s);if(f()){p.show=true;k.triggerRedrawOverlay()}else{q(true)}}function q(s){if(p.show){p.show=false;k.triggerRedrawOverlay();if(!s){k.getPlaceholder().trigger("plotunselected",[])}}}function c(s,w){var t,y,z,A,x=k.getAxes();for(var u in x){t=x[u];if(t.direction==w){A=w+t.n+"axis";if(!s[A]&&t.n==1){A=w+"axis"}if(s[A]){y=s[A].from;z=s[A].to;break}}}if(!s[A]){t=w=="x"?k.getXAxes()[0]:k.getYAxes()[0];y=s[w+"1"];z=s[w+"2"]}if(y!=null&&z!=null&&y>z){var v=y;y=z;z=v}return{from:y,to:z,axis:t}}function o(t,s){var v,u,w=k.getOptions();if(w.selection.mode=="y"){p.first.x=0;p.second.x=k.width()}else{u=c(t,"x");p.first.x=u.axis.p2c(u.from);p.second.x=u.axis.p2c(u.to)}if(w.selection.mode=="x"){p.first.y=0;p.second.y=k.height()}else{u=c(t,"y");p.first.y=u.axis.p2c(u.from);p.second.y=u.axis.p2c(u.to)}p.show=true;k.triggerRedrawOverlay();if(!s&&f()){i()}}function f(){var s=5;return Math.abs(p.second.x-p.first.x)>=s&&Math.abs(p.second.y-p.first.y)>=s}k.clearSelection=q;k.setSelection=o;k.getSelection=g;k.hooks.bindEvents.push(function(t,s){var u=t.getOptions();if(u.selection.mode!=null){s.mousemove(e);s.mousedown(n)}});k.hooks.drawOverlay.push(function(v,D){if(p.show&&f()){var t=v.getPlotOffset();var s=v.getOptions();D.save();D.translate(t.left,t.top);var z=a.color.parse(s.selection.color);D.strokeStyle=z.scale("a",0.8).toString();D.lineWidth=1;D.lineJoin="round";D.fillStyle=z.scale("a",0.4).toString();var B=Math.min(p.first.x,p.second.x),A=Math.min(p.first.y,p.second.y),C=Math.abs(p.second.x-p.first.x),u=Math.abs(p.second.y-p.first.y);D.fillRect(B,A,C,u);D.strokeRect(B,A,C,u);D.restore()}});k.hooks.shutdown.push(function(t,s){s.unbind("mousemove",e);s.unbind("mousedown",n);if(r){a(document).unbind("mouseup",r)}})}a.plot.plugins.push({init:b,options:{selection:{mode:null,color:"#e8cfac"}},name:"selection",version:"1.1"})})(jQuery); |
| /* | |
| Flot plugin for stacking data sets, i.e. putting them on top of each | |
| other, for accumulative graphs. | |
| The plugin assumes the data is sorted on x (or y if stacking | |
| horizontally). For line charts, it is assumed that if a line has an | |
| undefined gap (from a null point), then the line above it should have | |
| the same gap - insert zeros instead of "null" if you want another | |
| behaviour. This also holds for the start and end of the chart. Note | |
| that stacking a mix of positive and negative values in most instances | |
| doesn't make sense (so it looks weird). | |
| Two or more series are stacked when their "stack" attribute is set to | |
| the same key (which can be any number or string or just "true"). To | |
| specify the default stack, you can set | |
| series: { | |
| stack: null or true or key (number/string) | |
| } | |
| or specify it for a specific series | |
| $.plot($("#placeholder"), [{ data: [ ... ], stack: true }]) | |
| The stacking order is determined by the order of the data series in | |
| the array (later series end up on top of the previous). | |
| Internally, the plugin modifies the datapoints in each series, adding | |
| an offset to the y value. For line series, extra data points are | |
| inserted through interpolation. If there's a second y value, it's also | |
| adjusted (e.g for bar charts or filled areas). | |
| */ | |
| (function ($) { | |
| var options = { | |
| series: { stack: null } // or number/string | |
| }; | |
| function init(plot) { | |
| function findMatchingSeries(s, allseries) { | |
| var res = null | |
| for (var i = 0; i < allseries.length; ++i) { | |
| if (s == allseries[i]) | |
| break; | |
| if (allseries[i].stack == s.stack) | |
| res = allseries[i]; | |
| } | |
| return res; | |
| } | |
| function stackData(plot, s, datapoints) { | |
| if (s.stack == null) | |
| return; | |
| var other = findMatchingSeries(s, plot.getData()); | |
| if (!other) | |
| return; | |
| var ps = datapoints.pointsize, | |
| points = datapoints.points, | |
| otherps = other.datapoints.pointsize, | |
| otherpoints = other.datapoints.points, | |
| newpoints = [], | |
| px, py, intery, qx, qy, bottom, | |
| withlines = s.lines.show, | |
| horizontal = s.bars.horizontal, | |
| withbottom = ps > 2 && (horizontal ? datapoints.format[2].x : datapoints.format[2].y), | |
| withsteps = withlines && s.lines.steps, | |
| fromgap = true, | |
| keyOffset = horizontal ? 1 : 0, | |
| accumulateOffset = horizontal ? 0 : 1, | |
| i = 0, j = 0, l; | |
| while (true) { | |
| if (i >= points.length) | |
| break; | |
| l = newpoints.length; | |
| if (points[i] == null) { | |
| // copy gaps | |
| for (m = 0; m < ps; ++m) | |
| newpoints.push(points[i + m]); | |
| i += ps; | |
| } | |
| else if (j >= otherpoints.length) { | |
| // for lines, we can't use the rest of the points | |
| if (!withlines) { | |
| for (m = 0; m < ps; ++m) | |
| newpoints.push(points[i + m]); | |
| } | |
| i += ps; | |
| } | |
| else if (otherpoints[j] == null) { | |
| // oops, got a gap | |
| for (m = 0; m < ps; ++m) | |
| newpoints.push(null); | |
| fromgap = true; | |
| j += otherps; | |
| } | |
| else { | |
| // cases where we actually got two points | |
| px = points[i + keyOffset]; | |
| py = points[i + accumulateOffset]; | |
| qx = otherpoints[j + keyOffset]; | |
| qy = otherpoints[j + accumulateOffset]; | |
| bottom = 0; | |
| if (px == qx) { | |
| for (m = 0; m < ps; ++m) | |
| newpoints.push(points[i + m]); | |
| newpoints[l + accumulateOffset] += qy; | |
| bottom = qy; | |
| i += ps; | |
| j += otherps; | |
| } | |
| else if (px > qx) { | |
| // we got past point below, might need to | |
| // insert interpolated extra point | |
| if (withlines && i > 0 && points[i - ps] != null) { | |
| intery = py + (points[i - ps + accumulateOffset] - py) * (qx - px) / (points[i - ps + keyOffset] - px); | |
| newpoints.push(qx); | |
| newpoints.push(intery + qy); | |
| for (m = 2; m < ps; ++m) | |
| newpoints.push(points[i + m]); | |
| bottom = qy; | |
| } | |
| j += otherps; | |
| } | |
| else { // px < qx | |
| if (fromgap && withlines) { | |
| // if we come from a gap, we just skip this point | |
| i += ps; | |
| continue; | |
| } | |
| for (m = 0; m < ps; ++m) | |
| newpoints.push(points[i + m]); | |
| // we might be able to interpolate a point below, | |
| // this can give us a better y | |
| if (withlines && j > 0 && otherpoints[j - otherps] != null) | |
| bottom = qy + (otherpoints[j - otherps + accumulateOffset] - qy) * (px - qx) / (otherpoints[j - otherps + keyOffset] - qx); | |
| newpoints[l + accumulateOffset] += bottom; | |
| i += ps; | |
| } | |
| fromgap = false; | |
| if (l != newpoints.length && withbottom) | |
| newpoints[l + 2] += bottom; | |
| } | |
| // maintain the line steps invariant | |
| if (withsteps && l != newpoints.length && l > 0 | |
| && newpoints[l] != null | |
| && newpoints[l] != newpoints[l - ps] | |
| && newpoints[l + 1] != newpoints[l - ps + 1]) { | |
| for (m = 0; m < ps; ++m) | |
| newpoints[l + ps + m] = newpoints[l + m]; | |
| newpoints[l + 1] = newpoints[l - ps + 1]; | |
| } | |
| } | |
| datapoints.points = newpoints; | |
| } | |
| plot.hooks.processDatapoints.push(stackData); | |
| } | |
| $.plot.plugins.push({ | |
| init: init, | |
| options: options, | |
| name: 'stack', | |
| version: '1.2' | |
| }); | |
| })(jQuery); | |
| (function(b){var a={series:{stack:null}};function c(f){function d(k,j){var h=null;for(var g=0;g<j.length;++g){if(k==j[g]){break}if(j[g].stack==k.stack){h=j[g]}}return h}function e(C,v,g){if(v.stack==null){return}var p=d(v,C.getData());if(!p){return}var z=g.pointsize,F=g.points,h=p.datapoints.pointsize,y=p.datapoints.points,t=[],x,w,k,J,I,r,u=v.lines.show,G=v.bars.horizontal,o=z>2&&(G?g.format[2].x:g.format[2].y),n=u&&v.lines.steps,E=true,q=G?1:0,H=G?0:1,D=0,B=0,A;while(true){if(D>=F.length){break}A=t.length;if(F[D]==null){for(m=0;m<z;++m){t.push(F[D+m])}D+=z}else{if(B>=y.length){if(!u){for(m=0;m<z;++m){t.push(F[D+m])}}D+=z}else{if(y[B]==null){for(m=0;m<z;++m){t.push(null)}E=true;B+=h}else{x=F[D+q];w=F[D+H];J=y[B+q];I=y[B+H];r=0;if(x==J){for(m=0;m<z;++m){t.push(F[D+m])}t[A+H]+=I;r=I;D+=z;B+=h}else{if(x>J){if(u&&D>0&&F[D-z]!=null){k=w+(F[D-z+H]-w)*(J-x)/(F[D-z+q]-x);t.push(J);t.push(k+I);for(m=2;m<z;++m){t.push(F[D+m])}r=I}B+=h}else{if(E&&u){D+=z;continue}for(m=0;m<z;++m){t.push(F[D+m])}if(u&&B>0&&y[B-h]!=null){r=I+(y[B-h+H]-I)*(x-J)/(y[B-h+q]-J)}t[A+H]+=r;D+=z}}E=false;if(A!=t.length&&o){t[A+2]+=r}}}}if(n&&A!=t.length&&A>0&&t[A]!=null&&t[A]!=t[A-z]&&t[A+1]!=t[A-z+1]){for(m=0;m<z;++m){t[A+z+m]=t[A+m]}t[A+1]=t[A-z+1]}}g.points=t}f.hooks.processDatapoints.push(e)}b.plot.plugins.push({init:c,options:a,name:"stack",version:"1.2"})})(jQuery); |
| /* | |
| Flot plugin that adds some extra symbols for plotting points. | |
| The symbols are accessed as strings through the standard symbol | |
| choice: | |
| series: { | |
| points: { | |
| symbol: "square" // or "diamond", "triangle", "cross" | |
| } | |
| } | |
| */ | |
| (function ($) { | |
| function processRawData(plot, series, datapoints) { | |
| // we normalize the area of each symbol so it is approximately the | |
| // same as a circle of the given radius | |
| var handlers = { | |
| square: function (ctx, x, y, radius, shadow) { | |
| // pi * r^2 = (2s)^2 => s = r * sqrt(pi)/2 | |
| var size = radius * Math.sqrt(Math.PI) / 2; | |
| ctx.rect(x - size, y - size, size + size, size + size); | |
| }, | |
| diamond: function (ctx, x, y, radius, shadow) { | |
| // pi * r^2 = 2s^2 => s = r * sqrt(pi/2) | |
| var size = radius * Math.sqrt(Math.PI / 2); | |
| ctx.moveTo(x - size, y); | |
| ctx.lineTo(x, y - size); | |
| ctx.lineTo(x + size, y); | |
| ctx.lineTo(x, y + size); | |
| ctx.lineTo(x - size, y); | |
| }, | |
| triangle: function (ctx, x, y, radius, shadow) { | |
| // pi * r^2 = 1/2 * s^2 * sin (pi / 3) => s = r * sqrt(2 * pi / sin(pi / 3)) | |
| var size = radius * Math.sqrt(2 * Math.PI / Math.sin(Math.PI / 3)); | |
| var height = size * Math.sin(Math.PI / 3); | |
| ctx.moveTo(x - size/2, y + height/2); | |
| ctx.lineTo(x + size/2, y + height/2); | |
| if (!shadow) { | |
| ctx.lineTo(x, y - height/2); | |
| ctx.lineTo(x - size/2, y + height/2); | |
| } | |
| }, | |
| cross: function (ctx, x, y, radius, shadow) { | |
| // pi * r^2 = (2s)^2 => s = r * sqrt(pi)/2 | |
| var size = radius * Math.sqrt(Math.PI) / 2; | |
| ctx.moveTo(x - size, y - size); | |
| ctx.lineTo(x + size, y + size); | |
| ctx.moveTo(x - size, y + size); | |
| ctx.lineTo(x + size, y - size); | |
| } | |
| } | |
| var s = series.points.symbol; | |
| if (handlers[s]) | |
| series.points.symbol = handlers[s]; | |
| } | |
| function init(plot) { | |
| plot.hooks.processDatapoints.push(processRawData); | |
| } | |
| $.plot.plugins.push({ | |
| init: init, | |
| name: 'symbols', | |
| version: '1.0' | |
| }); | |
| })(jQuery); | |
| (function(b){function a(h,e,g){var d={square:function(k,j,n,i,m){var l=i*Math.sqrt(Math.PI)/2;k.rect(j-l,n-l,l+l,l+l)},diamond:function(k,j,n,i,m){var l=i*Math.sqrt(Math.PI/2);k.moveTo(j-l,n);k.lineTo(j,n-l);k.lineTo(j+l,n);k.lineTo(j,n+l);k.lineTo(j-l,n)},triangle:function(l,k,o,j,n){var m=j*Math.sqrt(2*Math.PI/Math.sin(Math.PI/3));var i=m*Math.sin(Math.PI/3);l.moveTo(k-m/2,o+i/2);l.lineTo(k+m/2,o+i/2);if(!n){l.lineTo(k,o-i/2);l.lineTo(k-m/2,o+i/2)}},cross:function(k,j,n,i,m){var l=i*Math.sqrt(Math.PI)/2;k.moveTo(j-l,n-l);k.lineTo(j+l,n+l);k.moveTo(j-l,n+l);k.lineTo(j+l,n-l)}};var f=e.points.symbol;if(d[f]){e.points.symbol=d[f]}}function c(d){d.hooks.processDatapoints.push(a)}b.plot.plugins.push({init:c,name:"symbols",version:"1.0"})})(jQuery); |
| /* | |
| Flot plugin for thresholding data. Controlled through the option | |
| "threshold" in either the global series options | |
| series: { | |
| threshold: { | |
| below: number | |
| color: colorspec | |
| } | |
| } | |
| or in a specific series | |
| $.plot($("#placeholder"), [{ data: [ ... ], threshold: { ... }}]) | |
| The data points below "below" are drawn with the specified color. This | |
| makes it easy to mark points below 0, e.g. for budget data. | |
| Internally, the plugin works by splitting the data into two series, | |
| above and below the threshold. The extra series below the threshold | |
| will have its label cleared and the special "originSeries" attribute | |
| set to the original series. You may need to check for this in hover | |
| events. | |
| */ | |
| (function ($) { | |
| var options = { | |
| series: { threshold: null } // or { below: number, color: color spec} | |
| }; | |
| function init(plot) { | |
| function thresholdData(plot, s, datapoints) { | |
| if (!s.threshold) | |
| return; | |
| var ps = datapoints.pointsize, i, x, y, p, prevp, | |
| thresholded = $.extend({}, s); // note: shallow copy | |
| thresholded.datapoints = { points: [], pointsize: ps }; | |
| thresholded.label = null; | |
| thresholded.color = s.threshold.color; | |
| thresholded.threshold = null; | |
| thresholded.originSeries = s; | |
| thresholded.data = []; | |
| var below = s.threshold.below, | |
| origpoints = datapoints.points, | |
| addCrossingPoints = s.lines.show; | |
| threspoints = []; | |
| newpoints = []; | |
| for (i = 0; i < origpoints.length; i += ps) { | |
| x = origpoints[i] | |
| y = origpoints[i + 1]; | |
| prevp = p; | |
| if (y < below) | |
| p = threspoints; | |
| else | |
| p = newpoints; | |
| if (addCrossingPoints && prevp != p && x != null | |
| && i > 0 && origpoints[i - ps] != null) { | |
| var interx = (x - origpoints[i - ps]) / (y - origpoints[i - ps + 1]) * (below - y) + x; | |
| prevp.push(interx); | |
| prevp.push(below); | |
| for (m = 2; m < ps; ++m) | |
| prevp.push(origpoints[i + m]); | |
| p.push(null); // start new segment | |
| p.push(null); | |
| for (m = 2; m < ps; ++m) | |
| p.push(origpoints[i + m]); | |
| p.push(interx); | |
| p.push(below); | |
| for (m = 2; m < ps; ++m) | |
| p.push(origpoints[i + m]); | |
| } | |
| p.push(x); | |
| p.push(y); | |
| } | |
| datapoints.points = newpoints; | |
| thresholded.datapoints.points = threspoints; | |
| if (thresholded.datapoints.points.length > 0) | |
| plot.getData().push(thresholded); | |
| // FIXME: there are probably some edge cases left in bars | |
| } | |
| plot.hooks.processDatapoints.push(thresholdData); | |
| } | |
| $.plot.plugins.push({ | |
| init: init, | |
| options: options, | |
| name: 'threshold', | |
| version: '1.0' | |
| }); | |
| })(jQuery); | |
| (function(B){var A={series:{threshold:null}};function C(D){function E(L,S,M){if(!S.threshold){return }var F=M.pointsize,I,O,N,G,K,H=B.extend({},S);H.datapoints={points:[],pointsize:F};H.label=null;H.color=S.threshold.color;H.threshold=null;H.originSeries=S;H.data=[];var P=S.threshold.below,Q=M.points,R=S.lines.show;threspoints=[];newpoints=[];for(I=0;I<Q.length;I+=F){O=Q[I];N=Q[I+1];K=G;if(N<P){G=threspoints}else{G=newpoints}if(R&&K!=G&&O!=null&&I>0&&Q[I-F]!=null){var J=(O-Q[I-F])/(N-Q[I-F+1])*(P-N)+O;K.push(J);K.push(P);for(m=2;m<F;++m){K.push(Q[I+m])}G.push(null);G.push(null);for(m=2;m<F;++m){G.push(Q[I+m])}G.push(J);G.push(P);for(m=2;m<F;++m){G.push(Q[I+m])}}G.push(O);G.push(N)}M.points=newpoints;H.datapoints.points=threspoints;if(H.datapoints.points.length>0){L.getData().push(H)}}D.hooks.processDatapoints.push(E)}B.plot.plugins.push({init:C,options:A,name:"threshold",version:"1.0"})})(jQuery); |
| //Flotr 0.2.0-alpha Copyright (c) 2009 Bas Wenneker, <http://solutoire.com>, MIT License. | |
| var Flotr={version:"0.2.0-alpha",author:"Bas Wenneker",website:"http://www.solutoire.com",_registeredTypes:{lines:"drawSeriesLines",points:"drawSeriesPoints",bars:"drawSeriesBars",candles:"drawSeriesCandles",pie:"drawSeriesPie"},register:function(A,B){Flotr._registeredTypes[A]=B+""},draw:function(B,D,A,C){C=C||Flotr.Graph;return new C(B,D,A)},getSeries:function(A){return A.collect(function(C){var B,C=(C.data)?Object.clone(C):{data:C};for(B=C.data.length-1;B>-1;--B){C.data[B][1]=(C.data[B][1]===null?null:parseFloat(C.data[B][1]))}return C})},merge:function(D,B){var A=B||{};for(var C in D){A[C]=(D[C]!=null&&typeof (D[C])=="object"&&!(D[C].constructor==Array||D[C].constructor==RegExp)&&!Object.isElement(D[C]))?Flotr.merge(D[C],B[C]):A[C]=D[C]}return A},getTickSize:function(E,D,A,B){var H=(A-D)/E;var G=Flotr.getMagnitude(H);var C=H/G;var F=10;if(C<1.5){F=1}else{if(C<2.25){F=2}else{if(C<3){F=((B==0)?2:2.5)}else{if(C<7.5){F=5}}}}return F*G},defaultTickFormatter:function(A){return A+""},defaultTrackFormatter:function(A){return"("+A.x+", "+A.y+")"},defaultPieLabelFormatter:function(A){return(A.fraction*100).toFixed(2)+"%"},getMagnitude:function(A){return Math.pow(10,Math.floor(Math.log(A)/Math.LN10))},toPixel:function(A){return Math.floor(A)+0.5},toRad:function(A){return -A*(Math.PI/180)},parseColor:function(D){if(D instanceof Flotr.Color){return D}var A,C=Flotr.Color;if((A=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(D))){return new C(parseInt(A[1]),parseInt(A[2]),parseInt(A[3]))}if((A=/rgba\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(D))){return new C(parseInt(A[1]),parseInt(A[2]),parseInt(A[3]),parseFloat(A[4]))}if((A=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(D))){return new C(parseFloat(A[1])*2.55,parseFloat(A[2])*2.55,parseFloat(A[3])*2.55)}if((A=/rgba\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(D))){return new C(parseFloat(A[1])*2.55,parseFloat(A[2])*2.55,parseFloat(A[3])*2.55,parseFloat(A[4]))}if((A=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(D))){return new C(parseInt(A[1],16),parseInt(A[2],16),parseInt(A[3],16))}if((A=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(D))){return new C(parseInt(A[1]+A[1],16),parseInt(A[2]+A[2],16),parseInt(A[3]+A[3],16))}var B=D.strip().toLowerCase();if(B=="transparent"){return new C(255,255,255,0)}return((A=C.lookupColors[B]))?new C(A[0],A[1],A[2]):false},extractColor:function(B){var A;do{A=B.getStyle("background-color").toLowerCase();if(!(A==""||A=="transparent")){break}B=B.up(0)}while(!B.nodeName.match(/^body$/i));return(A=="rgba(0, 0, 0, 0)")?"transparent":A}};Flotr.Graph=Class.create({initialize:function(B,C,A){this.el=$(B);if(!this.el){throw"The target container doesn't exist"}this.data=C;this.series=Flotr.getSeries(C);this.setOptions(A);this.lastMousePos={pageX:null,pageY:null};this.selection={first:{x:-1,y:-1},second:{x:-1,y:-1}};this.prevSelection=null;this.selectionInterval=null;this.ignoreClick=false;this.prevHit=null;this.constructCanvas();this.initEvents();this.findDataRanges();this.calculateTicks(this.axes.x);this.calculateTicks(this.axes.x2);this.calculateTicks(this.axes.y);this.calculateTicks(this.axes.y2);this.calculateSpacing();this.draw();this.insertLegend();if(this.options.spreadsheet.show){this.constructTabs()}},setOptions:function(B){var P={colors:["#00A8F0","#C0D800","#CB4B4B","#4DA74D","#9440ED"],title:null,subtitle:null,legend:{show:true,noColumns:1,labelFormatter:Prototype.K,labelBoxBorderColor:"#CCCCCC",labelBoxWidth:14,labelBoxHeight:10,labelBoxMargin:5,container:null,position:"nw",margin:5,backgroundColor:null,backgroundOpacity:0.85},xaxis:{ticks:null,showLabels:true,labelsAngle:0,title:null,titleAngle:0,noTicks:5,tickFormatter:Flotr.defaultTickFormatter,tickDecimals:null,min:null,max:null,autoscaleMargin:0,color:null},x2axis:{},yaxis:{ticks:null,showLabels:true,labelsAngle:0,title:null,titleAngle:90,noTicks:5,tickFormatter:Flotr.defaultTickFormatter,tickDecimals:null,min:null,max:null,autoscaleMargin:0,color:null},y2axis:{titleAngle:270},points:{show:false,radius:3,lineWidth:2,fill:true,fillColor:"#FFFFFF",fillOpacity:0.4},lines:{show:false,lineWidth:2,fill:false,fillColor:null,fillOpacity:0.4},bars:{show:false,lineWidth:2,barWidth:1,fill:true,fillColor:null,fillOpacity:0.4,horizontal:false,stacked:false},candles:{show:false,lineWidth:1,wickLineWidth:1,candleWidth:0.6,fill:true,upFillColor:"#00A8F0",downFillColor:"#CB4B4B",fillOpacity:0.5,barcharts:false},pie:{show:false,lineWidth:1,fill:true,fillColor:null,fillOpacity:0.6,explode:6,sizeRatio:0.6,startAngle:Math.PI/4,labelFormatter:Flotr.defaultPieLabelFormatter,pie3D:false,pie3DviewAngle:(Math.PI/2*0.8),pie3DspliceThickness:20},grid:{color:"#545454",backgroundColor:null,tickColor:"#DDDDDD",labelMargin:3,verticalLines:true,horizontalLines:true,outlineWidth:2},selection:{mode:null,color:"#B6D9FF",fps:20},mouse:{track:false,position:"se",relative:false,trackFormatter:Flotr.defaultTrackFormatter,margin:5,lineColor:"#FF3F19",trackDecimals:1,sensibility:2,radius:3},shadowSize:4,defaultType:"lines",HtmlText:true,fontSize:7.5,spreadsheet:{show:false,tabGraphLabel:"Graph",tabDataLabel:"Data",toolbarDownload:"Download CSV",toolbarSelectAll:"Select all"}};P.x2axis=Object.extend(Object.clone(P.xaxis),P.x2axis);P.y2axis=Object.extend(Object.clone(P.yaxis),P.y2axis);this.options=Flotr.merge((B||{}),P);this.axes={x:{options:this.options.xaxis,n:1},x2:{options:this.options.x2axis,n:2},y:{options:this.options.yaxis,n:1},y2:{options:this.options.y2axis,n:2}};var H=[],C=[],K=this.series.length,N=this.series.length,D=this.options.colors,A=[],G=0,M,J,I,O,E;for(J=N-1;J>-1;--J){M=this.series[J].color;if(M!=null){--N;if(Object.isNumber(M)){H.push(M)}else{A.push(Flotr.parseColor(M))}}}for(J=H.length-1;J>-1;--J){N=Math.max(N,H[J]+1)}for(J=0;C.length<N;){M=(D.length==J)?new Flotr.Color(100,100,100):Flotr.parseColor(D[J]);var F=G%2==1?-1:1;var L=1+F*Math.ceil(G/2)*0.2;M.scale(L,L,L);C.push(M);if(++J>=D.length){J=0;++G}}for(J=0,I=0;J<K;++J){O=this.series[J];if(O.color==null){O.color=C[I++].toString()}else{if(Object.isNumber(O.color)){O.color=C[O.color].toString()}}if(!O.xaxis){O.xaxis=this.axes.x}if(O.xaxis==1){O.xaxis=this.axes.x}else{if(O.xaxis==2){O.xaxis=this.axes.x2}}if(!O.yaxis){O.yaxis=this.axes.y}if(O.yaxis==1){O.yaxis=this.axes.y}else{if(O.yaxis==2){O.yaxis=this.axes.y2}}O.lines=Object.extend(Object.clone(this.options.lines),O.lines);O.points=Object.extend(Object.clone(this.options.points),O.points);O.bars=Object.extend(Object.clone(this.options.bars),O.bars);O.candles=Object.extend(Object.clone(this.options.candles),O.candles);O.pie=Object.extend(Object.clone(this.options.pie),O.pie);O.mouse=Object.extend(Object.clone(this.options.mouse),O.mouse);if(O.shadowSize==null){O.shadowSize=this.options.shadowSize}}},constructCanvas:function(){var C=this.el,B,D,A;this.canvas=C.select(".flotr-canvas")[0];this.overlay=C.select(".flotr-overlay")[0];C.childElements().invoke("remove");C.setStyle({position:"relative",cursor:"default"});this.canvasWidth=C.getWidth();this.canvasHeight=C.getHeight();B={width:this.canvasWidth,height:this.canvasHeight};if(this.canvasWidth<=0||this.canvasHeight<=0){throw"Invalid dimensions for plot, width = "+this.canvasWidth+", height = "+this.canvasHeight}if(!this.canvas){D=this.canvas=new Element("canvas",B);D.className="flotr-canvas";D=D.writeAttribute("style","position:absolute;left:0px;top:0px;")}else{D=this.canvas.writeAttribute(B)}C.insert(D);if(Prototype.Browser.IE){D=window.G_vmlCanvasManager.initElement(D)}this.ctx=D.getContext("2d");if(!this.overlay){A=this.overlay=new Element("canvas",B);A.className="flotr-overlay";A=A.writeAttribute("style","position:absolute;left:0px;top:0px;")}else{A=this.overlay.writeAttribute(B)}C.insert(A);if(Prototype.Browser.IE){A=window.G_vmlCanvasManager.initElement(A)}this.octx=A.getContext("2d");if(window.CanvasText){CanvasText.enable(this.ctx);CanvasText.enable(this.octx);this.textEnabled=true}},getTextDimensions:function(F,C,B,D){if(!F){return{width:0,height:0}}if(!this.options.HtmlText&&this.textEnabled){var E=this.ctx.getTextBounds(F,C);return{width:E.width+2,height:E.height+6}}else{var A=this.el.insert('<div style="position:absolute;top:-10000px;'+B+'" class="'+D+' flotr-dummy-div">'+F+"</div>").select(".flotr-dummy-div")[0];dim=A.getDimensions();A.remove();return dim}},loadDataGrid:function(){if(this.seriesData){return this.seriesData}var A=this.series;var B=[];for(i=0;i<A.length;++i){A[i].data.each(function(D){var C=D[0],F=D[1];if(r=B.find(function(G){return G[0]==C})){r[i+1]=F}else{var E=[];E[0]=C;E[i+1]=F;B.push(E)}})}B=B.sortBy(function(C){return C[0]});return this.seriesData=B},showTab:function(B,C){var A="canvas, .flotr-labels, .flotr-legend, .flotr-legend-bg, .flotr-title, .flotr-subtitle";switch(B){case"graph":this.datagrid.up().hide();this.el.select(A).invoke("show");this.tabs.data.removeClassName("selected");this.tabs.graph.addClassName("selected");break;case"data":this.constructDataGrid();this.datagrid.up().show();this.el.select(A).invoke("hide");this.tabs.data.addClassName("selected");this.tabs.graph.removeClassName("selected");break}},constructTabs:function(){var A=new Element("div",{className:"flotr-tabs-group",style:"position:absolute;left:0px;top:"+this.canvasHeight+"px;width:"+this.canvasWidth+"px;"});this.el.insert({bottom:A});this.tabs={graph:new Element("div",{className:"flotr-tab selected",style:"float:left;"}).update(this.options.spreadsheet.tabGraphLabel),data:new Element("div",{className:"flotr-tab",style:"float:left;"}).update(this.options.spreadsheet.tabDataLabel)};A.insert(this.tabs.graph).insert(this.tabs.data);this.el.setStyle({height:this.canvasHeight+this.tabs.data.getHeight()+2+"px"});this.tabs.graph.observe("click",(function(){this.showTab("graph")}).bind(this));this.tabs.data.observe("click",(function(){this.showTab("data")}).bind(this))},constructDataGrid:function(){if(this.datagrid){return this.datagrid}var D,B,L=this.series,J=this.loadDataGrid();var K=this.datagrid=new Element("table",{className:"flotr-datagrid",style:"height:100px;"});var C=["<colgroup><col />"];var F=['<tr class="first-row">'];F.push("<th> </th>");for(D=0;D<L.length;++D){F.push('<th scope="col">'+(L[D].label||String.fromCharCode(65+D))+"</th>");C.push("<col />")}F.push("</tr>");for(B=0;B<J.length;++B){F.push("<tr>");for(D=0;D<L.length+1;++D){var M="td";var G=(J[B][D]!=null?Math.round(J[B][D]*100000)/100000:"");if(D==0){M="th";var I;if(this.options.xaxis.ticks){var E=this.options.xaxis.ticks.find(function(N){return N[0]==J[B][D]});if(E){I=E[1]}}else{I=this.options.xaxis.tickFormatter(G)}if(I){G=I}}F.push("<"+M+(M=="th"?' scope="row"':"")+">"+G+"</"+M+">")}F.push("</tr>")}C.push("</colgroup>");K.update(C.join("")+F.join(""));if(!Prototype.Browser.IE){K.select("td").each(function(N){N.observe("mouseover",function(O){N=O.element();var P=N.previousSiblings();K.select("th[scope=col]")[P.length-1].addClassName("hover");K.select("colgroup col")[P.length].addClassName("hover")});N.observe("mouseout",function(){K.select("colgroup col.hover, th.hover").each(function(O){O.removeClassName("hover")})})})}var H=new Element("div",{className:"flotr-datagrid-toolbar"}).insert(new Element("button",{type:"button",className:"flotr-datagrid-toolbar-button"}).update(this.options.spreadsheet.toolbarDownload).observe("click",this.downloadCSV.bind(this))).insert(new Element("button",{type:"button",className:"flotr-datagrid-toolbar-button"}).update(this.options.spreadsheet.toolbarSelectAll).observe("click",this.selectAllData.bind(this)));var A=new Element("div",{className:"flotr-datagrid-container",style:"left:0px;top:0px;width:"+this.canvasWidth+"px;height:"+this.canvasHeight+"px;overflow:auto;"});A.insert(H);K.wrap(A.hide());this.el.insert(A);return K},selectAllData:function(){if(this.tabs){var B,A,E,D,C=this.constructDataGrid();this.showTab("data");(function(){if((E=C.ownerDocument)&&(D=E.defaultView)&&D.getSelection&&E.createRange&&(B=window.getSelection())&&B.removeAllRanges){A=E.createRange();A.selectNode(C);B.removeAllRanges();B.addRange(A)}else{if(document.body&&document.body.createTextRange&&(A=document.body.createTextRange())){A.moveToElementText(C);A.select()}}}).defer();return true}else{return false}},downloadCSV:function(){var D,A='"x"',C=this.series,E=this.loadDataGrid();for(D=0;D<C.length;++D){A+='%09"'+(C[D].label||String.fromCharCode(65+D))+'"'}A+="%0D%0A";for(D=0;D<E.length;++D){if(this.options.xaxis.ticks){var B=this.options.xaxis.ticks.find(function(F){return F[0]==E[D][0]});if(B){E[D][0]=B[1]}}else{E[D][0]=this.options.xaxis.tickFormatter(E[D][0])}A+=E[D].join("%09")+"%0D%0A"}if(Prototype.Browser.IE){A=A.gsub("%09","\t").gsub("%0A","\n").gsub("%0D","\r");window.open().document.write(A)}else{window.open("data:text/csv,"+A)}},initEvents:function(){this.overlay.stopObserving();this.overlay.observe("mousedown",this.mouseDownHandler.bind(this));this.overlay.observe("mousemove",this.mouseMoveHandler.bind(this));this.overlay.observe("click",this.clickHandler.bind(this))},findDataRanges:function(){var J=this.series,G=this.axes;G.x.datamin=0;G.x.datamax=0;G.x2.datamin=0;G.x2.datamax=0;G.y.datamin=0;G.y.datamax=0;G.y2.datamin=0;G.y2.datamax=0;if(J.length>0){var C,A,D,H,F,B,I,E;for(C=0;C<J.length;++C){B=J[C].data,I=J[C].xaxis,E=J[C].yaxis;if(B.length>0&&!J[C].hide){if(!I.used){I.datamin=I.datamax=B[0][0]}if(!E.used){E.datamin=E.datamax=B[0][1]}I.used=true;E.used=true;for(D=B.length-1;D>-1;--D){H=B[D][0];if(H<I.datamin){I.datamin=H}else{if(H>I.datamax){I.datamax=H}}for(A=1;A<B[D].length;A++){F=B[D][A];if(F<E.datamin){E.datamin=F}else{if(F>E.datamax){E.datamax=F}}}}}}}this.findXAxesValues();this.calculateRange(G.x);this.extendXRangeIfNeededByBar(G.x);if(G.x2.used){this.calculateRange(G.x2);this.extendXRangeIfNeededByBar(G.x2)}this.calculateRange(G.y);this.extendYRangeIfNeededByBar(G.y);if(G.y2.used){this.calculateRange(G.y2);this.extendYRangeIfNeededByBar(G.y2)}},calculateRange:function(D){var F=D.options,C=F.min!=null?F.min:D.datamin,A=F.max!=null?F.max:D.datamax,E;if(A-C==0){var B=(A==0)?1:0.01;C-=B;A+=B}D.tickSize=Flotr.getTickSize(F.noTicks,C,A,F.tickDecimals);if(F.min==null){E=F.autoscaleMargin;if(E!=0){C-=D.tickSize*E;if(C<0&&D.datamin>=0){C=0}C=D.tickSize*Math.floor(C/D.tickSize)}}if(F.max==null){E=F.autoscaleMargin;if(E!=0){A+=D.tickSize*E;if(A>0&&D.datamax<=0){A=0}A=D.tickSize*Math.ceil(A/D.tickSize)}}D.min=C;D.max=A},extendXRangeIfNeededByBar:function(A){if(A.options.max==null){var D=A.max,B,I,F,E,H=[],C=null;for(B=0;B<this.series.length;++B){I=this.series[B];F=I.bars;E=I.candles;if(I.axis==A&&(F.show||E.show)){if(!F.horizontal&&(F.barWidth+A.datamax>D)||(E.candleWidth+A.datamax>D)){D=A.max+I.bars.barWidth}if(F.stacked&&F.horizontal){for(j=0;j<I.data.length;j++){if(I.bars.show&&I.bars.stacked){var G=I.data[j][0];H[G]=(H[G]||0)+I.data[j][1];C=I}}for(j=0;j<H.length;j++){D=Math.max(H[j],D)}}}}A.lastSerie=C;A.max=D}},extendYRangeIfNeededByBar:function(A){if(A.options.max==null){var D=A.max,B,I,F,E,H=[],C=null;for(B=0;B<this.series.length;++B){I=this.series[B];F=I.bars;E=I.candles;if(I.yaxis==A&&F.show&&!I.hide){if(F.horizontal&&(F.barWidth+A.datamax>D)||(E.candleWidth+A.datamax>D)){D=A.max+F.barWidth}if(F.stacked&&!F.horizontal){for(j=0;j<I.data.length;j++){if(I.bars.show&&I.bars.stacked){var G=I.data[j][0];H[G]=(H[G]||0)+I.data[j][1];C=I}}for(j=0;j<H.length;j++){D=Math.max(H[j],D)}}}}A.lastSerie=C;A.max=D}},findXAxesValues:function(){for(i=this.series.length-1;i>-1;--i){s=this.series[i];s.xaxis.values=s.xaxis.values||[];for(j=s.data.length-1;j>-1;--j){s.xaxis.values[s.data[j][0]]={}}}},calculateTicks:function(D){var B=D.options,E,H;D.ticks=[];if(B.ticks){var G=B.ticks,I,F;if(Object.isFunction(G)){G=G({min:D.min,max:D.max})}for(E=0;E<G.length;++E){I=G[E];if(typeof (I)=="object"){H=I[0];F=(I.length>1)?I[1]:B.tickFormatter(H)}else{H=I;F=B.tickFormatter(H)}D.ticks[E]={v:H,label:F}}}else{var A=D.tickSize*Math.ceil(D.min/D.tickSize),C;for(E=0;A+E*D.tickSize<=D.max;++E){H=A+E*D.tickSize;C=B.tickDecimals;if(C==null){C=1-Math.floor(Math.log(D.tickSize)/Math.LN10)}if(C<0){C=0}H=H.toFixed(C);D.ticks.push({v:H,label:B.tickFormatter(H)})}}},calculateSpacing:function(){var L=this.axes,N=this.options,H=this.series,D=N.grid.labelMargin,M=L.x,A=L.x2,J=L.y,K=L.y2,F=2,G,E,C,I;[M,A,J,K].each(function(P){var O="";if(P.options.showLabels){for(G=0;G<P.ticks.length;++G){C=P.ticks[G].label.length;if(C>O.length){O=P.ticks[G].label}}}P.maxLabel=this.getTextDimensions(O,{size:N.fontSize,angle:Flotr.toRad(P.options.labelsAngle)},"font-size:smaller;","flotr-grid-label");P.titleSize=this.getTextDimensions(P.options.title,{size:N.fontSize*1.2,angle:Flotr.toRad(P.options.titleAngle)},"font-weight:bold;","flotr-axis-title")},this);I=this.getTextDimensions(N.title,{size:N.fontSize*1.5},"font-size:1em;font-weight:bold;","flotr-title");this.titleHeight=I.height;I=this.getTextDimensions(N.subtitle,{size:N.fontSize},"font-size:smaller;","flotr-subtitle");this.subtitleHeight=I.height;if(N.show){F=Math.max(F,N.points.radius+N.points.lineWidth/2)}for(E=0;E<N.length;++E){if(H[E].points.show){F=Math.max(F,H[E].points.radius+H[E].points.lineWidth/2)}}var B=this.plotOffset={left:0,right:0,top:0,bottom:0};B.left=B.right=B.top=B.bottom=F;B.bottom+=(M.options.showLabels?(M.maxLabel.height+D):0)+(M.options.title?(M.titleSize.height+D):0);B.top+=(A.options.showLabels?(A.maxLabel.height+D):0)+(A.options.title?(A.titleSize.height+D):0)+this.subtitleHeight+this.titleHeight;B.left+=(J.options.showLabels?(J.maxLabel.width+D):0)+(J.options.title?(J.titleSize.width+D):0);B.right+=(K.options.showLabels?(K.maxLabel.width+D):0)+(K.options.title?(K.titleSize.width+D):0);B.top=Math.floor(B.top);this.plotWidth=this.canvasWidth-B.left-B.right;this.plotHeight=this.canvasHeight-B.bottom-B.top;M.scale=this.plotWidth/(M.max-M.min);A.scale=this.plotWidth/(A.max-A.min);J.scale=this.plotHeight/(J.max-J.min);K.scale=this.plotHeight/(K.max-K.min)},draw:function(){this.drawGrid();this.drawLabels();this.drawTitles();if(this.series.length){this.el.fire("flotr:beforedraw",[this.series,this]);for(var A=0;A<this.series.length;A++){if(!this.series[A].hide){this.drawSeries(this.series[A])}}}this.el.fire("flotr:afterdraw",[this.series,this])},tHoz:function(A,B){B=B||this.axes.x;return(A-B.min)*B.scale},tVert:function(B,A){A=A||this.axes.y;return this.plotHeight-(B-A.min)*A.scale},drawGrid:function(){var B,E=this.options,A=this.ctx;if(E.grid.verticalLines||E.grid.horizontalLines){this.el.fire("flotr:beforegrid",[this.axes.x,this.axes.y,E,this])}A.save();A.translate(this.plotOffset.left,this.plotOffset.top);if(E.grid.backgroundColor!=null){A.fillStyle=E.grid.backgroundColor;A.fillRect(0,0,this.plotWidth,this.plotHeight)}A.lineWidth=1;A.strokeStyle=E.grid.tickColor;A.beginPath();if(E.grid.verticalLines){for(var D=0;D<this.axes.x.ticks.length;++D){B=this.axes.x.ticks[D].v;if((B==this.axes.x.min||B==this.axes.x.max)&&E.grid.outlineWidth!=0){continue}A.moveTo(Math.floor(this.tHoz(B))+A.lineWidth/2,0);A.lineTo(Math.floor(this.tHoz(B))+A.lineWidth/2,this.plotHeight)}}if(E.grid.horizontalLines){for(var C=0;C<this.axes.y.ticks.length;++C){B=this.axes.y.ticks[C].v;if((B==this.axes.y.min||B==this.axes.y.max)&&E.grid.outlineWidth!=0){continue}A.moveTo(0,Math.floor(this.tVert(B))+A.lineWidth/2);A.lineTo(this.plotWidth,Math.floor(this.tVert(B))+A.lineWidth/2)}}A.stroke();if(E.grid.outlineWidth!=0){A.lineWidth=E.grid.outlineWidth;A.strokeStyle=E.grid.color;A.lineJoin="round";A.strokeRect(0,0,this.plotWidth,this.plotHeight)}A.restore();if(E.grid.verticalLines||E.grid.horizontalLines){this.el.fire("flotr:aftergrid",[this.axes.x,this.axes.y,E,this])}},drawLabels:function(){var C=0,D,B,E,F,G,J=this.options,I=this.ctx,H=this.axes;for(E=0;E<H.x.ticks.length;++E){if(H.x.ticks[E].label){++C}}B=this.plotWidth/C;if(!J.HtmlText&&this.textEnabled){var A={size:J.fontSize,adjustAlign:true};D=H.x;A.color=D.options.color||J.grid.color;for(E=0;E<D.ticks.length&&D.options.showLabels&&D.used;++E){G=D.ticks[E];if(!G.label||G.label.length==0){continue}A.angle=Flotr.toRad(D.options.labelsAngle);A.halign="c";A.valign="t";I.drawText(G.label,this.plotOffset.left+this.tHoz(G.v,D),this.plotOffset.top+this.plotHeight+J.grid.labelMargin,A)}D=H.x2;A.color=D.options.color||J.grid.color;for(E=0;E<D.ticks.length&&D.options.showLabels&&D.used;++E){G=D.ticks[E];if(!G.label||G.label.length==0){continue}A.angle=Flotr.toRad(D.options.labelsAngle);A.halign="c";A.valign="b";I.drawText(G.label,this.plotOffset.left+this.tHoz(G.v,D),this.plotOffset.top+J.grid.labelMargin,A)}D=H.y;A.color=D.options.color||J.grid.color;for(E=0;E<D.ticks.length&&D.options.showLabels&&D.used;++E){G=D.ticks[E];if(!G.label||G.label.length==0){continue}A.angle=Flotr.toRad(D.options.labelsAngle);A.halign="r";A.valign="m";I.drawText(G.label,this.plotOffset.left-J.grid.labelMargin,this.plotOffset.top+this.tVert(G.v,D),A)}D=H.y2;A.color=D.options.color||J.grid.color;for(E=0;E<D.ticks.length&&D.options.showLabels&&D.used;++E){G=D.ticks[E];if(!G.label||G.label.length==0){continue}A.angle=Flotr.toRad(D.options.labelsAngle);A.halign="l";A.valign="m";I.drawText(G.label,this.plotOffset.left+this.plotWidth+J.grid.labelMargin,this.plotOffset.top+this.tVert(G.v,D),A);I.save();I.strokeStyle=A.color;I.beginPath();I.moveTo(this.plotOffset.left+this.plotWidth-8,this.plotOffset.top+this.tVert(G.v,D));I.lineTo(this.plotOffset.left+this.plotWidth,this.plotOffset.top+this.tVert(G.v,D));I.stroke();I.restore()}}else{if(H.x.options.showLabels||H.x2.options.showLabels||H.y.options.showLabels||H.y2.options.showLabels){F=['<div style="font-size:smaller;color:'+J.grid.color+';" class="flotr-labels">'];D=H.x;if(D.options.showLabels){for(E=0;E<D.ticks.length;++E){G=D.ticks[E];if(!G.label||G.label.length==0){continue}F.push('<div style="position:absolute;top:'+(this.plotOffset.top+this.plotHeight+J.grid.labelMargin)+"px;left:"+(this.plotOffset.left+this.tHoz(G.v,D)-B/2)+"px;width:"+B+"px;text-align:center;"+(D.options.color?("color:"+D.options.color+";"):"")+'" class="flotr-grid-label">'+G.label+"</div>")}}D=H.x2;if(D.options.showLabels&&D.used){for(E=0;E<D.ticks.length;++E){G=D.ticks[E];if(!G.label||G.label.length==0){continue}F.push('<div style="position:absolute;top:'+(this.plotOffset.top-J.grid.labelMargin-D.maxLabel.height)+"px;left:"+(this.plotOffset.left+this.tHoz(G.v,D)-B/2)+"px;width:"+B+"px;text-align:center;"+(D.options.color?("color:"+D.options.color+";"):"")+'" class="flotr-grid-label">'+G.label+"</div>")}}D=H.y;if(D.options.showLabels){for(E=0;E<D.ticks.length;++E){G=D.ticks[E];if(!G.label||G.label.length==0){continue}F.push('<div style="position:absolute;top:'+(this.plotOffset.top+this.tVert(G.v,D)-D.maxLabel.height/2)+"px;left:0;width:"+(this.plotOffset.left-J.grid.labelMargin)+"px;text-align:right;"+(D.options.color?("color:"+D.options.color+";"):"")+'" class="flotr-grid-label">'+G.label+"</div>")}}D=H.y2;if(D.options.showLabels&&D.used){I.save();I.strokeStyle=D.options.color||J.grid.color;I.beginPath();for(E=0;E<D.ticks.length;++E){G=D.ticks[E];if(!G.label||G.label.length==0){continue}F.push('<div style="position:absolute;top:'+(this.plotOffset.top+this.tVert(G.v,D)-D.maxLabel.height/2)+"px;right:0;width:"+(this.plotOffset.right-J.grid.labelMargin)+"px;text-align:left;"+(D.options.color?("color:"+D.options.color+";"):"")+'" class="flotr-grid-label">'+G.label+"</div>");I.moveTo(this.plotOffset.left+this.plotWidth-8,this.plotOffset.top+this.tVert(G.v,D));I.lineTo(this.plotOffset.left+this.plotWidth,this.plotOffset.top+this.tVert(G.v,D))}I.stroke();I.restore()}F.push("</div>");this.el.insert(F.join(""))}}},drawTitles:function(){var D,C=this.options,F=C.grid.labelMargin,B=this.ctx,A=this.axes;if(!C.HtmlText&&this.textEnabled){var E={size:C.fontSize,color:C.grid.color,halign:"c"};if(C.subtitle){B.drawText(C.subtitle,this.plotOffset.left+this.plotWidth/2,this.titleHeight+this.subtitleHeight-2,E)}E.weight=1.5;E.size*=1.5;if(C.title){B.drawText(C.title,this.plotOffset.left+this.plotWidth/2,this.titleHeight-2,E)}E.weight=1.8;E.size*=0.8;E.adjustAlign=true;if(A.x.options.title&&A.x.used){E.halign="c";E.valign="t";E.angle=Flotr.toRad(A.x.options.titleAngle);B.drawText(A.x.options.title,this.plotOffset.left+this.plotWidth/2,this.plotOffset.top+A.x.maxLabel.height+this.plotHeight+2*F,E)}if(A.x2.options.title&&A.x2.used){E.halign="c";E.valign="b";E.angle=Flotr.toRad(A.x2.options.titleAngle);B.drawText(A.x2.options.title,this.plotOffset.left+this.plotWidth/2,this.plotOffset.top-A.x2.maxLabel.height-2*F,E)}if(A.y.options.title&&A.y.used){E.halign="r";E.valign="m";E.angle=Flotr.toRad(A.y.options.titleAngle);B.drawText(A.y.options.title,this.plotOffset.left-A.y.maxLabel.width-2*F,this.plotOffset.top+this.plotHeight/2,E)}if(A.y2.options.title&&A.y2.used){E.halign="l";E.valign="m";E.angle=Flotr.toRad(A.y2.options.titleAngle);B.drawText(A.y2.options.title,this.plotOffset.left+this.plotWidth+A.y2.maxLabel.width+2*F,this.plotOffset.top+this.plotHeight/2,E)}}else{D=['<div style="color:'+C.grid.color+';" class="flotr-titles">'];if(C.title){D.push('<div style="position:absolute;top:0;left:'+this.plotOffset.left+"px;font-size:1em;font-weight:bold;text-align:center;width:"+this.plotWidth+'px;" class="flotr-title">'+C.title+"</div>")}if(C.subtitle){D.push('<div style="position:absolute;top:'+this.titleHeight+"px;left:"+this.plotOffset.left+"px;font-size:smaller;text-align:center;width:"+this.plotWidth+'px;" class="flotr-subtitle">'+C.subtitle+"</div>")}D.push("</div>");D.push('<div class="flotr-axis-title" style="font-weight:bold;">');if(A.x.options.title&&A.x.used){D.push('<div style="position:absolute;top:'+(this.plotOffset.top+this.plotHeight+C.grid.labelMargin+A.x.titleSize.height)+"px;left:"+this.plotOffset.left+"px;width:"+this.plotWidth+'px;text-align:center;" class="flotr-axis-title">'+A.x.options.title+"</div>")}if(A.x2.options.title&&A.x2.used){D.push('<div style="position:absolute;top:0;left:'+this.plotOffset.left+"px;width:"+this.plotWidth+'px;text-align:center;" class="flotr-axis-title">'+A.x2.options.title+"</div>")}if(A.y.options.title&&A.y.used){D.push('<div style="position:absolute;top:'+(this.plotOffset.top+this.plotHeight/2-A.y.titleSize.height/2)+'px;left:0;text-align:right;" class="flotr-axis-title">'+A.y.options.title+"</div>")}if(A.y2.options.title&&A.y2.used){D.push('<div style="position:absolute;top:'+(this.plotOffset.top+this.plotHeight/2-A.y.titleSize.height/2)+'px;right:0;text-align:right;" class="flotr-axis-title">'+A.y2.options.title+"</div>")}D.push("</div>");this.el.insert(D.join(""))}},drawSeries:function(A){A=A||this.series;var C=false;for(var B in Flotr._registeredTypes){if(A[B]&&A[B].show){this[Flotr._registeredTypes[B]](A);C=true}}if(!C){this[Flotr._registeredTypes[this.options.defaultType]](A)}},plotLine:function(I,F){var O=this.ctx,A=I.xaxis,K=I.yaxis,J=this.tHoz.bind(this),M=this.tVert.bind(this),H=I.data;if(H.length<2){return }var E=J(H[0][0],A),D=M(H[0][1],K)+F;O.beginPath();O.moveTo(E,D);for(var G=0;G<H.length-1;++G){var C=H[G][0],N=H[G][1],B=H[G+1][0],L=H[G+1][1];if(N===null||L===null){continue}if(N<=L&&N<K.min){if(L<K.min){continue}C=(K.min-N)/(L-N)*(B-C)+C;N=K.min}else{if(L<=N&&L<K.min){if(N<K.min){continue}B=(K.min-N)/(L-N)*(B-C)+C;L=K.min}}if(N>=L&&N>K.max){if(L>K.max){continue}C=(K.max-N)/(L-N)*(B-C)+C;N=K.max}else{if(L>=N&&L>K.max){if(N>K.max){continue}B=(K.max-N)/(L-N)*(B-C)+C;L=K.max}}if(C<=B&&C<A.min){if(B<A.min){continue}N=(A.min-C)/(B-C)*(L-N)+N;C=A.min}else{if(B<=C&&B<A.min){if(C<A.min){continue}L=(A.min-C)/(B-C)*(L-N)+N;B=A.min}}if(C>=B&&C>A.max){if(B>A.max){continue}N=(A.max-C)/(B-C)*(L-N)+N;C=A.max}else{if(B>=C&&B>A.max){if(C>A.max){continue}L=(A.max-C)/(B-C)*(L-N)+N;B=A.max}}if(E!=J(C,A)||D!=M(N,K)+F){O.moveTo(J(C,A),M(N,K)+F)}E=J(B,A);D=M(L,K)+F;O.lineTo(E,D)}O.stroke()},plotLineArea:function(J,D){var S=J.data;if(S.length<2){return }var L,G=0,N=this.ctx,Q=J.xaxis,B=J.yaxis,E=this.tHoz.bind(this),M=this.tVert.bind(this),H=Math.min(Math.max(0,B.min),B.max),F=true;N.beginPath();for(var O=0;O<S.length-1;++O){var R=S[O][0],C=S[O][1],P=S[O+1][0],A=S[O+1][1];if(R<=P&&R<Q.min){if(P<Q.min){continue}C=(Q.min-R)/(P-R)*(A-C)+C;R=Q.min}else{if(P<=R&&P<Q.min){if(R<Q.min){continue}A=(Q.min-R)/(P-R)*(A-C)+C;P=Q.min}}if(R>=P&&R>Q.max){if(P>Q.max){continue}C=(Q.max-R)/(P-R)*(A-C)+C;R=Q.max}else{if(P>=R&&P>Q.max){if(R>Q.max){continue}A=(Q.max-R)/(P-R)*(A-C)+C;P=Q.max}}if(F){N.moveTo(E(R,Q),M(H,B)+D);F=false}if(C>=B.max&&A>=B.max){N.lineTo(E(R,Q),M(B.max,B)+D);N.lineTo(E(P,Q),M(B.max,B)+D);continue}else{if(C<=B.min&&A<=B.min){N.lineTo(E(R,Q),M(B.min,B)+D);N.lineTo(E(P,Q),M(B.min,B)+D);continue}}var I=R,K=P;if(C<=A&&C<B.min&&A>=B.min){R=(B.min-C)/(A-C)*(P-R)+R;C=B.min}else{if(A<=C&&A<B.min&&C>=B.min){P=(B.min-C)/(A-C)*(P-R)+R;A=B.min}}if(C>=A&&C>B.max&&A<=B.max){R=(B.max-C)/(A-C)*(P-R)+R;C=B.max}else{if(A>=C&&A>B.max&&C<=B.max){P=(B.max-C)/(A-C)*(P-R)+R;A=B.max}}if(R!=I){L=(C<=B.min)?L=B.min:B.max;N.lineTo(E(I,Q),M(L,B)+D);N.lineTo(E(R,Q),M(L,B)+D)}N.lineTo(E(R,Q),M(C,B)+D);N.lineTo(E(P,Q),M(A,B)+D);if(P!=K){L=(A<=B.min)?B.min:B.max;N.lineTo(E(K,Q),M(L,B)+D);N.lineTo(E(P,Q),M(L,B)+D)}G=Math.max(P,K)}N.lineTo(E(G,Q),M(H,B)+D);N.closePath();N.fill()},drawSeriesLines:function(C){C=C||this.series;var B=this.ctx;B.save();B.translate(this.plotOffset.left,this.plotOffset.top);B.lineJoin="round";var D=C.lines.lineWidth;var A=C.shadowSize;if(A>0){B.lineWidth=A/2;var E=D/2+B.lineWidth/2;B.strokeStyle="rgba(0,0,0,0.1)";this.plotLine(C,E+A/2);B.strokeStyle="rgba(0,0,0,0.2)";this.plotLine(C,E);if(C.lines.fill){B.fillStyle="rgba(0,0,0,0.05)";this.plotLineArea(C,E+A/2)}}B.lineWidth=D;B.strokeStyle=C.color;if(C.lines.fill){B.fillStyle=C.lines.fillColor!=null?C.lines.fillColor:Flotr.parseColor(C.color).scale(null,null,null,C.lines.fillOpacity).toString();this.plotLineArea(C,0)}this.plotLine(C,0);B.restore()},drawSeriesPoints:function(C){var B=this.ctx;B.save();B.translate(this.plotOffset.left,this.plotOffset.top);var D=C.lines.lineWidth;var A=C.shadowSize;if(A>0){B.lineWidth=A/2;B.strokeStyle="rgba(0,0,0,0.1)";this.plotPointShadows(C,A/2+B.lineWidth/2,C.points.radius);B.strokeStyle="rgba(0,0,0,0.2)";this.plotPointShadows(C,B.lineWidth/2,C.points.radius)}B.lineWidth=C.points.lineWidth;B.strokeStyle=C.color;B.fillStyle=C.points.fillColor!=null?C.points.fillColor:C.color;this.plotPoints(C,C.points.radius,C.points.fill);B.restore()},plotPoints:function(C,E,I){var A=C.xaxis,F=C.yaxis,J=this.ctx,D,B=C.data;for(D=B.length-1;D>-1;--D){var H=B[D][0],G=B[D][1];if(H<A.min||H>A.max||G<F.min||G>F.max){continue}J.beginPath();J.arc(this.tHoz(H,A),this.tVert(G,F),E,0,2*Math.PI,true);if(I){J.fill()}J.stroke()}},plotPointShadows:function(D,B,F){var A=D.xaxis,G=D.yaxis,J=this.ctx,E,C=D.data;for(E=C.length-1;E>-1;--E){var I=C[E][0],H=C[E][1];if(I<A.min||I>A.max||H<G.min||H>G.max){continue}J.beginPath();J.arc(this.tHoz(I,A),this.tVert(H,G)+B,F,0,Math.PI,false);J.stroke()}},drawSeriesBars:function(B){var A=this.ctx,D=B.bars.barWidth,C=Math.min(B.bars.lineWidth,D);A.save();A.translate(this.plotOffset.left,this.plotOffset.top);A.lineJoin="miter";A.lineWidth=C;A.strokeStyle=B.color;this.plotBarsShadows(B,D,0,B.bars.fill);if(B.bars.fill){A.fillStyle=B.bars.fillColor!=null?B.bars.fillColor:Flotr.parseColor(B.color).scale(null,null,null,B.bars.fillOpacity).toString()}this.plotBars(B,D,0,B.bars.fill);A.restore()},plotBars:function(K,N,D,Q){var U=K.data;if(U.length<1){return }var S=K.xaxis,B=K.yaxis,P=this.ctx,F=this.tHoz.bind(this),O=this.tVert.bind(this);for(var R=0;R<U.length;R++){var J=U[R][0],I=U[R][1];var E=true,L=true,A=true;var H=0;if(K.bars.stacked){S.values.each(function(W,V){if(V==J){H=W.stack||0;W.stack=H+I}})}if(K.bars.horizontal){var C=H,T=J+H,G=I,M=I+N}else{var C=J,T=J+N,G=H,M=I+H}if(T<S.min||C>S.max||M<B.min||G>B.max){continue}if(C<S.min){C=S.min;E=false}if(T>S.max){T=S.max;if(S.lastSerie!=K&&K.bars.horizontal){L=false}}if(G<B.min){G=B.min}if(M>B.max){M=B.max;if(B.lastSerie!=K&&!K.bars.horizontal){L=false}}if(Q){P.beginPath();P.moveTo(F(C,S),O(G,B)+D);P.lineTo(F(C,S),O(M,B)+D);P.lineTo(F(T,S),O(M,B)+D);P.lineTo(F(T,S),O(G,B)+D);P.fill()}if(K.bars.lineWidth!=0&&(E||A||L)){P.beginPath();P.moveTo(F(C,S),O(G,B)+D);P[E?"lineTo":"moveTo"](F(C,S),O(M,B)+D);P[L?"lineTo":"moveTo"](F(T,S),O(M,B)+D);P[A?"lineTo":"moveTo"](F(T,S),O(G,B)+D);P.stroke()}}},plotBarsShadows:function(I,K,C){var T=I.data;if(T.length<1){return }var R=I.xaxis,A=I.yaxis,P=this.ctx,D=this.tHoz.bind(this),M=this.tVert.bind(this),N=this.options.shadowSize;for(var Q=0;Q<T.length;Q++){var H=T[Q][0],G=T[Q][1];var E=0;if(I.bars.stacked){R.values.each(function(V,U){if(U==H){E=V.stackShadow||0;V.stackShadow=E+G}})}if(I.bars.horizontal){var B=E,S=H+E,F=G,J=G+K}else{var B=H,S=H+K,F=E,J=G+E}if(S<R.min||B>R.max||J<A.min||F>A.max){continue}if(B<R.min){B=R.min}if(S>R.max){S=R.max}if(F<A.min){F=A.min}if(J>A.max){J=A.max}var O=D(S,R)-D(B,R)-((D(S,R)+N<=this.plotWidth)?0:N);var L=Math.max(0,M(F,A)-M(J,A)-((M(F,A)+N<=this.plotHeight)?0:N));P.fillStyle="rgba(0,0,0,0.05)";P.fillRect(Math.min(D(B,R)+N,this.plotWidth),Math.min(M(J,A)+N,this.plotWidth),O,L)}},drawSeriesCandles:function(B){var A=this.ctx,C=B.candles.candleWidth;A.save();A.translate(this.plotOffset.left,this.plotOffset.top);A.lineJoin="miter";A.lineWidth=B.candles.lineWidth;this.plotCandlesShadows(B,C/2);this.plotCandles(B,C/2);A.restore()},plotCandles:function(K,D){var W=K.data;if(W.length<1){return }var T=K.xaxis,B=K.yaxis,P=this.ctx,E=this.tHoz.bind(this),O=this.tVert.bind(this);for(var S=0;S<W.length;S++){var U=W[S],J=U[0],L=U[1],I=U[2],X=U[3],N=U[4];var C=J,V=J+K.candles.candleWidth,G=Math.max(B.min,X),M=Math.min(B.max,I),A=Math.max(B.min,Math.min(L,N)),R=Math.min(B.max,Math.max(L,N));if(V<T.min||C>T.max||M<B.min||G>B.max){continue}var Q=K.candles[L>N?"downFillColor":"upFillColor"];if(K.candles.fill&&!K.candles.barcharts){P.fillStyle=Flotr.parseColor(Q).scale(null,null,null,K.candles.fillOpacity).toString();P.fillRect(E(C,T),O(R,B)+D,E(V,T)-E(C,T),O(A,B)-O(R,B))}if(K.candles.lineWidth||K.candles.wickLineWidth){var J,H,F=(K.candles.wickLineWidth%2)/2;J=Math.floor(E((C+V)/2),T)+F;P.save();P.strokeStyle=Q;P.lineWidth=K.candles.wickLineWidth;P.lineCap="butt";if(K.candles.barcharts){P.beginPath();P.moveTo(J,Math.floor(O(M,B)+D));P.lineTo(J,Math.floor(O(G,B)+D));H=Math.floor(O(L,B)+D)+0.5;P.moveTo(Math.floor(E(C,T))+F,H);P.lineTo(J,H);H=Math.floor(O(N,B)+D)+0.5;P.moveTo(Math.floor(E(V,T))+F,H);P.lineTo(J,H)}else{P.strokeRect(E(C,T),O(R,B)+D,E(V,T)-E(C,T),O(A,B)-O(R,B));P.beginPath();P.moveTo(J,Math.floor(O(R,B)+D));P.lineTo(J,Math.floor(O(M,B)+D));P.moveTo(J,Math.floor(O(A,B)+D));P.lineTo(J,Math.floor(O(G,B)+D))}P.stroke();P.restore()}}},plotCandlesShadows:function(H,C){var T=H.data;if(T.length<1||H.candles.barcharts){return }var Q=H.xaxis,A=H.yaxis,D=this.tHoz.bind(this),M=this.tVert.bind(this),N=this.options.shadowSize;for(var P=0;P<T.length;P++){var R=T[P],G=R[0],I=R[1],F=R[2],U=R[3],K=R[4];var B=G,S=G+H.candles.candleWidth,E=Math.max(A.min,Math.min(I,K)),J=Math.min(A.max,Math.max(I,K));if(S<Q.min||B>Q.max||J<A.min||E>A.max){continue}var O=D(S,Q)-D(B,Q)-((D(S,Q)+N<=this.plotWidth)?0:N);var L=Math.max(0,M(E,A)-M(J,A)-((M(E,A)+N<=this.plotHeight)?0:N));this.ctx.fillStyle="rgba(0,0,0,0.05)";this.ctx.fillRect(Math.min(D(B,Q)+N,this.plotWidth),Math.min(M(J,A)+N,this.plotWidth),O,L)}},drawSeriesPie:function(G){if(!this.options.pie.drawn){var K=this.ctx,C=this.options,E=G.pie.lineWidth,I=G.shadowSize,R=G.data,D=(Math.min(this.canvasWidth,this.canvasHeight)*G.pie.sizeRatio)/2,H=[];var L=1;var P=Math.sin(G.pie.viewAngle)*G.pie.spliceThickness/L;var M={size:C.fontSize*1.2,color:C.grid.color,weight:1.5};var Q={x:(this.canvasWidth+this.plotOffset.left)/2,y:(this.canvasHeight-this.plotOffset.bottom)/2};var O=this.series.collect(function(T,S){if(T.pie.show){return{name:(T.label||T.data[0][1]),value:[S,T.data[0][1]],explode:T.pie.explode}}});var B=O.pluck("value").pluck(1).inject(0,function(S,T){return S+T});var F=0,N=G.pie.startAngle,J=0;var A=O.collect(function(S){N+=F;J=parseFloat(S.value[1]);F=J/B;return{name:S.name,fraction:F,x:S.value[0],y:J,explode:S.explode,startAngle:2*N*Math.PI,endAngle:2*(N+F)*Math.PI}});K.save();if(I>0){A.each(function(V){var S=(V.startAngle+V.endAngle)/2;var T=Q.x+Math.cos(S)*V.explode+I;var U=Q.y+Math.sin(S)*V.explode+I;this.plotSlice(T,U,D,V.startAngle,V.endAngle,false,L);K.fillStyle="rgba(0,0,0,0.1)";K.fill()},this)}if(C.HtmlText){H=['<div style="color:'+this.options.grid.color+'" class="flotr-labels">']}A.each(function(c,X){var W=(c.startAngle+c.endAngle)/2;var V=C.colors[X];var Y=Q.x+Math.cos(W)*c.explode;var U=Q.y+Math.sin(W)*c.explode;this.plotSlice(Y,U,D,c.startAngle,c.endAngle,false,L);if(G.pie.fill){K.fillStyle=Flotr.parseColor(V).scale(null,null,null,G.pie.fillOpacity).toString();K.fill()}K.lineWidth=E;K.strokeStyle=V;K.stroke();var b=C.pie.labelFormatter(c);var S=(Math.cos(W)<0);var a=Y+Math.cos(W)*(G.pie.explode+D);var Z=U+Math.sin(W)*(G.pie.explode+D);if(c.fraction&&b){if(C.HtmlText){var T="position:absolute;top:"+(Z-5)+"px;";if(S){T+="right:"+(this.canvasWidth-a)+"px;text-align:right;"}else{T+="left:"+a+"px;text-align:left;"}H.push('<div style="'+T+'" class="flotr-grid-label">'+b+"</div>")}else{M.halign=S?"r":"l";K.drawText(b,a,Z+M.size/2,M)}}},this);if(C.HtmlText){H.push("</div>");this.el.insert(H.join(""))}K.restore();C.pie.drawn=true}},plotSlice:function(B,H,A,E,D,F,G){var C=this.ctx;G=G||1;C.save();C.scale(1,G);C.beginPath();C.moveTo(B,H);C.arc(B,H,A,E,D,F);C.lineTo(B,H);C.closePath();C.restore()},plotPie:function(){},insertLegend:function(){if(!this.options.legend.show){return }var H=this.series,I=this.plotOffset,B=this.options,b=[],A=false,O=this.ctx,R;var Q=H.findAll(function(c){return(c.label&&!c.hide)}).size();if(Q){if(!B.HtmlText&&this.textEnabled){var T={size:B.fontSize*1.1,color:B.grid.color};var M=B.legend.position,N=B.legend.margin,L=B.legend.labelBoxWidth,Z=B.legend.labelBoxHeight,S=B.legend.labelBoxMargin,W=I.left+N,U=I.top+N;var a=0;for(R=H.length-1;R>-1;--R){if(!H[R].label||H[R].hide){continue}var E=B.legend.labelFormatter(H[R].label);a=Math.max(a,O.measureText(E,T))}var K=Math.round(L+S*3+a),C=Math.round(Q*(S+Z)+S);if(M.charAt(0)=="s"){U=I.top+this.plotHeight-(N+C)}if(M.charAt(1)=="e"){W=I.left+this.plotWidth-(N+K)}var P=Flotr.parseColor(B.legend.backgroundColor||"rgb(240,240,240)").scale(null,null,null,B.legend.backgroundOpacity||0.1).toString();O.fillStyle=P;O.fillRect(W,U,K,C);O.strokeStyle=B.legend.labelBoxBorderColor;O.strokeRect(Flotr.toPixel(W),Flotr.toPixel(U),K,C);var G=W+S;var F=U+S;for(R=0;R<H.length;R++){if(!H[R].label||H[R].hide){continue}var E=B.legend.labelFormatter(H[R].label);O.fillStyle=H[R].color;O.fillRect(G,F,L-1,Z-1);O.strokeStyle=B.legend.labelBoxBorderColor;O.lineWidth=1;O.strokeRect(Math.ceil(G)-1.5,Math.ceil(F)-1.5,L+2,Z+2);O.drawText(E,G+L+S,F+(Z+T.size-O.fontDescent(T))/2,T);F+=Z+S}}else{for(R=0;R<H.length;++R){if(!H[R].label||H[R].hide){continue}if(R%B.legend.noColumns==0){b.push(A?"</tr><tr>":"<tr>");A=true}var E=B.legend.labelFormatter(H[R].label);b.push('<td class="flotr-legend-color-box"><div style="border:1px solid '+B.legend.labelBoxBorderColor+';padding:1px"><div style="width:'+B.legend.labelBoxWidth+"px;height:"+B.legend.labelBoxHeight+"px;background-color:"+H[R].color+'"></div></div></td><td class="flotr-legend-label">'+E+"</td>")}if(A){b.push("</tr>")}if(b.length>0){var V='<table style="font-size:smaller;color:'+B.grid.color+'">'+b.join("")+"</table>";if(B.legend.container!=null){$(B.legend.container).update(V)}else{var D="";var M=B.legend.position,N=B.legend.margin;if(M.charAt(0)=="n"){D+="top:"+(N+I.top)+"px;"}else{if(M.charAt(0)=="s"){D+="bottom:"+(N+I.bottom)+"px;"}}if(M.charAt(1)=="e"){D+="right:"+(N+I.right)+"px;"}else{if(M.charAt(1)=="w"){D+="left:"+(N+I.left)+"px;"}}var J=this.el.insert('<div class="flotr-legend" style="position:absolute;z-index:2;'+D+'">'+V+"</div>").select("div.flotr-legend").first();if(B.legend.backgroundOpacity!=0){var Y=B.legend.backgroundColor;if(Y==null){var X=(B.grid.backgroundColor!=null)?B.grid.backgroundColor:Flotr.extractColor(J);Y=Flotr.parseColor(X).adjust(null,null,null,1).toString()}this.el.insert('<div class="flotr-legend-bg" style="position:absolute;width:'+J.getWidth()+"px;height:"+J.getHeight()+"px;"+D+"background-color:"+Y+';"> </div>').select("div.flotr-legend-bg").first().setStyle({opacity:B.legend.backgroundOpacity})}}}}}},getEventPosition:function(C){var G=this.overlay.cumulativeOffset(),F=(C.pageX-G.left-this.plotOffset.left),E=(C.pageY-G.top-this.plotOffset.top),D=0,B=0;if(C.pageX==null&&C.clientX!=null){var H=document.documentElement,A=document.body;D=C.clientX+(H&&H.scrollLeft||A.scrollLeft||0);B=C.clientY+(H&&H.scrollTop||A.scrollTop||0)}else{D=C.pageX;B=C.pageY}return{x:this.axes.x.min+F/this.axes.x.scale,x2:this.axes.x2.min+F/this.axes.x2.scale,y:this.axes.y.max-E/this.axes.y.scale,y2:this.axes.y2.max-E/this.axes.y2.scale,relX:F,relY:E,absX:D,absY:B}},clickHandler:function(A){if(this.ignoreClick){this.ignoreClick=false;return }this.el.fire("flotr:click",[this.getEventPosition(A),this])},mouseMoveHandler:function(A){var B=this.getEventPosition(A);this.lastMousePos.pageX=B.absX;this.lastMousePos.pageY=B.absY;if(this.selectionInterval==null&&(this.options.mouse.track||this.series.any(function(C){return C.mouse&&C.mouse.track}))){this.hit(B)}this.el.fire("flotr:mousemove",[A,B,this])},mouseDownHandler:function(C){if(C.isRightClick()){C.stop();var B=this.overlay;B.hide();function A(){B.show();$(document).stopObserving("mousemove",A)}$(document).observe("mousemove",A);return }if(!this.options.selection.mode||!C.isLeftClick()){return }this.setSelectionPos(this.selection.first,C);if(this.selectionInterval!=null){clearInterval(this.selectionInterval)}this.lastMousePos.pageX=null;this.selectionInterval=setInterval(this.updateSelection.bind(this),1000/this.options.selection.fps);this.mouseUpHandler=this.mouseUpHandler.bind(this);$(document).observe("mouseup",this.mouseUpHandler)},fireSelectEvent:function(){var A=this.axes,F=this.selection,C=(F.first.x<=F.second.x)?F.first.x:F.second.x,B=(F.first.x<=F.second.x)?F.second.x:F.first.x,E=(F.first.y>=F.second.y)?F.first.y:F.second.y,D=(F.first.y>=F.second.y)?F.second.y:F.first.y;C=A.x.min+C/A.x.scale;B=A.x.min+B/A.x.scale;E=A.y.max-E/A.y.scale;D=A.y.max-D/A.y.scale;this.el.fire("flotr:select",[{x1:C,y1:E,x2:B,y2:D},this])},mouseUpHandler:function(A){$(document).stopObserving("mouseup",this.mouseUpHandler);A.stop();if(this.selectionInterval!=null){clearInterval(this.selectionInterval);this.selectionInterval=null}this.setSelectionPos(this.selection.second,A);this.clearSelection();if(this.selectionIsSane()){this.drawSelection();this.fireSelectEvent();this.ignoreClick=true}},setSelectionPos:function(D,B){var A=this.options,C=$(this.overlay).cumulativeOffset();if(A.selection.mode.indexOf("x")==-1){D.x=(D==this.selection.first)?0:this.plotWidth}else{D.x=B.pageX-C.left-this.plotOffset.left;D.x=Math.min(Math.max(0,D.x),this.plotWidth)}if(A.selection.mode.indexOf("y")==-1){D.y=(D==this.selection.first)?0:this.plotHeight}else{D.y=B.pageY-C.top-this.plotOffset.top;D.y=Math.min(Math.max(0,D.y),this.plotHeight)}},updateSelection:function(){if(this.lastMousePos.pageX==null){return }this.setSelectionPos(this.selection.second,this.lastMousePos);this.clearSelection();if(this.selectionIsSane()){this.drawSelection()}},clearSelection:function(){if(this.prevSelection==null){return }var G=this.prevSelection,E=this.octx,C=this.plotOffset,A=Math.min(G.first.x,G.second.x),F=Math.min(G.first.y,G.second.y),B=Math.abs(G.second.x-G.first.x),D=Math.abs(G.second.y-G.first.y);E.clearRect(A+C.left-E.lineWidth,F+C.top-E.lineWidth,B+E.lineWidth*2,D+E.lineWidth*2);this.prevSelection=null},setSelection:function(G){var B=this.options,H=this.axes.x,A=this.axes.y,F=yaxis.scale,D=xaxis.scale,E=B.selection.mode.indexOf("x")!=-1,C=B.selection.mode.indexOf("y")!=-1;this.clearSelection();this.selection.first.y=E?0:(A.max-G.y1)*F;this.selection.second.y=E?this.plotHeight:(A.max-G.y2)*F;this.selection.first.x=C?0:(G.x1-H.min)*D;this.selection.second.x=C?this.plotWidth:(G.x2-H.min)*D;this.drawSelection();this.fireSelectEvent()},drawSelection:function(){var C=this.prevSelection,F=this.selection,H=this.octx,I=this.options,A=this.plotOffset;if(C!=null&&F.first.x==C.first.x&&F.first.y==C.first.y&&F.second.x==C.second.x&&F.second.y==C.second.y){return }H.strokeStyle=Flotr.parseColor(I.selection.color).scale(null,null,null,0.8).toString();H.lineWidth=1;H.lineJoin="round";H.fillStyle=Flotr.parseColor(I.selection.color).scale(null,null,null,0.4).toString();this.prevSelection={first:{x:F.first.x,y:F.first.y},second:{x:F.second.x,y:F.second.y}};var E=Math.min(F.first.x,F.second.x),D=Math.min(F.first.y,F.second.y),G=Math.abs(F.second.x-F.first.x),B=Math.abs(F.second.y-F.first.y);H.fillRect(E+A.left,D+A.top,G,B);H.strokeRect(E+A.left,D+A.top,G,B)},selectionIsSane:function(){var A=this.selection;return Math.abs(A.second.x-A.first.x)>=5&&Math.abs(A.second.y-A.first.y)>=5},clearHit:function(){if(this.prevHit){var B=this.options,A=this.plotOffset,C=this.prevHit;this.octx.clearRect(this.tHoz(C.x)+A.left-B.points.radius*2,this.tVert(C.y)+A.top-B.points.radius*2,B.points.radius*3+B.points.lineWidth*3,B.points.radius*3+B.points.lineWidth*3);this.prevHit=null}},hit:function(I){var G=this.series,C=this.options,R=this.prevHit,H=this.plotOffset,D=this.octx,S,A,M,Q,L={dist:Number.MAX_VALUE,x:null,y:null,relX:I.relX,relY:I.relY,absX:I.absX,absY:I.absY,mouse:null};for(Q=0;Q<G.length;Q++){s=G[Q];if(!s.mouse.track){continue}S=s.data;A=(s.xaxis.scale*s.mouse.sensibility);M=(s.yaxis.scale*s.mouse.sensibility);for(var P=0,B,E;P<S.length;P++){if(S[P][1]===null){continue}B=Math.pow(s.xaxis.scale*(S[P][0]-I.x),2);E=Math.pow(s.yaxis.scale*(S[P][1]-I.y),2);if(B<A&&E<M&&Math.sqrt(B+E)<L.dist){L.dist=Math.sqrt(B+E);L.x=S[P][0];L.y=S[P][1];L.mouse=s.mouse}}}if(L.mouse&&L.mouse.track&&!R||(R&&(L.x!=R.x||L.y!=R.y))){var K=this.mouseTrack||this.el.select(".flotr-mouse-value")[0],F="",J=C.mouse.position,N=C.mouse.margin,O="opacity:0.7;background-color:#000;color:#fff;display:none;position:absolute;padding:2px 8px;-moz-border-radius:4px;border-radius:4px;white-space:nowrap;";if(!C.mouse.relative){if(J.charAt(0)=="n"){F+="top:"+(N+H.top)+"px;"}else{if(J.charAt(0)=="s"){F+="bottom:"+(N+H.bottom)+"px;"}}if(J.charAt(1)=="e"){F+="right:"+(N+H.right)+"px;"}else{if(J.charAt(1)=="w"){F+="left:"+(N+H.left)+"px;"}}}else{if(J.charAt(0)=="n"){F+="bottom:"+(N-H.top-this.tVert(L.y)+this.canvasHeight)+"px;"}else{if(J.charAt(0)=="s"){F+="top:"+(N+H.top+this.tVert(L.y))+"px;"}}if(J.charAt(1)=="e"){F+="left:"+(N+H.left+this.tHoz(L.x))+"px;"}else{if(J.charAt(1)=="w"){F+="right:"+(N-H.left-this.tHoz(L.x)+this.canvasWidth)+"px;"}}}O+=F;if(!K){this.el.insert('<div class="flotr-mouse-value" style="'+O+'"></div>');K=this.mouseTrack=this.el.select(".flotr-mouse-value").first()}else{this.mouseTrack=K.setStyle(O)}if(L.x!==null&&L.y!==null){K.show();this.clearHit();if(L.mouse.lineColor!=null){D.save();D.translate(H.left,H.top);D.lineWidth=C.points.lineWidth;D.strokeStyle=L.mouse.lineColor;D.fillStyle="#ffffff";D.beginPath();D.arc(this.tHoz(L.x),this.tVert(L.y),C.mouse.radius,0,2*Math.PI,true);D.fill();D.stroke();D.restore()}this.prevHit=L;var T=L.mouse.trackDecimals;if(T==null||T<0){T=0}K.innerHTML=L.mouse.trackFormatter({x:L.x.toFixed(T),y:L.y.toFixed(T)});K.fire("flotr:hit",[L,this])}else{if(R){K.hide();this.clearHit()}}}},saveImage:function(D,C,A,B){var E=null;switch(D){case"jpeg":case"jpg":E=Canvas2Image.saveAsJPEG(this.canvas,B,C,A);break;default:case"png":E=Canvas2Image.saveAsPNG(this.canvas,B,C,A);break;case"bmp":E=Canvas2Image.saveAsBMP(this.canvas,B,C,A);break}if(Object.isElement(E)&&B){this.restoreCanvas();this.canvas.hide();this.overlay.hide();this.el.insert(E.setStyle({position:"absolute"}))}},restoreCanvas:function(){this.canvas.show();this.overlay.show();this.el.select("img").invoke("remove")}});Flotr.Color=Class.create({initialize:function(E,D,B,C){this.rgba=["r","g","b","a"];var A=4;while(-1<--A){this[this.rgba[A]]=arguments[A]||((A==3)?1:0)}this.normalize()},adjust:function(D,C,E,B){var A=4;while(-1<--A){if(arguments[A]!=null){this[this.rgba[A]]+=arguments[A]}}return this.normalize()},clone:function(){return new Flotr.Color(this.r,this.b,this.g,this.a)},limit:function(B,A,C){return Math.max(Math.min(B,C),A)},normalize:function(){var A=this.limit;this.r=A(parseInt(this.r),0,255);this.g=A(parseInt(this.g),0,255);this.b=A(parseInt(this.b),0,255);this.a=A(this.a,0,1);return this},scale:function(D,C,E,B){var A=4;while(-1<--A){if(arguments[A]!=null){this[this.rgba[A]]*=arguments[A]}}return this.normalize()},distance:function(B){if(!B){return }B=new Flotr.parseColor(B);var C=0;var A=3;while(-1<--A){C+=Math.abs(this[this.rgba[A]]-B[this.rgba[A]])}return C},toString:function(){return(this.a>=1)?"rgb("+[this.r,this.g,this.b].join(",")+")":"rgba("+[this.r,this.g,this.b,this.a].join(",")+")"}});Flotr.Color.lookupColors={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0]};Flotr.Date={format:function(F,E){if(!F){return }var A=function(H){H=H.toString();return H.length==1?"0"+H:H};var D=[];var C=false;for(var B=0;B<E.length;++B){var G=E.charAt(B);if(C){switch(G){case"h":G=F.getUTCHours().toString();break;case"H":G=A(F.getUTCHours());break;case"M":G=A(F.getUTCMinutes());break;case"S":G=A(F.getUTCSeconds());break;case"d":G=F.getUTCDate().toString();break;case"m":G=(F.getUTCMonth()+1).toString();break;case"y":G=F.getUTCFullYear().toString();break;case"b":G=Flotr.Date.monthNames[F.getUTCMonth()];break}D.push(G);C=false}else{if(G=="%"){C=true}else{D.push(G)}}}return D.join("")},timeUnits:{second:1000,minute:60*1000,hour:60*60*1000,day:24*60*60*1000,month:30*24*60*60*1000,year:365.2425*24*60*60*1000},spec:[[1,"second"],[2,"second"],[5,"second"],[10,"second"],[30,"second"],[1,"minute"],[2,"minute"],[5,"minute"],[10,"minute"],[30,"minute"],[1,"hour"],[2,"hour"],[4,"hour"],[8,"hour"],[12,"hour"],[1,"day"],[2,"day"],[3,"day"],[0.25,"month"],[0.5,"month"],[1,"month"],[2,"month"],[3,"month"],[6,"month"],[1,"year"]],monthNames:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"]}; |
| //Flotr 0.2.0-alpha Copyright (c) 2009 Bas Wenneker, <http://solutoire.com>, MIT License. | |
| // | |
| //Radar chart added by Ryan Simmons | |
| // | |
| /* $Id: flotr.js 82 2009-01-12 19:19:31Z fabien.menager $ */ | |
| var Flotr = { | |
| version: '0.2.0-alpha', | |
| author: 'Bas Wenneker', | |
| website: 'http://www.solutoire.com', | |
| /** | |
| * An object of the default registered graph types. Use Flotr.register(type, functionName) | |
| * to add your own type. | |
| */ | |
| _registeredTypes:{ | |
| 'lines': 'drawSeriesLines', | |
| 'points': 'drawSeriesPoints', | |
| 'bars': 'drawSeriesBars', | |
| 'candles': 'drawSeriesCandles', | |
| 'pie': 'drawSeriesPie', | |
| 'radar':'drawSeriesRadar' | |
| }, | |
| /** | |
| * Can be used to register your own chart type. Default types are 'lines', 'points' and 'bars'. | |
| * This is still experimental. | |
| * @todo Test and confirm. | |
| * @param {String} type - type of chart, like 'pies', 'bars' etc. | |
| * @param {String} functionName - Name of the draw function, like 'drawSeriesPies', 'drawSeriesBars' etc. | |
| */ | |
| register: function(type, functionName){ | |
| Flotr._registeredTypes[type] = functionName+''; | |
| }, | |
| /** | |
| * Draws the graph. This function is here for backwards compatibility with Flotr version 0.1.0alpha. | |
| * You could also draw graphs by directly calling Flotr.Graph(element, data, options). | |
| * @param {Element} el - element to insert the graph into | |
| * @param {Object} data - an array or object of dataseries | |
| * @param {Object} options - an object containing options | |
| * @param {Class} _GraphKlass_ - (optional) Class to pass the arguments to, defaults to Flotr.Graph | |
| * @return {Class} returns a new graph object and of course draws the graph. | |
| */ | |
| draw: function(el, data, options, _GraphKlass_){ | |
| _GraphKlass_ = _GraphKlass_ || Flotr.Graph; | |
| return new _GraphKlass_(el, data, options); | |
| }, | |
| /** | |
| * Collects dataseries from input and parses the series into the right format. It returns an Array | |
| * of Objects each having at least the 'data' key set. | |
| * @param {Array/Object} data - Object or array of dataseries | |
| * @return {Array} Array of Objects parsed into the right format ({(...,) data: [[x1,y1], [x2,y2], ...] (, ...)}) | |
| */ | |
| getSeries: function(data){ | |
| return data.collect(function(serie){ | |
| var i, serie = (serie.data) ? Object.clone(serie) : {'data': serie}; | |
| for (i = serie.data.length-1; i > -1; --i) { | |
| serie.data[i][1] = (serie.data[i][1] === null ? null : parseFloat(serie.data[i][1])); | |
| } | |
| return serie; | |
| }); | |
| }, | |
| /** | |
| * Recursively merges two objects. | |
| * @param {Object} src - source object (likely the object with the least properties) | |
| * @param {Object} dest - destination object (optional, object with the most properties) | |
| * @return {Object} recursively merged Object | |
| */ | |
| merge: function(src, dest){ | |
| var result = dest || {}; | |
| for(var i in src){ | |
| result[i] = (src[i] != null && typeof(src[i]) == 'object' && !(src[i].constructor == Array || src[i].constructor == RegExp) && !Object.isElement(src[i])) ? Flotr.merge(src[i], dest[i]) : result[i] = src[i]; | |
| } | |
| return result; | |
| }, | |
| /** | |
| * Function calculates the ticksize and returns it. | |
| * @param {Integer} noTicks - number of ticks | |
| * @param {Integer} min - lower bound integer value for the current axis | |
| * @param {Integer} max - upper bound integer value for the current axis | |
| * @param {Integer} decimals - number of decimals for the ticks | |
| * @return {Integer} returns the ticksize in pixels | |
| */ | |
| getTickSize: function(noTicks, min, max, decimals){ | |
| var delta = (max - min) / noTicks; | |
| var magn = Flotr.getMagnitude(delta); | |
| // Norm is between 1.0 and 10.0. | |
| var norm = delta / magn; | |
| var tickSize = 10; | |
| if(norm < 1.5) tickSize = 1; | |
| else if(norm < 2.25) tickSize = 2; | |
| else if(norm < 3) tickSize = ((decimals == 0) ? 2 : 2.5); | |
| else if(norm < 7.5) tickSize = 5; | |
| return tickSize * magn; | |
| }, | |
| /** | |
| * Default tick formatter. | |
| * @param {String/Integer} val - tick value integer | |
| * @return {String} formatted tick string | |
| */ | |
| defaultTickFormatter: function(val){ | |
| return val+''; | |
| }, | |
| /** | |
| * Formats the mouse tracker values. | |
| * @param {Object} obj - Track value Object {x:..,y:..} | |
| * @return {String} Formatted track string | |
| */ | |
| defaultTrackFormatter: function(obj){ | |
| return '('+obj.x+', '+obj.y+')'; | |
| }, | |
| defaultPieLabelFormatter: function(slice) { | |
| return (slice.fraction*100).toFixed(2)+'%'; | |
| }, | |
| /** | |
| * Returns the magnitude of the input value. | |
| * @param {Integer/Float} x - integer or float value | |
| * @return {Integer/Float} returns the magnitude of the input value | |
| */ | |
| getMagnitude: function(x){ | |
| return Math.pow(10, Math.floor(Math.log(x) / Math.LN10)); | |
| }, | |
| toPixel: function(val){ | |
| return Math.floor(val)+0.5;//((val-Math.round(val) < 0.4) ? (Math.floor(val)-0.5) : val); | |
| }, | |
| toRad: function(angle){ | |
| return -angle * (Math.PI/180); | |
| }, | |
| /** | |
| * Parses a color string and returns a corresponding Color. | |
| * @param {String} str - string thats representing a color | |
| * @return {Color} returns a Color object or false | |
| */ | |
| parseColor: function(str){ | |
| if (str instanceof Flotr.Color) return str; | |
| var result, Color = Flotr.Color; | |
| // rgb(num,num,num) | |
| if((result = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(str))) | |
| return new Color(parseInt(result[1]), parseInt(result[2]), parseInt(result[3])); | |
| // rgba(num,num,num,num) | |
| if((result = /rgba\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(str))) | |
| return new Color(parseInt(result[1]), parseInt(result[2]), parseInt(result[3]), parseFloat(result[4])); | |
| // rgb(num%,num%,num%) | |
| if((result = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(str))) | |
| return new Color(parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55); | |
| // rgba(num%,num%,num%,num) | |
| if((result = /rgba\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(str))) | |
| return new Color(parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55, parseFloat(result[4])); | |
| // #a0b1c2 | |
| if((result = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(str))) | |
| return new Color(parseInt(result[1],16), parseInt(result[2],16), parseInt(result[3],16)); | |
| // #fff | |
| if((result = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(str))) | |
| return new Color(parseInt(result[1]+result[1],16), parseInt(result[2]+result[2],16), parseInt(result[3]+result[3],16)); | |
| // Otherwise, we're most likely dealing with a named color. | |
| var name = str.strip().toLowerCase(); | |
| if(name == 'transparent'){ | |
| return new Color(255, 255, 255, 0); | |
| } | |
| return ((result = Color.lookupColors[name])) ? new Color(result[0], result[1], result[2]) : false; | |
| }, | |
| /** | |
| * Extracts the background-color of the passed element. | |
| * @param {Element} element | |
| * @return {String} color string | |
| */ | |
| extractColor: function(element){ | |
| var color; | |
| // Loop until we find an element with a background color and stop when we hit the body element. | |
| do { | |
| color = element.getStyle('background-color').toLowerCase(); | |
| if(!(color == '' || color == 'transparent')) break; | |
| element = element.up(0); | |
| } while(!element.nodeName.match(/^body$/i)); | |
| // Catch Safari's way of signaling transparent. | |
| return (color == 'rgba(0, 0, 0, 0)') ? 'transparent' : color; | |
| } | |
| }; | |
| /** | |
| * Flotr Graph class that plots a graph on creation. | |
| */ | |
| Flotr.Graph = Class.create({ | |
| /** | |
| * Flotr Graph constructor. | |
| * @param {Element} el - element to insert the graph into | |
| * @param {Object} data - an array or object of dataseries | |
| * @param {Object} options - an object containing options | |
| */ | |
| initialize: function(el, data, options){ | |
| this.el = $(el); | |
| if (!this.el) throw 'The target container doesn\'t exist'; | |
| this.data = data; | |
| this.series = Flotr.getSeries(data); | |
| this.setOptions(options); | |
| // Initialize some variables | |
| this.lastMousePos = { pageX: null, pageY: null }; | |
| this.selection = { first: { x: -1, y: -1}, second: { x: -1, y: -1} }; | |
| this.prevSelection = null; | |
| this.selectionInterval = null; | |
| this.ignoreClick = false; | |
| this.prevHit = null; | |
| // Create and prepare canvas. | |
| this.constructCanvas(); | |
| // Add event handlers for mouse tracking, clicking and selection | |
| this.initEvents(); | |
| this.findDataRanges(); | |
| this.calculateTicks(this.axes.x); | |
| this.calculateTicks(this.axes.x2); | |
| this.calculateTicks(this.axes.y); | |
| this.calculateTicks(this.axes.y2); | |
| this.calculateSpacing(); | |
| this.draw(); | |
| this.insertLegend(); | |
| // Graph and Data tabs | |
| if (this.options.spreadsheet.show) | |
| this.constructTabs(); | |
| }, | |
| /** | |
| * Sets options and initializes some variables and color specific values, used by the constructor. | |
| * @param {Object} opts - options object | |
| */ | |
| setOptions: function(opts){ | |
| var options = { | |
| colors: ['#00A8F0', '#C0D800', '#CB4B4B', '#4DA74D', '#9440ED'], //=> The default colorscheme. When there are > 5 series, additional colors are generated. | |
| title: null, | |
| subtitle: null, | |
| legend: { | |
| show: true, // => setting to true will show the legend, hide otherwise | |
| noColumns: 1, // => number of colums in legend table // @todo: doesn't work for HtmlText = false | |
| labelFormatter: Prototype.K, // => fn: string -> string | |
| labelBoxBorderColor: '#CCCCCC', // => border color for the little label boxes | |
| labelBoxWidth: 14, | |
| labelBoxHeight: 10, | |
| labelBoxMargin: 5, | |
| container: null, // => container (as jQuery object) to put legend in, null means default on top of graph | |
| position: 'nw', // => position of default legend container within plot | |
| margin: 5, // => distance from grid edge to default legend container within plot | |
| backgroundColor: null, // => null means auto-detect | |
| backgroundOpacity: 0.85// => set to 0 to avoid background, set to 1 for a solid background | |
| }, | |
| xaxis: { | |
| ticks: null, // => format: either [1, 3] or [[1, 'a'], 3] | |
| showLabels: true, // => setting to true will show the axis ticks labels, hide otherwise | |
| labelsAngle: 0, // => Labels' angle, in degrees | |
| title: null, // => axis title | |
| titleAngle: 0, // => axis title's angle, in degrees | |
| noTicks: 5, // => number of ticks for automagically generated ticks | |
| tickFormatter: Flotr.defaultTickFormatter, // => fn: number -> string | |
| tickDecimals: null, // => no. of decimals, null means auto | |
| min: null, // => min. value to show, null means set automatically | |
| max: null, // => max. value to show, null means set automatically | |
| autoscaleMargin: 0, // => margin in % to add if auto-setting min/max | |
| color: null | |
| }, | |
| x2axis: {}, | |
| yaxis: { | |
| ticks: null, // => format: either [1, 3] or [[1, 'a'], 3] | |
| showLabels: true, // => setting to true will show the axis ticks labels, hide otherwise | |
| labelsAngle: 0, // => Labels' angle, in degrees | |
| title: null, // => axis title | |
| titleAngle: 90, // => axis title's angle, in degrees | |
| noTicks: 5, // => number of ticks for automagically generated ticks | |
| tickFormatter: Flotr.defaultTickFormatter, // => fn: number -> string | |
| tickDecimals: null, // => no. of decimals, null means auto | |
| min: null, // => min. value to show, null means set automatically | |
| max: null, // => max. value to show, null means set automatically | |
| autoscaleMargin: 0, // => margin in % to add if auto-setting min/max | |
| color: null | |
| }, | |
| y2axis: { | |
| titleAngle: 270 | |
| }, | |
| points: { | |
| show: false, // => setting to true will show points, false will hide | |
| radius: 3, // => point radius (pixels) | |
| lineWidth: 2, // => line width in pixels | |
| fill: true, // => true to fill the points with a color, false for (transparent) no fill | |
| fillColor: '#FFFFFF', // => fill color | |
| fillOpacity: 0.4 | |
| }, | |
| lines: { | |
| show: false, // => setting to true will show lines, false will hide | |
| lineWidth: 2, // => line width in pixels | |
| fill: false, // => true to fill the area from the line to the x axis, false for (transparent) no fill | |
| fillColor: null, // => fill color | |
| fillOpacity: 0.4 // => opacity of the fill color, set to 1 for a solid fill, 0 hides the fill | |
| }, | |
| radar: { | |
| show: false, // => setting to true will show radar chart, false will hide | |
| lineWidth: 2, // => line width in pixels | |
| fill: false, // => true to fill the area from the line to the x axis, false for (transparent) no fill | |
| fillColor: null, // => fill color | |
| fillOpacity: 0.4 // => opacity of the fill color, set to 1 for a solid fill, 0 hides the fill | |
| }, | |
| bars: { | |
| show: false, // => setting to true will show bars, false will hide | |
| lineWidth: 2, // => in pixels | |
| barWidth: 1, // => in units of the x axis | |
| fill: true, // => true to fill the area from the line to the x axis, false for (transparent) no fill | |
| fillColor: null, // => fill color | |
| fillOpacity: 0.4, // => opacity of the fill color, set to 1 for a solid fill, 0 hides the fill | |
| horizontal: false, | |
| stacked: false | |
| }, | |
| candles: { | |
| show: false, // => setting to true will show candle sticks, false will hide | |
| lineWidth: 1, // => in pixels | |
| wickLineWidth: 1, // => in pixels | |
| candleWidth: 0.6, // => in units of the x axis | |
| fill: true, // => true to fill the area from the line to the x axis, false for (transparent) no fill | |
| upFillColor: '#00A8F0',// => up sticks fill color | |
| downFillColor: '#CB4B4B',// => down sticks fill color | |
| fillOpacity: 0.5, // => opacity of the fill color, set to 1 for a solid fill, 0 hides the fill | |
| barcharts: false // => draw as barcharts (not standard bars but financial barcharts) | |
| }, | |
| pie: { | |
| show: false, // => setting to true will show bars, false will hide | |
| lineWidth: 1, // => in pixels | |
| fill: true, // => true to fill the area from the line to the x axis, false for (transparent) no fill | |
| fillColor: null, // => fill color | |
| fillOpacity: 0.6, // => opacity of the fill color, set to 1 for a solid fill, 0 hides the fill | |
| explode: 6, | |
| sizeRatio: 0.6, | |
| startAngle: Math.PI/4, | |
| labelFormatter: Flotr.defaultPieLabelFormatter, | |
| pie3D: false, | |
| pie3DviewAngle: (Math.PI/2 * 0.8), | |
| pie3DspliceThickness: 20 | |
| }, | |
| grid: { | |
| color: '#545454', // => primary color used for outline and labels | |
| backgroundColor: null, // => null for transparent, else color | |
| tickColor: '#DDDDDD', // => color used for the ticks | |
| labelMargin: 3, // => margin in pixels | |
| verticalLines: true, // => whether to show gridlines in vertical direction | |
| horizontalLines: true, // => whether to show gridlines in horizontal direction | |
| outlineWidth: 2 // => width of the grid outline/border in pixels | |
| }, | |
| selection: { | |
| mode: null, // => one of null, 'x', 'y' or 'xy' | |
| color: '#B6D9FF', // => selection box color | |
| fps: 20 // => frames-per-second | |
| }, | |
| mouse: { | |
| track: false, // => true to track the mouse, no tracking otherwise | |
| position: 'se', // => position of the value box (default south-east) | |
| relative: false, // => next to the mouse cursor | |
| trackFormatter: Flotr.defaultTrackFormatter, // => formats the values in the value box | |
| margin: 5, // => margin in pixels of the valuebox | |
| lineColor: '#FF3F19', // => line color of points that are drawn when mouse comes near a value of a series | |
| trackDecimals: 1, // => decimals for the track values | |
| sensibility: 2, // => the lower this number, the more precise you have to aim to show a value | |
| radius: 3 // => radius of the track point | |
| }, | |
| radarChartMode: false, // => true to render radar grid / and setup scaling for radar chart | |
| shadowSize: 4, // => size of the 'fake' shadow | |
| defaultType: 'lines', // => default series type | |
| HtmlText: true, // => wether to draw the text using HTML or on the canvas | |
| fontSize: 7.5, // => canvas' text font size | |
| spreadsheet: { | |
| show: false, // => show the data grid using two tabs | |
| tabGraphLabel: 'Graph', | |
| tabDataLabel: 'Data', | |
| toolbarDownload: 'Download CSV', // @todo: add language support | |
| toolbarSelectAll: 'Select all' | |
| } | |
| } | |
| options.x2axis = Object.extend(Object.clone(options.xaxis), options.x2axis); | |
| options.y2axis = Object.extend(Object.clone(options.yaxis), options.y2axis); | |
| this.options = Flotr.merge((opts || {}), options); | |
| this.axes = { | |
| x: {options: this.options.xaxis, n: 1}, | |
| x2: {options: this.options.x2axis, n: 2}, | |
| y: {options: this.options.yaxis, n: 1}, | |
| y2: {options: this.options.y2axis, n: 2} | |
| }; | |
| // Initialize some variables used throughout this function. | |
| var assignedColors = [], | |
| colors = [], | |
| ln = this.series.length, | |
| neededColors = this.series.length, | |
| oc = this.options.colors, | |
| usedColors = [], | |
| variation = 0, | |
| c, i, j, s, tooClose; | |
| // Collect user-defined colors from series. | |
| for(i = neededColors - 1; i > -1; --i){ | |
| c = this.series[i].color; | |
| if(c != null){ | |
| --neededColors; | |
| if(Object.isNumber(c)) assignedColors.push(c); | |
| else usedColors.push(Flotr.parseColor(c)); | |
| } | |
| } | |
| // Calculate the number of colors that need to be generated. | |
| for(i = assignedColors.length - 1; i > -1; --i) | |
| neededColors = Math.max(neededColors, assignedColors[i] + 1); | |
| // Generate needed number of colors. | |
| for(i = 0; colors.length < neededColors;){ | |
| c = (oc.length == i) ? new Flotr.Color(100, 100, 100) : Flotr.parseColor(oc[i]); | |
| // Make sure each serie gets a different color. | |
| var sign = variation % 2 == 1 ? -1 : 1; | |
| var factor = 1 + sign * Math.ceil(variation / 2) * 0.2; | |
| c.scale(factor, factor, factor); | |
| /** | |
| * @todo if we're getting too close to something else, we should probably skip this one | |
| */ | |
| colors.push(c); | |
| if(++i >= oc.length){ | |
| i = 0; | |
| ++variation; | |
| } | |
| } | |
| // Fill the options with the generated colors. | |
| for(i = 0, j = 0; i < ln; ++i){ | |
| s = this.series[i]; | |
| // Assign the color. | |
| if(s.color == null){ | |
| s.color = colors[j++].toString(); | |
| }else if(Object.isNumber(s.color)){ | |
| s.color = colors[s.color].toString(); | |
| } | |
| if (!s.xaxis) s.xaxis = this.axes.x; | |
| if (s.xaxis == 1) s.xaxis = this.axes.x; | |
| else if (s.xaxis == 2) s.xaxis = this.axes.x2; | |
| if (!s.yaxis) s.yaxis = this.axes.y; | |
| if (s.yaxis == 1) s.yaxis = this.axes.y; | |
| else if (s.yaxis == 2) s.yaxis = this.axes.y2; | |
| // Apply missing options to the series. | |
| s.lines = Object.extend(Object.clone(this.options.lines), s.lines); | |
| s.points = Object.extend(Object.clone(this.options.points), s.points); | |
| s.bars = Object.extend(Object.clone(this.options.bars), s.bars); | |
| s.candles = Object.extend(Object.clone(this.options.candles), s.candles); | |
| s.pie = Object.extend(Object.clone(this.options.pie), s.pie); | |
| s.radar = Object.extend(Object.clone(this.options.radar), s.radar); | |
| s.mouse = Object.extend(Object.clone(this.options.mouse), s.mouse); | |
| if(s.shadowSize == null) s.shadowSize = this.options.shadowSize; | |
| } | |
| }, | |
| /** | |
| * Initializes the canvas and it's overlay canvas element. When the browser is IE, this makes use | |
| * of excanvas. The overlay canvas is inserted for displaying interactions. After the canvas elements | |
| * are created, the elements are inserted into the container element. | |
| */ | |
| constructCanvas: function(){ | |
| var el = this.el, | |
| size, c, oc; | |
| this.canvas = el.select('.flotr-canvas')[0]; | |
| this.overlay = el.select('.flotr-overlay')[0]; | |
| el.childElements().invoke('remove'); | |
| // For positioning labels and overlay. | |
| el.setStyle({position:'relative', cursor:'default'}); | |
| this.canvasWidth = el.getWidth(); | |
| this.canvasHeight = el.getHeight(); | |
| size = {'width': this.canvasWidth, 'height': this.canvasHeight}; | |
| if(this.canvasWidth <= 0 || this.canvasHeight <= 0){ | |
| throw 'Invalid dimensions for plot, width = ' + this.canvasWidth + ', height = ' + this.canvasHeight; | |
| } | |
| // Insert main canvas. | |
| if (!this.canvas) { | |
| c = this.canvas = new Element('canvas', size); | |
| c.className = 'flotr-canvas'; | |
| c = c.writeAttribute('style', 'position:absolute;left:0px;top:0px;'); | |
| } else { | |
| c = this.canvas.writeAttribute(size); | |
| } | |
| el.insert(c); | |
| if(Prototype.Browser.IE){ | |
| c = window.G_vmlCanvasManager.initElement(c); | |
| } | |
| this.ctx = c.getContext('2d'); | |
| // Insert overlay canvas for interactive features. | |
| if (!this.overlay) { | |
| oc = this.overlay = new Element('canvas', size); | |
| oc.className = 'flotr-overlay'; | |
| oc = oc.writeAttribute('style', 'position:absolute;left:0px;top:0px;'); | |
| } else { | |
| oc = this.overlay.writeAttribute(size); | |
| } | |
| el.insert(oc); | |
| if(Prototype.Browser.IE){ | |
| oc = window.G_vmlCanvasManager.initElement(oc); | |
| } | |
| this.octx = oc.getContext('2d'); | |
| // Enable text functions | |
| if (window.CanvasText) { | |
| CanvasText.enable(this.ctx); | |
| CanvasText.enable(this.octx); | |
| this.textEnabled = true; | |
| } | |
| }, | |
| getTextDimensions: function(text, canvasStyle, HtmlStyle, className) { | |
| if (!text) return {width:0, height:0}; | |
| if (!this.options.HtmlText && this.textEnabled) { | |
| var bounds = this.ctx.getTextBounds(text, canvasStyle); | |
| return { | |
| width: bounds.width+2, | |
| height: bounds.height+6 | |
| }; | |
| } | |
| else { | |
| var dummyDiv = this.el.insert('<div style="position:absolute;top:-10000px;'+HtmlStyle+'" class="'+className+' flotr-dummy-div">' + text + '</div>').select(".flotr-dummy-div")[0]; | |
| dim = dummyDiv.getDimensions(); | |
| dummyDiv.remove(); | |
| return dim; | |
| } | |
| }, | |
| loadDataGrid: function(){ | |
| if (this.seriesData) return this.seriesData; | |
| var s = this.series; | |
| var dg = []; | |
| /* The data grid is a 2 dimensions array. There is a row for each X value. | |
| * Each row contains the x value and the corresponding y value for each serie ('undefined' if there isn't one) | |
| **/ | |
| for(i = 0; i < s.length; ++i){ | |
| s[i].data.each(function(v) { | |
| var x = v[0], | |
| y = v[1]; | |
| if (r = dg.find(function(row) {return row[0] == x})) { | |
| r[i+1] = y; | |
| } | |
| else { | |
| var newRow = []; | |
| newRow[0] = x; | |
| newRow[i+1] = y | |
| dg.push(newRow); | |
| } | |
| }); | |
| } | |
| // The data grid is sorted by x value | |
| dg = dg.sortBy(function(v) { | |
| return v[0]; | |
| }); | |
| return this.seriesData = dg; | |
| }, | |
| // @todo: make a tab manager (Flotr.Tabs) | |
| showTab: function(tabName, onComplete){ | |
| var elementsClassNames = 'canvas, .flotr-labels, .flotr-legend, .flotr-legend-bg, .flotr-title, .flotr-subtitle'; | |
| switch(tabName) { | |
| case 'graph': | |
| this.datagrid.up().hide(); | |
| this.el.select(elementsClassNames).invoke('show'); | |
| this.tabs.data.removeClassName('selected'); | |
| this.tabs.graph.addClassName('selected'); | |
| break; | |
| case 'data': | |
| this.constructDataGrid(); | |
| this.datagrid.up().show(); | |
| this.el.select(elementsClassNames).invoke('hide'); | |
| this.tabs.data.addClassName('selected'); | |
| this.tabs.graph.removeClassName('selected'); | |
| break; | |
| } | |
| }, | |
| constructTabs: function(){ | |
| var tabsContainer = new Element('div', {className:'flotr-tabs-group', style:'position:absolute;left:0px;top:'+this.canvasHeight+'px;width:'+this.canvasWidth+'px;'}); | |
| this.el.insert({bottom: tabsContainer}); | |
| this.tabs = { | |
| graph: new Element('div', {className:'flotr-tab selected', style:'float:left;'}).update(this.options.spreadsheet.tabGraphLabel), | |
| data: new Element('div', {className:'flotr-tab', style:'float:left;'}).update(this.options.spreadsheet.tabDataLabel) | |
| } | |
| tabsContainer.insert(this.tabs.graph).insert(this.tabs.data); | |
| this.el.setStyle({height: this.canvasHeight+this.tabs.data.getHeight()+2+'px'}); | |
| this.tabs.graph.observe('click', (function() {this.showTab('graph')}).bind(this)); | |
| this.tabs.data.observe('click', (function() {this.showTab('data')}).bind(this)); | |
| }, | |
| // @todo: make a spreadsheet manager (Flotr.Spreadsheet) | |
| constructDataGrid: function(){ | |
| // If the data grid has already been built, nothing to do here | |
| if (this.datagrid) return this.datagrid; | |
| var i, j, | |
| s = this.series, | |
| datagrid = this.loadDataGrid(); | |
| var t = this.datagrid = new Element('table', {className:'flotr-datagrid', style:'height:100px;'}); | |
| var colgroup = ['<colgroup><col />']; | |
| // First row : series' labels | |
| var html = ['<tr class="first-row">']; | |
| html.push('<th> </th>'); | |
| for (i = 0; i < s.length; ++i) { | |
| html.push('<th scope="col">'+(s[i].label || String.fromCharCode(65+i))+'</th>'); | |
| colgroup.push('<col />'); | |
| } | |
| html.push('</tr>'); | |
| // Data rows | |
| for (j = 0; j < datagrid.length; ++j) { | |
| html.push('<tr>'); | |
| for (i = 0; i < s.length+1; ++i) { | |
| var tag = 'td'; | |
| var content = (datagrid[j][i] != null ? Math.round(datagrid[j][i]*100000)/100000 : ''); | |
| if (i == 0) { | |
| tag = 'th'; | |
| var label; | |
| if(this.options.xaxis.ticks) { | |
| var tick = this.options.xaxis.ticks.find(function (x) { return x[0] == datagrid[j][i] }); | |
| if (tick) label = tick[1]; | |
| } | |
| else { | |
| label = this.options.xaxis.tickFormatter(content); | |
| } | |
| if (label) content = label; | |
| } | |
| html.push('<'+tag+(tag=='th'?' scope="row"':'')+'>'+content+'</'+tag+'>'); | |
| } | |
| html.push('</tr>'); | |
| } | |
| colgroup.push('</colgroup>'); | |
| t.update(colgroup.join('')+html.join('')); | |
| if (!Prototype.Browser.IE) { | |
| t.select('td').each(function(td) { | |
| td.observe('mouseover', function(e){ | |
| td = e.element(); | |
| var siblings = td.previousSiblings(); | |
| t.select('th[scope=col]')[siblings.length-1].addClassName('hover'); | |
| t.select('colgroup col')[siblings.length].addClassName('hover'); | |
| }); | |
| td.observe('mouseout', function(){ | |
| t.select('colgroup col.hover, th.hover').each(function(e){e.removeClassName('hover')}); | |
| }); | |
| }); | |
| } | |
| var toolbar = new Element('div', {className: 'flotr-datagrid-toolbar'}). | |
| insert(new Element('button', {type:'button', className:'flotr-datagrid-toolbar-button'}).update(this.options.spreadsheet.toolbarDownload).observe('click', this.downloadCSV.bind(this))). | |
| insert(new Element('button', {type:'button', className:'flotr-datagrid-toolbar-button'}).update(this.options.spreadsheet.toolbarSelectAll).observe('click', this.selectAllData.bind(this))); | |
| var container = new Element('div', {className:'flotr-datagrid-container', style:'left:0px;top:0px;width:'+this.canvasWidth+'px;height:'+this.canvasHeight+'px;overflow:auto;'}); | |
| container.insert(toolbar); | |
| t.wrap(container.hide()); | |
| this.el.insert(container); | |
| return t; | |
| }, | |
| selectAllData: function(){ | |
| if (this.tabs) { | |
| var selection, range, doc, win, node = this.constructDataGrid(); | |
| this.showTab('data'); | |
| // deferred to be able to select the table | |
| (function () { | |
| if ((doc = node.ownerDocument) && (win = doc.defaultView) && | |
| win.getSelection && doc.createRange && | |
| (selection = window.getSelection()) && | |
| selection.removeAllRanges) { | |
| range = doc.createRange(); | |
| range.selectNode(node); | |
| selection.removeAllRanges(); | |
| selection.addRange(range); | |
| } | |
| else if (document.body && document.body.createTextRange && | |
| (range = document.body.createTextRange())) { | |
| range.moveToElementText(node); | |
| range.select(); | |
| } | |
| }).defer(); | |
| return true; | |
| } | |
| else return false; | |
| }, | |
| downloadCSV: function(){ | |
| var i, csv = '"x"', | |
| series = this.series, | |
| dg = this.loadDataGrid(); | |
| for (i = 0; i < series.length; ++i) { | |
| csv += '%09"'+(series[i].label || String.fromCharCode(65+i))+'"'; // \t | |
| } | |
| csv += "%0D%0A"; // \r\n | |
| for (i = 0; i < dg.length; ++i) { | |
| if (this.options.xaxis.ticks) { | |
| var tick = this.options.xaxis.ticks.find(function (x) { return x[0] == dg[i][0] }); | |
| if (tick) dg[i][0] = tick[1]; | |
| } else { | |
| dg[i][0] = this.options.xaxis.tickFormatter(dg[i][0]); | |
| } | |
| csv += dg[i].join('%09')+"%0D%0A"; // \t and \r\n | |
| } | |
| if (Prototype.Browser.IE) { | |
| csv = csv.gsub('%09', '\t').gsub('%0A', '\n').gsub('%0D', '\r'); | |
| window.open().document.write(csv); | |
| } | |
| else { | |
| window.open('data:text/csv,'+csv); | |
| } | |
| }, | |
| /** | |
| * Initializes event some handlers. | |
| */ | |
| initEvents: function () { | |
| //@todo: maybe stopObserving with only flotr functions | |
| this.overlay.stopObserving(); | |
| this.overlay.observe('mousedown', this.mouseDownHandler.bind(this)); | |
| this.overlay.observe('mousemove', this.mouseMoveHandler.bind(this)); | |
| this.overlay.observe('click', this.clickHandler.bind(this)); | |
| }, | |
| /** | |
| * Function determines the min and max values for the xaxis and yaxis. | |
| */ | |
| findDataRanges: function(){ | |
| var s = this.series, | |
| a = this.axes; | |
| a.x.datamin = 0; a.x.datamax = 0; | |
| a.x2.datamin = 0; a.x2.datamax = 0; | |
| a.y.datamin = 0; a.y.datamax = 0; | |
| a.y2.datamin = 0; a.y2.datamax = 0; | |
| if(s.length > 0){ | |
| var i, j, h, x, y, data, xaxis, yaxis; | |
| // Get datamin, datamax start values | |
| for(i = 0; i < s.length; ++i) { | |
| data = s[i].data, | |
| xaxis = s[i].xaxis, | |
| yaxis = s[i].yaxis; | |
| if (data.length > 0 && !s[i].hide) { | |
| if (!xaxis.used) xaxis.datamin = xaxis.datamax = data[0][0]; | |
| if (!yaxis.used) yaxis.datamin = yaxis.datamax = data[0][1]; | |
| xaxis.used = true; | |
| yaxis.used = true; | |
| for(h = data.length - 1; h > -1; --h){ | |
| x = data[h][0]; | |
| if(x < xaxis.datamin) xaxis.datamin = x; | |
| else if(x > xaxis.datamax) xaxis.datamax = x; | |
| for(j = 1; j < data[h].length; j++){ | |
| y = data[h][j]; | |
| if(y < yaxis.datamin) yaxis.datamin = y; | |
| else if(y > yaxis.datamax) yaxis.datamax = y; | |
| } | |
| } | |
| } | |
| if (this.options.radarChartMode) { | |
| xaxis.datamin = yaxis.datamin = - yaxis.datamax; | |
| xaxis.datamax = yaxis.datamax; | |
| if (!this.options.radarChartSides) this.options.radarChartSides = data.length; | |
| } | |
| } | |
| } | |
| this.findXAxesValues(); | |
| this.calculateRange(a.x); | |
| this.extendXRangeIfNeededByBar(a.x); | |
| if (a.x2.used) { | |
| this.calculateRange(a.x2); | |
| this.extendXRangeIfNeededByBar(a.x2); | |
| } | |
| this.calculateRange(a.y); | |
| this.extendYRangeIfNeededByBar(a.y); | |
| if (a.y2.used) { | |
| this.calculateRange(a.y2); | |
| this.extendYRangeIfNeededByBar(a.y2); | |
| } | |
| }, | |
| /** | |
| * Calculates the range of an axis to apply autoscaling. | |
| */ | |
| calculateRange: function(axis){ | |
| var o = axis.options, | |
| min = o.min != null ? o.min : axis.datamin, | |
| max = o.max != null ? o.max : axis.datamax, | |
| margin; | |
| if(max - min == 0.0){ | |
| var widen = (max == 0.0) ? 1.0 : 0.01; | |
| min -= widen; | |
| max += widen; | |
| } | |
| axis.tickSize = Flotr.getTickSize(o.noTicks, ((this.options.radarChartMode) ? 0 : min), max, o.tickDecimals); | |
| // Autoscaling. | |
| if(o.min == null){ | |
| // Add a margin. | |
| margin = o.autoscaleMargin; | |
| if(margin != 0){ | |
| min -= axis.tickSize * margin; | |
| // Make sure we don't go below zero if all values are positive. | |
| if(min < 0 && axis.datamin >= 0) min = 0; | |
| min = axis.tickSize * Math.floor(min / axis.tickSize); | |
| } | |
| } | |
| if(o.max == null){ | |
| margin = o.autoscaleMargin; | |
| if(margin != 0){ | |
| max += axis.tickSize * margin; | |
| if(max > 0 && axis.datamax <= 0) max = 0; | |
| max = axis.tickSize * Math.ceil(max / axis.tickSize); | |
| } | |
| } | |
| axis.min = min; | |
| axis.max = max; | |
| }, | |
| /** | |
| * Bar series autoscaling in x direction. | |
| */ | |
| extendXRangeIfNeededByBar: function(axis){ | |
| if(axis.options.max == null){ | |
| var newmax = axis.max, | |
| i, s, b, c, | |
| stackedSums = [], | |
| lastSerie = null; | |
| for(i = 0; i < this.series.length; ++i){ | |
| s = this.series[i]; | |
| b = s.bars; | |
| c = s.candles; | |
| if(s.axis == axis && (b.show || c.show)) { | |
| if (!b.horizontal && (b.barWidth + axis.datamax > newmax) || (c.candleWidth + axis.datamax > newmax)){ | |
| newmax = axis.max + s.bars.barWidth; | |
| } | |
| if(b.stacked && b.horizontal){ | |
| for (j = 0; j < s.data.length; j++) { | |
| if (s.bars.show && s.bars.stacked) { | |
| var x = s.data[j][0]; | |
| stackedSums[x] = (stackedSums[x] || 0) + s.data[j][1]; | |
| lastSerie = s; | |
| } | |
| } | |
| for (j = 0; j < stackedSums.length; j++) { | |
| newmax = Math.max(stackedSums[j], newmax); | |
| } | |
| } | |
| } | |
| } | |
| axis.lastSerie = lastSerie; | |
| axis.max = newmax; | |
| } | |
| }, | |
| /** | |
| * Bar series autoscaling in y direction. | |
| */ | |
| extendYRangeIfNeededByBar: function(axis){ | |
| if(axis.options.max == null){ | |
| var newmax = axis.max, | |
| i, s, b, c, | |
| stackedSums = [], | |
| lastSerie = null; | |
| for(i = 0; i < this.series.length; ++i){ | |
| s = this.series[i]; | |
| b = s.bars; | |
| c = s.candles; | |
| if (s.yaxis == axis && b.show && !s.hide) { | |
| if (b.horizontal && (b.barWidth + axis.datamax > newmax) || (c.candleWidth + axis.datamax > newmax)){ | |
| newmax = axis.max + b.barWidth; | |
| } | |
| if(b.stacked && !b.horizontal){ | |
| for (j = 0; j < s.data.length; j++) { | |
| if (s.bars.show && s.bars.stacked) { | |
| var x = s.data[j][0]; | |
| stackedSums[x] = (stackedSums[x] || 0) + s.data[j][1]; | |
| lastSerie = s; | |
| } | |
| } | |
| for (j = 0; j < stackedSums.length; j++) { | |
| newmax = Math.max(stackedSums[j], newmax); | |
| } | |
| } | |
| } | |
| } | |
| axis.lastSerie = lastSerie; | |
| axis.max = newmax; | |
| } | |
| }, | |
| /** | |
| * Find every values of the x axes | |
| */ | |
| findXAxesValues: function(){ | |
| for(i = this.series.length-1; i > -1 ; --i){ | |
| s = this.series[i]; | |
| s.xaxis.values = s.xaxis.values || []; | |
| for (j = s.data.length-1; j > -1 ; --j){ | |
| s.xaxis.values[s.data[j][0]] = {}; | |
| } | |
| } | |
| }, | |
| /** | |
| * Calculate axis ticks. | |
| * @param {Object} axis - axis object | |
| * @param {Object} o - axis options | |
| */ | |
| calculateTicks: function(axis){ | |
| var o = axis.options, i, v; | |
| axis.ticks = []; | |
| if(o.ticks){ | |
| var ticks = o.ticks, t, label; | |
| if(Object.isFunction(ticks)){ | |
| ticks = ticks({min: axis.min, max: axis.max}); | |
| } | |
| // Clean up the user-supplied ticks, copy them over. | |
| for(i = 0; i < ticks.length; ++i){ | |
| t = ticks[i]; | |
| if(typeof(t) == 'object'){ | |
| v = t[0]; | |
| label = (t.length > 1) ? t[1] : o.tickFormatter(v); | |
| }else{ | |
| v = t; | |
| label = o.tickFormatter(v); | |
| } | |
| axis.ticks[i] = { v: v, label: label }; | |
| } | |
| } | |
| else { | |
| // Round to nearest multiple of tick size. | |
| var start = axis.tickSize * Math.ceil(axis.min / axis.tickSize), | |
| decimals; | |
| // Then store all possible ticks. | |
| for(i = 0; start + i * axis.tickSize <= axis.max; ++i){ | |
| v = start + i * axis.tickSize; | |
| // Round (this is always needed to fix numerical instability). | |
| decimals = o.tickDecimals; | |
| if(decimals == null) decimals = 1 - Math.floor(Math.log(axis.tickSize) / Math.LN10); | |
| if(decimals < 0) decimals = 0; | |
| v = v.toFixed(decimals); | |
| axis.ticks.push({ v: v, label: o.tickFormatter(v) }); | |
| } | |
| } | |
| }, | |
| /** | |
| * Calculates axis label sizes. | |
| */ | |
| calculateSpacing: function(){ | |
| var a = this.axes, | |
| options = this.options, | |
| series = this.series, | |
| margin = options.grid.labelMargin, | |
| x = a.x, | |
| x2 = a.x2, | |
| y = a.y, | |
| y2 = a.y2, | |
| maxOutset = 2, | |
| i, j, l, dim; | |
| // Labels width and height | |
| [x, x2, y, y2].each(function(axis) { | |
| var maxLabel = ''; | |
| if (axis.options.showLabels) { | |
| for(i = 0; i < axis.ticks.length; ++i){ | |
| l = axis.ticks[i].label.length; | |
| if(l > maxLabel.length){ | |
| maxLabel = axis.ticks[i].label; | |
| } | |
| } | |
| } | |
| axis.maxLabel = this.getTextDimensions(maxLabel, {size:options.fontSize, angle: Flotr.toRad(axis.options.labelsAngle)}, 'font-size:smaller;', 'flotr-grid-label'); | |
| axis.titleSize = this.getTextDimensions(axis.options.title, {size: options.fontSize*1.2, angle: Flotr.toRad(axis.options.titleAngle)}, 'font-weight:bold;', 'flotr-axis-title'); | |
| }, this); | |
| // Title height | |
| dim = this.getTextDimensions(options.title, {size: options.fontSize*1.5}, 'font-size:1em;font-weight:bold;', 'flotr-title'); | |
| this.titleHeight = dim.height; | |
| // Subtitle height | |
| dim = this.getTextDimensions(options.subtitle, {size: options.fontSize}, 'font-size:smaller;', 'flotr-subtitle'); | |
| this.subtitleHeight = dim.height; | |
| // Grid outline line width. | |
| if(options.show){ | |
| maxOutset = Math.max(maxOutset, options.points.radius + options.points.lineWidth/2); | |
| } | |
| for(j = 0; j < options.length; ++j){ | |
| if (series[j].points.show){ | |
| maxOutset = Math.max(maxOutset, series[j].points.radius + series[j].points.lineWidth/2); | |
| } | |
| } | |
| var p = this.plotOffset = {left: 0, right: 0, top: 0, bottom: 0}; | |
| p.left = p.right = p.top = p.bottom = maxOutset; | |
| p.bottom += (x.options.showLabels ? (x.maxLabel.height + margin) : 0) + | |
| (x.options.title ? (x.titleSize.height + margin) : 0); | |
| p.top += (x2.options.showLabels ? (x2.maxLabel.height + margin) : 0) + | |
| (x2.options.title ? (x2.titleSize.height + margin) : 0) + this.subtitleHeight + this.titleHeight + | |
| this.options.radarChartMode ? (y.options.showLabels ? (y.maxLabel.height + margin) : 0) : 0; | |
| p.left += (y.options.showLabels ? (y.maxLabel.width + margin) : 0) + | |
| (y.options.title ? (y.titleSize.width + margin) : 0); | |
| p.right += (y2.options.showLabels ? (y2.maxLabel.width + margin) : 0) + | |
| (y2.options.title ? (y2.titleSize.width + margin) : 0) + | |
| this.options.radarChartMode ? (x.options.showLabels ? (x.maxLabel.width + margin) : 0) : 0; | |
| p.top = Math.floor(p.top); // In order the outline not to be blured | |
| this.plotWidth = this.canvasWidth - p.left - p.right; | |
| this.plotHeight = this.canvasHeight - p.bottom - p.top; | |
| x.scale = this.plotWidth / (x.max - x.min); | |
| x2.scale = this.plotWidth / (x2.max - x2.min); | |
| y.scale = this.plotHeight / (y.max - y.min); | |
| y2.scale = this.plotHeight / (y2.max - y2.min); | |
| }, | |
| /** | |
| * Draws grid, labels and series. | |
| */ | |
| draw: function() { | |
| this.drawGrid(); | |
| this.drawLabels(); | |
| this.drawTitles(); | |
| if(this.series.length){ | |
| this.el.fire('flotr:beforedraw', [this.series, this]); | |
| for(var i = 0; i < this.series.length; i++){ | |
| if (!this.series[i].hide) | |
| this.drawSeries(this.series[i]); | |
| } | |
| } | |
| this.el.fire('flotr:afterdraw', [this.series, this]); | |
| }, | |
| /** | |
| * Translates absolute horizontal x coordinates to relative coordinates. | |
| * @param {Integer} x - absolute integer x coordinate | |
| * @return {Integer} translated relative x coordinate | |
| */ | |
| tHoz: function(x, axis){ | |
| axis = axis || this.axes.x; | |
| return (x - axis.min) * axis.scale; | |
| }, | |
| /** | |
| * Translates absolute vertical x coordinates to relative coordinates. | |
| * @param {Integer} y - absolute integer y coordinate | |
| * @return {Integer} translated relative y coordinate | |
| */ | |
| tVert: function(y, axis){ | |
| axis = axis || this.axes.y; | |
| return this.plotHeight - (y - axis.min) * axis.scale; | |
| }, | |
| /** | |
| * Draws a grid for the graph. | |
| */ | |
| drawGrid: function(){ | |
| if (this.options.radarChartMode) { // If we are in radar chart mode call drawRadarGrid instead and exit | |
| this.drawRadarGrid(); | |
| return; | |
| } | |
| var v, o = this.options, | |
| ctx = this.ctx; | |
| if(o.grid.verticalLines || o.grid.horizontalLines){ | |
| this.el.fire('flotr:beforegrid', [this.axes.x, this.axes.y, o, this]); | |
| } | |
| ctx.save(); | |
| ctx.translate(this.plotOffset.left, this.plotOffset.top); | |
| // Draw grid background, if present in options. | |
| if(o.grid.backgroundColor != null){ | |
| ctx.fillStyle = o.grid.backgroundColor; | |
| ctx.fillRect(0, 0, this.plotWidth, this.plotHeight); | |
| } | |
| // Draw grid lines in vertical direction. | |
| ctx.lineWidth = 1; | |
| ctx.strokeStyle = o.grid.tickColor; | |
| ctx.beginPath(); | |
| if(o.grid.verticalLines){ | |
| for(var i = 0; i < this.axes.x.ticks.length; ++i){ | |
| v = this.axes.x.ticks[i].v; | |
| // Don't show lines on upper and lower bounds. | |
| if ((v == this.axes.x.min || v == this.axes.x.max) && o.grid.outlineWidth != 0) | |
| continue; | |
| ctx.moveTo(Math.floor(this.tHoz(v)) + ctx.lineWidth/2, 0); | |
| ctx.lineTo(Math.floor(this.tHoz(v)) + ctx.lineWidth/2, this.plotHeight); | |
| } | |
| } | |
| // Draw grid lines in horizontal direction. | |
| if(o.grid.horizontalLines){ | |
| for(var j = 0; j < this.axes.y.ticks.length; ++j){ | |
| v = this.axes.y.ticks[j].v; | |
| // Don't show lines on upper and lower bounds. | |
| if ((v == this.axes.y.min || v == this.axes.y.max) && o.grid.outlineWidth != 0) | |
| continue; | |
| ctx.moveTo(0, Math.floor(this.tVert(v)) + ctx.lineWidth/2); | |
| ctx.lineTo(this.plotWidth, Math.floor(this.tVert(v)) + ctx.lineWidth/2); | |
| } | |
| } | |
| ctx.stroke(); | |
| // Draw axis/grid border. | |
| if(o.grid.outlineWidth != 0) { | |
| ctx.lineWidth = o.grid.outlineWidth; | |
| ctx.strokeStyle = o.grid.color; | |
| ctx.lineJoin = 'round'; | |
| ctx.strokeRect(0, 0, this.plotWidth, this.plotHeight); | |
| } | |
| ctx.restore(); | |
| if(o.grid.verticalLines || o.grid.horizontalLines){ | |
| this.el.fire('flotr:aftergrid', [this.axes.x, this.axes.y, o, this]); | |
| } | |
| }, | |
| /** | |
| * Draws a grid for the graph. | |
| */ | |
| drawRadarGrid: function(){ | |
| var v, o = this.options, | |
| ctx = this.ctx; | |
| var sides = this.options.radarChartSides, | |
| degreesInRadiansForAngle = Math.PI * 2 / sides, | |
| nintyDegrees = Math.PI / 2; | |
| if(o.grid.verticalLines || o.grid.horizontalLines){ | |
| this.el.fire('flotr:beforegrid', [this.axes.x, this.axes.y, o, this]); | |
| } | |
| ctx.save(); | |
| ctx.translate(this.plotOffset.left, this.plotOffset.top); | |
| ctx.lineJoin = 'round'; | |
| // Draw grid background, if present in options. | |
| if(o.grid.backgroundColor != null){ | |
| ctx.fillStyle = o.grid.backgroundColor; | |
| ctx.fillRect(0, 0, this.plotWidth, this.plotHeight); | |
| } | |
| // Draw grid lines | |
| var regPoly = {}; | |
| regPoly.xaxis = {}; | |
| regPoly.yaxis = {}; | |
| regPoly.xaxis.min = regPoly.yaxis.min = this.axes.x.min; | |
| regPoly.xaxis.max = regPoly.yaxis.max = this.axes.x.max; | |
| regPoly.xaxis.scale = this.plotWidth / (this.axes.x.max - this.axes.x.min); | |
| regPoly.yaxis.scale = this.plotHeight / (this.axes.x.max - this.axes.x.min); | |
| ctx.lineWidth = 1; | |
| ctx.strokeStyle = o.grid.tickColor; | |
| if(o.grid.horizontalLines){ | |
| for(var j = 0; j < this.axes.y.ticks.length; ++j){ | |
| v = this.axes.y.ticks[j].v; | |
| if (v < 0) continue; | |
| // Don't show lines on upper and lower bounds. | |
| if ((v == this.axes.y.min || v == this.axes.y.max) && o.grid.outlineWidth != 0) | |
| continue; | |
| regPoly.data = new Array(); | |
| for (i = 0; i < sides; i++) { | |
| angle = nintyDegrees + (degreesInRadiansForAngle * i); | |
| regPoly.data[i] = [v * Math.cos(angle), v * Math.sin(angle)] | |
| } | |
| regPoly.data[sides] = regPoly.data[0]; | |
| this.plotLine(regPoly,0); | |
| } | |
| } | |
| // Draw axis/grid border. | |
| if(o.grid.outlineWidth != 0) { | |
| ctx.lineWidth = o.grid.outlineWidth; | |
| ctx.strokeStyle = o.grid.color; | |
| regPoly.data = new Array(); | |
| var radius = this.axes.x.max; | |
| for (i = 0; i < sides; i++) { | |
| angle = nintyDegrees + (degreesInRadiansForAngle * i); | |
| regPoly.data[i] = [radius * Math.cos(angle), radius * Math.sin(angle)] | |
| } | |
| regPoly.data[sides] = regPoly.data[0]; | |
| this.plotLine(regPoly,0); | |
| } | |
| ctx.lineWidth = 1; | |
| ctx.strokeStyle = o.grid.tickColor; | |
| ctx.beginPath(); | |
| if(o.grid.verticalLines){ | |
| for(var i = 0; i < sides; ++i){ | |
| ctx.moveTo(Math.floor(this.tHoz(0)) + ctx.lineWidth/2, | |
| Math.floor(this.tVert(0)) + ctx.lineWidth/2); | |
| ctx.lineTo(Math.floor(this.tHoz(regPoly.data[i][0])) + ctx.lineWidth/2, | |
| Math.floor(this.tVert(regPoly.data[i][1])) + ctx.lineWidth/2); | |
| } | |
| } | |
| ctx.stroke(); | |
| ctx.restore(); | |
| if(o.grid.verticalLines || o.grid.horizontalLines){ | |
| this.el.fire('flotr:aftergrid', [this.axes.x, this.axes.y, o, this]); | |
| } | |
| }, | |
| /** | |
| * Draws labels aroung radar chart | |
| */ | |
| drawRadarLabels:function(){ | |
| var ctx = this.ctx, | |
| options = this.options, | |
| axis = this.axes.x, | |
| tick, minY = 0, maxY = 0, | |
| xOffset, yOffset; | |
| var style = { | |
| size: options.fontSize, | |
| adjustAlign: true | |
| }; | |
| style.color = axis.options.color || options.grid.color; | |
| style.angle = Flotr.toRad(axis.options.labelsAngle); | |
| var radius = axis.max * 1, | |
| closeTo = axis.max * 0.1, | |
| sides = this.options.radarChartSides, | |
| degreesInRadiansForAngle = Math.PI * 2 / sides, | |
| nintyDegrees = Math.PI / 2, | |
| posdata = new Array(); | |
| for (i = 0; i < sides; i++) { | |
| angle = nintyDegrees + (degreesInRadiansForAngle * i); | |
| posdata[i] = [radius * Math.cos(angle), radius * Math.sin(angle)]; | |
| if (minY > posdata[i][1]) minY = posdata[i][1]; | |
| if (maxY < posdata[i][1]) maxY = posdata[i][1]; | |
| } | |
| for (i = 0; i < sides; i++) { | |
| tick = axis.ticks[i]; | |
| if(!tick.label || tick.label.length == 0) continue; | |
| yOffset = 0; | |
| if (posdata[i][0] > 0) { | |
| style.halign = 'l'; | |
| xOffset = options.grid.labelMargin; | |
| } else { | |
| style.halign = 'r'; | |
| xOffset = - options.grid.labelMargin; | |
| } | |
| style.valign = 'm'; | |
| if ((posdata[i][1] + closeTo) >= minY && (posdata[i][1] - closeTo) <= minY) { | |
| style.valign = 't' ; | |
| style.halign = 'c'; | |
| yOffset = options.grid.labelMargin; | |
| }; | |
| if (posdata[i][1] == maxY) { | |
| style.valign = 'b' ; | |
| style.halign = 'c'; | |
| yOffset = - options.grid.labelMargin; | |
| } | |
| ctx.drawText( | |
| tick.label, | |
| this.plotOffset.left + this.tHoz(posdata[i][0]) + xOffset, | |
| this.plotOffset.top + this.tVert(posdata[i][1]) + yOffset, | |
| style | |
| ); | |
| } | |
| }, | |
| /** | |
| * Draws labels for x and y axis. | |
| */ | |
| drawLabels: function(){ | |
| // Construct fixed width label boxes, which can be styled easily. | |
| var noLabels = 0, axis, | |
| xBoxWidth, i, html, tick, | |
| options = this.options, | |
| ctx = this.ctx, | |
| a = this.axes; | |
| for(i = 0; i < a.x.ticks.length; ++i){ | |
| if (a.x.ticks[i].label) { | |
| ++noLabels; | |
| } | |
| } | |
| xBoxWidth = this.plotWidth / noLabels; | |
| if (!options.HtmlText && this.textEnabled) { | |
| var style = { | |
| size: options.fontSize, | |
| adjustAlign: true | |
| }; | |
| // Add x labels. | |
| if (options.radarChartMode) { | |
| this.drawRadarLabels();} else { | |
| axis = a.x; | |
| style.color = axis.options.color || options.grid.color; | |
| for(i = 0; i < axis.ticks.length && axis.options.showLabels && axis.used; ++i){ | |
| tick = axis.ticks[i]; | |
| if(!tick.label || tick.label.length == 0) continue; | |
| style.angle = Flotr.toRad(axis.options.labelsAngle); | |
| style.halign = 'c'; | |
| style.valign = 't'; | |
| ctx.drawText( | |
| tick.label, | |
| this.plotOffset.left + this.tHoz(tick.v, axis), | |
| this.plotOffset.top + this.plotHeight + options.grid.labelMargin, | |
| style | |
| ); | |
| }} | |
| // Add x2 labels. | |
| axis = a.x2; | |
| style.color = axis.options.color || options.grid.color; | |
| for(i = 0; i < axis.ticks.length && axis.options.showLabels && axis.used; ++i){ | |
| tick = axis.ticks[i]; | |
| if(!tick.label || tick.label.length == 0) continue; | |
| style.angle = Flotr.toRad(axis.options.labelsAngle); | |
| style.halign = 'c'; | |
| style.valign = 'b'; | |
| ctx.drawText( | |
| tick.label, | |
| this.plotOffset.left + this.tHoz(tick.v, axis), | |
| this.plotOffset.top + options.grid.labelMargin, | |
| style | |
| ); | |
| } | |
| // Add y labels. | |
| axis = a.y; | |
| style.color = axis.options.color || options.grid.color; | |
| for(i = 0; i < axis.ticks.length && axis.options.showLabels && axis.used; ++i){ | |
| tick = axis.ticks[i]; | |
| if (!tick.label || tick.label.length == 0 || (tick.v < 0 && this.options.radarChartMode)) continue; | |
| style.angle = Flotr.toRad(axis.options.labelsAngle); | |
| style.halign = 'r'; | |
| style.valign = 'm'; | |
| ctx.drawText( | |
| tick.label, | |
| this.plotOffset.left + (this.options.radarChartMode ? this.tHoz(0) : 0) - options.grid.labelMargin, | |
| this.plotOffset.top + this.tVert(tick.v, axis), | |
| style | |
| ); | |
| } | |
| // Add y2 labels. | |
| axis = a.y2; | |
| style.color = axis.options.color || options.grid.color; | |
| for(i = 0; i < axis.ticks.length && axis.options.showLabels && axis.used; ++i){ | |
| tick = axis.ticks[i]; | |
| if (!tick.label || tick.label.length == 0) continue; | |
| style.angle = Flotr.toRad(axis.options.labelsAngle); | |
| style.halign = 'l'; | |
| style.valign = 'm'; | |
| ctx.drawText( | |
| tick.label, | |
| this.plotOffset.left + this.plotWidth + options.grid.labelMargin, | |
| this.plotOffset.top + this.tVert(tick.v, axis), | |
| style | |
| ); | |
| ctx.save(); | |
| ctx.strokeStyle = style.color; | |
| ctx.beginPath(); | |
| ctx.moveTo(this.plotOffset.left + this.plotWidth - 8, this.plotOffset.top + this.tVert(tick.v, axis)); | |
| ctx.lineTo(this.plotOffset.left + this.plotWidth, this.plotOffset.top + this.tVert(tick.v, axis)); | |
| ctx.stroke(); | |
| ctx.restore(); | |
| } | |
| } | |
| else if (a.x.options.showLabels || | |
| a.x2.options.showLabels || | |
| a.y.options.showLabels || | |
| a.y2.options.showLabels) { | |
| html = ['<div style="font-size:smaller;color:' + options.grid.color + ';" class="flotr-labels">']; | |
| // Add x labels. | |
| axis = a.x; | |
| if (axis.options.showLabels){ | |
| for(i = 0; i < axis.ticks.length; ++i){ | |
| tick = axis.ticks[i]; | |
| if(!tick.label || tick.label.length == 0) continue; | |
| html.push('<div style="position:absolute;top:' + (this.plotOffset.top + this.plotHeight + options.grid.labelMargin) + 'px;left:' + (this.plotOffset.left + this.tHoz(tick.v, axis) - xBoxWidth/2) + 'px;width:' + xBoxWidth + 'px;text-align:center;'+(axis.options.color?('color:'+axis.options.color+';'):'')+'" class="flotr-grid-label">' + tick.label + '</div>'); | |
| } | |
| } | |
| // Add x2 labels. | |
| axis = a.x2; | |
| if (axis.options.showLabels && axis.used){ | |
| for(i = 0; i < axis.ticks.length; ++i){ | |
| tick = axis.ticks[i]; | |
| if(!tick.label || tick.label.length == 0) continue; | |
| html.push('<div style="position:absolute;top:' + (this.plotOffset.top - options.grid.labelMargin - axis.maxLabel.height) + 'px;left:' + (this.plotOffset.left + this.tHoz(tick.v, axis) - xBoxWidth/2) + 'px;width:' + xBoxWidth + 'px;text-align:center;'+(axis.options.color?('color:'+axis.options.color+';'):'')+'" class="flotr-grid-label">' + tick.label + '</div>'); | |
| } | |
| } | |
| // Add y labels. | |
| axis = a.y; | |
| if (axis.options.showLabels){ | |
| for(i = 0; i < axis.ticks.length; ++i){ | |
| tick = axis.ticks[i]; | |
| if (!tick.label || tick.label.length == 0) continue; | |
| html.push('<div style="position:absolute;top:' + (this.plotOffset.top + this.tVert(tick.v, axis) - axis.maxLabel.height/2) + 'px;left:0;width:' + (this.plotOffset.left - options.grid.labelMargin) + 'px;text-align:right;'+(axis.options.color?('color:'+axis.options.color+';'):'')+'" class="flotr-grid-label">' + tick.label + '</div>'); | |
| } | |
| } | |
| // Add y2 labels. | |
| axis = a.y2; | |
| if (axis.options.showLabels && axis.used){ | |
| ctx.save(); | |
| ctx.strokeStyle = axis.options.color || options.grid.color; | |
| ctx.beginPath(); | |
| for(i = 0; i < axis.ticks.length; ++i){ | |
| tick = axis.ticks[i]; | |
| if (!tick.label || tick.label.length == 0) continue; | |
| html.push('<div style="position:absolute;top:' + (this.plotOffset.top + this.tVert(tick.v, axis) - axis.maxLabel.height/2) + 'px;right:0;width:' + (this.plotOffset.right - options.grid.labelMargin) + 'px;text-align:left;'+(axis.options.color?('color:'+axis.options.color+';'):'')+'" class="flotr-grid-label">' + tick.label + '</div>'); | |
| ctx.moveTo(this.plotOffset.left + this.plotWidth - 8, this.plotOffset.top + this.tVert(tick.v, axis)); | |
| ctx.lineTo(this.plotOffset.left + this.plotWidth, this.plotOffset.top + this.tVert(tick.v, axis)); | |
| } | |
| ctx.stroke(); | |
| ctx.restore(); | |
| } | |
| html.push('</div>'); | |
| this.el.insert(html.join('')); | |
| } | |
| }, | |
| /** | |
| * Draws the title and the subtitle | |
| */ | |
| drawTitles: function(){ | |
| var html, | |
| options = this.options, | |
| margin = options.grid.labelMargin, | |
| ctx = this.ctx, | |
| a = this.axes; | |
| if (!options.HtmlText && this.textEnabled) { | |
| var style = { | |
| size: options.fontSize, | |
| color: options.grid.color, | |
| halign: 'c' | |
| }; | |
| // Add subtitle | |
| if (options.subtitle){ | |
| ctx.drawText( | |
| options.subtitle, | |
| this.plotOffset.left + this.plotWidth/2, | |
| this.titleHeight + this.subtitleHeight - 2, | |
| style | |
| ); | |
| } | |
| style.weight = 1.5; | |
| style.size *= 1.5; | |
| // Add title | |
| if (options.title){ | |
| ctx.drawText( | |
| options.title, | |
| this.plotOffset.left + this.plotWidth/2, | |
| this.titleHeight - 2, | |
| style | |
| ); | |
| } | |
| style.weight = 1.8; | |
| style.size *= 0.8; | |
| style.adjustAlign = true; | |
| // Add x axis title | |
| if (a.x.options.title && a.x.used){ | |
| style.halign = 'c'; | |
| style.valign = 't'; | |
| style.angle = Flotr.toRad(a.x.options.titleAngle); | |
| ctx.drawText( | |
| a.x.options.title, | |
| this.plotOffset.left + this.plotWidth/2, | |
| this.plotOffset.top + a.x.maxLabel.height + this.plotHeight + 2 * margin, | |
| style | |
| ); | |
| } | |
| // Add x2 axis title | |
| if (a.x2.options.title && a.x2.used){ | |
| style.halign = 'c'; | |
| style.valign = 'b'; | |
| style.angle = Flotr.toRad(a.x2.options.titleAngle); | |
| ctx.drawText( | |
| a.x2.options.title, | |
| this.plotOffset.left + this.plotWidth/2, | |
| this.plotOffset.top - a.x2.maxLabel.height - 2 * margin, | |
| style | |
| ); | |
| } | |
| // Add y axis title | |
| if (a.y.options.title && a.y.used){ | |
| style.halign = 'r'; | |
| style.valign = 'm'; | |
| style.angle = Flotr.toRad(a.y.options.titleAngle); | |
| ctx.drawText( | |
| a.y.options.title, | |
| this.plotOffset.left - a.y.maxLabel.width - 2 * margin, | |
| this.plotOffset.top + this.plotHeight / 2, | |
| style | |
| ); | |
| } | |
| // Add y2 axis title | |
| if (a.y2.options.title && a.y2.used){ | |
| style.halign = 'l'; | |
| style.valign = 'm'; | |
| style.angle = Flotr.toRad(a.y2.options.titleAngle); | |
| ctx.drawText( | |
| a.y2.options.title, | |
| this.plotOffset.left + this.plotWidth + a.y2.maxLabel.width + 2 * margin, | |
| this.plotOffset.top + this.plotHeight / 2, | |
| style | |
| ); | |
| } | |
| } | |
| else { | |
| html = ['<div style="color:'+options.grid.color+';" class="flotr-titles">']; | |
| // Add title | |
| if (options.title){ | |
| html.push('<div style="position:absolute;top:0;left:'+this.plotOffset.left+'px;font-size:1em;font-weight:bold;text-align:center;width:'+this.plotWidth+'px;" class="flotr-title">'+options.title+'</div>'); | |
| } | |
| // Add subtitle | |
| if (options.subtitle){ | |
| html.push('<div style="position:absolute;top:'+this.titleHeight+'px;left:'+this.plotOffset.left+'px;font-size:smaller;text-align:center;width:'+this.plotWidth+'px;" class="flotr-subtitle">'+options.subtitle+'</div>'); | |
| } | |
| html.push('</div>'); | |
| html.push('<div class="flotr-axis-title" style="font-weight:bold;">'); | |
| // Add x axis title | |
| if (a.x.options.title && a.x.used){ | |
| html.push('<div style="position:absolute;top:' + (this.plotOffset.top + this.plotHeight + options.grid.labelMargin + a.x.titleSize.height) + 'px;left:' + this.plotOffset.left + 'px;width:' + this.plotWidth + 'px;text-align:center;" class="flotr-axis-title">' + a.x.options.title + '</div>'); | |
| } | |
| // Add x2 axis title | |
| if (a.x2.options.title && a.x2.used){ | |
| html.push('<div style="position:absolute;top:0;left:' + this.plotOffset.left + 'px;width:' + this.plotWidth + 'px;text-align:center;" class="flotr-axis-title">' + a.x2.options.title + '</div>'); | |
| } | |
| // Add y axis title | |
| if (a.y.options.title && a.y.used){ | |
| html.push('<div style="position:absolute;top:' + (this.plotOffset.top + this.plotHeight/2 - a.y.titleSize.height/2) + 'px;left:0;text-align:right;" class="flotr-axis-title">' + a.y.options.title + '</div>'); | |
| } | |
| // Add y2 axis title | |
| if (a.y2.options.title && a.y2.used){ | |
| html.push('<div style="position:absolute;top:' + (this.plotOffset.top + this.plotHeight/2 - a.y.titleSize.height/2) + 'px;right:0;text-align:right;" class="flotr-axis-title">' + a.y2.options.title + '</div>'); | |
| } | |
| html.push('</div>'); | |
| this.el.insert(html.join('')); | |
| } | |
| }, | |
| /** | |
| * Actually draws the graph. | |
| * @param {Object} series - series to draw | |
| */ | |
| drawSeries: function(series){ | |
| series = series || this.series; | |
| var drawn = false; | |
| for(var type in Flotr._registeredTypes){ | |
| if(series[type] && series[type].show){ | |
| this[Flotr._registeredTypes[type]](series); | |
| drawn = true; | |
| } | |
| } | |
| if(!drawn){ | |
| this[Flotr._registeredTypes[this.options.defaultType]](series); | |
| } | |
| }, | |
| plotLine: function(series, offset){ | |
| var ctx = this.ctx, | |
| xa = series.xaxis, | |
| ya = series.yaxis, | |
| tHoz = this.tHoz.bind(this), | |
| tVert = this.tVert.bind(this), | |
| data = series.data; | |
| if(data.length < 2) return; | |
| var prevx = tHoz(data[0][0], xa), | |
| prevy = tVert(data[0][1], ya) + offset; | |
| ctx.beginPath(); | |
| ctx.moveTo(prevx, prevy); | |
| for(var i = 0; i < data.length - 1; ++i){ | |
| var x1 = data[i][0], y1 = data[i][1], | |
| x2 = data[i+1][0], y2 = data[i+1][1]; | |
| // To allow empty values | |
| if (y1 === null || y2 === null) continue; | |
| /** | |
| * Clip with ymin. | |
| */ | |
| if(y1 <= y2 && y1 < ya.min){ | |
| /** | |
| * Line segment is outside the drawing area. | |
| */ | |
| if(y2 < ya.min) continue; | |
| /** | |
| * Compute new intersection point. | |
| */ | |
| x1 = (ya.min - y1) / (y2 - y1) * (x2 - x1) + x1; | |
| y1 = ya.min; | |
| }else if(y2 <= y1 && y2 < ya.min){ | |
| if(y1 < ya.min) continue; | |
| x2 = (ya.min - y1) / (y2 - y1) * (x2 - x1) + x1; | |
| y2 = ya.min; | |
| } | |
| /** | |
| * Clip with ymax. | |
| */ | |
| if(y1 >= y2 && y1 > ya.max) { | |
| if(y2 > ya.max) continue; | |
| x1 = (ya.max - y1) / (y2 - y1) * (x2 - x1) + x1; | |
| y1 = ya.max; | |
| } | |
| else if(y2 >= y1 && y2 > ya.max){ | |
| if(y1 > ya.max) continue; | |
| x2 = (ya.max - y1) / (y2 - y1) * (x2 - x1) + x1; | |
| y2 = ya.max; | |
| } | |
| /** | |
| * Clip with xmin. | |
| */ | |
| if(x1 <= x2 && x1 < xa.min){ | |
| if(x2 < xa.min) continue; | |
| y1 = (xa.min - x1) / (x2 - x1) * (y2 - y1) + y1; | |
| x1 = xa.min; | |
| }else if(x2 <= x1 && x2 < xa.min){ | |
| if(x1 < xa.min) continue; | |
| y2 = (xa.min - x1) / (x2 - x1) * (y2 - y1) + y1; | |
| x2 = xa.min; | |
| } | |
| /** | |
| * Clip with xmax. | |
| */ | |
| if(x1 >= x2 && x1 > xa.max){ | |
| if (x2 > xa.max) continue; | |
| y1 = (xa.max - x1) / (x2 - x1) * (y2 - y1) + y1; | |
| x1 = xa.max; | |
| }else if(x2 >= x1 && x2 > xa.max){ | |
| if(x1 > xa.max) continue; | |
| y2 = (xa.max - x1) / (x2 - x1) * (y2 - y1) + y1; | |
| x2 = xa.max; | |
| } | |
| if(prevx != tHoz(x1, xa) || prevy != tVert(y1, ya) + offset) | |
| ctx.moveTo(tHoz(x1, xa), tVert(y1, ya) + offset); | |
| prevx = tHoz(x2, xa); | |
| prevy = tVert(y2, ya) + offset; | |
| ctx.lineTo(prevx, prevy); | |
| } | |
| ctx.stroke(); | |
| }, | |
| /** | |
| * Function used to fill | |
| * @param {Object} data | |
| */ | |
| plotLineArea: function(series, offset){ | |
| var data = series.data; | |
| if(data.length < 2) return; | |
| var top, lastX = 0, | |
| ctx = this.ctx, | |
| xa = series.xaxis, | |
| ya = series.yaxis, | |
| tHoz = this.tHoz.bind(this), | |
| tVert = this.tVert.bind(this), | |
| bottom = Math.min(Math.max(0, ya.min), ya.max), | |
| first = true; | |
| ctx.beginPath(); | |
| for(var i = 0; i < data.length - 1; ++i){ | |
| var x1 = data[i][0], y1 = data[i][1], | |
| x2 = data[i+1][0], y2 = data[i+1][1]; | |
| if(x1 <= x2 && x1 < xa.min){ | |
| if(x2 < xa.min) continue; | |
| y1 = (xa.min - x1) / (x2 - x1) * (y2 - y1) + y1; | |
| x1 = xa.min; | |
| }else if(x2 <= x1 && x2 < xa.min){ | |
| if(x1 < xa.min) continue; | |
| y2 = (xa.min - x1) / (x2 - x1) * (y2 - y1) + y1; | |
| x2 = xa.min; | |
| } | |
| if(x1 >= x2 && x1 > xa.max){ | |
| if(x2 > xa.max) continue; | |
| y1 = (xa.max - x1) / (x2 - x1) * (y2 - y1) + y1; | |
| x1 = xa.max; | |
| }else if(x2 >= x1 && x2 > xa.max){ | |
| if (x1 > xa.max) continue; | |
| y2 = (xa.max - x1) / (x2 - x1) * (y2 - y1) + y1; | |
| x2 = xa.max; | |
| } | |
| if(first){ | |
| ctx.moveTo(tHoz(x1, xa), tVert(bottom, ya) + offset); | |
| first = false; | |
| } | |
| /** | |
| * Now check the case where both is outside. | |
| */ | |
| if(y1 >= ya.max && y2 >= ya.max){ | |
| ctx.lineTo(tHoz(x1, xa), tVert(ya.max, ya) + offset); | |
| ctx.lineTo(tHoz(x2, xa), tVert(ya.max, ya) + offset); | |
| continue; | |
| }else if(y1 <= ya.min && y2 <= ya.min){ | |
| ctx.lineTo(tHoz(x1, xa), tVert(ya.min, ya) + offset); | |
| ctx.lineTo(tHoz(x2, xa), tVert(ya.min, ya) + offset); | |
| continue; | |
| } | |
| /** | |
| * Else it's a bit more complicated, there might | |
| * be two rectangles and two triangles we need to fill | |
| * in; to find these keep track of the current x values. | |
| */ | |
| var x1old = x1, x2old = x2; | |
| /** | |
| * And clip the y values, without shortcutting. | |
| * Clip with ymin. | |
| */ | |
| if(y1 <= y2 && y1 < ya.min && y2 >= ya.min){ | |
| x1 = (ya.min - y1) / (y2 - y1) * (x2 - x1) + x1; | |
| y1 = ya.min; | |
| }else if(y2 <= y1 && y2 < ya.min && y1 >= ya.min){ | |
| x2 = (ya.min - y1) / (y2 - y1) * (x2 - x1) + x1; | |
| y2 = ya.min; | |
| } | |
| /** | |
| * Clip with ymax. | |
| */ | |
| if(y1 >= y2 && y1 > ya.max && y2 <= ya.max){ | |
| x1 = (ya.max - y1) / (y2 - y1) * (x2 - x1) + x1; | |
| y1 = ya.max; | |
| }else if(y2 >= y1 && y2 > ya.max && y1 <= ya.max){ | |
| x2 = (ya.max - y1) / (y2 - y1) * (x2 - x1) + x1; | |
| y2 = ya.max; | |
| } | |
| /** | |
| * If the x value was changed we got a rectangle to fill. | |
| */ | |
| if(x1 != x1old){ | |
| top = (y1 <= ya.min) ? top = ya.min : ya.max; | |
| ctx.lineTo(tHoz(x1old, xa), tVert(top, ya) + offset); | |
| ctx.lineTo(tHoz(x1, xa), tVert(top, ya) + offset); | |
| } | |
| /** | |
| * Fill the triangles. | |
| */ | |
| ctx.lineTo(tHoz(x1, xa), tVert(y1, ya) + offset); | |
| ctx.lineTo(tHoz(x2, xa), tVert(y2, ya) + offset); | |
| /** | |
| * Fill the other rectangle if it's there. | |
| */ | |
| if(x2 != x2old){ | |
| top = (y2 <= ya.min) ? ya.min : ya.max; | |
| ctx.lineTo(tHoz(x2old, xa), tVert(top, ya) + offset); | |
| ctx.lineTo(tHoz(x2, xa), tVert(top, ya) + offset); | |
| } | |
| lastX = Math.max(x2, x2old); | |
| } | |
| ctx.lineTo(tHoz(lastX, xa), tVert(bottom, ya) + offset); | |
| ctx.closePath(); | |
| ctx.fill(); | |
| }, | |
| /** | |
| * Function: (private) drawSeriesLines | |
| * | |
| * Function draws lines series in the canvas element. | |
| * | |
| * Parameters: | |
| * series - Series with options.lines.show = true. | |
| * | |
| * Returns: | |
| * void | |
| */ | |
| drawSeriesLines: function(series){ | |
| series = series || this.series; | |
| var ctx = this.ctx; | |
| ctx.save(); | |
| ctx.translate(this.plotOffset.left, this.plotOffset.top); | |
| ctx.lineJoin = 'round'; | |
| var lw = series.lines.lineWidth; | |
| var sw = series.shadowSize; | |
| if(sw > 0){ | |
| ctx.lineWidth = sw / 2; | |
| var offset = lw/2 + ctx.lineWidth/2; | |
| ctx.strokeStyle = "rgba(0,0,0,0.1)"; | |
| this.plotLine(series, offset + sw/2); | |
| ctx.strokeStyle = "rgba(0,0,0,0.2)"; | |
| this.plotLine(series, offset); | |
| if(series.lines.fill) { | |
| ctx.fillStyle = "rgba(0,0,0,0.05)"; | |
| this.plotLineArea(series, offset + sw/2); | |
| } | |
| } | |
| ctx.lineWidth = lw; | |
| ctx.strokeStyle = series.color; | |
| if(series.lines.fill){ | |
| ctx.fillStyle = series.lines.fillColor != null ? series.lines.fillColor : Flotr.parseColor(series.color).scale(null, null, null, series.lines.fillOpacity).toString(); | |
| this.plotLineArea(series, 0); | |
| } | |
| this.plotLine(series, 0); | |
| ctx.restore(); | |
| }, | |
| /** | |
| * Function: drawSeriesPoints | |
| * | |
| * Function draws point series in the canvas element. | |
| * | |
| * Parameters: | |
| * series - Series with options.points.show = true. | |
| * | |
| * Returns: | |
| * void | |
| */ | |
| drawSeriesPoints: function(series) { | |
| var ctx = this.ctx; | |
| ctx.save(); | |
| ctx.translate(this.plotOffset.left, this.plotOffset.top); | |
| var lw = series.lines.lineWidth; | |
| var sw = series.shadowSize; | |
| if(sw > 0){ | |
| ctx.lineWidth = sw / 2; | |
| ctx.strokeStyle = 'rgba(0,0,0,0.1)'; | |
| this.plotPointShadows(series, sw/2 + ctx.lineWidth/2, series.points.radius); | |
| ctx.strokeStyle = 'rgba(0,0,0,0.2)'; | |
| this.plotPointShadows(series, ctx.lineWidth/2, series.points.radius); | |
| } | |
| ctx.lineWidth = series.points.lineWidth; | |
| ctx.strokeStyle = series.color; | |
| ctx.fillStyle = series.points.fillColor != null ? series.points.fillColor : series.color; | |
| this.plotPoints(series, series.points.radius, series.points.fill); | |
| ctx.restore(); | |
| }, | |
| plotPoints: function (series, radius, fill) { | |
| var xa = series.xaxis, | |
| ya = series.yaxis, | |
| ctx = this.ctx, i, | |
| data = series.data; | |
| for(i = data.length - 1; i > -1; --i){ | |
| var x = data[i][0], y = data[i][1]; | |
| if(x < xa.min || x > xa.max || y < ya.min || y > ya.max) | |
| continue; | |
| ctx.beginPath(); | |
| ctx.arc(this.tHoz(x, xa), this.tVert(y, ya), radius, 0, 2 * Math.PI, true); | |
| if(fill) ctx.fill(); | |
| ctx.stroke(); | |
| } | |
| }, | |
| plotPointShadows: function(series, offset, radius){ | |
| var xa = series.xaxis, | |
| ya = series.yaxis, | |
| ctx = this.ctx, i, | |
| data = series.data; | |
| for(i = data.length - 1; i > -1; --i){ | |
| var x = data[i][0], y = data[i][1]; | |
| if (x < xa.min || x > xa.max || y < ya.min || y > ya.max) | |
| continue; | |
| ctx.beginPath(); | |
| ctx.arc(this.tHoz(x, xa), this.tVert(y, ya) + offset, radius, 0, Math.PI, false); | |
| ctx.stroke(); | |
| } | |
| }, | |
| /** | |
| * Function: drawSeriesBars | |
| * | |
| * Function draws bar series in the canvas element. | |
| * | |
| * Parameters: | |
| * series - Series with options.bars.show = true. | |
| * | |
| * Returns: | |
| * void | |
| */ | |
| drawSeriesBars: function(series) { | |
| var ctx = this.ctx, | |
| bw = series.bars.barWidth, | |
| lw = Math.min(series.bars.lineWidth, bw); | |
| ctx.save(); | |
| ctx.translate(this.plotOffset.left, this.plotOffset.top); | |
| ctx.lineJoin = 'miter'; | |
| /** | |
| * @todo linewidth not interpreted the right way. | |
| */ | |
| ctx.lineWidth = lw; | |
| ctx.strokeStyle = series.color; | |
| this.plotBarsShadows(series, bw, 0, series.bars.fill); | |
| if(series.bars.fill){ | |
| ctx.fillStyle = series.bars.fillColor != null ? series.bars.fillColor : Flotr.parseColor(series.color).scale(null, null, null, series.bars.fillOpacity).toString(); | |
| } | |
| this.plotBars(series, bw, 0, series.bars.fill); | |
| ctx.restore(); | |
| }, | |
| plotBars: function(series, barWidth, offset, fill){ | |
| var data = series.data; | |
| if(data.length < 1) return; | |
| var xa = series.xaxis, | |
| ya = series.yaxis, | |
| ctx = this.ctx, | |
| tHoz = this.tHoz.bind(this), | |
| tVert = this.tVert.bind(this); | |
| for(var i = 0; i < data.length; i++){ | |
| var x = data[i][0], | |
| y = data[i][1]; | |
| var drawLeft = true, drawTop = true, drawRight = true; | |
| // Stacked bars | |
| var stackOffset = 0; | |
| if(series.bars.stacked) { | |
| xa.values.each(function(o, v) { | |
| if (v == x) { | |
| stackOffset = o.stack || 0; | |
| o.stack = stackOffset + y; | |
| } | |
| }); | |
| } | |
| // @todo: fix horizontal bars support | |
| // Horizontal bars | |
| if(series.bars.horizontal) | |
| var left = stackOffset, right = x + stackOffset, bottom = y, top = y + barWidth; | |
| else | |
| var left = x, right = x + barWidth, bottom = stackOffset, top = y + stackOffset; | |
| if(right < xa.min || left > xa.max || top < ya.min || bottom > ya.max) | |
| continue; | |
| if(left < xa.min){ | |
| left = xa.min; | |
| drawLeft = false; | |
| } | |
| if(right > xa.max){ | |
| right = xa.max; | |
| if (xa.lastSerie != series && series.bars.horizontal) | |
| drawTop = false; | |
| } | |
| if(bottom < ya.min) | |
| bottom = ya.min; | |
| if(top > ya.max){ | |
| top = ya.max; | |
| if (ya.lastSerie != series && !series.bars.horizontal) | |
| drawTop = false; | |
| } | |
| /** | |
| * Fill the bar. | |
| */ | |
| if(fill){ | |
| ctx.beginPath(); | |
| ctx.moveTo(tHoz(left, xa), tVert(bottom, ya) + offset); | |
| ctx.lineTo(tHoz(left, xa), tVert(top, ya) + offset); | |
| ctx.lineTo(tHoz(right, xa), tVert(top, ya) + offset); | |
| ctx.lineTo(tHoz(right, xa), tVert(bottom, ya) + offset); | |
| ctx.fill(); | |
| } | |
| /** | |
| * Draw bar outline/border. | |
| */ | |
| if(series.bars.lineWidth != 0 && (drawLeft || drawRight || drawTop)){ | |
| ctx.beginPath(); | |
| ctx.moveTo(tHoz(left, xa), tVert(bottom, ya) + offset); | |
| ctx[drawLeft ?'lineTo':'moveTo'](tHoz(left, xa), tVert(top, ya) + offset); | |
| ctx[drawTop ?'lineTo':'moveTo'](tHoz(right, xa), tVert(top, ya) + offset); | |
| ctx[drawRight?'lineTo':'moveTo'](tHoz(right, xa), tVert(bottom, ya) + offset); | |
| ctx.stroke(); | |
| } | |
| } | |
| }, | |
| plotBarsShadows: function(series, barWidth, offset){ | |
| var data = series.data; | |
| if(data.length < 1) return; | |
| var xa = series.xaxis, | |
| ya = series.yaxis, | |
| ctx = this.ctx, | |
| tHoz = this.tHoz.bind(this), | |
| tVert = this.tVert.bind(this), | |
| sw = this.options.shadowSize; | |
| for(var i = 0; i < data.length; i++){ | |
| var x = data[i][0], | |
| y = data[i][1]; | |
| // Stacked bars | |
| var stackOffset = 0; | |
| if(series.bars.stacked) { | |
| xa.values.each(function(o, v) { | |
| if (v == x) { | |
| stackOffset = o.stackShadow || 0; | |
| o.stackShadow = stackOffset + y; | |
| } | |
| }); | |
| } | |
| // Horizontal bars | |
| if(series.bars.horizontal) | |
| var left = stackOffset, right = x + stackOffset, bottom = y, top = y + barWidth; | |
| else | |
| var left = x, right = x + barWidth, bottom = stackOffset, top = y + stackOffset; | |
| if(right < xa.min || left > xa.max || top < ya.min || bottom > ya.max) | |
| continue; | |
| if(left < xa.min) left = xa.min; | |
| if(right > xa.max) right = xa.max; | |
| if(bottom < ya.min) bottom = ya.min; | |
| if(top > ya.max) top = ya.max; | |
| var width = tHoz(right, xa)-tHoz(left, xa)-((tHoz(right, xa)+sw <= this.plotWidth) ? 0 : sw); | |
| var height = Math.max(0, tVert(bottom, ya)-tVert(top, ya)-((tVert(bottom, ya)+sw <= this.plotHeight) ? 0 : sw)); | |
| ctx.fillStyle = 'rgba(0,0,0,0.05)'; | |
| ctx.fillRect(Math.min(tHoz(left, xa)+sw, this.plotWidth), Math.min(tVert(top, ya)+sw, this.plotWidth), width, height); | |
| } | |
| }, | |
| /** | |
| * Function: drawSeriesCandles | |
| * | |
| * Function draws candles series in the canvas element. | |
| * | |
| * Parameters: | |
| * series - Series with options.candles.show = true. | |
| * | |
| * Returns: | |
| * void | |
| */ | |
| drawSeriesCandles: function(series) { | |
| var ctx = this.ctx, | |
| bw = series.candles.candleWidth; | |
| ctx.save(); | |
| ctx.translate(this.plotOffset.left, this.plotOffset.top); | |
| ctx.lineJoin = 'miter'; | |
| /** | |
| * @todo linewidth not interpreted the right way. | |
| */ | |
| ctx.lineWidth = series.candles.lineWidth; | |
| this.plotCandlesShadows(series, bw/2); | |
| this.plotCandles(series, bw/2); | |
| ctx.restore(); | |
| }, | |
| plotCandles: function(series, offset){ | |
| var data = series.data; | |
| if(data.length < 1) return; | |
| var xa = series.xaxis, | |
| ya = series.yaxis, | |
| ctx = this.ctx, | |
| tHoz = this.tHoz.bind(this), | |
| tVert = this.tVert.bind(this); | |
| for(var i = 0; i < data.length; i++){ | |
| var d = data[i], | |
| x = d[0], | |
| open = d[1], | |
| high = d[2], | |
| low = d[3], | |
| close = d[4]; | |
| var left = x, | |
| right = x + series.candles.candleWidth, | |
| bottom = Math.max(ya.min, low), | |
| top = Math.min(ya.max, high), | |
| bottom2 = Math.max(ya.min, Math.min(open, close)), | |
| top2 = Math.min(ya.max, Math.max(open, close)); | |
| if(right < xa.min || left > xa.max || top < ya.min || bottom > ya.max) | |
| continue; | |
| var color = series.candles[open>close?'downFillColor':'upFillColor']; | |
| /** | |
| * Fill the candle. | |
| */ | |
| if(series.candles.fill && !series.candles.barcharts){ | |
| ctx.fillStyle = Flotr.parseColor(color).scale(null, null, null, series.candles.fillOpacity).toString(); | |
| ctx.fillRect(tHoz(left, xa), tVert(top2, ya) + offset, tHoz(right, xa) - tHoz(left, xa), tVert(bottom2, ya) - tVert(top2, ya)); | |
| } | |
| /** | |
| * Draw candle outline/border, high, low. | |
| */ | |
| if(series.candles.lineWidth || series.candles.wickLineWidth){ | |
| var x, y, pixelOffset = (series.candles.wickLineWidth % 2) / 2; | |
| x = Math.floor(tHoz((left + right) / 2), xa) + pixelOffset; | |
| ctx.save(); | |
| ctx.strokeStyle = color; | |
| ctx.lineWidth = series.candles.wickLineWidth; | |
| ctx.lineCap = 'butt'; | |
| if (series.candles.barcharts) { | |
| ctx.beginPath(); | |
| ctx.moveTo(x, Math.floor(tVert(top, ya) + offset)); | |
| ctx.lineTo(x, Math.floor(tVert(bottom, ya) + offset)); | |
| y = Math.floor(tVert(open, ya) + offset)+0.5; | |
| ctx.moveTo(Math.floor(tHoz(left, xa))+pixelOffset, y); | |
| ctx.lineTo(x, y); | |
| y = Math.floor(tVert(close, ya) + offset)+0.5; | |
| ctx.moveTo(Math.floor(tHoz(right, xa))+pixelOffset, y); | |
| ctx.lineTo(x, y); | |
| } | |
| else { | |
| ctx.strokeRect(tHoz(left, xa), tVert(top2, ya) + offset, tHoz(right, xa) - tHoz(left, xa), tVert(bottom2, ya) - tVert(top2, ya)); | |
| ctx.beginPath(); | |
| ctx.moveTo(x, Math.floor(tVert(top2, ya) + offset)); | |
| ctx.lineTo(x, Math.floor(tVert(top, ya) + offset)); | |
| ctx.moveTo(x, Math.floor(tVert(bottom2, ya) + offset)); | |
| ctx.lineTo(x, Math.floor(tVert(bottom, ya) + offset)); | |
| } | |
| ctx.stroke(); | |
| ctx.restore(); | |
| } | |
| } | |
| }, | |
| plotCandlesShadows: function(series, offset){ | |
| var data = series.data; | |
| if(data.length < 1 || series.candles.barcharts) return; | |
| var xa = series.xaxis, | |
| ya = series.yaxis, | |
| tHoz = this.tHoz.bind(this), | |
| tVert = this.tVert.bind(this), | |
| sw = this.options.shadowSize; | |
| for(var i = 0; i < data.length; i++){ | |
| var d = data[i], | |
| x = d[0], | |
| open = d[1], | |
| high = d[2], | |
| low = d[3], | |
| close = d[4]; | |
| var left = x, | |
| right = x + series.candles.candleWidth, | |
| bottom = Math.max(ya.min, Math.min(open, close)), | |
| top = Math.min(ya.max, Math.max(open, close)); | |
| if(right < xa.min || left > xa.max || top < ya.min || bottom > ya.max) | |
| continue; | |
| var width = tHoz(right, xa)-tHoz(left, xa)-((tHoz(right, xa)+sw <= this.plotWidth) ? 0 : sw); | |
| var height = Math.max(0, tVert(bottom, ya)-tVert(top, ya)-((tVert(bottom, ya)+sw <= this.plotHeight) ? 0 : sw)); | |
| this.ctx.fillStyle = 'rgba(0,0,0,0.05)'; | |
| this.ctx.fillRect(Math.min(tHoz(left, xa)+sw, this.plotWidth), Math.min(tVert(top, ya)+sw, this.plotWidth), width, height); | |
| } | |
| }, | |
| /** | |
| * Function: drawSeriesRadar | |
| * | |
| * Function draws a radar chart on the canvas element. | |
| * | |
| * Parameters: | |
| * series - Series with options.radar.show = true. | |
| * | |
| * Returns: | |
| * void | |
| */ | |
| drawSeriesRadar: function(series) { | |
| var ctx = this.ctx, | |
| options = this.options, sides= series.data.length; | |
| var degreesInRadiansForAngle = Math.PI * 2 / sides, | |
| nintyDegrees = Math.PI / 2; | |
| var poly = {}; | |
| /* | |
| Draw radar grid | |
| poly.xaxis = series.xaxis; | |
| poly.yaxis = series.yaxis; | |
| ctx.save(); | |
| ctx.translate(this.plotOffset.left, this.plotOffset.top); | |
| ctx.lineJoin = 'round'; | |
| for (radius = 20; radius <= 100; radius += 20) { | |
| poly.data = new Array(); | |
| for (i = 0; i < sides; i++) { | |
| angle = nintyDegrees + (degreesInRadiansForAngle * i); | |
| poly.data[i] = [radius * Math.cos(angle), radius * Math.sin(angle)] | |
| } | |
| poly.data[sides] = poly.data[0]; | |
| this.plotLine(poly,0);} | |
| var outside = poly.data; | |
| for (i = 0; i < sides; i++) { | |
| poly.data = new Array(); | |
| poly.data[0] = [0,0]; | |
| poly.data[1] = outside[i]; | |
| this.plotLine(poly,0); | |
| } | |
| */ | |
| /* | |
| Convert Series data into X, Y co-ordinates | |
| */ | |
| if (!series.dataInRadarFormat) { | |
| poly.data = new Array(); | |
| for (i = 0; i < sides; i++) { | |
| angle = nintyDegrees + (degreesInRadiansForAngle * i); | |
| poly.data[i] = [series.data[i][1] * Math.cos(angle), series.data[i][1] * Math.sin(angle), series.data[i][0], series.data[i][1]] | |
| } | |
| poly.data[sides] = poly.data[0]; | |
| series.data = poly.data; | |
| series.lines = series.radar; | |
| series.lines.show = false; | |
| series.dataInRadarFormat = true; | |
| } | |
| this.drawSeriesLines(series); | |
| }, | |
| /** | |
| * Function: drawSeriesPie | |
| * | |
| * Function draws a pie in the canvas element. | |
| * | |
| * Parameters: | |
| * series - Series with options.pie.show = true. | |
| * | |
| * Returns: | |
| * void | |
| */ | |
| drawSeriesPie: function(series) { | |
| if (!this.options.pie.drawn) { | |
| var ctx = this.ctx, | |
| options = this.options, | |
| lw = series.pie.lineWidth, | |
| sw = series.shadowSize, | |
| data = series.data, | |
| radius = (Math.min(this.canvasWidth, this.canvasHeight) * series.pie.sizeRatio) / 2, | |
| html = []; | |
| var vScale = 1;//Math.cos(series.pie.viewAngle); | |
| var plotTickness = Math.sin(series.pie.viewAngle)*series.pie.spliceThickness / vScale; | |
| var style = { | |
| size: options.fontSize*1.2, | |
| color: options.grid.color, | |
| weight: 1.5 | |
| }; | |
| var center = { | |
| x: (this.canvasWidth+this.plotOffset.left)/2, | |
| y: (this.canvasHeight-this.plotOffset.bottom)/2 | |
| }; | |
| // Pie portions | |
| var portions = this.series.collect(function(hash, index){ | |
| if (hash.pie.show) | |
| return { | |
| name: (hash.label || hash.data[0][1]), | |
| value: [index, hash.data[0][1]], | |
| explode: hash.pie.explode | |
| }; | |
| }); | |
| // Sum of the portions' angles | |
| var sum = portions.pluck('value').pluck(1).inject(0, function(acc, n) { return acc + n; }); | |
| var fraction = 0.0, | |
| angle = series.pie.startAngle, | |
| value = 0.0; | |
| var slices = portions.collect(function(slice){ | |
| angle += fraction; | |
| value = parseFloat(slice.value[1]); // @warning : won't support null values !! | |
| fraction = value/sum; | |
| return { | |
| name: slice.name, | |
| fraction: fraction, | |
| x: slice.value[0], | |
| y: value, | |
| explode: slice.explode, | |
| startAngle: 2 * angle * Math.PI, | |
| endAngle: 2 * (angle + fraction) * Math.PI | |
| }; | |
| }); | |
| ctx.save(); | |
| if(sw > 0){ | |
| slices.each(function (slice) { | |
| var bisection = (slice.startAngle + slice.endAngle) / 2; | |
| var xOffset = center.x + Math.cos(bisection) * slice.explode + sw; | |
| var yOffset = center.y + Math.sin(bisection) * slice.explode + sw; | |
| this.plotSlice(xOffset, yOffset, radius, slice.startAngle, slice.endAngle, false, vScale); | |
| ctx.fillStyle = 'rgba(0,0,0,0.1)'; | |
| ctx.fill(); | |
| }, this); | |
| } | |
| if (options.HtmlText) { | |
| html = ['<div style="color:' + this.options.grid.color + '" class="flotr-labels">']; | |
| } | |
| slices.each(function (slice, index) { | |
| var bisection = (slice.startAngle + slice.endAngle) / 2; | |
| var color = options.colors[index]; | |
| var xOffset = center.x + Math.cos(bisection) * slice.explode; | |
| var yOffset = center.y + Math.sin(bisection) * slice.explode; | |
| this.plotSlice(xOffset, yOffset, radius, slice.startAngle, slice.endAngle, false, vScale); | |
| if(series.pie.fill){ | |
| ctx.fillStyle = Flotr.parseColor(color).scale(null, null, null, series.pie.fillOpacity).toString(); | |
| ctx.fill(); | |
| } | |
| ctx.lineWidth = lw; | |
| ctx.strokeStyle = color; | |
| ctx.stroke(); | |
| /*ctx.save(); | |
| ctx.scale(1, vScale); | |
| ctx.moveTo(xOffset, yOffset); | |
| ctx.beginPath(); | |
| ctx.lineTo(xOffset, yOffset+plotTickness); | |
| ctx.lineTo(xOffset+Math.cos(slice.startAngle)*radius, yOffset+Math.sin(slice.startAngle)*radius+plotTickness); | |
| ctx.lineTo(xOffset+Math.cos(slice.startAngle)*radius, yOffset+Math.sin(slice.startAngle)*radius); | |
| ctx.lineTo(xOffset, yOffset); | |
| ctx.closePath(); | |
| ctx.fill();ctx.stroke(); | |
| ctx.moveTo(xOffset, yOffset); | |
| ctx.beginPath(); | |
| ctx.lineTo(xOffset, yOffset+plotTickness); | |
| ctx.lineTo(xOffset+Math.cos(slice.endAngle)*radius, yOffset+Math.sin(slice.endAngle)*radius+plotTickness); | |
| ctx.lineTo(xOffset+Math.cos(slice.endAngle)*radius, yOffset+Math.sin(slice.endAngle)*radius); | |
| ctx.lineTo(xOffset, yOffset); | |
| ctx.closePath(); | |
| ctx.fill();ctx.stroke(); | |
| ctx.moveTo(xOffset+Math.cos(slice.startAngle)*radius, yOffset+Math.sin(slice.startAngle)*radius); | |
| ctx.beginPath(); | |
| ctx.lineTo(xOffset+Math.cos(slice.startAngle)*radius, yOffset+Math.sin(slice.startAngle)*radius+plotTickness); | |
| ctx.arc(xOffset, yOffset+plotTickness, radius, slice.startAngle, slice.endAngle, false); | |
| ctx.lineTo(xOffset+Math.cos(slice.endAngle)*radius, yOffset+Math.sin(slice.endAngle)*radius); | |
| ctx.arc(xOffset, yOffset, radius, slice.endAngle, slice.startAngle, true); | |
| ctx.closePath(); | |
| ctx.fill();ctx.stroke(); | |
| ctx.scale(1, 1/vScale); | |
| this.plotSlice(xOffset, yOffset+plotTickness, radius, slice.startAngle, slice.endAngle, false, vScale); | |
| ctx.stroke(); | |
| if(series.pie.fill){ | |
| ctx.fillStyle = Flotr.parseColor(color).scale(null, null, null, series.pie.fillOpacity).toString(); | |
| ctx.fill(); | |
| } | |
| ctx.restore();*/ | |
| var label = options.pie.labelFormatter(slice); | |
| var textAlignRight = (Math.cos(bisection) < 0); | |
| var distX = xOffset + Math.cos(bisection) * (series.pie.explode + radius); | |
| var distY = yOffset + Math.sin(bisection) * (series.pie.explode + radius); | |
| if (slice.fraction && label) { | |
| if (options.HtmlText) { | |
| var divStyle = 'position:absolute;top:' + (distY - 5) + 'px;'; //@todo: change | |
| if (textAlignRight) { | |
| divStyle += 'right:'+(this.canvasWidth - distX)+'px;text-align:right;'; | |
| } | |
| else { | |
| divStyle += 'left:'+distX+'px;text-align:left;'; | |
| } | |
| html.push('<div style="' + divStyle + '" class="flotr-grid-label">' + label + '</div>'); | |
| } | |
| else { | |
| style.halign = textAlignRight ? 'r' : 'l'; | |
| ctx.drawText( | |
| label, | |
| distX, | |
| distY + style.size / 2, | |
| style | |
| ); | |
| } | |
| } | |
| }, this); | |
| if (options.HtmlText) { | |
| html.push('</div>'); | |
| this.el.insert(html.join('')); | |
| } | |
| ctx.restore(); | |
| options.pie.drawn = true; | |
| } | |
| }, | |
| plotSlice: function(x, y, radius, startAngle, endAngle, fill, vScale) { | |
| var ctx = this.ctx; | |
| vScale = vScale || 1; | |
| ctx.save(); | |
| ctx.scale(1, vScale); | |
| ctx.beginPath(); | |
| ctx.moveTo(x, y); | |
| ctx.arc (x, y, radius, startAngle, endAngle, fill); | |
| ctx.lineTo(x, y); | |
| ctx.closePath(); | |
| ctx.restore(); | |
| }, | |
| plotPie: function() {}, | |
| /** | |
| * Function: insertLegend | |
| * | |
| * Function adds a legend div to the canvas container or draws it on the canvas. | |
| * | |
| * Parameters: | |
| * none | |
| * | |
| * Returns: | |
| * void | |
| */ | |
| insertLegend: function(){ | |
| if(!this.options.legend.show) | |
| return; | |
| var series = this.series, | |
| plotOffset = this.plotOffset, | |
| options = this.options, | |
| fragments = [], | |
| rowStarted = false, | |
| ctx = this.ctx, | |
| i; | |
| var noLegendItems = series.findAll(function(s) {return (s.label && !s.hide)}).size(); | |
| if (noLegendItems) { | |
| if (!options.HtmlText && this.textEnabled) { | |
| var style = { | |
| size: options.fontSize*1.1, | |
| color: options.grid.color | |
| }; | |
| // @todo: take css into account | |
| //var dummyDiv = this.el.insert('<div class="flotr-legend" style="position:absolute;top:-10000px;"></div>'); | |
| var p = options.legend.position, | |
| m = options.legend.margin, | |
| lbw = options.legend.labelBoxWidth, | |
| lbh = options.legend.labelBoxHeight, | |
| lbm = options.legend.labelBoxMargin, | |
| offsetX = plotOffset.left + m, | |
| offsetY = plotOffset.top + m; | |
| // We calculate the labels' max width | |
| var labelMaxWidth = 0; | |
| for(i = series.length - 1; i > -1; --i){ | |
| if(!series[i].label || series[i].hide) continue; | |
| var label = options.legend.labelFormatter(series[i].label); | |
| labelMaxWidth = Math.max(labelMaxWidth, ctx.measureText(label, style)); | |
| } | |
| var legendWidth = Math.round(lbw + lbm*3 + labelMaxWidth), | |
| legendHeight = Math.round(noLegendItems*(lbm+lbh) + lbm); | |
| if(p.charAt(0) == 's') offsetY = plotOffset.top + this.plotHeight - (m + legendHeight); | |
| if(p.charAt(1) == 'e') offsetX = plotOffset.left + this.plotWidth - (m + legendWidth); | |
| // Legend box | |
| var color = Flotr.parseColor(options.legend.backgroundColor || 'rgb(240,240,240)').scale(null, null, null, options.legend.backgroundOpacity || 0.1).toString(); | |
| ctx.fillStyle = color; | |
| ctx.fillRect(offsetX, offsetY, legendWidth, legendHeight); | |
| ctx.strokeStyle = options.legend.labelBoxBorderColor; | |
| ctx.strokeRect(Flotr.toPixel(offsetX), Flotr.toPixel(offsetY), legendWidth, legendHeight); | |
| // Legend labels | |
| var x = offsetX + lbm; | |
| var y = offsetY + lbm; | |
| for(i = 0; i < series.length; i++){ | |
| if(!series[i].label || series[i].hide) continue; | |
| var label = options.legend.labelFormatter(series[i].label); | |
| ctx.fillStyle = series[i].color; | |
| ctx.fillRect(x, y, lbw-1, lbh-1); | |
| ctx.strokeStyle = options.legend.labelBoxBorderColor; | |
| ctx.lineWidth = 1; | |
| ctx.strokeRect(Math.ceil(x)-1.5, Math.ceil(y)-1.5, lbw+2, lbh+2); | |
| // Legend text | |
| ctx.drawText( | |
| label, | |
| x + lbw + lbm, | |
| y + (lbh + style.size - ctx.fontDescent(style))/2, | |
| style | |
| ); | |
| y += lbh + lbm; | |
| } | |
| } | |
| else { | |
| for(i = 0; i < series.length; ++i){ | |
| if(!series[i].label || series[i].hide) continue; | |
| if(i % options.legend.noColumns == 0){ | |
| fragments.push(rowStarted ? '</tr><tr>' : '<tr>'); | |
| rowStarted = true; | |
| } | |
| var label = options.legend.labelFormatter(series[i].label); | |
| fragments.push('<td class="flotr-legend-color-box"><div style="border:1px solid ' + options.legend.labelBoxBorderColor + ';padding:1px"><div style="width:' + options.legend.labelBoxWidth + 'px;height:' + options.legend.labelBoxHeight + 'px;background-color:' + series[i].color + '"></div></div></td>' + | |
| '<td class="flotr-legend-label">' + label + '</td>'); | |
| } | |
| if(rowStarted) fragments.push('</tr>'); | |
| if(fragments.length > 0){ | |
| var table = '<table style="font-size:smaller;color:' + options.grid.color + '">' + fragments.join("") + '</table>'; | |
| if(options.legend.container != null){ | |
| $(options.legend.container).update(table); | |
| }else{ | |
| var pos = ''; | |
| var p = options.legend.position, m = options.legend.margin; | |
| if(p.charAt(0) == 'n') pos += 'top:' + (m + plotOffset.top) + 'px;'; | |
| else if(p.charAt(0) == 's') pos += 'bottom:' + (m + plotOffset.bottom) + 'px;'; | |
| if(p.charAt(1) == 'e') pos += 'right:' + (m + plotOffset.right) + 'px;'; | |
| else if(p.charAt(1) == 'w') pos += 'left:' + (m + plotOffset.left) + 'px;'; | |
| var div = this.el.insert('<div class="flotr-legend" style="position:absolute;z-index:2;' + pos +'">' + table + '</div>').select('div.flotr-legend').first(); | |
| if(options.legend.backgroundOpacity != 0.0){ | |
| /** | |
| * Put in the transparent background separately to avoid blended labels and | |
| * label boxes. | |
| */ | |
| var c = options.legend.backgroundColor; | |
| if(c == null){ | |
| var tmp = (options.grid.backgroundColor != null) ? options.grid.backgroundColor : Flotr.extractColor(div); | |
| c = Flotr.parseColor(tmp).adjust(null, null, null, 1).toString(); | |
| } | |
| this.el.insert('<div class="flotr-legend-bg" style="position:absolute;width:' + div.getWidth() + 'px;height:' + div.getHeight() + 'px;' + pos +'background-color:' + c + ';"> </div>').select('div.flotr-legend-bg').first().setStyle({ | |
| 'opacity': options.legend.backgroundOpacity | |
| }); | |
| } | |
| } | |
| } | |
| } | |
| } | |
| }, | |
| /** | |
| * Function: getEventPosition | |
| * | |
| * Calculates the coordinates from a mouse event object. | |
| * | |
| * Parameters: | |
| * event - Mouse Event object. | |
| * | |
| * Returns: | |
| * Object with x and y coordinates of the mouse. | |
| */ | |
| getEventPosition: function (event){ | |
| var offset = this.overlay.cumulativeOffset(), | |
| rx = (event.pageX - offset.left - this.plotOffset.left), | |
| ry = (event.pageY - offset.top - this.plotOffset.top), | |
| ax = 0, ay = 0 | |
| if(event.pageX == null && event.clientX != null){ | |
| var de = document.documentElement, b = document.body; | |
| ax = event.clientX + (de && de.scrollLeft || b.scrollLeft || 0); | |
| ay = event.clientY + (de && de.scrollTop || b.scrollTop || 0); | |
| }else{ | |
| ax = event.pageX; | |
| ay = event.pageY; | |
| } | |
| return { | |
| x: this.axes.x.min + rx / this.axes.x.scale, | |
| x2: this.axes.x2.min + rx / this.axes.x2.scale, | |
| y: this.axes.y.max - ry / this.axes.y.scale, | |
| y2: this.axes.y2.max - ry / this.axes.y2.scale, | |
| relX: rx, | |
| relY: ry, | |
| absX: ax, | |
| absY: ay | |
| }; | |
| }, | |
| /** | |
| * Function: clickHandler | |
| * | |
| * Handler observes the 'click' event and fires the 'flotr:click' event. | |
| * | |
| * Parameters: | |
| * event - 'click' Event object. | |
| * | |
| * Returns: | |
| * void | |
| */ | |
| clickHandler: function(event){ | |
| if(this.ignoreClick){ | |
| this.ignoreClick = false; | |
| return; | |
| } | |
| this.el.fire('flotr:click', [this.getEventPosition(event), this]); | |
| }, | |
| /** | |
| * Function: mouseMoveHandler | |
| * | |
| * Handler observes mouse movement over the graph area. Fires the | |
| * 'flotr:mousemove' event. | |
| * | |
| * Parameters: | |
| * event - 'mousemove' Event object. | |
| * | |
| * Returns: | |
| * void | |
| */ | |
| mouseMoveHandler: function(event){ | |
| var pos = this.getEventPosition(event); | |
| this.lastMousePos.pageX = pos.absX; | |
| this.lastMousePos.pageY = pos.absY; | |
| if(this.selectionInterval == null && (this.options.mouse.track || this.series.any(function(s){return s.mouse && s.mouse.track;}))){ | |
| this.hit(pos); | |
| } | |
| this.el.fire('flotr:mousemove', [event, pos, this]); | |
| }, | |
| /** | |
| * Function: mouseDownHandler | |
| * | |
| * Handler observes the 'mousedown' event. | |
| * | |
| * Parameters: | |
| * event - 'mousedown' Event object. | |
| * | |
| * Returns: | |
| * void | |
| */ | |
| mouseDownHandler: function (event){ | |
| if(event.isRightClick()) { | |
| event.stop(); | |
| var overlay = this.overlay; | |
| overlay.hide(); | |
| function cancelContextMenu () { | |
| overlay.show(); | |
| $(document).stopObserving('mousemove', cancelContextMenu); | |
| } | |
| $(document).observe('mousemove', cancelContextMenu); | |
| return; | |
| } | |
| if(!this.options.selection.mode || !event.isLeftClick()) return; | |
| this.setSelectionPos(this.selection.first, event); | |
| if(this.selectionInterval != null){ | |
| clearInterval(this.selectionInterval); | |
| } | |
| this.lastMousePos.pageX = null; | |
| this.selectionInterval = setInterval(this.updateSelection.bind(this), 1000/this.options.selection.fps); | |
| this.mouseUpHandler = this.mouseUpHandler.bind(this); | |
| $(document).observe('mouseup', this.mouseUpHandler); | |
| }, | |
| /** | |
| * Function: (private) fireSelectEvent | |
| * | |
| * Fires the 'flotr:select' event when the user made a selection. | |
| * | |
| * Parameters: | |
| * none | |
| * | |
| * Returns: | |
| * void | |
| */ | |
| fireSelectEvent: function(){ | |
| var a = this.axes, selection = this.selection, | |
| x1 = (selection.first.x <= selection.second.x) ? selection.first.x : selection.second.x, | |
| x2 = (selection.first.x <= selection.second.x) ? selection.second.x : selection.first.x, | |
| y1 = (selection.first.y >= selection.second.y) ? selection.first.y : selection.second.y, | |
| y2 = (selection.first.y >= selection.second.y) ? selection.second.y : selection.first.y; | |
| x1 = a.x.min + x1 / a.x.scale; | |
| x2 = a.x.min + x2 / a.x.scale; | |
| y1 = a.y.max - y1 / a.y.scale; | |
| y2 = a.y.max - y2 / a.y.scale; | |
| this.el.fire('flotr:select', [{x1:x1, y1:y1, x2:x2, y2:y2}, this]); | |
| }, | |
| /** | |
| * Function: (private) mouseUpHandler | |
| * | |
| * Handler observes the mouseup event for the document. | |
| * | |
| * Parameters: | |
| * event - 'mouseup' Event object. | |
| * | |
| * Returns: | |
| * void | |
| */ | |
| mouseUpHandler: function(event){ | |
| $(document).stopObserving('mouseup', this.mouseUpHandler); | |
| event.stop(); | |
| if(this.selectionInterval != null){ | |
| clearInterval(this.selectionInterval); | |
| this.selectionInterval = null; | |
| } | |
| this.setSelectionPos(this.selection.second, event); | |
| this.clearSelection(); | |
| if(this.selectionIsSane()){ | |
| this.drawSelection(); | |
| this.fireSelectEvent(); | |
| this.ignoreClick = true; | |
| } | |
| }, | |
| /** | |
| * Function: setSelectionPos | |
| * | |
| * Calculates the position of the selection. | |
| * | |
| * Parameters: | |
| * pos - Position object. | |
| * event - Event object. | |
| * | |
| * Returns: | |
| * void | |
| */ | |
| setSelectionPos: function(pos, event) { | |
| var options = this.options, | |
| offset = $(this.overlay).cumulativeOffset(); | |
| if(options.selection.mode.indexOf('x') == -1){ | |
| pos.x = (pos == this.selection.first) ? 0 : this.plotWidth; | |
| }else{ | |
| pos.x = event.pageX - offset.left - this.plotOffset.left; | |
| pos.x = Math.min(Math.max(0, pos.x), this.plotWidth); | |
| } | |
| if (options.selection.mode.indexOf('y') == -1){ | |
| pos.y = (pos == this.selection.first) ? 0 : this.plotHeight; | |
| }else{ | |
| pos.y = event.pageY - offset.top - this.plotOffset.top; | |
| pos.y = Math.min(Math.max(0, pos.y), this.plotHeight); | |
| } | |
| }, | |
| /** | |
| * Function: updateSelection | |
| * | |
| * Updates (draws) the selection box. | |
| * | |
| * Parameters: | |
| * none | |
| * | |
| * Returns: | |
| * void | |
| */ | |
| updateSelection: function(){ | |
| if(this.lastMousePos.pageX == null) return; | |
| this.setSelectionPos(this.selection.second, this.lastMousePos); | |
| this.clearSelection(); | |
| if(this.selectionIsSane()) this.drawSelection(); | |
| }, | |
| /** | |
| * Function: clearSelection | |
| * | |
| * Removes the selection box from the overlay canvas. | |
| * | |
| * Parameters: | |
| * none | |
| * | |
| * Returns: | |
| * void | |
| */ | |
| clearSelection: function() { | |
| if(this.prevSelection == null) return; | |
| var prevSelection = this.prevSelection, | |
| octx = this.octx, | |
| plotOffset = this.plotOffset, | |
| x = Math.min(prevSelection.first.x, prevSelection.second.x), | |
| y = Math.min(prevSelection.first.y, prevSelection.second.y), | |
| w = Math.abs(prevSelection.second.x - prevSelection.first.x), | |
| h = Math.abs(prevSelection.second.y - prevSelection.first.y); | |
| octx.clearRect(x + plotOffset.left - octx.lineWidth, | |
| y + plotOffset.top - octx.lineWidth, | |
| w + octx.lineWidth*2, | |
| h + octx.lineWidth*2); | |
| this.prevSelection = null; | |
| }, | |
| /** | |
| * Function: setSelection | |
| * | |
| * Allows the user the manually select an area. | |
| * | |
| * Parameters: | |
| * area - Object with coordinates to select. | |
| * | |
| * Returns: | |
| * void | |
| */ | |
| setSelection: function(area){ | |
| var options = this.options, | |
| xa = this.axes.x, | |
| ya = this.axes.y, | |
| vertScale = yaxis.scale, | |
| hozScale = xaxis.scale, | |
| selX = options.selection.mode.indexOf('x') != -1, | |
| selY = options.selection.mode.indexOf('y') != -1; | |
| this.clearSelection(); | |
| this.selection.first.y = selX ? 0 : (ya.max - area.y1) * vertScale; | |
| this.selection.second.y = selX ? this.plotHeight : (ya.max - area.y2) * vertScale; | |
| this.selection.first.x = selY ? 0 : (area.x1 - xa.min) * hozScale; | |
| this.selection.second.x = selY ? this.plotWidth : (area.x2 - xa.min) * hozScale; | |
| this.drawSelection(); | |
| this.fireSelectEvent(); | |
| }, | |
| /** | |
| * Function: (private) drawSelection | |
| * | |
| * Draws the selection box. | |
| * | |
| * Parameters: | |
| * none | |
| * | |
| * Returns: | |
| * void | |
| */ | |
| drawSelection: function() { | |
| var prevSelection = this.prevSelection, | |
| selection = this.selection, | |
| octx = this.octx, | |
| options = this.options, | |
| plotOffset = this.plotOffset; | |
| if(prevSelection != null && | |
| selection.first.x == prevSelection.first.x && | |
| selection.first.y == prevSelection.first.y && | |
| selection.second.x == prevSelection.second.x && | |
| selection.second.y == prevSelection.second.y) | |
| return; | |
| octx.strokeStyle = Flotr.parseColor(options.selection.color).scale(null, null, null, 0.8).toString(); | |
| octx.lineWidth = 1; | |
| octx.lineJoin = 'round'; | |
| octx.fillStyle = Flotr.parseColor(options.selection.color).scale(null, null, null, 0.4).toString(); | |
| this.prevSelection = { | |
| first: { x: selection.first.x, y: selection.first.y }, | |
| second: { x: selection.second.x, y: selection.second.y } | |
| }; | |
| var x = Math.min(selection.first.x, selection.second.x), | |
| y = Math.min(selection.first.y, selection.second.y), | |
| w = Math.abs(selection.second.x - selection.first.x), | |
| h = Math.abs(selection.second.y - selection.first.y); | |
| octx.fillRect(x + plotOffset.left, y + plotOffset.top, w, h); | |
| octx.strokeRect(x + plotOffset.left, y + plotOffset.top, w, h); | |
| }, | |
| /** | |
| * Function: (private) selectionIsSane | |
| * | |
| * Determines whether or not the selection is sane and should be drawn. | |
| * | |
| * Parameters: | |
| * none | |
| * | |
| * Returns: | |
| * boolean - True when sane, false otherwise. | |
| */ | |
| selectionIsSane: function(){ | |
| var selection = this.selection; | |
| return Math.abs(selection.second.x - selection.first.x) >= 5 && | |
| Math.abs(selection.second.y - selection.first.y) >= 5; | |
| }, | |
| /** | |
| * Function: clearHit | |
| * | |
| * Removes the mouse tracking point from the overlay. | |
| * | |
| * Parameters: | |
| * none | |
| * | |
| * Returns: | |
| * void | |
| */ | |
| clearHit: function(){ | |
| if(this.prevHit){ | |
| var options = this.options, | |
| plotOffset = this.plotOffset, | |
| prevHit = this.prevHit; | |
| this.octx.clearRect( | |
| this.tHoz(prevHit.x) + plotOffset.left - options.points.radius*2, | |
| this.tVert(prevHit.y) + plotOffset.top - options.points.radius*2, | |
| options.points.radius*3 + options.points.lineWidth*3, | |
| options.points.radius*3 + options.points.lineWidth*3 | |
| ); | |
| this.prevHit = null; | |
| } | |
| }, | |
| /** | |
| * Function: hit | |
| * | |
| * Retrieves the nearest data point from the mouse cursor. If it's within | |
| * a certain range, draw a point on the overlay canvas and display the x and y | |
| * value of the data. | |
| * | |
| * Parameters: | |
| * mouse - Object that holds the relative x and y coordinates of the cursor. | |
| * | |
| * Returns: | |
| * void | |
| */ | |
| hit: function(mouse){ | |
| var series = this.series, | |
| options = this.options, | |
| prevHit = this.prevHit, | |
| plotOffset = this.plotOffset, | |
| octx = this.octx, | |
| data, xsens, ysens, | |
| /** | |
| * Nearest data element. | |
| */ | |
| i, n = { | |
| dist:Number.MAX_VALUE, | |
| x:null, | |
| y:null, | |
| relX:mouse.relX, | |
| relY:mouse.relY, | |
| absX:mouse.absX, | |
| absY:mouse.absY, | |
| mouse:null, | |
| radarData:null | |
| }; | |
| for(i = 0; i < series.length; i++){ | |
| s = series[i]; | |
| if(!s.mouse.track) continue; | |
| data = s.data; | |
| xsens = (s.xaxis.scale*s.mouse.sensibility); | |
| ysens = (s.yaxis.scale*s.mouse.sensibility); | |
| for(var j = 0, xpow, ypow; j < data.length; j++){ | |
| if (data[j][1] === null) continue; | |
| xpow = Math.pow(s.xaxis.scale*(data[j][0] - mouse.x), 2); | |
| ypow = Math.pow(s.yaxis.scale*(data[j][1] - mouse.y), 2); | |
| if(xpow < xsens && ypow < ysens && Math.sqrt(xpow+ypow) < n.dist){ | |
| n.dist = Math.sqrt(xpow+ypow); | |
| n.x = data[j][0]; | |
| n.y = data[j][1]; | |
| n.radarLabel = data[j][2]; | |
| n.radarData = data[j][3]; | |
| n.mouse = s.mouse; | |
| } | |
| } | |
| } | |
| if(n.mouse && n.mouse.track && !prevHit || (prevHit && (n.x != prevHit.x || n.y != prevHit.y))){ | |
| var mt = this.mouseTrack || this.el.select(".flotr-mouse-value")[0], | |
| pos = '', | |
| p = options.mouse.position, | |
| m = options.mouse.margin, | |
| elStyle = 'opacity:0.7;background-color:#000;color:#fff;display:none;position:absolute;padding:2px 8px;-moz-border-radius:4px;border-radius:4px;white-space:nowrap;'; | |
| if (!options.mouse.relative) { // absolute to the canvas | |
| if(p.charAt(0) == 'n') pos += 'top:' + (m + plotOffset.top) + 'px;'; | |
| else if(p.charAt(0) == 's') pos += 'bottom:' + (m + plotOffset.bottom) + 'px;'; | |
| if(p.charAt(1) == 'e') pos += 'right:' + (m + plotOffset.right) + 'px;'; | |
| else if(p.charAt(1) == 'w') pos += 'left:' + (m + plotOffset.left) + 'px;'; | |
| } | |
| else { // relative to the mouse | |
| if(p.charAt(0) == 'n') pos += 'bottom:' + (m - plotOffset.top - this.tVert(n.y) + this.canvasHeight) + 'px;'; | |
| else if(p.charAt(0) == 's') pos += 'top:' + (m + plotOffset.top + this.tVert(n.y)) + 'px;'; | |
| if(p.charAt(1) == 'e') pos += 'left:' + (m + plotOffset.left + this.tHoz(n.x)) + 'px;'; | |
| else if(p.charAt(1) == 'w') pos += 'right:' + (m - plotOffset.left - this.tHoz(n.x) + this.canvasWidth) + 'px;'; | |
| } | |
| elStyle += pos; | |
| if(!mt){ | |
| this.el.insert('<div class="flotr-mouse-value" style="'+elStyle+'"></div>'); | |
| mt = this.mouseTrack = this.el.select('.flotr-mouse-value').first(); | |
| } | |
| else { | |
| this.mouseTrack = mt.setStyle(elStyle); | |
| } | |
| if(n.x !== null && n.y !== null){ | |
| mt.show(); | |
| this.clearHit(); | |
| if(n.mouse.lineColor != null){ | |
| octx.save(); | |
| octx.translate(plotOffset.left, plotOffset.top); | |
| octx.lineWidth = options.points.lineWidth; | |
| octx.strokeStyle = n.mouse.lineColor; | |
| octx.fillStyle = '#ffffff'; | |
| octx.beginPath(); | |
| octx.arc(this.tHoz(n.x), this.tVert(n.y), options.mouse.radius, 0, 2 * Math.PI, true); | |
| octx.fill(); | |
| octx.stroke(); | |
| octx.restore(); | |
| } | |
| this.prevHit = n; | |
| var decimals = n.mouse.trackDecimals; | |
| if(decimals == null || decimals < 0) decimals = 0; | |
| mt.innerHTML = n.mouse.trackFormatter({x: n.x.toFixed(decimals), y: n.y.toFixed(decimals), | |
| radarLabel: n.radarLabel, radarData: n.radarData.toFixed(decimals)}); | |
| mt.fire('flotr:hit', [n, this]); | |
| } | |
| else if(prevHit){ | |
| mt.hide(); | |
| this.clearHit(); | |
| } | |
| } | |
| }, | |
| saveImage: function (type, width, height, replaceCanvas) { | |
| var image = null; | |
| switch (type) { | |
| case 'jpeg': | |
| case 'jpg': image = Canvas2Image.saveAsJPEG(this.canvas, replaceCanvas, width, height); break; | |
| default: | |
| case 'png': image = Canvas2Image.saveAsPNG(this.canvas, replaceCanvas, width, height); break; | |
| case 'bmp': image = Canvas2Image.saveAsBMP(this.canvas, replaceCanvas, width, height); break; | |
| } | |
| if (Object.isElement(image) && replaceCanvas) { | |
| this.restoreCanvas(); | |
| this.canvas.hide(); | |
| this.overlay.hide(); | |
| this.el.insert(image.setStyle({position: 'absolute'})); | |
| } | |
| }, | |
| restoreCanvas: function() { | |
| this.canvas.show(); | |
| this.overlay.show(); | |
| this.el.select('img').invoke('remove'); | |
| } | |
| }); | |
| Flotr.Color = Class.create({ | |
| initialize: function(r, g, b, a){ | |
| this.rgba = ['r','g','b','a']; | |
| var x = 4; | |
| while(-1<--x){ | |
| this[this.rgba[x]] = arguments[x] || ((x==3) ? 1.0 : 0); | |
| } | |
| this.normalize(); | |
| }, | |
| adjust: function(rd, gd, bd, ad) { | |
| var x = 4; | |
| while(-1<--x){ | |
| if(arguments[x] != null) | |
| this[this.rgba[x]] += arguments[x]; | |
| } | |
| return this.normalize(); | |
| }, | |
| clone: function(){ | |
| return new Flotr.Color(this.r, this.b, this.g, this.a); | |
| }, | |
| limit: function(val,minVal,maxVal){ | |
| return Math.max(Math.min(val, maxVal), minVal); | |
| }, | |
| normalize: function(){ | |
| var limit = this.limit; | |
| this.r = limit(parseInt(this.r), 0, 255); | |
| this.g = limit(parseInt(this.g), 0, 255); | |
| this.b = limit(parseInt(this.b), 0, 255); | |
| this.a = limit(this.a, 0, 1); | |
| return this; | |
| }, | |
| scale: function(rf, gf, bf, af){ | |
| var x = 4; | |
| while(-1<--x){ | |
| if(arguments[x] != null) | |
| this[this.rgba[x]] *= arguments[x]; | |
| } | |
| return this.normalize(); | |
| }, | |
| distance: function(color){ | |
| if (!color) return; | |
| color = new Flotr.parseColor(color); | |
| var dist = 0; | |
| var x = 3; | |
| while(-1<--x){ | |
| dist += Math.abs(this[this.rgba[x]] - color[this.rgba[x]]); | |
| } | |
| return dist; | |
| }, | |
| toString: function(){ | |
| return (this.a >= 1.0) ? 'rgb('+[this.r,this.g,this.b].join(',')+')' : 'rgba('+[this.r,this.g,this.b,this.a].join(',')+')'; | |
| } | |
| }); | |
| Flotr.Color.lookupColors = { | |
| aqua:[0,255,255], | |
| azure:[240,255,255], | |
| beige:[245,245,220], | |
| black:[0,0,0], | |
| blue:[0,0,255], | |
| brown:[165,42,42], | |
| cyan:[0,255,255], | |
| darkblue:[0,0,139], | |
| darkcyan:[0,139,139], | |
| darkgrey:[169,169,169], | |
| darkgreen:[0,100,0], | |
| darkkhaki:[189,183,107], | |
| darkmagenta:[139,0,139], | |
| darkolivegreen:[85,107,47], | |
| darkorange:[255,140,0], | |
| darkorchid:[153,50,204], | |
| darkred:[139,0,0], | |
| darksalmon:[233,150,122], | |
| darkviolet:[148,0,211], | |
| fuchsia:[255,0,255], | |
| gold:[255,215,0], | |
| green:[0,128,0], | |
| indigo:[75,0,130], | |
| khaki:[240,230,140], | |
| lightblue:[173,216,230], | |
| lightcyan:[224,255,255], | |
| lightgreen:[144,238,144], | |
| lightgrey:[211,211,211], | |
| lightpink:[255,182,193], | |
| lightyellow:[255,255,224], | |
| lime:[0,255,0], | |
| magenta:[255,0,255], | |
| maroon:[128,0,0], | |
| navy:[0,0,128], | |
| olive:[128,128,0], | |
| orange:[255,165,0], | |
| pink:[255,192,203], | |
| purple:[128,0,128], | |
| violet:[128,0,128], | |
| red:[255,0,0], | |