Fix merge of git modules
--- /dev/null
+++ b/.gitignore
@@ -1,1 +1,9 @@
+/labs/tiles/12
+/labs/tiles/13
+/labs/tiles/14
+/labs/tiles/15
+/labs/tiles/16
+/labs/tiles/17
+/labs/tiles/19
+/nbproject/private/
--- /dev/null
+++ b/.gitmodules
@@ -1,1 +1,13 @@
+[submodule "js/flotr2"]
+ path = js/flotr2
+ url = https://github.com/HumbleSoftware/Flotr2.git
+[submodule "js/FlashCanvas"]
+ path = js/FlashCanvas
+ url = https://github.com/timcameronryan/FlashCanvas
+[submodule "lib/amon-php"]
+ path = lib/amon-php
+ url = https://github.com/martinrusev/amon-php.git
+[submodule "js/yepnope"]
+ path = js/yepnope
+ url = https://github.com/SlexAxton/yepnope.js.git
--- /dev/null
+++ b/Boxfile
@@ -1,1 +1,7 @@
+web1:
+ php_extensions:
+ - pgsql
+ - pdo
+ - pdo_pgsql
+ - curl
--- a/about.php
+++ b/about.php
@@ -1,31 +1,57 @@
<?php
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
include ('include/common.inc.php');
include_header("About", "about")
?>
<p>
-Busness Time - An ACT bus timetable webapp<br />
-Based on the maxious-canberra-transit-feed (<a
-href="http://s3-ap-southeast-1.amazonaws.com/busresources/cbrfeed.zip">download</a>,
-last updated <?php
-echo date("F d Y.", @filemtime('cbrfeed.zip')); ?>)<br />
-Source code for the <a
-href="https://github.com/maxious/ACTBus-data">transit
-feed</a> and <a href="https://github.com/maxious/ACTBus-ui">this
-site</a> available from github.<br />
-Uses jQuery Mobile, PHP, Ruby, Python, Google Transit Feed Specification tools, OpenTripPlanner, OpenLayers, OpenStreetMap, Cloudmade Geocoder and Tile Service<br />
-<br />
-Feedback encouraged; contact maxious@lambdacomplex.org<br />
+ Busness Time - An ACT bus timetable webapp<br />
+ Based on the maxious-canberra-transit-feed (<a
+ href="http://busresources.lambdacomplex.org/cbrfeed.zip">download</a>,
+ last updated <?php echo date("F d Y.", @filemtime('../busresources/cbrfeed.zip')); ?>)<br />
+ Source code for the <a
+ href="https://github.com/maxious/ACTBus-data">transit
+ feed</a> and <a href="https://github.com/maxious/ACTBus-ui">this
+ site</a> available from github.<br />
+ Uses jQuery Mobile, PHP, PostgreSQL, OpenTripPlanner, OpenLayers, OpenStreetMap, Cloudmade Geocoder and Tile Service<br />
+ Suburb Geocoding Based on <A href="http://www.abs.gov.au/AUSSTATS/abs@.nsf/Lookup/1270.0.55.003Main+Features1July%202011?OpenDocument">Australian Bureau of Statistics data.</a><br />
+ Street geocoding based on work by OpenStreetMap contributors<br>
<br />
-Some icons by Joseph Wain / glyphish.com<br />
-<br />
-<small>Disclaimer: The content of this website is of a general and informative nature. Please check with printed timetables or those available on http://action.act.gov.au before your trip.
-Whilst every effort has been made to ensure the high quality and accuracy of the Site, the Author makes no warranty,
-express or implied concerning the topicality, correctness, completeness or quality of the information, which is provided
-"as is". The Author expressly disclaims all warranties, including but not limited to warranties of fitness for a particular purpose and warranties of merchantability.
-All offers are not binding and without obligation. The Author expressly reserves the right, in his discretion, to suspend,
-change, modify, add or remove portions of the Site and to restrict or terminate the use and accessibility of the Site
-without prior notice. </small>
-<?
-include_footer();
-?>
+ Feedback encouraged; contact maxious@lambdacomplex.org<br />
+ <br />
+ Some icons by Joseph Wain / glyphish.com<br />
+ Native clients also available for iPhone(<a href="http://itunes.apple.com/au/app/cbrtimetable/id444287349?mt=8">cbrTimetable by Sandor Kolotenko</a>
+ , <a href="http://itunes.apple.com/au/app/act-buses/id376634797?mt=8">ACT Buses by David Sullivan</a>, <a href="http://itunes.apple.com/app/bus-trips-act/id489146525?mt=8">Bus Trips ACT by Molson Chengalath</a>)
+ , Android (<a href="https://market.android.com/details?id=com.action">MyBus 2.0 by Imagine Team</a>, <A href="https://market.android.com/details?id=GetMe2CanberraFree.source">GetMe2 Canberra by
+Colin Thompson </a>, <a href="https://market.android.com/details?id=au.com.transittimes.android">TransitTimes+ by Zervaas Enterprises</a>)
+ and Windows Phone 7 (<a href="http://www.windowsphone.com/en-AU/apps/d840375e-429c-4aa4-a358-80eec6ea9e66">TransHub Canberra by Soul Solutions</a>) Other web clients include <a href="http://canberra.itranzit.com/option.html">iTranzit</a>.
+ <br />
+ GTFS-realtime API:
+ Alerts and Trip Updates (but only Cancelled or Stop Skipped)
+ Default format binary Protocol Buffer but can get JSON by adding ?ascii=yes
+ <br />
+ <br />
+ <small>Disclaimer: The content of this website is of a general and informative nature. Please check with printed timetables or those available on http://action.act.gov.au before your trip.
+ Whilst every effort has been made to ensure the high quality and accuracy of the Site, the Author makes no warranty,
+ express or implied concerning the topicality, correctness, completeness or quality of the information, which is provided
+ "as is". The Author expressly disclaims all warranties, including but not limited to warranties of fitness for a particular purpose and warranties of merchantability.
+ All offers are not binding and without obligation. The Author expressly reserves the right, in his discretion, to suspend,
+ change, modify, add or remove portions of the Site and to restrict or terminate the use and accessibility of the Site
+ without prior notice. </small>
+ <?php
+ include_footer();
+ ?>
--- a/aws/awsStartup.sh
+++ /dev/null
@@ -1,28 +1,1 @@
-#!/bin/bash
-#this script should be run from a fresh git checkout from http://maxious.lambdacomplex.org
-#ami base must have yum install lighttpd-fastcgi, git, tomcat6
-#screen php-cli php-gd tomcat6-webapps tomcat6-admin-webapps svn maven2
-#http://www.how2forge.org/installing-lighttpd-with-php5-and-mysql-support-on-fedora-12
-cp /root/aws.php /tmp/
-chcon -h system_u:object_r:httpd_sys_content_t /var/www
-chcon -R -h root:object_r:httpd_sys_content_t /var/www/*
-chcon -R -t httpd_sys_content_rw_t /var/www/lib/staticmaplite/cache
-chmod -R 777 /var/www/lib/staticmaplite/cache
-wget http://s3-ap-southeast-1.amazonaws.com/busresources/cbrfeed.zip \
--O /var/www/cbrfeed.zip
-easy_install transitfeed
-easy_install simplejson
-screen -S viewsh -X quit
-screen -S viewsh -d -m /var/www/view.sh
-
-wget http://s3-ap-southeast-1.amazonaws.com/busresources/Graph.obj \
--O /tmp/Graph.obj
-rm -rfv /usr/share/tomcat6/webapps/opentripplanner*
-wget http://s3-ap-southeast-1.amazonaws.com/busresources/opentripplanner-webapp.war \
--O /usr/share/tomcat6/webapps/opentripplanner-webapp.war
-wget http://s3-ap-southeast-1.amazonaws.com/busresources/opentripplanner-api-webapp.war \
--O /usr/share/tomcat6/webapps/opentripplanner-api-webapp.war
-/etc/init.d/tomcat6 restart
-
-
--- a/aws/compress.conf
+++ /dev/null
@@ -1,33 +1,1 @@
-#######################################################################
-##
-## Output Compression
-## --------------------
-##
-## see http://www.lighttpd.net/documentation/compress.html
-##
-server.modules += ( "mod_compress" )
-##
-## where should the compressed files be cached?
-## see the base config for the declaration of the variable.
-##
-## This directory should be changed per vhost otherwise you can
-## run into trouble with overlapping filenames
-##
-compress.cache-dir = cache_dir + "/compress"
-
-##
-## FileTypes to compress.
-##
-#compress.filetype = ("text/plain", "text/html")
-compress.filetype = ("text/plain", "text/html", "text/javascript", "text/css", "text/xml")
-
-##
-## Maximum filesize that will be compressed.
-## Default is 0, which means unlimited file size.
-##
-#compress.max-filesize = 0
-
-##
-#######################################################################
-
--- a/aws/expire.conf
+++ /dev/null
@@ -1,29 +1,1 @@
-#######################################################################
-##
-## Expire Module
-## ---------------
-##
-## See http://www.lighttpd.net/documentation/expire.html
-##
-server.modules += ( "mod_expire" )
-##
-## assignes a expiration to all files below the specified path. The
-## specification of the time is made up of:
-##
-## <access|modification> <number> <years|months|days|hours|minutes|seconds>
-##
-#expire.url = (
-# "/buggy/" => "access 2 hours",
-# "/images/" => "access plus 1 seconds 2 minutes"
-#)
-etag.use-mtime = "enable"
-etag.use-inode = "disable"
-static-file.etags = "enable"
-$HTTP["url"] =~ "\.(css|js|png|jpg|ico|gif)$" {
- expire.url = ( "" => "access 7 days" )
-}
-
-##
-#######################################################################
-
--- a/aws/fastcgi.conf
+++ /dev/null
@@ -1,144 +1,1 @@
-#######################################################################
-##
-## FastCGI Module
-## ---------------
-##
-## http://www.lighttpd.net/documentation/fastcgi.html
-##
-server.modules += ( "mod_fastcgi" )
-fastcgi.server = ( ".php" =>
- ( "localhost" =>
- (
- "socket" =>
-"/var/run/lighttpd/php-fastcgi.socket",
- "bin-path" => "/usr/bin/php-cgi"
- )
- )
- )
-##
-## PHP Example
-## For PHP don't forget to set cgi.fix_pathinfo = 1 in the php.ini.
-##
-## The number of php processes you will get can be easily calculated:
-##
-## num-procs = max-procs * ( 1 + PHP_FCGI_CHILDREN )
-##
-## for the php-num-procs example it means you will get 17*5 = 85 php
-## processes. you always should need this high number for your very
-## busy sites. And if you have a lot of RAM. :)
-##
-#fastcgi.server = ( ".php" =>
-# ( "php-local" =>
-# (
-# "socket" => socket_dir + "/php-fastcgi-1.socket",
-# "bin-path" => server_root + "/php-cgi",
-# "max-procs" => 1,
-# "broken-scriptfilename" => "enable",
-# )
-# ),
-# ( "php-tcp" =>
-# (
-# "host" => "127.0.0.1",
-# "port" => 9999,
-# "check-local" => "disable",
-# "broken-scriptfilename" => "enable",
-# )
-# ),
-#
-# ( "php-num-procs" =>
-# (
-# "socket" => socket_dir + "/php-fastcgi-2.socket",
-# "bin-path" => server_root + "/php-cgi",
-# "bin-environment" => (
-# "PHP_FCGI_CHILDREN" => "16",
-# "PHP_FCGI_MAX_REQUESTS" => "10000",
-# ),
-# "max-procs" => 5,
-# "broken-scriptfilename" => "enable",
-# )
-# ),
-# )
-##
-## Ruby on Rails Example
-##
-## Normally you only run one Rails application on one vhost.
-##
-#$HTTP["host"] == "rails1.example.com" {
-# server.document-root = server_root + "/rails/someapp/public"
-# server.error-handler-404 = "/dispatch.fcgi"
-# fastcgi.server = ( ".fcgi" =>
-# ("someapp" =>
-# ( "socket" => socket_dir + "/someapp-fcgi.socket",
-# "bin-path" => server_root + "/rails/someapp/public/dispatch.fcgi",
-# "bin-environment" => (
-# "RAILS_ENV" => "production",
-# "TMP" => home_dir + "/rails/someapp",
-# ),
-# )
-# )
-# )
-#}
-
-##
-## Another example with multiple rails applications on one vhost.
-##
-## http://blog.lighttpd.net/articles/2005/11/23/lighttpd-1-4-8-and-multiple-rails-apps
-##
-#$HTTP["host"] == "rails2.example.com" {
-# $HTTP["url"] =~ "^/someapp1" {
-# server.document-root = server_root + "/rails/someapp1/public"
-# server.error-handler-404 = "/dispatch.fcgi"
-# fastcgi.server = ( ".fcgi" =>
-# ("someapp1" =>
-# ( "socket" => socket_dir + "/someapp1-fcgi.socket",
-# "bin-path" => server_root + "/rails/someapp1/public/dispatch.fcgi",
-# "bin-environment" => (
-# "RAILS_ENV" => "production",
-# "TMP" => home_dir + "/rails/someapp1",
-# ),
-# "strip-request-uri" => "/someapp1/"
-# )
-# )
-# )
-# }
-#
-# $HTTP["url"] =~ "^/someapp2" {
-# server.document-root = server_root + "/rails/someapp2/public"
-# server.error-handler-404 = "/dispatch.fcgi"
-# fastcgi.server = ( ".fcgi" =>
-# ("someapp2" =>
-# ( "socket" => socket_dir + "/someapp2-fcgi.socket",
-# "bin-path" => server_root + "/rails/someapp2/public/dispatch.fcgi",
-# "bin-environment" => (
-# "RAILS_ENV" => "production",
-# "TMP" => home_dir + "/rails/someapp2",
-# ),
-# "strip-request-uri" => "/someapp2/"
-# )
-# )
-# )
-# }
-#}
-
-## chrooted webserver + external PHP
-##
-## $ spawn-fcgi -f /usr/bin/php-cgi -p 2000 -a 127.0.0.1 -C 8
-##
-## webserver chrooted to /srv/www/
-## php running outside the chroot
-#
-#fastcgi.server = (
-# ".php" => ((
-# "host" => "127.0.0.1",
-# "port" => "2000",
-# "docroot" => "/srv/www/servers/www.example.org/htdocs/"
-# )))
-#
-#server.chroot = "/srv/www"
-#server.document-root = "/servers/wwww.example.org/htdocs/"
-#
-
-##
-#######################################################################
-
--- a/aws/modules.conf
+++ /dev/null
@@ -1,173 +1,1 @@
-#######################################################################
-##
-## Modules to load
-## -----------------
-##
-## at least mod_access and mod_accesslog should be loaded
-## all other module should only be loaded if really neccesary
-##
-## - saves some time
-## - saves memory
-##
-## the default module set contains:
-##
-## "mod_indexfile", "mod_dirlisting", "mod_staticfile"
-##
-## you dont have to include those modules in your list
-##
-## Modules, which are pulled in via conf.d/*.conf
-##
-## NOTE: the order of modules is important.
-##
-## - mod_accesslog -> conf.d/access_log.conf
-## - mod_compress -> conf.d/compress.conf
-## - mod_status -> conf.d/status.conf
-## - mod_webdav -> conf.d/webdav.conf
-## - mod_cml -> conf.d/cml.conf
-## - mod_evhost -> conf.d/evhost.conf
-## - mod_simple_vhost -> conf.d/simple_vhost.conf
-## - mod_mysql_vhost -> conf.d/mysql_vhost.conf
-## - mod_trigger_b4_dl -> conf.d/trigger_b4_dl.conf
-## - mod_userdir -> conf.d/userdir.conf
-## - mod_rrdtool -> conf.d/rrdtool.conf
-## - mod_ssi -> conf.d/ssi.conf
-## - mod_cgi -> conf.d/cgi.conf
-## - mod_scgi -> conf.d/scgi.conf
-## - mod_fastcgi -> conf.d/fastcgi.conf
-## - mod_proxy -> conf.d/proxy.conf
-## - mod_secdownload -> conf.d/secdownload.conf
-## - mod_expire -> conf.d/expire.conf
-##
-server.modules = (
- "mod_access",
-# "mod_alias",
-# "mod_auth",
-# "mod_evasive",
-# "mod_redirect",
-# "mod_rewrite",
-# "mod_setenv",
-# "mod_usertrack",
-)
-
-##
-#######################################################################
-
-#######################################################################
-##
-## Config for various Modules
-##
-
-##
-## mod_ssi
-##
-#include "conf.d/ssi.conf"
-
-##
-## mod_status
-##
-#include "conf.d/status.conf"
-
-##
-## mod_webdav
-##
-#include "conf.d/webdav.conf"
-
-##
-## mod_compress
-##
-include "conf.d/compress.conf"
-
-##
-## mod_userdir
-##
-#include "conf.d/userdir.conf"
-
-##
-## mod_magnet
-##
-#include "conf.d/magnet.conf"
-
-##
-## mod_cml
-##
-#include "conf.d/cml.conf"
-
-##
-## mod_rrdtool
-##
-#include "conf.d/rrdtool.conf"
-
-##
-## mod_proxy
-##
-#include "conf.d/proxy.conf"
-
-##
-## mod_expire
-##
-include "conf.d/expire.conf"
-
-##
-## mod_secdownload
-##
-#include "conf.d/secdownload.conf"
-
-##
-#######################################################################
-
-#######################################################################
-##
-## CGI modules
-##
-
-##
-## SCGI (mod_scgi)
-##
-#include "conf.d/scgi.conf"
-
-##
-## FastCGI (mod_fastcgi)
-##
-include "conf.d/fastcgi.conf"
-
-##
-## plain old CGI (mod_cgi)
-##
-#include "conf.d/cgi.conf"
-
-##
-#######################################################################
-
-#######################################################################
-##
-## VHost Modules
-##
-## Only load ONE of them!
-## ========================
-##
-
-##
-## You can use conditionals for vhosts aswell.
-##
-## see http://www.lighttpd.net/documentation/configuration.html
-##
-
-##
-## mod_evhost
-##
-#include "conf.d/evhost.conf"
-
-##
-## mod_simple_vhost
-##
-#include "conf.d/simple_vhost.conf"
-
-##
-## mod_mysql_vhost
-##
-#include "conf.d/mysql_vhost.conf"
-
-##
-#######################################################################
-
--- a/aws/php.ini
+++ /dev/null
@@ -1,1662 +1,1 @@
-[PHP]
-date.timezone = "Australia/Sydney"
-
-;;;;;;;;;;;;;;;;;;;
-; About php.ini ;
-;;;;;;;;;;;;;;;;;;;
-; PHP's initialization file, generally called php.ini, is responsible for
-; configuring many of the aspects of PHP's behavior.
-
-; PHP attempts to find and load this configuration from a number of locations.
-; The following is a summary of its search order:
-; 1. SAPI module specific location.
-; 2. The PHPRC environment variable. (As of PHP 5.2.0)
-; 3. A number of predefined registry keys on Windows (As of PHP 5.2.0)
-; 4. Current working directory (except CLI)
-; 5. The web server's directory (for SAPI modules), or directory of PHP
-; (otherwise in Windows)
-; 6. The directory from the --with-config-file-path compile time option, or the
-; Windows directory (C:\windows or C:\winnt)
-; See the PHP docs for more specific information.
-; http://www.php.net/manual/en/configuration.file.php
-
-; The syntax of the file is extremely simple. Whitespace and Lines
-; beginning with a semicolon are silently ignored (as you probably guessed).
-; Section headers (e.g. [Foo]) are also silently ignored, even though
-; they might mean something in the future.
-
-; Directives following the section heading [PATH=/www/mysite] only
-; apply to PHP files in the /www/mysite directory. Directives
-; following the section heading [HOST=www.example.com] only apply to
-; PHP files served from www.example.com. Directives set in these
-; special sections cannot be overridden by user-defined INI files or
-; at runtime. Currently, [PATH=] and [HOST=] sections only work under
-; CGI/FastCGI.
-; http://www.php.net/manual/en/ini.sections.php
-
-; Directives are specified using the following syntax:
-; directive = value
-; Directive names are *case sensitive* - foo=bar is different from FOO=bar.
-; Directives are variables used to configure PHP or PHP extensions.
-; There is no name validation. If PHP can't find an expected
-; directive because it is not set or is mistyped, a default value will be used.
-
-; The value can be a string, a number, a PHP constant (e.g. E_ALL or M_PI), one
-; of the INI constants (On, Off, True, False, Yes, No and None) or an expression
-; (e.g. E_ALL & ~E_NOTICE), a quoted string ("bar"), or a reference to a
-; previously set variable or directive (e.g. ${foo})
-
-; Expressions in the INI file are limited to bitwise operators and parentheses:
-; | bitwise OR
-; ^ bitwise XOR
-; & bitwise AND
-; ~ bitwise NOT
-; ! boolean NOT
-
-; Boolean flags can be turned on using the values 1, On, True or Yes.
-; They can be turned off using the values 0, Off, False or No.
-
-; An empty string can be denoted by simply not writing anything after the equal
-; sign, or by using the None keyword:
-
-; foo = ; sets foo to an empty string
-; foo = None ; sets foo to an empty string
-; foo = "None" ; sets foo to the string 'None'
-
-; If you use constants in your value, and these constants belong to a
-; dynamically loaded extension (either a PHP extension or a Zend extension),
-; you may only use these constants *after* the line that loads the extension.
-
-;;;;;;;;;;;;;;;;;;;
-; About this file ;
-;;;;;;;;;;;;;;;;;;;
-; PHP comes packaged with two INI files. One that is recommended to be used
-; in production environments and one that is recommended to be used in
-; development environments.
-
-; php.ini-production contains settings which hold security, performance and
-; best practices at its core. But please be aware, these settings may break
-; compatibility with older or less security conscience applications. We
-; recommending using the production ini in production and testing environments.
-
-; php.ini-development is very similar to its production variant, except it's
-; much more verbose when it comes to errors. We recommending using the
-; development version only in development environments as errors shown to
-; application users can inadvertently leak otherwise secure information.
-
-; This 2 files are provided, by RPM, in /usr/share/doc/php-common-*/
-; File used by RPM (the /etc/php.ini) is mainly the php.ini-production
-
-;;;;;;;;;;;;;;;;;;;
-; Quick Reference ;
-;;;;;;;;;;;;;;;;;;;
-; The following are all the settings which are different in either the production
-; or development versions of the INIs with respect to PHP's default behavior.
-; Please see the actual settings later in the document for more details as to why
-; we recommend these changes in PHP's behavior.
-
-; allow_call_time_pass_reference
-; Default Value: On
-; Development Value: Off
-; Production Value: Off
-
-; display_errors
-; Default Value: On
-; Development Value: On
-; Production Value: Off
-
-; display_startup_errors
-; Default Value: Off
-; Development Value: On
-; Production Value: Off
-
-; error_reporting
-; Default Value: E_ALL & ~E_NOTICE
-; Development Value: E_ALL | E_STRICT
-; Production Value: E_ALL & ~E_DEPRECATED
-
-; html_errors
-; Default Value: On
-; Development Value: On
-; Production value: Off
-
-; log_errors
-; Default Value: Off
-; Development Value: On
-; Production Value: On
-
-; magic_quotes_gpc
-; Default Value: On
-; Development Value: Off
-; Production Value: Off
-
-; max_input_time
-; Default Value: -1 (Unlimited)
-; Development Value: 60 (60 seconds)
-; Production Value: 60 (60 seconds)
-
-; output_buffering
-; Default Value: Off
-; Development Value: 4096
-; Production Value: 4096
-
-; register_argc_argv
-; Default Value: On
-; Development Value: Off
-; Production Value: Off
-
-; register_long_arrays
-; Default Value: On
-; Development Value: Off
-; Production Value: Off
-
-; request_order
-; Default Value: None
-; Development Value: "GP"
-; Production Value: "GP"
-
-; session.bug_compat_42
-; Default Value: On
-; Development Value: On
-; Production Value: Off
-
-; session.bug_compat_warn
-; Default Value: On
-; Development Value: On
-; Production Value: Off
-
-; session.gc_divisor
-; Default Value: 100
-; Development Value: 1000
-; Production Value: 1000
-
-; session.hash_bits_per_character
-; Default Value: 4
-; Development Value: 5
-; Production Value: 5
-
-; short_open_tag
-; Default Value: On
-; Development Value: Off
-; Production Value: Off
-
-; track_errors
-; Default Value: Off
-; Development Value: On
-; Production Value: Off
-
-; url_rewriter.tags
-; Default Value: "a=href,area=href,frame=src,form=,fieldset="
-; Development Value: "a=href,area=href,frame=src,input=src,form=fakeentry"
-; Production Value: "a=href,area=href,frame=src,input=src,form=fakeentry"
-
-; variables_order
-; Default Value: "EGPCS"
-; Development Value: "GPCS"
-; Production Value: "GPCS"
-
-;;;;;;;;;;;;;;;;;;;;
-; php.ini Options ;
-;;;;;;;;;;;;;;;;;;;;
-; Name for user-defined php.ini (.htaccess) files. Default is ".user.ini"
-;user_ini.filename = ".user.ini"
-
-; To disable this feature set this option to empty value
-;user_ini.filename =
-
-; TTL for user-defined php.ini files (time-to-live) in seconds. Default is 300 seconds (5 minutes)
-;user_ini.cache_ttl = 300
-
-;;;;;;;;;;;;;;;;;;;;
-; Language Options ;
-;;;;;;;;;;;;;;;;;;;;
-
-; Enable the PHP scripting language engine under Apache.
-; http://www.php.net/manual/en/apache.configuration.php#ini.engine
-engine = On
-
-; This directive determines whether or not PHP will recognize code between
-; <? and ?> tags as PHP source which should be processed as such. It's been
-; recommended for several years that you not use the short tag "short cut" and
-; instead to use the full <?php and ?> tag combination. With the wide spread use
-; of XML and use of these tags by other languages, the server can become easily
-; confused and end up parsing the wrong code in the wrong context. But because
-; this short cut has been a feature for such a long time, it's currently still
-; supported for backwards compatibility, but we recommend you don't use them.
-; Default Value: On
-; Development Value: Off
-; Production Value: Off
-; http://www.php.net/manual/en/ini.core.php#ini.short-open-tag
-short_open_tag = Off
-
-; Allow ASP-style <% %> tags.
-; http://www.php.net/manual/en/ini.core.php#ini.asp-tags
-asp_tags = Off
-
-; The number of significant digits displayed in floating point numbers.
-; http://www.php.net/manual/en/ini.core.php#ini.precision
-precision = 14
-
-; Enforce year 2000 compliance (will cause problems with non-compliant browsers)
-; http://www.php.net/manual/en/ini.core.php#ini.y2k-compliance
-y2k_compliance = On
-
-; Output buffering is a mechanism for controlling how much output data
-; (excluding headers and cookies) PHP should keep internally before pushing that
-; data to the client. If your application's output exceeds this setting, PHP
-; will send that data in chunks of roughly the size you specify.
-; Turning on this setting and managing its maximum buffer size can yield some
-; interesting side-effects depending on your application and web server.
-; You may be able to send headers and cookies after you've already sent output
-; through print or echo. You also may see performance benefits if your server is
-; emitting less packets due to buffered output versus PHP streaming the output
-; as it gets it. On production servers, 4096 bytes is a good setting for performance
-; reasons.
-; Note: Output buffering can also be controlled via Output Buffering Control
-; functions.
-; Possible Values:
-; On = Enabled and buffer is unlimited. (Use with caution)
-; Off = Disabled
-; Integer = Enables the buffer and sets its maximum size in bytes.
-; Default Value: Off
-; Development Value: 4096
-; Production Value: 4096
-; http://www.php.net/manual/en/outcontrol.configuration.php#ini.output-buffering
-output_buffering = 4096
-
-; You can redirect all of the output of your scripts to a function. For
-; example, if you set output_handler to "mb_output_handler", character
-; encoding will be transparently converted to the specified encoding.
-; Setting any output handler automatically turns on output buffering.
-; Note: People who wrote portable scripts should not depend on this ini
-; directive. Instead, explicitly set the output handler using ob_start().
-; Using this ini directive may cause problems unless you know what script
-; is doing.
-; Note: You cannot use both "mb_output_handler" with "ob_iconv_handler"
-; and you cannot use both "ob_gzhandler" and "zlib.output_compression".
-; Note: output_handler must be empty if this is set 'On' !!!!
-; Instead you must use zlib.output_handler.
-; http://www.php.net/manual/en/outcontrol.configuration.php#ini.output-handler
-;output_handler =
-
-; Transparent output compression using the zlib library
-; Valid values for this option are 'off', 'on', or a specific buffer size
-; to be used for compression (default is 4KB)
-; Note: Resulting chunk size may vary due to nature of compression. PHP
-; outputs chunks that are few hundreds bytes each as a result of
-; compression. If you prefer a larger chunk size for better
-; performance, enable output_buffering in addition.
-; Note: You need to use zlib.output_handler instead of the standard
-; output_handler, or otherwise the output will be corrupted.
-; http://www.php.net/manual/en/zlib.configuration.php#ini.zlib.output-compression
-zlib.output_compression = on
-
-; http://www.php.net/manual/en/zlib.configuration.php#ini.zlib.output-compression-level
-;zlib.output_compression_level = -1
-
-; You cannot specify additional output handlers if zlib.output_compression
-; is activated here. This setting does the same as output_handler but in
-; a different order.
-; http://www.php.net/manual/en/zlib.configuration.php#ini.zlib.output-handler
-;zlib.output_handler =
-
-; Implicit flush tells PHP to tell the output layer to flush itself
-; automatically after every output block. This is equivalent to calling the
-; PHP function flush() after each and every call to print() or echo() and each
-; and every HTML block. Turning this option on has serious performance
-; implications and is generally recommended for debugging purposes only.
-; http://www.php.net/manual/en/outcontrol.configuration.php#ini.implicit-flush
-implicit_flush = Off
-
-; The unserialize callback function will be called (with the undefined class'
-; name as parameter), if the unserializer finds an undefined class
-; which should be instantiated. A warning appears if the specified function is
-; not defined, or if the function doesn't include/implement the missing class.
-; So only set this entry, if you really want to implement such a
-; callback-function.
-unserialize_callback_func =
-
-; When floats & doubles are serialized store serialize_precision significant
-; digits after the floating point. The default value ensures that when floats
-; are decoded with unserialize, the data will remain the same.
-serialize_precision = 100
-
-; This directive allows you to enable and disable warnings which PHP will issue
-; if you pass a value by reference at function call time. Passing values by
-; reference at function call time is a deprecated feature which will be removed
-; from PHP at some point in the near future. The acceptable method for passing a
-; value by reference to a function is by declaring the reference in the functions
-; definition, not at call time. This directive does not disable this feature, it
-; only determines whether PHP will warn you about it or not. These warnings
-; should enabled in development environments only.
-; Default Value: On (Suppress warnings)
-; Development Value: Off (Issue warnings)
-; Production Value: Off (Issue warnings)
-; http://www.php.net/manual/en/ini.core.php#ini.allow-call-time-pass-reference
-allow_call_time_pass_reference = Off
-
-; Safe Mode
-; http://www.php.net/manual/en/ini.sect.safe-mode.php#ini.safe-mode
-safe_mode = Off
-
-; By default, Safe Mode does a UID compare check when
-; opening files. If you want to relax this to a GID compare,
-; then turn on safe_mode_gid.
-; http://www.php.net/manual/en/ini.sect.safe-mode.php#ini.safe-mode-gid
-safe_mode_gid = Off
-
-; When safe_mode is on, UID/GID checks are bypassed when
-; including files from this directory and its subdirectories.
-; (directory must also be in include_path or full path must
-; be used when including)
-; http://www.php.net/manual/en/ini.sect.safe-mode.php#ini.safe-mode-include-dir
-safe_mode_include_dir =
-
-; When safe_mode is on, only executables located in the safe_mode_exec_dir
-; will be allowed to be executed via the exec family of functions.
-; http://www.php.net/manual/en/ini.sect.safe-mode.php#ini.safe-mode-exec-dir
-safe_mode_exec_dir =
-
-; Setting certain environment variables may be a potential security breach.
-; This directive contains a comma-delimited list of prefixes. In Safe Mode,
-; the user may only alter environment variables whose names begin with the
-; prefixes supplied here. By default, users will only be able to set
-; environment variables that begin with PHP_ (e.g. PHP_FOO=BAR).
-; Note: If this directive is empty, PHP will let the user modify ANY
-; environment variable!
-; http://www.php.net/manual/en/ini.sect.safe-mode.php#ini.safe-mode-allowed-env-vars
-safe_mode_allowed_env_vars = PHP_
-
-; This directive contains a comma-delimited list of environment variables that
-; the end user won't be able to change using putenv(). These variables will be
-; protected even if safe_mode_allowed_env_vars is set to allow to change them.
-; http://www.php.net/manual/en/ini.sect.safe-mode.php#ini.safe-mode-protected-env-vars
-safe_mode_protected_env_vars = LD_LIBRARY_PATH
-
-; open_basedir, if set, limits all file operations to the defined directory
-; and below. This directive makes most sense if used in a per-directory
-; or per-virtualhost web server configuration file. This directive is
-; *NOT* affected by whether Safe Mode is turned On or Off.
-; http://www.php.net/manual/en/ini.sect.safe-mode.php#ini.open-basedir
-;open_basedir =
-
-; This directive allows you to disable certain functions for security reasons.
-; It receives a comma-delimited list of function names. This directive is
-; *NOT* affected by whether Safe Mode is turned On or Off.
-; http://www.php.net/manual/en/ini.sect.safe-mode.php#ini.disable-functions
-disable_functions =
-
-; This directive allows you to disable certain classes for security reasons.
-; It receives a comma-delimited list of class names. This directive is
-; *NOT* affected by whether Safe Mode is turned On or Off.
-; http://www.php.net/manual/en/ini.sect.safe-mode.php#ini.disable-classes
-disable_classes =
-
-; Colors for Syntax Highlighting mode. Anything that's acceptable in
-; <span style="color: ???????"> would work.
-; http://www.php.net/manual/en/misc.configuration.php#ini.syntax-highlighting
-;highlight.string = #DD0000
-;highlight.comment = #FF9900
-;highlight.keyword = #007700
-;highlight.bg = #FFFFFF
-;highlight.default = #0000BB
-;highlight.html = #000000
-
-; If enabled, the request will be allowed to complete even if the user aborts
-; the request. Consider enabling it if executing long requests, which may end up
-; being interrupted by the user or a browser timing out. PHP's default behavior
-; is to disable this feature.
-; http://www.php.net/manual/en/misc.configuration.php#ini.ignore-user-abort
-;ignore_user_abort = On
-
-; Determines the size of the realpath cache to be used by PHP. This value should
-; be increased on systems where PHP opens many files to reflect the quantity of
-; the file operations performed.
-; http://www.php.net/manual/en/ini.core.php#ini.realpath-cache-size
-;realpath_cache_size = 16k
-
-; Duration of time, in seconds for which to cache realpath information for a given
-; file or directory. For systems with rarely changing files, consider increasing this
-; value.
-; http://www.php.net/manual/en/ini.core.php#ini.realpath-cache-ttl
-;realpath_cache_ttl = 120
-
-;;;;;;;;;;;;;;;;;
-; Miscellaneous ;
-;;;;;;;;;;;;;;;;;
-
-; Decides whether PHP may expose the fact that it is installed on the server
-; (e.g. by adding its signature to the Web server header). It is no security
-; threat in any way, but it makes it possible to determine whether you use PHP
-; on your server or not.
-; http://www.php.net/manual/en/ini.core.php#ini.expose-php
-expose_php = On
-
-;;;;;;;;;;;;;;;;;;;
-; Resource Limits ;
-;;;;;;;;;;;;;;;;;;;
-
-; Maximum execution time of each script, in seconds
-; http://www.php.net/manual/en/info.configuration.php#ini.max-execution-time
-max_execution_time = 30
-
-; Maximum amount of time each script may spend parsing request data. It's a good
-; idea to limit this time on productions servers in order to eliminate unexpectedly
-; long running scripts.
-; Default Value: -1 (Unlimited)
-; Development Value: 60 (60 seconds)
-; Production Value: 60 (60 seconds)
-; http://www.php.net/manual/en/info.configuration.php#ini.max-input-time
-max_input_time = 60
-
-; Maximum input variable nesting level
-; http://www.php.net/manual/en/info.configuration.php#ini.max-input-nesting-level
-;max_input_nesting_level = 64
-
-; Maximum amount of memory a script may consume (128MB)
-; http://www.php.net/manual/en/ini.core.php#ini.memory-limit
-memory_limit = 128M
-
-;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;
-; Error handling and logging ;
-;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;
-
-; This directive informs PHP of which errors, warnings and notices you would like
-; it to take action for. The recommended way of setting values for this
-; directive is through the use of the error level constants and bitwise
-; operators. The error level constants are below here for convenience as well as
-; some common settings and their meanings.
-; By default, PHP is set to take action on all errors, notices and warnings EXCEPT
-; those related to E_NOTICE and E_STRICT, which together cover best practices and
-; recommended coding standards in PHP. For performance reasons, this is the
-; recommend error reporting setting. Your production server shouldn't be wasting
-; resources complaining about best practices and coding standards. That's what
-; development servers and development settings are for.
-; Note: The php.ini-development file has this setting as E_ALL | E_STRICT. This
-; means it pretty much reports everything which is exactly what you want during
-; development and early testing.
-;
-; Error Level Constants:
-; E_ALL - All errors and warnings (includes E_STRICT as of PHP 6.0.0)
-; E_ERROR - fatal run-time errors
-; E_RECOVERABLE_ERROR - almost fatal run-time errors
-; E_WARNING - run-time warnings (non-fatal errors)
-; E_PARSE - compile-time parse errors
-; E_NOTICE - run-time notices (these are warnings which often result
-; from a bug in your code, but it's possible that it was
-; intentional (e.g., using an uninitialized variable and
-; relying on the fact it's automatically initialized to an
-; empty string)
-; E_STRICT - run-time notices, enable to have PHP suggest changes
-; to your code which will ensure the best interoperability
-; and forward compatibility of your code
-; E_CORE_ERROR - fatal errors that occur during PHP's initial startup
-; E_CORE_WARNING - warnings (non-fatal errors) that occur during PHP's
-; initial startup
-; E_COMPILE_ERROR - fatal compile-time errors
-; E_COMPILE_WARNING - compile-time warnings (non-fatal errors)
-; E_USER_ERROR - user-generated error message
-; E_USER_WARNING - user-generated warning message
-; E_USER_NOTICE - user-generated notice message
-; E_DEPRECATED - warn about code that will not work in future versions
-; of PHP
-; E_USER_DEPRECATED - user-generated deprecation warnings
-;
-; Common Values:
-; E_ALL & ~E_NOTICE (Show all errors, except for notices and coding standards warnings.)
-; E_ALL & ~E_NOTICE | E_STRICT (Show all errors, except for notices)
-; E_COMPILE_ERROR|E_RECOVERABLE_ERROR|E_ERROR|E_CORE_ERROR (Show only errors)
-; E_ALL | E_STRICT (Show all errors, warnings and notices including coding standards.)
-; Default Value: E_ALL & ~E_NOTICE
-; Development Value: E_ALL | E_STRICT
-; Production Value: E_ALL & ~E_DEPRECATED
-; http://www.php.net/manual/en/errorfunc.configuration.php#ini.error-reporting
-error_reporting = E_ALL & ~E_DEPRECATED
-
-; This directive controls whether or not and where PHP will output errors,
-; notices and warnings too. Error output is very useful during development, but
-; it could be very dangerous in production environments. Depending on the code
-; which is triggering the error, sensitive information could potentially leak
-; out of your application such as database usernames and passwords or worse.
-; It's recommended that errors be logged on production servers rather than
-; having the errors sent to STDOUT.
-; Possible Values:
-; Off = Do not display any errors
-; stderr = Display errors to STDERR (affects only CGI/CLI binaries!)
-; On or stdout = Display errors to STDOUT
-; Default Value: On
-; Development Value: On
-; Production Value: Off
-; http://www.php.net/manual/en/errorfunc.configuration.php#ini.display-errors
-display_errors = Off
-
-; The display of errors which occur during PHP's startup sequence are handled
-; separately from display_errors. PHP's default behavior is to suppress those
-; errors from clients. Turning the display of startup errors on can be useful in
-; debugging configuration problems. But, it's strongly recommended that you
-; leave this setting off on production servers.
-; Default Value: Off
-; Development Value: On
-; Production Value: Off
-; http://www.php.net/manual/en/errorfunc.configuration.php#ini.display-startup-errors
-display_startup_errors = Off
-
-; Besides displaying errors, PHP can also log errors to locations such as a
-; server-specific log, STDERR, or a location specified by the error_log
-; directive found below. While errors should not be displayed on productions
-; servers they should still be monitored and logging is a great way to do that.
-; Default Value: Off
-; Development Value: On
-; Production Value: On
-; http://www.php.net/manual/en/errorfunc.configuration.php#ini.log-errors
-log_errors = On
-
-; Set maximum length of log_errors. In error_log information about the source is
-; added. The default is 1024 and 0 allows to not apply any maximum length at all.
-; http://www.php.net/manual/en/errorfunc.configuration.php#ini.log-errors-max-len
-log_errors_max_len = 1024
-
-; Do not log repeated messages. Repeated errors must occur in same file on same
-; line unless ignore_repeated_source is set true.
-; http://www.php.net/manual/en/errorfunc.configuration.php#ini.ignore-repeated-errors
-ignore_repeated_errors = Off
-
-; Ignore source of message when ignoring repeated messages. When this setting
-; is On you will not log errors with repeated messages from different files or
-; source lines.
-; http://www.php.net/manual/en/errorfunc.configuration.php#ini.ignore-repeated-source
-ignore_repeated_source = Off
-
-; If this parameter is set to Off, then memory leaks will not be shown (on
-; stdout or in the log). This has only effect in a debug compile, and if
-; error reporting includes E_WARNING in the allowed list
-; http://www.php.net/manual/en/errorfunc.configuration.php#ini.report-memleaks
-report_memleaks = On
-
-; This setting is on by default.
-;report_zend_debug = 0
-
-; Store the last error/warning message in $php_errormsg (boolean). Setting this value
-; to On can assist in debugging and is appropriate for development servers. It should
-; however be disabled on production servers.
-; Default Value: Off
-; Development Value: On
-; Production Value: Off
-; http://www.php.net/manual/en/errorfunc.configuration.php#ini.track-errors
-track_errors = Off
-
-; Turn off normal error reporting and emit XML-RPC error XML
-; http://www.php.net/manual/en/errorfunc.configuration.php#ini.xmlrpc-errors
-;xmlrpc_errors = 0
-
-; An XML-RPC faultCode
-;xmlrpc_error_number = 0
-
-; When PHP displays or logs an error, it has the capability of inserting html
-; links to documentation related to that error. This directive controls whether
-; those HTML links appear in error messages or not. For performance and security
-; reasons, it's recommended you disable this on production servers.
-; Default Value: On
-; Development Value: On
-; Production value: Off
-; http://www.php.net/manual/en/errorfunc.configuration.php#ini.html-errors
-html_errors = Off
-
-; If html_errors is set On PHP produces clickable error messages that direct
-; to a page describing the error or function causing the error in detail.
-; You can download a copy of the PHP manual from http://www.php.net/docs.php
-; and change docref_root to the base URL of your local copy including the
-; leading '/'. You must also specify the file extension being used including
-; the dot. PHP's default behavior is to leave these settings empty.
-; Note: Never use this feature for production boxes.
-; http://www.php.net/manual/en/errorfunc.configuration.php#ini.docref-root
-; Examples
-;docref_root = "/phpmanual/"
-
-; http://www.php.net/manual/en/errorfunc.configuration.php#ini.docref-ext
-;docref_ext = .html
-
-; String to output before an error message. PHP's default behavior is to leave
-; this setting blank.
-; http://www.php.net/manual/en/errorfunc.configuration.php#ini.error-prepend-string
-; Example:
-;error_prepend_string = "<font color=#ff0000>"
-
-; String to output after an error message. PHP's default behavior is to leave
-; this setting blank.
-; http://www.php.net/manual/en/errorfunc.configuration.php#ini.error-append-string
-; Example:
-;error_append_string = "</font>"
-
-; Log errors to specified file. PHP's default behavior is to leave this value
-; empty.
-; http://www.php.net/manual/en/errorfunc.configuration.php#ini.error-log
-; Example:
-;error_log = php_errors.log
-; Log errors to syslog (Event Log on NT, not valid in Windows 95).
-;error_log = syslog
-
-;;;;;;;;;;;;;;;;;
-; Data Handling ;
-;;;;;;;;;;;;;;;;;
-
-; Note - track_vars is ALWAYS enabled as of PHP 4.0.3
-
-; The separator used in PHP generated URLs to separate arguments.
-; PHP's default setting is "&".
-; http://www.php.net/manual/en/ini.core.php#ini.arg-separator.output
-; Example:
-;arg_separator.output = "&"
-
-; List of separator(s) used by PHP to parse input URLs into variables.
-; PHP's default setting is "&".
-; NOTE: Every character in this directive is considered as separator!
-; http://www.php.net/manual/en/ini.core.php#ini.arg-separator.input
-; Example:
-;arg_separator.input = ";&"
-
-; This directive determines which super global arrays are registered when PHP
-; starts up. If the register_globals directive is enabled, it also determines
-; what order variables are populated into the global space. G,P,C,E & S are
-; abbreviations for the following respective super globals: GET, POST, COOKIE,
-; ENV and SERVER. There is a performance penalty paid for the registration of
-; these arrays and because ENV is not as commonly used as the others, ENV is
-; is not recommended on productions servers. You can still get access to
-; the environment variables through getenv() should you need to.
-; Default Value: "EGPCS"
-; Development Value: "GPCS"
-; Production Value: "GPCS";
-; http://www.php.net/manual/en/ini.core.php#ini.variables-order
-variables_order = "GPCS"
-
-; This directive determines which super global data (G,P,C,E & S) should
-; be registered into the super global array REQUEST. If so, it also determines
-; the order in which that data is registered. The values for this directive are
-; specified in the same manner as the variables_order directive, EXCEPT one.
-; Leaving this value empty will cause PHP to use the value set in the
-; variables_order directive. It does not mean it will leave the super globals
-; array REQUEST empty.
-; Default Value: None
-; Development Value: "GP"
-; Production Value: "GP"
-; http://www.php.net/manual/en/ini.core.php#ini.request-order
-request_order = "GP"
-
-; Whether or not to register the EGPCS variables as global variables. You may
-; want to turn this off if you don't want to clutter your scripts' global scope
-; with user data. This makes most sense when coupled with track_vars - in which
-; case you can access all of the GPC variables through the $HTTP_*_VARS[],
-; variables.
-; You should do your best to write your scripts so that they do not require
-; register_globals to be on; Using form variables as globals can easily lead
-; to possible security problems, if the code is not very well thought of.
-; http://www.php.net/manual/en/ini.core.php#ini.register-globals
-register_globals = Off
-
-; Determines whether the deprecated long $HTTP_*_VARS type predefined variables
-; are registered by PHP or not. As they are deprecated, we obviously don't
-; recommend you use them. They are on by default for compatibility reasons but
-; they are not recommended on production servers.
-; Default Value: On
-; Development Value: Off
-; Production Value: Off
-; http://www.php.net/manual/en/ini.core.php#ini.register-long-arrays
-register_long_arrays = Off
-
-; This directive determines whether PHP registers $argv & $argc each time it
-; runs. $argv contains an array of all the arguments passed to PHP when a script
-; is invoked. $argc contains an integer representing the number of arguments
-; that were passed when the script was invoked. These arrays are extremely
-; useful when running scripts from the command line. When this directive is
-; enabled, registering these variables consumes CPU cycles and memory each time
-; a script is executed. For performance reasons, this feature should be disabled
-; on production servers.
-; Default Value: On
-; Development Value: Off
-; Production Value: Off
-; http://www.php.net/manual/en/ini.core.php#ini.register-argc-argv
-register_argc_argv = Off
-
-; When enabled, the SERVER and ENV variables are created when they're first
-; used (Just In Time) instead of when the script starts. If these variables
-; are not used within a script, having this directive on will result in a
-; performance gain. The PHP directives register_globals, register_long_arrays,
-; and register_argc_argv must be disabled for this directive to have any affect.
-; http://www.php.net/manual/en/ini.core.php#ini.auto-globals-jit
-auto_globals_jit = On
-
-; Maximum size of POST data that PHP will accept.
-; http://www.php.net/manual/en/ini.core.php#ini.post-max-size
-post_max_size = 8M
-
-; Magic quotes are a preprocessing feature of PHP where PHP will attempt to
-; escape any character sequences in GET, POST, COOKIE and ENV data which might
-; otherwise corrupt data being placed in resources such as databases before
-; making that data available to you. Because of character encoding issues and
-; non-standard SQL implementations across many databases, it's not currently
-; possible for this feature to be 100% accurate. PHP's default behavior is to
-; enable the feature. We strongly recommend you use the escaping mechanisms
-; designed specifically for the database your using instead of relying on this
-; feature. Also note, this feature has been deprecated as of PHP 5.3.0 and is
-; scheduled for removal in PHP 6.
-; Default Value: On
-; Development Value: Off
-; Production Value: Off
-; http://www.php.net/manual/en/info.configuration.php#ini.magic-quotes-gpc
-magic_quotes_gpc = Off
-
-; Magic quotes for runtime-generated data, e.g. data from SQL, from exec(), etc.
-; http://www.php.net/manual/en/info.configuration.php#ini.magic-quotes-runtime
-magic_quotes_runtime = Off
-
-; Use Sybase-style magic quotes (escape ' with '' instead of \').
-; http://www.php.net/manual/en/sybase.configuration.php#ini.magic-quotes-sybase
-magic_quotes_sybase = Off
-
-; Automatically add files before PHP document.
-; http://www.php.net/manual/en/ini.core.php#ini.auto-prepend-file
-auto_prepend_file =
-
-; Automatically add files after PHP document.
-; http://www.php.net/manual/en/ini.core.php#ini.auto-append-file
-auto_append_file =
-
-; As of 4.0b4, PHP always outputs a character encoding by default in
-; the Content-type: header. To disable sending of the charset, simply
-; set it to be empty.
-;
-; PHP's built-in default is text/html
-; http://www.php.net/manual/en/ini.core.php#ini.default-mimetype
-default_mimetype = "text/html"
-
-; PHP's default character set is set to empty.
-; http://www.php.net/manual/en/ini.core.php#ini.default-charset
-;default_charset = "iso-8859-1"
-
-; Always populate the $HTTP_RAW_POST_DATA variable. PHP's default behavior is
-; to disable this feature.
-; http://www.php.net/manual/en/ini.core.php#ini.always-populate-raw-post-data
-;always_populate_raw_post_data = On
-
-;;;;;;;;;;;;;;;;;;;;;;;;;
-; Paths and Directories ;
-;;;;;;;;;;;;;;;;;;;;;;;;;
-
-; UNIX: "/path1:/path2"
-;include_path = ".:/php/includes"
-;
-; Windows: "\path1;\path2"
-;include_path = ".;c:\php\includes"
-;
-; PHP's default setting for include_path is ".;/path/to/php/pear"
-; http://www.php.net/manual/en/ini.core.php#ini.include-path
-
-; The root of the PHP pages, used only if nonempty.
-; if PHP was not compiled with FORCE_REDIRECT, you SHOULD set doc_root
-; if you are running php as a CGI under any web server (other than IIS)
-; see documentation for security issues. The alternate is to use the
-; cgi.force_redirect configuration below
-; http://www.php.net/manual/en/ini.core.php#ini.doc-root
-doc_root =
-
-; The directory under which PHP opens the script using /~username used only
-; if nonempty.
-; http://www.php.net/manual/en/ini.core.php#ini.user-dir
-user_dir =
-
-; Directory in which the loadable extensions (modules) reside.
-; http://www.php.net/manual/en/ini.core.php#ini.extension-dir
-; extension_dir = "./"
-
-; Whether or not to enable the dl() function. The dl() function does NOT work
-; properly in multithreaded servers, such as IIS or Zeus, and is automatically
-; disabled on them.
-; http://www.php.net/manual/en/info.configuration.php#ini.enable-dl
-enable_dl = Off
-
-; cgi.force_redirect is necessary to provide security running PHP as a CGI under
-; most web servers. Left undefined, PHP turns this on by default. You can
-; turn it off here AT YOUR OWN RISK
-; **You CAN safely turn this off for IIS, in fact, you MUST.**
-; http://www.php.net/manual/en/ini.core.php#ini.cgi.force-redirect
-;cgi.force_redirect = 1
-
-; if cgi.nph is enabled it will force cgi to always sent Status: 200 with
-; every request. PHP's default behavior is to disable this feature.
-;cgi.nph = 1
-
-; if cgi.force_redirect is turned on, and you are not running under Apache or Netscape
-; (iPlanet) web servers, you MAY need to set an environment variable name that PHP
-; will look for to know it is OK to continue execution. Setting this variable MAY
-; cause security issues, KNOW WHAT YOU ARE DOING FIRST.
-; http://www.php.net/manual/en/ini.core.php#ini.cgi.redirect-status-env
-;cgi.redirect_status_env = ;
-
-; cgi.fix_pathinfo provides *real* PATH_INFO/PATH_TRANSLATED support for CGI. PHP's
-; previous behaviour was to set PATH_TRANSLATED to SCRIPT_FILENAME, and to not grok
-; what PATH_INFO is. For more information on PATH_INFO, see the cgi specs. Setting
-; this to 1 will cause PHP CGI to fix its paths to conform to the spec. A setting
-; of zero causes PHP to behave as before. Default is 1. You should fix your scripts
-; to use SCRIPT_FILENAME rather than PATH_TRANSLATED.
-; http://www.php.net/manual/en/ini.core.php#ini.cgi.fix-pathinfo
-cgi.fix_pathinfo=1
-
-; FastCGI under IIS (on WINNT based OS) supports the ability to impersonate
-; security tokens of the calling client. This allows IIS to define the
-; security context that the request runs under. mod_fastcgi under Apache
-; does not currently support this feature (03/17/2002)
-; Set to 1 if running under IIS. Default is zero.
-; http://www.php.net/manual/en/ini.core.php#ini.fastcgi.impersonate
-;fastcgi.impersonate = 1;
-
-; Disable logging through FastCGI connection. PHP's default behavior is to enable
-; this feature.
-;fastcgi.logging = 0
-
-; cgi.rfc2616_headers configuration option tells PHP what type of headers to
-; use when sending HTTP response code. If it's set 0 PHP sends Status: header that
-; is supported by Apache. When this option is set to 1 PHP will send
-; RFC2616 compliant header.
-; Default is zero.
-; http://www.php.net/manual/en/ini.core.php#ini.cgi.rfc2616-headers
-;cgi.rfc2616_headers = 0
-
-;;;;;;;;;;;;;;;;
-; File Uploads ;
-;;;;;;;;;;;;;;;;
-
-; Whether to allow HTTP file uploads.
-; http://www.php.net/manual/en/ini.core.php#ini.file-uploads
-file_uploads = On
-
-; Temporary directory for HTTP uploaded files (will use system default if not
-; specified).
-; http://www.php.net/manual/en/ini.core.php#ini.upload-tmp-dir
-;upload_tmp_dir =
-
-; Maximum allowed size for uploaded files.
-; http://www.php.net/manual/en/ini.core.php#ini.upload-max-filesize
-upload_max_filesize = 2M
-
-;;;;;;;;;;;;;;;;;;
-; Fopen wrappers ;
-;;;;;;;;;;;;;;;;;;
-
-; Whether to allow the treatment of URLs (like http:// or ftp://) as files.
-; http://www.php.net/manual/en/filesystem.configuration.php#ini.allow-url-fopen
-allow_url_fopen = On
-
-; Whether to allow include/require to open URLs (like http:// or ftp://) as files.
-; http://www.php.net/manual/en/filesystem.configuration.php#ini.allow-url-include
-allow_url_include = Off
-
-; Define the anonymous ftp password (your email address). PHP's default setting
-; for this is empty.
-; http://www.php.net/manual/en/filesystem.configuration.php#ini.from
-;from="john@doe.com"
-
-; Define the User-Agent string. PHP's default setting for this is empty.
-; http://www.php.net/manual/en/filesystem.configuration.php#ini.user-agent
-;user_agent="PHP"
-
-; Default timeout for socket based streams (seconds)
-; http://www.php.net/manual/en/filesystem.configuration.php#ini.default-socket-timeout
-default_socket_timeout = 60
-
-; If your scripts have to deal with files from Macintosh systems,
-; or you are running on a Mac and need to deal with files from
-; unix or win32 systems, setting this flag will cause PHP to
-; automatically detect the EOL character in those files so that
-; fgets() and file() will work regardless of the source of the file.
-; http://www.php.net/manual/en/filesystem.configuration.php#ini.auto-detect-line-endings
-;auto_detect_line_endings = Off
-
-;;;;;;;;;;;;;;;;;;;;;;
-; Dynamic Extensions ;
-;;;;;;;;;;;;;;;;;;;;;;
-
-; If you wish to have an extension loaded automatically, use the following
-; syntax:
-;
-; extension=modulename.extension
-;
-; For example
-;
-; extension=msql.so
-;
-; ... or with a path:
-;
-; extension=/path/to/extension/msql.so
-;
-; If you only provide the name of the extension, PHP will look for it in its
-; default extension directory.
-
-;;;;
-; Note: packaged extension modules are now loaded via the .ini files
-; found in the directory /etc/php.d; these are loaded by default.
-;;;;
-
-
-;;;;;;;;;;;;;;;;;;;
-; Module Settings ;
-;;;;;;;;;;;;;;;;;;;
-
-[Date]
-; Defines the default timezone used by the date functions
-; http://www.php.net/manual/en/datetime.configuration.php#ini.date.timezone
-;date.timezone =
-
-; http://www.php.net/manual/en/datetime.configuration.php#ini.date.default-latitude
-;date.default_latitude = 31.7667
-
-; http://www.php.net/manual/en/datetime.configuration.php#ini.date.default-longitude
-;date.default_longitude = 35.2333
-
-; http://www.php.net/manual/en/datetime.configuration.php#ini.date.sunrise-zenith
-;date.sunrise_zenith = 90.583333
-
-; http://www.php.net/manual/en/datetime.configuration.php#ini.date.sunset-zenith
-;date.sunset_zenith = 90.583333
-
-[filter]
-; http://www.php.net/manual/en/filter.configuration.php#ini.filter.default
-;filter.default = unsafe_raw
-
-; http://www.php.net/manual/en/filter.configuration.php#ini.filter.default-flags
-;filter.default_flags =
-
-[iconv]
-;iconv.input_encoding = ISO-8859-1
-;iconv.internal_encoding = ISO-8859-1
-;iconv.output_encoding = ISO-8859-1
-
-[intl]
-;intl.default_locale =
-
-[sqlite]
-; http://www.php.net/manual/en/sqlite.configuration.php#ini.sqlite.assoc-case
-;sqlite.assoc_case = 0
-
-[sqlite3]
-;sqlite3.extension_dir =
-
-[Pcre]
-;PCRE library backtracking limit.
-; http://www.php.net/manual/en/pcre.configuration.php#ini.pcre.backtrack-limit
-;pcre.backtrack_limit=100000
-
-;PCRE library recursion limit.
-;Please note that if you set this value to a high number you may consume all
-;the available process stack and eventually crash PHP (due to reaching the
-;stack size limit imposed by the Operating System).
-; http://www.php.net/manual/en/pcre.configuration.php#ini.pcre.recursion-limit
-;pcre.recursion_limit=100000
-
-[Pdo]
-; Whether to pool ODBC connections. Can be one of "strict", "relaxed" or "off"
-; http://www.php.net/manual/en/ref.pdo-odbc.php#ini.pdo-odbc.connection-pooling
-;pdo_odbc.connection_pooling=strict
-
-[Phar]
-; http://www.php.net/manual/en/phar.configuration.php#ini.phar.readonly
-;phar.readonly = On
-
-; http://www.php.net/manual/en/phar.configuration.php#ini.phar.require-hash
-;phar.require_hash = On
-
-;phar.cache_list =
-
-[Syslog]
-; Whether or not to define the various syslog variables (e.g. $LOG_PID,
-; $LOG_CRON, etc.). Turning it off is a good idea performance-wise. In
-; runtime, you can define these variables by calling define_syslog_variables().
-; http://www.php.net/manual/en/network.configuration.php#ini.define-syslog-variables
-define_syslog_variables = Off
-
-[mail function]
-; For Win32 only.
-; http://www.php.net/manual/en/mail.configuration.php#ini.smtp
-SMTP = localhost
-; http://www.php.net/manual/en/mail.configuration.php#ini.smtp-port
-smtp_port = 25
-
-; For Win32 only.
-; http://www.php.net/manual/en/mail.configuration.php#ini.sendmail-from
-;sendmail_from = me@example.com
-
-; For Unix only. You may supply arguments as well (default: "sendmail -t -i").
-; http://www.php.net/manual/en/mail.configuration.php#ini.sendmail-path
-sendmail_path = /usr/sbin/sendmail -t -i
-
-; Force the addition of the specified parameters to be passed as extra parameters
-; to the sendmail binary. These parameters will always replace the value of
-; the 5th parameter to mail(), even in safe mode.
-;mail.force_extra_parameters =
-
-; Add X-PHP-Originaiting-Script: that will include uid of the script followed by the filename
-mail.add_x_header = On
-
-; Log all mail() calls including the full path of the script, line #, to address and headers
-;mail.log =
-
-[SQL]
-; http://www.php.net/manual/en/ini.core.php#ini.sql.safe-mode
-sql.safe_mode = Off
-
-[ODBC]
-; http://www.php.net/manual/en/odbc.configuration.php#ini.uodbc.default-db
-;odbc.default_db = Not yet implemented
-
-; http://www.php.net/manual/en/odbc.configuration.php#ini.uodbc.default-user
-;odbc.default_user = Not yet implemented
-
-; http://www.php.net/manual/en/odbc.configuration.php#ini.uodbc.default-pw
-;odbc.default_pw = Not yet implemented
-
-; Allow or prevent persistent links.
-; http://www.php.net/manual/en/odbc.configuration.php#ini.uodbc.allow-persistent
-odbc.allow_persistent = On
-
-; Check that a connection is still valid before reuse.
-; http://www.php.net/manual/en/odbc.configuration.php#ini.uodbc.check-persistent
-odbc.check_persistent = On
-
-; Maximum number of persistent links. -1 means no limit.
-; http://www.php.net/manual/en/odbc.configuration.php#ini.uodbc.max-persistent
-odbc.max_persistent = -1
-
-; Maximum number of links (persistent + non-persistent). -1 means no limit.
-; http://www.php.net/manual/en/odbc.configuration.php#ini.uodbc.max-links
-odbc.max_links = -1
-
-; Handling of LONG fields. Returns number of bytes to variables. 0 means
-; passthru.
-; http://www.php.net/manual/en/odbc.configuration.php#ini.uodbc.defaultlrl
-odbc.defaultlrl = 4096
-
-; Handling of binary data. 0 means passthru, 1 return as is, 2 convert to char.
-; See the documentation on odbc_binmode and odbc_longreadlen for an explanation
-; of uodbc.defaultlrl and uodbc.defaultbinmode
-; http://www.php.net/manual/en/odbc.configuration.php#ini.uodbc.defaultbinmode
-odbc.defaultbinmode = 1
-
-;birdstep.max_links = -1
-
-[MySQL]
-; Allow or prevent persistent links.
-; http://www.php.net/manual/en/mysql.configuration.php#ini.mysql.allow-persistent
-mysql.allow_persistent = On
-
-; Maximum number of persistent links. -1 means no limit.
-; http://www.php.net/manual/en/mysql.configuration.php#ini.mysql.max-persistent
-mysql.max_persistent = -1
-
-; Maximum number of links (persistent + non-persistent). -1 means no limit.
-; http://www.php.net/manual/en/mysql.configuration.php#ini.mysql.max-links
-mysql.max_links = -1
-
-; Default port number for mysql_connect(). If unset, mysql_connect() will use
-; the $MYSQL_TCP_PORT or the mysql-tcp entry in /etc/services or the
-; compile-time value defined MYSQL_PORT (in that order). Win32 will only look
-; at MYSQL_PORT.
-; http://www.php.net/manual/en/mysql.configuration.php#ini.mysql.default-port
-mysql.default_port =
-
-; Default socket name for local MySQL connects. If empty, uses the built-in
-; MySQL defaults.
-; http://www.php.net/manual/en/mysql.configuration.php#ini.mysql.default-socket
-mysql.default_socket =
-
-; Default host for mysql_connect() (doesn't apply in safe mode).
-; http://www.php.net/manual/en/mysql.configuration.php#ini.mysql.default-host
-mysql.default_host =
-
-; Default user for mysql_connect() (doesn't apply in safe mode).
-; http://www.php.net/manual/en/mysql.configuration.php#ini.mysql.default-user
-mysql.default_user =
-
-; Default password for mysql_connect() (doesn't apply in safe mode).
-; Note that this is generally a *bad* idea to store passwords in this file.
-; *Any* user with PHP access can run 'echo get_cfg_var("mysql.default_password")
-; and reveal this password! And of course, any users with read access to this
-; file will be able to reveal the password as well.
-; http://www.php.net/manual/en/mysql.configuration.php#ini.mysql.default-password
-mysql.default_password =
-
-; Maximum time (in seconds) for connect timeout. -1 means no limit
-; http://www.php.net/manual/en/mysql.configuration.php#ini.mysql.connect-timeout
-mysql.connect_timeout = 60
-
-; Trace mode. When trace_mode is active (=On), warnings for table/index scans and
-; SQL-Errors will be displayed.
-; http://www.php.net/manual/en/mysql.configuration.php#ini.mysql.trace-mode
-mysql.trace_mode = Off
-
-[MySQLi]
-
-; Maximum number of links. -1 means no limit.
-; http://www.php.net/manual/en/mysqli.configuration.php#ini.mysqli.max-links
-mysqli.max_links = -1
-
-; Default port number for mysqli_connect(). If unset, mysqli_connect() will use
-; the $MYSQL_TCP_PORT or the mysql-tcp entry in /etc/services or the
-; compile-time value defined MYSQL_PORT (in that order). Win32 will only look
-; at MYSQL_PORT.
-; http://www.php.net/manual/en/mysqli.configuration.php#ini.mysqli.default-port
-mysqli.default_port = 3306
-
-; Default socket name for local MySQL connects. If empty, uses the built-in
-; MySQL defaults.
-; http://www.php.net/manual/en/mysqli.configuration.php#ini.mysqli.default-socket
-mysqli.default_socket =
-
-; Default host for mysql_connect() (doesn't apply in safe mode).
-; http://www.php.net/manual/en/mysqli.configuration.php#ini.mysqli.default-host
-mysqli.default_host =
-
-; Default user for mysql_connect() (doesn't apply in safe mode).
-; http://www.php.net/manual/en/mysqli.configuration.php#ini.mysqli.default-user
-mysqli.default_user =
-
-; Default password for mysqli_connect() (doesn't apply in safe mode).
-; Note that this is generally a *bad* idea to store passwords in this file.
-; *Any* user with PHP access can run 'echo get_cfg_var("mysqli.default_pw")
-; and reveal this password! And of course, any users with read access to this
-; file will be able to reveal the password as well.
-; http://www.php.net/manual/en/mysqli.configuration.php#ini.mysqli.default-pw
-mysqli.default_pw =
-
-; Allow or prevent reconnect
-mysqli.reconnect = Off
-
-[PostgresSQL]
-; Allow or prevent persistent links.
-; http://www.php.net/manual/en/pgsql.configuration.php#ini.pgsql.allow-persistent
-pgsql.allow_persistent = On
-
-; Detect broken persistent links always with pg_pconnect().
-; Auto reset feature requires a little overheads.
-; http://www.php.net/manual/en/pgsql.configuration.php#ini.pgsql.auto-reset-persistent
-pgsql.auto_reset_persistent = Off
-
-; Maximum number of persistent links. -1 means no limit.
-; http://www.php.net/manual/en/pgsql.configuration.php#ini.pgsql.max-persistent
-pgsql.max_persistent = -1
-
-; Maximum number of links (persistent+non persistent). -1 means no limit.
-; http://www.php.net/manual/en/pgsql.configuration.php#ini.pgsql.max-links
-pgsql.max_links = -1
-
-; Ignore PostgreSQL backends Notice message or not.
-; Notice message logging require a little overheads.
-; http://www.php.net/manual/en/pgsql.configuration.php#ini.pgsql.ignore-notice
-pgsql.ignore_notice = 0
-
-; Log PostgreSQL backends Noitce message or not.
-; Unless pgsql.ignore_notice=0, module cannot log notice message.
-; http://www.php.net/manual/en/pgsql.configuration.php#ini.pgsql.log-notice
-pgsql.log_notice = 0
-
-[Sybase-CT]
-; Allow or prevent persistent links.
-; http://www.php.net/manual/en/sybase.configuration.php#ini.sybct.allow-persistent
-sybct.allow_persistent = On
-
-; Maximum number of persistent links. -1 means no limit.
-; http://www.php.net/manual/en/sybase.configuration.php#ini.sybct.max-persistent
-sybct.max_persistent = -1
-
-; Maximum number of links (persistent + non-persistent). -1 means no limit.
-; http://www.php.net/manual/en/sybase.configuration.php#ini.sybct.max-links
-sybct.max_links = -1
-
-; Minimum server message severity to display.
-; http://www.php.net/manual/en/sybase.configuration.php#ini.sybct.min-server-severity
-sybct.min_server_severity = 10
-
-; Minimum client message severity to display.
-; http://www.php.net/manual/en/sybase.configuration.php#ini.sybct.min-client-severity
-sybct.min_client_severity = 10
-
-; Set per-context timeout
-; http://www.php.net/manual/en/sybase.configuration.php#ini.sybct.timeout
-;sybct.timeout=
-
-;sybct.packet_size
-
-[bcmath]
-; Number of decimal digits for all bcmath functions.
-; http://www.php.net/manual/en/bc.configuration.php#ini.bcmath.scale
-bcmath.scale = 0
-
-[browscap]
-; http://www.php.net/manual/en/misc.configuration.php#ini.browscap
-;browscap = extra/browscap.ini
-
-[Session]
-; Handler used to store/retrieve data.
-; http://www.php.net/manual/en/session.configuration.php#ini.session.save-handler
-session.save_handler = files
-
-; Argument passed to save_handler. In the case of files, this is the path
-; where data files are stored. Note: Windows users have to change this
-; variable in order to use PHP's session functions.
-;
-; As of PHP 4.0.1, you can define the path as:
-;
-; session.save_path = "N;/path"
-;
-; where N is an integer. Instead of storing all the session files in
-; /path, what this will do is use subdirectories N-levels deep, and
-; store the session data in those directories. This is useful if you
-; or your OS have problems with lots of files in one directory, and is
-; a more efficient layout for servers that handle lots of sessions.
-;
-; NOTE 1: PHP will not create this directory structure automatically.
-; You can use the script in the ext/session dir for that purpose.
-; NOTE 2: See the section on garbage collection below if you choose to
-; use subdirectories for session storage
-;
-; The file storage module creates files using mode 600 by default.
-; You can change that by using
-;
-; session.save_path = "N;MODE;/path"
-;
-; where MODE is the octal representation of the mode. Note that this
-; does not overwrite the process's umask.
-; http://www.php.net/manual/en/session.configuration.php#ini.session.save-path
-session.save_path = "/tmp"
-
-; Whether to use cookies.
-; http://www.php.net/manual/en/session.configuration.php#ini.session.use-cookies
-session.use_cookies = 1
-
-; http://www.php.net/manual/en/session.configuration.php#ini.session.cookie-secure
-;session.cookie_secure =
-
-; This option forces PHP to fetch and use a cookie for storing and maintaining
-; the session id. We encourage this operation as it's very helpful in combatting
-; session hijacking when not specifying and managing your own session id. It is
-; not the end all be all of session hijacking defense, but it's a good start.
-; http://www.php.net/manual/en/session.configuration.php#ini.session.use-only-cookies
-session.use_only_cookies = 1
-
-; Name of the session (used as cookie name).
-; http://www.php.net/manual/en/session.configuration.php#ini.session.name
-session.name = PHPSESSID
-
-; Initialize session on request startup.
-; http://www.php.net/manual/en/session.configuration.php#ini.session.auto-start
-session.auto_start = 0
-
-; Lifetime in seconds of cookie or, if 0, until browser is restarted.
-; http://www.php.net/manual/en/session.configuration.php#ini.session.cookie-lifetime
-session.cookie_lifetime = 0
-
-; The path for which the cookie is valid.
-; http://www.php.net/manual/en/session.configuration.php#ini.session.cookie-path
-session.cookie_path = /
-
-; The domain for which the cookie is valid.
-; http://www.php.net/manual/en/session.configuration.php#ini.session.cookie-domain
-session.cookie_domain =
-
-; Whether or not to add the httpOnly flag to the cookie, which makes it inaccessible to browser scripting languages such as JavaScript.
-; http://www.php.net/manual/en/session.configuration.php#ini.session.cookie-httponly
-session.cookie_httponly =
-
-; Handler used to serialize data. php is the standard serializer of PHP.
-; http://www.php.net/manual/en/session.configuration.php#ini.session.serialize-handler
-session.serialize_handler = php
-
-; Defines the probability that the 'garbage collection' process is started
-; on every session initialization. The probability is calculated by using
-; gc_probability/gc_divisor. Where session.gc_probability is the numerator
-; and gc_divisor is the denominator in the equation. Setting this value to 1
-; when the session.gc_divisor value is 100 will give you approximately a 1% chance
-; the gc will run on any give request.
-; Default Value: 1
-; Development Value: 1
-; Production Value: 1
-; http://www.php.net/manual/en/session.configuration.php#ini.session.gc-probability
-session.gc_probability = 1
-
-; Defines the probability that the 'garbage collection' process is started on every
-; session initialization. The probability is calculated by using the following equation:
-; gc_probability/gc_divisor. Where session.gc_probability is the numerator and
-; session.gc_divisor is the denominator in the equation. Setting this value to 1
-; when the session.gc_divisor value is 100 will give you approximately a 1% chance
-; the gc will run on any give request. Increasing this value to 1000 will give you
-; a 0.1% chance the gc will run on any give request. For high volume production servers,
-; this is a more efficient approach.
-; Default Value: 100
-; Development Value: 1000
-; Production Value: 1000
-; http://www.php.net/manual/en/session.configuration.php#ini.session.gc-divisor
-session.gc_divisor = 1000
-
-; After this number of seconds, stored data will be seen as 'garbage' and
-; cleaned up by the garbage collection process.
-; http://www.php.net/manual/en/session.configuration.php#ini.session.gc-maxlifetime
-session.gc_maxlifetime = 1440
-
-; NOTE: If you are using the subdirectory option for storing session files
-; (see session.save_path above), then garbage collection does *not*
-; happen automatically. You will need to do your own garbage
-; collection through a shell script, cron entry, or some other method.
-; For example, the following script would is the equivalent of
-; setting session.gc_maxlifetime to 1440 (1440 seconds = 24 minutes):
-; cd /path/to/sessions; find -cmin +24 | xargs rm
-
-; PHP 4.2 and less have an undocumented feature/bug that allows you to
-; to initialize a session variable in the global scope, even when register_globals
-; is disabled. PHP 4.3 and later will warn you, if this feature is used.
-; You can disable the feature and the warning separately. At this time,
-; the warning is only displayed, if bug_compat_42 is enabled. This feature
-; introduces some serious security problems if not handled correctly. It's
-; recommended that you do not use this feature on production servers. But you
-; should enable this on development servers and enable the warning as well. If you
-; do not enable the feature on development servers, you won't be warned when it's
-; used and debugging errors caused by this can be difficult to track down.
-; Default Value: On
-; Development Value: On
-; Production Value: Off
-; http://www.php.net/manual/en/session.configuration.php#ini.session.bug-compat-42
-session.bug_compat_42 = Off
-
-; This setting controls whether or not you are warned by PHP when initializing a
-; session value into the global space. session.bug_compat_42 must be enabled before
-; these warnings can be issued by PHP. See the directive above for more information.
-; Default Value: On
-; Development Value: On
-; Production Value: Off
-; http://www.php.net/manual/en/session.configuration.php#ini.session.bug-compat-warn
-session.bug_compat_warn = Off
-
-; Check HTTP Referer to invalidate externally stored URLs containing ids.
-; HTTP_REFERER has to contain this substring for the session to be
-; considered as valid.
-; http://www.php.net/manual/en/session.configuration.php#ini.session.referer-check
-session.referer_check =
-
-; How many bytes to read from the file.
-; http://www.php.net/manual/en/session.configuration.php#ini.session.entropy-length
-session.entropy_length = 0
-
-; Specified here to create the session id.
-; http://www.php.net/manual/en/session.configuration.php#ini.session.entropy-file
-;session.entropy_file = /dev/urandom
-session.entropy_file =
-
-; http://www.php.net/manual/en/session.configuration.php#ini.session.entropy-length
-;session.entropy_length = 16
-
-; Set to {nocache,private,public,} to determine HTTP caching aspects
-; or leave this empty to avoid sending anti-caching headers.
-; http://www.php.net/manual/en/session.configuration.php#ini.session.cache-limiter
-session.cache_limiter = nocache
-
-; Document expires after n minutes.
-; http://www.php.net/manual/en/session.configuration.php#ini.session.cache-expire
-session.cache_expire = 180
-
-; trans sid support is disabled by default.
-; Use of trans sid may risk your users security.
-; Use this option with caution.
-; - User may send URL contains active session ID
-; to other person via. email/irc/etc.
-; - URL that contains active session ID may be stored
-; in publically accessible computer.
-; - User may access your site with the same session ID
-; always using URL stored in browser's history or bookmarks.
-; http://www.php.net/manual/en/session.configuration.php#ini.session.use-trans-sid
-session.use_trans_sid = 0
-
-; Select a hash function for use in generating session ids.
-; Possible Values
-; 0 (MD5 128 bits)
-; 1 (SHA-1 160 bits)
-; http://www.php.net/manual/en/session.configuration.php#ini.session.hash-function
-session.hash_function = 0
-
-; Define how many bits are stored in each character when converting
-; the binary hash data to something readable.
-; Possible values:
-; 4 (4 bits: 0-9, a-f)
-; 5 (5 bits: 0-9, a-v)
-; 6 (6 bits: 0-9, a-z, A-Z, "-", ",")
-; Default Value: 4
-; Development Value: 5
-; Production Value: 5
-; http://www.php.net/manual/en/session.configuration.php#ini.session.hash-bits-per-character
-session.hash_bits_per_character = 5
-
-; The URL rewriter will look for URLs in a defined set of HTML tags.
-; form/fieldset are special; if you include them here, the rewriter will
-; add a hidden <input> field with the info which is otherwise appended
-; to URLs. If you want XHTML conformity, remove the form entry.
-; Note that all valid entries require a "=", even if no value follows.
-; Default Value: "a=href,area=href,frame=src,form=,fieldset="
-; Development Value: "a=href,area=href,frame=src,input=src,form=fakeentry"
-; Production Value: "a=href,area=href,frame=src,input=src,form=fakeentry"
-; http://www.php.net/manual/en/session.configuration.php#ini.url-rewriter.tags
-url_rewriter.tags = "a=href,area=href,frame=src,input=src,form=fakeentry"
-
-[MSSQL]
-; Allow or prevent persistent links.
-mssql.allow_persistent = On
-
-; Maximum number of persistent links. -1 means no limit.
-mssql.max_persistent = -1
-
-; Maximum number of links (persistent+non persistent). -1 means no limit.
-mssql.max_links = -1
-
-; Minimum error severity to display.
-mssql.min_error_severity = 10
-
-; Minimum message severity to display.
-mssql.min_message_severity = 10
-
-; Compatibility mode with old versions of PHP 3.0.
-mssql.compatability_mode = Off
-
-; Connect timeout
-;mssql.connect_timeout = 5
-
-; Query timeout
-;mssql.timeout = 60
-
-; Valid range 0 - 2147483647. Default = 4096.
-;mssql.textlimit = 4096
-
-; Valid range 0 - 2147483647. Default = 4096.
-;mssql.textsize = 4096
-
-; Limits the number of records in each batch. 0 = all records in one batch.
-;mssql.batchsize = 0
-
-; Specify how datetime and datetim4 columns are returned
-; On => Returns data converted to SQL server settings
-; Off => Returns values as YYYY-MM-DD hh:mm:ss
-;mssql.datetimeconvert = On
-
-; Use NT authentication when connecting to the server
-mssql.secure_connection = Off
-
-; Specify max number of processes. -1 = library default
-; msdlib defaults to 25
-; FreeTDS defaults to 4096
-;mssql.max_procs = -1
-
-; Specify client character set.
-; If empty or not set the client charset from freetds.comf is used
-; This is only used when compiled with FreeTDS
-;mssql.charset = "ISO-8859-1"
-
-[Assertion]
-; Assert(expr); active by default.
-; http://www.php.net/manual/en/info.configuration.php#ini.assert.active
-;assert.active = On
-
-; Issue a PHP warning for each failed assertion.
-; http://www.php.net/manual/en/info.configuration.php#ini.assert.warning
-;assert.warning = On
-
-; Don't bail out by default.
-; http://www.php.net/manual/en/info.configuration.php#ini.assert.bail
-;assert.bail = Off
-
-; User-function to be called if an assertion fails.
-; http://www.php.net/manual/en/info.configuration.php#ini.assert.callback
-;assert.callback = 0
-
-; Eval the expression with current error_reporting(). Set to true if you want
-; error_reporting(0) around the eval().
-; http://www.php.net/manual/en/info.configuration.php#ini.assert.quiet-eval
-;assert.quiet_eval = 0
-
-[COM]
-; path to a file containing GUIDs, IIDs or filenames of files with TypeLibs
-; http://www.php.net/manual/en/com.configuration.php#ini.com.typelib-file
-;com.typelib_file =
-
-; allow Distributed-COM calls
-; http://www.php.net/manual/en/com.configuration.php#ini.com.allow-dcom
-;com.allow_dcom = true
-
-; autoregister constants of a components typlib on com_load()
-; http://www.php.net/manual/en/com.configuration.php#ini.com.autoregister-typelib
-;com.autoregister_typelib = true
-
-; register constants casesensitive
-; http://www.php.net/manual/en/com.configuration.php#ini.com.autoregister-casesensitive
-;com.autoregister_casesensitive = false
-
-; show warnings on duplicate constant registrations
-; http://www.php.net/manual/en/com.configuration.php#ini.com.autoregister-verbose
-;com.autoregister_verbose = true
-
-[mbstring]
-; language for internal character representation.
-; http://www.php.net/manual/en/mbstring.configuration.php#ini.mbstring.language
-;mbstring.language = Japanese
-
-; internal/script encoding.
-; Some encoding cannot work as internal encoding.
-; (e.g. SJIS, BIG5, ISO-2022-*)
-; http://www.php.net/manual/en/mbstring.configuration.php#ini.mbstring.internal-encoding
-;mbstring.internal_encoding = EUC-JP
-
-; http input encoding.
-; http://www.php.net/manual/en/mbstring.configuration.php#ini.mbstring.http-input
-;mbstring.http_input = auto
-
-; http output encoding. mb_output_handler must be
-; registered as output buffer to function
-; http://www.php.net/manual/en/mbstring.configuration.php#ini.mbstring.http-output
-;mbstring.http_output = SJIS
-
-; enable automatic encoding translation according to
-; mbstring.internal_encoding setting. Input chars are
-; converted to internal encoding by setting this to On.
-; Note: Do _not_ use automatic encoding translation for
-; portable libs/applications.
-; http://www.php.net/manual/en/mbstring.configuration.php#ini.mbstring.encoding-translation
-;mbstring.encoding_translation = Off
-
-; automatic encoding detection order.
-; auto means
-; http://www.php.net/manual/en/mbstring.configuration.php#ini.mbstring.detect-order
-;mbstring.detect_order = auto
-
-; substitute_character used when character cannot be converted
-; one from another
-; http://www.php.net/manual/en/mbstring.configuration.php#ini.mbstring.substitute-character
-;mbstring.substitute_character = none;
-
-; overload(replace) single byte functions by mbstring functions.
-; mail(), ereg(), etc are overloaded by mb_send_mail(), mb_ereg(),
-; etc. Possible values are 0,1,2,4 or combination of them.
-; For example, 7 for overload everything.
-; 0: No overload
-; 1: Overload mail() function
-; 2: Overload str*() functions
-; 4: Overload ereg*() functions
-; http://www.php.net/manual/en/mbstring.configuration.php#ini.mbstring.func-overload
-;mbstring.func_overload = 0
-
-; enable strict encoding detection.
-;mbstring.strict_detection = Off
-
-; This directive specifies the regex pattern of content types for which mb_output_handler()
-; is activated.
-; Default: mbstring.http_output_conv_mimetype=^(text/|application/xhtml\+xml)
-;mbstring.http_output_conv_mimetype=
-
-[gd]
-; Tell the jpeg decode to ignore warnings and try to create
-; a gd image. The warning will then be displayed as notices
-; disabled by default
-; http://www.php.net/manual/en/image.configuration.php#ini.image.jpeg-ignore-warning
-;gd.jpeg_ignore_warning = 0
-
-[exif]
-; Exif UNICODE user comments are handled as UCS-2BE/UCS-2LE and JIS as JIS.
-; With mbstring support this will automatically be converted into the encoding
-; given by corresponding encode setting. When empty mbstring.internal_encoding
-; is used. For the decode settings you can distinguish between motorola and
-; intel byte order. A decode setting cannot be empty.
-; http://www.php.net/manual/en/exif.configuration.php#ini.exif.encode-unicode
-;exif.encode_unicode = ISO-8859-15
-
-; http://www.php.net/manual/en/exif.configuration.php#ini.exif.decode-unicode-motorola
-;exif.decode_unicode_motorola = UCS-2BE
-
-; http://www.php.net/manual/en/exif.configuration.php#ini.exif.decode-unicode-intel
-;exif.decode_unicode_intel = UCS-2LE
-
-; http://www.php.net/manual/en/exif.configuration.php#ini.exif.encode-jis
-;exif.encode_jis =
-
-; http://www.php.net/manual/en/exif.configuration.php#ini.exif.decode-jis-motorola
-;exif.decode_jis_motorola = JIS
-
-; http://www.php.net/manual/en/exif.configuration.php#ini.exif.decode-jis-intel
-;exif.decode_jis_intel = JIS
-
-[Tidy]
-; The path to a default tidy configuration file to use when using tidy
-; http://www.php.net/manual/en/tidy.configuration.php#ini.tidy.default-config
-;tidy.default_config = /usr/local/lib/php/default.tcfg
-
-; Should tidy clean and repair output automatically?
-; WARNING: Do not use this option if you are generating non-html content
-; such as dynamic images
-; http://www.php.net/manual/en/tidy.configuration.php#ini.tidy.clean-output
-tidy.clean_output = Off
-
-[soap]
-; Enables or disables WSDL caching feature.
-; http://www.php.net/manual/en/soap.configuration.php#ini.soap.wsdl-cache-enabled
-soap.wsdl_cache_enabled=1
-
-; Sets the directory name where SOAP extension will put cache files.
-; http://www.php.net/manual/en/soap.configuration.php#ini.soap.wsdl-cache-dir
-soap.wsdl_cache_dir="/tmp"
-
-; (time to live) Sets the number of second while cached file will be used
-; instead of original one.
-; http://www.php.net/manual/en/soap.configuration.php#ini.soap.wsdl-cache-ttl
-soap.wsdl_cache_ttl=86400
-
-[sysvshm]
-; A default size of the shared memory segment
-;sysvshm.init_mem = 10000
-
-
-; Local Variables:
-; tab-width: 4
-; End:
-
--- a/aws/rc.local
+++ /dev/null
@@ -1,14 +1,1 @@
-#!/bin/sh
-#
-# This script will be executed *after* all the other init scripts.
-# You can put your own initialization stuff in here if you don't
-# want to do the full Sys V style init stuff.
-touch /var/lock/subsys/local
-cd /tmp
-rm -rfv busui
-git clone http://maxious.lambdacomplex.org/busui/git
-sh busui/aws/awsStartup.sh
-
-
-
Binary files a/css/images/01-refresh.png and /dev/null differ
Binary files a/css/images/02-redo.png and /dev/null differ
Binary files a/css/images/06-magnify.png and /dev/null differ
Binary files a/css/images/07-map-marker.png and /dev/null differ
Binary files a/css/images/101-gameplan.png and /dev/null differ
Binary files a/css/images/102-walk.png and /dev/null differ
Binary files a/css/images/103-map.png and /dev/null differ
Binary files a/css/images/121-landscape.png and /dev/null differ
Binary files a/css/images/13-target.png and /dev/null differ
Binary files a/css/images/139-flags.png and /dev/null differ
Binary files a/css/images/145-persondot.png and /dev/null differ
Binary files a/css/images/184-warning.png and /dev/null differ
Binary files a/css/images/193-location-arrow.png and /dev/null differ
Binary files a/css/images/28-star.png and /dev/null differ
Binary files a/css/images/53-house.png and /dev/null differ
Binary files a/css/images/55-network.png and /dev/null differ
Binary files a/css/images/57-download.png and /dev/null differ
Binary files a/css/images/58-bookmark.png and /dev/null differ
Binary files a/css/images/59-flag.png and /dev/null differ
Binary files a/css/images/60-signpost.png and /dev/null differ
Binary files a/css/images/73-radar.png and /dev/null differ
Binary files a/css/images/74-location.png and /dev/null differ
Binary files a/css/images/83-calendar.png and /dev/null differ
Binary files /dev/null and b/css/images/91-beaker-2.png differ
Binary files /dev/null and b/css/images/ui-bg_diagonals-thick_18_b81900_40x40.png differ
Binary files /dev/null and b/css/images/ui-bg_diagonals-thick_20_666666_40x40.png differ
Binary files /dev/null and b/css/images/ui-bg_flat_10_000000_40x100.png differ
Binary files /dev/null and b/css/images/ui-bg_glass_100_f6f6f6_1x400.png differ
Binary files /dev/null and b/css/images/ui-bg_glass_100_fdf5ce_1x400.png differ
Binary files /dev/null and b/css/images/ui-bg_glass_65_ffffff_1x400.png differ
Binary files /dev/null and b/css/images/ui-bg_gloss-wave_35_f6a828_500x100.png differ
Binary files /dev/null and b/css/images/ui-bg_highlight-soft_100_eeeeee_1x100.png differ
Binary files /dev/null and b/css/images/ui-bg_highlight-soft_75_ffe45c_1x100.png differ
Binary files /dev/null and b/css/images/ui-icons_222222_256x240.png differ
Binary files /dev/null and b/css/images/ui-icons_228ef1_256x240.png differ
Binary files /dev/null and b/css/images/ui-icons_ef8c08_256x240.png differ
Binary files /dev/null and b/css/images/ui-icons_ffd27a_256x240.png differ
Binary files /dev/null and b/css/images/ui-icons_ffffff_256x240.png differ
Binary files /dev/null and b/css/images/warning.png differ
--- a/css/jquery-mobile-1.0a3.css
+++ /dev/null
@@ -1,16 +1,1 @@
-/*!
- * jQuery Mobile v1.0a3
- * http://jquerymobile.com/
- *
- * Copyright 2010, jQuery Project
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- */
-/*!
- * jQuery Mobile v1.0a3
- * http://jquerymobile.com/
- *
- * Copyright 2010, jQuery Project
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- */.ui-bar-a{border:1px solid #2a2a2a;background:#111;color:#fff;font-weight:bold;text-shadow:0 -1px 1px #000;background-image:-moz-linear-gradient(top,#3c3c3c,#111);background-image:-webkit-gradient(linear,left top,left bottom,color-stop(0,#3c3c3c),color-stop(1,#111));-msfilter:"progid:DXImageTransform.Microsoft.gradient(startColorStr='#3c3c3c', EndColorStr='#111111')"}.ui-bar-a,.ui-bar-a input,.ui-bar-a select,.ui-bar-a textarea,.ui-bar-a button{font-family:Helvetica,Arial,sans-serif}.ui-bar-a .ui-link-inherit{color:#fff}.ui-bar-a .ui-link{color:#7cc4e7;font-weight:bold}.ui-body-a{border:1px solid #2a2a2a;background:#222;color:#fff;text-shadow:0 1px 0 #000;font-weight:normal;background-image:-moz-linear-gradient(top,#666,#222);background-image:-webkit-gradient(linear,left top,left bottom,color-stop(0,#666),color-stop(1,#222));-ms-filter:"progid:DXImageTransform.Microsoft.gradient(startColorStr='#666666', EndColorStr='#222222)')"}.ui-body-a,.ui-body-a input,.ui-body-a select,.ui-body-a textarea,.ui-body-a button{font-family:Helvetica,Arial,sans-serif}.ui-body-a .ui-link-inherit{color:#fff}.ui-body-a .ui-link{color:#2489ce;font-weight:bold}.ui-br{border-bottom:1px solid rgba(130,130,130,.3)}.ui-btn-up-a{border:1px solid #222;background:#333;font-weight:bold;color:#fff;cursor:pointer;text-shadow:0 -1px 1px #000;text-decoration:none;background-image:-moz-linear-gradient(top,#555,#333);background-image:-webkit-gradient(linear,left top,left bottom,color-stop(0,#555),color-stop(1,#333));-ms-filter:"progid:DXImageTransform.Microsoft.gradient(startColorStr='#555555', EndColorStr='#333333')"}.ui-btn-up-a a.ui-link-inherit{color:#fff}.ui-btn-hover-a{border:1px solid #000;background:#444;font-weight:bold;color:#fff;text-shadow:0 -1px 1px #000;text-decoration:none;background-image:-moz-linear-gradient(top,#666,#444);background-image:-webkit-gradient(linear,left top,left bottom,color-stop(0,#666),color-stop(1,#444));-ms-filter:"progid:DXImageTransform.Microsoft.gradient(startColorStr='#666666', EndColorStr='#444444')"}.ui-btn-hover-a a.ui-link-inherit{color:#fff}.ui-btn-down-a{border:1px solid #000;background:#3d3d3d;font-weight:bold;color:#fff;text-shadow:0 -1px 1px #000;background-image:-moz-linear-gradient(top,#333,#5a5a5a);background-image:-webkit-gradient(linear,left top,left bottom,color-stop(0,#333),color-stop(1,#5a5a5a));-ms-filter:"progid:DXImageTransform.Microsoft.gradient(startColorStr='#333333', EndColorStr='#5a5a5a')"}.ui-btn-down-a a.ui-link-inherit{color:#fff}.ui-btn-up-a,.ui-btn-hover-a,.ui-btn-down-a{font-family:Helvetica,Arial,sans-serif}.ui-bar-b{border:1px solid #456f9a;background:#5e87b0;color:#fff;font-weight:bold;text-shadow:0 -1px 1px #254f7a;background-image:-moz-linear-gradient(top,#81a8ce,#5e87b0);background-image:-webkit-gradient(linear,left top,left bottom,color-stop(0,#81a8ce),color-stop(1,#5e87b0));-ms-filter:"progid:DXImageTransform.Microsoft.gradient(startColorStr='#81a8ce', EndColorStr='#5e87b0')"}.ui-bar-b,.ui-bar-b input,.ui-bar-b select,.ui-bar-b textarea,.ui-bar-b button{font-family:Helvetica,Arial,sans-serif}.ui-bar-b .ui-link-inherit{color:#fff}.ui-bar-b .ui-link{color:#7cc4e7;font-weight:bold}.ui-body-b{border:1px solid #c6c6c6;background:#ccc;color:#333;text-shadow:0 1px 0 #fff;font-weight:normal;background-image:-moz-linear-gradient(top,#e6e6e6,#ccc);background-image:-webkit-gradient(linear,left top,left bottom,color-stop(0,#e6e6e6),color-stop(1,#ccc));-ms-filter:"progid:DXImageTransform.Microsoft.gradient(startColorStr='#e6e6e6', EndColorStr='#cccccc')"}.ui-body-b,.ui-body-b input,.ui-body-b select,.ui-body-b textarea,.ui-body-b button{font-family:Helvetica,Arial,sans-serif}.ui-body-b .ui-link-inherit{color:#333}.ui-body-b .ui-link{color:#2489ce;font-weight:bold}.ui-btn-up-b{border:1px solid #145072;background:#2567ab;font-weight:bold;color:#fff;cursor:pointer;text-shadow:0 -1px 1px #145072;text-decoration:none;background-image:-moz-linear-gradient(top,#4e89c5,#2567ab);background-image:-webkit-gradient(linear,left top,left bottom,color-stop(0,#5f9cc5),color-stop(1,#396b9e));-ms-filter:"progid:DXImageTransform.Microsoft.gradient(startColorStr='#4e89c5', EndColorStr='#2567ab')"}.ui-btn-up-b a.ui-link-inherit{color:#fff}.ui-btn-hover-b{border:1px solid #00516e;background:#4b88b6;font-weight:bold;color:#fff;text-shadow:0 -1px 1px #014d68;background-image:-moz-linear-gradient(top,#72b0d4,#4b88b6);text-decoration:none;background-image:-webkit-gradient(linear,left top,left bottom,color-stop(0,#72b0d4),color-stop(1,#4b88b6));-ms-filter:"progid:DXImageTransform.Microsoft.gradient(startColorStr='#72b0d4', EndColorStr='#4b88b6')"}.ui-btn-hover-b a.ui-link-inherit{color:#fff}.ui-btn-down-b{border:1px solid #225377;background:#4e89c5;font-weight:bold;color:#fff;text-shadow:0 -1px 1px #225377;background-image:-moz-linear-gradient(top,#396b9e,#4e89c5);background-image:-webkit-gradient(linear,left top,left bottom,color-stop(0,#396b9e),color-stop(1,#4e89c5));-ms-filter:"progid:DXImageTransform.Microsoft.gradient(startColorStr='#396b9e', EndColorStr='#4e89c5')"}.ui-btn-down-b a.ui-link-inherit{color:#fff}.ui-btn-up-b,.ui-btn-hover-b,.ui-btn-down-b{font-family:Helvetica,Arial,sans-serif}.ui-bar-c{border:1px solid #b3b3b3;background:#e9eaeb;color:#3e3e3e;font-weight:bold;text-shadow:0 1px 1px #fff;background-image:-moz-linear-gradient(top,#f0f0f0,#e9eaeb);background-image:-webkit-gradient(linear,left top,left bottom,color-stop(0,#f0f0f0),color-stop(1,#e9eaeb));-ms-filter:"progid:DXImageTransform.Microsoft.gradient(startColorStr='#f0f0f0', EndColorStr='#e9eaeb')"}.ui-bar-c,.ui-bar-c input,.ui-bar-c select,.ui-bar-c textarea,.ui-bar-c button{font-family:Helvetica,Arial,sans-serif}.ui-body-c{border:1px solid #b3b3b3;color:#333;text-shadow:0 1px 0 #fff;background:#f0f0f0;background-image:-moz-linear-gradient(top,#eee,#ddd);background-image:-webkit-gradient(linear,left top,left bottom,color-stop(0,#eee),color-stop(1,#ddd));-ms-filter:"progid:DXImageTransform.Microsoft.gradient(startColorStr='#eeeeee', EndColorStr='#dddddd')"}.ui-body-c,.ui-body-c input,.ui-body-c select,.ui-body-c textarea,.ui-body-c button{font-family:Helvetica,Arial,sans-serif}.ui-body-c .ui-link-inherit{color:#333}.ui-body-c .ui-link{color:#2489ce;font-weight:bold}.ui-btn-up-c{border:1px solid #ccc;background:#eee;font-weight:bold;color:#444;cursor:pointer;text-shadow:0 1px 1px #f6f6f6;text-decoration:none;background-image:-moz-linear-gradient(top,#fefefe,#eee);background-image:-webkit-gradient(linear,left top,left bottom,color-stop(0,#fdfdfd),color-stop(1,#eee));-ms-filter:"progid:DXImageTransform.Microsoft.gradient(startColorStr='#fdfdfd', EndColorStr='#eeeeee')"}.ui-btn-up-c a.ui-link-inherit{color:#2f3e46}.ui-btn-hover-c{border:1px solid #bbb;background:#dadada;font-weight:bold;color:#101010;text-decoration:none;text-shadow:0 1px 1px #fff;background-image:-moz-linear-gradient(top,#ededed,#dadada);background-image:-webkit-gradient(linear,left top,left bottom,color-stop(0,#ededed),color-stop(1,#dadada));-ms-filter:"progid:DXImageTransform.Microsoft.gradient(startColorStr='#ededed', EndColorStr='#dadada')"}.ui-btn-hover-c a.ui-link-inherit{color:#2f3e46}.ui-btn-down-c{border:1px solid #808080;background:#fdfdfd;font-weight:bold;color:#111;text-shadow:0 1px 1px #fff;background-image:-moz-linear-gradient(top,#eee,#fdfdfd);background-image:-webkit-gradient(linear,left top,left bottom,color-stop(0,#eee),color-stop(1,#fdfdfd));-msfilter:"progid:DXImageTransform.Microsoft.gradient(startColorStr='#eeeeee', EndColorStr='#fdfdfd')"}.ui-btn-down-c a.ui-link-inherit{color:#2f3e46}.ui-btn-up-c,.ui-btn-hover-c,.ui-btn-down-c{font-family:Helvetica,Arial,sans-serif}.ui-bar-d{border:1px solid #ccc;background:#bbb;color:#333;text-shadow:0 1px 0 #eee;background-image:-moz-linear-gradient(top,#ddd,#bbb);background-image:-webkit-gradient(linear,left top,left bottom,color-stop(0,#ddd),color-stop(1,#bbb));-ms-filter:"progid:DXImageTransform.Microsoft.gradient(startColorStr='#dddddd', EndColorStr='#bbbbbb')"}.ui-bar-d,.ui-bar-d input,.ui-bar-d select,.ui-bar-d textarea,.ui-bar-d button{font-family:Helvetica,Arial,sans-serif}.ui-bar-d .ui-link-inherit{color:#333}.ui-bar-d .ui-link{color:#2489ce;font-weight:bold}.ui-body-d{border:1px solid #ccc;color:#333;text-shadow:0 1px 0 #fff;background:#fff}.ui-body-d,.ui-body-d input,.ui-body-d select,.ui-body-d textarea,.ui-body-d button{font-family:Helvetica,Arial,sans-serif}.ui-body-d .ui-link-inherit{color:#333}.ui-body-d .ui-link{color:#2489ce;font-weight:bold}.ui-btn-up-d{border:1px solid #ccc;background:#fff;font-weight:bold;color:#444;text-decoration:none;text-shadow:0 1px 1px #fff}.ui-btn-up-d a.ui-link-inherit{color:#333}.ui-btn-hover-d{border:1px solid #aaa;background:#eee;font-weight:bold;color:#222;cursor:pointer;text-shadow:0 1px 1px #fff;text-decoration:none;background-image:-moz-linear-gradient(top,#fdfdfd,#eee);background-image:-webkit-gradient(linear,left top,left bottom,color-stop(0,#fdfdfd),color-stop(1,#eee));-msfilter:"progid:DXImageTransform.Microsoft.gradient(startColorStr='#fdfdfd', EndColorStr='#eeeeee')"}.ui-btn-hover-d a.ui-link-inherit{color:#222}.ui-btn-down-d{border:1px solid #aaa;background:#fff;font-weight:bold;color:#111;text-shadow:0 1px 1px #fff;background-image:-moz-linear-gradient(top,#eee,#fff);background-image:-webkit-gradient(linear,left top,left bottom,color-stop(0,#eee),color-stop(1,#fff));-msfilter:"progid:DXImageTransform.Microsoft.gradient(startColorStr='#eeeeee', EndColorStr='#ffffff')"}.ui-btn-down-d a.ui-link-inherit{border:1px solid #808080;background:#ced0d2;font-weight:bold;color:#111;text-shadow:none;background-image:-moz-linear-gradient(top,#ccc,#eee);background-image:-webkit-gradient(linear,left top,left bottom,color-stop(0,#ccc),color-stop(1,#eee));-msfilter:"progid:DXImageTransform.Microsoft.gradient(startColorStr='#cccccc', EndColorStr='#eeeeee')"}.ui-btn-up-d,.ui-btn-hover-d,.ui-btn-down-d{font-family:Helvetica,Arial,sans-serif}.ui-bar-e{border:1px solid #f7c942;background:#fadb4e;color:#333;text-shadow:0 1px 0 #fff;background-image:-moz-linear-gradient(top,#fceda7,#fadb4e);background-image:-webkit-gradient(linear,left top,left bottom,color-stop(0,#fceda7),color-stop(1,#fadb4e));-msfilter:"progid:DXImageTransform.Microsoft.gradient(startColorStr='#fceda7', EndColorStr='#fadb4e')"}.ui-bar-e,.ui-bar-e input,.ui-bar-e select,.ui-bar-e textarea,.ui-bar-d button{font-family:Helvetica,Arial,sans-serif}.ui-bar-e .ui-link-inherit{color:#333}.ui-bar-e .ui-link{color:#2489ce;font-weight:bold}.ui-body-e{border:1px solid #f7c942;color:#333;text-shadow:0 1px 0 #fff;background:#faeb9e;background-image:-moz-linear-gradient(top,#fff,#faeb9e);background-image:-webkit-gradient(linear,left top,left bottom,color-stop(0,#fff),color-stop(1,#faeb9e));-msfilter:"progid:DXImageTransform.Microsoft.gradient(startColorStr='#ffffff', EndColorStr='#faeb9e')"}.ui-body-e,.ui-body-e input,.ui-body-e select,.ui-body-e textarea,.ui-body-e button{font-family:Helvetica,Arial,sans-serif}.ui-body-e .ui-link-inherit{color:#333}.ui-body-e .ui-link{color:#2489ce;font-weight:bold}.ui-btn-up-e{border:1px solid #f7c942;background:#fadb4e;font-weight:bold;color:#333;cursor:pointer;text-shadow:0 1px 1px #fe3;text-decoration:none;text-shadow:0 1px 0 #fff;background-image:-moz-linear-gradient(top,#fceda7,#fadb4e);background-image:-webkit-gradient(linear,left top,left bottom,color-stop(0,#fceda7),color-stop(1,#fadb4e));-ms-filter:"progid:DXImageTransform.Microsoft.gradient(startColorStr='#fceda7', EndColorStr='#fadb4e')"}.ui-btn-up-e a.ui-link-inherit{color:#333}.ui-btn-hover-e{border:1px solid #e79952;background:#fbe26f;font-weight:bold;color:#111;text-decoration:none;text-shadow:0 1px 1px #fff;background-image:-moz-linear-gradient(top,#fcf0b5,#fbe26f);background-image:-webkit-gradient(linear,left top,left bottom,color-stop(0,#fcf0b5),color-stop(1,#fbe26f));-msfilter:"progid:DXImageTransform.Microsoft.gradient(startColorStr='#fcf0b5', EndColorStr='#fbe26f')"}.ui-btn-hover-e a.ui-link-inherit{color:#333}.ui-btn-down-e{border:1px solid #f7c942;background:#fceda7;font-weight:bold;color:#111;text-shadow:0 1px 1px #fff;background-image:-moz-linear-gradient(top,#fadb4e,#fceda7);background-image:-webkit-gradient(linear,left top,left bottom,color-stop(0,#fadb4e),color-stop(1,#fceda7));-ms-filter:"progid:DXImageTransform.Microsoft.gradient(startColorStr='#fadb4e', EndColorStr='#fceda7')"}.ui-btn-down-e a.ui-link-inherit{color:#333}.ui-btn-up-e,.ui-btn-hover-e,.ui-btn-down-e{font-family:Helvetica,Arial,sans-serif}a.ui-link-inherit{text-decoration:none!important}.ui-btn-active{border:1px solid #155678;background:#4596ce;font-weight:bold;color:#fff;cursor:pointer;text-shadow:0 -1px 1px #145072;text-decoration:none;background-image:-moz-linear-gradient(top,#85bae4,#5393c5);background-image:-webkit-gradient(linear,left top,left bottom,color-stop(0,#85bae4),color-stop(1,#5393c5));-msfilter:"progid:DXImageTransform.Microsoft.gradient(startColorStr='#85bae4', EndColorStr='#5393c5')";outline:0}.ui-btn-active a.ui-link-inherit{color:#fff}.ui-btn-inner{border-top:1px solid #fff;border-color:rgba(255,255,255,.3)}.ui-corner-tl{-moz-border-radius-topleft:.6em;-webkit-border-top-left-radius:.6em;border-top-left-radius:.6em}.ui-corner-tr{-moz-border-radius-topright:.6em;-webkit-border-top-right-radius:.6em;border-top-right-radius:.6em}.ui-corner-bl{-moz-border-radius-bottomleft:.6em;-webkit-border-bottom-left-radius:.6em;border-bottom-left-radius:.6em}.ui-corner-br{-moz-border-radius-bottomright:.6em;-webkit-border-bottom-right-radius:.6em;border-bottom-right-radius:.6em}.ui-corner-top{-moz-border-radius-topleft:.6em;-webkit-border-top-left-radius:.6em;border-top-left-radius:.6em;-moz-border-radius-topright:.6em;-webkit-border-top-right-radius:.6em;border-top-right-radius:.6em}.ui-corner-bottom{-moz-border-radius-bottomleft:.6em;-webkit-border-bottom-left-radius:.6em;border-bottom-left-radius:.6em;-moz-border-radius-bottomright:.6em;-webkit-border-bottom-right-radius:.6em;border-bottom-right-radius:.6em}.ui-corner-right{-moz-border-radius-topright:.6em;-webkit-border-top-right-radius:.6em;border-top-right-radius:.6em;-moz-border-radius-bottomright:.6em;-webkit-border-bottom-right-radius:.6em;border-bottom-right-radius:.6em}.ui-corner-left{-moz-border-radius-topleft:.6em;-webkit-border-top-left-radius:.6em;border-top-left-radius:.6em;-moz-border-radius-bottomleft:.6em;-webkit-border-bottom-left-radius:.6em;border-bottom-left-radius:.6em}.ui-corner-all{-moz-border-radius:.6em;-webkit-border-radius:.6em;border-radius:.6em}.ui-disabled{opacity:.3}.ui-disabled,.ui-disabled a{cursor:default!important}.ui-icon{background-image:url(images/icons-18-white.png);background-repeat:no-repeat;background-color:#666;background-color:rgba(0,0,0,.4);-moz-border-radius:9px;-webkit-border-radius:9px;border-radius:9px}.ui-icon-disc{background-color:#666;background-color:rgba(0,0,0,.3);-moz-border-radius:9px;-webkit-border-radius:9px;border-radius:9px}.ui-icon-black{background-image:url(images/icons-18-black.png)}.ui-icon-black-disc{background-color:#fff;background-color:rgba(255,255,255,.3);-moz-border-radius:9px;-webkit-border-radius:9px;border-radius:9px}@media screen and (-webkit-min-device-pixel-ratio:2),screen and (max--moz-device-pixel-ratio:2){.ui-icon{background-image:url(images/icons-36-white.png);background-size:630px 18px}.ui-icon-black{background-image:url(images/icons-36-black.png)}}.ui-icon-plus{background-position:-0 0}.ui-icon-minus{background-position:-36px 0}.ui-icon-delete{background-position:-72px 0}.ui-icon-arrow-r{background-position:-108px 0}.ui-icon-arrow-l{background-position:-144px 0}.ui-icon-arrow-u{background-position:-180px 0}.ui-icon-arrow-d{background-position:-216px 0}.ui-icon-check{background-position:-252px 0}.ui-icon-gear{background-position:-288px 0}.ui-icon-refresh{background-position:-324px 0}.ui-icon-forward{background-position:-360px 0}.ui-icon-back{background-position:-396px 0}.ui-icon-grid{background-position:-432px 0}.ui-icon-star{background-position:-468px 0}.ui-icon-alert{background-position:-504px 0}.ui-icon-info{background-position:-540px 0}.ui-icon-home{background-position:-576px 0}.ui-icon-search{background-position:-612px 0}.ui-icon-checkbox-off,.ui-icon-checkbox-on,.ui-icon-radio-off,.ui-icon-radio-on{background-color:transparent;-moz-border-radius:0;-webkit-border-radius:0;border-radius:0;background-size:20px 20px}.ui-icon-checkbox-off{background-image:url(images/form-check-off.png)}.ui-icon-checkbox-on{background-image:url(images/form-check-on.png)}.ui-icon-radio-off{background-image:url(images/form-radio-off.png)}.ui-icon-radio-on{background-image:url(images/form-radio-on.png)}.ui-icon-searchfield{background-image:url(images/icon-search-black.png);background-size:16px 16px}.ui-icon-loading{background-image:url(images/ajax-loader.png);width:40px;height:40px;-moz-border-radius:20px;-webkit-border-radius:20px;border-radius:20px;background-size:35px 35px}.ui-btn-corner-tl{-moz-border-radius-topleft:1em;-webkit-border-top-left-radius:1em;border-top-left-radius:1em}.ui-btn-corner-tr{-moz-border-radius-topright:1em;-webkit-border-top-right-radius:1em;border-top-right-radius:1em}.ui-btn-corner-bl{-moz-border-radius-bottomleft:1em;-webkit-border-bottom-left-radius:1em;border-bottom-left-radius:1em}.ui-btn-corner-br{-moz-border-radius-bottomright:1em;-webkit-border-bottom-right-radius:1em;border-bottom-right-radius:1em}.ui-btn-corner-top{-moz-border-radius-topleft:1em;-webkit-border-top-left-radius:1em;border-top-left-radius:1em;-moz-border-radius-topright:1em;-webkit-border-top-right-radius:1em;border-top-right-radius:1em}.ui-btn-corner-bottom{-moz-border-radius-bottomleft:1em;-webkit-border-bottom-left-radius:1em;border-bottom-left-radius:1em;-moz-border-radius-bottomright:1em;-webkit-border-bottom-right-radius:1em;border-bottom-right-radius:1em}.ui-btn-corner-right{-moz-border-radius-topright:1em;-webkit-border-top-right-radius:1em;border-top-right-radius:1em;-moz-border-radius-bottomright:1em;-webkit-border-bottom-right-radius:1em;border-bottom-right-radius:1em}.ui-btn-corner-left{-moz-border-radius-topleft:1em;-webkit-border-top-left-radius:1em;border-top-left-radius:1em;-moz-border-radius-bottomleft:1em;-webkit-border-bottom-left-radius:1em;border-bottom-left-radius:1em}.ui-btn-corner-all{-moz-border-radius:1em;-webkit-border-radius:1em;border-radius:1em}.ui-corner-tl,.ui-corner-tr,.ui-corner-bl,.ui-corner-br,.ui-corner-top,.ui-corner-bottom,.ui-corner-right,.ui-corner-left,.ui-corner-all,.ui-btn-corner-tl,.ui-btn-corner-tr,.ui-btn-corner-bl,.ui-btn-corner-br,.ui-btn-corner-top,.ui-btn-corner-bottom,.ui-btn-corner-right,.ui-btn-corner-left,.ui-btn-corner-all{-webkit-background-clip:padding-box;-moz-background-clip:padding-box;background-clip:padding-box}.ui-overlay{background:#666;opacity:.5;filter:Alpha(Opacity=50);position:absolute;width:100%;height:100%}.ui-overlay-shadow{-moz-box-shadow:0 0 12px rgba(0,0,0,.6);-webkit-box-shadow:0 0 12px rgba(0,0,0,.6);box-shadow:0 0 12px rgba(0,0,0,.6)}.ui-shadow{-moz-box-shadow:0 1px 4px rgba(0,0,0,.3);-webkit-box-shadow:0 1px 4px rgba(0,0,0,.3);box-shadow:0 1px 4px rgba(0,0,0,.3)}.ui-bar-a .ui-shadow,.ui-bar-b .ui-shadow,.ui-bar-c .ui-shadow{-moz-box-shadow:0 1px 0 rgba(255,255,255,.3);-webkit-box-shadow:0 1px 0 rgba(255,255,255,.3);box-shadow:0 1px 0 rgba(255,255,255,.3)}.ui-shadow-inset{-moz-box-shadow:inset 0 1px 4px rgba(0,0,0,.2);-webkit-box-shadow:inset 0 1px 4px rgba(0,0,0,.2);box-shadow:inset 0 1px 4px rgba(0,0,0,.2)}.ui-icon-shadow{-moz-box-shadow:0 1px 0 rgba(255,255,255,.4);-webkit-box-shadow:0 1px 0 rgba(255,255,255,.4);box-shadow:0 1px 0 rgba(255,255,255,.4)}.ui-focus{-moz-box-shadow:0 0 12px #387bbe;-webkit-box-shadow:0 0 12px #387bbe;box-shadow:0 0 12px #387bbe}.ui-mobile-nosupport-boxshadow *{-moz-box-shadow:none!important;-webkit-box-shadow:none!important;box-shadow:none!important}.ui-mobile-nosupport-boxshadow .ui-focus{outline-width:2px}.ui-mobile fieldset,.ui-page{padding:0;margin:0}.ui-mobile a img,.ui-mobile fieldset{border:0}.ui-mobile-viewport{margin:0;overflow-x:hidden;-webkit-text-size-adjust:none;-ms-text-size-adjust:none;-webkit-tap-highlight-color:rgba(0,0,0,0)}[data-role=page],[data-role=dialog],.ui-page{top:0;left:0;width:100%;min-height:100%;position:absolute;display:none;border:0}.ui-page-active{display:block;overflow:visible}.portrait,.portrait .ui-page{min-height:480px}.landscape,.landscape .ui-page{min-height:320px}.ui-loading .ui-mobile-viewport{overflow:hidden!important}.ui-loading .ui-loader{display:block}.ui-loading .ui-page{overflow:hidden}.ui-loader{display:none;position:absolute;opacity:.85;z-index:10;left:50%;width:200px;margin-left:-130px;margin-top:-35px;padding:10px 30px}.ui-loader h1{font-size:15px;text-align:center}.ui-loader .ui-icon{position:static;display:block;opacity:.9;margin:0 auto;width:35px;height:35px;background-color:transparent}.ui-mobile-rendering>*{visibility:hidden}.ui-bar,.ui-body{position:relative;padding:.4em 15px;overflow:hidden;display:block;clear:both}.ui-bar{font-size:16px;margin:0}.ui-bar h1,.ui-bar h2,.ui-bar h3,.ui-bar h4,.ui-bar h5,.ui-bar h6{margin:0;padding:0;font-size:16px;display:inline-block}.ui-header,.ui-footer{display:block}.ui-page .ui-header,.ui-page .ui-footer{position:relative}.ui-header .ui-btn-left{position:absolute;left:10px;top:.4em}.ui-header .ui-title,.ui-footer .ui-title{text-align:center;font-size:16px;display:block;margin:.6em 90px .8em;padding:0;text-overflow:ellipsis;overflow:hidden;white-space:nowrap;outline:0!important}.ui-header .ui-btn-right{position:absolute;right:10px;top:.4em}.ui-content{border-width:0;overflow:visible;overflow-x:hidden;padding:15px}.ui-page-fullscreen .ui-content{padding:0}.ui-icon{width:18px;height:18px}.ui-fullscreen img{max-width:100%}.ui-nojs{position:absolute;left:-9999px}.spin{-webkit-transform:rotate(360deg);-webkit-animation-name:spin;-webkit-animation-duration:1s;-webkit-animation-iteration-count:infinite}@-webkit-keyframes spin{from{-webkit-transform:rotate(0deg)}to{-webkit-transform:rotate(360deg)}}.in,.out{-webkit-animation-timing-function:ease-in-out;-webkit-animation-duration:350ms}.slide.in{-webkit-transform:translateX(0);-webkit-animation-name:slideinfromright}.slide.out{-webkit-transform:translateX(-100%);-webkit-animation-name:slideouttoleft}.slide.in.reverse{-webkit-transform:translateX(0);-webkit-animation-name:slideinfromleft}.slide.out.reverse{-webkit-transform:translateX(100%);-webkit-animation-name:slideouttoright}.slideup.in{-webkit-transform:translateY(0);-webkit-animation-name:slideinfrombottom;z-index:10}.slideup.out{-webkit-animation-name:dontmove;z-index:0}.slideup.out.reverse{-webkit-transform:translateY(100%);z-index:10;-webkit-animation-name:slideouttobottom}.slideup.in.reverse{z-index:0;-webkit-animation-name:dontmove}.slidedown.in{-webkit-transform:translateY(0);-webkit-animation-name:slideinfromtop;z-index:10}.slidedown.out{-webkit-animation-name:dontmove;z-index:0}.slidedown.out.reverse{-webkit-transform:translateY(-100%);z-index:10;-webkit-animation-name:slideouttotop}.slidedown.in.reverse{z-index:0;-webkit-animation-name:dontmove}@-webkit-keyframes slideinfromright{from{-webkit-transform:translateX(100%)}to{-webkit-transform:translateX(0)}}@-webkit-keyframes slideinfromleft{from{-webkit-transform:translateX(-100%)}to{-webkit-transform:translateX(0)}}@-webkit-keyframes slideouttoleft{from{-webkit-transform:translateX(0)}to{-webkit-transform:translateX(-100%)}}@-webkit-keyframes slideouttoright{from{-webkit-transform:translateX(0)}to{-webkit-transform:translateX(100%)}}@-webkit-keyframes slideinfromtop{from{-webkit-transform:translateY(-100%)}to{-webkit-transform:translateY(0)}}@-webkit-keyframes slideinfrombottom{from{-webkit-transform:translateY(100%)}to{-webkit-transform:translateY(0)}}@-webkit-keyframes slideouttobottom{from{-webkit-transform:translateY(0)}to{-webkit-transform:translateY(100%)}}@-webkit-keyframes slideouttotop{from{-webkit-transform:translateY(0)}to{-webkit-transform:translateY(-100%)}}@-webkit-keyframes fadein{from{opacity:0}to{opacity:1}}@-webkit-keyframes fadeout{from{opacity:1}to{opacity:0}}.fade.in{opacity:1;z-index:10;-webkit-animation-name:fadein}.fade.out{z-index:0;-webkit-animation-name:fadeout}.ui-mobile-viewport-perspective{-webkit-perspective:1000;position:absolute}.ui-mobile-viewport-transitioning,.ui-mobile-viewport-transitioning .ui-page{width:100%;height:100%;overflow:hidden}.flip{-webkit-animation-duration:.65s;-webkit-backface-visibility:hidden;-webkit-transform:translateX(0)}.flip.in{-webkit-transform:rotateY(0) scale(1);-webkit-animation-name:flipinfromleft}.flip.out{-webkit-transform:rotateY(-180deg) scale(.8);-webkit-animation-name:flipouttoleft}.flip.in.reverse{-webkit-transform:rotateY(0) scale(1);-webkit-animation-name:flipinfromright}.flip.out.reverse{-webkit-transform:rotateY(180deg) scale(.8);-webkit-animation-name:flipouttoright}@-webkit-keyframes flipinfromright{from{-webkit-transform:rotateY(-180deg) scale(.8)}to{-webkit-transform:rotateY(0) scale(1)}}@-webkit-keyframes flipinfromleft{from{-webkit-transform:rotateY(180deg) scale(.8)}to{-webkit-transform:rotateY(0) scale(1)}}@-webkit-keyframes flipouttoleft{from{-webkit-transform:rotateY(0) scale(1)}to{-webkit-transform:rotateY(-180deg) scale(.8)}}@-webkit-keyframes flipouttoright{from{-webkit-transform:rotateY(0) scale(1)}to{-webkit-transform:rotateY(180deg) scale(.8)}}@-webkit-keyframes dontmove{from{opacity:1}to{opacity:1}}.pop{-webkit-transform-origin:50% 50%}.pop.in{-webkit-transform:scale(1);opacity:1;-webkit-animation-name:popin;z-index:10}.pop.out.reverse{-webkit-transform:scale(.2);opacity:0;-webkit-animation-name:popout;z-index:10}.pop.in.reverse{z-index:0;-webkit-animation-name:dontmove}@-webkit-keyframes popin{from{-webkit-transform:scale(.2);opacity:0}to{-webkit-transform:scale(1);opacity:1}}@-webkit-keyframes popout{from{-webkit-transform:scale(1);opacity:1}to{-webkit-transform:scale(.2);opacity:0}}.ui-grid-a,.ui-grid-b,.ui-grid-c,.ui-grid-d{overflow:hidden}.ui-block-a,.ui-block-b,.ui-block-c,.ui-block-d,.ui-block-e{margin:0;padding:0;border:0;float:left}.ui-grid-a .ui-block-a,.ui-grid-a .ui-block-b{width:50%}.ui-grid-a .ui-block-a{clear:left}.ui-grid-b .ui-block-a,.ui-grid-b .ui-block-b,.ui-grid-b .ui-block-c{width:33.333%}.ui-grid-b .ui-block-a{clear:left}.ui-grid-c .ui-block-a,.ui-grid-c .ui-block-b,.ui-grid-c .ui-block-c,.ui-grid-c .ui-block-d{width:25%}.ui-grid-c .ui-block-a{clear:left}.ui-grid-d .ui-block-a,.ui-grid-d .ui-block-b,.ui-grid-d .ui-block-c,.ui-grid-d .ui-block-d,.ui-grid-d .ui-block-e{width:20%}.ui-grid-d .ui-block-a{clear:left}.ui-header,.ui-footer,.ui-page-fullscreen .ui-header,.ui-page-fullscreen .ui-footer{position:absolute;overflow:hidden;width:100%;border-left-width:0;border-right-width:0}.ui-header-fixed,.ui-footer-fixed{z-index:1000;-webkit-transform:translateZ(0)}.ui-footer-duplicate,.ui-page-fullscreen .ui-fixed-inline{display:none}.ui-page-fullscreen .ui-header,.ui-page-fullscreen .ui-footer{opacity:.9}.ui-navbar{overflow:hidden}.ui-navbar ul,.ui-navbar-expanded ul{list-style:none;padding:0;margin:0;position:relative;display:block;border:0}.ui-navbar-collapsed ul{float:left;width:75%;margin-right:-2px}.ui-navbar-collapsed .ui-navbar-toggle{float:left;width:25%}.ui-navbar li.ui-navbar-truncate{position:absolute;left:-9999px;top:-9999px}.ui-navbar li .ui-btn,.ui-navbar .ui-navbar-toggle .ui-btn{display:block;font-size:12px;text-align:center;margin:0;border-right-width:0}.ui-navbar li .ui-btn{margin-right:-1px}.ui-navbar li .ui-btn:last-child{margin-right:0}.ui-header .ui-navbar li .ui-btn,.ui-header .ui-navbar .ui-navbar-toggle .ui-btn,.ui-footer .ui-navbar li .ui-btn,.ui-footer .ui-navbar .ui-navbar-toggle .ui-btn{border-top-width:0;border-bottom-width:0}.ui-navbar .ui-btn-inner{padding-left:2px;padding-right:2px}.ui-navbar-noicons li .ui-btn .ui-btn-inner,.ui-navbar-noicons .ui-navbar-toggle .ui-btn-inner{padding-top:.8em;padding-bottom:.9em}.ui-navbar-expanded .ui-btn{margin:0;font-size:14px}.ui-navbar-expanded .ui-btn-inner{padding-left:5px;padding-right:5px}.ui-navbar-expanded .ui-btn-icon-top .ui-btn-inner{padding:45px 5px 15px;text-align:center}.ui-navbar-expanded .ui-btn-icon-top .ui-icon{top:15px}.ui-navbar-expanded .ui-btn-icon-bottom .ui-btn-inner{padding:15px 5px 45px;text-align:center}.ui-navbar-expanded .ui-btn-icon-bottom .ui-icon{bottom:15px}.ui-navbar-expanded li .ui-btn .ui-btn-inner{min-height:2.5em}.ui-navbar-expanded .ui-navbar-noicons .ui-btn .ui-btn-inner{padding-top:1.8em;padding-bottom:1.9em}.ui-btn{display:block;text-align:center;cursor:pointer;position:relative;margin:.5em 5px;padding:0}.ui-btn:focus,.ui-btn:active{outline:0}.ui-header .ui-btn,.ui-footer .ui-btn,.ui-bar .ui-btn{display:inline-block;font-size:13px;margin:0}.ui-btn-inline{display:inline-block}.ui-btn-inner{padding:.6em 25px;display:block;height:100%;text-overflow:ellipsis;overflow:hidden;white-space:nowrap;position:relative}.ui-header .ui-btn-inner,.ui-footer .ui-btn-inner,.ui-bar .ui-btn-inner{padding:.4em 8px .5em}.ui-btn-icon-notext{display:inline-block;width:20px;height:20px;padding:2px 1px 2px 3px;text-indent:-9999px}.ui-btn-icon-notext .ui-btn-inner{padding:0}.ui-btn-icon-notext .ui-btn-text{position:absolute;left:-999px}.ui-btn-icon-left .ui-btn-inner{padding-left:33px}.ui-header .ui-btn-icon-left .ui-btn-inner,.ui-footer .ui-btn-icon-left .ui-btn-inner,.ui-bar .ui-btn-icon-left .ui-btn-inner{padding-left:27px}.ui-btn-icon-right .ui-btn-inner{padding-right:33px}.ui-header .ui-btn-icon-right .ui-btn-inner,.ui-footer .ui-btn-icon-right .ui-btn-inner,.ui-bar .ui-btn-icon-right .ui-btn-inner{padding-right:27px}.ui-btn-icon-top .ui-btn-inner{padding-top:33px}.ui-header .ui-btn-icon-top .ui-btn-inner,.ui-footer .ui-btn-icon-top .ui-btn-inner,.ui-bar .ui-btn-icon-top .ui-btn-inner{padding-top:27px}.ui-btn-icon-bottom .ui-btn-inner{padding-bottom:33px}.ui-header .ui-btn-icon-bottom .ui-btn-inner,.ui-footer .ui-btn-icon-bottom .ui-btn-inner,.ui-bar .ui-btn-icon-bottom .ui-btn-inner{padding-bottom:27px}.ui-btn-icon-notext .ui-icon{display:block}.ui-btn-icon-left .ui-icon,.ui-btn-icon-right .ui-icon{position:absolute;top:50%;margin-top:-9px}.ui-btn-icon-top .ui-icon,.ui-btn-icon-bottom .ui-icon{position:absolute;left:50%;margin-left:-9px}.ui-btn-icon-left .ui-icon{left:10px}.ui-btn-icon-right .ui-icon{right:10px}.ui-header .ui-btn-icon-left .ui-icon,.ui-footer .ui-btn-icon-left .ui-icon,.ui-bar .ui-btn-icon-left .ui-icon{left:4px}.ui-header .ui-btn-icon-right .ui-icon,.ui-footer .ui-btn-icon-right .ui-icon,.ui-bar .ui-btn-icon-right .ui-icon{right:4px}.ui-header .ui-btn-icon-top .ui-icon,.ui-footer .ui-btn-icon-top .ui-icon,.ui-bar .ui-btn-icon-top .ui-icon{top:4px}.ui-header .ui-btn-icon-bottom .ui-icon,.ui-footer .ui-btn-icon-bottom .ui-icon,.ui-bar .ui-btn-icon-bottom .ui-icon{bottom:4px}.ui-btn-icon-top .ui-icon{top:5px}.ui-btn-icon-bottom .ui-icon{bottom:5px}.ui-btn-hidden{position:absolute;top:0;left:0;width:100%;height:100%;-webkit-appearance:button;opacity:0;cursor:pointer}.ui-collapsible-contain{margin:.5em 0}.ui-collapsible-heading{font-size:16px;display:block;margin:0 -8px;padding:0;border-width:0 0 1px 0;position:relative}.ui-collapsible-heading a{text-align:left;margin:0}.ui-collapsible-heading a .ui-btn-inner{padding-left:40px}.ui-collapsible-heading a span.ui-btn{position:absolute;left:6px;top:50%;margin:-12px 0 0 0;width:20px;height:20px;padding:1px 0 1px 2px;text-indent:-9999px}.ui-collapsible-heading a span.ui-btn .ui-btn-inner{padding:0}.ui-collapsible-heading a span.ui-btn .ui-icon{left:0;margin-top:-10px}.ui-collapsible-heading-status{position:absolute;left:-9999px}.ui-collapsible-content{display:block;padding:10px 0 10px 8px}.ui-collapsible-content-collapsed{display:none}.ui-collapsible-set{margin:.5em 0}.ui-collapsible-set .ui-collapsible-contain{margin:-1px 0 0}.ui-controlgroup,fieldset.ui-controlgroup{padding:0;margin:.5em 0 1em}.ui-bar .ui-controlgroup{margin:0 .3em}.ui-controlgroup-label{font-size:16px;line-height:1.4;font-weight:normal;margin:0 0 .3em}.ui-controlgroup-controls{display:block;width:95%}.ui-controlgroup li{list-style:none}.ui-controlgroup-vertical .ui-btn,.ui-controlgroup-vertical .ui-checkbox,.ui-controlgroup-vertical .ui-radio{margin:0;border-bottom-width:0}.ui-controlgroup-vertical .ui-controlgroup-last{border-bottom-width:1px}.ui-controlgroup-horizontal{padding:0}.ui-controlgroup-horizontal .ui-btn,.ui-controlgroup-horizontal .ui-checkbox,.ui-controlgroup-horizontal .ui-radio{margin:0 -5px 0 0;display:inline-block}.ui-controlgroup-horizontal .ui-checkbox .ui-btn,.ui-controlgroup-horizontal .ui-radio .ui-btn,.ui-controlgroup-horizontal .ui-checkbox:last-child,.ui-controlgroup-horizontal .ui-radio:last-child{margin-right:0}.ui-controlgroup-horizontal .ui-controlgroup-last{margin-right:0}.ui-controlgroup .ui-checkbox label,.ui-controlgroup .ui-radio label{font-size:16px}.min-width-480px .ui-controlgroup-label{vertical-align:top;display:inline-block;width:20%;margin:0 2% 0 0}.min-width-480px .ui-controlgroup-controls{width:60%;display:inline-block}.ui-dialog{min-height:480px}.ui-dialog .ui-header,.ui-dialog .ui-content,.ui-dialog .ui-footer{margin:15px;position:relative}.ui-dialog .ui-header,.ui-dialog .ui-footer{z-index:10;width:auto}.ui-dialog .ui-content,.ui-dialog .ui-footer{margin-top:-15px}.ui-checkbox,.ui-radio{position:relative;margin:.2em 0 .5em;z-index:1}.ui-checkbox .ui-btn,.ui-radio .ui-btn{margin:0;text-align:left;z-index:2}.ui-checkbox .ui-btn-icon-left .ui-btn-inner,.ui-radio .ui-btn-icon-left .ui-btn-inner{padding-left:45px}.ui-checkbox .ui-btn-icon-right .ui-btn-inner,.ui-radio .ui-btn-icon-right .ui-btn-inner{padding-right:45px}.ui-checkbox .ui-btn-icon-left .ui-icon,.ui-radio .ui-btn-icon-left .ui-icon{left:15px}.ui-checkbox .ui-btn-icon-right .ui-icon,.ui-radio .ui-btn-icon-right .ui-icon{right:15px}.ui-checkbox input,.ui-radio input{position:absolute;left:20px;top:50%;width:10px;height:10px;margin:-5px 0 0 0;outline:0!important;z-index:1}.ui-field-contain{background:0;padding:1.5em 0;margin:0;border-bottom-width:1px;overflow:visible}.ui-field-contain:first-child{border-top-width:0}.min-width-480px .ui-field-contain{border-width:0;padding:0;margin:1em 0}.ui-select{display:block;position:relative}.ui-select select{position:absolute;left:-9999px;top:-9999px}.ui-select .ui-btn select{cursor:pointer;-webkit-appearance:button;left:0;top:0;width:100%;height:100%;opacity:.001}.ui-select .ui-btn select.ui-select-nativeonly{opacity:1}.ui-select .ui-btn-icon-right .ui-btn-inner{padding-right:45px}.ui-select .ui-btn-icon-right .ui-icon{right:15px}label.ui-select{font-size:16px;line-height:1.4;font-weight:normal;margin:0 0 .3em;display:block}.ui-select .ui-btn-text,.ui-selectmenu .ui-btn-text{display:inline-block;min-height:1em}.ui-select .ui-btn-text{text-overflow:ellipsis;overflow:hidden;width:85%}.ui-selectmenu{position:absolute;padding:0;z-index:100!important;width:80%;max-width:350px;padding:6px}.ui-selectmenu .ui-listview{margin:0}.ui-selectmenu .ui-btn.ui-li-divider{cursor:default}.ui-selectmenu-hidden{top:-9999px;left:-9999px}.ui-selectmenu-screen{position:absolute;top:0;left:0;width:100%;height:100%;z-index:99}.ui-screen-hidden,.ui-selectmenu-list .ui-li .ui-icon{display:none}.ui-selectmenu-list .ui-li .ui-icon{display:block}.ui-li.ui-selectmenu-placeholder{display:none}.min-width-480px label.ui-select{display:inline-block;width:20%;margin:0 2% 0 0}.min-width-480px .ui-select{width:60%;display:inline-block}.ui-selectmenu .ui-header h1:after{content:'.';visibility:hidden}label.ui-input-text{font-size:16px;line-height:1.4;display:block;font-weight:normal;margin:0 0 .3em}input.ui-input-text,textarea.ui-input-text{background-image:none;padding:.4em;line-height:1.4;font-size:16px;display:block;width:95%}input.ui-input-text{-webkit-appearance:none}textarea.ui-input-text{height:50px;-webkit-transition:height 200ms linear;-moz-transition:height 200ms linear;-o-transition:height 200ms linear;transition:height 200ms linear}.ui-input-search{padding:0 30px;width:77%;background-position:8px 50%;background-repeat:no-repeat;position:relative}.ui-input-search input.ui-input-text{border:0;width:98%;padding:.4em 0;margin:0;display:block;background:transparent none;outline:0!important}.ui-input-search .ui-input-clear{position:absolute;right:0;top:50%;margin-top:-14px}.ui-input-search .ui-input-clear-hidden{display:none}.min-width-480px label.ui-input-text{vertical-align:top}.min-width-480px label.ui-input-text{display:inline-block;width:20%;margin:0 2% 0 0}.min-width-480px input.ui-input-text,.min-width-480px textarea.ui-input-text,.min-width-480px .ui-input-search{width:60%;display:inline-block}.min-width-480px .ui-input-search{width:50%}.ui-listview{margin:0;counter-reset:listnumbering}.ui-content .ui-listview{margin:-15px}.ui-content .ui-listview-inset{margin:1em 0}.ui-listview,.ui-li{list-style:none;padding:0;zoom:1}.ui-li{display:block;margin:0;position:relative;overflow:hidden;text-align:left;border-width:0;border-top-width:1px}.ui-li .ui-btn-text{text-overflow:ellipsis;overflow:hidden;white-space:nowrap}.ui-li-divider,.ui-li-static{padding:.5em 15px;font-size:14px;font-weight:bold;counter-reset:listnumbering}ol.ui-listview .ui-link-inherit:before,.ui-li-dec{font-size:.8em;display:inline-block;padding-right:.3em;font-weight:normal;counter-increment:listnumbering;content:counter(listnumbering) ". "}ol.ui-listview .ui-li-jsnumbering:before{content:""!important}.ui-listview-inset .ui-li{border-right-width:1px;border-left-width:1px}.ui-li:last-child{border-bottom-width:1px}.ui-li .ui-btn-inner{display:block;position:relative;padding:.7em 75px .7em 15px}.ui-li-has-thumb .ui-btn-inner{min-height:60px;padding-left:100px}.ui-li-has-icon .ui-btn-inner{min-height:20px;padding-left:40px}.ui-li-heading{font-size:16px;font-weight:bold;display:block;margin:.6em 0;text-overflow:ellipsis;overflow:hidden;white-space:nowrap}.ui-li-desc{font-size:12px;font-weight:normal;display:block;margin:-.5em 0 .6em;text-overflow:ellipsis;overflow:hidden;white-space:nowrap}.ui-li-thumb,.ui-li-icon{position:absolute;left:1px;top:0;max-height:80px;max-width:80px}.ui-li-icon{max-height:40px;max-width:40px;left:10px;top:.9em}.ui-li-thumb,.ui-li-icon,.ui-li-content{float:left;margin-right:10px}.ui-li-aside{float:right;width:50%;text-align:right;margin:.3em 0}.min-width-480px .ui-li-aside{width:45%}.ui-li-has-alt .ui-btn-inner{padding-right:95px}.ui-li-count{position:absolute;font-size:11px;font-weight:bold;padding:.2em .5em;top:50%;margin-top:-.9em;right:38px}.ui-li-divider .ui-li-count{right:10px}.ui-li-has-alt .ui-li-count{right:55px}.ui-li-link-alt{position:absolute;width:40px;height:100%;border-width:0;border-left-width:1px;top:0;right:0;margin:0;padding:0}.ui-li-link-alt .ui-btn{overflow:hidden;position:absolute;right:8px;top:50%;margin:-11px 0 0 0;border-bottom-width:1px}.ui-li-link-alt .ui-btn-inner{padding:0;position:static}.ui-li-link-alt .ui-btn .ui-icon{right:50%;margin-right:-9px}.ui-listview-filter{border-width:0;overflow:hidden;margin:-15px -15px 15px -15px}.ui-listview-filter .ui-input-search{margin:5px;width:auto;display:block}@media only screen and (min-device-width:768px) and (max-device-width:1024px){.ui-li .ui-btn-text{overflow:visible}}label.ui-slider{display:block}input.ui-slider-input,.min-width-480px input.ui-slider-input{display:inline-block;width:50px}select.ui-slider-switch{display:none}div.ui-slider{position:relative;display:inline-block;overflow:visible;height:15px;padding:0;margin:0 2% 0 20px;top:4px;width:66%}a.ui-slider-handle{position:absolute;z-index:10;top:50%;width:28px;height:28px;margin-top:-15px;margin-left:-15px}a.ui-slider-handle .ui-btn-inner{padding-left:0;padding-right:0}.min-width-480px label.ui-slider{display:inline-block;width:20%;margin:0 2% 0 0}.min-width-480px div.ui-slider{width:45%}div.ui-slider-switch{height:32px;overflow:hidden;margin-left:0}div.ui-slider-inneroffset{margin-left:50%;position:absolute;top:1px;height:100%;width:50%}div.ui-slider-handle-snapping{-webkit-transition:left 100ms linear}div.ui-slider-labelbg{position:absolute;top:0;margin:0;border-width:0}div.ui-slider-switch div.ui-slider-labelbg-a{width:60%;height:100%;left:0}div.ui-slider-switch div.ui-slider-labelbg-b{width:60%;height:100%;right:0}.ui-slider-switch-a div.ui-slider-labelbg-a,.ui-slider-switch-b div.ui-slider-labelbg-b{z-index:1}.ui-slider-switch-a div.ui-slider-labelbg-b,.ui-slider-switch-b div.ui-slider-labelbg-a{z-index:10}div.ui-slider-switch a.ui-slider-handle{z-index:20;width:101%;height:32px;margin-top:-18px;margin-left:-101%}span.ui-slider-label{width:100%;position:absolute;height:32px;font-size:16px;text-align:center;line-height:2;background:0;border-color:transparent}span.ui-slider-label-a{left:-100%;margin-right:-1px}span.ui-slider-label-b{right:-100%;margin-left:-1px}
+
--- /dev/null
+++ b/css/jquery-ui-1.8.12.custom.css
@@ -1,1 +1,348 @@
-
+/*
+ * jQuery UI CSS Framework 1.8.12
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Theming/API
+ */
+
+/* Layout helpers
+----------------------------------*/
+.ui-helper-hidden { display: none; }
+.ui-helper-hidden-accessible { position: absolute !important; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); }
+.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; }
+.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; }
+.ui-helper-clearfix { display: inline-block; }
+/* required comment for clearfix to work in Opera \*/
+* html .ui-helper-clearfix { height:1%; }
+.ui-helper-clearfix { display:block; }
+/* end clearfix */
+.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); }
+
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-disabled { cursor: default !important; }
+
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.jqui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Overlays */
+.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; }
+
+
+/*
+ * jQuery UI CSS Framework 1.8.12
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Theming/API
+ *
+ * To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Trebuchet%20MS,%20Tahoma,%20Verdana,%20Arial,%20sans-serif&fwDefault=bold&fsDefault=1.1em&cornerRadius=4px&bgColorHeader=f6a828&bgTextureHeader=12_gloss_wave.png&bgImgOpacityHeader=35&borderColorHeader=e78f08&fcHeader=ffffff&iconColorHeader=ffffff&bgColorContent=eeeeee&bgTextureContent=03_highlight_soft.png&bgImgOpacityContent=100&borderColorContent=dddddd&fcContent=333333&iconColorContent=222222&bgColorDefault=f6f6f6&bgTextureDefault=02_glass.png&bgImgOpacityDefault=100&borderColorDefault=cccccc&fcDefault=1c94c4&iconColorDefault=ef8c08&bgColorHover=fdf5ce&bgTextureHover=02_glass.png&bgImgOpacityHover=100&borderColorHover=fbcb09&fcHover=c77405&iconColorHover=ef8c08&bgColorActive=ffffff&bgTextureActive=02_glass.png&bgImgOpacityActive=65&borderColorActive=fbd850&fcActive=eb8f00&iconColorActive=ef8c08&bgColorHighlight=ffe45c&bgTextureHighlight=03_highlight_soft.png&bgImgOpacityHighlight=75&borderColorHighlight=fed22f&fcHighlight=363636&iconColorHighlight=228ef1&bgColorError=b81900&bgTextureError=08_diagonals_thick.png&bgImgOpacityError=18&borderColorError=cd0a0a&fcError=ffffff&iconColorError=ffd27a&bgColorOverlay=666666&bgTextureOverlay=08_diagonals_thick.png&bgImgOpacityOverlay=20&opacityOverlay=50&bgColorShadow=000000&bgTextureShadow=01_flat.png&bgImgOpacityShadow=10&opacityShadow=20&thicknessShadow=5px&offsetTopShadow=-5px&offsetLeftShadow=-5px&cornerRadiusShadow=5px
+ */
+
+
+/* Component containers
+----------------------------------*/
+.ui-widget { font-family: Trebuchet MS, Tahoma, Verdana, Arial, sans-serif; font-size: 1.1em; }
+.ui-widget .ui-widget { font-size: 1em; }
+.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Trebuchet MS, Tahoma, Verdana, Arial, sans-serif; font-size: 1em; }
+.ui-widget-content { border: 1px solid #dddddd; background: #eeeeee url(images/ui-bg_highlight-soft_100_eeeeee_1x100.png) 50% top repeat-x; color: #333333; }
+.ui-widget-content a { color: #333333; }
+.ui-widget-header { border: 1px solid #e78f08; background: #f6a828 url(images/ui-bg_gloss-wave_35_f6a828_500x100.png) 50% 50% repeat-x; color: #ffffff; font-weight: bold; }
+.ui-widget-header a { color: #ffffff; }
+
+/* Interaction states
+----------------------------------*/
+.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #cccccc; background: #f6f6f6 url(images/ui-bg_glass_100_f6f6f6_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #1c94c4; }
+.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #1c94c4; text-decoration: none; }
+.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #fbcb09; background: #fdf5ce url(images/ui-bg_glass_100_fdf5ce_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #c77405; }
+.ui-state-hover a, .ui-state-hover a:hover { color: #c77405; text-decoration: none; }
+.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #fbd850; background: #ffffff url(images/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #eb8f00; }
+.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #eb8f00; text-decoration: none; }
+.ui-widget :active { outline: none; }
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #fed22f; background: #ffe45c url(images/ui-bg_highlight-soft_75_ffe45c_1x100.png) 50% top repeat-x; color: #363636; }
+.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636; }
+.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a; background: #b81900 url(images/ui-bg_diagonals-thick_18_b81900_40x40.png) 50% 50% repeat; color: #ffffff; }
+.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #ffffff; }
+.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #ffffff; }
+.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; }
+.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; }
+.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; }
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.jqui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png); }
+.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); }
+.ui-widget-header .ui-icon {background-image: url(images/ui-icons_ffffff_256x240.png); }
+.ui-state-default .ui-icon { background-image: url(images/ui-icons_ef8c08_256x240.png); }
+.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_ef8c08_256x240.png); }
+.ui-state-active .ui-icon {background-image: url(images/ui-icons_ef8c08_256x240.png); }
+.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_228ef1_256x240.png); }
+.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_ffd27a_256x240.png); }
+
+/* positioning */
+.ui-icon-carat-1-n { background-position: 0 0; }
+.ui-icon-carat-1-ne { background-position: -16px 0; }
+.ui-icon-carat-1-e { background-position: -32px 0; }
+.ui-icon-carat-1-se { background-position: -48px 0; }
+.ui-icon-carat-1-s { background-position: -64px 0; }
+.ui-icon-carat-1-sw { background-position: -80px 0; }
+.ui-icon-carat-1-w { background-position: -96px 0; }
+.ui-icon-carat-1-nw { background-position: -112px 0; }
+.ui-icon-carat-2-n-s { background-position: -128px 0; }
+.ui-icon-carat-2-e-w { background-position: -144px 0; }
+.ui-icon-triangle-1-n { background-position: 0 -16px; }
+.ui-icon-triangle-1-ne { background-position: -16px -16px; }
+.ui-icon-triangle-1-e { background-position: -32px -16px; }
+.ui-icon-triangle-1-se { background-position: -48px -16px; }
+.ui-icon-triangle-1-s { background-position: -64px -16px; }
+.ui-icon-triangle-1-sw { background-position: -80px -16px; }
+.ui-icon-triangle-1-w { background-position: -96px -16px; }
+.ui-icon-triangle-1-nw { background-position: -112px -16px; }
+.ui-icon-triangle-2-n-s { background-position: -128px -16px; }
+.ui-icon-triangle-2-e-w { background-position: -144px -16px; }
+.ui-icon-arrow-1-n { background-position: 0 -32px; }
+.ui-icon-arrow-1-ne { background-position: -16px -32px; }
+.ui-icon-arrow-1-e { background-position: -32px -32px; }
+.ui-icon-arrow-1-se { background-position: -48px -32px; }
+.ui-icon-arrow-1-s { background-position: -64px -32px; }
+.ui-icon-arrow-1-sw { background-position: -80px -32px; }
+.ui-icon-arrow-1-w { background-position: -96px -32px; }
+.ui-icon-arrow-1-nw { background-position: -112px -32px; }
+.ui-icon-arrow-2-n-s { background-position: -128px -32px; }
+.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; }
+.ui-icon-arrow-2-e-w { background-position: -160px -32px; }
+.ui-icon-arrow-2-se-nw { background-position: -176px -32px; }
+.ui-icon-arrowstop-1-n { background-position: -192px -32px; }
+.ui-icon-arrowstop-1-e { background-position: -208px -32px; }
+.ui-icon-arrowstop-1-s { background-position: -224px -32px; }
+.ui-icon-arrowstop-1-w { background-position: -240px -32px; }
+.ui-icon-arrowthick-1-n { background-position: 0 -48px; }
+.ui-icon-arrowthick-1-ne { background-position: -16px -48px; }
+.ui-icon-arrowthick-1-e { background-position: -32px -48px; }
+.ui-icon-arrowthick-1-se { background-position: -48px -48px; }
+.ui-icon-arrowthick-1-s { background-position: -64px -48px; }
+.ui-icon-arrowthick-1-sw { background-position: -80px -48px; }
+.ui-icon-arrowthick-1-w { background-position: -96px -48px; }
+.ui-icon-arrowthick-1-nw { background-position: -112px -48px; }
+.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; }
+.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; }
+.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; }
+.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; }
+.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; }
+.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; }
+.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; }
+.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; }
+.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; }
+.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; }
+.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; }
+.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; }
+.ui-icon-arrowreturn-1-w { background-position: -64px -64px; }
+.ui-icon-arrowreturn-1-n { background-position: -80px -64px; }
+.ui-icon-arrowreturn-1-e { background-position: -96px -64px; }
+.ui-icon-arrowreturn-1-s { background-position: -112px -64px; }
+.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; }
+.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; }
+.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; }
+.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; }
+.ui-icon-arrow-4 { background-position: 0 -80px; }
+.ui-icon-arrow-4-diag { background-position: -16px -80px; }
+.ui-icon-extlink { background-position: -32px -80px; }
+.ui-icon-newwin { background-position: -48px -80px; }
+.ui-icon-refresh { background-position: -64px -80px; }
+.ui-icon-shuffle { background-position: -80px -80px; }
+.ui-icon-transfer-e-w { background-position: -96px -80px; }
+.ui-icon-transferthick-e-w { background-position: -112px -80px; }
+.ui-icon-folder-collapsed { background-position: 0 -96px; }
+.ui-icon-folder-open { background-position: -16px -96px; }
+.ui-icon-document { background-position: -32px -96px; }
+.ui-icon-document-b { background-position: -48px -96px; }
+.ui-icon-note { background-position: -64px -96px; }
+.ui-icon-mail-closed { background-position: -80px -96px; }
+.ui-icon-mail-open { background-position: -96px -96px; }
+.ui-icon-suitcase { background-position: -112px -96px; }
+.ui-icon-comment { background-position: -128px -96px; }
+.ui-icon-person { background-position: -144px -96px; }
+.ui-icon-print { background-position: -160px -96px; }
+.ui-icon-trash { background-position: -176px -96px; }
+.ui-icon-locked { background-position: -192px -96px; }
+.ui-icon-unlocked { background-position: -208px -96px; }
+.ui-icon-bookmark { background-position: -224px -96px; }
+.ui-icon-tag { background-position: -240px -96px; }
+.ui-icon-home { background-position: 0 -112px; }
+.ui-icon-flag { background-position: -16px -112px; }
+.ui-icon-calendar { background-position: -32px -112px; }
+.ui-icon-cart { background-position: -48px -112px; }
+.ui-icon-pencil { background-position: -64px -112px; }
+.ui-icon-clock { background-position: -80px -112px; }
+.ui-icon-disk { background-position: -96px -112px; }
+.ui-icon-calculator { background-position: -112px -112px; }
+.ui-icon-zoomin { background-position: -128px -112px; }
+.ui-icon-zoomout { background-position: -144px -112px; }
+.ui-icon-search { background-position: -160px -112px; }
+.ui-icon-wrench { background-position: -176px -112px; }
+.ui-icon-gear { background-position: -192px -112px; }
+.ui-icon-heart { background-position: -208px -112px; }
+.ui-icon-star { background-position: -224px -112px; }
+.ui-icon-link { background-position: -240px -112px; }
+.ui-icon-cancel { background-position: 0 -128px; }
+.ui-icon-plus { background-position: -16px -128px; }
+.ui-icon-plusthick { background-position: -32px -128px; }
+.ui-icon-minus { background-position: -48px -128px; }
+.ui-icon-minusthick { background-position: -64px -128px; }
+.ui-icon-close { background-position: -80px -128px; }
+.ui-icon-closethick { background-position: -96px -128px; }
+.ui-icon-key { background-position: -112px -128px; }
+.ui-icon-lightbulb { background-position: -128px -128px; }
+.ui-icon-scissors { background-position: -144px -128px; }
+.ui-icon-clipboard { background-position: -160px -128px; }
+.ui-icon-copy { background-position: -176px -128px; }
+.ui-icon-contact { background-position: -192px -128px; }
+.ui-icon-image { background-position: -208px -128px; }
+.ui-icon-video { background-position: -224px -128px; }
+.ui-icon-script { background-position: -240px -128px; }
+.ui-icon-alert { background-position: 0 -144px; }
+.ui-icon-info { background-position: -16px -144px; }
+.ui-icon-notice { background-position: -32px -144px; }
+.ui-icon-help { background-position: -48px -144px; }
+.ui-icon-check { background-position: -64px -144px; }
+.ui-icon-bullet { background-position: -80px -144px; }
+.ui-icon-radio-off { background-position: -96px -144px; }
+.ui-icon-radio-on { background-position: -112px -144px; }
+.ui-icon-pin-w { background-position: -128px -144px; }
+.ui-icon-pin-s { background-position: -144px -144px; }
+.ui-icon-play { background-position: 0 -160px; }
+.ui-icon-pause { background-position: -16px -160px; }
+.ui-icon-seek-next { background-position: -32px -160px; }
+.ui-icon-seek-prev { background-position: -48px -160px; }
+.ui-icon-seek-end { background-position: -64px -160px; }
+.ui-icon-seek-start { background-position: -80px -160px; }
+/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */
+.ui-icon-seek-first { background-position: -80px -160px; }
+.ui-icon-stop { background-position: -96px -160px; }
+.ui-icon-eject { background-position: -112px -160px; }
+.ui-icon-volume-off { background-position: -128px -160px; }
+.ui-icon-volume-on { background-position: -144px -160px; }
+.ui-icon-power { background-position: 0 -176px; }
+.ui-icon-signal-diag { background-position: -16px -176px; }
+.ui-icon-signal { background-position: -32px -176px; }
+.ui-icon-battery-0 { background-position: -48px -176px; }
+.ui-icon-battery-1 { background-position: -64px -176px; }
+.ui-icon-battery-2 { background-position: -80px -176px; }
+.ui-icon-battery-3 { background-position: -96px -176px; }
+.ui-icon-circle-plus { background-position: 0 -192px; }
+.ui-icon-circle-minus { background-position: -16px -192px; }
+.ui-icon-circle-close { background-position: -32px -192px; }
+.ui-icon-circle-triangle-e { background-position: -48px -192px; }
+.ui-icon-circle-triangle-s { background-position: -64px -192px; }
+.ui-icon-circle-triangle-w { background-position: -80px -192px; }
+.ui-icon-circle-triangle-n { background-position: -96px -192px; }
+.ui-icon-circle-arrow-e { background-position: -112px -192px; }
+.ui-icon-circle-arrow-s { background-position: -128px -192px; }
+.ui-icon-circle-arrow-w { background-position: -144px -192px; }
+.ui-icon-circle-arrow-n { background-position: -160px -192px; }
+.ui-icon-circle-zoomin { background-position: -176px -192px; }
+.ui-icon-circle-zoomout { background-position: -192px -192px; }
+.ui-icon-circle-check { background-position: -208px -192px; }
+.ui-icon-circlesmall-plus { background-position: 0 -208px; }
+.ui-icon-circlesmall-minus { background-position: -16px -208px; }
+.ui-icon-circlesmall-close { background-position: -32px -208px; }
+.ui-icon-squaresmall-plus { background-position: -48px -208px; }
+.ui-icon-squaresmall-minus { background-position: -64px -208px; }
+.ui-icon-squaresmall-close { background-position: -80px -208px; }
+.ui-icon-grip-dotted-vertical { background-position: 0 -224px; }
+.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; }
+.ui-icon-grip-solid-vertical { background-position: -32px -224px; }
+.ui-icon-grip-solid-horizontal { background-position: -48px -224px; }
+.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; }
+.ui-icon-grip-diagonal-se { background-position: -80px -224px; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Corner radius */
+.ui-corner-tl { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; }
+.ui-corner-tr { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; }
+.ui-corner-bl { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; }
+.ui-corner-br { -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
+.ui-corner-top { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; }
+.ui-corner-bottom { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
+.ui-corner-right { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
+.ui-corner-left { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; }
+.ui-corner-all { -moz-border-radius: 4px; -webkit-border-radius: 4px; border-radius: 4px; }
+
+/* Overlays */
+.ui-widget-overlay { background: #666666 url(images/ui-bg_diagonals-thick_20_666666_40x40.png) 50% 50% repeat; opacity: .50;filter:Alpha(Opacity=50); }
+.ui-widget-shadow { margin: -5px 0 0 -5px; padding: 5px; background: #000000 url(images/ui-bg_flat_10_000000_40x100.png) 50% 50% repeat-x; opacity: .20;filter:Alpha(Opacity=20); -moz-border-radius: 5px; -webkit-border-radius: 5px; border-radius: 5px; }/*
+ * jQuery UI Autocomplete 1.8.12
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Autocomplete#theming
+ */
+.ui-autocomplete { position: absolute; cursor: default; }
+
+/* workarounds */
+* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */
+
+/*
+ * jQuery UI Menu 1.8.12
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Menu#theming
+ */
+.ui-menu {
+ list-style:none;
+ padding: 2px;
+ margin: 0;
+ display:block;
+ float: left;
+}
+.ui-menu .ui-menu {
+ margin-top: -3px;
+}
+.ui-menu .ui-menu-item {
+ margin:0;
+ padding: 0;
+ zoom: 1;
+ float: left;
+ clear: left;
+ width: 100%;
+}
+.ui-menu .ui-menu-item a {
+ text-decoration:none;
+ display:block;
+ padding:.2em .4em;
+ line-height:1.5;
+ zoom:1;
+}
+.ui-menu .ui-menu-item a.ui-state-hover,
+.ui-menu .ui-menu-item a.ui-state-active {
+ font-weight: normal;
+ margin: -1px;
+}
+
--- a/css/jquery.ui.datepicker.mobile.css
+++ /dev/null
@@ -1,18 +1,1 @@
-div.hasDatepicker{display:block;padding:0;overflow:visible;margin:8px 0;}
-.ui-datepicker{overflow:visible;margin:0;max-width:500px;}
-.ui-datepicker .ui-datepicker-header{position:relative;padding:.4em 0;border-bottom:0;font-weight:bold;}
-.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next{padding:1px 0 1px 2px;position:absolute;top:.5em;margin-top:0;text-indent:-9999px;}
-.ui-datepicker .ui-datepicker-prev{left:6px;}
-.ui-datepicker .ui-datepicker-next{right:6px;}
-.ui-datepicker .ui-datepicker-title{margin:0 2.3em;line-height:1.8em;text-align:center;}
-.ui-datepicker .ui-datepicker-title select{font-size:1em;margin:1px 0;}
-.ui-datepicker select.ui-datepicker-month-year{width:100%;}
-.ui-datepicker select.ui-datepicker-month, .ui-datepicker select.ui-datepicker-year{width:49%;}
-.ui-datepicker table{width:100%;border-collapse:collapse;margin:0;}
-.ui-datepicker td{border-width:1px;padding:0;text-align:center;}
-.ui-datepicker td span, .ui-datepicker td a{display:block;padding:.2em 0;font-weight:bold;margin:0;border-width:0;text-align:center;text-decoration:none;}
-.ui-datepicker-calendar th{padding-top:.3em;padding-bottom:.3em;}
-.ui-datepicker-calendar th span, .ui-datepicker-calendar span.ui-state-default{opacity:.3;}
-.ui-datepicker-calendar td a{padding-top:.5em;padding-bottom:.5em;}
-.min-width-480px div.hasDatepicker{width:63%;display:inline-block;margin:0;}
--- /dev/null
+++ b/css/local.css.php
@@ -1,1 +1,221 @@
-
+<?php
+
+header('Content-type: text/css');
+ob_start("compress");
+
+function compress($buffer) {
+ /* remove comments */
+ $buffer = preg_replace('!/\*[^*]*\*+([^/][^*]*\*+)*/!', '', $buffer);
+ /* remove tabs, spaces, newlines, etc. */
+ $buffer = str_replace(array("\r\n", "\r", "\n", "\t", ' ', ' ', ' '), '', $buffer);
+ return $buffer;
+}
+
+echo '
+.ui-li-thumb, .ui-li-icon { position: relative; }
+
+ .ui-navbar {
+ width: 100%;
+ }
+ .ui-btn-inner {
+ white-space: normal !important;
+ }
+ .ui-li-heading {
+ white-space: normal !important;
+ }
+ .ui-listview-filter {
+ margin: 0 !important;
+ }
+ .ui-icon-navigation {
+ background-image: url(images/113-navigation.png);
+ background-position: 1px 0;
+ }
+ .ui-icon-beaker {
+ background-image: url(images/91-beaker-2.png);
+ background-position: 1px 0;
+ }
+ #footer {
+ text-size: 0.75em;
+ text-align: center;
+ }
+ body {
+ background-color: #F0F0F0;
+ }
+ #jqm-homeheader {
+ text-align: center;
+ }
+ .viaPoints {
+ display: none;
+ text-size: 0.2em;
+ }
+ .min-width-480px .viaPoints {
+ display: inline;
+ }
+ #extrainfo {
+ visibility: hidden;
+ display: none;
+ }
+ .servicewarning {
+ padding: 1em;
+ margin-bottom: 0.5em;
+ text-size: 0.2em;
+ background-color: #FF9;
+ -moz-border-radius: 15px;
+border-radius: 15px;
+ }
+
+
+#footer {
+clear:both;
+text-align:center;
+}
+ // source http://webaim.org/techniques/skipnav/
+ #skip a, #skip a:hover, #skip a:visited
+{
+position:absolute;
+left:0px;
+top:-500px;
+width:1px;
+height:1px;
+overflow:hidden;
+}
+
+#skip a:active, #skip a:focus
+{
+position:static;
+width:auto;
+height:auto;
+}';
+
+//if (false)
+echo '
+// adaptive layout from jQuery Mobile docs site
+.type-interior .content-secondary {
+ border-right: 0;
+ border-left: 0;
+ margin: 10px -15px 0;
+ background: #fff;
+ border-top: 1px solid #ccc;
+}
+.type-home .ui-content {
+ margin-top: 5px;
+}
+.type-interior .ui-content {
+ padding-bottom: 0;
+}
+.content-secondary .ui-collapsible-contain {
+ padding: 10px 15px;
+
+}
+.content-secondary .ui-collapsible-heading {
+ margin: 0 0 30px;
+}
+.content-secondary .ui-collapsible-heading-collapsed,
+.content-secondary .ui-collapsible-content {
+ padding:0;
+ margin: 0;
+}
+ /* hires ahoy */
+@media all and (min-width: 650px){
+
+.content-secondary {
+ text-align: left;
+ float: left;
+ width: 45%;
+ background: none;
+ border-top: 0;
+ }
+ .content-secondary,
+ .type-interior .content-secondary {
+ margin: 30px 0 20px 2%;
+ padding: 20px 4% 0 0;
+ background: none;
+ }
+ .type-index .content-secondary {
+ padding: 0;
+ }
+ .type-index .content-secondary .ui-listview {
+ margin: 0;
+ }
+ .content-primary {
+ width: 45%;
+ float: right;
+ margin-top: 30px;
+ margin-right: 1%;
+ padding-right: 1%;
+ }
+ .content-primary ul:first-child {
+ margin-top: 0;
+ }
+
+ .type-interior .content-primary {
+ padding: 1.5em 6% 3em 0;
+ margin: 0;
+ }
+ /* fix up the collapsibles - expanded on desktop */
+ .content-secondary .ui-collapsible-heading {
+ display: none;
+ }
+ .content-secondary .ui-collapsible-contain {
+ margin:0;
+ }
+ .content-secondary .ui-collapsible-content {
+ display: block;
+ margin: 0;
+ padding: 0;
+ }
+ .type-interior .content-secondary .ui-li-divider {
+ padding-top: 1em;
+ padding-bottom: 1em;
+ }
+ .type-interior .content-secondary {
+ margin: 0;
+ padding: 0;
+ }
+}
+@media all and (min-width: 750px){
+ .type-home .ui-content,
+ .type-interior .ui-content {
+ background-position: 39%;
+ }
+ .content-secondary {
+ width: 34%;
+ }
+ .content-primary {
+ width: 56%;
+ padding-right: 1%;
+ }
+ .type-interior .ui-content {
+ background-position: 34%;
+ }
+}
+
+@media all and (min-width: 1200px){
+ .type-home .ui-content{
+ background-position: 38.5%;
+ }
+ .type-interior .ui-content {
+ background-position: 30%;
+ }
+ .content-secondary {
+ width: 30%;
+ padding-right:6%;
+ margin: 30px 0 20px 5%;
+ }
+ .type-interior .content-secondary {
+ margin: 0;
+ padding: 0;
+ }
+ .content-primary {
+ width: 50%;
+ margin-right: 5%;
+ padding-right: 3%;
+ }
+ .type-interior .content-primary {
+ width: 60%;
+ }
+}
+';
+ob_end_flush();
+?>
+
--- /dev/null
+++ b/dotcloud/postinstall
@@ -1,1 +1,19 @@
+#!/bin/bash
+#dotcloud postinstall
+curl http://s3-ap-southeast-1.amazonaws.com/busresources/cbrfeed.zip \
+-o /home/dotcloud/current/cbrfeed.zip
+curl http://s3-ap-southeast-1.amazonaws.com/busresources/Graph.obj \
+-o /tmp/Graph.obj
+
+#db setup
+#curl https://github.com/maxious/ACTBus-ui/raw/master/transitdata.cbrfeed.sql.gz -o transitdata.cbrfeed.sql.gz
+#curl https://github.com/maxious/ACTBus-ui/raw/master/lib/postgis.sql -o postgis.sql
+#createlang -d transitdata plpgsql
+#psql -d transitdata -f postgis.sql
+#gunzip /var/www/transitdata.cbrfeed.sql.gz
+#psql -d transitdata -f transitdata.cbrfeed.sql
+#createuser transitdata -SDRP
+#password transitdata
+#psql -c \"GRANT SELECT ON TABLE agency,calendar,calendar_dates,routes,stop_times,stops,trips TO transitdata;\"
+
--- /dev/null
+++ b/dotcloud/push.sh
@@ -1,1 +1,7 @@
+#wget http://s3-ap-southeast-1.amazonaws.com/busresources/opentripplanner-webapp.war
+cp ~/workspace/opentripplanner/maven.1277125291275/opentripplanner-webapp/target/opentripplanner-webapp.war ./
+#wget http://s3-ap-southeast-1.amazonaws.com/busresources/opentripplanner-api-webapp.war
+cp ~/workspace/opentripplanner/maven.1277125291275/opentripplanner-api-webapp/target/opentripplanner-api-webapp.war ./
+dotcloud push actbus.otp ./
+
--- a/feedback.php
+++ b/feedback.php
@@ -1,33 +1,23 @@
<?php
include ("include/common.inc.php");
+ $GTFSREnabled = false;
include_header("Feedback", "feedback");
function sendEmail($topic, $message)
{
$address = "maxious@lambdacomplex.org";
- if (file_exists("/tmp/aws.php")) {
- include_once ("lib/ses.php");
- include_once ("/tmp/aws.php");
- $con = new SimpleEmailService($accessKey, $secretKey);
- //$con->verifyEmailAddress($address);
- //$con->listVerifiedEmailAddresses();
- $m = new SimpleEmailServiceMessage();
- $m->addTo($address);
- $m->setFrom($address);
- $m->setSubject($topic);
- $m->setMessageFromString($message);
- $con->sendEmail($m);
- }
- else {
// In case any of our lines are larger than 70 characters, we should use wordwrap()
$message = wordwrap($message, 70);
// Send
mail($address, $topic, $message);
- }
+
}
-
+if (isset($_REQUEST['feedback']) || isset($_REQUEST['newlocation'])){
+ sendEmail("bus.lambda feedback",print_r($_REQUEST,true));
+ echo "<h2 style='text-align: center;'>Thank you for your feedback!</h2>";
+} else {
$stopid = "";
$stopcode = "";
-$urlparts = explode("?",$_SERVER["HTTP_REFERER"]);
+if (isset($_SERVER["HTTP_REFERER"])) $urlparts = explode("?",$_SERVER["HTTP_REFERER"]);
if (isset($urlparts[1])) {
$getparams = explode("&",$urlparts[1]);
foreach ($getparams as $param) {
@@ -39,30 +29,40 @@
?>
<h3>Add/Move/Delete a Bus Stop Location</h3>
+<form action="feedback.php" method="post">
StopID: <input type="text" name="stopid" value="<?php echo $stopid ?>"/><br>
or StopCode: <input type="text" name="stopcode" value="<?php echo $stopcode ?>"/><br>
<small> if you click on feedback from a stop page, these will get filled in automatically. else describe the location/street of the stop in one of these boxes </small><br>
Suggested Stop Location (lat/long or words): <input type="text" name="newlocation"/><br>
-<small> if your device supports javascript, you can pick a location from the map above</small><br>
+<!--<small> if your device supports javascript, you can pick a location from the map above</small><br>-->
<input type="submit" value="Submit!"/>
-
+</form>
<h3>Bug Report/Feedback</h3>
Please leave feedback about bugs/errors or general suggestions about improvements that could be made to the way the data is presented!
-<textarea id="feedback">
+<form action="feedback.php" method="post">
+<textarea name="feedback">
</textarea>
-<textarea id="extrainfo">
+<textarea name="extrainfo" id="extrainfo">
<?php
- echo "Referrer URL: ".$_SERVER["HTTP_REFERER"];
+ echo "Referrer URL: ".($_SERVER["HTTP_REFERER"] ? $_SERVER["HTTP_REFERER"] : "");
+ echo "\nCurrent page URL: ".curPageURL();
echo "\nUser Agent: ".$_SERVER["HTTP_USER_AGENT"];
echo "\nUser host/IP: ".$_SERVER["HTTP_X_FORWARDED_FOR"]." ".$_SERVER["REMOTE_ADDR"];
echo "\nServer host/IP: ".php_uname("n");
echo "\nCurrent date/time: ". date("c");
+ echo "\nCurrent code revision: ".exec("git rev-parse --short HEAD");
+ echo "\nCurrent timetables version: ".date("c",@filemtime('../busresources/cbrfeed.zip'));
echo "\nDump of session: ".print_r($_SESSION,true);
?>
</textarea>
<input type="submit" value="Submit!"/>
+</form>
+<?php
+}
+include_footer();
+?>
--- /dev/null
+++ b/geo/route.kml.php
@@ -1,1 +1,105 @@
+<?php
+header('Content-Type: application/vnd.google-earth.kml+xml');
+include ('../include/common.inc.php');
+header('Content-Disposition: attachment; filename="route.' . urlencode($routeid) . '.kml"');
+$debugOkay = Array(); // disable debugging output even on dev server
+echo '<?xml version="1.0" encoding="UTF-8"?>
+<kml xmlns="http://www.opengis.net/kml/2.2" xmlns:atom="http://www.w3.org/2005/Atom"><Document>';
+echo '
+ <Style id="ylw-pushpin">
+ <IconStyle>
+ <Icon>
+ <href>http://maps.google.com/mapfiles/kml/pushpin/ylw-pushpin.png</href>
+
+ </Icon>
+ </IconStyle>
+
+ </Style>
+ <Style id="blue-pushpin">
+ <IconStyle>
+ <Icon>
+ <href>http://maps.google.com/mapfiles/kml/pushpin/blue-pushpin.png</href>
+
+ </Icon>
+ </IconStyle>
+
+ </Style>
+ <Style id="grn-pushpin">
+ <IconStyle>
+ <Icon>
+ <href>http://maps.google.com/mapfiles/kml/pushpin/grn-pushpin.png</href>
+
+ </Icon>
+ </IconStyle>
+ </Style>
+ <Style id="yellowLineYellowPoly">
+ <LineStyle>
+ <color>7f00ebff</color>
+ <width>4</width>
+ </LineStyle>
+ <PolyStyle>
+ <color>7f00ebff</color>
+ </PolyStyle>
+ </Style>
+ <Style id="blueLineBluePoly">
+ <LineStyle>
+ <color>7fff0000</color>
+ <width>4</width>
+ </LineStyle>
+ <PolyStyle>
+ <color>7fff0000</color>
+ </PolyStyle>
+ </Style>
+ ';
+$route = getRoute($routeid);
+echo "\n<Placemark>\n";
+$_REQUEST['time'] = "12:00";
+$trip = getRouteNextTrip($routeid, 0);
+$link = curPageURL() . "/../trip.php?routeid=" . htmlspecialchars($route["route_id"]. "&directionid=0&tripid=".$trip['trip_id']) ;
+echo "<name>" . $route['route_short_name'] . " Direction 0 </name>";
+echo '<atom:link rel="related" href="' . $link . '"/>';
+echo '<description><![CDATA[ <a href="' . $link . '">' . $route['route_short_name'] . " Direction 0</a>]]> </description>";
+echo "<styleUrl>#yellowLineYellowPoly</styleUrl>";
+echo getTripShape($trip['trip_id']);
+ echo "</Placemark>\n";
+$stops = Array();
+foreach (getTripStops($trip['trip_id']) as $stop) {
+ $stop['style'] = "#ylw-pushpin";
+ $stops[$stop['stop_id']] = $stop;
+}
+
+
+echo "\n<Placemark>\n";
+$trip = getRouteNextTrip($routeid, 1);
+$link = curPageURL() . "/../trip.php?routeid=" . htmlspecialchars($route["route_id"]. "&directionid=1&tripid=".$trip['trip_id']) ;
+echo "<name>" . $route['route_short_name'] . " Direction 1 </name>";
+echo '<atom:link rel="related" href="' . $link . '"/>';
+echo '<description><![CDATA[ <a href="' . $link . '">' . $route['route_short_name'] . " Direction 1</a>]]> </description>";
+echo "<styleUrl>#blueLineBluePoly</styleUrl>";
+
+echo getTripShape($trip['trip_id']);
+ echo "</Placemark>\n";
+foreach (getTripStops($trip['trip_id']) as $stop) {
+ if (isset($stops[$stop['stop_id']])) {
+ $stop['style'] = "#grn-pushpin";
+ } else {
+ $stop['style'] = "#blue-pushpin";
+ }
+ $stops[$stop['stop_id']] = $stop;
+}
+foreach ($stops as $stop) {
+ echo "\n<Placemark>\n";
+ $link = curPageURL() . '/../stop.php?stopid=' . htmlspecialchars($stop['stop_id']);
+ echo "<name>" . htmlspecialchars($stop['stop_name']) . "</name>";
+ echo '<atom:link rel="related" href="' . $link . '"/>';
+ echo '<description><![CDATA[ <a href="' . $link . '">' . htmlspecialchars($stop['stop_name']) . "</a>]]> </description>";
+ echo "<styleUrl>" . $stop['style'] . "</styleUrl>";
+ echo $stop['positionkml'];
+ echo "</Placemark>\n";
+}
+
+echo "</Document></kml>\n";
+?>
+
+
--- /dev/null
+++ b/geo/stops.kml.php
@@ -1,1 +1,40 @@
+<?php
+header('Content-type: application/vnd.google-earth.kml+xml');
+include ('../include/common.inc.php');
+header('Content-Disposition: attachment; filename="stops.kml"');
+$debugOkay = Array(); // disable debugging output even on dev server
+//http://wiki.openstreetmap.org/wiki/OpenLayers_Dynamic_KML
+// Creates the KML/XML Document.
+$dom = new DOMDocument('1.0', 'UTF-8');
+// Creates the root KML element and appends it to the root document.
+$node = $dom->createElementNS('http://www.opengis.net/kml/2.2', 'kml');
+$parNode = $dom->appendChild($node);
+// Creates a KML Document element and append it to the KML element.
+$dnode = $dom->createElement('Document');
+$docNode = $parNode->appendChild($dnode);
+if ($suburb != "") $result_stops = getStopsBySuburb($suburb);
+else $result_stops = getStops();
+foreach ($result_stops as $stop) {
+ $description = '<a href="'.curPageURL() . '/../stop.php?stopid=' . $stop['stop_id'] . '">View stop page</a><br>';
+ // Creates a Placemark and append it to the Document.
+ $node = $dom->createElement('Placemark');
+ $placeNode = $docNode->appendChild($node);
+ // Creates an id attribute and assign it the value of id column.
+ $placeNode->setAttribute('id', 'placemark' . $stop['stop_id']);
+ // Create name, and description elements and assigns them the values of the name and address columns from the results.
+ $nameNode = $dom->createElement('name', htmlentities($stop['stop_name']));
+ $descriptionNode = $dom->createElement('description', $description);
+ $placeNode->appendChild($nameNode);
+ $placeNode->appendChild($descriptionNode);
+ // Creates a Point element.
+ $pointNode = $dom->createElement('Point');
+ $placeNode->appendChild($pointNode);
+ // Creates a coordinates element and gives it the value of the lng and lat columns from the results.
+ $coorStr = $stop['stop_lon'] . ',' . $stop['stop_lat'];
+ $coorNode = $dom->createElement('coordinates', $coorStr);
+ $pointNode->appendChild($coorNode);
+}
+$kmlOutput = $dom->saveXML();
+echo $kmlOutput;
+?>
--- /dev/null
+++ b/geo/trip.kml.php
@@ -1,1 +1,70 @@
+<?php
+header('Content-Type: application/vnd.google-earth.kml+xml');
+include ('../include/common.inc.php');
+header('Content-Disposition: attachment; filename="trip.' . urlencode($tripid) . '.kml"');
+$debugOkay = Array(); // disable debugging output even on dev server
+echo '<?xml version="1.0" encoding="UTF-8"?>
+<kml xmlns="http://www.opengis.net/kml/2.2" xmlns:atom="http://www.w3.org/2005/Atom"><Document>';
+echo '
+ <Style id="ylw-pushpin">
+ <IconStyle>
+ <Icon>
+ <href>http://maps.google.com/mapfiles/kml/pushpin/ylw-pushpin.png</href>
+
+ </Icon>
+ </IconStyle>
+
+ </Style>
+ <Style id="blue-pushpin">
+ <IconStyle>
+ <Icon>
+ <href>http://maps.google.com/mapfiles/kml/pushpin/blue-pushpin.png</href>
+
+ </Icon>
+ </IconStyle>
+
+ </Style>
+ <Style id="grn-pushpin">
+ <IconStyle>
+ <Icon>
+ <href>http://maps.google.com/mapfiles/kml/pushpin/grn-pushpin.png</href>
+
+ </Icon>
+ </IconStyle>
+ </Style>
+ <Style id="yellowLineGreenPoly">
+ <LineStyle>
+ <color>7f00ff00</color>
+ <width>4</width>
+ </LineStyle>
+ <PolyStyle>
+ <color>7f00ffff</color>
+ </PolyStyle>
+ </Style>';
+$trip = getTrip($tripid);
+echo "\n<Placemark>\n";
+$link = curPageURL() . "/../trip.php?tripid=" . htmlspecialchars($$tripid);
+echo "<name>" . $tripid . "</name>";
+echo '<atom:link rel="related" href="' . $link . '"/>';
+echo '<description><![CDATA[ <a href="' . $link . '">' . $tripid . "</a>]]> </description>";
+echo "<styleUrl>#yellowLineGreenPoly</styleUrl>";
+
+echo getTripShape($tripid);
+
+echo "</Placemark>\n";
+foreach (getTripStopTimes($tripid) as $stop) {
+ echo "\n<Placemark>\n";
+ $link = curPageURL() . '/../trip.php?tripid=' . htmlspecialchars($tripid);
+ echo "<name>" . $stop['arrival_time'] . " @ " . htmlspecialchars($stop['stop_name']) . "</name>";
+ echo '<atom:link rel="related" href="' . $link . '"/>';
+ echo '<description><![CDATA[ <a href="' . $link . '">' . htmlspecialchars($stop['stop_name']) . "</a>]]> </description>";
+ echo "<styleUrl>#blue-pushpin</styleUrl>";
+ echo "<Point><coordinates>" . $stop['stop_lon'] . "," . $stop['stop_lat'] . "</coordinates></Point>";
+
+ echo "</Placemark>\n";
+}
+echo "</Document></kml>\n";
+?>
+
+
--- /dev/null
+++ b/include/common-auth.inc.php
@@ -1,1 +1,33 @@
+<?php
+require $basePath.'lib/openid.php';
+$openid = new LightOpenID($_SERVER['HTTP_HOST']);
+
+function login()
+{
+ global $openid;
+ if(!$openid->mode) {
+ $openid->required = array('contact/email');
+ $openid->identity = 'https://www.google.com/accounts/o8/id';
+ header('Location: ' . $openid->authUrl());
+ }
+ }
+
+function auth()
+
+{
+ if ($_SESSION['authed'] == true) return true;
+ global $openid;
+
+ if($openid->mode) {
+ $attr = $openid->getAttributes();
+ if ($attr["contact/email"] != "maxious@gmail.com") {
+ die("Access Denied");
+ } else {
+ $_SESSION['authed'] = true;
+ }
+ } else {
+ login();
+ }
+ }
+
--- /dev/null
+++ b/include/common-db.inc.php
@@ -1,1 +1,39 @@
+<?php
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
+if (strstr(php_uname('n'),"actbus")) {
+ $conn = new PDO("pgsql:dbname=transitdata;user=transitdata;password=transitdata;host=bus-main.lambdacomplex.org");
+} else if (isDebugServer()) {
+ $conn = new PDO("pgsql:dbname=transitdata;user=postgres;password=snmc;host=localhost");
+} else {
+ $conn = new PDO("pgsql:dbname=transitdata;user=transitdata;password=transitdata;host=localhost");
+}
+if (!$conn) {
+ die("A database error occurred.\n");
+}
+
+function databaseError($errMsg) {
+ if ($errMsg[1] != "") {
+ die(print_r($errMsg,true));
+ }
+}
+
+include ('db/route-dao.inc.php');
+include ('db/trip-dao.inc.php');
+include ('db/stop-dao.inc.php');
+include ('db/servicealert-dao.inc.php');
+
--- a/include/common-geo.inc.php
+++ b/include/common-geo.inc.php
@@ -1,151 +1,170 @@
<?php
+
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
// SELECT array_to_string(array(SELECT REPLACE(name_2006, ',', '\,') as name FROM suburbs order by name), ',')
$suburbs = explode(",", "Acton,Ainslie,Amaroo,Aranda,Banks,Barton,Belconnen,Bonner,Bonython,Braddon,Bruce,Calwell,Campbell,Chapman,Charnwood,Chifley,Chisholm,City,Conder,Cook,Curtin,Deakin,Dickson,Downer,Duffy,Dunlop,Evatt,Fadden,Farrer,Fisher,Florey,Flynn,Forrest,Franklin,Fraser,Fyshwick,Garran,Gilmore,Giralang,Gordon,Gowrie,Greenway,Griffith,Gungahlin,Hackett,Hall,Harrison,Hawker,Higgins,Holder,Holt,Hughes,Hume,Isaacs,Isabella Plains,Kaleen,Kambah,Kingston,Latham,Lawson,Lyneham,Lyons,Macarthur,Macgregor,Macquarie,Mawson,McKellar,Melba,Mitchell,Monash,Narrabundah,Ngunnawal,Nicholls,Oaks Estate,O'Connor,O'Malley,Oxley,Page,Palmerston,Parkes,Pearce,Phillip,Pialligo,Red Hill,Reid,Richardson,Rivett,Russell,Scullin,Spence,Stirling,Symonston,Tharwa,Theodore,Torrens,Turner,Wanniassa,Waramanga,Watson,Weetangera,Weston,Yarralumla");
-function staticmap($mapPoints, $zoom = 0, $markerImage = "iconb", $collapsible = true)
-{
- $width = 300;
- $height = 300;
- $metersperpixel[9] = 305.492 * $width;
- $metersperpixel[10] = 152.746 * $width;
- $metersperpixel[11] = 76.373 * $width;
- $metersperpixel[12] = 38.187 * $width;
- $metersperpixel[13] = 19.093 * $width;
- $metersperpixel[14] = 9.547 * $width;
- $metersperpixel[15] = 4.773 * $width;
- $metersperpixel[16] = 2.387 * $width;
- // $metersperpixel[17]=1.193*$width;
- $center = "";
- $markers = "";
- $minlat = 999;
- $minlon = 999;
- $maxlat = 0;
- $maxlon = 0;
- if (sizeof($mapPoints) < 1) return "map error";
- if (sizeof($mapPoints) === 1) {
- if ($zoom == 0) $zoom = 14;
- $markers.= "{$mapPoints[0][0]},{$mapPoints[0][1]},$markerimage";
- $center = "{$mapPoints[0][0]},{$mapPoints[0][1]}";
- }
- else {
- foreach ($mapPoints as $index => $mapPoint) {
- $markers.= $mapPoint[0] . "," . $mapPoint[1] . "," . $markerImage . ($index + 1);
- if ($index + 1 != sizeof($mapPoints)) $markers.= "|";
- if ($mapPoint[0] < $minlat) $minlat = $mapPoint[0];
- if ($mapPoint[0] > $maxlat) $maxlat = $mapPoint[0];
- if ($mapPoint[1] < $minlon) $minlon = $mapPoint[1];
- if ($mapPoint[1] > $maxlon) $maxlon = $mapPoint[1];
- $totalLat+= $mapPoint[0];
- $totalLon+= $mapPoint[1];
- }
- if ($zoom == 0) {
- $mapwidthinmeters = distance($minlat, $minlon, $minlat, $maxlon);
- foreach (array_reverse($metersperpixel, true) as $zoomLevel => $maxdistance) {
- if ($zoom == 0 && $mapwidthinmeters < ($maxdistance + 50)) $zoom = $zoomLevel;
- }
- }
- $center = $totalLat / sizeof($mapPoints) . "," . $totalLon / sizeof($mapPoints);
- }
- $output = "";
- if ($collapsible) $output.= '<div data-role="collapsible" data-collapsed="true"><h3>Open Map...</h3>';
- $output.= '<center><img src="' . curPageURL() . 'lib/staticmaplite/staticmap.php?center=' . $center . '&zoom=' . $zoom . '&size=' . $width . 'x' . $height . '&maptype=mapnik&markers=' .
-$markers . '" width=' . $width . ' height=' . $height . '></center>';
- if ($collapsible) $output.= '</div>';
- return $output;
+
+function staticmap($mapPoints, $collapsible = true, $twotone = false, $path = false, $numbered = false) {
+
+ $markers = "";
+ $height = 300;
+ $width = $height;
+ $index = 0;
+ if (sizeof($mapPoints) < 1)
+ return "map error";
+ if (sizeof($mapPoints) === 1) {
+ $markers = "markers={$mapPoints[0][0]},{$mapPoints[0][1]}";
+ } else {
+ if (!$numbered) {
+ $markers = "markers=";
+ }
+ if ($path) {
+ $markers.= "markers={$mapPoints[0][0]},{$mapPoints[0][1]}&path=";
+ }
+ foreach ($mapPoints as $index => $mapPoint) {
+ if ($twotone && $index == 0) {
+ $markers = "markerd=color:red|".$mapPoint[0] . "," . $mapPoint[1]."&markers=";
+ } else {
+ if ($numbered) {
+ $label = ($index > 9 ? 9 : $index);
+ $markers.= "markers=label:$label|" . $mapPoint[0] . "," . $mapPoint[1];
+ if ($index + 1 != sizeof($mapPoints)) {
+ $markers.= "&";
+ }
+ } else {
+ $markers.= $mapPoint[0] . "," . $mapPoint[1];
+ if ($index + 1 != sizeof($mapPoints)) {
+ $markers.= "|";
+ }
+ }
+ $index++;
+ }
+ }
+ }
+ $output = "";
+ if ($collapsible)
+ $output.= '<div class="map" data-role="collapsible" data-collapsed="true"><h3>Open Map...</h3>';
+ if (isIOSDevice()) $output.= '<img class="hiresmap" src="http://maps.googleapis.com/maps/api/staticmap?size=' . $width . 'x' . $height . '&' . $markers . '&scale=2&sensor=true" width=' . $width . ' height=' . $height . ' alt="map of stop location">';
+ else $output.= '<img class="lowresmap" src="http://maps.googleapis.com/maps/api/staticmap?size=' . $width . 'x' . $height . '&' . $markers . '&scale=1&format=jpg&sensor=true" width=' . $width . ' height=' . $height . ' alt="map of stop location">';
+
+ if ($collapsible)
+ $output.= '</div>';
+ return $output;
}
-function distance($lat1, $lng1, $lat2, $lng2, $roundLargeValues = false)
-{
- $pi80 = M_PI / 180;
- $lat1*= $pi80;
- $lng1*= $pi80;
- $lat2*= $pi80;
- $lng2*= $pi80;
- $r = 6372.797; // mean radius of Earth in km
- $dlat = $lat2 - $lat1;
- $dlng = $lng2 - $lng1;
- $a = sin($dlat / 2) * sin($dlat / 2) + cos($lat1) * cos($lat2) * sin($dlng / 2) * sin($dlng / 2);
- $c = 2 * atan2(sqrt($a) , sqrt(1 - $a));
- $km = $r * $c;
- if ($roundLargeValues) {
- if ($km < 1) return floor($km * 1000);
- else return round($km,2)."k";
- } else return floor($km * 1000);
+
+function distance($lat1, $lng1, $lat2, $lng2, $roundLargeValues = false) {
+ $pi80 = M_PI / 180;
+ $lat1*= $pi80;
+ $lng1*= $pi80;
+ $lat2*= $pi80;
+ $lng2*= $pi80;
+ $r = 6372.797; // mean radius of Earth in km
+ $dlat = $lat2 - $lat1;
+ $dlng = $lng2 - $lng1;
+ $a = sin($dlat / 2) * sin($dlat / 2) + cos($lat1) * cos($lat2) * sin($dlng / 2) * sin($dlng / 2);
+ $c = 2 * atan2(sqrt($a), sqrt(1 - $a));
+ $km = $r * $c;
+ if ($roundLargeValues) {
+ if ($km < 1)
+ return floor($km * 1000);
+ else
+ return round($km, 2) . "k";
+ }
+ else
+ return floor($km * 1000);
}
-function decodePolylineToArray($encoded)
-{
- // source: http://latlongeeks.com/forum/viewtopic.php?f=4&t=5
- $length = strlen($encoded);
- $index = 0;
- $points = array();
- $lat = 0;
- $lng = 0;
- while ($index < $length) {
- // Temporary variable to hold each ASCII byte.
- $b = 0;
- // The encoded polyline consists of a latitude value followed by a
- // longitude value. They should always come in pairs. Read the
- // latitude value first.
- $shift = 0;
- $result = 0;
- do {
- // The `ord(substr($encoded, $index++))` statement returns the ASCII
- // code for the character at $index. Subtract 63 to get the original
- // value. (63 was added to ensure proper ASCII characters are displayed
- // in the encoded polyline string, which is `human` readable)
- $b = ord(substr($encoded, $index++)) - 63;
- // AND the bits of the byte with 0x1f to get the original 5-bit `chunk.
- // Then left shift the bits by the required amount, which increases
- // by 5 bits each time.
- // OR the value into $results, which sums up the individual 5-bit chunks
- // into the original value. Since the 5-bit chunks were reversed in
- // order during encoding, reading them in this way ensures proper
- // summation.
- $result|= ($b & 0x1f) << $shift;
- $shift+= 5;
- }
- // Continue while the read byte is >= 0x20 since the last `chunk`
- // was not OR'd with 0x20 during the conversion process. (Signals the end)
- while ($b >= 0x20);
- // Check if negative, and convert. (All negative values have the last bit
- // set)
- $dlat = (($result & 1) ? ~($result >> 1) : ($result >> 1));
- // Compute actual latitude since value is offset from previous value.
- $lat+= $dlat;
- // The next values will correspond to the longitude for this point.
- $shift = 0;
- $result = 0;
- do {
- $b = ord(substr($encoded, $index++)) - 63;
- $result|= ($b & 0x1f) << $shift;
- $shift+= 5;
- } while ($b >= 0x20);
- $dlng = (($result & 1) ? ~($result >> 1) : ($result >> 1));
- $lng+= $dlng;
- // The actual latitude and longitude values were multiplied by
- // 1e5 before encoding so that they could be converted to a 32-bit
- // integer representation. (With a decimal accuracy of 5 places)
- // Convert back to original values.
- $points[] = array(
- $lat * 1e-5,
- $lng * 1e-5
- );
- }
- return $points;
+
+function decodePolylineToArray($encoded) {
+ // source: http://latlongeeks.com/forum/viewtopic.php?f=4&t=5
+ $length = strlen($encoded);
+ $index = 0;
+ $points = array();
+ $lat = 0;
+ $lng = 0;
+ while ($index < $length) {
+ // Temporary variable to hold each ASCII byte.
+ $b = 0;
+ // The encoded polyline consists of a latitude value followed by a
+ // longitude value. They should always come in pairs. Read the
+ // latitude value first.
+ $shift = 0;
+ $result = 0;
+ do {
+ // The `ord(substr($encoded, $index++))` statement returns the ASCII
+ // code for the character at $index. Subtract 63 to get the original
+ // value. (63 was added to ensure proper ASCII characters are displayed
+ // in the encoded polyline string, which is `human` readable)
+ $b = ord(substr($encoded, $index++)) - 63;
+ // AND the bits of the byte with 0x1f to get the original 5-bit `chunk.
+ // Then left shift the bits by the required amount, which increases
+ // by 5 bits each time.
+ // OR the value into $results, which sums up the individual 5-bit chunks
+ // into the original value. Since the 5-bit chunks were reversed in
+ // order during encoding, reading them in this way ensures proper
+ // summation.
+ $result|= ($b & 0x1f) << $shift;
+ $shift+= 5;
+ }
+ // Continue while the read byte is >= 0x20 since the last `chunk`
+ // was not OR'd with 0x20 during the conversion process. (Signals the end)
+ while ($b >= 0x20);
+ // Check if negative, and convert. (All negative values have the last bit
+ // set)
+ $dlat = (($result & 1) ? ~($result >> 1) : ($result >> 1));
+ // Compute actual latitude since value is offset from previous value.
+ $lat+= $dlat;
+ // The next values will correspond to the longitude for this point.
+ $shift = 0;
+ $result = 0;
+ do {
+ $b = ord(substr($encoded, $index++)) - 63;
+ $result|= ($b & 0x1f) << $shift;
+ $shift+= 5;
+ } while ($b >= 0x20);
+ $dlng = (($result & 1) ? ~($result >> 1) : ($result >> 1));
+ $lng+= $dlng;
+ // The actual latitude and longitude values were multiplied by
+ // 1e5 before encoding so that they could be converted to a 32-bit
+ // integer representation. (With a decimal accuracy of 5 places)
+ // Convert back to original values.
+ $points[] = array(
+ $lat * 1e-5,
+ $lng * 1e-5
+ );
+ }
+ return $points;
}
-function geocode($query, $giveOptions)
-{
- global $cloudmadeAPIkey;
- $url = "http://geocoding.cloudmade.com/$cloudmadeAPIkey/geocoding/v2/find.js?query=" . urlencode($query) . "&bbox=-35.5,149.00,-35.15,149.1930&return_location=true&bbox_only=true";
- $contents = json_decode(getPage($url));
- if ($giveOptions) return $contents->features;
- elseif (isset($contents->features[0]->centroid)) return $contents->features[0]->centroid->coordinates[0] . "," . $contents->features[0]->centroid->coordinates[1];
- else return "";
+
+function geocode($query, $giveOptions) {
+ global $cloudmadeAPIkey;
+ $url = "http://geocoding.cloudmade.com/$cloudmadeAPIkey/geocoding/v2/find.js?query=" . urlencode($query) . "&bbox=-35.5,149.00,-35.15,149.1930&return_location=true&bbox_only=true";
+ $contents = json_decode(getPage($url));
+ if ($giveOptions)
+ return $contents->features;
+ elseif (isset($contents->features[0]->centroid))
+ return $contents->features[0]->centroid->coordinates[0] . "," . $contents->features[0]->centroid->coordinates[1];
+ else
+ return "";
}
-function reverseGeocode($lat, $lng)
-{
- global $cloudmadeAPIkey;
- $url = "http://geocoding.cloudmade.com/$cloudmadeAPIkey/geocoding/v2/find.js?around=" . $lat . "," . $lng . "&distance=closest&object_type=road";
- $contents = json_decode(getPage($url));
- return $contents->features[0]->properties->name;
+
+function reverseGeocode($lat, $lng) {
+ global $cloudmadeAPIkey;
+ $url = "http://geocoding.cloudmade.com/$cloudmadeAPIkey/geocoding/v2/find.js?around=" . $lat . "," . $lng . "&distance=closest&object_type=road";
+ $contents = json_decode(getPage($url));
+ return $contents->features[0]->properties->name;
}
-?>
--- a/include/common-net.inc.php
+++ b/include/common-net.inc.php
@@ -1,30 +1,46 @@
<?php
-function getPage($url)
-{
- debug($url, "json");
- $ch = curl_init($url);
- curl_setopt($ch, CURLOPT_RETURNTRANSFER, 1);
- curl_setopt($ch, CURLOPT_HEADER, 0);
- curl_setopt($ch, CURLOPT_TIMEOUT, 30);
- $page = curl_exec($ch);
- if (curl_errno($ch)) {
- echo "<font color=red> Database temporarily unavailable: ";
- echo curl_errno($ch) . " " . curl_error($ch);
- if (isDebug()) {
- echo $url;
- }
- echo "</font><br>";
- }
- curl_close($ch);
- debug(print_r($page,true),"json");
- return $page;
+
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
+
+function getPage($url) {
+ debug($url, "json");
+ $ch = curl_init($url);
+ curl_setopt($ch, CURLOPT_RETURNTRANSFER, 1);
+ curl_setopt($ch, CURLOPT_HEADER, 0);
+ curl_setopt($ch, CURLOPT_TIMEOUT, 45);
+ $page = curl_exec($ch);
+ if (curl_errno($ch)) {
+ echo "<font color=red> Database temporarily unavailable: ";
+ echo curl_errno($ch) . " " . curl_error($ch);
+ if (isDebug()) {
+ echo $url;
+ }
+ echo "</font><br>";
+ }
+ curl_close($ch);
+ debug(print_r($page, true), "json");
+ return $page;
}
-function curPageURL()
-{
- $isHTTPS = (isset($_SERVER["HTTPS"]) && $_SERVER["HTTPS"] == "on");
- $port = (isset($_SERVER["SERVER_PORT"]) && ((!$isHTTPS && $_SERVER["SERVER_PORT"] != "80") || ($isHTTPS && $_SERVER["SERVER_PORT"] != "443")));
- $port = ($port) ? ':' . $_SERVER["SERVER_PORT"] : '';
- $url = ($isHTTPS ? 'https://' : 'http://') . $_SERVER["SERVER_NAME"] . $port . htmlentities(dirname($_SERVER['PHP_SELF']) , ENT_QUOTES) . "/";
- return $url;
+function curPageURL() {
+ $isHTTPS = (isset($_SERVER["HTTPS"]) && $_SERVER["HTTPS"] == "on");
+ $port = (isset($_SERVER["SERVER_PORT"]) && ((!$isHTTPS && $_SERVER["SERVER_PORT"] != "80") || ($isHTTPS && $_SERVER["SERVER_PORT"] != "443")));
+ $port = ($port) ? ':' . $_SERVER["SERVER_PORT"] : '';
+ $url = ($isHTTPS ? 'https://' : 'http://') . $_SERVER["SERVER_NAME"] . $port . htmlentities(dirname($_SERVER['PHP_SELF']), ENT_QUOTES);
+ return $url;
}
-?>
+
+
--- /dev/null
+++ b/include/common-request.inc.php
@@ -1,1 +1,84 @@
+<?php
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
+if (isset($_REQUEST['firstLetter'])) {
+ $firstLetter = filter_var($_REQUEST['firstLetter'], FILTER_SANITIZE_STRING);
+}
+if (isset($_REQUEST['bysuburbs'])) {
+ $bysuburbs = true;
+}
+if (isset($_REQUEST['bynumber'])) {
+ $bynumber = true;
+}
+if (isset($_REQUEST['allstops'])) {
+ $allstops = true;
+}
+if (isset($_REQUEST['nearby'])) {
+ $nearby = true;
+}
+if (isset($_REQUEST['suburb'])) {
+ $suburb = $_REQUEST['suburb'];
+}
+if (isset($_REQUEST['pageKey'])) {
+ $pageKey = filter_var($_REQUEST['pageKey'], FILTER_SANITIZE_NUMBER_INT);
+}
+if (isset($_REQUEST['lat'])) {
+ $lat = filter_var($_REQUEST['lat'], FILTER_SANITIZE_NUMBER_FLOAT, FILTER_FLAG_ALLOW_FRACTION);
+}
+if (isset($_REQUEST['lon'])) {
+ $lon = filter_var($_REQUEST['lon'], FILTER_SANITIZE_NUMBER_FLOAT, FILTER_FLAG_ALLOW_FRACTION);
+}
+if (isset($_REQUEST['radius'])) {
+ $max_distance = filter_var($_REQUEST['radius'], FILTER_SANITIZE_NUMBER_INT);
+}
+if (isset($_REQUEST['numberSeries'])) {
+ $numberSeries = filter_var($_REQUEST['numberSeries'], FILTER_SANITIZE_NUMBER_INT);
+}
+if (isset($_REQUEST['routeDestination'])) {
+ $routeDestination = urldecode(filter_var($_REQUEST['routeDestination'], FILTER_SANITIZE_ENCODED));
+}
+if (isset($_REQUEST['routename'])) {
+ $routename = urldecode(filter_var($_REQUEST['routename'], FILTER_SANITIZE_ENCODED));
+}
+if (isset($_REQUEST['stopcode'])) {
+ $stopcode = filter_var($_REQUEST['stopcode'], FILTER_SANITIZE_STRING);
+}
+if (isset($_REQUEST['stopids'])) {
+ $stopids = explode(",", filter_var($_REQUEST['stopids'], FILTER_SANITIZE_STRING));
+}
+if (isset($_REQUEST['filterIncludeRoutes'])) {
+ $filterIncludeRoutes = explode(",", filter_var($_REQUEST['filterIncludeRoutes'], FILTER_SANITIZE_STRING));
+}
+if (isset($_REQUEST['filterHasStop'])) {
+ $filterHasStop = filter_var($_REQUEST['filterHasStop'], FILTER_SANITIZE_STRING);
+}
+if (isset($_REQUEST['tripid'])) {
+ $tripid = filter_var($_REQUEST['tripid'], FILTER_SANITIZE_STRING);
+}
+if (isset($_REQUEST['routeid'])) {
+ $routeid = filter_var($_REQUEST['routeid'], FILTER_SANITIZE_STRING);
+}
+if (isset($_REQUEST['directionid'])) {
+ $directionid = filter_var($_REQUEST['directionid'], FILTER_SANITIZE_STRING);
+}
+if (isset($_REQUEST['stopid'])) {
+ $stopid = filter_var($_REQUEST['stopid'], FILTER_SANITIZE_NUMBER_INT);
+}
+if (isset($_REQUEST['geolocate'])) {
+ $geolocate = filter_var($_REQUEST['geolocate'], FILTER_SANITIZE_URL);
+}
+
--- /dev/null
+++ b/include/common-session.inc.php
@@ -1,1 +1,70 @@
+<?php
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
+// you have to open the session to be able to modify or remove it
+session_start();
+if (isset($_REQUEST['geolocate']) && $_REQUEST['geolocate'] != "Enter co-ordinates or address here") {
+ $geocoded = false;
+ if (isset($_REQUEST['lat']) && isset($_REQUEST['lon'])) {
+ $_SESSION['lat'] = trim(filter_var($_REQUEST['lat'], FILTER_SANITIZE_NUMBER_FLOAT, FILTER_FLAG_ALLOW_FRACTION));
+ $_SESSION['lon'] = trim(filter_var($_REQUEST['lon'], FILTER_SANITIZE_NUMBER_FLOAT, FILTER_FLAG_ALLOW_FRACTION));
+ } else {
+ if (startsWith($geolocate, "-")) {
+ $locateparts = explode(",", $geolocate);
+ $_SESSION['lat'] = $locateparts[0];
+ $_SESSION['lon'] = $locateparts[1];
+ } else if (strpos($geolocate, "(") !== false) {
+ $geoParts = explode("(", $geolocate);
+ $locateparts = explode(",", str_replace(")", "", $geoParts[1]));
+ $_SESSION['lat'] = $locateparts[0];
+ $_SESSION['lon'] = $locateparts[1];
+ } else {
+ $contents = geocode($geolocate, true);
+ print_r($contents);
+ if (isset($contents[0]->centroid)) {
+ $geocoded = true;
+ $_SESSION['lat'] = $contents[0]->centroid->coordinates[0];
+ $_SESSION['lon'] = $contents[0]->centroid->coordinates[1];
+ } else {
+ $_SESSION['lat'] = "";
+ $_SESSION['lon'] = "";
+ }
+ }
+ }
+ sessionUpdated();
+}
+
+function sessionUpdated() {
+ $_SESSION['lastUpdated'] = time();
+}
+
+// timeoutSession
+$TIMEOUT_LIMIT = 60 * 5; // 5 minutes
+if (isset($_SESSION['lastUpdated']) && $_SESSION['lastUpdated'] + $TIMEOUT_LIMIT < time()) {
+ debug("Session timeout " . ($_SESSION['lastUpdated'] + $TIMEOUT_LIMIT) . ">" . time(), "session");
+ session_destroy();
+ session_start();
+}
+
+//debug(print_r($_SESSION, true) , "session");
+function current_time($time = "") {
+ if (isset($_REQUEST['time'])) return $_REQUEST['time'];
+ else if ($time != "") date("H:i:s",$time);
+ else return date("H:i:s");
+}
+
+
--- a/include/common-template.inc.php
+++ b/include/common-template.inc.php
@@ -1,138 +1,132 @@
<?php
- // Copyright 2009 Google Inc. All Rights Reserved.
- $GA_ACCOUNT = "MO-22173039-1";
- $GA_PIXEL = "/lib/ga.php";
-
- function googleAnalyticsGetImageUrl() {
+
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
+
+// Copyright 2009 Google Inc. All Rights Reserved.
+$GA_ACCOUNT = "MO-22173039-1";
+$GA_PIXEL = "/lib/ga.php";
+
+function googleAnalyticsGetImageUrl() {
global $GA_ACCOUNT, $GA_PIXEL;
+ //if (stristr($_SERVER['HTTP_USER_AGENT'], 'Googlebot') return "";
$url = "";
- $url .= $GA_PIXEL . "?";
- $url .= "utmac=" . $GA_ACCOUNT;
- $url .= "&utmn=" . rand(0, 0x7fffffff);
- $referer = $_SERVER["HTTP_REFERER"];
+ $url.= $GA_PIXEL . "?";
+ $url.= "utmac=" . $GA_ACCOUNT;
+ $url.= "&utmn=" . rand(0, 0x7fffffff);
+ $referer = (isset($_SERVER["HTTP_REFERER"]) ? $_SERVER["HTTP_REFERER"] : "");
$query = $_SERVER["QUERY_STRING"];
$path = $_SERVER["REQUEST_URI"];
if (empty($referer)) {
- $referer = "-";
- }
- $url .= "&utmr=" . urlencode($referer);
+ $referer = "-";
+ }
+ $url.= "&utmr=" . urlencode($referer);
if (!empty($path)) {
- $url .= "&utmp=" . urlencode($path);
- }
- $url .= "&guid=ON";
+ $url.= "&utmp=" . urlencode($path);
+ }
+ $url.= "&guid=ON";
return str_replace("&", "&", $url);
- }
-
-function include_header($pageTitle, $pageType, $opendiv = true, $geolocate = false, $datepicker = false)
-{
- echo '
+}
+
+function include_header($pageTitle, $pageType, $opendiv = true, $geolocate = false, $datepicker = false) {
+ global $basePath, $GTFSREnabled, $stopid, $routeid;
+ echo '
<!DOCTYPE html>
<html lang="en">
<head>
<meta charset="UTF-8">
- <title>' . $pageTitle . '</title>
- <meta name="google-site-verification"
-content="-53T5Qn4TB_de1NyfR_ZZkEVdUNcNFSaYKSFkWKx-sY" />';
- if ($datepicker) echo '<link rel="stylesheet" href="css/jquery.ui.datepicker.mobile.css" />';
- if (isDebugServer()) echo '<link rel="stylesheet" href="css/jquery-mobile-1.0a3.css" />
- <script type="text/javascript" src="js/jquery-1.5.js"></script>
- <script>$(document).bind("mobileinit", function(){
+<meta name="viewport" content="width=device-width, initial-scale=1">
+<title>' . $pageTitle . ' - Canberra Bus Timetable</title>
+ <meta name="google-site-verification" content="-53T5Qn4TB_de1NyfR_ZZkEVdUNcNFSaYKSFkWKx-sY" />
+<link rel="dns-prefetch" href="//code.jquery.com">
+<link rel="dns-prefetch" href="//ajax.googleapis.com">';
+ $jqmVersion = "1.0.1";
+ echo '
+ <script src="'.$basePath.'js/yepnope/yepnope.1.5.3-min.js"></script>
+ <script>
+ yepnope([{
+ load: "//ajax.googleapis.com/ajax/libs/jquery/1.6.4/jquery.min.js",
+ complete: function () {
+
+ $(document).bind("mobileinit", function(){
$.mobile.ajaxEnabled = false;
-});
-</script>
- <script type="text/javascript" src="js/jquery-mobile-1.0a3.js"></script>';
- else echo '<link rel="stylesheet" href="http://code.jquery.com/mobile/1.0a3/jquery.mobile-1.0a3.min.css" />
- <script type="text/javascript" src="http://code.jquery.com/jquery-1.5.1.min.js"></script>
- <script>$(document).bind("mobileinit", function(){
- $.mobile.ajaxEnabled = false;
-});
-</script>
- <script type="text/javascript" src="http://code.jquery.com/mobile/1.0a3/jquery.mobile-1.0a3.min.js"></script>';
- if ($datepicker) echo '<script>
- //reset type=date inputs to text
- $( document ).bind( "mobileinit", function(){
- $.mobile.page.prototype.options.degradeInputs.date = true;
- });
- </script>
- <script src="js/jQuery.ui.datepicker.js"></script>';
- echo '<style type="text/css">
- .ui-navbar {
- width: 100%;
- }
- .ui-btn-inner {
- white-space: normal !important;
- }
- .ui-li-heading {
- white-space: normal !important;
- }
- .ui-listview-filter {
- margin: 0 !important;
- }
- .ui-icon-navigation {
- background-image: url(css/images/113-navigation.png);
- background-position: 1px 0;
- }
- #footer {
- text-size: 0.75em;
- text-align: center;
- }
- body {
- background-color: #F0F0F0;
- }
- #jqm-homeheader {
- text-align: center;
- }
- .viaPoints {
- display: none;
- text-size: 0.2em;
- }
- .min-width-480px .viaPoints {
- display: block;
- }
- #extrainfo {
- visibility: hidden;
- display: none;
- }
- // source http://webaim.org/techniques/skipnav/
- #skip a, #skip a:hover, #skip a:visited
-{
-position:absolute;
-left:0px;
-top:-500px;
-width:1px;
-height:1px;
-overflow:hidden;
-}
-
-#skip a:active, #skip a:focus
-{
-position:static;
-width:auto;
-height:auto;
-}
-</style>';
- if (strstr($_SERVER['HTTP_USER_AGENT'], 'iPhone') || strstr($_SERVER['HTTP_USER_AGENT'], 'iPod')) {
- echo '<meta name="apple-mobile-web-app-capable" content="yes" />
+}); }
+
+}, {
+ load: ["//code.jquery.com/mobile/' . $jqmVersion . '/jquery.mobile-' . $jqmVersion . '.min.css","//code.jquery.com/mobile/' . $jqmVersion . '/jquery.mobile-' . $jqmVersion . '.min.js"]
+ }, {
+ load: ["' . $basePath . 'css/jquery-ui-1.8.12.custom.css","' . $basePath . 'js/jquery.ui.core.min.js","' . $basePath . 'js/jquery.ui.position.min.js","' . $basePath . 'js/jquery.ui.widget.min.js","' . $basePath . 'js/jquery.ui.autocomplete.min.js"],
+ complete: function() {
+ $( "#geolocate" ).autocomplete({
+ source: "lib/autocomplete.php",
+ minLength: 2
+ });
+ $( "#from" ).autocomplete({
+ source: "lib/autocomplete.php",
+ minLength: 2
+ });
+ $( "#to" ).autocomplete({
+ source: "lib/autocomplete.php",
+ minLength: 2
+ });
+ }
+
+
+}]);
+
+</script>
+ ';
+ echo '<style type="text/css">';
+ if (strstr($_SERVER['HTTP_USER_AGENT'], 'Android'))
+ echo '.ui-shadow,.ui-btn-up-a,.ui-btn-hover-a,.ui-btn-down-a,.ui-body-b,.ui-btn-up-b,.ui-btn-hover-b,
+.ui-btn-down-b,.ui-bar-c,.ui-body-c,.ui-btn-up-c,.ui-btn-hover-c,.ui-btn-down-c,.ui-bar-c,.ui-body-d,
+.ui-btn-up-d,.ui-btn-hover-d,.ui-btn-down-d,.ui-bar-d,.ui-body-e,.ui-btn-up-e,.ui-btn-hover-e,
+.ui-btn-down-e,.ui-bar-e,.ui-overlay-shadow,.ui-shadow,.ui-btn-active,.ui-body-a,.ui-bar-a {
+ text-shadow: none;
+ box-shadow: none;
+ -webkit-box-shadow: none;
+}';
+ echo '</style>';
+ echo '<link rel="stylesheet" href="' . $basePath . 'css/local.css.php" />';
+ if (isIOSDevice()) {
+ echo '<meta name="apple-mobile-web-app-capable" content="yes" />
<meta name="apple-mobile-web-app-status-bar-style" content="black" />
<link rel="apple-touch-startup-image" href="startup.png" />
<link rel="apple-touch-icon" href="apple-touch-icon.png" />';
- }
- if ($geolocate) {
- echo "<script>
+ }
+ if ($geolocate) {
+ echo "<script>
function success(position) {
+$('#error').val('Location now detected. Please wait for data to load.');
$('#geolocate').val(position.coords.latitude+','+position.coords.longitude);
-$.ajax({ url: \"include/common.inc.php?geolocate=yes&lat=\"+position.coords.latitude+\"&lon=\"+position.coords.longitude });
-location.reload(true);
+$.ajax({ async: false,
+success: function(){
+ location.reload(true);
+ },
+url: \"include/common.inc.php?geolocate=yes&lat=\"+position.coords.latitude+\"&lon=\"+position.coords.longitude });
}
function error(msg) {
- console.log(msg);
+$('#error').val('Error: '+msg);
}
function geolocate() {
if (navigator.geolocation) {
var options = {
- enableHighAccuracy: false,
+ enableHighAccuracy: true,
timeout: 60000,
maximumAge: 10000
}
@@ -141,46 +135,86 @@
}
$(document).ready(function() {
$('#here').click(function(event) { $('#geolocate').val(geolocate()); return false;});
-$('#here').show();
+ $('#here').show();
});
";
-if (!isset($_SESSION['lat']) || $_SESSION['lat'] == "") echo "geolocate();";
-echo "</script> ";
- }
- if (isAnalyticsOn()) echo '
-<script type="text/javascript">'."
+ if (!isset($_SESSION['lat']) || $_SESSION['lat'] == "")
+ echo "geolocate();";
+ echo "</script> ";
+ }
+ if (isAnalyticsOn())
+ echo '
+<script type="text/javascript">' . "
var _gaq = _gaq || [];
_gaq.push(['_setAccount', 'UA-22173039-1']);
_gaq.push(['_trackPageview']);
+ _gaq.push(['_trackPageLoadTime']);
</script>";
-echo '</head>
+ echo '</head>
<body>
<div id="skip">
<a href="#maincontent">Skip to content</a>
</div>
';
- if ($opendiv) {
- echo '<div data-role="page">
- <script>
-$(document).ready(function ()
-{
- document.title = "' . $pageTitle . '";
-});
-</script>
- <div data-role="header">
+ if ($opendiv) {
+ echo '<div data-role="page">
+ <div data-role="header" data-position="inline">
+ <a href="' . (isset($_SERVER["HTTP_REFERER"]) ? $_SERVER["HTTP_REFERER"] : "javascript:history.go(-1)") . '" data-icon="arrow-l" data-rel="back" class="ui-btn-left">Back</a>
<h1>' . $pageTitle . '</h1>
+ <a href="' . $basePath . '/index.php" data-icon="home" class="ui-btn-right">Home</a>
</div><!-- /header -->
<a name="maincontent" id="maincontent"></a>
<div data-role="content"> ';
- }
-}
-function include_footer()
-{
- echo '<div id="footer"><a href="about.php">About/Contact Us</a> <a href="feedback.php">Feedback/Bug Report</a></a>';
- echo '</div>';
- if (isAnalyticsOn()) {
- echo "<script> (function() {
+ if ($GTFSREnabled) {
+ $overrides = getServiceOverride();
+ if (isset($overrides['service_id'])) {
+ if ($overrides['service_id'] == "noservice") {
+ echo '<div class="servicewarning">Buses are <strong>not running today</strong> due to industrial action/public holiday. See <a
+href="http://www.action.act.gov.au">http://www.action.act.gov.au</a> for details.</div>';
+ } else {
+ echo '<div class="servicewarning">Buses are running on an altered timetable today due to industrial action/public holiday. See <a href="http://www.action.act.gov.au">http://www.action.act.gov.au</a> for details.</div>';
+ }
+ }
+ $serviceAlerts = Array();
+ $globalAlerts = getServiceAlertsAsArray("agency", "0");
+ if ($globalAlerts != null) {
+ // echo "getting alerts due to network wide";
+ $serviceAlerts = array_merge($serviceAlerts, $globalAlerts);
+ }
+ if (isset($stopid)) {
+ $stopAlerts = getServiceAlertsAsArray("stop", $stopid);
+ if ($stopAlerts != null) {
+ // echo "getting alerts due to stop $stopid";
+ $serviceAlerts = array_merge($serviceAlerts, $stopAlerts);
+ }
+ }
+ if (isset($routeid)) {
+ $routeAlerts = getServiceAlertsAsArray("route", $routeid);
+ if ($routeAlerts != null) {
+ // echo "getting alerts due to route $routeid";
+ $serviceAlerts = array_merge($serviceAlerts, $routeAlerts);
+ }
+ }
+ if (isset($serviceAlerts['entity']) && sizeof($serviceAlerts['entity']) > 0) {
+ foreach ($serviceAlerts['entity'] as $entity) {
+ echo "<div class='servicewarning'><b>{$entity['alert']['header_text']['translation'][0]['text']}</b> <small>"
+ . date("F jS Y, g:i a", $entity['alert']['active_period'][0]['start']) . " to "
+ . date("F jS Y, g:i a", $entity['alert']['active_period'][0]['end']) . "</small>
+ <br>Warning: {$entity['alert']['description_text']['translation'][0]['text']}
+ <br><a href='{$entity['alert']['url']['translation'][0]['text']}'>Source</a> </div>";
+ }
+ }
+ }
+ }
+}
+
+function include_footer() {
+ global $basePath;
+ echo '<div id="footer"><a href="' . $basePath . 'about.php">About/Contact Us</a> <a href="' . $basePath . 'feedback.php">Feedback/Bug Report</a> <a href="' . $basePath . 'privacy.php">Privacy Policy</a>';
+ echo '</div>';
+ if (isAnalyticsOn()) {
+ echo "<script> (function() {
var ga = document.createElement('script'); ga.type =
'text/javascript'; ga.async = true;
ga.src = ('https:' == document.location.protocol ?
@@ -188,53 +222,104 @@
var s = document.getElementsByTagName('script')[0];
s.parentNode.insertBefore(ga, s);
})();</script>";
- $googleAnalyticsImageUrl = googleAnalyticsGetImageUrl();
- echo '<noscript><img src="' . $googleAnalyticsImageUrl . '" /></noscript>';
- }
-}
-function timePlaceSettings($geolocate = false)
-{
- global $service_periods;
- $geoerror = false;
- if ($geolocate == true) {
- $geoerror = !isset($_SESSION['lat']) || !isset($_SESSION['lat']) || $_SESSION['lat'] == "" || $_SESSION['lon'] == "";
- }
- if ($geoerror) {
- echo '<div class="error">Sorry, but your location could not currently be detected.
+ $googleAnalyticsImageUrl = googleAnalyticsGetImageUrl();
+ echo '<noscript><img src="' . $googleAnalyticsImageUrl . '" alt=""/></noscript>';
+ }
+ echo "\n</div></div></body></html>";
+}
+
+function timeSettings() {
+ global $service_periods;
+ echo '<div id="settings" data-role="collapsible" data-collapsed="true">
+<h3>Change Time (' . (isset($_REQUEST['time']) ? $_REQUEST['time'] : "Current Time,") . ' ' . ucwords(service_period()) . ')...</h3>
+ <form action="' . basename($_SERVER['PHP_SELF']) . '" method="GET">
+ <input type="hidden" name="suburb" id="suburb" value="' . (isset($_REQUEST['suburb']) ? $_REQUEST['suburb'] : "") . '"/>
+
+ <input type="hidden" name="stopid" id="stopid" value="' . (isset($_REQUEST['stopid']) ? $_REQUEST['stopid'] : "") . '"/>
+ <input type="hidden" name="stopcode" id="stopcode" value="' . (isset($_REQUEST['stopcode']) ? $_REQUEST['stopcode'] : "") . '"/>
+ <div class="ui-body">
+ <div data-role="fieldcontain">
+ <label for="time"> Time: </label>
+ <input type="time" name="time" id="time" value="' . (isset($_REQUEST['time']) ? $_REQUEST['time'] : date("H:i")) . '"/>
+ <a href="#" name="currentTime" id="currentTime" onClick="var d = new Date();' . "$('#time').val(d.getHours() +':'+ (d.getMinutes().toString().length == 1 ? '0'+ d.getMinutes(): d.getMinutes()));" . '">Current Time?</a>
+ </div>
+ <div data-role="fieldcontain">
+ <label for="service_period"> Service Period: </label>
+ <select name="service_period" id="service_period">';
+ foreach ($service_periods as $service_period) {
+ echo "<option value=\"$service_period\"" . (service_period() === $service_period ? " SELECTED" : "") . '>' . ucwords($service_period) . '</option>';
+ }
+ echo '</select>
+ <a href="#" style="display:none" name="currentPeriod" id="currentPeriod">Current Period?</a>
+ </div>
+
+ <input type="submit" value="Update"/>
+ </div></form>
+ </div>';
+}
+
+function placeSettings() {
+
+ $geoerror = false;
+ $geoerror = !isset($_SESSION['lat']) || !isset($_SESSION['lat']) || $_SESSION['lat'] == "" || $_SESSION['lon'] == "";
+
+ echo '<div id="error">';
+ if ($geoerror) {
+ echo 'Sorry, but your location could not currently be detected.
Please allow location permission, wait for your location to be detected,
- or enter an address/co-ordinates in the box below.</div>';
- }
- echo '<div data-role="collapsible" data-collapsed="' . !$geoerror . '">
- <h3>Change Time/Place (' . (isset($_SESSION['time']) ? $_SESSION['time'] : "Current Time,") . ' ' . ucwords(service_period()) . ')...</h3>
- <form action="'.basename($_SERVER['PHP_SELF'])."?".$_SERVER['QUERY_STRING'].'" method="post">
+ or enter an address/co-ordinates in the box below.';
+ }
+ echo '</div>';
+ echo '<div id="settings" data-role="collapsible" data-collapsed="' . !$geoerror . '">
+ <h3>Change Location...</h3>
+ <form action="' . basename($_SERVER['PHP_SELF']) . "?" . $_SERVER['QUERY_STRING'] . '" method="post">
<div class="ui-body">
<div data-role="fieldcontain">
<label for="geolocate"> Current Location: </label>
<input type="text" id="geolocate" name="geolocate" value="' . (isset($_SESSION['lat']) && isset($_SESSION['lon']) ? $_SESSION['lat'] . "," . $_SESSION['lon'] : "Enter co-ordinates or address here") . '"/> <a href="#" style="display:none" name="here" id="here">Here?</a>
</div>
- <div data-role="fieldcontain">
- <label for="time"> Time: </label>
- <input type="time" name="time" id="time" value="' . (isset($_SESSION['time']) ? $_SESSION['time'] : date("H:i")) . '"/>
- <a href="#" name="currentTime" id="currentTime" onClick="var d = new Date();'. "$('#time').val(d.getHours() +':'+ d.getMinutes());".'">Current Time?</a>
- </div>
- <div data-role="fieldcontain">
- <label for="service_period"> Service Period: </label>
- <select name="service_period" id="service_period">';
- foreach ($service_periods as $service_period) {
- echo "<option value=\"$service_period\"" . (service_period() === $service_period ? " SELECTED" : "") . '>' . ucwords($service_period) . '</option>';
- }
- echo '</select>
- <a href="#" style="display:none" name="currentPeriod" id="currentPeriod"/>Current Period?</a>
- </div>
<input type="submit" value="Update"/>
- </form>
- </div></div>';
-}
-function trackEvent($category, $action, $label = "", $value = -1) {
- if (isAnalyticsOn()) {
- echo "<script> _gaq.push(['_trackEvent', $category, $action".($label != "" ? ", $label" : "").($value != -1 ? ", $value" : "")."]);</script>";
- }
-}
-?>
-
+ </div></form>
+ </div>';
+}
+
+function trackEvent($category, $action, $label = "", $value = - 1) {
+ if (isAnalyticsOn()) {
+ echo "\n<script> _gaq.push(['_trackEvent', '$category', '$action'" . ($label != "" ? ", '$label'" : "") . ($value != - 1 ? ", $value" : "") . "]);</script>";
+ }
+}
+
+//stop list collapsing
+function stopCompare($stopName) {
+ return substr(trim(preg_replace("/\(Platform.*/", "", $stopName)), 0, 9);
+}
+
+function stopGroupTitle($stopName, $stopdesc) {
+ if (preg_match("/Dr |Cct |Cir |Av |St |Cr |Parade |Way |Bank /", $stopName)) {
+ $descParts = explode("<br>", $stopdesc);
+ return trim(str_replace("Street: ", "", $descParts[0]));
+ } else {
+ return trim(preg_replace("/\(Platform.*/", "", $stopName));
+ }
+}
+
+function viaPointNames($tripid, $stop_sequence = "") {
+ $viaPointNames = Array();
+ foreach (viaPoints($tripid, $stop_sequence) as $point) {
+ if (strstr($point['stop_name'], "Station")
+ || strstr($point['stop_name'], "Shops")
+ || strstr($point['stop_name'], "CIT")
+ || strstr($point['stop_name'], "School")
+ || strstr($point['stop_name'], "University")
+ ) {
+ $viaPointNames[] = $point['stop_name'];
+ }
+ }
+ if (sizeof($viaPointNames) > 0) {
+ return r_implode(", ", $viaPointNames);
+ } else {
+ return "";
+ }
+}
+
--- a/include/common-transit.inc.php
+++ b/include/common-transit.inc.php
@@ -1,73 +1,339 @@
<?php
+
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
$service_periods = Array(
- 'sunday',
- 'saturday',
- 'weekday'
+ 'sunday',
+ 'saturday',
+ 'weekday'
);
-function service_period()
-{
- if (isset($_SESSION['service_period'])) return $_SESSION['service_period'];
- switch (date('w')) {
- case 0:
- return 'sunday';
- case 6:
- return 'saturday';
- default:
- return 'weekday';
- }
-}
-function midnight_seconds()
-{
- // from http://www.perturb.org/display/Perlfunc__Seconds_Since_Midnight.html
- if (isset($_SESSION['time'])) {
- $time = strtotime($_SESSION['time']);
- return (date("G", $time) * 3600) + (date("i", $time) * 60) + date("s", $time);
- }
- return (date("G") * 3600) + (date("i") * 60) + date("s");
-}
-function midnight_seconds_to_time($seconds)
-{
- if ($seconds > 0) {
- $midnight = mktime(0, 0, 0, date("n") , date("j") , date("Y"));
- return date("h:ia", $midnight + $seconds);
- }
- else {
- return "";
- }
-}
-function viaPoints($tripid, $stopid, $timingPointsOnly = false)
-{
- global $APIurl;
- $url = $APIurl . "/json/tripstoptimes?trip=" . $tripid;
- $json = json_decode(getPage($url));
- debug(print_r($json, true));
- $stops = $json[0];
- $times = $json[1];
- $foundStop = false;
- $viaPoints = Array();
- foreach ($stops as $key => $row) {
- if ($foundStop) {
- if (!$timingPointsOnly || !startsWith($row[5], "Wj")) {
- $viaPoints[] = Array(
- "id" => $row[0],
- "name" => $row[1],
- "time" => $times[$key]
- );
- }
- }
- else {
- if ($row[0] == $stopid) $foundStop = true;
- }
- }
- return $viaPoints;
-}
-function viaPointNames($tripid, $stopid)
-{
- $points = viaPoints($tripid, $stopid, true);
- $pointNames = Array();
- foreach ($points as $point) {
- $pointNames[] = $point['name'];
- }
- return implode(", ", $pointNames);
-}
-?>
+
+function service_period($date = "") {
+
+ if (isset($_REQUEST['service_period'])) {
+ return $_REQUEST['service_period'];
+ }
+
+ $override = getServiceOverride($date);
+ if (isset($override['service_id'])) {
+ return strtolower($override['service_id']);
+ }
+ $date = ($date != "" ? $date : time());
+ $dow = date('w', $date);
+
+ switch ($dow) {
+ case 0:
+ return 'sunday';
+ case 6:
+ return 'saturday';
+ default:
+ return 'weekday';
+ }
+}
+
+function service_ids($service_period, $date = "") {
+ switch ($service_period) {
+ case 'sunday':
+ return Array("Sunday", "Sunday");
+ case 'saturday':
+ return Array("Saturday", "Saturday");
+ default:
+ $date = ($date != "" ? $date : time());
+// school holidays
+ $ymd = date('Ymd', $date);
+ $dow = date('w', $date);
+ if (intval($ymd) < "20120203" && $dow != 0 && $dow != 6) {
+ return Array("Weekday-SchoolVacation", "Weekday-SchoolVacation");
+ } else {
+ return Array("Weekday", "Weekday");
+ }
+ }
+}
+
+function valid_service_ids() {
+ return array_merge(service_ids(""), service_ids('saturday'), service_ids('sunday'));
+}
+
+function midnight_seconds($time = "") {
+ // from http://www.perturb.org/display/Perlfunc__Seconds_Since_Midnight.html
+ if ($time != "") {
+ return (date("G", $time) * 3600) + (date("i", $time) * 60) + date("s", $time);
+ }
+ if (isset($_SESSION['time'])) {
+ $time = strtotime($_SESSION['time']);
+ return (date("G", $time) * 3600) + (date("i", $time) * 60) + date("s", $time);
+ }
+ return (date("G") * 3600) + (date("i") * 60) + date("s");
+}
+
+function midnight_seconds_to_time($seconds) {
+ if ($seconds > 0) {
+ $midnight = mktime(0, 0, 0, date("n"), date("j"), date("Y"));
+ return date("h:ia", $midnight + $seconds);
+ } else {
+ return "";
+ }
+}
+
+if ($GTFSREnabled) {
+ $serviceAlertCause = Array(
+ "UNKNOWN_CAUSE" => "Unknown cause",
+ "OTHER_CAUSE" => "Other cause",
+ "TECHNICAL_PROBLEM" => "Technical problem",
+ "STRIKE" => "Strike",
+ "DEMONSTRATION" => "Demonstration",
+ "ACCIDENT" => "Accident",
+ "HOLIDAY" => "Holiday",
+ "WEATHER" => "Weather",
+ "MAINTENANCE" => "Maintenance",
+ "CONSTRUCTION" => "Construction",
+ "POLICE_ACTIVITY" => "Police activity",
+ "MEDICAL_EMERGENCY" => "Medical emergency"
+ );
+ $serviceAlertEffect = Array(
+ "NO_SERVICE" => "No service",
+ "REDUCED_SERVICE" => "Reduced service",
+ "SIGNIFICANT_DELAYS" => "Significant delays",
+ "DETOUR" => "Detour",
+ "ADDITIONAL_SERVICE" => "Additional service",
+ "MODIFIED_SERVICE" => "Modified service",
+ "OTHER_EFFECT" => "Other effect",
+ "UNKNOWN_EFFECT" => "Unknown effect",
+ "STOP_MOVED" => "Stop moved");
+
+ set_include_path(get_include_path() . PATH_SEPARATOR . ($basePath . "lib/Protobuf-PHP/library/DrSlump/"));
+
+ include_once("Protobuf.php");
+ include_once("Protobuf/Message.php");
+ include_once("Protobuf/Registry.php");
+ include_once("Protobuf/Descriptor.php");
+ include_once("Protobuf/Field.php");
+
+ include_once($basePath . "lib/Protobuf-PHP/gtfs-realtime.php");
+ include_once("Protobuf/CodecInterface.php");
+ include_once("Protobuf/Codec/PhpArray.php");
+ include_once("Protobuf/Codec/Binary.php");
+ include_once("Protobuf/Codec/Binary/Writer.php");
+ include_once("Protobuf/Codec/Json.php");
+
+ function getServiceAlerts($filter_class = "", $filter_id = "") {
+ /*
+
+ also need last modified epoch of client gtfs
+
+ - add,remove,patch,inform (null)
+ - stop
+ - trip
+ - network
+ - classes (WHERE=)
+ - route (short_name or route_id)
+ - street
+ - stop
+ - trip
+ Currently support:
+ network inform
+ trip patch: stop remove
+ street inform: route inform, trip inform, stop inform
+ route patch: trip remove
+ */
+ $current_alerts = getCurrentAlerts();
+ $informed_count = 0;
+ if (sizeof($current_alerts) > 0) {
+
+ $fm = new transit_realtime\FeedMessage();
+ $fh = new transit_realtime\FeedHeader();
+ $fh->setGtfsRealtimeVersion(1);
+ $fh->setTimestamp(time());
+ $fm->setHeader($fh);
+ foreach ($current_alerts as $current_alert) {
+ $affectsFilteredEntities = false;
+ $fe = new transit_realtime\FeedEntity();
+ $fe->setId($current_alert['id']);
+ $fe->setIsDeleted(false);
+ $alert = new transit_realtime\Alert();
+ $tr = new transit_realtime\TimeRange();
+ $tr->setStart($current_alert['start']);
+ $tr->setEnd($current_alert['end']);
+ $alert->addActivePeriod($tr);
+ $informedEntities = getInformedAlerts($current_alert['id'], $filter_class, $filter_id);
+ if (sizeof($informedEntities) > 0) {
+
+ $affectsFilteredEntities = true;
+ foreach ($informedEntities as $informedEntity) {
+ $informed_count++;
+ $informed = Array();
+ $es = new transit_realtime\EntitySelector();
+ if ($informedEntity['informed_class'] == "agency") {
+ $es->setAgencyId($informedEntity['informed_id']);
+ }
+ if ($informedEntity['informed_class'] == "stop") {
+ $es->setStopId($informedEntity['informed_id']);
+ }
+ if ($informedEntity['informed_class'] == "route") {
+ $es->setRouteId($informedEntity['informed_id']);
+ }
+ if ($informedEntity['informed_class'] == "trip") {
+ $td = new transit_realtime\TripDescriptor();
+ $td->setTripId($informedEntity['informed_id']);
+ $es->setTrip($td);
+ }
+ $alert->addInformedEntity($es);
+}
+ }
+ if ($current_alert['cause'] != "") {
+ $alert->setCause(constant("transit_realtime\Alert\Cause::" . $current_alert['cause']));
+ }
+ if ($current_alert['effect'] != "") {
+ $alert->setEffect(constant("transit_realtime\Alert\Effect::" . $current_alert['effect']));
+ }
+ if ($current_alert['url'] != "") {
+ $tsUrl = new transit_realtime\TranslatedString();
+ $tUrl = new transit_realtime\TranslatedString\Translation();
+ $tUrl->setText($current_alert['url']);
+ $tUrl->setLanguage("en");
+ $tsUrl->addTranslation($tUrl);
+ $alert->setUrl($tsUrl);
+ }
+ if ($current_alert['header'] != "") {
+ $tsHeaderText = new transit_realtime\TranslatedString();
+ $tHeaderText = new transit_realtime\TranslatedString\Translation();
+ $tHeaderText->setText($current_alert['header']);
+ $tHeaderText->setLanguage("en");
+ $tsHeaderText->addTranslation($tHeaderText);
+ $alert->setHeaderText($tsHeaderText);
+ }
+ if ($current_alert['description'] != "") {
+ $tsDescriptionText = new transit_realtime\TranslatedString();
+ $tDescriptionText = new transit_realtime\TranslatedString\Translation();
+ $tDescriptionText->setText(trim($current_alert['description']));
+ $tDescriptionText->setLanguage("en");
+ $tsDescriptionText->addTranslation($tDescriptionText);
+ $alert->setDescriptionText($tsDescriptionText);
+ }
+ $fe->setAlert($alert);
+ if ($affectsFilteredEntities) {
+ $fm->addEntity($fe);
+ }
+ }
+ if ($informed_count > 0) {
+ return $fm;
+ } else {
+ return null;
+ }
+ } else
+ return null;
+ }
+
+ function getServiceAlertsAsArray($filter_class = "", $filter_id = "") {
+
+ $alerts = getServiceAlerts($filter_class, $filter_id);
+ if ($alerts != null) {
+ $codec = new DrSlump\Protobuf\Codec\PhpArray();
+
+ return $codec->encode($alerts);
+ } else {
+ return null;
+ }
+ }
+
+ function getServiceAlertsAsBinary($filter_class = "", $filter_id = "") {
+ $codec = new DrSlump\Protobuf\Codec\Binary();
+ return $codec->encode(getServiceAlerts($filter_class, $filter_id));
+ }
+
+ function getServiceAlertsAsJSON($filter_class = "", $filter_id = "") {
+ $codec = new DrSlump\Protobuf\Codec\Json();
+ return $codec->encode(getServiceAlerts($filter_class, $filter_id));
+ }
+
+ function getServiceAlertsByClass() {
+ $return = Array();
+ $alerts = getServiceAlertsAsArray("", "");
+ foreach ($alerts['entities'] as $entity) {
+ foreach ($entity['informed'] as $informed) {
+ foreach ($informed as $key => $value) {
+ if (strpos("_id", $key) > 0) {
+ $parts = explode($key);
+ $class = $parts[0];
+ $id = $value;
+ }
+ }
+ $return[$class][$id][] = $entity;
+ }
+ }
+ }
+
+ function getTripUpdates($filter_class = "", $filter_id = "") {
+ $fm = new transit_realtime\FeedMessage();
+ $fh = new transit_realtime\FeedHeader();
+ $fh->setGtfsRealtimeVersion(1);
+ $fh->setTimestamp(time());
+ $fm->setHeader($fh);
+ foreach (getCurrentAlerts() as $alert) {
+ $informedEntities = getInformedAlerts($alert['id'], $_REQUEST['filter_class'], $_REQUEST['filter_id']);
+ $stops = Array();
+ $routestrips = Array();
+ if (sizeof($informedEntities) > 0) {
+ if ($informedEntity['informed_class'] == "stop" && $informed["x-action"] == "remove") {
+ $stops[] = $informedEntity['informed_id'];
+ }
+ if (($informedEntity['informed_class'] == "route" || $informedEntity['informed_class'] == "trip") && $informed["x-action"] == "patch") {
+ $routestrips[] = Array("id" => $informedEntity['informed_id'],
+ "type" => $informedEntity['informed_class']);
+ }
+ }
+ foreach ($routestrips as $routetrip) {
+ $fe = new transit_realtime\FeedEntity();
+ $fe->setId($alert['id'] . $routetrip['id']);
+ $fe->setIsDeleted(false);
+ $tu = new transit_realtime\TripUpdate();
+ $td = new transit_realtime\TripDescriptor();
+ if ($routetrip['type'] == "route") {
+ $td->setRouteId($routetrip['id']);
+ } else if ($routetrip['type'] == "trip") {
+ $td->setTripId($routetrip['id']);
+ }
+ $tu->setTrip($td);
+ foreach ($stops as $stop) {
+ $stu = new transit_realtime\TripUpdate\StopTimeUpdate();
+ $stu->setStopId($stop);
+ $stu->setScheduleRelationship(transit_realtime\TripUpdate\StopTimeUpdate\ScheduleRelationship::SKIPPED);
+ $tu->addStopTimeUpdate($stu);
+ }
+ $fe->setTripUpdate($tu);
+ $fm->addEntity($fe);
+ }
+ }
+ return $fm;
+ }
+
+ function getTripUpdatesAsArray($filter_class = "", $filter_id = "") {
+ $codec = new DrSlump\Protobuf\Codec\PhpArray();
+ return $codec->encode(getTripUpdates($filter_class, $filter_id));
+ }
+
+ function getTripUpdatesAsBinary($filter_class = "", $filter_id = "") {
+ $codec = new DrSlump\Protobuf\Codec\Binary();
+ return $codec->encode(getTripUpdates($filter_class, $filter_id));
+ }
+
+ function getTripUpdatesAsJSON($filter_class = "", $filter_id = "") {
+ $codec = new DrSlump\Protobuf\Codec\Json();
+ return $codec->encode(getTripUpdates($filter_class, $filter_id));
+ }
+
+}
+
--- a/include/common.inc.php
+++ b/include/common.inc.php
@@ -1,176 +1,210 @@
<?php
+
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
+
date_default_timezone_set('Australia/ACT');
-$APIurl = "http://localhost:8765";
$debugOkay = Array(
- "session",
- "json",
- "phperror",
- "awsgtfs",
- "awsotp",
- "other"
+ "session",
+ "json",
+ "phperror",
+ "awsotp",
+ //"squallotp",
+ //"vanilleotp",
+ "database",
+ "other"
);
-if (isDebug("awsgtfs")) {
- $APIurl = "http://bus-main.lambdacomplex.org:8765";
-}
+$GTFSREnabled = true;
$cloudmadeAPIkey = "daa03470bb8740298d4b10e3f03d63e6";
$googleMapsAPIkey = "ABQIAAAA95XYXN0cki3Yj_Sb71CFvBTPaLd08ONybQDjcH_VdYtHHLgZvRTw2INzI_m17_IoOUqH3RNNmlTk1Q";
$otpAPIurl = 'http://localhost:8080/opentripplanner-api-webapp/';
-if (isDebug("awsotp") || php_uname('n') == "maxious.xen.prgmr.com") {
- $otpAPIurl = 'http://bus-main.lambdacomplex.org:8080/opentripplanner-api-webapp/';
-}
-if (isDebug("phperror")) error_reporting(E_ALL ^ E_NOTICE);
+if (isDebug("awsotp") || php_uname('n') == "maxious.xen.prgmr.com" || strstr(php_uname('n'),"actbus")) {
+ $otpAPIurl = 'http://bus-main.lambdacomplex.org:8080/opentripplanner-api-webapp/';
+}
+if (isDebug("dotcloudotp") || php_uname('n') == "actbus-www") {
+ $otpAPIurl = 'http://otp.actbus.dotcloud.com/opentripplanner-api-webapp/';
+}
+if (isDebug("squallotp")) {
+ $otpAPIurl = 'http://10.0.1.108:5080/opentripplanner-api-webapp/';
+}
+if (isDebug("vanilleotp")) {
+ $otpAPIurl = 'http://10.0.1.135:8080/opentripplanner-api-webapp/';
+}
+if (isDebug("phperror"))
+ error_reporting(E_ALL ^ E_NOTICE);
+$basePath = "";
+if (strstr($_SERVER['PHP_SELF'], "labs/")
+ || strstr($_SERVER['PHP_SELF'], "myway/")
+ || strstr($_SERVER['PHP_SELF'], "lib/")
+ || strstr($_SERVER['PHP_SELF'], "geo/")
+ || strstr($_SERVER['PHP_SELF'], "include/")
+ || strstr($_SERVER['PHP_SELF'], "rtpis/")) {
+ $basePath = "../";
+}
+
+function isDebugServer() {
+
+ return php_sapi_name() == "cli" || strstr(php_uname('n'),"actbus") || isset($_SERVER['SERVER_NAME']) && ( $_SERVER['SERVER_NAME'] == "azusa" || $_SERVER['SERVER_NAME'] == "vanille"
+ || $_SERVER['SERVER_NAME'] == "localhost" || $_SERVER['SERVER_NAME'] == "127.0.0.1" || $_SERVER['SERVER_NAME'] == "192.168.1.8" || $_SERVER['SERVER_NAME'] == "192.168.178.24");
+}
+
+if (isset($_SERVER['SERVER_NAME']) && $_SERVER['SERVER_NAME'] == "maxious.xen.prgmr.com") {
+// Set the exception handler
+require $basePath."/lib/amon-php/amon.php";
+Amon::setup_exception_handler();
+}
+
include_once ("common-geo.inc.php");
include_once ("common-net.inc.php");
+include_once ("common-transit.inc.php");
+if (!strstr($_SERVER['PHP_SELF'], "feedback")) {
+ include_once ("common-db.inc.php");
+}
+
+include_once ("common-request.inc.php");
+include_once ("common-session.inc.php");
+include_once ("common-auth.inc.php");
include_once ("common-template.inc.php");
-include_once ("common-transit.inc.php");
-// you have to open the session to be able to modify or remove it
-session_start();
-if (isset($_REQUEST['service_period'])) {
- $_SESSION['service_period'] = filter_var($_REQUEST['service_period'], FILTER_SANITIZE_STRING);
-}
-if (isset($_REQUEST['time'])) {
- $_SESSION['time'] = filter_var($_REQUEST['time'], FILTER_SANITIZE_STRING);
-}
-if (isset($_REQUEST['geolocate'])) {
- $geocoded = false;
- if (isset($_REQUEST['lat']) && isset($_REQUEST['lon'])) {
- $_SESSION['lat'] = trim(filter_var($_REQUEST['lat'], FILTER_SANITIZE_NUMBER_FLOAT, FILTER_FLAG_ALLOW_FRACTION));
- $_SESSION['lon'] = trim(filter_var($_REQUEST['lon'], FILTER_SANITIZE_NUMBER_FLOAT, FILTER_FLAG_ALLOW_FRACTION));
- }
- else {
- $geolocate = filter_var($_REQUEST['geolocate'], FILTER_SANITIZE_URL);
- echo $_REQUEST['geolocate'];
- if (startsWith($geolocate, "-")) {
- $locateparts = explode(",", $geolocate);
- $_SESSION['lat'] = $locateparts[0];
- $_SESSION['lon'] = $locateparts[1];
- }
- else {
- $contents = geocode($geolocate, true);
- print_r($contents);
- if (isset($contents[0]->centroid)) {
- $geocoded = true;
- $_SESSION['lat'] = $contents[0]->centroid->coordinates[0];
- $_SESSION['lon'] = $contents[0]->centroid->coordinates[1];
- }
- else {
- $_SESSION['lat'] = "";
- $_SESSION['lon'] = "";
- }
- }
- }
- if ($_SESSION['lat'] != "" && isAnalyticsOn()) {
- trackEvent("Geolocation","Updated Location", "Geocoded - ".($geocoded ? "Yes" : "No"));
- }
-}
-debug(print_r($_SESSION, true) , "session");
-function isDebugServer()
-{
- return $_SERVER['SERVER_NAME'] == "10.0.1.154" || $_SERVER['SERVER_NAME'] == "localhost" || $_SERVER['SERVER_NAME'] == "127.0.0.1" || !$_SERVER['SERVER_NAME'];
-}
-function isAnalyticsOn()
-{
- return !isDebugServer();
-}
-function isDebug($debugReason = "other")
-{
- global $debugOkay;
- return in_array($debugReason, $debugOkay, false) && isDebugServer();
-}
-function debug($msg, $debugReason = "other")
-{
- if (isDebug($debugReason)) echo "\n<!-- " . date(DATE_RFC822) . "\n $msg -->\n";
-}
-function isJQueryMobileDevice()
-{
- // http://forum.jquery.com/topic/what-is-the-best-way-to-detect-all-useragents-which-can-handle-jquery-mobile#14737000002087897
- $user_agent = $_SERVER['HTTP_USER_AGENT'];
- return preg_match('/iphone/i', $user_agent) || preg_match('/android/i', $user_agent) || preg_match('/webos/i', $user_agent) || preg_match('/ios/i', $user_agent) || preg_match('/bada/i', $user_agent) || preg_match('/maemo/i', $user_agent) || preg_match('/meego/i', $user_agent) || preg_match('/fennec/i', $user_agent) || (preg_match('/symbian/i', $user_agent) && preg_match('/s60/i', $user_agent) && $browser['majorver'] >= 5) || (preg_match('/symbian/i', $user_agent) && preg_match('/platform/i', $user_agent) && $browser['majorver'] >= 3) || (preg_match('/blackberry/i', $user_agent) && $browser['majorver'] >= 5) || (preg_match('/opera mobile/i', $user_agent) && $browser['majorver'] >= 10) || (preg_match('/opera mini/i', $user_agent) && $browser['majorver'] >= 5);
-}
-function isFastDevice()
-{
- $ua = $_SERVER['HTTP_USER_AGENT'];
- $fastDevices = Array(
- "Mozilla/5.0 (X11;",
- "Mozilla/5.0 (Windows;",
- "Mozilla/5.0 (iP",
- "Mozilla/5.0 (Linux; U; Android",
- "Mozilla/4.0 (compatible; MSIE"
- );
- $slowDevices = Array(
- "J2ME",
- "MIDP",
- "Opera/",
- "Mozilla/2.0 (compatible;",
- "Mozilla/3.0 (compatible;"
- );
- return true;
-}
-function array_flatten($a, $f = array())
-{
- if (!$a || !is_array($a)) return '';
- foreach ($a as $k => $v) {
- if (is_array($v)) $f = array_flatten($v, $f);
- else $f[$k] = $v;
- }
- return $f;
-}
-function remove_spaces($string)
-{
- return str_replace(' ', '', $string);
-}
-function object2array($object)
-{
- if (is_object($object)) {
- foreach ($object as $key => $value) {
- $array[$key] = $value;
- }
- }
- else {
- $array = $object;
- }
- return $array;
-}
-function startsWith($haystack, $needle, $case = true)
-{
- if ($case) {
- return (strcmp(substr($haystack, 0, strlen($needle)) , $needle) === 0);
- }
- return (strcasecmp(substr($haystack, 0, strlen($needle)) , $needle) === 0);
-}
-
-function endsWith($haystack, $needle, $case = true)
-{
- if ($case) {
- return (strcmp(substr($haystack, strlen($haystack) - strlen($needle)) , $needle) === 0);
- }
- return (strcasecmp(substr($haystack, strlen($haystack) - strlen($needle)) , $needle) === 0);
-}
-function bracketsMeanNewLine($input)
-{
- return str_replace(")", "</small>", str_replace("(", "<br><small>", $input));
-}
-function sksort(&$array, $subkey = "id", $sort_ascending = false)
-{
- if (count($array)) $temp_array[key($array) ] = array_shift($array);
- foreach ($array as $key => $val) {
- $offset = 0;
- $found = false;
- foreach ($temp_array as $tmp_key => $tmp_val) {
- if (!$found and strtolower($val[$subkey]) > strtolower($tmp_val[$subkey])) {
- $temp_array = array_merge((array)array_slice($temp_array, 0, $offset) , array(
- $key => $val
- ) , array_slice($temp_array, $offset));
- $found = true;
- }
- $offset++;
- }
- if (!$found) $temp_array = array_merge($temp_array, array(
- $key => $val
- ));
- }
- if ($sort_ascending) $array = array_reverse($temp_array);
- else $array = $temp_array;
-}
-?>
-
+
+function isAnalyticsOn() {
+ $user_agent = $_SERVER['HTTP_USER_AGENT'];
+ return !isDebugServer() && !preg_match('/cloudkick/i', $user_agent) && !preg_match('/googlebot/i', $user_agent) &&
+ !preg_match('/baidu/i', $user_agent);
+}
+
+function isDebug($debugReason = "other") {
+ global $debugOkay;
+ return in_array($debugReason, $debugOkay, false) && isDebugServer();
+}
+
+function debug($msg, $debugReason = "other") {
+ if (isDebug($debugReason))
+ echo "\n<!-- " . date(DATE_RFC822) . "\n $msg -->\n";
+}
+function isIOSDevice() {
+ return strstr($_SERVER['HTTP_USER_AGENT'], 'iPhone') || strstr($_SERVER['HTTP_USER_AGENT'], 'iPod') || strstr($_SERVER['HTTP_USER_AGENT'], 'iPad');
+}
+function isJQueryMobileDevice() {
+ // http://forum.jquery.com/topic/what-is-the-best-way-to-detect-all-useragents-which-can-handle-jquery-mobile#14737000002087897
+ $user_agent = $_SERVER['HTTP_USER_AGENT'];
+ return preg_match('/iphone/i', $user_agent) || preg_match('/android/i', $user_agent) || preg_match('/webos/i', $user_agent) || preg_match('/ios/i', $user_agent) || preg_match('/bada/i', $user_agent) || preg_match('/maemo/i', $user_agent) || preg_match('/meego/i', $user_agent) || preg_match('/fennec/i', $user_agent) || (preg_match('/symbian/i', $user_agent) && preg_match('/s60/i', $user_agent) && $browser['majorver'] >= 5) || (preg_match('/symbian/i', $user_agent) && preg_match('/platform/i', $user_agent) && $browser['majorver'] >= 3) || (preg_match('/blackberry/i', $user_agent) && $browser['majorver'] >= 5) || (preg_match('/opera mobile/i', $user_agent) && $browser['majorver'] >= 10) || (preg_match('/opera mini/i', $user_agent) && $browser['majorver'] >= 5);
+}
+
+
+function array_flatten($a, $f = array()) {
+ if (!$a || !is_array($a))
+ return '';
+ foreach ($a as $k => $v) {
+ if (is_array($v))
+ $f = array_flatten($v, $f);
+ else
+ $f[$k] = $v;
+ }
+ return $f;
+}
+
+function remove_spaces($string) {
+ return str_replace(' ', '', $string);
+}
+
+function object2array($object) {
+ if (is_object($object)) {
+ foreach ($object as $key => $value) {
+ $array[$key] = $value;
+ }
+ } else {
+ $array = $object;
+ }
+ return $array;
+}
+
+function startsWith($haystack, $needle, $case = true) {
+ if ($case) {
+ return (strcmp(substr($haystack, 0, strlen($needle)), $needle) === 0);
+ }
+ return (strcasecmp(substr($haystack, 0, strlen($needle)), $needle) === 0);
+}
+
+function endsWith($haystack, $needle, $case = true) {
+ if ($case) {
+ return (strcmp(substr($haystack, strlen($haystack) - strlen($needle)), $needle) === 0);
+ }
+ return (strcasecmp(substr($haystack, strlen($haystack) - strlen($needle)), $needle) === 0);
+}
+
+function sksort(&$array, $subkey = "id", $sort_ascending = false) {
+ if (count($array))
+ $temp_array[key($array)] = array_shift($array);
+ foreach ($array as $key => $val) {
+ $offset = 0;
+ $found = false;
+ foreach ($temp_array as $tmp_key => $tmp_val) {
+ if (!$found and strtolower($val[$subkey]) > strtolower($tmp_val[$subkey])) {
+ $temp_array = array_merge((array) array_slice($temp_array, 0, $offset), array(
+ $key => $val
+ ), array_slice($temp_array, $offset));
+ $found = true;
+ }
+ $offset++;
+ }
+ if (!$found)
+ $temp_array = array_merge($temp_array, array(
+ $key => $val
+ ));
+ }
+ if ($sort_ascending)
+ $array = array_reverse($temp_array);
+ else
+ $array = $temp_array;
+}
+
+function sktimesort(&$array, $subkey = "id", $sort_ascending = false) {
+ if (count($array))
+ $temp_array[key($array)] = array_shift($array);
+ foreach ($array as $key => $val) {
+ $offset = 0;
+ $found = false;
+ foreach ($temp_array as $tmp_key => $tmp_val) {
+ if (!$found and strtotime($val[$subkey]) > strtotime($tmp_val[$subkey])) {
+ $temp_array = array_merge((array) array_slice($temp_array, 0, $offset), array(
+ $key => $val
+ ), array_slice($temp_array, $offset));
+ $found = true;
+ }
+ $offset++;
+ }
+ if (!$found)
+ $temp_array = array_merge($temp_array, array(
+ $key => $val
+ ));
+ }
+ if ($sort_ascending && isset($temp_array))
+ $array = array_reverse($temp_array);
+ else
+ $array = $temp_array;
+}
+
+function r_implode($glue, $pieces) {
+ foreach ($pieces as $r_pieces) {
+ if (is_array($r_pieces)) {
+ $retVal[] = r_implode($glue, $r_pieces);
+ } else {
+ $retVal[] = $r_pieces;
+ }
+ }
+ return implode($glue, $retVal);
+}
+
--- /dev/null
+++ b/include/db/route-dao.inc.php
@@ -1,1 +1,307 @@
-
+<?php
+
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
+
+function getRoute($routeID) {
+ global $conn;
+ $query = "Select * from routes where route_id = :routeID LIMIT 1";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":routeID", $routeID);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetch(PDO :: FETCH_ASSOC);
+}
+
+function getRoutesByShortName($routeShortName) {
+ global $conn;
+ $query = "Select distinct route_id, route_short_name from routes where route_short_name = :routeShortName";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":routeShortName", $routeShortName);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+
+function getRouteHeadsigns($routeID) {
+ global $conn;
+ $query = "select stops.stop_name, trip_headsign, direction_id,max(service_id) as service_id, count(*)
+ from routes join trips on trips.route_id = routes.route_id
+join stop_times on stop_times.trip_id = trips.trip_id join stops on
+stop_times.stop_id = stops.stop_id where trips.route_id = :routeID
+and stop_times.stop_sequence = 1 group by stops.stop_name, trip_headsign, direction_id having count(*) > 2";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":routeID", $routeID);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ $results = $query->fetchAll();
+ if (is_array($results)) {
+ return $results;
+ } else {
+ return Array($results);
+ }
+}
+function getRouteDescription($routeID, $directionID) {
+ $trip = getRouteNextTrip($routeID, $directionID);
+ $start = getTripStartingPoint($trip['trip_id']);
+ $end = getTripDestination($trip['trip_id']);
+ return "From ".$start['stop_name']." to ".$end['stop_name'];
+}
+function getRouteByFullName($routeFullName) {
+ global $conn;
+ $query = "Select * from routes where route_short_name||route_long_name = :routeFullName LIMIT 1";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":routeFullName", $routeFullName);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetch(PDO :: FETCH_ASSOC);
+}
+
+function getRoutes() {
+ global $conn;
+ $query = "Select * from routes order by route_short_name;";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+
+function getRoutesByNumberSeries($routeNumberSeries = "") {
+ global $conn;
+ if (strlen($routeNumberSeries) == 1) {
+ return getRoute($routeNumberSeries);
+ }
+ $seriesMin = substr($routeNumberSeries, 0, -1) . "0";
+ $seriesMax = substr($routeNumberSeries, 0, -1) . "9";
+ $query = "Select distinct routes.route_id,routes.route_short_name,routes.route_long_name,service_id from routes join trips on trips.route_id =
+routes.route_id join stop_times on stop_times.trip_id = trips.trip_id where to_number(route_short_name, 'FM999') between :seriesMin and :seriesMax OR route_short_name LIKE :routeNumberSeries order by route_short_name;";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":seriesMin", $seriesMin);
+ $query->bindParam(":seriesMax", $seriesMax);
+ $routeNumberSeries = "% " . substr($routeNumberSeries, 0, -1) . "%";
+ $query->bindParam(":routeNumberSeries", $routeNumberSeries);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+
+function getRouteNextTrip($routeID, $directionID) {
+ global $conn;
+
+ $query = "select routes.route_id,routes.route_url,direction_id,trips.trip_id,trip_headsign,departure_time,service_id from routes join trips on trips.route_id = routes.route_id
+join stop_times on stop_times.trip_id = trips.trip_id where arrival_time between :currentTime and :futureTime
+and routes.route_id = :routeID and trips.direction_id = :directionID order by
+arrival_time limit 1";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":currentTime", current_time());
+ $futureTime = current_time(strtotime(current_time() ." +2h"));
+ if (date("h",strtotime(current_time()) > 22)) $futureTime = "23:59:59";
+ $query->bindParam(":futureTime", $futureTime);
+ $query->bindParam(":routeID", $routeID);
+ $query->bindParam(":directionID", $directionID);
+ $query->execute();
+ databaseError($conn->errorInfo());
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ $r = $query->fetch(PDO :: FETCH_ASSOC);
+ return $r;
+}
+
+function getRouteFirstTrip($routeID,$directionID) {
+ global $conn;
+
+ $query = "select * from routes join trips on trips.route_id = routes.route_id
+join stop_times on stop_times.trip_id = trips.trip_id where routes.route_id = :routeID
+and trips.direction_id = :directionID order by
+arrival_time DESC limit 1";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":routeID", $routeID);
+
+ $query->bindParam(":directionID", $directionID);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+
+ $r = $query->fetch(PDO :: FETCH_ASSOC);
+ return $r;
+}
+
+function getRouteAtStop($routeID, $directionID, $stop_id) {
+ $nextTrip = getRouteNextTrip($routeID, $directionID);
+ if ($nextTrip['trip_id']) {
+ foreach (getTripStopTimes($nextTrip['trip_id']) as $tripStop) {
+ if ($tripStop['stop_id'] == $stop_id)
+ return $tripStop;
+ }
+ }
+ return Array();
+}
+
+function getRouteTrips($routeID, $directionID = "", $service_period = "") {
+ global $conn;
+ if ($service_period == "")
+ $service_period = service_period();
+ $service_ids = service_ids($service_period);
+ $sidA = $service_ids[0];
+ $sidB = $service_ids[1];
+ $directionSQL = "";
+ if ($directionID != "")
+ $directionSQL = " and direction_id = :directionID ";
+ $query = "select routes.route_id,trips.trip_id,service_id,arrival_time, stop_id, stop_sequence from routes join trips on trips.route_id = routes.route_id
+join stop_times on stop_times.trip_id = trips.trip_id where (service_id=:service_periodA OR service_id=:service_periodB)
+AND (routes.route_id = :routeID) " . $directionSQL . " and stop_sequence = '1' order by
+arrival_time ";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":routeID", $routeID);
+ $query->bindParam(":service_periodA", $sidA);
+ $query->bindParam(":service_periodB", $sidB);
+ if ($directionSQL != "")
+ $query->bindParam(":directionID", $directionID);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+
+function getRoutesByDestination($destination = "", $service_period = "") {
+ global $conn;
+ if ($service_period == "")
+ $service_period = service_period();
+ $service_ids = service_ids($service_period);
+ $sidA = $service_ids[0];
+ $sidB = $service_ids[1];
+ if ($destination != "") {
+ /* $query = "SELECT DISTINCT trips.route_id,route_short_name,route_long_name, service_id
+FROM stop_times join trips on trips.trip_id =
+stop_times.trip_id join routes on trips.route_id = routes.route_id
+WHERE route_long_name = :destination AND (service_id=:service_periodA OR service_id=:service_periodB)
+ order by route_short_name";*/
+ $query = "select route_id, direction_id, stop_name, b.trip_id, b.stop_sequence from (select route_id, direction_id, max(stop_sequence) as stop_sequence, max(a.trip_id) as trip_id from stop_times inner join (SELECT route_id, direction_id, max(trip_id) as trip_id
+ from trips group by route_id,direction_id) as a on stop_times.trip_id = a.trip_id group by route_id, direction_id) as b inner join stop_times on b.trip_id = stop_times.trip_id inner join stops on stop_times.stop_id = stops.stop_id where stop_times.stop_sequence = b.stop_sequence and stop_name = :destination order by route_id;";
+ } else {
+ $query = "select stop_name from (select route_id, direction_id, max(stop_sequence) as stop_sequence, max(a.trip_id) as trip_id from stop_times inner join (SELECT route_id, direction_id, max(trip_id) as trip_id
+ from trips group by route_id,direction_id) as a on stop_times.trip_id = a.trip_id group by route_id, direction_id) as b inner join stop_times on b.trip_id = stop_times.trip_id inner join stops on stop_times.stop_id = stops.stop_id where stop_times.stop_sequence = b.stop_sequence group by stop_name order by stop_name;";
+ }
+ debug($query, "database");
+ $query = $conn->prepare($query);
+
+ //$query->bindParam(":service_periodA", $sidA);
+ //$query->bindParam(":service_periodB", $sidB);
+ if ($destination != "")
+ $query->bindParam(":destination", $destination);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+
+function getRoutesBySuburb($suburb, $service_period = "") {
+ if ($service_period == "")
+ $service_period = service_period();
+ $service_ids = service_ids($service_period);
+ $sidA = $service_ids[0];
+ $sidB = $service_ids[1];
+
+ global $conn;
+ $query = "SELECT DISTINCT service_id,trips.route_id,route_short_name,route_long_name
+FROM stop_times join trips on trips.trip_id = stop_times.trip_id
+join routes on trips.route_id = routes.route_id
+join stops on stops.stop_id = stop_times.stop_id
+WHERE stop_desc LIKE :suburb AND (service_id=:service_periodA OR service_id=:service_periodB)
+ ORDER BY route_short_name";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":service_periodA", $sidA);
+ $query->bindParam(":service_periodB", $sidB);
+ $suburb = "%Suburb: %" . $suburb . "%";
+ $query->bindParam(":suburb", $suburb);
+ $query->execute();
+
+ databaseError($conn->errorInfo());
+
+ return $query->fetchAll();
+}
+
+function getRoutesNearby($lat, $lng, $limit = "", $distance = 500) {
+ // if ($service_period == "")
+ $service_period = service_period();
+ $service_ids = service_ids($service_period);
+ $sidA = $service_ids[0];
+ $sidB = $service_ids[1];
+ $limitSQL = "";
+ if ($limit != "")
+ $limitSQL = " LIMIT :limit ";
+ global $conn;
+ $query = "SELECT service_id,trips.route_id,trips.direction_id,route_short_name,route_long_name,min(stops.stop_id) as stop_id,
+ min(ST_Distance(position, ST_GeographyFromText('SRID=4326;POINT($lng $lat)'), FALSE)) as distance
+FROM stop_times
+join trips on trips.trip_id = stop_times.trip_id
+join routes on trips.route_id = routes.route_id
+join stops on stops.stop_id = stop_times.stop_id
+WHERE (service_id=:service_periodA OR service_id=:service_periodB)
+AND ST_DWithin(position, ST_GeographyFromText('SRID=4326;POINT($lng $lat)'), :distance, FALSE)
+ group by service_id,trips.route_id,trips.direction_id,route_short_name,route_long_name
+ order by distance $limitSQL";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":service_periodA", $sidA);
+ $query->bindParam(":service_periodB", $sidB);
+ $query->bindParam(":distance", $distance);
+ if ($limit != "")
+ $query->bindParam(":limit", $limit);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+
--- /dev/null
+++ b/include/db/servicealert-dao.inc.php
@@ -1,1 +1,185 @@
+<?php
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
+
+function getServiceOverride($date = "") {
+ global $conn;
+ $query = "Select * from calendar_dates where date = :date and exception_type = '1' LIMIT 1";
+ // debug($query,"database");
+ $query = $conn->prepare($query); // Create a prepared statement
+ $date = date("Ymd", ($date != "" ? $date : time()));
+ $query->bindParam(":date", $date);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetch(PDO :: FETCH_ASSOC);
+}
+
+function getServiceAlert($alertID) {
+ global $conn;
+ $query = "SELECT id,extract('epoch' from start) as start, extract('epoch' from \"end\") as \"end\",cause,effect,header,description,url from servicealerts_alerts where id = :servicealert_id";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":servicealert_id", $alertID);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetch(PDO :: FETCH_ASSOC);
+}
+
+function updateServiceAlert($alertID, $alert) {
+ global $conn;
+ $query = 'update servicealerts_alerts set start=:start, "end"=:end, header=:header, description=:description, url=:url, cause=:cause, effect=:effect where id = :servicealert_id';
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindValue(":servicealert_id", $alertID);
+ $query->bindValue(":start", $alert['startdate']);
+ $query->bindValue(":end", $alert['enddate']);
+ $query->bindValue(":header", $alert['header']);
+ $query->bindValue(":description", $alert['description']);
+ $query->bindValue(":url", $alert['url']);
+ $query->bindValue(":cause", $alert['cause']);
+ $query->bindValue(":effect", $alert['effect']);
+ $query->execute();
+
+ print_r($conn->errorInfo());
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetch(PDO :: FETCH_ASSOC);
+}
+
+function addServiceAlert($alert) {
+ global $conn;
+ $query = 'INSERT INTO servicealerts_alerts (start, "end", header, description, url,cause,effect) VALUES (:start, :end, :header, :description, :url,:cause,:effect) ';
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ //print_r($alert);
+ $query->bindValue(":start", $alert['startdate']);
+ $query->bindValue(":end", $alert['enddate']);
+ $query->bindValue(":header", $alert['header']);
+ $query->bindValue(":description", $alert['description']);
+ $query->bindValue(":url", $alert['url']);
+ $query->bindValue(":cause", $alert['cause']);
+ $query->bindValue(":effect", $alert['effect']);
+ $query->execute();
+
+ print_r($conn->errorInfo());
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetch(PDO :: FETCH_ASSOC);
+}
+
+function getCurrentAlerts() {
+ global $conn;
+ $query = "SELECT id,extract('epoch' from start) as start, extract('epoch' from \"end\") as \"end\",cause,effect,header,description,url from servicealerts_alerts where NOW() > start and NOW() < \"end\"";
+ // debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+
+function getFutureAlerts() {
+ global $conn;
+ $query = "SELECT id,extract('epoch' from start) as start, extract('epoch' from \"end\") as \"end\",cause,effect,header,description,url from servicealerts_alerts where NOW() > start or NOW() < \"end\"";
+ // debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+
+function getInformedAlerts($id, $filter_class, $filter_id) {
+
+ global $conn;
+ //echo "$id, $filter_class, $filter_id\n";
+ $query = "SELECT * from servicealerts_informed where servicealert_id = :servicealert_id";
+
+ if ($filter_class != "") {
+ $query .= " AND informed_class = :informed_class ";
+ }
+ if ($filter_id != "") {
+ $query .= " AND informed_id = :informed_id ";
+ }
+ // debug($query, "database");
+ $query = $conn->prepare($query);
+ if ($filter_class != "") {
+ $query->bindParam(":informed_class", $filter_class);
+ }
+ if ($filter_id != "") {
+ $query->bindParam(":informed_id", $filter_id);
+ }
+ $query->bindParam(":servicealert_id", $id);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+
+function deleteInformedAlert($serviceAlertID, $class, $id) {
+ global $conn;
+ $query = 'DELETE from servicealerts_informed where servicealert_id = :servicealert_id and informed_class = :informed_class AND informed_id = :informed_id';
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":servicealert_id", $serviceAlertID);
+ $query->bindParam(":informed_class", $class);
+ $query->bindParam(":informed_id", $id);
+ $query->execute();
+ print_r($conn->errorInfo());
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return null;
+}
+
+function addInformedAlert($serviceAlertID, $class, $id, $action) {
+ global $conn;
+ $query = 'INSERT INTO servicealerts_informed (servicealert_id , informed_class , informed_id, informed_action)
+ VALUES(:servicealert_id ,:informed_class, :informed_id, :informed_action)';
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":servicealert_id", $serviceAlertID);
+ $query->bindParam(":informed_class", $class);
+ $query->bindParam(":informed_id", $id);
+ $query->bindParam(":informed_action", $action);
+ $query->execute();
+
+ print_r($conn->errorInfo());
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return null;
+}
+
--- /dev/null
+++ b/include/db/stop-dao.inc.php
@@ -1,1 +1,249 @@
-
+<?php
+
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
+
+function getStop($stopID) {
+ global $conn;
+ $query = "Select * from stops where stop_id = :stopID LIMIT 1";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":stopID", $stopID);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetch(PDO :: FETCH_ASSOC);
+}
+
+function getStops($firstLetter = "", $startsWith = "") {
+ global $conn;
+ $conditions = Array();
+ if ($firstLetter != "")
+ $conditions[] = "substr(stop_name,1,1) = :firstLetter";
+ if ($startsWith != "")
+ $conditions[] = "stop_name like :startsWith";
+ $query = "Select * from stops";
+ if (sizeof($conditions) > 0) {
+ if (sizeof($conditions) > 1) {
+ $query .= " Where " . implode(" AND ", $conditions) . " ";
+ } else {
+ $query .= " Where " . $conditions[0] . " ";
+ }
+ }
+ $query .= " order by stop_name;";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ if ($firstLetter != "")
+ $query->bindParam(":firstLetter", $firstLetter);
+
+ if ($startsWith != "") {
+ $startsWith = $startsWith . "%";
+ $query->bindParam(":startsWith", $startsWith);
+ }
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+
+function getNearbyStops($lat, $lng, $limit = "", $distance = 1000) {
+ if ($lat == null || $lng == null)
+ return Array();
+ if ($limit != "")
+ $limitSQL = " LIMIT :limit ";
+ global $conn;
+ $query = "Select *, ST_Distance(position, ST_GeographyFromText('SRID=4326;POINT($lng $lat)'), FALSE) as distance
+ from stops WHERE ST_DWithin(position, ST_GeographyFromText('SRID=4326;POINT($lng $lat)'), :distance, FALSE)
+ order by distance $limitSQL;";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":distance", $distance);
+ $query->bindParam(":limit", $limit);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+
+function getStopsByName($name) {
+ global $conn;
+ $query = "Select * from stops where stop_name LIKE :name;";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $name = $name . "%";
+ $query->bindParam(":name", $name);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+
+function getStopsBySuburb($suburb) {
+ global $conn;
+ $query = "Select * from stops where stop_desc LIKE :suburb order by stop_name;";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $suburb = "%<br>Suburb: %" . $suburb . "%";
+ $query->bindParam(":suburb", $suburb);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+
+function getStopsByStopCode($stop_code, $startsWith = "") {
+ global $conn;
+ $query = "Select * from stops where (stop_code = :stop_code OR stop_code LIKE :stop_code2)";
+ if ($startsWith != "")
+ $query .= " AND stop_name like :startsWith";
+
+ debug($query, "database");
+ $query = $conn->prepare($query);
+
+ $query->bindParam(":stop_code", $stop_code);
+ $stop_code2 = $stop_code . "%";
+ $query->bindParam(":stop_code2", $stop_code2);
+ if ($startsWith != "") {
+ $startsWith = $startsWith . "%";
+ $query->bindParam(":startsWith", $startsWith);
+ }
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+
+function getStopRoutes($stopID, $service_period) {
+ if ($service_period == "") {
+ $service_period = service_period();
+ }
+ $service_ids = service_ids($service_period);
+ $sidA = $service_ids[0];
+ $sidB = $service_ids[1];
+ global $conn;
+ $query = "SELECT distinct service_id,trips.route_id,route_short_name,route_long_name
+FROM stop_times join trips on trips.trip_id =
+stop_times.trip_id join routes on trips.route_id = routes.route_id WHERE stop_id = :stopID
+AND (service_id=:service_periodA OR service_id=:service_periodB)";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":service_periodA", $sidA);
+ $query->bindParam(":service_periodB", $sidB);
+ $query->bindParam(":stopID", $stopID);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+
+function getStopTrips($stopID, $service_period = "", $afterTime = "", $limit = "", $route_short_name = "") {
+ if ($service_period == "") {
+ $service_period = service_period();
+ }
+ $service_ids = service_ids($service_period);
+ $sidA = $service_ids[0];
+ $sidB = $service_ids[1];
+ $limitSQL = "";
+ if ($limit != "")
+ $limitSQL .= " LIMIT :limit ";
+
+ global $conn;
+ if ($afterTime != "") {
+ $query = " SELECT stop_times.trip_id,stop_times.arrival_time,stop_times.stop_id,stop_sequence,service_id,trips.route_id,trips.direction_id,trips.trip_headsign,route_short_name,route_long_name,end_times.arrival_time as end_time
+FROM stop_times
+join trips on trips.trip_id =
+stop_times.trip_id
+join routes on trips.route_id = routes.route_id , (SELECT trip_id,max(arrival_time) as arrival_time from stop_times
+ WHERE stop_times.arrival_time IS NOT NULL group by trip_id) as end_times
+WHERE stop_times.stop_id = :stopID
+AND stop_times.trip_id = end_times.trip_id
+AND (service_id=:service_periodA OR service_id=:service_periodB) " . ($route_short_name != "" ? " AND route_short_name = :route_short_name " : "") . "
+AND end_times.arrival_time > :afterTime
+ORDER BY end_time $limitSQL";
+ } else {
+ $query = "SELECT stop_times.trip_id,arrival_time,stop_times.stop_id,stop_sequence,service_id,trips.route_id,route_short_name,route_long_name
+FROM stop_times
+join trips on trips.trip_id =
+stop_times.trip_id
+join routes on trips.route_id = routes.route_id
+WHERE stop_times.stop_id = :stopID
+AND (service_id=:service_periodA OR service_id=:service_periodB) " . ($route_short_name != "" ? " AND route_short_name = :route_short_name " : "") . "
+ORDER BY arrival_time $limitSQL";
+ }
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":service_periodA", $sidA);
+ $query->bindParam(":service_periodB", $sidB);
+ $query->bindParam(":stopID", $stopID);
+ if ($limit != "")
+ $query->bindParam(":limit", $limit);
+ if ($afterTime != "")
+ $query->bindParam(":afterTime", $afterTime);
+ if ($route_short_name != "")
+ $query->bindParam(":route_short_name", $route_short_name);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+
+function getStopTripsWithTimes($stopID, $time = "", $service_period = "", $time_range = "", $limit = "") {
+ if ($service_period == "")
+ $service_period = service_period();
+ if ($time_range == "")
+ $time_range = (24 * 60 * 60);
+ if ($time == "")
+ $time = current_time();
+ if ($limit == "")
+ $limit = 10;
+ $trips = getStopTrips($stopID, $service_period, $time);
+ $timedTrips = Array();
+ if ($trips && sizeof($trips) > 0) {
+ foreach ($trips as $trip) {
+ if ($trip['arrival_time'] != "") {
+ if (strtotime($trip['arrival_time']) > strtotime($time) and strtotime($trip['arrival_time']) < (strtotime($time) + $time_range)) {
+ $timedTrips[] = $trip;
+ }
+ } else {
+ $timedTrip = getTripAtStop($trip['trip_id'], $trip['stop_sequence']);
+ if ($timedTrip['arrival_time'] > $time and strtotime($timedTrip['arrival_time']) < (strtotime($time) + $time_range)) {
+ $timedTrips[] = $timedTrip;
+ }
+ }
+ if (sizeof($timedTrips) > $limit)
+ break;
+ }
+ sktimesort($timedTrips, "arrival_time", true);
+ }
+ return $timedTrips;
+}
+
--- /dev/null
+++ b/include/db/trip-dao.inc.php
@@ -1,1 +1,224 @@
-
+<?php
+
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
+
+function getTrip($tripID) {
+ global $conn;
+ $query = "Select * from trips
+ join routes on trips.route_id = routes.route_id
+ where trip_id = :tripID
+ LIMIT 1";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":tripID", $tripID);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+
+ return Array();
+ }
+ return $query->fetch(PDO :: FETCH_ASSOC);
+}
+function getTripStops($tripID) {
+ global $conn;
+ $query = "SELECT stops.stop_id, stop_name, ST_AsKML(position) as positionkml,
+ stop_sequence, trips.trip_id
+FROM stop_times
+join trips on trips.trip_id = stop_times.trip_id
+join stops on stops.stop_id = stop_times.stop_id
+WHERE trips.trip_id = :tripID ORDER BY stop_sequence";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":tripID", $tripID);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+
+function getTripHasStop($tripID, $stopID) {
+ global $conn;
+ $query = "SELECT stop_id
+FROM stop_times
+join trips on trips.trip_id = stop_times.trip_id
+WHERE trips.trip_id = :tripID and stop_times.stop_id = :stopID";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":tripID", $tripID);
+ $query->bindParam(":stopID", $stopID);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return ($query->fetchColumn() > 0);
+}
+
+function getTripShape($tripID) {
+ // todo, use shapes table if shape_id specified
+ global $conn;
+ $query = "SELECT ST_AsKML(ST_MakeLine(geometry(a.shape_pt))) as the_route
+FROM (SELECT shapes.shape_id,shape_pt from shapes
+inner join trips on shapes.shape_id = trips.shape_id
+WHERE trips.trip_id = :tripID ORDER BY shape_pt_sequence) as a group by a.shape_id";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":tripID", $tripID);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchColumn(0);
+}
+
+function getTripStopTimes($tripID) {
+ global $conn;
+ $query = "SELECT stop_times.trip_id,trip_headsign,arrival_time,stop_times.stop_id
+ ,stop_lat,stop_lon,stop_name,stop_desc,stop_code,
+ stop_sequence,service_id,trips.route_id,route_short_name,route_long_name
+FROM stop_times
+join trips on trips.trip_id = stop_times.trip_id
+join routes on trips.route_id = routes.route_id
+join stops on stops.stop_id = stop_times.stop_id
+WHERE trips.trip_id = :tripID ORDER BY stop_sequence";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":tripID", $tripID);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ $stopTimes = $query->fetchAll();
+ return $stopTimes;
+}
+
+function getTripAtStop($tripID, $stop_sequence) {
+ global $conn;
+ foreach (getTripStopTimes($tripID) as $tripStop) {
+ if ($tripStop['stop_sequence'] == $stop_sequence)
+ return $tripStop;
+ }
+ return Array();
+}
+
+function getTripStartTime($tripID) {
+ global $conn;
+ $query = "Select * from stop_times
+ where trip_id = :tripID
+ AND arrival_time IS NOT NULL
+ AND stop_sequence = '1'";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":tripID", $tripID);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ $r = $query->fetch(PDO :: FETCH_ASSOC);
+ return $r['arrival_time'];
+}
+
+function getTripEndTime($tripID) {
+ global $conn;
+ $query = "SELECT trip_id,max(arrival_time) as arrival_time from stop_times
+ WHERE stop_times.arrival_time IS NOT NULL and trip_id = :tripID group by trip_id";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":tripID", $tripID);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ $r = $query->fetch(PDO :: FETCH_ASSOC);
+ return $r['arrival_time'];
+}
+function getTripStartingPoint($tripID) {
+ global $conn;
+ $query = "SELECT stops.stop_id, stops.stop_name, stops.stop_desc
+ from stop_times inner join stops on stop_times.stop_id = stops.stop_id
+ WHERE trip_id = :tripID and stop_sequence = '1' limit 1";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":tripID", $tripID);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ $r = $query->fetch(PDO :: FETCH_ASSOC);
+ return $r;
+}
+
+function getTripDestination($tripID) {
+ global $conn;
+ $query = "SELECT stops.stop_id, stops.stop_name, stops.stop_desc
+ from stop_times inner join stops on stop_times.stop_id = stops.stop_id
+ WHERE trip_id = :tripID order by stop_sequence desc limit 1";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":tripID", $tripID);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ $r = $query->fetch(PDO :: FETCH_ASSOC);
+ return $r;
+}
+
+function getActiveTrips($time) {
+ global $conn;
+ if ($time == "")
+ $time = current_time();
+ $query = "Select distinct stop_times.trip_id, start_times.arrival_time as start_time, end_times.arrival_time as end_time from stop_times, (SELECT trip_id,arrival_time from stop_times WHERE stop_times.arrival_time IS NOT NULL
+AND stop_sequence = '1') as start_times, (SELECT trip_id,max(arrival_time) as arrival_time from stop_times WHERE stop_times.arrival_time IS NOT NULL group by trip_id) as end_times
+WHERE start_times.trip_id = end_times.trip_id AND stop_times.trip_id = end_times.trip_id AND :time > start_times.arrival_time AND :time < end_times.arrival_time";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":time", $time);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+
+function viaPoints($tripID, $stop_sequence = "") {
+ global $conn;
+ $query = "SELECT stops.stop_id, stop_name, arrival_time
+FROM stop_times join stops on stops.stop_id = stop_times.stop_id
+WHERE stop_times.trip_id = :tripID
+" . ($stop_sequence != "" ? " AND stop_sequence > :stop_sequence " : "") . " ORDER BY stop_sequence";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ if ($stop_sequence != "")
+ $query->bindParam(":stop_sequence", $stop_sequence);
+ $query->bindParam(":tripID", $tripID);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
--- a/index.php
+++ b/index.php
@@ -1,31 +1,45 @@
<?php
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
include ('include/common.inc.php');
include_header("bus.lambdacomplex.org", "index", false)
?>
<div data-role="page">
- <div data-role="content">
- <div id="jqm-homeheader">
- <h1>busness time</h1><br><small>Canberra Bus Timetables and Trip Planner</small>
- </div>
- <a name="maincontent" id="maincontent"></a>
- <a href="tripPlanner.php" data-role="button" data-icon="navigation">Launch Trip Planner...</a>
- <ul data-role="listview" data-inset="true" data-theme="c" data-dividertheme="b">
- <li data-role="list-divider">Timetables - Stops</li>
- <li><a href="stopList.php">Major (Timing Point) Stops</a></li>
- <li><a href="stopList.php?allstops=yes">All Stops</a></li>
- <li><a href="stopList.php?suburbs=yes">Stops By Suburb</a></li>
- <li><a class="nearby" href="stopList.php?nearby=yes">Nearby Stops</a></li>
- </ul>
- <ul data-role="listview" data-inset="true" data-theme="c" data-dividertheme="b">
- <li data-role="list-divider">Timetables - Routes</li>
- <li><a href="routeList.php">Routes By Final Destination</a></li>
- <li><a href="routeList.php?bynumber=yes">Routes By Number</a></li>
- <li><a href="routeList.php?bysuburb=yes">Routes By Suburb</a></li>
- <li><a class="nearby" href="routeList.php?nearby=yes">Nearby Routes</a></li>
- </ul>
-<?php
-echo timePlaceSettings();
-include_footer(true)
-?>
-
+ <div data-role="content">
+ <div id="jqm-homeheader">
+ <h1>busness time</h1><br><small>Canberra Bus Timetables and Trip Planner</small>
+ </div>
+ <a name="maincontent" id="maincontent"></a>
+ <a href="tripPlanner.php" data-role="button" data-icon="navigation">Launch Trip Planner...</a>
+ <ul data-role="listview" data-inset="true" data-theme="c" data-dividertheme="b">
+ <li data-role="list-divider">Timetables - Stops</li>
+ <li><a href="stopList.php">Stops By Name</a></li>
+ <li><a href="stopList.php?bysuburbs=yes">Stops By Suburb</a></li>
+ <li><a class="nearby" href="stopList.php?nearby=yes">Nearby Stops</a></li>
+ </ul>
+ <ul data-role="listview" data-inset="true" data-theme="c" data-dividertheme="b">
+ <li data-role="list-divider">Timetables - Routes</li>
+ <li><a href="routeList.php">Routes By Final Destination</a></li>
+ <li><a href="routeList.php?bynumber=yes">Routes By Number</a></li>
+ <li><a href="routeList.php?bysuburbs=yes">Routes By Suburb</a></li>
+ <li><a class="nearby" href="routeList.php?nearby=yes">Nearby Routes</a></li>
+ </ul>
+ <!--<a href="labs/index.php" data-role="button" data-icon="beaker">Busness R&D</a>-->
+ <a href="myway/index.php" data-role="button">MyWay Balance and Timeliness Survey Results</a>
+ <?php
+ include_footer(true)
+ ?>
--- /dev/null
+++ b/js/FlashCanvas
--- /dev/null
+++ b/js/flotr2
--- a/js/jQuery.ui.datepicker.js
+++ /dev/null
@@ -1,156 +1,1 @@
-/*!
- * jQuery UI 1.8.5
- *
- * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI
- */
-(function(c,j){function k(a){return!c(a).parents().andSelf().filter(function(){return c.curCSS(this,"visibility")==="hidden"||c.expr.filters.hidden(this)}).length}c.ui=c.ui||{};if(!c.ui.version){c.extend(c.ui,{version:"1.8.5",keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,
-NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});c.fn.extend({_focus:c.fn.focus,focus:function(a,b){return typeof a==="number"?this.each(function(){var d=this;setTimeout(function(){c(d).focus();b&&b.call(d)},a)}):this._focus.apply(this,arguments)},scrollParent:function(){var a;a=c.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(c.curCSS(this,
-"position",1))&&/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!a.length?c(document):a},zIndex:function(a){if(a!==j)return this.css("zIndex",a);if(this.length){a=c(this[0]);for(var b;a.length&&a[0]!==document;){b=a.css("position");
-if(b==="absolute"||b==="relative"||b==="fixed"){b=parseInt(a.css("zIndex"));if(!isNaN(b)&&b!=0)return b}a=a.parent()}}return 0},disableSelection:function(){return this.bind("mousedown.ui-disableSelection selectstart.ui-disableSelection",function(a){a.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});c.each(["Width","Height"],function(a,b){function d(f,g,l,m){c.each(e,function(){g-=parseFloat(c.curCSS(f,"padding"+this,true))||0;if(l)g-=parseFloat(c.curCSS(f,
-"border"+this+"Width",true))||0;if(m)g-=parseFloat(c.curCSS(f,"margin"+this,true))||0});return g}var e=b==="Width"?["Left","Right"]:["Top","Bottom"],h=b.toLowerCase(),i={innerWidth:c.fn.innerWidth,innerHeight:c.fn.innerHeight,outerWidth:c.fn.outerWidth,outerHeight:c.fn.outerHeight};c.fn["inner"+b]=function(f){if(f===j)return i["inner"+b].call(this);return this.each(function(){c.style(this,h,d(this,f)+"px")})};c.fn["outer"+b]=function(f,g){if(typeof f!=="number")return i["outer"+b].call(this,f);return this.each(function(){c.style(this,
-h,d(this,f,true,g)+"px")})}});c.extend(c.expr[":"],{data:function(a,b,d){return!!c.data(a,d[3])},focusable:function(a){var b=a.nodeName.toLowerCase(),d=c.attr(a,"tabindex");if("area"===b){b=a.parentNode;d=b.name;if(!a.href||!d||b.nodeName.toLowerCase()!=="map")return false;a=c("img[usemap=#"+d+"]")[0];return!!a&&k(a)}return(/input|select|textarea|button|object/.test(b)?!a.disabled:"a"==b?a.href||!isNaN(d):!isNaN(d))&&k(a)},tabbable:function(a){var b=c.attr(a,"tabindex");return(isNaN(b)||b>=0)&&c(a).is(":focusable")}});
-c(function(){var a=document.createElement("div"),b=document.body;c.extend(a.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});c.support.minHeight=b.appendChild(a).offsetHeight===100;b.removeChild(a).style.display="none"});c.extend(c.ui,{plugin:{add:function(a,b,d){a=c.ui[a].prototype;for(var e in d){a.plugins[e]=a.plugins[e]||[];a.plugins[e].push([b,d[e]])}},call:function(a,b,d){if((b=a.plugins[b])&&a.element[0].parentNode)for(var e=0;e<b.length;e++)a.options[b[e][0]]&&b[e][1].apply(a.element,
-d)}},contains:function(a,b){return document.compareDocumentPosition?a.compareDocumentPosition(b)&16:a!==b&&a.contains(b)},hasScroll:function(a,b){if(c(a).css("overflow")==="hidden")return false;b=b&&b==="left"?"scrollLeft":"scrollTop";var d=false;if(a[b]>0)return true;a[b]=1;d=a[b]>0;a[b]=0;return d},isOverAxis:function(a,b,d){return a>b&&a<b+d},isOver:function(a,b,d,e,h,i){return c.ui.isOverAxis(a,d,h)&&c.ui.isOverAxis(b,e,i)}})}})(jQuery);
-;/*
- * jQuery UI Datepicker 1.8.5
- *
- * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Datepicker
- *
- * Depends:
- * jquery.ui.core.js
- */
-(function(d,G){function L(){this.debug=false;this._curInst=null;this._keyEvent=false;this._disabledInputs=[];this._inDialog=this._datepickerShowing=false;this._mainDivId="ui-datepicker-div";this._inlineClass="ui-datepicker-inline";this._appendClass="ui-datepicker-append";this._triggerClass="ui-datepicker-trigger";this._dialogClass="ui-datepicker-dialog";this._disableClass="ui-datepicker-disabled";this._unselectableClass="ui-datepicker-unselectable";this._currentClass="ui-datepicker-current-day";this._dayOverClass=
-"ui-datepicker-days-cell-over";this.regional=[];this.regional[""]={closeText:"Done",prevText:"Prev",nextText:"Next",currentText:"Today",monthNames:["January","February","March","April","May","June","July","August","September","October","November","December"],monthNamesShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],dayNames:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],dayNamesShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],dayNamesMin:["Su",
-"Mo","Tu","We","Th","Fr","Sa"],weekHeader:"Wk",dateFormat:"mm/dd/yy",firstDay:0,isRTL:false,showMonthAfterYear:false,yearSuffix:""};this._defaults={showOn:"focus",showAnim:"fadeIn",showOptions:{},defaultDate:null,appendText:"",buttonText:"...",buttonImage:"",buttonImageOnly:false,hideIfNoPrevNext:false,navigationAsDateFormat:false,gotoCurrent:false,changeMonth:false,changeYear:false,yearRange:"c-10:c+10",showOtherMonths:false,selectOtherMonths:false,showWeek:false,calculateWeek:this.iso8601Week,shortYearCutoff:"+10",
-minDate:null,maxDate:null,duration:"fast",beforeShowDay:null,beforeShow:null,onSelect:null,onChangeMonthYear:null,onClose:null,numberOfMonths:1,showCurrentAtPos:0,stepMonths:1,stepBigMonths:12,altField:"",altFormat:"",constrainInput:true,showButtonPanel:false,autoSize:false};d.extend(this._defaults,this.regional[""]);this.dpDiv=d('<div id="'+this._mainDivId+'" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all ui-helper-hidden-accessible"></div>')}function E(a,b){d.extend(a,
-b);for(var c in b)if(b[c]==null||b[c]==G)a[c]=b[c];return a}d.extend(d.ui,{datepicker:{version:"1.8.5"}});var y=(new Date).getTime();d.extend(L.prototype,{markerClassName:"hasDatepicker",log:function(){this.debug&&console.log.apply("",arguments)},_widgetDatepicker:function(){return this.dpDiv},setDefaults:function(a){E(this._defaults,a||{});return this},_attachDatepicker:function(a,b){var c=null;for(var e in this._defaults){var f=a.getAttribute("date:"+e);if(f){c=c||{};try{c[e]=eval(f)}catch(h){c[e]=
-f}}}e=a.nodeName.toLowerCase();f=e=="div"||e=="span";if(!a.id){this.uuid+=1;a.id="dp"+this.uuid}var i=this._newInst(d(a),f);i.settings=d.extend({},b||{},c||{});if(e=="input")this._connectDatepicker(a,i);else f&&this._inlineDatepicker(a,i)},_newInst:function(a,b){return{id:a[0].id.replace(/([^A-Za-z0-9_])/g,"\\\\$1"),input:a,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:b,dpDiv:!b?this.dpDiv:d('<div class="'+this._inlineClass+' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>')}},
-_connectDatepicker:function(a,b){var c=d(a);b.append=d([]);b.trigger=d([]);if(!c.hasClass(this.markerClassName)){this._attachments(c,b);c.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker",function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});this._autoSize(b);d.data(a,"datepicker",b)}},_attachments:function(a,b){var c=this._get(b,"appendText"),e=this._get(b,"isRTL");b.append&&
-b.append.remove();if(c){b.append=d('<span class="'+this._appendClass+'">'+c+"</span>");a[e?"before":"after"](b.append)}a.unbind("focus",this._showDatepicker);b.trigger&&b.trigger.remove();c=this._get(b,"showOn");if(c=="focus"||c=="both")a.focus(this._showDatepicker);if(c=="button"||c=="both"){c=this._get(b,"buttonText");var f=this._get(b,"buttonImage");b.trigger=d(this._get(b,"buttonImageOnly")?d("<img/>").addClass(this._triggerClass).attr({src:f,alt:c,title:c}):d('<button type="button"></button>').addClass(this._triggerClass).html(f==
-""?c:d("<img/>").attr({src:f,alt:c,title:c})));a[e?"before":"after"](b.trigger);b.trigger.click(function(){d.datepicker._datepickerShowing&&d.datepicker._lastInput==a[0]?d.datepicker._hideDatepicker():d.datepicker._showDatepicker(a[0]);return false})}},_autoSize:function(a){if(this._get(a,"autoSize")&&!a.inline){var b=new Date(2009,11,20),c=this._get(a,"dateFormat");if(c.match(/[DM]/)){var e=function(f){for(var h=0,i=0,g=0;g<f.length;g++)if(f[g].length>h){h=f[g].length;i=g}return i};b.setMonth(e(this._get(a,
-c.match(/MM/)?"monthNames":"monthNamesShort")));b.setDate(e(this._get(a,c.match(/DD/)?"dayNames":"dayNamesShort"))+20-b.getDay())}a.input.attr("size",this._formatDate(a,b).length)}},_inlineDatepicker:function(a,b){var c=d(a);if(!c.hasClass(this.markerClassName)){c.addClass(this.markerClassName).append(b.dpDiv).bind("setData.datepicker",function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});d.data(a,"datepicker",b);this._setDate(b,this._getDefaultDate(b),
-true);this._updateDatepicker(b);this._updateAlternate(b)}},_dialogDatepicker:function(a,b,c,e,f){a=this._dialogInst;if(!a){this.uuid+=1;this._dialogInput=d('<input type="text" id="'+("dp"+this.uuid)+'" style="position: absolute; top: -100px; width: 0px; z-index: -10;"/>');this._dialogInput.keydown(this._doKeyDown);d("body").append(this._dialogInput);a=this._dialogInst=this._newInst(this._dialogInput,false);a.settings={};d.data(this._dialogInput[0],"datepicker",a)}E(a.settings,e||{});b=b&&b.constructor==
-Date?this._formatDate(a,b):b;this._dialogInput.val(b);this._pos=f?f.length?f:[f.pageX,f.pageY]:null;if(!this._pos)this._pos=[document.documentElement.clientWidth/2-100+(document.documentElement.scrollLeft||document.body.scrollLeft),document.documentElement.clientHeight/2-150+(document.documentElement.scrollTop||document.body.scrollTop)];this._dialogInput.css("left",this._pos[0]+20+"px").css("top",this._pos[1]+"px");a.settings.onSelect=c;this._inDialog=true;this.dpDiv.addClass(this._dialogClass);this._showDatepicker(this._dialogInput[0]);
-d.blockUI&&d.blockUI(this.dpDiv);d.data(this._dialogInput[0],"datepicker",a);return this},_destroyDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();d.removeData(a,"datepicker");if(e=="input"){c.append.remove();c.trigger.remove();b.removeClass(this.markerClassName).unbind("focus",this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup",this._doKeyUp)}else if(e=="div"||e=="span")b.removeClass(this.markerClassName).empty()}},
-_enableDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=false;c.trigger.filter("button").each(function(){this.disabled=false}).end().filter("img").css({opacity:"1.0",cursor:""})}else if(e=="div"||e=="span")b.children("."+this._inlineClass).children().removeClass("ui-state-disabled");this._disabledInputs=d.map(this._disabledInputs,function(f){return f==a?null:f})}},_disableDatepicker:function(a){var b=
-d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=true;c.trigger.filter("button").each(function(){this.disabled=true}).end().filter("img").css({opacity:"0.5",cursor:"default"})}else if(e=="div"||e=="span")b.children("."+this._inlineClass).children().addClass("ui-state-disabled");this._disabledInputs=d.map(this._disabledInputs,function(f){return f==a?null:f});this._disabledInputs[this._disabledInputs.length]=a}},_isDisabledDatepicker:function(a){if(!a)return false;
-for(var b=0;b<this._disabledInputs.length;b++)if(this._disabledInputs[b]==a)return true;return false},_getInst:function(a){try{return d.data(a,"datepicker")}catch(b){throw"Missing instance data for this datepicker";}},_optionDatepicker:function(a,b,c){var e=this._getInst(a);if(arguments.length==2&&typeof b=="string")return b=="defaults"?d.extend({},d.datepicker._defaults):e?b=="all"?d.extend({},e.settings):this._get(e,b):null;var f=b||{};if(typeof b=="string"){f={};f[b]=c}if(e){this._curInst==e&&
-this._hideDatepicker();var h=this._getDateDatepicker(a,true);E(e.settings,f);this._attachments(d(a),e);this._autoSize(e);this._setDateDatepicker(a,h);this._updateDatepicker(e)}},_changeDatepicker:function(a,b,c){this._optionDatepicker(a,b,c)},_refreshDatepicker:function(a){(a=this._getInst(a))&&this._updateDatepicker(a)},_setDateDatepicker:function(a,b){if(a=this._getInst(a)){this._setDate(a,b);this._updateDatepicker(a);this._updateAlternate(a)}},_getDateDatepicker:function(a,b){(a=this._getInst(a))&&
-!a.inline&&this._setDateFromField(a,b);return a?this._getDate(a):null},_doKeyDown:function(a){var b=d.datepicker._getInst(a.target),c=true,e=b.dpDiv.is(".ui-datepicker-rtl");b._keyEvent=true;if(d.datepicker._datepickerShowing)switch(a.keyCode){case 9:d.datepicker._hideDatepicker();c=false;break;case 13:c=d("td."+d.datepicker._dayOverClass,b.dpDiv).add(d("td."+d.datepicker._currentClass,b.dpDiv));c[0]?d.datepicker._selectDay(a.target,b.selectedMonth,b.selectedYear,c[0]):d.datepicker._hideDatepicker();
-return false;case 27:d.datepicker._hideDatepicker();break;case 33:d.datepicker._adjustDate(a.target,a.ctrlKey?-d.datepicker._get(b,"stepBigMonths"):-d.datepicker._get(b,"stepMonths"),"M");break;case 34:d.datepicker._adjustDate(a.target,a.ctrlKey?+d.datepicker._get(b,"stepBigMonths"):+d.datepicker._get(b,"stepMonths"),"M");break;case 35:if(a.ctrlKey||a.metaKey)d.datepicker._clearDate(a.target);c=a.ctrlKey||a.metaKey;break;case 36:if(a.ctrlKey||a.metaKey)d.datepicker._gotoToday(a.target);c=a.ctrlKey||
-a.metaKey;break;case 37:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,e?+1:-1,"D");c=a.ctrlKey||a.metaKey;if(a.originalEvent.altKey)d.datepicker._adjustDate(a.target,a.ctrlKey?-d.datepicker._get(b,"stepBigMonths"):-d.datepicker._get(b,"stepMonths"),"M");break;case 38:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,-7,"D");c=a.ctrlKey||a.metaKey;break;case 39:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,e?-1:+1,"D");c=a.ctrlKey||a.metaKey;if(a.originalEvent.altKey)d.datepicker._adjustDate(a.target,
-a.ctrlKey?+d.datepicker._get(b,"stepBigMonths"):+d.datepicker._get(b,"stepMonths"),"M");break;case 40:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,+7,"D");c=a.ctrlKey||a.metaKey;break;default:c=false}else if(a.keyCode==36&&a.ctrlKey)d.datepicker._showDatepicker(this);else c=false;if(c){a.preventDefault();a.stopPropagation()}},_doKeyPress:function(a){var b=d.datepicker._getInst(a.target);if(d.datepicker._get(b,"constrainInput")){b=d.datepicker._possibleChars(d.datepicker._get(b,"dateFormat"));
-var c=String.fromCharCode(a.charCode==G?a.keyCode:a.charCode);return a.ctrlKey||c<" "||!b||b.indexOf(c)>-1}},_doKeyUp:function(a){a=d.datepicker._getInst(a.target);if(a.input.val()!=a.lastVal)try{if(d.datepicker.parseDate(d.datepicker._get(a,"dateFormat"),a.input?a.input.val():null,d.datepicker._getFormatConfig(a))){d.datepicker._setDateFromField(a);d.datepicker._updateAlternate(a);d.datepicker._updateDatepicker(a)}}catch(b){d.datepicker.log(b)}return true},_showDatepicker:function(a){a=a.target||
-a;if(a.nodeName.toLowerCase()!="input")a=d("input",a.parentNode)[0];if(!(d.datepicker._isDisabledDatepicker(a)||d.datepicker._lastInput==a)){var b=d.datepicker._getInst(a);d.datepicker._curInst&&d.datepicker._curInst!=b&&d.datepicker._curInst.dpDiv.stop(true,true);var c=d.datepicker._get(b,"beforeShow");E(b.settings,c?c.apply(a,[a,b]):{});b.lastVal=null;d.datepicker._lastInput=a;d.datepicker._setDateFromField(b);if(d.datepicker._inDialog)a.value="";if(!d.datepicker._pos){d.datepicker._pos=d.datepicker._findPos(a);
-d.datepicker._pos[1]+=a.offsetHeight}var e=false;d(a).parents().each(function(){e|=d(this).css("position")=="fixed";return!e});if(e&&d.browser.opera){d.datepicker._pos[0]-=document.documentElement.scrollLeft;d.datepicker._pos[1]-=document.documentElement.scrollTop}c={left:d.datepicker._pos[0],top:d.datepicker._pos[1]};d.datepicker._pos=null;b.dpDiv.css({position:"absolute",display:"block",top:"-1000px"});d.datepicker._updateDatepicker(b);c=d.datepicker._checkOffset(b,c,e);b.dpDiv.css({position:d.datepicker._inDialog&&
-d.blockUI?"static":e?"fixed":"absolute",display:"none",left:c.left+"px",top:c.top+"px"});if(!b.inline){c=d.datepicker._get(b,"showAnim");var f=d.datepicker._get(b,"duration"),h=function(){d.datepicker._datepickerShowing=true;var i=d.datepicker._getBorders(b.dpDiv);b.dpDiv.find("iframe.ui-datepicker-cover").css({left:-i[0],top:-i[1],width:b.dpDiv.outerWidth(),height:b.dpDiv.outerHeight()})};b.dpDiv.zIndex(d(a).zIndex()+1);d.effects&&d.effects[c]?b.dpDiv.show(c,d.datepicker._get(b,"showOptions"),f,
-h):b.dpDiv[c||"show"](c?f:null,h);if(!c||!f)h();b.input.is(":visible")&&!b.input.is(":disabled")&&b.input.focus();d.datepicker._curInst=b}}},_updateDatepicker:function(a){var b=this,c=d.datepicker._getBorders(a.dpDiv);a.dpDiv.empty().append(this._generateHTML(a)).find("iframe.ui-datepicker-cover").css({left:-c[0],top:-c[1],width:a.dpDiv.outerWidth(),height:a.dpDiv.outerHeight()}).end().find("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a").bind("mouseout",function(){d(this).removeClass("ui-state-hover");
-this.className.indexOf("ui-datepicker-prev")!=-1&&d(this).removeClass("ui-datepicker-prev-hover");this.className.indexOf("ui-datepicker-next")!=-1&&d(this).removeClass("ui-datepicker-next-hover")}).bind("mouseover",function(){if(!b._isDisabledDatepicker(a.inline?a.dpDiv.parent()[0]:a.input[0])){d(this).parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover");d(this).addClass("ui-state-hover");this.className.indexOf("ui-datepicker-prev")!=-1&&d(this).addClass("ui-datepicker-prev-hover");
-this.className.indexOf("ui-datepicker-next")!=-1&&d(this).addClass("ui-datepicker-next-hover")}}).end().find("."+this._dayOverClass+" a").trigger("mouseover").end();c=this._getNumberOfMonths(a);var e=c[1];e>1?a.dpDiv.addClass("ui-datepicker-multi-"+e).css("width",17*e+"em"):a.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("");a.dpDiv[(c[0]!=1||c[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi");a.dpDiv[(this._get(a,"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl");
-a==d.datepicker._curInst&&d.datepicker._datepickerShowing&&a.input&&a.input.is(":visible")&&!a.input.is(":disabled")&&a.input.focus()},_getBorders:function(a){var b=function(c){return{thin:1,medium:2,thick:3}[c]||c};return[parseFloat(b(a.css("border-left-width"))),parseFloat(b(a.css("border-top-width")))]},_checkOffset:function(a,b,c){var e=a.dpDiv.outerWidth(),f=a.dpDiv.outerHeight(),h=a.input?a.input.outerWidth():0,i=a.input?a.input.outerHeight():0,g=document.documentElement.clientWidth+d(document).scrollLeft(),
-k=document.documentElement.clientHeight+d(document).scrollTop();b.left-=this._get(a,"isRTL")?e-h:0;b.left-=c&&b.left==a.input.offset().left?d(document).scrollLeft():0;b.top-=c&&b.top==a.input.offset().top+i?d(document).scrollTop():0;b.left-=Math.min(b.left,b.left+e>g&&g>e?Math.abs(b.left+e-g):0);b.top-=Math.min(b.top,b.top+f>k&&k>f?Math.abs(f+i):0);return b},_findPos:function(a){for(var b=this._get(this._getInst(a),"isRTL");a&&(a.type=="hidden"||a.nodeType!=1);)a=a[b?"previousSibling":"nextSibling"];
-a=d(a).offset();return[a.left,a.top]},_hideDatepicker:function(a){var b=this._curInst;if(!(!b||a&&b!=d.data(a,"datepicker")))if(this._datepickerShowing){a=this._get(b,"showAnim");var c=this._get(b,"duration"),e=function(){d.datepicker._tidyDialog(b);this._curInst=null};d.effects&&d.effects[a]?b.dpDiv.hide(a,d.datepicker._get(b,"showOptions"),c,e):b.dpDiv[a=="slideDown"?"slideUp":a=="fadeIn"?"fadeOut":"hide"](a?c:null,e);a||e();if(a=this._get(b,"onClose"))a.apply(b.input?b.input[0]:null,[b.input?b.input.val():
-"",b]);this._datepickerShowing=false;this._lastInput=null;if(this._inDialog){this._dialogInput.css({position:"absolute",left:"0",top:"-100px"});if(d.blockUI){d.unblockUI();d("body").append(this.dpDiv)}}this._inDialog=false}},_tidyDialog:function(a){a.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")},_checkExternalClick:function(a){if(d.datepicker._curInst){a=d(a.target);a[0].id!=d.datepicker._mainDivId&&a.parents("#"+d.datepicker._mainDivId).length==0&&!a.hasClass(d.datepicker.markerClassName)&&
-!a.hasClass(d.datepicker._triggerClass)&&d.datepicker._datepickerShowing&&!(d.datepicker._inDialog&&d.blockUI)&&d.datepicker._hideDatepicker()}},_adjustDate:function(a,b,c){a=d(a);var e=this._getInst(a[0]);if(!this._isDisabledDatepicker(a[0])){this._adjustInstDate(e,b+(c=="M"?this._get(e,"showCurrentAtPos"):0),c);this._updateDatepicker(e)}},_gotoToday:function(a){a=d(a);var b=this._getInst(a[0]);if(this._get(b,"gotoCurrent")&&b.currentDay){b.selectedDay=b.currentDay;b.drawMonth=b.selectedMonth=b.currentMonth;
-b.drawYear=b.selectedYear=b.currentYear}else{var c=new Date;b.selectedDay=c.getDate();b.drawMonth=b.selectedMonth=c.getMonth();b.drawYear=b.selectedYear=c.getFullYear()}this._notifyChange(b);this._adjustDate(a)},_selectMonthYear:function(a,b,c){a=d(a);var e=this._getInst(a[0]);e._selectingMonthYear=false;e["selected"+(c=="M"?"Month":"Year")]=e["draw"+(c=="M"?"Month":"Year")]=parseInt(b.options[b.selectedIndex].value,10);this._notifyChange(e);this._adjustDate(a)},_clickMonthYear:function(a){var b=
-this._getInst(d(a)[0]);b.input&&b._selectingMonthYear&&setTimeout(function(){b.input.focus()},0);b._selectingMonthYear=!b._selectingMonthYear},_selectDay:function(a,b,c,e){var f=d(a);if(!(d(e).hasClass(this._unselectableClass)||this._isDisabledDatepicker(f[0]))){f=this._getInst(f[0]);f.selectedDay=f.currentDay=d("a",e).html();f.selectedMonth=f.currentMonth=b;f.selectedYear=f.currentYear=c;this._selectDate(a,this._formatDate(f,f.currentDay,f.currentMonth,f.currentYear))}},_clearDate:function(a){a=
-d(a);this._getInst(a[0]);this._selectDate(a,"")},_selectDate:function(a,b){a=this._getInst(d(a)[0]);b=b!=null?b:this._formatDate(a);a.input&&a.input.val(b);this._updateAlternate(a);var c=this._get(a,"onSelect");if(c)c.apply(a.input?a.input[0]:null,[b,a]);else a.input&&a.input.trigger("change");if(a.inline)this._updateDatepicker(a);else{this._hideDatepicker();this._lastInput=a.input[0];typeof a.input[0]!="object"&&a.input.focus();this._lastInput=null}},_updateAlternate:function(a){var b=this._get(a,
-"altField");if(b){var c=this._get(a,"altFormat")||this._get(a,"dateFormat"),e=this._getDate(a),f=this.formatDate(c,e,this._getFormatConfig(a));d(b).each(function(){d(this).val(f)})}},noWeekends:function(a){a=a.getDay();return[a>0&&a<6,""]},iso8601Week:function(a){a=new Date(a.getTime());a.setDate(a.getDate()+4-(a.getDay()||7));var b=a.getTime();a.setMonth(0);a.setDate(1);return Math.floor(Math.round((b-a)/864E5)/7)+1},parseDate:function(a,b,c){if(a==null||b==null)throw"Invalid arguments";b=typeof b==
-"object"?b.toString():b+"";if(b=="")return null;for(var e=(c?c.shortYearCutoff:null)||this._defaults.shortYearCutoff,f=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,h=(c?c.dayNames:null)||this._defaults.dayNames,i=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort,g=(c?c.monthNames:null)||this._defaults.monthNames,k=c=-1,l=-1,u=-1,j=false,o=function(p){(p=z+1<a.length&&a.charAt(z+1)==p)&&z++;return p},m=function(p){o(p);p=new RegExp("^\\d{1,"+(p=="@"?14:p=="!"?20:p=="y"?4:p=="o"?
-3:2)+"}");p=b.substring(s).match(p);if(!p)throw"Missing number at position "+s;s+=p[0].length;return parseInt(p[0],10)},n=function(p,w,H){p=o(p)?H:w;for(w=0;w<p.length;w++)if(b.substr(s,p[w].length).toLowerCase()==p[w].toLowerCase()){s+=p[w].length;return w+1}throw"Unknown name at position "+s;},r=function(){if(b.charAt(s)!=a.charAt(z))throw"Unexpected literal at position "+s;s++},s=0,z=0;z<a.length;z++)if(j)if(a.charAt(z)=="'"&&!o("'"))j=false;else r();else switch(a.charAt(z)){case "d":l=m("d");
-break;case "D":n("D",f,h);break;case "o":u=m("o");break;case "m":k=m("m");break;case "M":k=n("M",i,g);break;case "y":c=m("y");break;case "@":var v=new Date(m("@"));c=v.getFullYear();k=v.getMonth()+1;l=v.getDate();break;case "!":v=new Date((m("!")-this._ticksTo1970)/1E4);c=v.getFullYear();k=v.getMonth()+1;l=v.getDate();break;case "'":if(o("'"))r();else j=true;break;default:r()}if(c==-1)c=(new Date).getFullYear();else if(c<100)c+=(new Date).getFullYear()-(new Date).getFullYear()%100+(c<=e?0:-100);if(u>
--1){k=1;l=u;do{e=this._getDaysInMonth(c,k-1);if(l<=e)break;k++;l-=e}while(1)}v=this._daylightSavingAdjust(new Date(c,k-1,l));if(v.getFullYear()!=c||v.getMonth()+1!=k||v.getDate()!=l)throw"Invalid date";return v},ATOM:"yy-mm-dd",COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))*24*
-60*60*1E7,formatDate:function(a,b,c){if(!b)return"";var e=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,f=(c?c.dayNames:null)||this._defaults.dayNames,h=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort;c=(c?c.monthNames:null)||this._defaults.monthNames;var i=function(o){(o=j+1<a.length&&a.charAt(j+1)==o)&&j++;return o},g=function(o,m,n){m=""+m;if(i(o))for(;m.length<n;)m="0"+m;return m},k=function(o,m,n,r){return i(o)?r[m]:n[m]},l="",u=false;if(b)for(var j=0;j<a.length;j++)if(u)if(a.charAt(j)==
-"'"&&!i("'"))u=false;else l+=a.charAt(j);else switch(a.charAt(j)){case "d":l+=g("d",b.getDate(),2);break;case "D":l+=k("D",b.getDay(),e,f);break;case "o":l+=g("o",(b.getTime()-(new Date(b.getFullYear(),0,0)).getTime())/864E5,3);break;case "m":l+=g("m",b.getMonth()+1,2);break;case "M":l+=k("M",b.getMonth(),h,c);break;case "y":l+=i("y")?b.getFullYear():(b.getYear()%100<10?"0":"")+b.getYear()%100;break;case "@":l+=b.getTime();break;case "!":l+=b.getTime()*1E4+this._ticksTo1970;break;case "'":if(i("'"))l+=
-"'";else u=true;break;default:l+=a.charAt(j)}return l},_possibleChars:function(a){for(var b="",c=false,e=function(h){(h=f+1<a.length&&a.charAt(f+1)==h)&&f++;return h},f=0;f<a.length;f++)if(c)if(a.charAt(f)=="'"&&!e("'"))c=false;else b+=a.charAt(f);else switch(a.charAt(f)){case "d":case "m":case "y":case "@":b+="0123456789";break;case "D":case "M":return null;case "'":if(e("'"))b+="'";else c=true;break;default:b+=a.charAt(f)}return b},_get:function(a,b){return a.settings[b]!==G?a.settings[b]:this._defaults[b]},
-_setDateFromField:function(a,b){if(a.input.val()!=a.lastVal){var c=this._get(a,"dateFormat"),e=a.lastVal=a.input?a.input.val():null,f,h;f=h=this._getDefaultDate(a);var i=this._getFormatConfig(a);try{f=this.parseDate(c,e,i)||h}catch(g){this.log(g);e=b?"":e}a.selectedDay=f.getDate();a.drawMonth=a.selectedMonth=f.getMonth();a.drawYear=a.selectedYear=f.getFullYear();a.currentDay=e?f.getDate():0;a.currentMonth=e?f.getMonth():0;a.currentYear=e?f.getFullYear():0;this._adjustInstDate(a)}},_getDefaultDate:function(a){return this._restrictMinMax(a,
-this._determineDate(a,this._get(a,"defaultDate"),new Date))},_determineDate:function(a,b,c){var e=function(h){var i=new Date;i.setDate(i.getDate()+h);return i},f=function(h){try{return d.datepicker.parseDate(d.datepicker._get(a,"dateFormat"),h,d.datepicker._getFormatConfig(a))}catch(i){}var g=(h.toLowerCase().match(/^c/)?d.datepicker._getDate(a):null)||new Date,k=g.getFullYear(),l=g.getMonth();g=g.getDate();for(var u=/([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g,j=u.exec(h);j;){switch(j[2]||"d"){case "d":case "D":g+=
-parseInt(j[1],10);break;case "w":case "W":g+=parseInt(j[1],10)*7;break;case "m":case "M":l+=parseInt(j[1],10);g=Math.min(g,d.datepicker._getDaysInMonth(k,l));break;case "y":case "Y":k+=parseInt(j[1],10);g=Math.min(g,d.datepicker._getDaysInMonth(k,l));break}j=u.exec(h)}return new Date(k,l,g)};if(b=(b=b==null?c:typeof b=="string"?f(b):typeof b=="number"?isNaN(b)?c:e(b):b)&&b.toString()=="Invalid Date"?c:b){b.setHours(0);b.setMinutes(0);b.setSeconds(0);b.setMilliseconds(0)}return this._daylightSavingAdjust(b)},
-_daylightSavingAdjust:function(a){if(!a)return null;a.setHours(a.getHours()>12?a.getHours()+2:0);return a},_setDate:function(a,b,c){var e=!b,f=a.selectedMonth,h=a.selectedYear;b=this._restrictMinMax(a,this._determineDate(a,b,new Date));a.selectedDay=a.currentDay=b.getDate();a.drawMonth=a.selectedMonth=a.currentMonth=b.getMonth();a.drawYear=a.selectedYear=a.currentYear=b.getFullYear();if((f!=a.selectedMonth||h!=a.selectedYear)&&!c)this._notifyChange(a);this._adjustInstDate(a);if(a.input)a.input.val(e?
-"":this._formatDate(a))},_getDate:function(a){return!a.currentYear||a.input&&a.input.val()==""?null:this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay))},_generateHTML:function(a){var b=new Date;b=this._daylightSavingAdjust(new Date(b.getFullYear(),b.getMonth(),b.getDate()));var c=this._get(a,"isRTL"),e=this._get(a,"showButtonPanel"),f=this._get(a,"hideIfNoPrevNext"),h=this._get(a,"navigationAsDateFormat"),i=this._getNumberOfMonths(a),g=this._get(a,"showCurrentAtPos"),k=
-this._get(a,"stepMonths"),l=i[0]!=1||i[1]!=1,u=this._daylightSavingAdjust(!a.currentDay?new Date(9999,9,9):new Date(a.currentYear,a.currentMonth,a.currentDay)),j=this._getMinMaxDate(a,"min"),o=this._getMinMaxDate(a,"max");g=a.drawMonth-g;var m=a.drawYear;if(g<0){g+=12;m--}if(o){var n=this._daylightSavingAdjust(new Date(o.getFullYear(),o.getMonth()-i[0]*i[1]+1,o.getDate()));for(n=j&&n<j?j:n;this._daylightSavingAdjust(new Date(m,g,1))>n;){g--;if(g<0){g=11;m--}}}a.drawMonth=g;a.drawYear=m;n=this._get(a,
-"prevText");n=!h?n:this.formatDate(n,this._daylightSavingAdjust(new Date(m,g-k,1)),this._getFormatConfig(a));n=this._canAdjustMonth(a,-1,m,g)?'<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery_'+y+".datepicker._adjustDate('#"+a.id+"', -"+k+", 'M');\" title=\""+n+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"e":"w")+'">'+n+"</span></a>":f?"":'<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+n+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"e":"w")+'">'+
-n+"</span></a>";var r=this._get(a,"nextText");r=!h?r:this.formatDate(r,this._daylightSavingAdjust(new Date(m,g+k,1)),this._getFormatConfig(a));f=this._canAdjustMonth(a,+1,m,g)?'<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery_'+y+".datepicker._adjustDate('#"+a.id+"', +"+k+", 'M');\" title=\""+r+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"w":"e")+'">'+r+"</span></a>":f?"":'<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+r+'"><span class="ui-icon ui-icon-circle-triangle-'+
-(c?"w":"e")+'">'+r+"</span></a>";k=this._get(a,"currentText");r=this._get(a,"gotoCurrent")&&a.currentDay?u:b;k=!h?k:this.formatDate(k,r,this._getFormatConfig(a));h=!a.inline?'<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery_'+y+'.datepicker._hideDatepicker();">'+this._get(a,"closeText")+"</button>":"";e=e?'<div class="ui-datepicker-buttonpane ui-widget-content">'+(c?h:"")+(this._isInRange(a,r)?'<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery_'+
-y+".datepicker._gotoToday('#"+a.id+"');\">"+k+"</button>":"")+(c?"":h)+"</div>":"";h=parseInt(this._get(a,"firstDay"),10);h=isNaN(h)?0:h;k=this._get(a,"showWeek");r=this._get(a,"dayNames");this._get(a,"dayNamesShort");var s=this._get(a,"dayNamesMin"),z=this._get(a,"monthNames"),v=this._get(a,"monthNamesShort"),p=this._get(a,"beforeShowDay"),w=this._get(a,"showOtherMonths"),H=this._get(a,"selectOtherMonths");this._get(a,"calculateWeek");for(var M=this._getDefaultDate(a),I="",C=0;C<i[0];C++){for(var N=
-"",D=0;D<i[1];D++){var J=this._daylightSavingAdjust(new Date(m,g,a.selectedDay)),t=" ui-corner-all",x="";if(l){x+='<div class="ui-datepicker-group';if(i[1]>1)switch(D){case 0:x+=" ui-datepicker-group-first";t=" ui-corner-"+(c?"right":"left");break;case i[1]-1:x+=" ui-datepicker-group-last";t=" ui-corner-"+(c?"left":"right");break;default:x+=" ui-datepicker-group-middle";t="";break}x+='">'}x+='<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix'+t+'">'+(/all|left/.test(t)&&C==0?c?
-f:n:"")+(/all|right/.test(t)&&C==0?c?n:f:"")+this._generateMonthYearHeader(a,g,m,j,o,C>0||D>0,z,v)+'</div><table class="ui-datepicker-calendar"><thead><tr>';var A=k?'<th class="ui-datepicker-week-col">'+this._get(a,"weekHeader")+"</th>":"";for(t=0;t<7;t++){var q=(t+h)%7;A+="<th"+((t+h+6)%7>=5?' class="ui-datepicker-week-end"':"")+'><span title="'+r[q]+'">'+s[q]+"</span></th>"}x+=A+"</tr></thead><tbody>";A=this._getDaysInMonth(m,g);if(m==a.selectedYear&&g==a.selectedMonth)a.selectedDay=Math.min(a.selectedDay,
-A);t=(this._getFirstDayOfMonth(m,g)-h+7)%7;A=l?6:Math.ceil((t+A)/7);q=this._daylightSavingAdjust(new Date(m,g,1-t));for(var O=0;O<A;O++){x+="<tr>";var P=!k?"":'<td class="ui-datepicker-week-col">'+this._get(a,"calculateWeek")(q)+"</td>";for(t=0;t<7;t++){var F=p?p.apply(a.input?a.input[0]:null,[q]):[true,""],B=q.getMonth()!=g,K=B&&!H||!F[0]||j&&q<j||o&&q>o;P+='<td class="'+((t+h+6)%7>=5?" ui-datepicker-week-end":"")+(B?" ui-datepicker-other-month":"")+(q.getTime()==J.getTime()&&g==a.selectedMonth&&
-a._keyEvent||M.getTime()==q.getTime()&&M.getTime()==J.getTime()?" "+this._dayOverClass:"")+(K?" "+this._unselectableClass+" ui-state-disabled":"")+(B&&!w?"":" "+F[1]+(q.getTime()==u.getTime()?" "+this._currentClass:"")+(q.getTime()==b.getTime()?" ui-datepicker-today":""))+'"'+((!B||w)&&F[2]?' title="'+F[2]+'"':"")+(K?"":' onclick="DP_jQuery_'+y+".datepicker._selectDay('#"+a.id+"',"+q.getMonth()+","+q.getFullYear()+', this);return false;"')+">"+(B&&!w?" ":K?'<span class="ui-state-default">'+q.getDate()+
-"</span>":'<a class="ui-state-default'+(q.getTime()==b.getTime()?" ui-state-highlight":"")+(q.getTime()==J.getTime()?" ui-state-active":"")+(B?" ui-priority-secondary":"")+'" href="#">'+q.getDate()+"</a>")+"</td>";q.setDate(q.getDate()+1);q=this._daylightSavingAdjust(q)}x+=P+"</tr>"}g++;if(g>11){g=0;m++}x+="</tbody></table>"+(l?"</div>"+(i[0]>0&&D==i[1]-1?'<div class="ui-datepicker-row-break"></div>':""):"");N+=x}I+=N}I+=e+(d.browser.msie&&parseInt(d.browser.version,10)<7&&!a.inline?'<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>':
-"");a._keyEvent=false;return I},_generateMonthYearHeader:function(a,b,c,e,f,h,i,g){var k=this._get(a,"changeMonth"),l=this._get(a,"changeYear"),u=this._get(a,"showMonthAfterYear"),j='<div class="ui-datepicker-title">',o="";if(h||!k)o+='<span class="ui-datepicker-month">'+i[b]+"</span>";else{i=e&&e.getFullYear()==c;var m=f&&f.getFullYear()==c;o+='<select class="ui-datepicker-month" onchange="DP_jQuery_'+y+".datepicker._selectMonthYear('#"+a.id+"', this, 'M');\" onclick=\"DP_jQuery_"+y+".datepicker._clickMonthYear('#"+
-a.id+"');\">";for(var n=0;n<12;n++)if((!i||n>=e.getMonth())&&(!m||n<=f.getMonth()))o+='<option value="'+n+'"'+(n==b?' selected="selected"':"")+">"+g[n]+"</option>";o+="</select>"}u||(j+=o+(h||!(k&&l)?" ":""));if(h||!l)j+='<span class="ui-datepicker-year">'+c+"</span>";else{g=this._get(a,"yearRange").split(":");var r=(new Date).getFullYear();i=function(s){s=s.match(/c[+-].*/)?c+parseInt(s.substring(1),10):s.match(/[+-].*/)?r+parseInt(s,10):parseInt(s,10);return isNaN(s)?r:s};b=i(g[0]);g=Math.max(b,
-i(g[1]||""));b=e?Math.max(b,e.getFullYear()):b;g=f?Math.min(g,f.getFullYear()):g;for(j+='<select class="ui-datepicker-year" onchange="DP_jQuery_'+y+".datepicker._selectMonthYear('#"+a.id+"', this, 'Y');\" onclick=\"DP_jQuery_"+y+".datepicker._clickMonthYear('#"+a.id+"');\">";b<=g;b++)j+='<option value="'+b+'"'+(b==c?' selected="selected"':"")+">"+b+"</option>";j+="</select>"}j+=this._get(a,"yearSuffix");if(u)j+=(h||!(k&&l)?" ":"")+o;j+="</div>";return j},_adjustInstDate:function(a,b,c){var e=
-a.drawYear+(c=="Y"?b:0),f=a.drawMonth+(c=="M"?b:0);b=Math.min(a.selectedDay,this._getDaysInMonth(e,f))+(c=="D"?b:0);e=this._restrictMinMax(a,this._daylightSavingAdjust(new Date(e,f,b)));a.selectedDay=e.getDate();a.drawMonth=a.selectedMonth=e.getMonth();a.drawYear=a.selectedYear=e.getFullYear();if(c=="M"||c=="Y")this._notifyChange(a)},_restrictMinMax:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");b=c&&b<c?c:b;return b=a&&b>a?a:b},_notifyChange:function(a){var b=this._get(a,
-"onChangeMonthYear");if(b)b.apply(a.input?a.input[0]:null,[a.selectedYear,a.selectedMonth+1,a])},_getNumberOfMonths:function(a){a=this._get(a,"numberOfMonths");return a==null?[1,1]:typeof a=="number"?[1,a]:a},_getMinMaxDate:function(a,b){return this._determineDate(a,this._get(a,b+"Date"),null)},_getDaysInMonth:function(a,b){return 32-(new Date(a,b,32)).getDate()},_getFirstDayOfMonth:function(a,b){return(new Date(a,b,1)).getDay()},_canAdjustMonth:function(a,b,c,e){var f=this._getNumberOfMonths(a);
-c=this._daylightSavingAdjust(new Date(c,e+(b<0?b:f[0]*f[1]),1));b<0&&c.setDate(this._getDaysInMonth(c.getFullYear(),c.getMonth()));return this._isInRange(a,c)},_isInRange:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");return(!c||b.getTime()>=c.getTime())&&(!a||b.getTime()<=a.getTime())},_getFormatConfig:function(a){var b=this._get(a,"shortYearCutoff");b=typeof b!="string"?b:(new Date).getFullYear()%100+parseInt(b,10);return{shortYearCutoff:b,dayNamesShort:this._get(a,
-"dayNamesShort"),dayNames:this._get(a,"dayNames"),monthNamesShort:this._get(a,"monthNamesShort"),monthNames:this._get(a,"monthNames")}},_formatDate:function(a,b,c,e){if(!b){a.currentDay=a.selectedDay;a.currentMonth=a.selectedMonth;a.currentYear=a.selectedYear}b=b?typeof b=="object"?b:this._daylightSavingAdjust(new Date(e,c,b)):this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return this.formatDate(this._get(a,"dateFormat"),b,this._getFormatConfig(a))}});d.fn.datepicker=
-function(a){if(!d.datepicker.initialized){d(document).mousedown(d.datepicker._checkExternalClick).find("body").append(d.datepicker.dpDiv);d.datepicker.initialized=true}var b=Array.prototype.slice.call(arguments,1);if(typeof a=="string"&&(a=="isDisabled"||a=="getDate"||a=="widget"))return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this[0]].concat(b));if(a=="option"&&arguments.length==2&&typeof arguments[1]=="string")return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this[0]].concat(b));
-return this.each(function(){typeof a=="string"?d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this].concat(b)):d.datepicker._attachDatepicker(this,a)})};d.datepicker=new L;d.datepicker.initialized=false;d.datepicker.uuid=(new Date).getTime();d.datepicker.version="1.8.5";window["DP_jQuery_"+y]=d})(jQuery);
-;/*
-* jQuery Mobile Framework : temporary extension to port jQuery UI's datepicker for mobile
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT or GPL Version 2 licenses.
-* http://jquery.org/license
-*/
-(function($, undefined ) {
- //cache previous datepicker ui method
- var prevDp = $.fn.datepicker;
-
- //rewrite datepicker
- $.fn.datepicker = function( options ){
-
- var dp = this;
-
- //call cached datepicker plugin
- prevDp.call( this, options );
-
- //extend with some dom manipulation to update the markup for jQM
- //call immediately
- function updateDatepicker(){
- $( ".ui-datepicker-header", dp ).addClass("ui-body-c ui-corner-top").removeClass("ui-corner-all");
- $( ".ui-datepicker-prev, .ui-datepicker-next", dp ).attr("href", "#");
- $( ".ui-datepicker-prev", dp ).buttonMarkup({iconpos: "notext", icon: "arrow-l", shadow: true, corners: true});
- $( ".ui-datepicker-next", dp ).buttonMarkup({iconpos: "notext", icon: "arrow-r", shadow: true, corners: true});
- $( ".ui-datepicker-calendar th", dp ).addClass("ui-bar-c");
- $( ".ui-datepicker-calendar td", dp ).addClass("ui-body-c");
- $( ".ui-datepicker-calendar a", dp ).buttonMarkup({corners: false, shadow: false});
- $( ".ui-datepicker-calendar a.ui-state-active", dp ).addClass("ui-btn-active"); // selected date
- $( ".ui-datepicker-calendar a.ui-state-highlight", dp ).addClass("ui-btn-up-e"); // today"s date
- $( ".ui-datepicker-calendar .ui-btn", dp ).each(function(){
- var el = $(this);
- // remove extra button markup - necessary for date value to be interpreted correctly
- el.html( el.find( ".ui-btn-text" ).text() );
- });
- };
-
- //update now
- updateDatepicker();
-
- // and on click
- $( dp ).click( updateDatepicker );
-
- //return jqm obj
- return this;
- };
-
- //bind to pagecreate to automatically enhance date inputs
- $( ".ui-page" ).live( "pagecreate", function(){
- $( "#date, input[type='date'], input[data-type='date']" ).each(function(){
- if ($(this).hasClass("hasDatepicker") == false) {
- $(this).after( $( "<div />" ).datepicker({ altField: "#" + $(this).attr( "id" ), showOtherMonths: true }) );
- $(this).addClass("hasDatepicker");
- }
- });
- });
-})( jQuery );
-
--- a/js/jquery-1.5.js
+++ /dev/null
@@ -1,8177 +1,1 @@
-/*!
- * jQuery JavaScript Library v1.5
- * http://jquery.com/
- *
- * Copyright 2011, John Resig
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * Includes Sizzle.js
- * http://sizzlejs.com/
- * Copyright 2011, The Dojo Foundation
- * Released under the MIT, BSD, and GPL Licenses.
- *
- * Date: Mon Jan 31 08:31:29 2011 -0500
- */
-(function( window, undefined ) {
-// Use the correct document accordingly with window argument (sandbox)
-var document = window.document;
-var jQuery = (function() {
-
-// Define a local copy of jQuery
-var jQuery = function( selector, context ) {
- // The jQuery object is actually just the init constructor 'enhanced'
- return new jQuery.fn.init( selector, context, rootjQuery );
- },
-
- // Map over jQuery in case of overwrite
- _jQuery = window.jQuery,
-
- // Map over the $ in case of overwrite
- _$ = window.$,
-
- // A central reference to the root jQuery(document)
- rootjQuery,
-
- // A simple way to check for HTML strings or ID strings
- // (both of which we optimize for)
- quickExpr = /^(?:[^<]*(<[\w\W]+>)[^>]*$|#([\w\-]+)$)/,
-
- // Check if a string has a non-whitespace character in it
- rnotwhite = /\S/,
-
- // Used for trimming whitespace
- trimLeft = /^\s+/,
- trimRight = /\s+$/,
-
- // Check for digits
- rdigit = /\d/,
-
- // Match a standalone tag
- rsingleTag = /^<(\w+)\s*\/?>(?:<\/\1>)?$/,
-
- // JSON RegExp
- rvalidchars = /^[\],:{}\s]*$/,
- rvalidescape = /\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,
- rvalidtokens = /"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,
- rvalidbraces = /(?:^|:|,)(?:\s*\[)+/g,
-
- // Useragent RegExp
- rwebkit = /(webkit)[ \/]([\w.]+)/,
- ropera = /(opera)(?:.*version)?[ \/]([\w.]+)/,
- rmsie = /(msie) ([\w.]+)/,
- rmozilla = /(mozilla)(?:.*? rv:([\w.]+))?/,
-
- // Keep a UserAgent string for use with jQuery.browser
- userAgent = navigator.userAgent,
-
- // For matching the engine and version of the browser
- browserMatch,
-
- // Has the ready events already been bound?
- readyBound = false,
-
- // The deferred used on DOM ready
- readyList,
-
- // Promise methods
- promiseMethods = "then done fail isResolved isRejected promise".split( " " ),
-
- // The ready event handler
- DOMContentLoaded,
-
- // Save a reference to some core methods
- toString = Object.prototype.toString,
- hasOwn = Object.prototype.hasOwnProperty,
- push = Array.prototype.push,
- slice = Array.prototype.slice,
- trim = String.prototype.trim,
- indexOf = Array.prototype.indexOf,
-
- // [[Class]] -> type pairs
- class2type = {};
-
-jQuery.fn = jQuery.prototype = {
- constructor: jQuery,
- init: function( selector, context, rootjQuery ) {
- var match, elem, ret, doc;
-
- // Handle $(""), $(null), or $(undefined)
- if ( !selector ) {
- return this;
- }
-
- // Handle $(DOMElement)
- if ( selector.nodeType ) {
- this.context = this[0] = selector;
- this.length = 1;
- return this;
- }
-
- // The body element only exists once, optimize finding it
- if ( selector === "body" && !context && document.body ) {
- this.context = document;
- this[0] = document.body;
- this.selector = "body";
- this.length = 1;
- return this;
- }
-
- // Handle HTML strings
- if ( typeof selector === "string" ) {
- // Are we dealing with HTML string or an ID?
- match = quickExpr.exec( selector );
-
- // Verify a match, and that no context was specified for #id
- if ( match && (match[1] || !context) ) {
-
- // HANDLE: $(html) -> $(array)
- if ( match[1] ) {
- context = context instanceof jQuery ? context[0] : context;
- doc = (context ? context.ownerDocument || context : document);
-
- // If a single string is passed in and it's a single tag
- // just do a createElement and skip the rest
- ret = rsingleTag.exec( selector );
-
- if ( ret ) {
- if ( jQuery.isPlainObject( context ) ) {
- selector = [ document.createElement( ret[1] ) ];
- jQuery.fn.attr.call( selector, context, true );
-
- } else {
- selector = [ doc.createElement( ret[1] ) ];
- }
-
- } else {
- ret = jQuery.buildFragment( [ match[1] ], [ doc ] );
- selector = (ret.cacheable ? jQuery.clone(ret.fragment) : ret.fragment).childNodes;
- }
-
- return jQuery.merge( this, selector );
-
- // HANDLE: $("#id")
- } else {
- elem = document.getElementById( match[2] );
-
- // Check parentNode to catch when Blackberry 4.6 returns
- // nodes that are no longer in the document #6963
- if ( elem && elem.parentNode ) {
- // Handle the case where IE and Opera return items
- // by name instead of ID
- if ( elem.id !== match[2] ) {
- return rootjQuery.find( selector );
- }
-
- // Otherwise, we inject the element directly into the jQuery object
- this.length = 1;
- this[0] = elem;
- }
-
- this.context = document;
- this.selector = selector;
- return this;
- }
-
- // HANDLE: $(expr, $(...))
- } else if ( !context || context.jquery ) {
- return (context || rootjQuery).find( selector );
-
- // HANDLE: $(expr, context)
- // (which is just equivalent to: $(context).find(expr)
- } else {
- return this.constructor( context ).find( selector );
- }
-
- // HANDLE: $(function)
- // Shortcut for document ready
- } else if ( jQuery.isFunction( selector ) ) {
- return rootjQuery.ready( selector );
- }
-
- if (selector.selector !== undefined) {
- this.selector = selector.selector;
- this.context = selector.context;
- }
-
- return jQuery.makeArray( selector, this );
- },
-
- // Start with an empty selector
- selector: "",
-
- // The current version of jQuery being used
- jquery: "1.5",
-
- // The default length of a jQuery object is 0
- length: 0,
-
- // The number of elements contained in the matched element set
- size: function() {
- return this.length;
- },
-
- toArray: function() {
- return slice.call( this, 0 );
- },
-
- // Get the Nth element in the matched element set OR
- // Get the whole matched element set as a clean array
- get: function( num ) {
- return num == null ?
-
- // Return a 'clean' array
- this.toArray() :
-
- // Return just the object
- ( num < 0 ? this[ this.length + num ] : this[ num ] );
- },
-
- // Take an array of elements and push it onto the stack
- // (returning the new matched element set)
- pushStack: function( elems, name, selector ) {
- // Build a new jQuery matched element set
- var ret = this.constructor();
-
- if ( jQuery.isArray( elems ) ) {
- push.apply( ret, elems );
-
- } else {
- jQuery.merge( ret, elems );
- }
-
- // Add the old object onto the stack (as a reference)
- ret.prevObject = this;
-
- ret.context = this.context;
-
- if ( name === "find" ) {
- ret.selector = this.selector + (this.selector ? " " : "") + selector;
- } else if ( name ) {
- ret.selector = this.selector + "." + name + "(" + selector + ")";
- }
-
- // Return the newly-formed element set
- return ret;
- },
-
- // Execute a callback for every element in the matched set.
- // (You can seed the arguments with an array of args, but this is
- // only used internally.)
- each: function( callback, args ) {
- return jQuery.each( this, callback, args );
- },
-
- ready: function( fn ) {
- // Attach the listeners
- jQuery.bindReady();
-
- // Add the callback
- readyList.done( fn );
-
- return this;
- },
-
- eq: function( i ) {
- return i === -1 ?
- this.slice( i ) :
- this.slice( i, +i + 1 );
- },
-
- first: function() {
- return this.eq( 0 );
- },
-
- last: function() {
- return this.eq( -1 );
- },
-
- slice: function() {
- return this.pushStack( slice.apply( this, arguments ),
- "slice", slice.call(arguments).join(",") );
- },
-
- map: function( callback ) {
- return this.pushStack( jQuery.map(this, function( elem, i ) {
- return callback.call( elem, i, elem );
- }));
- },
-
- end: function() {
- return this.prevObject || this.constructor(null);
- },
-
- // For internal use only.
- // Behaves like an Array's method, not like a jQuery method.
- push: push,
- sort: [].sort,
- splice: [].splice
-};
-
-// Give the init function the jQuery prototype for later instantiation
-jQuery.fn.init.prototype = jQuery.fn;
-
-jQuery.extend = jQuery.fn.extend = function() {
- var options, name, src, copy, copyIsArray, clone,
- target = arguments[0] || {},
- i = 1,
- length = arguments.length,
- deep = false;
-
- // Handle a deep copy situation
- if ( typeof target === "boolean" ) {
- deep = target;
- target = arguments[1] || {};
- // skip the boolean and the target
- i = 2;
- }
-
- // Handle case when target is a string or something (possible in deep copy)
- if ( typeof target !== "object" && !jQuery.isFunction(target) ) {
- target = {};
- }
-
- // extend jQuery itself if only one argument is passed
- if ( length === i ) {
- target = this;
- --i;
- }
-
- for ( ; i < length; i++ ) {
- // Only deal with non-null/undefined values
- if ( (options = arguments[ i ]) != null ) {
- // Extend the base object
- for ( name in options ) {
- src = target[ name ];
- copy = options[ name ];
-
- // Prevent never-ending loop
- if ( target === copy ) {
- continue;
- }
-
- // Recurse if we're merging plain objects or arrays
- if ( deep && copy && ( jQuery.isPlainObject(copy) || (copyIsArray = jQuery.isArray(copy)) ) ) {
- if ( copyIsArray ) {
- copyIsArray = false;
- clone = src && jQuery.isArray(src) ? src : [];
-
- } else {
- clone = src && jQuery.isPlainObject(src) ? src : {};
- }
-
- // Never move original objects, clone them
- target[ name ] = jQuery.extend( deep, clone, copy );
-
- // Don't bring in undefined values
- } else if ( copy !== undefined ) {
- target[ name ] = copy;
- }
- }
- }
- }
-
- // Return the modified object
- return target;
-};
-
-jQuery.extend({
- noConflict: function( deep ) {
- window.$ = _$;
-
- if ( deep ) {
- window.jQuery = _jQuery;
- }
-
- return jQuery;
- },
-
- // Is the DOM ready to be used? Set to true once it occurs.
- isReady: false,
-
- // A counter to track how many items to wait for before
- // the ready event fires. See #6781
- readyWait: 1,
-
- // Handle when the DOM is ready
- ready: function( wait ) {
- // A third-party is pushing the ready event forwards
- if ( wait === true ) {
- jQuery.readyWait--;
- }
-
- // Make sure that the DOM is not already loaded
- if ( !jQuery.readyWait || (wait !== true && !jQuery.isReady) ) {
- // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443).
- if ( !document.body ) {
- return setTimeout( jQuery.ready, 1 );
- }
-
- // Remember that the DOM is ready
- jQuery.isReady = true;
-
- // If a normal DOM Ready event fired, decrement, and wait if need be
- if ( wait !== true && --jQuery.readyWait > 0 ) {
- return;
- }
-
- // If there are functions bound, to execute
- readyList.resolveWith( document, [ jQuery ] );
-
- // Trigger any bound ready events
- if ( jQuery.fn.trigger ) {
- jQuery( document ).trigger( "ready" ).unbind( "ready" );
- }
- }
- },
-
- bindReady: function() {
- if ( readyBound ) {
- return;
- }
-
- readyBound = true;
-
- // Catch cases where $(document).ready() is called after the
- // browser event has already occurred.
- if ( document.readyState === "complete" ) {
- // Handle it asynchronously to allow scripts the opportunity to delay ready
- return setTimeout( jQuery.ready, 1 );
- }
-
- // Mozilla, Opera and webkit nightlies currently support this event
- if ( document.addEventListener ) {
- // Use the handy event callback
- document.addEventListener( "DOMContentLoaded", DOMContentLoaded, false );
-
- // A fallback to window.onload, that will always work
- window.addEventListener( "load", jQuery.ready, false );
-
- // If IE event model is used
- } else if ( document.attachEvent ) {
- // ensure firing before onload,
- // maybe late but safe also for iframes
- document.attachEvent("onreadystatechange", DOMContentLoaded);
-
- // A fallback to window.onload, that will always work
- window.attachEvent( "onload", jQuery.ready );
-
- // If IE and not a frame
- // continually check to see if the document is ready
- var toplevel = false;
-
- try {
- toplevel = window.frameElement == null;
- } catch(e) {}
-
- if ( document.documentElement.doScroll && toplevel ) {
- doScrollCheck();
- }
- }
- },
-
- // See test/unit/core.js for details concerning isFunction.
- // Since version 1.3, DOM methods and functions like alert
- // aren't supported. They return false on IE (#2968).
- isFunction: function( obj ) {
- return jQuery.type(obj) === "function";
- },
-
- isArray: Array.isArray || function( obj ) {
- return jQuery.type(obj) === "array";
- },
-
- // A crude way of determining if an object is a window
- isWindow: function( obj ) {
- return obj && typeof obj === "object" && "setInterval" in obj;
- },
-
- isNaN: function( obj ) {
- return obj == null || !rdigit.test( obj ) || isNaN( obj );
- },
-
- type: function( obj ) {
- return obj == null ?
- String( obj ) :
- class2type[ toString.call(obj) ] || "object";
- },
-
- isPlainObject: function( obj ) {
- // Must be an Object.
- // Because of IE, we also have to check the presence of the constructor property.
- // Make sure that DOM nodes and window objects don't pass through, as well
- if ( !obj || jQuery.type(obj) !== "object" || obj.nodeType || jQuery.isWindow( obj ) ) {
- return false;
- }
-
- // Not own constructor property must be Object
- if ( obj.constructor &&
- !hasOwn.call(obj, "constructor") &&
- !hasOwn.call(obj.constructor.prototype, "isPrototypeOf") ) {
- return false;
- }
-
- // Own properties are enumerated firstly, so to speed up,
- // if last one is own, then all properties are own.
-
- var key;
- for ( key in obj ) {}
-
- return key === undefined || hasOwn.call( obj, key );
- },
-
- isEmptyObject: function( obj ) {
- for ( var name in obj ) {
- return false;
- }
- return true;
- },
-
- error: function( msg ) {
- throw msg;
- },
-
- parseJSON: function( data ) {
- if ( typeof data !== "string" || !data ) {
- return null;
- }
-
- // Make sure leading/trailing whitespace is removed (IE can't handle it)
- data = jQuery.trim( data );
-
- // Make sure the incoming data is actual JSON
- // Logic borrowed from http://json.org/json2.js
- if ( rvalidchars.test(data.replace(rvalidescape, "@")
- .replace(rvalidtokens, "]")
- .replace(rvalidbraces, "")) ) {
-
- // Try to use the native JSON parser first
- return window.JSON && window.JSON.parse ?
- window.JSON.parse( data ) :
- (new Function("return " + data))();
-
- } else {
- jQuery.error( "Invalid JSON: " + data );
- }
- },
-
- // Cross-browser xml parsing
- // (xml & tmp used internally)
- parseXML: function( data , xml , tmp ) {
-
- if ( window.DOMParser ) { // Standard
- tmp = new DOMParser();
- xml = tmp.parseFromString( data , "text/xml" );
- } else { // IE
- xml = new ActiveXObject( "Microsoft.XMLDOM" );
- xml.async = "false";
- xml.loadXML( data );
- }
-
- tmp = xml.documentElement;
-
- if ( ! tmp || ! tmp.nodeName || tmp.nodeName === "parsererror" ) {
- jQuery.error( "Invalid XML: " + data );
- }
-
- return xml;
- },
-
- noop: function() {},
-
- // Evalulates a script in a global context
- globalEval: function( data ) {
- if ( data && rnotwhite.test(data) ) {
- // Inspired by code by Andrea Giammarchi
- // http://webreflection.blogspot.com/2007/08/global-scope-evaluation-and-dom.html
- var head = document.getElementsByTagName("head")[0] || document.documentElement,
- script = document.createElement("script");
-
- script.type = "text/javascript";
-
- if ( jQuery.support.scriptEval() ) {
- script.appendChild( document.createTextNode( data ) );
- } else {
- script.text = data;
- }
-
- // Use insertBefore instead of appendChild to circumvent an IE6 bug.
- // This arises when a base node is used (#2709).
- head.insertBefore( script, head.firstChild );
- head.removeChild( script );
- }
- },
-
- nodeName: function( elem, name ) {
- return elem.nodeName && elem.nodeName.toUpperCase() === name.toUpperCase();
- },
-
- // args is for internal usage only
- each: function( object, callback, args ) {
- var name, i = 0,
- length = object.length,
- isObj = length === undefined || jQuery.isFunction(object);
-
- if ( args ) {
- if ( isObj ) {
- for ( name in object ) {
- if ( callback.apply( object[ name ], args ) === false ) {
- break;
- }
- }
- } else {
- for ( ; i < length; ) {
- if ( callback.apply( object[ i++ ], args ) === false ) {
- break;
- }
- }
- }
-
- // A special, fast, case for the most common use of each
- } else {
- if ( isObj ) {
- for ( name in object ) {
- if ( callback.call( object[ name ], name, object[ name ] ) === false ) {
- break;
- }
- }
- } else {
- for ( var value = object[0];
- i < length && callback.call( value, i, value ) !== false; value = object[++i] ) {}
- }
- }
-
- return object;
- },
-
- // Use native String.trim function wherever possible
- trim: trim ?
- function( text ) {
- return text == null ?
- "" :
- trim.call( text );
- } :
-
- // Otherwise use our own trimming functionality
- function( text ) {
- return text == null ?
- "" :
- text.toString().replace( trimLeft, "" ).replace( trimRight, "" );
- },
-
- // results is for internal usage only
- makeArray: function( array, results ) {
- var ret = results || [];
-
- if ( array != null ) {
- // The window, strings (and functions) also have 'length'
- // The extra typeof function check is to prevent crashes
- // in Safari 2 (See: #3039)
- // Tweaked logic slightly to handle Blackberry 4.7 RegExp issues #6930
- var type = jQuery.type(array);
-
- if ( array.length == null || type === "string" || type === "function" || type === "regexp" || jQuery.isWindow( array ) ) {
- push.call( ret, array );
- } else {
- jQuery.merge( ret, array );
- }
- }
-
- return ret;
- },
-
- inArray: function( elem, array ) {
- if ( array.indexOf ) {
- return array.indexOf( elem );
- }
-
- for ( var i = 0, length = array.length; i < length; i++ ) {
- if ( array[ i ] === elem ) {
- return i;
- }
- }
-
- return -1;
- },
-
- merge: function( first, second ) {
- var i = first.length,
- j = 0;
-
- if ( typeof second.length === "number" ) {
- for ( var l = second.length; j < l; j++ ) {
- first[ i++ ] = second[ j ];
- }
-
- } else {
- while ( second[j] !== undefined ) {
- first[ i++ ] = second[ j++ ];
- }
- }
-
- first.length = i;
-
- return first;
- },
-
- grep: function( elems, callback, inv ) {
- var ret = [], retVal;
- inv = !!inv;
-
- // Go through the array, only saving the items
- // that pass the validator function
- for ( var i = 0, length = elems.length; i < length; i++ ) {
- retVal = !!callback( elems[ i ], i );
- if ( inv !== retVal ) {
- ret.push( elems[ i ] );
- }
- }
-
- return ret;
- },
-
- // arg is for internal usage only
- map: function( elems, callback, arg ) {
- var ret = [], value;
-
- // Go through the array, translating each of the items to their
- // new value (or values).
- for ( var i = 0, length = elems.length; i < length; i++ ) {
- value = callback( elems[ i ], i, arg );
-
- if ( value != null ) {
- ret[ ret.length ] = value;
- }
- }
-
- // Flatten any nested arrays
- return ret.concat.apply( [], ret );
- },
-
- // A global GUID counter for objects
- guid: 1,
-
- proxy: function( fn, proxy, thisObject ) {
- if ( arguments.length === 2 ) {
- if ( typeof proxy === "string" ) {
- thisObject = fn;
- fn = thisObject[ proxy ];
- proxy = undefined;
-
- } else if ( proxy && !jQuery.isFunction( proxy ) ) {
- thisObject = proxy;
- proxy = undefined;
- }
- }
-
- if ( !proxy && fn ) {
- proxy = function() {
- return fn.apply( thisObject || this, arguments );
- };
- }
-
- // Set the guid of unique handler to the same of original handler, so it can be removed
- if ( fn ) {
- proxy.guid = fn.guid = fn.guid || proxy.guid || jQuery.guid++;
- }
-
- // So proxy can be declared as an argument
- return proxy;
- },
-
- // Mutifunctional method to get and set values to a collection
- // The value/s can be optionally by executed if its a function
- access: function( elems, key, value, exec, fn, pass ) {
- var length = elems.length;
-
- // Setting many attributes
- if ( typeof key === "object" ) {
- for ( var k in key ) {
- jQuery.access( elems, k, key[k], exec, fn, value );
- }
- return elems;
- }
-
- // Setting one attribute
- if ( value !== undefined ) {
- // Optionally, function values get executed if exec is true
- exec = !pass && exec && jQuery.isFunction(value);
-
- for ( var i = 0; i < length; i++ ) {
- fn( elems[i], key, exec ? value.call( elems[i], i, fn( elems[i], key ) ) : value, pass );
- }
-
- return elems;
- }
-
- // Getting an attribute
- return length ? fn( elems[0], key ) : undefined;
- },
-
- now: function() {
- return (new Date()).getTime();
- },
-
- // Create a simple deferred (one callbacks list)
- _Deferred: function() {
- var // callbacks list
- callbacks = [],
- // stored [ context , args ]
- fired,
- // to avoid firing when already doing so
- firing,
- // flag to know if the deferred has been cancelled
- cancelled,
- // the deferred itself
- deferred = {
-
- // done( f1, f2, ...)
- done: function() {
- if ( !cancelled ) {
- var args = arguments,
- i,
- length,
- elem,
- type,
- _fired;
- if ( fired ) {
- _fired = fired;
- fired = 0;
- }
- for ( i = 0, length = args.length; i < length; i++ ) {
- elem = args[ i ];
- type = jQuery.type( elem );
- if ( type === "array" ) {
- deferred.done.apply( deferred, elem );
- } else if ( type === "function" ) {
- callbacks.push( elem );
- }
- }
- if ( _fired ) {
- deferred.resolveWith( _fired[ 0 ], _fired[ 1 ] );
- }
- }
- return this;
- },
-
- // resolve with given context and args
- resolveWith: function( context, args ) {
- if ( !cancelled && !fired && !firing ) {
- firing = 1;
- try {
- while( callbacks[ 0 ] ) {
- callbacks.shift().apply( context, args );
- }
- }
- finally {
- fired = [ context, args ];
- firing = 0;
- }
- }
- return this;
- },
-
- // resolve with this as context and given arguments
- resolve: function() {
- deferred.resolveWith( jQuery.isFunction( this.promise ) ? this.promise() : this, arguments );
- return this;
- },
-
- // Has this deferred been resolved?
- isResolved: function() {
- return !!( firing || fired );
- },
-
- // Cancel
- cancel: function() {
- cancelled = 1;
- callbacks = [];
- return this;
- }
- };
-
- return deferred;
- },
-
- // Full fledged deferred (two callbacks list)
- Deferred: function( func ) {
- var deferred = jQuery._Deferred(),
- failDeferred = jQuery._Deferred(),
- promise;
- // Add errorDeferred methods, then and promise
- jQuery.extend( deferred, {
- then: function( doneCallbacks, failCallbacks ) {
- deferred.done( doneCallbacks ).fail( failCallbacks );
- return this;
- },
- fail: failDeferred.done,
- rejectWith: failDeferred.resolveWith,
- reject: failDeferred.resolve,
- isRejected: failDeferred.isResolved,
- // Get a promise for this deferred
- // If obj is provided, the promise aspect is added to the object
- promise: function( obj , i /* internal */ ) {
- if ( obj == null ) {
- if ( promise ) {
- return promise;
- }
- promise = obj = {};
- }
- i = promiseMethods.length;
- while( i-- ) {
- obj[ promiseMethods[ i ] ] = deferred[ promiseMethods[ i ] ];
- }
- return obj;
- }
- } );
- // Make sure only one callback list will be used
- deferred.then( failDeferred.cancel, deferred.cancel );
- // Unexpose cancel
- delete deferred.cancel;
- // Call given func if any
- if ( func ) {
- func.call( deferred, deferred );
- }
- return deferred;
- },
-
- // Deferred helper
- when: function( object ) {
- var args = arguments,
- length = args.length,
- deferred = length <= 1 && object && jQuery.isFunction( object.promise ) ?
- object :
- jQuery.Deferred(),
- promise = deferred.promise(),
- resolveArray;
-
- if ( length > 1 ) {
- resolveArray = new Array( length );
- jQuery.each( args, function( index, element ) {
- jQuery.when( element ).then( function( value ) {
- resolveArray[ index ] = arguments.length > 1 ? slice.call( arguments, 0 ) : value;
- if( ! --length ) {
- deferred.resolveWith( promise, resolveArray );
- }
- }, deferred.reject );
- } );
- } else if ( deferred !== object ) {
- deferred.resolve( object );
- }
- return promise;
- },
-
- // Use of jQuery.browser is frowned upon.
- // More details: http://docs.jquery.com/Utilities/jQuery.browser
- uaMatch: function( ua ) {
- ua = ua.toLowerCase();
-
- var match = rwebkit.exec( ua ) ||
- ropera.exec( ua ) ||
- rmsie.exec( ua ) ||
- ua.indexOf("compatible") < 0 && rmozilla.exec( ua ) ||
- [];
-
- return { browser: match[1] || "", version: match[2] || "0" };
- },
-
- sub: function() {
- function jQuerySubclass( selector, context ) {
- return new jQuerySubclass.fn.init( selector, context );
- }
- jQuery.extend( true, jQuerySubclass, this );
- jQuerySubclass.superclass = this;
- jQuerySubclass.fn = jQuerySubclass.prototype = this();
- jQuerySubclass.fn.constructor = jQuerySubclass;
- jQuerySubclass.subclass = this.subclass;
- jQuerySubclass.fn.init = function init( selector, context ) {
- if ( context && context instanceof jQuery && !(context instanceof jQuerySubclass) ) {
- context = jQuerySubclass(context);
- }
-
- return jQuery.fn.init.call( this, selector, context, rootjQuerySubclass );
- };
- jQuerySubclass.fn.init.prototype = jQuerySubclass.fn;
- var rootjQuerySubclass = jQuerySubclass(document);
- return jQuerySubclass;
- },
-
- browser: {}
-});
-
-// Create readyList deferred
-readyList = jQuery._Deferred();
-
-// Populate the class2type map
-jQuery.each("Boolean Number String Function Array Date RegExp Object".split(" "), function(i, name) {
- class2type[ "[object " + name + "]" ] = name.toLowerCase();
-});
-
-browserMatch = jQuery.uaMatch( userAgent );
-if ( browserMatch.browser ) {
- jQuery.browser[ browserMatch.browser ] = true;
- jQuery.browser.version = browserMatch.version;
-}
-
-// Deprecated, use jQuery.browser.webkit instead
-if ( jQuery.browser.webkit ) {
- jQuery.browser.safari = true;
-}
-
-if ( indexOf ) {
- jQuery.inArray = function( elem, array ) {
- return indexOf.call( array, elem );
- };
-}
-
-// IE doesn't match non-breaking spaces with \s
-if ( rnotwhite.test( "\xA0" ) ) {
- trimLeft = /^[\s\xA0]+/;
- trimRight = /[\s\xA0]+$/;
-}
-
-// All jQuery objects should point back to these
-rootjQuery = jQuery(document);
-
-// Cleanup functions for the document ready method
-if ( document.addEventListener ) {
- DOMContentLoaded = function() {
- document.removeEventListener( "DOMContentLoaded", DOMContentLoaded, false );
- jQuery.ready();
- };
-
-} else if ( document.attachEvent ) {
- DOMContentLoaded = function() {
- // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443).
- if ( document.readyState === "complete" ) {
- document.detachEvent( "onreadystatechange", DOMContentLoaded );
- jQuery.ready();
- }
- };
-}
-
-// The DOM ready check for Internet Explorer
-function doScrollCheck() {
- if ( jQuery.isReady ) {
- return;
- }
-
- try {
- // If IE is used, use the trick by Diego Perini
- // http://javascript.nwbox.com/IEContentLoaded/
- document.documentElement.doScroll("left");
- } catch(e) {
- setTimeout( doScrollCheck, 1 );
- return;
- }
-
- // and execute any waiting functions
- jQuery.ready();
-}
-
-// Expose jQuery to the global object
-return (window.jQuery = window.$ = jQuery);
-
-})();
-
-
-(function() {
-
- jQuery.support = {};
-
- var div = document.createElement("div");
-
- div.style.display = "none";
- div.innerHTML = " <link/><table></table><a href='/a' style='color:red;float:left;opacity:.55;'>a</a><input type='checkbox'/>";
-
- var all = div.getElementsByTagName("*"),
- a = div.getElementsByTagName("a")[0],
- select = document.createElement("select"),
- opt = select.appendChild( document.createElement("option") );
-
- // Can't get basic test support
- if ( !all || !all.length || !a ) {
- return;
- }
-
- jQuery.support = {
- // IE strips leading whitespace when .innerHTML is used
- leadingWhitespace: div.firstChild.nodeType === 3,
-
- // Make sure that tbody elements aren't automatically inserted
- // IE will insert them into empty tables
- tbody: !div.getElementsByTagName("tbody").length,
-
- // Make sure that link elements get serialized correctly by innerHTML
- // This requires a wrapper element in IE
- htmlSerialize: !!div.getElementsByTagName("link").length,
-
- // Get the style information from getAttribute
- // (IE uses .cssText insted)
- style: /red/.test( a.getAttribute("style") ),
-
- // Make sure that URLs aren't manipulated
- // (IE normalizes it by default)
- hrefNormalized: a.getAttribute("href") === "/a",
-
- // Make sure that element opacity exists
- // (IE uses filter instead)
- // Use a regex to work around a WebKit issue. See #5145
- opacity: /^0.55$/.test( a.style.opacity ),
-
- // Verify style float existence
- // (IE uses styleFloat instead of cssFloat)
- cssFloat: !!a.style.cssFloat,
-
- // Make sure that if no value is specified for a checkbox
- // that it defaults to "on".
- // (WebKit defaults to "" instead)
- checkOn: div.getElementsByTagName("input")[0].value === "on",
-
- // Make sure that a selected-by-default option has a working selected property.
- // (WebKit defaults to false instead of true, IE too, if it's in an optgroup)
- optSelected: opt.selected,
-
- // Will be defined later
- deleteExpando: true,
- optDisabled: false,
- checkClone: false,
- _scriptEval: null,
- noCloneEvent: true,
- boxModel: null,
- inlineBlockNeedsLayout: false,
- shrinkWrapBlocks: false,
- reliableHiddenOffsets: true
- };
-
- // Make sure that the options inside disabled selects aren't marked as disabled
- // (WebKit marks them as diabled)
- select.disabled = true;
- jQuery.support.optDisabled = !opt.disabled;
-
- jQuery.support.scriptEval = function() {
- if ( jQuery.support._scriptEval === null ) {
- var root = document.documentElement,
- script = document.createElement("script"),
- id = "script" + jQuery.now();
-
- script.type = "text/javascript";
- try {
- script.appendChild( document.createTextNode( "window." + id + "=1;" ) );
- } catch(e) {}
-
- root.insertBefore( script, root.firstChild );
-
- // Make sure that the execution of code works by injecting a script
- // tag with appendChild/createTextNode
- // (IE doesn't support this, fails, and uses .text instead)
- if ( window[ id ] ) {
- jQuery.support._scriptEval = true;
- delete window[ id ];
- } else {
- jQuery.support._scriptEval = false;
- }
-
- root.removeChild( script );
- // release memory in IE
- root = script = id = null;
- }
-
- return jQuery.support._scriptEval;
- };
-
- // Test to see if it's possible to delete an expando from an element
- // Fails in Internet Explorer
- try {
- delete div.test;
-
- } catch(e) {
- jQuery.support.deleteExpando = false;
- }
-
- if ( div.attachEvent && div.fireEvent ) {
- div.attachEvent("onclick", function click() {
- // Cloning a node shouldn't copy over any
- // bound event handlers (IE does this)
- jQuery.support.noCloneEvent = false;
- div.detachEvent("onclick", click);
- });
- div.cloneNode(true).fireEvent("onclick");
- }
-
- div = document.createElement("div");
- div.innerHTML = "<input type='radio' name='radiotest' checked='checked'/>";
-
- var fragment = document.createDocumentFragment();
- fragment.appendChild( div.firstChild );
-
- // WebKit doesn't clone checked state correctly in fragments
- jQuery.support.checkClone = fragment.cloneNode(true).cloneNode(true).lastChild.checked;
-
- // Figure out if the W3C box model works as expected
- // document.body must exist before we can do this
- jQuery(function() {
- var div = document.createElement("div"),
- body = document.getElementsByTagName("body")[0];
-
- // Frameset documents with no body should not run this code
- if ( !body ) {
- return;
- }
-
- div.style.width = div.style.paddingLeft = "1px";
- body.appendChild( div );
- jQuery.boxModel = jQuery.support.boxModel = div.offsetWidth === 2;
-
- if ( "zoom" in div.style ) {
- // Check if natively block-level elements act like inline-block
- // elements when setting their display to 'inline' and giving
- // them layout
- // (IE < 8 does this)
- div.style.display = "inline";
- div.style.zoom = 1;
- jQuery.support.inlineBlockNeedsLayout = div.offsetWidth === 2;
-
- // Check if elements with layout shrink-wrap their children
- // (IE 6 does this)
- div.style.display = "";
- div.innerHTML = "<div style='width:4px;'></div>";
- jQuery.support.shrinkWrapBlocks = div.offsetWidth !== 2;
- }
-
- div.innerHTML = "<table><tr><td style='padding:0;border:0;display:none'></td><td>t</td></tr></table>";
- var tds = div.getElementsByTagName("td");
-
- // Check if table cells still have offsetWidth/Height when they are set
- // to display:none and there are still other visible table cells in a
- // table row; if so, offsetWidth/Height are not reliable for use when
- // determining if an element has been hidden directly using
- // display:none (it is still safe to use offsets if a parent element is
- // hidden; don safety goggles and see bug #4512 for more information).
- // (only IE 8 fails this test)
- jQuery.support.reliableHiddenOffsets = tds[0].offsetHeight === 0;
-
- tds[0].style.display = "";
- tds[1].style.display = "none";
-
- // Check if empty table cells still have offsetWidth/Height
- // (IE < 8 fail this test)
- jQuery.support.reliableHiddenOffsets = jQuery.support.reliableHiddenOffsets && tds[0].offsetHeight === 0;
- div.innerHTML = "";
-
- body.removeChild( div ).style.display = "none";
- div = tds = null;
- });
-
- // Technique from Juriy Zaytsev
- // http://thinkweb2.com/projects/prototype/detecting-event-support-without-browser-sniffing/
- var eventSupported = function( eventName ) {
- var el = document.createElement("div");
- eventName = "on" + eventName;
-
- // We only care about the case where non-standard event systems
- // are used, namely in IE. Short-circuiting here helps us to
- // avoid an eval call (in setAttribute) which can cause CSP
- // to go haywire. See: https://developer.mozilla.org/en/Security/CSP
- if ( !el.attachEvent ) {
- return true;
- }
-
- var isSupported = (eventName in el);
- if ( !isSupported ) {
- el.setAttribute(eventName, "return;");
- isSupported = typeof el[eventName] === "function";
- }
- el = null;
-
- return isSupported;
- };
-
- jQuery.support.submitBubbles = eventSupported("submit");
- jQuery.support.changeBubbles = eventSupported("change");
-
- // release memory in IE
- div = all = a = null;
-})();
-
-
-
-var rbrace = /^(?:\{.*\}|\[.*\])$/;
-
-jQuery.extend({
- cache: {},
-
- // Please use with caution
- uuid: 0,
-
- // Unique for each copy of jQuery on the page
- // Non-digits removed to match rinlinejQuery
- expando: "jQuery" + ( jQuery.fn.jquery + Math.random() ).replace( /\D/g, "" ),
-
- // The following elements throw uncatchable exceptions if you
- // attempt to add expando properties to them.
- noData: {
- "embed": true,
- // Ban all objects except for Flash (which handle expandos)
- "object": "clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",
- "applet": true
- },
-
- hasData: function( elem ) {
- elem = elem.nodeType ? jQuery.cache[ elem[jQuery.expando] ] : elem[ jQuery.expando ];
-
- return !!elem && !jQuery.isEmptyObject(elem);
- },
-
- data: function( elem, name, data, pvt /* Internal Use Only */ ) {
- if ( !jQuery.acceptData( elem ) ) {
- return;
- }
-
- var internalKey = jQuery.expando, getByName = typeof name === "string", thisCache,
-
- // We have to handle DOM nodes and JS objects differently because IE6-7
- // can't GC object references properly across the DOM-JS boundary
- isNode = elem.nodeType,
-
- // Only DOM nodes need the global jQuery cache; JS object data is
- // attached directly to the object so GC can occur automatically
- cache = isNode ? jQuery.cache : elem,
-
- // Only defining an ID for JS objects if its cache already exists allows
- // the code to shortcut on the same path as a DOM node with no cache
- id = isNode ? elem[ jQuery.expando ] : elem[ jQuery.expando ] && jQuery.expando;
-
- // Avoid doing any more work than we need to when trying to get data on an
- // object that has no data at all
- if ( (!id || (pvt && id && !cache[ id ][ internalKey ])) && getByName && data === undefined ) {
- return;
- }
-
- if ( !id ) {
- // Only DOM nodes need a new unique ID for each element since their data
- // ends up in the global cache
- if ( isNode ) {
- elem[ jQuery.expando ] = id = ++jQuery.uuid;
- } else {
- id = jQuery.expando;
- }
- }
-
- if ( !cache[ id ] ) {
- cache[ id ] = {};
- }
-
- // An object can be passed to jQuery.data instead of a key/value pair; this gets
- // shallow copied over onto the existing cache
- if ( typeof name === "object" ) {
- if ( pvt ) {
- cache[ id ][ internalKey ] = jQuery.extend(cache[ id ][ internalKey ], name);
- } else {
- cache[ id ] = jQuery.extend(cache[ id ], name);
- }
- }
-
- thisCache = cache[ id ];
-
- // Internal jQuery data is stored in a separate object inside the object's data
- // cache in order to avoid key collisions between internal data and user-defined
- // data
- if ( pvt ) {
- if ( !thisCache[ internalKey ] ) {
- thisCache[ internalKey ] = {};
- }
-
- thisCache = thisCache[ internalKey ];
- }
-
- if ( data !== undefined ) {
- thisCache[ name ] = data;
- }
-
- // TODO: This is a hack for 1.5 ONLY. It will be removed in 1.6. Users should
- // not attempt to inspect the internal events object using jQuery.data, as this
- // internal data object is undocumented and subject to change.
- if ( name === "events" && !thisCache[name] ) {
- return thisCache[ internalKey ] && thisCache[ internalKey ].events;
- }
-
- return getByName ? thisCache[ name ] : thisCache;
- },
-
- removeData: function( elem, name, pvt /* Internal Use Only */ ) {
- if ( !jQuery.acceptData( elem ) ) {
- return;
- }
-
- var internalKey = jQuery.expando, isNode = elem.nodeType,
-
- // See jQuery.data for more information
- cache = isNode ? jQuery.cache : elem,
-
- // See jQuery.data for more information
- id = isNode ? elem[ jQuery.expando ] : jQuery.expando;
-
- // If there is already no cache entry for this object, there is no
- // purpose in continuing
- if ( !cache[ id ] ) {
- return;
- }
-
- if ( name ) {
- var thisCache = pvt ? cache[ id ][ internalKey ] : cache[ id ];
-
- if ( thisCache ) {
- delete thisCache[ name ];
-
- // If there is no data left in the cache, we want to continue
- // and let the cache object itself get destroyed
- if ( !jQuery.isEmptyObject(thisCache) ) {
- return;
- }
- }
- }
-
- // See jQuery.data for more information
- if ( pvt ) {
- delete cache[ id ][ internalKey ];
-
- // Don't destroy the parent cache unless the internal data object
- // had been the only thing left in it
- if ( !jQuery.isEmptyObject(cache[ id ]) ) {
- return;
- }
- }
-
- var internalCache = cache[ id ][ internalKey ];
-
- // Browsers that fail expando deletion also refuse to delete expandos on
- // the window, but it will allow it on all other JS objects; other browsers
- // don't care
- if ( jQuery.support.deleteExpando || cache != window ) {
- delete cache[ id ];
- } else {
- cache[ id ] = null;
- }
-
- // We destroyed the entire user cache at once because it's faster than
- // iterating through each key, but we need to continue to persist internal
- // data if it existed
- if ( internalCache ) {
- cache[ id ] = {};
- cache[ id ][ internalKey ] = internalCache;
-
- // Otherwise, we need to eliminate the expando on the node to avoid
- // false lookups in the cache for entries that no longer exist
- } else if ( isNode ) {
- // IE does not allow us to delete expando properties from nodes,
- // nor does it have a removeAttribute function on Document nodes;
- // we must handle all of these cases
- if ( jQuery.support.deleteExpando ) {
- delete elem[ jQuery.expando ];
- } else if ( elem.removeAttribute ) {
- elem.removeAttribute( jQuery.expando );
- } else {
- elem[ jQuery.expando ] = null;
- }
- }
- },
-
- // For internal use only.
- _data: function( elem, name, data ) {
- return jQuery.data( elem, name, data, true );
- },
-
- // A method for determining if a DOM node can handle the data expando
- acceptData: function( elem ) {
- if ( elem.nodeName ) {
- var match = jQuery.noData[ elem.nodeName.toLowerCase() ];
-
- if ( match ) {
- return !(match === true || elem.getAttribute("classid") !== match);
- }
- }
-
- return true;
- }
-});
-
-jQuery.fn.extend({
- data: function( key, value ) {
- var data = null;
-
- if ( typeof key === "undefined" ) {
- if ( this.length ) {
- data = jQuery.data( this[0] );
-
- if ( this[0].nodeType === 1 ) {
- var attr = this[0].attributes, name;
- for ( var i = 0, l = attr.length; i < l; i++ ) {
- name = attr[i].name;
-
- if ( name.indexOf( "data-" ) === 0 ) {
- name = name.substr( 5 );
- dataAttr( this[0], name, data[ name ] );
- }
- }
- }
- }
-
- return data;
-
- } else if ( typeof key === "object" ) {
- return this.each(function() {
- jQuery.data( this, key );
- });
- }
-
- var parts = key.split(".");
- parts[1] = parts[1] ? "." + parts[1] : "";
-
- if ( value === undefined ) {
- data = this.triggerHandler("getData" + parts[1] + "!", [parts[0]]);
-
- // Try to fetch any internally stored data first
- if ( data === undefined && this.length ) {
- data = jQuery.data( this[0], key );
- data = dataAttr( this[0], key, data );
- }
-
- return data === undefined && parts[1] ?
- this.data( parts[0] ) :
- data;
-
- } else {
- return this.each(function() {
- var $this = jQuery( this ),
- args = [ parts[0], value ];
-
- $this.triggerHandler( "setData" + parts[1] + "!", args );
- jQuery.data( this, key, value );
- $this.triggerHandler( "changeData" + parts[1] + "!", args );
- });
- }
- },
-
- removeData: function( key ) {
- return this.each(function() {
- jQuery.removeData( this, key );
- });
- }
-});
-
-function dataAttr( elem, key, data ) {
- // If nothing was found internally, try to fetch any
- // data from the HTML5 data-* attribute
- if ( data === undefined && elem.nodeType === 1 ) {
- data = elem.getAttribute( "data-" + key );
-
- if ( typeof data === "string" ) {
- try {
- data = data === "true" ? true :
- data === "false" ? false :
- data === "null" ? null :
- !jQuery.isNaN( data ) ? parseFloat( data ) :
- rbrace.test( data ) ? jQuery.parseJSON( data ) :
- data;
- } catch( e ) {}
-
- // Make sure we set the data so it isn't changed later
- jQuery.data( elem, key, data );
-
- } else {
- data = undefined;
- }
- }
-
- return data;
-}
-
-
-
-
-jQuery.extend({
- queue: function( elem, type, data ) {
- if ( !elem ) {
- return;
- }
-
- type = (type || "fx") + "queue";
- var q = jQuery._data( elem, type );
-
- // Speed up dequeue by getting out quickly if this is just a lookup
- if ( !data ) {
- return q || [];
- }
-
- if ( !q || jQuery.isArray(data) ) {
- q = jQuery._data( elem, type, jQuery.makeArray(data) );
-
- } else {
- q.push( data );
- }
-
- return q;
- },
-
- dequeue: function( elem, type ) {
- type = type || "fx";
-
- var queue = jQuery.queue( elem, type ),
- fn = queue.shift();
-
- // If the fx queue is dequeued, always remove the progress sentinel
- if ( fn === "inprogress" ) {
- fn = queue.shift();
- }
-
- if ( fn ) {
- // Add a progress sentinel to prevent the fx queue from being
- // automatically dequeued
- if ( type === "fx" ) {
- queue.unshift("inprogress");
- }
-
- fn.call(elem, function() {
- jQuery.dequeue(elem, type);
- });
- }
-
- if ( !queue.length ) {
- jQuery.removeData( elem, type + "queue", true );
- }
- }
-});
-
-jQuery.fn.extend({
- queue: function( type, data ) {
- if ( typeof type !== "string" ) {
- data = type;
- type = "fx";
- }
-
- if ( data === undefined ) {
- return jQuery.queue( this[0], type );
- }
- return this.each(function( i ) {
- var queue = jQuery.queue( this, type, data );
-
- if ( type === "fx" && queue[0] !== "inprogress" ) {
- jQuery.dequeue( this, type );
- }
- });
- },
- dequeue: function( type ) {
- return this.each(function() {
- jQuery.dequeue( this, type );
- });
- },
-
- // Based off of the plugin by Clint Helfers, with permission.
- // http://blindsignals.com/index.php/2009/07/jquery-delay/
- delay: function( time, type ) {
- time = jQuery.fx ? jQuery.fx.speeds[time] || time : time;
- type = type || "fx";
-
- return this.queue( type, function() {
- var elem = this;
- setTimeout(function() {
- jQuery.dequeue( elem, type );
- }, time );
- });
- },
-
- clearQueue: function( type ) {
- return this.queue( type || "fx", [] );
- }
-});
-
-
-
-
-var rclass = /[\n\t\r]/g,
- rspaces = /\s+/,
- rreturn = /\r/g,
- rspecialurl = /^(?:href|src|style)$/,
- rtype = /^(?:button|input)$/i,
- rfocusable = /^(?:button|input|object|select|textarea)$/i,
- rclickable = /^a(?:rea)?$/i,
- rradiocheck = /^(?:radio|checkbox)$/i;
-
-jQuery.props = {
- "for": "htmlFor",
- "class": "className",
- readonly: "readOnly",
- maxlength: "maxLength",
- cellspacing: "cellSpacing",
- rowspan: "rowSpan",
- colspan: "colSpan",
- tabindex: "tabIndex",
- usemap: "useMap",
- frameborder: "frameBorder"
-};
-
-jQuery.fn.extend({
- attr: function( name, value ) {
- return jQuery.access( this, name, value, true, jQuery.attr );
- },
-
- removeAttr: function( name, fn ) {
- return this.each(function(){
- jQuery.attr( this, name, "" );
- if ( this.nodeType === 1 ) {
- this.removeAttribute( name );
- }
- });
- },
-
- addClass: function( value ) {
- if ( jQuery.isFunction(value) ) {
- return this.each(function(i) {
- var self = jQuery(this);
- self.addClass( value.call(this, i, self.attr("class")) );
- });
- }
-
- if ( value && typeof value === "string" ) {
- var classNames = (value || "").split( rspaces );
-
- for ( var i = 0, l = this.length; i < l; i++ ) {
- var elem = this[i];
-
- if ( elem.nodeType === 1 ) {
- if ( !elem.className ) {
- elem.className = value;
-
- } else {
- var className = " " + elem.className + " ",
- setClass = elem.className;
-
- for ( var c = 0, cl = classNames.length; c < cl; c++ ) {
- if ( className.indexOf( " " + classNames[c] + " " ) < 0 ) {
- setClass += " " + classNames[c];
- }
- }
- elem.className = jQuery.trim( setClass );
- }
- }
- }
- }
-
- return this;
- },
-
- removeClass: function( value ) {
- if ( jQuery.isFunction(value) ) {
- return this.each(function(i) {
- var self = jQuery(this);
- self.removeClass( value.call(this, i, self.attr("class")) );
- });
- }
-
- if ( (value && typeof value === "string") || value === undefined ) {
- var classNames = (value || "").split( rspaces );
-
- for ( var i = 0, l = this.length; i < l; i++ ) {
- var elem = this[i];
-
- if ( elem.nodeType === 1 && elem.className ) {
- if ( value ) {
- var className = (" " + elem.className + " ").replace(rclass, " ");
- for ( var c = 0, cl = classNames.length; c < cl; c++ ) {
- className = className.replace(" " + classNames[c] + " ", " ");
- }
- elem.className = jQuery.trim( className );
-
- } else {
- elem.className = "";
- }
- }
- }
- }
-
- return this;
- },
-
- toggleClass: function( value, stateVal ) {
- var type = typeof value,
- isBool = typeof stateVal === "boolean";
-
- if ( jQuery.isFunction( value ) ) {
- return this.each(function(i) {
- var self = jQuery(this);
- self.toggleClass( value.call(this, i, self.attr("class"), stateVal), stateVal );
- });
- }
-
- return this.each(function() {
- if ( type === "string" ) {
- // toggle individual class names
- var className,
- i = 0,
- self = jQuery( this ),
- state = stateVal,
- classNames = value.split( rspaces );
-
- while ( (className = classNames[ i++ ]) ) {
- // check each className given, space seperated list
- state = isBool ? state : !self.hasClass( className );
- self[ state ? "addClass" : "removeClass" ]( className );
- }
-
- } else if ( type === "undefined" || type === "boolean" ) {
- if ( this.className ) {
- // store className if set
- jQuery._data( this, "__className__", this.className );
- }
-
- // toggle whole className
- this.className = this.className || value === false ? "" : jQuery._data( this, "__className__" ) || "";
- }
- });
- },
-
- hasClass: function( selector ) {
- var className = " " + selector + " ";
- for ( var i = 0, l = this.length; i < l; i++ ) {
- if ( (" " + this[i].className + " ").replace(rclass, " ").indexOf( className ) > -1 ) {
- return true;
- }
- }
-
- return false;
- },
-
- val: function( value ) {
- if ( !arguments.length ) {
- var elem = this[0];
-
- if ( elem ) {
- if ( jQuery.nodeName( elem, "option" ) ) {
- // attributes.value is undefined in Blackberry 4.7 but
- // uses .value. See #6932
- var val = elem.attributes.value;
- return !val || val.specified ? elem.value : elem.text;
- }
-
- // We need to handle select boxes special
- if ( jQuery.nodeName( elem, "select" ) ) {
- var index = elem.selectedIndex,
- values = [],
- options = elem.options,
- one = elem.type === "select-one";
-
- // Nothing was selected
- if ( index < 0 ) {
- return null;
- }
-
- // Loop through all the selected options
- for ( var i = one ? index : 0, max = one ? index + 1 : options.length; i < max; i++ ) {
- var option = options[ i ];
-
- // Don't return options that are disabled or in a disabled optgroup
- if ( option.selected && (jQuery.support.optDisabled ? !option.disabled : option.getAttribute("disabled") === null) &&
- (!option.parentNode.disabled || !jQuery.nodeName( option.parentNode, "optgroup" )) ) {
-
- // Get the specific value for the option
- value = jQuery(option).val();
-
- // We don't need an array for one selects
- if ( one ) {
- return value;
- }
-
- // Multi-Selects return an array
- values.push( value );
- }
- }
-
- return values;
- }
-
- // Handle the case where in Webkit "" is returned instead of "on" if a value isn't specified
- if ( rradiocheck.test( elem.type ) && !jQuery.support.checkOn ) {
- return elem.getAttribute("value") === null ? "on" : elem.value;
- }
-
- // Everything else, we just grab the value
- return (elem.value || "").replace(rreturn, "");
-
- }
-
- return undefined;
- }
-
- var isFunction = jQuery.isFunction(value);
-
- return this.each(function(i) {
- var self = jQuery(this), val = value;
-
- if ( this.nodeType !== 1 ) {
- return;
- }
-
- if ( isFunction ) {
- val = value.call(this, i, self.val());
- }
-
- // Treat null/undefined as ""; convert numbers to string
- if ( val == null ) {
- val = "";
- } else if ( typeof val === "number" ) {
- val += "";
- } else if ( jQuery.isArray(val) ) {
- val = jQuery.map(val, function (value) {
- return value == null ? "" : value + "";
- });
- }
-
- if ( jQuery.isArray(val) && rradiocheck.test( this.type ) ) {
- this.checked = jQuery.inArray( self.val(), val ) >= 0;
-
- } else if ( jQuery.nodeName( this, "select" ) ) {
- var values = jQuery.makeArray(val);
-
- jQuery( "option", this ).each(function() {
- this.selected = jQuery.inArray( jQuery(this).val(), values ) >= 0;
- });
-
- if ( !values.length ) {
- this.selectedIndex = -1;
- }
-
- } else {
- this.value = val;
- }
- });
- }
-});
-
-jQuery.extend({
- attrFn: {
- val: true,
- css: true,
- html: true,
- text: true,
- data: true,
- width: true,
- height: true,
- offset: true
- },
-
- attr: function( elem, name, value, pass ) {
- // don't get/set attributes on text, comment and attribute nodes
- if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || elem.nodeType === 2 ) {
- return undefined;
- }
-
- if ( pass && name in jQuery.attrFn ) {
- return jQuery(elem)[name](value);
- }
-
- var notxml = elem.nodeType !== 1 || !jQuery.isXMLDoc( elem ),
- // Whether we are setting (or getting)
- set = value !== undefined;
-
- // Try to normalize/fix the name
- name = notxml && jQuery.props[ name ] || name;
-
- // Only do all the following if this is a node (faster for style)
- if ( elem.nodeType === 1 ) {
- // These attributes require special treatment
- var special = rspecialurl.test( name );
-
- // Safari mis-reports the default selected property of an option
- // Accessing the parent's selectedIndex property fixes it
- if ( name === "selected" && !jQuery.support.optSelected ) {
- var parent = elem.parentNode;
- if ( parent ) {
- parent.selectedIndex;
-
- // Make sure that it also works with optgroups, see #5701
- if ( parent.parentNode ) {
- parent.parentNode.selectedIndex;
- }
- }
- }
-
- // If applicable, access the attribute via the DOM 0 way
- // 'in' checks fail in Blackberry 4.7 #6931
- if ( (name in elem || elem[ name ] !== undefined) && notxml && !special ) {
- if ( set ) {
- // We can't allow the type property to be changed (since it causes problems in IE)
- if ( name === "type" && rtype.test( elem.nodeName ) && elem.parentNode ) {
- jQuery.error( "type property can't be changed" );
- }
-
- if ( value === null ) {
- if ( elem.nodeType === 1 ) {
- elem.removeAttribute( name );
- }
-
- } else {
- elem[ name ] = value;
- }
- }
-
- // browsers index elements by id/name on forms, give priority to attributes.
- if ( jQuery.nodeName( elem, "form" ) && elem.getAttributeNode(name) ) {
- return elem.getAttributeNode( name ).nodeValue;
- }
-
- // elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set
- // http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/
- if ( name === "tabIndex" ) {
- var attributeNode = elem.getAttributeNode( "tabIndex" );
-
- return attributeNode && attributeNode.specified ?
- attributeNode.value :
- rfocusable.test( elem.nodeName ) || rclickable.test( elem.nodeName ) && elem.href ?
- 0 :
- undefined;
- }
-
- return elem[ name ];
- }
-
- if ( !jQuery.support.style && notxml && name === "style" ) {
- if ( set ) {
- elem.style.cssText = "" + value;
- }
-
- return elem.style.cssText;
- }
-
- if ( set ) {
- // convert the value to a string (all browsers do this but IE) see #1070
- elem.setAttribute( name, "" + value );
- }
-
- // Ensure that missing attributes return undefined
- // Blackberry 4.7 returns "" from getAttribute #6938
- if ( !elem.attributes[ name ] && (elem.hasAttribute && !elem.hasAttribute( name )) ) {
- return undefined;
- }
-
- var attr = !jQuery.support.hrefNormalized && notxml && special ?
- // Some attributes require a special call on IE
- elem.getAttribute( name, 2 ) :
- elem.getAttribute( name );
-
- // Non-existent attributes return null, we normalize to undefined
- return attr === null ? undefined : attr;
- }
- // Handle everything which isn't a DOM element node
- if ( set ) {
- elem[ name ] = value;
- }
- return elem[ name ];
- }
-});
-
-
-
-
-var rnamespaces = /\.(.*)$/,
- rformElems = /^(?:textarea|input|select)$/i,
- rperiod = /\./g,
- rspace = / /g,
- rescape = /[^\w\s.|`]/g,
- fcleanup = function( nm ) {
- return nm.replace(rescape, "\\$&");
- },
- eventKey = "events";
-
-/*
- * A number of helper functions used for managing events.
- * Many of the ideas behind this code originated from
- * Dean Edwards' addEvent library.
- */
-jQuery.event = {
-
- // Bind an event to an element
- // Original by Dean Edwards
- add: function( elem, types, handler, data ) {
- if ( elem.nodeType === 3 || elem.nodeType === 8 ) {
- return;
- }
-
- // For whatever reason, IE has trouble passing the window object
- // around, causing it to be cloned in the process
- if ( jQuery.isWindow( elem ) && ( elem !== window && !elem.frameElement ) ) {
- elem = window;
- }
-
- if ( handler === false ) {
- handler = returnFalse;
- } else if ( !handler ) {
- // Fixes bug #7229. Fix recommended by jdalton
- return;
- }
-
- var handleObjIn, handleObj;
-
- if ( handler.handler ) {
- handleObjIn = handler;
- handler = handleObjIn.handler;
- }
-
- // Make sure that the function being executed has a unique ID
- if ( !handler.guid ) {
- handler.guid = jQuery.guid++;
- }
-
- // Init the element's event structure
- var elemData = jQuery._data( elem );
-
- // If no elemData is found then we must be trying to bind to one of the
- // banned noData elements
- if ( !elemData ) {
- return;
- }
-
- var events = elemData[ eventKey ],
- eventHandle = elemData.handle;
-
- if ( typeof events === "function" ) {
- // On plain objects events is a fn that holds the the data
- // which prevents this data from being JSON serialized
- // the function does not need to be called, it just contains the data
- eventHandle = events.handle;
- events = events.events;
-
- } else if ( !events ) {
- if ( !elem.nodeType ) {
- // On plain objects, create a fn that acts as the holder
- // of the values to avoid JSON serialization of event data
- elemData[ eventKey ] = elemData = function(){};
- }
-
- elemData.events = events = {};
- }
-
- if ( !eventHandle ) {
- elemData.handle = eventHandle = function() {
- // Handle the second event of a trigger and when
- // an event is called after a page has unloaded
- return typeof jQuery !== "undefined" && !jQuery.event.triggered ?
- jQuery.event.handle.apply( eventHandle.elem, arguments ) :
- undefined;
- };
- }
-
- // Add elem as a property of the handle function
- // This is to prevent a memory leak with non-native events in IE.
- eventHandle.elem = elem;
-
- // Handle multiple events separated by a space
- // jQuery(...).bind("mouseover mouseout", fn);
- types = types.split(" ");
-
- var type, i = 0, namespaces;
-
- while ( (type = types[ i++ ]) ) {
- handleObj = handleObjIn ?
- jQuery.extend({}, handleObjIn) :
- { handler: handler, data: data };
-
- // Namespaced event handlers
- if ( type.indexOf(".") > -1 ) {
- namespaces = type.split(".");
- type = namespaces.shift();
- handleObj.namespace = namespaces.slice(0).sort().join(".");
-
- } else {
- namespaces = [];
- handleObj.namespace = "";
- }
-
- handleObj.type = type;
- if ( !handleObj.guid ) {
- handleObj.guid = handler.guid;
- }
-
- // Get the current list of functions bound to this event
- var handlers = events[ type ],
- special = jQuery.event.special[ type ] || {};
-
- // Init the event handler queue
- if ( !handlers ) {
- handlers = events[ type ] = [];
-
- // Check for a special event handler
- // Only use addEventListener/attachEvent if the special
- // events handler returns false
- if ( !special.setup || special.setup.call( elem, data, namespaces, eventHandle ) === false ) {
- // Bind the global event handler to the element
- if ( elem.addEventListener ) {
- elem.addEventListener( type, eventHandle, false );
-
- } else if ( elem.attachEvent ) {
- elem.attachEvent( "on" + type, eventHandle );
- }
- }
- }
-
- if ( special.add ) {
- special.add.call( elem, handleObj );
-
- if ( !handleObj.handler.guid ) {
- handleObj.handler.guid = handler.guid;
- }
- }
-
- // Add the function to the element's handler list
- handlers.push( handleObj );
-
- // Keep track of which events have been used, for global triggering
- jQuery.event.global[ type ] = true;
- }
-
- // Nullify elem to prevent memory leaks in IE
- elem = null;
- },
-
- global: {},
-
- // Detach an event or set of events from an element
- remove: function( elem, types, handler, pos ) {
- // don't do events on text and comment nodes
- if ( elem.nodeType === 3 || elem.nodeType === 8 ) {
- return;
- }
-
- if ( handler === false ) {
- handler = returnFalse;
- }
-
- var ret, type, fn, j, i = 0, all, namespaces, namespace, special, eventType, handleObj, origType,
- elemData = jQuery.hasData( elem ) && jQuery._data( elem ),
- events = elemData && elemData[ eventKey ];
-
- if ( !elemData || !events ) {
- return;
- }
-
- if ( typeof events === "function" ) {
- elemData = events;
- events = events.events;
- }
-
- // types is actually an event object here
- if ( types && types.type ) {
- handler = types.handler;
- types = types.type;
- }
-
- // Unbind all events for the element
- if ( !types || typeof types === "string" && types.charAt(0) === "." ) {
- types = types || "";
-
- for ( type in events ) {
- jQuery.event.remove( elem, type + types );
- }
-
- return;
- }
-
- // Handle multiple events separated by a space
- // jQuery(...).unbind("mouseover mouseout", fn);
- types = types.split(" ");
-
- while ( (type = types[ i++ ]) ) {
- origType = type;
- handleObj = null;
- all = type.indexOf(".") < 0;
- namespaces = [];
-
- if ( !all ) {
- // Namespaced event handlers
- namespaces = type.split(".");
- type = namespaces.shift();
-
- namespace = new RegExp("(^|\\.)" +
- jQuery.map( namespaces.slice(0).sort(), fcleanup ).join("\\.(?:.*\\.)?") + "(\\.|$)");
- }
-
- eventType = events[ type ];
-
- if ( !eventType ) {
- continue;
- }
-
- if ( !handler ) {
- for ( j = 0; j < eventType.length; j++ ) {
- handleObj = eventType[ j ];
-
- if ( all || namespace.test( handleObj.namespace ) ) {
- jQuery.event.remove( elem, origType, handleObj.handler, j );
- eventType.splice( j--, 1 );
- }
- }
-
- continue;
- }
-
- special = jQuery.event.special[ type ] || {};
-
- for ( j = pos || 0; j < eventType.length; j++ ) {
- handleObj = eventType[ j ];
-
- if ( handler.guid === handleObj.guid ) {
- // remove the given handler for the given type
- if ( all || namespace.test( handleObj.namespace ) ) {
- if ( pos == null ) {
- eventType.splice( j--, 1 );
- }
-
- if ( special.remove ) {
- special.remove.call( elem, handleObj );
- }
- }
-
- if ( pos != null ) {
- break;
- }
- }
- }
-
- // remove generic event handler if no more handlers exist
- if ( eventType.length === 0 || pos != null && eventType.length === 1 ) {
- if ( !special.teardown || special.teardown.call( elem, namespaces ) === false ) {
- jQuery.removeEvent( elem, type, elemData.handle );
- }
-
- ret = null;
- delete events[ type ];
- }
- }
-
- // Remove the expando if it's no longer used
- if ( jQuery.isEmptyObject( events ) ) {
- var handle = elemData.handle;
- if ( handle ) {
- handle.elem = null;
- }
-
- delete elemData.events;
- delete elemData.handle;
-
- if ( typeof elemData === "function" ) {
- jQuery.removeData( elem, eventKey, true );
-
- } else if ( jQuery.isEmptyObject( elemData ) ) {
- jQuery.removeData( elem, undefined, true );
- }
- }
- },
-
- // bubbling is internal
- trigger: function( event, data, elem /*, bubbling */ ) {
- // Event object or event type
- var type = event.type || event,
- bubbling = arguments[3];
-
- if ( !bubbling ) {
- event = typeof event === "object" ?
- // jQuery.Event object
- event[ jQuery.expando ] ? event :
- // Object literal
- jQuery.extend( jQuery.Event(type), event ) :
- // Just the event type (string)
- jQuery.Event(type);
-
- if ( type.indexOf("!") >= 0 ) {
- event.type = type = type.slice(0, -1);
- event.exclusive = true;
- }
-
- // Handle a global trigger
- if ( !elem ) {
- // Don't bubble custom events when global (to avoid too much overhead)
- event.stopPropagation();
-
- // Only trigger if we've ever bound an event for it
- if ( jQuery.event.global[ type ] ) {
- // XXX This code smells terrible. event.js should not be directly
- // inspecting the data cache
- jQuery.each( jQuery.cache, function() {
- // internalKey variable is just used to make it easier to find
- // and potentially change this stuff later; currently it just
- // points to jQuery.expando
- var internalKey = jQuery.expando,
- internalCache = this[ internalKey ];
- if ( internalCache && internalCache.events && internalCache.events[type] ) {
- jQuery.event.trigger( event, data, internalCache.handle.elem );
- }
- });
- }
- }
-
- // Handle triggering a single element
-
- // don't do events on text and comment nodes
- if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 ) {
- return undefined;
- }
-
- // Clean up in case it is reused
- event.result = undefined;
- event.target = elem;
-
- // Clone the incoming data, if any
- data = jQuery.makeArray( data );
- data.unshift( event );
- }
-
- event.currentTarget = elem;
-
- // Trigger the event, it is assumed that "handle" is a function
- var handle = elem.nodeType ?
- jQuery._data( elem, "handle" ) :
- (jQuery._data( elem, eventKey ) || {}).handle;
-
- if ( handle ) {
- handle.apply( elem, data );
- }
-
- var parent = elem.parentNode || elem.ownerDocument;
-
- // Trigger an inline bound script
- try {
- if ( !(elem && elem.nodeName && jQuery.noData[elem.nodeName.toLowerCase()]) ) {
- if ( elem[ "on" + type ] && elem[ "on" + type ].apply( elem, data ) === false ) {
- event.result = false;
- event.preventDefault();
- }
- }
-
- // prevent IE from throwing an error for some elements with some event types, see #3533
- } catch (inlineError) {}
-
- if ( !event.isPropagationStopped() && parent ) {
- jQuery.event.trigger( event, data, parent, true );
-
- } else if ( !event.isDefaultPrevented() ) {
- var old,
- target = event.target,
- targetType = type.replace( rnamespaces, "" ),
- isClick = jQuery.nodeName( target, "a" ) && targetType === "click",
- special = jQuery.event.special[ targetType ] || {};
-
- if ( (!special._default || special._default.call( elem, event ) === false) &&
- !isClick && !(target && target.nodeName && jQuery.noData[target.nodeName.toLowerCase()]) ) {
-
- try {
- if ( target[ targetType ] ) {
- // Make sure that we don't accidentally re-trigger the onFOO events
- old = target[ "on" + targetType ];
-
- if ( old ) {
- target[ "on" + targetType ] = null;
- }
-
- jQuery.event.triggered = true;
- target[ targetType ]();
- }
-
- // prevent IE from throwing an error for some elements with some event types, see #3533
- } catch (triggerError) {}
-
- if ( old ) {
- target[ "on" + targetType ] = old;
- }
-
- jQuery.event.triggered = false;
- }
- }
- },
-
- handle: function( event ) {
- var all, handlers, namespaces, namespace_re, events,
- namespace_sort = [],
- args = jQuery.makeArray( arguments );
-
- event = args[0] = jQuery.event.fix( event || window.event );
- event.currentTarget = this;
-
- // Namespaced event handlers
- all = event.type.indexOf(".") < 0 && !event.exclusive;
-
- if ( !all ) {
- namespaces = event.type.split(".");
- event.type = namespaces.shift();
- namespace_sort = namespaces.slice(0).sort();
- namespace_re = new RegExp("(^|\\.)" + namespace_sort.join("\\.(?:.*\\.)?") + "(\\.|$)");
- }
-
- event.namespace = event.namespace || namespace_sort.join(".");
-
- events = jQuery._data(this, eventKey);
-
- if ( typeof events === "function" ) {
- events = events.events;
- }
-
- handlers = (events || {})[ event.type ];
-
- if ( events && handlers ) {
- // Clone the handlers to prevent manipulation
- handlers = handlers.slice(0);
-
- for ( var j = 0, l = handlers.length; j < l; j++ ) {
- var handleObj = handlers[ j ];
-
- // Filter the functions by class
- if ( all || namespace_re.test( handleObj.namespace ) ) {
- // Pass in a reference to the handler function itself
- // So that we can later remove it
- event.handler = handleObj.handler;
- event.data = handleObj.data;
- event.handleObj = handleObj;
-
- var ret = handleObj.handler.apply( this, args );
-
- if ( ret !== undefined ) {
- event.result = ret;
- if ( ret === false ) {
- event.preventDefault();
- event.stopPropagation();
- }
- }
-
- if ( event.isImmediatePropagationStopped() ) {
- break;
- }
- }
- }
- }
-
- return event.result;
- },
-
- props: "altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode layerX layerY metaKey newValue offsetX offsetY pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "),
-
- fix: function( event ) {
- if ( event[ jQuery.expando ] ) {
- return event;
- }
-
- // store a copy of the original event object
- // and "clone" to set read-only properties
- var originalEvent = event;
- event = jQuery.Event( originalEvent );
-
- for ( var i = this.props.length, prop; i; ) {
- prop = this.props[ --i ];
- event[ prop ] = originalEvent[ prop ];
- }
-
- // Fix target property, if necessary
- if ( !event.target ) {
- // Fixes #1925 where srcElement might not be defined either
- event.target = event.srcElement || document;
- }
-
- // check if target is a textnode (safari)
- if ( event.target.nodeType === 3 ) {
- event.target = event.target.parentNode;
- }
-
- // Add relatedTarget, if necessary
- if ( !event.relatedTarget && event.fromElement ) {
- event.relatedTarget = event.fromElement === event.target ? event.toElement : event.fromElement;
- }
-
- // Calculate pageX/Y if missing and clientX/Y available
- if ( event.pageX == null && event.clientX != null ) {
- var doc = document.documentElement,
- body = document.body;
-
- event.pageX = event.clientX + (doc && doc.scrollLeft || body && body.scrollLeft || 0) - (doc && doc.clientLeft || body && body.clientLeft || 0);
- event.pageY = event.clientY + (doc && doc.scrollTop || body && body.scrollTop || 0) - (doc && doc.clientTop || body && body.clientTop || 0);
- }
-
- // Add which for key events
- if ( event.which == null && (event.charCode != null || event.keyCode != null) ) {
- event.which = event.charCode != null ? event.charCode : event.keyCode;
- }
-
- // Add metaKey to non-Mac browsers (use ctrl for PC's and Meta for Macs)
- if ( !event.metaKey && event.ctrlKey ) {
- event.metaKey = event.ctrlKey;
- }
-
- // Add which for click: 1 === left; 2 === middle; 3 === right
- // Note: button is not normalized, so don't use it
- if ( !event.which && event.button !== undefined ) {
- event.which = (event.button & 1 ? 1 : ( event.button & 2 ? 3 : ( event.button & 4 ? 2 : 0 ) ));
- }
-
- return event;
- },
-
- // Deprecated, use jQuery.guid instead
- guid: 1E8,
-
- // Deprecated, use jQuery.proxy instead
- proxy: jQuery.proxy,
-
- special: {
- ready: {
- // Make sure the ready event is setup
- setup: jQuery.bindReady,
- teardown: jQuery.noop
- },
-
- live: {
- add: function( handleObj ) {
- jQuery.event.add( this,
- liveConvert( handleObj.origType, handleObj.selector ),
- jQuery.extend({}, handleObj, {handler: liveHandler, guid: handleObj.handler.guid}) );
- },
-
- remove: function( handleObj ) {
- jQuery.event.remove( this, liveConvert( handleObj.origType, handleObj.selector ), handleObj );
- }
- },
-
- beforeunload: {
- setup: function( data, namespaces, eventHandle ) {
- // We only want to do this special case on windows
- if ( jQuery.isWindow( this ) ) {
- this.onbeforeunload = eventHandle;
- }
- },
-
- teardown: function( namespaces, eventHandle ) {
- if ( this.onbeforeunload === eventHandle ) {
- this.onbeforeunload = null;
- }
- }
- }
- }
-};
-
-jQuery.removeEvent = document.removeEventListener ?
- function( elem, type, handle ) {
- if ( elem.removeEventListener ) {
- elem.removeEventListener( type, handle, false );
- }
- } :
- function( elem, type, handle ) {
- if ( elem.detachEvent ) {
- elem.detachEvent( "on" + type, handle );
- }
- };
-
-jQuery.Event = function( src ) {
- // Allow instantiation without the 'new' keyword
- if ( !this.preventDefault ) {
- return new jQuery.Event( src );
- }
-
- // Event object
- if ( src && src.type ) {
- this.originalEvent = src;
- this.type = src.type;
-
- // Events bubbling up the document may have been marked as prevented
- // by a handler lower down the tree; reflect the correct value.
- this.isDefaultPrevented = (src.defaultPrevented || src.returnValue === false ||
- src.getPreventDefault && src.getPreventDefault()) ? returnTrue : returnFalse;
-
- // Event type
- } else {
- this.type = src;
- }
-
- // timeStamp is buggy for some events on Firefox(#3843)
- // So we won't rely on the native value
- this.timeStamp = jQuery.now();
-
- // Mark it as fixed
- this[ jQuery.expando ] = true;
-};
-
-function returnFalse() {
- return false;
-}
-function returnTrue() {
- return true;
-}
-
-// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding
-// http://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html
-jQuery.Event.prototype = {
- preventDefault: function() {
- this.isDefaultPrevented = returnTrue;
-
- var e = this.originalEvent;
- if ( !e ) {
- return;
- }
-
- // if preventDefault exists run it on the original event
- if ( e.preventDefault ) {
- e.preventDefault();
-
- // otherwise set the returnValue property of the original event to false (IE)
- } else {
- e.returnValue = false;
- }
- },
- stopPropagation: function() {
- this.isPropagationStopped = returnTrue;
-
- var e = this.originalEvent;
- if ( !e ) {
- return;
- }
- // if stopPropagation exists run it on the original event
- if ( e.stopPropagation ) {
- e.stopPropagation();
- }
- // otherwise set the cancelBubble property of the original event to true (IE)
- e.cancelBubble = true;
- },
- stopImmediatePropagation: function() {
- this.isImmediatePropagationStopped = returnTrue;
- this.stopPropagation();
- },
- isDefaultPrevented: returnFalse,
- isPropagationStopped: returnFalse,
- isImmediatePropagationStopped: returnFalse
-};
-
-// Checks if an event happened on an element within another element
-// Used in jQuery.event.special.mouseenter and mouseleave handlers
-var withinElement = function( event ) {
- // Check if mouse(over|out) are still within the same parent element
- var parent = event.relatedTarget;
-
- // Firefox sometimes assigns relatedTarget a XUL element
- // which we cannot access the parentNode property of
- try {
- // Traverse up the tree
- while ( parent && parent !== this ) {
- parent = parent.parentNode;
- }
-
- if ( parent !== this ) {
- // set the correct event type
- event.type = event.data;
-
- // handle event if we actually just moused on to a non sub-element
- jQuery.event.handle.apply( this, arguments );
- }
-
- // assuming we've left the element since we most likely mousedover a xul element
- } catch(e) { }
-},
-
-// In case of event delegation, we only need to rename the event.type,
-// liveHandler will take care of the rest.
-delegate = function( event ) {
- event.type = event.data;
- jQuery.event.handle.apply( this, arguments );
-};
-
-// Create mouseenter and mouseleave events
-jQuery.each({
- mouseenter: "mouseover",
- mouseleave: "mouseout"
-}, function( orig, fix ) {
- jQuery.event.special[ orig ] = {
- setup: function( data ) {
- jQuery.event.add( this, fix, data && data.selector ? delegate : withinElement, orig );
- },
- teardown: function( data ) {
- jQuery.event.remove( this, fix, data && data.selector ? delegate : withinElement );
- }
- };
-});
-
-// submit delegation
-if ( !jQuery.support.submitBubbles ) {
-
- jQuery.event.special.submit = {
- setup: function( data, namespaces ) {
- if ( this.nodeName && this.nodeName.toLowerCase() !== "form" ) {
- jQuery.event.add(this, "click.specialSubmit", function( e ) {
- var elem = e.target,
- type = elem.type;
-
- if ( (type === "submit" || type === "image") && jQuery( elem ).closest("form").length ) {
- e.liveFired = undefined;
- return trigger( "submit", this, arguments );
- }
- });
-
- jQuery.event.add(this, "keypress.specialSubmit", function( e ) {
- var elem = e.target,
- type = elem.type;
-
- if ( (type === "text" || type === "password") && jQuery( elem ).closest("form").length && e.keyCode === 13 ) {
- e.liveFired = undefined;
- return trigger( "submit", this, arguments );
- }
- });
-
- } else {
- return false;
- }
- },
-
- teardown: function( namespaces ) {
- jQuery.event.remove( this, ".specialSubmit" );
- }
- };
-
-}
-
-// change delegation, happens here so we have bind.
-if ( !jQuery.support.changeBubbles ) {
-
- var changeFilters,
-
- getVal = function( elem ) {
- var type = elem.type, val = elem.value;
-
- if ( type === "radio" || type === "checkbox" ) {
- val = elem.checked;
-
- } else if ( type === "select-multiple" ) {
- val = elem.selectedIndex > -1 ?
- jQuery.map( elem.options, function( elem ) {
- return elem.selected;
- }).join("-") :
- "";
-
- } else if ( elem.nodeName.toLowerCase() === "select" ) {
- val = elem.selectedIndex;
- }
-
- return val;
- },
-
- testChange = function testChange( e ) {
- var elem = e.target, data, val;
-
- if ( !rformElems.test( elem.nodeName ) || elem.readOnly ) {
- return;
- }
-
- data = jQuery._data( elem, "_change_data" );
- val = getVal(elem);
-
- // the current data will be also retrieved by beforeactivate
- if ( e.type !== "focusout" || elem.type !== "radio" ) {
- jQuery._data( elem, "_change_data", val );
- }
-
- if ( data === undefined || val === data ) {
- return;
- }
-
- if ( data != null || val ) {
- e.type = "change";
- e.liveFired = undefined;
- return jQuery.event.trigger( e, arguments[1], elem );
- }
- };
-
- jQuery.event.special.change = {
- filters: {
- focusout: testChange,
-
- beforedeactivate: testChange,
-
- click: function( e ) {
- var elem = e.target, type = elem.type;
-
- if ( type === "radio" || type === "checkbox" || elem.nodeName.toLowerCase() === "select" ) {
- return testChange.call( this, e );
- }
- },
-
- // Change has to be called before submit
- // Keydown will be called before keypress, which is used in submit-event delegation
- keydown: function( e ) {
- var elem = e.target, type = elem.type;
-
- if ( (e.keyCode === 13 && elem.nodeName.toLowerCase() !== "textarea") ||
- (e.keyCode === 32 && (type === "checkbox" || type === "radio")) ||
- type === "select-multiple" ) {
- return testChange.call( this, e );
- }
- },
-
- // Beforeactivate happens also before the previous element is blurred
- // with this event you can't trigger a change event, but you can store
- // information
- beforeactivate: function( e ) {
- var elem = e.target;
- jQuery._data( elem, "_change_data", getVal(elem) );
- }
- },
-
- setup: function( data, namespaces ) {
- if ( this.type === "file" ) {
- return false;
- }
-
- for ( var type in changeFilters ) {
- jQuery.event.add( this, type + ".specialChange", changeFilters[type] );
- }
-
- return rformElems.test( this.nodeName );
- },
-
- teardown: function( namespaces ) {
- jQuery.event.remove( this, ".specialChange" );
-
- return rformElems.test( this.nodeName );
- }
- };
-
- changeFilters = jQuery.event.special.change.filters;
-
- // Handle when the input is .focus()'d
- changeFilters.focus = changeFilters.beforeactivate;
-}
-
-function trigger( type, elem, args ) {
- args[0].type = type;
- return jQuery.event.handle.apply( elem, args );
-}
-
-// Create "bubbling" focus and blur events
-if ( document.addEventListener ) {
- jQuery.each({ focus: "focusin", blur: "focusout" }, function( orig, fix ) {
- jQuery.event.special[ fix ] = {
- setup: function() {
- this.addEventListener( orig, handler, true );
- },
- teardown: function() {
- this.removeEventListener( orig, handler, true );
- }
- };
-
- function handler( e ) {
- e = jQuery.event.fix( e );
- e.type = fix;
- return jQuery.event.handle.call( this, e );
- }
- });
-}
-
-jQuery.each(["bind", "one"], function( i, name ) {
- jQuery.fn[ name ] = function( type, data, fn ) {
- // Handle object literals
- if ( typeof type === "object" ) {
- for ( var key in type ) {
- this[ name ](key, data, type[key], fn);
- }
- return this;
- }
-
- if ( jQuery.isFunction( data ) || data === false ) {
- fn = data;
- data = undefined;
- }
-
- var handler = name === "one" ? jQuery.proxy( fn, function( event ) {
- jQuery( this ).unbind( event, handler );
- return fn.apply( this, arguments );
- }) : fn;
-
- if ( type === "unload" && name !== "one" ) {
- this.one( type, data, fn );
-
- } else {
- for ( var i = 0, l = this.length; i < l; i++ ) {
- jQuery.event.add( this[i], type, handler, data );
- }
- }
-
- return this;
- };
-});
-
-jQuery.fn.extend({
- unbind: function( type, fn ) {
- // Handle object literals
- if ( typeof type === "object" && !type.preventDefault ) {
- for ( var key in type ) {
- this.unbind(key, type[key]);
- }
-
- } else {
- for ( var i = 0, l = this.length; i < l; i++ ) {
- jQuery.event.remove( this[i], type, fn );
- }
- }
-
- return this;
- },
-
- delegate: function( selector, types, data, fn ) {
- return this.live( types, data, fn, selector );
- },
-
- undelegate: function( selector, types, fn ) {
- if ( arguments.length === 0 ) {
- return this.unbind( "live" );
-
- } else {
- return this.die( types, null, fn, selector );
- }
- },
-
- trigger: function( type, data ) {
- return this.each(function() {
- jQuery.event.trigger( type, data, this );
- });
- },
-
- triggerHandler: function( type, data ) {
- if ( this[0] ) {
- var event = jQuery.Event( type );
- event.preventDefault();
- event.stopPropagation();
- jQuery.event.trigger( event, data, this[0] );
- return event.result;
- }
- },
-
- toggle: function( fn ) {
- // Save reference to arguments for access in closure
- var args = arguments,
- i = 1;
-
- // link all the functions, so any of them can unbind this click handler
- while ( i < args.length ) {
- jQuery.proxy( fn, args[ i++ ] );
- }
-
- return this.click( jQuery.proxy( fn, function( event ) {
- // Figure out which function to execute
- var lastToggle = ( jQuery._data( this, "lastToggle" + fn.guid ) || 0 ) % i;
- jQuery._data( this, "lastToggle" + fn.guid, lastToggle + 1 );
-
- // Make sure that clicks stop
- event.preventDefault();
-
- // and execute the function
- return args[ lastToggle ].apply( this, arguments ) || false;
- }));
- },
-
- hover: function( fnOver, fnOut ) {
- return this.mouseenter( fnOver ).mouseleave( fnOut || fnOver );
- }
-});
-
-var liveMap = {
- focus: "focusin",
- blur: "focusout",
- mouseenter: "mouseover",
- mouseleave: "mouseout"
-};
-
-jQuery.each(["live", "die"], function( i, name ) {
- jQuery.fn[ name ] = function( types, data, fn, origSelector /* Internal Use Only */ ) {
- var type, i = 0, match, namespaces, preType,
- selector = origSelector || this.selector,
- context = origSelector ? this : jQuery( this.context );
-
- if ( typeof types === "object" && !types.preventDefault ) {
- for ( var key in types ) {
- context[ name ]( key, data, types[key], selector );
- }
-
- return this;
- }
-
- if ( jQuery.isFunction( data ) ) {
- fn = data;
- data = undefined;
- }
-
- types = (types || "").split(" ");
-
- while ( (type = types[ i++ ]) != null ) {
- match = rnamespaces.exec( type );
- namespaces = "";
-
- if ( match ) {
- namespaces = match[0];
- type = type.replace( rnamespaces, "" );
- }
-
- if ( type === "hover" ) {
- types.push( "mouseenter" + namespaces, "mouseleave" + namespaces );
- continue;
- }
-
- preType = type;
-
- if ( type === "focus" || type === "blur" ) {
- types.push( liveMap[ type ] + namespaces );
- type = type + namespaces;
-
- } else {
- type = (liveMap[ type ] || type) + namespaces;
- }
-
- if ( name === "live" ) {
- // bind live handler
- for ( var j = 0, l = context.length; j < l; j++ ) {
- jQuery.event.add( context[j], "live." + liveConvert( type, selector ),
- { data: data, selector: selector, handler: fn, origType: type, origHandler: fn, preType: preType } );
- }
-
- } else {
- // unbind live handler
- context.unbind( "live." + liveConvert( type, selector ), fn );
- }
- }
-
- return this;
- };
-});
-
-function liveHandler( event ) {
- var stop, maxLevel, related, match, handleObj, elem, j, i, l, data, close, namespace, ret,
- elems = [],
- selectors = [],
- events = jQuery._data( this, eventKey );
-
- if ( typeof events === "function" ) {
- events = events.events;
- }
-
- // Make sure we avoid non-left-click bubbling in Firefox (#3861) and disabled elements in IE (#6911)
- if ( event.liveFired === this || !events || !events.live || event.target.disabled || event.button && event.type === "click" ) {
- return;
- }
-
- if ( event.namespace ) {
- namespace = new RegExp("(^|\\.)" + event.namespace.split(".").join("\\.(?:.*\\.)?") + "(\\.|$)");
- }
-
- event.liveFired = this;
-
- var live = events.live.slice(0);
-
- for ( j = 0; j < live.length; j++ ) {
- handleObj = live[j];
-
- if ( handleObj.origType.replace( rnamespaces, "" ) === event.type ) {
- selectors.push( handleObj.selector );
-
- } else {
- live.splice( j--, 1 );
- }
- }
-
- match = jQuery( event.target ).closest( selectors, event.currentTarget );
-
- for ( i = 0, l = match.length; i < l; i++ ) {
- close = match[i];
-
- for ( j = 0; j < live.length; j++ ) {
- handleObj = live[j];
-
- if ( close.selector === handleObj.selector && (!namespace || namespace.test( handleObj.namespace )) ) {
- elem = close.elem;
- related = null;
-
- // Those two events require additional checking
- if ( handleObj.preType === "mouseenter" || handleObj.preType === "mouseleave" ) {
- event.type = handleObj.preType;
- related = jQuery( event.relatedTarget ).closest( handleObj.selector )[0];
- }
-
- if ( !related || related !== elem ) {
- elems.push({ elem: elem, handleObj: handleObj, level: close.level });
- }
- }
- }
- }
-
- for ( i = 0, l = elems.length; i < l; i++ ) {
- match = elems[i];
-
- if ( maxLevel && match.level > maxLevel ) {
- break;
- }
-
- event.currentTarget = match.elem;
- event.data = match.handleObj.data;
- event.handleObj = match.handleObj;
-
- ret = match.handleObj.origHandler.apply( match.elem, arguments );
-
- if ( ret === false || event.isPropagationStopped() ) {
- maxLevel = match.level;
-
- if ( ret === false ) {
- stop = false;
- }
- if ( event.isImmediatePropagationStopped() ) {
- break;
- }
- }
- }
-
- return stop;
-}
-
-function liveConvert( type, selector ) {
- return (type && type !== "*" ? type + "." : "") + selector.replace(rperiod, "`").replace(rspace, "&");
-}
-
-jQuery.each( ("blur focus focusin focusout load resize scroll unload click dblclick " +
- "mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " +
- "change select submit keydown keypress keyup error").split(" "), function( i, name ) {
-
- // Handle event binding
- jQuery.fn[ name ] = function( data, fn ) {
- if ( fn == null ) {
- fn = data;
- data = null;
- }
-
- return arguments.length > 0 ?
- this.bind( name, data, fn ) :
- this.trigger( name );
- };
-
- if ( jQuery.attrFn ) {
- jQuery.attrFn[ name ] = true;
- }
-});
-
-
-/*!
- * Sizzle CSS Selector Engine
- * Copyright 2011, The Dojo Foundation
- * Released under the MIT, BSD, and GPL Licenses.
- * More information: http://sizzlejs.com/
- */
-(function(){
-
-var chunker = /((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,
- done = 0,
- toString = Object.prototype.toString,
- hasDuplicate = false,
- baseHasDuplicate = true;
-
-// Here we check if the JavaScript engine is using some sort of
-// optimization where it does not always call our comparision
-// function. If that is the case, discard the hasDuplicate value.
-// Thus far that includes Google Chrome.
-[0, 0].sort(function() {
- baseHasDuplicate = false;
- return 0;
-});
-
-var Sizzle = function( selector, context, results, seed ) {
- results = results || [];
- context = context || document;
-
- var origContext = context;
-
- if ( context.nodeType !== 1 && context.nodeType !== 9 ) {
- return [];
- }
-
- if ( !selector || typeof selector !== "string" ) {
- return results;
- }
-
- var m, set, checkSet, extra, ret, cur, pop, i,
- prune = true,
- contextXML = Sizzle.isXML( context ),
- parts = [],
- soFar = selector;
-
- // Reset the position of the chunker regexp (start from head)
- do {
- chunker.exec( "" );
- m = chunker.exec( soFar );
-
- if ( m ) {
- soFar = m[3];
-
- parts.push( m[1] );
-
- if ( m[2] ) {
- extra = m[3];
- break;
- }
- }
- } while ( m );
-
- if ( parts.length > 1 && origPOS.exec( selector ) ) {
-
- if ( parts.length === 2 && Expr.relative[ parts[0] ] ) {
- set = posProcess( parts[0] + parts[1], context );
-
- } else {
- set = Expr.relative[ parts[0] ] ?
- [ context ] :
- Sizzle( parts.shift(), context );
-
- while ( parts.length ) {
- selector = parts.shift();
-
- if ( Expr.relative[ selector ] ) {
- selector += parts.shift();
- }
-
- set = posProcess( selector, set );
- }
- }
-
- } else {
- // Take a shortcut and set the context if the root selector is an ID
- // (but not if it'll be faster if the inner selector is an ID)
- if ( !seed && parts.length > 1 && context.nodeType === 9 && !contextXML &&
- Expr.match.ID.test(parts[0]) && !Expr.match.ID.test(parts[parts.length - 1]) ) {
-
- ret = Sizzle.find( parts.shift(), context, contextXML );
- context = ret.expr ?
- Sizzle.filter( ret.expr, ret.set )[0] :
- ret.set[0];
- }
-
- if ( context ) {
- ret = seed ?
- { expr: parts.pop(), set: makeArray(seed) } :
- Sizzle.find( parts.pop(), parts.length === 1 && (parts[0] === "~" || parts[0] === "+") && context.parentNode ? context.parentNode : context, contextXML );
-
- set = ret.expr ?
- Sizzle.filter( ret.expr, ret.set ) :
- ret.set;
-
- if ( parts.length > 0 ) {
- checkSet = makeArray( set );
-
- } else {
- prune = false;
- }
-
- while ( parts.length ) {
- cur = parts.pop();
- pop = cur;
-
- if ( !Expr.relative[ cur ] ) {
- cur = "";
- } else {
- pop = parts.pop();
- }
-
- if ( pop == null ) {
- pop = context;
- }
-
- Expr.relative[ cur ]( checkSet, pop, contextXML );
- }
-
- } else {
- checkSet = parts = [];
- }
- }
-
- if ( !checkSet ) {
- checkSet = set;
- }
-
- if ( !checkSet ) {
- Sizzle.error( cur || selector );
- }
-
- if ( toString.call(checkSet) === "[object Array]" ) {
- if ( !prune ) {
- results.push.apply( results, checkSet );
-
- } else if ( context && context.nodeType === 1 ) {
- for ( i = 0; checkSet[i] != null; i++ ) {
- if ( checkSet[i] && (checkSet[i] === true || checkSet[i].nodeType === 1 && Sizzle.contains(context, checkSet[i])) ) {
- results.push( set[i] );
- }
- }
-
- } else {
- for ( i = 0; checkSet[i] != null; i++ ) {
- if ( checkSet[i] && checkSet[i].nodeType === 1 ) {
- results.push( set[i] );
- }
- }
- }
-
- } else {
- makeArray( checkSet, results );
- }
-
- if ( extra ) {
- Sizzle( extra, origContext, results, seed );
- Sizzle.uniqueSort( results );
- }
-
- return results;
-};
-
-Sizzle.uniqueSort = function( results ) {
- if ( sortOrder ) {
- hasDuplicate = baseHasDuplicate;
- results.sort( sortOrder );
-
- if ( hasDuplicate ) {
- for ( var i = 1; i < results.length; i++ ) {
- if ( results[i] === results[ i - 1 ] ) {
- results.splice( i--, 1 );
- }
- }
- }
- }
-
- return results;
-};
-
-Sizzle.matches = function( expr, set ) {
- return Sizzle( expr, null, null, set );
-};
-
-Sizzle.matchesSelector = function( node, expr ) {
- return Sizzle( expr, null, null, [node] ).length > 0;
-};
-
-Sizzle.find = function( expr, context, isXML ) {
- var set;
-
- if ( !expr ) {
- return [];
- }
-
- for ( var i = 0, l = Expr.order.length; i < l; i++ ) {
- var match,
- type = Expr.order[i];
-
- if ( (match = Expr.leftMatch[ type ].exec( expr )) ) {
- var left = match[1];
- match.splice( 1, 1 );
-
- if ( left.substr( left.length - 1 ) !== "\\" ) {
- match[1] = (match[1] || "").replace(/\\/g, "");
- set = Expr.find[ type ]( match, context, isXML );
-
- if ( set != null ) {
- expr = expr.replace( Expr.match[ type ], "" );
- break;
- }
- }
- }
- }
-
- if ( !set ) {
- set = typeof context.getElementsByTagName !== "undefined" ?
- context.getElementsByTagName( "*" ) :
- [];
- }
-
- return { set: set, expr: expr };
-};
-
-Sizzle.filter = function( expr, set, inplace, not ) {
- var match, anyFound,
- old = expr,
- result = [],
- curLoop = set,
- isXMLFilter = set && set[0] && Sizzle.isXML( set[0] );
-
- while ( expr && set.length ) {
- for ( var type in Expr.filter ) {
- if ( (match = Expr.leftMatch[ type ].exec( expr )) != null && match[2] ) {
- var found, item,
- filter = Expr.filter[ type ],
- left = match[1];
-
- anyFound = false;
-
- match.splice(1,1);
-
- if ( left.substr( left.length - 1 ) === "\\" ) {
- continue;
- }
-
- if ( curLoop === result ) {
- result = [];
- }
-
- if ( Expr.preFilter[ type ] ) {
- match = Expr.preFilter[ type ]( match, curLoop, inplace, result, not, isXMLFilter );
-
- if ( !match ) {
- anyFound = found = true;
-
- } else if ( match === true ) {
- continue;
- }
- }
-
- if ( match ) {
- for ( var i = 0; (item = curLoop[i]) != null; i++ ) {
- if ( item ) {
- found = filter( item, match, i, curLoop );
- var pass = not ^ !!found;
-
- if ( inplace && found != null ) {
- if ( pass ) {
- anyFound = true;
-
- } else {
- curLoop[i] = false;
- }
-
- } else if ( pass ) {
- result.push( item );
- anyFound = true;
- }
- }
- }
- }
-
- if ( found !== undefined ) {
- if ( !inplace ) {
- curLoop = result;
- }
-
- expr = expr.replace( Expr.match[ type ], "" );
-
- if ( !anyFound ) {
- return [];
- }
-
- break;
- }
- }
- }
-
- // Improper expression
- if ( expr === old ) {
- if ( anyFound == null ) {
- Sizzle.error( expr );
-
- } else {
- break;
- }
- }
-
- old = expr;
- }
-
- return curLoop;
-};
-
-Sizzle.error = function( msg ) {
- throw "Syntax error, unrecognized expression: " + msg;
-};
-
-var Expr = Sizzle.selectors = {
- order: [ "ID", "NAME", "TAG" ],
-
- match: {
- ID: /#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,
- CLASS: /\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,
- NAME: /\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/,
- ATTR: /\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(?:(['"])(.*?)\3|(#?(?:[\w\u00c0-\uFFFF\-]|\\.)*)|)|)\s*\]/,
- TAG: /^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/,
- CHILD: /:(only|nth|last|first)-child(?:\(\s*(even|odd|(?:[+\-]?\d+|(?:[+\-]?\d*)?n\s*(?:[+\-]\s*\d+)?))\s*\))?/,
- POS: /:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/,
- PSEUDO: /:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/
- },
-
- leftMatch: {},
-
- attrMap: {
- "class": "className",
- "for": "htmlFor"
- },
-
- attrHandle: {
- href: function( elem ) {
- return elem.getAttribute( "href" );
- }
- },
-
- relative: {
- "+": function(checkSet, part){
- var isPartStr = typeof part === "string",
- isTag = isPartStr && !/\W/.test( part ),
- isPartStrNotTag = isPartStr && !isTag;
-
- if ( isTag ) {
- part = part.toLowerCase();
- }
-
- for ( var i = 0, l = checkSet.length, elem; i < l; i++ ) {
- if ( (elem = checkSet[i]) ) {
- while ( (elem = elem.previousSibling) && elem.nodeType !== 1 ) {}
-
- checkSet[i] = isPartStrNotTag || elem && elem.nodeName.toLowerCase() === part ?
- elem || false :
- elem === part;
- }
- }
-
- if ( isPartStrNotTag ) {
- Sizzle.filter( part, checkSet, true );
- }
- },
-
- ">": function( checkSet, part ) {
- var elem,
- isPartStr = typeof part === "string",
- i = 0,
- l = checkSet.length;
-
- if ( isPartStr && !/\W/.test( part ) ) {
- part = part.toLowerCase();
-
- for ( ; i < l; i++ ) {
- elem = checkSet[i];
-
- if ( elem ) {
- var parent = elem.parentNode;
- checkSet[i] = parent.nodeName.toLowerCase() === part ? parent : false;
- }
- }
-
- } else {
- for ( ; i < l; i++ ) {
- elem = checkSet[i];
-
- if ( elem ) {
- checkSet[i] = isPartStr ?
- elem.parentNode :
- elem.parentNode === part;
- }
- }
-
- if ( isPartStr ) {
- Sizzle.filter( part, checkSet, true );
- }
- }
- },
-
- "": function(checkSet, part, isXML){
- var nodeCheck,
- doneName = done++,
- checkFn = dirCheck;
-
- if ( typeof part === "string" && !/\W/.test(part) ) {
- part = part.toLowerCase();
- nodeCheck = part;
- checkFn = dirNodeCheck;
- }
-
- checkFn( "parentNode", part, doneName, checkSet, nodeCheck, isXML );
- },
-
- "~": function( checkSet, part, isXML ) {
- var nodeCheck,
- doneName = done++,
- checkFn = dirCheck;
-
- if ( typeof part === "string" && !/\W/.test( part ) ) {
- part = part.toLowerCase();
- nodeCheck = part;
- checkFn = dirNodeCheck;
- }
-
- checkFn( "previousSibling", part, doneName, checkSet, nodeCheck, isXML );
- }
- },
-
- find: {
- ID: function( match, context, isXML ) {
- if ( typeof context.getElementById !== "undefined" && !isXML ) {
- var m = context.getElementById(match[1]);
- // Check parentNode to catch when Blackberry 4.6 returns
- // nodes that are no longer in the document #6963
- return m && m.parentNode ? [m] : [];
- }
- },
-
- NAME: function( match, context ) {
- if ( typeof context.getElementsByName !== "undefined" ) {
- var ret = [],
- results = context.getElementsByName( match[1] );
-
- for ( var i = 0, l = results.length; i < l; i++ ) {
- if ( results[i].getAttribute("name") === match[1] ) {
- ret.push( results[i] );
- }
- }
-
- return ret.length === 0 ? null : ret;
- }
- },
-
- TAG: function( match, context ) {
- if ( typeof context.getElementsByTagName !== "undefined" ) {
- return context.getElementsByTagName( match[1] );
- }
- }
- },
- preFilter: {
- CLASS: function( match, curLoop, inplace, result, not, isXML ) {
- match = " " + match[1].replace(/\\/g, "") + " ";
-
- if ( isXML ) {
- return match;
- }
-
- for ( var i = 0, elem; (elem = curLoop[i]) != null; i++ ) {
- if ( elem ) {
- if ( not ^ (elem.className && (" " + elem.className + " ").replace(/[\t\n\r]/g, " ").indexOf(match) >= 0) ) {
- if ( !inplace ) {
- result.push( elem );
- }
-
- } else if ( inplace ) {
- curLoop[i] = false;
- }
- }
- }
-
- return false;
- },
-
- ID: function( match ) {
- return match[1].replace(/\\/g, "");
- },
-
- TAG: function( match, curLoop ) {
- return match[1].toLowerCase();
- },
-
- CHILD: function( match ) {
- if ( match[1] === "nth" ) {
- if ( !match[2] ) {
- Sizzle.error( match[0] );
- }
-
- match[2] = match[2].replace(/^\+|\s*/g, '');
-
- // parse equations like 'even', 'odd', '5', '2n', '3n+2', '4n-1', '-n+6'
- var test = /(-?)(\d*)(?:n([+\-]?\d*))?/.exec(
- match[2] === "even" && "2n" || match[2] === "odd" && "2n+1" ||
- !/\D/.test( match[2] ) && "0n+" + match[2] || match[2]);
-
- // calculate the numbers (first)n+(last) including if they are negative
- match[2] = (test[1] + (test[2] || 1)) - 0;
- match[3] = test[3] - 0;
- }
- else if ( match[2] ) {
- Sizzle.error( match[0] );
- }
-
- // TODO: Move to normal caching system
- match[0] = done++;
-
- return match;
- },
-
- ATTR: function( match, curLoop, inplace, result, not, isXML ) {
- var name = match[1] = match[1].replace(/\\/g, "");
-
- if ( !isXML && Expr.attrMap[name] ) {
- match[1] = Expr.attrMap[name];
- }
-
- // Handle if an un-quoted value was used
- match[4] = ( match[4] || match[5] || "" ).replace(/\\/g, "");
-
- if ( match[2] === "~=" ) {
- match[4] = " " + match[4] + " ";
- }
-
- return match;
- },
-
- PSEUDO: function( match, curLoop, inplace, result, not ) {
- if ( match[1] === "not" ) {
- // If we're dealing with a complex expression, or a simple one
- if ( ( chunker.exec(match[3]) || "" ).length > 1 || /^\w/.test(match[3]) ) {
- match[3] = Sizzle(match[3], null, null, curLoop);
-
- } else {
- var ret = Sizzle.filter(match[3], curLoop, inplace, true ^ not);
-
- if ( !inplace ) {
- result.push.apply( result, ret );
- }
-
- return false;
- }
-
- } else if ( Expr.match.POS.test( match[0] ) || Expr.match.CHILD.test( match[0] ) ) {
- return true;
- }
-
- return match;
- },
-
- POS: function( match ) {
- match.unshift( true );
-
- return match;
- }
- },
-
- filters: {
- enabled: function( elem ) {
- return elem.disabled === false && elem.type !== "hidden";
- },
-
- disabled: function( elem ) {
- return elem.disabled === true;
- },
-
- checked: function( elem ) {
- return elem.checked === true;
- },
-
- selected: function( elem ) {
- // Accessing this property makes selected-by-default
- // options in Safari work properly
- elem.parentNode.selectedIndex;
-
- return elem.selected === true;
- },
-
- parent: function( elem ) {
- return !!elem.firstChild;
- },
-
- empty: function( elem ) {
- return !elem.firstChild;
- },
-
- has: function( elem, i, match ) {
- return !!Sizzle( match[3], elem ).length;
- },
-
- header: function( elem ) {
- return (/h\d/i).test( elem.nodeName );
- },
-
- text: function( elem ) {
- return "text" === elem.type;
- },
- radio: function( elem ) {
- return "radio" === elem.type;
- },
-
- checkbox: function( elem ) {
- return "checkbox" === elem.type;
- },
-
- file: function( elem ) {
- return "file" === elem.type;
- },
- password: function( elem ) {
- return "password" === elem.type;
- },
-
- submit: function( elem ) {
- return "submit" === elem.type;
- },
-
- image: function( elem ) {
- return "image" === elem.type;
- },
-
- reset: function( elem ) {
- return "reset" === elem.type;
- },
-
- button: function( elem ) {
- return "button" === elem.type || elem.nodeName.toLowerCase() === "button";
- },
-
- input: function( elem ) {
- return (/input|select|textarea|button/i).test( elem.nodeName );
- }
- },
- setFilters: {
- first: function( elem, i ) {
- return i === 0;
- },
-
- last: function( elem, i, match, array ) {
- return i === array.length - 1;
- },
-
- even: function( elem, i ) {
- return i % 2 === 0;
- },
-
- odd: function( elem, i ) {
- return i % 2 === 1;
- },
-
- lt: function( elem, i, match ) {
- return i < match[3] - 0;
- },
-
- gt: function( elem, i, match ) {
- return i > match[3] - 0;
- },
-
- nth: function( elem, i, match ) {
- return match[3] - 0 === i;
- },
-
- eq: function( elem, i, match ) {
- return match[3] - 0 === i;
- }
- },
- filter: {
- PSEUDO: function( elem, match, i, array ) {
- var name = match[1],
- filter = Expr.filters[ name ];
-
- if ( filter ) {
- return filter( elem, i, match, array );
-
- } else if ( name === "contains" ) {
- return (elem.textContent || elem.innerText || Sizzle.getText([ elem ]) || "").indexOf(match[3]) >= 0;
-
- } else if ( name === "not" ) {
- var not = match[3];
-
- for ( var j = 0, l = not.length; j < l; j++ ) {
- if ( not[j] === elem ) {
- return false;
- }
- }
-
- return true;
-
- } else {
- Sizzle.error( name );
- }
- },
-
- CHILD: function( elem, match ) {
- var type = match[1],
- node = elem;
-
- switch ( type ) {
- case "only":
- case "first":
- while ( (node = node.previousSibling) ) {
- if ( node.nodeType === 1 ) {
- return false;
- }
- }
-
- if ( type === "first" ) {
- return true;
- }
-
- node = elem;
-
- case "last":
- while ( (node = node.nextSibling) ) {
- if ( node.nodeType === 1 ) {
- return false;
- }
- }
-
- return true;
-
- case "nth":
- var first = match[2],
- last = match[3];
-
- if ( first === 1 && last === 0 ) {
- return true;
- }
-
- var doneName = match[0],
- parent = elem.parentNode;
-
- if ( parent && (parent.sizcache !== doneName || !elem.nodeIndex) ) {
- var count = 0;
-
- for ( node = parent.firstChild; node; node = node.nextSibling ) {
- if ( node.nodeType === 1 ) {
- node.nodeIndex = ++count;
- }
- }
-
- parent.sizcache = doneName;
- }
-
- var diff = elem.nodeIndex - last;
-
- if ( first === 0 ) {
- return diff === 0;
-
- } else {
- return ( diff % first === 0 && diff / first >= 0 );
- }
- }
- },
-
- ID: function( elem, match ) {
- return elem.nodeType === 1 && elem.getAttribute("id") === match;
- },
-
- TAG: function( elem, match ) {
- return (match === "*" && elem.nodeType === 1) || elem.nodeName.toLowerCase() === match;
- },
-
- CLASS: function( elem, match ) {
- return (" " + (elem.className || elem.getAttribute("class")) + " ")
- .indexOf( match ) > -1;
- },
-
- ATTR: function( elem, match ) {
- var name = match[1],
- result = Expr.attrHandle[ name ] ?
- Expr.attrHandle[ name ]( elem ) :
- elem[ name ] != null ?
- elem[ name ] :
- elem.getAttribute( name ),
- value = result + "",
- type = match[2],
- check = match[4];
-
- return result == null ?
- type === "!=" :
- type === "=" ?
- value === check :
- type === "*=" ?
- value.indexOf(check) >= 0 :
- type === "~=" ?
- (" " + value + " ").indexOf(check) >= 0 :
- !check ?
- value && result !== false :
- type === "!=" ?
- value !== check :
- type === "^=" ?
- value.indexOf(check) === 0 :
- type === "$=" ?
- value.substr(value.length - check.length) === check :
- type === "|=" ?
- value === check || value.substr(0, check.length + 1) === check + "-" :
- false;
- },
-
- POS: function( elem, match, i, array ) {
- var name = match[2],
- filter = Expr.setFilters[ name ];
-
- if ( filter ) {
- return filter( elem, i, match, array );
- }
- }
- }
-};
-
-var origPOS = Expr.match.POS,
- fescape = function(all, num){
- return "\\" + (num - 0 + 1);
- };
-
-for ( var type in Expr.match ) {
- Expr.match[ type ] = new RegExp( Expr.match[ type ].source + (/(?![^\[]*\])(?![^\(]*\))/.source) );
- Expr.leftMatch[ type ] = new RegExp( /(^(?:.|\r|\n)*?)/.source + Expr.match[ type ].source.replace(/\\(\d+)/g, fescape) );
-}
-
-var makeArray = function( array, results ) {
- array = Array.prototype.slice.call( array, 0 );
-
- if ( results ) {
- results.push.apply( results, array );
- return results;
- }
-
- return array;
-};
-
-// Perform a simple check to determine if the browser is capable of
-// converting a NodeList to an array using builtin methods.
-// Also verifies that the returned array holds DOM nodes
-// (which is not the case in the Blackberry browser)
-try {
- Array.prototype.slice.call( document.documentElement.childNodes, 0 )[0].nodeType;
-
-// Provide a fallback method if it does not work
-} catch( e ) {
- makeArray = function( array, results ) {
- var i = 0,
- ret = results || [];
-
- if ( toString.call(array) === "[object Array]" ) {
- Array.prototype.push.apply( ret, array );
-
- } else {
- if ( typeof array.length === "number" ) {
- for ( var l = array.length; i < l; i++ ) {
- ret.push( array[i] );
- }
-
- } else {
- for ( ; array[i]; i++ ) {
- ret.push( array[i] );
- }
- }
- }
-
- return ret;
- };
-}
-
-var sortOrder, siblingCheck;
-
-if ( document.documentElement.compareDocumentPosition ) {
- sortOrder = function( a, b ) {
- if ( a === b ) {
- hasDuplicate = true;
- return 0;
- }
-
- if ( !a.compareDocumentPosition || !b.compareDocumentPosition ) {
- return a.compareDocumentPosition ? -1 : 1;
- }
-
- return a.compareDocumentPosition(b) & 4 ? -1 : 1;
- };
-
-} else {
- sortOrder = function( a, b ) {
- var al, bl,
- ap = [],
- bp = [],
- aup = a.parentNode,
- bup = b.parentNode,
- cur = aup;
-
- // The nodes are identical, we can exit early
- if ( a === b ) {
- hasDuplicate = true;
- return 0;
-
- // If the nodes are siblings (or identical) we can do a quick check
- } else if ( aup === bup ) {
- return siblingCheck( a, b );
-
- // If no parents were found then the nodes are disconnected
- } else if ( !aup ) {
- return -1;
-
- } else if ( !bup ) {
- return 1;
- }
-
- // Otherwise they're somewhere else in the tree so we need
- // to build up a full list of the parentNodes for comparison
- while ( cur ) {
- ap.unshift( cur );
- cur = cur.parentNode;
- }
-
- cur = bup;
-
- while ( cur ) {
- bp.unshift( cur );
- cur = cur.parentNode;
- }
-
- al = ap.length;
- bl = bp.length;
-
- // Start walking down the tree looking for a discrepancy
- for ( var i = 0; i < al && i < bl; i++ ) {
- if ( ap[i] !== bp[i] ) {
- return siblingCheck( ap[i], bp[i] );
- }
- }
-
- // We ended someplace up the tree so do a sibling check
- return i === al ?
- siblingCheck( a, bp[i], -1 ) :
- siblingCheck( ap[i], b, 1 );
- };
-
- siblingCheck = function( a, b, ret ) {
- if ( a === b ) {
- return ret;
- }
-
- var cur = a.nextSibling;
-
- while ( cur ) {
- if ( cur === b ) {
- return -1;
- }
-
- cur = cur.nextSibling;
- }
-
- return 1;
- };
-}
-
-// Utility function for retreiving the text value of an array of DOM nodes
-Sizzle.getText = function( elems ) {
- var ret = "", elem;
-
- for ( var i = 0; elems[i]; i++ ) {
- elem = elems[i];
-
- // Get the text from text nodes and CDATA nodes
- if ( elem.nodeType === 3 || elem.nodeType === 4 ) {
- ret += elem.nodeValue;
-
- // Traverse everything else, except comment nodes
- } else if ( elem.nodeType !== 8 ) {
- ret += Sizzle.getText( elem.childNodes );
- }
- }
-
- return ret;
-};
-
-// Check to see if the browser returns elements by name when
-// querying by getElementById (and provide a workaround)
-(function(){
- // We're going to inject a fake input element with a specified name
- var form = document.createElement("div"),
- id = "script" + (new Date()).getTime(),
- root = document.documentElement;
-
- form.innerHTML = "<a name='" + id + "'/>";
-
- // Inject it into the root element, check its status, and remove it quickly
- root.insertBefore( form, root.firstChild );
-
- // The workaround has to do additional checks after a getElementById
- // Which slows things down for other browsers (hence the branching)
- if ( document.getElementById( id ) ) {
- Expr.find.ID = function( match, context, isXML ) {
- if ( typeof context.getElementById !== "undefined" && !isXML ) {
- var m = context.getElementById(match[1]);
-
- return m ?
- m.id === match[1] || typeof m.getAttributeNode !== "undefined" && m.getAttributeNode("id").nodeValue === match[1] ?
- [m] :
- undefined :
- [];
- }
- };
-
- Expr.filter.ID = function( elem, match ) {
- var node = typeof elem.getAttributeNode !== "undefined" && elem.getAttributeNode("id");
-
- return elem.nodeType === 1 && node && node.nodeValue === match;
- };
- }
-
- root.removeChild( form );
-
- // release memory in IE
- root = form = null;
-})();
-
-(function(){
- // Check to see if the browser returns only elements
- // when doing getElementsByTagName("*")
-
- // Create a fake element
- var div = document.createElement("div");
- div.appendChild( document.createComment("") );
-
- // Make sure no comments are found
- if ( div.getElementsByTagName("*").length > 0 ) {
- Expr.find.TAG = function( match, context ) {
- var results = context.getElementsByTagName( match[1] );
-
- // Filter out possible comments
- if ( match[1] === "*" ) {
- var tmp = [];
-
- for ( var i = 0; results[i]; i++ ) {
- if ( results[i].nodeType === 1 ) {
- tmp.push( results[i] );
- }
- }
-
- results = tmp;
- }
-
- return results;
- };
- }
-
- // Check to see if an attribute returns normalized href attributes
- div.innerHTML = "<a href='#'></a>";
-
- if ( div.firstChild && typeof div.firstChild.getAttribute !== "undefined" &&
- div.firstChild.getAttribute("href") !== "#" ) {
-
- Expr.attrHandle.href = function( elem ) {
- return elem.getAttribute( "href", 2 );
- };
- }
-
- // release memory in IE
- div = null;
-})();
-
-if ( document.querySelectorAll ) {
- (function(){
- var oldSizzle = Sizzle,
- div = document.createElement("div"),
- id = "__sizzle__";
-
- div.innerHTML = "<p class='TEST'></p>";
-
- // Safari can't handle uppercase or unicode characters when
- // in quirks mode.
- if ( div.querySelectorAll && div.querySelectorAll(".TEST").length === 0 ) {
- return;
- }
-
- Sizzle = function( query, context, extra, seed ) {
- context = context || document;
-
- // Only use querySelectorAll on non-XML documents
- // (ID selectors don't work in non-HTML documents)
- if ( !seed && !Sizzle.isXML(context) ) {
- // See if we find a selector to speed up
- var match = /^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec( query );
-
- if ( match && (context.nodeType === 1 || context.nodeType === 9) ) {
- // Speed-up: Sizzle("TAG")
- if ( match[1] ) {
- return makeArray( context.getElementsByTagName( query ), extra );
-
- // Speed-up: Sizzle(".CLASS")
- } else if ( match[2] && Expr.find.CLASS && context.getElementsByClassName ) {
- return makeArray( context.getElementsByClassName( match[2] ), extra );
- }
- }
-
- if ( context.nodeType === 9 ) {
- // Speed-up: Sizzle("body")
- // The body element only exists once, optimize finding it
- if ( query === "body" && context.body ) {
- return makeArray( [ context.body ], extra );
-
- // Speed-up: Sizzle("#ID")
- } else if ( match && match[3] ) {
- var elem = context.getElementById( match[3] );
-
- // Check parentNode to catch when Blackberry 4.6 returns
- // nodes that are no longer in the document #6963
- if ( elem && elem.parentNode ) {
- // Handle the case where IE and Opera return items
- // by name instead of ID
- if ( elem.id === match[3] ) {
- return makeArray( [ elem ], extra );
- }
-
- } else {
- return makeArray( [], extra );
- }
- }
-
- try {
- return makeArray( context.querySelectorAll(query), extra );
- } catch(qsaError) {}
-
- // qSA works strangely on Element-rooted queries
- // We can work around this by specifying an extra ID on the root
- // and working up from there (Thanks to Andrew Dupont for the technique)
- // IE 8 doesn't work on object elements
- } else if ( context.nodeType === 1 && context.nodeName.toLowerCase() !== "object" ) {
- var old = context.getAttribute( "id" ),
- nid = old || id,
- hasParent = context.parentNode,
- relativeHierarchySelector = /^\s*[+~]/.test( query );
-
- if ( !old ) {
- context.setAttribute( "id", nid );
- } else {
- nid = nid.replace( /'/g, "\\$&" );
- }
- if ( relativeHierarchySelector && hasParent ) {
- context = context.parentNode;
- }
-
- try {
- if ( !relativeHierarchySelector || hasParent ) {
- return makeArray( context.querySelectorAll( "[id='" + nid + "'] " + query ), extra );
- }
-
- } catch(pseudoError) {
- } finally {
- if ( !old ) {
- context.removeAttribute( "id" );
- }
- }
- }
- }
-
- return oldSizzle(query, context, extra, seed);
- };
-
- for ( var prop in oldSizzle ) {
- Sizzle[ prop ] = oldSizzle[ prop ];
- }
-
- // release memory in IE
- div = null;
- })();
-}
-
-(function(){
- var html = document.documentElement,
- matches = html.matchesSelector || html.mozMatchesSelector || html.webkitMatchesSelector || html.msMatchesSelector,
- pseudoWorks = false;
-
- try {
- // This should fail with an exception
- // Gecko does not error, returns false instead
- matches.call( document.documentElement, "[test!='']:sizzle" );
-
- } catch( pseudoError ) {
- pseudoWorks = true;
- }
-
- if ( matches ) {
- Sizzle.matchesSelector = function( node, expr ) {
- // Make sure that attribute selectors are quoted
- expr = expr.replace(/\=\s*([^'"\]]*)\s*\]/g, "='$1']");
-
- if ( !Sizzle.isXML( node ) ) {
- try {
- if ( pseudoWorks || !Expr.match.PSEUDO.test( expr ) && !/!=/.test( expr ) ) {
- return matches.call( node, expr );
- }
- } catch(e) {}
- }
-
- return Sizzle(expr, null, null, [node]).length > 0;
- };
- }
-})();
-
-(function(){
- var div = document.createElement("div");
-
- div.innerHTML = "<div class='test e'></div><div class='test'></div>";
-
- // Opera can't find a second classname (in 9.6)
- // Also, make sure that getElementsByClassName actually exists
- if ( !div.getElementsByClassName || div.getElementsByClassName("e").length === 0 ) {
- return;
- }
-
- // Safari caches class attributes, doesn't catch changes (in 3.2)
- div.lastChild.className = "e";
-
- if ( div.getElementsByClassName("e").length === 1 ) {
- return;
- }
-
- Expr.order.splice(1, 0, "CLASS");
- Expr.find.CLASS = function( match, context, isXML ) {
- if ( typeof context.getElementsByClassName !== "undefined" && !isXML ) {
- return context.getElementsByClassName(match[1]);
- }
- };
-
- // release memory in IE
- div = null;
-})();
-
-function dirNodeCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) {
- for ( var i = 0, l = checkSet.length; i < l; i++ ) {
- var elem = checkSet[i];
-
- if ( elem ) {
- var match = false;
-
- elem = elem[dir];
-
- while ( elem ) {
- if ( elem.sizcache === doneName ) {
- match = checkSet[elem.sizset];
- break;
- }
-
- if ( elem.nodeType === 1 && !isXML ){
- elem.sizcache = doneName;
- elem.sizset = i;
- }
-
- if ( elem.nodeName.toLowerCase() === cur ) {
- match = elem;
- break;
- }
-
- elem = elem[dir];
- }
-
- checkSet[i] = match;
- }
- }
-}
-
-function dirCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) {
- for ( var i = 0, l = checkSet.length; i < l; i++ ) {
- var elem = checkSet[i];
-
- if ( elem ) {
- var match = false;
-
- elem = elem[dir];
-
- while ( elem ) {
- if ( elem.sizcache === doneName ) {
- match = checkSet[elem.sizset];
- break;
- }
-
- if ( elem.nodeType === 1 ) {
- if ( !isXML ) {
- elem.sizcache = doneName;
- elem.sizset = i;
- }
-
- if ( typeof cur !== "string" ) {
- if ( elem === cur ) {
- match = true;
- break;
- }
-
- } else if ( Sizzle.filter( cur, [elem] ).length > 0 ) {
- match = elem;
- break;
- }
- }
-
- elem = elem[dir];
- }
-
- checkSet[i] = match;
- }
- }
-}
-
-if ( document.documentElement.contains ) {
- Sizzle.contains = function( a, b ) {
- return a !== b && (a.contains ? a.contains(b) : true);
- };
-
-} else if ( document.documentElement.compareDocumentPosition ) {
- Sizzle.contains = function( a, b ) {
- return !!(a.compareDocumentPosition(b) & 16);
- };
-
-} else {
- Sizzle.contains = function() {
- return false;
- };
-}
-
-Sizzle.isXML = function( elem ) {
- // documentElement is verified for cases where it doesn't yet exist
- // (such as loading iframes in IE - #4833)
- var documentElement = (elem ? elem.ownerDocument || elem : 0).documentElement;
-
- return documentElement ? documentElement.nodeName !== "HTML" : false;
-};
-
-var posProcess = function( selector, context ) {
- var match,
- tmpSet = [],
- later = "",
- root = context.nodeType ? [context] : context;
-
- // Position selectors must be done after the filter
- // And so must :not(positional) so we move all PSEUDOs to the end
- while ( (match = Expr.match.PSEUDO.exec( selector )) ) {
- later += match[0];
- selector = selector.replace( Expr.match.PSEUDO, "" );
- }
-
- selector = Expr.relative[selector] ? selector + "*" : selector;
-
- for ( var i = 0, l = root.length; i < l; i++ ) {
- Sizzle( selector, root[i], tmpSet );
- }
-
- return Sizzle.filter( later, tmpSet );
-};
-
-// EXPOSE
-jQuery.find = Sizzle;
-jQuery.expr = Sizzle.selectors;
-jQuery.expr[":"] = jQuery.expr.filters;
-jQuery.unique = Sizzle.uniqueSort;
-jQuery.text = Sizzle.getText;
-jQuery.isXMLDoc = Sizzle.isXML;
-jQuery.contains = Sizzle.contains;
-
-
-})();
-
-
-var runtil = /Until$/,
- rparentsprev = /^(?:parents|prevUntil|prevAll)/,
- // Note: This RegExp should be improved, or likely pulled from Sizzle
- rmultiselector = /,/,
- isSimple = /^.[^:#\[\.,]*$/,
- slice = Array.prototype.slice,
- POS = jQuery.expr.match.POS,
- // methods guaranteed to produce a unique set when starting from a unique set
- guaranteedUnique = {
- children: true,
- contents: true,
- next: true,
- prev: true
- };
-
-jQuery.fn.extend({
- find: function( selector ) {
- var ret = this.pushStack( "", "find", selector ),
- length = 0;
-
- for ( var i = 0, l = this.length; i < l; i++ ) {
- length = ret.length;
- jQuery.find( selector, this[i], ret );
-
- if ( i > 0 ) {
- // Make sure that the results are unique
- for ( var n = length; n < ret.length; n++ ) {
- for ( var r = 0; r < length; r++ ) {
- if ( ret[r] === ret[n] ) {
- ret.splice(n--, 1);
- break;
- }
- }
- }
- }
- }
-
- return ret;
- },
-
- has: function( target ) {
- var targets = jQuery( target );
- return this.filter(function() {
- for ( var i = 0, l = targets.length; i < l; i++ ) {
- if ( jQuery.contains( this, targets[i] ) ) {
- return true;
- }
- }
- });
- },
-
- not: function( selector ) {
- return this.pushStack( winnow(this, selector, false), "not", selector);
- },
-
- filter: function( selector ) {
- return this.pushStack( winnow(this, selector, true), "filter", selector );
- },
-
- is: function( selector ) {
- return !!selector && jQuery.filter( selector, this ).length > 0;
- },
-
- closest: function( selectors, context ) {
- var ret = [], i, l, cur = this[0];
-
- if ( jQuery.isArray( selectors ) ) {
- var match, selector,
- matches = {},
- level = 1;
-
- if ( cur && selectors.length ) {
- for ( i = 0, l = selectors.length; i < l; i++ ) {
- selector = selectors[i];
-
- if ( !matches[selector] ) {
- matches[selector] = jQuery.expr.match.POS.test( selector ) ?
- jQuery( selector, context || this.context ) :
- selector;
- }
- }
-
- while ( cur && cur.ownerDocument && cur !== context ) {
- for ( selector in matches ) {
- match = matches[selector];
-
- if ( match.jquery ? match.index(cur) > -1 : jQuery(cur).is(match) ) {
- ret.push({ selector: selector, elem: cur, level: level });
- }
- }
-
- cur = cur.parentNode;
- level++;
- }
- }
-
- return ret;
- }
-
- var pos = POS.test( selectors ) ?
- jQuery( selectors, context || this.context ) : null;
-
- for ( i = 0, l = this.length; i < l; i++ ) {
- cur = this[i];
-
- while ( cur ) {
- if ( pos ? pos.index(cur) > -1 : jQuery.find.matchesSelector(cur, selectors) ) {
- ret.push( cur );
- break;
-
- } else {
- cur = cur.parentNode;
- if ( !cur || !cur.ownerDocument || cur === context ) {
- break;
- }
- }
- }
- }
-
- ret = ret.length > 1 ? jQuery.unique(ret) : ret;
-
- return this.pushStack( ret, "closest", selectors );
- },
-
- // Determine the position of an element within
- // the matched set of elements
- index: function( elem ) {
- if ( !elem || typeof elem === "string" ) {
- return jQuery.inArray( this[0],
- // If it receives a string, the selector is used
- // If it receives nothing, the siblings are used
- elem ? jQuery( elem ) : this.parent().children() );
- }
- // Locate the position of the desired element
- return jQuery.inArray(
- // If it receives a jQuery object, the first element is used
- elem.jquery ? elem[0] : elem, this );
- },
-
- add: function( selector, context ) {
- var set = typeof selector === "string" ?
- jQuery( selector, context ) :
- jQuery.makeArray( selector ),
- all = jQuery.merge( this.get(), set );
-
- return this.pushStack( isDisconnected( set[0] ) || isDisconnected( all[0] ) ?
- all :
- jQuery.unique( all ) );
- },
-
- andSelf: function() {
- return this.add( this.prevObject );
- }
-});
-
-// A painfully simple check to see if an element is disconnected
-// from a document (should be improved, where feasible).
-function isDisconnected( node ) {
- return !node || !node.parentNode || node.parentNode.nodeType === 11;
-}
-
-jQuery.each({
- parent: function( elem ) {
- var parent = elem.parentNode;
- return parent && parent.nodeType !== 11 ? parent : null;
- },
- parents: function( elem ) {
- return jQuery.dir( elem, "parentNode" );
- },
- parentsUntil: function( elem, i, until ) {
- return jQuery.dir( elem, "parentNode", until );
- },
- next: function( elem ) {
- return jQuery.nth( elem, 2, "nextSibling" );
- },
- prev: function( elem ) {
- return jQuery.nth( elem, 2, "previousSibling" );
- },
- nextAll: function( elem ) {
- return jQuery.dir( elem, "nextSibling" );
- },
- prevAll: function( elem ) {
- return jQuery.dir( elem, "previousSibling" );
- },
- nextUntil: function( elem, i, until ) {
- return jQuery.dir( elem, "nextSibling", until );
- },
- prevUntil: function( elem, i, until ) {
- return jQuery.dir( elem, "previousSibling", until );
- },
- siblings: function( elem ) {
- return jQuery.sibling( elem.parentNode.firstChild, elem );
- },
- children: function( elem ) {
- return jQuery.sibling( elem.firstChild );
- },
- contents: function( elem ) {
- return jQuery.nodeName( elem, "iframe" ) ?
- elem.contentDocument || elem.contentWindow.document :
- jQuery.makeArray( elem.childNodes );
- }
-}, function( name, fn ) {
- jQuery.fn[ name ] = function( until, selector ) {
- var ret = jQuery.map( this, fn, until ),
- // The variable 'args' was introduced in
- // https://github.com/jquery/jquery/commit/52a0238
- // to work around a bug in Chrome 10 (Dev) and should be removed when the bug is fixed.
- // http://code.google.com/p/v8/issues/detail?id=1050
- args = slice.call(arguments);
-
- if ( !runtil.test( name ) ) {
- selector = until;
- }
-
- if ( selector && typeof selector === "string" ) {
- ret = jQuery.filter( selector, ret );
- }
-
- ret = this.length > 1 && !guaranteedUnique[ name ] ? jQuery.unique( ret ) : ret;
-
- if ( (this.length > 1 || rmultiselector.test( selector )) && rparentsprev.test( name ) ) {
- ret = ret.reverse();
- }
-
- return this.pushStack( ret, name, args.join(",") );
- };
-});
-
-jQuery.extend({
- filter: function( expr, elems, not ) {
- if ( not ) {
- expr = ":not(" + expr + ")";
- }
-
- return elems.length === 1 ?
- jQuery.find.matchesSelector(elems[0], expr) ? [ elems[0] ] : [] :
- jQuery.find.matches(expr, elems);
- },
-
- dir: function( elem, dir, until ) {
- var matched = [],
- cur = elem[ dir ];
-
- while ( cur && cur.nodeType !== 9 && (until === undefined || cur.nodeType !== 1 || !jQuery( cur ).is( until )) ) {
- if ( cur.nodeType === 1 ) {
- matched.push( cur );
- }
- cur = cur[dir];
- }
- return matched;
- },
-
- nth: function( cur, result, dir, elem ) {
- result = result || 1;
- var num = 0;
-
- for ( ; cur; cur = cur[dir] ) {
- if ( cur.nodeType === 1 && ++num === result ) {
- break;
- }
- }
-
- return cur;
- },
-
- sibling: function( n, elem ) {
- var r = [];
-
- for ( ; n; n = n.nextSibling ) {
- if ( n.nodeType === 1 && n !== elem ) {
- r.push( n );
- }
- }
-
- return r;
- }
-});
-
-// Implement the identical functionality for filter and not
-function winnow( elements, qualifier, keep ) {
- if ( jQuery.isFunction( qualifier ) ) {
- return jQuery.grep(elements, function( elem, i ) {
- var retVal = !!qualifier.call( elem, i, elem );
- return retVal === keep;
- });
-
- } else if ( qualifier.nodeType ) {
- return jQuery.grep(elements, function( elem, i ) {
- return (elem === qualifier) === keep;
- });
-
- } else if ( typeof qualifier === "string" ) {
- var filtered = jQuery.grep(elements, function( elem ) {
- return elem.nodeType === 1;
- });
-
- if ( isSimple.test( qualifier ) ) {
- return jQuery.filter(qualifier, filtered, !keep);
- } else {
- qualifier = jQuery.filter( qualifier, filtered );
- }
- }
-
- return jQuery.grep(elements, function( elem, i ) {
- return (jQuery.inArray( elem, qualifier ) >= 0) === keep;
- });
-}
-
-
-
-
-var rinlinejQuery = / jQuery\d+="(?:\d+|null)"/g,
- rleadingWhitespace = /^\s+/,
- rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig,
- rtagName = /<([\w:]+)/,
- rtbody = /<tbody/i,
- rhtml = /<|&#?\w+;/,
- rnocache = /<(?:script|object|embed|option|style)/i,
- // checked="checked" or checked (html5)
- rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i,
- wrapMap = {
- option: [ 1, "<select multiple='multiple'>", "</select>" ],
- legend: [ 1, "<fieldset>", "</fieldset>" ],
- thead: [ 1, "<table>", "</table>" ],
- tr: [ 2, "<table><tbody>", "</tbody></table>" ],
- td: [ 3, "<table><tbody><tr>", "</tr></tbody></table>" ],
- col: [ 2, "<table><tbody></tbody><colgroup>", "</colgroup></table>" ],
- area: [ 1, "<map>", "</map>" ],
- _default: [ 0, "", "" ]
- };
-
-wrapMap.optgroup = wrapMap.option;
-wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead;
-wrapMap.th = wrapMap.td;
-
-// IE can't serialize <link> and <script> tags normally
-if ( !jQuery.support.htmlSerialize ) {
- wrapMap._default = [ 1, "div<div>", "</div>" ];
-}
-
-jQuery.fn.extend({
- text: function( text ) {
- if ( jQuery.isFunction(text) ) {
- return this.each(function(i) {
- var self = jQuery( this );
-
- self.text( text.call(this, i, self.text()) );
- });
- }
-
- if ( typeof text !== "object" && text !== undefined ) {
- return this.empty().append( (this[0] && this[0].ownerDocument || document).createTextNode( text ) );
- }
-
- return jQuery.text( this );
- },
-
- wrapAll: function( html ) {
- if ( jQuery.isFunction( html ) ) {
- return this.each(function(i) {
- jQuery(this).wrapAll( html.call(this, i) );
- });
- }
-
- if ( this[0] ) {
- // The elements to wrap the target around
- var wrap = jQuery( html, this[0].ownerDocument ).eq(0).clone(true);
-
- if ( this[0].parentNode ) {
- wrap.insertBefore( this[0] );
- }
-
- wrap.map(function() {
- var elem = this;
-
- while ( elem.firstChild && elem.firstChild.nodeType === 1 ) {
- elem = elem.firstChild;
- }
-
- return elem;
- }).append(this);
- }
-
- return this;
- },
-
- wrapInner: function( html ) {
- if ( jQuery.isFunction( html ) ) {
- return this.each(function(i) {
- jQuery(this).wrapInner( html.call(this, i) );
- });
- }
-
- return this.each(function() {
- var self = jQuery( this ),
- contents = self.contents();
-
- if ( contents.length ) {
- contents.wrapAll( html );
-
- } else {
- self.append( html );
- }
- });
- },
-
- wrap: function( html ) {
- return this.each(function() {
- jQuery( this ).wrapAll( html );
- });
- },
-
- unwrap: function() {
- return this.parent().each(function() {
- if ( !jQuery.nodeName( this, "body" ) ) {
- jQuery( this ).replaceWith( this.childNodes );
- }
- }).end();
- },
-
- append: function() {
- return this.domManip(arguments, true, function( elem ) {
- if ( this.nodeType === 1 ) {
- this.appendChild( elem );
- }
- });
- },
-
- prepend: function() {
- return this.domManip(arguments, true, function( elem ) {
- if ( this.nodeType === 1 ) {
- this.insertBefore( elem, this.firstChild );
- }
- });
- },
-
- before: function() {
- if ( this[0] && this[0].parentNode ) {
- return this.domManip(arguments, false, function( elem ) {
- this.parentNode.insertBefore( elem, this );
- });
- } else if ( arguments.length ) {
- var set = jQuery(arguments[0]);
- set.push.apply( set, this.toArray() );
- return this.pushStack( set, "before", arguments );
- }
- },
-
- after: function() {
- if ( this[0] && this[0].parentNode ) {
- return this.domManip(arguments, false, function( elem ) {
- this.parentNode.insertBefore( elem, this.nextSibling );
- });
- } else if ( arguments.length ) {
- var set = this.pushStack( this, "after", arguments );
- set.push.apply( set, jQuery(arguments[0]).toArray() );
- return set;
- }
- },
-
- // keepData is for internal use only--do not document
- remove: function( selector, keepData ) {
- for ( var i = 0, elem; (elem = this[i]) != null; i++ ) {
- if ( !selector || jQuery.filter( selector, [ elem ] ).length ) {
- if ( !keepData && elem.nodeType === 1 ) {
- jQuery.cleanData( elem.getElementsByTagName("*") );
- jQuery.cleanData( [ elem ] );
- }
-
- if ( elem.parentNode ) {
- elem.parentNode.removeChild( elem );
- }
- }
- }
-
- return this;
- },
-
- empty: function() {
- for ( var i = 0, elem; (elem = this[i]) != null; i++ ) {
- // Remove element nodes and prevent memory leaks
- if ( elem.nodeType === 1 ) {
- jQuery.cleanData( elem.getElementsByTagName("*") );
- }
-
- // Remove any remaining nodes
- while ( elem.firstChild ) {
- elem.removeChild( elem.firstChild );
- }
- }
-
- return this;
- },
-
- clone: function( dataAndEvents, deepDataAndEvents ) {
- dataAndEvents = dataAndEvents == null ? true : dataAndEvents;
- deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents;
-
- return this.map( function () {
- return jQuery.clone( this, dataAndEvents, deepDataAndEvents );
- });
- },
-
- html: function( value ) {
- if ( value === undefined ) {
- return this[0] && this[0].nodeType === 1 ?
- this[0].innerHTML.replace(rinlinejQuery, "") :
- null;
-
- // See if we can take a shortcut and just use innerHTML
- } else if ( typeof value === "string" && !rnocache.test( value ) &&
- (jQuery.support.leadingWhitespace || !rleadingWhitespace.test( value )) &&
- !wrapMap[ (rtagName.exec( value ) || ["", ""])[1].toLowerCase() ] ) {
-
- value = value.replace(rxhtmlTag, "<$1></$2>");
-
- try {
- for ( var i = 0, l = this.length; i < l; i++ ) {
- // Remove element nodes and prevent memory leaks
- if ( this[i].nodeType === 1 ) {
- jQuery.cleanData( this[i].getElementsByTagName("*") );
- this[i].innerHTML = value;
- }
- }
-
- // If using innerHTML throws an exception, use the fallback method
- } catch(e) {
- this.empty().append( value );
- }
-
- } else if ( jQuery.isFunction( value ) ) {
- this.each(function(i){
- var self = jQuery( this );
-
- self.html( value.call(this, i, self.html()) );
- });
-
- } else {
- this.empty().append( value );
- }
-
- return this;
- },
-
- replaceWith: function( value ) {
- if ( this[0] && this[0].parentNode ) {
- // Make sure that the elements are removed from the DOM before they are inserted
- // this can help fix replacing a parent with child elements
- if ( jQuery.isFunction( value ) ) {
- return this.each(function(i) {
- var self = jQuery(this), old = self.html();
- self.replaceWith( value.call( this, i, old ) );
- });
- }
-
- if ( typeof value !== "string" ) {
- value = jQuery( value ).detach();
- }
-
- return this.each(function() {
- var next = this.nextSibling,
- parent = this.parentNode;
-
- jQuery( this ).remove();
-
- if ( next ) {
- jQuery(next).before( value );
- } else {
- jQuery(parent).append( value );
- }
- });
- } else {
- return this.pushStack( jQuery(jQuery.isFunction(value) ? value() : value), "replaceWith", value );
- }
- },
-
- detach: function( selector ) {
- return this.remove( selector, true );
- },
-
- domManip: function( args, table, callback ) {
- var results, first, fragment, parent,
- value = args[0],
- scripts = [];
-
- // We can't cloneNode fragments that contain checked, in WebKit
- if ( !jQuery.support.checkClone && arguments.length === 3 && typeof value === "string" && rchecked.test( value ) ) {
- return this.each(function() {
- jQuery(this).domManip( args, table, callback, true );
- });
- }
-
- if ( jQuery.isFunction(value) ) {
- return this.each(function(i) {
- var self = jQuery(this);
- args[0] = value.call(this, i, table ? self.html() : undefined);
- self.domManip( args, table, callback );
- });
- }
-
- if ( this[0] ) {
- parent = value && value.parentNode;
-
- // If we're in a fragment, just use that instead of building a new one
- if ( jQuery.support.parentNode && parent && parent.nodeType === 11 && parent.childNodes.length === this.length ) {
- results = { fragment: parent };
-
- } else {
- results = jQuery.buildFragment( args, this, scripts );
- }
-
- fragment = results.fragment;
-
- if ( fragment.childNodes.length === 1 ) {
- first = fragment = fragment.firstChild;
- } else {
- first = fragment.firstChild;
- }
-
- if ( first ) {
- table = table && jQuery.nodeName( first, "tr" );
-
- for ( var i = 0, l = this.length, lastIndex = l - 1; i < l; i++ ) {
- callback.call(
- table ?
- root(this[i], first) :
- this[i],
- // Make sure that we do not leak memory by inadvertently discarding
- // the original fragment (which might have attached data) instead of
- // using it; in addition, use the original fragment object for the last
- // item instead of first because it can end up being emptied incorrectly
- // in certain situations (Bug #8070).
- // Fragments from the fragment cache must always be cloned and never used
- // in place.
- results.cacheable || (l > 1 && i < lastIndex) ?
- jQuery.clone( fragment, true, true ) :
- fragment
- );
- }
- }
-
- if ( scripts.length ) {
- jQuery.each( scripts, evalScript );
- }
- }
-
- return this;
- }
-});
-
-function root( elem, cur ) {
- return jQuery.nodeName(elem, "table") ?
- (elem.getElementsByTagName("tbody")[0] ||
- elem.appendChild(elem.ownerDocument.createElement("tbody"))) :
- elem;
-}
-
-function cloneCopyEvent( src, dest ) {
-
- if ( dest.nodeType !== 1 || !jQuery.hasData( src ) ) {
- return;
- }
-
- var internalKey = jQuery.expando,
- oldData = jQuery.data( src ),
- curData = jQuery.data( dest, oldData );
-
- // Switch to use the internal data object, if it exists, for the next
- // stage of data copying
- if ( (oldData = oldData[ internalKey ]) ) {
- var events = oldData.events;
- curData = curData[ internalKey ] = jQuery.extend({}, oldData);
-
- if ( events ) {
- delete curData.handle;
- curData.events = {};
-
- for ( var type in events ) {
- for ( var i = 0, l = events[ type ].length; i < l; i++ ) {
- jQuery.event.add( dest, type, events[ type ][ i ], events[ type ][ i ].data );
- }
- }
- }
- }
-}
-
-function cloneFixAttributes(src, dest) {
- // We do not need to do anything for non-Elements
- if ( dest.nodeType !== 1 ) {
- return;
- }
-
- var nodeName = dest.nodeName.toLowerCase();
-
- // clearAttributes removes the attributes, which we don't want,
- // but also removes the attachEvent events, which we *do* want
- dest.clearAttributes();
-
- // mergeAttributes, in contrast, only merges back on the
- // original attributes, not the events
- dest.mergeAttributes(src);
-
- // IE6-8 fail to clone children inside object elements that use
- // the proprietary classid attribute value (rather than the type
- // attribute) to identify the type of content to display
- if ( nodeName === "object" ) {
- dest.outerHTML = src.outerHTML;
-
- } else if ( nodeName === "input" && (src.type === "checkbox" || src.type === "radio") ) {
- // IE6-8 fails to persist the checked state of a cloned checkbox
- // or radio button. Worse, IE6-7 fail to give the cloned element
- // a checked appearance if the defaultChecked value isn't also set
- if ( src.checked ) {
- dest.defaultChecked = dest.checked = src.checked;
- }
-
- // IE6-7 get confused and end up setting the value of a cloned
- // checkbox/radio button to an empty string instead of "on"
- if ( dest.value !== src.value ) {
- dest.value = src.value;
- }
-
- // IE6-8 fails to return the selected option to the default selected
- // state when cloning options
- } else if ( nodeName === "option" ) {
- dest.selected = src.defaultSelected;
-
- // IE6-8 fails to set the defaultValue to the correct value when
- // cloning other types of input fields
- } else if ( nodeName === "input" || nodeName === "textarea" ) {
- dest.defaultValue = src.defaultValue;
- }
-
- // Event data gets referenced instead of copied if the expando
- // gets copied too
- dest.removeAttribute( jQuery.expando );
-}
-
-jQuery.buildFragment = function( args, nodes, scripts ) {
- var fragment, cacheable, cacheresults,
- doc = (nodes && nodes[0] ? nodes[0].ownerDocument || nodes[0] : document);
-
- // Only cache "small" (1/2 KB) HTML strings that are associated with the main document
- // Cloning options loses the selected state, so don't cache them
- // IE 6 doesn't like it when you put <object> or <embed> elements in a fragment
- // Also, WebKit does not clone 'checked' attributes on cloneNode, so don't cache
- if ( args.length === 1 && typeof args[0] === "string" && args[0].length < 512 && doc === document &&
- args[0].charAt(0) === "<" && !rnocache.test( args[0] ) && (jQuery.support.checkClone || !rchecked.test( args[0] )) ) {
-
- cacheable = true;
- cacheresults = jQuery.fragments[ args[0] ];
- if ( cacheresults ) {
- if ( cacheresults !== 1 ) {
- fragment = cacheresults;
- }
- }
- }
-
- if ( !fragment ) {
- fragment = doc.createDocumentFragment();
- jQuery.clean( args, doc, fragment, scripts );
- }
-
- if ( cacheable ) {
- jQuery.fragments[ args[0] ] = cacheresults ? fragment : 1;
- }
-
- return { fragment: fragment, cacheable: cacheable };
-};
-
-jQuery.fragments = {};
-
-jQuery.each({
- appendTo: "append",
- prependTo: "prepend",
- insertBefore: "before",
- insertAfter: "after",
- replaceAll: "replaceWith"
-}, function( name, original ) {
- jQuery.fn[ name ] = function( selector ) {
- var ret = [],
- insert = jQuery( selector ),
- parent = this.length === 1 && this[0].parentNode;
-
- if ( parent && parent.nodeType === 11 && parent.childNodes.length === 1 && insert.length === 1 ) {
- insert[ original ]( this[0] );
- return this;
-
- } else {
- for ( var i = 0, l = insert.length; i < l; i++ ) {
- var elems = (i > 0 ? this.clone(true) : this).get();
- jQuery( insert[i] )[ original ]( elems );
- ret = ret.concat( elems );
- }
-
- return this.pushStack( ret, name, insert.selector );
- }
- };
-});
-
-jQuery.extend({
- clone: function( elem, dataAndEvents, deepDataAndEvents ) {
- var clone = elem.cloneNode(true),
- srcElements,
- destElements,
- i;
-
- if ( !jQuery.support.noCloneEvent && (elem.nodeType === 1 || elem.nodeType === 11) && !jQuery.isXMLDoc(elem) ) {
- // IE copies events bound via attachEvent when using cloneNode.
- // Calling detachEvent on the clone will also remove the events
- // from the original. In order to get around this, we use some
- // proprietary methods to clear the events. Thanks to MooTools
- // guys for this hotness.
-
- // Using Sizzle here is crazy slow, so we use getElementsByTagName
- // instead
- srcElements = elem.getElementsByTagName("*");
- destElements = clone.getElementsByTagName("*");
-
- // Weird iteration because IE will replace the length property
- // with an element if you are cloning the body and one of the
- // elements on the page has a name or id of "length"
- for ( i = 0; srcElements[i]; ++i ) {
- cloneFixAttributes( srcElements[i], destElements[i] );
- }
-
- cloneFixAttributes( elem, clone );
- }
-
- // Copy the events from the original to the clone
- if ( dataAndEvents ) {
-
- cloneCopyEvent( elem, clone );
-
- if ( deepDataAndEvents && "getElementsByTagName" in elem ) {
-
- srcElements = elem.getElementsByTagName("*");
- destElements = clone.getElementsByTagName("*");
-
- if ( srcElements.length ) {
- for ( i = 0; srcElements[i]; ++i ) {
- cloneCopyEvent( srcElements[i], destElements[i] );
- }
- }
- }
- }
- // Return the cloned set
- return clone;
- },
- clean: function( elems, context, fragment, scripts ) {
- context = context || document;
-
- // !context.createElement fails in IE with an error but returns typeof 'object'
- if ( typeof context.createElement === "undefined" ) {
- context = context.ownerDocument || context[0] && context[0].ownerDocument || document;
- }
-
- var ret = [];
-
- for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) {
- if ( typeof elem === "number" ) {
- elem += "";
- }
-
- if ( !elem ) {
- continue;
- }
-
- // Convert html string into DOM nodes
- if ( typeof elem === "string" && !rhtml.test( elem ) ) {
- elem = context.createTextNode( elem );
-
- } else if ( typeof elem === "string" ) {
- // Fix "XHTML"-style tags in all browsers
- elem = elem.replace(rxhtmlTag, "<$1></$2>");
-
- // Trim whitespace, otherwise indexOf won't work as expected
- var tag = (rtagName.exec( elem ) || ["", ""])[1].toLowerCase(),
- wrap = wrapMap[ tag ] || wrapMap._default,
- depth = wrap[0],
- div = context.createElement("div");
-
- // Go to html and back, then peel off extra wrappers
- div.innerHTML = wrap[1] + elem + wrap[2];
-
- // Move to the right depth
- while ( depth-- ) {
- div = div.lastChild;
- }
-
- // Remove IE's autoinserted <tbody> from table fragments
- if ( !jQuery.support.tbody ) {
-
- // String was a <table>, *may* have spurious <tbody>
- var hasBody = rtbody.test(elem),
- tbody = tag === "table" && !hasBody ?
- div.firstChild && div.firstChild.childNodes :
-
- // String was a bare <thead> or <tfoot>
- wrap[1] === "<table>" && !hasBody ?
- div.childNodes :
- [];
-
- for ( var j = tbody.length - 1; j >= 0 ; --j ) {
- if ( jQuery.nodeName( tbody[ j ], "tbody" ) && !tbody[ j ].childNodes.length ) {
- tbody[ j ].parentNode.removeChild( tbody[ j ] );
- }
- }
-
- }
-
- // IE completely kills leading whitespace when innerHTML is used
- if ( !jQuery.support.leadingWhitespace && rleadingWhitespace.test( elem ) ) {
- div.insertBefore( context.createTextNode( rleadingWhitespace.exec(elem)[0] ), div.firstChild );
- }
-
- elem = div.childNodes;
- }
-
- if ( elem.nodeType ) {
- ret.push( elem );
- } else {
- ret = jQuery.merge( ret, elem );
- }
- }
-
- if ( fragment ) {
- for ( i = 0; ret[i]; i++ ) {
- if ( scripts && jQuery.nodeName( ret[i], "script" ) && (!ret[i].type || ret[i].type.toLowerCase() === "text/javascript") ) {
- scripts.push( ret[i].parentNode ? ret[i].parentNode.removeChild( ret[i] ) : ret[i] );
-
- } else {
- if ( ret[i].nodeType === 1 ) {
- ret.splice.apply( ret, [i + 1, 0].concat(jQuery.makeArray(ret[i].getElementsByTagName("script"))) );
- }
- fragment.appendChild( ret[i] );
- }
- }
- }
-
- return ret;
- },
-
- cleanData: function( elems ) {
- var data, id, cache = jQuery.cache, internalKey = jQuery.expando, special = jQuery.event.special,
- deleteExpando = jQuery.support.deleteExpando;
-
- for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) {
- if ( elem.nodeName && jQuery.noData[elem.nodeName.toLowerCase()] ) {
- continue;
- }
-
- id = elem[ jQuery.expando ];
-
- if ( id ) {
- data = cache[ id ] && cache[ id ][ internalKey ];
-
- if ( data && data.events ) {
- for ( var type in data.events ) {
- if ( special[ type ] ) {
- jQuery.event.remove( elem, type );
-
- // This is a shortcut to avoid jQuery.event.remove's overhead
- } else {
- jQuery.removeEvent( elem, type, data.handle );
- }
- }
-
- // Null the DOM reference to avoid IE6/7/8 leak (#7054)
- if ( data.handle ) {
- data.handle.elem = null;
- }
- }
-
- if ( deleteExpando ) {
- delete elem[ jQuery.expando ];
-
- } else if ( elem.removeAttribute ) {
- elem.removeAttribute( jQuery.expando );
- }
-
- delete cache[ id ];
- }
- }
- }
-});
-
-function evalScript( i, elem ) {
- if ( elem.src ) {
- jQuery.ajax({
- url: elem.src,
- async: false,
- dataType: "script"
- });
- } else {
- jQuery.globalEval( elem.text || elem.textContent || elem.innerHTML || "" );
- }
-
- if ( elem.parentNode ) {
- elem.parentNode.removeChild( elem );
- }
-}
-
-
-
-
-var ralpha = /alpha\([^)]*\)/i,
- ropacity = /opacity=([^)]*)/,
- rdashAlpha = /-([a-z])/ig,
- rupper = /([A-Z])/g,
- rnumpx = /^-?\d+(?:px)?$/i,
- rnum = /^-?\d/,
-
- cssShow = { position: "absolute", visibility: "hidden", display: "block" },
- cssWidth = [ "Left", "Right" ],
- cssHeight = [ "Top", "Bottom" ],
- curCSS,
-
- getComputedStyle,
- currentStyle,
-
- fcamelCase = function( all, letter ) {
- return letter.toUpperCase();
- };
-
-jQuery.fn.css = function( name, value ) {
- // Setting 'undefined' is a no-op
- if ( arguments.length === 2 && value === undefined ) {
- return this;
- }
-
- return jQuery.access( this, name, value, true, function( elem, name, value ) {
- return value !== undefined ?
- jQuery.style( elem, name, value ) :
- jQuery.css( elem, name );
- });
-};
-
-jQuery.extend({
- // Add in style property hooks for overriding the default
- // behavior of getting and setting a style property
- cssHooks: {
- opacity: {
- get: function( elem, computed ) {
- if ( computed ) {
- // We should always get a number back from opacity
- var ret = curCSS( elem, "opacity", "opacity" );
- return ret === "" ? "1" : ret;
-
- } else {
- return elem.style.opacity;
- }
- }
- }
- },
-
- // Exclude the following css properties to add px
- cssNumber: {
- "zIndex": true,
- "fontWeight": true,
- "opacity": true,
- "zoom": true,
- "lineHeight": true
- },
-
- // Add in properties whose names you wish to fix before
- // setting or getting the value
- cssProps: {
- // normalize float css property
- "float": jQuery.support.cssFloat ? "cssFloat" : "styleFloat"
- },
-
- // Get and set the style property on a DOM Node
- style: function( elem, name, value, extra ) {
- // Don't set styles on text and comment nodes
- if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style ) {
- return;
- }
-
- // Make sure that we're working with the right name
- var ret, origName = jQuery.camelCase( name ),
- style = elem.style, hooks = jQuery.cssHooks[ origName ];
-
- name = jQuery.cssProps[ origName ] || origName;
-
- // Check if we're setting a value
- if ( value !== undefined ) {
- // Make sure that NaN and null values aren't set. See: #7116
- if ( typeof value === "number" && isNaN( value ) || value == null ) {
- return;
- }
-
- // If a number was passed in, add 'px' to the (except for certain CSS properties)
- if ( typeof value === "number" && !jQuery.cssNumber[ origName ] ) {
- value += "px";
- }
-
- // If a hook was provided, use that value, otherwise just set the specified value
- if ( !hooks || !("set" in hooks) || (value = hooks.set( elem, value )) !== undefined ) {
- // Wrapped to prevent IE from throwing errors when 'invalid' values are provided
- // Fixes bug #5509
- try {
- style[ name ] = value;
- } catch(e) {}
- }
-
- } else {
- // If a hook was provided get the non-computed value from there
- if ( hooks && "get" in hooks && (ret = hooks.get( elem, false, extra )) !== undefined ) {
- return ret;
- }
-
- // Otherwise just get the value from the style object
- return style[ name ];
- }
- },
-
- css: function( elem, name, extra ) {
- // Make sure that we're working with the right name
- var ret, origName = jQuery.camelCase( name ),
- hooks = jQuery.cssHooks[ origName ];
-
- name = jQuery.cssProps[ origName ] || origName;
-
- // If a hook was provided get the computed value from there
- if ( hooks && "get" in hooks && (ret = hooks.get( elem, true, extra )) !== undefined ) {
- return ret;
-
- // Otherwise, if a way to get the computed value exists, use that
- } else if ( curCSS ) {
- return curCSS( elem, name, origName );
- }
- },
-
- // A method for quickly swapping in/out CSS properties to get correct calculations
- swap: function( elem, options, callback ) {
- var old = {};
-
- // Remember the old values, and insert the new ones
- for ( var name in options ) {
- old[ name ] = elem.style[ name ];
- elem.style[ name ] = options[ name ];
- }
-
- callback.call( elem );
-
- // Revert the old values
- for ( name in options ) {
- elem.style[ name ] = old[ name ];
- }
- },
-
- camelCase: function( string ) {
- return string.replace( rdashAlpha, fcamelCase );
- }
-});
-
-// DEPRECATED, Use jQuery.css() instead
-jQuery.curCSS = jQuery.css;
-
-jQuery.each(["height", "width"], function( i, name ) {
- jQuery.cssHooks[ name ] = {
- get: function( elem, computed, extra ) {
- var val;
-
- if ( computed ) {
- if ( elem.offsetWidth !== 0 ) {
- val = getWH( elem, name, extra );
-
- } else {
- jQuery.swap( elem, cssShow, function() {
- val = getWH( elem, name, extra );
- });
- }
-
- if ( val <= 0 ) {
- val = curCSS( elem, name, name );
-
- if ( val === "0px" && currentStyle ) {
- val = currentStyle( elem, name, name );
- }
-
- if ( val != null ) {
- // Should return "auto" instead of 0, use 0 for
- // temporary backwards-compat
- return val === "" || val === "auto" ? "0px" : val;
- }
- }
-
- if ( val < 0 || val == null ) {
- val = elem.style[ name ];
-
- // Should return "auto" instead of 0, use 0 for
- // temporary backwards-compat
- return val === "" || val === "auto" ? "0px" : val;
- }
-
- return typeof val === "string" ? val : val + "px";
- }
- },
-
- set: function( elem, value ) {
- if ( rnumpx.test( value ) ) {
- // ignore negative width and height values #1599
- value = parseFloat(value);
-
- if ( value >= 0 ) {
- return value + "px";
- }
-
- } else {
- return value;
- }
- }
- };
-});
-
-if ( !jQuery.support.opacity ) {
- jQuery.cssHooks.opacity = {
- get: function( elem, computed ) {
- // IE uses filters for opacity
- return ropacity.test((computed && elem.currentStyle ? elem.currentStyle.filter : elem.style.filter) || "") ?
- (parseFloat(RegExp.$1) / 100) + "" :
- computed ? "1" : "";
- },
-
- set: function( elem, value ) {
- var style = elem.style;
-
- // IE has trouble with opacity if it does not have layout
- // Force it by setting the zoom level
- style.zoom = 1;
-
- // Set the alpha filter to set the opacity
- var opacity = jQuery.isNaN(value) ?
- "" :
- "alpha(opacity=" + value * 100 + ")",
- filter = style.filter || "";
-
- style.filter = ralpha.test(filter) ?
- filter.replace(ralpha, opacity) :
- style.filter + ' ' + opacity;
- }
- };
-}
-
-if ( document.defaultView && document.defaultView.getComputedStyle ) {
- getComputedStyle = function( elem, newName, name ) {
- var ret, defaultView, computedStyle;
-
- name = name.replace( rupper, "-$1" ).toLowerCase();
-
- if ( !(defaultView = elem.ownerDocument.defaultView) ) {
- return undefined;
- }
-
- if ( (computedStyle = defaultView.getComputedStyle( elem, null )) ) {
- ret = computedStyle.getPropertyValue( name );
- if ( ret === "" && !jQuery.contains( elem.ownerDocument.documentElement, elem ) ) {
- ret = jQuery.style( elem, name );
- }
- }
-
- return ret;
- };
-}
-
-if ( document.documentElement.currentStyle ) {
- currentStyle = function( elem, name ) {
- var left,
- ret = elem.currentStyle && elem.currentStyle[ name ],
- rsLeft = elem.runtimeStyle && elem.runtimeStyle[ name ],
- style = elem.style;
-
- // From the awesome hack by Dean Edwards
- // http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291
-
- // If we're not dealing with a regular pixel number
- // but a number that has a weird ending, we need to convert it to pixels
- if ( !rnumpx.test( ret ) && rnum.test( ret ) ) {
- // Remember the original values
- left = style.left;
-
- // Put in the new values to get a computed value out
- if ( rsLeft ) {
- elem.runtimeStyle.left = elem.currentStyle.left;
- }
- style.left = name === "fontSize" ? "1em" : (ret || 0);
- ret = style.pixelLeft + "px";
-
- // Revert the changed values
- style.left = left;
- if ( rsLeft ) {
- elem.runtimeStyle.left = rsLeft;
- }
- }
-
- return ret === "" ? "auto" : ret;
- };
-}
-
-curCSS = getComputedStyle || currentStyle;
-
-function getWH( elem, name, extra ) {
- var which = name === "width" ? cssWidth : cssHeight,
- val = name === "width" ? elem.offsetWidth : elem.offsetHeight;
-
- if ( extra === "border" ) {
- return val;
- }
-
- jQuery.each( which, function() {
- if ( !extra ) {
- val -= parseFloat(jQuery.css( elem, "padding" + this )) || 0;
- }
-
- if ( extra === "margin" ) {
- val += parseFloat(jQuery.css( elem, "margin" + this )) || 0;
-
- } else {
- val -= parseFloat(jQuery.css( elem, "border" + this + "Width" )) || 0;
- }
- });
-
- return val;
-}
-
-if ( jQuery.expr && jQuery.expr.filters ) {
- jQuery.expr.filters.hidden = function( elem ) {
- var width = elem.offsetWidth,
- height = elem.offsetHeight;
-
- return (width === 0 && height === 0) || (!jQuery.support.reliableHiddenOffsets && (elem.style.display || jQuery.css( elem, "display" )) === "none");
- };
-
- jQuery.expr.filters.visible = function( elem ) {
- return !jQuery.expr.filters.hidden( elem );
- };
-}
-
-
-
-
-var r20 = /%20/g,
- rbracket = /\[\]$/,
- rCRLF = /\r?\n/g,
- rhash = /#.*$/,
- rheaders = /^(.*?):\s*(.*?)\r?$/mg, // IE leaves an \r character at EOL
- rinput = /^(?:color|date|datetime|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i,
- rnoContent = /^(?:GET|HEAD)$/,
- rprotocol = /^\/\//,
- rquery = /\?/,
- rscript = /<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi,
- rselectTextarea = /^(?:select|textarea)/i,
- rspacesAjax = /\s+/,
- rts = /([?&])_=[^&]*/,
- rurl = /^(\w+:)\/\/([^\/?#:]+)(?::(\d+))?/,
-
- // Keep a copy of the old load method
- _load = jQuery.fn.load,
-
- /* Prefilters
- * 1) They are useful to introduce custom dataTypes (see ajax/jsonp.js for an example)
- * 2) These are called:
- * - BEFORE asking for a transport
- * - AFTER param serialization (s.data is a string if s.processData is true)
- * 3) key is the dataType
- * 4) the catchall symbol "*" can be used
- * 5) execution will start with transport dataType and THEN continue down to "*" if needed
- */
- prefilters = {},
-
- /* Transports bindings
- * 1) key is the dataType
- * 2) the catchall symbol "*" can be used
- * 3) selection will start with transport dataType and THEN go to "*" if needed
- */
- transports = {};
-
-// Base "constructor" for jQuery.ajaxPrefilter and jQuery.ajaxTransport
-function addToPrefiltersOrTransports( structure ) {
-
- // dataTypeExpression is optional and defaults to "*"
- return function( dataTypeExpression, func ) {
-
- if ( typeof dataTypeExpression !== "string" ) {
- func = dataTypeExpression;
- dataTypeExpression = "*";
- }
-
- if ( jQuery.isFunction( func ) ) {
- var dataTypes = dataTypeExpression.toLowerCase().split( rspacesAjax ),
- i = 0,
- length = dataTypes.length,
- dataType,
- list,
- placeBefore;
-
- // For each dataType in the dataTypeExpression
- for(; i < length; i++ ) {
- dataType = dataTypes[ i ];
- // We control if we're asked to add before
- // any existing element
- placeBefore = /^\+/.test( dataType );
- if ( placeBefore ) {
- dataType = dataType.substr( 1 ) || "*";
- }
- list = structure[ dataType ] = structure[ dataType ] || [];
- // then we add to the structure accordingly
- list[ placeBefore ? "unshift" : "push" ]( func );
- }
- }
- };
-}
-
-//Base inspection function for prefilters and transports
-function inspectPrefiltersOrTransports( structure, options, originalOptions, jXHR,
- dataType /* internal */, inspected /* internal */ ) {
-
- dataType = dataType || options.dataTypes[ 0 ];
- inspected = inspected || {};
-
- inspected[ dataType ] = true;
-
- var list = structure[ dataType ],
- i = 0,
- length = list ? list.length : 0,
- executeOnly = ( structure === prefilters ),
- selection;
-
- for(; i < length && ( executeOnly || !selection ); i++ ) {
- selection = list[ i ]( options, originalOptions, jXHR );
- // If we got redirected to another dataType
- // we try there if not done already
- if ( typeof selection === "string" ) {
- if ( inspected[ selection ] ) {
- selection = undefined;
- } else {
- options.dataTypes.unshift( selection );
- selection = inspectPrefiltersOrTransports(
- structure, options, originalOptions, jXHR, selection, inspected );
- }
- }
- }
- // If we're only executing or nothing was selected
- // we try the catchall dataType if not done already
- if ( ( executeOnly || !selection ) && !inspected[ "*" ] ) {
- selection = inspectPrefiltersOrTransports(
- structure, options, originalOptions, jXHR, "*", inspected );
- }
- // unnecessary when only executing (prefilters)
- // but it'll be ignored by the caller in that case
- return selection;
-}
-
-jQuery.fn.extend({
- load: function( url, params, callback ) {
- if ( typeof url !== "string" && _load ) {
- return _load.apply( this, arguments );
-
- // Don't do a request if no elements are being requested
- } else if ( !this.length ) {
- return this;
- }
-
- var off = url.indexOf( " " );
- if ( off >= 0 ) {
- var selector = url.slice( off, url.length );
- url = url.slice( 0, off );
- }
-
- // Default to a GET request
- var type = "GET";
-
- // If the second parameter was provided
- if ( params ) {
- // If it's a function
- if ( jQuery.isFunction( params ) ) {
- // We assume that it's the callback
- callback = params;
- params = null;
-
- // Otherwise, build a param string
- } else if ( typeof params === "object" ) {
- params = jQuery.param( params, jQuery.ajaxSettings.traditional );
- type = "POST";
- }
- }
-
- var self = this;
-
- // Request the remote document
- jQuery.ajax({
- url: url,
- type: type,
- dataType: "html",
- data: params,
- // Complete callback (responseText is used internally)
- complete: function( jXHR, status, responseText ) {
- // Store the response as specified by the jXHR object
- responseText = jXHR.responseText;
- // If successful, inject the HTML into all the matched elements
- if ( jXHR.isResolved() ) {
- // #4825: Get the actual response in case
- // a dataFilter is present in ajaxSettings
- jXHR.done(function( r ) {
- responseText = r;
- });
- // See if a selector was specified
- self.html( selector ?
- // Create a dummy div to hold the results
- jQuery("<div>")
- // inject the contents of the document in, removing the scripts
- // to avoid any 'Permission Denied' errors in IE
- .append(responseText.replace(rscript, ""))
-
- // Locate the specified elements
- .find(selector) :
-
- // If not, just inject the full result
- responseText );
- }
-
- if ( callback ) {
- self.each( callback, [ responseText, status, jXHR ] );
- }
- }
- });
-
- return this;
- },
-
- serialize: function() {
- return jQuery.param( this.serializeArray() );
- },
-
- serializeArray: function() {
- return this.map(function(){
- return this.elements ? jQuery.makeArray( this.elements ) : this;
- })
- .filter(function(){
- return this.name && !this.disabled &&
- ( this.checked || rselectTextarea.test( this.nodeName ) ||
- rinput.test( this.type ) );
- })
- .map(function( i, elem ){
- var val = jQuery( this ).val();
-
- return val == null ?
- null :
- jQuery.isArray( val ) ?
- jQuery.map( val, function( val, i ){
- return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) };
- }) :
- { name: elem.name, value: val.replace( rCRLF, "\r\n" ) };
- }).get();
- }
-});
-
-// Attach a bunch of functions for handling common AJAX events
-jQuery.each( "ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split( " " ), function( i, o ){
- jQuery.fn[ o ] = function( f ){
- return this.bind( o, f );
- };
-} );
-
-jQuery.each( [ "get", "post" ], function( i, method ) {
- jQuery[ method ] = function( url, data, callback, type ) {
- // shift arguments if data argument was omitted
- if ( jQuery.isFunction( data ) ) {
- type = type || callback;
- callback = data;
- data = null;
- }
-
- return jQuery.ajax({
- type: method,
- url: url,
- data: data,
- success: callback,
- dataType: type
- });
- };
-} );
-
-jQuery.extend({
-
- getScript: function( url, callback ) {
- return jQuery.get( url, null, callback, "script" );
- },
-
- getJSON: function( url, data, callback ) {
- return jQuery.get( url, data, callback, "json" );
- },
-
- ajaxSetup: function( settings ) {
- jQuery.extend( true, jQuery.ajaxSettings, settings );
- if ( settings.context ) {
- jQuery.ajaxSettings.context = settings.context;
- }
- },
-
- ajaxSettings: {
- url: location.href,
- global: true,
- type: "GET",
- contentType: "application/x-www-form-urlencoded",
- processData: true,
- async: true,
- /*
- timeout: 0,
- data: null,
- dataType: null,
- username: null,
- password: null,
- cache: null,
- traditional: false,
- headers: {},
- crossDomain: null,
- */
-
- accepts: {
- xml: "application/xml, text/xml",
- html: "text/html",
- text: "text/plain",
- json: "application/json, text/javascript",
- "*": "*/*"
- },
-
- contents: {
- xml: /xml/,
- html: /html/,
- json: /json/
- },
-
- responseFields: {
- xml: "responseXML",
- text: "responseText"
- },
-
- // List of data converters
- // 1) key format is "source_type destination_type" (a single space in-between)
- // 2) the catchall symbol "*" can be used for source_type
- converters: {
-
- // Convert anything to text
- "* text": window.String,
-
- // Text to html (true = no transformation)
- "text html": true,
-
- // Evaluate text as a json expression
- "text json": jQuery.parseJSON,
-
- // Parse text as xml
- "text xml": jQuery.parseXML
- }
- },
-
- ajaxPrefilter: addToPrefiltersOrTransports( prefilters ),
- ajaxTransport: addToPrefiltersOrTransports( transports ),
-
- // Main method
- ajax: function( url, options ) {
-
- // If options is not an object,
- // we simulate pre-1.5 signature
- if ( typeof options !== "object" ) {
- options = url;
- url = undefined;
- }
-
- // Force options to be an object
- options = options || {};
-
- var // Create the final options object
- s = jQuery.extend( true, {}, jQuery.ajaxSettings, options ),
- // Callbacks contexts
- // We force the original context if it exists
- // or take it from jQuery.ajaxSettings otherwise
- // (plain objects used as context get extended)
- callbackContext =
- ( s.context = ( "context" in options ? options : jQuery.ajaxSettings ).context ) || s,
- globalEventContext = callbackContext === s ? jQuery.event : jQuery( callbackContext ),
- // Deferreds
- deferred = jQuery.Deferred(),
- completeDeferred = jQuery._Deferred(),
- // Status-dependent callbacks
- statusCode = s.statusCode || {},
- // Headers (they are sent all at once)
- requestHeaders = {},
- // Response headers
- responseHeadersString,
- responseHeaders,
- // transport
- transport,
- // timeout handle
- timeoutTimer,
- // Cross-domain detection vars
- loc = document.location,
- protocol = loc.protocol || "http:",
- parts,
- // The jXHR state
- state = 0,
- // Loop variable
- i,
- // Fake xhr
- jXHR = {
-
- readyState: 0,
-
- // Caches the header
- setRequestHeader: function( name, value ) {
- if ( state === 0 ) {
- requestHeaders[ name.toLowerCase() ] = value;
- }
- return this;
- },
-
- // Raw string
- getAllResponseHeaders: function() {
- return state === 2 ? responseHeadersString : null;
- },
-
- // Builds headers hashtable if needed
- getResponseHeader: function( key ) {
- var match;
- if ( state === 2 ) {
- if ( !responseHeaders ) {
- responseHeaders = {};
- while( ( match = rheaders.exec( responseHeadersString ) ) ) {
- responseHeaders[ match[1].toLowerCase() ] = match[ 2 ];
- }
- }
- match = responseHeaders[ key.toLowerCase() ];
- }
- return match || null;
- },
-
- // Cancel the request
- abort: function( statusText ) {
- statusText = statusText || "abort";
- if ( transport ) {
- transport.abort( statusText );
- }
- done( 0, statusText );
- return this;
- }
- };
-
- // Callback for when everything is done
- // It is defined here because jslint complains if it is declared
- // at the end of the function (which would be more logical and readable)
- function done( status, statusText, responses, headers) {
-
- // Called once
- if ( state === 2 ) {
- return;
- }
-
- // State is "done" now
- state = 2;
-
- // Clear timeout if it exists
- if ( timeoutTimer ) {
- clearTimeout( timeoutTimer );
- }
-
- // Dereference transport for early garbage collection
- // (no matter how long the jXHR object will be used)
- transport = undefined;
-
- // Cache response headers
- responseHeadersString = headers || "";
-
- // Set readyState
- jXHR.readyState = status ? 4 : 0;
-
- var isSuccess,
- success,
- error,
- response = responses ? ajaxHandleResponses( s, jXHR, responses ) : undefined,
- lastModified,
- etag;
-
- // If successful, handle type chaining
- if ( status >= 200 && status < 300 || status === 304 ) {
-
- // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode.
- if ( s.ifModified ) {
-
- if ( ( lastModified = jXHR.getResponseHeader( "Last-Modified" ) ) ) {
- jQuery.lastModified[ s.url ] = lastModified;
- }
- if ( ( etag = jXHR.getResponseHeader( "Etag" ) ) ) {
- jQuery.etag[ s.url ] = etag;
- }
- }
-
- // If not modified
- if ( status === 304 ) {
-
- statusText = "notmodified";
- isSuccess = true;
-
- // If we have data
- } else {
-
- try {
- success = ajaxConvert( s, response );
- statusText = "success";
- isSuccess = true;
- } catch(e) {
- // We have a parsererror
- statusText = "parsererror";
- error = e;
- }
- }
- } else {
- // We extract error from statusText
- // then normalize statusText and status for non-aborts
- error = statusText;
- if( status ) {
- statusText = "error";
- if ( status < 0 ) {
- status = 0;
- }
- }
- }
-
- // Set data for the fake xhr object
- jXHR.status = status;
- jXHR.statusText = statusText;
-
- // Success/Error
- if ( isSuccess ) {
- deferred.resolveWith( callbackContext, [ success, statusText, jXHR ] );
- } else {
- deferred.rejectWith( callbackContext, [ jXHR, statusText, error ] );
- }
-
- // Status-dependent callbacks
- jXHR.statusCode( statusCode );
- statusCode = undefined;
-
- if ( s.global ) {
- globalEventContext.trigger( "ajax" + ( isSuccess ? "Success" : "Error" ),
- [ jXHR, s, isSuccess ? success : error ] );
- }
-
- // Complete
- completeDeferred.resolveWith( callbackContext, [ jXHR, statusText ] );
-
- if ( s.global ) {
- globalEventContext.trigger( "ajaxComplete", [ jXHR, s] );
- // Handle the global AJAX counter
- if ( !( --jQuery.active ) ) {
- jQuery.event.trigger( "ajaxStop" );
- }
- }
- }
-
- // Attach deferreds
- deferred.promise( jXHR );
- jXHR.success = jXHR.done;
- jXHR.error = jXHR.fail;
- jXHR.complete = completeDeferred.done;
-
- // Status-dependent callbacks
- jXHR.statusCode = function( map ) {
- if ( map ) {
- var tmp;
- if ( state < 2 ) {
- for( tmp in map ) {
- statusCode[ tmp ] = [ statusCode[tmp], map[tmp] ];
- }
- } else {
- tmp = map[ jXHR.status ];
- jXHR.then( tmp, tmp );
- }
- }
- return this;
- };
-
- // Remove hash character (#7531: and string promotion)
- // Add protocol if not provided (#5866: IE7 issue with protocol-less urls)
- // We also use the url parameter if available
- s.url = ( "" + ( url || s.url ) ).replace( rhash, "" ).replace( rprotocol, protocol + "//" );
-
- // Extract dataTypes list
- s.dataTypes = jQuery.trim( s.dataType || "*" ).toLowerCase().split( rspacesAjax );
-
- // Determine if a cross-domain request is in order
- if ( !s.crossDomain ) {
- parts = rurl.exec( s.url.toLowerCase() );
- s.crossDomain = !!( parts &&
- ( parts[ 1 ] != protocol || parts[ 2 ] != loc.hostname ||
- ( parts[ 3 ] || ( parts[ 1 ] === "http:" ? 80 : 443 ) ) !=
- ( loc.port || ( protocol === "http:" ? 80 : 443 ) ) )
- );
- }
-
- // Convert data if not already a string
- if ( s.data && s.processData && typeof s.data !== "string" ) {
- s.data = jQuery.param( s.data, s.traditional );
- }
-
- // Apply prefilters
- inspectPrefiltersOrTransports( prefilters, s, options, jXHR );
-
- // Uppercase the type
- s.type = s.type.toUpperCase();
-
- // Determine if request has content
- s.hasContent = !rnoContent.test( s.type );
-
- // Watch for a new set of requests
- if ( s.global && jQuery.active++ === 0 ) {
- jQuery.event.trigger( "ajaxStart" );
- }
-
- // More options handling for requests with no content
- if ( !s.hasContent ) {
-
- // If data is available, append data to url
- if ( s.data ) {
- s.url += ( rquery.test( s.url ) ? "&" : "?" ) + s.data;
- }
-
- // Add anti-cache in url if needed
- if ( s.cache === false ) {
-
- var ts = jQuery.now(),
- // try replacing _= if it is there
- ret = s.url.replace( rts, "$1_=" + ts );
-
- // if nothing was replaced, add timestamp to the end
- s.url = ret + ( (ret === s.url ) ? ( rquery.test( s.url ) ? "&" : "?" ) + "_=" + ts : "" );
- }
- }
-
- // Set the correct header, if data is being sent
- if ( s.data && s.hasContent && s.contentType !== false || options.contentType ) {
- requestHeaders[ "content-type" ] = s.contentType;
- }
-
- // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode.
- if ( s.ifModified ) {
- if ( jQuery.lastModified[ s.url ] ) {
- requestHeaders[ "if-modified-since" ] = jQuery.lastModified[ s.url ];
- }
- if ( jQuery.etag[ s.url ] ) {
- requestHeaders[ "if-none-match" ] = jQuery.etag[ s.url ];
- }
- }
-
- // Set the Accepts header for the server, depending on the dataType
- requestHeaders.accept = s.dataTypes[ 0 ] && s.accepts[ s.dataTypes[0] ] ?
- s.accepts[ s.dataTypes[0] ] + ( s.dataTypes[ 0 ] !== "*" ? ", */*; q=0.01" : "" ) :
- s.accepts[ "*" ];
-
- // Check for headers option
- for ( i in s.headers ) {
- requestHeaders[ i.toLowerCase() ] = s.headers[ i ];
- }
-
- // Allow custom headers/mimetypes and early abort
- if ( s.beforeSend && ( s.beforeSend.call( callbackContext, jXHR, s ) === false || state === 2 ) ) {
- // Abort if not done already
- done( 0, "abort" );
- // Return false
- jXHR = false;
-
- } else {
-
- // Install callbacks on deferreds
- for ( i in { success: 1, error: 1, complete: 1 } ) {
- jXHR[ i ]( s[ i ] );
- }
-
- // Get transport
- transport = inspectPrefiltersOrTransports( transports, s, options, jXHR );
-
- // If no transport, we auto-abort
- if ( !transport ) {
- done( -1, "No Transport" );
- } else {
- // Set state as sending
- state = jXHR.readyState = 1;
- // Send global event
- if ( s.global ) {
- globalEventContext.trigger( "ajaxSend", [ jXHR, s ] );
- }
- // Timeout
- if ( s.async && s.timeout > 0 ) {
- timeoutTimer = setTimeout( function(){
- jXHR.abort( "timeout" );
- }, s.timeout );
- }
-
- try {
- transport.send( requestHeaders, done );
- } catch (e) {
- // Propagate exception as error if not done
- if ( status < 2 ) {
- done( -1, e );
- // Simply rethrow otherwise
- } else {
- jQuery.error( e );
- }
- }
- }
- }
- return jXHR;
- },
-
- // Serialize an array of form elements or a set of
- // key/values into a query string
- param: function( a, traditional ) {
- var s = [],
- add = function( key, value ) {
- // If value is a function, invoke it and return its value
- value = jQuery.isFunction( value ) ? value() : value;
- s[ s.length ] = encodeURIComponent( key ) + "=" + encodeURIComponent( value );
- };
-
- // Set traditional to true for jQuery <= 1.3.2 behavior.
- if ( traditional === undefined ) {
- traditional = jQuery.ajaxSettings.traditional;
- }
-
- // If an array was passed in, assume that it is an array of form elements.
- if ( jQuery.isArray( a ) || a.jquery ) {
- // Serialize the form elements
- jQuery.each( a, function() {
- add( this.name, this.value );
- } );
-
- } else {
- // If traditional, encode the "old" way (the way 1.3.2 or older
- // did it), otherwise encode params recursively.
- for ( var prefix in a ) {
- buildParams( prefix, a[ prefix ], traditional, add );
- }
- }
-
- // Return the resulting serialization
- return s.join( "&" ).replace( r20, "+" );
- }
-});
-
-function buildParams( prefix, obj, traditional, add ) {
- if ( jQuery.isArray( obj ) && obj.length ) {
- // Serialize array item.
- jQuery.each( obj, function( i, v ) {
- if ( traditional || rbracket.test( prefix ) ) {
- // Treat each array item as a scalar.
- add( prefix, v );
-
- } else {
- // If array item is non-scalar (array or object), encode its
- // numeric index to resolve deserialization ambiguity issues.
- // Note that rack (as of 1.0.0) can't currently deserialize
- // nested arrays properly, and attempting to do so may cause
- // a server error. Possible fixes are to modify rack's
- // deserialization algorithm or to provide an option or flag
- // to force array serialization to be shallow.
- buildParams( prefix + "[" + ( typeof v === "object" || jQuery.isArray(v) ? i : "" ) + "]", v, traditional, add );
- }
- });
-
- } else if ( !traditional && obj != null && typeof obj === "object" ) {
- // If we see an array here, it is empty and should be treated as an empty
- // object
- if ( jQuery.isArray( obj ) || jQuery.isEmptyObject( obj ) ) {
- add( prefix, "" );
-
- // Serialize object item.
- } else {
- jQuery.each( obj, function( k, v ) {
- buildParams( prefix + "[" + k + "]", v, traditional, add );
- });
- }
-
- } else {
- // Serialize scalar item.
- add( prefix, obj );
- }
-}
-
-// This is still on the jQuery object... for now
-// Want to move this to jQuery.ajax some day
-jQuery.extend({
-
- // Counter for holding the number of active queries
- active: 0,
-
- // Last-Modified header cache for next request
- lastModified: {},
- etag: {}
-
-});
-
-/* Handles responses to an ajax request:
- * - sets all responseXXX fields accordingly
- * - finds the right dataType (mediates between content-type and expected dataType)
- * - returns the corresponding response
- */
-function ajaxHandleResponses( s, jXHR, responses ) {
-
- var contents = s.contents,
- dataTypes = s.dataTypes,
- responseFields = s.responseFields,
- ct,
- type,
- finalDataType,
- firstDataType;
-
- // Fill responseXXX fields
- for( type in responseFields ) {
- if ( type in responses ) {
- jXHR[ responseFields[type] ] = responses[ type ];
- }
- }
-
- // Remove auto dataType and get content-type in the process
- while( dataTypes[ 0 ] === "*" ) {
- dataTypes.shift();
- if ( ct === undefined ) {
- ct = jXHR.getResponseHeader( "content-type" );
- }
- }
-
- // Check if we're dealing with a known content-type
- if ( ct ) {
- for ( type in contents ) {
- if ( contents[ type ] && contents[ type ].test( ct ) ) {
- dataTypes.unshift( type );
- break;
- }
- }
- }
-
- // Check to see if we have a response for the expected dataType
- if ( dataTypes[ 0 ] in responses ) {
- finalDataType = dataTypes[ 0 ];
- } else {
- // Try convertible dataTypes
- for ( type in responses ) {
- if ( !dataTypes[ 0 ] || s.converters[ type + " " + dataTypes[0] ] ) {
- finalDataType = type;
- break;
- }
- if ( !firstDataType ) {
- firstDataType = type;
- }
- }
- // Or just use first one
- finalDataType = finalDataType || firstDataType;
- }
-
- // If we found a dataType
- // We add the dataType to the list if needed
- // and return the corresponding response
- if ( finalDataType ) {
- if ( finalDataType !== dataTypes[ 0 ] ) {
- dataTypes.unshift( finalDataType );
- }
- return responses[ finalDataType ];
- }
-}
-
-// Chain conversions given the request and the original response
-function ajaxConvert( s, response ) {
-
- // Apply the dataFilter if provided
- if ( s.dataFilter ) {
- response = s.dataFilter( response, s.dataType );
- }
-
- var dataTypes = s.dataTypes,
- converters = s.converters,
- i,
- length = dataTypes.length,
- tmp,
- // Current and previous dataTypes
- current = dataTypes[ 0 ],
- prev,
- // Conversion expression
- conversion,
- // Conversion function
- conv,
- // Conversion functions (transitive conversion)
- conv1,
- conv2;
-
- // For each dataType in the chain
- for( i = 1; i < length; i++ ) {
-
- // Get the dataTypes
- prev = current;
- current = dataTypes[ i ];
-
- // If current is auto dataType, update it to prev
- if( current === "*" ) {
- current = prev;
- // If no auto and dataTypes are actually different
- } else if ( prev !== "*" && prev !== current ) {
-
- // Get the converter
- conversion = prev + " " + current;
- conv = converters[ conversion ] || converters[ "* " + current ];
-
- // If there is no direct converter, search transitively
- if ( !conv ) {
- conv2 = undefined;
- for( conv1 in converters ) {
- tmp = conv1.split( " " );
- if ( tmp[ 0 ] === prev || tmp[ 0 ] === "*" ) {
- conv2 = converters[ tmp[1] + " " + current ];
- if ( conv2 ) {
- conv1 = converters[ conv1 ];
- if ( conv1 === true ) {
- conv = conv2;
- } else if ( conv2 === true ) {
- conv = conv1;
- }
- break;
- }
- }
- }
- }
- // If we found no converter, dispatch an error
- if ( !( conv || conv2 ) ) {
- jQuery.error( "No conversion from " + conversion.replace(" "," to ") );
- }
- // If found converter is not an equivalence
- if ( conv !== true ) {
- // Convert with 1 or 2 converters accordingly
- response = conv ? conv( response ) : conv2( conv1(response) );
- }
- }
- }
- return response;
-}
-
-
-
-
-var jsc = jQuery.now(),
- jsre = /(\=)\?(&|$)|()\?\?()/i;
-
-// Default jsonp settings
-jQuery.ajaxSetup({
- jsonp: "callback",
- jsonpCallback: function() {
- return jQuery.expando + "_" + ( jsc++ );
- }
-});
-
-// Detect, normalize options and install callbacks for jsonp requests
-jQuery.ajaxPrefilter( "json jsonp", function( s, originalSettings, dataIsString /* internal */ ) {
-
- dataIsString = ( typeof s.data === "string" );
-
- if ( s.dataTypes[ 0 ] === "jsonp" ||
- originalSettings.jsonpCallback ||
- originalSettings.jsonp != null ||
- s.jsonp !== false && ( jsre.test( s.url ) ||
- dataIsString && jsre.test( s.data ) ) ) {
-
- var responseContainer,
- jsonpCallback = s.jsonpCallback =
- jQuery.isFunction( s.jsonpCallback ) ? s.jsonpCallback() : s.jsonpCallback,
- previous = window[ jsonpCallback ],
- url = s.url,
- data = s.data,
- replace = "$1" + jsonpCallback + "$2";
-
- if ( s.jsonp !== false ) {
- url = url.replace( jsre, replace );
- if ( s.url === url ) {
- if ( dataIsString ) {
- data = data.replace( jsre, replace );
- }
- if ( s.data === data ) {
- // Add callback manually
- url += (/\?/.test( url ) ? "&" : "?") + s.jsonp + "=" + jsonpCallback;
- }
- }
- }
-
- s.url = url;
- s.data = data;
-
- window[ jsonpCallback ] = function( response ) {
- responseContainer = [ response ];
- };
-
- s.complete = [ function() {
-
- // Set callback back to previous value
- window[ jsonpCallback ] = previous;
-
- // Call if it was a function and we have a response
- if ( previous) {
- if ( responseContainer && jQuery.isFunction( previous ) ) {
- window[ jsonpCallback ] ( responseContainer[ 0 ] );
- }
- } else {
- // else, more memory leak avoidance
- try{
- delete window[ jsonpCallback ];
- } catch( e ) {}
- }
-
- }, s.complete ];
-
- // Use data converter to retrieve json after script execution
- s.converters["script json"] = function() {
- if ( ! responseContainer ) {
- jQuery.error( jsonpCallback + " was not called" );
- }
- return responseContainer[ 0 ];
- };
-
- // force json dataType
- s.dataTypes[ 0 ] = "json";
-
- // Delegate to script
- return "script";
- }
-} );
-
-
-
-
-// Install script dataType
-jQuery.ajaxSetup({
- accepts: {
- script: "text/javascript, application/javascript"
- },
- contents: {
- script: /javascript/
- },
- converters: {
- "text script": function( text ) {
- jQuery.globalEval( text );
- return text;
- }
- }
-});
-
-// Handle cache's special case and global
-jQuery.ajaxPrefilter( "script", function( s ) {
- if ( s.cache === undefined ) {
- s.cache = false;
- }
- if ( s.crossDomain ) {
- s.type = "GET";
- s.global = false;
- }
-} );
-
-// Bind script tag hack transport
-jQuery.ajaxTransport( "script", function(s) {
-
- // This transport only deals with cross domain requests
- if ( s.crossDomain ) {
-
- var script,
- head = document.getElementsByTagName( "head" )[ 0 ] || document.documentElement;
-
- return {
-
- send: function( _, callback ) {
-
- script = document.createElement( "script" );
-
- script.async = "async";
-
- if ( s.scriptCharset ) {
- script.charset = s.scriptCharset;
- }
-
- script.src = s.url;
-
- // Attach handlers for all browsers
- script.onload = script.onreadystatechange = function( _, isAbort ) {
-
- if ( !script.readyState || /loaded|complete/.test( script.readyState ) ) {
-
- // Handle memory leak in IE
- script.onload = script.onreadystatechange = null;
-
- // Remove the script
- if ( head && script.parentNode ) {
- head.removeChild( script );
- }
-
- // Dereference the script
- script = undefined;
-
- // Callback if not abort
- if ( !isAbort ) {
- callback( 200, "success" );
- }
- }
- };
- // Use insertBefore instead of appendChild to circumvent an IE6 bug.
- // This arises when a base node is used (#2709 and #4378).
- head.insertBefore( script, head.firstChild );
- },
-
- abort: function() {
- if ( script ) {
- script.onload( 0, 1 );
- }
- }
- };
- }
-} );
-
-
-
-
-var // Next active xhr id
- xhrId = jQuery.now(),
-
- // active xhrs
- xhrs = {},
-
- // #5280: see below
- xhrUnloadAbortInstalled,
-
- // XHR used to determine supports properties
- testXHR;
-
-// Create the request object
-// (This is still attached to ajaxSettings for backward compatibility)
-jQuery.ajaxSettings.xhr = window.ActiveXObject ?
- /* Microsoft failed to properly
- * implement the XMLHttpRequest in IE7 (can't request local files),
- * so we use the ActiveXObject when it is available
- * Additionally XMLHttpRequest can be disabled in IE7/IE8 so
- * we need a fallback.
- */
- function() {
- if ( window.location.protocol !== "file:" ) {
- try {
- return new window.XMLHttpRequest();
- } catch( xhrError ) {}
- }
-
- try {
- return new window.ActiveXObject("Microsoft.XMLHTTP");
- } catch( activeError ) {}
- } :
- // For all other browsers, use the standard XMLHttpRequest object
- function() {
- return new window.XMLHttpRequest();
- };
-
-// Test if we can create an xhr object
-try {
- testXHR = jQuery.ajaxSettings.xhr();
-} catch( xhrCreationException ) {}
-
-//Does this browser support XHR requests?
-jQuery.support.ajax = !!testXHR;
-
-// Does this browser support crossDomain XHR requests
-jQuery.support.cors = testXHR && ( "withCredentials" in testXHR );
-
-// No need for the temporary xhr anymore
-testXHR = undefined;
-
-// Create transport if the browser can provide an xhr
-if ( jQuery.support.ajax ) {
-
- jQuery.ajaxTransport(function( s ) {
- // Cross domain only allowed if supported through XMLHttpRequest
- if ( !s.crossDomain || jQuery.support.cors ) {
-
- var callback;
-
- return {
- send: function( headers, complete ) {
-
- // #5280: we need to abort on unload or IE will keep connections alive
- if ( !xhrUnloadAbortInstalled ) {
-
- xhrUnloadAbortInstalled = 1;
-
- jQuery(window).bind( "unload", function() {
-
- // Abort all pending requests
- jQuery.each( xhrs, function( _, xhr ) {
- if ( xhr.onreadystatechange ) {
- xhr.onreadystatechange( 1 );
- }
- } );
-
- } );
- }
-
- // Get a new xhr
- var xhr = s.xhr(),
- handle;
-
- // Open the socket
- // Passing null username, generates a login popup on Opera (#2865)
- if ( s.username ) {
- xhr.open( s.type, s.url, s.async, s.username, s.password );
- } else {
- xhr.open( s.type, s.url, s.async );
- }
-
- // Requested-With header
- // Not set for crossDomain requests with no content
- // (see why at http://trac.dojotoolkit.org/ticket/9486)
- // Won't change header if already provided
- if ( !( s.crossDomain && !s.hasContent ) && !headers["x-requested-with"] ) {
- headers[ "x-requested-with" ] = "XMLHttpRequest";
- }
-
- // Need an extra try/catch for cross domain requests in Firefox 3
- try {
- jQuery.each( headers, function( key, value ) {
- xhr.setRequestHeader( key, value );
- } );
- } catch( _ ) {}
-
- // Do send the request
- // This may raise an exception which is actually
- // handled in jQuery.ajax (so no try/catch here)
- xhr.send( ( s.hasContent && s.data ) || null );
-
- // Listener
- callback = function( _, isAbort ) {
-
- // Was never called and is aborted or complete
- if ( callback && ( isAbort || xhr.readyState === 4 ) ) {
-
- // Only called once
- callback = 0;
-
- // Do not keep as active anymore
- if ( handle ) {
- xhr.onreadystatechange = jQuery.noop;
- delete xhrs[ handle ];
- }
-
- // If it's an abort
- if ( isAbort ) {
- // Abort it manually if needed
- if ( xhr.readyState !== 4 ) {
- xhr.abort();
- }
- } else {
- // Get info
- var status = xhr.status,
- statusText,
- responseHeaders = xhr.getAllResponseHeaders(),
- responses = {},
- xml = xhr.responseXML;
-
- // Construct response list
- if ( xml && xml.documentElement /* #4958 */ ) {
- responses.xml = xml;
- }
- responses.text = xhr.responseText;
-
- // Firefox throws an exception when accessing
- // statusText for faulty cross-domain requests
- try {
- statusText = xhr.statusText;
- } catch( e ) {
- // We normalize with Webkit giving an empty statusText
- statusText = "";
- }
-
- // Filter status for non standard behaviours
- status =
- // Opera returns 0 when it should be 304
- // Webkit returns 0 for failing cross-domain no matter the real status
- status === 0 ?
- (
- // Webkit, Firefox: filter out faulty cross-domain requests
- !s.crossDomain || statusText ?
- (
- // Opera: filter out real aborts #6060
- responseHeaders ?
- 304 :
- 0
- ) :
- // We assume 302 but could be anything cross-domain related
- 302
- ) :
- (
- // IE sometimes returns 1223 when it should be 204 (see #1450)
- status == 1223 ?
- 204 :
- status
- );
-
- // Call complete
- complete( status, statusText, responses, responseHeaders );
- }
- }
- };
-
- // if we're in sync mode or it's in cache
- // and has been retrieved directly (IE6 & IE7)
- // we need to manually fire the callback
- if ( !s.async || xhr.readyState === 4 ) {
- callback();
- } else {
- // Add to list of active xhrs
- handle = xhrId++;
- xhrs[ handle ] = xhr;
- xhr.onreadystatechange = callback;
- }
- },
-
- abort: function() {
- if ( callback ) {
- callback(0,1);
- }
- }
- };
- }
- });
-}
-
-
-
-
-var elemdisplay = {},
- rfxtypes = /^(?:toggle|show|hide)$/,
- rfxnum = /^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i,
- timerId,
- fxAttrs = [
- // height animations
- [ "height", "marginTop", "marginBottom", "paddingTop", "paddingBottom" ],
- // width animations
- [ "width", "marginLeft", "marginRight", "paddingLeft", "paddingRight" ],
- // opacity animations
- [ "opacity" ]
- ];
-
-jQuery.fn.extend({
- show: function( speed, easing, callback ) {
- var elem, display;
-
- if ( speed || speed === 0 ) {
- return this.animate( genFx("show", 3), speed, easing, callback);
-
- } else {
- for ( var i = 0, j = this.length; i < j; i++ ) {
- elem = this[i];
- display = elem.style.display;
-
- // Reset the inline display of this element to learn if it is
- // being hidden by cascaded rules or not
- if ( !jQuery._data(elem, "olddisplay") && display === "none" ) {
- display = elem.style.display = "";
- }
-
- // Set elements which have been overridden with display: none
- // in a stylesheet to whatever the default browser style is
- // for such an element
- if ( display === "" && jQuery.css( elem, "display" ) === "none" ) {
- jQuery._data(elem, "olddisplay", defaultDisplay(elem.nodeName));
- }
- }
-
- // Set the display of most of the elements in a second loop
- // to avoid the constant reflow
- for ( i = 0; i < j; i++ ) {
- elem = this[i];
- display = elem.style.display;
-
- if ( display === "" || display === "none" ) {
- elem.style.display = jQuery._data(elem, "olddisplay") || "";
- }
- }
-
- return this;
- }
- },
-
- hide: function( speed, easing, callback ) {
- if ( speed || speed === 0 ) {
- return this.animate( genFx("hide", 3), speed, easing, callback);
-
- } else {
- for ( var i = 0, j = this.length; i < j; i++ ) {
- var display = jQuery.css( this[i], "display" );
-
- if ( display !== "none" && !jQuery._data( this[i], "olddisplay" ) ) {
- jQuery._data( this[i], "olddisplay", display );
- }
- }
-
- // Set the display of the elements in a second loop
- // to avoid the constant reflow
- for ( i = 0; i < j; i++ ) {
- this[i].style.display = "none";
- }
-
- return this;
- }
- },
-
- // Save the old toggle function
- _toggle: jQuery.fn.toggle,
-
- toggle: function( fn, fn2, callback ) {
- var bool = typeof fn === "boolean";
-
- if ( jQuery.isFunction(fn) && jQuery.isFunction(fn2) ) {
- this._toggle.apply( this, arguments );
-
- } else if ( fn == null || bool ) {
- this.each(function() {
- var state = bool ? fn : jQuery(this).is(":hidden");
- jQuery(this)[ state ? "show" : "hide" ]();
- });
-
- } else {
- this.animate(genFx("toggle", 3), fn, fn2, callback);
- }
-
- return this;
- },
-
- fadeTo: function( speed, to, easing, callback ) {
- return this.filter(":hidden").css("opacity", 0).show().end()
- .animate({opacity: to}, speed, easing, callback);
- },
-
- animate: function( prop, speed, easing, callback ) {
- var optall = jQuery.speed(speed, easing, callback);
-
- if ( jQuery.isEmptyObject( prop ) ) {
- return this.each( optall.complete );
- }
-
- return this[ optall.queue === false ? "each" : "queue" ](function() {
- // XXX 'this' does not always have a nodeName when running the
- // test suite
-
- var opt = jQuery.extend({}, optall), p,
- isElement = this.nodeType === 1,
- hidden = isElement && jQuery(this).is(":hidden"),
- self = this;
-
- for ( p in prop ) {
- var name = jQuery.camelCase( p );
-
- if ( p !== name ) {
- prop[ name ] = prop[ p ];
- delete prop[ p ];
- p = name;
- }
-
- if ( prop[p] === "hide" && hidden || prop[p] === "show" && !hidden ) {
- return opt.complete.call(this);
- }
-
- if ( isElement && ( p === "height" || p === "width" ) ) {
- // Make sure that nothing sneaks out
- // Record all 3 overflow attributes because IE does not
- // change the overflow attribute when overflowX and
- // overflowY are set to the same value
- opt.overflow = [ this.style.overflow, this.style.overflowX, this.style.overflowY ];
-
- // Set display property to inline-block for height/width
- // animations on inline elements that are having width/height
- // animated
- if ( jQuery.css( this, "display" ) === "inline" &&
- jQuery.css( this, "float" ) === "none" ) {
- if ( !jQuery.support.inlineBlockNeedsLayout ) {
- this.style.display = "inline-block";
-
- } else {
- var display = defaultDisplay(this.nodeName);
-
- // inline-level elements accept inline-block;
- // block-level elements need to be inline with layout
- if ( display === "inline" ) {
- this.style.display = "inline-block";
-
- } else {
- this.style.display = "inline";
- this.style.zoom = 1;
- }
- }
- }
- }
-
- if ( jQuery.isArray( prop[p] ) ) {
- // Create (if needed) and add to specialEasing
- (opt.specialEasing = opt.specialEasing || {})[p] = prop[p][1];
- prop[p] = prop[p][0];
- }
- }
-
- if ( opt.overflow != null ) {
- this.style.overflow = "hidden";
- }
-
- opt.curAnim = jQuery.extend({}, prop);
-
- jQuery.each( prop, function( name, val ) {
- var e = new jQuery.fx( self, opt, name );
-
- if ( rfxtypes.test(val) ) {
- e[ val === "toggle" ? hidden ? "show" : "hide" : val ]( prop );
-
- } else {
- var parts = rfxnum.exec(val),
- start = e.cur() || 0;
-
- if ( parts ) {
- var end = parseFloat( parts[2] ),
- unit = parts[3] || "px";
-
- // We need to compute starting value
- if ( unit !== "px" ) {
- jQuery.style( self, name, (end || 1) + unit);
- start = ((end || 1) / e.cur()) * start;
- jQuery.style( self, name, start + unit);
- }
-
- // If a +=/-= token was provided, we're doing a relative animation
- if ( parts[1] ) {
- end = ((parts[1] === "-=" ? -1 : 1) * end) + start;
- }
-
- e.custom( start, end, unit );
-
- } else {
- e.custom( start, val, "" );
- }
- }
- });
-
- // For JS strict compliance
- return true;
- });
- },
-
- stop: function( clearQueue, gotoEnd ) {
- var timers = jQuery.timers;
-
- if ( clearQueue ) {
- this.queue([]);
- }
-
- this.each(function() {
- // go in reverse order so anything added to the queue during the loop is ignored
- for ( var i = timers.length - 1; i >= 0; i-- ) {
- if ( timers[i].elem === this ) {
- if (gotoEnd) {
- // force the next step to be the last
- timers[i](true);
- }
-
- timers.splice(i, 1);
- }
- }
- });
-
- // start the next in the queue if the last step wasn't forced
- if ( !gotoEnd ) {
- this.dequeue();
- }
-
- return this;
- }
-
-});
-
-function genFx( type, num ) {
- var obj = {};
-
- jQuery.each( fxAttrs.concat.apply([], fxAttrs.slice(0,num)), function() {
- obj[ this ] = type;
- });
-
- return obj;
-}
-
-// Generate shortcuts for custom animations
-jQuery.each({
- slideDown: genFx("show", 1),
- slideUp: genFx("hide", 1),
- slideToggle: genFx("toggle", 1),
- fadeIn: { opacity: "show" },
- fadeOut: { opacity: "hide" },
- fadeToggle: { opacity: "toggle" }
-}, function( name, props ) {
- jQuery.fn[ name ] = function( speed, easing, callback ) {
- return this.animate( props, speed, easing, callback );
- };
-});
-
-jQuery.extend({
- speed: function( speed, easing, fn ) {
- var opt = speed && typeof speed === "object" ? jQuery.extend({}, speed) : {
- complete: fn || !fn && easing ||
- jQuery.isFunction( speed ) && speed,
- duration: speed,
- easing: fn && easing || easing && !jQuery.isFunction(easing) && easing
- };
-
- opt.duration = jQuery.fx.off ? 0 : typeof opt.duration === "number" ? opt.duration :
- opt.duration in jQuery.fx.speeds ? jQuery.fx.speeds[opt.duration] : jQuery.fx.speeds._default;
-
- // Queueing
- opt.old = opt.complete;
- opt.complete = function() {
- if ( opt.queue !== false ) {
- jQuery(this).dequeue();
- }
- if ( jQuery.isFunction( opt.old ) ) {
- opt.old.call( this );
- }
- };
-
- return opt;
- },
-
- easing: {
- linear: function( p, n, firstNum, diff ) {
- return firstNum + diff * p;
- },
- swing: function( p, n, firstNum, diff ) {
- return ((-Math.cos(p*Math.PI)/2) + 0.5) * diff + firstNum;
- }
- },
-
- timers: [],
-
- fx: function( elem, options, prop ) {
- this.options = options;
- this.elem = elem;
- this.prop = prop;
-
- if ( !options.orig ) {
- options.orig = {};
- }
- }
-
-});
-
-jQuery.fx.prototype = {
- // Simple function for setting a style value
- update: function() {
- if ( this.options.step ) {
- this.options.step.call( this.elem, this.now, this );
- }
-
- (jQuery.fx.step[this.prop] || jQuery.fx.step._default)( this );
- },
-
- // Get the current size
- cur: function() {
- if ( this.elem[this.prop] != null && (!this.elem.style || this.elem.style[this.prop] == null) ) {
- return this.elem[ this.prop ];
- }
-
- var r = parseFloat( jQuery.css( this.elem, this.prop ) );
- return r || 0;
- },
-
- // Start an animation from one number to another
- custom: function( from, to, unit ) {
- var self = this,
- fx = jQuery.fx;
-
- this.startTime = jQuery.now();
- this.start = from;
- this.end = to;
- this.unit = unit || this.unit || "px";
- this.now = this.start;
- this.pos = this.state = 0;
-
- function t( gotoEnd ) {
- return self.step(gotoEnd);
- }
-
- t.elem = this.elem;
-
- if ( t() && jQuery.timers.push(t) && !timerId ) {
- timerId = setInterval(fx.tick, fx.interval);
- }
- },
-
- // Simple 'show' function
- show: function() {
- // Remember where we started, so that we can go back to it later
- this.options.orig[this.prop] = jQuery.style( this.elem, this.prop );
- this.options.show = true;
-
- // Begin the animation
- // Make sure that we start at a small width/height to avoid any
- // flash of content
- this.custom(this.prop === "width" || this.prop === "height" ? 1 : 0, this.cur());
-
- // Start by showing the element
- jQuery( this.elem ).show();
- },
-
- // Simple 'hide' function
- hide: function() {
- // Remember where we started, so that we can go back to it later
- this.options.orig[this.prop] = jQuery.style( this.elem, this.prop );
- this.options.hide = true;
-
- // Begin the animation
- this.custom(this.cur(), 0);
- },
-
- // Each step of an animation
- step: function( gotoEnd ) {
- var t = jQuery.now(), done = true;
-
- if ( gotoEnd || t >= this.options.duration + this.startTime ) {
- this.now = this.end;
- this.pos = this.state = 1;
- this.update();
-
- this.options.curAnim[ this.prop ] = true;
-
- for ( var i in this.options.curAnim ) {
- if ( this.options.curAnim[i] !== true ) {
- done = false;
- }
- }
-
- if ( done ) {
- // Reset the overflow
- if ( this.options.overflow != null && !jQuery.support.shrinkWrapBlocks ) {
- var elem = this.elem,
- options = this.options;
-
- jQuery.each( [ "", "X", "Y" ], function (index, value) {
- elem.style[ "overflow" + value ] = options.overflow[index];
- } );
- }
-
- // Hide the element if the "hide" operation was done
- if ( this.options.hide ) {
- jQuery(this.elem).hide();
- }
-
- // Reset the properties, if the item has been hidden or shown
- if ( this.options.hide || this.options.show ) {
- for ( var p in this.options.curAnim ) {
- jQuery.style( this.elem, p, this.options.orig[p] );
- }
- }
-
- // Execute the complete function
- this.options.complete.call( this.elem );
- }
-
- return false;
-
- } else {
- var n = t - this.startTime;
- this.state = n / this.options.duration;
-
- // Perform the easing function, defaults to swing
- var specialEasing = this.options.specialEasing && this.options.specialEasing[this.prop];
- var defaultEasing = this.options.easing || (jQuery.easing.swing ? "swing" : "linear");
- this.pos = jQuery.easing[specialEasing || defaultEasing](this.state, n, 0, 1, this.options.duration);
- this.now = this.start + ((this.end - this.start) * this.pos);
-
- // Perform the next step of the animation
- this.update();
- }
-
- return true;
- }
-};
-
-jQuery.extend( jQuery.fx, {
- tick: function() {
- var timers = jQuery.timers;
-
- for ( var i = 0; i < timers.length; i++ ) {
- if ( !timers[i]() ) {
- timers.splice(i--, 1);
- }
- }
-
- if ( !timers.length ) {
- jQuery.fx.stop();
- }
- },
-
- interval: 13,
-
- stop: function() {
- clearInterval( timerId );
- timerId = null;
- },
-
- speeds: {
- slow: 600,
- fast: 200,
- // Default speed
- _default: 400
- },
-
- step: {
- opacity: function( fx ) {
- jQuery.style( fx.elem, "opacity", fx.now );
- },
-
- _default: function( fx ) {
- if ( fx.elem.style && fx.elem.style[ fx.prop ] != null ) {
- fx.elem.style[ fx.prop ] = (fx.prop === "width" || fx.prop === "height" ? Math.max(0, fx.now) : fx.now) + fx.unit;
- } else {
- fx.elem[ fx.prop ] = fx.now;
- }
- }
- }
-});
-
-if ( jQuery.expr && jQuery.expr.filters ) {
- jQuery.expr.filters.animated = function( elem ) {
- return jQuery.grep(jQuery.timers, function( fn ) {
- return elem === fn.elem;
- }).length;
- };
-}
-
-function defaultDisplay( nodeName ) {
- if ( !elemdisplay[ nodeName ] ) {
- var elem = jQuery("<" + nodeName + ">").appendTo("body"),
- display = elem.css("display");
-
- elem.remove();
-
- if ( display === "none" || display === "" ) {
- display = "block";
- }
-
- elemdisplay[ nodeName ] = display;
- }
-
- return elemdisplay[ nodeName ];
-}
-
-
-
-
-var rtable = /^t(?:able|d|h)$/i,
- rroot = /^(?:body|html)$/i;
-
-if ( "getBoundingClientRect" in document.documentElement ) {
- jQuery.fn.offset = function( options ) {
- var elem = this[0], box;
-
- if ( options ) {
- return this.each(function( i ) {
- jQuery.offset.setOffset( this, options, i );
- });
- }
-
- if ( !elem || !elem.ownerDocument ) {
- return null;
- }
-
- if ( elem === elem.ownerDocument.body ) {
- return jQuery.offset.bodyOffset( elem );
- }
-
- try {
- box = elem.getBoundingClientRect();
- } catch(e) {}
-
- var doc = elem.ownerDocument,
- docElem = doc.documentElement;
-
- // Make sure we're not dealing with a disconnected DOM node
- if ( !box || !jQuery.contains( docElem, elem ) ) {
- return box ? { top: box.top, left: box.left } : { top: 0, left: 0 };
- }
-
- var body = doc.body,
- win = getWindow(doc),
- clientTop = docElem.clientTop || body.clientTop || 0,
- clientLeft = docElem.clientLeft || body.clientLeft || 0,
- scrollTop = (win.pageYOffset || jQuery.support.boxModel && docElem.scrollTop || body.scrollTop ),
- scrollLeft = (win.pageXOffset || jQuery.support.boxModel && docElem.scrollLeft || body.scrollLeft),
- top = box.top + scrollTop - clientTop,
- left = box.left + scrollLeft - clientLeft;
-
- return { top: top, left: left };
- };
-
-} else {
- jQuery.fn.offset = function( options ) {
- var elem = this[0];
-
- if ( options ) {
- return this.each(function( i ) {
- jQuery.offset.setOffset( this, options, i );
- });
- }
-
- if ( !elem || !elem.ownerDocument ) {
- return null;
- }
-
- if ( elem === elem.ownerDocument.body ) {
- return jQuery.offset.bodyOffset( elem );
- }
-
- jQuery.offset.initialize();
-
- var computedStyle,
- offsetParent = elem.offsetParent,
- prevOffsetParent = elem,
- doc = elem.ownerDocument,
- docElem = doc.documentElement,
- body = doc.body,
- defaultView = doc.defaultView,
- prevComputedStyle = defaultView ? defaultView.getComputedStyle( elem, null ) : elem.currentStyle,
- top = elem.offsetTop,
- left = elem.offsetLeft;
-
- while ( (elem = elem.parentNode) && elem !== body && elem !== docElem ) {
- if ( jQuery.offset.supportsFixedPosition && prevComputedStyle.position === "fixed" ) {
- break;
- }
-
- computedStyle = defaultView ? defaultView.getComputedStyle(elem, null) : elem.currentStyle;
- top -= elem.scrollTop;
- left -= elem.scrollLeft;
-
- if ( elem === offsetParent ) {
- top += elem.offsetTop;
- left += elem.offsetLeft;
-
- if ( jQuery.offset.doesNotAddBorder && !(jQuery.offset.doesAddBorderForTableAndCells && rtable.test(elem.nodeName)) ) {
- top += parseFloat( computedStyle.borderTopWidth ) || 0;
- left += parseFloat( computedStyle.borderLeftWidth ) || 0;
- }
-
- prevOffsetParent = offsetParent;
- offsetParent = elem.offsetParent;
- }
-
- if ( jQuery.offset.subtractsBorderForOverflowNotVisible && computedStyle.overflow !== "visible" ) {
- top += parseFloat( computedStyle.borderTopWidth ) || 0;
- left += parseFloat( computedStyle.borderLeftWidth ) || 0;
- }
-
- prevComputedStyle = computedStyle;
- }
-
- if ( prevComputedStyle.position === "relative" || prevComputedStyle.position === "static" ) {
- top += body.offsetTop;
- left += body.offsetLeft;
- }
-
- if ( jQuery.offset.supportsFixedPosition && prevComputedStyle.position === "fixed" ) {
- top += Math.max( docElem.scrollTop, body.scrollTop );
- left += Math.max( docElem.scrollLeft, body.scrollLeft );
- }
-
- return { top: top, left: left };
- };
-}
-
-jQuery.offset = {
- initialize: function() {
- var body = document.body, container = document.createElement("div"), innerDiv, checkDiv, table, td, bodyMarginTop = parseFloat( jQuery.css(body, "marginTop") ) || 0,
- html = "<div style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;'><div></div></div><table style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;' cellpadding='0' cellspacing='0'><tr><td></td></tr></table>";
-
- jQuery.extend( container.style, { position: "absolute", top: 0, left: 0, margin: 0, border: 0, width: "1px", height: "1px", visibility: "hidden" } );
-
- container.innerHTML = html;
- body.insertBefore( container, body.firstChild );
- innerDiv = container.firstChild;
- checkDiv = innerDiv.firstChild;
- td = innerDiv.nextSibling.firstChild.firstChild;
-
- this.doesNotAddBorder = (checkDiv.offsetTop !== 5);
- this.doesAddBorderForTableAndCells = (td.offsetTop === 5);
-
- checkDiv.style.position = "fixed";
- checkDiv.style.top = "20px";
-
- // safari subtracts parent border width here which is 5px
- this.supportsFixedPosition = (checkDiv.offsetTop === 20 || checkDiv.offsetTop === 15);
- checkDiv.style.position = checkDiv.style.top = "";
-
- innerDiv.style.overflow = "hidden";
- innerDiv.style.position = "relative";
-
- this.subtractsBorderForOverflowNotVisible = (checkDiv.offsetTop === -5);
-
- this.doesNotIncludeMarginInBodyOffset = (body.offsetTop !== bodyMarginTop);
-
- body.removeChild( container );
- body = container = innerDiv = checkDiv = table = td = null;
- jQuery.offset.initialize = jQuery.noop;
- },
-
- bodyOffset: function( body ) {
- var top = body.offsetTop,
- left = body.offsetLeft;
-
- jQuery.offset.initialize();
-
- if ( jQuery.offset.doesNotIncludeMarginInBodyOffset ) {
- top += parseFloat( jQuery.css(body, "marginTop") ) || 0;
- left += parseFloat( jQuery.css(body, "marginLeft") ) || 0;
- }
-
- return { top: top, left: left };
- },
-
- setOffset: function( elem, options, i ) {
- var position = jQuery.css( elem, "position" );
-
- // set position first, in-case top/left are set even on static elem
- if ( position === "static" ) {
- elem.style.position = "relative";
- }
-
- var curElem = jQuery( elem ),
- curOffset = curElem.offset(),
- curCSSTop = jQuery.css( elem, "top" ),
- curCSSLeft = jQuery.css( elem, "left" ),
- calculatePosition = (position === "absolute" && jQuery.inArray('auto', [curCSSTop, curCSSLeft]) > -1),
- props = {}, curPosition = {}, curTop, curLeft;
-
- // need to be able to calculate position if either top or left is auto and position is absolute
- if ( calculatePosition ) {
- curPosition = curElem.position();
- }
-
- curTop = calculatePosition ? curPosition.top : parseInt( curCSSTop, 10 ) || 0;
- curLeft = calculatePosition ? curPosition.left : parseInt( curCSSLeft, 10 ) || 0;
-
- if ( jQuery.isFunction( options ) ) {
- options = options.call( elem, i, curOffset );
- }
-
- if (options.top != null) {
- props.top = (options.top - curOffset.top) + curTop;
- }
- if (options.left != null) {
- props.left = (options.left - curOffset.left) + curLeft;
- }
-
- if ( "using" in options ) {
- options.using.call( elem, props );
- } else {
- curElem.css( props );
- }
- }
-};
-
-
-jQuery.fn.extend({
- position: function() {
- if ( !this[0] ) {
- return null;
- }
-
- var elem = this[0],
-
- // Get *real* offsetParent
- offsetParent = this.offsetParent(),
-
- // Get correct offsets
- offset = this.offset(),
- parentOffset = rroot.test(offsetParent[0].nodeName) ? { top: 0, left: 0 } : offsetParent.offset();
-
- // Subtract element margins
- // note: when an element has margin: auto the offsetLeft and marginLeft
- // are the same in Safari causing offset.left to incorrectly be 0
- offset.top -= parseFloat( jQuery.css(elem, "marginTop") ) || 0;
- offset.left -= parseFloat( jQuery.css(elem, "marginLeft") ) || 0;
-
- // Add offsetParent borders
- parentOffset.top += parseFloat( jQuery.css(offsetParent[0], "borderTopWidth") ) || 0;
- parentOffset.left += parseFloat( jQuery.css(offsetParent[0], "borderLeftWidth") ) || 0;
-
- // Subtract the two offsets
- return {
- top: offset.top - parentOffset.top,
- left: offset.left - parentOffset.left
- };
- },
-
- offsetParent: function() {
- return this.map(function() {
- var offsetParent = this.offsetParent || document.body;
- while ( offsetParent && (!rroot.test(offsetParent.nodeName) && jQuery.css(offsetParent, "position") === "static") ) {
- offsetParent = offsetParent.offsetParent;
- }
- return offsetParent;
- });
- }
-});
-
-
-// Create scrollLeft and scrollTop methods
-jQuery.each( ["Left", "Top"], function( i, name ) {
- var method = "scroll" + name;
-
- jQuery.fn[ method ] = function(val) {
- var elem = this[0], win;
-
- if ( !elem ) {
- return null;
- }
-
- if ( val !== undefined ) {
- // Set the scroll offset
- return this.each(function() {
- win = getWindow( this );
-
- if ( win ) {
- win.scrollTo(
- !i ? val : jQuery(win).scrollLeft(),
- i ? val : jQuery(win).scrollTop()
- );
-
- } else {
- this[ method ] = val;
- }
- });
- } else {
- win = getWindow( elem );
-
- // Return the scroll offset
- return win ? ("pageXOffset" in win) ? win[ i ? "pageYOffset" : "pageXOffset" ] :
- jQuery.support.boxModel && win.document.documentElement[ method ] ||
- win.document.body[ method ] :
- elem[ method ];
- }
- };
-});
-
-function getWindow( elem ) {
- return jQuery.isWindow( elem ) ?
- elem :
- elem.nodeType === 9 ?
- elem.defaultView || elem.parentWindow :
- false;
-}
-
-
-
-
-// Create innerHeight, innerWidth, outerHeight and outerWidth methods
-jQuery.each([ "Height", "Width" ], function( i, name ) {
-
- var type = name.toLowerCase();
-
- // innerHeight and innerWidth
- jQuery.fn["inner" + name] = function() {
- return this[0] ?
- parseFloat( jQuery.css( this[0], type, "padding" ) ) :
- null;
- };
-
- // outerHeight and outerWidth
- jQuery.fn["outer" + name] = function( margin ) {
- return this[0] ?
- parseFloat( jQuery.css( this[0], type, margin ? "margin" : "border" ) ) :
- null;
- };
-
- jQuery.fn[ type ] = function( size ) {
- // Get window width or height
- var elem = this[0];
- if ( !elem ) {
- return size == null ? null : this;
- }
-
- if ( jQuery.isFunction( size ) ) {
- return this.each(function( i ) {
- var self = jQuery( this );
- self[ type ]( size.call( this, i, self[ type ]() ) );
- });
- }
-
- if ( jQuery.isWindow( elem ) ) {
- // Everyone else use document.documentElement or document.body depending on Quirks vs Standards mode
- // 3rd condition allows Nokia support, as it supports the docElem prop but not CSS1Compat
- var docElemProp = elem.document.documentElement[ "client" + name ];
- return elem.document.compatMode === "CSS1Compat" && docElemProp ||
- elem.document.body[ "client" + name ] || docElemProp;
-
- // Get document width or height
- } else if ( elem.nodeType === 9 ) {
- // Either scroll[Width/Height] or offset[Width/Height], whichever is greater
- return Math.max(
- elem.documentElement["client" + name],
- elem.body["scroll" + name], elem.documentElement["scroll" + name],
- elem.body["offset" + name], elem.documentElement["offset" + name]
- );
-
- // Get or set width or height on the element
- } else if ( size === undefined ) {
- var orig = jQuery.css( elem, type ),
- ret = parseFloat( orig );
-
- return jQuery.isNaN( ret ) ? orig : ret;
-
- // Set the width or height on the element (default to pixels if value is unitless)
- } else {
- return this.css( type, typeof size === "string" ? size : size + "px" );
- }
- };
-
-});
-
-
-})(window);
-
--- a/js/jquery-mobile-1.0a3.js
+++ /dev/null
@@ -1,122 +1,1 @@
-/*!
- * jQuery Mobile v1.0a3
- * http://jquerymobile.com/
- *
- * Copyright 2010, jQuery Project
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- */
-(function(a,d){if(a.cleanData){var c=a.cleanData;a.cleanData=function(b){for(var g=0,e;(e=b[g])!=null;g++)a(e).triggerHandler("remove");c(b)}}else{var f=a.fn.remove;a.fn.remove=function(b,g){return this.each(function(){if(!g)if(!b||a.filter(b,[this]).length)a("*",this).add([this]).each(function(){a(this).triggerHandler("remove")});return f.call(a(this),b,g)})}}a.widget=function(b,g,e){var i=b.split(".")[0],h;b=b.split(".")[1];h=i+"-"+b;if(!e){e=g;g=a.Widget}a.expr[":"][h]=function(k){return!!a.data(k,
-b)};a[i]=a[i]||{};a[i][b]=function(k,j){arguments.length&&this._createWidget(k,j)};g=new g;g.options=a.extend(true,{},g.options);a[i][b].prototype=a.extend(true,g,{namespace:i,widgetName:b,widgetEventPrefix:a[i][b].prototype.widgetEventPrefix||b,widgetBaseClass:h},e);a.widget.bridge(b,a[i][b])};a.widget.bridge=function(b,g){a.fn[b]=function(e){var i=typeof e==="string",h=Array.prototype.slice.call(arguments,1),k=this;e=!i&&h.length?a.extend.apply(null,[true,e].concat(h)):e;if(i&&e.charAt(0)==="_")return k;
-i?this.each(function(){var j=a.data(this,b);if(!j)throw"cannot call methods on "+b+" prior to initialization; attempted to call method '"+e+"'";if(!a.isFunction(j[e]))throw"no such method '"+e+"' for "+b+" widget instance";var o=j[e].apply(j,h);if(o!==j&&o!==d){k=o;return false}}):this.each(function(){var j=a.data(this,b);j?j.option(e||{})._init():a.data(this,b,new g(e,this))});return k}};a.Widget=function(b,g){arguments.length&&this._createWidget(b,g)};a.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",
-options:{disabled:false},_createWidget:function(b,g){a.data(g,this.widgetName,this);this.element=a(g);this.options=a.extend(true,{},this.options,this._getCreateOptions(),b);var e=this;this.element.bind("remove."+this.widgetName,function(){e.destroy()});this._create();this._trigger("create");this._init()},_getCreateOptions:function(){var b={};if(a.metadata)b=a.metadata.get(element)[this.widgetName];return b},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName);
-this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+"-disabled ui-state-disabled")},widget:function(){return this.element},option:function(b,g){var e=b;if(arguments.length===0)return a.extend({},this.options);if(typeof b==="string"){if(g===d)return this.options[b];e={};e[b]=g}this._setOptions(e);return this},_setOptions:function(b){var g=this;a.each(b,function(e,i){g._setOption(e,i)});return this},_setOption:function(b,g){this.options[b]=g;if(b===
-"disabled")this.widget()[g?"addClass":"removeClass"](this.widgetBaseClass+"-disabled ui-state-disabled").attr("aria-disabled",g);return this},enable:function(){return this._setOption("disabled",false)},disable:function(){return this._setOption("disabled",true)},_trigger:function(b,g,e){var i=this.options[b];g=a.Event(g);g.type=(b===this.widgetEventPrefix?b:this.widgetEventPrefix+b).toLowerCase();e=e||{};if(g.originalEvent){b=a.event.props.length;for(var h;b;){h=a.event.props[--b];g[h]=g.originalEvent[h]}}this.element.trigger(g,
-e);return!(a.isFunction(i)&&i.call(this.element[0],g,e)===false||g.isDefaultPrevented())}}})(jQuery);(function(a,d){a.widget("mobile.widget",{_getCreateOptions:function(){var c=this.element,f={};a.each(this.options,function(b){var g=c.data(b.replace(/[A-Z]/g,function(e){return"-"+e.toLowerCase()}));if(g!==d)f[b]=g});return f}})})(jQuery);
-(function(a){function d(){var g=c.width(),e=[],i=[],h;f.removeClass("min-width-"+b.join("px min-width-")+"px max-width-"+b.join("px max-width-")+"px");a.each(b,function(k,j){g>=j&&e.push("min-width-"+j+"px");g<=j&&i.push("max-width-"+j+"px")});if(e.length)h=e.join(" ");if(i.length)h+=" "+i.join(" ");f.addClass(h)}var c=a(window),f=a("html"),b=[320,480,768,1024];a.mobile.media=function(){var g={},e=a("<div id='jquery-mediatest'>"),i=a("<body>").append(e);return function(h){if(!(h in g)){var k=document.createElement("style"),
-j="@media "+h+" { #jquery-mediatest { position:absolute; } }";k.type="text/css";if(k.styleSheet)k.styleSheet.cssText=j;else k.appendChild(document.createTextNode(j));f.prepend(i).prepend(k);g[h]=e.css("position")==="absolute";i.add(k).remove()}return g[h]}}();a.mobile.addResolutionBreakpoints=function(g){if(a.type(g)==="array")b=b.concat(g);else b.push(g);b.sort(function(e,i){return e-i});d()};a(document).bind("mobileinit.htmlclass",function(){c.bind("orientationchange.htmlclass resize.htmlclass",
-function(g){g.orientation&&f.removeClass("portrait landscape").addClass(g.orientation);d()})});a(function(){c.trigger("orientationchange.htmlclass")})})(jQuery);
-(function(a,d){function c(h){var k=h.charAt(0).toUpperCase()+h.substr(1);h=(h+" "+g.join(k+" ")+k).split(" ");for(var j in h)if(b[j]!==d)return true}var f=a("<body>").prependTo("html"),b=f[0].style,g=["webkit","moz","o"],e=window.palmGetResource||window.PalmServiceBridge,i=window.blackberry;a.extend(a.support,{orientation:"orientation"in window,touch:"ontouchend"in document,cssTransitions:"WebKitTransitionEvent"in window,pushState:!!history.pushState,mediaquery:a.mobile.media("only all"),cssPseudoElement:!!c("content"),
-boxShadow:!!c("boxShadow")&&!i,scrollTop:("pageXOffset"in window||"scrollTop"in document.documentElement||"scrollTop"in f[0])&&!e,dynamicBaseTag:function(){var h=location.protocol+"//"+location.host+location.pathname+"ui-dir/",k=a("head base"),j=null,o="";if(k.length)o=k.attr("href");else k=j=a("<base>",{href:h}).appendTo("head");var p=a("<a href='testurl'></a>").prependTo(f)[0].href;k[0].href=o?o:location.pathname;j&&j.remove();return p.indexOf(h)===0}()});f.remove();a.support.boxShadow||a("html").addClass("ui-mobile-nosupport-boxshadow")})(jQuery);
-(function(a,d){a.each("touchstart touchmove touchend orientationchange tap taphold swipe swipeleft swiperight scrollstart scrollstop".split(" "),function(e,i){a.fn[i]=function(h){return h?this.bind(i,h):this.trigger(i)};a.attrFn[i]=true});var c=a.support.touch,f=c?"touchstart":"mousedown",b=c?"touchend":"mouseup",g=c?"touchmove":"mousemove";a.event.special.scrollstart={enabled:true,setup:function(){function e(j,o){h=o;var p=j.type;j.type=h?"scrollstart":"scrollstop";a.event.handle.call(i,j);j.type=
-p}var i=this,h,k;a(i).bind("touchmove scroll",function(j){if(a.event.special.scrollstart.enabled){h||e(j,true);clearTimeout(k);k=setTimeout(function(){e(j,false)},50)}})}};a.event.special.tap={setup:function(){var e=this,i=a(e);i.bind("mousedown touchstart",function(h){function k(n){if(n.type=="scroll")j=true;else{n=n.type=="touchmove"?n.originalEvent.touches[0]:n;if(Math.abs(v[0]-n.pageX)>10||Math.abs(v[1]-n.pageY)>10)j=true}}if(h.which&&h.which!==1||i.data("prevEvent")&&i.data("prevEvent")!==h.type)return false;
-i.data("prevEvent",h.type);setTimeout(function(){i.removeData("prevEvent")},800);var j=false,o=true,p=h.target,t=h.originalEvent,v=h.type=="touchstart"?[t.touches[0].pageX,t.touches[0].pageY]:[h.pageX,h.pageY],m,r;r=setTimeout(function(){if(o&&!j){m=h.type;h.type="taphold";a.event.handle.call(e,h);h.type=m}},750);a(window).one("scroll",k);i.bind("mousemove touchmove",k).one("mouseup touchend",function(n){i.unbind("mousemove touchmove",k);a(window).unbind("scroll",k);clearTimeout(r);o=false;if(!j&&
-p==n.target){m=n.type;n.type="tap";a.event.handle.call(e,n);n.type=m}})})}};a.event.special.swipe={setup:function(){var e=a(this);e.bind(f,function(i){function h(p){if(j){var t=p.originalEvent.touches?p.originalEvent.touches[0]:p;o={time:(new Date).getTime(),coords:[t.pageX,t.pageY]};Math.abs(j.coords[0]-o.coords[0])>10&&p.preventDefault()}}var k=i.originalEvent.touches?i.originalEvent.touches[0]:i,j={time:(new Date).getTime(),coords:[k.pageX,k.pageY],origin:a(i.target)},o;e.bind(g,h).one(b,function(){e.unbind(g,
-h);if(j&&o)if(o.time-j.time<1E3&&Math.abs(j.coords[0]-o.coords[0])>30&&Math.abs(j.coords[1]-o.coords[1])<75)j.origin.trigger("swipe").trigger(j.coords[0]>o.coords[0]?"swipeleft":"swiperight");j=o=d})})}};(function(e){function i(){var o=k();if(o!==j){j=o;h.trigger("orientationchange")}}var h=e(window),k,j;e.event.special.orientationchange={setup:function(){if(e.support.orientation)return false;j=k();h.bind("resize",i)},teardown:function(){if(e.support.orientation)return false;h.unbind("resize",i)},
-add:function(o){var p=o.handler;o.handler=function(t){t.orientation=k();return p.apply(this,arguments)}}};k=function(){var o=document.documentElement;return o&&o.clientWidth/o.clientHeight<1.1?"portrait":"landscape"}})(jQuery);a.each({scrollstop:"scrollstart",taphold:"tap",swipeleft:"swipe",swiperight:"swipe"},function(e,i){a.event.special[e]={setup:function(){a(this).bind(i,a.noop)}}})})(jQuery);
-(function(a,d,c){function f(j){j=j||location.href;return"#"+j.replace(/^[^#]*#?(.*)$/,"$1")}var b="hashchange",g=document,e,i=a.event.special,h=g.documentMode,k="on"+b in d&&(h===c||h>7);a.fn[b]=function(j){return j?this.bind(b,j):this.trigger(b)};a.fn[b].delay=50;i[b]=a.extend(i[b],{setup:function(){if(k)return false;a(e.start)},teardown:function(){if(k)return false;a(e.stop)}});e=function(){function j(){var n=f(),u=r(t);if(n!==t){m(t=n,u);a(d).trigger(b)}else if(u!==t)location.href=location.href.replace(/#.*/,
-"")+u;p=setTimeout(j,a.fn[b].delay)}var o={},p,t=f(),v=function(n){return n},m=v,r=v;o.start=function(){p||j()};o.stop=function(){p&&clearTimeout(p);p=c};a.browser.msie&&!k&&function(){var n,u;o.start=function(){if(!n){u=(u=a.fn[b].src)&&u+f();n=a('<iframe tabindex="-1" title="empty"/>').hide().one("load",function(){u||m(f());j()}).attr("src",u||"javascript:0").insertAfter("body")[0].contentWindow;g.onpropertychange=function(){try{if(event.propertyName==="title")n.document.title=g.title}catch(l){}}}};
-o.stop=v;r=function(){return f(n.location.href)};m=function(l,s){var q=n.document,w=a.fn[b].domain;if(l!==s){q.title=g.title;q.open();w&&q.write('<script>document.domain="'+w+'"<\/script>');q.close();n.location.hash=l}}}();return o}()})(jQuery,this);
-(function(a){a.widget("mobile.page",a.mobile.widget,{options:{backBtnText:"Back",addBackBtn:true,degradeInputs:{color:false,date:false,datetime:false,"datetime-local":false,email:false,month:false,number:false,range:"number",search:true,tel:false,time:false,url:false,week:false},keepNative:null},_create:function(){var d=this.element,c=this.options;this.keepNative="[data-role='none'], [data-role='nojs']"+(c.keepNative?", "+c.keepNative:"");if(this._trigger("beforeCreate")!==false){d.find("[data-role='page'], [data-role='content']").andSelf().each(function(){a(this).addClass("ui-"+
-a(this).data("role"))});d.find("[data-role='nojs']").addClass("ui-nojs");d.find("[data-role]").andSelf().each(function(){var f=a(this),b=f.data("role"),g=f.data("theme");if(b==="header"||b==="footer"){f.addClass("ui-bar-"+(g||f.parent("[data-role=page]").data("theme")||"a"));f.attr("role",b==="header"?"banner":"contentinfo");g=f.children("a");var e=g.hasClass("ui-btn-left"),i=g.hasClass("ui-btn-right");if(!e)e=g.eq(0).not(".ui-btn-right").addClass("ui-btn-left").length;i||g.eq(1).addClass("ui-btn-right");
-c.addBackBtn&&b==="header"&&a(".ui-page").length>1&&d.data("url")!==a.mobile.path.stripHash(location.hash)&&!e&&f.data("backbtn")!==false&&a("<a href='#' class='ui-btn-left' data-rel='back' data-icon='arrow-l'>"+c.backBtnText+"</a>").prependTo(f);f.children("h1, h2, h3, h4, h5, h6").addClass("ui-title").attr({tabindex:"0",role:"heading","aria-level":"1"})}else if(b==="content"){g&&f.addClass("ui-body-"+g);f.attr("role","main")}else if(b==="page")f.addClass("ui-body-"+(g||"c"));switch(b){case "header":case "footer":case "page":case "content":f.addClass("ui-"+
-b);break;case "collapsible":case "fieldcontain":case "navbar":case "listview":case "dialog":f[b]()}});this._enhanceControls();d.find("[data-role='button'], .ui-bar > a, .ui-header > a, .ui-footer > a").not(".ui-btn").not(this.keepNative).buttonMarkup();d.find("[data-role='controlgroup']").controlgroup();d.find("a:not(.ui-btn):not(.ui-link-inherit)").not(this.keepNative).addClass("ui-link");d.fixHeaderFooter()}},_enhanceControls:function(){var d=this.options;this.element.find("input").not(this.keepNative).each(function(){var b=
-this.getAttribute("type"),g=d.degradeInputs[b]||"text";d.degradeInputs[b]&&a(this).replaceWith(a("<div>").html(a(this).clone()).html().replace(/type="([a-zA-Z]+)"/,"type="+g+" data-type='$1'"))});var c=this.element.find("input, textarea, select, button"),f=c.not(this.keepNative);c=c.filter("input[type=text]");c.length&&typeof c[0].autocorrect!=="undefined"&&c.each(function(){this.setAttribute("autocorrect","off");this.setAttribute("autocomplete","off")});f.filter("[type='radio'], [type='checkbox']").checkboxradio();
-f.filter("button, [type='button'], [type='submit'], [type='reset'], [type='image']").button();f.filter("input, textarea").not("[type='radio'], [type='checkbox'], [type='button'], [type='submit'], [type='reset'], [type='image'], [type='hidden']").textinput();f.filter("input, select").filter("[data-role='slider'], [data-type='range']").slider();f.filter("select:not([data-role='slider'])").selectmenu()}})})(jQuery);
-(function(a,d,c){a.extend(a.mobile,{subPageUrlKey:"ui-page",nonHistorySelectors:"dialog",activePageClass:"ui-page-active",activeBtnClass:"ui-btn-active",ajaxEnabled:true,hashListeningEnabled:true,ajaxLinksEnabled:true,ajaxFormsEnabled:true,defaultTransition:"slide",loadingMessage:"loading",metaViewportContent:"width=device-width, minimum-scale=1, maximum-scale=1",gradeA:function(){return a.support.mediaquery},autoInitialize:true,keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,
-COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});a(d.document).trigger("mobileinit");if(a.mobile.gradeA()){var f=a(d),b=a("html"),g=a("head"),e=a.mobile.loadingMessage?a("<div class='ui-loader ui-body-a ui-corner-all'><span class='ui-icon ui-icon-loading spin'></span><h1>"+
-a.mobile.loadingMessage+"</h1></div>"):c;b.addClass("ui-mobile ui-mobile-rendering");a.mobile.metaViewportContent&&a("<meta>",{name:"viewport",content:a.mobile.metaViewportContent}).prependTo(g);a.extend(a.mobile,{pageLoading:function(i){if(i)b.removeClass("ui-loading");else{if(a.mobile.loadingMessage){i=a("."+a.mobile.activeBtnClass).first();e.appendTo(a.mobile.pageContainer).css({top:a.support.scrollTop&&a(d).scrollTop()+a(d).height()/2||i.length&&i.offset().top||100})}b.addClass("ui-loading")}},
-silentScroll:function(i){i=i||0;a.event.special.scrollstart.enabled=false;setTimeout(function(){d.scrollTo(0,i);a(document).trigger("silentscroll",{x:0,y:i})},20);setTimeout(function(){a.event.special.scrollstart.enabled=true},150)},initializePage:function(){var i=a("[data-role='page']");i.add("[data-role='dialog']").each(function(){a(this).attr("data-url",a(this).attr("id"))});a.mobile.firstPage=i.first();a.mobile.pageContainer=i.first().parent().addClass("ui-mobile-viewport");a.mobile.pageLoading();
-!a.mobile.hashListeningEnabled||!a.mobile.path.stripHash(location.hash)?a.mobile.changePage(a.mobile.firstPage,false,true,false,true):f.trigger("hashchange",[true])}});a.mobile.autoInitialize&&a(a.mobile.initializePage);f.load(a.mobile.silentScroll)}})(jQuery,this);
-(function(a,d){function c(l){if(i&&(!i.closest(".ui-page-active").length||l))i.removeClass(a.mobile.activeBtnClass);i=null}var f=a(window),b=a("html"),g=a("head"),e={get:function(l){if(l==d)l=location.hash;return e.stripHash(l).replace(/[^\/]*\.[^\/*]+$/,"")},getFilePath:function(l){var s="&"+a.mobile.subPageUrlKey;return l&&l.split(s)[0].split(t)[0]},set:function(l){location.hash=l},origin:"",setOrigin:function(){e.origin=e.get(location.protocol+"//"+location.host+location.pathname)},makeAbsolute:function(l){return e.get()+
-l},clean:function(l){return l.replace(location.protocol+"//"+location.host,"")},stripHash:function(l){return l.replace(/^#/,"")},isExternal:function(l){return e.hasProtocol(e.clean(l))},hasProtocol:function(l){return/^(:?\w+:)/.test(l)},isRelative:function(l){return/^[^\/|#]/.test(l)&&!e.hasProtocol(l)},isEmbeddedPage:function(l){return/^#/.test(l)}},i=null,h={stack:[],activeIndex:0,getActive:function(){return h.stack[h.activeIndex]},getPrev:function(){return h.stack[h.activeIndex-1]},getNext:function(){return h.stack[h.activeIndex+
-1]},addNew:function(l,s){h.getNext()&&h.clearForward();h.stack.push({url:l,transition:s});h.activeIndex=h.stack.length-1},clearForward:function(){h.stack=h.stack.slice(0,h.activeIndex+1)},ignoreNextHashChange:true},k="[tabindex],a,button:visible,select:visible,input",j=null,o=[],p=false,t="&ui-state=dialog",v=g.children("base"),m=location.protocol+"//"+location.host,r=e.get(m+location.pathname),n=r;if(v.length){var u=v.attr("href");if(u)n=u.search(/^[^:/]+:\/\/[^/]+\/?/)==-1?u.charAt(0)=="/"?m+u:
-r+u:u;n+=n.charAt(n.length-1)=="/"?" ":"/"}base=a.support.dynamicBaseTag?{element:v.length?v:a("<base>",{href:n}).prependTo(g),set:function(l){base.element.attr("href",n+e.get(l))},reset:function(){base.element.attr("href",n)}}:d;e.setOrigin();a.fn.animationComplete=function(l){if(a.support.cssTransitions)return a(this).one("webkitAnimationEnd",l);else setTimeout(l,0)};a.mobile.updateHash=e.set;a.mobile.path=e;a.mobile.base=base;a.mobile.urlstack=h.stack;a.mobile.urlHistory=h;a.mobile.changePage=
-function(l,s,q,w,z){function F(){function A(){if(w!==false&&x){h.ignoreNextHashChange=false;e.set(x)}!I&&!K&&h.addNew(x,s);c();a.mobile.silentScroll(l.data("lastScroll"));var G=l,P=G.find(".ui-title:eq(0)");P.length?P.focus():G.find(k).eq(0).focus();y&&y.data("page")._trigger("hide",null,{nextPage:l});l.data("page")._trigger("show",null,{prevPage:y||a("")});a.mobile.activePage=l;L!=null&&L.remove();b.removeClass("ui-mobile-rendering");p=false;o.length>0&&a.mobile.changePage.apply(a.mobile,o.pop())}
-function B(G){a.mobile.pageContainer.addClass(G);D.push(G)}a.mobile.silentScroll();var M=f.scrollTop(),J=["flip"],D=[];if(x.indexOf("&"+a.mobile.subPageUrlKey)>-1)l=a("[data-url='"+x+"']");if(y){y.data("lastScroll",M);y.data("page")._trigger("beforehide",{nextPage:l})}l.data("page")._trigger("beforeshow",{prevPage:y||a("")});if(s&&s!=="none"){a.mobile.pageLoading(true);a.inArray(s,J)>=0&&B("ui-mobile-viewport-perspective");B("ui-mobile-viewport-transitioning");if(y)y.addClass(s+" out "+(q?"reverse":
-""));l.addClass(a.mobile.activePageClass+" "+s+" in "+(q?"reverse":""));l.animationComplete(function(){y.add(l).removeClass("out in reverse "+s);y&&y.removeClass(a.mobile.activePageClass);A();a.mobile.pageContainer.removeClass(D.join(" "));D=[]})}else{a.mobile.pageLoading(true);y&&y.removeClass(a.mobile.activePageClass);l.addClass(a.mobile.activePageClass);A()}}function Q(){if(j||l.data("role")=="dialog"){x=h.getActive().url+t;if(j){l.attr("data-role",j);j=null}}l.page()}var E=a.type(l)==="array",
-H=a.type(l)==="object",y=E?l[0]:a.mobile.activePage;l=E?l[1]:l;var x=fileUrl=a.type(l)==="string"?e.stripHash(l):"",C=d,N="get",R=false,L=null,O=h.getActive(),I=false,K=false;if(!(O&&h.stack.length>1&&O.url===x&&!E&&!H))if(p)o.unshift(arguments);else{p=true;if(z){a.each(h.stack,function(A){if(this.url==x){urlIndex=A;I=A<h.activeIndex;K=!I;h.activeIndex=A}});if(I){q=true;s=s||O.transition}else if(K)s=s||h.getActive().transition}if(H&&l.url){x=l.url;C=l.data;N=l.type;R=true;if(C&&N=="get"){if(a.type(C)==
-"object")C=a.param(C);x+="?"+C;C=d}}base&&base.reset();a(window.document.activeElement).add("input:focus, textarea:focus, select:focus").blur();if(x){l=a("[data-url='"+x+"']");fileUrl=e.getFilePath(x)}else{E=l.attr("data-url");H=e.getFilePath(E);if(E!=H)fileUrl=H}if(s===d)s=a.mobile.defaultTransition;if(l.length&&!R){fileUrl&&base&&base.set(fileUrl);Q();F()}else{if(l.length)L=l;a.mobile.pageLoading();a.ajax({url:fileUrl,type:N,data:C,success:function(A){var B=/ data-url="(.*)"/.test(A)&&RegExp.$1;
-if(B){base&&base.set(B);x=fileUrl=e.getFilePath(B)}else base&&base.set(fileUrl);B=a("<div></div>");B.get(0).innerHTML=A;l=B.find('[data-role="page"], [data-role="dialog"]').first();if(!a.support.dynamicBaseTag){var M=e.get(fileUrl);l.find("[src],link[href]").each(function(){var J=a(this).is("[href]")?"href":"src",D=a(this).attr(J);D.replace(location.protocol+"//"+location.host+location.pathname,"");/^(\w+:|#|\/)/.test(D)||a(this).attr(J,M+D)})}l.attr("data-url",fileUrl).appendTo(a.mobile.pageContainer);
-Q();setTimeout(function(){F()},0)},error:function(){a.mobile.pageLoading(true);c(true);base&&base.set(e.get());a("<div class='ui-loader ui-overlay-shadow ui-body-e ui-corner-all'><h1>Error Loading Page</h1></div>").css({display:"block",opacity:0.96,top:a(window).scrollTop()+100}).appendTo(a.mobile.pageContainer).delay(800).fadeOut(400,function(){a(this).remove()})}})}}};a("form[data-ajax!='false']").live("submit",function(l){if(a.mobile.ajaxEnabled&&a.mobile.ajaxFormsEnabled){var s=a(this).attr("method"),
-q=e.clean(a(this).attr("action"));if(!e.isExternal(q)){if(e.isRelative(q))q=e.makeAbsolute(q);a.mobile.changePage({url:q,type:s,data:a(this).serialize()},d,d,true);l.preventDefault()}}});a("a").live("click",function(l){var s=a(this),q=s.attr("href")||"#";q=e.clean(q);var w=s.is("[rel='external']"),z=e.isEmbeddedPage(q);w=e.isExternal(q)||w&&!z;z=s.is("[target]");var F=s.is("[data-ajax='false']");if(s.is("[data-rel='back']")){window.history.back();return false}if(q==="#")return false;i=s.closest(".ui-btn").addClass(a.mobile.activeBtnClass);
-if(w||F||z||!a.mobile.ajaxEnabled||!a.mobile.ajaxLinksEnabled){c(true);if(z)window.open(q);else if(F)return;else location.href=q}else{w=s.data("transition");z=(z=s.data("direction"))&&z=="reverse"||s.data("back");j=s.attr("data-rel");if(e.isRelative(q))q=e.makeAbsolute(q);q=e.stripHash(q);a.mobile.changePage(q,w,z)}l.preventDefault()});f.bind("hashchange",function(){var l=e.stripHash(location.hash),s=a.mobile.urlHistory.stack.length===0?false:d;if(!a.mobile.hashListeningEnabled||!h.ignoreNextHashChange||
-h.stack.length>1&&l.indexOf(t)>-1&&!a.mobile.activePage.is(".ui-dialog")){if(!h.ignoreNextHashChange)h.ignoreNextHashChange=true}else l?a.mobile.changePage(l,s,d,false,true):a.mobile.changePage(a.mobile.firstPage,s,true,false,true)})})(jQuery);
-(function(a,d){a.fn.fixHeaderFooter=function(){if(!a.support.scrollTop)return this;return this.each(function(){var c=a(this);c.data("fullscreen")&&c.addClass("ui-page-fullscreen");c.find('.ui-header[data-position="fixed"]').addClass("ui-header-fixed ui-fixed-inline fade");c.find('.ui-footer[data-position="fixed"]').addClass("ui-footer-fixed ui-fixed-inline fade")})};a.fixedToolbars=function(){function c(){if(!e&&g=="overlay"){i||a.fixedToolbars.hide(true);a.fixedToolbars.startShowTimer()}}function f(m){var r=
-0;if(m){var n=m.offsetParent,u=document.body;for(r=m.offsetTop;m&&m!=u;){r+=m.scrollTop||0;if(m==n){r+=n.offsetTop;n=m.offsetParent}m=m.parentNode}}return r}function b(m){var r=a(window).scrollTop(),n=f(m[0]),u=m.css("top")=="auto"?0:parseFloat(m.css("top")),l=window.innerHeight,s=m.outerHeight(),q=m.parents(".ui-page:not(.ui-page-fullscreen)").length;if(m.is(".ui-header-fixed")){u=r-n+u;if(u<n)u=0;return m.css("top",q?u:r)}else{u=r+l-s-(n-u);return m.css("top",q?u:r+l-s)}}if(a.support.scrollTop){var g=
-"inline",e=false,i,h,k=a.support.touch,j=k?"touchstart":"mousedown",o=k?"touchend":"mouseup",p=null,t=false,v=true;a(function(){a(document).bind(j,function(m){if(v)a(m.target).closest("a,input,textarea,select,button,label,.ui-header-fixed,.ui-footer-fixed").length||(p=g)}).bind(o,function(m){if(v)if(!a(m.target).closest("a,input,textarea,select,button,label,.ui-header-fixed,.ui-footer-fixed").length)if(!t){a.fixedToolbars.toggle(p);p=null}}).bind("scrollstart",function(m){if(!a(m.target).closest("a,input,textarea,select,button,label,.ui-header-fixed,.ui-footer-fixed").length){t=
-true;if(p==null)p=g;if(e=(m=p=="overlay")||!!i){a.fixedToolbars.clearShowTimer();m&&a.fixedToolbars.hide(true)}}}).bind("scrollstop",function(m){if(!a(m.target).closest("a,input,textarea,select,button,label,.ui-header-fixed,.ui-footer-fixed").length){t=false;if(e){e=false;a.fixedToolbars.startShowTimer()}p=null}}).bind("silentscroll",c);a(window).bind("resize",c)});a(".ui-page").live("pagebeforeshow",function(m){m=a(m.target).find('[data-role="footer"]:not(.ui-sticky-footer)');var r=m.data("id");
-h=null;if(r){h=a('.ui-footer[data-id="'+r+'"].ui-sticky-footer');if(h.length==0){h=m;m=h.clone();h.addClass("ui-sticky-footer").before(m)}m.addClass("ui-footer-duplicate");h.appendTo(a.pageContainer).css("top",0);b(h)}});a(".ui-page").live("pageshow",function(m){h&&h.length&&h.appendTo(m.target).css("top",0);a.fixedToolbars.show(true,this)});return{show:function(m,r){a.fixedToolbars.clearShowTimer();g="overlay";return(r?a(r):a.mobile.activePage?a.mobile.activePage:a(".ui-page-active")).children(".ui-header-fixed:first, .ui-footer-fixed:not(.ui-footer-duplicate):last").each(function(){var n=
-a(this),u=a(window).scrollTop(),l=f(n[0]),s=window.innerHeight,q=n.outerHeight();u=n.is(".ui-header-fixed")&&u<=l+q||n.is(".ui-footer-fixed")&&l<=u+s;n.addClass("ui-fixed-overlay").removeClass("ui-fixed-inline");!u&&!m&&n.animationComplete(function(){n.removeClass("in")}).addClass("in");b(n)})},hide:function(m){g="inline";return(a.mobile.activePage?a.mobile.activePage:a(".ui-page-active")).children(".ui-header-fixed:first, .ui-footer-fixed:not(.ui-footer-duplicate):last").each(function(){var r=a(this),
-n=r.css("top");n=n=="auto"?0:parseFloat(n);r.addClass("ui-fixed-inline").removeClass("ui-fixed-overlay");if(n<0||r.is(".ui-header-fixed")&&n!=0)if(m)r.css("top",0);else r.css("top")!=="auto"&&parseFloat(r.css("top"))!==0&&r.animationComplete(function(){r.removeClass("out reverse");r.css("top",0)}).addClass("out reverse")})},startShowTimer:function(){a.fixedToolbars.clearShowTimer();var m=a.makeArray(arguments);i=setTimeout(function(){i=d;a.fixedToolbars.show.apply(null,m)},100)},clearShowTimer:function(){i&&
-clearTimeout(i);i=d},toggle:function(m){if(m)g=m;return g=="overlay"?a.fixedToolbars.hide():a.fixedToolbars.show()},setTouchToggleEnabled:function(m){v=m}}}}()})(jQuery);
-(function(a,d){a.widget("mobile.checkboxradio",a.mobile.widget,{options:{theme:null},_create:function(){var c=this,f=this.element,b=f.closest("form,fieldset,[data-role='page']").find("label[for='"+f.attr("id")+"']"),g=f.attr("type"),e="ui-icon-"+g+"-off";if(!(g!="checkbox"&&g!="radio")){if(!this.options.theme)this.options.theme=this.element.data("theme");b.buttonMarkup({theme:this.options.theme,icon:this.element.parents("[data-type='horizontal']").length?d:e,shadow:false});f.add(b).wrapAll("<div class='ui-"+
-g+"'></div>");b.bind({mouseover:function(){if(a(this).parent().is(".ui-disabled"))return false},touchmove:function(i){i=i.originalEvent.touches[0];if(b.data("movestart")){if(Math.abs(b.data("movestart")[0]-i.pageX)>10||Math.abs(abel.data("movestart")[1]-i.pageY)>10)b.data("moved",true)}else b.data("movestart",[parseFloat(i.pageX),parseFloat(i.pageY)])},"touchend mouseup":function(i){b.removeData("movestart");if(b.data("etype")&&b.data("etype")!==i.type||b.data("moved")){b.removeData("etype").removeData("moved");
-b.data("moved")&&b.removeData("moved");return false}b.data("etype",i.type);c._cacheVals();f.attr("checked",g==="radio"&&true||!f.is(":checked"));c._updateAll();i.preventDefault()},click:false});f.bind({mousedown:function(){this._cacheVals()},click:function(){c._updateAll()},focus:function(){b.addClass("ui-focus")},blur:function(){b.removeClass("ui-focus")}});this.refresh()}},_cacheVals:function(){this._getInputSet().each(function(){a(this).data("cacheVal",a(this).is(":checked"))})},_getInputSet:function(){return this.element.closest("form,fieldset,[data-role='page']").find("input[name='"+
-this.element.attr("name")+"'][type='"+this.element.attr("type")+"']")},_updateAll:function(){this._getInputSet().each(function(){var c=a(this).data("cacheVal");if(c&&c!==a(this).is(":checked")||a(this).is("[type='checkbox']"))a(this).trigger("change")}).checkboxradio("refresh")},refresh:function(){var c=this.element,f=c.closest("form,fieldset,[data-role='page']").find("label[for='"+c.attr("id")+"']"),b=c.attr("type"),g=f.find(".ui-icon"),e="ui-icon-"+b+"-on";b="ui-icon-"+b+"-off";if(c[0].checked){f.addClass("ui-btn-active");
-g.addClass(e);g.removeClass(b)}else{f.removeClass("ui-btn-active");g.removeClass(e);g.addClass(b)}c.is(":disabled")?this.disable():this.enable()},disable:function(){this.element.attr("disabled",true).parent().addClass("ui-disabled")},enable:function(){this.element.attr("disabled",false).parent().removeClass("ui-disabled")}})})(jQuery);
-(function(a){a.widget("mobile.textinput",a.mobile.widget,{options:{theme:null},_create:function(){var d=this.element,c=this.options,f=c.theme;if(!f){f=this.element.closest("[class*='ui-bar-'],[class*='ui-body-']");f=f.length?/ui-(bar|body)-([a-z])/.exec(f.attr("class"))[2]:"c"}f=" ui-body-"+f;a("label[for="+d.attr("id")+"]").addClass("ui-input-text");d.addClass("ui-input-text ui-body-"+c.theme);var b=d;if(d.is('[type="search"],[data-type="search"]')){b=d.wrap('<div class="ui-input-search ui-shadow-inset ui-btn-corner-all ui-btn-shadow ui-icon-searchfield'+
-f+'"></div>').parent();var g=a('<a href="#" class="ui-input-clear" title="clear text">clear text</a>').tap(function(h){d.val("").focus();d.trigger("change");g.addClass("ui-input-clear-hidden");h.preventDefault()}).appendTo(b).buttonMarkup({icon:"delete",iconpos:"notext",corners:true,shadow:true});c=function(){d.val()==""?g.addClass("ui-input-clear-hidden"):g.removeClass("ui-input-clear-hidden")};c();d.keyup(c)}else d.addClass("ui-corner-all ui-shadow-inset"+f);d.focus(function(){b.addClass("ui-focus")}).blur(function(){b.removeClass("ui-focus")});
-if(d.is("textarea")){var e=function(){var h=d[0].scrollHeight;d[0].clientHeight<h&&d.css({height:h+15})},i;d.keyup(function(){clearTimeout(i);i=setTimeout(e,100)})}},disable:function(){(this.element.attr("disabled",true).is('[type="search"],[data-type="search"]')?this.element.parent():this.element).addClass("ui-disabled")},enable:function(){(this.element.attr("disabled",false).is('[type="search"],[data-type="search"]')?this.element.parent():this.element).removeClass("ui-disabled")}})})(jQuery);
-(function(a){a.widget("mobile.selectmenu",a.mobile.widget,{options:{theme:null,disabled:false,icon:"arrow-d",iconpos:"right",inline:null,corners:true,shadow:true,iconshadow:true,menuPageTheme:"b",overlayTheme:"a",hidePlaceholderMenuItems:true,closeText:"Close",nativeMenu:false},_create:function(){var d=this,c=this.options,f=this.element.wrap("<div class='ui-select'>"),b=f.attr("id"),g=a("label[for="+b+"]").addClass("ui-select"),e=(d.options.nativeMenu?a("<div/>"):a("<a>",{href:"#",role:"button",id:k,
-"aria-haspopup":"true","aria-owns":j})).text(a(f[0].options.item(f[0].selectedIndex)).text()).insertBefore(f).buttonMarkup({theme:c.theme,icon:c.icon,iconpos:c.iconpos,inline:c.inline,corners:c.corners,shadow:c.shadow,iconshadow:c.iconshadow}),i=d.isMultiple=f[0].multiple;c.nativeMenu&&window.opera&&window.opera.version&&f.addClass("ui-select-nativeonly");if(!c.nativeMenu){var h=f.find("option"),k=b+"-button",j=b+"-menu",o=f.closest(".ui-page"),p=/ui-btn-up-([a-z])/.exec(e.attr("class"))[1],t=a("<div data-role='dialog' data-theme='"+
-c.menuPageTheme+"'><div data-role='header'><div class='ui-title'>"+g.text()+"</div></div><div data-role='content'></div></div>").appendTo(a.mobile.pageContainer).page(),v=t.find(".ui-content"),m=t.find(".ui-header a"),r=a("<div>",{"class":"ui-selectmenu-screen ui-screen-hidden"}).appendTo(o),n=a("<div>",{"class":"ui-selectmenu ui-selectmenu-hidden ui-overlay-shadow ui-corner-all pop ui-body-"+c.overlayTheme}).insertAfter(r),u=a("<ul>",{"class":"ui-selectmenu-list",id:j,role:"listbox","aria-labelledby":k,
-"data-theme":p}).appendTo(n);p=a("<div>",{"class":"ui-header ui-bar-"+p}).prependTo(n);var l=a("<h1>",{"class":"ui-title"}).appendTo(p),s=a("<a>",{"data-iconpos":"notext","data-icon":"delete",text:c.closeText,href:"#","class":"ui-btn-left"}).appendTo(p).buttonMarkup()}if(i)d.buttonCount=a("<span>").addClass("ui-li-count ui-btn-up-c ui-btn-corner-all").hide().appendTo(e);c.disabled&&this.disable();f.change(function(){d.refresh()});a.extend(d,{select:f,optionElems:h,selectID:b,label:g,buttonId:k,menuId:j,
-thisPage:o,button:e,menuPage:t,menuPageContent:v,screen:r,listbox:n,list:u,menuType:void 0,header:p,headerClose:s,headerTitle:l,placeholder:""});if(c.nativeMenu){f.appendTo(e).bind("touchstart mousedown",function(){e.addClass(a.mobile.activeBtnClass)}).bind("focus mouseover",function(){e.trigger("mouseover")}).bind("touchmove",function(){e.removeClass(a.mobile.activeBtnClass)}).bind("change blur mouseout",function(){e.trigger("mouseout").removeClass(a.mobile.activeBtnClass)});e.attr("tabindex","-1")}else{d.refresh();
-f.attr("tabindex","-1").focus(function(){a(this).blur();e.focus()});e.bind("touchstart",function(q){a(this).data("startTouches",a.extend({},q.originalEvent.touches[0]))}).bind(a.support.touch?"touchend":"mouseup",function(q){a(this).data("moved")?a(this).removeData("moved"):d.open();q.preventDefault()}).bind("touchmove",function(q){q=q.originalEvent.touches[0];var w=a(this).data("startTouches"),z=Math.abs(q.pageY-w.pageY);if(Math.abs(q.pageX-w.pageX)>10||z>10)a(this).data("moved",true)});u.delegate("li:not(.ui-disabled, .ui-li-divider)",
-"click",function(q){if(a(q.target).is("a")){var w=u.find("li:not(.ui-li-divider)").index(this);w=d.optionElems.eq(w)[0];w.selected=i?!w.selected:true;i&&a(this).find(".ui-icon").toggleClass("ui-icon-checkbox-on",w.selected).toggleClass("ui-icon-checkbox-off",!w.selected);f.trigger("change");i||d.close();q.preventDefault()}});r.add(s).add(m).bind("click",function(q){d.close();q.preventDefault();a.contains(m[0],q.target)&&q.stopImmediatePropagation()})}},_buildList:function(){var d=this,c=this.options,
-f=this.placeholder,b=[],g=[],e=d.isMultiple?"checkbox-off":"false";d.list.empty().filter(".ui-listview").listview("destroy");d.select.find("option").each(function(){var i=a(this),h=i.parent(),k=i.text(),j="<a href='#'>"+k+"</a>",o=[],p=[];if(h.is("optgroup")){h=h.attr("label");if(a.inArray(h,b)===-1){g.push("<li data-role='list-divider'>"+h+"</li>");b.push(h)}}if(!this.getAttribute("value")||k.length==0||i.data("placeholder")){c.hidePlaceholderMenuItems&&o.push("ui-selectmenu-placeholder");f=d.placeholder=
-k}if(this.disabled){o.push("ui-disabled");p.push("aria-disabled='true'")}g.push("<li data-icon='"+e+"' class='"+o.join(" ")+"' "+p.join(" ")+">"+j+"</li>")});d.list.html(g.join(" "));this.isMultiple||this.headerClose.hide();!this.isMultiple&&!f.length?this.header.hide():this.headerTitle.text(this.placeholder);d.list.listview()},refresh:function(d){var c=this,f=this.element,b=this.isMultiple,g=this.optionElems=f.find("option"),e=g.filter(":selected"),i=e.map(function(){return g.index(this)}).get();
-if(!c.options.nativeMenu&&(d||f[0].options.length>c.list.find("li").length))c._buildList();c.button.find(".ui-btn-text").text(function(){if(!b)return e.text();return e.length?e.map(function(){return a(this).text()}).get().join(", "):c.placeholder});if(b)c.buttonCount[e.length>1?"show":"hide"]().text(e.length);c.options.nativeMenu||c.list.find("li:not(.ui-li-divider)").removeClass(a.mobile.activeBtnClass).attr("aria-selected",false).each(function(h){if(a.inArray(h,i)>-1){h=a(this).addClass(a.mobile.activeBtnClass);
-h.find("a").attr("aria-selected",true);b&&h.find(".ui-icon").removeClass("ui-icon-checkbox-off").addClass("ui-icon-checkbox-on")}})},open:function(){function d(){c.list.find(".ui-btn-active").focus()}if(!(this.options.disabled||this.options.nativeMenu)){var c=this,f=c.list.outerHeight(),b=c.list.outerWidth(),g=a(window).scrollTop(),e=c.button.offset().top,i=window.innerHeight,h=c.list.parents(".ui-dialog").length;c.button.addClass(a.mobile.activeBtnClass);if(h||f>i-80||!a.support.scrollTop){g==0&&
-e>i&&c.thisPage.one("pagehide",function(){a(this).data("lastScroll",e)});c.menuPage.one("pageshow",function(){a(window).one("silentscroll",function(){d()})});c.menuType="page";c.menuPageContent.append(c.list);a.mobile.changePage(c.menuPage,"pop",false,true)}else{c.menuType="overlay";c.screen.height(a(document).height()).removeClass("ui-screen-hidden");h=e-g;var k=g+i-e,j=f/2;f=h>f/2&&k>f/2?e+c.button.outerHeight()/2-j:h>k?g+i-f-30:g+30;b=c.button.offset().left+c.button.outerWidth()/2-b/2;c.listbox.append(c.list).removeClass("ui-selectmenu-hidden").css({top:f,
-left:b}).addClass("in");d()}setTimeout(function(){c.isOpen=true},400)}},close:function(){function d(){setTimeout(function(){c.button.focus();c.button.removeClass(a.mobile.activeBtnClass)},40);c.listbox.removeAttr("style").append(c.list)}if(!(this.options.disabled||!this.isOpen||this.options.nativeMenu)){var c=this;if(c.menuType=="page"){a.mobile.changePage([c.menuPage,c.thisPage],"pop",true,false);c.menuPage.one("pagehide",d)}else{c.screen.addClass("ui-screen-hidden");c.listbox.addClass("ui-selectmenu-hidden").removeAttr("style").removeClass("in");
-d()}this.isOpen=false}},disable:function(){this.element.attr("disabled",true);this.button.addClass("ui-disabled").attr("aria-disabled",true);return this._setOption("disabled",true)},enable:function(){this.element.attr("disabled",false);this.button.removeClass("ui-disabled").attr("aria-disabled",false);return this._setOption("disabled",false)}})})(jQuery);
-(function(a){a.fn.buttonMarkup=function(c){return this.each(function(){var f=a(this),b=a.extend({},a.fn.buttonMarkup.defaults,f.data(),c),g,e="ui-btn-inner",i;d&&d();if(!b.theme){g=f.closest("[class*='ui-bar-'],[class*='ui-body-']");b.theme=g.length?/ui-(bar|body)-([a-z])/.exec(g.attr("class"))[2]:"c"}g="ui-btn ui-btn-up-"+b.theme;if(b.inline)g+=" ui-btn-inline";if(b.icon){b.icon="ui-icon-"+b.icon;b.iconpos=b.iconpos||"left";i="ui-icon "+b.icon;if(b.shadow)i+=" ui-icon-shadow"}if(b.iconpos){g+=" ui-btn-icon-"+
-b.iconpos;b.iconpos=="notext"&&!f.attr("title")&&f.attr("title",f.text())}if(b.corners){g+=" ui-btn-corner-all";e+=" ui-btn-corner-all"}if(b.shadow)g+=" ui-shadow";f.attr("data-theme",b.theme).addClass(g);b=("<D class='"+e+"'><D class='ui-btn-text'></D>"+(b.icon?"<span class='"+i+"'></span>":"")+"</D>").replace(/D/g,b.wrapperEls);f.wrapInner(b)})};a.fn.buttonMarkup.defaults={corners:true,shadow:true,iconshadow:true,wrapperEls:"span"};var d=function(){a(".ui-btn:not(.ui-disabled)").live({"touchstart mousedown":function(){var c=
-a(this).attr("data-theme");a(this).removeClass("ui-btn-up-"+c).addClass("ui-btn-down-"+c)},"touchmove touchend mouseup":function(){var c=a(this).attr("data-theme");a(this).removeClass("ui-btn-down-"+c).addClass("ui-btn-up-"+c)},"mouseover focus":function(){var c=a(this).attr("data-theme");a(this).removeClass("ui-btn-up-"+c).addClass("ui-btn-hover-"+c)},"mouseout blur":function(){var c=a(this).attr("data-theme");a(this).removeClass("ui-btn-hover-"+c).addClass("ui-btn-up-"+c)}});d=null}})(jQuery);
-(function(a){a.widget("mobile.button",a.mobile.widget,{options:{theme:null,icon:null,iconpos:null,inline:null,corners:true,shadow:true,iconshadow:true},_create:function(){var d=this.element,c=this.options;this.button=a("<div></div>").text(d.text()||d.val()).buttonMarkup({theme:c.theme,icon:c.icon,iconpos:c.iconpos,inline:c.inline,corners:c.corners,shadow:c.shadow,iconshadow:c.iconshadow}).insertBefore(d).append(d.addClass("ui-btn-hidden"));d.attr("type")!=="reset"&&d.click(function(){var f=a("<input>",
-{type:"hidden",name:d.attr("name"),value:d.attr("value")}).insertBefore(d);a(document).submit(function(){f.remove()})})},enable:function(){this.element.attr("disabled",false);this.button.removeClass("ui-disabled").attr("aria-disabled",false);return this._setOption("disabled",false)},disable:function(){this.element.attr("disabled",true);this.button.addClass("ui-disabled").attr("aria-disabled",true);return this._setOption("disabled",true)}})})(jQuery);
-(function(a){a.widget("mobile.slider",a.mobile.widget,{options:{theme:null,trackTheme:null,disabled:false},_create:function(){var d=this,c=this.element,f=c.parents("[class*=ui-bar-],[class*=ui-body-]").eq(0);f=f.length?f.attr("class").match(/ui-(bar|body)-([a-z])/)[2]:"c";var b=this.options.theme?this.options.theme:f,g=this.options.trackTheme?this.options.trackTheme:f,e=c[0].nodeName.toLowerCase();f=e=="select"?"ui-slider-switch":"";var i=c.attr("id"),h=i+"-label";i=a("[for="+i+"]").attr("id",h);
-var k=function(){return e=="input"?parseFloat(c.val()):c[0].selectedIndex},j=e=="input"?parseFloat(c.attr("min")):0,o=e=="input"?parseFloat(c.attr("max")):c.find("option").length-1,p=window.parseFloat(c.attr("step")||1),t=a('<div class="ui-slider '+f+" ui-btn-down-"+g+' ui-btn-corner-all" role="application"></div>'),v=a('<a href="#" class="ui-slider-handle"></a>').appendTo(t).buttonMarkup({corners:true,theme:b,shadow:true}).attr({role:"slider","aria-valuemin":j,"aria-valuemax":o,"aria-valuenow":k(),
-"aria-valuetext":k(),title:k(),"aria-labelledby":h});a.extend(this,{slider:t,handle:v,dragging:false,beforeStart:null});if(e=="select"){t.wrapInner('<div class="ui-slider-inneroffset"></div>');c.find("option");c.find("option").each(function(m){var r=m==0?"b":"a",n=m==0?"right":"left";m=m==0?" ui-btn-down-"+g:" ui-btn-active";a('<div class="ui-slider-labelbg ui-slider-labelbg-'+r+m+" ui-btn-corner-"+n+'"></div>').prependTo(t);a('<span class="ui-slider-label ui-slider-label-'+r+m+" ui-btn-corner-"+
-n+'" role="img">'+a(this).text()+"</span>").prependTo(v)})}i.addClass("ui-slider");c.addClass(e=="input"?"ui-slider-input":"ui-slider-switch").change(function(){d.refresh(k(),true)}).keyup(function(){d.refresh(k(),true,true)}).blur(function(){d.refresh(k(),true)});a(document).bind("touchmove mousemove",function(m){if(d.dragging){d.refresh(m);return false}});t.bind("touchstart mousedown",function(m){d.dragging=true;if(e==="select")d.beforeStart=c[0].selectedIndex;d.refresh(m);return false});t.add(document).bind("touchend mouseup",
-function(){if(d.dragging){d.dragging=false;if(e==="select"){if(d.beforeStart===c[0].selectedIndex)d.refresh(d.beforeStart===0?1:0);var m=k();m=Math.round(m/(o-j)*100);v.addClass("ui-slider-handle-snapping").css("left",m+"%").animationComplete(function(){v.removeClass("ui-slider-handle-snapping")})}return false}});t.insertAfter(c);this.handle.bind("touchstart mousedown",function(){a(this).focus()});this.handle.bind("keydown",function(m){var r=k();if(!d.options.disabled){switch(m.keyCode){case a.mobile.keyCode.HOME:case a.mobile.keyCode.END:case a.mobile.keyCode.PAGE_UP:case a.mobile.keyCode.PAGE_DOWN:case a.mobile.keyCode.UP:case a.mobile.keyCode.RIGHT:case a.mobile.keyCode.DOWN:case a.mobile.keyCode.LEFT:m.preventDefault();
-if(!d._keySliding){d._keySliding=true;a(this).addClass("ui-state-active")}}switch(m.keyCode){case a.mobile.keyCode.HOME:d.refresh(j);break;case a.mobile.keyCode.END:d.refresh(o);break;case a.mobile.keyCode.PAGE_UP:case a.mobile.keyCode.UP:case a.mobile.keyCode.RIGHT:d.refresh(r+p);break;case a.mobile.keyCode.PAGE_DOWN:case a.mobile.keyCode.DOWN:case a.mobile.keyCode.LEFT:d.refresh(r-p)}}}).keyup(function(){if(d._keySliding){d._keySliding=false;a(this).removeClass("ui-state-active")}});this.refresh()},
-refresh:function(d,c,f){if(!this.options.disabled){var b=this.element,g=b[0].nodeName.toLowerCase(),e=g==="input"?parseFloat(b.attr("min")):0,i=g==="input"?parseFloat(b.attr("max")):b.find("option").length-1;if(typeof d==="object"){d=d.originalEvent.touches?d.originalEvent.touches[0]:d;if(!this.dragging||d.pageX<this.slider.offset().left-8||d.pageX>this.slider.offset().left+this.slider.width()+8)return;d=Math.round((d.pageX-this.slider.offset().left)/this.slider.width()*100)}else{if(d==null)d=g===
-"input"?parseFloat(b.val()):b[0].selectedIndex;d=(parseFloat(d)-e)/(i-e)*100}if(!isNaN(d)){if(d<0)d=0;if(d>100)d=100;var h=Math.round(d/100*(i-e))+e;if(h<e)h=e;if(h>i)h=i;this.handle.css("left",d+"%");this.handle.attr({"aria-valuenow":g==="input"?h:b.find("option").eq(h).attr("value"),"aria-valuetext":g==="input"?h:b.find("option").eq(h).text(),title:h});if(g==="select")h===0?this.slider.addClass("ui-slider-switch-a").removeClass("ui-slider-switch-b"):this.slider.addClass("ui-slider-switch-b").removeClass("ui-slider-switch-a");
-if(!f){if(g==="input")b.val(h);else b[0].selectedIndex=h;c||b.trigger("change")}}}},enable:function(){this.element.attr("disabled",false);this.slider.removeClass("ui-disabled").attr("aria-disabled",false);return this._setOption("disabled",false)},disable:function(){this.element.attr("disabled",true);this.slider.addClass("ui-disabled").attr("aria-disabled",true);return this._setOption("disabled",true)}})})(jQuery);
-(function(a){a.widget("mobile.collapsible",a.mobile.widget,{options:{expandCueText:" click to expand contents",collapseCueText:" click to collapse contents",collapsed:false,heading:">:header,>legend",theme:null,iconTheme:"d"},_create:function(){var d=this.element,c=this.options,f=d.addClass("ui-collapsible-contain"),b=d.find(c.heading).eq(0),g=f.wrapInner('<div class="ui-collapsible-content"></div>').find(".ui-collapsible-content");d=d.closest('[data-role="collapsible-set"]').addClass("ui-collapsible-set");
-if(b.is("legend")){b=a('<div role="heading">'+b.html()+"</div>").insertBefore(b);b.next().remove()}b.insertBefore(g);b.addClass("ui-collapsible-heading").append('<span class="ui-collapsible-heading-status"></span>').wrapInner('<a href="#" class="ui-collapsible-heading-toggle"></a>').find("a:eq(0)").buttonMarkup({shadow:!!!d.length,corners:false,iconPos:"left",icon:"plus",theme:c.theme}).find(".ui-icon").removeAttr("class").buttonMarkup({shadow:true,corners:true,iconPos:"notext",icon:"plus",theme:c.iconTheme});
-if(d.length)f.data("collapsible-last")&&b.find("a:eq(0), .ui-btn-inner").addClass("ui-corner-bottom");else b.find("a:eq(0)").addClass("ui-corner-all").find(".ui-btn-inner").addClass("ui-corner-all");f.bind("collapse",function(e){if(!e.isDefaultPrevented()){e.preventDefault();b.addClass("ui-collapsible-heading-collapsed").find(".ui-collapsible-heading-status").text(c.expandCueText);b.find(".ui-icon").removeClass("ui-icon-minus").addClass("ui-icon-plus");g.addClass("ui-collapsible-content-collapsed").attr("aria-hidden",
-true);f.data("collapsible-last")&&b.find("a:eq(0), .ui-btn-inner").addClass("ui-corner-bottom")}}).bind("expand",function(e){if(!e.isDefaultPrevented()){e.preventDefault();b.removeClass("ui-collapsible-heading-collapsed").find(".ui-collapsible-heading-status").text(c.collapseCueText);b.find(".ui-icon").removeClass("ui-icon-plus").addClass("ui-icon-minus");g.removeClass("ui-collapsible-content-collapsed").attr("aria-hidden",false);f.data("collapsible-last")&&b.find("a:eq(0), .ui-btn-inner").removeClass("ui-corner-bottom")}}).trigger(c.collapsed?
-"collapse":"expand");if(d.length&&!d.data("collapsiblebound")){d.data("collapsiblebound",true).bind("expand",function(e){a(this).find(".ui-collapsible-contain").not(a(e.target).closest(".ui-collapsible-contain")).not("> .ui-collapsible-contain .ui-collapsible-contain").trigger("collapse")});d=d.find("[data-role=collapsible]");d.first().find("a:eq(0)").addClass("ui-corner-top").find(".ui-btn-inner").addClass("ui-corner-top");d.last().data("collapsible-last",true)}b.bind(a.support.touch?"touchstart":
-"click",function(){b.is(".ui-collapsible-heading-collapsed")?f.trigger("expand"):f.trigger("collapse");return false})}})})(jQuery);
-(function(a){a.fn.controlgroup=function(d){return this.each(function(){function c(e){e.removeClass("ui-btn-corner-all ui-shadow").eq(0).addClass(g[0]).end().filter(":last").addClass(g[1]).addClass("ui-controlgroup-last")}var f=a.extend({direction:a(this).data("type")||"vertical",shadow:false},d),b=a(this).find(">legend"),g=f.direction=="horizontal"?["ui-corner-left","ui-corner-right"]:["ui-corner-top","ui-corner-bottom"];a(this).find("input:eq(0)").attr("type");if(b.length){a(this).wrapInner('<div class="ui-controlgroup-controls"></div>');
-a('<div role="heading" class="ui-controlgroup-label">'+b.html()+"</div>").insertBefore(a(this).children(0));b.remove()}a(this).addClass("ui-corner-all ui-controlgroup ui-controlgroup-"+f.direction);c(a(this).find(".ui-btn"));c(a(this).find(".ui-btn-inner"));f.shadow&&a(this).addClass("ui-shadow")})}})(jQuery);(function(a){a.fn.fieldcontain=function(){return this.addClass("ui-field-contain ui-body ui-br")}})(jQuery);
-(function(a){a.widget("mobile.listview",a.mobile.widget,{options:{theme:"c",countTheme:"c",headerTheme:"b",dividerTheme:"b",splitIcon:"arrow-r",splitTheme:"b",inset:false},_create:function(){var d=this.element,c=this.options;d.addClass("ui-listview").attr("role","listbox");c.inset&&d.addClass("ui-listview-inset ui-corner-all ui-shadow");d.delegate(".ui-li","focusin",function(){a(this).attr("tabindex","0")});this._itemApply(d,d);this.refresh(true);d.keydown(function(f){var b=a(f.target),g=b.closest("li");
-switch(f.keyCode){case 38:f=g.prev();if(f.length){b.blur().attr("tabindex","-1");f.find("a").first().focus()}return false;case 40:f=g.next();if(f.length){b.blur().attr("tabindex","-1");f.find("a").first().focus()}return false;case 39:f=g.find("a.ui-li-link-alt");if(f.length){b.blur();f.first().focus()}return false;case 37:f=g.find("a.ui-link-inherit");if(f.length){b.blur();f.first().focus()}return false;case 13:case 32:b.trigger("click");return false}});d.delegate("li","click",function(f){if(!a(f.target).closest("a").length){a(this).find("a").first().trigger("click");
-return false}})},_itemApply:function(d,c){c.find(".ui-li-count").addClass("ui-btn-up-"+(d.data("counttheme")||this.options.countTheme)+" ui-btn-corner-all");c.find("h1, h2, h3, h4, h5, h6").addClass("ui-li-heading");c.find("p, dl").addClass("ui-li-desc");c.find("li").find("img:eq(0)").addClass("ui-li-thumb").each(function(){a(this).closest("li").addClass(a(this).is(".ui-li-icon")?"ui-li-has-icon":"ui-li-has-thumb")});var f=c.find(".ui-li-aside");f.length&&f.each(function(b,g){a(g).prependTo(a(g).parent())});
-a.support.cssPseudoElement||a.nodeName(c[0],"ol")},_removeCorners:function(d){d.add(d.find(".ui-btn-inner, .ui-li-link-alt, .ui-li-thumb")).removeClass("ui-corner-top ui-corner-bottom ui-corner-br ui-corner-bl ui-corner-tr ui-corner-tl")},refresh:function(d){this._createSubPages();var c=this.options,f=this.element,b=this,g=f.data("dividertheme")||c.dividerTheme,e=f.children("li"),i=a.support.cssPseudoElement||!a.nodeName(f[0],"ol")?0:1;i&&f.find(".ui-li-dec").remove();e.attr({role:"option",tabindex:"-1"});
-e.first().attr("tabindex","0");e.each(function(h){var k=a(this),j="ui-li";if(!(!d&&k.hasClass("ui-li"))){var o=k.data("theme")||c.theme,p=k.find("a");if(p.length){var t=k.data("icon");k.buttonMarkup({wrapperEls:"div",shadow:false,corners:false,iconpos:"right",icon:p.length>1||t===false?false:t||"arrow-r",theme:o});p.first().addClass("ui-link-inherit");if(p.length>1){j+=" ui-li-has-alt";p=p.last();t=f.data("splittheme")||p.data("theme")||c.splitTheme;p.appendTo(k).attr("title",p.text()).addClass("ui-li-link-alt").empty().buttonMarkup({shadow:false,
-corners:false,theme:o,icon:false,iconpos:false}).find(".ui-btn-inner").append(a("<span>").buttonMarkup({shadow:true,corners:true,theme:t,iconpos:"notext",icon:f.data("spliticon")||p.data("icon")||c.splitIcon}))}}else if(k.data("role")==="list-divider"){j+=" ui-li-divider ui-btn ui-bar-"+g;k.attr("role","heading");if(i)i=1}else j+=" ui-li-static ui-btn-up-"+o;if(c.inset){if(h===0){j+=" ui-corner-top";k.add(k.find(".ui-btn-inner")).find(".ui-li-link-alt").addClass("ui-corner-tr").end().find(".ui-li-thumb").addClass("ui-corner-tl");
-k.next().next().length&&b._removeCorners(k.next())}if(h===e.length-1){j+=" ui-corner-bottom";k.add(k.find(".ui-btn-inner")).find(".ui-li-link-alt").addClass("ui-corner-br").end().find(".ui-li-thumb").addClass("ui-corner-bl");k.prev().prev().length&&b._removeCorners(k.prev())}}i&&j.indexOf("ui-li-divider")<0&&k.find(".ui-link-inherit").first().addClass("ui-li-jsnumbering").prepend("<span class='ui-li-dec'>"+i++ +". </span>");k.addClass(j);d||b._itemApply(f,k)}})},_idStringEscape:function(d){return d.replace(/[^a-zA-Z0-9]/g,
-"-")},_createSubPages:function(){var d=this.element,c=d.closest(".ui-page"),f=c.data("url"),b=this.options,g=this,e=c.find("[data-role='footer']").data("id");a(d.find("ul, ol").toArray().reverse()).each(function(i){var h=a(this),k=h.parent(),j=a.trim(k.contents()[0].nodeValue)||k.find("a:first").text();i=f+"&"+a.mobile.subPageUrlKey+"="+g._idStringEscape(j+" "+i);var o=h.data("theme")||b.theme,p=h.data("counttheme")||d.data("counttheme")||b.countTheme;h.wrap("<div data-role='page'><div data-role='content'></div></div>").parent().before("<div data-role='header' data-theme='"+
-b.headerTheme+"'><div class='ui-title'>"+j+"</div></div>").after(e?a("<div>",{"data-role":"footer","data-id":e,"class":"ui-footer-duplicate"}):"").parent().attr({"data-url":i,"data-theme":o,"data-count-theme":p}).appendTo(a.mobile.pageContainer).page();h=k.find("a:first");h.length||(h=a("<a></a>").html(j).prependTo(k.empty()));h.attr("href","#"+i)}).listview()}})})(jQuery);
-(function(a){a.mobile.listview.prototype.options.filter=false;a("[data-role='listview']").live("listviewcreate",function(){var d=a(this);if(d.data("listview").options.filter){var c=a("<form>",{"class":"ui-listview-filter ui-bar-c",role:"search"});a("<input>",{placeholder:"Filter results...","data-type":"search"}).bind("keyup change",function(){var f=this.value.toLowerCase();d.children().show();f&&d.children().filter(function(){return a(this).text().toLowerCase().indexOf(f)===-1}).hide()}).appendTo(c).textinput();
-c.insertBefore(d)}})})(jQuery);
-(function(a){a.widget("mobile.dialog",a.mobile.widget,{options:{},_create:function(){this.element.attr("role","dialog").addClass("ui-page ui-dialog ui-body-a").find("[data-role=header]").addClass("ui-corner-top ui-overlay-shadow").prepend('<a href="#" data-icon="delete" data-rel="back" data-iconpos="notext">Close</a>').end().find('.ui-content:not([class*="ui-body-"])').addClass("ui-body-c").end().find(".ui-content,[data-role=footer]").last().addClass("ui-corner-bottom ui-overlay-shadow");this.element.bind("click submit",
-function(d){d=d.type=="click"?a(d.target).closest("a"):a(d.target).closest("form");d.length&&!d.data("transition")&&d.attr("data-transition",a.mobile.urlHistory.getActive().transition).attr("data-direction","reverse")})},close:function(){window.history.back()}})})(jQuery);
-(function(a,d){a.widget("mobile.navbar",a.mobile.widget,{options:{iconpos:"top",grid:null},_create:function(){var c=this.element,f=c.find("a"),b=f.filter("[data-icon]").length?this.options.iconpos:d;c.addClass("ui-navbar").attr("role","navigation").find("ul").grid({grid:this.options.grid});b||c.addClass("ui-navbar-noicons");f.buttonMarkup({corners:false,shadow:false,iconpos:b});c.delegate("a","click",function(){f.removeClass("ui-btn-active");a(this).addClass("ui-btn-active")})}})})(jQuery);
-(function(a){a.fn.grid=function(d){return this.each(function(){var c=a.extend({grid:null},d),f=a(this).children(),b={a:2,b:3,c:4,d:5};c=c.grid;if(!c)if(f.length<=5)for(var g in b){if(b[g]==f.length)c=g}else c="a";b=b[c];a(this).addClass("ui-grid-"+c);f.filter(":nth-child("+b+"n+1)").addClass("ui-block-a");f.filter(":nth-child("+b+"n+2)").addClass("ui-block-b");b>2&&f.filter(":nth-child(3n+3)").addClass("ui-block-c");b>3&&f.filter(":nth-child(4n+4)").addClass("ui-block-d");b>4&&f.filter(":nth-child(5n+5)").addClass("ui-block-e")})}})(jQuery);
--- a/js/jquery.effects.core.js
+++ /dev/null
@@ -1,748 +1,1 @@
-/*
- * jQuery UI Effects @VERSION
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Effects/
- */
-;jQuery.effects || (function($, undefined) {
-$.effects = {};
-
-
-
-/******************************************************************************/
-/****************************** COLOR ANIMATIONS ******************************/
-/******************************************************************************/
-
-// override the animation for color styles
-$.each(['backgroundColor', 'borderBottomColor', 'borderLeftColor',
- 'borderRightColor', 'borderTopColor', 'borderColor', 'color', 'outlineColor'],
-function(i, attr) {
- $.fx.step[attr] = function(fx) {
- if (!fx.colorInit) {
- fx.start = getColor(fx.elem, attr);
- fx.end = getRGB(fx.end);
- fx.colorInit = true;
- }
-
- fx.elem.style[attr] = 'rgb(' +
- Math.max(Math.min(parseInt((fx.pos * (fx.end[0] - fx.start[0])) + fx.start[0], 10), 255), 0) + ',' +
- Math.max(Math.min(parseInt((fx.pos * (fx.end[1] - fx.start[1])) + fx.start[1], 10), 255), 0) + ',' +
- Math.max(Math.min(parseInt((fx.pos * (fx.end[2] - fx.start[2])) + fx.start[2], 10), 255), 0) + ')';
- };
-});
-
-// Color Conversion functions from highlightFade
-// By Blair Mitchelmore
-// http://jquery.offput.ca/highlightFade/
-
-// Parse strings looking for color tuples [255,255,255]
-function getRGB(color) {
- var result;
-
- // Check if we're already dealing with an array of colors
- if ( color && color.constructor == Array && color.length == 3 )
- return color;
-
- // Look for rgb(num,num,num)
- if (result = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(color))
- return [parseInt(result[1],10), parseInt(result[2],10), parseInt(result[3],10)];
-
- // Look for rgb(num%,num%,num%)
- if (result = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(color))
- return [parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55];
-
- // Look for #a0b1c2
- if (result = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(color))
- return [parseInt(result[1],16), parseInt(result[2],16), parseInt(result[3],16)];
-
- // Look for #fff
- if (result = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(color))
- return [parseInt(result[1]+result[1],16), parseInt(result[2]+result[2],16), parseInt(result[3]+result[3],16)];
-
- // Look for rgba(0, 0, 0, 0) == transparent in Safari 3
- if (result = /rgba\(0, 0, 0, 0\)/.exec(color))
- return colors['transparent'];
-
- // Otherwise, we're most likely dealing with a named color
- return colors[$.trim(color).toLowerCase()];
-}
-
-function getColor(elem, attr) {
- var color;
-
- do {
- color = $.curCSS(elem, attr);
-
- // Keep going until we find an element that has color, or we hit the body
- if ( color != '' && color != 'transparent' || $.nodeName(elem, "body") )
- break;
-
- attr = "backgroundColor";
- } while ( elem = elem.parentNode );
-
- return getRGB(color);
-};
-
-// Some named colors to work with
-// From Interface by Stefan Petre
-// http://interface.eyecon.ro/
-
-var colors = {
- aqua:[0,255,255],
- azure:[240,255,255],
- beige:[245,245,220],
- black:[0,0,0],
- blue:[0,0,255],
- brown:[165,42,42],
- cyan:[0,255,255],
- darkblue:[0,0,139],
- darkcyan:[0,139,139],
- darkgrey:[169,169,169],
- darkgreen:[0,100,0],
- darkkhaki:[189,183,107],
- darkmagenta:[139,0,139],
- darkolivegreen:[85,107,47],
- darkorange:[255,140,0],
- darkorchid:[153,50,204],
- darkred:[139,0,0],
- darksalmon:[233,150,122],
- darkviolet:[148,0,211],
- fuchsia:[255,0,255],
- gold:[255,215,0],
- green:[0,128,0],
- indigo:[75,0,130],
- khaki:[240,230,140],
- lightblue:[173,216,230],
- lightcyan:[224,255,255],
- lightgreen:[144,238,144],
- lightgrey:[211,211,211],
- lightpink:[255,182,193],
- lightyellow:[255,255,224],
- lime:[0,255,0],
- magenta:[255,0,255],
- maroon:[128,0,0],
- navy:[0,0,128],
- olive:[128,128,0],
- orange:[255,165,0],
- pink:[255,192,203],
- purple:[128,0,128],
- violet:[128,0,128],
- red:[255,0,0],
- silver:[192,192,192],
- white:[255,255,255],
- yellow:[255,255,0],
- transparent: [255,255,255]
-};
-
-
-
-/******************************************************************************/
-/****************************** CLASS ANIMATIONS ******************************/
-/******************************************************************************/
-
-var classAnimationActions = ['add', 'remove', 'toggle'],
- shorthandStyles = {
- border: 1,
- borderBottom: 1,
- borderColor: 1,
- borderLeft: 1,
- borderRight: 1,
- borderTop: 1,
- borderWidth: 1,
- margin: 1,
- padding: 1
- };
-
-function getElementStyles() {
- var style = document.defaultView
- ? document.defaultView.getComputedStyle(this, null)
- : this.currentStyle,
- newStyle = {},
- key,
- camelCase;
-
- // webkit enumerates style porperties
- if (style && style.length && style[0] && style[style[0]]) {
- var len = style.length;
- while (len--) {
- key = style[len];
- if (typeof style[key] == 'string') {
- camelCase = key.replace(/\-(\w)/g, function(all, letter){
- return letter.toUpperCase();
- });
- newStyle[camelCase] = style[key];
- }
- }
- } else {
- for (key in style) {
- if (typeof style[key] === 'string') {
- newStyle[key] = style[key];
- }
- }
- }
-
- return newStyle;
-}
-
-function filterStyles(styles) {
- var name, value;
- for (name in styles) {
- value = styles[name];
- if (
- // ignore null and undefined values
- value == null ||
- // ignore functions (when does this occur?)
- $.isFunction(value) ||
- // shorthand styles that need to be expanded
- name in shorthandStyles ||
- // ignore scrollbars (break in IE)
- (/scrollbar/).test(name) ||
-
- // only colors or values that can be converted to numbers
- (!(/color/i).test(name) && isNaN(parseFloat(value)))
- ) {
- delete styles[name];
- }
- }
-
- return styles;
-}
-
-function styleDifference(oldStyle, newStyle) {
- var diff = { _: 0 }, // http://dev.jquery.com/ticket/5459
- name;
-
- for (name in newStyle) {
- if (oldStyle[name] != newStyle[name]) {
- diff[name] = newStyle[name];
- }
- }
-
- return diff;
-}
-
-$.effects.animateClass = function(value, duration, easing, callback) {
- if ($.isFunction(easing)) {
- callback = easing;
- easing = null;
- }
-
- return this.queue('fx', function() {
- var that = $(this),
- originalStyleAttr = that.attr('style') || ' ',
- originalStyle = filterStyles(getElementStyles.call(this)),
- newStyle,
- className = that.attr('className');
-
- $.each(classAnimationActions, function(i, action) {
- if (value[action]) {
- that[action + 'Class'](value[action]);
- }
- });
- newStyle = filterStyles(getElementStyles.call(this));
- that.attr('className', className);
-
- that.animate(styleDifference(originalStyle, newStyle), duration, easing, function() {
- $.each(classAnimationActions, function(i, action) {
- if (value[action]) { that[action + 'Class'](value[action]); }
- });
- // work around bug in IE by clearing the cssText before setting it
- if (typeof that.attr('style') == 'object') {
- that.attr('style').cssText = '';
- that.attr('style').cssText = originalStyleAttr;
- } else {
- that.attr('style', originalStyleAttr);
- }
- if (callback) { callback.apply(this, arguments); }
- });
-
- // $.animate adds a function to the end of the queue
- // but we want it at the front
- var queue = $.queue(this),
- anim = queue.splice(queue.length - 1, 1)[0];
- queue.splice(1, 0, anim);
- $.dequeue(this);
- });
-};
-
-$.fn.extend({
- _addClass: $.fn.addClass,
- addClass: function(classNames, speed, easing, callback) {
- return speed ? $.effects.animateClass.apply(this, [{ add: classNames },speed,easing,callback]) : this._addClass(classNames);
- },
-
- _removeClass: $.fn.removeClass,
- removeClass: function(classNames,speed,easing,callback) {
- return speed ? $.effects.animateClass.apply(this, [{ remove: classNames },speed,easing,callback]) : this._removeClass(classNames);
- },
-
- _toggleClass: $.fn.toggleClass,
- toggleClass: function(classNames, force, speed, easing, callback) {
- if ( typeof force == "boolean" || force === undefined ) {
- if ( !speed ) {
- // without speed parameter;
- return this._toggleClass(classNames, force);
- } else {
- return $.effects.animateClass.apply(this, [(force?{add:classNames}:{remove:classNames}),speed,easing,callback]);
- }
- } else {
- // without switch parameter;
- return $.effects.animateClass.apply(this, [{ toggle: classNames },force,speed,easing]);
- }
- },
-
- switchClass: function(remove,add,speed,easing,callback) {
- return $.effects.animateClass.apply(this, [{ add: add, remove: remove },speed,easing,callback]);
- }
-});
-
-
-
-/******************************************************************************/
-/*********************************** EFFECTS **********************************/
-/******************************************************************************/
-
-$.extend($.effects, {
- version: "@VERSION",
-
- // Saves a set of properties in a data storage
- save: function(element, set) {
- for(var i=0; i < set.length; i++) {
- if(set[i] !== null) element.data("ec.storage."+set[i], element[0].style[set[i]]);
- }
- },
-
- // Restores a set of previously saved properties from a data storage
- restore: function(element, set) {
- for(var i=0; i < set.length; i++) {
- if(set[i] !== null) element.css(set[i], element.data("ec.storage."+set[i]));
- }
- },
-
- setMode: function(el, mode) {
- if (mode == 'toggle') mode = el.is(':hidden') ? 'show' : 'hide'; // Set for toggle
- return mode;
- },
-
- getBaseline: function(origin, original) { // Translates a [top,left] array into a baseline value
- // this should be a little more flexible in the future to handle a string & hash
- var y, x;
- switch (origin[0]) {
- case 'top': y = 0; break;
- case 'middle': y = 0.5; break;
- case 'bottom': y = 1; break;
- default: y = origin[0] / original.height;
- };
- switch (origin[1]) {
- case 'left': x = 0; break;
- case 'center': x = 0.5; break;
- case 'right': x = 1; break;
- default: x = origin[1] / original.width;
- };
- return {x: x, y: y};
- },
-
- // Wraps the element around a wrapper that copies position properties
- createWrapper: function(element) {
-
- // if the element is already wrapped, return it
- if (element.parent().is('.ui-effects-wrapper')) {
- return element.parent();
- }
-
- // wrap the element
- var props = {
- width: element.outerWidth(true),
- height: element.outerHeight(true),
- 'float': element.css('float')
- },
- wrapper = $('<div></div>')
- .addClass('ui-effects-wrapper')
- .css({
- fontSize: '100%',
- background: 'transparent',
- border: 'none',
- margin: 0,
- padding: 0
- });
-
- element.wrap(wrapper);
- wrapper = element.parent(); //Hotfix for jQuery 1.4 since some change in wrap() seems to actually loose the reference to the wrapped element
-
- // transfer positioning properties to the wrapper
- if (element.css('position') == 'static') {
- wrapper.css({ position: 'relative' });
- element.css({ position: 'relative' });
- } else {
- $.extend(props, {
- position: element.css('position'),
- zIndex: element.css('z-index')
- });
- $.each(['top', 'left', 'bottom', 'right'], function(i, pos) {
- props[pos] = element.css(pos);
- if (isNaN(parseInt(props[pos], 10))) {
- props[pos] = 'auto';
- }
- });
- element.css({position: 'relative', top: 0, left: 0, right: 'auto', bottom: 'auto' });
- }
-
- return wrapper.css(props).show();
- },
-
- removeWrapper: function(element) {
- if (element.parent().is('.ui-effects-wrapper'))
- return element.parent().replaceWith(element);
- return element;
- },
-
- setTransition: function(element, list, factor, value) {
- value = value || {};
- $.each(list, function(i, x){
- unit = element.cssUnit(x);
- if (unit[0] > 0) value[x] = unit[0] * factor + unit[1];
- });
- return value;
- }
-});
-
-
-function _normalizeArguments(effect, options, speed, callback) {
- // shift params for method overloading
- if (typeof effect == 'object') {
- callback = options;
- speed = null;
- options = effect;
- effect = options.effect;
- }
- if ($.isFunction(options)) {
- callback = options;
- speed = null;
- options = {};
- }
- if (typeof options == 'number' || $.fx.speeds[options]) {
- callback = speed;
- speed = options;
- options = {};
- }
- if ($.isFunction(speed)) {
- callback = speed;
- speed = null;
- }
-
- options = options || {};
-
- speed = speed || options.duration;
- speed = $.fx.off ? 0 : typeof speed == 'number'
- ? speed : speed in $.fx.speeds ? $.fx.speeds[speed] : $.fx.speeds._default;
-
- callback = callback || options.complete;
-
- return [effect, options, speed, callback];
-}
-
-function standardSpeed( speed ) {
- // valid standard speeds
- if ( !speed || typeof speed === "number" || $.fx.speeds[ speed ] ) {
- return true;
- }
-
- // invalid strings - treat as "normal" speed
- if ( typeof speed === "string" && !$.effects[ speed ] ) {
- return true;
- }
-
- return false;
-}
-
-$.fn.extend({
- effect: function(effect, options, speed, callback) {
- var args = _normalizeArguments.apply(this, arguments),
- // TODO: make effects take actual parameters instead of a hash
- args2 = {
- options: args[1],
- duration: args[2],
- callback: args[3]
- },
- mode = args2.options.mode,
- effectMethod = $.effects[effect];
-
- if ( $.fx.off || !effectMethod ) {
- // delegate to the original method (e.g., .show()) if possible
- if ( mode ) {
- return this[ mode ]( args2.duration, args2.callback );
- } else {
- return this.each(function() {
- if ( args2.callback ) {
- args2.callback.call( this );
- }
- });
- }
- }
-
- return effectMethod.call(this, args2);
- },
-
- _show: $.fn.show,
- show: function(speed) {
- if ( standardSpeed( speed ) ) {
- return this._show.apply(this, arguments);
- } else {
- var args = _normalizeArguments.apply(this, arguments);
- args[1].mode = 'show';
- return this.effect.apply(this, args);
- }
- },
-
- _hide: $.fn.hide,
- hide: function(speed) {
- if ( standardSpeed( speed ) ) {
- return this._hide.apply(this, arguments);
- } else {
- var args = _normalizeArguments.apply(this, arguments);
- args[1].mode = 'hide';
- return this.effect.apply(this, args);
- }
- },
-
- // jQuery core overloads toggle and creates _toggle
- __toggle: $.fn.toggle,
- toggle: function(speed) {
- if ( standardSpeed( speed ) || typeof speed === "boolean" || $.isFunction( speed ) ) {
- return this.__toggle.apply(this, arguments);
- } else {
- var args = _normalizeArguments.apply(this, arguments);
- args[1].mode = 'toggle';
- return this.effect.apply(this, args);
- }
- },
-
- // helper functions
- cssUnit: function(key) {
- var style = this.css(key), val = [];
- $.each( ['em','px','%','pt'], function(i, unit){
- if(style.indexOf(unit) > 0)
- val = [parseFloat(style), unit];
- });
- return val;
- }
-});
-
-
-
-/******************************************************************************/
-/*********************************** EASING ***********************************/
-/******************************************************************************/
-
-/*
- * jQuery Easing v1.3 - http://gsgd.co.uk/sandbox/jquery/easing/
- *
- * Uses the built in easing capabilities added In jQuery 1.1
- * to offer multiple easing options
- *
- * TERMS OF USE - jQuery Easing
- *
- * Open source under the BSD License.
- *
- * Copyright 2008 George McGinley Smith
- * All rights reserved.
- *
- * Redistribution and use in source and binary forms, with or without modification,
- * are permitted provided that the following conditions are met:
- *
- * Redistributions of source code must retain the above copyright notice, this list of
- * conditions and the following disclaimer.
- * Redistributions in binary form must reproduce the above copyright notice, this list
- * of conditions and the following disclaimer in the documentation and/or other materials
- * provided with the distribution.
- *
- * Neither the name of the author nor the names of contributors may be used to endorse
- * or promote products derived from this software without specific prior written permission.
- *
- * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY
- * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
- * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
- * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
- * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
- * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED
- * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
- * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
- * OF THE POSSIBILITY OF SUCH DAMAGE.
- *
-*/
-
-// t: current time, b: begInnIng value, c: change In value, d: duration
-$.easing.jswing = $.easing.swing;
-
-$.extend($.easing,
-{
- def: 'easeOutQuad',
- swing: function (x, t, b, c, d) {
- //alert($.easing.default);
- return $.easing[$.easing.def](x, t, b, c, d);
- },
- easeInQuad: function (x, t, b, c, d) {
- return c*(t/=d)*t + b;
- },
- easeOutQuad: function (x, t, b, c, d) {
- return -c *(t/=d)*(t-2) + b;
- },
- easeInOutQuad: function (x, t, b, c, d) {
- if ((t/=d/2) < 1) return c/2*t*t + b;
- return -c/2 * ((--t)*(t-2) - 1) + b;
- },
- easeInCubic: function (x, t, b, c, d) {
- return c*(t/=d)*t*t + b;
- },
- easeOutCubic: function (x, t, b, c, d) {
- return c*((t=t/d-1)*t*t + 1) + b;
- },
- easeInOutCubic: function (x, t, b, c, d) {
- if ((t/=d/2) < 1) return c/2*t*t*t + b;
- return c/2*((t-=2)*t*t + 2) + b;
- },
- easeInQuart: function (x, t, b, c, d) {
- return c*(t/=d)*t*t*t + b;
- },
- easeOutQuart: function (x, t, b, c, d) {
- return -c * ((t=t/d-1)*t*t*t - 1) + b;
- },
- easeInOutQuart: function (x, t, b, c, d) {
- if ((t/=d/2) < 1) return c/2*t*t*t*t + b;
- return -c/2 * ((t-=2)*t*t*t - 2) + b;
- },
- easeInQuint: function (x, t, b, c, d) {
- return c*(t/=d)*t*t*t*t + b;
- },
- easeOutQuint: function (x, t, b, c, d) {
- return c*((t=t/d-1)*t*t*t*t + 1) + b;
- },
- easeInOutQuint: function (x, t, b, c, d) {
- if ((t/=d/2) < 1) return c/2*t*t*t*t*t + b;
- return c/2*((t-=2)*t*t*t*t + 2) + b;
- },
- easeInSine: function (x, t, b, c, d) {
- return -c * Math.cos(t/d * (Math.PI/2)) + c + b;
- },
- easeOutSine: function (x, t, b, c, d) {
- return c * Math.sin(t/d * (Math.PI/2)) + b;
- },
- easeInOutSine: function (x, t, b, c, d) {
- return -c/2 * (Math.cos(Math.PI*t/d) - 1) + b;
- },
- easeInExpo: function (x, t, b, c, d) {
- return (t==0) ? b : c * Math.pow(2, 10 * (t/d - 1)) + b;
- },
- easeOutExpo: function (x, t, b, c, d) {
- return (t==d) ? b+c : c * (-Math.pow(2, -10 * t/d) + 1) + b;
- },
- easeInOutExpo: function (x, t, b, c, d) {
- if (t==0) return b;
- if (t==d) return b+c;
- if ((t/=d/2) < 1) return c/2 * Math.pow(2, 10 * (t - 1)) + b;
- return c/2 * (-Math.pow(2, -10 * --t) + 2) + b;
- },
- easeInCirc: function (x, t, b, c, d) {
- return -c * (Math.sqrt(1 - (t/=d)*t) - 1) + b;
- },
- easeOutCirc: function (x, t, b, c, d) {
- return c * Math.sqrt(1 - (t=t/d-1)*t) + b;
- },
- easeInOutCirc: function (x, t, b, c, d) {
- if ((t/=d/2) < 1) return -c/2 * (Math.sqrt(1 - t*t) - 1) + b;
- return c/2 * (Math.sqrt(1 - (t-=2)*t) + 1) + b;
- },
- easeInElastic: function (x, t, b, c, d) {
- var s=1.70158;var p=0;var a=c;
- if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3;
- if (a < Math.abs(c)) { a=c; var s=p/4; }
- else var s = p/(2*Math.PI) * Math.asin (c/a);
- return -(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
- },
- easeOutElastic: function (x, t, b, c, d) {
- var s=1.70158;var p=0;var a=c;
- if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3;
- if (a < Math.abs(c)) { a=c; var s=p/4; }
- else var s = p/(2*Math.PI) * Math.asin (c/a);
- return a*Math.pow(2,-10*t) * Math.sin( (t*d-s)*(2*Math.PI)/p ) + c + b;
- },
- easeInOutElastic: function (x, t, b, c, d) {
- var s=1.70158;var p=0;var a=c;
- if (t==0) return b; if ((t/=d/2)==2) return b+c; if (!p) p=d*(.3*1.5);
- if (a < Math.abs(c)) { a=c; var s=p/4; }
- else var s = p/(2*Math.PI) * Math.asin (c/a);
- if (t < 1) return -.5*(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
- return a*Math.pow(2,-10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )*.5 + c + b;
- },
- easeInBack: function (x, t, b, c, d, s) {
- if (s == undefined) s = 1.70158;
- return c*(t/=d)*t*((s+1)*t - s) + b;
- },
- easeOutBack: function (x, t, b, c, d, s) {
- if (s == undefined) s = 1.70158;
- return c*((t=t/d-1)*t*((s+1)*t + s) + 1) + b;
- },
- easeInOutBack: function (x, t, b, c, d, s) {
- if (s == undefined) s = 1.70158;
- if ((t/=d/2) < 1) return c/2*(t*t*(((s*=(1.525))+1)*t - s)) + b;
- return c/2*((t-=2)*t*(((s*=(1.525))+1)*t + s) + 2) + b;
- },
- easeInBounce: function (x, t, b, c, d) {
- return c - $.easing.easeOutBounce (x, d-t, 0, c, d) + b;
- },
- easeOutBounce: function (x, t, b, c, d) {
- if ((t/=d) < (1/2.75)) {
- return c*(7.5625*t*t) + b;
- } else if (t < (2/2.75)) {
- return c*(7.5625*(t-=(1.5/2.75))*t + .75) + b;
- } else if (t < (2.5/2.75)) {
- return c*(7.5625*(t-=(2.25/2.75))*t + .9375) + b;
- } else {
- return c*(7.5625*(t-=(2.625/2.75))*t + .984375) + b;
- }
- },
- easeInOutBounce: function (x, t, b, c, d) {
- if (t < d/2) return $.easing.easeInBounce (x, t*2, 0, c, d) * .5 + b;
- return $.easing.easeOutBounce (x, t*2-d, 0, c, d) * .5 + c*.5 + b;
- }
-});
-
-/*
- *
- * TERMS OF USE - EASING EQUATIONS
- *
- * Open source under the BSD License.
- *
- * Copyright 2001 Robert Penner
- * All rights reserved.
- *
- * Redistribution and use in source and binary forms, with or without modification,
- * are permitted provided that the following conditions are met:
- *
- * Redistributions of source code must retain the above copyright notice, this list of
- * conditions and the following disclaimer.
- * Redistributions in binary form must reproduce the above copyright notice, this list
- * of conditions and the following disclaimer in the documentation and/or other materials
- * provided with the distribution.
- *
- * Neither the name of the author nor the names of contributors may be used to endorse
- * or promote products derived from this software without specific prior written permission.
- *
- * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY
- * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
- * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
- * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
- * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
- * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED
- * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
- * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
- * OF THE POSSIBILITY OF SUCH DAMAGE.
- *
- */
-
-})(jQuery);
-
--- a/js/jquery.ui.autocomplete.js
+++ /dev/null
@@ -1,426 +1,1 @@
-/*
- * jQuery UI Autocomplete @VERSION
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Autocomplete
- *
- * Depends:
- * jquery.ui.core.js
- * jquery.ui.widget.js
- * jquery.ui.position.js
- * jquery.ui.menu.js
- */
-(function( $, undefined ) {
-// used to prevent race conditions with remote data sources
-var requestIndex = 0;
-
-$.widget( "ui.autocomplete", {
- defaultElement: "<input>",
- options: {
- appendTo: "body",
- delay: 300,
- minLength: 1,
- position: {
- my: "left top",
- at: "left bottom",
- collision: "none"
- },
- source: null
- },
-
- pending: 0,
-
- _create: function() {
- var self = this,
- doc = this.element[ 0 ].ownerDocument,
- suppressKeyPress;
-
- this.element
- .addClass( "ui-autocomplete-input" )
- .attr( "autocomplete", "off" )
- // TODO verify these actually work as intended
- .attr({
- role: "textbox",
- "aria-autocomplete": "list",
- "aria-haspopup": "true"
- })
- .bind( "keydown.autocomplete", function( event ) {
- if ( self.options.disabled || self.element.attr( "readonly" ) ) {
- return;
- }
-
- suppressKeyPress = false;
- var keyCode = $.ui.keyCode;
- switch( event.keyCode ) {
- case keyCode.PAGE_UP:
- self._move( "previousPage", event );
- break;
- case keyCode.PAGE_DOWN:
- self._move( "nextPage", event );
- break;
- case keyCode.UP:
- self._move( "previous", event );
- // prevent moving cursor to beginning of text field in some browsers
- event.preventDefault();
- break;
- case keyCode.DOWN:
- self._move( "next", event );
- // prevent moving cursor to end of text field in some browsers
- event.preventDefault();
- break;
- case keyCode.ENTER:
- case keyCode.NUMPAD_ENTER:
- // when menu is open and has focus
- if ( self.menu.active ) {
- // #6055 - Opera still allows the keypress to occur
- // which causes forms to submit
- suppressKeyPress = true;
- event.preventDefault();
- }
- //passthrough - ENTER and TAB both select the current element
- case keyCode.TAB:
- if ( !self.menu.active ) {
- return;
- }
- self.menu.select( event );
- break;
- case keyCode.ESCAPE:
- self.element.val( self.term );
- self.close( event );
- break;
- default:
- // keypress is triggered before the input value is changed
- clearTimeout( self.searching );
- self.searching = setTimeout(function() {
- // only search if the value has changed
- if ( self.term != self.element.val() ) {
- self.selectedItem = null;
- self.search( null, event );
- }
- }, self.options.delay );
- break;
- }
- })
- .bind( "keypress.autocomplete", function( event ) {
- if ( suppressKeyPress ) {
- suppressKeyPress = false;
- event.preventDefault();
- }
- })
- .bind( "focus.autocomplete", function() {
- if ( self.options.disabled ) {
- return;
- }
-
- self.selectedItem = null;
- self.previous = self.element.val();
- })
- .bind( "blur.autocomplete", function( event ) {
- if ( self.options.disabled ) {
- return;
- }
-
- clearTimeout( self.searching );
- // clicks on the menu (or a button to trigger a search) will cause a blur event
- self.closing = setTimeout(function() {
- self.close( event );
- self._change( event );
- }, 150 );
- });
- this._initSource();
- this.response = function() {
- return self._response.apply( self, arguments );
- };
- this.menu = $( "<ul></ul>" )
- .addClass( "ui-autocomplete" )
- .appendTo( $( this.options.appendTo || "body", doc )[0] )
- // prevent the close-on-blur in case of a "slow" click on the menu (long mousedown)
- .mousedown(function( event ) {
- // clicking on the scrollbar causes focus to shift to the body
- // but we can't detect a mouseup or a click immediately afterward
- // so we have to track the next mousedown and close the menu if
- // the user clicks somewhere outside of the autocomplete
- var menuElement = self.menu.element[ 0 ];
- if ( !$( event.target ).closest( ".ui-menu-item" ).length ) {
- setTimeout(function() {
- $( document ).one( 'mousedown', function( event ) {
- if ( event.target !== self.element[ 0 ] &&
- event.target !== menuElement &&
- !$.contains( menuElement, event.target ) ) {
- self.close();
- }
- });
- }, 1 );
- }
-
- // use another timeout to make sure the blur-event-handler on the input was already triggered
- setTimeout(function() {
- clearTimeout( self.closing );
- }, 13);
- })
- .menu({
- // custom key handling for now
- input: $(),
- focus: function( event, ui ) {
- var item = ui.item.data( "item.autocomplete" );
- if ( false !== self._trigger( "focus", event, { item: item } ) ) {
- // use value to match what will end up in the input, if it was a key event
- if ( /^key/.test(event.originalEvent.type) ) {
- self.element.val( item.value );
- }
- }
- },
- select: function( event, ui ) {
- var item = ui.item.data( "item.autocomplete" ),
- previous = self.previous;
-
- // only trigger when focus was lost (click on menu)
- if ( self.element[0] !== doc.activeElement ) {
- self.element.focus();
- self.previous = previous;
- // #6109 - IE triggers two focus events and the second
- // is asynchronous, so we need to reset the previous
- // term synchronously and asynchronously :-(
- setTimeout(function() {
- self.previous = previous;
- self.selectedItem = item;
- }, 1);
- }
-
- if ( false !== self._trigger( "select", event, { item: item } ) ) {
- self.element.val( item.value );
- }
- // reset the term after the select event
- // this allows custom select handling to work properly
- self.term = self.element.val();
-
- self.close( event );
- self.selectedItem = item;
- },
- blur: function( event, ui ) {
- // don't set the value of the text field if it's already correct
- // this prevents moving the cursor unnecessarily
- if ( self.menu.element.is(":visible") &&
- ( self.element.val() !== self.term ) ) {
- self.element.val( self.term );
- }
- }
- })
- .zIndex( this.element.zIndex() + 1 )
- .hide()
- .data( "menu" );
- if ( $.fn.bgiframe ) {
- this.menu.element.bgiframe();
- }
- },
-
- _destroy: function() {
- this.element
- .removeClass( "ui-autocomplete-input" )
- .removeAttr( "autocomplete" )
- .removeAttr( "role" )
- .removeAttr( "aria-autocomplete" )
- .removeAttr( "aria-haspopup" );
- this.menu.element.remove();
- },
-
- _setOption: function( key, value ) {
- this._super( "_setOption", key, value );
- if ( key === "source" ) {
- this._initSource();
- }
- if ( key === "appendTo" ) {
- this.menu.element.appendTo( $( value || "body", this.element[0].ownerDocument )[0] )
- }
- if ( key === "disabled" && value && this.xhr ) {
- this.xhr.abort();
- }
- },
-
- _initSource: function() {
- var self = this,
- array,
- url;
- if ( $.isArray(this.options.source) ) {
- array = this.options.source;
- this.source = function( request, response ) {
- response( $.ui.autocomplete.filter(array, request.term) );
- };
- } else if ( typeof this.options.source === "string" ) {
- url = this.options.source;
- this.source = function( request, response ) {
- if ( self.xhr ) {
- self.xhr.abort();
- }
- self.xhr = $.ajax({
- url: url,
- data: request,
- dataType: "json",
- autocompleteRequest: ++requestIndex,
- success: function( data, status ) {
- if ( this.autocompleteRequest === requestIndex ) {
- response( data );
- }
- },
- error: function() {
- if ( this.autocompleteRequest === requestIndex ) {
- response( [] );
- }
- }
- });
- };
- } else {
- this.source = this.options.source;
- }
- },
-
- search: function( value, event ) {
- value = value != null ? value : this.element.val();
-
- // always save the actual value, not the one passed as an argument
- this.term = this.element.val();
-
- if ( value.length < this.options.minLength ) {
- return this.close( event );
- }
-
- clearTimeout( this.closing );
- if ( this._trigger( "search", event ) === false ) {
- return;
- }
-
- return this._search( value );
- },
-
- _search: function( value ) {
- this.pending++;
- this.element.addClass( "ui-autocomplete-loading" );
-
- this.source( { term: value }, this.response );
- },
-
- _response: function( content ) {
- if ( !this.options.disabled && content && content.length ) {
- content = this._normalize( content );
- this._suggest( content );
- this._trigger( "open" );
- } else {
- this.close();
- }
- this.pending--;
- if ( !this.pending ) {
- this.element.removeClass( "ui-autocomplete-loading" );
- }
- },
-
- close: function( event ) {
- clearTimeout( this.closing );
- if ( this.menu.element.is(":visible") ) {
- this.menu.element.hide();
- this.menu.deactivate();
- this._trigger( "close", event );
- }
- },
-
- _change: function( event ) {
- if ( this.previous !== this.element.val() ) {
- this._trigger( "change", event, { item: this.selectedItem } );
- }
- },
-
- _normalize: function( items ) {
- // assume all items have the right format when the first item is complete
- if ( items.length && items[0].label && items[0].value ) {
- return items;
- }
- return $.map( items, function(item) {
- if ( typeof item === "string" ) {
- return {
- label: item,
- value: item
- };
- }
- return $.extend({
- label: item.label || item.value,
- value: item.value || item.label
- }, item );
- });
- },
-
- _suggest: function( items ) {
- var ul = this.menu.element
- .empty()
- .zIndex( this.element.zIndex() + 1 );
- this._renderMenu( ul, items );
- // TODO refresh should check if the active item is still in the dom, removing the need for a manual deactivate
- this.menu.deactivate();
- this.menu.refresh();
-
- // size and position menu
- ul.show();
- this._resizeMenu();
- ul.position( $.extend({
- of: this.element
- }, this.options.position ));
- },
-
- _resizeMenu: function() {
- var ul = this.menu.element;
- ul.outerWidth( Math.max(
- ul.width( "" ).outerWidth(),
- this.element.outerWidth()
- ) );
- },
-
- _renderMenu: function( ul, items ) {
- var self = this;
- $.each( items, function( index, item ) {
- self._renderItem( ul, item );
- });
- },
-
- _renderItem: function( ul, item) {
- return $( "<li></li>" )
- .data( "item.autocomplete", item )
- .append( $( "<a></a>" ).text( item.label ) )
- .appendTo( ul );
- },
-
- _move: function( direction, event ) {
- if ( !this.menu.element.is(":visible") ) {
- this.search( null, event );
- return;
- }
- if ( this.menu.first() && /^previous/.test(direction) ||
- this.menu.last() && /^next/.test(direction) ) {
- this.element.val( this.term );
- this.menu.deactivate();
- return;
- }
- this.menu[ direction ]( event );
- },
-
- widget: function() {
- return this.menu.element;
- }
-});
-
-$.extend( $.ui.autocomplete, {
- version: "@VERSION",
- escapeRegex: function( value ) {
- return value.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, "\\$&");
- },
- filter: function(array, term) {
- var matcher = new RegExp( $.ui.autocomplete.escapeRegex(term), "i" );
- return $.grep( array, function(value) {
- return matcher.test( value.label || value.value || value );
- });
- }
-});
-
-}( jQuery ));
-
--- /dev/null
+++ b/js/jquery.ui.autocomplete.min.js
@@ -1,1 +1,33 @@
+/*
+ * jQuery UI Autocomplete 1.8.12
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Autocomplete
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ * jquery.ui.position.js
+ */
+(function(d){var e=0;d.widget("ui.autocomplete",{options:{appendTo:"body",autoFocus:false,delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},pending:0,_create:function(){var a=this,b=this.element[0].ownerDocument,g;this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(c){if(!(a.options.disabled||a.element.attr("readonly"))){g=
+false;var f=d.ui.keyCode;switch(c.keyCode){case f.PAGE_UP:a._move("previousPage",c);break;case f.PAGE_DOWN:a._move("nextPage",c);break;case f.UP:a._move("previous",c);c.preventDefault();break;case f.DOWN:a._move("next",c);c.preventDefault();break;case f.ENTER:case f.NUMPAD_ENTER:if(a.menu.active){g=true;c.preventDefault()}case f.TAB:if(!a.menu.active)return;a.menu.select(c);break;case f.ESCAPE:a.element.val(a.term);a.close(c);break;default:clearTimeout(a.searching);a.searching=setTimeout(function(){if(a.term!=
+a.element.val()){a.selectedItem=null;a.search(null,c)}},a.options.delay);break}}}).bind("keypress.autocomplete",function(c){if(g){g=false;c.preventDefault()}}).bind("focus.autocomplete",function(){if(!a.options.disabled){a.selectedItem=null;a.previous=a.element.val()}}).bind("blur.autocomplete",function(c){if(!a.options.disabled){clearTimeout(a.searching);a.closing=setTimeout(function(){a.close(c);a._change(c)},150)}});this._initSource();this.response=function(){return a._response.apply(a,arguments)};
+this.menu=d("<ul></ul>").addClass("ui-autocomplete").appendTo(d(this.options.appendTo||"body",b)[0]).mousedown(function(c){var f=a.menu.element[0];d(c.target).closest(".ui-menu-item").length||setTimeout(function(){d(document).one("mousedown",function(h){h.target!==a.element[0]&&h.target!==f&&!d.ui.contains(f,h.target)&&a.close()})},1);setTimeout(function(){clearTimeout(a.closing)},13)}).menu({focus:function(c,f){f=f.item.data("item.autocomplete");false!==a._trigger("focus",c,{item:f})&&/^key/.test(c.originalEvent.type)&&
+a.element.val(f.value)},selected:function(c,f){var h=f.item.data("item.autocomplete"),i=a.previous;if(a.element[0]!==b.activeElement){a.element.focus();a.previous=i;setTimeout(function(){a.previous=i;a.selectedItem=h},1)}false!==a._trigger("select",c,{item:h})&&a.element.val(h.value);a.term=a.element.val();a.close(c);a.selectedItem=h},blur:function(){a.menu.element.is(":visible")&&a.element.val()!==a.term&&a.element.val(a.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu");
+d.fn.bgiframe&&this.menu.element.bgiframe()},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup");this.menu.element.remove();d.Widget.prototype.destroy.call(this)},_setOption:function(a,b){d.Widget.prototype._setOption.apply(this,arguments);a==="source"&&this._initSource();if(a==="appendTo")this.menu.element.appendTo(d(b||"body",this.element[0].ownerDocument)[0]);a==="disabled"&&
+b&&this.xhr&&this.xhr.abort()},_initSource:function(){var a=this,b,g;if(d.isArray(this.options.source)){b=this.options.source;this.source=function(c,f){f(d.ui.autocomplete.filter(b,c.term))}}else if(typeof this.options.source==="string"){g=this.options.source;this.source=function(c,f){a.xhr&&a.xhr.abort();a.xhr=d.ajax({url:g,data:c,dataType:"json",autocompleteRequest:++e,success:function(h){this.autocompleteRequest===e&&f(h)},error:function(){this.autocompleteRequest===e&&f([])}})}}else this.source=
+this.options.source},search:function(a,b){a=a!=null?a:this.element.val();this.term=this.element.val();if(a.length<this.options.minLength)return this.close(b);clearTimeout(this.closing);if(this._trigger("search",b)!==false)return this._search(a)},_search:function(a){this.pending++;this.element.addClass("ui-autocomplete-loading");this.source({term:a},this.response)},_response:function(a){if(!this.options.disabled&&a&&a.length){a=this._normalize(a);this._suggest(a);this._trigger("open")}else this.close();
+this.pending--;this.pending||this.element.removeClass("ui-autocomplete-loading")},close:function(a){clearTimeout(this.closing);if(this.menu.element.is(":visible")){this.menu.element.hide();this.menu.deactivate();this._trigger("close",a)}},_change:function(a){this.previous!==this.element.val()&&this._trigger("change",a,{item:this.selectedItem})},_normalize:function(a){if(a.length&&a[0].label&&a[0].value)return a;return d.map(a,function(b){if(typeof b==="string")return{label:b,value:b};return d.extend({label:b.label||
+b.value,value:b.value||b.label},b)})},_suggest:function(a){var b=this.menu.element.empty().zIndex(this.element.zIndex()+1);this._renderMenu(b,a);this.menu.deactivate();this.menu.refresh();b.show();this._resizeMenu();b.position(d.extend({of:this.element},this.options.position));this.options.autoFocus&&this.menu.next(new d.Event("mouseover"))},_resizeMenu:function(){var a=this.menu.element;a.outerWidth(Math.max(a.width("").outerWidth(),this.element.outerWidth()))},_renderMenu:function(a,b){var g=this;
+d.each(b,function(c,f){g._renderItem(a,f)})},_renderItem:function(a,b){return d("<li></li>").data("item.autocomplete",b).append(d("<a></a>").text(b.label)).appendTo(a)},_move:function(a,b){if(this.menu.element.is(":visible"))if(this.menu.first()&&/^previous/.test(a)||this.menu.last()&&/^next/.test(a)){this.element.val(this.term);this.menu.deactivate()}else this.menu[a](b);else this.search(null,b)},widget:function(){return this.menu.element}});d.extend(d.ui.autocomplete,{escapeRegex:function(a){return a.replace(/[-[\]{}()*+?.,\\^$|#\s]/g,
+"\\$&")},filter:function(a,b){var g=new RegExp(d.ui.autocomplete.escapeRegex(b),"i");return d.grep(a,function(c){return g.test(c.label||c.value||c)})}})})(jQuery);
+(function(d){d.widget("ui.menu",{_create:function(){var e=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(a){if(d(a.target).closest(".ui-menu-item a").length){a.preventDefault();e.select(a)}});this.refresh()},refresh:function(){var e=this;this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem").children("a").addClass("ui-corner-all").attr("tabindex",
+-1).mouseenter(function(a){e.activate(a,d(this).parent())}).mouseleave(function(){e.deactivate()})},activate:function(e,a){this.deactivate();if(this.hasScroll()){var b=a.offset().top-this.element.offset().top,g=this.element.attr("scrollTop"),c=this.element.height();if(b<0)this.element.attr("scrollTop",g+b);else b>=c&&this.element.attr("scrollTop",g+b-c+a.height())}this.active=a.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end();this._trigger("focus",e,{item:a})},
+deactivate:function(){if(this.active){this.active.children("a").removeClass("ui-state-hover").removeAttr("id");this._trigger("blur");this.active=null}},next:function(e){this.move("next",".ui-menu-item:first",e)},previous:function(e){this.move("prev",".ui-menu-item:last",e)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(e,a,b){if(this.active){e=this.active[e+"All"](".ui-menu-item").eq(0);
+e.length?this.activate(b,e):this.activate(b,this.element.children(a))}else this.activate(b,this.element.children(a))},nextPage:function(e){if(this.hasScroll())if(!this.active||this.last())this.activate(e,this.element.children(".ui-menu-item:first"));else{var a=this.active.offset().top,b=this.element.height(),g=this.element.children(".ui-menu-item").filter(function(){var c=d(this).offset().top-a-b+d(this).height();return c<10&&c>-10});g.length||(g=this.element.children(".ui-menu-item:last"));this.activate(e,
+g)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active||this.last()?":first":":last"))},previousPage:function(e){if(this.hasScroll())if(!this.active||this.first())this.activate(e,this.element.children(".ui-menu-item:last"));else{var a=this.active.offset().top,b=this.element.height();result=this.element.children(".ui-menu-item").filter(function(){var g=d(this).offset().top-a+b-d(this).height();return g<10&&g>-10});result.length||(result=this.element.children(".ui-menu-item:first"));
+this.activate(e,result)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active||this.first()?":last":":first"))},hasScroll:function(){return this.element.height()<this.element.attr("scrollHeight")},select:function(e){this._trigger("selected",e,{item:this.active})}})})(jQuery);
--- /dev/null
+++ b/js/jquery.ui.core.min.js
@@ -1,1 +1,18 @@
+/*!
+ * jQuery UI 1.8.12
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI
+ */
+(function(c,j){function k(a){return!c(a).parents().andSelf().filter(function(){return c.curCSS(this,"visibility")==="hidden"||c.expr.filters.hidden(this)}).length}c.ui=c.ui||{};if(!c.ui.version){c.extend(c.ui,{version:"1.8.12",keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,
+NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});c.fn.extend({_focus:c.fn.focus,focus:function(a,b){return typeof a==="number"?this.each(function(){var d=this;setTimeout(function(){c(d).focus();b&&b.call(d)},a)}):this._focus.apply(this,arguments)},scrollParent:function(){var a;a=c.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(c.curCSS(this,
+"position",1))&&/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!a.length?c(document):a},zIndex:function(a){if(a!==j)return this.css("zIndex",a);if(this.length){a=c(this[0]);for(var b;a.length&&a[0]!==document;){b=a.css("position");
+if(b==="absolute"||b==="relative"||b==="fixed"){b=parseInt(a.css("zIndex"),10);if(!isNaN(b)&&b!==0)return b}a=a.parent()}}return 0},disableSelection:function(){return this.bind((c.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection",function(a){a.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});c.each(["Width","Height"],function(a,b){function d(f,g,l,m){c.each(e,function(){g-=parseFloat(c.curCSS(f,"padding"+this,true))||0;if(l)g-=parseFloat(c.curCSS(f,
+"border"+this+"Width",true))||0;if(m)g-=parseFloat(c.curCSS(f,"margin"+this,true))||0});return g}var e=b==="Width"?["Left","Right"]:["Top","Bottom"],h=b.toLowerCase(),i={innerWidth:c.fn.innerWidth,innerHeight:c.fn.innerHeight,outerWidth:c.fn.outerWidth,outerHeight:c.fn.outerHeight};c.fn["inner"+b]=function(f){if(f===j)return i["inner"+b].call(this);return this.each(function(){c(this).css(h,d(this,f)+"px")})};c.fn["outer"+b]=function(f,g){if(typeof f!=="number")return i["outer"+b].call(this,f);return this.each(function(){c(this).css(h,
+d(this,f,true,g)+"px")})}});c.extend(c.expr[":"],{data:function(a,b,d){return!!c.data(a,d[3])},focusable:function(a){var b=a.nodeName.toLowerCase(),d=c.attr(a,"tabindex");if("area"===b){b=a.parentNode;d=b.name;if(!a.href||!d||b.nodeName.toLowerCase()!=="map")return false;a=c("img[usemap=#"+d+"]")[0];return!!a&&k(a)}return(/input|select|textarea|button|object/.test(b)?!a.disabled:"a"==b?a.href||!isNaN(d):!isNaN(d))&&k(a)},tabbable:function(a){var b=c.attr(a,"tabindex");return(isNaN(b)||b>=0)&&c(a).is(":focusable")}});
+c(function(){var a=document.body,b=a.appendChild(b=document.createElement("div"));c.extend(b.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});c.support.minHeight=b.offsetHeight===100;c.support.selectstart="onselectstart"in b;a.removeChild(b).style.display="none"});c.extend(c.ui,{plugin:{add:function(a,b,d){a=c.ui[a].prototype;for(var e in d){a.plugins[e]=a.plugins[e]||[];a.plugins[e].push([b,d[e]])}},call:function(a,b,d){if((b=a.plugins[b])&&a.element[0].parentNode)for(var e=0;e<b.length;e++)a.options[b[e][0]]&&
+b[e][1].apply(a.element,d)}},contains:function(a,b){return document.compareDocumentPosition?a.compareDocumentPosition(b)&16:a!==b&&a.contains(b)},hasScroll:function(a,b){if(c(a).css("overflow")==="hidden")return false;b=b&&b==="left"?"scrollLeft":"scrollTop";var d=false;if(a[b]>0)return true;a[b]=1;d=a[b]>0;a[b]=0;return d},isOverAxis:function(a,b,d){return a>b&&a<b+d},isOver:function(a,b,d,e,h,i){return c.ui.isOverAxis(a,d,h)&&c.ui.isOverAxis(b,e,i)}})}})(jQuery);
--- a/js/jquery.ui.position.js
+++ /dev/null
@@ -1,252 +1,1 @@
-/*
- * jQuery UI Position @VERSION
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Position
- */
-(function( $, undefined ) {
-$.ui = $.ui || {};
-
-var horizontalPositions = /left|center|right/,
- verticalPositions = /top|center|bottom/,
- center = "center",
- _position = $.fn.position,
- _offset = $.fn.offset;
-
-$.fn.position = function( options ) {
- if ( !options || !options.of ) {
- return _position.apply( this, arguments );
- }
-
- // make a copy, we don't want to modify arguments
- options = $.extend( {}, options );
-
- var target = $( options.of ),
- targetElem = target[0],
- collision = ( options.collision || "flip" ).split( " " ),
- offset = options.offset ? options.offset.split( " " ) : [ 0, 0 ],
- targetWidth,
- targetHeight,
- basePosition;
-
- if ( targetElem.nodeType === 9 ) {
- targetWidth = target.width();
- targetHeight = target.height();
- basePosition = { top: 0, left: 0 };
- } else if ( $.isWindow( targetElem ) ) {
- targetWidth = target.width();
- targetHeight = target.height();
- basePosition = { top: target.scrollTop(), left: target.scrollLeft() };
- } else if ( targetElem.preventDefault ) {
- // force left top to allow flipping
- options.at = "left top";
- targetWidth = targetHeight = 0;
- basePosition = { top: options.of.pageY, left: options.of.pageX };
- } else {
- targetWidth = target.outerWidth();
- targetHeight = target.outerHeight();
- basePosition = target.offset();
- }
-
- // force my and at to have valid horizontal and veritcal positions
- // if a value is missing or invalid, it will be converted to center
- $.each( [ "my", "at" ], function() {
- var pos = ( options[this] || "" ).split( " " );
- if ( pos.length === 1) {
- pos = horizontalPositions.test( pos[0] ) ?
- pos.concat( [center] ) :
- verticalPositions.test( pos[0] ) ?
- [ center ].concat( pos ) :
- [ center, center ];
- }
- pos[ 0 ] = horizontalPositions.test( pos[0] ) ? pos[ 0 ] : center;
- pos[ 1 ] = verticalPositions.test( pos[1] ) ? pos[ 1 ] : center;
- options[ this ] = pos;
- });
-
- // normalize collision option
- if ( collision.length === 1 ) {
- collision[ 1 ] = collision[ 0 ];
- }
-
- // normalize offset option
- offset[ 0 ] = parseInt( offset[0], 10 ) || 0;
- if ( offset.length === 1 ) {
- offset[ 1 ] = offset[ 0 ];
- }
- offset[ 1 ] = parseInt( offset[1], 10 ) || 0;
-
- if ( options.at[0] === "right" ) {
- basePosition.left += targetWidth;
- } else if ( options.at[0] === center ) {
- basePosition.left += targetWidth / 2;
- }
-
- if ( options.at[1] === "bottom" ) {
- basePosition.top += targetHeight;
- } else if ( options.at[1] === center ) {
- basePosition.top += targetHeight / 2;
- }
-
- basePosition.left += offset[ 0 ];
- basePosition.top += offset[ 1 ];
-
- return this.each(function() {
- var elem = $( this ),
- elemWidth = elem.outerWidth(),
- elemHeight = elem.outerHeight(),
- marginLeft = parseInt( $.curCSS( this, "marginLeft", true ) ) || 0,
- marginTop = parseInt( $.curCSS( this, "marginTop", true ) ) || 0,
- collisionWidth = elemWidth + marginLeft +
- ( parseInt( $.curCSS( this, "marginRight", true ) ) || 0 ),
- collisionHeight = elemHeight + marginTop +
- ( parseInt( $.curCSS( this, "marginBottom", true ) ) || 0 ),
- position = $.extend( {}, basePosition ),
- collisionPosition;
-
- if ( options.my[0] === "right" ) {
- position.left -= elemWidth;
- } else if ( options.my[0] === center ) {
- position.left -= elemWidth / 2;
- }
-
- if ( options.my[1] === "bottom" ) {
- position.top -= elemHeight;
- } else if ( options.my[1] === center ) {
- position.top -= elemHeight / 2;
- }
-
- // prevent fractions (see #5280)
- position.left = Math.round( position.left );
- position.top = Math.round( position.top );
-
- collisionPosition = {
- left: position.left - marginLeft,
- top: position.top - marginTop
- };
-
- $.each( [ "left", "top" ], function( i, dir ) {
- if ( $.ui.position[ collision[i] ] ) {
- $.ui.position[ collision[i] ][ dir ]( position, {
- targetWidth: targetWidth,
- targetHeight: targetHeight,
- elemWidth: elemWidth,
- elemHeight: elemHeight,
- collisionPosition: collisionPosition,
- collisionWidth: collisionWidth,
- collisionHeight: collisionHeight,
- offset: offset,
- my: options.my,
- at: options.at
- });
- }
- });
-
- if ( $.fn.bgiframe ) {
- elem.bgiframe();
- }
- elem.offset( $.extend( position, { using: options.using } ) );
- });
-};
-
-$.ui.position = {
- fit: {
- left: function( position, data ) {
- var win = $( window ),
- over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft();
- position.left = over > 0 ? position.left - over : Math.max( position.left - data.collisionPosition.left, position.left );
- },
- top: function( position, data ) {
- var win = $( window ),
- over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop();
- position.top = over > 0 ? position.top - over : Math.max( position.top - data.collisionPosition.top, position.top );
- }
- },
-
- flip: {
- left: function( position, data ) {
- if ( data.at[0] === center ) {
- return;
- }
- var win = $( window ),
- over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(),
- myOffset = data.my[ 0 ] === "left" ?
- -data.elemWidth :
- data.my[ 0 ] === "right" ?
- data.elemWidth :
- 0,
- atOffset = data.at[ 0 ] === "left" ?
- data.targetWidth :
- -data.targetWidth,
- offset = -2 * data.offset[ 0 ];
- position.left += data.collisionPosition.left < 0 ?
- myOffset + atOffset + offset :
- over > 0 ?
- myOffset + atOffset + offset :
- 0;
- },
- top: function( position, data ) {
- if ( data.at[1] === center ) {
- return;
- }
- var win = $( window ),
- over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(),
- myOffset = data.my[ 1 ] === "top" ?
- -data.elemHeight :
- data.my[ 1 ] === "bottom" ?
- data.elemHeight :
- 0,
- atOffset = data.at[ 1 ] === "top" ?
- data.targetHeight :
- -data.targetHeight,
- offset = -2 * data.offset[ 1 ];
- position.top += data.collisionPosition.top < 0 ?
- myOffset + atOffset + offset :
- over > 0 ?
- myOffset + atOffset + offset :
- 0;
- }
- }
-};
-
-// offset setter from jQuery 1.4
-if ( !$.offset.setOffset ) {
- $.offset.setOffset = function( elem, options ) {
- // set position first, in-case top/left are set even on static elem
- if ( /static/.test( $.curCSS( elem, "position" ) ) ) {
- elem.style.position = "relative";
- }
- var curElem = $( elem ),
- curOffset = curElem.offset(),
- curTop = parseInt( $.curCSS( elem, "top", true ), 10 ) || 0,
- curLeft = parseInt( $.curCSS( elem, "left", true ), 10) || 0,
- props = {
- top: (options.top - curOffset.top) + curTop,
- left: (options.left - curOffset.left) + curLeft
- };
-
- if ( 'using' in options ) {
- options.using.call( elem, props );
- } else {
- curElem.css( props );
- }
- };
-
- $.fn.offset = function( options ) {
- var elem = this[ 0 ];
- if ( !elem || !elem.ownerDocument ) { return null; }
- if ( options ) {
- return this.each(function() {
- $.offset.setOffset( this, options );
- });
- }
- return _offset.call( this );
- };
-}
-
-}( jQuery ));
-
--- /dev/null
+++ b/js/jquery.ui.position.min.js
@@ -1,1 +1,17 @@
+/*
+ * jQuery UI Position 1.8.12
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Position
+ */
+(function(c){c.ui=c.ui||{};var n=/left|center|right/,o=/top|center|bottom/,t=c.fn.position,u=c.fn.offset;c.fn.position=function(b){if(!b||!b.of)return t.apply(this,arguments);b=c.extend({},b);var a=c(b.of),d=a[0],g=(b.collision||"flip").split(" "),e=b.offset?b.offset.split(" "):[0,0],h,k,j;if(d.nodeType===9){h=a.width();k=a.height();j={top:0,left:0}}else if(d.setTimeout){h=a.width();k=a.height();j={top:a.scrollTop(),left:a.scrollLeft()}}else if(d.preventDefault){b.at="left top";h=k=0;j={top:b.of.pageY,
+left:b.of.pageX}}else{h=a.outerWidth();k=a.outerHeight();j=a.offset()}c.each(["my","at"],function(){var f=(b[this]||"").split(" ");if(f.length===1)f=n.test(f[0])?f.concat(["center"]):o.test(f[0])?["center"].concat(f):["center","center"];f[0]=n.test(f[0])?f[0]:"center";f[1]=o.test(f[1])?f[1]:"center";b[this]=f});if(g.length===1)g[1]=g[0];e[0]=parseInt(e[0],10)||0;if(e.length===1)e[1]=e[0];e[1]=parseInt(e[1],10)||0;if(b.at[0]==="right")j.left+=h;else if(b.at[0]==="center")j.left+=h/2;if(b.at[1]==="bottom")j.top+=
+k;else if(b.at[1]==="center")j.top+=k/2;j.left+=e[0];j.top+=e[1];return this.each(function(){var f=c(this),l=f.outerWidth(),m=f.outerHeight(),p=parseInt(c.curCSS(this,"marginLeft",true))||0,q=parseInt(c.curCSS(this,"marginTop",true))||0,v=l+p+(parseInt(c.curCSS(this,"marginRight",true))||0),w=m+q+(parseInt(c.curCSS(this,"marginBottom",true))||0),i=c.extend({},j),r;if(b.my[0]==="right")i.left-=l;else if(b.my[0]==="center")i.left-=l/2;if(b.my[1]==="bottom")i.top-=m;else if(b.my[1]==="center")i.top-=
+m/2;i.left=Math.round(i.left);i.top=Math.round(i.top);r={left:i.left-p,top:i.top-q};c.each(["left","top"],function(s,x){c.ui.position[g[s]]&&c.ui.position[g[s]][x](i,{targetWidth:h,targetHeight:k,elemWidth:l,elemHeight:m,collisionPosition:r,collisionWidth:v,collisionHeight:w,offset:e,my:b.my,at:b.at})});c.fn.bgiframe&&f.bgiframe();f.offset(c.extend(i,{using:b.using}))})};c.ui.position={fit:{left:function(b,a){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();b.left=
+d>0?b.left-d:Math.max(b.left-a.collisionPosition.left,b.left)},top:function(b,a){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();b.top=d>0?b.top-d:Math.max(b.top-a.collisionPosition.top,b.top)}},flip:{left:function(b,a){if(a.at[0]!=="center"){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();var g=a.my[0]==="left"?-a.elemWidth:a.my[0]==="right"?a.elemWidth:0,e=a.at[0]==="left"?a.targetWidth:-a.targetWidth,h=-2*a.offset[0];b.left+=
+a.collisionPosition.left<0?g+e+h:d>0?g+e+h:0}},top:function(b,a){if(a.at[1]!=="center"){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();var g=a.my[1]==="top"?-a.elemHeight:a.my[1]==="bottom"?a.elemHeight:0,e=a.at[1]==="top"?a.targetHeight:-a.targetHeight,h=-2*a.offset[1];b.top+=a.collisionPosition.top<0?g+e+h:d>0?g+e+h:0}}}};if(!c.offset.setOffset){c.offset.setOffset=function(b,a){if(/static/.test(c.curCSS(b,"position")))b.style.position="relative";var d=c(b),
+g=d.offset(),e=parseInt(c.curCSS(b,"top",true),10)||0,h=parseInt(c.curCSS(b,"left",true),10)||0;g={top:a.top-g.top+e,left:a.left-g.left+h};"using"in a?a.using.call(b,g):d.css(g)};c.fn.offset=function(b){var a=this[0];if(!a||!a.ownerDocument)return null;if(b)return this.each(function(){c.offset.setOffset(this,b)});return u.call(this)}}})(jQuery);
--- a/js/jquery.ui.widget.js
+++ /dev/null
@@ -1,324 +1,1 @@
-/*!
- * jQuery UI Widget @VERSION
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Widget
- */
-(function( $, undefined ) {
-var slice = Array.prototype.slice;
-
-var _cleanData = $.cleanData;
-$.cleanData = function( elems ) {
- for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) {
- $( elem ).triggerHandler( "remove" );
- }
- _cleanData( elems );
-};
-
-$.widget = function( name, base, prototype ) {
- var namespace = name.split( "." )[ 0 ],
- fullName;
- name = name.split( "." )[ 1 ];
- fullName = namespace + "-" + name;
-
- if ( !prototype ) {
- prototype = base;
- base = $.Widget;
- }
-
- // create selector for plugin
- $.expr[ ":" ][ fullName ] = function( elem ) {
- return !!$.data( elem, name );
- };
-
- $[ namespace ] = $[ namespace ] || {};
- $[ namespace ][ name ] = $[ namespace ][ name ] || function( options, element ) {
- // allow instantiation without "new" keyword
- if ( !this._createWidget ) {
- return new $[ namespace ][ name ]( options, element );
- }
-
- // allow instantiation without initializing for simple inheritance
- // must use "new" keyword (the code above always passes args)
- if ( arguments.length ) {
- this._createWidget( options, element );
- }
- };
-
- var basePrototype = new base();
- // we need to make the options hash a property directly on the new instance
- // otherwise we'll modify the options hash on the prototype that we're
- // inheriting from
- basePrototype.options = $.extend( true, {}, basePrototype.options );
- $[ namespace ][ name ].prototype = $.extend( true, basePrototype, {
- namespace: namespace,
- widgetName: name,
- widgetEventPrefix: name,
- widgetBaseClass: fullName,
- base: base.prototype
- }, prototype );
-
- $.widget.bridge( name, $[ namespace ][ name ] );
-};
-
-$.widget.bridge = function( name, object ) {
- $.fn[ name ] = function( options ) {
- var isMethodCall = typeof options === "string",
- args = slice.call( arguments, 1 ),
- returnValue = this;
-
- // allow multiple hashes to be passed on init
- options = !isMethodCall && args.length ?
- $.extend.apply( null, [ true, options ].concat(args) ) :
- options;
-
- // prevent calls to internal methods
- if ( isMethodCall && options.charAt( 0 ) === "_" ) {
- return returnValue;
- }
-
- if ( isMethodCall ) {
- this.each(function() {
- var instance = $.data( this, name );
- if ( !instance ) {
- return $.error( "cannot call methods on " + name + " prior to initialization; " +
- "attempted to call method '" + options + "'" );
- }
- if ( !$.isFunction( instance[options] ) ) {
- return $.error( "no such method '" + options + "' for " + name + " widget instance" );
- }
- var methodValue = instance[ options ].apply( instance, args );
- if ( methodValue !== instance && methodValue !== undefined ) {
- returnValue = methodValue;
- return false;
- }
- });
- } else {
- this.each(function() {
- var instance = $.data( this, name );
- if ( instance ) {
- instance.option( options || {} )._init();
- } else {
- object( options, this );
- }
- });
- }
-
- return returnValue;
- };
-};
-
-$.Widget = function( options, element ) {
- // allow instantiation without "new" keyword
- if ( !this._createWidget ) {
- return new $[ namespace ][ name ]( options, element );
- }
-
- // allow instantiation without initializing for simple inheritance
- // must use "new" keyword (the code above always passes args)
- if ( arguments.length ) {
- this._createWidget( options, element );
- }
-};
-
-$.Widget.prototype = {
- widgetName: "widget",
- widgetEventPrefix: "",
- defaultElement: "<div>",
- options: {
- disabled: false
- },
- _createWidget: function( options, element ) {
- element = $( element || this.defaultElement || this )[ 0 ];
- this.element = $( element );
- this.options = $.extend( true, {},
- this.options,
- this._getCreateOptions(),
- options );
-
- this.bindings = $();
- this.hoverable = $();
- this.focusable = $();
-
- if ( element !== this ) {
- $.data( element, this.widgetName, this );
- this._bind({ remove: "destroy" });
- }
-
- this._create();
- this._trigger( "create" );
- this._init();
- },
- _getCreateOptions: function() {
- return $.metadata && $.metadata.get( this.element[0] )[ this.widgetName ];
- },
- _create: $.noop,
- _init: $.noop,
-
- _super: function( method ) {
- return this.base[ method ].apply( this, slice.call( arguments, 1 ) );
- },
- _superApply: function( method, args ) {
- return this.base[ method ].apply( this, args );
- },
-
- destroy: function() {
- this._destroy();
- // we can probably remove the unbind calls in 2.0
- // all event bindings should go through this._bind()
- this.element
- .unbind( "." + this.widgetName )
- .removeData( this.widgetName );
- this.widget()
- .unbind( "." + this.widgetName )
- .removeAttr( "aria-disabled" )
- .removeClass(
- this.widgetBaseClass + "-disabled " +
- "ui-state-disabled" );
-
- // clean up events and states
- this.bindings.unbind( "." + this.widgetName );
- this.hoverable.removeClass( "ui-state-hover" );
- this.focusable.removeClass( "ui-state-focus" );
- },
- _destroy: $.noop,
-
- widget: function() {
- return this.element;
- },
-
- option: function( key, value ) {
- var options = key;
-
- if ( arguments.length === 0 ) {
- // don't return a reference to the internal hash
- return $.extend( {}, this.options );
- }
-
- if (typeof key === "string" ) {
- if ( value === undefined ) {
- return this.options[ key ];
- }
- options = {};
- options[ key ] = value;
- }
-
- this._setOptions( options );
-
- return this;
- },
- _setOptions: function( options ) {
- var self = this;
- $.each( options, function( key, value ) {
- self._setOption( key, value );
- });
-
- return this;
- },
- _setOption: function( key, value ) {
- this.options[ key ] = value;
-
- if ( key === "disabled" ) {
- this.widget()
- .toggleClass( this.widgetBaseClass + "-disabled ui-state-disabled", !!value )
- .attr( "aria-disabled", value );
- this.hoverable.removeClass( "ui-state-hover" );
- this.focusable.removeClass( "ui-state-focus" );
- }
-
- return this;
- },
-
- enable: function() {
- return this._setOption( "disabled", false );
- },
- disable: function() {
- return this._setOption( "disabled", true );
- },
-
- _bind: function( element, handlers ) {
- // no element argument, shuffle and use this.element
- if ( !handlers ) {
- handlers = element;
- element = this.element;
- } else {
- this.bindings = this.bindings.add( element );
- }
- var instance = this;
- $.each( handlers, function( event, handler ) {
- element.bind( event + "." + instance.widgetName, function() {
- // allow widgets to customize the disabled handling
- // - disabled as an array instead of boolean
- // - disabled class as method for disabling individual parts
- if ( instance.options.disabled === true ||
- $( this ).hasClass( "ui-state-disabled" ) ) {
- return;
- }
- return ( typeof handler === "string" ? instance[ handler ] : handler )
- .apply( instance, arguments );
- });
- });
- },
-
- _hoverable: function( element ) {
- this.hoverable = this.hoverable.add( element );
- this._bind( element, {
- mouseenter: function( event ) {
- $( event.currentTarget ).addClass( "ui-state-hover" );
- },
- mouseleave: function( event ) {
- $( event.currentTarget ).removeClass( "ui-state-hover" );
- }
- });
- },
-
- _focusable: function( element ) {
- this.focusable = this.focusable.add( element );
- this._bind( element, {
- focusin: function( event ) {
- $( event.currentTarget ).addClass( "ui-state-focus" );
- },
- focusout: function( event ) {
- $( event.currentTarget ).removeClass( "ui-state-focus" );
- }
- });
- },
-
- _trigger: function( type, event, data ) {
- var callback = this.options[ type ],
- args;
-
- event = $.Event( event );
- event.type = ( type === this.widgetEventPrefix ?
- type :
- this.widgetEventPrefix + type ).toLowerCase();
- data = data || {};
-
- // copy original event properties over to the new event
- // this would happen if we could call $.event.fix instead of $.Event
- // but we don't have a way to force an event to be fixed multiple times
- if ( event.originalEvent ) {
- for ( var i = $.event.props.length, prop; i; ) {
- prop = $.event.props[ --i ];
- event[ prop ] = event.originalEvent[ prop ];
- }
- }
-
- this.element.trigger( event, data );
-
- args = $.isArray( data ) ?
- [ event ].concat( data ) :
- [ event, data ];
-
- return !( $.isFunction( callback ) &&
- callback.apply( this.element[0], args ) === false ||
- event.isDefaultPrevented() );
- }
-};
-
-})( jQuery );
-
--- /dev/null
+++ b/js/jquery.ui.widget.min.js
@@ -1,1 +1,16 @@
+/*!
+ * jQuery UI Widget 1.8.12
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Widget
+ */
+(function(b,j){if(b.cleanData){var k=b.cleanData;b.cleanData=function(a){for(var c=0,d;(d=a[c])!=null;c++)b(d).triggerHandler("remove");k(a)}}else{var l=b.fn.remove;b.fn.remove=function(a,c){return this.each(function(){if(!c)if(!a||b.filter(a,[this]).length)b("*",this).add([this]).each(function(){b(this).triggerHandler("remove")});return l.call(b(this),a,c)})}}b.widget=function(a,c,d){var e=a.split(".")[0],f;a=a.split(".")[1];f=e+"-"+a;if(!d){d=c;c=b.Widget}b.expr[":"][f]=function(h){return!!b.data(h,
+a)};b[e]=b[e]||{};b[e][a]=function(h,g){arguments.length&&this._createWidget(h,g)};c=new c;c.options=b.extend(true,{},c.options);b[e][a].prototype=b.extend(true,c,{namespace:e,widgetName:a,widgetEventPrefix:b[e][a].prototype.widgetEventPrefix||a,widgetBaseClass:f},d);b.widget.bridge(a,b[e][a])};b.widget.bridge=function(a,c){b.fn[a]=function(d){var e=typeof d==="string",f=Array.prototype.slice.call(arguments,1),h=this;d=!e&&f.length?b.extend.apply(null,[true,d].concat(f)):d;if(e&&d.charAt(0)==="_")return h;
+e?this.each(function(){var g=b.data(this,a),i=g&&b.isFunction(g[d])?g[d].apply(g,f):g;if(i!==g&&i!==j){h=i;return false}}):this.each(function(){var g=b.data(this,a);g?g.option(d||{})._init():b.data(this,a,new c(d,this))});return h}};b.Widget=function(a,c){arguments.length&&this._createWidget(a,c)};b.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",options:{disabled:false},_createWidget:function(a,c){b.data(c,this.widgetName,this);this.element=b(c);this.options=b.extend(true,{},this.options,
+this._getCreateOptions(),a);var d=this;this.element.bind("remove."+this.widgetName,function(){d.destroy()});this._create();this._trigger("create");this._init()},_getCreateOptions:function(){return b.metadata&&b.metadata.get(this.element[0])[this.widgetName]},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName);this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+"-disabled ui-state-disabled")},
+widget:function(){return this.element},option:function(a,c){var d=a;if(arguments.length===0)return b.extend({},this.options);if(typeof a==="string"){if(c===j)return this.options[a];d={};d[a]=c}this._setOptions(d);return this},_setOptions:function(a){var c=this;b.each(a,function(d,e){c._setOption(d,e)});return this},_setOption:function(a,c){this.options[a]=c;if(a==="disabled")this.widget()[c?"addClass":"removeClass"](this.widgetBaseClass+"-disabled ui-state-disabled").attr("aria-disabled",c);return this},
+enable:function(){return this._setOption("disabled",false)},disable:function(){return this._setOption("disabled",true)},_trigger:function(a,c,d){var e=this.options[a];c=b.Event(c);c.type=(a===this.widgetEventPrefix?a:this.widgetEventPrefix+a).toLowerCase();d=d||{};if(c.originalEvent){a=b.event.props.length;for(var f;a;){f=b.event.props[--a];c[f]=c.originalEvent[f]}}this.element.trigger(c,d);return!(b.isFunction(e)&&e.call(this.element[0],c,d)===false||c.isDefaultPrevented())}}})(jQuery);
--- /dev/null
+++ b/js/yepnope
--- /dev/null
+++ b/labs/index.php
@@ -1,1 +1,18 @@
+<?php
+include ('../include/common.inc.php');
+include_header("Busness R&D", "index");
+?>
+ <ul data-role="listview" data-theme="e" data-groupingtheme="e">
+ <li data-role="list-divider" > Experimental Features </li>
+ <li><a href="busstopdensity.php"><h3>Bus Stop Density Map</h3>
+ <p>Analysis of bus stop coverage</p></a></li>
+ <li><a href="stopBrowser.php"><h3>Bus Stop Browser Map</h3>
+ <p>Bus stop location/route browser</p></a></li>
+ </ul>
+ </div>
+<?php
+include_footer()
+?>
+
+
--- a/labs/myway_api.json.php
+++ /dev/null
@@ -1,125 +1,1 @@
-<?php
-function cleanString($subject)
-{
- $subject = str_replace(" ", " ", $subject);
- $subject = str_replace("&", "&", $subject);
- $subject = preg_replace('/[^\r\n\t\x20-\x7E\xA0-\xFF]/', '', $subject);
- $subject = str_replace(" ", " ", $subject);
- return trim($subject);
-}
-$return = Array();
-/*if (file_exists("mywayresponse.txt")) {
- @$fh = fopen("mywayresponse.txt", 'r');
- if ($fh) {
- $pageHTML = fread($fh, filesize("mywayresponse.txt"));
- fclose($fh);
- }
-}*/
-//set POST variables
-$url = 'https://www.action.act.gov.au/ARTS/use_Funcs.asp';
-$field_mapping = Array(
- "card_number" => "SRNO",
- "DOBmonth" => "month",
- "DOBday" => "day",
- "DOByear" => "year",
- "secret_answer" => "pwrd",
- "button" => "button"
-);
-foreach (Array(
- "card_number",
- "DOBday",
- "DOBmonth",
- "DOByear"
-) as $field_name) {
- if (isset($_REQUEST[$field_name])) {
- $fields[$field_name] = filter_var($_REQUEST[$field_name], FILTER_SANITIZE_NUMBER_INT);
- }
- else {
- $return["error"][] = $field_name. " parameter invalid or unspecified";
- }
-}
-if (isset($_REQUEST['secret_answer'])) {
- $fields['secret_answer'] = filter_var($_REQUEST['secret_answer'], FILTER_SANITIZE_STRING, Array(
- FILTER_FLAG_NO_ENCODE_QUOTES,
- FILTER_FLAG_STRIP_HIGH,
- FILTER_FLAG_STRIP_LOW
- ));
-}
-else {
- $return["error"][] = "secret_answer parameter invalid or unspecified";
-}
-$fields['button'] = 'Submit';
-$fields_string = "";
-//url-ify the data for the POST
-foreach ($fields as $key => $value) {
- if (sizeof($value) === 0) $return['error'][] = $key . " parameter invalid or unspecified";
- $fields_string.= $field_mapping[$key] . '=' . $value . '&';
-}
-$fields_string = rtrim($fields_string, '&');
-if (!isset($return['error'])) {
- //open connection
- $ch = curl_init();
- //set the url, number of POST vars, POST data
- curl_setopt($ch, CURLOPT_URL, $url);
- curl_setopt($ch, CURLOPT_POST, count($fields));
- curl_setopt($ch, CURLOPT_POSTFIELDS, $fields_string);
- curl_setopt($ch, CURLOPT_RETURNTRANSFER, 1);
- curl_setopt($ch, CURLOPT_HEADER, 0);
- curl_setopt($ch, CURLOPT_TIMEOUT, 30);
- //execute post
- $pageHTML = curl_exec($ch);
- if (curl_errno($ch)) $return["error"][] = "Network error " . curl_errno($ch) . " " . curl_error($ch) . " " . $url . $fields_string;
- //close connection
- curl_close($ch);
-}
-if (!isset($return['error'])) {
- include_once ('simple_html_dom.php');
- $page = str_get_html($pageHTML);
- $pageAlerts = $page->find(".smartCardAlert");
- if (sizeof($pageAlerts) > 0) {
- $return['error'][] = $pageAlerts[0]->plaintext;
- }
- if (!isset($return['error'])) {
- $tableNum = 0;
- $tableName = Array(
- 1 => "myway_carddetails",
- 2 => "myway_transactions"
- );
- foreach ($page->find("table") as $table) {
- $tableNum++;
- $tableColumns = Array();
- $tableColumnNum = 0;
- foreach ($table->find("th") as $th) {
- $tableColumns[$tableColumnNum] = cleanString($th->plaintext);
- $tableColumnNum++;
- }
- $tableRowNum = 0;
- foreach ($table->find("tr") as $tr) {
- $tableColumnNum = 0;
- foreach ($tr->find("td") as $td) {
- if ($tableNum == 1) $return[$tableName[$tableNum]][$tableColumns[$tableColumnNum]] = cleanString($td->plaintext);
- else $return[$tableName[$tableNum]][$tableRowNum][$tableColumns[$tableColumnNum]] = cleanString($td->plaintext);
- $tableColumnNum++;
- }
- $tableRowNum++;
- }
- }
- }
-}
-if (sizeof($return) == 0) {
-$return['error'][] = "No data extracted from MyWay website - API may be out of date";
-}
-
-header('Content-Type: text/javascript; charset=utf8');
-// header('Access-Control-Allow-Origin: http://bus.lambdacomplex.org/');
-header('Access-Control-Max-Age: 3628800');
-header('Access-Control-Allow-Methods: GET, POST, PUT, DELETE');
-if (isset($_GET['callback'])) {
- $json = '(' . json_encode($return) . ');'; //must wrap in parens and end with semicolon
- print_r($_GET['callback'] . $json); //callback is prepended for json-p
-
-}
-else echo json_encode($return);
-?>
-
--- a/labs/mywaybalance.php
+++ /dev/null
@@ -1,64 +1,1 @@
-<?php
-include ('../include/common.inc.php');
-include_header("MyWay Balance", "mywayBalance", true, false, true);
-$return = Array();
-function printBalance($cardNumber, $date, $pwrd)
-{
- global $return;
- $return = json_decode(getPage(curPageURL() . "/myway_api.json.php?card_number=$cardNumber&DOBday={$date[0]}&DOBmonth={$date[1]}&DOByear={$date[2]}&secret_answer=$pwrd"), true);
-
- if (isset($return['error'])) {
- echo "<font color=red>" . var_dump($return['error']) . "</font>";
- } else {
- echo "<h2>Balance: " . $return['myway_carddetails']['Card Balance'] . "</h2>";
- echo '<ul data-role="listview" data-inset="true"><li data-role="list-divider"> Recent Transactions </li>';
- foreach ($return['myway_transactions'] as $transaction) {
- echo "<li><b>" . $transaction["Date / Time"] . "</b>";
- echo "<br><small>" . $transaction["TX Reference No / Type"]. "</small>";
- echo '<p class="ui-li-aside">'.$transaction["TX Amount"].'</p>';
- echo "</li>";
- }
- echo "</ul>";
- }
-}
-if (isset($_REQUEST['card_number']) && isset($_REQUEST['date']) && isset($_REQUEST['secret_answer'])) {
- $cardNumber = $_REQUEST['card_number'];
- $date = explode("/", $_REQUEST['date']);
- $pwrd = $_REQUEST['secret_answer'];
- if ($_REQUEST['remember'] == true) {
- $_COOKIE['card_number'] = $cardNumber;
- $_COOKIE['date'] = $date;
- $_COOKIE['secret_answer'] = $pwrd;
- }
- printBalance($cardNumber, $date, $pwrd);
-}
-else if (isset($_COOKIE['card_number']) && isset($_COOKIE['date']) && isset($_COOKIE['secret_answer'])) {
- $cardNumber = $_COOKIE['card_number'];
- $date = explode("/", $_COOKIE['date']);
- $pwrd = $_COOKIE['secret_answer'];
- printBalance($cardNumber, $date, $pwrd);
-}
-else {
- $date = (isset($_REQUEST['date']) ? filter_var($_REQUEST['date'], FILTER_SANITIZE_STRING) : date("m/d/Y"));
- echo '<form action="" method="post">
- <div data-role="fieldcontain">
- <label for="card_number">Card number</label>
- <input type="text" name="card_number" id="card_number" value="' . $card_number . '" />
- </div>
- <div data-role="fieldcontain">
- <label for="date"> Date of birth </label>
- <input type="text" name="date" id="date" value="' . $date . '" />
- </div>
- <div data-role="fieldcontain">
- <label for="secret_answer"> Secret question answer </label>
- <input type="text" name="secret_answer" id="secret_answer" value="' . $secret_answer . '" />
- </div>
- <div data-role="fieldcontain">
- <label for="remember"> Remember these details? </label>
- <input type="checkbox" name="remember" id="remember" checked="yes" />
- </div>
- <input type="submit" value="Go!"></form>';
-}
-include_footer();
-?>
--- a/labs/stop.pdf.php
+++ /dev/null
@@ -1,196 +1,1 @@
-<?php
-include ('../include/common.inc.php');
-$stopid = filter_var($_REQUEST['stopid'], FILTER_SANITIZE_NUMBER_INT);
-$url = $APIurl . "/json/stop?stop_id=" . $stopid;
-$stop = json_decode(getPage($url));
-$html.= '<table><tr><td><br><br> ';
-$url = $APIurl . "/json/stoproutes?stop=" . $stopid . "&time=" . midnight_seconds() . "&service_period=" . service_period();
-$routes = json_decode(getPage($url));
-foreach ($routes as $route) {
- $html.= '<br> <a href="trip.php?routeid=' . $route[0] . '&stopid=' . $stopid . '">' . $route[1] . ' - ' . $route[2] . '</a>';
- $viaPoints = viaPointNames($route[3], $stopid);
- if ($viaPoints != "") $html.= '<br><small>Via: ' . $viaPoints . '</small>';
- $html.= "<br>";
-}
-$html.= '</td><td>' . staticmap(Array(
- 0 => Array(
- $stop[2],
- $stop[3]
- )
-) , 0, "iconb", false) . "</td></tr>";
-$url = $APIurl . "/json/stoptrips?stop=" . $stopid . "&time=" . midnight_seconds() . "&service_period=" . service_period();
-$trips = json_decode(getPage($url));
-$html.= "</table><br><br><table>";
-$html.= "<thead><tr><th>Route</th><th>Time</th></tr></thead>";
-debug(print_r($trips, true));
-foreach ($trips as $row) {
- $html.= '<tr><td><a href="trip.php?stopid=' . $stopid . '&tripid=' . $row[1][0] . '">' . $row[1][1] . "</a></td>";
- $html.= '<td>' . midnight_seconds_to_time($row[0]) . '</td>';
- $html.= '</tr>';
-}
-$html.= '</table>';
-if (sizeof($trips) == 0) $html.= "<center>No trips in the near future.</center>";
-require_once ('lib/tcpdf/config/lang/eng.php');
-require_once ('lib/tcpdf/tcpdf.php');
-// create new PDF document
-class Custom_TCPDF extends TCPDF
-{
- var $QRCodeURL;
- function set_QRCodeURL($url)
- {
- $this->QRCodeURL = $url;
- }
- /**
- * This method is used to render the page header.
- * It is automatically called by AddPage() and could be overwritten in your own inherited class.
- * @public
- */
- public function Header()
- {
- if ($this->header_xobjid < 0) {
- // start a new XObject Template
- $this->header_xobjid = $this->startTemplate($this->w, $this->tMargin + 10);
- $headerfont = $this->getHeaderFont();
- $headerdata = $this->getHeaderData();
- $this->y = $this->header_margin;
- if ($this->rtl) {
- $this->x = $this->w - $this->original_rMargin;
- }
- else {
- $this->x = $this->original_lMargin - 10;
- }
- if (isset($this->QRCodeURL)) {
- // QRCODE,H : QR-CODE Best error correction
- $style = array(
- 'border' => 1,
- 'padding' => 0,
- 'fgcolor' => array(
- 0,
- 0,
- 0
- ) ,
- 'bgcolor' => false, //array(255,255,255)
- 'module_width' => 1, // width of a single module in points
- 'module_height' => 1
- // height of a single module in points
-
- );
- $this->write2DBarcode($this->QRCodeURL, 'QRCODE,H', '', '', 25, 25, $style, 'T');
- $imgy = 50 + 20;
- }
- elseif (($headerdata['logo']) AND ($headerdata['logo'] != K_BLANK_IMAGE)) {
- $imgtype = $this->getImageFileType(K_PATH_IMAGES . $headerdata['logo']);
- if (($imgtype == 'eps') OR ($imgtype == 'ai')) {
- $this->ImageEps(K_PATH_IMAGES . $headerdata['logo'], '', '', $headerdata['logo_width']);
- }
- elseif ($imgtype == 'svg') {
- $this->ImageSVG(K_PATH_IMAGES . $headerdata['logo'], '', '', $headerdata['logo_width']);
- }
- else {
- $this->Image(K_PATH_IMAGES . $headerdata['logo'], '', '', $headerdata['logo_width']);
- }
- $imgy = $this->getImageRBY();
- }
- else {
- $imgy = $this->y;
- }
- $cell_height = round(($this->cell_height_ratio * $headerfont[2]) / $this->k, 2);
- // set starting margin for text data cell
- if ($this->getRTL()) {
- $header_x = $this->original_rMargin + ($headerdata['logo_width'] * 1.1);
- }
- else {
- $header_x = $this->original_lMargin + ($headerdata['logo_width'] * 1.1);
- }
- $cw = $this->w - $this->original_lMargin - $this->original_rMargin - ($headerdata['logo_width'] * 1.1);
- $this->SetTextColor(0, 0, 0);
- // header title
- $this->SetFont($headerfont[0], 'B', $headerfont[2] + 1);
- $this->SetX($header_x);
- $this->Cell($cw, $cell_height, $headerdata['title'], 0, 1, '', 0, '', 0);
- // header string
- $this->SetFont($headerfont[0], $headerfont[1], $headerfont[2]);
- $this->SetX($header_x);
- $this->MultiCell($cw, $cell_height, $headerdata['string'], 0, '', 0, 1, '', '', true, 0, false);
- // print an ending header line
- //$this->SetLineStyle(array('width' => 0.85 / $this->k, 'cap' => 'butt', 'join' => 'miter', 'dash' => 0, 'color' => array(0, 0, 0)));
- //$this->SetY((2.835 / $this->k) + max($imgy, $this->y));
- if ($this->rtl) {
- $this->SetX($this->original_rMargin);
- }
- else {
- $this->SetX($this->original_lMargin);
- }
- //$this->Cell(($this->w - $this->original_lMargin - $this->original_rMargin), 0, '', 'T', 0, 'C');
- $this->endTemplate();
- }
- // print header template
- $x = 0;
- $dx = 0;
- if ($this->booklet AND (($this->page % 2) == 0)) {
- // adjust margins for booklet mode
- $dx = ($this->original_lMargin - $this->original_rMargin);
- }
- if ($this->rtl) {
- $x = $this->w + $dx;
- }
- else {
- $x = 0 + $dx;
- }
- $this->printTemplate($this->header_xobjid, $x, 0, 0, 0, '', '', false);
- }
-}
-$pdf = new Custom_TCPDF(PDF_PAGE_ORIENTATION, PDF_UNIT, PDF_PAGE_FORMAT, true, 'UTF-8', false);
-// set document information
-$pdf->SetCreator(PDF_CREATOR);
-$pdf->SetAuthor('bus.lambdacomplex.org');
-$pdf->SetTitle($stop[1]);
-// set default header data
-$pdf->SetHeaderData(PDF_HEADER_LOGO, PDF_HEADER_LOGO_WIDTH, $stop[1] . " Timetable", "Some description of customization like Weekdays, 9am-10am");
-$pdf->set_QRCodeURL(curPageURL() . "stop.php?stopid=" . $_REQUEST['stopid']);
-// set header and footer fonts
-$pdf->setHeaderFont(Array(
- PDF_FONT_NAME_MAIN,
- '',
- PDF_FONT_SIZE_MAIN
-));
-$pdf->setFooterFont(Array(
- PDF_FONT_NAME_DATA,
- '',
- PDF_FONT_SIZE_DATA
-));
-// set default monospaced font
-$pdf->SetDefaultMonospacedFont(PDF_FONT_MONOSPACED);
-//set margins
-$pdf->SetMargins(PDF_MARGIN_LEFT, PDF_MARGIN_TOP, PDF_MARGIN_RIGHT);
-$pdf->SetHeaderMargin(PDF_MARGIN_HEADER);
-$pdf->SetFooterMargin(PDF_MARGIN_FOOTER);
-//set auto page breaks
-$pdf->SetAutoPageBreak(TRUE, PDF_MARGIN_BOTTOM);
-//set image scale factor
-$pdf->setImageScale(PDF_IMAGE_SCALE_RATIO);
-//set some language-dependent strings
-$pdf->setLanguageArray($l);
-// ---------------------------------------------------------
-// set default font subsetting mode
-$pdf->setFontSubsetting(true);
-// Set font
-// dejavusans is a UTF-8 Unicode font, if you only need to
-// print standard ASCII chars, you can use core fonts like
-// helvetica or times to reduce file size.
-$pdf->SetFont('helvetica', '', 14, '', true);
-// Add a page
-// This method has several options, check the source code documentation for more information.
-$pdf->AddPage();
-// Print text using writeHTMLCell()
-$pdf->writeHTMLCell($w = 0, $h = 0, $x = '', $y = '', $html, $border = 0, $ln = 1, $fill = 0, $reseth = true, $align = '', $autopadding = true);
-// ---------------------------------------------------------
-// Close and output PDF document
-// This method has several options, check the source code documentation for more information.
-$pdf->Output('example_001.pdf', 'I');
-//============================================================+
-// END OF FILE
-//============================================================+
-?>
-
--- a/labs/tripPlannerTester.php
+++ /dev/null
@@ -1,88 +1,1 @@
-<?php
-include ('../include/common.inc.php');
-//Test code to grab transit times
-// make sure to sleep(10);
-$boundingBoxes = Array(
- "belconnen" => Array(
- "startlat" => - 35.1828,
- "startlon" => 149.0295,
- "finishlat" => - 35.2630,
- "finishlon" => 149.1045,
- ) ,
- "north gungahlin civic" => Array(
- "startlat" => - 35.2652,
- "startlon" => 149.1045,
- "finishlat" => -35.2955,
- "finishlon" => 149.1559,
- ) ,
- "west duffy" => Array(
- "startlat" => - 35.3252,
- "startlon" => 149.0240,
- "finishlat" => - 35.3997,
- "finishlon" => 149.0676,
- ) ,
- "central south" => Array(
- "startlat" => - 35.3042,
- "startlon" => 149.0762,
- "finishlat" => - 35.3370,
- "finishlon" => 149.1806,
- ) ,
- "south" => Array(
- "startlat" => - 35.3403,
- "startlon" => 149.0714,
- "finishlat" => - 35.4607,
- "finishlon" => 149.1243,
- )
-
-);
-$latdeltasize = 0.025;
-$londeltasize = 0.025;
-$from = "Barry Drive";
-$fromPlace = (startsWith($from, "-") ? $from : geocode($from, false));
-$startTime = "9:00 am";
-$startDate = "21/03/2011";
-$counter = 0;
-$useragent = "Mozilla/5.0 (Windows; U; Windows NT 5.1; en-US; rv:1.8.1.1) Gecko/20061204 Firefox/2.0.0.1";
-echo "<pre>";
-echo "lat,lon,time,latdeltasize, londeltasize, region key name\n";
-foreach ($boundingBoxes as $key => $boundingBox) {
- for ($i = $boundingBox['startlat']; $i >= $boundingBox['finishlat']; $i-= $latdeltasize) {
- for ($j = $boundingBox['startlon']; $j <= $boundingBox['finishlon']; $j+= $londeltasize) {
- $url = $otpAPIurl . "ws/plan?date=" . urlencode($startDate) . "&time=" . urlencode($startTime) . "&mode=TRANSIT%2CWALK&optimize=QUICK&maxWalkDistance=840&wheelchair=false&toPlace=" . $i . "," . $j . "&fromPlace=$fromPlace&intermediatePlaces=";
- $ch = curl_init($url);
- curl_setopt($ch, CURLOPT_RETURNTRANSFER, 1);
- curl_setopt($ch, CURLOPT_HEADER, 0);
- curl_setopt($ch, CURLOPT_HTTPHEADER, array(
- "Accept: application/json"
- ));
- curl_setopt($ch, CURLOPT_TIMEOUT, 5);
- $page = curl_exec($ch);
- if (curl_errno($ch)) {
- echo "Trip planner temporarily unavailable: " . curl_errno($ch) . " " . curl_error($ch);
- }
- else {
- $tripplan = json_decode($page);
- if (isset($tripplan->error)) var_dump($tripplan->error);
- $times = Array();
- if (is_array($tripplan->plan->itineraries->itinerary)) {
-
- foreach ($tripplan->plan->itineraries->itinerary as $itineraryNumber => $itinerary) {
- $times[] = floor($itinerary->duration / 60000);
- }
-
- }
- else {
- $times[] = floor($tripplan->plan->itineraries->itinerary->duration / 60000);
- }
- echo "$i,$j," . min($times) . ",$latdeltasize, $londeltasize,$key\n";
- }
- flush();
- ob_flush();
- curl_close($ch);
- }
- }
-}
-echo "</pre>";
-?>
-
--- a/layar_api.php
+++ b/layar_api.php
@@ -1,61 +1,72 @@
<?php
+
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
include ('include/common.inc.php');
$output = Array();
$output['hotspots'] = Array();
$output['layer'] = "canberrabusstops";
$max_page = 10;
$max_results = 50;
-$page_start = 0 + filter_var($_REQUEST['pageKey'], FILTER_SANITIZE_NUMBER_INT);
-$page_end = $max_page + filter_var($_REQUEST['pageKey'], FILTER_SANITIZE_NUMBER_INT);
-$lat = filter_var($_REQUEST['lat'], FILTER_SANITIZE_NUMBER_FLOAT, FILTER_FLAG_ALLOW_FRACTION);
-$lon = filter_var($_REQUEST['lon'], FILTER_SANITIZE_NUMBER_FLOAT, FILTER_FLAG_ALLOW_FRACTION);
-$url = $APIurl . "/json/neareststops?lat=$lat&lon=$lon&limit=50";
-$contents = json_decode(getPage($url));
-debug(print_r($contents, true));
+$page_start = 0 + $pageKey;
+$page_end = $max_page + $pageKey;
+$contents = getNearbyStops($lat, $lon, 50, $max_distance);
$stopNum = 0;
-foreach ($contents as $row) {
- $stopNum++;
- if ($stopNum > $page_start && $stopNum <= $page_end) {
- $hotspot = Array();
- $hotspot['id'] = $row[0];
- $hotspot['title'] = $row[1];
- $hotspot['type'] = 0;
- $hotspot['lat'] = floor($row[2] * 1000000);
- $hotspot['lon'] = floor($row[3] * 1000000);
- $hotspot['distance'] = distance($row[2], $row[3], $_REQUEST['lat'], $_REQUEST['lon']);
- $hotspot['actions'] = Array(
- Array(
- "label" => 'View more trips/information',
- 'uri' => 'http://bus.lambdacomplex.org/' . 'stop.php?stopid=' . $row[0]
- )
- );
- $url = $APIurl . "/json/stoptrips?stop=" . $row[0] . "&time=" . midnight_seconds() . "&service_period=" . service_period() . "&limit=4&time_range=" . strval(90 * 60);
- $trips = json_decode(getPage($url));
- debug(print_r($trips, true));
- foreach ($trips as $key => $row) {
- if ($key < 3) {
- $hotspot['line' . strval($key + 2) ] = $row[1][1] . ' @ ' . midnight_seconds_to_time($row[0]);
- }
- }
- if (sizeof($trips) == 0) $hotspot['line2'] = 'No trips in the near future.';
- $output['hotspots'][] = $hotspot;
- }
+foreach ($contents as $stop) {
+ $stopNum++;
+ if ($stopNum > $page_start && $stopNum <= $page_end) {
+ $hotspot = Array();
+ $hotspot['id'] = $stop['stop_id'];
+ $hotspot['title'] = $stop['stop_name'];
+ $hotspot['type'] = 0;
+ $hotspot['lat'] = floor($stop['stop_lat'] * 1000000);
+ $hotspot['lon'] = floor($stop['stop_lon'] * 1000000);
+ $hotspot['distance'] = floor($stop['distance']);
+ $hotspot['attribution'] = "ACTION Buses";
+ $hotspot['actions'] = Array(
+ Array(
+ "label" => 'View more trips/information',
+ 'uri' => 'http://bus.lambdacomplex.org/' . 'stop.php?stopid=' . $stop['stop_id']
+ )
+ );
+ $trips = getStopTripsWithTimes($stop['stop_id'], "", "", "", 3);
+ foreach ($trips as $key => $row) {
+ if ($key < 3) {
+ $destination = getTripDestination($row['trip_id']);
+ $hotspot['line' . strval($key + 2)] = $row['route_short_name'] . ' ' . $destination['stop_name'] . ' @ ' . $row['arrival_time'];
+ }
+ }
+ if (sizeof($trips) == 0)
+ $hotspot['line2'] = 'No trips in the near future.';
+ $output['hotspots'][] = $hotspot;
+ }
}
if (sizeof($hotspot) > 0) {
- $output['errorString'] = 'ok';
- $output['errorCode'] = 0;
+ $output['errorString'] = 'ok';
+ $output['errorCode'] = 0;
+} else {
+ $output['errorString'] = 'no results, try increasing range';
+ $output['errorCode'] = 21;
}
-else {
- $output['errorString'] = 'no results, try increasing range';
- $output['errorCode'] = 21;
-}
-if ($page_end >= $max_results || sizeof($hotspot) < $max_page) {
- $output["morePages"] = false;
- $output["nextPageKey"] = null;
-}
-else {
- $output["morePages"] = true;
- $output["nextPageKey"] = $page_end;
+if ($page_end >= $max_results || sizeof($contents) < $page_start + $max_page) {
+ $output["morePages"] = false;
+ $output["nextPageKey"] = null;
+} else {
+ $output["morePages"] = true;
+ $output["nextPageKey"] = $page_end;
}
echo json_encode($output);
?>
--- /dev/null
+++ b/lib/Protobuf-PHP/LICENSE
@@ -1,1 +1,21 @@
+The MIT License
+Copyright (c) 2011 Iván -DrSlump- Montes
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
--- /dev/null
+++ b/lib/Protobuf-PHP/README.md
@@ -1,1 +1,198 @@
+Protobuf for PHP
+================
+Protobuf for PHP is an implementation of Google's Protocol Buffers for the PHP
+language, supporting its binary data serialization and including a `protoc`
+plugin to generate PHP classes from .proto files.
+
+Great effort has been put into generating PHP files that include all sort of type
+hints to aide IDE's with autocompletion. Therefore, it can not only be used to
+communicate with Protocol Buffers services but also as a generation tool for
+_data objects_ no matter what the final serialization is.
+
+For more information see the [included man pages](http://drslump.github.com/Protobuf-PHP/).
+
+
+## Requirements
+
+ - PHP 5.3
+ - Pear's Console_CommandLine (for the protoc wrapper tool)
+ - Google's `protoc` compiler version 2.3 or above
+ - GMP or BC Math extensions ¹
+
+ ¹ Only needed for negative values in `int32`, `int64` or `fixed64` types. See
+ the _known issues_ section.
+
+
+## Features
+
+### Working
+
+ - Standard types (numbers, string, enums, messages, etc)
+ - Pluggable serialization backends (codecs)
+ - Standard Binary
+ - Standard TextFormat ¹
+ - PhpArray
+ - JSON
+ - [ProtoJson](https://github.com/drslump/ProtoJson) (_TagMap_ and _Indexed_ variants)
+ - XML
+ - Protoc compiler plugin to generate the PHP classes
+ - Extensions
+ - Unknown fields
+ - Packed fields
+ - Reflection
+ - Dynamic messages with annotations support
+ - Generates service interfaces
+ - Includes comments from .proto files in the generated files
+ - Pear package for easy installation
+
+¹ Only serialization is supported
+
+### Future
+
+ - Speed optimized code generation mode
+ - Support numbers beyond PHP's native limits
+
+
+
+## Example usage
+
+ $person = new Tutorial\Person();
+ $person->name = 'DrSlump';
+ $person->setId(12);
+
+ $book = new Tutorial\AddressBook();
+ $book->addPerson($person);
+
+ // Use default codec
+ $data = $book->serialize();
+
+ // Use custom codec
+ $codec = new \DrSlump\Protobuf\Codec\Binary();
+ $data = $codec->encode($book);
+ // ... or ...
+ $data = $book->serialize($codec);
+
+
+## Installation
+
+Install with Pear
+
+ pear channel-discover pear.pollinimini.net
+ pear install drslump/Protobuf-beta
+
+You can also get the latest version by checking out a copy of the
+repository in your computer.
+
+
+
+## Known issues
+
+
+### Types
+
+PHP is very weak when dealing with numbers processing. Several work arounds have been applied
+to the standard binary codec to reduce incompatibilities between Protobuf types and PHP ones.
+
+ - Protobuf stores floating point values using the [IEEE 754](http://en.wikipedia.org/wiki/IEEE_754) standard
+ with 64bit words for the `double` and 32bit for the `float` types. PHP supports IEEE 754 natively although
+ the precission is platform dependant, however it typically supports 64bit doubles. It means that
+ if your PHP was compiled with 64bit sized doubles (or greater) you shouldn't have any problem encoding
+ and decoded float and double typed values with Protobuf.
+
+ - Integer values are also [platform dependant in PHP](http://www.php.net/manual/en/language.types.integer.php).
+ The library has been developed and tested against PHP binaries compiled with 64bit integers. The encoding and
+ decoding algorithm should in theory work no matter if PHP uses 32bit or 64bit integers internally, just take
+ into account that with 32bit integers the numbers cannot exceed in any case the `PHP_INT_MAX` value (2147483647).
+
+ While Protobuf supports unsigned integers PHP does not. In fact, numbers above the compiled PHP maximum
+ integer (`PHP_INT_MAX`, 0x7FFFFFFFFFFFFFFF for 64bits) will be automatically casted to doubles, which
+ typically will offer 53bits of decimal precission, allowing to safely work with numbers upto
+ 0x20000000000000 (2^53), even if they are represented in PHP as floats instead of integers. Higher numbers
+ will loose precission or might even return an _infinity_ value, note that the library does not include
+ any checking for these numbers and using them might provoke unexpected behaviour.
+
+ Negative values when encoded as `int32`, `int64` or `fixed64` types require the big integer extensions
+ [GMP](http://www.php.net/gmp) or [BC Math](http://www.php.net/bc) (the later only for 64bit architectures)
+ to be available in your PHP environment. The reason is that when encoding these negative numbers without
+ using _zigzag_ the binary representation uses the most significant bit for the sign, thus the numbers become
+ above the maximum supported values in PHP. The library will check for these conditions and will automatically
+ try to use GMP or BC to process the value.
+
+
+### Strings
+
+The binary codec expects strings to be encoded using UTF-8. PHP does not natively support string encodings,
+PHP's string data type is basically a length delimited stream of bytes, so it's not trivial to include
+automatic encoding conversion into the library encoding and decoding routines. Instead of trying to guess
+or offer a configuration interface for the encoding, the binary codec will process the `string` type just as
+it would process `byte` one, delegating on your application the task of encoding or decoding in the desired
+character set.
+
+### Memory usage
+
+Large messages might be troublesome since the way the library is modelled does not allow to parse or
+serialize messages as a streams, instead the whole operation is performed in memory, which allows for faster
+processing but could consume too much RAM if messages are too large.
+
+
+### Unknown fields
+
+Since wire types are different across different codec's formats, it's not possible to transcode unkwnon
+fields consumed in one codec to another. This means, for example, that when consuming a message using the
+binary codec, if it contains unknown fields, they won't be included when serializing the message using the
+Json codec.
+
+
+## Generating PHP classes
+
+The generation tool is designed to be run as a `protoc` plugin, thus it should
+work with any proto file supported by the official compiler.
+
+ protoc --plugin=protoc-gen-php --php_out=./build tutorial.proto
+
+To make use of non-standard options in your proto files (like `php.namespace`) you'll
+have to import the `php.proto` file included with the library. It's location will
+depend on where you've installed this library.
+
+ protoc -I=./Protobuf-PHP/library/DrSlump/Protobuf/Compiler/protos \
+ --plugin=protoc-gen-php --php_out=./build tutorial.proto
+
+In order to make your life easier, the supplied protoc plugin offers an additional
+execution mode, where it acts as a wrapper for the `protoc` invocation. It will
+automatically include the `php.proto` path so that you don't need to worry about it.
+
+ protoc-gen-php -o ./build tutorial.proto
+
+
+## LICENSE:
+
+ The MIT License
+
+ Copyright (c) 2011 Iván -DrSlump- Montes
+
+ Permission is hereby granted, free of charge, to any person obtaining
+ a copy of this software and associated documentation files (the
+ 'Software'), to deal in the Software without restriction, including
+ without limitation the rights to use, copy, modify, merge, publish,
+ distribute, sublicense, and/or sell copies of the Software, and to
+ permit persons to whom the Software is furnished to do so, subject to
+ the following conditions:
+
+ The above copyright notice and this permission notice shall be
+ included in all copies or substantial portions of the Software.
+
+ THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+ EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+ MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+ IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+ CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+ TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+ SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+
+
+
+
+
+
+
--- /dev/null
+++ b/lib/Protobuf-PHP/Rakefile
@@ -1,1 +1,120 @@
+# encoding: utf-8
+namespace :pear do
+ support_files = ['README.md', 'LICENSE', 'protoc-gen-php.php', 'protoc-gen-php.bat']
+ tpl_file = 'package.pear'
+ xml_file = 'library/package.xml'
+
+ desc "Generate package.xml"
+ task :xml => [:clean] do |t, args|
+ unless ENV['version'] then
+ puts 'Version number not given. Use "pear:xml version=1.0"'
+ exit 1
+ end
+
+ # Get template contents
+ text = File.read(tpl_file, :encoding => "UTF-8")
+ # Replace the version, date and time
+ text = text.gsub("{VERSION}", ENV['version'])
+ text = text.gsub('{DATE}', Time.now.strftime('%Y-%m-%d'))
+ text = text.gsub('{TIME}', Time.now.strftime('%H:%M:%S'))
+
+ # Include source files
+ dirs = []
+ Dir.glob('library/**/*.*') do |file|
+ file[0, 'library/'.length] = ''
+ dirs << '<file name="' + file + '" role="php">'
+ dirs << '<tasks:replace from="@package_version@" to="version" type="package-info" />'
+ dirs << '</file>'
+ end
+
+ text = text.gsub('{DIRS}', dirs.join("\n"))
+
+ # Generate a new pear package.xml
+ xml = File.new(xml_file, 'w')
+ xml.syswrite(text);
+ xml.close();
+ end
+
+ desc "Build a release"
+ task :package => ['doc:build', :xml] do
+
+ # Copy supporting files to the package root
+
+ support_files.each do |file|
+ cp file, "library/#{file}"
+ end
+
+ begin
+ sh "pear package -n #{xml_file}"
+ rescue Exception => e
+ puts "Rolling back..."
+ Rake::Task['pear:clean'].execute
+ raise
+ end
+
+ Rake::Task['pear:clean'].execute
+ end
+
+ desc "Clean up"
+ task :clean do
+ puts "Cleaning up..."
+
+ # Remove package.xml
+ rm_f xml_file
+
+ # Remove supporting files
+ support_files.each { |file| rm_f "library/#{file}" }
+ end
+
+end
+
+namespace :doc do
+
+ desc "Generate manual"
+ task :build do
+ version = ENV['version']
+ ENV['RONN_MANUAL'] = "Protobuf-PHP #{version}"
+ ENV['RONN_ORGANIZATION'] = "Ivan -DrSlump- Montes"
+ sh "ronn -w -s toc -r5 --markdown man/*.ronn"
+ end
+
+ desc 'Publish to github pages'
+ task :github => 'doc:build' do
+ require 'git'
+ require 'logger'
+
+ remote = `git remote show origin`
+ .split(%r{\n}) # Ruby 1.9 only has grep() on Array
+ .grep(/Push.*URL/)
+ .first[/git@.*/]
+
+ files = [
+ 'protoc-gen-php.1.html',
+ 'protobuf-php.3.html',
+ 'protobuf-php.5.html',
+ ]
+
+ root = "/tmp/checkout-#{Time.now.to_i}"
+ g = Git.clone(remote, root, :log => Logger.new(STDOUT))
+
+ # Make sure this actually switches branches.
+ g.checkout(g.branch('gh-pages'))
+
+ files.each {|file|
+ cp "man/#{file}", "#{root}/."
+ g.add(file)
+ }
+
+ g.commit('Regenerating Github Pages.')
+
+ # PUSH!
+ g.push(g.remote('origin'), g.branch('gh-pages'))
+
+ puts '--> GitHub Pages Commit and Push successful.'
+ end
+
+end
+
+
+
--- /dev/null
+++ b/lib/Protobuf-PHP/gtfs-realtime.php
@@ -1,1 +1,3673 @@
-
+<?php
+// DO NOT EDIT! Generated by Protobuf-PHP protoc plugin @package_version@
+// cmd line php -f protoc-gen-php.php gtfs-realtime.proto -i ./
+// Source: gtfs-realtime.proto
+// Date: 2011-08-23 07:08:46
+
+// @@protoc_insertion_point(scope_file)
+
+namespace transit_realtime {
+
+ // @@protoc_insertion_point(scope_namespace)
+ // @@protoc_insertion_point(namespace_transit_realtime)
+
+ class FeedMessage extends \DrSlump\Protobuf\Message {
+
+ /** @var \Closure[] */
+ protected static $__extensions = array();
+
+ public static function descriptor()
+ {
+ $descriptor = new \DrSlump\Protobuf\Descriptor(__CLASS__, 'transit_realtime.FeedMessage');
+
+ // required .transit_realtime.FeedHeader header = 1
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 1;
+ $f->name = "header";
+ $f->type = 11;
+ $f->rule = 2;
+ $f->reference = '\transit_realtime\FeedHeader';
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.FeedMessage:header)
+ $descriptor->addField($f);
+
+ // repeated .transit_realtime.FeedEntity entity = 2
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 2;
+ $f->name = "entity";
+ $f->type = 11;
+ $f->rule = 3;
+ $f->reference = '\transit_realtime\FeedEntity';
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.FeedMessage:entity)
+ $descriptor->addField($f);
+
+ foreach (self::$__extensions as $cb) {
+ $descriptor->addField($cb(), true);
+ }
+
+ // @@protoc_insertion_point(scope_descriptor)
+ // @@protoc_insertion_point(descriptor_transit_realtime.FeedMessage)
+
+ return $descriptor;
+ }
+
+ /** @var \transit_realtime\FeedHeader */
+ public $header = null;
+
+ /** @var \transit_realtime\FeedEntity[] */
+ public $entity = array();
+
+
+ /**
+ * Check if <header> has a value
+ *
+ * @return boolean
+ */
+ public function hasHeader(){
+ return $this->_has(1);
+ }
+
+ /**
+ * Clear <header> value
+ *
+ * @return \transit_realtime\FeedMessage
+ */
+ public function clearHeader(){
+ return $this->_clear(1);
+ }
+
+ /**
+ * Get <header> value
+ *
+ * @return \transit_realtime\FeedHeader
+ */
+ public function getHeader(){
+ return $this->_get(1);
+ }
+
+ /**
+ * Set <header> value
+ *
+ * @param \transit_realtime\FeedHeader $value
+ * @return \transit_realtime\FeedMessage
+ */
+ public function setHeader(\transit_realtime\FeedHeader $value){
+ return $this->_set(1, $value);
+ }
+
+ /**
+ * Check if <entity> has a value
+ *
+ * @return boolean
+ */
+ public function hasEntity(){
+ return $this->_has(2);
+ }
+
+ /**
+ * Clear <entity> value
+ *
+ * @return \transit_realtime\FeedMessage
+ */
+ public function clearEntity(){
+ return $this->_clear(2);
+ }
+
+ /**
+ * Get <entity> value
+ *
+ * @param int $idx
+ * @return \transit_realtime\FeedEntity
+ */
+ public function getEntity($idx = NULL){
+ return $this->_get(2, $idx);
+ }
+
+ /**
+ * Set <entity> value
+ *
+ * @param \transit_realtime\FeedEntity $value
+ * @return \transit_realtime\FeedMessage
+ */
+ public function setEntity(\transit_realtime\FeedEntity $value, $idx = NULL){
+ return $this->_set(2, $value, $idx);
+ }
+
+ /**
+ * Get all elements of <entity>
+ *
+ * @return \transit_realtime\FeedEntity[]
+ */
+ public function getEntityList(){
+ return $this->_get(2);
+ }
+
+ /**
+ * Add a new element to <entity>
+ *
+ * @param \transit_realtime\FeedEntity $value
+ * @return \transit_realtime\FeedMessage
+ */
+ public function addEntity(\transit_realtime\FeedEntity $value){
+ return $this->_add(2, $value);
+ }
+
+
+ // @@protoc_insertion_point(scope_class)
+ // @@protoc_insertion_point(class_transit_realtime.FeedMessage)
+ }
+}
+
+namespace transit_realtime\FeedHeader {
+
+ // @@protoc_insertion_point(scope_namespace)
+ // @@protoc_insertion_point(namespace_transit_realtime.FeedHeader)
+
+ class Incrementality {
+ const FULL_DATASET = 0;
+ const DIFFERENTIAL = 1;
+
+ // @@protoc_insertion_point(scope_class)
+ // @@protoc_insertion_point(class_transit_realtime.FeedHeader.Incrementality)
+ }
+}
+namespace transit_realtime {
+
+ // @@protoc_insertion_point(scope_namespace)
+ // @@protoc_insertion_point(namespace_transit_realtime)
+
+ class FeedHeader extends \DrSlump\Protobuf\Message {
+
+ /** @var \Closure[] */
+ protected static $__extensions = array();
+
+ public static function descriptor()
+ {
+ $descriptor = new \DrSlump\Protobuf\Descriptor(__CLASS__, 'transit_realtime.FeedHeader');
+
+ // required gtfs_realtime_version = 1
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 1;
+ $f->name = "gtfs_realtime_version";
+ $f->type = 9;
+ $f->rule = 2;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.FeedHeader:gtfs_realtime_version)
+ $descriptor->addField($f);
+
+ // optional .transit_realtime.FeedHeader.Incrementality incrementality = 2
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 2;
+ $f->name = "incrementality";
+ $f->type = 14;
+ $f->rule = 1;
+ $f->reference = '\transit_realtime\FeedHeader\Incrementality';
+ $f->default = \transit_realtime\FeedHeader\Incrementality::FULL_DATASET;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.FeedHeader:incrementality)
+ $descriptor->addField($f);
+
+ // optional timestamp = 3
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 3;
+ $f->name = "timestamp";
+ $f->type = 4;
+ $f->rule = 1;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.FeedHeader:timestamp)
+ $descriptor->addField($f);
+
+ foreach (self::$__extensions as $cb) {
+ $descriptor->addField($cb(), true);
+ }
+
+ // @@protoc_insertion_point(scope_descriptor)
+ // @@protoc_insertion_point(descriptor_transit_realtime.FeedHeader)
+
+ return $descriptor;
+ }
+
+ /** @var string */
+ public $gtfs_realtime_version = null;
+
+ /** @var int - \transit_realtime\FeedHeader\Incrementality */
+ public $incrementality = \transit_realtime\FeedHeader\Incrementality::FULL_DATASET;
+
+ /** @var int */
+ public $timestamp = null;
+
+
+ /**
+ * Check if <gtfs_realtime_version> has a value
+ *
+ * @return boolean
+ */
+ public function hasGtfsRealtimeVersion(){
+ return $this->_has(1);
+ }
+
+ /**
+ * Clear <gtfs_realtime_version> value
+ *
+ * @return \transit_realtime\FeedHeader
+ */
+ public function clearGtfsRealtimeVersion(){
+ return $this->_clear(1);
+ }
+
+ /**
+ * Get <gtfs_realtime_version> value
+ *
+ * @return string
+ */
+ public function getGtfsRealtimeVersion(){
+ return $this->_get(1);
+ }
+
+ /**
+ * Set <gtfs_realtime_version> value
+ *
+ * @param string $value
+ * @return \transit_realtime\FeedHeader
+ */
+ public function setGtfsRealtimeVersion( $value){
+ return $this->_set(1, $value);
+ }
+
+ /**
+ * Check if <incrementality> has a value
+ *
+ * @return boolean
+ */
+ public function hasIncrementality(){
+ return $this->_has(2);
+ }
+
+ /**
+ * Clear <incrementality> value
+ *
+ * @return \transit_realtime\FeedHeader
+ */
+ public function clearIncrementality(){
+ return $this->_clear(2);
+ }
+
+ /**
+ * Get <incrementality> value
+ *
+ * @return int - \transit_realtime\FeedHeader\Incrementality
+ */
+ public function getIncrementality(){
+ return $this->_get(2);
+ }
+
+ /**
+ * Set <incrementality> value
+ *
+ * @param int - \transit_realtime\FeedHeader\Incrementality $value
+ * @return \transit_realtime\FeedHeader
+ */
+ public function setIncrementality( $value){
+ return $this->_set(2, $value);
+ }
+
+ /**
+ * Check if <timestamp> has a value
+ *
+ * @return boolean
+ */
+ public function hasTimestamp(){
+ return $this->_has(3);
+ }
+
+ /**
+ * Clear <timestamp> value
+ *
+ * @return \transit_realtime\FeedHeader
+ */
+ public function clearTimestamp(){
+ return $this->_clear(3);
+ }
+
+ /**
+ * Get <timestamp> value
+ *
+ * @return int
+ */
+ public function getTimestamp(){
+ return $this->_get(3);
+ }
+
+ /**
+ * Set <timestamp> value
+ *
+ * @param int $value
+ * @return \transit_realtime\FeedHeader
+ */
+ public function setTimestamp( $value){
+ return $this->_set(3, $value);
+ }
+
+
+ // @@protoc_insertion_point(scope_class)
+ // @@protoc_insertion_point(class_transit_realtime.FeedHeader)
+ }
+}
+
+namespace transit_realtime {
+
+ // @@protoc_insertion_point(scope_namespace)
+ // @@protoc_insertion_point(namespace_transit_realtime)
+
+ class FeedEntity extends \DrSlump\Protobuf\Message {
+
+ /** @var \Closure[] */
+ protected static $__extensions = array();
+
+ public static function descriptor()
+ {
+ $descriptor = new \DrSlump\Protobuf\Descriptor(__CLASS__, 'transit_realtime.FeedEntity');
+
+ // required id = 1
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 1;
+ $f->name = "id";
+ $f->type = 9;
+ $f->rule = 2;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.FeedEntity:id)
+ $descriptor->addField($f);
+
+ // optional is_deleted = 2
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 2;
+ $f->name = "is_deleted";
+ $f->type = 8;
+ $f->rule = 1;
+ $f->default = false;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.FeedEntity:is_deleted)
+ $descriptor->addField($f);
+
+ // optional .transit_realtime.TripUpdate trip_update = 3
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 3;
+ $f->name = "trip_update";
+ $f->type = 11;
+ $f->rule = 1;
+ $f->reference = '\transit_realtime\TripUpdate';
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.FeedEntity:trip_update)
+ $descriptor->addField($f);
+
+ // optional .transit_realtime.VehiclePosition vehicle = 4
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 4;
+ $f->name = "vehicle";
+ $f->type = 11;
+ $f->rule = 1;
+ $f->reference = '\transit_realtime\VehiclePosition';
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.FeedEntity:vehicle)
+ $descriptor->addField($f);
+
+ // optional .transit_realtime.Alert alert = 5
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 5;
+ $f->name = "alert";
+ $f->type = 11;
+ $f->rule = 1;
+ $f->reference = '\transit_realtime\Alert';
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.FeedEntity:alert)
+ $descriptor->addField($f);
+
+ foreach (self::$__extensions as $cb) {
+ $descriptor->addField($cb(), true);
+ }
+
+ // @@protoc_insertion_point(scope_descriptor)
+ // @@protoc_insertion_point(descriptor_transit_realtime.FeedEntity)
+
+ return $descriptor;
+ }
+
+ /** @var string */
+ public $id = null;
+
+ /** @var boolean */
+ public $is_deleted = true;
+
+ /** @var \transit_realtime\TripUpdate */
+ public $trip_update = null;
+
+ /** @var \transit_realtime\VehiclePosition */
+ public $vehicle = null;
+
+ /** @var \transit_realtime\Alert */
+ public $alert = null;
+
+
+ /**
+ * Check if <id> has a value
+ *
+ * @return boolean
+ */
+ public function hasId(){
+ return $this->_has(1);
+ }
+
+ /**
+ * Clear <id> value
+ *
+ * @return \transit_realtime\FeedEntity
+ */
+ public function clearId(){
+ return $this->_clear(1);
+ }
+
+ /**
+ * Get <id> value
+ *
+ * @return string
+ */
+ public function getId(){
+ return $this->_get(1);
+ }
+
+ /**
+ * Set <id> value
+ *
+ * @param string $value
+ * @return \transit_realtime\FeedEntity
+ */
+ public function setId( $value){
+ return $this->_set(1, $value);
+ }
+
+ /**
+ * Check if <is_deleted> has a value
+ *
+ * @return boolean
+ */
+ public function hasIsDeleted(){
+ return $this->_has(2);
+ }
+
+ /**
+ * Clear <is_deleted> value
+ *
+ * @return \transit_realtime\FeedEntity
+ */
+ public function clearIsDeleted(){
+ return $this->_clear(2);
+ }
+
+ /**
+ * Get <is_deleted> value
+ *
+ * @return boolean
+ */
+ public function getIsDeleted(){
+ return $this->_get(2);
+ }
+
+ /**
+ * Set <is_deleted> value
+ *
+ * @param boolean $value
+ * @return \transit_realtime\FeedEntity
+ */
+ public function setIsDeleted( $value){
+ return $this->_set(2, $value);
+ }
+
+ /**
+ * Check if <trip_update> has a value
+ *
+ * @return boolean
+ */
+ public function hasTripUpdate(){
+ return $this->_has(3);
+ }
+
+ /**
+ * Clear <trip_update> value
+ *
+ * @return \transit_realtime\FeedEntity
+ */
+ public function clearTripUpdate(){
+ return $this->_clear(3);
+ }
+
+ /**
+ * Get <trip_update> value
+ *
+ * @return \transit_realtime\TripUpdate
+ */
+ public function getTripUpdate(){
+ return $this->_get(3);
+ }
+
+ /**
+ * Set <trip_update> value
+ *
+ * @param \transit_realtime\TripUpdate $value
+ * @return \transit_realtime\FeedEntity
+ */
+ public function setTripUpdate(\transit_realtime\TripUpdate $value){
+ return $this->_set(3, $value);
+ }
+
+ /**
+ * Check if <vehicle> has a value
+ *
+ * @return boolean
+ */
+ public function hasVehicle(){
+ return $this->_has(4);
+ }
+
+ /**
+ * Clear <vehicle> value
+ *
+ * @return \transit_realtime\FeedEntity
+ */
+ public function clearVehicle(){
+ return $this->_clear(4);
+ }
+
+ /**
+ * Get <vehicle> value
+ *
+ * @return \transit_realtime\VehiclePosition
+ */
+ public function getVehicle(){
+ return $this->_get(4);
+ }
+
+ /**
+ * Set <vehicle> value
+ *
+ * @param \transit_realtime\VehiclePosition $value
+ * @return \transit_realtime\FeedEntity
+ */
+ public function setVehicle(\transit_realtime\VehiclePosition $value){
+ return $this->_set(4, $value);
+ }
+
+ /**
+ * Check if <alert> has a value
+ *
+ * @return boolean
+ */
+ public function hasAlert(){
+ return $this->_has(5);
+ }
+
+ /**
+ * Clear <alert> value
+ *
+ * @return \transit_realtime\FeedEntity
+ */
+ public function clearAlert(){
+ return $this->_clear(5);
+ }
+
+ /**
+ * Get <alert> value
+ *
+ * @return \transit_realtime\Alert
+ */
+ public function getAlert(){
+ return $this->_get(5);
+ }
+
+ /**
+ * Set <alert> value
+ *
+ * @param \transit_realtime\Alert $value
+ * @return \transit_realtime\FeedEntity
+ */
+ public function setAlert(\transit_realtime\Alert $value){
+ return $this->_set(5, $value);
+ }
+
+
+ // @@protoc_insertion_point(scope_class)
+ // @@protoc_insertion_point(class_transit_realtime.FeedEntity)
+ }
+}
+
+namespace transit_realtime\TripUpdate {
+
+ // @@protoc_insertion_point(scope_namespace)
+ // @@protoc_insertion_point(namespace_transit_realtime.TripUpdate)
+
+ class StopTimeEvent extends \DrSlump\Protobuf\Message {
+
+ /** @var \Closure[] */
+ protected static $__extensions = array();
+
+ public static function descriptor()
+ {
+ $descriptor = new \DrSlump\Protobuf\Descriptor(__CLASS__, 'transit_realtime.TripUpdate.StopTimeEvent');
+
+ // optional delay = 1
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 1;
+ $f->name = "delay";
+ $f->type = 5;
+ $f->rule = 1;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.TripUpdate.StopTimeEvent:delay)
+ $descriptor->addField($f);
+
+ // optional time = 2
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 2;
+ $f->name = "time";
+ $f->type = 3;
+ $f->rule = 1;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.TripUpdate.StopTimeEvent:time)
+ $descriptor->addField($f);
+
+ // optional uncertainty = 3
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 3;
+ $f->name = "uncertainty";
+ $f->type = 5;
+ $f->rule = 1;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.TripUpdate.StopTimeEvent:uncertainty)
+ $descriptor->addField($f);
+
+ foreach (self::$__extensions as $cb) {
+ $descriptor->addField($cb(), true);
+ }
+
+ // @@protoc_insertion_point(scope_descriptor)
+ // @@protoc_insertion_point(descriptor_transit_realtime.TripUpdate.StopTimeEvent)
+
+ return $descriptor;
+ }
+
+ /** @var int */
+ public $delay = null;
+
+ /** @var int */
+ public $time = null;
+
+ /** @var int */
+ public $uncertainty = null;
+
+
+ /**
+ * Check if <delay> has a value
+ *
+ * @return boolean
+ */
+ public function hasDelay(){
+ return $this->_has(1);
+ }
+
+ /**
+ * Clear <delay> value
+ *
+ * @return \transit_realtime\TripUpdate\StopTimeEvent
+ */
+ public function clearDelay(){
+ return $this->_clear(1);
+ }
+
+ /**
+ * Get <delay> value
+ *
+ * @return int
+ */
+ public function getDelay(){
+ return $this->_get(1);
+ }
+
+ /**
+ * Set <delay> value
+ *
+ * @param int $value
+ * @return \transit_realtime\TripUpdate\StopTimeEvent
+ */
+ public function setDelay( $value){
+ return $this->_set(1, $value);
+ }
+
+ /**
+ * Check if <time> has a value
+ *
+ * @return boolean
+ */
+ public function hasTime(){
+ return $this->_has(2);
+ }
+
+ /**
+ * Clear <time> value
+ *
+ * @return \transit_realtime\TripUpdate\StopTimeEvent
+ */
+ public function clearTime(){
+ return $this->_clear(2);
+ }
+
+ /**
+ * Get <time> value
+ *
+ * @return int
+ */
+ public function getTime(){
+ return $this->_get(2);
+ }
+
+ /**
+ * Set <time> value
+ *
+ * @param int $value
+ * @return \transit_realtime\TripUpdate\StopTimeEvent
+ */
+ public function setTime( $value){
+ return $this->_set(2, $value);
+ }
+
+ /**
+ * Check if <uncertainty> has a value
+ *
+ * @return boolean
+ */
+ public function hasUncertainty(){
+ return $this->_has(3);
+ }
+
+ /**
+ * Clear <uncertainty> value
+ *
+ * @return \transit_realtime\TripUpdate\StopTimeEvent
+ */
+ public function clearUncertainty(){
+ return $this->_clear(3);
+ }
+
+ /**
+ * Get <uncertainty> value
+ *
+ * @return int
+ */
+ public function getUncertainty(){
+ return $this->_get(3);
+ }
+
+ /**
+ * Set <uncertainty> value
+ *
+ * @param int $value
+ * @return \transit_realtime\TripUpdate\StopTimeEvent
+ */
+ public function setUncertainty( $value){
+ return $this->_set(3, $value);
+ }
+
+
+ // @@protoc_insertion_point(scope_class)
+ // @@protoc_insertion_point(class_transit_realtime.TripUpdate.StopTimeEvent)
+ }
+}
+
+namespace transit_realtime\TripUpdate\StopTimeUpdate {
+
+ // @@protoc_insertion_point(scope_namespace)
+ // @@protoc_insertion_point(namespace_transit_realtime.TripUpdate.StopTimeUpdate)
+
+ class ScheduleRelationship {
+ const SCHEDULED = 0;
+ const SKIPPED = 1;
+ const NO_DATA = 2;
+
+ // @@protoc_insertion_point(scope_class)
+ // @@protoc_insertion_point(class_transit_realtime.TripUpdate.StopTimeUpdate.ScheduleRelationship)
+ }
+}
+namespace transit_realtime\TripUpdate {
+
+ // @@protoc_insertion_point(scope_namespace)
+ // @@protoc_insertion_point(namespace_transit_realtime.TripUpdate)
+
+ class StopTimeUpdate extends \DrSlump\Protobuf\Message {
+
+ /** @var \Closure[] */
+ protected static $__extensions = array();
+
+ public static function descriptor()
+ {
+ $descriptor = new \DrSlump\Protobuf\Descriptor(__CLASS__, 'transit_realtime.TripUpdate.StopTimeUpdate');
+
+ // optional stop_sequence = 1
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 1;
+ $f->name = "stop_sequence";
+ $f->type = 13;
+ $f->rule = 1;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.TripUpdate.StopTimeUpdate:stop_sequence)
+ $descriptor->addField($f);
+
+ // optional stop_id = 4
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 4;
+ $f->name = "stop_id";
+ $f->type = 9;
+ $f->rule = 1;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.TripUpdate.StopTimeUpdate:stop_id)
+ $descriptor->addField($f);
+
+ // optional .transit_realtime.TripUpdate.StopTimeEvent arrival = 2
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 2;
+ $f->name = "arrival";
+ $f->type = 11;
+ $f->rule = 1;
+ $f->reference = '\transit_realtime\TripUpdate\StopTimeEvent';
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.TripUpdate.StopTimeUpdate:arrival)
+ $descriptor->addField($f);
+
+ // optional .transit_realtime.TripUpdate.StopTimeEvent departure = 3
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 3;
+ $f->name = "departure";
+ $f->type = 11;
+ $f->rule = 1;
+ $f->reference = '\transit_realtime\TripUpdate\StopTimeEvent';
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.TripUpdate.StopTimeUpdate:departure)
+ $descriptor->addField($f);
+
+ // optional .transit_realtime.TripUpdate.StopTimeUpdate.ScheduleRelationship schedule_relationship = 5
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 5;
+ $f->name = "schedule_relationship";
+ $f->type = 14;
+ $f->rule = 1;
+ $f->reference = '\transit_realtime\TripUpdate\StopTimeUpdate\ScheduleRelationship';
+ $f->default = \transit_realtime\TripUpdate\StopTimeUpdate\ScheduleRelationship::SCHEDULED;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.TripUpdate.StopTimeUpdate:schedule_relationship)
+ $descriptor->addField($f);
+
+ foreach (self::$__extensions as $cb) {
+ $descriptor->addField($cb(), true);
+ }
+
+ // @@protoc_insertion_point(scope_descriptor)
+ // @@protoc_insertion_point(descriptor_transit_realtime.TripUpdate.StopTimeUpdate)
+
+ return $descriptor;
+ }
+
+ /** @var int */
+ public $stop_sequence = null;
+
+ /** @var string */
+ public $stop_id = null;
+
+ /** @var \transit_realtime\TripUpdate\StopTimeEvent */
+ public $arrival = null;
+
+ /** @var \transit_realtime\TripUpdate\StopTimeEvent */
+ public $departure = null;
+
+ /** @var int - \transit_realtime\TripUpdate\StopTimeUpdate\ScheduleRelationship */
+ public $schedule_relationship = \transit_realtime\TripUpdate\StopTimeUpdate\ScheduleRelationship::SCHEDULED;
+
+
+ /**
+ * Check if <stop_sequence> has a value
+ *
+ * @return boolean
+ */
+ public function hasStopSequence(){
+ return $this->_has(1);
+ }
+
+ /**
+ * Clear <stop_sequence> value
+ *
+ * @return \transit_realtime\TripUpdate\StopTimeUpdate
+ */
+ public function clearStopSequence(){
+ return $this->_clear(1);
+ }
+
+ /**
+ * Get <stop_sequence> value
+ *
+ * @return int
+ */
+ public function getStopSequence(){
+ return $this->_get(1);
+ }
+
+ /**
+ * Set <stop_sequence> value
+ *
+ * @param int $value
+ * @return \transit_realtime\TripUpdate\StopTimeUpdate
+ */
+ public function setStopSequence( $value){
+ return $this->_set(1, $value);
+ }
+
+ /**
+ * Check if <stop_id> has a value
+ *
+ * @return boolean
+ */
+ public function hasStopId(){
+ return $this->_has(4);
+ }
+
+ /**
+ * Clear <stop_id> value
+ *
+ * @return \transit_realtime\TripUpdate\StopTimeUpdate
+ */
+ public function clearStopId(){
+ return $this->_clear(4);
+ }
+
+ /**
+ * Get <stop_id> value
+ *
+ * @return string
+ */
+ public function getStopId(){
+ return $this->_get(4);
+ }
+
+ /**
+ * Set <stop_id> value
+ *
+ * @param string $value
+ * @return \transit_realtime\TripUpdate\StopTimeUpdate
+ */
+ public function setStopId( $value){
+ return $this->_set(4, $value);
+ }
+
+ /**
+ * Check if <arrival> has a value
+ *
+ * @return boolean
+ */
+ public function hasArrival(){
+ return $this->_has(2);
+ }
+
+ /**
+ * Clear <arrival> value
+ *
+ * @return \transit_realtime\TripUpdate\StopTimeUpdate
+ */
+ public function clearArrival(){
+ return $this->_clear(2);
+ }
+
+ /**
+ * Get <arrival> value
+ *
+ * @return \transit_realtime\TripUpdate\StopTimeEvent
+ */
+ public function getArrival(){
+ return $this->_get(2);
+ }
+
+ /**
+ * Set <arrival> value
+ *
+ * @param \transit_realtime\TripUpdate\StopTimeEvent $value
+ * @return \transit_realtime\TripUpdate\StopTimeUpdate
+ */
+ public function setArrival(\transit_realtime\TripUpdate\StopTimeEvent $value){
+ return $this->_set(2, $value);
+ }
+
+ /**
+ * Check if <departure> has a value
+ *
+ * @return boolean
+ */
+ public function hasDeparture(){
+ return $this->_has(3);
+ }
+
+ /**
+ * Clear <departure> value
+ *
+ * @return \transit_realtime\TripUpdate\StopTimeUpdate
+ */
+ public function clearDeparture(){
+ return $this->_clear(3);
+ }
+
+ /**
+ * Get <departure> value
+ *
+ * @return \transit_realtime\TripUpdate\StopTimeEvent
+ */
+ public function getDeparture(){
+ return $this->_get(3);
+ }
+
+ /**
+ * Set <departure> value
+ *
+ * @param \transit_realtime\TripUpdate\StopTimeEvent $value
+ * @return \transit_realtime\TripUpdate\StopTimeUpdate
+ */
+ public function setDeparture(\transit_realtime\TripUpdate\StopTimeEvent $value){
+ return $this->_set(3, $value);
+ }
+
+ /**
+ * Check if <schedule_relationship> has a value
+ *
+ * @return boolean
+ */
+ public function hasScheduleRelationship(){
+ return $this->_has(5);
+ }
+
+ /**
+ * Clear <schedule_relationship> value
+ *
+ * @return \transit_realtime\TripUpdate\StopTimeUpdate
+ */
+ public function clearScheduleRelationship(){
+ return $this->_clear(5);
+ }
+
+ /**
+ * Get <schedule_relationship> value
+ *
+ * @return int - \transit_realtime\TripUpdate\StopTimeUpdate\ScheduleRelationship
+ */
+ public function getScheduleRelationship(){
+ return $this->_get(5);
+ }
+
+ /**
+ * Set <schedule_relationship> value
+ *
+ * @param int - \transit_realtime\TripUpdate\StopTimeUpdate\ScheduleRelationship $value
+ * @return \transit_realtime\TripUpdate\StopTimeUpdate
+ */
+ public function setScheduleRelationship( $value){
+ return $this->_set(5, $value);
+ }
+
+
+ // @@protoc_insertion_point(scope_class)
+ // @@protoc_insertion_point(class_transit_realtime.TripUpdate.StopTimeUpdate)
+ }
+}
+
+namespace transit_realtime {
+
+ // @@protoc_insertion_point(scope_namespace)
+ // @@protoc_insertion_point(namespace_transit_realtime)
+
+ class TripUpdate extends \DrSlump\Protobuf\Message {
+
+ /** @var \Closure[] */
+ protected static $__extensions = array();
+
+ public static function descriptor()
+ {
+ $descriptor = new \DrSlump\Protobuf\Descriptor(__CLASS__, 'transit_realtime.TripUpdate');
+
+ // required .transit_realtime.TripDescriptor trip = 1
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 1;
+ $f->name = "trip";
+ $f->type = 11;
+ $f->rule = 2;
+ $f->reference = '\transit_realtime\TripDescriptor';
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.TripUpdate:trip)
+ $descriptor->addField($f);
+
+ // optional .transit_realtime.VehicleDescriptor vehicle = 3
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 3;
+ $f->name = "vehicle";
+ $f->type = 11;
+ $f->rule = 1;
+ $f->reference = '\transit_realtime\VehicleDescriptor';
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.TripUpdate:vehicle)
+ $descriptor->addField($f);
+
+ // repeated .transit_realtime.TripUpdate.StopTimeUpdate stop_time_update = 2
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 2;
+ $f->name = "stop_time_update";
+ $f->type = 11;
+ $f->rule = 3;
+ $f->reference = '\transit_realtime\TripUpdate\StopTimeUpdate';
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.TripUpdate:stop_time_update)
+ $descriptor->addField($f);
+
+ foreach (self::$__extensions as $cb) {
+ $descriptor->addField($cb(), true);
+ }
+
+ // @@protoc_insertion_point(scope_descriptor)
+ // @@protoc_insertion_point(descriptor_transit_realtime.TripUpdate)
+
+ return $descriptor;
+ }
+
+ /** @var \transit_realtime\TripDescriptor */
+ public $trip = null;
+
+ /** @var \transit_realtime\VehicleDescriptor */
+ public $vehicle = null;
+
+ /** @var \transit_realtime\TripUpdate\StopTimeUpdate[] */
+ public $stop_time_update = array();
+
+
+ /**
+ * Check if <trip> has a value
+ *
+ * @return boolean
+ */
+ public function hasTrip(){
+ return $this->_has(1);
+ }
+
+ /**
+ * Clear <trip> value
+ *
+ * @return \transit_realtime\TripUpdate
+ */
+ public function clearTrip(){
+ return $this->_clear(1);
+ }
+
+ /**
+ * Get <trip> value
+ *
+ * @return \transit_realtime\TripDescriptor
+ */
+ public function getTrip(){
+ return $this->_get(1);
+ }
+
+ /**
+ * Set <trip> value
+ *
+ * @param \transit_realtime\TripDescriptor $value
+ * @return \transit_realtime\TripUpdate
+ */
+ public function setTrip(\transit_realtime\TripDescriptor $value){
+ return $this->_set(1, $value);
+ }
+
+ /**
+ * Check if <vehicle> has a value
+ *
+ * @return boolean
+ */
+ public function hasVehicle(){
+ return $this->_has(3);
+ }
+
+ /**
+ * Clear <vehicle> value
+ *
+ * @return \transit_realtime\TripUpdate
+ */
+ public function clearVehicle(){
+ return $this->_clear(3);
+ }
+
+ /**
+ * Get <vehicle> value
+ *
+ * @return \transit_realtime\VehicleDescriptor
+ */
+ public function getVehicle(){
+ return $this->_get(3);
+ }
+
+ /**
+ * Set <vehicle> value
+ *
+ * @param \transit_realtime\VehicleDescriptor $value
+ * @return \transit_realtime\TripUpdate
+ */
+ public function setVehicle(\transit_realtime\VehicleDescriptor $value){
+ return $this->_set(3, $value);
+ }
+
+ /**
+ * Check if <stop_time_update> has a value
+ *
+ * @return boolean
+ */
+ public function hasStopTimeUpdate(){
+ return $this->_has(2);
+ }
+
+ /**
+ * Clear <stop_time_update> value
+ *
+ * @return \transit_realtime\TripUpdate
+ */
+ public function clearStopTimeUpdate(){
+ return $this->_clear(2);
+ }
+
+ /**
+ * Get <stop_time_update> value
+ *
+ * @param int $idx
+ * @return \transit_realtime\TripUpdate\StopTimeUpdate
+ */
+ public function getStopTimeUpdate($idx = NULL){
+ return $this->_get(2, $idx);
+ }
+
+ /**
+ * Set <stop_time_update> value
+ *
+ * @param \transit_realtime\TripUpdate\StopTimeUpdate $value
+ * @return \transit_realtime\TripUpdate
+ */
+ public function setStopTimeUpdate(\transit_realtime\TripUpdate\StopTimeUpdate $value, $idx = NULL){
+ return $this->_set(2, $value, $idx);
+ }
+
+ /**
+ * Get all elements of <stop_time_update>
+ *
+ * @return \transit_realtime\TripUpdate\StopTimeUpdate[]
+ */
+ public function getStopTimeUpdateList(){
+ return $this->_get(2);
+ }
+
+ /**
+ * Add a new element to <stop_time_update>
+ *
+ * @param \transit_realtime\TripUpdate\StopTimeUpdate $value
+ * @return \transit_realtime\TripUpdate
+ */
+ public function addStopTimeUpdate(\transit_realtime\TripUpdate\StopTimeUpdate $value){
+ return $this->_add(2, $value);
+ }
+
+
+ // @@protoc_insertion_point(scope_class)
+ // @@protoc_insertion_point(class_transit_realtime.TripUpdate)
+ }
+}
+
+namespace transit_realtime\VehiclePosition {
+
+ // @@protoc_insertion_point(scope_namespace)
+ // @@protoc_insertion_point(namespace_transit_realtime.VehiclePosition)
+
+ class VehicleStopStatus {
+ const INCOMING_AT = 0;
+ const STOPPED_AT = 1;
+ const IN_TRANSIT_TO = 2;
+
+ // @@protoc_insertion_point(scope_class)
+ // @@protoc_insertion_point(class_transit_realtime.VehiclePosition.VehicleStopStatus)
+ }
+}
+namespace transit_realtime\VehiclePosition {
+
+ // @@protoc_insertion_point(scope_namespace)
+ // @@protoc_insertion_point(namespace_transit_realtime.VehiclePosition)
+
+ class CongestionLevel {
+ const UNKNOWN_CONGESTION_LEVEL = 0;
+ const RUNNING_SMOOTHLY = 1;
+ const STOP_AND_GO = 2;
+ const CONGESTION = 3;
+ const SEVERE_CONGESTION = 4;
+
+ // @@protoc_insertion_point(scope_class)
+ // @@protoc_insertion_point(class_transit_realtime.VehiclePosition.CongestionLevel)
+ }
+}
+namespace transit_realtime {
+
+ // @@protoc_insertion_point(scope_namespace)
+ // @@protoc_insertion_point(namespace_transit_realtime)
+
+ class VehiclePosition extends \DrSlump\Protobuf\Message {
+
+ /** @var \Closure[] */
+ protected static $__extensions = array();
+
+ public static function descriptor()
+ {
+ $descriptor = new \DrSlump\Protobuf\Descriptor(__CLASS__, 'transit_realtime.VehiclePosition');
+
+ // optional .transit_realtime.TripDescriptor trip = 1
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 1;
+ $f->name = "trip";
+ $f->type = 11;
+ $f->rule = 1;
+ $f->reference = '\transit_realtime\TripDescriptor';
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.VehiclePosition:trip)
+ $descriptor->addField($f);
+
+ // optional .transit_realtime.VehicleDescriptor vehicle = 8
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 8;
+ $f->name = "vehicle";
+ $f->type = 11;
+ $f->rule = 1;
+ $f->reference = '\transit_realtime\VehicleDescriptor';
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.VehiclePosition:vehicle)
+ $descriptor->addField($f);
+
+ // optional .transit_realtime.Position position = 2
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 2;
+ $f->name = "position";
+ $f->type = 11;
+ $f->rule = 1;
+ $f->reference = '\transit_realtime\Position';
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.VehiclePosition:position)
+ $descriptor->addField($f);
+
+ // optional current_stop_sequence = 3
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 3;
+ $f->name = "current_stop_sequence";
+ $f->type = 13;
+ $f->rule = 1;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.VehiclePosition:current_stop_sequence)
+ $descriptor->addField($f);
+
+ // optional stop_id = 7
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 7;
+ $f->name = "stop_id";
+ $f->type = 9;
+ $f->rule = 1;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.VehiclePosition:stop_id)
+ $descriptor->addField($f);
+
+ // optional .transit_realtime.VehiclePosition.VehicleStopStatus current_status = 4
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 4;
+ $f->name = "current_status";
+ $f->type = 14;
+ $f->rule = 1;
+ $f->reference = '\transit_realtime\VehiclePosition\VehicleStopStatus';
+ $f->default = \transit_realtime\VehiclePosition\VehicleStopStatus::IN_TRANSIT_TO;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.VehiclePosition:current_status)
+ $descriptor->addField($f);
+
+ // optional timestamp = 5
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 5;
+ $f->name = "timestamp";
+ $f->type = 4;
+ $f->rule = 1;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.VehiclePosition:timestamp)
+ $descriptor->addField($f);
+
+ // optional .transit_realtime.VehiclePosition.CongestionLevel congestion_level = 6
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 6;
+ $f->name = "congestion_level";
+ $f->type = 14;
+ $f->rule = 1;
+ $f->reference = '\transit_realtime\VehiclePosition\CongestionLevel';
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.VehiclePosition:congestion_level)
+ $descriptor->addField($f);
+
+ foreach (self::$__extensions as $cb) {
+ $descriptor->addField($cb(), true);
+ }
+
+ // @@protoc_insertion_point(scope_descriptor)
+ // @@protoc_insertion_point(descriptor_transit_realtime.VehiclePosition)
+
+ return $descriptor;
+ }
+
+ /** @var \transit_realtime\TripDescriptor */
+ public $trip = null;
+
+ /** @var \transit_realtime\VehicleDescriptor */
+ public $vehicle = null;
+
+ /** @var \transit_realtime\Position */
+ public $position = null;
+
+ /** @var int */
+ public $current_stop_sequence = null;
+
+ /** @var string */
+ public $stop_id = null;
+
+ /** @var int - \transit_realtime\VehiclePosition\VehicleStopStatus */
+ public $current_status = \transit_realtime\VehiclePosition\VehicleStopStatus::IN_TRANSIT_TO;
+
+ /** @var int */
+ public $timestamp = null;
+
+ /** @var int - \transit_realtime\VehiclePosition\CongestionLevel */
+ public $congestion_level = null;
+
+
+ /**
+ * Check if <trip> has a value
+ *
+ * @return boolean
+ */
+ public function hasTrip(){
+ return $this->_has(1);
+ }
+
+ /**
+ * Clear <trip> value
+ *
+ * @return \transit_realtime\VehiclePosition
+ */
+ public function clearTrip(){
+ return $this->_clear(1);
+ }
+
+ /**
+ * Get <trip> value
+ *
+ * @return \transit_realtime\TripDescriptor
+ */
+ public function getTrip(){
+ return $this->_get(1);
+ }
+
+ /**
+ * Set <trip> value
+ *
+ * @param \transit_realtime\TripDescriptor $value
+ * @return \transit_realtime\VehiclePosition
+ */
+ public function setTrip(\transit_realtime\TripDescriptor $value){
+ return $this->_set(1, $value);
+ }
+
+ /**
+ * Check if <vehicle> has a value
+ *
+ * @return boolean
+ */
+ public function hasVehicle(){
+ return $this->_has(8);
+ }
+
+ /**
+ * Clear <vehicle> value
+ *
+ * @return \transit_realtime\VehiclePosition
+ */
+ public function clearVehicle(){
+ return $this->_clear(8);
+ }
+
+ /**
+ * Get <vehicle> value
+ *
+ * @return \transit_realtime\VehicleDescriptor
+ */
+ public function getVehicle(){
+ return $this->_get(8);
+ }
+
+ /**
+ * Set <vehicle> value
+ *
+ * @param \transit_realtime\VehicleDescriptor $value
+ * @return \transit_realtime\VehiclePosition
+ */
+ public function setVehicle(\transit_realtime\VehicleDescriptor $value){
+ return $this->_set(8, $value);
+ }
+
+ /**
+ * Check if <position> has a value
+ *
+ * @return boolean
+ */
+ public function hasPosition(){
+ return $this->_has(2);
+ }
+
+ /**
+ * Clear <position> value
+ *
+ * @return \transit_realtime\VehiclePosition
+ */
+ public function clearPosition(){
+ return $this->_clear(2);
+ }
+
+ /**
+ * Get <position> value
+ *
+ * @return \transit_realtime\Position
+ */
+ public function getPosition(){
+ return $this->_get(2);
+ }
+
+ /**
+ * Set <position> value
+ *
+ * @param \transit_realtime\Position $value
+ * @return \transit_realtime\VehiclePosition
+ */
+ public function setPosition(\transit_realtime\Position $value){
+ return $this->_set(2, $value);
+ }
+
+ /**
+ * Check if <current_stop_sequence> has a value
+ *
+ * @return boolean
+ */
+ public function hasCurrentStopSequence(){
+ return $this->_has(3);
+ }
+
+ /**
+ * Clear <current_stop_sequence> value
+ *
+ * @return \transit_realtime\VehiclePosition
+ */
+ public function clearCurrentStopSequence(){
+ return $this->_clear(3);
+ }
+
+ /**
+ * Get <current_stop_sequence> value
+ *
+ * @return int
+ */
+ public function getCurrentStopSequence(){
+ return $this->_get(3);
+ }
+
+ /**
+ * Set <current_stop_sequence> value
+ *
+ * @param int $value
+ * @return \transit_realtime\VehiclePosition
+ */
+ public function setCurrentStopSequence( $value){
+ return $this->_set(3, $value);
+ }
+
+ /**
+ * Check if <stop_id> has a value
+ *
+ * @return boolean
+ */
+ public function hasStopId(){
+ return $this->_has(7);
+ }
+
+ /**
+ * Clear <stop_id> value
+ *
+ * @return \transit_realtime\VehiclePosition
+ */
+ public function clearStopId(){
+ return $this->_clear(7);
+ }
+
+ /**
+ * Get <stop_id> value
+ *
+ * @return string
+ */
+ public function getStopId(){
+ return $this->_get(7);
+ }
+
+ /**
+ * Set <stop_id> value
+ *
+ * @param string $value
+ * @return \transit_realtime\VehiclePosition
+ */
+ public function setStopId( $value){
+ return $this->_set(7, $value);
+ }
+
+ /**
+ * Check if <current_status> has a value
+ *
+ * @return boolean
+ */
+ public function hasCurrentStatus(){
+ return $this->_has(4);
+ }
+
+ /**
+ * Clear <current_status> value
+ *
+ * @return \transit_realtime\VehiclePosition
+ */
+ public function clearCurrentStatus(){
+ return $this->_clear(4);
+ }
+
+ /**
+ * Get <current_status> value
+ *
+ * @return int - \transit_realtime\VehiclePosition\VehicleStopStatus
+ */
+ public function getCurrentStatus(){
+ return $this->_get(4);
+ }
+
+ /**
+ * Set <current_status> value
+ *
+ * @param int - \transit_realtime\VehiclePosition\VehicleStopStatus $value
+ * @return \transit_realtime\VehiclePosition
+ */
+ public function setCurrentStatus( $value){
+ return $this->_set(4, $value);
+ }
+
+ /**
+ * Check if <timestamp> has a value
+ *
+ * @return boolean
+ */
+ public function hasTimestamp(){
+ return $this->_has(5);
+ }
+
+ /**
+ * Clear <timestamp> value
+ *
+ * @return \transit_realtime\VehiclePosition
+ */
+ public function clearTimestamp(){
+ return $this->_clear(5);
+ }
+
+ /**
+ * Get <timestamp> value
+ *
+ * @return int
+ */
+ public function getTimestamp(){
+ return $this->_get(5);
+ }
+
+ /**
+ * Set <timestamp> value
+ *
+ * @param int $value
+ * @return \transit_realtime\VehiclePosition
+ */
+ public function setTimestamp( $value){
+ return $this->_set(5, $value);
+ }
+
+ /**
+ * Check if <congestion_level> has a value
+ *
+ * @return boolean
+ */
+ public function hasCongestionLevel(){
+ return $this->_has(6);
+ }
+
+ /**
+ * Clear <congestion_level> value
+ *
+ * @return \transit_realtime\VehiclePosition
+ */
+ public function clearCongestionLevel(){
+ return $this->_clear(6);
+ }
+
+ /**
+ * Get <congestion_level> value
+ *
+ * @return int - \transit_realtime\VehiclePosition\CongestionLevel
+ */
+ public function getCongestionLevel(){
+ return $this->_get(6);
+ }
+
+ /**
+ * Set <congestion_level> value
+ *
+ * @param int - \transit_realtime\VehiclePosition\CongestionLevel $value
+ * @return \transit_realtime\VehiclePosition
+ */
+ public function setCongestionLevel( $value){
+ return $this->_set(6, $value);
+ }
+
+
+ // @@protoc_insertion_point(scope_class)
+ // @@protoc_insertion_point(class_transit_realtime.VehiclePosition)
+ }
+}
+
+namespace transit_realtime\Alert {
+
+ // @@protoc_insertion_point(scope_namespace)
+ // @@protoc_insertion_point(namespace_transit_realtime.Alert)
+
+ class Cause {
+ const UNKNOWN_CAUSE = 1;
+ const OTHER_CAUSE = 2;
+ const TECHNICAL_PROBLEM = 3;
+ const STRIKE = 4;
+ const DEMONSTRATION = 5;
+ const ACCIDENT = 6;
+ const HOLIDAY = 7;
+ const WEATHER = 8;
+ const MAINTENANCE = 9;
+ const CONSTRUCTION = 10;
+ const POLICE_ACTIVITY = 11;
+ const MEDICAL_EMERGENCY = 12;
+
+ // @@protoc_insertion_point(scope_class)
+ // @@protoc_insertion_point(class_transit_realtime.Alert.Cause)
+ }
+}
+namespace transit_realtime\Alert {
+
+ // @@protoc_insertion_point(scope_namespace)
+ // @@protoc_insertion_point(namespace_transit_realtime.Alert)
+
+ class Effect {
+ const NO_SERVICE = 1;
+ const REDUCED_SERVICE = 2;
+ const SIGNIFICANT_DELAYS = 3;
+ const DETOUR = 4;
+ const ADDITIONAL_SERVICE = 5;
+ const MODIFIED_SERVICE = 6;
+ const OTHER_EFFECT = 7;
+ const UNKNOWN_EFFECT = 8;
+ const STOP_MOVED = 9;
+
+ // @@protoc_insertion_point(scope_class)
+ // @@protoc_insertion_point(class_transit_realtime.Alert.Effect)
+ }
+}
+namespace transit_realtime {
+
+ // @@protoc_insertion_point(scope_namespace)
+ // @@protoc_insertion_point(namespace_transit_realtime)
+
+ class Alert extends \DrSlump\Protobuf\Message {
+
+ /** @var \Closure[] */
+ protected static $__extensions = array();
+
+ public static function descriptor()
+ {
+ $descriptor = new \DrSlump\Protobuf\Descriptor(__CLASS__, 'transit_realtime.Alert');
+
+ // repeated .transit_realtime.TimeRange active_period = 1
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 1;
+ $f->name = "active_period";
+ $f->type = 11;
+ $f->rule = 3;
+ $f->reference = '\transit_realtime\TimeRange';
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.Alert:active_period)
+ $descriptor->addField($f);
+
+ // repeated .transit_realtime.EntitySelector informed_entity = 5
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 5;
+ $f->name = "informed_entity";
+ $f->type = 11;
+ $f->rule = 3;
+ $f->reference = '\transit_realtime\EntitySelector';
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.Alert:informed_entity)
+ $descriptor->addField($f);
+
+ // optional .transit_realtime.Alert.Cause cause = 6
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 6;
+ $f->name = "cause";
+ $f->type = 14;
+ $f->rule = 1;
+ $f->reference = '\transit_realtime\Alert\Cause';
+ $f->default = \transit_realtime\Alert\Cause::UNKNOWN_CAUSE;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.Alert:cause)
+ $descriptor->addField($f);
+
+ // optional .transit_realtime.Alert.Effect effect = 7
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 7;
+ $f->name = "effect";
+ $f->type = 14;
+ $f->rule = 1;
+ $f->reference = '\transit_realtime\Alert\Effect';
+ $f->default = \transit_realtime\Alert\Effect::UNKNOWN_EFFECT;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.Alert:effect)
+ $descriptor->addField($f);
+
+ // optional .transit_realtime.TranslatedString url = 8
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 8;
+ $f->name = "url";
+ $f->type = 11;
+ $f->rule = 1;
+ $f->reference = '\transit_realtime\TranslatedString';
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.Alert:url)
+ $descriptor->addField($f);
+
+ // optional .transit_realtime.TranslatedString header_text = 10
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 10;
+ $f->name = "header_text";
+ $f->type = 11;
+ $f->rule = 1;
+ $f->reference = '\transit_realtime\TranslatedString';
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.Alert:header_text)
+ $descriptor->addField($f);
+
+ // optional .transit_realtime.TranslatedString description_text = 11
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 11;
+ $f->name = "description_text";
+ $f->type = 11;
+ $f->rule = 1;
+ $f->reference = '\transit_realtime\TranslatedString';
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.Alert:description_text)
+ $descriptor->addField($f);
+
+ foreach (self::$__extensions as $cb) {
+ $descriptor->addField($cb(), true);
+ }
+
+ // @@protoc_insertion_point(scope_descriptor)
+ // @@protoc_insertion_point(descriptor_transit_realtime.Alert)
+
+ return $descriptor;
+ }
+
+ /** @var \transit_realtime\TimeRange[] */
+ public $active_period = array();
+
+ /** @var \transit_realtime\EntitySelector[] */
+ public $informed_entity = array();
+
+ /** @var int - \transit_realtime\Alert\Cause */
+ public $cause = \transit_realtime\Alert\Cause::UNKNOWN_CAUSE;
+
+ /** @var int - \transit_realtime\Alert\Effect */
+ public $effect = \transit_realtime\Alert\Effect::UNKNOWN_EFFECT;
+
+ /** @var \transit_realtime\TranslatedString */
+ public $url = null;
+
+ /** @var \transit_realtime\TranslatedString */
+ public $header_text = null;
+
+ /** @var \transit_realtime\TranslatedString */
+ public $description_text = null;
+
+
+ /**
+ * Check if <active_period> has a value
+ *
+ * @return boolean
+ */
+ public function hasActivePeriod(){
+ return $this->_has(1);
+ }
+
+ /**
+ * Clear <active_period> value
+ *
+ * @return \transit_realtime\Alert
+ */
+ public function clearActivePeriod(){
+ return $this->_clear(1);
+ }
+
+ /**
+ * Get <active_period> value
+ *
+ * @param int $idx
+ * @return \transit_realtime\TimeRange
+ */
+ public function getActivePeriod($idx = NULL){
+ return $this->_get(1, $idx);
+ }
+
+ /**
+ * Set <active_period> value
+ *
+ * @param \transit_realtime\TimeRange $value
+ * @return \transit_realtime\Alert
+ */
+ public function setActivePeriod(\transit_realtime\TimeRange $value, $idx = NULL){
+ return $this->_set(1, $value, $idx);
+ }
+
+ /**
+ * Get all elements of <active_period>
+ *
+ * @return \transit_realtime\TimeRange[]
+ */
+ public function getActivePeriodList(){
+ return $this->_get(1);
+ }
+
+ /**
+ * Add a new element to <active_period>
+ *
+ * @param \transit_realtime\TimeRange $value
+ * @return \transit_realtime\Alert
+ */
+ public function addActivePeriod(\transit_realtime\TimeRange $value){
+ return $this->_add(1, $value);
+ }
+
+ /**
+ * Check if <informed_entity> has a value
+ *
+ * @return boolean
+ */
+ public function hasInformedEntity(){
+ return $this->_has(5);
+ }
+
+ /**
+ * Clear <informed_entity> value
+ *
+ * @return \transit_realtime\Alert
+ */
+ public function clearInformedEntity(){
+ return $this->_clear(5);
+ }
+
+ /**
+ * Get <informed_entity> value
+ *
+ * @param int $idx
+ * @return \transit_realtime\EntitySelector
+ */
+ public function getInformedEntity($idx = NULL){
+ return $this->_get(5, $idx);
+ }
+
+ /**
+ * Set <informed_entity> value
+ *
+ * @param \transit_realtime\EntitySelector $value
+ * @return \transit_realtime\Alert
+ */
+ public function setInformedEntity(\transit_realtime\EntitySelector $value, $idx = NULL){
+ return $this->_set(5, $value, $idx);
+ }
+
+ /**
+ * Get all elements of <informed_entity>
+ *
+ * @return \transit_realtime\EntitySelector[]
+ */
+ public function getInformedEntityList(){
+ return $this->_get(5);
+ }
+
+ /**
+ * Add a new element to <informed_entity>
+ *
+ * @param \transit_realtime\EntitySelector $value
+ * @return \transit_realtime\Alert
+ */
+ public function addInformedEntity(\transit_realtime\EntitySelector $value){
+ return $this->_add(5, $value);
+ }
+
+ /**
+ * Check if <cause> has a value
+ *
+ * @return boolean
+ */
+ public function hasCause(){
+ return $this->_has(6);
+ }
+
+ /**
+ * Clear <cause> value
+ *
+ * @return \transit_realtime\Alert
+ */
+ public function clearCause(){
+ return $this->_clear(6);
+ }
+
+ /**
+ * Get <cause> value
+ *
+ * @return int - \transit_realtime\Alert\Cause
+ */
+ public function getCause(){
+ return $this->_get(6);
+ }
+
+ /**
+ * Set <cause> value
+ *
+ * @param int - \transit_realtime\Alert\Cause $value
+ * @return \transit_realtime\Alert
+ */
+ public function setCause( $value){
+ return $this->_set(6, $value);
+ }
+
+ /**
+ * Check if <effect> has a value
+ *
+ * @return boolean
+ */
+ public function hasEffect(){
+ return $this->_has(7);
+ }
+
+ /**
+ * Clear <effect> value
+ *
+ * @return \transit_realtime\Alert
+ */
+ public function clearEffect(){
+ return $this->_clear(7);
+ }
+
+ /**
+ * Get <effect> value
+ *
+ * @return int - \transit_realtime\Alert\Effect
+ */
+ public function getEffect(){
+ return $this->_get(7);
+ }
+
+ /**
+ * Set <effect> value
+ *
+ * @param int - \transit_realtime\Alert\Effect $value
+ * @return \transit_realtime\Alert
+ */
+ public function setEffect( $value){
+ return $this->_set(7, $value);
+ }
+
+ /**
+ * Check if <url> has a value
+ *
+ * @return boolean
+ */
+ public function hasUrl(){
+ return $this->_has(8);
+ }
+
+ /**
+ * Clear <url> value
+ *
+ * @return \transit_realtime\Alert
+ */
+ public function clearUrl(){
+ return $this->_clear(8);
+ }
+
+ /**
+ * Get <url> value
+ *
+ * @return \transit_realtime\TranslatedString
+ */
+ public function getUrl(){
+ return $this->_get(8);
+ }
+
+ /**
+ * Set <url> value
+ *
+ * @param \transit_realtime\TranslatedString $value
+ * @return \transit_realtime\Alert
+ */
+ public function setUrl(\transit_realtime\TranslatedString $value){
+ return $this->_set(8, $value);
+ }
+
+ /**
+ * Check if <header_text> has a value
+ *
+ * @return boolean
+ */
+ public function hasHeaderText(){
+ return $this->_has(10);
+ }
+
+ /**
+ * Clear <header_text> value
+ *
+ * @return \transit_realtime\Alert
+ */
+ public function clearHeaderText(){
+ return $this->_clear(10);
+ }
+
+ /**
+ * Get <header_text> value
+ *
+ * @return \transit_realtime\TranslatedString
+ */
+ public function getHeaderText(){
+ return $this->_get(10);
+ }
+
+ /**
+ * Set <header_text> value
+ *
+ * @param \transit_realtime\TranslatedString $value
+ * @return \transit_realtime\Alert
+ */
+ public function setHeaderText(\transit_realtime\TranslatedString $value){
+ return $this->_set(10, $value);
+ }
+
+ /**
+ * Check if <description_text> has a value
+ *
+ * @return boolean
+ */
+ public function hasDescriptionText(){
+ return $this->_has(11);
+ }
+
+ /**
+ * Clear <description_text> value
+ *
+ * @return \transit_realtime\Alert
+ */
+ public function clearDescriptionText(){
+ return $this->_clear(11);
+ }
+
+ /**
+ * Get <description_text> value
+ *
+ * @return \transit_realtime\TranslatedString
+ */
+ public function getDescriptionText(){
+ return $this->_get(11);
+ }
+
+ /**
+ * Set <description_text> value
+ *
+ * @param \transit_realtime\TranslatedString $value
+ * @return \transit_realtime\Alert
+ */
+ public function setDescriptionText(\transit_realtime\TranslatedString $value){
+ return $this->_set(11, $value);
+ }
+
+
+ // @@protoc_insertion_point(scope_class)
+ // @@protoc_insertion_point(class_transit_realtime.Alert)
+ }
+}
+
+namespace transit_realtime {
+
+ // @@protoc_insertion_point(scope_namespace)
+ // @@protoc_insertion_point(namespace_transit_realtime)
+
+ class TimeRange extends \DrSlump\Protobuf\Message {
+
+ /** @var \Closure[] */
+ protected static $__extensions = array();
+
+ public static function descriptor()
+ {
+ $descriptor = new \DrSlump\Protobuf\Descriptor(__CLASS__, 'transit_realtime.TimeRange');
+
+ // optional start = 1
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 1;
+ $f->name = "start";
+ $f->type = 4;
+ $f->rule = 1;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.TimeRange:start)
+ $descriptor->addField($f);
+
+ // optional end = 2
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 2;
+ $f->name = "end";
+ $f->type = 4;
+ $f->rule = 1;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.TimeRange:end)
+ $descriptor->addField($f);
+
+ foreach (self::$__extensions as $cb) {
+ $descriptor->addField($cb(), true);
+ }
+
+ // @@protoc_insertion_point(scope_descriptor)
+ // @@protoc_insertion_point(descriptor_transit_realtime.TimeRange)
+
+ return $descriptor;
+ }
+
+ /** @var int */
+ public $start = null;
+
+ /** @var int */
+ public $end = null;
+
+
+ /**
+ * Check if <start> has a value
+ *
+ * @return boolean
+ */
+ public function hasStart(){
+ return $this->_has(1);
+ }
+
+ /**
+ * Clear <start> value
+ *
+ * @return \transit_realtime\TimeRange
+ */
+ public function clearStart(){
+ return $this->_clear(1);
+ }
+
+ /**
+ * Get <start> value
+ *
+ * @return int
+ */
+ public function getStart(){
+ return $this->_get(1);
+ }
+
+ /**
+ * Set <start> value
+ *
+ * @param int $value
+ * @return \transit_realtime\TimeRange
+ */
+ public function setStart( $value){
+ return $this->_set(1, $value);
+ }
+
+ /**
+ * Check if <end> has a value
+ *
+ * @return boolean
+ */
+ public function hasEnd(){
+ return $this->_has(2);
+ }
+
+ /**
+ * Clear <end> value
+ *
+ * @return \transit_realtime\TimeRange
+ */
+ public function clearEnd(){
+ return $this->_clear(2);
+ }
+
+ /**
+ * Get <end> value
+ *
+ * @return int
+ */
+ public function getEnd(){
+ return $this->_get(2);
+ }
+
+ /**
+ * Set <end> value
+ *
+ * @param int $value
+ * @return \transit_realtime\TimeRange
+ */
+ public function setEnd( $value){
+ return $this->_set(2, $value);
+ }
+
+
+ // @@protoc_insertion_point(scope_class)
+ // @@protoc_insertion_point(class_transit_realtime.TimeRange)
+ }
+}
+
+namespace transit_realtime {
+
+ // @@protoc_insertion_point(scope_namespace)
+ // @@protoc_insertion_point(namespace_transit_realtime)
+
+ class Position extends \DrSlump\Protobuf\Message {
+
+ /** @var \Closure[] */
+ protected static $__extensions = array();
+
+ public static function descriptor()
+ {
+ $descriptor = new \DrSlump\Protobuf\Descriptor(__CLASS__, 'transit_realtime.Position');
+
+ // required latitude = 1
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 1;
+ $f->name = "latitude";
+ $f->type = 2;
+ $f->rule = 2;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.Position:latitude)
+ $descriptor->addField($f);
+
+ // required longitude = 2
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 2;
+ $f->name = "longitude";
+ $f->type = 2;
+ $f->rule = 2;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.Position:longitude)
+ $descriptor->addField($f);
+
+ // optional bearing = 3
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 3;
+ $f->name = "bearing";
+ $f->type = 2;
+ $f->rule = 1;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.Position:bearing)
+ $descriptor->addField($f);
+
+ // optional odometer = 4
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 4;
+ $f->name = "odometer";
+ $f->type = 1;
+ $f->rule = 1;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.Position:odometer)
+ $descriptor->addField($f);
+
+ // optional speed = 5
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 5;
+ $f->name = "speed";
+ $f->type = 2;
+ $f->rule = 1;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.Position:speed)
+ $descriptor->addField($f);
+
+ foreach (self::$__extensions as $cb) {
+ $descriptor->addField($cb(), true);
+ }
+
+ // @@protoc_insertion_point(scope_descriptor)
+ // @@protoc_insertion_point(descriptor_transit_realtime.Position)
+
+ return $descriptor;
+ }
+
+ /** @var float */
+ public $latitude = null;
+
+ /** @var float */
+ public $longitude = null;
+
+ /** @var float */
+ public $bearing = null;
+
+ /** @var float */
+ public $odometer = null;
+
+ /** @var float */
+ public $speed = null;
+
+
+ /**
+ * Check if <latitude> has a value
+ *
+ * @return boolean
+ */
+ public function hasLatitude(){
+ return $this->_has(1);
+ }
+
+ /**
+ * Clear <latitude> value
+ *
+ * @return \transit_realtime\Position
+ */
+ public function clearLatitude(){
+ return $this->_clear(1);
+ }
+
+ /**
+ * Get <latitude> value
+ *
+ * @return float
+ */
+ public function getLatitude(){
+ return $this->_get(1);
+ }
+
+ /**
+ * Set <latitude> value
+ *
+ * @param float $value
+ * @return \transit_realtime\Position
+ */
+ public function setLatitude( $value){
+ return $this->_set(1, $value);
+ }
+
+ /**
+ * Check if <longitude> has a value
+ *
+ * @return boolean
+ */
+ public function hasLongitude(){
+ return $this->_has(2);
+ }
+
+ /**
+ * Clear <longitude> value
+ *
+ * @return \transit_realtime\Position
+ */
+ public function clearLongitude(){
+ return $this->_clear(2);
+ }
+
+ /**
+ * Get <longitude> value
+ *
+ * @return float
+ */
+ public function getLongitude(){
+ return $this->_get(2);
+ }
+
+ /**
+ * Set <longitude> value
+ *
+ * @param float $value
+ * @return \transit_realtime\Position
+ */
+ public function setLongitude( $value){
+ return $this->_set(2, $value);
+ }
+
+ /**
+ * Check if <bearing> has a value
+ *
+ * @return boolean
+ */
+ public function hasBearing(){
+ return $this->_has(3);
+ }
+
+ /**
+ * Clear <bearing> value
+ *
+ * @return \transit_realtime\Position
+ */
+ public function clearBearing(){
+ return $this->_clear(3);
+ }
+
+ /**
+ * Get <bearing> value
+ *
+ * @return float
+ */
+ public function getBearing(){
+ return $this->_get(3);
+ }
+
+ /**
+ * Set <bearing> value
+ *
+ * @param float $value
+ * @return \transit_realtime\Position
+ */
+ public function setBearing( $value){
+ return $this->_set(3, $value);
+ }
+
+ /**
+ * Check if <odometer> has a value
+ *
+ * @return boolean
+ */
+ public function hasOdometer(){
+ return $this->_has(4);
+ }
+
+ /**
+ * Clear <odometer> value
+ *
+ * @return \transit_realtime\Position
+ */
+ public function clearOdometer(){
+ return $this->_clear(4);
+ }
+
+ /**
+ * Get <odometer> value
+ *
+ * @return float
+ */
+ public function getOdometer(){
+ return $this->_get(4);
+ }
+
+ /**
+ * Set <odometer> value
+ *
+ * @param float $value
+ * @return \transit_realtime\Position
+ */
+ public function setOdometer( $value){
+ return $this->_set(4, $value);
+ }
+
+ /**
+ * Check if <speed> has a value
+ *
+ * @return boolean
+ */
+ public function hasSpeed(){
+ return $this->_has(5);
+ }
+
+ /**
+ * Clear <speed> value
+ *
+ * @return \transit_realtime\Position
+ */
+ public function clearSpeed(){
+ return $this->_clear(5);
+ }
+
+ /**
+ * Get <speed> value
+ *
+ * @return float
+ */
+ public function getSpeed(){
+ return $this->_get(5);
+ }
+
+ /**
+ * Set <speed> value
+ *
+ * @param float $value
+ * @return \transit_realtime\Position
+ */
+ public function setSpeed( $value){
+ return $this->_set(5, $value);
+ }
+
+
+ // @@protoc_insertion_point(scope_class)
+ // @@protoc_insertion_point(class_transit_realtime.Position)
+ }
+}
+
+namespace transit_realtime\TripDescriptor {
+
+ // @@protoc_insertion_point(scope_namespace)
+ // @@protoc_insertion_point(namespace_transit_realtime.TripDescriptor)
+
+ class ScheduleRelationship {
+ const SCHEDULED = 0;
+ const ADDED = 1;
+ const UNSCHEDULED = 2;
+ const CANCELED = 3;
+ const REPLACEMENT = 5;
+
+ // @@protoc_insertion_point(scope_class)
+ // @@protoc_insertion_point(class_transit_realtime.TripDescriptor.ScheduleRelationship)
+ }
+}
+namespace transit_realtime {
+
+ // @@protoc_insertion_point(scope_namespace)
+ // @@protoc_insertion_point(namespace_transit_realtime)
+
+ class TripDescriptor extends \DrSlump\Protobuf\Message {
+
+ /** @var \Closure[] */
+ protected static $__extensions = array();
+
+ public static function descriptor()
+ {
+ $descriptor = new \DrSlump\Protobuf\Descriptor(__CLASS__, 'transit_realtime.TripDescriptor');
+
+ // optional trip_id = 1
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 1;
+ $f->name = "trip_id";
+ $f->type = 9;
+ $f->rule = 1;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.TripDescriptor:trip_id)
+ $descriptor->addField($f);
+
+ // optional route_id = 5
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 5;
+ $f->name = "route_id";
+ $f->type = 9;
+ $f->rule = 1;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.TripDescriptor:route_id)
+ $descriptor->addField($f);
+
+ // optional start_time = 2
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 2;
+ $f->name = "start_time";
+ $f->type = 9;
+ $f->rule = 1;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.TripDescriptor:start_time)
+ $descriptor->addField($f);
+
+ // optional start_date = 3
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 3;
+ $f->name = "start_date";
+ $f->type = 9;
+ $f->rule = 1;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.TripDescriptor:start_date)
+ $descriptor->addField($f);
+
+ // optional .transit_realtime.TripDescriptor.ScheduleRelationship schedule_relationship = 4
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 4;
+ $f->name = "schedule_relationship";
+ $f->type = 14;
+ $f->rule = 1;
+ $f->reference = '\transit_realtime\TripDescriptor\ScheduleRelationship';
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.TripDescriptor:schedule_relationship)
+ $descriptor->addField($f);
+
+ foreach (self::$__extensions as $cb) {
+ $descriptor->addField($cb(), true);
+ }
+
+ // @@protoc_insertion_point(scope_descriptor)
+ // @@protoc_insertion_point(descriptor_transit_realtime.TripDescriptor)
+
+ return $descriptor;
+ }
+
+ /** @var string */
+ public $trip_id = null;
+
+ /** @var string */
+ public $route_id = null;
+
+ /** @var string */
+ public $start_time = null;
+
+ /** @var string */
+ public $start_date = null;
+
+ /** @var int - \transit_realtime\TripDescriptor\ScheduleRelationship */
+ public $schedule_relationship = null;
+
+
+ /**
+ * Check if <trip_id> has a value
+ *
+ * @return boolean
+ */
+ public function hasTripId(){
+ return $this->_has(1);
+ }
+
+ /**
+ * Clear <trip_id> value
+ *
+ * @return \transit_realtime\TripDescriptor
+ */
+ public function clearTripId(){
+ return $this->_clear(1);
+ }
+
+ /**
+ * Get <trip_id> value
+ *
+ * @return string
+ */
+ public function getTripId(){
+ return $this->_get(1);
+ }
+
+ /**
+ * Set <trip_id> value
+ *
+ * @param string $value
+ * @return \transit_realtime\TripDescriptor
+ */
+ public function setTripId( $value){
+ return $this->_set(1, $value);
+ }
+
+ /**
+ * Check if <route_id> has a value
+ *
+ * @return boolean
+ */
+ public function hasRouteId(){
+ return $this->_has(5);
+ }
+
+ /**
+ * Clear <route_id> value
+ *
+ * @return \transit_realtime\TripDescriptor
+ */
+ public function clearRouteId(){
+ return $this->_clear(5);
+ }
+
+ /**
+ * Get <route_id> value
+ *
+ * @return string
+ */
+ public function getRouteId(){
+ return $this->_get(5);
+ }
+
+ /**
+ * Set <route_id> value
+ *
+ * @param string $value
+ * @return \transit_realtime\TripDescriptor
+ */
+ public function setRouteId( $value){
+ return $this->_set(5, $value);
+ }
+
+ /**
+ * Check if <start_time> has a value
+ *
+ * @return boolean
+ */
+ public function hasStartTime(){
+ return $this->_has(2);
+ }
+
+ /**
+ * Clear <start_time> value
+ *
+ * @return \transit_realtime\TripDescriptor
+ */
+ public function clearStartTime(){
+ return $this->_clear(2);
+ }
+
+ /**
+ * Get <start_time> value
+ *
+ * @return string
+ */
+ public function getStartTime(){
+ return $this->_get(2);
+ }
+
+ /**
+ * Set <start_time> value
+ *
+ * @param string $value
+ * @return \transit_realtime\TripDescriptor
+ */
+ public function setStartTime( $value){
+ return $this->_set(2, $value);
+ }
+
+ /**
+ * Check if <start_date> has a value
+ *
+ * @return boolean
+ */
+ public function hasStartDate(){
+ return $this->_has(3);
+ }
+
+ /**
+ * Clear <start_date> value
+ *
+ * @return \transit_realtime\TripDescriptor
+ */
+ public function clearStartDate(){
+ return $this->_clear(3);
+ }
+
+ /**
+ * Get <start_date> value
+ *
+ * @return string
+ */
+ public function getStartDate(){
+ return $this->_get(3);
+ }
+
+ /**
+ * Set <start_date> value
+ *
+ * @param string $value
+ * @return \transit_realtime\TripDescriptor
+ */
+ public function setStartDate( $value){
+ return $this->_set(3, $value);
+ }
+
+ /**
+ * Check if <schedule_relationship> has a value
+ *
+ * @return boolean
+ */
+ public function hasScheduleRelationship(){
+ return $this->_has(4);
+ }
+
+ /**
+ * Clear <schedule_relationship> value
+ *
+ * @return \transit_realtime\TripDescriptor
+ */
+ public function clearScheduleRelationship(){
+ return $this->_clear(4);
+ }
+
+ /**
+ * Get <schedule_relationship> value
+ *
+ * @return int - \transit_realtime\TripDescriptor\ScheduleRelationship
+ */
+ public function getScheduleRelationship(){
+ return $this->_get(4);
+ }
+
+ /**
+ * Set <schedule_relationship> value
+ *
+ * @param int - \transit_realtime\TripDescriptor\ScheduleRelationship $value
+ * @return \transit_realtime\TripDescriptor
+ */
+ public function setScheduleRelationship( $value){
+ return $this->_set(4, $value);
+ }
+
+
+ // @@protoc_insertion_point(scope_class)
+ // @@protoc_insertion_point(class_transit_realtime.TripDescriptor)
+ }
+}
+
+namespace transit_realtime {
+
+ // @@protoc_insertion_point(scope_namespace)
+ // @@protoc_insertion_point(namespace_transit_realtime)
+
+ class VehicleDescriptor extends \DrSlump\Protobuf\Message {
+
+ /** @var \Closure[] */
+ protected static $__extensions = array();
+
+ public static function descriptor()
+ {
+ $descriptor = new \DrSlump\Protobuf\Descriptor(__CLASS__, 'transit_realtime.VehicleDescriptor');
+
+ // optional id = 1
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 1;
+ $f->name = "id";
+ $f->type = 9;
+ $f->rule = 1;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.VehicleDescriptor:id)
+ $descriptor->addField($f);
+
+ // optional label = 2
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 2;
+ $f->name = "label";
+ $f->type = 9;
+ $f->rule = 1;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.VehicleDescriptor:label)
+ $descriptor->addField($f);
+
+ // optional license_plate = 3
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 3;
+ $f->name = "license_plate";
+ $f->type = 9;
+ $f->rule = 1;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.VehicleDescriptor:license_plate)
+ $descriptor->addField($f);
+
+ foreach (self::$__extensions as $cb) {
+ $descriptor->addField($cb(), true);
+ }
+
+ // @@protoc_insertion_point(scope_descriptor)
+ // @@protoc_insertion_point(descriptor_transit_realtime.VehicleDescriptor)
+
+ return $descriptor;
+ }
+
+ /** @var string */
+ public $id = null;
+
+ /** @var string */
+ public $label = null;
+
+ /** @var string */
+ public $license_plate = null;
+
+
+ /**
+ * Check if <id> has a value
+ *
+ * @return boolean
+ */
+ public function hasId(){
+ return $this->_has(1);
+ }
+
+ /**
+ * Clear <id> value
+ *
+ * @return \transit_realtime\VehicleDescriptor
+ */
+ public function clearId(){
+ return $this->_clear(1);
+ }
+
+ /**
+ * Get <id> value
+ *
+ * @return string
+ */
+ public function getId(){
+ return $this->_get(1);
+ }
+
+ /**
+ * Set <id> value
+ *
+ * @param string $value
+ * @return \transit_realtime\VehicleDescriptor
+ */
+ public function setId( $value){
+ return $this->_set(1, $value);
+ }
+
+ /**
+ * Check if <label> has a value
+ *
+ * @return boolean
+ */
+ public function hasLabel(){
+ return $this->_has(2);
+ }
+
+ /**
+ * Clear <label> value
+ *
+ * @return \transit_realtime\VehicleDescriptor
+ */
+ public function clearLabel(){
+ return $this->_clear(2);
+ }
+
+ /**
+ * Get <label> value
+ *
+ * @return string
+ */
+ public function getLabel(){
+ return $this->_get(2);
+ }
+
+ /**
+ * Set <label> value
+ *
+ * @param string $value
+ * @return \transit_realtime\VehicleDescriptor
+ */
+ public function setLabel( $value){
+ return $this->_set(2, $value);
+ }
+
+ /**
+ * Check if <license_plate> has a value
+ *
+ * @return boolean
+ */
+ public function hasLicensePlate(){
+ return $this->_has(3);
+ }
+
+ /**
+ * Clear <license_plate> value
+ *
+ * @return \transit_realtime\VehicleDescriptor
+ */
+ public function clearLicensePlate(){
+ return $this->_clear(3);
+ }
+
+ /**
+ * Get <license_plate> value
+ *
+ * @return string
+ */
+ public function getLicensePlate(){
+ return $this->_get(3);
+ }
+
+ /**
+ * Set <license_plate> value
+ *
+ * @param string $value
+ * @return \transit_realtime\VehicleDescriptor
+ */
+ public function setLicensePlate( $value){
+ return $this->_set(3, $value);
+ }
+
+
+ // @@protoc_insertion_point(scope_class)
+ // @@protoc_insertion_point(class_transit_realtime.VehicleDescriptor)
+ }
+}
+
+namespace transit_realtime {
+
+ // @@protoc_insertion_point(scope_namespace)
+ // @@protoc_insertion_point(namespace_transit_realtime)
+
+ class EntitySelector extends \DrSlump\Protobuf\Message {
+
+ /** @var \Closure[] */
+ protected static $__extensions = array();
+
+ public static function descriptor()
+ {
+ $descriptor = new \DrSlump\Protobuf\Descriptor(__CLASS__, 'transit_realtime.EntitySelector');
+
+ // optional agency_id = 1
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 1;
+ $f->name = "agency_id";
+ $f->type = 9;
+ $f->rule = 1;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.EntitySelector:agency_id)
+ $descriptor->addField($f);
+
+ // optional route_id = 2
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 2;
+ $f->name = "route_id";
+ $f->type = 9;
+ $f->rule = 1;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.EntitySelector:route_id)
+ $descriptor->addField($f);
+
+ // optional route_type = 3
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 3;
+ $f->name = "route_type";
+ $f->type = 5;
+ $f->rule = 1;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.EntitySelector:route_type)
+ $descriptor->addField($f);
+
+ // optional .transit_realtime.TripDescriptor trip = 4
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 4;
+ $f->name = "trip";
+ $f->type = 11;
+ $f->rule = 1;
+ $f->reference = '\transit_realtime\TripDescriptor';
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.EntitySelector:trip)
+ $descriptor->addField($f);
+
+ // optional stop_id = 5
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 5;
+ $f->name = "stop_id";
+ $f->type = 9;
+ $f->rule = 1;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.EntitySelector:stop_id)
+ $descriptor->addField($f);
+
+ foreach (self::$__extensions as $cb) {
+ $descriptor->addField($cb(), true);
+ }
+
+ // @@protoc_insertion_point(scope_descriptor)
+ // @@protoc_insertion_point(descriptor_transit_realtime.EntitySelector)
+
+ return $descriptor;
+ }
+
+ /** @var string */
+ public $agency_id = null;
+
+ /** @var string */
+ public $route_id = null;
+
+ /** @var int */
+ public $route_type = null;
+
+ /** @var \transit_realtime\TripDescriptor */
+ public $trip = null;
+
+ /** @var string */
+ public $stop_id = null;
+
+
+ /**
+ * Check if <agency_id> has a value
+ *
+ * @return boolean
+ */
+ public function hasAgencyId(){
+ return $this->_has(1);
+ }
+
+ /**
+ * Clear <agency_id> value
+ *
+ * @return \transit_realtime\EntitySelector
+ */
+ public function clearAgencyId(){
+ return $this->_clear(1);
+ }
+
+ /**
+ * Get <agency_id> value
+ *
+ * @return string
+ */
+ public function getAgencyId(){
+ return $this->_get(1);
+ }
+
+ /**
+ * Set <agency_id> value
+ *
+ * @param string $value
+ * @return \transit_realtime\EntitySelector
+ */
+ public function setAgencyId( $value){
+ return $this->_set(1, $value);
+ }
+
+ /**
+ * Check if <route_id> has a value
+ *
+ * @return boolean
+ */
+ public function hasRouteId(){
+ return $this->_has(2);
+ }
+
+ /**
+ * Clear <route_id> value
+ *
+ * @return \transit_realtime\EntitySelector
+ */
+ public function clearRouteId(){
+ return $this->_clear(2);
+ }
+
+ /**
+ * Get <route_id> value
+ *
+ * @return string
+ */
+ public function getRouteId(){
+ return $this->_get(2);
+ }
+
+ /**
+ * Set <route_id> value
+ *
+ * @param string $value
+ * @return \transit_realtime\EntitySelector
+ */
+ public function setRouteId( $value){
+ return $this->_set(2, $value);
+ }
+
+ /**
+ * Check if <route_type> has a value
+ *
+ * @return boolean
+ */
+ public function hasRouteType(){
+ return $this->_has(3);
+ }
+
+ /**
+ * Clear <route_type> value
+ *
+ * @return \transit_realtime\EntitySelector
+ */
+ public function clearRouteType(){
+ return $this->_clear(3);
+ }
+
+ /**
+ * Get <route_type> value
+ *
+ * @return int
+ */
+ public function getRouteType(){
+ return $this->_get(3);
+ }
+
+ /**
+ * Set <route_type> value
+ *
+ * @param int $value
+ * @return \transit_realtime\EntitySelector
+ */
+ public function setRouteType( $value){
+ return $this->_set(3, $value);
+ }
+
+ /**
+ * Check if <trip> has a value
+ *
+ * @return boolean
+ */
+ public function hasTrip(){
+ return $this->_has(4);
+ }
+
+ /**
+ * Clear <trip> value
+ *
+ * @return \transit_realtime\EntitySelector
+ */
+ public function clearTrip(){
+ return $this->_clear(4);
+ }
+
+ /**
+ * Get <trip> value
+ *
+ * @return \transit_realtime\TripDescriptor
+ */
+ public function getTrip(){
+ return $this->_get(4);
+ }
+
+ /**
+ * Set <trip> value
+ *
+ * @param \transit_realtime\TripDescriptor $value
+ * @return \transit_realtime\EntitySelector
+ */
+ public function setTrip(\transit_realtime\TripDescriptor $value){
+ return $this->_set(4, $value);
+ }
+
+ /**
+ * Check if <stop_id> has a value
+ *
+ * @return boolean
+ */
+ public function hasStopId(){
+ return $this->_has(5);
+ }
+
+ /**
+ * Clear <stop_id> value
+ *
+ * @return \transit_realtime\EntitySelector
+ */
+ public function clearStopId(){
+ return $this->_clear(5);
+ }
+
+ /**
+ * Get <stop_id> value
+ *
+ * @return string
+ */
+ public function getStopId(){
+ return $this->_get(5);
+ }
+
+ /**
+ * Set <stop_id> value
+ *
+ * @param string $value
+ * @return \transit_realtime\EntitySelector
+ */
+ public function setStopId( $value){
+ return $this->_set(5, $value);
+ }
+
+
+ // @@protoc_insertion_point(scope_class)
+ // @@protoc_insertion_point(class_transit_realtime.EntitySelector)
+ }
+}
+
+namespace transit_realtime\TranslatedString {
+
+ // @@protoc_insertion_point(scope_namespace)
+ // @@protoc_insertion_point(namespace_transit_realtime.TranslatedString)
+
+ class Translation extends \DrSlump\Protobuf\Message {
+
+ /** @var \Closure[] */
+ protected static $__extensions = array();
+
+ public static function descriptor()
+ {
+ $descriptor = new \DrSlump\Protobuf\Descriptor(__CLASS__, 'transit_realtime.TranslatedString.Translation');
+
+ // required text = 1
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 1;
+ $f->name = "text";
+ $f->type = 9;
+ $f->rule = 2;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.TranslatedString.Translation:text)
+ $descriptor->addField($f);
+
+ // optional language = 2
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 2;
+ $f->name = "language";
+ $f->type = 9;
+ $f->rule = 1;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.TranslatedString.Translation:language)
+ $descriptor->addField($f);
+
+ foreach (self::$__extensions as $cb) {
+ $descriptor->addField($cb(), true);
+ }
+
+ // @@protoc_insertion_point(scope_descriptor)
+ // @@protoc_insertion_point(descriptor_transit_realtime.TranslatedString.Translation)
+
+ return $descriptor;
+ }
+
+ /** @var string */
+ public $text = null;
+
+ /** @var string */
+ public $language = null;
+
+
+ /**
+ * Check if <text> has a value
+ *
+ * @return boolean
+ */
+ public function hasText(){
+ return $this->_has(1);
+ }
+
+ /**
+ * Clear <text> value
+ *
+ * @return \transit_realtime\TranslatedString\Translation
+ */
+ public function clearText(){
+ return $this->_clear(1);
+ }
+
+ /**
+ * Get <text> value
+ *
+ * @return string
+ */
+ public function getText(){
+ return $this->_get(1);
+ }
+
+ /**
+ * Set <text> value
+ *
+ * @param string $value
+ * @return \transit_realtime\TranslatedString\Translation
+ */
+ public function setText( $value){
+ return $this->_set(1, $value);
+ }
+
+ /**
+ * Check if <language> has a value
+ *
+ * @return boolean
+ */
+ public function hasLanguage(){
+ return $this->_has(2);
+ }
+
+ /**
+ * Clear <language> value
+ *
+ * @return \transit_realtime\TranslatedString\Translation
+ */
+ public function clearLanguage(){
+ return $this->_clear(2);
+ }
+
+ /**
+ * Get <language> value
+ *
+ * @return string
+ */
+ public function getLanguage(){
+ return $this->_get(2);
+ }
+
+ /**
+ * Set <language> value
+ *
+ * @param string $value
+ * @return \transit_realtime\TranslatedString\Translation
+ */
+ public function setLanguage( $value){
+ return $this->_set(2, $value);
+ }
+
+
+ // @@protoc_insertion_point(scope_class)
+ // @@protoc_insertion_point(class_transit_realtime.TranslatedString.Translation)
+ }
+}
+
+namespace transit_realtime {
+
+ // @@protoc_insertion_point(scope_namespace)
+ // @@protoc_insertion_point(namespace_transit_realtime)
+
+ class TranslatedString extends \DrSlump\Protobuf\Message {
+
+ /** @var \Closure[] */
+ protected static $__extensions = array();
+
+ public static function descriptor()
+ {
+ $descriptor = new \DrSlump\Protobuf\Descriptor(__CLASS__, 'transit_realtime.TranslatedString');
+
+ // repeated .transit_realtime.TranslatedString.Translation translation = 1
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 1;
+ $f->name = "translation";
+ $f->type = 11;
+ $f->rule = 3;
+ $f->reference = '\transit_realtime\TranslatedString\Translation';
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_transit_realtime.TranslatedString:translation)
+ $descriptor->addField($f);
+
+ foreach (self::$__extensions as $cb) {
+ $descriptor->addField($cb(), true);
+ }
+
+ // @@protoc_insertion_point(scope_descriptor)
+ // @@protoc_insertion_point(descriptor_transit_realtime.TranslatedString)
+
+ return $descriptor;
+ }
+
+ /** @var \transit_realtime\TranslatedString\Translation[] */
+ public $translation = array();
+
+
+ /**
+ * Check if <translation> has a value
+ *
+ * @return boolean
+ */
+ public function hasTranslation(){
+ return $this->_has(1);
+ }
+
+ /**
+ * Clear <translation> value
+ *
+ * @return \transit_realtime\TranslatedString
+ */
+ public function clearTranslation(){
+ return $this->_clear(1);
+ }
+
+ /**
+ * Get <translation> value
+ *
+ * @param int $idx
+ * @return \transit_realtime\TranslatedString\Translation
+ */
+ public function getTranslation($idx = NULL){
+ return $this->_get(1, $idx);
+ }
+
+ /**
+ * Set <translation> value
+ *
+ * @param \transit_realtime\TranslatedString\Translation $value
+ * @return \transit_realtime\TranslatedString
+ */
+ public function setTranslation(\transit_realtime\TranslatedString\Translation $value, $idx = NULL){
+ return $this->_set(1, $value, $idx);
+ }
+
+ /**
+ * Get all elements of <translation>
+ *
+ * @return \transit_realtime\TranslatedString\Translation[]
+ */
+ public function getTranslationList(){
+ return $this->_get(1);
+ }
+
+ /**
+ * Add a new element to <translation>
+ *
+ * @param \transit_realtime\TranslatedString\Translation $value
+ * @return \transit_realtime\TranslatedString
+ */
+ public function addTranslation(\transit_realtime\TranslatedString\Translation $value){
+ return $this->_add(1, $value);
+ }
+
+
+ // @@protoc_insertion_point(scope_class)
+ // @@protoc_insertion_point(class_transit_realtime.TranslatedString)
+ }
+}
+
+
--- /dev/null
+++ b/lib/Protobuf-PHP/gtfs-realtime.proto
@@ -1,1 +1,498 @@
-
+// Copyright 2010 Google Inc
+//
+// The content of this file is licensed under the Creative Commons Attribution
+// 3.0 License.
+//
+// Protocol definition file for GTFS-realtime.
+//
+// GTFS-realtime lets transit agencies provide consumers with realtime
+// information about disruptions to their service (stations closed, lines not
+// operating, important delays etc), location of their vehicles and expected
+// arrival times.
+//
+// This protocol is published on http://code.google.com/transit/realtime/ .
+
+syntax = "proto2";
+
+option cc_api_version = 2;
+option py_api_version = 1;
+
+option java_package = "com.google.transit.realtime";
+package transit_realtime;
+
+// The contents of a feed message.
+// A feed is a continuous stream of feed messages. Each message in the stream is
+// obtained as a response to an appropriate HTTP GET request.
+// A realtime feed is always defined with relation to an existing GTFS feed.
+// All the entity ids are resolved with respect to the GTFS feed.
+//
+// A feed depends on some external configuration:
+// - The corresponding GTFS feed.
+// - Feed application (updates, positions or alerts). A feed should contain only
+// items of one specified application; all the other entities will be ignored.
+// - Polling frequency
+message FeedMessage {
+ // Metadata about this feed and feed message.
+ required FeedHeader header = 1;
+
+ // Contents of the feed.
+ repeated FeedEntity entity = 2;
+}
+
+// Metadata about a feed, included in feed messages.
+message FeedHeader {
+ // Version of the feed specification.
+ // The current version is 1.0.
+ required string gtfs_realtime_version = 1;
+
+ // Determines whether the current fetch is incremental.
+ enum Incrementality {
+ FULL_DATASET = 0;
+ DIFFERENTIAL = 1;
+ }
+ optional Incrementality incrementality = 2 [default = FULL_DATASET];
+
+ // This timestamp identifies the moment when the content of this feed has been
+ // created (in server time). In POSIX time (i.e., number of seconds since
+ // January 1st 1970 00:00:00 UTC).
+ optional uint64 timestamp = 3;
+}
+
+// A definition (or update) of an entity in the transit feed.
+message FeedEntity {
+ // The ids are used only to provide incrementality support. The id should be
+ // unique within a FeedMessage. Consequent FeedMessages may contain
+ // FeedEntities with the same id. In case of a DIFFERENTIAL update the new
+ // FeedEntity with some id will replace the old FeedEntity with the same id
+ // (or delete it - see is_deleted below).
+ // The actual GTFS entities (e.g. stations, routes, trips) referenced by the
+ // feed must be specified by explicit selectors (see EntitySelector below for
+ // more info).
+ required string id = 1;
+
+ // Whether this entity is to be deleted. Relevant only for incremental
+ // fetches.
+ optional bool is_deleted = 2 [default = false];
+
+ // Data about the entity itself. Exactly one of the following fields must be
+ // present (unless the entity is being deleted).
+ optional TripUpdate trip_update = 3;
+ optional VehiclePosition vehicle = 4;
+ optional Alert alert = 5;
+}
+
+//
+// Entities used in the feed.
+//
+
+// Realtime update of the progress of a vehicle along a trip.
+// Depending on the value of ScheduleRelationship, a TripUpdate can specify:
+// - A trip that proceeds along the schedule.
+// - A trip that proceeds along a route but has no fixed schedule.
+// - A trip that have been added or removed with regard to schedule.
+//
+// The updates can be for future, predicted arrival/departure events, or for
+// past events that already occurred.
+// Normally, updates should get more precise and more certain (see
+// uncertainty below) as the events gets closer to current time.
+// Even if that is not possible, the information for past events should be
+// precise and certain. In particular, if an update points to time in the past
+// but its update's uncertainty is not 0, the client should conclude that the
+// update is a (wrong) prediction and that the trip has not completed yet.
+//
+// Note that the update can describe a trip that is already completed.
+// To this end, it is enough to provide an update for the last stop of the trip.
+// If the time of that is in the past, the client will conclude from that that
+// the whole trip is in the past (it is possible, although inconsequential, to
+// also provide updates for preceding stops).
+// This option is most relevant for a trip that has completed ahead of schedule,
+// but according to the schedule, the trip is still proceeding at the current
+// time. Removing the updates for this trip could make the client assume
+// that the trip is still proceeding.
+// Note that the feed provider is allowed, but not required, to purge past
+// updates - this is one case where this would be practically useful.
+message TripUpdate {
+ // The Trip that this message applies to. There can be at most one
+ // TripUpdate entity for each actual trip instance.
+ // If there is none, that means there is no prediction information available.
+ // It does *not* mean that the trip is progressing according to schedule.
+ required TripDescriptor trip = 1;
+
+ // Additional information on the vehicle that is serving this trip.
+ optional VehicleDescriptor vehicle = 3;
+
+ // Timing information for a single predicted event (either arrival or
+ // departure).
+ // Timing consists of delay and/or estimated time, and uncertainty.
+ // - delay should be used when the prediction is given relative to some
+ // existing schedule in GTFS.
+ // - time should be given whether there is a predicted schedule or not. If
+ // both time and delay are specified, time will take precedence
+ // (although normally, time, if given for a scheduled trip, should be
+ // equal to scheduled time in GTFS + delay).
+ //
+ // Uncertainty applies equally to both time and delay.
+ // The uncertainty roughly specifies the expected error in true delay (but
+ // note, we don't yet define its precise statistical meaning). It's possible
+ // for the uncertainty to be 0, for example for trains that are driven under
+ // computer timing control.
+ message StopTimeEvent {
+ // Delay (in seconds) can be positive (meaning that the vehicle is late) or
+ // negative (meaning that the vehicle is ahead of schedule). Delay of 0
+ // means that the vehicle is exactly on time.
+ optional int32 delay = 1;
+
+ // Event as absolute time.
+ // In Unix time (i.e., number of seconds since January 1st 1970 00:00:00
+ // UTC).
+ optional int64 time = 2;
+
+ // If uncertainty is omitted, it is interpreted as unknown.
+ // If the prediction is unknown or too uncertain, the delay (or time) field
+ // should be empty. In such case, the uncertainty field is ignored.
+ // To specify a completely certain prediction, set its uncertainty to 0.
+ optional int32 uncertainty = 3;
+ }
+
+ // Realtime update for arrival and/or departure events for a given stop on a
+ // trip. Updates can be supplied for both past and future events.
+ // The producer is allowed, although not required, to drop past events.
+ message StopTimeUpdate {
+ // The update is linked to a specific stop either through stop_sequence or
+ // stop_id, so one of the fields below must necessarily be set.
+ // See the documentation in TripDescriptor for more information.
+
+ // Must be the same as in stop_times.txt in the corresponding GTFS feed.
+ optional uint32 stop_sequence = 1;
+ // Must be the same as in stops.txt in the corresponding GTFS feed.
+ optional string stop_id = 4;
+
+ optional StopTimeEvent arrival = 2;
+ optional StopTimeEvent departure = 3;
+
+ // The relation between this StopTime and the static schedule.
+ enum ScheduleRelationship {
+ // The vehicle is proceeding in accordance with its static schedule of
+ // stops, although not necessarily according to the times of the schedule.
+ // At least one of arrival and departure must be provided. If the schedule
+ // for this stop contains both arrival and departure times then so must
+ // this update. An update with only an arrival, say, where the schedule
+ // has both, indicates that the trip is terminating early at this stop.
+ SCHEDULED = 0;
+
+ // The stop is skipped, i.e., the vehicle will not stop at this stop.
+ // Arrival and departure are optional.
+ SKIPPED = 1;
+
+ // No data is given for this stop. The main intention for this value is to
+ // give the predictions only for part of a trip, i.e., if the last update
+ // for a trip has a NO_DATA specifier, then StopTimes for the rest of the
+ // stops in the trip are considered to be unspecified as well.
+ // Neither arrival nor departure should be supplied.
+ NO_DATA = 2;
+ }
+ optional ScheduleRelationship schedule_relationship = 5
+ [default = SCHEDULED];
+ }
+
+ // Updates to StopTimes for the trip (both future, i.e., predictions, and in
+ // some cases, past ones, i.e., those that already happened).
+ // The updates must be sorted by stop_sequence, and apply for all the
+ // following stops of the trip up to the next specified one.
+ //
+ // Example 1:
+ // For a trip with 20 stops, a StopTimeUpdate with arrival delay and departure
+ // delay of 0 for stop_sequence of the current stop means that the trip is
+ // exactly on time.
+ //
+ // Example 2:
+ // For the same trip instance, 3 StopTimeUpdates are provided:
+ // - delay of 5 min for stop_sequence 3
+ // - delay of 1 min for stop_sequence 8
+ // - delay of unspecified duration for stop_sequence 10
+ // This will be interpreted as:
+ // - stop_sequences 3,4,5,6,7 have delay of 5 min.
+ // - stop_sequences 8,9 have delay of 1 min.
+ // - stop_sequences 10,... have unknown delay.
+ repeated StopTimeUpdate stop_time_update = 2;
+}
+
+// Realtime positioning information for a given vehicle.
+message VehiclePosition {
+ // The Trip that this vehicle is serving.
+ // Can be empty or partial if the vehicle can not be identified with a given
+ // trip instance.
+ optional TripDescriptor trip = 1;
+
+ // Additional information on the vehicle that is serving this trip.
+ optional VehicleDescriptor vehicle = 8;
+
+ // Current position of this vehicle.
+ optional Position position = 2;
+
+ // The stop sequence index of the current stop. The meaning of
+ // current_stop_sequence (i.e., the stop that it refers to) is determined by
+ // current_status.
+ // If current_status is missing IN_TRANSIT_TO is assumed.
+ optional uint32 current_stop_sequence = 3;
+ // Identifies the current stop. The value must be the same as in stops.txt in
+ // the corresponding GTFS feed.
+ optional string stop_id = 7;
+
+ enum VehicleStopStatus {
+ // The vehicle is just about to arrive at the stop (on a stop
+ // display, the vehicle symbol typically flashes).
+ INCOMING_AT = 0;
+
+ // The vehicle is standing at the stop.
+ STOPPED_AT = 1;
+
+ // The vehicle has departed and is in transit to the next stop.
+ IN_TRANSIT_TO = 2;
+ }
+ // The exact status of the vehicle with respect to the current stop.
+ // Ignored if current_stop_sequence is missing.
+ optional VehicleStopStatus current_status = 4 [default = IN_TRANSIT_TO];
+
+ // Moment at which the vehicle's position was measured. In POSIX time
+ // (i.e., number of seconds since January 1st 1970 00:00:00 UTC).
+ optional uint64 timestamp = 5;
+
+ // Congestion level that is affecting this vehicle.
+ enum CongestionLevel {
+ UNKNOWN_CONGESTION_LEVEL = 0;
+ RUNNING_SMOOTHLY = 1;
+ STOP_AND_GO = 2;
+ CONGESTION = 3;
+ SEVERE_CONGESTION = 4; // People leaving their cars.
+ }
+ optional CongestionLevel congestion_level = 6;
+}
+
+// An alert, indicating some sort of incident in the public transit network.
+message Alert {
+ // Time when the alert should be shown to the user. If missing, the
+ // alert will be shown as long as it appears in the feed.
+ // If multiple ranges are given, the alert will be shown during all of them.
+ repeated TimeRange active_period = 1;
+
+ // Entities whose users we should notify of this alert.
+ repeated EntitySelector informed_entity = 5;
+
+ // Cause of this alert.
+ enum Cause {
+ UNKNOWN_CAUSE = 1;
+ OTHER_CAUSE = 2; // Not machine-representable.
+ TECHNICAL_PROBLEM = 3;
+ STRIKE = 4; // Public transit agency employees stopped working.
+ DEMONSTRATION = 5; // People are blocking the streets.
+ ACCIDENT = 6;
+ HOLIDAY = 7;
+ WEATHER = 8;
+ MAINTENANCE = 9;
+ CONSTRUCTION = 10;
+ POLICE_ACTIVITY = 11;
+ MEDICAL_EMERGENCY = 12;
+ }
+ optional Cause cause = 6 [default = UNKNOWN_CAUSE];
+
+ // What is the effect of this problem on the affected entity.
+ enum Effect {
+ NO_SERVICE = 1;
+ REDUCED_SERVICE = 2;
+
+ // We don't care about INsignificant delays: they are hard to detect, have
+ // little impact on the user, and would clutter the results as they are too
+ // frequent.
+ SIGNIFICANT_DELAYS = 3;
+
+ DETOUR = 4;
+ ADDITIONAL_SERVICE = 5;
+ MODIFIED_SERVICE = 6;
+ OTHER_EFFECT = 7;
+ UNKNOWN_EFFECT = 8;
+ STOP_MOVED = 9;
+ }
+ optional Effect effect = 7 [default = UNKNOWN_EFFECT];
+
+ // The URL which provides additional information about the alert.
+ optional TranslatedString url = 8;
+
+ // Alert header. Contains a short summary of the alert text.
+ optional TranslatedString header_text = 10;
+
+ // Full description for the alert. The information in the description
+ // should add to the information of the header.
+ optional TranslatedString description_text = 11;
+}
+
+//
+// Low level data structures used above.
+//
+
+// A time interval.
+message TimeRange {
+ // Start time, in POSIX time (i.e., number of seconds since January 1st 1970
+ // 00:00:00 UTC).
+ // If missing, the interval starts at minus infinity.
+ optional uint64 start = 1;
+
+ // End time, in POSIX time (i.e., number of seconds since January 1st 1970
+ // 00:00:00 UTC).
+ // If missing, the interval ends at plus infinity.
+ optional uint64 end = 2;
+}
+
+// A position.
+message Position {
+ // Degrees North, in the WGS-84 coordinate system.
+ required float latitude = 1;
+
+ // Degrees East, in the WGS-84 coordinate system.
+ required float longitude = 2;
+
+ // Bearing, in degrees, clockwise from North, i.e., 0 is North and 90 is East.
+ // This can be the compass bearing, or the direction towards the next stop
+ // or intermediate location.
+ // This should not be direction deduced from the sequence of previous
+ // positions, which can be computed from previous data.
+ optional float bearing = 3;
+
+ // Odometer value, in meters.
+ optional double odometer = 4;
+ // Momentary speed measured by the vehicle, in meters per second.
+ optional float speed = 5;
+
+}
+
+// A descriptor that identifies an instance of a GTFS trip, or all instances of
+// a trip along a route.
+// - To specify a single trip instance, the trip_id (and if necessary,
+// start_time) is set. If route_id is also set, then it should be same as one
+// that the given trip corresponds to.
+// - To specify all the trips along a given route, only the route_id should be
+// set. Note that if the trip_id is not known, then stop sequence ids in
+// TripUpdate are not sufficient, and stop_ids must be provided as well. In
+// addition, absolute arrival/departure times must be provided.
+message TripDescriptor {
+ // The trip_id from the GTFS feed that this selector refers to.
+ // For non frequency expanded trips, this field is enough to uniquely identify
+ // the trip. For frequency expanded, start_time and start_date might also be
+ // necessary.
+ optional string trip_id = 1;
+
+ // The route_id from the GTFS that this selector refers to.
+ optional string route_id = 5;
+
+ // The scheduled start time of this trip instance.
+ // This field should be given only if the trip is frequency-expanded in the
+ // GTFS feed. The value must precisely correspond to start_time specified for
+ // the route in the GTFS feed plus some multiple of headway_secs.
+ // Format of the field is same as that of GTFS/frequencies.txt/start_time,
+ // e.g., 11:15:35 or 25:15:35.
+ optional string start_time = 2;
+
+ // The scheduled start date of this trip instance.
+ // Must be provided to disambiguate trips that are so late as to collide with
+ // a scheduled trip on a next day. For example, for a train that departs 8:00
+ // and 20:00 every day, and is 12 hours late, there would be two distinct
+ // trips on the same time.
+ // This field can be provided but is not mandatory for schedules in which such
+ // collisions are impossible - for example, a service running on hourly
+ // schedule where a vehicle that is one hour late is not considered to be
+ // related to schedule anymore.
+ // In YYYYMMDD format.
+ optional string start_date = 3;
+
+ // The relation between this trip and the static schedule. If a trip is done
+ // in accordance with temporary schedule, not reflected in GTFS, then it
+ // shouldn't be marked as SCHEDULED, but likely as ADDED.
+ enum ScheduleRelationship {
+ // Trip that is running in accordance with its GTFS schedule, or is close
+ // enough to the scheduled trip to be associated with it.
+ SCHEDULED = 0;
+
+ // An extra trip that was added in addition to a running schedule, for
+ // example, to replace a broken vehicle or to respond to sudden passenger
+ // load.
+ ADDED = 1;
+
+ // A trip that is running with no schedule associated to it, for example, if
+ // there is no schedule at all.
+ UNSCHEDULED = 2;
+
+ // A trip that existed in the schedule but was removed.
+ CANCELED = 3;
+
+ // A trip that replaces a portion of static schedule.
+ // If the trip selector identifies a certain trip instance, then only that
+ // instance is replaced. If the selector identifies a route, then all the
+ // trips along that route are replaced.
+ //
+ // The replacement applies only to the portion of the trip supplied. For
+ // instance, consider a route that goes through stops A,B,C,D,E,F, and a
+ // REPLACEMENT trip provides data for stops A,B,C. Then, the times for stops
+ // D,E,F are still taken from the static schedule.
+ //
+ // A feed might supply several REPLACEMENT trips. In this case, the portion
+ // of static schedule that is replaced is the union of what is defined by
+ // all the feeds. Normally, all the REPLACEMENT trips should either
+ // correspond to the same route or to individual trip instances.
+ REPLACEMENT = 5;
+ }
+ optional ScheduleRelationship schedule_relationship = 4;
+}
+
+// Identification information for the vehicle performing the trip.
+message VehicleDescriptor {
+ // Internal system identification of the vehicle. Should be unique per
+ // vehicle, and can be used for tracking the vehicle as it proceeds through
+ // the system.
+ optional string id = 1;
+
+ // User visible label, i.e., something that must be shown to the passenger to
+ // help identify the correct vehicle.
+ optional string label = 2;
+
+ // The license plate of the vehicle.
+ optional string license_plate = 3;
+}
+
+// A selector for an entity in a GTFS feed.
+message EntitySelector {
+ // The values of the fields should correspond to the appropriate fields in the
+ // GTFS feed.
+ // At least one specifier must be given. If several are given, then the
+ // matching has to apply to all the given specifiers.
+ optional string agency_id = 1;
+ optional string route_id = 2;
+ // corresponds to route_type in GTFS.
+ optional int32 route_type = 3;
+ optional TripDescriptor trip = 4;
+ optional string stop_id = 5;
+}
+
+// An internationalized message containing per-language versions of a snippet of
+// text or a URL.
+// One of the strings from a message will be picked up. The resolution proceeds
+// as follows:
+// 1. If the UI language matches the language code of a translation,
+// the first matching translation is picked.
+// 2. If a default UI language (e.g., English) matches the language code of a
+// translation, the first matching translation is picked.
+// 3. If some translation has an unspecified language code, that translation is
+// picked.
+message TranslatedString {
+ message Translation {
+ // A UTF-8 string containing the message.
+ required string text = 1;
+ // BCP-47 language code. Can be omitted if the language is unknown or if
+ // no i18n is done at all for the feed. At most one translation is
+ // allowed to have an unspecified language tag.
+ optional string language = 2;
+ }
+ // At least one translation must be provided.
+ repeated Translation translation = 1;
+}
+
+
--- /dev/null
+++ b/lib/Protobuf-PHP/library/DrSlump/Protobuf.php
@@ -1,1 +1,167 @@
+<?php
+namespace DrSlump;
+
+use DrSlump\Protobuf;
+
+class Protobuf
+{
+ const VERSION = '@package_version@';
+
+ const RULE_OPTIONAL = 1;
+ const RULE_REQUIRED = 2;
+ const RULE_REPEATED = 3;
+ const RULE_UNKNOWN = -1;
+
+ const TYPE_DOUBLE = 1;
+ const TYPE_FLOAT = 2;
+ const TYPE_INT64 = 3;
+ const TYPE_UINT64 = 4;
+ const TYPE_INT32 = 5;
+ const TYPE_FIXED64 = 6;
+ const TYPE_FIXED32 = 7;
+ const TYPE_BOOL = 8;
+ const TYPE_STRING = 9;
+ const TYPE_GROUP = 10;
+ const TYPE_MESSAGE = 11;
+ const TYPE_BYTES = 12;
+ const TYPE_UINT32 = 13;
+ const TYPE_ENUM = 14;
+ const TYPE_SFIXED32 = 15;
+ const TYPE_SFIXED64 = 16;
+ const TYPE_SINT32 = 17;
+ const TYPE_SINT64 = 18;
+ const TYPE_UNKNOWN = -1;
+
+
+ static protected $codecs = array();
+
+
+ /**
+ * Setup SPL autoloader for Protobuf library classes
+ *
+ * @static
+ * @return void
+ */
+ static public function autoload()
+ {
+ spl_autoload_register(function($class){
+ $prefix = __CLASS__ . '\\';
+ if (strpos($class, $prefix) === 0) {
+ // Remove vendor from name
+ $class = substr($class, strlen(__NAMESPACE__)+1);
+ // Convert namespace separator to directory ones
+ $class = str_replace('\\', DIRECTORY_SEPARATOR, $class);
+ // Prefix with this file's directory
+ $class = __DIR__ . DIRECTORY_SEPARATOR . $class;
+
+ include($class . '.php');
+ return true;
+ }
+
+ return false;
+ });
+ }
+
+ /**
+ * Obtain an instance of the descriptor's registry
+ *
+ * @static
+ * @return Protobuf\Registry
+ */
+ static public function getRegistry()
+ {
+ static $registry = NULL;
+
+ if (NULL === $registry) {
+ $registry = new Protobuf\Registry();
+ }
+
+ return $registry;
+ }
+
+
+ static public function getCodec($codec = null)
+ {
+ if ($codec instanceof Protobuf\CodecInterface) {
+ return $codec;
+ }
+
+ // Bootstrap the library's default codec if none is available
+ if (!isset(self::$codecs['default'])) {
+ $default = new Protobuf\Codec\Binary();
+ self::registerCodec('default', $default);
+ self::registerCodec('binary', $default);
+ }
+
+ if (is_string($codec)) {
+ $codec = strtolower($codec);
+ if (!isset(self::$codecs[$codec])) {
+ throw new Protobuf\Exception('No codec found by name "' . $codec . '"');
+ }
+ return self::$codecs[$codec];
+ }
+
+ return self::getCodec('default');
+ }
+
+ static public function setDefaultCodec($codec)
+ {
+ if (is_string($codec)) {
+ $codec = self::getCodec($codec);
+ }
+
+ if ($codec instanceof Protobuf\CodecInterface) {
+ self::registerCodec('default', $codec);
+ } else {
+ throw new Protobuf\Exception('Codec must implement DrSlump\Protobuf\CodecInterface');
+ }
+ }
+
+ static public function registerCodec($name, Protobuf\CodecInterface $codec)
+ {
+ $name = strtolower($name);
+ self::$codecs[$name] = $codec;
+ }
+
+ static public function unregisterCodec($name)
+ {
+ $name = strtolower($name);
+ if (isset(self::$codecs[$name])) {
+ unset(self::$codecs[$name]);
+ return true;
+ }
+ return false;
+ }
+
+ /**
+ * Encodes a message using the default codec
+ *
+ * @static
+ * @param \DrSlump\Protobuf\Message $message
+ * @return string
+ */
+ static public function encode(Protobuf\Message $message)
+ {
+ $codec = self::getCodec();
+ return $codec->encode($message);
+ }
+
+ /**
+ * @static
+ * @param String|Message $message
+ * @param String $data
+ * @return \DrSlump\Protobuf\Message
+ */
+ static public function decode($message, $data)
+ {
+ if (is_string($message)) {
+ $message = '\\' . ltrim($message, '\\');
+ $message = new $message;
+ }
+
+ $codec = self::getCodec();
+ return $codec->decode($message, $data);
+ }
+}
+
--- /dev/null
+++ b/lib/Protobuf-PHP/library/DrSlump/Protobuf/AnnotatedMessage.php
@@ -1,1 +1,116 @@
+<?php
+namespace DrSlump\Protobuf;
+
+use DrSlump\Protobuf;
+
+abstract class AnnotatedMessage extends Message
+{
+ static public function descriptor()
+ {
+ $class = get_called_class();
+
+ // Instantiate a new descriptor
+ $descriptor = new Descriptor($class);
+
+ $rflClass = new \ReflectionClass($class);
+ $props = $rflClass->getProperties();
+ foreach ($props as $prop) {
+ $doc = $prop->getDocComment();
+ if (empty($doc)) {
+ continue;
+ }
+
+ // Format: @protobuf(tag=X, type=bool, required=true)
+
+ // Extract annotation from the comment
+ if (!preg_match('/@protobuf\s?\(([^\)]+)\)/', $doc, $m)) {
+ continue;
+ }
+
+ // Parse params
+ $params = explode(',', $m[1]);
+ $params = array_filter(array_map('trim', $params));
+
+ $options = array();
+ foreach ($params as $param) {
+ $parts = explode('=', $param);
+ $parts = array_filter(array_map('trim', $parts));
+ $options[$parts[0]] = count($parts) < 2
+ ? true
+ : $parts[1];
+ }
+
+ // Check if we have the minimum required options
+ if (empty($options['tag'])) {
+ throw new \InvalidArgumentException('The tag option is required for property ' . $prop->getName());
+ }
+ if (empty($options['type'])) {
+ throw new \InvalidArgumentException('The type option is required for property ' . $prop->getName());
+ }
+
+ // Normalize boolean values
+ foreach(array('required', 'optional', 'repeated', 'packed') as $opt) {
+ if (isset($options[$opt])) {
+ $options[$opt] = filter_var($options[$opt], FILTER_VALIDATE_BOOLEAN);
+ }
+ }
+
+ // Build a field descriptor
+ $f = new Protobuf\Field();
+ $f->number = (int)$options['tag'];
+ $f->name = $prop->getName();
+
+ // Convert type name to its numeric constant
+ switch (strtolower($options['type'])) {
+ case 'double' : $f->type = Protobuf::TYPE_DOUBLE; break;
+ case 'float' : $f->type = Protobuf::TYPE_FLOAT; break;
+ case 'int64' : $f->type = Protobuf::TYPE_INT64; break;
+ case 'uint64' : $f->type = Protobuf::TYPE_UINT64; break;
+ case 'int32' : $f->type = Protobuf::TYPE_INT32; break;
+ case 'fixed64' : $f->type = Protobuf::TYPE_FIXED64; break;
+ case 'fixed32' : $f->type = Protobuf::TYPE_FIXED32; break;
+ case 'bool' : $f->type = Protobuf::TYPE_BOOL; break;
+ case 'string' : $f->type = Protobuf::TYPE_STRING; break;
+ case 'message' : $f->type = Protobuf::TYPE_MESSAGE; break;
+ case 'bytes' : $f->type = Protobuf::TYPE_BYTES; break;
+ case 'uint32' : $f->type = Protobuf::TYPE_UINT32; break;
+ case 'enum' : $f->type = Protobuf::TYPE_ENUM; break;
+ case 'sfixed32': $f->type = Protobuf::TYPE_SFIXED32; break;
+ case 'sfixed64': $f->type = Protobuf::TYPE_SFIXED64; break;
+ case 'sint32' : $f->type = Protobuf::TYPE_SINT32; break;
+ case 'sint64' : $f->type = Protobuf::TYPE_SINT64; break;
+ default:
+ throw new \InvalidArgumentException('Type ' . $options['type'] . ' is not recognized as valid for property ' . $prop->getName());
+ }
+
+ // Define the rule type
+ $f->rule = Protobuf::RULE_OPTIONAL;
+ if (!empty($options['required'])) $f->rule = Protobuf::RULE_REQUIRED;
+ if (!empty($options['repeated'])) $f->rule = Protobuf::RULE_REPEATED;
+
+ // Check if it's flagged as packed
+ if (isset($options['packed'])) {
+ $f->packed = $options['packed'];
+ }
+
+ // Get the reference
+ if (isset($options['reference'])) {
+ $f->reference = $options['reference'];
+ } else if ($f->type === Protobuf::TYPE_MESSAGE || $f->type === Protobuf::TYPE_ENUM) {
+ throw new \InvalidArgumentException('Property ' . $prop->getName() . ' requires the "reference" option');
+ }
+
+ if (isset($options['default'])) {
+ $f->default = $options['default'];
+ }
+
+ // Add the field to the message descriptor
+ $descriptor->addField($f);
+ }
+
+ return $descriptor;
+ }
+
+}
+
--- /dev/null
+++ b/lib/Protobuf-PHP/library/DrSlump/Protobuf/Codec/Binary.php
@@ -1,1 +1,389 @@
-
+<?php
+
+namespace DrSlump\Protobuf\Codec;
+
+use DrSlump\Protobuf;
+
+class Binary implements Protobuf\CodecInterface
+{
+ const WIRE_VARINT = 0;
+ const WIRE_FIXED64 = 1;
+ const WIRE_LENGTH = 2;
+ const WIRE_GROUP_START = 3;
+ const WIRE_GROUP_END = 4;
+ const WIRE_FIXED32 = 5;
+ const WIRE_UNKNOWN = -1;
+
+ /**
+ * @param \DrSlump\Protobuf\Message $message
+ * @return string
+ */
+ public function encode(Protobuf\Message $message)
+ {
+ return $this->encodeMessage($message);
+ }
+
+ /**
+ * @param String|Message $message
+ * @param String $data
+ * @return \DrSlump\Protobuf\Message
+ */
+ public function decode(Protobuf\Message $message, $data)
+ {
+ return $this->decodeMessage($message, $data);
+ }
+
+
+ protected function encodeMessage(Protobuf\Message $message)
+ {
+ $writer = new Binary\Writer();
+
+ // Get message descriptor
+ $descriptor = Protobuf::getRegistry()->getDescriptor($message);
+
+ foreach ($descriptor->getFields() as $tag=>$field) {
+
+ $empty = !$message->_has($tag);
+ if ($field->isRequired() && $empty) {
+ throw new \UnexpectedValueException(
+ 'Message ' . get_class($message) . '\'s field tag ' . $tag . '(' . $field->getName() . ') is required but has no value'
+ );
+ }
+
+ // Skip empty fields
+ if ($empty) {
+ continue;
+ }
+
+ $type = $field->getType();
+ $wire = $field->isPacked() ? self::WIRE_LENGTH : $this->getWireType($type, null);
+
+ // Compute key with tag number and wire type
+ $key = $tag << 3 | $wire;
+
+ $value = $message->_get($tag);
+
+ if ($field->isRepeated()) {
+
+ // Packed fields are encoded as a length-delimited stream containing
+ // the concatenated encoding of each value.
+ if ($field->isPacked() && !empty($value)) {
+ $subwriter = new Binary\Writer();
+ foreach($value as $val) {
+ $this->encodeSimpleType($subwriter, $type, $val);
+ }
+ $data = $subwriter->getBytes();
+ $writer->varint($key);
+ $writer->varint(strlen($data));
+ $writer->write($data);
+ } else {
+ foreach($value as $val) {
+ if ($type !== Protobuf::TYPE_MESSAGE) {
+ $writer->varint($key);
+ $this->encodeSimpleType($writer, $type, $val);
+ } else {
+ $writer->varint($key);
+ $data = $this->encodeMessage($val);
+ $writer->varint(strlen($data));
+ $writer->write($data);
+ }
+ }
+ }
+ } else {
+ if ($type !== Protobuf::TYPE_MESSAGE) {
+ $writer->varint($key);
+ $this->encodeSimpleType($writer, $type, $value);
+ } else {
+ $writer->varint($key);
+ $data = $this->encodeMessage($value);
+ $writer->varint(strlen($data));
+ $writer->write($data);
+ }
+ }
+ }
+
+ return $writer->getBytes();
+ }
+
+ protected function encodeSimpleType($writer, $type, $value)
+ {
+ switch ($type) {
+ case Protobuf::TYPE_INT32:
+ case Protobuf::TYPE_INT64:
+ case Protobuf::TYPE_UINT64:
+ case Protobuf::TYPE_UINT32:
+ $writer->varint($value);
+ break;
+
+ case Protobuf::TYPE_SINT32: // ZigZag
+ $writer->zigzag($value, 32);
+ break;
+
+ case Protobuf::TYPE_SINT64 : // ZigZag
+ $writer->zigzag($value, 64);
+ break;
+
+ case Protobuf::TYPE_DOUBLE:
+ $writer->double($value);
+ break;
+ case Protobuf::TYPE_FIXED64:
+ $writer->fixed64($value);
+ break;
+ case Protobuf::TYPE_SFIXED64:
+ $writer->sFixed64($value);
+ break;
+
+ case Protobuf::TYPE_FLOAT:
+ $writer->float($value);
+ break;
+ case Protobuf::TYPE_FIXED32:
+ $writer->fixed32($value);
+ break;
+ case Protobuf::TYPE_SFIXED32:
+ $writer->sFixed32($value);
+ break;
+
+ case Protobuf::TYPE_BOOL:
+ $writer->varint($value ? 1 : 0);
+ break;
+
+ case Protobuf::TYPE_STRING:
+ case Protobuf::TYPE_BYTES:
+ $writer->varint(strlen($value));
+ $writer->write($value);
+ break;
+
+ case Protobuf::TYPE_MESSAGE:
+ // Messages are not supported in this method
+ return null;
+
+ case Protobuf::TYPE_ENUM:
+ $writer->varint($value);
+ break;
+
+ default:
+ throw new \Exception('Unknown field type ' . $type);
+ }
+ }
+
+
+ protected function decodeMessage(\DrSlump\Protobuf\Message $message, $data)
+ {
+ /** @var $message \DrSlump\Protobuf\Message */
+ /** @var $descriptor \DrSlump\Protobuf\Descriptor */
+
+ // Create a binary reader for the data
+ $reader = new Protobuf\Codec\Binary\Reader($data);
+
+ // Get message descriptor
+ $descriptor = Protobuf::getRegistry()->getDescriptor($message);
+
+ while (!$reader->eof()) {
+
+ // Get initial varint with tag number and wire type
+ $key = $reader->varint();
+ if ($reader->eof()) break;
+
+ $wire = $key & 0x7;
+ $tag = $key >> 3;
+
+ // Find the matching field for the tag number
+ $field = $descriptor->getField($tag);
+ if (!$field) {
+ $data = $this->decodeUnknown($reader, $wire);
+ $unknown = new Binary\Unknown($tag, $wire, $data);
+ $message->addUnknown($unknown);
+ continue;
+ }
+
+ $type = $field->getType();
+
+ // Check if we are dealing with a packed stream, we cannot rely on the packed
+ // flag of the message since we cannot be certain if the creator of the message
+ // was using it.
+ if ($wire === self::WIRE_LENGTH && $field->isRepeated() && $this->isPackable($type)) {
+ $length = $reader->varint();
+ $until = $reader->pos() + $length;
+ while ($reader->pos() < $until) {
+ $item = $this->decodeSimpleType($reader, $type, self::WIRE_VARINT);
+ $message->_add($tag, $item);
+ }
+
+ } else {
+
+ // Assert wire and type match
+ $this->assertWireType($wire, $type);
+
+ // Check if it's a sub-message
+ if ($type === Protobuf::TYPE_MESSAGE) {
+ $submessage = $field->getReference();
+ $submessage = new $submessage;
+
+ $length = $this->decodeSimpleType($reader, Protobuf::TYPE_INT64, self::WIRE_VARINT);
+ $data = $reader->read($length);
+
+ $value = $this->decodeMessage($submessage, $data);
+ } else {
+ $value = $this->decodeSimpleType($reader, $type, $wire);
+ }
+
+ // Support non-packed repeated fields
+ if ($field->isRepeated()) {
+ $message->_add($tag, $value);
+ } else {
+ $message->_set($tag, $value);
+ }
+ }
+ }
+
+ return $message;
+ }
+
+ protected function isPackable($type)
+ {
+ static $packable = array(
+ Protobuf::TYPE_INT64,
+ Protobuf::TYPE_UINT64,
+ Protobuf::TYPE_INT32,
+ Protobuf::TYPE_UINT32,
+ Protobuf::TYPE_SINT32,
+ Protobuf::TYPE_SINT64,
+ Protobuf::TYPE_DOUBLE,
+ Protobuf::TYPE_FIXED64,
+ Protobuf::TYPE_SFIXED64,
+ Protobuf::TYPE_FLOAT,
+ Protobuf::TYPE_FIXED32,
+ Protobuf::TYPE_SFIXED32,
+ Protobuf::TYPE_BOOL,
+ Protobuf::TYPE_ENUM
+ );
+
+ return in_array($type, $packable);
+ }
+
+ protected function decodeUnknown($reader, $wire)
+ {
+ switch ($wire) {
+ case self::WIRE_VARINT:
+ return $reader->varint();
+ case self::WIRE_LENGTH:
+ $length = $reader->varint();
+ return $reader->read($length);
+ case self::WIRE_FIXED32:
+ return $reader->fixed32();
+ case self::WIRE_FIXED64:
+ return $reader->fixed64();
+ case self::WIRE_GROUP_START:
+ case self::WIRE_GROUP_END:
+ throw new \RuntimeException('Groups are deprecated in Protocol Buffers and unsupported by this library');
+ default:
+ throw new \RuntimeException('Unsupported wire type (' . $wire . ') while consuming unknown field');
+ }
+ }
+
+ protected function assertWireType($wire, $type)
+ {
+ $expected = $this->getWireType($type, $wire);
+ if ($wire !== $expected) {
+ throw new \RuntimeException("Expected wire type $expected but got $wire for type $type");
+ }
+ }
+
+ protected function getWireType($type, $default)
+ {
+ switch ($type) {
+ case Protobuf::TYPE_INT32:
+ case Protobuf::TYPE_INT64:
+ case Protobuf::TYPE_UINT32:
+ case Protobuf::TYPE_UINT64:
+ case Protobuf::TYPE_SINT32:
+ case Protobuf::TYPE_SINT64:
+ case Protobuf::TYPE_BOOL:
+ case Protobuf::TYPE_ENUM:
+ return self::WIRE_VARINT;
+ case Protobuf::TYPE_FIXED64:
+ case Protobuf::TYPE_SFIXED64:
+ case Protobuf::TYPE_DOUBLE:
+ return self::WIRE_FIXED64;
+ case Protobuf::TYPE_STRING:
+ case Protobuf::TYPE_BYTES:
+ case Protobuf::TYPE_MESSAGE:
+ return self::WIRE_LENGTH;
+ case Protobuf::TYPE_FIXED32:
+ case Protobuf::TYPE_SFIXED32:
+ case Protobuf::TYPE_FLOAT:
+ return self::WIRE_FIXED32;
+ default:
+ // Unknown fields just return the reported wire type
+ return $default;
+ }
+ }
+
+ protected function decodeSimpleType($reader, $type, $wireType)
+ {
+ switch ($type) {
+ case Protobuf::TYPE_INT64:
+ case Protobuf::TYPE_UINT64:
+ case Protobuf::TYPE_INT32:
+ case Protobuf::TYPE_UINT32:
+ return $reader->varint();
+
+ case Protobuf::TYPE_SINT32: // ZigZag
+ return $reader->zigzag();
+ case Protobuf::TYPE_SINT64: // ZigZag
+ return $reader->zigzag();
+ case Protobuf::TYPE_DOUBLE:
+ return $reader->double();
+ case Protobuf::TYPE_FIXED64:
+ return $reader->fixed64();
+ case Protobuf::TYPE_SFIXED64:
+ return $reader->sFixed64();
+
+ case Protobuf::TYPE_FLOAT:
+ return $reader->float();
+ case Protobuf::TYPE_FIXED32:
+ return $reader->fixed32();
+ case Protobuf::TYPE_SFIXED32:
+ return $reader->sFixed32();
+
+ case Protobuf::TYPE_BOOL:
+ return (bool)$reader->varint();
+
+ case Protobuf::TYPE_STRING:
+ $length = $reader->varint();
+ return $reader->read($length);
+
+ case Protobuf::TYPE_MESSAGE:
+ // Messages are not supported in this method
+ return null;
+
+ case Protobuf::TYPE_BYTES:
+ $length = $reader->varint();
+ return $reader->read($length);
+
+ case Protobuf::TYPE_ENUM:
+ return $reader->varint();
+
+ default:
+ // Unknown type, follow wire type rules
+ switch ($wireType) {
+ case self::WIRE_VARINT:
+ return $reader->varint();
+ case self::WIRE_FIXED32:
+ return $reader->fixed32();
+ case self::WIRE_FIXED64:
+ return $reader->fixed64();
+ case self::WIRE_LENGTH:
+ $length = $reader->varint();
+ return $reader->read($length);
+ case self::WIRE_GROUP_START:
+ case self::WIRE_GROUP_END:
+ throw new \RuntimeException('Group is deprecated and not supported');
+ default:
+ throw new \RuntimeException('Unsupported wire type number ' . $wireType);
+ }
+ }
+
+ }
+
+}
--- /dev/null
+++ b/lib/Protobuf-PHP/library/DrSlump/Protobuf/Codec/Binary/Reader.php
@@ -1,1 +1,223 @@
-
+<?php
+
+namespace DrSlump\Protobuf\Codec\Binary;
+
+/**
+ * Implements reading primitives for Protobuf binary streams
+ *
+ * Important: There are no checks in place for overflows, so you must
+ * be aware of PHP's integer and floating point limits.
+ *
+ * @note Protobuf uses little-endian order
+ */
+class Reader
+{
+ /** @var resource */
+ protected $_fd;
+
+ /**
+ * Create a new reader from a file descriptor or a string of bytes
+ *
+ * @param resource|string $fdOrString
+ */
+ public function __construct($fdOrString)
+ {
+ if (is_resource($fdOrString)) {
+ $this->_fd = $fdOrString;
+ } else {
+ // @todo Could this be faster by using a custom String wrapper?
+ $this->_fd = fopen('data://text/plain,' . urlencode($fdOrString), 'rb');
+ }
+ }
+
+ public function __destruct()
+ {
+ fclose($this->_fd);
+ }
+
+ /**
+ * Obtain a number of bytes from the string
+ *
+ * @throws \RuntimeException
+ * @param int $length
+ * @return string
+ */
+ public function read($length)
+ {
+ // Protect against 0 byte reads when an EOF
+ if ($length < 1) return '';
+
+ $bytes = fread($this->_fd, $length);
+ if (FALSE === $bytes) {
+ throw new \RuntimeException('Failed to read ' . $length . ' bytes');
+ }
+
+ return $bytes;
+ }
+
+ /**
+ * Check if we have reached the end of the stream
+ *
+ * @return bool
+ */
+ public function eof()
+ {
+ return feof($this->_fd);
+ }
+
+ /**
+ * Obtain the current position in the stream
+ *
+ * @return int
+ */
+ public function pos()
+ {
+ return ftell($this->_fd);
+ }
+
+ /**
+ * Obtain a byte
+ *
+ * @return int
+ */
+ public function byte()
+ {
+ return ord($this->read(1));
+ }
+
+ /**
+ * Decode a varint
+ *
+ * @return int
+ */
+ public function varint()
+ {
+ $result = $shift = 0;
+ do {
+ $byte = $this->byte();
+ $result |= ($byte & 0x7f) << $shift;
+ $shift += 7;
+ } while ($byte > 0x7f);
+
+ return $result;
+ }
+
+ /**
+ * Decodes a zigzag integer of the given bits
+ *
+ * @param int $bits - Either 32 or 64
+ */
+ public function zigzag()
+ {
+ $number = $this->varint();
+ return ($number >> 1) ^ (-($number & 1));
+ }
+
+ /**
+ * Decode a fixed 32bit integer with sign
+ *
+ * @return int
+ */
+ public function sFixed32()
+ {
+ $bytes = $this->read(4);
+ if ($this->isBigEndian()) {
+ $bytes = strrev($bytes);
+ }
+
+ list(, $result) = unpack('l', $bytes);
+ return $result;
+ }
+
+ /**
+ * Decode a fixed 32bit integer without sign
+ *
+ * @return int
+ */
+ public function fixed32()
+ {
+ $bytes = $this->read(4);
+
+ if (PHP_INT_SIZE < 8) {
+ list(, $lo, $hi) = unpack('v*', $bytes);
+ $result = $hi << 16 | $lo;
+ } else {
+ list(, $result) = unpack('V*', $bytes);
+ }
+
+ return $result;
+ }
+
+ /**
+ * Decode a fixed 62bit integer with sign
+ *
+ * @return int
+ */
+ public function sFixed64()
+ {
+ $bytes = $this->read(8);
+
+ list(, $lo0, $lo1, $hi0, $hi1) = unpack('v*', $bytes);
+ return ($hi1 << 16 | $hi0) << 32 | ($lo1 << 16 | $lo0);
+ }
+
+ /**
+ * Decode a fixed 62bit integer without sign
+ *
+ * @return int
+ */
+ public function fixed64()
+ {
+ return $this->sFixed64();
+ }
+
+ /**
+ * Decode a 32bit float
+ *
+ * @return float
+ */
+ public function float()
+ {
+ $bytes = $this->read(4);
+ if ($this->isBigEndian()) {
+ $bytes = strrev($bytes);
+ }
+
+ list(, $result) = unpack('f', $bytes);
+ return $result;
+ }
+
+ /**
+ * Decode a 64bit double
+ *
+ * @return float
+ */
+ public function double()
+ {
+ $bytes = $this->read(8);
+ if ($this->isBigEndian()) {
+ $bytes = strrev($bytes);
+ }
+
+ list(, $result) = unpack('d', $bytes);
+ return $result;
+ }
+
+ /**
+ * Check if the current architecture is Big Endian
+ *
+ * @return bool
+ */
+ public function isBigEndian()
+ {
+ static $endianness;
+
+ if (NULL === $endianness) {
+ list(,$result) = unpack('L', pack('V', 1));
+ $endianness = $result !== 1;
+ }
+
+ return $endianness;
+ }
+}
+
--- /dev/null
+++ b/lib/Protobuf-PHP/library/DrSlump/Protobuf/Codec/Binary/Unknown.php
@@ -1,1 +1,14 @@
+<?php
+namespace DrSlump\Protobuf\Codec\Binary;
+
+class Unknown extends \DrSlump\Protobuf\Unknown
+{
+ public function __construct($tag, $type, $data)
+ {
+ $this->tag = $tag;
+ $this->type = $type;
+ $this->data = $data;
+ }
+}
+
--- /dev/null
+++ b/lib/Protobuf-PHP/library/DrSlump/Protobuf/Codec/Binary/Writer.php
@@ -1,1 +1,318 @@
-
+<?php
+
+namespace DrSlump\Protobuf\Codec\Binary;
+
+/**
+ * Implements writing primitives for Protobuf binary streams
+ *
+ * @note Protobuf uses little-endian order
+ */
+class Writer
+{
+ /** @var resource */
+ protected $_fd;
+
+
+ public function __construct()
+ {
+ $this->_fd = fopen('php://memory', 'wb');
+ }
+
+ public function __destruct()
+ {
+ fclose($this->_fd);
+ }
+
+ /**
+ * Get the current bytes in the stream
+ *
+ * @return string
+ */
+ public function getBytes()
+ {
+ fseek($this->_fd, 0, SEEK_SET);
+ return stream_get_contents($this->_fd);
+ }
+
+ /**
+ * Store the given bytes in the stream
+ *
+ * @throws \RuntimeException
+ * @param string $bytes
+ * @param int $length
+ */
+ public function write($bytes, $length = null)
+ {
+ if ($length === NULL) {
+ $length = strlen($bytes);
+ }
+
+ $written = fwrite($this->_fd, $bytes, $length);
+ if ($written !== $length) {
+ throw new \RuntimeException('Failed to write ' . $length . ' bytes');
+ }
+ }
+
+ /**
+ * Store a single byte
+ *
+ * @param int $value
+ */
+ public function byte($value)
+ {
+ $this->write(chr($value), 1);
+ }
+
+ /**
+ * Store an integer encoded as varint
+ *
+ * @throws \OutOfBoundsException
+ * @param int $value
+ */
+ public function varint($value)
+ {
+ // Small values do not need to be encoded
+ if ($value >= 0 && $value < 0x80) {
+ $this->byte($value);
+ return;
+ }
+
+ // Build an array of bytes with the encoded values
+ if ($value > 0) {
+ $values = array();
+ while ($value > 0) {
+ $values[] = 0x80 | ($value & 0x7f);
+ $value = $value >> 7;
+ }
+ } else if (function_exists('gmp_init')) {
+ $value = PHP_INT_SIZE < 8
+ ? gmp_and($value, '0x0ffffffffffffffff')
+ : sprintf('%u', $value);
+
+ $values = $this->varint_gmp($value);
+ } else if (PHP_INT_SIZE < 8) {
+ throw new \OutOfBoundsException(
+ "PHP versions compiled with 32bit integers can only support negative integer encoding with GMP extension ($value was given)"
+ );
+ } else if (function_exists('bccomp')) {
+ $value = sprintf('%u', $value);
+ $values = $this->varint_bc($value);
+ } else {
+ throw new \OutOfBoundsException("Varints of negative integers are only supported with GMP or BC big integers PHP extensions ($value was given)");
+ }
+
+ // Remove the MSB flag from the last byte
+ $values[count($values)-1] &= 0x7f;
+
+ // Convert the byte sized ints to actual bytes in a string
+ //$bytes = implode('', array_map('chr', $values));
+ $bytes = call_user_func_array('pack', array_merge(array('C*'), $values));;
+
+ $this->write($bytes);
+ }
+
+ public function varint_gmp($value)
+ {
+ static $x00, $x7f, $x80;
+
+ if (NULL === $x00) {
+ $x00 = \gmp_init(0x00);
+ $x7f = \gmp_init(0x7f);
+ $x80 = \gmp_init(0x80);
+ }
+
+ $values = array();
+ while (\gmp_cmp($value, $x00) > 0) {
+ $values[] = \gmp_intval(\gmp_and($value, $x7f)) | 0x80;
+ $value = \gmp_div_q($value, $x80);
+ }
+
+ return $values;
+ }
+
+ public function varint_bc($value)
+ {
+ $values = array();
+ while (\bccomp($value, 0, 0) > 0) {
+ // Get the last 7bits of the number
+ $bin = '';
+ $dec = $value;
+ do {
+ $rest = bcmod($dec, 2);
+ $dec = bcdiv($dec, 2, 0);
+ $bin = $rest . $bin;
+ } while ($dec > 0 && strlen($bin) < 7);
+
+ // Pack as a decimal and apply the flag
+ $values[] = intval($bin, 2) | 0x80;
+
+ $value = bcdiv($value, 0x80, 0);
+ }
+
+ return $values;
+ }
+
+ /**
+ * Encodes an integer with zigzag
+ *
+ * @param int $value
+ * @param int $base Either 32 or 64 bits
+ */
+ public function zigzag($value, $base = 32)
+ {
+ $value = ($value << 1) ^ ($value >> $base-1);
+ $this->varint($value);
+ }
+
+ /**
+ * Encode an integer as a fixed of 32bits with sign
+ *
+ * @param int $value
+ */
+ public function sFixed32($value)
+ {
+ $bytes = pack('l*', $value);
+ if ($this->isBigEndian()) {
+ $bytes = strrev($bytes);
+ }
+
+ $this->write($bytes, 4);
+ }
+
+ /**
+ * Encode an integer as a fixed of 32bits without sign
+ *
+ * @param int $value
+ */
+ public function fixed32($value)
+ {
+ $bytes = pack('V*', $value);
+ $this->write($bytes, 4);
+ }
+
+ /**
+ * Encode an integer as a fixed of 64bits with sign
+ *
+ * @param int $value
+ */
+ public function sFixed64($value)
+ {
+ if ($value >= 0) {
+ $this->fixed64($value);
+ } else if (function_exists('gmp_init')) {
+ $this->sFixed64_gmp($value);
+ } else if (function_exists('bcadd')) {
+ $this->sFixed64_bc($value);
+ } else {
+ throw new \OutOfBoundsException("The signed Fixed64 type with negative integers is only supported with GMP or BC big integers PHP extensions ($value was given)");
+ }
+ }
+
+ public function sFixed64_gmp($value)
+ {
+ static $xff, $x100;
+
+ if (NULL === $xff) {
+ $xff = gmp_init(0xff);
+ $x100 = gmp_init(0x100);
+ }
+
+ $value = PHP_INT_SIZE < 8
+ ? gmp_and($value, '0x0ffffffffffffffff')
+ : gmp_init(sprintf('%u', $value));
+
+ $bytes = '';
+ for ($i=0; $i<8; $i++) {
+ $bytes .= chr(gmp_intval(gmp_and($value, $xff)));
+ $value = gmp_div_q($value, $x100);
+ }
+
+ $this->write($bytes);
+ }
+
+ public function sFixed64_bc($value)
+ {
+ if (PHP_INT_SIZE < 8) {
+ throw new \OutOfBoundsException(
+ "PHP versions compiled with 32bit integers can only support negative integer encoding with GMP extension ($value was given)"
+ );
+ }
+
+ $value = sprintf('%u', $value);
+
+ $bytes = '';
+ for ($i=0; $i<8; $i++) {
+ // Get the last 8bits of the number
+ $bin = '';
+ $dec = $value;
+ do {
+ $bin = bcmod($dec, 2) . $bin;
+ $dec = bcdiv($dec, 2, 0);
+ } while (strlen($bin) < 8);
+
+ // Pack the byte
+ $bytes .= chr(intval($bin, 2));
+
+ $value = bcdiv($value, 0x100, 0);
+ }
+
+ $this->write($bytes);
+ }
+
+ /**
+ * Encode an integer as a fixed of 64bits without sign
+ *
+ * @param int $value
+ */
+ public function fixed64($value)
+ {
+ $bytes = pack('V*', $value & 0xffffffff, $value / (0xffffffff+1));
+ $this->write($bytes, 8);
+ }
+
+ /**
+ * Encode a number as a 32bit float
+ *
+ * @param float $value
+ */
+ public function float($value)
+ {
+ $bytes = pack('f*', $value);
+ if ($this->isBigEndian()) {
+ $bytes = strrev($bytes);
+ }
+ $this->write($bytes, 4);
+ }
+
+ /**
+ * Encode a number as a 64bit double
+ *
+ * @param float $value
+ */
+ public function double($value)
+ {
+ $bytes = pack('d*', $value);
+ if ($this->isBigEndian()) {
+ $bytes = strrev($bytes);
+ }
+ $this->write($bytes, 8);
+ }
+
+ /**
+ * Checks if the current architecture is Big Endian
+ *
+ * @return bool
+ */
+ public function isBigEndian()
+ {
+ static $endianness;
+
+ if (NULL === $endianness) {
+ list(,$result) = unpack('L', pack('V', 1));
+ $endianness = $result !== 1;
+ }
+
+ return $endianness;
+ }
+}
+
--- /dev/null
+++ b/lib/Protobuf-PHP/library/DrSlump/Protobuf/Codec/Json.php
@@ -1,1 +1,39 @@
+<?php
+namespace DrSlump\Protobuf\Codec;
+
+use DrSlump\Protobuf;
+
+/**
+ * This codec serializes and unserializes from/to Json strings
+ * where the keys represent the field's name.
+ *
+ * It makes use of the PhpArray codec to do the heavy work to just
+ * take care of converting the array to/from Json strings.
+ */
+class Json extends PhpArray
+ implements Protobuf\CodecInterface
+{
+ /**
+ * @param \DrSlump\Protobuf\Message $message
+ * @return string
+ */
+ public function encode(Protobuf\Message $message)
+ {
+ $data = $this->encodeMessage($message);
+ return json_encode($data);
+ }
+
+ /**
+ * @param \DrSlump\Protobuf\Message $message
+ * @param string $data
+ * @return \DrSlump\Protobuf\Message
+ */
+ public function decode(Protobuf\Message $message, $data)
+ {
+ $data = json_decode($data);
+ return $this->decodeMessage($message, $data);
+ }
+
+}
+
--- /dev/null
+++ b/lib/Protobuf-PHP/library/DrSlump/Protobuf/Codec/JsonIndexed.php
@@ -1,1 +1,140 @@
+<?php
+namespace DrSlump\Protobuf\Codec;
+
+use DrSlump\Protobuf;
+
+/**
+ * This codec serializes and unserializes from/to Json strings
+ * where the keys are packed as the first element of numeric arrays,
+ * optimizing the resulting payload size.
+ *
+ */
+class JsonIndexed extends Json
+ implements Protobuf\CodecInterface
+{
+
+ protected function encodeMessage(Protobuf\Message $message)
+ {
+ $descriptor = Protobuf::getRegistry()->getDescriptor($message);
+
+ $index = '';
+ $data = array();
+ foreach ($descriptor->getFields() as $tag=>$field) {
+ $empty = !$message->_has($tag);
+ if ($field->isRequired() && $empty) {
+ throw new \UnexpectedValueException(
+ 'Message ' . get_class($message) . '\'s field tag ' . $tag . '(' . $field->getName() . ') is required but has no value'
+ );
+ }
+
+ if ($empty) {
+ continue;
+ }
+
+ $index .= $this->i2c($tag + 48);
+
+ $value = $message->_get($tag);
+
+ if ($field->isRepeated()) {
+ $repeats = array();
+ foreach ($value as $val) {
+ if ($field->getType() !== Protobuf::TYPE_MESSAGE) {
+ $repeats[] = $val;
+ } else {
+ $repeats[] = $this->encodeMessage($val);
+ }
+ }
+ $data[] = $repeats;
+ } else {
+ if ($field->getType() === Protobuf::TYPE_MESSAGE) {
+ $data[] = $this->encodeMessage($value);
+ } else {
+ $data[] = $value;
+ }
+ }
+ }
+
+ // Insert the index at first element
+ array_unshift($data, $index);
+
+ return $data;
+ }
+
+ protected function decodeMessage(Protobuf\Message $message, $data)
+ {
+ // Get message descriptor
+ $descriptor = Protobuf::getRegistry()->getDescriptor($message);
+
+ // Split the index in UTF8 characters
+ preg_match_all('/./u', $data[0], $chars);
+
+ $chars = $chars[0];
+ for ($i=1; $i<count($data); $i++) {
+
+ $k = $this->c2i($chars[$i-1]) - 48;
+ $v = $data[$i];
+
+ $field = $descriptor->getField($k);
+
+ if (NULL === $field) {
+ // Unknown
+ $unknown = new PhpArray\Unknown($k, gettype($v), $v);
+ $message->addUnknown($unknown);
+ continue;
+ }
+
+ if ($field->getType() === Protobuf::TYPE_MESSAGE) {
+ $nested = $field->getReference();
+ if ($field->isRepeated()) {
+ foreach ($v as $vv) {
+ $obj = $this->decodeMessage(new $nested, $vv);
+ $message->_add($k, $obj);
+ }
+ } else {
+ $obj = $this->decodeMessage(new $nested, $v);
+ $message->_set($k, $obj);
+ }
+ } else {
+ $message->_set($k, $v);
+ }
+ }
+
+ return $message;
+ }
+
+ /**
+ * Converts an Unicode codepoint number to an UTF-8 character
+ *
+ * @param int $codepoint
+ * @return string
+ */
+ protected function i2c($codepoint)
+ {
+ return $codepoint < 128
+ ? chr($codepoint)
+ : html_entity_decode("&#$codepoint;", ENT_NOQUOTES, 'UTF-8');
+ }
+
+ /**
+ * Converts an UTF-8 character to an Unicode codepoint number
+ *
+ * @param string $char
+ * @return int
+ */
+ protected function c2i($char)
+ {
+ $value = ord($char[0]);
+ if ($value < 128) return $value;
+
+ if ($value < 224) {
+ return (($value % 32) * 64) + (ord($char[1]) % 64);
+ } else {
+ return (($value % 16) * 4096) +
+ ((ord($char[1]) % 64) * 64) +
+ (ord($char[2]) % 64);
+ }
+ }
+
+}
+
--- /dev/null
+++ b/lib/Protobuf-PHP/library/DrSlump/Protobuf/Codec/JsonTagMap.php
@@ -1,1 +1,24 @@
+<?php
+namespace DrSlump\Protobuf\Codec;
+
+use DrSlump\Protobuf;
+
+/**
+ * This codec serializes and unserializes from/to Json strings
+ * where the keys represent the field's tag numbers.
+ *
+ * It makes use of the PhpArray codec to do the heavy work to just
+ * take care of converting the array to/from Json strings.
+ */
+class JsonTagMap extends Json
+ implements Protobuf\CodecInterface
+{
+
+ public function __construct()
+ {
+ // Setup the codec to use tag numbers as keys
+ $this->useTagNumberAsKey(true);
+ }
+}
+
--- /dev/null
+++ b/lib/Protobuf-PHP/library/DrSlump/Protobuf/Codec/PhpArray.php
@@ -1,1 +1,147 @@
+<?php
+namespace DrSlump\Protobuf\Codec;
+
+use DrSlump\Protobuf;
+
+/**
+ * This codec serializes and unserializes data from/to PHP associative
+ * arrays, allowing it to be used as a base for an arbitrary number
+ * of different serializations (json, yaml, ini, xml ...).
+ *
+ */
+class PhpArray implements Protobuf\CodecInterface
+{
+ /** @var bool */
+ protected $useTagNumber = false;
+
+ /**
+ * Tells the codec to expect the array keys to contain the
+ * field's tag number instead of the name.
+ *
+ * @param bool $useIt
+ */
+ public function useTagNumberAsKey($useIt = true)
+ {
+ $this->useTagNumber = $useIt;
+ }
+
+ /**
+ * @param \DrSlump\Protobuf\Message $message
+ * @return array
+ */
+ public function encode(Protobuf\Message $message)
+ {
+ return $this->encodeMessage($message);
+ }
+
+ /**
+ * @param \DrSlump\Protobuf\Message $message
+ * @param array $data
+ * @return \DrSlump\Protobuf\Message
+ */
+ public function decode(Protobuf\Message $message, $data)
+ {
+ return $this->decodeMessage($message, $data);
+ }
+
+ protected function encodeMessage(Protobuf\Message $message)
+ {
+ $descriptor = Protobuf::getRegistry()->getDescriptor($message);
+
+ $data = array();
+ foreach ($descriptor->getFields() as $tag=>$field) {
+
+ $empty = !$message->_has($tag);
+ if ($field->isRequired() && $empty) {
+ throw new \UnexpectedValueException(
+ 'Message ' . get_class($message) . '\'s field tag ' . $tag . '(' . $field->getName() . ') is required but has no value'
+ );
+ }
+
+ if ($empty) {
+ continue;
+ }
+
+ $key = $this->useTagNumber ? $field->getNumber() : $field->getName();
+ $v = $message->_get($tag);
+
+ if ($field->isRepeated()) {
+ // Make sure the value is an array of values
+ $v = is_array($v) ? $v : array($v);
+ foreach ($v as $k=>$vv) {
+ $v[$k] = $this->filterValue($vv, $field);
+ }
+ } else {
+ $v = $this->filterValue($v, $field);
+ }
+
+ $data[$key] = $v;
+ }
+
+ return $data;
+ }
+
+ protected function decodeMessage(Protobuf\Message $message, $data)
+ {
+ // Get message descriptor
+ $descriptor = Protobuf::getRegistry()->getDescriptor($message);
+
+ foreach ($data as $key=>$v) {
+
+ // Get the field by tag number or name
+ $field = $this->useTagNumber
+ ? $descriptor->getField($key)
+ : $descriptor->getFieldByName($key);
+
+ // Unknown field found
+ if (!$field) {
+ $unknown = new PhpArray\Unknown($key, gettype($v), $v);
+ $message->addUnknown($unknown);
+ continue;
+ }
+
+ if ($field->isRepeated()) {
+ // Make sure the value is an array of values
+ $v = is_array($v) && is_int(key($v)) ? $v : array($v);
+ foreach ($v as $k=>$vv) {
+ $v[$k] = $this->filterValue($vv, $field);
+ }
+ } else {
+ $v = $this->filterValue($v, $field);
+ }
+
+ $message->_set($field->getNumber(), $v);
+ }
+
+ return $message;
+ }
+
+ protected function filterValue($value, Protobuf\Field $field)
+ {
+ switch ($field->getType()) {
+ case Protobuf::TYPE_MESSAGE:
+ // Tell apart encoding and decoding
+ if ($value instanceof Protobuf\Message) {
+ return $this->encodeMessage($value);
+ } else {
+ $nested = $field->getReference();
+ return $this->decodeMessage(new $nested, $value);
+ }
+ case Protobuf::TYPE_BOOL:
+ return filter_var($value, FILTER_VALIDATE_BOOLEAN);
+ case Protobuf::TYPE_STRING:
+ case Protobuf::TYPE_BYTES:
+ return (string)$value;
+ case Protobuf::TYPE_FLOAT:
+ case Protobuf::TYPE_DOUBLE:
+ return filter_var($value, FILTER_VALIDATE_FLOAT);
+ // Assume the rest are ints
+ default:
+ return filter_var($value, FILTER_VALIDATE_INT);
+ }
+ }
+
+
+}
+
--- /dev/null
+++ b/lib/Protobuf-PHP/library/DrSlump/Protobuf/Codec/PhpArray/Unknown.php
@@ -1,1 +1,14 @@
+<?php
+namespace DrSlump\Protobuf\Codec\PhpArray;
+
+class Unknown extends \DrSlump\Protobuf\Unknown
+{
+ public function __construct($tag, $type, $data)
+ {
+ $this->tag = $tag;
+ $this->type = $type;
+ $this->data = $data;
+ }
+}
+
--- /dev/null
+++ b/lib/Protobuf-PHP/library/DrSlump/Protobuf/Codec/TextFormat.php
@@ -1,1 +1,82 @@
+<?php
+namespace DrSlump\Protobuf\Codec;
+
+use DrSlump\Protobuf;
+
+/**
+ * This codec serializes to Protobuf's TextFormat, unserialization
+ * is not supported.
+ *
+ */
+class TextFormat implements Protobuf\CodecInterface
+{
+ /**
+ * @param \DrSlump\Protobuf\Message $message
+ * @return string
+ */
+ public function encode(Protobuf\Message $message)
+ {
+ return $this->encodeMessage($message);
+ }
+
+ /**
+ *
+ * @throw \DrSlump\Protobuf\Exception - Decoding is not supported
+ * @param \DrSlump\Protobuf\Message $message
+ * @param String $data
+ * @return \DrSlump\Protobuf\Message
+ */
+ public function decode(Protobuf\Message $message, $data)
+ {
+ throw new \BadMethodCallException('TextFormat codec does not support decoding');
+ }
+
+ protected function encodeMessage(Protobuf\Message $message, $level = 0)
+ {
+ $descriptor = Protobuf::getRegistry()->getDescriptor($message);
+
+ $indent = str_repeat(' ', $level);
+ $data = '';
+ foreach ($descriptor->getFields() as $tag=>$field) {
+
+ $empty = !$message->_has($tag);
+ if ($field->isRequired() && $empty) {
+ throw new \UnexpectedValueException(
+ 'Message ' . get_class($message) . '\'s field tag ' . $tag . '(' . $field->getName() . ') is required but has no value'
+ );
+ }
+
+ if ($empty) {
+ continue;
+ }
+
+ $name = $field->getName();
+ $value = $message->_get($tag);
+
+ if ($field->isRepeated()) {
+ foreach ($value as $val) {
+ if ($field->getType() !== Protobuf::TYPE_MESSAGE) {
+ $data .= $indent . $name . ': ' . json_encode($val) . "\n";
+ } else {
+ $data .= $indent . $name . " {\n";
+ $data .= $this->encodeMessage($val, $level+1);
+ $data .= $indent . "}\n";
+ }
+ }
+ } else {
+ if ($field->getType() === Protobuf::TYPE_MESSAGE) {
+ $data .= $indent . $name . " {\n";
+ $data .= $this->encodeMessage($value, $level+1);
+ $data .= $indent . "}\n";
+ } else {
+ $data .= $indent . $name . ': ' . json_encode($value) . "\n";
+ }
+ }
+ }
+
+ return $data;
+ }
+}
+
+
--- /dev/null
+++ b/lib/Protobuf-PHP/library/DrSlump/Protobuf/Codec/Xml.php
@@ -1,1 +1,139 @@
+<?php
+namespace DrSlump\Protobuf\Codec;
+
+use DrSlump\Protobuf;
+
+/**
+ * This codec serializes and unserializes from/to Xml documents
+ * where the elements represent the field's name.
+ *
+ * It makes use of the PhpArray codec to do the heavy work to just
+ * take care of converting the array to/from XML.
+ */
+class Xml extends PhpArray
+ implements Protobuf\CodecInterface
+{
+ /** @var bool */
+ protected $dom = false;
+ /** @var string */
+ protected $root;
+
+ /**
+ * @param array $options
+ */
+ public function __construct(array $options = array())
+ {
+ foreach ($options as $option=>$value) {
+ $this->setOption($option, $value);
+ }
+ }
+
+ /**
+ * @throws \InvalidArgumentException
+ * @param string $option
+ * @param mixed $value
+ * @return void
+ */
+ public function setOption($option, $value)
+ {
+ switch (strtolower($option)) {
+ case 'root':
+ $this->root = $value;
+ break;
+ case 'dom':
+ $this->dom = (bool)$value;
+ break;
+ default:
+ throw new \InvalidArgumentException('Unknown option ' . $option);
+ }
+ }
+
+ /**
+ * @param \DrSlump\Protobuf\Message $message
+ * @return string | \SimpleXMLElement
+ */
+ public function encode(Protobuf\Message $message)
+ {
+ // Generate an associative array
+ $data = $this->encodeMessage($message);
+
+ // Build an XML representation
+ $root = $this->root ?: str_replace('\\', '_', get_class($message));
+ $root = new \SimpleXMLElement('<?xml version="1.0"?><' . $root . '></' . $root . '>');
+ $this->arrayToXml($root, $data);
+
+ return $this->dom ? $root : $root->asXML();
+ }
+
+ /**
+ * @param \SimpleXMLElement $elem
+ * @param array $data
+ * @param null $label
+ */
+ protected function arrayToXml(\SimpleXMLElement $elem, array $data, $label = null)
+ {
+ foreach ($data as $k=>$v) {
+ if (is_array($v)) {
+ // Detect nested messages
+ if (!is_int(key($v))) {
+ $child = $elem->addChild($label ?: $k);
+ $this->arrayToXml($child, $v);
+ // Lists are forced a fixed label
+ } else {
+ $this->arrayToXml($elem, $v, $k);
+ }
+ } else {
+ $elem->addChild($label ?: $k, $v);
+ }
+ }
+ }
+
+ /**
+ * @param \DrSlump\Protobuf\Message $message
+ * @param string | \SimpleXMLElement $xml
+ * @return \DrSlump\Protobuf\Message
+ */
+ public function decode(Protobuf\Message $message, $xml)
+ {
+ if (is_string($xml)) {
+ $xml = new \SimpleXMLElement($xml);
+ }
+
+ // Build an associative array from the XML
+ $data = $this->xmlToArray($xml);
+ // Generate a message from the data
+ return $this->decodeMessage($message, $data);
+ }
+
+ /**
+ * @param \SimpleXMLElement $elem
+ * @return array
+ */
+ protected function xmlToArray(\SimpleXMLElement $elem)
+ {
+ $data = array();
+ foreach ($elem->children() as $child) {
+ if (count($child->children())) {
+ $value = $this->xmlToArray($child);
+ } else {
+ $value = (string)$child;
+ }
+
+ $name = $child->getName();
+ if (isset($data[$name])) {
+ // If not yet a "list" array
+ if (!is_array($data[$name]) || !is_int(key($data[$name]))) {
+ $data[$name] = array($data[$name]);
+ }
+ $data[$name][] = $value;
+ } else {
+ $data[$name] = $value;
+ }
+ }
+
+ return $data;
+ }
+
+}
+
--- /dev/null
+++ b/lib/Protobuf-PHP/library/DrSlump/Protobuf/CodecInterface.php
@@ -1,1 +1,9 @@
+<?php
+namespace DrSlump\Protobuf;
+
+interface CodecInterface
+{
+ public function encode(\DrSlump\Protobuf\Message $message);
+ public function decode(\DrSlump\Protobuf\Message $message, $data);
+}
--- /dev/null
+++ b/lib/Protobuf-PHP/library/DrSlump/Protobuf/Compiler.php
@@ -1,1 +1,212 @@
-
+<?php
+
+namespace DrSlump\Protobuf;
+
+// Load descriptor messages
+require_once __DIR__ . '/Compiler/protos/descriptor.pb.php';
+require_once __DIR__ . '/Compiler/protos/plugin.pb.php';
+require_once __DIR__ . '/Compiler/protos/php.pb.php';
+require_once __DIR__ . '/Compiler/protos/json.pb.php';
+
+use DrSlump\Protobuf;
+use google\protobuf as proto;
+
+class Compiler
+{
+ /** @var bool */
+ protected $verbose = false;
+ /** @var array */
+ protected $packages = array();
+ /** @var \DrSlump\Protobuf\Compiler\CommentsParser */
+ protected $comments;
+ /** @var bool */
+ protected $skipImported = false;
+ /** @var array */
+ protected $options = array();
+ /** @var array */
+ protected $protos = array();
+
+ public function __construct($verbose = false)
+ {
+ $this->verbose = $verbose;
+ $this->comments = new Compiler\CommentsParser();
+ }
+
+ public function stderr($str)
+ {
+ $str = str_replace("\n", PHP_EOL, $str);
+ fputs(STDERR, $str . PHP_EOL);
+ }
+
+ public function notice($str)
+ {
+ if ($this->verbose) {
+ $this->stderr('NOTICE: ' . $str);
+ }
+ }
+
+ public function warning($str)
+ {
+ $this->stderr('WARNING: ' . $str);
+ }
+
+ protected function error($str)
+ {
+ $this->stderr('ERROR: ' . $str);
+ }
+
+ public function getPackages()
+ {
+ return $this->packages;
+ }
+
+ public function hasPackage($package)
+ {
+ return isset($this->packages[$package]);
+ }
+
+ public function getPackage($package)
+ {
+ return $this->packages[$package];
+ }
+
+ public function setPackage($package, $namespace)
+ {
+ $this->packages[$package] = $namespace;
+ }
+
+ public function getOption($option, $type = 'string')
+ {
+ $value = isset($this->options[$option])
+ ? $this->options[$option]
+ : null;
+
+ switch ($type) {
+ case 'bool':
+ return filter_var($value, FILTER_VALIDATE_BOOLEAN);
+ default:
+ return $value;
+ }
+ }
+
+ public function camelize($name)
+ {
+ return preg_replace_callback(
+ '/_([a-z])/i',
+ function($m){ return strtoupper($m[1]); },
+ $name
+ );
+ }
+
+ public function compile($data)
+ {
+ // Parse the request
+ $req = new \google\protobuf\compiler\CodeGeneratorRequest($data);
+
+ // Set default generator class
+ $generator = __CLASS__ . '\PhpGenerator';
+
+ // Reset comments parser
+ $this->comments->reset();
+ $parseComments = false;
+
+ // Get plugin arguments
+ if ($req->hasParameter()) {
+ parse_str($req->getParameter(), $args);
+ foreach ($args as $arg=>$val) {
+ switch($arg){
+ case 'verbose':
+ $this->verbose = filter_var($val, FILTER_VALIDATE_BOOLEAN, FILTER_NULL_ON_FAILURE);
+ break;
+ case 'json':
+ $this->notice("Using ProtoJson generator");
+ $generator = __CLASS__ . '\JsonGenerator';
+ break;
+ case 'comments':
+ $parseComments = filter_var($val, FILTER_VALIDATE_BOOLEAN);
+ break;
+ case 'protos':
+ $this->protos = $val;
+ break;
+ case 'skip-imported':
+ $this->skipImported = filter_var($val, FILTER_VALIDATE_BOOLEAN);
+ break;
+ case 'options':
+ $this->options = $val;
+ break;
+ default:
+ $this->warning('Skipping unknown option ' . $arg);
+ }
+ }
+ }
+
+ // Parse comments if we're told to do so
+ if ($parseComments) {
+ if (empty($this->protos)) {
+ throw new \RuntimeException('Unable to port comments if .proto files are not passed as argument');
+ }
+ foreach ($this->protos as $fname) {
+ $src = file_get_contents($fname);
+ if (FALSE === $src) {
+ throw new \RuntimeException('Unable to parse file ' . $fname . ' for comments');
+ }
+ $this->comments->parse($src);
+ }
+ }
+
+ /** @var $generator \DrSlump\Protobuf\Compiler\AbstractGenerator */
+ $generator = new $generator($this);
+
+ // Setup response object
+ $resp = new \google\protobuf\compiler\CodeGeneratorResponse();
+
+ // First iterate over all the protos to get a map of namespaces
+ $this->packages = array();
+ foreach($req->getProtoFileList() as $proto) {
+ $package = $proto->getPackage();
+ $namespace = $generator->getNamespace($proto);
+ if (isset($this->packages[$package]) && $namespace !== $this->packages[$package]) {
+ $this->warning("Package $package was already mapped to {$this->packages[$package]} but has now been overridden to $namespace");
+ }
+ $this->packages[$package] = $namespace;
+ $this->notice("Mapping $package to $namespace");
+ }
+
+ // Get the list of files to generate
+ $files = $req->getFileToGenerate();
+
+ // Run each file
+ foreach ($req->getProtoFileList() as $file) {
+ // Only compile those given to generate, not the imported ones
+ if ($this->skipImported && !in_array($file->getName(), $files)) {
+ $this->notice('Skipping generation of imported file "' . $file->getName() . '"');
+ continue;
+ }
+
+ $sources = $generator->generate($file);
+ foreach ($sources as $source) {
+ $this->notice('Generating "' . $source->getName() . '"');
+ $resp->addFile($source);
+ }
+ }
+
+ // Finally serialize the response object
+ return $resp->serialize();
+ }
+
+ public function getComment($ident, $prefix = '')
+ {
+ if (!$this->comments->hasComment($ident)) {
+ return null;
+ }
+
+ $comment = $this->comments->getComment($ident);
+ if (0 < strlen($prefix)) {
+ $comment = $prefix . str_replace("\n", "\n$prefix", $comment);
+ }
+
+ return $comment;
+ }
+}
+
+
--- /dev/null
+++ b/lib/Protobuf-PHP/library/DrSlump/Protobuf/Compiler/AbstractGenerator.php
@@ -1,1 +1,41 @@
+<?php
+namespace DrSlump\Protobuf\Compiler;
+
+use google\protobuf as proto;
+
+abstract class AbstractGenerator
+{
+ /** @var \DrSlump\Protobuf\Compiler */
+ protected $compiler;
+ /** @var \google\protobuf\FileDescriptorProto */
+ protected $proto;
+
+ /** @var array */
+ protected $extensions = array();
+
+ public function __construct(\DrSlump\Protobuf\Compiler $compiler)
+ {
+ $this->compiler = $compiler;
+ }
+
+ public function getNamespace(proto\FileDescriptorProto $proto = NULL)
+ {
+ return NULL === $proto
+ ? $this->proto->getPackage()
+ : $proto->getPackage();
+ }
+
+ public function generate(proto\FileDescriptorProto $proto)
+ {
+ $this->proto = $proto;
+ }
+
+
+ abstract protected function compileEnum(proto\EnumDescriptorProto $enum, $namespace);
+
+ abstract protected function compileMessage(proto\DescriptorProto $msg, $namespace);
+
+ abstract protected function compileExtension(proto\FieldDescriptorProto $field, $ns, $indent);
+}
+
--- /dev/null
+++ b/lib/Protobuf-PHP/library/DrSlump/Protobuf/Compiler/Cli.php
@@ -1,1 +1,238 @@
-
+<?php
+
+namespace DrSlump\Protobuf\Compiler;
+
+require_once 'Console/CommandLine.php';
+
+use DrSlump\Protobuf;
+
+class Cli
+{
+ public static function run($pluginExecutable)
+ {
+ // Open STDIN in non-blocking mode
+ $fp = fopen('php://stdin', 'rb');
+ stream_set_blocking($fp, FALSE);
+
+ // Loop until STDIN is closed or we've waited too long for data
+ $cnt = 0;
+ $stdin = '';
+ while (!feof($fp) && $cnt++ < 10) {
+ // give protoc some time to feed the data
+ usleep(10000);
+ // read the bytes
+ $bytes = fread($fp, 1024);
+ if (strlen($bytes)) {
+ $cnt = 0;
+ $stdin .= $bytes;
+ }
+ }
+
+ // If no input was given we launch protoc from here
+ if (0 === strlen($stdin)) {
+ self::runProtoc($pluginExecutable);
+ exit(0);
+ }
+
+ // We have data from stdin so compile it
+ try {
+ // Create a compiler interface
+ $comp = new Protobuf\Compiler();
+ echo $comp->compile($stdin);
+ exit(0);
+ } catch(\Exception $e) {
+ fputs(STDERR, 'ERROR: ' . $e->getMessage());
+ fputs(STDERR, $e->getTraceAsString());
+ exit(255);
+ }
+ }
+
+ public static function runProtoc($pluginExecutable)
+ {
+ $result = self::parseArguments();
+
+ $protocBin = $result->options['protoc'];
+
+ // Check if protoc is available
+ exec("$protocBin --version", $output, $return);
+
+ if (0 !== $return && 1 !== $return) {
+ fputs(STDERR, "ERROR: Unable to find the protoc command.". PHP_EOL);
+ fputs(STDERR, " Please make sure it's installed and available in the path." . PHP_EOL);
+ exit(1);
+ }
+
+ if (!preg_match('/[0-9\.]+/', $output[0], $m)) {
+ fputs(STDERR, "ERROR: Unable to get protoc command version.". PHP_EOL);
+ fputs(STDERR, " Please make sure it's installed and available in the path." . PHP_EOL);
+ exit(1);
+ }
+
+ if (version_compare($m[0], '2.3.0') < 0) {
+ fputs(STDERR, "ERROR: The protoc command in your system is too old." . PHP_EOL);
+ fputs(STDERR, " Minimum version required is 2.3.0 but found {$m[0]}." . PHP_EOL);
+ exit(1);
+ }
+
+ $cmd[] = $protocBin;
+ $cmd[] = '--plugin=protoc-gen-php=' . escapeshellarg($pluginExecutable);
+
+ // Include paths
+ $cmd[] = '--proto_path=' . escapeshellarg(__DIR__ . DIRECTORY_SEPARATOR . 'protos');
+ if (!empty($result->options['include'])) {
+ foreach($result->options['include'] as $include) {
+ $include = realpath($include);
+ $cmd[] = '--proto_path=' . escapeshellarg($include);
+ }
+ }
+
+ // Convert proto files to absolute paths
+ $protos = array();
+ foreach ($result->args['protos'] as $proto) {
+ $realpath = realpath($proto);
+ if (FALSE === $realpath) {
+ fputs(STDERR, "ERROR: File '$proto' does not exists");
+ exit(1);
+ }
+
+ $protos[] = $realpath;
+ }
+
+ // Protoc will pass custom arguments to the plugin if they are given
+ // before a colon character. ie: --php_out="foo=bar:/path/to/plugin"
+ // We make use of it to pass arguments encoded as an URI query string
+
+ $args = array();
+ if ($result->options['comments']) {
+ $args['comments'] = 1;
+ // Protos are only needed for comments right now
+ $args['protos'] = $protos;
+ }
+ if ($result->options['verbose']) {
+ $args['verbose'] = 1;
+ }
+ if ($result->options['json']) {
+ $args['json'] = 1;
+ }
+ if ($result->options['skipImported']) {
+ $args['skip-imported'] = 1;
+ }
+ if ($result->options['define']) {
+ $args['options'] = array();
+ foreach($result->options['define'] as $define) {
+ $parts = explode('=', $define);
+ $parts = array_filter(array_map('trim', $parts));
+ if (count($parts) === 1) {
+ $parts[1] = 1;
+ }
+ $args['options'][$parts[0]] = $parts[1];
+ }
+ }
+
+ $cmd[] = '--php_out=' .
+ escapeshellarg(
+ http_build_query($args, '', '&') .
+ ':' .
+ $result->options['out']
+ );
+
+ // Add the chosen proto files to generate
+ foreach ($protos as $proto) {
+ $cmd[] = escapeshellarg($proto);
+ }
+
+ $cmdStr = implode(' ', $cmd);
+
+ // Run command with stderr redirected to stdout
+ passthru($cmdStr . ' 2>&1', $return);
+
+ if ($return !== 0) {
+ fputs(STDERR, PHP_EOL);
+ fputs(STDERR, 'ERROR: protoc exited with an error (' . $return . ') when executed with: ' . PHP_EOL);
+ fputs(STDERR, ' ' . implode(" \\\n ", $cmd) . PHP_EOL);
+ exit($return);
+ }
+ }
+
+
+ public static function parseArguments()
+ {
+ $main = new \Console_CommandLine();
+
+ $main->addOption('out', array(
+ 'short_name' => '-o',
+ 'long_name' => '--out',
+ 'action' => 'StoreString',
+ 'description' => 'destination directory for generated files',
+ 'default' => './',
+ ));
+
+ $main->addOption('include', array(
+ 'short_name' => '-i',
+ 'long_name' => '--include',
+ 'action' => 'StoreArray',
+ 'description' => 'define an include path (can be repeated)',
+ 'multiple' => true,
+ ));
+
+
+ $main->addOption('json', array(
+ 'short_name' => '-j',
+ 'long_name' => '--json',
+ 'action' => 'StoreTrue',
+ 'description' => 'turn on ProtoJson Javascript file generation',
+ ));
+
+ $main->addOption('protoc', array(
+ 'long_name' => '--protoc',
+ 'action' => 'StoreString',
+ 'default' => 'protoc',
+ 'description' => 'protoc compiler executable path',
+ ));
+
+ $main->addOption('skipImported', array(
+ 'long_name' => '--skip-imported',
+ 'action' => 'StoreTrue',
+ 'default' => false,
+ 'description' => 'do not generate imported proto files',
+ ));
+
+ $main->addOption('comments', array(
+ 'long_name' => '--comments',
+ 'action' => 'StoreTrue',
+ 'description' => 'port .proto comments to generated code',
+ ));
+
+ $main->addOption('define', array(
+ 'short_name' => '-D',
+ 'long_name' => '--define',
+ 'action' => 'StoreArray',
+ 'multiple' => true,
+ 'description' => 'define a generator option (ie: -Dmultifile -Dsuffix=pb.php)',
+ ));
+
+ $main->addOption('verbose', array(
+ 'short_name' => '-v',
+ 'long_name' => '--verbose',
+ 'action' => 'StoreTrue',
+ 'description' => 'turn on verbose output',
+ ));
+
+
+ $main->addArgument('protos', array(
+ 'multiple' => true,
+ 'description' => 'proto files',
+ ));
+
+ try {
+ echo 'Protobuf-PHP ' . Protobuf::VERSION . ' by Ivan -DrSlump- Montes' . PHP_EOL . PHP_EOL;
+ $result = $main->parse();
+ return $result;
+ } catch (\Exception $e) {
+ $main->displayError($e->getMessage());
+ exit(1);
+ }
+ }
+
+}
+
--- /dev/null
+++ b/lib/Protobuf-PHP/library/DrSlump/Protobuf/Compiler/CommentsParser.php
@@ -1,1 +1,136 @@
+<?php
+namespace DrSlump\Protobuf\Compiler;
+
+class CommentsParser
+{
+ /** @var array - Hold a mapping of entity => comment */
+ protected $comments = array();
+
+ /** @var array - Define tokenizer regular expressions */
+ protected $tokens = array(
+ 'comment' => '/\*([\S\s]+?)\*/',
+ 'package' => 'package\s+([A-Z0-9_]+)',
+ 'struct' => '(?:message|enum|service)\s+([A-Z0-9_]+)',
+ 'close' => '}',
+ 'field' => '(?:required|optional|repeated)\s+[^=]+=\s*([0-9]+)[^;]*;',
+ 'rpc' => 'rpc\s+([A-Z0-9_]+)[^;]+'
+ );
+
+ /** @var string - The regular expresion for the tokenizer */
+ protected $regexp;
+
+ public function __construct()
+ {
+ // Generate a regular expression for all tokens
+ $regexp = array();
+ foreach ($this->tokens as $token=>$exp) {
+ $regexp[] = '(?<' . $token . '>' . $exp . ')';
+ }
+ $this->regexp = '@' . implode('|', $regexp) . '@i';
+ }
+
+ /**
+ * Reset the currently stored comments
+ */
+ public function reset()
+ {
+ $this->comments = array();
+ }
+
+ /**
+ * Parse a Proto file source code to fetch comments
+ *
+ * @param string $src
+ */
+ public function parse($src)
+ {
+ // Build an stream of tokens from the regular expression
+ $tokens = array();
+ $offset = 0;
+ while (preg_match($this->regexp, $src, $m, PREG_OFFSET_CAPTURE, $offset)) {
+ foreach ($this->tokens as $k=>$v) {
+ if (!empty($m[$k]) && 0 < strlen($m[$k][0])) {
+ $tokens[] = array(
+ 'token' => $k,
+ 'value' => array_shift(array_pop($m)),
+ );
+ }
+ }
+ $offset = $m[0][1] + strlen($m[0][0]);
+ }
+
+ // Parse the tokens stream to assign comments
+ $comment = null;
+ $stack = array();
+ foreach ($tokens as $token) {
+ if ($token['token'] === 'comment') {
+ $comment = $token['value'];
+ } elseif ($token['token'] === 'package') {
+ $stack[] = $token['value'];
+ $comment = null;
+ } elseif ($token['token'] === 'struct') {
+ $stack[] = $token['value'];
+ if ($comment) {
+ $this->setComment(implode('.', $stack), $comment);
+ $comment = null;
+ }
+ } elseif ($token['token'] === 'close') {
+ array_pop($stack);
+ $comment = null;
+ } elseif ($token['token'] === 'field' || $token['token'] === 'rpc') {
+ if ($comment) {
+ $this->setComment(implode('.', $stack) . '.' . $token['value'], $comment);
+ $comment = null;
+ }
+ }
+ }
+ }
+
+ /**
+ * Set a comment for the given identifier. The identifier is composed
+ * of the package, followed by the message (and nested messages). Field
+ * comments are suffixed with the tag number.
+ *
+ * @example
+ *
+ * $this->setComment('MyPackage.MyMessage.Nested.2', 'field comment');
+ *
+ * @param string $ident
+ * @param string $comment
+ */
+ public function setComment($ident, $comment)
+ {
+ $comment = str_replace("\r\n", "\n", $comment);
+ $comment = preg_replace('/^[\s\*]+/m', '', $comment);
+ $comment = trim($comment, "* \n");
+ $this->comments[$ident] = $comment;
+ }
+
+ /**
+ * Get the comment for a given identifier
+ *
+ * @param string $ident
+ * @return string|null
+ */
+ public function getComment($ident)
+ {
+ return isset($this->comments[$ident])
+ ? $this->comments[$ident]
+ : null;
+ }
+
+ /**
+ * Checks if a comment exists for a given identifier
+ *
+ * @param string $ident
+ * @return bool
+ */
+ public function hasComment($ident)
+ {
+ return isset($this->comments[$ident]);
+ }
+}
+
+
+
--- /dev/null
+++ b/lib/Protobuf-PHP/library/DrSlump/Protobuf/Compiler/JsonGenerator.php
@@ -1,1 +1,353 @@
-
+<?php
+
+namespace DrSlump\Protobuf\Compiler;
+
+use DrSlump\Protobuf;
+use google\protobuf as proto;
+
+class JsonGenerator extends AbstractGenerator
+{
+ public function getNamespace(proto\FileDescriptorProto $proto)
+ {
+ $namespace = $proto->getPackage();
+ $opts = $proto->getOptions();
+ if (isset($opts['json.package'])) {
+ $namespace = $opts['jsonpackage'];
+ }
+ if (isset($opts['json.namespace'])) {
+ $namespace = $opts['json.namespace'];
+ }
+
+ $namespace = trim($namespace, '.');
+ return $namespace;
+ }
+
+ public function compileEnum(proto\EnumDescriptorProto $enum, $namespace)
+ {
+ $s[]= "$namespace.$enum->name = {";
+ $lines = array();
+ foreach ($enum->getValueList() as $value) {
+ $lines[] = " /** @const */ $value->name: $value->number";
+ }
+ $s[]= implode(",\n", $lines);
+ $s[]= '};';
+ $s[]= '';
+ return implode("\n", $s);
+ }
+
+ public function compileExtension(proto\FieldDescriptorProto $field, $ns, $indent)
+ {
+ $extendee = $this->normalizeReference($field->getExtendee());
+ $name = $field->getName();
+ if ($ns) {
+ $name = $ns . '.' . $name;
+ }
+ $field->setName($name);
+
+ $s[]= "ProtoJson.extend($extendee, {";
+ $s[]= " $field->number: " . $this->generateField($field);
+ $s[]= "});";
+ $s[]= '';
+
+ return $indent . implode("\n$indent", $s);
+ }
+
+ public function compileMessage(proto\DescriptorProto $msg, $namespace)
+ {
+ $s[]= "/**";
+ $s[]= " * @constructor";
+ $s[]= " * @augments {ProtoJson.Message}";
+ $s[]= " * @extends ProtoJson.Message";
+ $s[]= " * @memberOf $namespace";
+ $s[]= " * @param {object} data - Optional, provide initial data to parse";
+ $s[]= " */";
+ $s[]= "$namespace.$msg->name = ProtoJson.create({";
+ $s[]= " fields: {";
+
+ $lines = array();
+ foreach ($msg->getFieldList() as $field) {
+ $lines[] = " $field->number: " . $this->generateField($field);
+ }
+ $s[] = implode(",\n", $lines);
+
+ $s[]= " },";
+ $s[]= " ranges: [";
+ // @todo dump extension ranges
+ $s[]= " ]";
+ $s[]= "});";
+ $s[]= "";
+
+ // Compute a new namespace with the message name as suffix
+ $namespace .= "." . $msg->getName();
+
+ // Generate getters/setters
+ foreach ($msg->getFieldList() as $field) {
+ $s[]= $this->generateAccessors($field, $namespace);
+ }
+
+ // Generate Enums
+ foreach ($msg->getEnumTypeList() as $enum):
+ $s[]= $this->compileEnum($enum, $namespace);
+ endforeach;
+
+ // Generate nested messages
+ foreach ($msg->getNestedTypeList() as $msg):
+ $s[]= $this->compileMessage($msg, $namespace);
+ endforeach;
+
+ // Collect extensions
+ foreach ($msg->getExtensionList() as $field) {
+ $this->extensions[$field->getExtendee()][] = array($namespace, $field);
+ }
+
+ return implode("\n", $s);
+ }
+
+ public function compileProtoFile(proto\FileDescriptorProto $proto)
+ {
+ $file = new proto\compiler\CodeGeneratorResponse\File();
+
+ $opts = $proto->getOptions();
+ $name = pathinfo($proto->getName(), PATHINFO_FILENAME);
+ $name .= isset($opts['json.suffix'])
+ ? $opts['json.suffix']
+ : '.js';
+ $file->setName($name);
+
+ $namespace = $this->getNamespace($proto);
+
+ $s[]= "// DO NOT EDIT! Generated by Protobuf for PHP protoc plugin " . Protobuf::VERSION;
+ $s[]= "// Source: " . $proto->getName();
+ $s[]= "// Date: " . date('Y-m-d H:i:s');
+ $s[]= "";
+
+ $s[]= "(function(){";
+ $s[]= "/** @namespace */";
+ $s[]= "var $namespace = $namespace || {};";
+ $s[]= "";
+ $s[]= "// Make it CommonJS compatible";
+ $s[]= "if (typeof exports !== 'undefined') {";
+ $s[]= " var ProtoJson = this.ProtoJson;";
+ $s[]= " if (!ProtoJson && typeof require !== 'undefined')";
+ $s[]= " ProtoJson = require('ProtoJson');";
+ $s[]= " $namespace = exports;";
+ $s[]= "} else {";
+ $s[]= " this.$namespace = $namespace;";
+ $s[]= "}";
+ $s[]= "";
+
+
+ // Generate Enums
+ foreach ($proto->getEnumTypeList() as $enum) {
+ $s[]= $this->compileEnum($enum, $namespace);
+ }
+
+ // Generate Messages
+ foreach ($proto->getMessageTypeList() as $msg) {
+ $s[] = $this->compileMessage($msg, $namespace);
+ }
+
+ // Collect extensions
+ if ($proto->hasExtension()) {
+ foreach ($proto->getExtensionList() as $field) {
+ $this->extensions[$field->getExtendee()][] = array($namespace, $field);
+ }
+ }
+
+ // Dump all extensions found in this proto file
+ if (count($this->extensions)) {
+ foreach ($this->extensions as $extendee => $fields) {
+ foreach ($fields as $pair) {
+ list($ns, $field) = $pair;
+ $s[]= $this->compileExtension($field, $ns, '');
+ }
+ }
+ }
+
+ $s[]= "})();";
+
+ $src = implode("\n", $s);
+ $file->setContent($src);
+ return array($file);
+ }
+
+ public function generateField(proto\FieldDescriptorProto $field)
+ {
+ $reference = 'null';
+ if ($field->hasTypeName()) {
+ $reference = $field->getTypeName();
+ if (substr($reference, 0, 1) !== '.') {
+ throw new \RuntimeException('Only fully qualified names are supported: ' . $reference);
+ }
+ $reference = "'" . $this->normalizeReference($reference) . "'";
+ }
+
+ $default = 'null';
+ if ($field->hasDefaultValue()):
+ switch ($field->getType()) {
+ case Protobuf::TYPE_BOOL:
+ $default = $field->getDefaultValue() ? 'true' : 'false';
+ break;
+ case Protobuf::TYPE_STRING:
+ $default = '"' . addcslashes($field->getDefaultValue(), '"\\') . '"';
+ break;
+ case Protobuf::TYPE_ENUM:
+ $default = $this->normalizeReference($field->getTypeName()) . '.' . $field->getDefaultValue();
+ break;
+ default: // Numbers
+ $default = $field->getDefaultValue();
+ }
+ endif;
+
+ $data = array(
+ "'" . $field->getName() . "'",
+ $field->getLabel(),
+ $field->getType(),
+ $reference,
+ $default,
+ '{}'
+ );
+
+ return '[' . implode(', ', $data) . ']';
+ }
+
+ public function generateAccessors($field, $namespace)
+ {
+ $camel = $this->comp->camelize(ucfirst($field->getName()));
+
+ $s[]= "/**";
+ $s[]= " * Check <$field->name> value";
+ $s[]= " * @return {Boolean}";
+ $s[]= " */";
+ $s[]= "$namespace.prototype.has$camel = function(){";
+ $s[]= " return this._has($field->number);";
+ $s[]= "};";
+ $s[]= "";
+
+ $s[]= "/**";
+ $s[]= " * Set a value for <$field->name>";
+ $s[]= " * @param {" . $this->getJsDoc($field) . "} value";
+ $s[]= " * @return {". $namespace . "}";
+ $s[]= " */";
+ $s[]= "$namespace.prototype.set$camel = function(value){";
+ $s[]= " return this._set($field->number, value);";
+ $s[]= "};";
+ $s[]= "";
+
+
+ $s[]= "/**";
+ $s[]= " * Clear the value of <$field->name>";
+ $s[]= " * @return {". $namespace . "}";
+ $s[]= " */";
+ $s[]= "$namespace.prototype.clear$camel = function(){";
+ $s[]= " return this._clear($field->number);";
+ $s[]= "};";
+ $s[]= "";
+
+
+ if ($field->getLabel() !== Protobuf::RULE_REPEATED):
+
+ $s[]= "/**";
+ $s[]= " * Get <$field->name> value";
+ $s[]= " * @return {" . $this->getJsDoc($field) . "}";
+ $s[]= " */";
+ $s[]= "$namespace.prototype.get$camel = function(){";
+ $s[]= " return this._get($field->number);";
+ $s[]= "};";
+ $s[]= "";
+
+ else:
+
+ $s[]= "/**";
+ $s[]= " * Get an item from <$field->name>";
+ $s[]= " * @param {int} idx";
+ $s[]= " * @return {" . $this->getJsDoc($field) . "}";
+ $s[]= " */";
+ $s[]= "$namespace.prototype.get$camel = function(idx){";
+ $s[]= " return this._get($field->number, idx);";
+ $s[]= "};";
+ $s[]= "";
+
+
+ $s[]= "/**";
+ $s[]= " * Get <$field->name> value";
+ $s[]= " * @return {" . $this->getJsDoc($field) . "[]}";
+ $s[]= " */";
+ $s[]= "$namespace.prototype.get{$camel}List = function(){";
+ $s[]= " return this._get($field->number);";
+ $s[]= "};";
+ $s[]= "";
+
+ $s[]= "/**";
+ $s[]= " * Add a value to <$field->name>";
+ $s[]= " * @param {" . $this->getJsDoc($field) . "} value";
+ $s[]= " * @return {" . $namespace . "}";
+ $s[]= " */";
+ $s[]= "$namespace.prototype.add$camel = function(value){";
+ $s[]= " return this._add($field->number, value);";
+ $s[]= "};";
+ $s[]= "";
+
+ endif;
+
+
+ return implode("\n", $s);
+ }
+
+ public function getJsDoc(proto\FieldDescriptorProto $field)
+ {
+ switch ($field->getType()) {
+ case Protobuf::TYPE_DOUBLE:
+ case Protobuf::TYPE_FLOAT:
+ return 'Float';
+ case Protobuf::TYPE_INT64:
+ case Protobuf::TYPE_UINT64:
+ case Protobuf::TYPE_INT32:
+ case Protobuf::TYPE_FIXED64:
+ case Protobuf::TYPE_FIXED32:
+ case Protobuf::TYPE_UINT32:
+ case Protobuf::TYPE_SFIXED32:
+ case Protobuf::TYPE_SFIXED64:
+ case Protobuf::TYPE_SINT32:
+ case Protobuf::TYPE_SINT64:
+ return 'Int';
+ case Protobuf::TYPE_BOOL:
+ return 'Boolean';
+ case Protobuf::TYPE_STRING:
+ return 'String';
+ case Protobuf::TYPE_MESSAGE:
+ return $this->normalizeReference($field->getTypeName());
+ case Protobuf::TYPE_BYTES:
+ return 'String';
+ case Protobuf::TYPE_ENUM:
+ return 'Int (' . $this->normalizeReference($field->getTypeName()) . ')';
+
+ case Protobuf::TYPE_GROUP:
+ default:
+ return 'unknown';
+ }
+ }
+
+ public function normalizeReference($reference)
+ {
+ // Remove leading dot
+ $reference = ltrim($reference, '.');
+
+ if (!$this->comp->hasPackage($reference)) {
+ $found = false;
+ foreach ($this->comp->getPackages() as $package=>$namespace) {
+ if (0 === strpos($reference, $package.'.')) {
+ $reference = $namespace . substr($reference, strlen($package));
+ $found = true;
+ }
+ }
+ if (!$found) {
+ $this->comp->warning('Non tracked package name found "' . $reference . '"');
+ }
+ } else {
+ $reference = $this->comp->getPackage($reference);
+ }
+
+ return $reference;
+ }
+}
--- /dev/null
+++ b/lib/Protobuf-PHP/library/DrSlump/Protobuf/Compiler/PhpGenerator.php
@@ -1,1 +1,610 @@
-
+<?php
+
+namespace DrSlump\Protobuf\Compiler;
+
+use DrSlump\Protobuf;
+use google\protobuf as proto;
+
+class PhpGenerator extends AbstractGenerator
+{
+ protected $components = array();
+
+ protected function addComponent($ns, $name, $src)
+ {
+ if (NULL !== $ns) {
+ $name = $this->normalizeNS($ns . '.' . $name);
+ }
+ $this->components[$name] = $src;
+ }
+
+ /**
+ * Get an option from the compiler arguments or from the proto file.
+ *
+ * @param string $name
+ * @return string|null
+ */
+ protected function getOption($name)
+ {
+ $opt = $this->compiler->getOption($name);
+
+ if (NULL === $opt) {
+ $opts = $this->proto->getOptions();
+ if (!empty($opts) && isset($opts['php.' . $name])) {
+ $opt = $opts['php.' . $name];
+ }
+ }
+
+ return $opt;
+ }
+
+ public function getNamespace(proto\FileDescriptorProto $proto = NULL)
+ {
+ $proto = $proto ?: $this->proto;
+
+ $opts = $proto->getOptions();
+ if ($this->compiler->getOption('namespace')) {
+ $namespace = $this->compiler->getOption('namespace');
+ } else if ($this->compiler->getOption('package')) {
+ $namespace = $this->compiler->getOption('package');
+ } else if (isset($opts['php.namespace'])) {
+ $namespace = $opts['php.namespace'];
+ } else {
+ $namespace = parent::getNamespace($proto);
+ }
+
+ $namespace = trim($namespace, '.\\');
+ return str_replace('.', '\\', $namespace);
+ }
+
+ public function generate(proto\FileDescriptorProto $proto)
+ {
+ parent::generate($proto);
+
+ $this->components = array();
+ $namespace = $proto->getPackage();
+
+ // Generate Enums
+ foreach ($proto->getEnumType() as $enum) {
+ $src = $this->compileEnum($enum, $namespace);
+ $this->addComponent($namespace, $enum->getName(), $src);
+ }
+
+ // Generate Messages
+ foreach ($proto->getMessageType() as $msg) {
+ $src = $this->compileMessage($msg, $namespace);
+ $this->addComponent($namespace, $msg->getName(), $src);
+ }
+
+ // Generate services
+ if ($this->getOption('generic_services') && count($proto->hasService())):
+ foreach ($proto->getServiceList() as $service) {
+ $src = $this->compileService($service, $namespace);
+ $this->addComponent($namespace, $service->getName(), $src);
+ }
+ endif;
+
+ // Collect extensions
+ if ($proto->hasExtension()) {
+ foreach ($proto->getExtensionList() as $field) {
+ $this->extensions[$field->getExtendee()][] = array($namespace, $field);
+ }
+ }
+
+ // Dump all extensions found in this proto file
+ if (count($this->extensions)):
+ $s[]= 'namespace {';
+ foreach ($this->extensions as $extendee => $fields) {
+ foreach ($fields as $pair) {
+ list($ns, $field) = $pair;
+ $s[] = $this->compileExtension($field, $ns, ' ');
+ }
+ }
+ $s[]= '}';
+
+ $src = implode(PHP_EOL, $s);
+
+ // In multifile mode we output all the extensions in a file named after
+ // the proto file, since it's not trivial or even possible in all cases
+ // to include the extensions with the extended message file.
+ $fname = pathinfo($proto->getName(), PATHINFO_FILENAME);
+ $this->addComponent(null, $fname . '-extensions', $src);
+
+ // Reset extensions for next proto file
+ $this->extensions = array();
+ endif;
+
+
+ $files = array();
+ if (!$this->getOption('multifile')) {
+ $src = '';
+ foreach ($this->components as $content) {
+ $src .= $content;
+ }
+ $fname = pathinfo($proto->getName(), PATHINFO_FILENAME);
+ $files[] = $this->buildFile($proto, $fname, $src);
+ } else {
+ foreach ($this->components as $ns => $content) {
+ $fname = str_replace('\\', '/', $ns);
+ $files[] = $this->buildFile($proto, $fname, $content);
+ }
+ }
+
+ return $files;
+ }
+
+ protected function buildFile(proto\FileDescriptorProto $proto, $fname, $contents)
+ {
+ $suffix = $this->getOption('suffix') ?: '.php';
+ $fname .= $suffix;
+
+ $file = new \google\protobuf\compiler\CodeGeneratorResponse\File();
+ $file->setName($fname);
+
+ $s = array();
+ $s[]= "<?php";
+ $s[]= "// DO NOT EDIT! Generated by Protobuf-PHP protoc plugin " . Protobuf::VERSION;
+ $s[]= "// Source: " . $proto->getName();
+ $s[]= "// Date: " . date('Y-m-d H:i:s');
+ $s[]= "";
+ $s[]= "// @@protoc_insertion_point(scope_file)";
+ $s[]= "";
+
+ $contents = implode(PHP_EOL, $s) . PHP_EOL . $contents;
+ $file->setContent($contents);
+ return $file;
+ }
+
+ protected function compileEnum(proto\EnumDescriptorProto $enum, $ns)
+ {
+ $s = array();
+
+ $s[]= "namespace " . $this->normalizeNS($ns) . " {";
+ $s[]= "";
+ $s[]= " // @@protoc_insertion_point(scope_namespace)";
+ $s[]= " // @@protoc_insertion_point(namespace_$ns)";
+ $s[]= "";
+
+ $cmt = $this->compiler->getComment($ns . '.' . $enum->getName(), ' * ');
+ if ($cmt):
+ $s[]= " /**";
+ $s[]= $cmt;
+ $s[]= " */";
+ endif;
+
+ $s[]= " class " . $enum->getName() . " {";
+ foreach ($enum->getValueList() as $value):
+ $s[]= " const " . $value->getName() . " = " . $value->getNumber() . ";";
+ endforeach;
+ $s[]= "";
+ $s[]= " // @@protoc_insertion_point(scope_class)";
+ $s[]= ' // @@protoc_insertion_point(class_' . $ns . '.' . $enum->getName() . ')';
+ $s[]= " }";
+ $s[]= "}";
+ $s[]= "";
+
+ return implode(PHP_EOL, $s);
+ }
+
+ protected function compileMessage(proto\DescriptorProto $msg, $ns)
+ {
+ $s = array();
+ $s[]= "namespace " . $this->normalizeNS($ns) . " {";
+ $s[]= "";
+ $s[]= " // @@protoc_insertion_point(scope_namespace)";
+ $s[]= " // @@protoc_insertion_point(namespace_$ns)";
+ $s[]= "";
+
+ $cmt = $this->compiler->getComment($ns . '.' . $msg->getName(), ' * ');
+ if ($cmt):
+ $s[]= " /**";
+ $s[]= $cmt;
+ $s[]= " */";
+ endif;
+
+ // Compute a new namespace with the message name as suffix
+ $ns .= '.' . $msg->getName();
+
+ $s[]= ' class ' . $msg->getName() . ' extends \DrSlump\Protobuf\Message {';
+ $s[]= "";
+ $s[]= ' /** @var \Closure[] */';
+ $s[]= ' protected static $__extensions = array();';
+ $s[]= '';
+ $s[]= ' public static function descriptor()';
+ $s[]= ' {';
+ $s[]= ' $descriptor = new \DrSlump\Protobuf\Descriptor(__CLASS__, \'' . $ns . '\');';
+ $s[]= '';
+ foreach ($msg->getField() as $field):
+ $s[]= $this->compileField($field, $ns, " ");
+ $s[]= ' $descriptor->addField($f);';
+ $s[]= '';
+ endforeach;
+ $s[]= ' foreach (self::$__extensions as $cb) {';
+ $s[]= ' $descriptor->addField($cb(), true);';
+ $s[]= ' }';
+ $s[]= '';
+ $s[]= ' // @@protoc_insertion_point(scope_descriptor)';
+ $s[]= ' // @@protoc_insertion_point(descriptor_' . $ns . ')';
+ $s[]= '';
+ $s[]= ' return $descriptor;';
+ $s[]= ' }';
+ $s[]= '';
+
+ //$s[]= " protected static \$__exts = array(";
+ //foreach ($msg->getExtensionRange() as $range):
+ //$s[]= ' array(' . $range->getStart() . ', ' . ($range->getEnd()-1) . '),';
+ //endforeach;
+ //$s[]= " );";
+ //$s[]= "";
+
+ foreach ($msg->getField() as $field):
+ $s[]= $this->generatePublicField($field, $ns, " ");
+ endforeach;
+ $s[]= "";
+
+ foreach ($msg->getField() as $field):
+ $s[]= $this->generateAccessors($field, $ns, " ");
+ endforeach;
+
+ $s[]= "";
+ $s[]= " // @@protoc_insertion_point(scope_class)";
+ $s[]= ' // @@protoc_insertion_point(class_' . $ns . ')';
+ $s[]= " }";
+ $s[]= "}";
+ $s[]= "";
+
+ // Generate Enums
+ if ($msg->hasEnumType()):
+ foreach ($msg->getEnumType() as $enum):
+ $src = $this->compileEnum($enum, $ns);
+ $this->addComponent($ns, $enum->getName(), $src);
+ endforeach;
+ endif;
+
+ // Generate nested messages
+ if ($msg->hasNestedType()):
+ foreach ($msg->getNestedType() as $msg):
+ $src = $this->compileMessage($msg, $ns);
+ $this->addComponent($ns, $msg->getName(), $src);
+ endforeach;
+ endif;
+
+ // Collect extensions
+ if ($msg->hasExtension()) {
+ foreach ($msg->getExtensionList() as $field) {
+ $this->_extensions[$field->getExtendee()][] = array($ns, $field);
+ }
+ }
+
+ return implode(PHP_EOL, $s) . PHP_EOL;
+ }
+
+
+ protected function compileField(proto\FieldDescriptorProto $field, $ns, $indent)
+ {
+ switch ($field->getLabel()) {
+ case Protobuf::RULE_REQUIRED:
+ $rule = 'required';
+ break;
+ case Protobuf::RULE_OPTIONAL:
+ $rule = 'optional';
+ break;
+ case Protobuf::RULE_REPEATED:
+ $rule = 'repeated';
+ break;
+ }
+
+ $s[]= "// $rule " . $field->getTypeName() . " " . $field->getName() . " = " . $field->getNumber();
+ $s[]= '$f = new \DrSlump\Protobuf\Field();';
+ $s[]= '$f->number = ' . $field->getNumber() . ';';
+ $s[]= '$f->name = "'. $field->getName() . '";';
+ $s[]= '$f->type = ' . $field->getType() . ';';
+ $s[]= '$f->rule = ' . $field->getLabel() . ';';
+
+ if ($field->hasTypeName()):
+ $ref = $field->getTypeName();
+ if (substr($ref, 0, 1) !== '.') {
+ throw new \RuntimeException("Only fully qualified names are supported but found '$ref' at $ns");
+ }
+ $s[]= '$f->reference = \'\\' . $this->normalizeNS($ref) . "';";
+ endif;
+
+ if ($field->hasDefaultValue()):
+ switch ($field->getType()) {
+ case Protobuf::TYPE_BOOL:
+ $bool = filter_var($field->getDefaultValue(), FILTER_VALIDATE_BOOLEAN);
+ $s[]= '$f->default = ' . ($bool ? 'true' : 'false') . ';';
+ break;
+ case Protobuf::TYPE_STRING:
+ $s[]= '$f->default = "' . addcslashes($field->getDefaultValue(), '"\\') . '";';
+ break;
+ case Protobuf::TYPE_ENUM:
+ $value = '\\' . $this->normalizeNS($field->getTypeName()) . '::' . $field->getDefaultValue();
+ $s[]= '$f->default = ' . $value . ';';
+ break;
+ default: // Numbers
+ $s[]= '$f->default = ' . $field->getDefaultValue() . ';';
+ }
+ endif;
+
+ $s[]= '// @@protoc_insertion_point(scope_field)';
+ $s[]= '// @@protoc_insertion_point(field_' . $ns . ':' . $field->getName() . ')';
+
+ return $indent . implode(PHP_EOL.$indent, $s);
+ }
+
+ protected function compileExtension(proto\FieldDescriptorProto $field, $ns, $indent)
+ {
+ $extendee = $this->normalizeNS($field->getExtendee());
+ $name = $this->normalizeNS($ns . '.' . $field->getName());
+ $field->setName($name);
+
+ $s[]= "\\$extendee::extension(function(){";
+ $s[]= $this->compileField($field, $ns, $indent.' ');
+ $s[]= ' // @@protoc_insertion_point(scope_extension)';
+ $s[]= ' // @@protoc_insertion_point(extension_' . $ns . ':' . $field->getName() . ')';
+ $s[]= ' return $f;';
+ $s[]= "});";
+
+ return $indent . implode(PHP_EOL.$indent, $s);
+ }
+
+ protected function compileService(proto\ServiceDescriptorProto $service, $ns)
+ {
+ $s = array();
+ $s[]= 'namespace ' . $this->normalizeNS($ns) . ' {';
+ $s[]= '';
+ $s[]= " // @@protoc_insertion_point(scope_namespace)";
+ $s[]= " // @@protoc_insertion_point(namespace_$ns)";
+ $s[]= '';
+
+ $cmt = $this->compiler->getComment($ns . '.' . $service->getName(), ' * ');
+ if ($cmt):
+ $s[]= " /**";
+ $s[]= $cmt;
+ $s[]= " */";
+ endif;
+
+ $s[]= ' interface ' . $service->getName();
+ $s[]= ' {';
+ $s[]= ' // @@protoc_insertion_point(scope_interface)';
+ $s[]= ' // @@protoc_insertion_point(interface_' . $ns . '.' . $service->getName() . ')';
+ $s[]= '';
+
+ foreach ($service->getMethodList() as $method):
+ $s[]= ' /**';
+
+ $cmt = $this->compiler->getComment($ns . '.' . $service->getName() . '.' . $method->getName(), ' * ');
+ if ($cmt):
+ $s[]= $cmt;
+ $s[]= ' * ';
+ endif;
+
+ $s[]= ' * @param ' . $this->normalizeNS($method->getInputType()) . ' $input';
+ $s[]= ' * @return ' . $this->normalizeNS($method->getOutputType());
+ $s[]= ' */';
+ $s[]= ' public function ' . $method->getName() . '(' . $this->normalizeNS($method->getInputType()) . ' $input);';
+ $s[]= '';
+ endforeach;
+ $s[]= ' }';
+ $s[]= '}';
+ $s[]= '';
+
+ return implode(PHP_EOL, $s) . PHP_EOL;
+ }
+
+ protected function generatePublicField(proto\FieldDescriptorProto $field, $ns, $indent)
+ {
+ $cmt = $this->compiler->getComment($ns . '.' . $field->getNumber(), "$indent * ");
+ if ($cmt) {
+ $cmt = "\n" . $cmt . "\n$indent *";
+ }
+
+ if ($field->getLabel() === Protobuf::RULE_REPEATED) {
+ $s[]= "/** $cmt @var " . $this->getJavaDocType($field) . "[] " . ($cmt ? "\n$indent" : '') . " */";
+ $s[]= 'public $' . $field->getName() . " = array();";
+ } else {
+ $s[]= "/** $cmt @var " . $this->getJavaDocType($field) . ($cmt ? "\n$indent" : '') . " */";
+ $default = 'null';
+ if ($field->hasDefaultValue()) {
+ switch ($field->getType()) {
+ case Protobuf::TYPE_BOOL:
+ $default = $field->getDefaultValue() ? 'true' : 'false';
+ break;
+ case Protobuf::TYPE_STRING:
+ $default = '"' . addcslashes($field->getDefaultValue(), '"\\') . '"';
+ break;
+ case Protobuf::TYPE_ENUM:
+ $default = '\\' . $this->normalizeNS($field->getTypeName()) . '::' . $field->getDefaultValue();
+ break;
+ default: // Numbers
+ $default = $field->getDefaultValue();
+ }
+ }
+ $s[]= 'public $' . $field->getName() . ' = ' . $default . ';';
+ }
+ $s[]= "";
+
+ return $indent . implode(PHP_EOL.$indent, $s);
+ }
+
+ protected function generateAccessors(proto\FieldDescriptorProto $field, $ns, $indent)
+ {
+ $tag = $field->getNumber();
+ $name = $field->getName();
+ $camel = $this->compiler->camelize(ucfirst($name));
+
+ $typehint = '';
+ $typedoc = $this->getJavaDocType($field);
+ if (0 === strpos($typedoc, '\\')) {
+ $typehint = $typedoc;
+ }
+
+ // hasXXX
+ $s[]= "/**";
+ $s[]= " * Check if <$name> has a value";
+ $s[]= " *";
+ $s[]= " * @return boolean";
+ $s[]= " */";
+ $s[]= "public function has$camel(){";
+ $s[]= " return \$this->_has($tag);";
+ $s[]= "}";
+ $s[]= "";
+
+ // clearXXX
+ $s[]= "/**";
+ $s[]= " * Clear <$name> value";
+ $s[]= " *";
+ $s[]= " * @return \\" . $this->normalizeNS($ns);
+ $s[]= " */";
+ $s[]= "public function clear$camel(){";
+ $s[]= " return \$this->_clear($tag);";
+ $s[]= "}";
+ $s[]= "";
+
+
+ if ($field->getLabel() === Protobuf::RULE_REPEATED):
+
+ // getXXX
+ $s[]= "/**";
+ $s[]= " * Get <$name> value";
+ $s[]= " *";
+ $s[]= " * @param int \$idx";
+ $s[]= " * @return $typedoc";
+ $s[]= " */";
+ $s[]= "public function get$camel(\$idx = NULL){";
+ $s[]= " return \$this->_get($tag, \$idx);";
+ $s[]= "}";
+ $s[]= "";
+
+ // setXXX
+ $s[]= "/**";
+ $s[]= " * Set <$name> value";
+ $s[]= " *";
+ $s[]= " * @param $typedoc \$value";
+ $s[]= " * @return \\" . $this->normalizeNS($ns);
+ $s[]= " */";
+ $s[]= "public function set$camel($typehint \$value, \$idx = NULL){";
+ $s[]= " return \$this->_set($tag, \$value, \$idx);";
+ $s[]= "}";
+ $s[]= "";
+
+ $s[]= "/**";
+ $s[]= " * Get all elements of <$name>";
+ $s[]= " *";
+ $s[]= " * @return {$typedoc}[]";
+ $s[]= " */";
+ $s[]= "public function get{$camel}List(){";
+ $s[]= " return \$this->_get($tag);";
+ $s[]= "}";
+ $s[]= "";
+
+ $s[]= "/**";
+ $s[]= " * Add a new element to <$name>";
+ $s[]= " *";
+ $s[]= " * @param $typedoc \$value";
+ $s[]= " * @return \\" . $this->normalizeNS($ns);
+ $s[]= " */";
+ $s[]= "public function add$camel($typehint \$value){";
+ $s[]= " return \$this->_add($tag, \$value);";
+ $s[]= "}";
+ $s[]= "";
+
+ else:
+
+ // getXXX
+ $s[]= "/**";
+ $s[]= " * Get <$name> value";
+ $s[]= " *";
+ $s[]= " * @return $typedoc";
+ $s[]= " */";
+ $s[]= "public function get$camel(){";
+ $s[]= " return \$this->_get($tag);";
+ $s[]= "}";
+ $s[]= "";
+
+ // setXXX
+ $s[]= "/**";
+ $s[]= " * Set <$name> value";
+ $s[]= " *";
+ $s[]= " * @param $typedoc \$value";
+ $s[]= " * @return \\" . $this->normalizeNS($ns);
+ $s[]= " */";
+ $s[]= "public function set$camel($typehint \$value){";
+ $s[]= " return \$this->_set($tag, \$value);";
+ $s[]= "}";
+ $s[]= "";
+
+ endif;
+
+ return $indent . implode(PHP_EOL.$indent, $s);
+ }
+
+ protected function getJavaDocType(proto\FieldDescriptorProto $field)
+ {
+ switch ($field->getType()) {
+ case Protobuf::TYPE_DOUBLE:
+ case Protobuf::TYPE_FLOAT:
+ return 'float';
+ case Protobuf::TYPE_INT64:
+ case Protobuf::TYPE_UINT64:
+ case Protobuf::TYPE_INT32:
+ case Protobuf::TYPE_FIXED64:
+ case Protobuf::TYPE_FIXED32:
+ case Protobuf::TYPE_UINT32:
+ case Protobuf::TYPE_SFIXED32:
+ case Protobuf::TYPE_SFIXED64:
+ case Protobuf::TYPE_SINT32:
+ case Protobuf::TYPE_SINT64:
+ return 'int';
+ case Protobuf::TYPE_BOOL:
+ return 'boolean';
+ case Protobuf::TYPE_STRING:
+ return 'string';
+ case Protobuf::TYPE_MESSAGE:
+ return '\\' . $this->normalizeNS($field->getTypeName());
+ case Protobuf::TYPE_BYTES:
+ return 'string';
+ case Protobuf::TYPE_ENUM:
+ return 'int - \\' . $this->normalizeNS($field->getTypeName());
+
+ case Protobuf::TYPE_GROUP:
+ default:
+ return 'unknown';
+ }
+ }
+
+ protected function normalizeNS($package)
+ {
+ // Remove leading dot (used in references)
+ $package = ltrim($package, '.');
+
+ if ($this->compiler->hasPackage($package)) {
+ return $this->compiler->getPackage($package);
+ }
+
+ // Check the currently registered packages to find a root one
+ $found = null;
+ foreach ($this->compiler->getPackages() as $pkg=>$ns) {
+ // Keep only the longest match
+ if (0 === strpos($package, $pkg.'.') && strlen($found) < strlen($pkg)) {
+ $found = $pkg;
+ }
+ }
+
+ // If no matching package was found issue a warning and use the package name
+ if (!$found) {
+ $this->compiler->warning('Non tracked package name found "' . $package . '"');
+ $namespace = str_replace('.', '\\', $package);
+ } else {
+ // Complete the namespace with the remaining package
+ $namespace = $this->compiler->getPackage($found);
+ $namespace .= substr($package, strlen($found));
+ $namespace = str_replace('.', '\\', $namespace);
+ // Set the newly found namespace in the registry
+ $this->compiler->setPackage($package, $namespace);
+ }
+
+ return $namespace;
+ }
+}
+
--- /dev/null
+++ b/lib/Protobuf-PHP/library/DrSlump/Protobuf/Compiler/protos/descriptor.pb.php
@@ -1,1 +1,4780 @@
-
+<?php
+// DO NOT EDIT! Generated by Protobuf for PHP protoc plugin @package_version@
+// Source: descriptor.proto
+// Date: 2011-03-20 01:26:49
+
+namespace google\protobuf {
+
+ class FileDescriptorSet extends \DrSlump\Protobuf\Message {
+
+ /** @var \DrSlump\Protobuf\Descriptor */
+ protected static $__descriptor;
+ /** @var \Closure[] */
+ protected static $__extensions = array();
+
+ public static function descriptor(\DrSlump\Protobuf\Descriptor $descriptor = NULL)
+ {
+ if (NULL !== $descriptor) {
+ self::$__descriptor = $descriptor;
+ return self::$__descriptor;
+ }
+
+ if (!self::$__descriptor) {
+ $descriptor = new \DrSlump\Protobuf\Descriptor("\google\protobuf\FileDescriptorSet");
+
+ // repeated .google.protobuf.FileDescriptorProto file = 1
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 1;
+ $f->name = "file";
+ $f->nameOrig = "file";
+ $f->type = 11;
+ $f->rule = 3;
+ $f->reference = "\google\protobuf\FileDescriptorProto";
+ $descriptor->addField($f);
+
+ foreach (self::$__extensions as $cb) {
+ $descriptor->addField($cb(), true);
+ }
+
+ self::$__descriptor = $descriptor;
+ }
+
+ return self::$__descriptor;
+ }
+
+ /** @var \google\protobuf\FileDescriptorProto[] */
+ public $file = array();
+
+
+ /**
+ * Check if <file> has a value
+ *
+ * @return boolean
+ */
+ public function hasFile(){
+ return $this->_has(1);
+ }
+
+ /**
+ * Clear <file> value
+ *
+ * @return \google\protobuf\FileDescriptorSet
+ */
+ public function clearFile(){
+ return $this->_clear(1);
+ }
+
+ /**
+ * Get <file> value
+ *
+ * @param int $idx
+ * @return \google\protobuf\FileDescriptorProto
+ */
+ public function getFile($idx = NULL){
+ return $this->_get(1, $idx);
+ }
+
+ /**
+ * Set <file> value
+ *
+ * @param \google\protobuf\FileDescriptorProto $value
+ * @return \google\protobuf\FileDescriptorSet
+ */
+ public function setFile(\google\protobuf\FileDescriptorProto $value, $idx = NULL){
+ return $this->_set(1, $value, $idx);
+ }
+
+ /**
+ * Get all elements of <file>
+ *
+ * @return \google\protobuf\FileDescriptorProto[]
+ */
+ public function getFileList(){
+ return $this->_get(1);
+ }
+
+ /**
+ * Add a new element to <file>
+ *
+ * @param \google\protobuf\FileDescriptorProto $value
+ * @return \google\protobuf\FileDescriptorSet
+ */
+ public function addFile(\google\protobuf\FileDescriptorProto $value){
+ return $this->_add(1, $value);
+ }
+
+ }
+}
+
+namespace google\protobuf {
+
+ class FileDescriptorProto extends \DrSlump\Protobuf\Message {
+
+ /** @var \DrSlump\Protobuf\Descriptor */
+ protected static $__descriptor;
+ /** @var \Closure[] */
+ protected static $__extensions = array();
+
+ public static function descriptor(\DrSlump\Protobuf\Descriptor $descriptor = NULL)
+ {
+ if (NULL !== $descriptor) {
+ self::$__descriptor = $descriptor;
+ return self::$__descriptor;
+ }
+
+ if (!self::$__descriptor) {
+ $descriptor = new \DrSlump\Protobuf\Descriptor("\google\protobuf\FileDescriptorProto");
+
+ // optional name = 1
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 1;
+ $f->name = "name";
+ $f->nameOrig = "name";
+ $f->type = 9;
+ $f->rule = 1;
+ $descriptor->addField($f);
+
+ // optional package = 2
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 2;
+ $f->name = "package";
+ $f->nameOrig = "package";
+ $f->type = 9;
+ $f->rule = 1;
+ $descriptor->addField($f);
+
+ // repeated dependency = 3
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 3;
+ $f->name = "dependency";
+ $f->nameOrig = "dependency";
+ $f->type = 9;
+ $f->rule = 3;
+ $descriptor->addField($f);
+
+ // repeated .google.protobuf.DescriptorProto message_type = 4
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 4;
+ $f->name = "message_type";
+ $f->type = 11;
+ $f->rule = 3;
+ $f->reference = "\google\protobuf\DescriptorProto";
+ $descriptor->addField($f);
+
+ // repeated .google.protobuf.EnumDescriptorProto enum_type = 5
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 5;
+ $f->name = "enum_type";
+ $f->type = 11;
+ $f->rule = 3;
+ $f->reference = "\google\protobuf\EnumDescriptorProto";
+ $descriptor->addField($f);
+
+ // repeated .google.protobuf.ServiceDescriptorProto service = 6
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 6;
+ $f->name = "service";
+ $f->nameOrig = "service";
+ $f->type = 11;
+ $f->rule = 3;
+ $f->reference = "\google\protobuf\ServiceDescriptorProto";
+ $descriptor->addField($f);
+
+ // repeated .google.protobuf.FieldDescriptorProto extension = 7
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 7;
+ $f->name = "extension";
+ $f->nameOrig = "extension";
+ $f->type = 11;
+ $f->rule = 3;
+ $f->reference = "\google\protobuf\FieldDescriptorProto";
+ $descriptor->addField($f);
+
+ // optional .google.protobuf.FileOptions options = 8
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 8;
+ $f->name = "options";
+ $f->nameOrig = "options";
+ $f->type = 11;
+ $f->rule = 1;
+ $f->reference = "\google\protobuf\FileOptions";
+ $descriptor->addField($f);
+
+ // optional .google.protobuf.SourceCodeInfo source_code_info = 9
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 9;
+ $f->name = "source_code_info";
+ $f->type = 11;
+ $f->rule = 1;
+ $f->reference = "\google\protobuf\SourceCodeInfo";
+ $descriptor->addField($f);
+
+ foreach (self::$__extensions as $cb) {
+ $descriptor->addField($cb(), true);
+ }
+
+ self::$__descriptor = $descriptor;
+ }
+
+ return self::$__descriptor;
+ }
+
+ /** @var string */
+ public $name = null;
+
+ /** @var string */
+ public $package = null;
+
+ /** @var string[] */
+ public $dependency = array();
+
+ /** @var \google\protobuf\DescriptorProto[] */
+ public $message_type = array();
+
+ /** @var \google\protobuf\EnumDescriptorProto[] */
+ public $enum_type = array();
+
+ /** @var \google\protobuf\ServiceDescriptorProto[] */
+ public $service = array();
+
+ /** @var \google\protobuf\FieldDescriptorProto[] */
+ public $extension = array();
+
+ /** @var \google\protobuf\FileOptions */
+ public $options = null;
+
+ /** @var \google\protobuf\SourceCodeInfo */
+ public $source_code_info = null;
+
+
+ /**
+ * Check if <name> has a value
+ *
+ * @return boolean
+ */
+ public function hasName(){
+ return $this->_has(1);
+ }
+
+ /**
+ * Clear <name> value
+ *
+ * @return \google\protobuf\FileDescriptorProto
+ */
+ public function clearName(){
+ return $this->_clear(1);
+ }
+
+ /**
+ * Get <name> value
+ *
+ * @return string
+ */
+ public function getName(){
+ return $this->_get(1);
+ }
+
+ /**
+ * Set <name> value
+ *
+ * @param string $value
+ * @return \google\protobuf\FileDescriptorProto
+ */
+ public function setName( $value){
+ return $this->_set(1, $value);
+ }
+
+ /**
+ * Check if <package> has a value
+ *
+ * @return boolean
+ */
+ public function hasPackage(){
+ return $this->_has(2);
+ }
+
+ /**
+ * Clear <package> value
+ *
+ * @return \google\protobuf\FileDescriptorProto
+ */
+ public function clearPackage(){
+ return $this->_clear(2);
+ }
+
+ /**
+ * Get <package> value
+ *
+ * @return string
+ */
+ public function getPackage(){
+ return $this->_get(2);
+ }
+
+ /**
+ * Set <package> value
+ *
+ * @param string $value
+ * @return \google\protobuf\FileDescriptorProto
+ */
+ public function setPackage( $value){
+ return $this->_set(2, $value);
+ }
+
+ /**
+ * Check if <dependency> has a value
+ *
+ * @return boolean
+ */
+ public function hasDependency(){
+ return $this->_has(3);
+ }
+
+ /**
+ * Clear <dependency> value
+ *
+ * @return \google\protobuf\FileDescriptorProto
+ */
+ public function clearDependency(){
+ return $this->_clear(3);
+ }
+
+ /**
+ * Get <dependency> value
+ *
+ * @param int $idx
+ * @return string
+ */
+ public function getDependency($idx = NULL){
+ return $this->_get(3, $idx);
+ }
+
+ /**
+ * Set <dependency> value
+ *
+ * @param string $value
+ * @return \google\protobuf\FileDescriptorProto
+ */
+ public function setDependency( $value, $idx = NULL){
+ return $this->_set(3, $value, $idx);
+ }
+
+ /**
+ * Get all elements of <dependency>
+ *
+ * @return string[]
+ */
+ public function getDependencyList(){
+ return $this->_get(3);
+ }
+
+ /**
+ * Add a new element to <dependency>
+ *
+ * @param string $value
+ * @return \google\protobuf\FileDescriptorProto
+ */
+ public function addDependency( $value){
+ return $this->_add(3, $value);
+ }
+
+ /**
+ * Check if <message_type> has a value
+ *
+ * @return boolean
+ */
+ public function hasMessageType(){
+ return $this->_has(4);
+ }
+
+ /**
+ * Clear <message_type> value
+ *
+ * @return \google\protobuf\FileDescriptorProto
+ */
+ public function clearMessageType(){
+ return $this->_clear(4);
+ }
+
+ /**
+ * Get <message_type> value
+ *
+ * @param int $idx
+ * @return \google\protobuf\DescriptorProto
+ */
+ public function getMessageType($idx = NULL){
+ return $this->_get(4, $idx);
+ }
+
+ /**
+ * Set <message_type> value
+ *
+ * @param \google\protobuf\DescriptorProto $value
+ * @return \google\protobuf\FileDescriptorProto
+ */
+ public function setMessageType(\google\protobuf\DescriptorProto $value, $idx = NULL){
+ return $this->_set(4, $value, $idx);
+ }
+
+ /**
+ * Get all elements of <message_type>
+ *
+ * @return \google\protobuf\DescriptorProto[]
+ */
+ public function getMessageTypeList(){
+ return $this->_get(4);
+ }
+
+ /**
+ * Add a new element to <message_type>
+ *
+ * @param \google\protobuf\DescriptorProto $value
+ * @return \google\protobuf\FileDescriptorProto
+ */
+ public function addMessageType(\google\protobuf\DescriptorProto $value){
+ return $this->_add(4, $value);
+ }
+
+ /**
+ * Check if <enum_type> has a value
+ *
+ * @return boolean
+ */
+ public function hasEnumType(){
+ return $this->_has(5);
+ }
+
+ /**
+ * Clear <enum_type> value
+ *
+ * @return \google\protobuf\FileDescriptorProto
+ */
+ public function clearEnumType(){
+ return $this->_clear(5);
+ }
+
+ /**
+ * Get <enum_type> value
+ *
+ * @param int $idx
+ * @return \google\protobuf\EnumDescriptorProto
+ */
+ public function getEnumType($idx = NULL){
+ return $this->_get(5, $idx);
+ }
+
+ /**
+ * Set <enum_type> value
+ *
+ * @param \google\protobuf\EnumDescriptorProto $value
+ * @return \google\protobuf\FileDescriptorProto
+ */
+ public function setEnumType(\google\protobuf\EnumDescriptorProto $value, $idx = NULL){
+ return $this->_set(5, $value, $idx);
+ }
+
+ /**
+ * Get all elements of <enum_type>
+ *
+ * @return \google\protobuf\EnumDescriptorProto[]
+ */
+ public function getEnumTypeList(){
+ return $this->_get(5);
+ }
+
+ /**
+ * Add a new element to <enum_type>
+ *
+ * @param \google\protobuf\EnumDescriptorProto $value
+ * @return \google\protobuf\FileDescriptorProto
+ */
+ public function addEnumType(\google\protobuf\EnumDescriptorProto $value){
+ return $this->_add(5, $value);
+ }
+
+ /**
+ * Check if <service> has a value
+ *
+ * @return boolean
+ */
+ public function hasService(){
+ return $this->_has(6);
+ }
+
+ /**
+ * Clear <service> value
+ *
+ * @return \google\protobuf\FileDescriptorProto
+ */
+ public function clearService(){
+ return $this->_clear(6);
+ }
+
+ /**
+ * Get <service> value
+ *
+ * @param int $idx
+ * @return \google\protobuf\ServiceDescriptorProto
+ */
+ public function getService($idx = NULL){
+ return $this->_get(6, $idx);
+ }
+
+ /**
+ * Set <service> value
+ *
+ * @param \google\protobuf\ServiceDescriptorProto $value
+ * @return \google\protobuf\FileDescriptorProto
+ */
+ public function setService(\google\protobuf\ServiceDescriptorProto $value, $idx = NULL){
+ return $this->_set(6, $value, $idx);
+ }
+
+ /**
+ * Get all elements of <service>
+ *
+ * @return \google\protobuf\ServiceDescriptorProto[]
+ */
+ public function getServiceList(){
+ return $this->_get(6);
+ }
+
+ /**
+ * Add a new element to <service>
+ *
+ * @param \google\protobuf\ServiceDescriptorProto $value
+ * @return \google\protobuf\FileDescriptorProto
+ */
+ public function addService(\google\protobuf\ServiceDescriptorProto $value){
+ return $this->_add(6, $value);
+ }
+
+ /**
+ * Check if <extension> has a value
+ *
+ * @return boolean
+ */
+ public function hasExtension(){
+ return $this->_has(7);
+ }
+
+ /**
+ * Clear <extension> value
+ *
+ * @return \google\protobuf\FileDescriptorProto
+ */
+ public function clearExtension(){
+ return $this->_clear(7);
+ }
+
+ /**
+ * Get <extension> value
+ *
+ * @param int $idx
+ * @return \google\protobuf\FieldDescriptorProto
+ */
+ public function getExtension($idx = NULL){
+ return $this->_get(7, $idx);
+ }
+
+ /**
+ * Set <extension> value
+ *
+ * @param \google\protobuf\FieldDescriptorProto $value
+ * @return \google\protobuf\FileDescriptorProto
+ */
+ public function setExtension(\google\protobuf\FieldDescriptorProto $value, $idx = NULL){
+ return $this->_set(7, $value, $idx);
+ }
+
+ /**
+ * Get all elements of <extension>
+ *
+ * @return \google\protobuf\FieldDescriptorProto[]
+ */
+ public function getExtensionList(){
+ return $this->_get(7);
+ }
+
+ /**
+ * Add a new element to <extension>
+ *
+ * @param \google\protobuf\FieldDescriptorProto $value
+ * @return \google\protobuf\FileDescriptorProto
+ */
+ public function addExtension(\google\protobuf\FieldDescriptorProto $value){
+ return $this->_add(7, $value);
+ }
+
+ /**
+ * Check if <options> has a value
+ *
+ * @return boolean
+ */
+ public function hasOptions(){
+ return $this->_has(8);
+ }
+
+ /**
+ * Clear <options> value
+ *
+ * @return \google\protobuf\FileDescriptorProto
+ */
+ public function clearOptions(){
+ return $this->_clear(8);
+ }
+
+ /**
+ * Get <options> value
+ *
+ * @return \google\protobuf\FileOptions
+ */
+ public function getOptions(){
+ return $this->_get(8);
+ }
+
+ /**
+ * Set <options> value
+ *
+ * @param \google\protobuf\FileOptions $value
+ * @return \google\protobuf\FileDescriptorProto
+ */
+ public function setOptions(\google\protobuf\FileOptions $value){
+ return $this->_set(8, $value);
+ }
+
+ /**
+ * Check if <source_code_info> has a value
+ *
+ * @return boolean
+ */
+ public function hasSourceCodeInfo(){
+ return $this->_has(9);
+ }
+
+ /**
+ * Clear <source_code_info> value
+ *
+ * @return \google\protobuf\FileDescriptorProto
+ */
+ public function clearSourceCodeInfo(){
+ return $this->_clear(9);
+ }
+
+ /**
+ * Get <source_code_info> value
+ *
+ * @return \google\protobuf\SourceCodeInfo
+ */
+ public function getSourceCodeInfo(){
+ return $this->_get(9);
+ }
+
+ /**
+ * Set <source_code_info> value
+ *
+ * @param \google\protobuf\SourceCodeInfo $value
+ * @return \google\protobuf\FileDescriptorProto
+ */
+ public function setSourceCodeInfo(\google\protobuf\SourceCodeInfo $value){
+ return $this->_set(9, $value);
+ }
+
+ }
+}
+
+namespace google\protobuf {
+
+ class DescriptorProto extends \DrSlump\Protobuf\Message {
+
+ /** @var \DrSlump\Protobuf\Descriptor */
+ protected static $__descriptor;
+ /** @var \Closure[] */
+ protected static $__extensions = array();
+
+ public static function descriptor(\DrSlump\Protobuf\Descriptor $descriptor = NULL)
+ {
+ if (NULL !== $descriptor) {
+ self::$__descriptor = $descriptor;
+ return self::$__descriptor;
+ }
+
+ if (!self::$__descriptor) {
+ $descriptor = new \DrSlump\Protobuf\Descriptor("\google\protobuf\DescriptorProto");
+
+ // optional name = 1
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 1;
+ $f->name = "name";
+ $f->nameOrig = "name";
+ $f->type = 9;
+ $f->rule = 1;
+ $descriptor->addField($f);
+
+ // repeated .google.protobuf.FieldDescriptorProto field = 2
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 2;
+ $f->name = "field";
+ $f->nameOrig = "field";
+ $f->type = 11;
+ $f->rule = 3;
+ $f->reference = "\google\protobuf\FieldDescriptorProto";
+ $descriptor->addField($f);
+
+ // repeated .google.protobuf.FieldDescriptorProto extension = 6
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 6;
+ $f->name = "extension";
+ $f->nameOrig = "extension";
+ $f->type = 11;
+ $f->rule = 3;
+ $f->reference = "\google\protobuf\FieldDescriptorProto";
+ $descriptor->addField($f);
+
+ // repeated .google.protobuf.DescriptorProto nested_type = 3
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 3;
+ $f->name = "nested_type";
+ $f->type = 11;
+ $f->rule = 3;
+ $f->reference = "\google\protobuf\DescriptorProto";
+ $descriptor->addField($f);
+
+ // repeated .google.protobuf.EnumDescriptorProto enum_type = 4
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 4;
+ $f->name = "enum_type";
+ $f->type = 11;
+ $f->rule = 3;
+ $f->reference = "\google\protobuf\EnumDescriptorProto";
+ $descriptor->addField($f);
+
+ // repeated .google.protobuf.DescriptorProto.ExtensionRange extension_range = 5
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 5;
+ $f->name = "extension_range";
+ $f->type = 11;
+ $f->rule = 3;
+ $f->reference = "\google\protobuf\DescriptorProto\ExtensionRange";
+ $descriptor->addField($f);
+
+ // optional .google.protobuf.MessageOptions options = 7
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 7;
+ $f->name = "options";
+ $f->nameOrig = "options";
+ $f->type = 11;
+ $f->rule = 1;
+ $f->reference = "\google\protobuf\MessageOptions";
+ $descriptor->addField($f);
+
+ foreach (self::$__extensions as $cb) {
+ $descriptor->addField($cb(), true);
+ }
+
+ self::$__descriptor = $descriptor;
+ }
+
+ return self::$__descriptor;
+ }
+
+ /** @var string */
+ public $name = null;
+
+ /** @var \google\protobuf\FieldDescriptorProto[] */
+ public $field = array();
+
+ /** @var \google\protobuf\FieldDescriptorProto[] */
+ public $extension = array();
+
+ /** @var \google\protobuf\DescriptorProto[] */
+ public $nested_type = array();
+
+ /** @var \google\protobuf\EnumDescriptorProto[] */
+ public $enum_type = array();
+
+ /** @var \google\protobuf\DescriptorProto\ExtensionRange[] */
+ public $extension_range = array();
+
+ /** @var \google\protobuf\MessageOptions */
+ public $options = null;
+
+
+ /**
+ * Check if <name> has a value
+ *
+ * @return boolean
+ */
+ public function hasName(){
+ return $this->_has(1);
+ }
+
+ /**
+ * Clear <name> value
+ *
+ * @return \google\protobuf\DescriptorProto
+ */
+ public function clearName(){
+ return $this->_clear(1);
+ }
+
+ /**
+ * Get <name> value
+ *
+ * @return string
+ */
+ public function getName(){
+ return $this->_get(1);
+ }
+
+ /**
+ * Set <name> value
+ *
+ * @param string $value
+ * @return \google\protobuf\DescriptorProto
+ */
+ public function setName( $value){
+ return $this->_set(1, $value);
+ }
+
+ /**
+ * Check if <field> has a value
+ *
+ * @return boolean
+ */
+ public function hasField(){
+ return $this->_has(2);
+ }
+
+ /**
+ * Clear <field> value
+ *
+ * @return \google\protobuf\DescriptorProto
+ */
+ public function clearField(){
+ return $this->_clear(2);
+ }
+
+ /**
+ * Get <field> value
+ *
+ * @param int $idx
+ * @return \google\protobuf\FieldDescriptorProto
+ */
+ public function getField($idx = NULL){
+ return $this->_get(2, $idx);
+ }
+
+ /**
+ * Set <field> value
+ *
+ * @param \google\protobuf\FieldDescriptorProto $value
+ * @return \google\protobuf\DescriptorProto
+ */
+ public function setField(\google\protobuf\FieldDescriptorProto $value, $idx = NULL){
+ return $this->_set(2, $value, $idx);
+ }
+
+ /**
+ * Get all elements of <field>
+ *
+ * @return \google\protobuf\FieldDescriptorProto[]
+ */
+ public function getFieldList(){
+ return $this->_get(2);
+ }
+
+ /**
+ * Add a new element to <field>
+ *
+ * @param \google\protobuf\FieldDescriptorProto $value
+ * @return \google\protobuf\DescriptorProto
+ */
+ public function addField(\google\protobuf\FieldDescriptorProto $value){
+ return $this->_add(2, $value);
+ }
+
+ /**
+ * Check if <extension> has a value
+ *
+ * @return boolean
+ */
+ public function hasExtension(){
+ return $this->_has(6);
+ }
+
+ /**
+ * Clear <extension> value
+ *
+ * @return \google\protobuf\DescriptorProto
+ */
+ public function clearExtension(){
+ return $this->_clear(6);
+ }
+
+ /**
+ * Get <extension> value
+ *
+ * @param int $idx
+ * @return \google\protobuf\FieldDescriptorProto
+ */
+ public function getExtension($idx = NULL){
+ return $this->_get(6, $idx);
+ }
+
+ /**
+ * Set <extension> value
+ *
+ * @param \google\protobuf\FieldDescriptorProto $value
+ * @return \google\protobuf\DescriptorProto
+ */
+ public function setExtension(\google\protobuf\FieldDescriptorProto $value, $idx = NULL){
+ return $this->_set(6, $value, $idx);
+ }
+
+ /**
+ * Get all elements of <extension>
+ *
+ * @return \google\protobuf\FieldDescriptorProto[]
+ */
+ public function getExtensionList(){
+ return $this->_get(6);
+ }
+
+ /**
+ * Add a new element to <extension>
+ *
+ * @param \google\protobuf\FieldDescriptorProto $value
+ * @return \google\protobuf\DescriptorProto
+ */
+ public function addExtension(\google\protobuf\FieldDescriptorProto $value){
+ return $this->_add(6, $value);
+ }
+
+ /**
+ * Check if <nested_type> has a value
+ *
+ * @return boolean
+ */
+ public function hasNestedType(){
+ return $this->_has(3);
+ }
+
+ /**
+ * Clear <nested_type> value
+ *
+ * @return \google\protobuf\DescriptorProto
+ */
+ public function clearNestedType(){
+ return $this->_clear(3);
+ }
+
+ /**
+ * Get <nested_type> value
+ *
+ * @param int $idx
+ * @return \google\protobuf\DescriptorProto
+ */
+ public function getNestedType($idx = NULL){
+ return $this->_get(3, $idx);
+ }
+
+ /**
+ * Set <nested_type> value
+ *
+ * @param \google\protobuf\DescriptorProto $value
+ * @return \google\protobuf\DescriptorProto
+ */
+ public function setNestedType(\google\protobuf\DescriptorProto $value, $idx = NULL){
+ return $this->_set(3, $value, $idx);
+ }
+
+ /**
+ * Get all elements of <nested_type>
+ *
+ * @return \google\protobuf\DescriptorProto[]
+ */
+ public function getNestedTypeList(){
+ return $this->_get(3);
+ }
+
+ /**
+ * Add a new element to <nested_type>
+ *
+ * @param \google\protobuf\DescriptorProto $value
+ * @return \google\protobuf\DescriptorProto
+ */
+ public function addNestedType(\google\protobuf\DescriptorProto $value){
+ return $this->_add(3, $value);
+ }
+
+ /**
+ * Check if <enum_type> has a value
+ *
+ * @return boolean
+ */
+ public function hasEnumType(){
+ return $this->_has(4);
+ }
+
+ /**
+ * Clear <enum_type> value
+ *
+ * @return \google\protobuf\DescriptorProto
+ */
+ public function clearEnumType(){
+ return $this->_clear(4);
+ }
+
+ /**
+ * Get <enum_type> value
+ *
+ * @param int $idx
+ * @return \google\protobuf\EnumDescriptorProto
+ */
+ public function getEnumType($idx = NULL){
+ return $this->_get(4, $idx);
+ }
+
+ /**
+ * Set <enum_type> value
+ *
+ * @param \google\protobuf\EnumDescriptorProto $value
+ * @return \google\protobuf\DescriptorProto
+ */
+ public function setEnumType(\google\protobuf\EnumDescriptorProto $value, $idx = NULL){
+ return $this->_set(4, $value, $idx);
+ }
+
+ /**
+ * Get all elements of <enum_type>
+ *
+ * @return \google\protobuf\EnumDescriptorProto[]
+ */
+ public function getEnumTypeList(){
+ return $this->_get(4);
+ }
+
+ /**
+ * Add a new element to <enum_type>
+ *
+ * @param \google\protobuf\EnumDescriptorProto $value
+ * @return \google\protobuf\DescriptorProto
+ */
+ public function addEnumType(\google\protobuf\EnumDescriptorProto $value){
+ return $this->_add(4, $value);
+ }
+
+ /**
+ * Check if <extension_range> has a value
+ *
+ * @return boolean
+ */
+ public function hasExtensionRange(){
+ return $this->_has(5);
+ }
+
+ /**
+ * Clear <extension_range> value
+ *
+ * @return \google\protobuf\DescriptorProto
+ */
+ public function clearExtensionRange(){
+ return $this->_clear(5);
+ }
+
+ /**
+ * Get <extension_range> value
+ *
+ * @param int $idx
+ * @return \google\protobuf\DescriptorProto\ExtensionRange
+ */
+ public function getExtensionRange($idx = NULL){
+ return $this->_get(5, $idx);
+ }
+
+ /**
+ * Set <extension_range> value
+ *
+ * @param \google\protobuf\DescriptorProto\ExtensionRange $value
+ * @return \google\protobuf\DescriptorProto
+ */
+ public function setExtensionRange(\google\protobuf\DescriptorProto\ExtensionRange $value, $idx = NULL){
+ return $this->_set(5, $value, $idx);
+ }
+
+ /**
+ * Get all elements of <extension_range>
+ *
+ * @return \google\protobuf\DescriptorProto\ExtensionRange[]
+ */
+ public function getExtensionRangeList(){
+ return $this->_get(5);
+ }
+
+ /**
+ * Add a new element to <extension_range>
+ *
+ * @param \google\protobuf\DescriptorProto\ExtensionRange $value
+ * @return \google\protobuf\DescriptorProto
+ */
+ public function addExtensionRange(\google\protobuf\DescriptorProto\ExtensionRange $value){
+ return $this->_add(5, $value);
+ }
+
+ /**
+ * Check if <options> has a value
+ *
+ * @return boolean
+ */
+ public function hasOptions(){
+ return $this->_has(7);
+ }
+
+ /**
+ * Clear <options> value
+ *
+ * @return \google\protobuf\DescriptorProto
+ */
+ public function clearOptions(){
+ return $this->_clear(7);
+ }
+
+ /**
+ * Get <options> value
+ *
+ * @return \google\protobuf\MessageOptions
+ */
+ public function getOptions(){
+ return $this->_get(7);
+ }
+
+ /**
+ * Set <options> value
+ *
+ * @param \google\protobuf\MessageOptions $value
+ * @return \google\protobuf\DescriptorProto
+ */
+ public function setOptions(\google\protobuf\MessageOptions $value){
+ return $this->_set(7, $value);
+ }
+
+ }
+}
+
+namespace google\protobuf\DescriptorProto {
+
+ class ExtensionRange extends \DrSlump\Protobuf\Message {
+
+ /** @var \DrSlump\Protobuf\Descriptor */
+ protected static $__descriptor;
+ /** @var \Closure[] */
+ protected static $__extensions = array();
+
+ public static function descriptor(\DrSlump\Protobuf\Descriptor $descriptor = NULL)
+ {
+ if (NULL !== $descriptor) {
+ self::$__descriptor = $descriptor;
+ return self::$__descriptor;
+ }
+
+ if (!self::$__descriptor) {
+ $descriptor = new \DrSlump\Protobuf\Descriptor("\google\protobuf\DescriptorProto\ExtensionRange");
+
+ // optional start = 1
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 1;
+ $f->name = "start";
+ $f->nameOrig = "start";
+ $f->type = 5;
+ $f->rule = 1;
+ $descriptor->addField($f);
+
+ // optional end = 2
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 2;
+ $f->name = "end";
+ $f->nameOrig = "end";
+ $f->type = 5;
+ $f->rule = 1;
+ $descriptor->addField($f);
+
+ foreach (self::$__extensions as $cb) {
+ $descriptor->addField($cb(), true);
+ }
+
+ self::$__descriptor = $descriptor;
+ }
+
+ return self::$__descriptor;
+ }
+
+ /** @var int */
+ public $start = null;
+
+ /** @var int */
+ public $end = null;
+
+
+ /**
+ * Check if <start> has a value
+ *
+ * @return boolean
+ */
+ public function hasStart(){
+ return $this->_has(1);
+ }
+
+ /**
+ * Clear <start> value
+ *
+ * @return \google\protobuf\DescriptorProto\ExtensionRange
+ */
+ public function clearStart(){
+ return $this->_clear(1);
+ }
+
+ /**
+ * Get <start> value
+ *
+ * @return int
+ */
+ public function getStart(){
+ return $this->_get(1);
+ }
+
+ /**
+ * Set <start> value
+ *
+ * @param int $value
+ * @return \google\protobuf\DescriptorProto\ExtensionRange
+ */
+ public function setStart( $value){
+ return $this->_set(1, $value);
+ }
+
+ /**
+ * Check if <end> has a value
+ *
+ * @return boolean
+ */
+ public function hasEnd(){
+ return $this->_has(2);
+ }
+
+ /**
+ * Clear <end> value
+ *
+ * @return \google\protobuf\DescriptorProto\ExtensionRange
+ */
+ public function clearEnd(){
+ return $this->_clear(2);
+ }
+
+ /**
+ * Get <end> value
+ *
+ * @return int
+ */
+ public function getEnd(){
+ return $this->_get(2);
+ }
+
+ /**
+ * Set <end> value
+ *
+ * @param int $value
+ * @return \google\protobuf\DescriptorProto\ExtensionRange
+ */
+ public function setEnd( $value){
+ return $this->_set(2, $value);
+ }
+
+ }
+}
+
+namespace google\protobuf {
+
+ class FieldDescriptorProto extends \DrSlump\Protobuf\Message {
+
+ /** @var \DrSlump\Protobuf\Descriptor */
+ protected static $__descriptor;
+ /** @var \Closure[] */
+ protected static $__extensions = array();
+
+ public static function descriptor(\DrSlump\Protobuf\Descriptor $descriptor = NULL)
+ {
+ if (NULL !== $descriptor) {
+ self::$__descriptor = $descriptor;
+ return self::$__descriptor;
+ }
+
+ if (!self::$__descriptor) {
+ $descriptor = new \DrSlump\Protobuf\Descriptor("\google\protobuf\FieldDescriptorProto");
+
+ // optional name = 1
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 1;
+ $f->name = "name";
+ $f->nameOrig = "name";
+ $f->type = 9;
+ $f->rule = 1;
+ $descriptor->addField($f);
+
+ // optional number = 3
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 3;
+ $f->name = "number";
+ $f->nameOrig = "number";
+ $f->type = 5;
+ $f->rule = 1;
+ $descriptor->addField($f);
+
+ // optional .google.protobuf.FieldDescriptorProto.Label label = 4
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 4;
+ $f->name = "label";
+ $f->nameOrig = "label";
+ $f->type = 14;
+ $f->rule = 1;
+ $f->reference = "\google\protobuf\FieldDescriptorProto\Label";
+ $descriptor->addField($f);
+
+ // optional .google.protobuf.FieldDescriptorProto.Type type = 5
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 5;
+ $f->name = "type";
+ $f->nameOrig = "type";
+ $f->type = 14;
+ $f->rule = 1;
+ $f->reference = "\google\protobuf\FieldDescriptorProto\Type";
+ $descriptor->addField($f);
+
+ // optional type_name = 6
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 6;
+ $f->name = "type_name";
+ $f->type = 9;
+ $f->rule = 1;
+ $descriptor->addField($f);
+
+ // optional extendee = 2
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 2;
+ $f->name = "extendee";
+ $f->nameOrig = "extendee";
+ $f->type = 9;
+ $f->rule = 1;
+ $descriptor->addField($f);
+
+ // optional default_value = 7
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 7;
+ $f->name = "default_value";
+ $f->type = 9;
+ $f->rule = 1;
+ $descriptor->addField($f);
+
+ // optional .google.protobuf.FieldOptions options = 8
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 8;
+ $f->name = "options";
+ $f->nameOrig = "options";
+ $f->type = 11;
+ $f->rule = 1;
+ $f->reference = "\google\protobuf\FieldOptions";
+ $descriptor->addField($f);
+
+ foreach (self::$__extensions as $cb) {
+ $descriptor->addField($cb(), true);
+ }
+
+ self::$__descriptor = $descriptor;
+ }
+
+ return self::$__descriptor;
+ }
+
+ /** @var string */
+ public $name = null;
+
+ /** @var int */
+ public $number = null;
+
+ /** @var int - \google\protobuf\FieldDescriptorProto\Label */
+ public $label = null;
+
+ /** @var int - \google\protobuf\FieldDescriptorProto\Type */
+ public $type = null;
+
+ /** @var string */
+ public $type_name = null;
+
+ /** @var string */
+ public $extendee = null;
+
+ /** @var string */
+ public $default_value = null;
+
+ /** @var \google\protobuf\FieldOptions */
+ public $options = null;
+
+
+ /**
+ * Check if <name> has a value
+ *
+ * @return boolean
+ */
+ public function hasName(){
+ return $this->_has(1);
+ }
+
+ /**
+ * Clear <name> value
+ *
+ * @return \google\protobuf\FieldDescriptorProto
+ */
+ public function clearName(){
+ return $this->_clear(1);
+ }
+
+ /**
+ * Get <name> value
+ *
+ * @return string
+ */
+ public function getName(){
+ return $this->_get(1);
+ }
+
+ /**
+ * Set <name> value
+ *
+ * @param string $value
+ * @return \google\protobuf\FieldDescriptorProto
+ */
+ public function setName( $value){
+ return $this->_set(1, $value);
+ }
+
+ /**
+ * Check if <number> has a value
+ *
+ * @return boolean
+ */
+ public function hasNumber(){
+ return $this->_has(3);
+ }
+
+ /**
+ * Clear <number> value
+ *
+ * @return \google\protobuf\FieldDescriptorProto
+ */
+ public function clearNumber(){
+ return $this->_clear(3);
+ }
+
+ /**
+ * Get <number> value
+ *
+ * @return int
+ */
+ public function getNumber(){
+ return $this->_get(3);
+ }
+
+ /**
+ * Set <number> value
+ *
+ * @param int $value
+ * @return \google\protobuf\FieldDescriptorProto
+ */
+ public function setNumber( $value){
+ return $this->_set(3, $value);
+ }
+
+ /**
+ * Check if <label> has a value
+ *
+ * @return boolean
+ */
+ public function hasLabel(){
+ return $this->_has(4);
+ }
+
+ /**
+ * Clear <label> value
+ *
+ * @return \google\protobuf\FieldDescriptorProto
+ */
+ public function clearLabel(){
+ return $this->_clear(4);
+ }
+
+ /**
+ * Get <label> value
+ *
+ * @return int - \google\protobuf\FieldDescriptorProto\Label
+ */
+ public function getLabel(){
+ return $this->_get(4);
+ }
+
+ /**
+ * Set <label> value
+ *
+ * @param int - \google\protobuf\FieldDescriptorProto\Label $value
+ * @return \google\protobuf\FieldDescriptorProto
+ */
+ public function setLabel( $value){
+ return $this->_set(4, $value);
+ }
+
+ /**
+ * Check if <type> has a value
+ *
+ * @return boolean
+ */
+ public function hasType(){
+ return $this->_has(5);
+ }
+
+ /**
+ * Clear <type> value
+ *
+ * @return \google\protobuf\FieldDescriptorProto
+ */
+ public function clearType(){
+ return $this->_clear(5);
+ }
+
+ /**
+ * Get <type> value
+ *
+ * @return int - \google\protobuf\FieldDescriptorProto\Type
+ */
+ public function getType(){
+ return $this->_get(5);
+ }
+
+ /**
+ * Set <type> value
+ *
+ * @param int - \google\protobuf\FieldDescriptorProto\Type $value
+ * @return \google\protobuf\FieldDescriptorProto
+ */
+ public function setType( $value){
+ return $this->_set(5, $value);
+ }
+
+ /**
+ * Check if <type_name> has a value
+ *
+ * @return boolean
+ */
+ public function hasTypeName(){
+ return $this->_has(6);
+ }
+
+ /**
+ * Clear <type_name> value
+ *
+ * @return \google\protobuf\FieldDescriptorProto
+ */
+ public function clearTypeName(){
+ return $this->_clear(6);
+ }
+
+ /**
+ * Get <type_name> value
+ *
+ * @return string
+ */
+ public function getTypeName(){
+ return $this->_get(6);
+ }
+
+ /**
+ * Set <type_name> value
+ *
+ * @param string $value
+ * @return \google\protobuf\FieldDescriptorProto
+ */
+ public function setTypeName( $value){
+ return $this->_set(6, $value);
+ }
+
+ /**
+ * Check if <extendee> has a value
+ *
+ * @return boolean
+ */
+ public function hasExtendee(){
+ return $this->_has(2);
+ }
+
+ /**
+ * Clear <extendee> value
+ *
+ * @return \google\protobuf\FieldDescriptorProto
+ */
+ public function clearExtendee(){
+ return $this->_clear(2);
+ }
+
+ /**
+ * Get <extendee> value
+ *
+ * @return string
+ */
+ public function getExtendee(){
+ return $this->_get(2);
+ }
+
+ /**
+ * Set <extendee> value
+ *
+ * @param string $value
+ * @return \google\protobuf\FieldDescriptorProto
+ */
+ public function setExtendee( $value){
+ return $this->_set(2, $value);
+ }
+
+ /**
+ * Check if <default_value> has a value
+ *
+ * @return boolean
+ */
+ public function hasDefaultValue(){
+ return $this->_has(7);
+ }
+
+ /**
+ * Clear <default_value> value
+ *
+ * @return \google\protobuf\FieldDescriptorProto
+ */
+ public function clearDefaultValue(){
+ return $this->_clear(7);
+ }
+
+ /**
+ * Get <default_value> value
+ *
+ * @return string
+ */
+ public function getDefaultValue(){
+ return $this->_get(7);
+ }
+
+ /**
+ * Set <default_value> value
+ *
+ * @param string $value
+ * @return \google\protobuf\FieldDescriptorProto
+ */
+ public function setDefaultValue( $value){
+ return $this->_set(7, $value);
+ }
+
+ /**
+ * Check if <options> has a value
+ *
+ * @return boolean
+ */
+ public function hasOptions(){
+ return $this->_has(8);
+ }
+
+ /**
+ * Clear <options> value
+ *
+ * @return \google\protobuf\FieldDescriptorProto
+ */
+ public function clearOptions(){
+ return $this->_clear(8);
+ }
+
+ /**
+ * Get <options> value
+ *
+ * @return \google\protobuf\FieldOptions
+ */
+ public function getOptions(){
+ return $this->_get(8);
+ }
+
+ /**
+ * Set <options> value
+ *
+ * @param \google\protobuf\FieldOptions $value
+ * @return \google\protobuf\FieldDescriptorProto
+ */
+ public function setOptions(\google\protobuf\FieldOptions $value){
+ return $this->_set(8, $value);
+ }
+
+ }
+}
+
+namespace google\protobuf\FieldDescriptorProto {
+
+ class Type {
+ const TYPE_DOUBLE = 1;
+ const TYPE_FLOAT = 2;
+ const TYPE_INT64 = 3;
+ const TYPE_UINT64 = 4;
+ const TYPE_INT32 = 5;
+ const TYPE_FIXED64 = 6;
+ const TYPE_FIXED32 = 7;
+ const TYPE_BOOL = 8;
+ const TYPE_STRING = 9;
+ const TYPE_GROUP = 10;
+ const TYPE_MESSAGE = 11;
+ const TYPE_BYTES = 12;
+ const TYPE_UINT32 = 13;
+ const TYPE_ENUM = 14;
+ const TYPE_SFIXED32 = 15;
+ const TYPE_SFIXED64 = 16;
+ const TYPE_SINT32 = 17;
+ const TYPE_SINT64 = 18;
+ }
+}
+
+namespace google\protobuf\FieldDescriptorProto {
+
+ class Label {
+ const LABEL_OPTIONAL = 1;
+ const LABEL_REQUIRED = 2;
+ const LABEL_REPEATED = 3;
+ }
+}
+
+namespace google\protobuf {
+
+ class EnumDescriptorProto extends \DrSlump\Protobuf\Message {
+
+ /** @var \DrSlump\Protobuf\Descriptor */
+ protected static $__descriptor;
+ /** @var \Closure[] */
+ protected static $__extensions = array();
+
+ public static function descriptor(\DrSlump\Protobuf\Descriptor $descriptor = NULL)
+ {
+ if (NULL !== $descriptor) {
+ self::$__descriptor = $descriptor;
+ return self::$__descriptor;
+ }
+
+ if (!self::$__descriptor) {
+ $descriptor = new \DrSlump\Protobuf\Descriptor("\google\protobuf\EnumDescriptorProto");
+
+ // optional name = 1
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 1;
+ $f->name = "name";
+ $f->nameOrig = "name";
+ $f->type = 9;
+ $f->rule = 1;
+ $descriptor->addField($f);
+
+ // repeated .google.protobuf.EnumValueDescriptorProto value = 2
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 2;
+ $f->name = "value";
+ $f->nameOrig = "value";
+ $f->type = 11;
+ $f->rule = 3;
+ $f->reference = "\google\protobuf\EnumValueDescriptorProto";
+ $descriptor->addField($f);
+
+ // optional .google.protobuf.EnumOptions options = 3
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 3;
+ $f->name = "options";
+ $f->nameOrig = "options";
+ $f->type = 11;
+ $f->rule = 1;
+ $f->reference = "\google\protobuf\EnumOptions";
+ $descriptor->addField($f);
+
+ foreach (self::$__extensions as $cb) {
+ $descriptor->addField($cb(), true);
+ }
+
+ self::$__descriptor = $descriptor;
+ }
+
+ return self::$__descriptor;
+ }
+
+ /** @var string */
+ public $name = null;
+
+ /** @var \google\protobuf\EnumValueDescriptorProto[] */
+ public $value = array();
+
+ /** @var \google\protobuf\EnumOptions */
+ public $options = null;
+
+
+ /**
+ * Check if <name> has a value
+ *
+ * @return boolean
+ */
+ public function hasName(){
+ return $this->_has(1);
+ }
+
+ /**
+ * Clear <name> value
+ *
+ * @return \google\protobuf\EnumDescriptorProto
+ */
+ public function clearName(){
+ return $this->_clear(1);
+ }
+
+ /**
+ * Get <name> value
+ *
+ * @return string
+ */
+ public function getName(){
+ return $this->_get(1);
+ }
+
+ /**
+ * Set <name> value
+ *
+ * @param string $value
+ * @return \google\protobuf\EnumDescriptorProto
+ */
+ public function setName( $value){
+ return $this->_set(1, $value);
+ }
+
+ /**
+ * Check if <value> has a value
+ *
+ * @return boolean
+ */
+ public function hasValue(){
+ return $this->_has(2);
+ }
+
+ /**
+ * Clear <value> value
+ *
+ * @return \google\protobuf\EnumDescriptorProto
+ */
+ public function clearValue(){
+ return $this->_clear(2);
+ }
+
+ /**
+ * Get <value> value
+ *
+ * @param int $idx
+ * @return \google\protobuf\EnumValueDescriptorProto
+ */
+ public function getValue($idx = NULL){
+ return $this->_get(2, $idx);
+ }
+
+ /**
+ * Set <value> value
+ *
+ * @param \google\protobuf\EnumValueDescriptorProto $value
+ * @return \google\protobuf\EnumDescriptorProto
+ */
+ public function setValue(\google\protobuf\EnumValueDescriptorProto $value, $idx = NULL){
+ return $this->_set(2, $value, $idx);
+ }
+
+ /**
+ * Get all elements of <value>
+ *
+ * @return \google\protobuf\EnumValueDescriptorProto[]
+ */
+ public function getValueList(){
+ return $this->_get(2);
+ }
+
+ /**
+ * Add a new element to <value>
+ *
+ * @param \google\protobuf\EnumValueDescriptorProto $value
+ * @return \google\protobuf\EnumDescriptorProto
+ */
+ public function addValue(\google\protobuf\EnumValueDescriptorProto $value){
+ return $this->_add(2, $value);
+ }
+
+ /**
+ * Check if <options> has a value
+ *
+ * @return boolean
+ */
+ public function hasOptions(){
+ return $this->_has(3);
+ }
+
+ /**
+ * Clear <options> value
+ *
+ * @return \google\protobuf\EnumDescriptorProto
+ */
+ public function clearOptions(){
+ return $this->_clear(3);
+ }
+
+ /**
+ * Get <options> value
+ *
+ * @return \google\protobuf\EnumOptions
+ */
+ public function getOptions(){
+ return $this->_get(3);
+ }
+
+ /**
+ * Set <options> value
+ *
+ * @param \google\protobuf\EnumOptions $value
+ * @return \google\protobuf\EnumDescriptorProto
+ */
+ public function setOptions(\google\protobuf\EnumOptions $value){
+ return $this->_set(3, $value);
+ }
+
+ }
+}
+
+namespace google\protobuf {
+
+ class EnumValueDescriptorProto extends \DrSlump\Protobuf\Message {
+
+ /** @var \DrSlump\Protobuf\Descriptor */
+ protected static $__descriptor;
+ /** @var \Closure[] */
+ protected static $__extensions = array();
+
+ public static function descriptor(\DrSlump\Protobuf\Descriptor $descriptor = NULL)
+ {
+ if (NULL !== $descriptor) {
+ self::$__descriptor = $descriptor;
+ return self::$__descriptor;
+ }
+
+ if (!self::$__descriptor) {
+ $descriptor = new \DrSlump\Protobuf\Descriptor("\google\protobuf\EnumValueDescriptorProto");
+
+ // optional name = 1
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 1;
+ $f->name = "name";
+ $f->nameOrig = "name";
+ $f->type = 9;
+ $f->rule = 1;
+ $descriptor->addField($f);
+
+ // optional number = 2
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 2;
+ $f->name = "number";
+ $f->nameOrig = "number";
+ $f->type = 5;
+ $f->rule = 1;
+ $descriptor->addField($f);
+
+ // optional .google.protobuf.EnumValueOptions options = 3
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 3;
+ $f->name = "options";
+ $f->nameOrig = "options";
+ $f->type = 11;
+ $f->rule = 1;
+ $f->reference = "\google\protobuf\EnumValueOptions";
+ $descriptor->addField($f);
+
+ foreach (self::$__extensions as $cb) {
+ $descriptor->addField($cb(), true);
+ }
+
+ self::$__descriptor = $descriptor;
+ }
+
+ return self::$__descriptor;
+ }
+
+ /** @var string */
+ public $name = null;
+
+ /** @var int */
+ public $number = null;
+
+ /** @var \google\protobuf\EnumValueOptions */
+ public $options = null;
+
+
+ /**
+ * Check if <name> has a value
+ *
+ * @return boolean
+ */
+ public function hasName(){
+ return $this->_has(1);
+ }
+
+ /**
+ * Clear <name> value
+ *
+ * @return \google\protobuf\EnumValueDescriptorProto
+ */
+ public function clearName(){
+ return $this->_clear(1);
+ }
+
+ /**
+ * Get <name> value
+ *
+ * @return string
+ */
+ public function getName(){
+ return $this->_get(1);
+ }
+
+ /**
+ * Set <name> value
+ *
+ * @param string $value
+ * @return \google\protobuf\EnumValueDescriptorProto
+ */
+ public function setName( $value){
+ return $this->_set(1, $value);
+ }
+
+ /**
+ * Check if <number> has a value
+ *
+ * @return boolean
+ */
+ public function hasNumber(){
+ return $this->_has(2);
+ }
+
+ /**
+ * Clear <number> value
+ *
+ * @return \google\protobuf\EnumValueDescriptorProto
+ */
+ public function clearNumber(){
+ return $this->_clear(2);
+ }
+
+ /**
+ * Get <number> value
+ *
+ * @return int
+ */
+ public function getNumber(){
+ return $this->_get(2);
+ }
+
+ /**
+ * Set <number> value
+ *
+ * @param int $value
+ * @return \google\protobuf\EnumValueDescriptorProto
+ */
+ public function setNumber( $value){
+ return $this->_set(2, $value);
+ }
+
+ /**
+ * Check if <options> has a value
+ *
+ * @return boolean
+ */
+ public function hasOptions(){
+ return $this->_has(3);
+ }
+
+ /**
+ * Clear <options> value
+ *
+ * @return \google\protobuf\EnumValueDescriptorProto
+ */
+ public function clearOptions(){
+ return $this->_clear(3);
+ }
+
+ /**
+ * Get <options> value
+ *
+ * @return \google\protobuf\EnumValueOptions
+ */
+ public function getOptions(){
+ return $this->_get(3);
+ }
+
+ /**
+ * Set <options> value
+ *
+ * @param \google\protobuf\EnumValueOptions $value
+ * @return \google\protobuf\EnumValueDescriptorProto
+ */
+ public function setOptions(\google\protobuf\EnumValueOptions $value){
+ return $this->_set(3, $value);
+ }
+
+ }
+}
+
+namespace google\protobuf {
+
+ class ServiceDescriptorProto extends \DrSlump\Protobuf\Message {
+
+ /** @var \DrSlump\Protobuf\Descriptor */
+ protected static $__descriptor;
+ /** @var \Closure[] */
+ protected static $__extensions = array();
+
+ public static function descriptor(\DrSlump\Protobuf\Descriptor $descriptor = NULL)
+ {
+ if (NULL !== $descriptor) {
+ self::$__descriptor = $descriptor;
+ return self::$__descriptor;
+ }
+
+ if (!self::$__descriptor) {
+ $descriptor = new \DrSlump\Protobuf\Descriptor("\google\protobuf\ServiceDescriptorProto");
+
+ // optional name = 1
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 1;
+ $f->name = "name";
+ $f->nameOrig = "name";
+ $f->type = 9;
+ $f->rule = 1;
+ $descriptor->addField($f);
+
+ // repeated .google.protobuf.MethodDescriptorProto method = 2
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 2;
+ $f->name = "method";
+ $f->nameOrig = "method";
+ $f->type = 11;
+ $f->rule = 3;
+ $f->reference = "\google\protobuf\MethodDescriptorProto";
+ $descriptor->addField($f);
+
+ // optional .google.protobuf.ServiceOptions options = 3
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 3;
+ $f->name = "options";
+ $f->nameOrig = "options";
+ $f->type = 11;
+ $f->rule = 1;
+ $f->reference = "\google\protobuf\ServiceOptions";
+ $descriptor->addField($f);
+
+ foreach (self::$__extensions as $cb) {
+ $descriptor->addField($cb(), true);
+ }
+
+ self::$__descriptor = $descriptor;
+ }
+
+ return self::$__descriptor;
+ }
+
+ /** @var string */
+ public $name = null;
+
+ /** @var \google\protobuf\MethodDescriptorProto[] */
+ public $method = array();
+
+ /** @var \google\protobuf\ServiceOptions */
+ public $options = null;
+
+
+ /**
+ * Check if <name> has a value
+ *
+ * @return boolean
+ */
+ public function hasName(){
+ return $this->_has(1);
+ }
+
+ /**
+ * Clear <name> value
+ *
+ * @return \google\protobuf\ServiceDescriptorProto
+ */
+ public function clearName(){
+ return $this->_clear(1);
+ }
+
+ /**
+ * Get <name> value
+ *
+ * @return string
+ */
+ public function getName(){
+ return $this->_get(1);
+ }
+
+ /**
+ * Set <name> value
+ *
+ * @param string $value
+ * @return \google\protobuf\ServiceDescriptorProto
+ */
+ public function setName( $value){
+ return $this->_set(1, $value);
+ }
+
+ /**
+ * Check if <method> has a value
+ *
+ * @return boolean
+ */
+ public function hasMethod(){
+ return $this->_has(2);
+ }
+
+ /**
+ * Clear <method> value
+ *
+ * @return \google\protobuf\ServiceDescriptorProto
+ */
+ public function clearMethod(){
+ return $this->_clear(2);
+ }
+
+ /**
+ * Get <method> value
+ *
+ * @param int $idx
+ * @return \google\protobuf\MethodDescriptorProto
+ */
+ public function getMethod($idx = NULL){
+ return $this->_get(2, $idx);
+ }
+
+ /**
+ * Set <method> value
+ *
+ * @param \google\protobuf\MethodDescriptorProto $value
+ * @return \google\protobuf\ServiceDescriptorProto
+ */
+ public function setMethod(\google\protobuf\MethodDescriptorProto $value, $idx = NULL){
+ return $this->_set(2, $value, $idx);
+ }
+
+ /**
+ * Get all elements of <method>
+ *
+ * @return \google\protobuf\MethodDescriptorProto[]
+ */
+ public function getMethodList(){
+ return $this->_get(2);
+ }
+
+ /**
+ * Add a new element to <method>
+ *
+ * @param \google\protobuf\MethodDescriptorProto $value
+ * @return \google\protobuf\ServiceDescriptorProto
+ */
+ public function addMethod(\google\protobuf\MethodDescriptorProto $value){
+ return $this->_add(2, $value);
+ }
+
+ /**
+ * Check if <options> has a value
+ *
+ * @return boolean
+ */
+ public function hasOptions(){
+ return $this->_has(3);
+ }
+
+ /**
+ * Clear <options> value
+ *
+ * @return \google\protobuf\ServiceDescriptorProto
+ */
+ public function clearOptions(){
+ return $this->_clear(3);
+ }
+
+ /**
+ * Get <options> value
+ *
+ * @return \google\protobuf\ServiceOptions
+ */
+ public function getOptions(){
+ return $this->_get(3);
+ }
+
+ /**
+ * Set <options> value
+ *
+ * @param \google\protobuf\ServiceOptions $value
+ * @return \google\protobuf\ServiceDescriptorProto
+ */
+ public function setOptions(\google\protobuf\ServiceOptions $value){
+ return $this->_set(3, $value);
+ }
+
+ }
+}
+
+namespace google\protobuf {
+
+ class MethodDescriptorProto extends \DrSlump\Protobuf\Message {
+
+ /** @var \DrSlump\Protobuf\Descriptor */
+ protected static $__descriptor;
+ /** @var \Closure[] */
+ protected static $__extensions = array();
+
+ public static function descriptor(\DrSlump\Protobuf\Descriptor $descriptor = NULL)
+ {
+ if (NULL !== $descriptor) {
+ self::$__descriptor = $descriptor;
+ return self::$__descriptor;
+ }
+
+ if (!self::$__descriptor) {
+ $descriptor = new \DrSlump\Protobuf\Descriptor("\google\protobuf\MethodDescriptorProto");
+
+ // optional name = 1
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 1;
+ $f->name = "name";
+ $f->nameOrig = "name";
+ $f->type = 9;
+ $f->rule = 1;
+ $descriptor->addField($f);
+
+ // optional input_type = 2
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 2;
+ $f->name = "input_type";
+ $f->type = 9;
+ $f->rule = 1;
+ $descriptor->addField($f);
+
+ // optional output_type = 3
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 3;
+ $f->name = "output_type";
+ $f->type = 9;
+ $f->rule = 1;
+ $descriptor->addField($f);
+
+ // optional .google.protobuf.MethodOptions options = 4
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 4;
+ $f->name = "options";
+ $f->nameOrig = "options";
+ $f->type = 11;
+ $f->rule = 1;
+ $f->reference = "\google\protobuf\MethodOptions";
+ $descriptor->addField($f);
+
+ foreach (self::$__extensions as $cb) {
+ $descriptor->addField($cb(), true);
+ }
+
+ self::$__descriptor = $descriptor;
+ }
+
+ return self::$__descriptor;
+ }
+
+ /** @var string */
+ public $name = null;
+
+ /** @var string */
+ public $input_type = null;
+
+ /** @var string */
+ public $output_type = null;
+
+ /** @var \google\protobuf\MethodOptions */
+ public $options = null;
+
+
+ /**
+ * Check if <name> has a value
+ *
+ * @return boolean
+ */
+ public function hasName(){
+ return $this->_has(1);
+ }
+
+ /**
+ * Clear <name> value
+ *
+ * @return \google\protobuf\MethodDescriptorProto
+ */
+ public function clearName(){
+ return $this->_clear(1);
+ }
+
+ /**
+ * Get <name> value
+ *
+ * @return string
+ */
+ public function getName(){
+ return $this->_get(1);
+ }
+
+ /**
+ * Set <name> value
+ *
+ * @param string $value
+ * @return \google\protobuf\MethodDescriptorProto
+ */
+ public function setName( $value){
+ return $this->_set(1, $value);
+ }
+
+ /**
+ * Check if <input_type> has a value
+ *
+ * @return boolean
+ */
+ public function hasInputType(){
+ return $this->_has(2);
+ }
+
+ /**
+ * Clear <input_type> value
+ *
+ * @return \google\protobuf\MethodDescriptorProto
+ */
+ public function clearInputType(){
+ return $this->_clear(2);
+ }
+
+ /**
+ * Get <input_type> value
+ *
+ * @return string
+ */
+ public function getInputType(){
+ return $this->_get(2);
+ }
+
+ /**
+ * Set <input_type> value
+ *
+ * @param string $value
+ * @return \google\protobuf\MethodDescriptorProto
+ */
+ public function setInputType( $value){
+ return $this->_set(2, $value);
+ }
+
+ /**
+ * Check if <output_type> has a value
+ *
+ * @return boolean
+ */
+ public function hasOutputType(){
+ return $this->_has(3);
+ }
+
+ /**
+ * Clear <output_type> value
+ *
+ * @return \google\protobuf\MethodDescriptorProto
+ */
+ public function clearOutputType(){
+ return $this->_clear(3);
+ }
+
+ /**
+ * Get <output_type> value
+ *
+ * @return string
+ */
+ public function getOutputType(){
+ return $this->_get(3);
+ }
+
+ /**
+ * Set <output_type> value
+ *
+ * @param string $value
+ * @return \google\protobuf\MethodDescriptorProto
+ */
+ public function setOutputType( $value){
+ return $this->_set(3, $value);
+ }
+
+ /**
+ * Check if <options> has a value
+ *
+ * @return boolean
+ */
+ public function hasOptions(){
+ return $this->_has(4);
+ }
+
+ /**
+ * Clear <options> value
+ *
+ * @return \google\protobuf\MethodDescriptorProto
+ */
+ public function clearOptions(){
+ return $this->_clear(4);
+ }
+
+ /**
+ * Get <options> value
+ *
+ * @return \google\protobuf\MethodOptions
+ */
+ public function getOptions(){
+ return $this->_get(4);
+ }
+
+ /**
+ * Set <options> value
+ *
+ * @param \google\protobuf\MethodOptions $value
+ * @return \google\protobuf\MethodDescriptorProto
+ */
+ public function setOptions(\google\protobuf\MethodOptions $value){
+ return $this->_set(4, $value);
+ }
+
+ }
+}
+
+namespace google\protobuf {
+
+ class FileOptions extends \DrSlump\Protobuf\Message {
+
+ /** @var \DrSlump\Protobuf\Descriptor */
+ protected static $__descriptor;
+ /** @var \Closure[] */
+ protected static $__extensions = array();
+
+ public static function descriptor(\DrSlump\Protobuf\Descriptor $descriptor = NULL)
+ {
+ if (NULL !== $descriptor) {
+ self::$__descriptor = $descriptor;
+ return self::$__descriptor;
+ }
+
+ if (!self::$__descriptor) {
+ $descriptor = new \DrSlump\Protobuf\Descriptor("\google\protobuf\FileOptions");
+
+ // optional java_package = 1
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 1;
+ $f->name = "java_package";
+ $f->type = 9;
+ $f->rule = 1;
+ $descriptor->addField($f);
+
+ // optional java_outer_classname = 8
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 8;
+ $f->name = "java_outer_classname";
+ $f->type = 9;
+ $f->rule = 1;
+ $descriptor->addField($f);
+
+ // optional java_multiple_files = 10
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 10;
+ $f->name = "java_multiple_files";
+ $f->type = 8;
+ $f->rule = 1;
+ $f->default = true;
+ $descriptor->addField($f);
+
+ // optional java_generate_equals_and_hash = 20
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 20;
+ $f->name = "java_generate_equals_and_hash";
+ $f->type = 8;
+ $f->rule = 1;
+ $f->default = true;
+ $descriptor->addField($f);
+
+ // optional .google.protobuf.FileOptions.OptimizeMode optimize_for = 9
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 9;
+ $f->name = "optimize_for";
+ $f->type = 14;
+ $f->rule = 1;
+ $f->reference = "\google\protobuf\FileOptions\OptimizeMode";
+ $f->default = "SPEED";
+ $descriptor->addField($f);
+
+ // optional cc_generic_services = 16
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 16;
+ $f->name = "cc_generic_services";
+ $f->type = 8;
+ $f->rule = 1;
+ $f->default = true;
+ $descriptor->addField($f);
+
+ // optional java_generic_services = 17
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 17;
+ $f->name = "java_generic_services";
+ $f->type = 8;
+ $f->rule = 1;
+ $f->default = true;
+ $descriptor->addField($f);
+
+ // optional py_generic_services = 18
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 18;
+ $f->name = "py_generic_services";
+ $f->type = 8;
+ $f->rule = 1;
+ $f->default = true;
+ $descriptor->addField($f);
+
+ // repeated .google.protobuf.UninterpretedOption uninterpreted_option = 999
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 999;
+ $f->name = "uninterpreted_option";
+ $f->type = 11;
+ $f->rule = 3;
+ $f->reference = "\google\protobuf\UninterpretedOption";
+ $descriptor->addField($f);
+
+ foreach (self::$__extensions as $cb) {
+ $descriptor->addField($cb(), true);
+ }
+
+ self::$__descriptor = $descriptor;
+ }
+
+ return self::$__descriptor;
+ }
+
+ /** @var string */
+ public $java_package = null;
+
+ /** @var string */
+ public $java_outer_classname = null;
+
+ /** @var boolean */
+ public $java_multiple_files = true;
+
+ /** @var boolean */
+ public $java_generate_equals_and_hash = true;
+
+ /** @var int - \google\protobuf\FileOptions\OptimizeMode */
+ public $optimize_for = "SPEED";
+
+ /** @var boolean */
+ public $cc_generic_services = true;
+
+ /** @var boolean */
+ public $java_generic_services = true;
+
+ /** @var boolean */
+ public $py_generic_services = true;
+
+ /** @var \google\protobuf\UninterpretedOption[] */
+ public $uninterpreted_option = array();
+
+
+ /**
+ * Check if <java_package> has a value
+ *
+ * @return boolean
+ */
+ public function hasJavaPackage(){
+ return $this->_has(1);
+ }
+
+ /**
+ * Clear <java_package> value
+ *
+ * @return \google\protobuf\FileOptions
+ */
+ public function clearJavaPackage(){
+ return $this->_clear(1);
+ }
+
+ /**
+ * Get <java_package> value
+ *
+ * @return string
+ */
+ public function getJavaPackage(){
+ return $this->_get(1);
+ }
+
+ /**
+ * Set <java_package> value
+ *
+ * @param string $value
+ * @return \google\protobuf\FileOptions
+ */
+ public function setJavaPackage( $value){
+ return $this->_set(1, $value);
+ }
+
+ /**
+ * Check if <java_outer_classname> has a value
+ *
+ * @return boolean
+ */
+ public function hasJavaOuterClassname(){
+ return $this->_has(8);
+ }
+
+ /**
+ * Clear <java_outer_classname> value
+ *
+ * @return \google\protobuf\FileOptions
+ */
+ public function clearJavaOuterClassname(){
+ return $this->_clear(8);
+ }
+
+ /**
+ * Get <java_outer_classname> value
+ *
+ * @return string
+ */
+ public function getJavaOuterClassname(){
+ return $this->_get(8);
+ }
+
+ /**
+ * Set <java_outer_classname> value
+ *
+ * @param string $value
+ * @return \google\protobuf\FileOptions
+ */
+ public function setJavaOuterClassname( $value){
+ return $this->_set(8, $value);
+ }
+
+ /**
+ * Check if <java_multiple_files> has a value
+ *
+ * @return boolean
+ */
+ public function hasJavaMultipleFiles(){
+ return $this->_has(10);
+ }
+
+ /**
+ * Clear <java_multiple_files> value
+ *
+ * @return \google\protobuf\FileOptions
+ */
+ public function clearJavaMultipleFiles(){
+ return $this->_clear(10);
+ }
+
+ /**
+ * Get <java_multiple_files> value
+ *
+ * @return boolean
+ */
+ public function getJavaMultipleFiles(){
+ return $this->_get(10);
+ }
+
+ /**
+ * Set <java_multiple_files> value
+ *
+ * @param boolean $value
+ * @return \google\protobuf\FileOptions
+ */
+ public function setJavaMultipleFiles( $value){
+ return $this->_set(10, $value);
+ }
+
+ /**
+ * Check if <java_generate_equals_and_hash> has a value
+ *
+ * @return boolean
+ */
+ public function hasJavaGenerateEqualsAndHash(){
+ return $this->_has(20);
+ }
+
+ /**
+ * Clear <java_generate_equals_and_hash> value
+ *
+ * @return \google\protobuf\FileOptions
+ */
+ public function clearJavaGenerateEqualsAndHash(){
+ return $this->_clear(20);
+ }
+
+ /**
+ * Get <java_generate_equals_and_hash> value
+ *
+ * @return boolean
+ */
+ public function getJavaGenerateEqualsAndHash(){
+ return $this->_get(20);
+ }
+
+ /**
+ * Set <java_generate_equals_and_hash> value
+ *
+ * @param boolean $value
+ * @return \google\protobuf\FileOptions
+ */
+ public function setJavaGenerateEqualsAndHash( $value){
+ return $this->_set(20, $value);
+ }
+
+ /**
+ * Check if <optimize_for> has a value
+ *
+ * @return boolean
+ */
+ public function hasOptimizeFor(){
+ return $this->_has(9);
+ }
+
+ /**
+ * Clear <optimize_for> value
+ *
+ * @return \google\protobuf\FileOptions
+ */
+ public function clearOptimizeFor(){
+ return $this->_clear(9);
+ }
+
+ /**
+ * Get <optimize_for> value
+ *
+ * @return int - \google\protobuf\FileOptions\OptimizeMode
+ */
+ public function getOptimizeFor(){
+ return $this->_get(9);
+ }
+
+ /**
+ * Set <optimize_for> value
+ *
+ * @param int - \google\protobuf\FileOptions\OptimizeMode $value
+ * @return \google\protobuf\FileOptions
+ */
+ public function setOptimizeFor( $value){
+ return $this->_set(9, $value);
+ }
+
+ /**
+ * Check if <cc_generic_services> has a value
+ *
+ * @return boolean
+ */
+ public function hasCcGenericServices(){
+ return $this->_has(16);
+ }
+
+ /**
+ * Clear <cc_generic_services> value
+ *
+ * @return \google\protobuf\FileOptions
+ */
+ public function clearCcGenericServices(){
+ return $this->_clear(16);
+ }
+
+ /**
+ * Get <cc_generic_services> value
+ *
+ * @return boolean
+ */
+ public function getCcGenericServices(){
+ return $this->_get(16);
+ }
+
+ /**
+ * Set <cc_generic_services> value
+ *
+ * @param boolean $value
+ * @return \google\protobuf\FileOptions
+ */
+ public function setCcGenericServices( $value){
+ return $this->_set(16, $value);
+ }
+
+ /**
+ * Check if <java_generic_services> has a value
+ *
+ * @return boolean
+ */
+ public function hasJavaGenericServices(){
+ return $this->_has(17);
+ }
+
+ /**
+ * Clear <java_generic_services> value
+ *
+ * @return \google\protobuf\FileOptions
+ */
+ public function clearJavaGenericServices(){
+ return $this->_clear(17);
+ }
+
+ /**
+ * Get <java_generic_services> value
+ *
+ * @return boolean
+ */
+ public function getJavaGenericServices(){
+ return $this->_get(17);
+ }
+
+ /**
+ * Set <java_generic_services> value
+ *
+ * @param boolean $value
+ * @return \google\protobuf\FileOptions
+ */
+ public function setJavaGenericServices( $value){
+ return $this->_set(17, $value);
+ }
+
+ /**
+ * Check if <py_generic_services> has a value
+ *
+ * @return boolean
+ */
+ public function hasPyGenericServices(){
+ return $this->_has(18);
+ }
+
+ /**
+ * Clear <py_generic_services> value
+ *
+ * @return \google\protobuf\FileOptions
+ */
+ public function clearPyGenericServices(){
+ return $this->_clear(18);
+ }
+
+ /**
+ * Get <py_generic_services> value
+ *
+ * @return boolean
+ */
+ public function getPyGenericServices(){
+ return $this->_get(18);
+ }
+
+ /**
+ * Set <py_generic_services> value
+ *
+ * @param boolean $value
+ * @return \google\protobuf\FileOptions
+ */
+ public function setPyGenericServices( $value){
+ return $this->_set(18, $value);
+ }
+
+ /**
+ * Check if <uninterpreted_option> has a value
+ *
+ * @return boolean
+ */
+ public function hasUninterpretedOption(){
+ return $this->_has(999);
+ }
+
+ /**
+ * Clear <uninterpreted_option> value
+ *
+ * @return \google\protobuf\FileOptions
+ */
+ public function clearUninterpretedOption(){
+ return $this->_clear(999);
+ }
+
+ /**
+ * Get <uninterpreted_option> value
+ *
+ * @param int $idx
+ * @return \google\protobuf\UninterpretedOption
+ */
+ public function getUninterpretedOption($idx = NULL){
+ return $this->_get(999, $idx);
+ }
+
+ /**
+ * Set <uninterpreted_option> value
+ *
+ * @param \google\protobuf\UninterpretedOption $value
+ * @return \google\protobuf\FileOptions
+ */
+ public function setUninterpretedOption(\google\protobuf\UninterpretedOption $value, $idx = NULL){
+ return $this->_set(999, $value, $idx);
+ }
+
+ /**
+ * Get all elements of <uninterpreted_option>
+ *
+ * @return \google\protobuf\UninterpretedOption[]
+ */
+ public function getUninterpretedOptionList(){
+ return $this->_get(999);
+ }
+
+ /**
+ * Add a new element to <uninterpreted_option>
+ *
+ * @param \google\protobuf\UninterpretedOption $value
+ * @return \google\protobuf\FileOptions
+ */
+ public function addUninterpretedOption(\google\protobuf\UninterpretedOption $value){
+ return $this->_add(999, $value);
+ }
+
+ }
+}
+
+namespace google\protobuf\FileOptions {
+
+ class OptimizeMode {
+ const SPEED = 1;
+ const CODE_SIZE = 2;
+ const LITE_RUNTIME = 3;
+ }
+}
+
+namespace google\protobuf {
+
+ class MessageOptions extends \DrSlump\Protobuf\Message {
+
+ /** @var \DrSlump\Protobuf\Descriptor */
+ protected static $__descriptor;
+ /** @var \Closure[] */
+ protected static $__extensions = array();
+
+ public static function descriptor(\DrSlump\Protobuf\Descriptor $descriptor = NULL)
+ {
+ if (NULL !== $descriptor) {
+ self::$__descriptor = $descriptor;
+ return self::$__descriptor;
+ }
+
+ if (!self::$__descriptor) {
+ $descriptor = new \DrSlump\Protobuf\Descriptor("\google\protobuf\MessageOptions");
+
+ // optional message_set_wire_format = 1
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 1;
+ $f->name = "message_set_wire_format";
+ $f->type = 8;
+ $f->rule = 1;
+ $f->default = true;
+ $descriptor->addField($f);
+
+ // optional no_standard_descriptor_accessor = 2
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 2;
+ $f->name = "no_standard_descriptor_accessor";
+ $f->type = 8;
+ $f->rule = 1;
+ $f->default = true;
+ $descriptor->addField($f);
+
+ // repeated .google.protobuf.UninterpretedOption uninterpreted_option = 999
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 999;
+ $f->name = "uninterpreted_option";
+ $f->type = 11;
+ $f->rule = 3;
+ $f->reference = "\google\protobuf\UninterpretedOption";
+ $descriptor->addField($f);
+
+ foreach (self::$__extensions as $cb) {
+ $descriptor->addField($cb(), true);
+ }
+
+ self::$__descriptor = $descriptor;
+ }
+
+ return self::$__descriptor;
+ }
+
+ /** @var boolean */
+ public $message_set_wire_format = true;
+
+ /** @var boolean */
+ public $no_standard_descriptor_accessor = true;
+
+ /** @var \google\protobuf\UninterpretedOption[] */
+ public $uninterpreted_option = array();
+
+
+ /**
+ * Check if <message_set_wire_format> has a value
+ *
+ * @return boolean
+ */
+ public function hasMessageSetWireFormat(){
+ return $this->_has(1);
+ }
+
+ /**
+ * Clear <message_set_wire_format> value
+ *
+ * @return \google\protobuf\MessageOptions
+ */
+ public function clearMessageSetWireFormat(){
+ return $this->_clear(1);
+ }
+
+ /**
+ * Get <message_set_wire_format> value
+ *
+ * @return boolean
+ */
+ public function getMessageSetWireFormat(){
+ return $this->_get(1);
+ }
+
+ /**
+ * Set <message_set_wire_format> value
+ *
+ * @param boolean $value
+ * @return \google\protobuf\MessageOptions
+ */
+ public function setMessageSetWireFormat( $value){
+ return $this->_set(1, $value);
+ }
+
+ /**
+ * Check if <no_standard_descriptor_accessor> has a value
+ *
+ * @return boolean
+ */
+ public function hasNoStandardDescriptorAccessor(){
+ return $this->_has(2);
+ }
+
+ /**
+ * Clear <no_standard_descriptor_accessor> value
+ *
+ * @return \google\protobuf\MessageOptions
+ */
+ public function clearNoStandardDescriptorAccessor(){
+ return $this->_clear(2);
+ }
+
+ /**
+ * Get <no_standard_descriptor_accessor> value
+ *
+ * @return boolean
+ */
+ public function getNoStandardDescriptorAccessor(){
+ return $this->_get(2);
+ }
+
+ /**
+ * Set <no_standard_descriptor_accessor> value
+ *
+ * @param boolean $value
+ * @return \google\protobuf\MessageOptions
+ */
+ public function setNoStandardDescriptorAccessor( $value){
+ return $this->_set(2, $value);
+ }
+
+ /**
+ * Check if <uninterpreted_option> has a value
+ *
+ * @return boolean
+ */
+ public function hasUninterpretedOption(){
+ return $this->_has(999);
+ }
+
+ /**
+ * Clear <uninterpreted_option> value
+ *
+ * @return \google\protobuf\MessageOptions
+ */
+ public function clearUninterpretedOption(){
+ return $this->_clear(999);
+ }
+
+ /**
+ * Get <uninterpreted_option> value
+ *
+ * @param int $idx
+ * @return \google\protobuf\UninterpretedOption
+ */
+ public function getUninterpretedOption($idx = NULL){
+ return $this->_get(999, $idx);
+ }
+
+ /**
+ * Set <uninterpreted_option> value
+ *
+ * @param \google\protobuf\UninterpretedOption $value
+ * @return \google\protobuf\MessageOptions
+ */
+ public function setUninterpretedOption(\google\protobuf\UninterpretedOption $value, $idx = NULL){
+ return $this->_set(999, $value, $idx);
+ }
+
+ /**
+ * Get all elements of <uninterpreted_option>
+ *
+ * @return \google\protobuf\UninterpretedOption[]
+ */
+ public function getUninterpretedOptionList(){
+ return $this->_get(999);
+ }
+
+ /**
+ * Add a new element to <uninterpreted_option>
+ *
+ * @param \google\protobuf\UninterpretedOption $value
+ * @return \google\protobuf\MessageOptions
+ */
+ public function addUninterpretedOption(\google\protobuf\UninterpretedOption $value){
+ return $this->_add(999, $value);
+ }
+
+ }
+}
+
+namespace google\protobuf {
+
+ class FieldOptions extends \DrSlump\Protobuf\Message {
+
+ /** @var \DrSlump\Protobuf\Descriptor */
+ protected static $__descriptor;
+ /** @var \Closure[] */
+ protected static $__extensions = array();
+
+ public static function descriptor(\DrSlump\Protobuf\Descriptor $descriptor = NULL)
+ {
+ if (NULL !== $descriptor) {
+ self::$__descriptor = $descriptor;
+ return self::$__descriptor;
+ }
+
+ if (!self::$__descriptor) {
+ $descriptor = new \DrSlump\Protobuf\Descriptor("\google\protobuf\FieldOptions");
+
+ // optional .google.protobuf.FieldOptions.CType ctype = 1
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 1;
+ $f->name = "ctype";
+ $f->nameOrig = "ctype";
+ $f->type = 14;
+ $f->rule = 1;
+ $f->reference = "\google\protobuf\FieldOptions\CType";
+ $f->default = "STRING";
+ $descriptor->addField($f);
+
+ // optional packed = 2
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 2;
+ $f->name = "packed";
+ $f->nameOrig = "packed";
+ $f->type = 8;
+ $f->rule = 1;
+ $descriptor->addField($f);
+
+ // optional deprecated = 3
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 3;
+ $f->name = "deprecated";
+ $f->nameOrig = "deprecated";
+ $f->type = 8;
+ $f->rule = 1;
+ $f->default = true;
+ $descriptor->addField($f);
+
+ // optional experimental_map_key = 9
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 9;
+ $f->name = "experimental_map_key";
+ $f->type = 9;
+ $f->rule = 1;
+ $descriptor->addField($f);
+
+ // repeated .google.protobuf.UninterpretedOption uninterpreted_option = 999
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 999;
+ $f->name = "uninterpreted_option";
+ $f->type = 11;
+ $f->rule = 3;
+ $f->reference = "\google\protobuf\UninterpretedOption";
+ $descriptor->addField($f);
+
+ foreach (self::$__extensions as $cb) {
+ $descriptor->addField($cb(), true);
+ }
+
+ self::$__descriptor = $descriptor;
+ }
+
+ return self::$__descriptor;
+ }
+
+ /** @var int - \google\protobuf\FieldOptions\CType */
+ public $ctype = "STRING";
+
+ /** @var boolean */
+ public $packed = null;
+
+ /** @var boolean */
+ public $deprecated = true;
+
+ /** @var string */
+ public $experimental_map_key = null;
+
+ /** @var \google\protobuf\UninterpretedOption[] */
+ public $uninterpreted_option = array();
+
+
+ /**
+ * Check if <ctype> has a value
+ *
+ * @return boolean
+ */
+ public function hasCtype(){
+ return $this->_has(1);
+ }
+
+ /**
+ * Clear <ctype> value
+ *
+ * @return \google\protobuf\FieldOptions
+ */
+ public function clearCtype(){
+ return $this->_clear(1);
+ }
+
+ /**
+ * Get <ctype> value
+ *
+ * @return int - \google\protobuf\FieldOptions\CType
+ */
+ public function getCtype(){
+ return $this->_get(1);
+ }
+
+ /**
+ * Set <ctype> value
+ *
+ * @param int - \google\protobuf\FieldOptions\CType $value
+ * @return \google\protobuf\FieldOptions
+ */
+ public function setCtype( $value){
+ return $this->_set(1, $value);
+ }
+
+ /**
+ * Check if <packed> has a value
+ *
+ * @return boolean
+ */
+ public function hasPacked(){
+ return $this->_has(2);
+ }
+
+ /**
+ * Clear <packed> value
+ *
+ * @return \google\protobuf\FieldOptions
+ */
+ public function clearPacked(){
+ return $this->_clear(2);
+ }
+
+ /**
+ * Get <packed> value
+ *
+ * @return boolean
+ */
+ public function getPacked(){
+ return $this->_get(2);
+ }
+
+ /**
+ * Set <packed> value
+ *
+ * @param boolean $value
+ * @return \google\protobuf\FieldOptions
+ */
+ public function setPacked( $value){
+ return $this->_set(2, $value);
+ }
+
+ /**
+ * Check if <deprecated> has a value
+ *
+ * @return boolean
+ */
+ public function hasDeprecated(){
+ return $this->_has(3);
+ }
+
+ /**
+ * Clear <deprecated> value
+ *
+ * @return \google\protobuf\FieldOptions
+ */
+ public function clearDeprecated(){
+ return $this->_clear(3);
+ }
+
+ /**
+ * Get <deprecated> value
+ *
+ * @return boolean
+ */
+ public function getDeprecated(){
+ return $this->_get(3);
+ }
+
+ /**
+ * Set <deprecated> value
+ *
+ * @param boolean $value
+ * @return \google\protobuf\FieldOptions
+ */
+ public function setDeprecated( $value){
+ return $this->_set(3, $value);
+ }
+
+ /**
+ * Check if <experimental_map_key> has a value
+ *
+ * @return boolean
+ */
+ public function hasExperimentalMapKey(){
+ return $this->_has(9);
+ }
+
+ /**
+ * Clear <experimental_map_key> value
+ *
+ * @return \google\protobuf\FieldOptions
+ */
+ public function clearExperimentalMapKey(){
+ return $this->_clear(9);
+ }
+
+ /**
+ * Get <experimental_map_key> value
+ *
+ * @return string
+ */
+ public function getExperimentalMapKey(){
+ return $this->_get(9);
+ }
+
+ /**
+ * Set <experimental_map_key> value
+ *
+ * @param string $value
+ * @return \google\protobuf\FieldOptions
+ */
+ public function setExperimentalMapKey( $value){
+ return $this->_set(9, $value);
+ }
+
+ /**
+ * Check if <uninterpreted_option> has a value
+ *
+ * @return boolean
+ */
+ public function hasUninterpretedOption(){
+ return $this->_has(999);
+ }
+
+ /**
+ * Clear <uninterpreted_option> value
+ *
+ * @return \google\protobuf\FieldOptions
+ */
+ public function clearUninterpretedOption(){
+ return $this->_clear(999);
+ }
+
+ /**
+ * Get <uninterpreted_option> value
+ *
+ * @param int $idx
+ * @return \google\protobuf\UninterpretedOption
+ */
+ public function getUninterpretedOption($idx = NULL){
+ return $this->_get(999, $idx);
+ }
+
+ /**
+ * Set <uninterpreted_option> value
+ *
+ * @param \google\protobuf\UninterpretedOption $value
+ * @return \google\protobuf\FieldOptions
+ */
+ public function setUninterpretedOption(\google\protobuf\UninterpretedOption $value, $idx = NULL){
+ return $this->_set(999, $value, $idx);
+ }
+
+ /**
+ * Get all elements of <uninterpreted_option>
+ *
+ * @return \google\protobuf\UninterpretedOption[]
+ */
+ public function getUninterpretedOptionList(){
+ return $this->_get(999);
+ }
+
+ /**
+ * Add a new element to <uninterpreted_option>
+ *
+ * @param \google\protobuf\UninterpretedOption $value
+ * @return \google\protobuf\FieldOptions
+ */
+ public function addUninterpretedOption(\google\protobuf\UninterpretedOption $value){
+ return $this->_add(999, $value);
+ }
+
+ }
+}
+
+namespace google\protobuf\FieldOptions {
+
+ class CType {
+ const STRING = 0;
+ const CORD = 1;
+ const STRING_PIECE = 2;
+ }
+}
+
+namespace google\protobuf {
+
+ class EnumOptions extends \DrSlump\Protobuf\Message {
+
+ /** @var \DrSlump\Protobuf\Descriptor */
+ protected static $__descriptor;
+ /** @var \Closure[] */
+ protected static $__extensions = array();
+
+ public static function descriptor(\DrSlump\Protobuf\Descriptor $descriptor = NULL)
+ {
+ if (NULL !== $descriptor) {
+ self::$__descriptor = $descriptor;
+ return self::$__descriptor;
+ }
+
+ if (!self::$__descriptor) {
+ $descriptor = new \DrSlump\Protobuf\Descriptor("\google\protobuf\EnumOptions");
+
+ // repeated .google.protobuf.UninterpretedOption uninterpreted_option = 999
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 999;
+ $f->name = "uninterpreted_option";
+ $f->type = 11;
+ $f->rule = 3;
+ $f->reference = "\google\protobuf\UninterpretedOption";
+ $descriptor->addField($f);
+
+ foreach (self::$__extensions as $cb) {
+ $descriptor->addField($cb(), true);
+ }
+
+ self::$__descriptor = $descriptor;
+ }
+
+ return self::$__descriptor;
+ }
+
+ /** @var \google\protobuf\UninterpretedOption[] */
+ public $uninterpreted_option = array();
+
+
+ /**
+ * Check if <uninterpreted_option> has a value
+ *
+ * @return boolean
+ */
+ public function hasUninterpretedOption(){
+ return $this->_has(999);
+ }
+
+ /**
+ * Clear <uninterpreted_option> value
+ *
+ * @return \google\protobuf\EnumOptions
+ */
+ public function clearUninterpretedOption(){
+ return $this->_clear(999);
+ }
+
+ /**
+ * Get <uninterpreted_option> value
+ *
+ * @param int $idx
+ * @return \google\protobuf\UninterpretedOption
+ */
+ public function getUninterpretedOption($idx = NULL){
+ return $this->_get(999, $idx);
+ }
+
+ /**
+ * Set <uninterpreted_option> value
+ *
+ * @param \google\protobuf\UninterpretedOption $value
+ * @return \google\protobuf\EnumOptions
+ */
+ public function setUninterpretedOption(\google\protobuf\UninterpretedOption $value, $idx = NULL){
+ return $this->_set(999, $value, $idx);
+ }
+
+ /**
+ * Get all elements of <uninterpreted_option>
+ *
+ * @return \google\protobuf\UninterpretedOption[]
+ */
+ public function getUninterpretedOptionList(){
+ return $this->_get(999);
+ }
+
+ /**
+ * Add a new element to <uninterpreted_option>
+ *
+ * @param \google\protobuf\UninterpretedOption $value
+ * @return \google\protobuf\EnumOptions
+ */
+ public function addUninterpretedOption(\google\protobuf\UninterpretedOption $value){
+ return $this->_add(999, $value);
+ }
+
+ }
+}
+
+namespace google\protobuf {
+
+ class EnumValueOptions extends \DrSlump\Protobuf\Message {
+
+ /** @var \DrSlump\Protobuf\Descriptor */
+ protected static $__descriptor;
+ /** @var \Closure[] */
+ protected static $__extensions = array();
+
+ public static function descriptor(\DrSlump\Protobuf\Descriptor $descriptor = NULL)
+ {
+ if (NULL !== $descriptor) {
+ self::$__descriptor = $descriptor;
+ return self::$__descriptor;
+ }
+
+ if (!self::$__descriptor) {
+ $descriptor = new \DrSlump\Protobuf\Descriptor("\google\protobuf\EnumValueOptions");
+
+ // repeated .google.protobuf.UninterpretedOption uninterpreted_option = 999
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 999;
+ $f->name = "uninterpreted_option";
+ $f->type = 11;
+ $f->rule = 3;
+ $f->reference = "\google\protobuf\UninterpretedOption";
+ $descriptor->addField($f);
+
+ foreach (self::$__extensions as $cb) {
+ $descriptor->addField($cb(), true);
+ }
+
+ self::$__descriptor = $descriptor;
+ }
+
+ return self::$__descriptor;
+ }
+
+ /** @var \google\protobuf\UninterpretedOption[] */
+ public $uninterpreted_option = array();
+
+
+ /**
+ * Check if <uninterpreted_option> has a value
+ *
+ * @return boolean
+ */
+ public function hasUninterpretedOption(){
+ return $this->_has(999);
+ }
+
+ /**
+ * Clear <uninterpreted_option> value
+ *
+ * @return \google\protobuf\EnumValueOptions
+ */
+ public function clearUninterpretedOption(){
+ return $this->_clear(999);
+ }
+
+ /**
+ * Get <uninterpreted_option> value
+ *
+ * @param int $idx
+ * @return \google\protobuf\UninterpretedOption
+ */
+ public function getUninterpretedOption($idx = NULL){
+ return $this->_get(999, $idx);
+ }
+
+ /**
+ * Set <uninterpreted_option> value
+ *
+ * @param \google\protobuf\UninterpretedOption $value
+ * @return \google\protobuf\EnumValueOptions
+ */
+ public function setUninterpretedOption(\google\protobuf\UninterpretedOption $value, $idx = NULL){
+ return $this->_set(999, $value, $idx);
+ }
+
+ /**
+ * Get all elements of <uninterpreted_option>
+ *
+ * @return \google\protobuf\UninterpretedOption[]
+ */
+ public function getUninterpretedOptionList(){
+ return $this->_get(999);
+ }
+
+ /**
+ * Add a new element to <uninterpreted_option>
+ *
+ * @param \google\protobuf\UninterpretedOption $value
+ * @return \google\protobuf\EnumValueOptions
+ */
+ public function addUninterpretedOption(\google\protobuf\UninterpretedOption $value){
+ return $this->_add(999, $value);
+ }
+
+ }
+}
+
+namespace google\protobuf {
+
+ class ServiceOptions extends \DrSlump\Protobuf\Message {
+
+ /** @var \DrSlump\Protobuf\Descriptor */
+ protected static $__descriptor;
+ /** @var \Closure[] */
+ protected static $__extensions = array();
+
+ public static function descriptor(\DrSlump\Protobuf\Descriptor $descriptor = NULL)
+ {
+ if (NULL !== $descriptor) {
+ self::$__descriptor = $descriptor;
+ return self::$__descriptor;
+ }
+
+ if (!self::$__descriptor) {
+ $descriptor = new \DrSlump\Protobuf\Descriptor("\google\protobuf\ServiceOptions");
+
+ // repeated .google.protobuf.UninterpretedOption uninterpreted_option = 999
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 999;
+ $f->name = "uninterpreted_option";
+ $f->type = 11;
+ $f->rule = 3;
+ $f->reference = "\google\protobuf\UninterpretedOption";
+ $descriptor->addField($f);
+
+ foreach (self::$__extensions as $cb) {
+ $descriptor->addField($cb(), true);
+ }
+
+ self::$__descriptor = $descriptor;
+ }
+
+ return self::$__descriptor;
+ }
+
+ /** @var \google\protobuf\UninterpretedOption[] */
+ public $uninterpreted_option = array();
+
+
+ /**
+ * Check if <uninterpreted_option> has a value
+ *
+ * @return boolean
+ */
+ public function hasUninterpretedOption(){
+ return $this->_has(999);
+ }
+
+ /**
+ * Clear <uninterpreted_option> value
+ *
+ * @return \google\protobuf\ServiceOptions
+ */
+ public function clearUninterpretedOption(){
+ return $this->_clear(999);
+ }
+
+ /**
+ * Get <uninterpreted_option> value
+ *
+ * @param int $idx
+ * @return \google\protobuf\UninterpretedOption
+ */
+ public function getUninterpretedOption($idx = NULL){
+ return $this->_get(999, $idx);
+ }
+
+ /**
+ * Set <uninterpreted_option> value
+ *
+ * @param \google\protobuf\UninterpretedOption $value
+ * @return \google\protobuf\ServiceOptions
+ */
+ public function setUninterpretedOption(\google\protobuf\UninterpretedOption $value, $idx = NULL){
+ return $this->_set(999, $value, $idx);
+ }
+
+ /**
+ * Get all elements of <uninterpreted_option>
+ *
+ * @return \google\protobuf\UninterpretedOption[]
+ */
+ public function getUninterpretedOptionList(){
+ return $this->_get(999);
+ }
+
+ /**
+ * Add a new element to <uninterpreted_option>
+ *
+ * @param \google\protobuf\UninterpretedOption $value
+ * @return \google\protobuf\ServiceOptions
+ */
+ public function addUninterpretedOption(\google\protobuf\UninterpretedOption $value){
+ return $this->_add(999, $value);
+ }
+
+ }
+}
+
+namespace google\protobuf {
+
+ class MethodOptions extends \DrSlump\Protobuf\Message {
+
+ /** @var \DrSlump\Protobuf\Descriptor */
+ protected static $__descriptor;
+ /** @var \Closure[] */
+ protected static $__extensions = array();
+
+ public static function descriptor(\DrSlump\Protobuf\Descriptor $descriptor = NULL)
+ {
+ if (NULL !== $descriptor) {
+ self::$__descriptor = $descriptor;
+ return self::$__descriptor;
+ }
+
+ if (!self::$__descriptor) {
+ $descriptor = new \DrSlump\Protobuf\Descriptor("\google\protobuf\MethodOptions");
+
+ // repeated .google.protobuf.UninterpretedOption uninterpreted_option = 999
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 999;
+ $f->name = "uninterpreted_option";
+ $f->type = 11;
+ $f->rule = 3;
+ $f->reference = "\google\protobuf\UninterpretedOption";
+ $descriptor->addField($f);
+
+ foreach (self::$__extensions as $cb) {
+ $descriptor->addField($cb(), true);
+ }
+
+ self::$__descriptor = $descriptor;
+ }
+
+ return self::$__descriptor;
+ }
+
+ /** @var \google\protobuf\UninterpretedOption[] */
+ public $uninterpreted_option = array();
+
+
+ /**
+ * Check if <uninterpreted_option> has a value
+ *
+ * @return boolean
+ */
+ public function hasUninterpretedOption(){
+ return $this->_has(999);
+ }
+
+ /**
+ * Clear <uninterpreted_option> value
+ *
+ * @return \google\protobuf\MethodOptions
+ */
+ public function clearUninterpretedOption(){
+ return $this->_clear(999);
+ }
+
+ /**
+ * Get <uninterpreted_option> value
+ *
+ * @param int $idx
+ * @return \google\protobuf\UninterpretedOption
+ */
+ public function getUninterpretedOption($idx = NULL){
+ return $this->_get(999, $idx);
+ }
+
+ /**
+ * Set <uninterpreted_option> value
+ *
+ * @param \google\protobuf\UninterpretedOption $value
+ * @return \google\protobuf\MethodOptions
+ */
+ public function setUninterpretedOption(\google\protobuf\UninterpretedOption $value, $idx = NULL){
+ return $this->_set(999, $value, $idx);
+ }
+
+ /**
+ * Get all elements of <uninterpreted_option>
+ *
+ * @return \google\protobuf\UninterpretedOption[]
+ */
+ public function getUninterpretedOptionList(){
+ return $this->_get(999);
+ }
+
+ /**
+ * Add a new element to <uninterpreted_option>
+ *
+ * @param \google\protobuf\UninterpretedOption $value
+ * @return \google\protobuf\MethodOptions
+ */
+ public function addUninterpretedOption(\google\protobuf\UninterpretedOption $value){
+ return $this->_add(999, $value);
+ }
+
+ }
+}
+
+namespace google\protobuf {
+
+ class UninterpretedOption extends \DrSlump\Protobuf\Message {
+
+ /** @var \DrSlump\Protobuf\Descriptor */
+ protected static $__descriptor;
+ /** @var \Closure[] */
+ protected static $__extensions = array();
+
+ public static function descriptor(\DrSlump\Protobuf\Descriptor $descriptor = NULL)
+ {
+ if (NULL !== $descriptor) {
+ self::$__descriptor = $descriptor;
+ return self::$__descriptor;
+ }
+
+ if (!self::$__descriptor) {
+ $descriptor = new \DrSlump\Protobuf\Descriptor("\google\protobuf\UninterpretedOption");
+
+ // repeated .google.protobuf.UninterpretedOption.NamePart name = 2
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 2;
+ $f->name = "name";
+ $f->nameOrig = "name";
+ $f->type = 11;
+ $f->rule = 3;
+ $f->reference = "\google\protobuf\UninterpretedOption\NamePart";
+ $descriptor->addField($f);
+
+ // optional identifier_value = 3
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 3;
+ $f->name = "identifier_value";
+ $f->type = 9;
+ $f->rule = 1;
+ $descriptor->addField($f);
+
+ // optional positive_int_value = 4
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 4;
+ $f->name = "positive_int_value";
+ $f->type = 4;
+ $f->rule = 1;
+ $descriptor->addField($f);
+
+ // optional negative_int_value = 5
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 5;
+ $f->name = "negative_int_value";
+ $f->type = 3;
+ $f->rule = 1;
+ $descriptor->addField($f);
+
+ // optional double_value = 6
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 6;
+ $f->name = "double_value";
+ $f->type = 1;
+ $f->rule = 1;
+ $descriptor->addField($f);
+
+ // optional string_value = 7
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 7;
+ $f->name = "string_value";
+ $f->type = 12;
+ $f->rule = 1;
+ $descriptor->addField($f);
+
+ // optional aggregate_value = 8
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 8;
+ $f->name = "aggregate_value";
+ $f->type = 9;
+ $f->rule = 1;
+ $descriptor->addField($f);
+
+ foreach (self::$__extensions as $cb) {
+ $descriptor->addField($cb(), true);
+ }
+
+ self::$__descriptor = $descriptor;
+ }
+
+ return self::$__descriptor;
+ }
+
+ /** @var \google\protobuf\UninterpretedOption\NamePart[] */
+ public $name = array();
+
+ /** @var string */
+ public $identifier_value = null;
+
+ /** @var int */
+ public $positive_int_value = null;
+
+ /** @var int */
+ public $negative_int_value = null;
+
+ /** @var float */
+ public $double_value = null;
+
+ /** @var string */
+ public $string_value = null;
+
+ /** @var string */
+ public $aggregate_value = null;
+
+
+ /**
+ * Check if <name> has a value
+ *
+ * @return boolean
+ */
+ public function hasName(){
+ return $this->_has(2);
+ }
+
+ /**
+ * Clear <name> value
+ *
+ * @return \google\protobuf\UninterpretedOption
+ */
+ public function clearName(){
+ return $this->_clear(2);
+ }
+
+ /**
+ * Get <name> value
+ *
+ * @param int $idx
+ * @return \google\protobuf\UninterpretedOption\NamePart
+ */
+ public function getName($idx = NULL){
+ return $this->_get(2, $idx);
+ }
+
+ /**
+ * Set <name> value
+ *
+ * @param \google\protobuf\UninterpretedOption\NamePart $value
+ * @return \google\protobuf\UninterpretedOption
+ */
+ public function setName(\google\protobuf\UninterpretedOption\NamePart $value, $idx = NULL){
+ return $this->_set(2, $value, $idx);
+ }
+
+ /**
+ * Get all elements of <name>
+ *
+ * @return \google\protobuf\UninterpretedOption\NamePart[]
+ */
+ public function getNameList(){
+ return $this->_get(2);
+ }
+
+ /**
+ * Add a new element to <name>
+ *
+ * @param \google\protobuf\UninterpretedOption\NamePart $value
+ * @return \google\protobuf\UninterpretedOption
+ */
+ public function addName(\google\protobuf\UninterpretedOption\NamePart $value){
+ return $this->_add(2, $value);
+ }
+
+ /**
+ * Check if <identifier_value> has a value
+ *
+ * @return boolean
+ */
+ public function hasIdentifierValue(){
+ return $this->_has(3);
+ }
+
+ /**
+ * Clear <identifier_value> value
+ *
+ * @return \google\protobuf\UninterpretedOption
+ */
+ public function clearIdentifierValue(){
+ return $this->_clear(3);
+ }
+
+ /**
+ * Get <identifier_value> value
+ *
+ * @return string
+ */
+ public function getIdentifierValue(){
+ return $this->_get(3);
+ }
+
+ /**
+ * Set <identifier_value> value
+ *
+ * @param string $value
+ * @return \google\protobuf\UninterpretedOption
+ */
+ public function setIdentifierValue( $value){
+ return $this->_set(3, $value);
+ }
+
+ /**
+ * Check if <positive_int_value> has a value
+ *
+ * @return boolean
+ */
+ public function hasPositiveIntValue(){
+ return $this->_has(4);
+ }
+
+ /**
+ * Clear <positive_int_value> value
+ *
+ * @return \google\protobuf\UninterpretedOption
+ */
+ public function clearPositiveIntValue(){
+ return $this->_clear(4);
+ }
+
+ /**
+ * Get <positive_int_value> value
+ *
+ * @return int
+ */
+ public function getPositiveIntValue(){
+ return $this->_get(4);
+ }
+
+ /**
+ * Set <positive_int_value> value
+ *
+ * @param int $value
+ * @return \google\protobuf\UninterpretedOption
+ */
+ public function setPositiveIntValue( $value){
+ return $this->_set(4, $value);
+ }
+
+ /**
+ * Check if <negative_int_value> has a value
+ *
+ * @return boolean
+ */
+ public function hasNegativeIntValue(){
+ return $this->_has(5);
+ }
+
+ /**
+ * Clear <negative_int_value> value
+ *
+ * @return \google\protobuf\UninterpretedOption
+ */
+ public function clearNegativeIntValue(){
+ return $this->_clear(5);
+ }
+
+ /**
+ * Get <negative_int_value> value
+ *
+ * @return int
+ */
+ public function getNegativeIntValue(){
+ return $this->_get(5);
+ }
+
+ /**
+ * Set <negative_int_value> value
+ *
+ * @param int $value
+ * @return \google\protobuf\UninterpretedOption
+ */
+ public function setNegativeIntValue( $value){
+ return $this->_set(5, $value);
+ }
+
+ /**
+ * Check if <double_value> has a value
+ *
+ * @return boolean
+ */
+ public function hasDoubleValue(){
+ return $this->_has(6);
+ }
+
+ /**
+ * Clear <double_value> value
+ *
+ * @return \google\protobuf\UninterpretedOption
+ */
+ public function clearDoubleValue(){
+ return $this->_clear(6);
+ }
+
+ /**
+ * Get <double_value> value
+ *
+ * @return float
+ */
+ public function getDoubleValue(){
+ return $this->_get(6);
+ }
+
+ /**
+ * Set <double_value> value
+ *
+ * @param float $value
+ * @return \google\protobuf\UninterpretedOption
+ */
+ public function setDoubleValue( $value){
+ return $this->_set(6, $value);
+ }
+
+ /**
+ * Check if <string_value> has a value
+ *
+ * @return boolean
+ */
+ public function hasStringValue(){
+ return $this->_has(7);
+ }
+
+ /**
+ * Clear <string_value> value
+ *
+ * @return \google\protobuf\UninterpretedOption
+ */
+ public function clearStringValue(){
+ return $this->_clear(7);
+ }
+
+ /**
+ * Get <string_value> value
+ *
+ * @return string
+ */
+ public function getStringValue(){
+ return $this->_get(7);
+ }
+
+ /**
+ * Set <string_value> value
+ *
+ * @param string $value
+ * @return \google\protobuf\UninterpretedOption
+ */
+ public function setStringValue( $value){
+ return $this->_set(7, $value);
+ }
+
+ /**
+ * Check if <aggregate_value> has a value
+ *
+ * @return boolean
+ */
+ public function hasAggregateValue(){
+ return $this->_has(8);
+ }
+
+ /**
+ * Clear <aggregate_value> value
+ *
+ * @return \google\protobuf\UninterpretedOption
+ */
+ public function clearAggregateValue(){
+ return $this->_clear(8);
+ }
+
+ /**
+ * Get <aggregate_value> value
+ *
+ * @return string
+ */
+ public function getAggregateValue(){
+ return $this->_get(8);
+ }
+
+ /**
+ * Set <aggregate_value> value
+ *
+ * @param string $value
+ * @return \google\protobuf\UninterpretedOption
+ */
+ public function setAggregateValue( $value){
+ return $this->_set(8, $value);
+ }
+
+ }
+}
+
+namespace google\protobuf\UninterpretedOption {
+
+ class NamePart extends \DrSlump\Protobuf\Message {
+
+ /** @var \DrSlump\Protobuf\Descriptor */
+ protected static $__descriptor;
+ /** @var \Closure[] */
+ protected static $__extensions = array();
+
+ public static function descriptor(\DrSlump\Protobuf\Descriptor $descriptor = NULL)
+ {
+ if (NULL !== $descriptor) {
+ self::$__descriptor = $descriptor;
+ return self::$__descriptor;
+ }
+
+ if (!self::$__descriptor) {
+ $descriptor = new \DrSlump\Protobuf\Descriptor("\google\protobuf\UninterpretedOption\NamePart");
+
+ // required name_part = 1
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 1;
+ $f->name = "name_part";
+ $f->type = 9;
+ $f->rule = 2;
+ $descriptor->addField($f);
+
+ // required is_extension = 2
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 2;
+ $f->name = "is_extension";
+ $f->type = 8;
+ $f->rule = 2;
+ $descriptor->addField($f);
+
+ foreach (self::$__extensions as $cb) {
+ $descriptor->addField($cb(), true);
+ }
+
+ self::$__descriptor = $descriptor;
+ }
+
+ return self::$__descriptor;
+ }
+
+ /** @var string */
+ public $name_part = null;
+
+ /** @var boolean */
+ public $is_extension = null;
+
+
+ /**
+ * Check if <name_part> has a value
+ *
+ * @return boolean
+ */
+ public function hasNamePart(){
+ return $this->_has(1);
+ }
+
+ /**
+ * Clear <name_part> value
+ *
+ * @return \google\protobuf\UninterpretedOption\NamePart
+ */
+ public function clearNamePart(){
+ return $this->_clear(1);
+ }
+
+ /**
+ * Get <name_part> value
+ *
+ * @return string
+ */
+ public function getNamePart(){
+ return $this->_get(1);
+ }
+
+ /**
+ * Set <name_part> value
+ *
+ * @param string $value
+ * @return \google\protobuf\UninterpretedOption\NamePart
+ */
+ public function setNamePart( $value){
+ return $this->_set(1, $value);
+ }
+
+ /**
+ * Check if <is_extension> has a value
+ *
+ * @return boolean
+ */
+ public function hasIsExtension(){
+ return $this->_has(2);
+ }
+
+ /**
+ * Clear <is_extension> value
+ *
+ * @return \google\protobuf\UninterpretedOption\NamePart
+ */
+ public function clearIsExtension(){
+ return $this->_clear(2);
+ }
+
+ /**
+ * Get <is_extension> value
+ *
+ * @return boolean
+ */
+ public function getIsExtension(){
+ return $this->_get(2);
+ }
+
+ /**
+ * Set <is_extension> value
+ *
+ * @param boolean $value
+ * @return \google\protobuf\UninterpretedOption\NamePart
+ */
+ public function setIsExtension( $value){
+ return $this->_set(2, $value);
+ }
+
+ }
+}
+
+namespace google\protobuf {
+
+ class SourceCodeInfo extends \DrSlump\Protobuf\Message {
+
+ /** @var \DrSlump\Protobuf\Descriptor */
+ protected static $__descriptor;
+ /** @var \Closure[] */
+ protected static $__extensions = array();
+
+ public static function descriptor(\DrSlump\Protobuf\Descriptor $descriptor = NULL)
+ {
+ if (NULL !== $descriptor) {
+ self::$__descriptor = $descriptor;
+ return self::$__descriptor;
+ }
+
+ if (!self::$__descriptor) {
+ $descriptor = new \DrSlump\Protobuf\Descriptor("\google\protobuf\SourceCodeInfo");
+
+ // repeated .google.protobuf.SourceCodeInfo.Location location = 1
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 1;
+ $f->name = "location";
+ $f->nameOrig = "location";
+ $f->type = 11;
+ $f->rule = 3;
+ $f->reference = "\google\protobuf\SourceCodeInfo\Location";
+ $descriptor->addField($f);
+
+ foreach (self::$__extensions as $cb) {
+ $descriptor->addField($cb(), true);
+ }
+
+ self::$__descriptor = $descriptor;
+ }
+
+ return self::$__descriptor;
+ }
+
+ /** @var \google\protobuf\SourceCodeInfo\Location[] */
+ public $location = array();
+
+
+ /**
+ * Check if <location> has a value
+ *
+ * @return boolean
+ */
+ public function hasLocation(){
+ return $this->_has(1);
+ }
+
+ /**
+ * Clear <location> value
+ *
+ * @return \google\protobuf\SourceCodeInfo
+ */
+ public function clearLocation(){
+ return $this->_clear(1);
+ }
+
+ /**
+ * Get <location> value
+ *
+ * @param int $idx
+ * @return \google\protobuf\SourceCodeInfo\Location
+ */
+ public function getLocation($idx = NULL){
+ return $this->_get(1, $idx);
+ }
+
+ /**
+ * Set <location> value
+ *
+ * @param \google\protobuf\SourceCodeInfo\Location $value
+ * @return \google\protobuf\SourceCodeInfo
+ */
+ public function setLocation(\google\protobuf\SourceCodeInfo\Location $value, $idx = NULL){
+ return $this->_set(1, $value, $idx);
+ }
+
+ /**
+ * Get all elements of <location>
+ *
+ * @return \google\protobuf\SourceCodeInfo\Location[]
+ */
+ public function getLocationList(){
+ return $this->_get(1);
+ }
+
+ /**
+ * Add a new element to <location>
+ *
+ * @param \google\protobuf\SourceCodeInfo\Location $value
+ * @return \google\protobuf\SourceCodeInfo
+ */
+ public function addLocation(\google\protobuf\SourceCodeInfo\Location $value){
+ return $this->_add(1, $value);
+ }
+
+ }
+}
+
+namespace google\protobuf\SourceCodeInfo {
+
+ class Location extends \DrSlump\Protobuf\Message {
+
+ /** @var \DrSlump\Protobuf\Descriptor */
+ protected static $__descriptor;
+ /** @var \Closure[] */
+ protected static $__extensions = array();
+
+ public static function descriptor(\DrSlump\Protobuf\Descriptor $descriptor = NULL)
+ {
+ if (NULL !== $descriptor) {
+ self::$__descriptor = $descriptor;
+ return self::$__descriptor;
+ }
+
+ if (!self::$__descriptor) {
+ $descriptor = new \DrSlump\Protobuf\Descriptor("\google\protobuf\SourceCodeInfo\Location");
+
+ // repeated path = 1
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 1;
+ $f->name = "path";
+ $f->nameOrig = "path";
+ $f->type = 5;
+ $f->rule = 3;
+ $descriptor->addField($f);
+
+ // repeated span = 2
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 2;
+ $f->name = "span";
+ $f->nameOrig = "span";
+ $f->type = 5;
+ $f->rule = 3;
+ $descriptor->addField($f);
+
+ foreach (self::$__extensions as $cb) {
+ $descriptor->addField($cb(), true);
+ }
+
+ self::$__descriptor = $descriptor;
+ }
+
+ return self::$__descriptor;
+ }
+
+ /** @var int[] */
+ public $path = array();
+
+ /** @var int[] */
+ public $span = array();
+
+
+ /**
+ * Check if <path> has a value
+ *
+ * @return boolean
+ */
+ public function hasPath(){
+ return $this->_has(1);
+ }
+
+ /**
+ * Clear <path> value
+ *
+ * @return \google\protobuf\SourceCodeInfo\Location
+ */
+ public function clearPath(){
+ return $this->_clear(1);
+ }
+
+ /**
+ * Get <path> value
+ *
+ * @param int $idx
+ * @return int
+ */
+ public function getPath($idx = NULL){
+ return $this->_get(1, $idx);
+ }
+
+ /**
+ * Set <path> value
+ *
+ * @param int $value
+ * @return \google\protobuf\SourceCodeInfo\Location
+ */
+ public function setPath( $value, $idx = NULL){
+ return $this->_set(1, $value, $idx);
+ }
+
+ /**
+ * Get all elements of <path>
+ *
+ * @return int[]
+ */
+ public function getPathList(){
+ return $this->_get(1);
+ }
+
+ /**
+ * Add a new element to <path>
+ *
+ * @param int $value
+ * @return \google\protobuf\SourceCodeInfo\Location
+ */
+ public function addPath( $value){
+ return $this->_add(1, $value);
+ }
+
+ /**
+ * Check if <span> has a value
+ *
+ * @return boolean
+ */
+ public function hasSpan(){
+ return $this->_has(2);
+ }
+
+ /**
+ * Clear <span> value
+ *
+ * @return \google\protobuf\SourceCodeInfo\Location
+ */
+ public function clearSpan(){
+ return $this->_clear(2);
+ }
+
+ /**
+ * Get <span> value
+ *
+ * @param int $idx
+ * @return int
+ */
+ public function getSpan($idx = NULL){
+ return $this->_get(2, $idx);
+ }
+
+ /**
+ * Set <span> value
+ *
+ * @param int $value
+ * @return \google\protobuf\SourceCodeInfo\Location
+ */
+ public function setSpan( $value, $idx = NULL){
+ return $this->_set(2, $value, $idx);
+ }
+
+ /**
+ * Get all elements of <span>
+ *
+ * @return int[]
+ */
+ public function getSpanList(){
+ return $this->_get(2);
+ }
+
+ /**
+ * Add a new element to <span>
+ *
+ * @param int $value
+ * @return \google\protobuf\SourceCodeInfo\Location
+ */
+ public function addSpan( $value){
+ return $this->_add(2, $value);
+ }
+
+ }
+}
+
--- /dev/null
+++ b/lib/Protobuf-PHP/library/DrSlump/Protobuf/Compiler/protos/descriptor.proto
@@ -1,1 +1,535 @@
-
+// Protocol Buffers - Google's data interchange format
+// Copyright 2008 Google Inc. All rights reserved.
+// http://code.google.com/p/protobuf/
+//
+// Redistribution and use in source and binary forms, with or without
+// modification, are permitted provided that the following conditions are
+// met:
+//
+// * Redistributions of source code must retain the above copyright
+// notice, this list of conditions and the following disclaimer.
+// * Redistributions in binary form must reproduce the above
+// copyright notice, this list of conditions and the following disclaimer
+// in the documentation and/or other materials provided with the
+// distribution.
+// * Neither the name of Google Inc. nor the names of its
+// contributors may be used to endorse or promote products derived from
+// this software without specific prior written permission.
+//
+// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS
+// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT
+// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR
+// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT
+// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL,
+// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT
+// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE,
+// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY
+// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT
+// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE
+// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+
+// Author: kenton@google.com (Kenton Varda)
+// Based on original Protocol Buffers design by
+// Sanjay Ghemawat, Jeff Dean, and others.
+//
+// The messages in this file describe the definitions found in .proto files.
+// A valid .proto file can be translated directly to a FileDescriptorProto
+// without any other information (e.g. without reading its imports).
+
+
+
+package google.protobuf;
+
+option java_package = "com.google.protobuf";
+option java_outer_classname = "DescriptorProtos";
+
+// descriptor.proto must be optimized for speed because reflection-based
+// algorithms don't work during bootstrapping.
+option optimize_for = SPEED;
+
+// The protocol compiler can output a FileDescriptorSet containing the .proto
+// files it parses.
+message FileDescriptorSet {
+ repeated FileDescriptorProto file = 1;
+}
+
+// Describes a complete .proto file.
+message FileDescriptorProto {
+ optional string name = 1; // file name, relative to root of source tree
+ optional string package = 2; // e.g. "foo", "foo.bar", etc.
+
+ // Names of files imported by this file.
+ repeated string dependency = 3;
+
+ // All top-level definitions in this file.
+ repeated DescriptorProto message_type = 4;
+ repeated EnumDescriptorProto enum_type = 5;
+ repeated ServiceDescriptorProto service = 6;
+ repeated FieldDescriptorProto extension = 7;
+
+ optional FileOptions options = 8;
+
+ // This field contains optional information about the original source code.
+ // You may safely remove this entire field whithout harming runtime
+ // functionality of the descriptors -- the information is needed only by
+ // development tools.
+ optional SourceCodeInfo source_code_info = 9;
+}
+
+// Describes a message type.
+message DescriptorProto {
+ optional string name = 1;
+
+ repeated FieldDescriptorProto field = 2;
+ repeated FieldDescriptorProto extension = 6;
+
+ repeated DescriptorProto nested_type = 3;
+ repeated EnumDescriptorProto enum_type = 4;
+
+ message ExtensionRange {
+ optional int32 start = 1;
+ optional int32 end = 2;
+ }
+ repeated ExtensionRange extension_range = 5;
+
+ optional MessageOptions options = 7;
+}
+
+// Describes a field within a message.
+message FieldDescriptorProto {
+ enum Type {
+ // 0 is reserved for errors.
+ // Order is weird for historical reasons.
+ TYPE_DOUBLE = 1;
+ TYPE_FLOAT = 2;
+ TYPE_INT64 = 3; // Not ZigZag encoded. Negative numbers
+ // take 10 bytes. Use TYPE_SINT64 if negative
+ // values are likely.
+ TYPE_UINT64 = 4;
+ TYPE_INT32 = 5; // Not ZigZag encoded. Negative numbers
+ // take 10 bytes. Use TYPE_SINT32 if negative
+ // values are likely.
+ TYPE_FIXED64 = 6;
+ TYPE_FIXED32 = 7;
+ TYPE_BOOL = 8;
+ TYPE_STRING = 9;
+ TYPE_GROUP = 10; // Tag-delimited aggregate.
+ TYPE_MESSAGE = 11; // Length-delimited aggregate.
+
+ // New in version 2.
+ TYPE_BYTES = 12;
+ TYPE_UINT32 = 13;
+ TYPE_ENUM = 14;
+ TYPE_SFIXED32 = 15;
+ TYPE_SFIXED64 = 16;
+ TYPE_SINT32 = 17; // Uses ZigZag encoding.
+ TYPE_SINT64 = 18; // Uses ZigZag encoding.
+ };
+
+ enum Label {
+ // 0 is reserved for errors
+ LABEL_OPTIONAL = 1;
+ LABEL_REQUIRED = 2;
+ LABEL_REPEATED = 3;
+ // TODO(sanjay): Should we add LABEL_MAP?
+ };
+
+ optional string name = 1;
+ optional int32 number = 3;
+ optional Label label = 4;
+
+ // If type_name is set, this need not be set. If both this and type_name
+ // are set, this must be either TYPE_ENUM or TYPE_MESSAGE.
+ optional Type type = 5;
+
+ // For message and enum types, this is the name of the type. If the name
+ // starts with a '.', it is fully-qualified. Otherwise, C++-like scoping
+ // rules are used to find the type (i.e. first the nested types within this
+ // message are searched, then within the parent, on up to the root
+ // namespace).
+ optional string type_name = 6;
+
+ // For extensions, this is the name of the type being extended. It is
+ // resolved in the same manner as type_name.
+ optional string extendee = 2;
+
+ // For numeric types, contains the original text representation of the value.
+ // For booleans, "true" or "false".
+ // For strings, contains the default text contents (not escaped in any way).
+ // For bytes, contains the C escaped value. All bytes >= 128 are escaped.
+ // TODO(kenton): Base-64 encode?
+ optional string default_value = 7;
+
+ optional FieldOptions options = 8;
+}
+
+// Describes an enum type.
+message EnumDescriptorProto {
+ optional string name = 1;
+
+ repeated EnumValueDescriptorProto value = 2;
+
+ optional EnumOptions options = 3;
+}
+
+// Describes a value within an enum.
+message EnumValueDescriptorProto {
+ optional string name = 1;
+ optional int32 number = 2;
+
+ optional EnumValueOptions options = 3;
+}
+
+// Describes a service.
+message ServiceDescriptorProto {
+ optional string name = 1;
+ repeated MethodDescriptorProto method = 2;
+
+ optional ServiceOptions options = 3;
+}
+
+// Describes a method of a service.
+message MethodDescriptorProto {
+ optional string name = 1;
+
+ // Input and output type names. These are resolved in the same way as
+ // FieldDescriptorProto.type_name, but must refer to a message type.
+ optional string input_type = 2;
+ optional string output_type = 3;
+
+ optional MethodOptions options = 4;
+}
+
+// ===================================================================
+// Options
+
+// Each of the definitions above may have "options" attached. These are
+// just annotations which may cause code to be generated slightly differently
+// or may contain hints for code that manipulates protocol messages.
+//
+// Clients may define custom options as extensions of the *Options messages.
+// These extensions may not yet be known at parsing time, so the parser cannot
+// store the values in them. Instead it stores them in a field in the *Options
+// message called uninterpreted_option. This field must have the same name
+// across all *Options messages. We then use this field to populate the
+// extensions when we build a descriptor, at which point all protos have been
+// parsed and so all extensions are known.
+//
+// Extension numbers for custom options may be chosen as follows:
+// * For options which will only be used within a single application or
+// organization, or for experimental options, use field numbers 50000
+// through 99999. It is up to you to ensure that you do not use the
+// same number for multiple options.
+// * For options which will be published and used publicly by multiple
+// independent entities, e-mail kenton@google.com to reserve extension
+// numbers. Simply tell me how many you need and I'll send you back a
+// set of numbers to use -- there's no need to explain how you intend to
+// use them. If this turns out to be popular, a web service will be set up
+// to automatically assign option numbers.
+
+
+message FileOptions {
+
+ // Sets the Java package where classes generated from this .proto will be
+ // placed. By default, the proto package is used, but this is often
+ // inappropriate because proto packages do not normally start with backwards
+ // domain names.
+ optional string java_package = 1;
+
+
+ // If set, all the classes from the .proto file are wrapped in a single
+ // outer class with the given name. This applies to both Proto1
+ // (equivalent to the old "--one_java_file" option) and Proto2 (where
+ // a .proto always translates to a single class, but you may want to
+ // explicitly choose the class name).
+ optional string java_outer_classname = 8;
+
+ // If set true, then the Java code generator will generate a separate .java
+ // file for each top-level message, enum, and service defined in the .proto
+ // file. Thus, these types will *not* be nested inside the outer class
+ // named by java_outer_classname. However, the outer class will still be
+ // generated to contain the file's getDescriptor() method as well as any
+ // top-level extensions defined in the file.
+ optional bool java_multiple_files = 10 [default=false];
+
+ // If set true, then the Java code generator will generate equals() and
+ // hashCode() methods for all messages defined in the .proto file. This is
+ // purely a speed optimization, as the AbstractMessage base class includes
+ // reflection-based implementations of these methods.
+ optional bool java_generate_equals_and_hash = 20 [default=false];
+
+ // Generated classes can be optimized for speed or code size.
+ enum OptimizeMode {
+ SPEED = 1; // Generate complete code for parsing, serialization,
+ // etc.
+ CODE_SIZE = 2; // Use ReflectionOps to implement these methods.
+ LITE_RUNTIME = 3; // Generate code using MessageLite and the lite runtime.
+ }
+ optional OptimizeMode optimize_for = 9 [default=SPEED];
+
+
+
+
+ // Should generic services be generated in each language? "Generic" services
+ // are not specific to any particular RPC system. They are generated by the
+ // main code generators in each language (without additional plugins).
+ // Generic services were the only kind of service generation supported by
+ // early versions of proto2.
+ //
+ // Generic services are now considered deprecated in favor of using plugins
+ // that generate code specific to your particular RPC system. Therefore,
+ // these default to false. Old code which depends on generic services should
+ // explicitly set them to true.
+ optional bool cc_generic_services = 16 [default=false];
+ optional bool java_generic_services = 17 [default=false];
+ optional bool py_generic_services = 18 [default=false];
+
+ // The parser stores options it doesn't recognize here. See above.
+ repeated UninterpretedOption uninterpreted_option = 999;
+
+ // Clients can define custom options in extensions of this message. See above.
+ extensions 1000 to max;
+}
+
+message MessageOptions {
+ // Set true to use the old proto1 MessageSet wire format for extensions.
+ // This is provided for backwards-compatibility with the MessageSet wire
+ // format. You should not use this for any other reason: It's less
+ // efficient, has fewer features, and is more complicated.
+ //
+ // The message must be defined exactly as follows:
+ // message Foo {
+ // option message_set_wire_format = true;
+ // extensions 4 to max;
+ // }
+ // Note that the message cannot have any defined fields; MessageSets only
+ // have extensions.
+ //
+ // All extensions of your type must be singular messages; e.g. they cannot
+ // be int32s, enums, or repeated messages.
+ //
+ // Because this is an option, the above two restrictions are not enforced by
+ // the protocol compiler.
+ optional bool message_set_wire_format = 1 [default=false];
+
+ // Disables the generation of the standard "descriptor()" accessor, which can
+ // conflict with a field of the same name. This is meant to make migration
+ // from proto1 easier; new code should avoid fields named "descriptor".
+ optional bool no_standard_descriptor_accessor = 2 [default=false];
+
+ // The parser stores options it doesn't recognize here. See above.
+ repeated UninterpretedOption uninterpreted_option = 999;
+
+ // Clients can define custom options in extensions of this message. See above.
+ extensions 1000 to max;
+}
+
+message FieldOptions {
+ // The ctype option instructs the C++ code generator to use a different
+ // representation of the field than it normally would. See the specific
+ // options below. This option is not yet implemented in the open source
+ // release -- sorry, we'll try to include it in a future version!
+ optional CType ctype = 1 [default = STRING];
+ enum CType {
+ // Default mode.
+ STRING = 0;
+
+ CORD = 1;
+
+ STRING_PIECE = 2;
+ }
+ // The packed option can be enabled for repeated primitive fields to enable
+ // a more efficient representation on the wire. Rather than repeatedly
+ // writing the tag and type for each element, the entire array is encoded as
+ // a single length-delimited blob.
+ optional bool packed = 2;
+
+
+ // Is this field deprecated?
+ // Depending on the target platform, this can emit Deprecated annotations
+ // for accessors, or it will be completely ignored; in the very least, this
+ // is a formalization for deprecating fields.
+ optional bool deprecated = 3 [default=false];
+
+ // EXPERIMENTAL. DO NOT USE.
+ // For "map" fields, the name of the field in the enclosed type that
+ // is the key for this map. For example, suppose we have:
+ // message Item {
+ // required string name = 1;
+ // required string value = 2;
+ // }
+ // message Config {
+ // repeated Item items = 1 [experimental_map_key="name"];
+ // }
+ // In this situation, the map key for Item will be set to "name".
+ // TODO: Fully-implement this, then remove the "experimental_" prefix.
+ optional string experimental_map_key = 9;
+
+ // The parser stores options it doesn't recognize here. See above.
+ repeated UninterpretedOption uninterpreted_option = 999;
+
+ // Clients can define custom options in extensions of this message. See above.
+ extensions 1000 to max;
+}
+
+message EnumOptions {
+
+ // The parser stores options it doesn't recognize here. See above.
+ repeated UninterpretedOption uninterpreted_option = 999;
+
+ // Clients can define custom options in extensions of this message. See above.
+ extensions 1000 to max;
+}
+
+message EnumValueOptions {
+ // The parser stores options it doesn't recognize here. See above.
+ repeated UninterpretedOption uninterpreted_option = 999;
+
+ // Clients can define custom options in extensions of this message. See above.
+ extensions 1000 to max;
+}
+
+message ServiceOptions {
+
+ // Note: Field numbers 1 through 32 are reserved for Google's internal RPC
+ // framework. We apologize for hoarding these numbers to ourselves, but
+ // we were already using them long before we decided to release Protocol
+ // Buffers.
+
+ // The parser stores options it doesn't recognize here. See above.
+ repeated UninterpretedOption uninterpreted_option = 999;
+
+ // Clients can define custom options in extensions of this message. See above.
+ extensions 1000 to max;
+}
+
+message MethodOptions {
+
+ // Note: Field numbers 1 through 32 are reserved for Google's internal RPC
+ // framework. We apologize for hoarding these numbers to ourselves, but
+ // we were already using them long before we decided to release Protocol
+ // Buffers.
+
+ // The parser stores options it doesn't recognize here. See above.
+ repeated UninterpretedOption uninterpreted_option = 999;
+
+ // Clients can define custom options in extensions of this message. See above.
+ extensions 1000 to max;
+}
+
+// A message representing a option the parser does not recognize. This only
+// appears in options protos created by the compiler::Parser class.
+// DescriptorPool resolves these when building Descriptor objects. Therefore,
+// options protos in descriptor objects (e.g. returned by Descriptor::options(),
+// or produced by Descriptor::CopyTo()) will never have UninterpretedOptions
+// in them.
+message UninterpretedOption {
+ // The name of the uninterpreted option. Each string represents a segment in
+ // a dot-separated name. is_extension is true iff a segment represents an
+ // extension (denoted with parentheses in options specs in .proto files).
+ // E.g.,{ ["foo", false], ["bar.baz", true], ["qux", false] } represents
+ // "foo.(bar.baz).qux".
+ message NamePart {
+ required string name_part = 1;
+ required bool is_extension = 2;
+ }
+ repeated NamePart name = 2;
+
+ // The value of the uninterpreted option, in whatever type the tokenizer
+ // identified it as during parsing. Exactly one of these should be set.
+ optional string identifier_value = 3;
+ optional uint64 positive_int_value = 4;
+ optional int64 negative_int_value = 5;
+ optional double double_value = 6;
+ optional bytes string_value = 7;
+ optional string aggregate_value = 8;
+}
+
+// ===================================================================
+// Optional source code info
+
+// Encapsulates information about the original source file from which a
+// FileDescriptorProto was generated.
+message SourceCodeInfo {
+ // A Location identifies a piece of source code in a .proto file which
+ // corresponds to a particular definition. This information is intended
+ // to be useful to IDEs, code indexers, documentation generators, and similar
+ // tools.
+ //
+ // For example, say we have a file like:
+ // message Foo {
+ // optional string foo = 1;
+ // }
+ // Let's look at just the field definition:
+ // optional string foo = 1;
+ // ^ ^^ ^^ ^ ^^^
+ // a bc de f ghi
+ // We have the following locations:
+ // span path represents
+ // [a,i) [ 4, 0, 2, 0 ] The whole field definition.
+ // [a,b) [ 4, 0, 2, 0, 4 ] The label (optional).
+ // [c,d) [ 4, 0, 2, 0, 5 ] The type (string).
+ // [e,f) [ 4, 0, 2, 0, 1 ] The name (foo).
+ // [g,h) [ 4, 0, 2, 0, 3 ] The number (1).
+ //
+ // Notes:
+ // - A location may refer to a repeated field itself (i.e. not to any
+ // particular index within it). This is used whenever a set of elements are
+ // logically enclosed in a single code segment. For example, an entire
+ // extend block (possibly containing multiple extension definitions) will
+ // have an outer location whose path refers to the "extensions" repeated
+ // field without an index.
+ // - Multiple locations may have the same path. This happens when a single
+ // logical declaration is spread out across multiple places. The most
+ // obvious example is the "extend" block again -- there may be multiple
+ // extend blocks in the same scope, each of which will have the same path.
+ // - A location's span is not always a subset of its parent's span. For
+ // example, the "extendee" of an extension declaration appears at the
+ // beginning of the "extend" block and is shared by all extensions within
+ // the block.
+ // - Just because a location's span is a subset of some other location's span
+ // does not mean that it is a descendent. For example, a "group" defines
+ // both a type and a field in a single declaration. Thus, the locations
+ // corresponding to the type and field and their components will overlap.
+ // - Code which tries to interpret locations should probably be designed to
+ // ignore those that it doesn't understand, as more types of locations could
+ // be recorded in the future.
+ repeated Location location = 1;
+ message Location {
+ // Identifies which part of the FileDescriptorProto was defined at this
+ // location.
+ //
+ // Each element is a field number or an index. They form a path from
+ // the root FileDescriptorProto to the place where the definition. For
+ // example, this path:
+ // [ 4, 3, 2, 7, 1 ]
+ // refers to:
+ // file.message_type(3) // 4, 3
+ // .field(7) // 2, 7
+ // .name() // 1
+ // This is because FileDescriptorProto.message_type has field number 4:
+ // repeated DescriptorProto message_type = 4;
+ // and DescriptorProto.field has field number 2:
+ // repeated FieldDescriptorProto field = 2;
+ // and FieldDescriptorProto.name has field number 1:
+ // optional string name = 1;
+ //
+ // Thus, the above path gives the location of a field name. If we removed
+ // the last element:
+ // [ 4, 3, 2, 7 ]
+ // this path refers to the whole field declaration (from the beginning
+ // of the label to the terminating semicolon).
+ repeated int32 path = 1 [packed=true];
+
+ // Always has exactly three or four elements: start line, start column,
+ // end line (optional, otherwise assumed same as start line), end column.
+ // These are packed into a single field for efficiency. Note that line
+ // and column numbers are zero-based -- typically you will want to add
+ // 1 to each before displaying to a user.
+ repeated int32 span = 2 [packed=true];
+
+ // TODO(kenton): Record comments appearing before and after the
+ // declaration.
+ }
+}
+
--- /dev/null
+++ b/lib/Protobuf-PHP/library/DrSlump/Protobuf/Compiler/protos/json.pb.php
@@ -1,1 +1,28 @@
+<?php
+// DO NOT EDIT! Generated by Protobuf for PHP protoc plugin @package_version@
+// Source: php.proto
+// Date: 2011-03-20 01:27:38
+namespace {
+
+ \google\protobuf\FileOptions::extension(function(){
+ // optional php.namespace = 50002
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 50102;
+ $f->name = "json.namespace";
+ $f->type = 9;
+ $f->rule = 1;
+ return $f;
+ });
+ \google\protobuf\FileOptions::extension(function(){
+ // optional php.suffix = 50003
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 50103;
+ $f->name = "json.suffix";
+ $f->type = 9;
+ $f->rule = 1;
+ $f->default = ".pb.js";
+ return $f;
+ });
+}
+
--- /dev/null
+++ b/lib/Protobuf-PHP/library/DrSlump/Protobuf/Compiler/protos/json.proto
@@ -1,1 +1,37 @@
+import "descriptor.proto";
+package json;
+
+extend google.protobuf.FileOptions {
+
+ // Set the namespace (overrides package)
+ optional string namespace = 50102;
+ // Suffix for file names
+ optional string suffix = 50103 [default = ".pb.js"];
+
+}
+
+//extend google.protobuf.MessageOptions {
+//
+//}
+//
+//extend google.protobuf.FieldOptions {
+//
+//}
+//
+//extend google.protobuf.EnumOptions {
+//
+//}
+//
+//extend google.protobuf.EnumValueOptions {
+//
+//}
+//
+//extend google.protobuf.ServiceOptions {
+//
+//}
+//
+//extend google.protobuf.MethodOptions {
+//
+//}
+
--- /dev/null
+++ b/lib/Protobuf-PHP/library/DrSlump/Protobuf/Compiler/protos/php.pb.php
@@ -1,1 +1,48 @@
+<?php
+// DO NOT EDIT! Generated by Protobuf for PHP protoc plugin @package_version@
+// Source: php.proto
+// Date: 2011-03-20 01:27:38
+namespace {
+
+ \google\protobuf\FileOptions::extension(function(){
+ // optional php.namespace = 50002
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 50002;
+ $f->name = "php.namespace";
+ $f->type = 9;
+ $f->rule = 1;
+ return $f;
+ });
+ \google\protobuf\FileOptions::extension(function(){
+ // optional php.suffix = 50003
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 50003;
+ $f->name = "php.suffix";
+ $f->type = 9;
+ $f->rule = 1;
+ $f->default = ".php";
+ return $f;
+ });
+ \google\protobuf\FileOptions::extension(function(){
+ // optional php.multiple = 50004
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 50004;
+ $f->name = "php.multifile";
+ $f->type = 8;
+ $f->rule = 1;
+ $f->default = false;
+ return $f;
+ });
+ \google\protobuf\FileOptions::extension(function(){
+ // optional php.generic_services = 50005
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 50005;
+ $f->name = "php.generic_services";
+ $f->type = 8;
+ $f->rule = 1;
+ $f->default = false;
+ return $f;
+ });
+}
+
--- /dev/null
+++ b/lib/Protobuf-PHP/library/DrSlump/Protobuf/Compiler/protos/php.proto
@@ -1,1 +1,41 @@
+import "descriptor.proto";
+package php;
+
+extend google.protobuf.FileOptions {
+
+ // Set the namespace (overrides package)
+ optional string namespace = 50002;
+ // Suffix for file names
+ optional string suffix = 50003 [default = ".php"];
+ // Generate a file for each structure in the proto
+ optional bool multifile = 50004 [default = false];
+ // Generate interfaces for service definitions
+ optional bool generic_services = 50005 [default = false];
+
+}
+
+//extend google.protobuf.MessageOptions {
+//
+//}
+//
+//extend google.protobuf.FieldOptions {
+//
+//}
+//
+//extend google.protobuf.EnumOptions {
+//
+//}
+//
+//extend google.protobuf.EnumValueOptions {
+//
+//}
+//
+//extend google.protobuf.ServiceOptions {
+//
+//}
+//
+//extend google.protobuf.MethodOptions {
+//
+//}
+
--- /dev/null
+++ b/lib/Protobuf-PHP/library/DrSlump/Protobuf/Compiler/protos/plugin.pb.php
@@ -1,1 +1,555 @@
-
+<?php
+// DO NOT EDIT! Generated by Protobuf for PHP protoc plugin @package_version@
+// Source: plugin.proto
+// Date: 2011-03-20 01:27:33
+
+namespace google\protobuf\compiler {
+
+ class CodeGeneratorRequest extends \DrSlump\Protobuf\Message {
+
+ /** @var \DrSlump\Protobuf\Descriptor */
+ protected static $__descriptor;
+ /** @var \Closure[] */
+ protected static $__extensions = array();
+
+ public static function descriptor(\DrSlump\Protobuf\Descriptor $descriptor = NULL)
+ {
+ if (NULL !== $descriptor) {
+ self::$__descriptor = $descriptor;
+ return self::$__descriptor;
+ }
+
+ if (!self::$__descriptor) {
+ $descriptor = new \DrSlump\Protobuf\Descriptor("\google\protobuf\compiler\CodeGeneratorRequest");
+
+ // repeated file_to_generate = 1
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 1;
+ $f->name = "file_to_generate";
+ $f->type = 9;
+ $f->rule = 3;
+ $descriptor->addField($f);
+
+ // optional parameter = 2
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 2;
+ $f->name = "parameter";
+ $f->nameOrig = "parameter";
+ $f->type = 9;
+ $f->rule = 1;
+ $descriptor->addField($f);
+
+ // repeated .google.protobuf.FileDescriptorProto proto_file = 15
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 15;
+ $f->name = "proto_file";
+ $f->type = 11;
+ $f->rule = 3;
+ $f->reference = "\google\protobuf\FileDescriptorProto";
+ $descriptor->addField($f);
+
+ foreach (self::$__extensions as $cb) {
+ $descriptor->addField($cb(), true);
+ }
+
+ self::$__descriptor = $descriptor;
+ }
+
+ return self::$__descriptor;
+ }
+
+ /** @var string[] */
+ public $file_to_generate = array();
+
+ /** @var string */
+ public $parameter = null;
+
+ /** @var \google\protobuf\FileDescriptorProto[] */
+ public $proto_file = array();
+
+
+ /**
+ * Check if <file_to_generate> has a value
+ *
+ * @return boolean
+ */
+ public function hasFileToGenerate(){
+ return $this->_has(1);
+ }
+
+ /**
+ * Clear <file_to_generate> value
+ *
+ * @return \google\protobuf\compiler\CodeGeneratorRequest
+ */
+ public function clearFileToGenerate(){
+ return $this->_clear(1);
+ }
+
+ /**
+ * Get <file_to_generate> value
+ *
+ * @param int $idx
+ * @return string
+ */
+ public function getFileToGenerate($idx = NULL){
+ return $this->_get(1, $idx);
+ }
+
+ /**
+ * Set <file_to_generate> value
+ *
+ * @param string $value
+ * @return \google\protobuf\compiler\CodeGeneratorRequest
+ */
+ public function setFileToGenerate( $value, $idx = NULL){
+ return $this->_set(1, $value, $idx);
+ }
+
+ /**
+ * Get all elements of <file_to_generate>
+ *
+ * @return string[]
+ */
+ public function getFileToGenerateList(){
+ return $this->_get(1);
+ }
+
+ /**
+ * Add a new element to <file_to_generate>
+ *
+ * @param string $value
+ * @return \google\protobuf\compiler\CodeGeneratorRequest
+ */
+ public function addFileToGenerate( $value){
+ return $this->_add(1, $value);
+ }
+
+ /**
+ * Check if <parameter> has a value
+ *
+ * @return boolean
+ */
+ public function hasParameter(){
+ return $this->_has(2);
+ }
+
+ /**
+ * Clear <parameter> value
+ *
+ * @return \google\protobuf\compiler\CodeGeneratorRequest
+ */
+ public function clearParameter(){
+ return $this->_clear(2);
+ }
+
+ /**
+ * Get <parameter> value
+ *
+ * @return string
+ */
+ public function getParameter(){
+ return $this->_get(2);
+ }
+
+ /**
+ * Set <parameter> value
+ *
+ * @param string $value
+ * @return \google\protobuf\compiler\CodeGeneratorRequest
+ */
+ public function setParameter( $value){
+ return $this->_set(2, $value);
+ }
+
+ /**
+ * Check if <proto_file> has a value
+ *
+ * @return boolean
+ */
+ public function hasProtoFile(){
+ return $this->_has(15);
+ }
+
+ /**
+ * Clear <proto_file> value
+ *
+ * @return \google\protobuf\compiler\CodeGeneratorRequest
+ */
+ public function clearProtoFile(){
+ return $this->_clear(15);
+ }
+
+ /**
+ * Get <proto_file> value
+ *
+ * @param int $idx
+ * @return \google\protobuf\FileDescriptorProto
+ */
+ public function getProtoFile($idx = NULL){
+ return $this->_get(15, $idx);
+ }
+
+ /**
+ * Set <proto_file> value
+ *
+ * @param \google\protobuf\FileDescriptorProto $value
+ * @return \google\protobuf\compiler\CodeGeneratorRequest
+ */
+ public function setProtoFile(\google\protobuf\FileDescriptorProto $value, $idx = NULL){
+ return $this->_set(15, $value, $idx);
+ }
+
+ /**
+ * Get all elements of <proto_file>
+ *
+ * @return \google\protobuf\FileDescriptorProto[]
+ */
+ public function getProtoFileList(){
+ return $this->_get(15);
+ }
+
+ /**
+ * Add a new element to <proto_file>
+ *
+ * @param \google\protobuf\FileDescriptorProto $value
+ * @return \google\protobuf\compiler\CodeGeneratorRequest
+ */
+ public function addProtoFile(\google\protobuf\FileDescriptorProto $value){
+ return $this->_add(15, $value);
+ }
+
+ }
+}
+
+namespace google\protobuf\compiler {
+
+ class CodeGeneratorResponse extends \DrSlump\Protobuf\Message {
+
+ /** @var \DrSlump\Protobuf\Descriptor */
+ protected static $__descriptor;
+ /** @var \Closure[] */
+ protected static $__extensions = array();
+
+ public static function descriptor(\DrSlump\Protobuf\Descriptor $descriptor = NULL)
+ {
+ if (NULL !== $descriptor) {
+ self::$__descriptor = $descriptor;
+ return self::$__descriptor;
+ }
+
+ if (!self::$__descriptor) {
+ $descriptor = new \DrSlump\Protobuf\Descriptor("\google\protobuf\compiler\CodeGeneratorResponse");
+
+ // optional error = 1
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 1;
+ $f->name = "error";
+ $f->nameOrig = "error";
+ $f->type = 9;
+ $f->rule = 1;
+ $descriptor->addField($f);
+
+ // repeated .google.protobuf.compiler.CodeGeneratorResponse.File file = 15
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 15;
+ $f->name = "file";
+ $f->nameOrig = "file";
+ $f->type = 11;
+ $f->rule = 3;
+ $f->reference = "\google\protobuf\compiler\CodeGeneratorResponse\File";
+ $descriptor->addField($f);
+
+ foreach (self::$__extensions as $cb) {
+ $descriptor->addField($cb(), true);
+ }
+
+ self::$__descriptor = $descriptor;
+ }
+
+ return self::$__descriptor;
+ }
+
+ /** @var string */
+ public $error = null;
+
+ /** @var \google\protobuf\compiler\CodeGeneratorResponse\File[] */
+ public $file = array();
+
+
+ /**
+ * Check if <error> has a value
+ *
+ * @return boolean
+ */
+ public function hasError(){
+ return $this->_has(1);
+ }
+
+ /**
+ * Clear <error> value
+ *
+ * @return \google\protobuf\compiler\CodeGeneratorResponse
+ */
+ public function clearError(){
+ return $this->_clear(1);
+ }
+
+ /**
+ * Get <error> value
+ *
+ * @return string
+ */
+ public function getError(){
+ return $this->_get(1);
+ }
+
+ /**
+ * Set <error> value
+ *
+ * @param string $value
+ * @return \google\protobuf\compiler\CodeGeneratorResponse
+ */
+ public function setError( $value){
+ return $this->_set(1, $value);
+ }
+
+ /**
+ * Check if <file> has a value
+ *
+ * @return boolean
+ */
+ public function hasFile(){
+ return $this->_has(15);
+ }
+
+ /**
+ * Clear <file> value
+ *
+ * @return \google\protobuf\compiler\CodeGeneratorResponse
+ */
+ public function clearFile(){
+ return $this->_clear(15);
+ }
+
+ /**
+ * Get <file> value
+ *
+ * @param int $idx
+ * @return \google\protobuf\compiler\CodeGeneratorResponse\File
+ */
+ public function getFile($idx = NULL){
+ return $this->_get(15, $idx);
+ }
+
+ /**
+ * Set <file> value
+ *
+ * @param \google\protobuf\compiler\CodeGeneratorResponse\File $value
+ * @return \google\protobuf\compiler\CodeGeneratorResponse
+ */
+ public function setFile(\google\protobuf\compiler\CodeGeneratorResponse\File $value, $idx = NULL){
+ return $this->_set(15, $value, $idx);
+ }
+
+ /**
+ * Get all elements of <file>
+ *
+ * @return \google\protobuf\compiler\CodeGeneratorResponse\File[]
+ */
+ public function getFileList(){
+ return $this->_get(15);
+ }
+
+ /**
+ * Add a new element to <file>
+ *
+ * @param \google\protobuf\compiler\CodeGeneratorResponse\File $value
+ * @return \google\protobuf\compiler\CodeGeneratorResponse
+ */
+ public function addFile(\google\protobuf\compiler\CodeGeneratorResponse\File $value){
+ return $this->_add(15, $value);
+ }
+
+ }
+}
+
+namespace google\protobuf\compiler\CodeGeneratorResponse {
+
+ class File extends \DrSlump\Protobuf\Message {
+
+ /** @var \DrSlump\Protobuf\Descriptor */
+ protected static $__descriptor;
+ /** @var \Closure[] */
+ protected static $__extensions = array();
+
+ public static function descriptor(\DrSlump\Protobuf\Descriptor $descriptor = NULL)
+ {
+ if (NULL !== $descriptor) {
+ self::$__descriptor = $descriptor;
+ return self::$__descriptor;
+ }
+
+ if (!self::$__descriptor) {
+ $descriptor = new \DrSlump\Protobuf\Descriptor("\google\protobuf\compiler\CodeGeneratorResponse\File");
+
+ // optional name = 1
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 1;
+ $f->name = "name";
+ $f->nameOrig = "name";
+ $f->type = 9;
+ $f->rule = 1;
+ $descriptor->addField($f);
+
+ // optional insertion_point = 2
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 2;
+ $f->name = "insertion_point";
+ $f->type = 9;
+ $f->rule = 1;
+ $descriptor->addField($f);
+
+ // optional content = 15
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 15;
+ $f->name = "content";
+ $f->nameOrig = "content";
+ $f->type = 9;
+ $f->rule = 1;
+ $descriptor->addField($f);
+
+ foreach (self::$__extensions as $cb) {
+ $descriptor->addField($cb(), true);
+ }
+
+ self::$__descriptor = $descriptor;
+ }
+
+ return self::$__descriptor;
+ }
+
+ /** @var string */
+ public $name = null;
+
+ /** @var string */
+ public $insertion_point = null;
+
+ /** @var string */
+ public $content = null;
+
+
+ /**
+ * Check if <name> has a value
+ *
+ * @return boolean
+ */
+ public function hasName(){
+ return $this->_has(1);
+ }
+
+ /**
+ * Clear <name> value
+ *
+ * @return \google\protobuf\compiler\CodeGeneratorResponse\File
+ */
+ public function clearName(){
+ return $this->_clear(1);
+ }
+
+ /**
+ * Get <name> value
+ *
+ * @return string
+ */
+ public function getName(){
+ return $this->_get(1);
+ }
+
+ /**
+ * Set <name> value
+ *
+ * @param string $value
+ * @return \google\protobuf\compiler\CodeGeneratorResponse\File
+ */
+ public function setName( $value){
+ return $this->_set(1, $value);
+ }
+
+ /**
+ * Check if <insertion_point> has a value
+ *
+ * @return boolean
+ */
+ public function hasInsertionPoint(){
+ return $this->_has(2);
+ }
+
+ /**
+ * Clear <insertion_point> value
+ *
+ * @return \google\protobuf\compiler\CodeGeneratorResponse\File
+ */
+ public function clearInsertionPoint(){
+ return $this->_clear(2);
+ }
+
+ /**
+ * Get <insertion_point> value
+ *
+ * @return string
+ */
+ public function getInsertionPoint(){
+ return $this->_get(2);
+ }
+
+ /**
+ * Set <insertion_point> value
+ *
+ * @param string $value
+ * @return \google\protobuf\compiler\CodeGeneratorResponse\File
+ */
+ public function setInsertionPoint( $value){
+ return $this->_set(2, $value);
+ }
+
+ /**
+ * Check if <content> has a value
+ *
+ * @return boolean
+ */
+ public function hasContent(){
+ return $this->_has(15);
+ }
+
+ /**
+ * Clear <content> value
+ *
+ * @return \google\protobuf\compiler\CodeGeneratorResponse\File
+ */
+ public function clearContent(){
+ return $this->_clear(15);
+ }
+
+ /**
+ * Get <content> value
+ *
+ * @return string
+ */
+ public function getContent(){
+ return $this->_get(15);
+ }
+
+ /**
+ * Set <content> value
+ *
+ * @param string $value
+ * @return \google\protobuf\compiler\CodeGeneratorResponse\File
+ */
+ public function setContent( $value){
+ return $this->_set(15, $value);
+ }
+
+ }
+}
+
--- /dev/null
+++ b/lib/Protobuf-PHP/library/DrSlump/Protobuf/Compiler/protos/plugin.proto
@@ -1,1 +1,146 @@
+// Protocol Buffers - Google's data interchange format
+// Copyright 2008 Google Inc. All rights reserved.
+// http://code.google.com/p/protobuf/
+//
+// Redistribution and use in source and binary forms, with or without
+// modification, are permitted provided that the following conditions are
+// met:
+//
+// * Redistributions of source code must retain the above copyright
+// notice, this list of conditions and the following disclaimer.
+// * Redistributions in binary form must reproduce the above
+// copyright notice, this list of conditions and the following disclaimer
+// in the documentation and/or other materials provided with the
+// distribution.
+// * Neither the name of Google Inc. nor the names of its
+// contributors may be used to endorse or promote products derived from
+// this software without specific prior written permission.
+//
+// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS
+// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT
+// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR
+// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT
+// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL,
+// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT
+// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE,
+// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY
+// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT
+// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE
+// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+// Author: kenton@google.com (Kenton Varda)
+//
+// WARNING: The plugin interface is currently EXPERIMENTAL and is subject to
+// change.
+//
+// protoc (aka the Protocol Compiler) can be extended via plugins. A plugin is
+// just a program that reads a CodeGeneratorRequest from stdin and writes a
+// CodeGeneratorResponse to stdout.
+//
+// Plugins written using C++ can use google/protobuf/compiler/plugin.h instead
+// of dealing with the raw protocol defined here.
+//
+// A plugin executable needs only to be placed somewhere in the path. The
+// plugin should be named "protoc-gen-$NAME", and will then be used when the
+// flag "--${NAME}_out" is passed to protoc.
+
+package google.protobuf.compiler;
+
+import "descriptor.proto";
+
+// An encoded CodeGeneratorRequest is written to the plugin's stdin.
+message CodeGeneratorRequest {
+ // The .proto files that were explicitly listed on the command-line. The
+ // code generator should generate code only for these files. Each file's
+ // descriptor will be included in proto_file, below.
+ repeated string file_to_generate = 1;
+
+ // The generator parameter passed on the command-line.
+ optional string parameter = 2;
+
+ // FileDescriptorProtos for all files in files_to_generate and everything
+ // they import. The files will appear in topological order, so each file
+ // appears before any file that imports it.
+ //
+ // protoc guarantees that all proto_files will be written after
+ // the fields above, even though this is not technically guaranteed by the
+ // protobuf wire format. This theoretically could allow a plugin to stream
+ // in the FileDescriptorProtos and handle them one by one rather than read
+ // the entire set into memory at once. However, as of this writing, this
+ // is not similarly optimized on protoc's end -- it will store all fields in
+ // memory at once before sending them to the plugin.
+ repeated FileDescriptorProto proto_file = 15;
+}
+
+// The plugin writes an encoded CodeGeneratorResponse to stdout.
+message CodeGeneratorResponse {
+ // Error message. If non-empty, code generation failed. The plugin process
+ // should exit with status code zero even if it reports an error in this way.
+ //
+ // This should be used to indicate errors in .proto files which prevent the
+ // code generator from generating correct code. Errors which indicate a
+ // problem in protoc itself -- such as the input CodeGeneratorRequest being
+ // unparseable -- should be reported by writing a message to stderr and
+ // exiting with a non-zero status code.
+ optional string error = 1;
+
+ // Represents a single generated file.
+ message File {
+ // The file name, relative to the output directory. The name must not
+ // contain "." or ".." components and must be relative, not be absolute (so,
+ // the file cannot lie outside the output directory). "/" must be used as
+ // the path separator, not "\".
+ //
+ // If the name is omitted, the content will be appended to the previous
+ // file. This allows the generator to break large files into small chunks,
+ // and allows the generated text to be streamed back to protoc so that large
+ // files need not reside completely in memory at one time. Note that as of
+ // this writing protoc does not optimize for this -- it will read the entire
+ // CodeGeneratorResponse before writing files to disk.
+ optional string name = 1;
+
+ // If non-empty, indicates that the named file should already exist, and the
+ // content here is to be inserted into that file at a defined insertion
+ // point. This feature allows a code generator to extend the output
+ // produced by another code generator. The original generator may provide
+ // insertion points by placing special annotations in the file that look
+ // like:
+ // @@protoc_insertion_point(NAME)
+ // The annotation can have arbitrary text before and after it on the line,
+ // which allows it to be placed in a comment. NAME should be replaced with
+ // an identifier naming the point -- this is what other generators will use
+ // as the insertion_point. Code inserted at this point will be placed
+ // immediately above the line containing the insertion point (thus multiple
+ // insertions to the same point will come out in the order they were added).
+ // The double-@ is intended to make it unlikely that the generated code
+ // could contain things that look like insertion points by accident.
+ //
+ // For example, the C++ code generator places the following line in the
+ // .pb.h files that it generates:
+ // // @@protoc_insertion_point(namespace_scope)
+ // This line appears within the scope of the file's package namespace, but
+ // outside of any particular class. Another plugin can then specify the
+ // insertion_point "namespace_scope" to generate additional classes or
+ // other declarations that should be placed in this scope.
+ //
+ // Note that if the line containing the insertion point begins with
+ // whitespace, the same whitespace will be added to every line of the
+ // inserted text. This is useful for languages like Python, where
+ // indentation matters. In these languages, the insertion point comment
+ // should be indented the same amount as any inserted code will need to be
+ // in order to work correctly in that context.
+ //
+ // The code generator that generates the initial file and the one which
+ // inserts into it must both run as part of a single invocation of protoc.
+ // Code generators are executed in the order in which they appear on the
+ // command line.
+ //
+ // If |insertion_point| is present, |name| must also be present.
+ optional string insertion_point = 2;
+
+ // The file contents.
+ optional string content = 15;
+ }
+ repeated File file = 15;
+}
+
--- /dev/null
+++ b/lib/Protobuf-PHP/library/DrSlump/Protobuf/Descriptor.php
@@ -1,1 +1,121 @@
+<?php
+namespace DrSlump\Protobuf;
+
+use DrSlump\Protobuf;
+
+class Descriptor
+{
+ /** @var String Holds the class name of the message */
+ protected $class;
+
+ /** @var String Holds the original proto name */
+ protected $name;
+
+ /** @var \DrSlump\Protobuf\Field[] */
+ protected $fields = array();
+
+ /** @var array - Cache the relation between names and tags */
+ protected $names = array();
+
+
+ /**
+ * @param string $class
+ * @param string $name
+ */
+ public function __construct($class, $name = null)
+ {
+ $this->class = trim($class, '\\ ');
+ $this->name = $name ? trim($name, '. ') : NULL;
+ }
+
+ /**
+ * @return string
+ */
+ public function getClass()
+ {
+ return $this->class;
+ }
+
+ /**
+ * @return string|null
+ */
+ public function getName()
+ {
+ return $this->name;
+ }
+
+ /**
+ * Obtain the list of fields in the message
+ *
+ * @return \DrSlump\Protobuf\Field[]
+ */
+ public function getFields()
+ {
+ return $this->fields;
+ }
+
+ /**
+ * Adds a field to the message
+ *
+ * @param \DrSlump\Protobuf\Field $field
+ * @param bool $isExtension
+ */
+ public function addField(Protobuf\Field $field, $isExtension = false)
+ {
+ $field->extension = $isExtension;
+ $this->fields[ $field->number ] = $field;
+ }
+
+ /**
+ * Obtain a field descriptor by its tag number
+ *
+ * @param int $tag
+ * @return \DrSlump\Protobuf\Field | NULL
+ */
+ public function getField($tag)
+ {
+ return isset($this->fields[$tag])
+ ? $this->fields[$tag]
+ : NULL;
+ }
+
+ /**
+ * Obtain a field descriptor by its name
+ *
+ * @param string $name
+ * @return \DrSlump\Protobuf\Field | NULL
+ */
+ public function getFieldByName($name)
+ {
+ // Check cached map
+ if (isset($this->names[$name])) {
+ return $this->getField($this->names[$name]);
+ }
+
+ // Loop thru all fields to find it
+ foreach ($this->fields as $tag=>$field) {
+ // Cache it for next calls
+ $fname = $field->getName();
+ $this->names[$fname] = $tag;
+
+ if ($name === $fname) {
+ return $field;
+ }
+ }
+
+ return null;
+ }
+
+ /**
+ * Check if the given tag number matches a field
+ *
+ * @param int $tag
+ * @return bool
+ */
+ public function hasField($tag)
+ {
+ return isset($this->fields[$tag]);
+ }
+}
+
--- /dev/null
+++ b/lib/Protobuf-PHP/library/DrSlump/Protobuf/Exception.php
@@ -1,1 +1,8 @@
+<?php
+namespace DrSlump\Protobuf;
+
+class Exception extends \Exception
+{
+
+}
--- /dev/null
+++ b/lib/Protobuf-PHP/library/DrSlump/Protobuf/Field.php
@@ -1,1 +1,86 @@
+<?php
+namespace DrSlump\Protobuf;
+
+use DrSlump\Protobuf;
+
+class Field
+{
+ public $number;
+ public $name;
+ public $type = Protobuf::TYPE_UNKNOWN;
+ public $rule = Protobuf::RULE_OPTIONAL;
+ public $reference;
+ public $default;
+ public $packed = false;
+ public $extension = false;
+
+ public function __construct(array $opts = array())
+ {
+ if (!empty($opts)) {
+ if (isset($opts['number'])) $this->number = (int)$opts['number'];
+ if (isset($opts['name'])) $this->name = $opts['name'];
+ if (isset($opts['type'])) $this->type = (int)$opts['type'];
+ if (isset($opts['rule'])) $this->rule = (int)$opts['rule'];
+ if (isset($opts['packed'])) $this->packed = (bool)$opts['packed'];
+ if (isset($opts['reference'])) $this->reference = $opts['reference'];
+ if (isset($opts['default'])) $this->default = $opts['default'];
+ if (isset($opts['extension'])) $this->extension = (bool)$opts['extension'];
+ }
+ }
+
+ public function getNumber()
+ {
+ return $this->number;
+ }
+
+ public function getType()
+ {
+ return $this->type;
+ }
+
+ public function getName()
+ {
+ return $this->name;
+ }
+
+ public function getReference()
+ {
+ return $this->reference;
+ }
+
+ public function getDefault()
+ {
+ return $this->default;
+ }
+
+ public function hasDefault()
+ {
+ return $this->default !== NULL;
+ }
+
+ public function isOptional()
+ {
+ return $this->rule === Protobuf::RULE_OPTIONAL;
+ }
+
+ public function isRequired()
+ {
+ return $this->rule === Protobuf::RULE_REQUIRED;
+ }
+
+ public function isRepeated()
+ {
+ return $this->rule === Protobuf::RULE_REPEATED;
+ }
+
+ public function isPacked()
+ {
+ return $this->packed;
+ }
+
+ public function isExtension()
+ {
+ return $this->extension;
+ }
+}
--- /dev/null
+++ b/lib/Protobuf-PHP/library/DrSlump/Protobuf/Message.php
@@ -1,1 +1,377 @@
-
+<?php
+
+namespace DrSlump\Protobuf;
+
+use DrSlump\Protobuf;
+
+abstract class Message implements \ArrayAccess
+{
+ /** @var \Closure[] */
+ static protected $__extensions = array();
+
+ /** @var \DrSlump\Protobuf\Descriptor */
+ protected $_descriptor;
+ /** @var array Store data for extension fields */
+ protected $_extensions = array();
+ /** @var array Store data for unknown values */
+ protected $_unknown = array();
+
+ /**
+ * @static
+ * @abstract
+ * @return \DrSlump\Protobuf\Descriptor
+ */
+ public static function descriptor()
+ {
+ throw new \BadMethodCallException('This method should be implemented in inherited classes');
+ }
+
+ /**
+ * Register an extension configuration callback
+ *
+ * @static
+ * @param \Closure $fn
+ */
+ public static function extension(\Closure $fn)
+ {
+ static::$__extensions[] = $fn;
+ }
+
+ /**
+ * @param string $data
+ */
+ public function __construct($data = null)
+ {
+ // Cache the descriptor instance
+ $this->_descriptor = Protobuf::getRegistry()->getDescriptor($this);
+
+ // Assign default values to extensions
+ foreach ($this->_descriptor->getFields() as $f) {
+ if ($f->isExtension() && $f->hasDefault()) {
+ $this->_extensions[$f->getName()] = $f->getDefault();
+ }
+ }
+
+ if (NULL !== $data) {
+ $this->parse($data);
+ }
+ }
+
+ // Implements ArrayAccess for extensions and unknown fields
+
+ public function offsetExists($offset)
+ {
+ if (is_numeric($offset)) {
+ return $this->_has($offset);
+ } else {
+ return $this->hasExtension($offset);
+ }
+ }
+
+ public function offsetSet($offset, $value)
+ {
+ if (is_numeric($offset)) {
+ $this->_set($offset, $value);
+ } else {
+ $this->setExtension($offset, $value);
+ }
+ }
+
+ public function offsetGet( $offset )
+ {
+ if (is_numeric($offset)) {
+ return $this->_get($offset);
+ } else {
+ return $this->getExtension($offset);
+ }
+ }
+
+ public function offsetUnset( $offset )
+ {
+ if (is_numeric($offset)) {
+ $this->_clear($offset);
+ } else {
+ $this->clearExtension($offset);
+ }
+ }
+
+ /**
+ * Parse the given data to hydrate the object
+ *
+ * @param string $data
+ * @param CodecInterface|null $codec
+ */
+ public function parse($data, Protobuf\CodecInterface $codec = null)
+ {
+ $codec = Protobuf::getCodec($codec);
+ $codec->decode($this, $data);
+ }
+
+ /**
+ * Serialize the current object data
+ *
+ * @param CodecInterface|null $codec
+ * @return string
+ */
+ public function serialize(Protobuf\CodecInterface $codec = null)
+ {
+ $codec = Protobuf::getCodec($codec);
+ return $codec->encode($this);
+ }
+
+
+ /**
+ * Checks if the given tag number is set
+ *
+ * @param int $tag
+ * @return bool
+ */
+ public function _has($tag)
+ {
+ if ($this->_descriptor->hasField($tag)) {
+ $f = $this->_descriptor->getField($tag);
+ $name = $f->getName();
+
+ if ($f->isExtension()) {
+ return $f->isRepeated()
+ ? count($this->_extensions[$name]) > 0
+ : $this->_extensions[$name] !== NULL;
+ } else {
+ return $f->isRepeated()
+ ? count($this->$name) > 0
+ : $this->$name !== NULL;
+ }
+ }
+
+ return false;
+ }
+
+ /**
+ * Get the value by tag number
+ *
+ * @param int $tag
+ * @param int|null $idx
+ * @return mixed
+ */
+ public function _get($tag, $idx = null)
+ {
+ $f = $this->_descriptor->getField($tag);
+
+ if (!$f) {
+ return null;
+ }
+
+ $name = $f->getName();
+
+ if (!$f->isExtension()) {
+
+ return $idx !== NULL
+ ? $this->{$name}[$idx]
+ : $this->$name;
+
+ } else {
+
+ return $idx !== NULL
+ ? $this->_extensions[$name][$idx]
+ : $this->_extensions[$name];
+
+ }
+
+ }
+
+ /**
+ * Sets the value by tag number
+ *
+ * @throws \Exception If trying to set an unknown field
+ * @param int $tag
+ * @param mixed $value
+ * @param int|null $idx
+ * @return \DrSlump\Protobuf\Message - Fluent interface
+ */
+ public function _set($tag, $value, $idx = null)
+ {
+ $f = $this->_descriptor->getField($tag);
+
+ if (!$f) {
+ throw new \Exception('Unknown fields not supported');
+ }
+
+ $name = $f->getName();
+ if (!$f->isExtension()) {
+
+ if ($idx === NULL) {
+ $this->$name = $value;
+ } else {
+ $this->{$name}[$idx] = $value;
+ }
+
+ } else {
+ if ($idx === NULL) {
+ $this->_extensions[$name] = $value;
+ } else {
+ $this->_extensions[$name][$idx] = $value;
+ }
+ }
+
+ return $this;
+ }
+
+ /**
+ * Adds a new value to a repeated field by tag number
+ *
+ * @throws \Exception If trying to modify an unknown field
+ * @param int $tag
+ * @param mixed $value
+ * @return Message
+ */
+ public function _add($tag, $value)
+ {
+ $f = $this->_descriptor->getField($tag);
+
+ if (!$f) {
+ throw new \Exception('Unknown fields not supported');
+ }
+
+ $name = $f->getName();
+ if (!$f->isExtension()) {
+ $this->{$name}[] = $value;
+ } else {
+ $this->_extensions[$name][] = $value;
+ }
+
+ return $this;
+ }
+
+ /**
+ * Clears/Resets a field by tag number
+ *
+ * @throws \Exception If trying to modify an unknown field
+ * @param int $tag
+ * @return \DrSlump\Protobuf\Message - Fluent interface
+ */
+ public function _clear($tag)
+ {
+ $f = $this->_descriptor->getField($tag);
+
+ if (!$f) {
+ throw new \Exception('Unknown fields not supported');
+ }
+
+ $name = $f->getName();
+ if (!$f->isExtension()) {
+ $this->$name = $f->isRepeated()
+ ? array()
+ : NULL;
+ } else {
+ $this->_extensions[$name] = $f->isRepeated()
+ ? array()
+ : NULL;
+ }
+
+ return $this;
+ }
+
+ // Extensions public methods.
+ // @todo Check if extension name is defined
+
+ /**
+ * Checks if an extension field is set
+ *
+ * @param string $extname
+ * @return bool
+ */
+ public function hasExtension($extname)
+ {
+ return isset($this->_extensions[$extname]);
+ }
+
+ /**
+ * Get the value of an extension field
+ *
+ * @param string $extname
+ * @param int|null $idx
+ * @return mixed
+ */
+ public function getExtension($extname, $idx = null)
+ {
+ if (!isset($this->_extensions[$extname])) return NULL;
+
+ return $idx === NULL
+ ? $this->_extensions[$extname]
+ : $this->_extensions[$extname][$idx];
+ }
+
+ /**
+ * Get all the values of a repeated extension field
+ *
+ * @param string $extname
+ * @return array
+ */
+ public function getExtensionList($extname)
+ {
+ return isset($this->_extensions[$extname])
+ ? $this->_extensions[$extname]
+ : array();
+ }
+
+ /**
+ * Set the value for an extension field
+ *
+ * @param string $extname
+ * @param mixed $value
+ * @param int|null $idx
+ * @return \DrSlump\Protobuf\Message - Fluent Interface
+ */
+ public function setExtension($extname, $value, $idx = null)
+ {
+ if (NULL !== $idx) {
+ if (empty($this->_extensions)) {
+ $this->_extensions[$extname] = array();
+ }
+ $this->_extensions[$extname][$idx] = $value;
+ }
+
+ $this->_extensions[$extname] = $value;
+
+ return $this;
+ }
+
+ /**
+ * Adds a value to repeated extension field
+ *
+ * @param string $extname
+ * @param mixed $value
+ * @return \DrSlump\Protobuf\Message - Fluent Interface
+ */
+ public function addExtension($extname, $value)
+ {
+ $this->_extensions[$extname][] = $value;
+ }
+
+ /**
+ * @param $extname
+ * @return void
+ */
+ public function clearExtension($extname)
+ {
+ unset($this->_extensions[$extname]);
+ }
+
+
+ public function addUnknown(Unknown $unknown)
+ {
+ $this->_unknown[] = $unknown;
+ }
+
+ public function getUnknown()
+ {
+ return $this->_unknown;
+ }
+
+ public function clearUnknown()
+ {
+ $this->_unknown = array();
+ }
+
+}
+
--- /dev/null
+++ b/lib/Protobuf-PHP/library/DrSlump/Protobuf/Registry.php
@@ -1,1 +1,75 @@
+<?php
+namespace DrSlump\Protobuf;
+
+use DrSlump\Protobuf;
+
+/**
+ * Keeps instances of the different message descriptors used.
+ *
+ */
+class Registry
+{
+ /** @var array */
+ protected $descriptors = array();
+
+ /**
+ * @param string|\DrSlump\Protobuf\Message $message
+ * @param \DrSlump\Protobuf\Descriptor $descriptor
+ */
+ public function setDescriptor($message, Descriptor $descriptor)
+ {
+ $message = is_object($message) ? get_class($message) : $message;
+ $message = ltrim($message, '\\');
+
+ $this->descriptors[$message] = $descriptor;
+ }
+
+ /**
+ * Obtains the descriptor for the given message class, obtaining
+ * it if not yet loaded.
+ *
+ * @param string|\DrSlump\Protobuf\Message $message
+ * @return \DrSlump\Protobuf\Descriptor
+ */
+ public function getDescriptor($message)
+ {
+ $message = is_object($message) ? get_class($message) : $message;
+ $message = ltrim($message, '\\');
+
+ // Build a descriptor for the message
+ if (!isset($this->descriptors[$message])) {
+ $class = '\\' . $message;
+ if (!class_exists($class)) {
+ throw Protobuf\Exception('Message class "' . $class . '" not available');
+ }
+
+ $this->descriptors[$message] = $class::descriptor();
+ }
+
+ return $this->descriptors[$message];
+ }
+
+ /**
+ * @param string|\DrSlump\Protobuf\Message $message
+ * @return bool
+ */
+ public function hasDescriptor($message)
+ {
+ $message = is_object($message) ? get_class($message) : $message;
+ $message = ltrim($message, '\\');
+
+ return isset($this->descriptors[$message]);
+ }
+
+ /**
+ * @param string|\DrSlump\Protobuf\Message $message
+ */
+ public function unsetDescriptor($message)
+ {
+ $message = is_object($message) ? get_class($message) : $message;
+ $message = ltrim($message, '\\');
+
+ unset($this->descriptors[$message]);
+ }
+}
--- /dev/null
+++ b/lib/Protobuf-PHP/library/DrSlump/Protobuf/Unknown.php
@@ -1,1 +1,10 @@
+<?php
+namespace DrSlump\Protobuf;
+
+abstract class Unknown
+{
+ public $tag = 0;
+ public $data = null;
+}
+
--- /dev/null
+++ b/lib/Protobuf-PHP/man/protobuf-php.3.ronn
@@ -1,1 +1,118 @@
+protobuf-php(3) -- The framework
+================================
+## SYNOPSIS
+
+ <?php
+ require_once 'DrSlump\Protobuf.php';
+
+ use DrSlump\Protobuf;
+
+ $data = file_get_contents('data.pb');
+ $person = new Tutorial\Person($data);
+ echo $person->getName();
+
+
+## DESCRIPTION
+
+Protobuf-PHP is a library to generate, parse and serialize data structures
+compatible with Google's Protocol Buffers using the PHP language.
+
+## CODECS
+
+The library is designed to work with a pluggable mechanism for encoding and decoding
+messages, allowing it to be used not only to communicate using the standard binary
+format but also with Json or XML based formats.
+
+You can create your own codecs by either extending a provided one or implementing the
+`Protobuf\CodecInterface`. Creating custom codecs offers the possibility to use
+Protobuf-PHP code generation tool to work with legacy formats or even as a simple
+way to interact with database adapters.
+
+### Standard Binary
+
+This is the standard binary format supported by the official libraries distributed
+by Google. It's pretty much compatible with the official implementations although
+there are some known issues, mostly regarding big integer numbers, which are documented
+in the readme file that comes with the library.
+
+### Standard TextFormat
+
+The official libraries also support a text based format for debugging purposes. The
+current implementation of this codec only supports encoding or serialization.
+
+### PhpArray
+
+This is more of an internal codec to ease the implementation of some others. It is
+able to serializa message objects to PHP's associative arrays and intantiate message
+objects from them.
+
+Since most serialization libraries in PHP will natively support associative arrays, this
+codec can be used as an easy way to incorporate those formats for their use
+with Protobuf messages. The Json and XML codecs are examples of this use case.
+
+### JSON
+
+It allows to generate or consume JSON formatted strings, which is a very popular
+format for REST based web services for example. This codec can be used to communicate
+with JavaScript in the browser or with third party REST web services.
+
+### ProtoJson
+
+[ProtoJson](https://github.com/drslump/ProtoJson) allows to apply some payload
+minification strategies when working with JSON formatted messages. Taking advantatge
+of Protobuf's property names mapping to a integer number, it offers two encoding
+variants (_TagMap_ and _Indexed_) that use that number instead of the field name
+as key in the messages to reduce the total size of the payload.
+
+### XML
+
+A very simple codec to work with XML based messages. It has no knowledge of namespaces
+and other advanced XML features but should be enough to integrate with third parties
+that are restricted to simple XML payloads. It can also serve as a base for more
+customized integrations, by extendind this codec to consume and generate XML messages
+specific to your service.
+
+
+
+## ANNOTATED MESSAGES
+
+While the most common use case is to use the protoc-gen-php(1) `protoc` plugin to
+generate source code representing the messages defined in .proto files, it's also
+possible to define messages at runtime without the code generation step.
+
+An easy way to define messages directly in your code is to use the `Protobuf\AnnotatedMessage`
+abstract class, which allows to annotate your classes so that the _codecs_ know how
+to parse and serialize those messages.
+
+ class Person extends \DrSlump\Protobuf\AnnotatedMessage {
+ /** @protobuf(tag=1, type=string, required) */
+ public $name;
+ /** @protobuf(tag=2, type=int32, required) */
+ public $id;
+ /** @protobuf(tag=3, type=string, optional) */
+ public $email;
+ /** @protobuf(tag=4, repeated, type=message, reference=Person) */
+ public $friends = array();
+ }
+
+
+## EXAMPLES
+
+
+
+## BUGS
+
+Please report bugs using GitHub's issue tracker at http://github.com/drslump/protobuf-php/issues
+
+
+## COPYRIGHT
+
+Protobuf for PHP is Copyright (C) 2011 Ivan -DrSlump- Montes <http://pollinimini.net>
+
+
+## SEE ALSO
+
+protoc-gen-php(1), protobuf-php(5),
+<http://github.com/drslump/protobuf-php>
+
--- /dev/null
+++ b/lib/Protobuf-PHP/man/protobuf-php.5.ronn
@@ -1,1 +1,60 @@
+protobuf-php(5) -- Proto files
+================================
+## SYNOPSIS
+
+Protobuf for PHP supports a few custom options for proto files.
+
+
+## DESCRIPTION
+
+Proto files processed with Protobuf for PHP can use a number of custom options
+that affect the generated source code.
+
+ * `php.suffix` <string>:
+ Sets a custom suffix for the generated PHP files. By default ".php" is used.
+
+ * `php.namespace` <string>:
+ Defines the namespace to use for the generated PHP classes.
+
+ * `php.package` <string>:
+ An alias for `php.namespace`
+
+ * `php.multifile` <boolean>:
+ By default a single PHP file is generated for each Proto file processed,
+ including in it all the messages, enums and extensions defined in the proto
+ definition. If this option is set to `true` then each message and enum is
+ generated in a separate file, following PEAR's conventions, and if extensions
+ are pressent in the proto definition a file named after the proto file with the
+ suffix "-extensions" will contain them.
+
+ * `php.generic_services` <boolean>:
+ By default no service interfaces will be generated. If this option is set
+ to true then Interfaces will be created for each `service` definition found,
+ including a method named after each `rpc` entry.
+
+
+
+## EXAMPLES ##
+
+ option (php.suffix) = ".pb.php"
+ option (php.namespace) = "MyOrg.Protos"
+ option (php.multifile) = true
+ option (php.generic_services) = true
+
+
+## BUGS ##
+
+Please report bugs using GitHub's issue tracker at http://github.com/drslump/protobuf-php/issues
+
+
+## COPYRIGHT ##
+
+Protobuf for PHP is Copyright (C) 2011 Ivan -DrSlump- Montes <http://pollinimini.net>
+
+
+## SEE ALSO
+
+protoc-gen-php(1), protobuf-php(3),
+<http://github.com/drslump/protobuf-php>
+
--- /dev/null
+++ b/lib/Protobuf-PHP/man/protoc-gen-php.1.ronn
@@ -1,1 +1,99 @@
+protoc-gen-php(1) -- protoc compiler plugin
+===========================================
+## SYNOPSIS
+
+ `protoc-gen-php` [`-v`] [`-o` _directory_] [`-i` _directory_] <file>...
+
+
+## DESCRIPTION
+
+**protoc-gen-php** is a Google's Protocol Buffers compiler plugin
+for the `protoc` tool. It generates PHP classes compatible with
+**Protobuf for PHP** from .proto files.
+
+
+## REQUIREMENTS ##
+
+**protoc-gen-php** is written in PHP using features first found on
+PHP 5.3. It also requires the Console_CommandLine package from Pear.
+
+Additionally you'll also need to have a working copy of Google Protocol
+Buffers's _protoc_ command, version 2.3 or above, available on your path.
+
+
+## OPTIONS ##
+
+The command accepts the following command-line options (switches).
+
+ * `-v`, `--verbose`:
+ Enables verbose mode. Additional information will be printed when
+ processing the files.
+
+ * `-h`, `--help`:
+ Prints the usage help message and quits.
+
+ * `-i` _directory_, `--include`=_directory_:
+ Tells the protoc compiler to look into that directory when resolving
+ import statements. Note that you can use this switch more than once
+ to configure multiple directories.
+
+ * `-o` _directory_, `--out`=_directory_:
+ Tells the protoc compiler to create generated files in the given
+ directory. If not set it will create the files in the working
+ directory.
+
+ * `--protoc`=_path to protoc binary_:
+ If you don't happen to have the `protoc` binary in your path, you can
+ use this option to indicate a path to it.
+
+ * `--skip-imported`
+ Flags the compiler to only generate source code for the proto file
+ explicitely given on the command line. This means that imported files
+ will not be generated when using this option.
+
+ * `--comments`
+ Parses the .proto files looking for multiline comments (/* ... */) to
+ include them in the generated files.
+
+ * `-Ddefine`, `-Ddefine`=_value_:
+ Defines an option (defaults to true if no value given) to pass to
+ the generator. See protobuf-php(5) for supported options, noting that
+ the `php.` prefix shall not be used here.
+
+
+## EXAMPLES ##
+
+Generate a PHP file from a proto file:
+
+ $ protoc-gen-php tutorial.proto
+
+Generate PHP files in the "build" directory for each proto file found the
+"protos" directory:
+
+ $ protoc-gen-php -o build protos/*.proto
+
+Generate a PHP file from a proto file using imports from an include path:
+
+ $ protoc-gen-php -i ./protos protos/tutorial.proto
+
+Generate a PHP file with a custom extension
+
+ $ protoc-gen-php -Dsuffix=pb.php tutorial.proto
+
+
+## BUGS ##
+
+Please report bugs using GitHub's issue tracker at http://github.com/drslump/protobuf-php/issues
+
+
+## COPYRIGHT ##
+
+Protobuf for PHP is Copyright (C) 2011 Ivan -DrSlump- Montes <http://pollinimini.net>
+
+
+## SEE ALSO
+
+protobuf-php(3), protobuf-php(5),
+<http://github.com/drslump/protobuf-php>
+
--- /dev/null
+++ b/lib/Protobuf-PHP/package.pear
@@ -1,1 +1,83 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<package packagerversion="1.8.0" version="2.0" xmlns="http://pear.php.net/dtd/package-2.0" xmlns:tasks="http://pear.php.net/dtd/tasks-1.0" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" xsi:schemaLocation="http://pear.php.net/dtd/tasks-1.0
+ http://pear.php.net/dtd/tasks-1.0.xsd
+ http://pear.php.net/dtd/package-2.0
+ http://pear.php.net/dtd/package-2.0.xsd">
+ <name>Protobuf</name>
+ <channel>pear.pollinimini.net</channel>
+ <summary>PHP implementation of Google's Protocol Buffers</summary>
+ <description>
+Protobuf for PHP is an implementation of Google's Protocol Buffers for the
+PHP language, supporting its binary data serialization and including a
+protoc plugin to generate PHP classes from .proto files.
+ </description>
+ <lead>
+ <name>Iván -DrSlump- Montes</name>
+ <user>drslump</user>
+ <email>drslump@pollinimini.net</email>
+ <active>yes</active>
+ </lead>
+ <date>{DATE}</date>
+ <time>{TIME}</time>
+ <version>
+ <release>{VERSION}</release>
+ <api>{VERSION}</api>
+ </version>
+ <stability>
+ <release>beta</release>
+ <api>beta</api>
+ </stability>
+ <license uri="http://creativecommons.org/licenses/MIT">The MIT License</license>
+ <notes>http://github.com/drslump/Protobuf-PHP</notes>
+ <contents>
+ <dir name="/">
+ <file baseinstalldir="/" name="LICENSE" role="doc"/>
+ <file baseinstalldir="/" name="README.md" role="doc"/>
+ <file baseinstalldir="/" name="protoc-gen-php.php" role="script">
+ <tasks:replace from="/usr/bin/env php" to="php_bin" type="pear-config"/>
+ <tasks:replace from="@php_bin@" to="php_bin" type="pear-config" />
+ <tasks:replace from="@package_version@" to="version" type="package-info" />
+ </file>
+ <file baseinstalldir="/" name="protoc-gen-php.bat" role="script">
+ <tasks:replace from="@php_bin@" to="php_bin" type="pear-config" />
+ <tasks:replace from="@bin_dir@" to="bin_dir" type="pear-config" />
+ <tasks:replace from="@package_version@" to="version" type="package-info" />
+ </file>
+ {DIRS}
+ </dir>
+ </contents>
+ <dependencies>
+ <required>
+ <php>
+ <min>5.3.0</min>
+ </php>
+ <pearinstaller>
+ <min>1.9.2</min>
+ </pearinstaller>
+ <package>
+ <name>Console_CommandLine</name>
+ <channel>pear.php.net</channel>
+ <min>1.1.0</min>
+ </package>
+ </required>
+ </dependencies>
+ <phprelease>
+ <installconditions>
+ <os>
+ <name>windows</name>
+ </os>
+ </installconditions>
+ <filelist>
+ <install as="protoc-gen-php" name="protoc-gen-php.php" />
+ <install as="protoc-gen-php.bat" name="protoc-gen-php.bat" />
+ </filelist>
+ </phprelease>
+ <phprelease>
+ <filelist>
+ <install as="protoc-gen-php" name="protoc-gen-php.php" />
+ <ignore name="protoc-gen-php.bat" />
+ </filelist>
+ </phprelease>
+</package>
+
--- /dev/null
+++ b/lib/Protobuf-PHP/protoc-gen-php.bat
@@ -1,1 +1,19 @@
+@echo off
+REM Protobuf-PHP
+REM Copyright (C) 2011 Iván -DrSlump- Montes <drslump@pollinimini.net>
+REM
+REM This source file is subject to the MIT license that is bundled
+REM with this package in the file LICENSE.
+REM It is also available through the world-wide-web at this URL:
+REM http://creativecommons.org/licenses/MIT/
+if "%PHPBIN%" == "" set PHPBIN=@php_bin@
+if not exist "%PHPBIN%" if "%PHP_PEAR_PHP_BIN%" neq "" goto USE_PEAR_PATH
+GOTO RUN
+
+:USE_PEAR_PATH
+set PHPBIN=%PHP_PEAR_PHP_BIN%
+
+:RUN
+"%PHPBIN%" "@bin_dir@\protoc-gen-php" %*
+
--- /dev/null
+++ b/lib/Protobuf-PHP/protoc-gen-php.php
@@ -1,1 +1,47 @@
+#!/usr/bin/env php
+<?php
+// The MIT License
+//
+// Copyright (c) 2011 Iván -DrSlump- Montes
+//
+// Permission is hereby granted, free of charge, to any person obtaining a copy
+// of this software and associated documentation files (the "Software"), to deal
+// in the Software without restriction, including without limitation the rights
+// to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+// copies of the Software, and to permit persons to whom the Software is
+// furnished to do so, subject to the following conditions:
+//
+// The above copyright notice and this permission notice shall be included in
+// all copies or substantial portions of the Software.
+//
+// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+// IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+// FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+// AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+// LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+// OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+// THE SOFTWARE.
+// Set up default timezone
+date_default_timezone_set('GMT');
+
+// For non pear packaged versions use relative include path
+if (strpos('@php_bin@', '@php_bin') === 0) {
+ set_include_path(__DIR__ . DIRECTORY_SEPARATOR . 'library' . PATH_SEPARATOR . get_include_path());
+}
+
+require_once 'DrSlump/Protobuf.php';
+
+// Setup autoloader
+\DrSlump\Protobuf::autoload();
+
+try {
+ // Run the cli interface
+ \DrSlump\Protobuf\Compiler\Cli::run(__FILE__);
+ exit(0);
+
+} catch(Exception $e) {
+ fputs(STDERR, (string)$e . PHP_EOL);
+ exit(1);
+}
+
Binary files /dev/null and b/lib/Protobuf-PHP/protoc.exe differ
--- /dev/null
+++ b/lib/Protobuf-PHP/test-alert.php
@@ -1,1 +1,69 @@
+<?php
+include_once("library/DrSlump/Protobuf.php");
+include_once("library/DrSlump/Protobuf/Message.php");
+include_once("library/DrSlump/Protobuf/Registry.php");
+include_once("library/DrSlump/Protobuf/Descriptor.php");
+include_once("library/DrSlump/Protobuf/Field.php");
+include_once("gtfs-realtime.php");
+include_once("library/DrSlump/Protobuf/CodecInterface.php");
+include_once("library/DrSlump/Protobuf/Codec/PhpArray.php");
+include_once("library/DrSlump/Protobuf/Codec/Binary.php");
+include_once("library/DrSlump/Protobuf/Codec/Binary/Writer.php");
+include_once("library/DrSlump/Protobuf/Codec/Json.php");
+//print_r(get_declared_classes());
+$fm = new transit_realtime\FeedMessage();
+$fh = new transit_realtime\FeedHeader();
+$fh->setGtfsRealtimeVersion(1);
+$fh->setTimestamp(time());
+$fm->setHeader($fh);
+$fe = new transit_realtime\FeedEntity();
+ $fe->setId("1234");
+ $fe->setIsDeleted(false);
+ $alert = new transit_realtime\Alert();
+ $tr = new transit_realtime\TimeRange();
+ $tr->setStart(000);
+ $tr->setEnd(001);
+ $alert-> addActivePeriod($tr);
+ $es = new transit_realtime\EntitySelector();
+ $es->setAgencyId("0");
+ $es->setStopId("0");
+ $es->setRouteId("0");
+ $td = new transit_realtime\TripDescriptor();
+ $td->setTripId("0");
+ $es->setTrip($td);
+ $alert-> addInformedEntity($es);
+ $alert->setCause(constant("transit_realtime\Alert\Cause::"."UNKNOWN_CAUSE"));
+ $alert->setEffect(constant("transit_realtime\Alert\Effect::"."UNKNOWN_EFFECT"));
+ $tsUrl = new transit_realtime\TranslatedString();
+ $tUrl = new transit_realtime\TranslatedString\Translation();
+ $tUrl->setText("http");
+ $tUrl->setLanguage("en");
+ $tsUrl->addTranslation($tUrl);
+ $alert->setUrl($tsUrl);
+ $tsHeaderText= new transit_realtime\TranslatedString();
+ $tHeaderText = new transit_realtime\TranslatedString\Translation();
+ $tHeaderText->setText("http");
+ $tHeaderText->setLanguage("en");
+ $tsHeaderText->addTranslation($tHeaderText);
+ $alert->setHeaderText($tsHeaderText);
+ $tsDescriptionText= new transit_realtime\TranslatedString();
+ $tDescriptionText = new transit_realtime\TranslatedString\Translation();
+ $tDescriptionText->setText("http");
+ $tDescriptionText->setLanguage("en");
+ $tsDescriptionText->addTranslation($tDescriptionText);
+ $alert->setDescriptionText($tsDescriptionText);
+ $fe->setAlert($alert);
+$fm->addEntity($fe);
+//var_dump($fm);
+
+//$codec = new DrSlump\Protobuf\Codec\Binary();
+//echo $codec->encode($fm);
+
+//$codec = new DrSlump\Protobuf\Codec\Json();
+//echo $codec->encode($fm);
+
+$codec = new DrSlump\Protobuf\Codec\PhpArray();
+print_r($codec->encode($fm));
+
+?>
--- /dev/null
+++ b/lib/Protobuf-PHP/test-tripupdates.php
@@ -1,1 +1,44 @@
+ <?php
+include_once("library/DrSlump/Protobuf.php");
+include_once("library/DrSlump/Protobuf/Message.php");
+include_once("library/DrSlump/Protobuf/Registry.php");
+include_once("library/DrSlump/Protobuf/Descriptor.php");
+include_once("library/DrSlump/Protobuf/Field.php");
+include_once("gtfs-realtime.php");
+include_once("library/DrSlump/Protobuf/CodecInterface.php");
+include_once("library/DrSlump/Protobuf/Codec/PhpArray.php");
+include_once("library/DrSlump/Protobuf/Codec/Binary.php");
+include_once("library/DrSlump/Protobuf/Codec/Binary/Writer.php");
+include_once("library/DrSlump/Protobuf/Codec/Json.php");
+//print_r(get_declared_classes());
+$fm = new transit_realtime\FeedMessage();
+$fh = new transit_realtime\FeedHeader();
+$fh->setGtfsRealtimeVersion(1);
+$fh->setTimestamp(time());
+$fm->setHeader($fh);
+$fe = new transit_realtime\FeedEntity();
+ $fe->setId("1234");
+ $fe->setIsDeleted(false);
+ $tu = new transit_realtime\TripUpdate();
+ $td = new transit_realtime\TripDescriptor();
+ $td->setRouteId("0");
+ $tu->setTrip($td);
+ $stu = new transit_realtime\TripUpdate\StopTimeUpdate();
+ $stu->setStopId("1");
+ $stu->setScheduleRelationship(transit_realtime\TripUpdate\StopTimeUpdate\ScheduleRelationship::SKIPPED);
+ $tu->addStopTimeUpdate($stu);
+ $fe->setTripUpdate($tu);
+$fm->addEntity($fe);
+//var_dump($fm);
+
+//$codec = new DrSlump\Protobuf\Codec\Binary();
+//echo $codec->encode($fm);
+
+//$codec = new DrSlump\Protobuf\Codec\Json();
+//echo $codec->encode($fm);
+
+$codec = new DrSlump\Protobuf\Codec\PhpArray();
+print_r($codec->encode($fm));
+
+?>
--- /dev/null
+++ b/lib/Protobuf-PHP/tests/Protobuf.Codec.Binary.spec.php
@@ -1,1 +1,222 @@
-
+<?php
+
+require_once __DIR__ . '/../library/DrSlump/Protobuf.php';
+
+error_reporting(E_ALL);
+
+use \DrSlump\Protobuf;
+
+Protobuf::autoload();
+
+include_once __DIR__ . '/protos/simple.php';
+include_once __DIR__ . '/protos/repeated.php';
+include_once __DIR__ . '/protos/addressbook.php';
+
+describe "Binary Codec"
+
+ before
+
+ $codec = new Protobuf\Codec\Binary();
+ Protobuf::setDefaultCodec($codec);
+
+ $W->bin_simple = file_get_contents(__DIR__ . '/protos/simple.bin');
+ $W->bin_book = file_get_contents(__DIR__ . '/protos/addressbook.bin');
+ $W->bin_repeated_string = file_get_contents(__DIR__ . '/protos/repeated-string.bin');
+ $W->bin_repeated_int32 = file_get_contents(__DIR__ . '/protos/repeated-int32.bin');
+ $W->bin_repeated_nested = file_get_contents(__DIR__ . '/protos/repeated-nested.bin');
+ end;
+
+ describe "serialize"
+
+ it "a simple message comparing types with protoc"
+
+ $max = pow(2, 54)-1;
+ $min = -$max;
+
+ $fields = array(
+ 'double' => array(1, 0.1, 1.0, -1, -0.1, -100000, 123456789.12345, -123456789.12345),
+ 'float' => array(1, 0.1, 1.0, -1, -0.1, -100000, 12345.123, -12345.123),
+ 'int64' => array(0, 1, -1, 123456789123456789, -123456789123456789, $min),
+ 'uint64' => array(0, 1, 1000, 123456789123456789, PHP_INT_MAX, $max),
+ 'int32' => array(0, 1, -1, 123456789, -123456789),
+ 'fixed64' => array(0, 1, 1000, 123456789123456789),
+ 'fixed32' => array(0, 1, 1000, 123456789),
+ 'bool' => array(0, 1),
+ 'string' => array("", "foo"),
+ 'bytes' => array("", "foo"),
+ 'uint32' => array(0, 1, 1000, 123456789),
+ 'sfixed32' => array(0, 1, -1, 123456789, -123456789),
+ 'sfixed64' => array(0, 1, -1, 123456789123456789, -123456789123456789),
+ 'sint32' => array(0, 1, -1, 123456789, -123456789),
+ 'sint64' => array(0, 1, -1, 123456789123456789, -123456789123456789, $min, $max),
+ );
+
+
+ foreach ($fields as $field=>$values) {
+ foreach ($values as $value) {
+ $simple = new Tests\Simple();
+ $simple->$field = $value;
+ $bin = Protobuf::encode($simple);
+
+ if (is_string($value)) $value = '"' . $value . '"';
+
+ exec("echo '$field: $value' | protoc --encode=tests.Simple -Itests tests/protos/simple.proto", $out);
+
+ $out = implode("\n", $out);
+
+ $printValue = var_export($value, true);
+ bin2hex($bin) should eq (bin2hex($out)) as "Encoding $field with value $printValue";
+ }
+ }
+
+ foreach ($fields as $field=>$values) {
+ foreach ($values as $value) {
+ $cmdValue = is_string($value)
+ ? '"' . $value . '"'
+ : $value;
+
+ exec("echo '$field: $cmdValue' | protoc --encode=tests.Simple -Itests tests/protos/simple.proto", $out);
+ $out = implode("\n", $out);
+
+ $simple = Protobuf::decode('\tests\Simple', $out);
+
+ // Hack the comparison for float precision
+ if (is_float($simple->$field)) {
+ $precision = strlen($value) - strpos($value, '.');
+ $simple->$field = round($simple->$field, $precision);
+ }
+
+ $printValue = var_export($value, true);
+ $simple->$field should eq $value as "Decoding $field with value $printValue";
+ }
+ }
+ end.
+
+ it. "a message with repeated fields"
+
+ $repeated = new Tests\Repeated();
+ $repeated->addString('one');
+ $repeated->addString('two');
+ $repeated->addString('three');
+ $bin = Protobuf::encode($repeated);
+ $bin should be $W->bin_repeated_string;
+
+ $repeated = new Tests\Repeated();
+ $repeated->addInt(1);
+ $repeated->addInt(2);
+ $repeated->addInt(3);
+ $bin = Protobuf::encode($repeated);
+ $bin should be $W->bin_repeated_int32;
+
+
+ $repeated = new Tests\Repeated();
+ $nested = new Tests\Repeated\Nested();
+ $nested->setId(1);
+ $repeated->addNested($nested);
+ $nested = new Tests\Repeated\Nested();
+ $nested->setId(2);
+ $repeated->addNested($nested);
+ $nested = new Tests\Repeated\Nested();
+ $nested->setId(3);
+ $repeated->addNested($nested);
+ $bin = Protobuf::encode($repeated);
+ $bin should eq $W->bin_repeated_nested;
+ end.
+
+ it. "a complex message"
+
+ $book = new Tests\AddressBook();
+ $person = new Tests\Person();
+ $person->name = 'John Doe';
+ $person->id = 2051;
+ $person->email = 'john.doe@gmail.com';
+ $phone = new Tests\Person\PhoneNumber;
+ $phone->number = '1231231212';
+ $phone->type = Tests\Person\PhoneType::HOME;
+ $person->addPhone($phone);
+ $phone = new Tests\Person\PhoneNumber;
+ $phone->number = '55512321312';
+ $phone->type = Tests\Person\PhoneType::MOBILE;
+ $person->addPhone($phone);
+ $book->addPerson($person);
+
+ $person = new Tests\Person();
+ $person->name = 'Iván Montes';
+ $person->id = 23;
+ $person->email = 'drslump@pollinimini.net';
+ $phone = new Tests\Person\PhoneNumber;
+ $phone->number = '3493123123';
+ $phone->type = Tests\Person\PhoneType::WORK;
+ $person->addPhone($phone);
+ $book->addPerson($person);
+
+ $bin = Protobuf::encode($book);
+ $bin should eq $W->bin_book but not be false;
+
+ end.
+
+ end;
+
+ describe "unserialize"
+
+ it "a simple message"
+ $simple = Protobuf::decode('Tests\Simple', $W->bin_simple);
+ $simple should be instanceof 'Tests\Simple';
+ $simple->string should be 'foo';
+ $simple->int32 should be -123456789;
+ end.
+
+ it "a message with repeated fields"
+
+ $repeated = Protobuf::decode('Tests\Repeated', $W->bin_repeated_string);
+ $repeated should be instanceof 'Tests\Repeated';
+ $repeated->getString() should eq array('one', 'two', 'three');
+
+ $repeated = Protobuf::decode('Tests\Repeated', $W->bin_repeated_int32);
+ $repeated should be instanceof 'Tests\Repeated';
+ $repeated->getInt() should eq array(1,2,3);
+
+ $repeated = Protobuf::decode('Tests\Repeated', $W->bin_repeated_nested);
+ $repeated should be instanceof 'Tests\Repeated';
+ foreach ($repeated->getNested() as $i=>$nested) {
+ $nested->getId() should eq ($i+1);
+ }
+ end.
+
+ it "a complex message"
+ $complex = Protobuf::decode('Tests\AddressBook', $W->bin_book);
+ count($complex->person) should eq 2;
+ $complex->getPerson(0)->name should eq 'John Doe';
+ $complex->getPerson(1)->name should eq 'Iván Montes';
+ $complex->getPerson(0)->getPhone(1)->number should eq '55512321312';
+ end.
+
+ end;
+
+ describe "multi codec"
+
+ before
+ $W->jsonCodec = new Protobuf\Codec\Json();
+ end
+
+ it "a simple message"
+
+ $simple = Protobuf::decode('Tests\Simple', $W->bin_simple);
+ $json = $W->jsonCodec->encode($simple);
+ $simple = $W->jsonCodec->decode(new \Tests\Simple, $json);
+ $bin = Protobuf::encode($simple);
+ $bin should be $W->bin_simple;
+
+ end.
+
+ it "a message with repeated fields"
+ $repeated = Protobuf::decode('Tests\Repeated', $W->bin_repeated_nested);
+ $json = $W->jsonCodec->encode($repeated);
+ $repeated = $W->jsonCodec->decode(new \Tests\Repeated, $json);
+ $bin = Protobuf::encode($repeated);
+ $bin should be $W->bin_repeated_nested;
+ end.
+
+ end;
+end;
+
--- /dev/null
+++ b/lib/Protobuf-PHP/tests/Protobuf.Codec.Json.spec.php
@@ -1,1 +1,214 @@
-
+<?php
+
+require_once __DIR__ . '/../library/DrSlump/Protobuf.php';
+
+use \DrSlump\Protobuf;
+
+Protobuf::autoload();
+
+include_once __DIR__ . '/protos/simple.php';
+include_once __DIR__ . '/protos/repeated.php';
+include_once __DIR__ . '/protos/addressbook.php';
+
+include_once __DIR__ . '/protos/Annotated/Simple.php';
+include_once __DIR__ . '/protos/Annotated/Repeated.php';
+include_once __DIR__ . '/protos/Annotated/Addressbook.php';
+
+
+describe "JSON Codec"
+
+ before
+ Protobuf::setDefaultCodec(new ProtoBuf\Codec\Json);
+ end
+
+ describe "serialize"
+
+ it "a simple message"
+ $simple = new Tests\Simple();
+ $simple->string = 'FOO';
+ $simple->int32 = 1000;
+ $json = Protobuf::encode($simple);
+ $json. should. eq. '{"int32":1000,"string":"FOO"}';
+ end.
+
+ it. "a message with repeated fields"
+
+ $repeated = new \Tests\Repeated();
+ $repeated->addString('one');
+ $repeated->addString('two');
+ $repeated->addString('three');
+ $bin = Protobuf::encode($repeated);
+ $bin should be '{"string":["one","two","three"]}';
+
+ $repeated = new Tests\Repeated();
+ $repeated->addInt(1);
+ $repeated->addInt(2);
+ $repeated->addInt(3);
+ $bin = Protobuf::encode($repeated);
+ $bin should be '{"int":[1,2,3]}';
+
+ $repeated = new Tests\Repeated();
+ $nested = new Tests\Repeated\Nested();
+ $nested->setId(1);
+ $repeated->addNested($nested);
+ $nested = new Tests\Repeated\Nested();
+ $nested->setId(2);
+ $repeated->addNested($nested);
+ $nested = new Tests\Repeated\Nested();
+ $nested->setId(3);
+ $repeated->addNested($nested);
+ $json = Protobuf::encode($repeated);
+ $json should eq '{"nested":[{"id":1},{"id":2},{"id":3}]}';
+ end.
+
+ it. "a complex message"
+
+ $book = new Tests\AddressBook();
+ $person = new Tests\Person();
+ $person->name = 'John Doe';
+ $person->id = 2051;
+ $person->email = 'john.doe@gmail.com';
+ $phone = new Tests\Person\PhoneNumber;
+ $phone->number = '1231231212';
+ $phone->type = Tests\Person\PhoneType::HOME;
+ $person->addPhone($phone);
+ $phone = new Tests\Person\PhoneNumber;
+ $phone->number = '55512321312';
+ $phone->type = Tests\Person\PhoneType::MOBILE;
+ $person->addPhone($phone);
+ $book->addPerson($person);
+
+ $person = new Tests\Person();
+ $person->name = 'Iván Montes';
+ $person->id = 23;
+ $person->email = 'drslump@pollinimini.net';
+ $phone = new Tests\Person\PhoneNumber;
+ $phone->number = '3493123123';
+ $phone->type = Tests\Person\PhoneType::WORK;
+ $person->addPhone($phone);
+ $book->addPerson($person);
+
+ $json = Protobuf::encode($book);
+
+ $expected = '{
+ "person":[
+ {
+ "name":"John Doe",
+ "id":2051,
+ "email":"john.doe@gmail.com",
+ "phone":[
+ {"number":"1231231212","type":1},
+ {"number":"55512321312","type":0}
+ ]
+ },
+ {
+ "name":"Iv\u00e1n Montes",
+ "id":23,
+ "email":"drslump@pollinimini.net",
+ "phone":[{"number":"3493123123","type":2}]
+ }
+ ]
+ }';
+
+ $expected = preg_replace('/\n\s*/', '', $expected);
+
+ $json should be $expected;
+ end.
+
+ it "an annotated simple message"
+ $simple = new tests\Annotated\Simple();
+ $simple->foo = 'FOO';
+ $simple->bar = 1000;
+ $json = Protobuf::encode($simple);
+ $json. should. eq. '{"foo":"FOO","bar":1000}';
+ end.
+
+ it "an annotated message with repeated fields"
+ $repeated = new \Tests\Annotated\Repeated();
+ $repeated->string = array('one', 'two', 'three');
+ $bin = Protobuf::encode($repeated);
+ $bin should be '{"string":["one","two","three"]}';
+
+ $repeated = new Tests\Annotated\Repeated();
+ $repeated->int = array(1,2,3);
+ $bin = Protobuf::encode($repeated);
+ $bin should be '{"int":[1,2,3]}';
+
+ $repeated = new Tests\Annotated\Repeated();
+ $repeated->nested = array();
+ $nested = new Tests\Annotated\RepeatedNested();
+ $nested->id = 1;
+ $repeated->nested[] = $nested;
+ $nested = new Tests\Annotated\RepeatedNested();
+ $nested->id = 2;
+ $repeated->nested[] = $nested;
+ $nested = new Tests\Annotated\RepeatedNested();
+ $nested->id = 3;
+ $repeated->nested[] = $nested;
+ $json = Protobuf::encode($repeated);
+ $json should eq '{"nested":[{"id":1},{"id":2},{"id":3}]}';
+ end.
+ end;
+
+ describe "unserialize"
+
+ it "should unserialize a simple message"
+ $json = '{"string":"FOO","int32":1000}';
+ $simple = Protobuf::decode('Tests\Simple', $json);
+ $simple should be instanceof 'Tests\Simple';
+ $simple->string should equal 'FOO';
+ $simple->int32 should equal 1000;
+ end.
+
+ it "a message with repeated fields"
+
+ $json = '{"string":["one","two","three"]}';
+ $repeated = Protobuf::decode('Tests\Repeated', $json);
+ $repeated->getString() should eq array('one', 'two', 'three');
+
+ $json = '{"int":[1,2,3]}';
+ $repeated = Protobuf::decode('Tests\Repeated', $json);
+ $repeated should be instanceof 'Tests\Repeated';
+ $repeated->getInt() should eq array(1,2,3);
+
+ $json = '{"nested":[{"id":1},{"id":2},{"id":3}]}';
+ $repeated = Protobuf::decode('Tests\Repeated', $json);
+ $repeated should be instanceof 'Tests\Repeated';
+ foreach ($repeated->getNested() as $i=>$nested) {
+ $nested->getId() should eq ($i+1);
+ }
+ end.
+
+ it "a complex message"
+ $json = '{
+ "person":[
+ {
+ "name":"John Doe",
+ "id":2051,
+ "email":"john.doe@gmail.com",
+ "phone":[
+ {"number":"1231231212","type":1},
+ {"number":"55512321312","type":0}
+ ]
+ },
+ {
+ "name":"Iv\u00e1n Montes",
+ "id":23,
+ "email":"drslump@pollinimini.net",
+ "phone":[{"number":"3493123123","type":2}]
+ }
+ ]
+ }';
+
+ $json = preg_replace('/\n\s*/', '', $json);
+
+ $complex = Protobuf::decode('Tests\AddressBook', $json);
+ count($complex->person) should eq 2;
+ $complex->getPerson(0)->name should eq 'John Doe';
+ $complex->getPerson(1)->name should eq 'Iván Montes';
+ $complex->getPerson(0)->getPhone(1)->number should eq '55512321312';
+ end.
+
+ end;
+end;
+
--- /dev/null
+++ b/lib/Protobuf-PHP/tests/Protobuf.Codec.JsonIndexed.spec.php
@@ -1,1 +1,187 @@
+<?php
+require_once __DIR__ . '/../library/DrSlump/Protobuf.php';
+
+use \DrSlump\Protobuf;
+
+Protobuf::autoload();
+
+include_once __DIR__ . '/protos/simple.php';
+include_once __DIR__ . '/protos/repeated.php';
+include_once __DIR__ . '/protos/addressbook.php';
+
+describe "JSON Indexed Codec"
+
+ before
+ Protobuf::setDefaultCodec(new Protobuf\Codec\JsonIndexed);
+ end
+
+ describe "serialize"
+
+ it "should serialize a simple message"
+ $simple = new Tests\Simple();
+ $simple->string = 'FOO';
+ $simple->int32 = 1000;
+ $json = Protobuf::encode($simple);
+ $json. should. eq. '["59",1000,"FOO"]';
+ end.
+
+ it. "a message with repeated fields"
+
+ $repeated = new Tests\Repeated();
+ $repeated->addString('one');
+ $repeated->addString('two');
+ $repeated->addString('three');
+ $bin = Protobuf::encode($repeated);
+ $bin should be '["1",["one","two","three"]]';
+
+ $repeated = new Tests\Repeated();
+ $repeated->addInt(1);
+ $repeated->addInt(2);
+ $repeated->addInt(3);
+ $bin = Protobuf::encode($repeated);
+ $bin should be '["2",[1,2,3]]';
+
+ $repeated = new Tests\Repeated();
+ $nested = new Tests\Repeated\Nested();
+ $nested->setId(1);
+ $repeated->addNested($nested);
+ $nested = new Tests\Repeated\Nested();
+ $nested->setId(2);
+ $repeated->addNested($nested);
+ $nested = new Tests\Repeated\Nested();
+ $nested->setId(3);
+ $repeated->addNested($nested);
+ $json = Protobuf::encode($repeated);
+ $json should eq '["3",[["1",1],["1",2],["1",3]]]';
+ end.
+
+ it. "a complex message"
+
+ $book = new Tests\AddressBook();
+ $person = new Tests\Person();
+ $person->name = 'John Doe';
+ $person->id = 2051;
+ $person->email = 'john.doe@gmail.com';
+ $phone = new Tests\Person\PhoneNumber;
+ $phone->number = '1231231212';
+ $phone->type = Tests\Person\PhoneType::HOME;
+ $person->addPhone($phone);
+ $phone = new Tests\Person\PhoneNumber;
+ $phone->number = '55512321312';
+ $phone->type = Tests\Person\PhoneType::MOBILE;
+ $person->addPhone($phone);
+ $book->addPerson($person);
+
+ $person = new Tests\Person();
+ $person->name = 'Iván Montes';
+ $person->id = 23;
+ $person->email = 'drslump@pollinimini.net';
+ $phone = new Tests\Person\PhoneNumber;
+ $phone->number = '3493123123';
+ $phone->type = Tests\Person\PhoneType::WORK;
+ $person->addPhone($phone);
+ $book->addPerson($person);
+
+ $json = Protobuf::encode($book);
+
+ $expected = '[
+ "1",
+ [
+ [
+ "1234",
+ "John Doe",
+ 2051,
+ "john.doe@gmail.com",
+ [
+ ["12","1231231212",1],
+ ["12","55512321312",0]
+ ]
+ ],
+ [
+ "1234",
+ "Iv\u00e1n Montes",
+ 23,
+ "drslump@pollinimini.net",
+ [
+ ["12","3493123123",2]
+ ]
+ ]
+ ]
+ ]';
+
+ $expected = preg_replace('/\n\s*/', '', $expected);
+
+ $json should be $expected;
+ end.
+ end;
+
+ describe "unserialize"
+
+ it "should unserialize a simple message"
+ $json = '["59",1000,"FOO"]';
+ $simple = Protobuf::decode('Tests\Simple', $json);
+ $simple should be instanceof 'Tests\Simple';
+ $simple->string should equal 'FOO';
+ $simple->int32 should equal 1000;
+ end.
+
+ it "a message with repeated fields"
+
+ $json = '["1",["one","two","three"]]';
+ $repeated = Protobuf::decode('Tests\Repeated', $json);
+ $repeated->getString() should eq array('one', 'two', 'three');
+
+ $json = '["2",[1,2,3]]';
+ $repeated = Protobuf::decode('Tests\Repeated', $json);
+ $repeated should be instanceof 'Tests\Repeated';
+ $repeated->getInt() should eq array(1,2,3);
+
+ $json = '["3",[["1",1],["1",2],["1",3]]]';
+ $repeated = Protobuf::decode('Tests\Repeated', $json);
+ $repeated should be instanceof 'Tests\Repeated';
+ foreach ($repeated->getNested() as $i=>$nested) {
+ $nested->getId() should eq ($i+1);
+ }
+ end.
+
+ it "a complex message"
+ $json = '[
+ "1",
+ [
+ [
+ "1234",
+ "John Doe",
+ 2051,
+ "john.doe@gmail.com",
+ [
+ ["12","1231231212",1],
+ ["12","55512321312",0]
+ ]
+ ],
+ [
+ "1234",
+ "Iv\u00e1n Montes",
+ 23,
+ "drslump@pollinimini.net",
+ [
+ ["12","3493123123",2]
+ ]
+ ]
+ ]
+ ]';
+
+ $json = preg_replace('/\n\s*/', '', $json);
+
+ $complex = Protobuf::decode('Tests\AddressBook', $json);
+ count($complex->person) should eq 2;
+ $complex->getPerson(0)->name should eq 'John Doe';
+ $complex->getPerson(1)->name should eq 'Iván Montes';
+ $complex->getPerson(0)->getPhone(1)->number should eq '55512321312';
+ end.
+
+
+
+ end;
+end;
+
--- /dev/null
+++ b/lib/Protobuf-PHP/tests/Protobuf.Codec.JsonTagMap.spec.php
@@ -1,1 +1,175 @@
+<?php
+require_once __DIR__ . '/../library/DrSlump/Protobuf.php';
+
+use \DrSlump\Protobuf;
+
+Protobuf::autoload();
+
+include_once __DIR__ . '/protos/simple.php';
+include_once __DIR__ . '/protos/repeated.php';
+include_once __DIR__ . '/protos/addressbook.php';
+
+describe "JSON TagMap Codec"
+
+ before
+ Protobuf::setDefaultCodec(new Protobuf\Codec\JsonTagMap);
+ end
+
+ describe "serialize"
+
+ it "should serialize a simple message"
+ $simple = new Tests\Simple();
+ $simple->string = 'FOO';
+ $simple->int32 = 1000;
+ $json = Protobuf::encode($simple);
+ $json. should. eq. '{"5":1000,"9":"FOO"}';
+ end.
+
+ it. "a message with repeated fields"
+
+ $repeated = new Tests\Repeated();
+ $repeated->addString('one');
+ $repeated->addString('two');
+ $repeated->addString('three');
+ $bin = Protobuf::encode($repeated);
+ $bin should be '{"1":["one","two","three"]}';
+
+ $repeated = new Tests\Repeated();
+ $repeated->addInt(1);
+ $repeated->addInt(2);
+ $repeated->addInt(3);
+ $bin = Protobuf::encode($repeated);
+ $bin should be '{"2":[1,2,3]}';
+
+ $repeated = new Tests\Repeated();
+ $nested = new Tests\Repeated\Nested();
+ $nested->setId(1);
+ $repeated->addNested($nested);
+ $nested = new Tests\Repeated\Nested();
+ $nested->setId(2);
+ $repeated->addNested($nested);
+ $nested = new Tests\Repeated\Nested();
+ $nested->setId(3);
+ $repeated->addNested($nested);
+ $json = Protobuf::encode($repeated);
+ $json should eq '{"3":[{"1":1},{"1":2},{"1":3}]}';
+ end.
+
+ it. "a complex message"
+
+ $book = new Tests\AddressBook();
+ $person = new Tests\Person();
+ $person->name = 'John Doe';
+ $person->id = 2051;
+ $person->email = 'john.doe@gmail.com';
+ $phone = new Tests\Person\PhoneNumber;
+ $phone->number = '1231231212';
+ $phone->type = Tests\Person\PhoneType::HOME;
+ $person->addPhone($phone);
+ $phone = new Tests\Person\PhoneNumber;
+ $phone->number = '55512321312';
+ $phone->type = Tests\Person\PhoneType::MOBILE;
+ $person->addPhone($phone);
+ $book->addPerson($person);
+
+ $person = new Tests\Person();
+ $person->name = 'Iván Montes';
+ $person->id = 23;
+ $person->email = 'drslump@pollinimini.net';
+ $phone = new Tests\Person\PhoneNumber;
+ $phone->number = '3493123123';
+ $phone->type = Tests\Person\PhoneType::WORK;
+ $person->addPhone($phone);
+ $book->addPerson($person);
+
+ $json = Protobuf::encode($book);
+
+ $expected = '{
+ "1":[
+ {
+ "1":"John Doe",
+ "2":2051,
+ "3":"john.doe@gmail.com",
+ "4":[
+ {"1":"1231231212","2":1},
+ {"1":"55512321312","2":0}
+ ]
+ },
+ {
+ "1":"Iv\u00e1n Montes",
+ "2":23,
+ "3":"drslump@pollinimini.net",
+ "4":[{"1":"3493123123","2":2}]
+ }
+ ]
+ }';
+
+ $expected = preg_replace('/\n\s*/', '', $expected);
+
+ $json should be $expected;
+ end.
+ end;
+
+ describe "unserialize"
+
+ it "should unserialize a simple message"
+ $json = '{"9":"FOO","5":1000}';
+ $simple = Protobuf::decode('Tests\Simple', $json);
+ $simple should be instanceof 'Tests\Simple';
+ $simple->string should equal 'FOO';
+ $simple->int32 should equal 1000;
+ end.
+
+ it "a message with repeated fields"
+
+ $json = '{"1":["one","two","three"]}';
+ $repeated = Protobuf::decode('Tests\Repeated', $json);
+ $repeated->getString() should eq array('one', 'two', 'three');
+
+ $json = '{"2":[1,2,3]}';
+ $repeated = Protobuf::decode('Tests\Repeated', $json);
+ $repeated should be instanceof 'Tests\Repeated';
+ $repeated->getInt() should eq array(1,2,3);
+
+ $json = '{"3":[{"1":1},{"1":2},{"1":3}]}';
+ $repeated = Protobuf::decode('Tests\Repeated', $json);
+ $repeated should be instanceof 'Tests\Repeated';
+ foreach ($repeated->getNested() as $i=>$nested) {
+ $nested->getId() should eq ($i+1);
+ }
+ end.
+
+ it "a complex message"
+ $json = '{
+ "1":[
+ {
+ "1":"John Doe",
+ "2":2051,
+ "3":"john.doe@gmail.com",
+ "4":[
+ {"1":"1231231212","2":1},
+ {"1":"55512321312","2":0}
+ ]
+ },
+ {
+ "1":"Iv\u00e1n Montes",
+ "2":23,
+ "3":"drslump@pollinimini.net",
+ "4":[{"1":"3493123123","2":2}]
+ }
+ ]
+ }';
+
+ $json = preg_replace('/\n\s*/', '', $json);
+
+ $complex = Protobuf::decode('Tests\AddressBook', $json);
+ count($complex->person) should eq 2;
+ $complex->getPerson(0)->name should eq 'John Doe';
+ $complex->getPerson(1)->name should eq 'Iván Montes';
+ $complex->getPerson(0)->getPhone(1)->number should eq '55512321312';
+ end.
+
+ end;
+end;
+
--- /dev/null
+++ b/lib/Protobuf-PHP/tests/Protobuf.Codec.TextFormat.spec.php
@@ -1,1 +1,131 @@
+<?php
+require_once __DIR__ . '/../library/DrSlump/Protobuf.php';
+
+use \DrSlump\Protobuf;
+
+Protobuf::autoload();
+
+include_once __DIR__ . '/protos/simple.php';
+include_once __DIR__ . '/protos/repeated.php';
+include_once __DIR__ . '/protos/addressbook.php';
+
+describe "TextFormat Codec"
+
+ before
+ Protobuf::setDefaultCodec(new ProtoBuf\Codec\TextFormat);
+ end
+
+ describe "serialize"
+
+ it "should serialize a simple message"
+ $simple = new Tests\Simple();
+ $simple->string = 'FOO';
+ $simple->int32 = 1000;
+ $txt = Protobuf::encode($simple);
+ $txt . should. be. "int32: 1000\nstring: \"FOO\"\n";
+ end.
+
+ it. "a message with repeated fields"
+
+ $repeated = new \Tests\Repeated();
+ $repeated->addString('one');
+ $repeated->addString('two');
+ $repeated->addString('three');
+ $txt = Protobuf::encode($repeated);
+ $txt should be "string: \"one\"\nstring: \"two\"\nstring: \"three\"\n";
+
+ $repeated = new Tests\Repeated();
+ $repeated->addInt(1);
+ $repeated->addInt(2);
+ $repeated->addInt(3);
+ $txt = Protobuf::encode($repeated);
+ $txt should be "int: 1\nint: 2\nint: 3\n";
+
+ $repeated = new Tests\Repeated();
+ $nested = new Tests\Repeated\Nested();
+ $nested->setId(1);
+ $repeated->addNested($nested);
+ $nested = new Tests\Repeated\Nested();
+ $nested->setId(2);
+ $repeated->addNested($nested);
+ $nested = new Tests\Repeated\Nested();
+ $nested->setId(3);
+ $repeated->addNested($nested);
+ $txt = Protobuf::encode($repeated);
+ $txt should eq "nested {\n id: 1\n}\nnested {\n id: 2\n}\nnested {\n id: 3\n}\n";
+ end.
+
+ it. "a complex message"
+
+ $book = new Tests\AddressBook();
+ $person = new Tests\Person();
+ $person->name = 'John Doe';
+ $person->id = 2051;
+ $person->email = 'john.doe@gmail.com';
+ $phone = new Tests\Person\PhoneNumber;
+ $phone->number = '1231231212';
+ $phone->type = Tests\Person\PhoneType::HOME;
+ $person->addPhone($phone);
+ $phone = new Tests\Person\PhoneNumber;
+ $phone->number = '55512321312';
+ $phone->type = Tests\Person\PhoneType::MOBILE;
+ $person->addPhone($phone);
+ $book->addPerson($person);
+
+ $person = new Tests\Person();
+ $person->name = 'Iván Montes';
+ $person->id = 23;
+ $person->email = 'drslump@pollinimini.net';
+ $phone = new Tests\Person\PhoneNumber;
+ $phone->number = '3493123123';
+ $phone->type = Tests\Person\PhoneType::WORK;
+ $person->addPhone($phone);
+ $book->addPerson($person);
+
+ $txt = Protobuf::encode($book);
+ $txt = str_replace(' ', '', $txt);
+ $txt = trim($txt);
+
+ $expected = '
+ person {
+ name: "John Doe"
+ id: 2051
+ email: "john.doe@gmail.com"
+ phone {
+ number: "1231231212"
+ type: 1
+ }
+ phone {
+ number: "55512321312"
+ type: 0
+ }
+ }
+ person {
+ name: "Iv\u00e1n Montes"
+ id: 23
+ email: "drslump@pollinimini.net"
+ phone {
+ number: "3493123123"
+ type: 2
+ }
+ }
+ ';
+
+ $expected = str_replace(' ', '', $expected);
+ $expected = trim($expected);
+
+ $txt should be $expected;
+ end.
+ end;
+
+ describe "unserialize"
+
+ # throws \BadMethodCallException
+ it "TextFormat does not implement decoding"
+ $txt = "foo: \"FOO\"\nbar: \"BAR\"\n";
+ $simple = Protobuf::decode('Tests\Simple', $txt);
+ end.
+ end;
+end;
+
--- /dev/null
+++ b/lib/Protobuf-PHP/tests/Protobuf.Codec.Xml.spec.php
@@ -1,1 +1,178 @@
+<?php
+require_once __DIR__ . '/../library/DrSlump/Protobuf.php';
+
+use \DrSlump\Protobuf;
+
+Protobuf::autoload();
+
+include_once __DIR__ . '/protos/simple.php';
+include_once __DIR__ . '/protos/repeated.php';
+include_once __DIR__ . '/protos/addressbook.php';
+
+describe "XML Codec"
+
+ before
+ Protobuf::setDefaultCodec(new ProtoBuf\Codec\Xml);
+ end
+
+ describe "serialize"
+
+ it "a simple message"
+ $simple = new Tests\Simple();
+ $simple->string = 'FOO';
+ $simple->int32 = 1000;
+ $xml = Protobuf::encode($simple);
+ $sxe = simplexml_load_string($xml);
+ $sxe->string should eq "FOO";
+ $sxe->int32 should eq 1000;
+ end.
+
+ it. "a message with repeated fields"
+
+ $repeated = new \Tests\Repeated();
+ $repeated->addString('one');
+ $repeated->addString('two');
+ $repeated->addString('three');
+ $xml = Protobuf::encode($repeated);
+ $xml = simplexml_load_string($xml);
+ $xml->string[0] should eq 'one';
+ $xml->string[1] should eq 'two';
+ $xml->string[2] should eq 'three';
+
+ $repeated = new Tests\Repeated();
+ $repeated->addInt(1);
+ $repeated->addInt(2);
+ $repeated->addInt(3);
+ $xml = Protobuf::encode($repeated);
+ $xml = simplexml_load_string($xml);
+ $xml->int[0] should eq 1;
+ $xml->int[1] should eq 2;
+ $xml->int[2] should eq 3;
+
+ $repeated = new Tests\Repeated();
+ $nested = new Tests\Repeated\Nested();
+ $nested->setId(1);
+ $repeated->addNested($nested);
+ $nested = new Tests\Repeated\Nested();
+ $nested->setId(2);
+ $repeated->addNested($nested);
+ $nested = new Tests\Repeated\Nested();
+ $nested->setId(3);
+ $repeated->addNested($nested);
+ $xml = Protobuf::encode($repeated);
+ $xml = simplexml_load_string($xml);
+ $xml->nested[0]->id should eq 1;
+ $xml->nested[1]->id should eq 2;
+ $xml->nested[2]->id should eq 3;
+ end.
+
+ it. "a complex message"
+
+ $book = new Tests\AddressBook();
+ $person = new Tests\Person();
+ $person->name = 'John Doe';
+ $person->id = 2051;
+ $person->email = 'john.doe@gmail.com';
+ $phone = new Tests\Person\PhoneNumber;
+ $phone->number = '1231231212';
+ $phone->type = Tests\Person\PhoneType::HOME;
+ $person->addPhone($phone);
+ $phone = new Tests\Person\PhoneNumber;
+ $phone->number = '55512321312';
+ $phone->type = Tests\Person\PhoneType::MOBILE;
+ $person->addPhone($phone);
+ $book->addPerson($person);
+
+ $person = new Tests\Person();
+ $person->name = 'Iván Montes';
+ $person->id = 23;
+ $person->email = 'drslump@pollinimini.net';
+ $phone = new Tests\Person\PhoneNumber;
+ $phone->number = '3493123123';
+ $phone->type = Tests\Person\PhoneType::WORK;
+ $person->addPhone($phone);
+ $book->addPerson($person);
+
+ $xml = Protobuf::encode($book);
+ $xml = simplexml_load_string($xml);
+
+ $xml->person[0]->name should eq "John Doe";
+ $xml->person[0]->phone[1]->number should eq "55512321312";
+ $xml->person[1]->id should eq 23;
+ $xml->person[1]->phone[0]->type should eq 2;
+ end.
+ end;
+
+ describe "unserialize"
+
+ it "should unserialize a simple message"
+ $xml = new SimpleXmlElement('<root></root>');
+ $xml->addChild('string', 'FOO');
+ $xml->addChild('int32', 1000);
+
+ $simple = Protobuf::decode('Tests\Simple', $xml);
+ $simple should be instanceof 'Tests\Simple';
+ $simple->string should equal 'FOO';
+ $simple->int32 should equal 1000;
+ end.
+
+ it "a message with repeated fields"
+
+ $xml = new SimpleXMLElement('<root></root>');
+ $xml->addChild('string', 'one');
+ $xml->addChild('string', 'two');
+ $xml->addChild('string', 'three');
+
+ $repeated = Protobuf::decode('Tests\Repeated', $xml);
+ $repeated->getString() should eq array('one', 'two', 'three');
+
+ $xml = new SimpleXMLElement('<root></root>');
+ $xml->addChild('int', 1);
+ $xml->addChild('int', 2);
+ $xml->addChild('int', 3);
+
+ $repeated = Protobuf::decode('Tests\Repeated', $xml);
+ $repeated should be instanceof 'Tests\Repeated';
+ $repeated->getInt() should eq array(1,2,3);
+
+ $xml = new SimpleXMLElement('<root></root>');
+ $xml->addChild('nested')->addChild('id', 1);
+ $xml->addChild('nested')->addChild('id', 2);
+ $xml->addChild('nested')->addChild('id', 3);
+
+ $repeated = Protobuf::decode('Tests\Repeated', $xml);
+ $repeated should be instanceof 'Tests\Repeated';
+ foreach ($repeated->getNested() as $i=>$nested) {
+ $nested->getId() should eq ($i+1);
+ }
+ end.
+
+ it "a complex message"
+
+ $xml = new SimpleXMLElement('<root></root>');
+ $p = $xml->addChild('person');
+ $p->addChild('name', 'John Doe');
+ $p->addChild('id', 2051);
+ $p->addChild('email', 'john.doe@gmail.com');
+ $p = $p->addChild('phone');
+ $p->addChild('number', '1231231212');
+ $p->addChild('type', 1);
+ $p = $xml->addChild('person');
+ $p->addChild('name', 'Iván Montes');
+ $p->addChild('id', 23);
+ $p->addChild('email', 'drslump@pollinimini.net');
+ $p = $p->addChild('phone');
+ $p->addChild('number', '3493123123');
+ $p->addChild('type', 2);
+
+ $complex = Protobuf::decode('Tests\AddressBook', $xml->asXML());
+ count($complex->person) should eq 2;
+ $complex->getPerson(0)->name should eq 'John Doe';
+ $complex->getPerson(1)->name should eq 'Iván Montes';
+ $complex->getPerson(1)->getPhone(0)->number should eq '3493123123';
+ end.
+
+ end;
+end;
+
--- /dev/null
+++ b/lib/Protobuf-PHP/tests/Protobuf.spec.php
@@ -1,1 +1,65 @@
+<?php
+require_once __DIR__ . '/../library/DrSlump/Protobuf.php';
+
+use DrSlump\Protobuf;
+
+describe 'Protobuf'
+
+ //before
+ Protobuf::autoload();
+ //end
+
+ it 'should autoload classes'
+ new Protobuf\Codec\Binary();
+ end.
+
+ describe 'codecs registry'
+ it 'should get a default codec if none set'
+ $codec = Protobuf::getCodec();
+ $codec should be an instance of '\DrSlump\Protobuf\CodecInterface';
+ end.
+
+ it 'should return the passed codec instance'
+ $passed = new Protobuf\Codec\Binary();
+ $getted = Protobuf::getCodec($passed);
+ $getted should be $passed
+ end.
+
+ it. 'should register a new codec'
+ $setted = new Protobuf\Codec\Binary();
+ Protobuf::registerCodec('test', $setted);
+ $getted = Protobuf::getCodec('test');
+ $getted should be $setted
+ end.
+
+ it 'should register a new default codec'
+ $setted = new Protobuf\Codec\Binary();
+ Protobuf::setDefaultCodec($setted);
+ Protobuf::getCodec() should be $setted
+ end.
+
+ # throws DrSlump\Protobuf\Exception
+ it. 'should unregister a codec'
+ $setted = new Protobuf\Codec\Binary();
+ Protobuf::registerCodec('test', $setted);
+ $result = Protobuf::unregisterCodec('test');
+ $result should be true;
+ // If not set throws an exception
+ Protobuf::getCodec('test');
+ end.
+
+ it. 'should unregister the default codec'
+ $result = Protobuf::unregisterCodec('default');
+ $result should be true;
+ // Ensure a new default is given
+ $getted = Protobuf::getCodec();
+ $getted should be instanceof 'DrSlump\Protobuf\Codec\Binary'
+ end.
+ end;
+end;
+
+
+
+
+
--- /dev/null
+++ b/lib/Protobuf-PHP/tests/benchmark.php
@@ -1,1 +1,74 @@
+<?php
+require_once 'Benchmark/Profiler.php';
+require_once __DIR__ . '/../library/DrSlump/Protobuf.php';
+
+use \DrSlump\Protobuf;
+
+Protobuf::autoload();
+
+include_once __DIR__ . '/protos/simple.php';
+include_once __DIR__ . '/protos/addressbook.php';
+
+
+class Benchmark {
+
+ protected $tests = array(
+ 'DecodeBinarySimple',
+ 'DecodeJsonSimple',
+ );
+
+ public function run($iterations = 1000)
+ {
+ $profiler = new Benchmark_Profiler(true);
+ foreach ($this->tests as $test) {
+ $method = 'config' . $test;
+ $args = $this->$method();
+
+ $method = 'run' . $test;
+ $profiler->enterSection($test);
+ for ($i=0; $i<$iterations; $i++) {
+ call_user_func_array(array($this, $method), $args);
+ }
+ $profiler->leaveSection($test);
+ }
+
+ $profiler->stop();
+ $profiler->display();
+ }
+
+ protected function configDecodeBinarySimple()
+ {
+ return array(
+ new Protobuf\Codec\Binary(),
+ file_get_contents(__DIR__ . '/protos/simple.bin')
+ );
+ }
+
+ protected function runDecodeBinarySimple($codec, $data)
+ {
+ $codec->decode(new tests\Simple(), $data);
+ }
+
+ protected function configDecodeJsonSimple()
+ {
+ $codecBin = new Protobuf\Codec\Binary();
+ $codecJson = new Protobuf\Codec\Json();
+
+ $bin = $this->configDecodeBinarySimple();
+ $simple = $codecBin->decode(new tests\Simple(), $bin[1]);
+ $data = $codecJson->encode($simple);
+ return array($codecJson, $data);
+ }
+
+ protected function runDecodeJsonSimple($codec, $data)
+ {
+ $codec->decode(new tests\Simple(), $data);
+ }
+}
+
+
+$bench = new Benchmark();
+$bench->run(1000);
+
+
--- /dev/null
+++ b/lib/Protobuf-PHP/tests/protos/Annotated/Addressbook.php
@@ -1,1 +1,10 @@
+<?php
+/**
+ * Created by IntelliJ IDEA.
+ * User: drslump
+ * Date: 6/27/11
+ * Time: 12:48 AM
+ * To change this template use File | Settings | File Templates.
+ */
+
--- /dev/null
+++ b/lib/Protobuf-PHP/tests/protos/Annotated/Repeated.php
@@ -1,1 +1,20 @@
+<?php
+namespace Tests\Annotated;
+
+class Repeated extends \DrSlump\Protobuf\AnnotatedMessage
+{
+ /** @protobuf(tag=1, type=string, repeated) */
+ public $string;
+ /** @protobuf(tag=2, type=int32, repeated) */
+ public $int;
+ /** @protobuf(tag=3, type=message, reference=tests\Annotated\RepeatedNested, repeated) */
+ public $nested;
+}
+
+class RepeatedNested extends \DrSlump\Protobuf\AnnotatedMessage
+{
+ /** @protobuf(tag=1, type=int32) */
+ public $id;
+}
+
--- /dev/null
+++ b/lib/Protobuf-PHP/tests/protos/Annotated/Simple.php
@@ -1,1 +1,14 @@
+<?php
+namespace Tests\Annotated;
+
+class Simple extends \DrSlump\Protobuf\AnnotatedMessage
+{
+ /** @protobuf(tag=1, type=string, required) */
+ public $foo;
+ /** @protobuf(tag=2, type=int32, required) */
+ public $bar;
+ /** @protobuf(tag=3, type=string, optional) */
+ public $baz;
+}
+
Binary files /dev/null and b/lib/Protobuf-PHP/tests/protos/addressbook.bin differ
--- /dev/null
+++ b/lib/Protobuf-PHP/tests/protos/addressbook.php
@@ -1,1 +1,460 @@
-
+<?php
+// DO NOT EDIT! Generated by Protobuf for PHP protoc plugin @package_version@
+// Source: addressbook.proto
+// Date: 2011-04-13 17:07:17
+
+namespace tests {
+
+ class Person extends \DrSlump\Protobuf\Message {
+
+ /** @var \Closure[] */
+ protected static $__extensions = array();
+
+ public static function descriptor()
+ {
+ $descriptor = new \DrSlump\Protobuf\Descriptor('\tests\Person');
+
+ // required name = 1
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 1;
+ $f->name = "name";
+ $f->type = 9;
+ $f->rule = 2;
+ $descriptor->addField($f);
+
+ // required id = 2
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 2;
+ $f->name = "id";
+ $f->type = 5;
+ $f->rule = 2;
+ $descriptor->addField($f);
+
+ // optional email = 3
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 3;
+ $f->name = "email";
+ $f->type = 9;
+ $f->rule = 1;
+ $descriptor->addField($f);
+
+ // repeated .tests.Person.PhoneNumber phone = 4
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 4;
+ $f->name = "phone";
+ $f->type = 11;
+ $f->rule = 3;
+ $f->reference = '\tests\Person\PhoneNumber';
+ $descriptor->addField($f);
+
+ foreach (self::$__extensions as $cb) {
+ $descriptor->addField($cb(), true);
+ }
+
+ return $descriptor;
+ }
+
+ /** @var string */
+ public $name = null;
+
+ /** @var int */
+ public $id = null;
+
+ /** @var string */
+ public $email = null;
+
+ /** @var \tests\Person\PhoneNumber[] */
+ public $phone = array();
+
+
+ /**
+ * Check if <name> has a value
+ *
+ * @return boolean
+ */
+ public function hasName(){
+ return $this->_has(1);
+ }
+
+ /**
+ * Clear <name> value
+ *
+ * @return \tests\Person
+ */
+ public function clearName(){
+ return $this->_clear(1);
+ }
+
+ /**
+ * Get <name> value
+ *
+ * @return string
+ */
+ public function getName(){
+ return $this->_get(1);
+ }
+
+ /**
+ * Set <name> value
+ *
+ * @param string $value
+ * @return \tests\Person
+ */
+ public function setName( $value){
+ return $this->_set(1, $value);
+ }
+
+ /**
+ * Check if <id> has a value
+ *
+ * @return boolean
+ */
+ public function hasId(){
+ return $this->_has(2);
+ }
+
+ /**
+ * Clear <id> value
+ *
+ * @return \tests\Person
+ */
+ public function clearId(){
+ return $this->_clear(2);
+ }
+
+ /**
+ * Get <id> value
+ *
+ * @return int
+ */
+ public function getId(){
+ return $this->_get(2);
+ }
+
+ /**
+ * Set <id> value
+ *
+ * @param int $value
+ * @return \tests\Person
+ */
+ public function setId( $value){
+ return $this->_set(2, $value);
+ }
+
+ /**
+ * Check if <email> has a value
+ *
+ * @return boolean
+ */
+ public function hasEmail(){
+ return $this->_has(3);
+ }
+
+ /**
+ * Clear <email> value
+ *
+ * @return \tests\Person
+ */
+ public function clearEmail(){
+ return $this->_clear(3);
+ }
+
+ /**
+ * Get <email> value
+ *
+ * @return string
+ */
+ public function getEmail(){
+ return $this->_get(3);
+ }
+
+ /**
+ * Set <email> value
+ *
+ * @param string $value
+ * @return \tests\Person
+ */
+ public function setEmail( $value){
+ return $this->_set(3, $value);
+ }
+
+ /**
+ * Check if <phone> has a value
+ *
+ * @return boolean
+ */
+ public function hasPhone(){
+ return $this->_has(4);
+ }
+
+ /**
+ * Clear <phone> value
+ *
+ * @return \tests\Person
+ */
+ public function clearPhone(){
+ return $this->_clear(4);
+ }
+
+ /**
+ * Get <phone> value
+ *
+ * @param int $idx
+ * @return \tests\Person\PhoneNumber
+ */
+ public function getPhone($idx = NULL){
+ return $this->_get(4, $idx);
+ }
+
+ /**
+ * Set <phone> value
+ *
+ * @param \tests\Person\PhoneNumber $value
+ * @return \tests\Person
+ */
+ public function setPhone(\tests\Person\PhoneNumber $value, $idx = NULL){
+ return $this->_set(4, $value, $idx);
+ }
+
+ /**
+ * Get all elements of <phone>
+ *
+ * @return \tests\Person\PhoneNumber[]
+ */
+ public function getPhoneList(){
+ return $this->_get(4);
+ }
+
+ /**
+ * Add a new element to <phone>
+ *
+ * @param \tests\Person\PhoneNumber $value
+ * @return \tests\Person
+ */
+ public function addPhone(\tests\Person\PhoneNumber $value){
+ return $this->_add(4, $value);
+ }
+
+ }
+}
+
+namespace tests\Person {
+
+ class PhoneType {
+ const MOBILE = 0;
+ const HOME = 1;
+ const WORK = 2;
+ }
+}
+
+namespace tests\Person {
+
+ class PhoneNumber extends \DrSlump\Protobuf\Message {
+
+ /** @var \Closure[] */
+ protected static $__extensions = array();
+
+ public static function descriptor(\DrSlump\Protobuf\Descriptor $descriptor = NULL)
+ {
+ $descriptor = new \DrSlump\Protobuf\Descriptor('\tests\Person\PhoneNumber');
+
+ // required number = 1
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 1;
+ $f->name = "number";
+ $f->type = 9;
+ $f->rule = 2;
+ $descriptor->addField($f);
+
+ // optional .tests.Person.PhoneType type = 2
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 2;
+ $f->name = "type";
+ $f->type = 14;
+ $f->rule = 1;
+ $f->reference = '\tests\Person\PhoneType';
+ $f->default = \tests\Person\PhoneType::HOME;
+ $descriptor->addField($f);
+
+ foreach (self::$__extensions as $cb) {
+ $descriptor->addField($cb(), true);
+ }
+
+ return $descriptor;
+ }
+
+ /** @var string */
+ public $number = null;
+
+ /** @var int - \tests\Person\PhoneType */
+ public $type = \tests\Person\PhoneType::HOME;
+
+
+ /**
+ * Check if <number> has a value
+ *
+ * @return boolean
+ */
+ public function hasNumber(){
+ return $this->_has(1);
+ }
+
+ /**
+ * Clear <number> value
+ *
+ * @return \tests\Person\PhoneNumber
+ */
+ public function clearNumber(){
+ return $this->_clear(1);
+ }
+
+ /**
+ * Get <number> value
+ *
+ * @return string
+ */
+ public function getNumber(){
+ return $this->_get(1);
+ }
+
+ /**
+ * Set <number> value
+ *
+ * @param string $value
+ * @return \tests\Person\PhoneNumber
+ */
+ public function setNumber( $value){
+ return $this->_set(1, $value);
+ }
+
+ /**
+ * Check if <type> has a value
+ *
+ * @return boolean
+ */
+ public function hasType(){
+ return $this->_has(2);
+ }
+
+ /**
+ * Clear <type> value
+ *
+ * @return \tests\Person\PhoneNumber
+ */
+ public function clearType(){
+ return $this->_clear(2);
+ }
+
+ /**
+ * Get <type> value
+ *
+ * @return int - \tests\Person\PhoneType
+ */
+ public function getType(){
+ return $this->_get(2);
+ }
+
+ /**
+ * Set <type> value
+ *
+ * @param int - \tests\Person\PhoneType $value
+ * @return \tests\Person\PhoneNumber
+ */
+ public function setType( $value){
+ return $this->_set(2, $value);
+ }
+
+ }
+}
+
+namespace tests {
+
+ class AddressBook extends \DrSlump\Protobuf\Message {
+
+ /** @var \Closure[] */
+ protected static $__extensions = array();
+
+ public static function descriptor(\DrSlump\Protobuf\Descriptor $descriptor = NULL)
+ {
+ $descriptor = new \DrSlump\Protobuf\Descriptor('\tests\AddressBook');
+
+ // repeated .tests.Person person = 1
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 1;
+ $f->name = "person";
+ $f->type = 11;
+ $f->rule = 3;
+ $f->reference = '\tests\Person';
+ $descriptor->addField($f);
+
+ foreach (self::$__extensions as $cb) {
+ $descriptor->addField($cb(), true);
+ }
+
+ return $descriptor;
+ }
+
+ /** @var \tests\Person[] */
+ public $person = array();
+
+
+ /**
+ * Check if <person> has a value
+ *
+ * @return boolean
+ */
+ public function hasPerson(){
+ return $this->_has(1);
+ }
+
+ /**
+ * Clear <person> value
+ *
+ * @return \tests\AddressBook
+ */
+ public function clearPerson(){
+ return $this->_clear(1);
+ }
+
+ /**
+ * Get <person> value
+ *
+ * @param int $idx
+ * @return \tests\Person
+ */
+ public function getPerson($idx = NULL){
+ return $this->_get(1, $idx);
+ }
+
+ /**
+ * Set <person> value
+ *
+ * @param \tests\Person $value
+ * @return \tests\AddressBook
+ */
+ public function setPerson(\tests\Person $value, $idx = NULL){
+ return $this->_set(1, $value, $idx);
+ }
+
+ /**
+ * Get all elements of <person>
+ *
+ * @return \tests\Person[]
+ */
+ public function getPersonList(){
+ return $this->_get(1);
+ }
+
+ /**
+ * Add a new element to <person>
+ *
+ * @param \tests\Person $value
+ * @return \tests\AddressBook
+ */
+ public function addPerson(\tests\Person $value){
+ return $this->_add(1, $value);
+ }
+
+ }
+}
+
--- /dev/null
+++ b/lib/Protobuf-PHP/tests/protos/addressbook.proto
@@ -1,1 +1,44 @@
+import "php.proto";
+package tests;
+
+//option (php.namespace) = "Example";
+//option (php.multifile) = true;
+
+/**
+ * Defines a Person in the addressbook
+ */
+message Person {
+ /* The full name of the person */
+ required string name = 1;
+ /* The person Id in the database */
+ required int32 id = 2;
+ /* The person email */
+ optional string email = 3;
+
+ /* Different types of phones */
+ enum PhoneType {
+ MOBILE = 0;
+ HOME = 1;
+ WORK = 2;
+ }
+
+ /*
+ A phone number record
+ */
+ message PhoneNumber {
+ required string number = 1;
+ optional PhoneType type = 2 [default = HOME];
+ }
+
+ /* The different phone numbers associated to a person */
+ repeated PhoneNumber phone = 4;
+}
+
+/* A collection of persons contact details */
+message AddressBook {
+ repeated Person person = 1;
+
+ extensions 1000 to max;
+}
+
--- /dev/null
+++ b/lib/Protobuf-PHP/tests/protos/addressbook.txt
@@ -1,1 +1,23 @@
+person {
+ name: "John Doe"
+ id: 2051
+ email: "john.doe@gmail.com"
+ phone {
+ number: "1231231212"
+ type: HOME
+ }
+ phone {
+ number: "55512321312"
+ type: MOBILE
+ }
+}
+person {
+ name: "Iván Montes"
+ id: 23
+ email: "drslump@pollinimini.net"
+ phone {
+ number: "3493123123"
+ type: WORK
+ }
+}
--- /dev/null
+++ b/lib/Protobuf-PHP/tests/protos/repeated-int32.bin
@@ -1,1 +1,1 @@
-
+
--- /dev/null
+++ b/lib/Protobuf-PHP/tests/protos/repeated-int32.txt
@@ -1,1 +1,4 @@
+int: 1
+int: 2
+int: 3
--- /dev/null
+++ b/lib/Protobuf-PHP/tests/protos/repeated-nested.bin
@@ -1,1 +1,1 @@
-
+
--- /dev/null
+++ b/lib/Protobuf-PHP/tests/protos/repeated-nested.txt
@@ -1,1 +1,10 @@
+nested {
+ id: 1
+}
+nested {
+ id: 2
+}
+nested {
+ id: 3
+}
--- /dev/null
+++ b/lib/Protobuf-PHP/tests/protos/repeated-string.bin
@@ -1,1 +1,4 @@
+one
+two
+three
--- /dev/null
+++ b/lib/Protobuf-PHP/tests/protos/repeated-string.txt
@@ -1,1 +1,4 @@
+string: "one"
+string: "two"
+string: "three"
--- /dev/null
+++ b/lib/Protobuf-PHP/tests/protos/repeated.php
@@ -1,1 +1,302 @@
-
+<?php
+// DO NOT EDIT! Generated by Protobuf for PHP protoc plugin @package_version@
+// Source: repeated.proto
+// Date: 2011-04-12 14:07:42
+
+namespace tests {
+
+ class Repeated extends \DrSlump\Protobuf\Message {
+
+ /** @var \Closure[] */
+ protected static $__extensions = array();
+
+ public static function descriptor(\DrSlump\Protobuf\Descriptor $descriptor = NULL)
+ {
+ $descriptor = new \DrSlump\Protobuf\Descriptor('\tests\Repeated');
+
+ // repeated string = 1
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 1;
+ $f->name = "string";
+ $f->type = 9;
+ $f->rule = 3;
+ $descriptor->addField($f);
+
+ // repeated int = 2
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 2;
+ $f->name = "int";
+ $f->type = 5;
+ $f->rule = 3;
+ $descriptor->addField($f);
+
+ // repeated .tests.Repeated.Nested nested = 3
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 3;
+ $f->name = "nested";
+ $f->type = 11;
+ $f->rule = 3;
+ $f->reference = '\tests\Repeated\Nested';
+ $descriptor->addField($f);
+
+ foreach (self::$__extensions as $cb) {
+ $descriptor->addField($cb(), true);
+ }
+
+ return $descriptor;
+ }
+
+ /** @var string[] */
+ public $string = array();
+
+ /** @var int[] */
+ public $int = array();
+
+ /** @var \tests\Repeated\Nested[] */
+ public $nested = array();
+
+
+ /**
+ * Check if <string> has a value
+ *
+ * @return boolean
+ */
+ public function hasString(){
+ return $this->_has(1);
+ }
+
+ /**
+ * Clear <string> value
+ *
+ * @return \tests\Repeated
+ */
+ public function clearString(){
+ return $this->_clear(1);
+ }
+
+ /**
+ * Get <string> value
+ *
+ * @param int $idx
+ * @return string
+ */
+ public function getString($idx = NULL){
+ return $this->_get(1, $idx);
+ }
+
+ /**
+ * Set <string> value
+ *
+ * @param string $value
+ * @return \tests\Repeated
+ */
+ public function setString( $value, $idx = NULL){
+ return $this->_set(1, $value, $idx);
+ }
+
+ /**
+ * Get all elements of <string>
+ *
+ * @return string[]
+ */
+ public function getStringList(){
+ return $this->_get(1);
+ }
+
+ /**
+ * Add a new element to <string>
+ *
+ * @param string $value
+ * @return \tests\Repeated
+ */
+ public function addString( $value){
+ return $this->_add(1, $value);
+ }
+
+ /**
+ * Check if <int> has a value
+ *
+ * @return boolean
+ */
+ public function hasInt(){
+ return $this->_has(2);
+ }
+
+ /**
+ * Clear <int> value
+ *
+ * @return \tests\Repeated
+ */
+ public function clearInt(){
+ return $this->_clear(2);
+ }
+
+ /**
+ * Get <int> value
+ *
+ * @param int $idx
+ * @return int
+ */
+ public function getInt($idx = NULL){
+ return $this->_get(2, $idx);
+ }
+
+ /**
+ * Set <int> value
+ *
+ * @param int $value
+ * @return \tests\Repeated
+ */
+ public function setInt( $value, $idx = NULL){
+ return $this->_set(2, $value, $idx);
+ }
+
+ /**
+ * Get all elements of <int>
+ *
+ * @return int[]
+ */
+ public function getIntList(){
+ return $this->_get(2);
+ }
+
+ /**
+ * Add a new element to <int>
+ *
+ * @param int $value
+ * @return \tests\Repeated
+ */
+ public function addInt( $value){
+ return $this->_add(2, $value);
+ }
+
+ /**
+ * Check if <nested> has a value
+ *
+ * @return boolean
+ */
+ public function hasNested(){
+ return $this->_has(3);
+ }
+
+ /**
+ * Clear <nested> value
+ *
+ * @return \tests\Repeated
+ */
+ public function clearNested(){
+ return $this->_clear(3);
+ }
+
+ /**
+ * Get <nested> value
+ *
+ * @param int $idx
+ * @return \tests\Repeated\Nested
+ */
+ public function getNested($idx = NULL){
+ return $this->_get(3, $idx);
+ }
+
+ /**
+ * Set <nested> value
+ *
+ * @param \tests\Repeated\Nested $value
+ * @return \tests\Repeated
+ */
+ public function setNested(\tests\Repeated\Nested $value, $idx = NULL){
+ return $this->_set(3, $value, $idx);
+ }
+
+ /**
+ * Get all elements of <nested>
+ *
+ * @return \tests\Repeated\Nested[]
+ */
+ public function getNestedList(){
+ return $this->_get(3);
+ }
+
+ /**
+ * Add a new element to <nested>
+ *
+ * @param \tests\Repeated\Nested $value
+ * @return \tests\Repeated
+ */
+ public function addNested(\tests\Repeated\Nested $value){
+ return $this->_add(3, $value);
+ }
+
+ }
+}
+
+namespace tests\Repeated {
+
+ class Nested extends \DrSlump\Protobuf\Message {
+
+ /** @var \Closure[] */
+ protected static $__extensions = array();
+
+ public static function descriptor(\DrSlump\Protobuf\Descriptor $descriptor = NULL)
+ {
+ $descriptor = new \DrSlump\Protobuf\Descriptor('\tests\Repeated\Nested');
+
+ // optional id = 1
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 1;
+ $f->name = "id";
+ $f->type = 5;
+ $f->rule = 1;
+ $descriptor->addField($f);
+
+ foreach (self::$__extensions as $cb) {
+ $descriptor->addField($cb(), true);
+ }
+
+ return $descriptor;
+ }
+
+ /** @var int */
+ public $id = null;
+
+
+ /**
+ * Check if <id> has a value
+ *
+ * @return boolean
+ */
+ public function hasId(){
+ return $this->_has(1);
+ }
+
+ /**
+ * Clear <id> value
+ *
+ * @return \tests\Repeated\Nested
+ */
+ public function clearId(){
+ return $this->_clear(1);
+ }
+
+ /**
+ * Get <id> value
+ *
+ * @return int
+ */
+ public function getId(){
+ return $this->_get(1);
+ }
+
+ /**
+ * Set <id> value
+ *
+ * @param int $value
+ * @return \tests\Repeated\Nested
+ */
+ public function setId( $value){
+ return $this->_set(1, $value);
+ }
+
+ }
+}
+
--- /dev/null
+++ b/lib/Protobuf-PHP/tests/protos/repeated.proto
@@ -1,1 +1,13 @@
+package tests;
+message Repeated {
+
+ message Nested {
+ optional int32 id = 1;
+ }
+
+ repeated string string = 1;
+ repeated int32 int = 2;
+ repeated Nested nested = 3;
+}
+
--- /dev/null
+++ b/lib/Protobuf-PHP/tests/protos/simple.bin
@@ -1,1 +1,1 @@
-
--- /dev/null
+++ b/lib/Protobuf-PHP/tests/protos/simple.php
@@ -1,1 +1,789 @@
-
+<?php
+// DO NOT EDIT! Generated by Protobuf-PHP protoc plugin @package_version@
+// Source: simple.proto
+// Date: 2011-07-10 10:05:44
+
+// @@protoc_insertion_point(scope_file)
+
+namespace tests {
+
+ // @@protoc_insertion_point(scope_namespace)
+ // @@protoc_insertion_point(namespace_tests)
+
+ class Simple extends \DrSlump\Protobuf\Message {
+
+ /** @var \Closure[] */
+ protected static $__extensions = array();
+
+ public static function descriptor()
+ {
+ $descriptor = new \DrSlump\Protobuf\Descriptor('\tests\Simple');
+
+ // optional double = 1
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 1;
+ $f->name = "double";
+ $f->type = 1;
+ $f->rule = 1;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_tests.Simple:double)
+ $descriptor->addField($f);
+
+ // optional float = 2
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 2;
+ $f->name = "float";
+ $f->type = 2;
+ $f->rule = 1;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_tests.Simple:float)
+ $descriptor->addField($f);
+
+ // optional int64 = 3
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 3;
+ $f->name = "int64";
+ $f->type = 3;
+ $f->rule = 1;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_tests.Simple:int64)
+ $descriptor->addField($f);
+
+ // optional uint64 = 4
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 4;
+ $f->name = "uint64";
+ $f->type = 4;
+ $f->rule = 1;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_tests.Simple:uint64)
+ $descriptor->addField($f);
+
+ // optional int32 = 5
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 5;
+ $f->name = "int32";
+ $f->type = 5;
+ $f->rule = 1;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_tests.Simple:int32)
+ $descriptor->addField($f);
+
+ // optional fixed64 = 6
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 6;
+ $f->name = "fixed64";
+ $f->type = 6;
+ $f->rule = 1;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_tests.Simple:fixed64)
+ $descriptor->addField($f);
+
+ // optional fixed32 = 7
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 7;
+ $f->name = "fixed32";
+ $f->type = 7;
+ $f->rule = 1;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_tests.Simple:fixed32)
+ $descriptor->addField($f);
+
+ // optional bool = 8
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 8;
+ $f->name = "bool";
+ $f->type = 8;
+ $f->rule = 1;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_tests.Simple:bool)
+ $descriptor->addField($f);
+
+ // optional string = 9
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 9;
+ $f->name = "string";
+ $f->type = 9;
+ $f->rule = 1;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_tests.Simple:string)
+ $descriptor->addField($f);
+
+ // optional bytes = 12
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 12;
+ $f->name = "bytes";
+ $f->type = 12;
+ $f->rule = 1;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_tests.Simple:bytes)
+ $descriptor->addField($f);
+
+ // optional uint32 = 13
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 13;
+ $f->name = "uint32";
+ $f->type = 13;
+ $f->rule = 1;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_tests.Simple:uint32)
+ $descriptor->addField($f);
+
+ // optional sfixed32 = 15
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 15;
+ $f->name = "sfixed32";
+ $f->type = 15;
+ $f->rule = 1;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_tests.Simple:sfixed32)
+ $descriptor->addField($f);
+
+ // optional sfixed64 = 16
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 16;
+ $f->name = "sfixed64";
+ $f->type = 16;
+ $f->rule = 1;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_tests.Simple:sfixed64)
+ $descriptor->addField($f);
+
+ // optional sint32 = 17
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 17;
+ $f->name = "sint32";
+ $f->type = 17;
+ $f->rule = 1;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_tests.Simple:sint32)
+ $descriptor->addField($f);
+
+ // optional sint64 = 18
+ $f = new \DrSlump\Protobuf\Field();
+ $f->number = 18;
+ $f->name = "sint64";
+ $f->type = 18;
+ $f->rule = 1;
+ // @@protoc_insertion_point(scope_field)
+ // @@protoc_insertion_point(field_tests.Simple:sint64)
+ $descriptor->addField($f);
+
+ foreach (self::$__extensions as $cb) {
+ $descriptor->addField($cb(), true);
+ }
+
+ // @@protoc_insertion_point(scope_descriptor)
+ // @@protoc_insertion_point(descriptor_tests.Simple)
+
+ return $descriptor;
+ }
+
+ /** @var float */
+ public $double = null;
+
+ /** @var float */
+ public $float = null;
+
+ /** @var int */
+ public $int64 = null;
+
+ /** @var int */
+ public $uint64 = null;
+
+ /** @var int */
+ public $int32 = null;
+
+ /** @var int */
+ public $fixed64 = null;
+
+ /** @var int */
+ public $fixed32 = null;
+
+ /** @var boolean */
+ public $bool = null;
+
+ /** @var string */
+ public $string = null;
+
+ /** @var string */
+ public $bytes = null;
+
+ /** @var int */
+ public $uint32 = null;
+
+ /** @var int */
+ public $sfixed32 = null;
+
+ /** @var int */
+ public $sfixed64 = null;
+
+ /** @var int */
+ public $sint32 = null;
+
+ /** @var int */
+ public $sint64 = null;
+
+
+ /**
+ * Check if <double> has a value
+ *
+ * @return boolean
+ */
+ public function hasDouble(){
+ return $this->_has(1);
+ }
+
+ /**
+ * Clear <double> value
+ *
+ * @return \tests\Simple
+ */
+ public function clearDouble(){
+ return $this->_clear(1);
+ }
+
+ /**
+ * Get <double> value
+ *
+ * @return float
+ */
+ public function getDouble(){
+ return $this->_get(1);
+ }
+
+ /**
+ * Set <double> value
+ *
+ * @param float $value
+ * @return \tests\Simple
+ */
+ public function setDouble( $value){
+ return $this->_set(1, $value);
+ }
+
+ /**
+ * Check if <float> has a value
+ *
+ * @return boolean
+ */
+ public function hasFloat(){
+ return $this->_has(2);
+ }
+
+ /**
+ * Clear <float> value
+ *
+ * @return \tests\Simple
+ */
+ public function clearFloat(){
+ return $this->_clear(2);
+ }
+
+ /**
+ * Get <float> value
+ *
+ * @return float
+ */
+ public function getFloat(){
+ return $this->_get(2);
+ }
+
+ /**
+ * Set <float> value
+ *
+ * @param float $value
+ * @return \tests\Simple
+ */
+ public function setFloat( $value){
+ return $this->_set(2, $value);
+ }
+
+ /**
+ * Check if <int64> has a value
+ *
+ * @return boolean
+ */
+ public function hasInt64(){
+ return $this->_has(3);
+ }
+
+ /**
+ * Clear <int64> value
+ *
+ * @return \tests\Simple
+ */
+ public function clearInt64(){
+ return $this->_clear(3);
+ }
+
+ /**
+ * Get <int64> value
+ *
+ * @return int
+ */
+ public function getInt64(){
+ return $this->_get(3);
+ }
+
+ /**
+ * Set <int64> value
+ *
+ * @param int $value
+ * @return \tests\Simple
+ */
+ public function setInt64( $value){
+ return $this->_set(3, $value);
+ }
+
+ /**
+ * Check if <uint64> has a value
+ *
+ * @return boolean
+ */
+ public function hasUint64(){
+ return $this->_has(4);
+ }
+
+ /**
+ * Clear <uint64> value
+ *
+ * @return \tests\Simple
+ */
+ public function clearUint64(){
+ return $this->_clear(4);
+ }
+
+ /**
+ * Get <uint64> value
+ *
+ * @return int
+ */
+ public function getUint64(){
+ return $this->_get(4);
+ }
+
+ /**
+ * Set <uint64> value
+ *
+ * @param int $value
+ * @return \tests\Simple
+ */
+ public function setUint64( $value){
+ return $this->_set(4, $value);
+ }
+
+ /**
+ * Check if <int32> has a value
+ *
+ * @return boolean
+ */
+ public function hasInt32(){
+ return $this->_has(5);
+ }
+
+ /**
+ * Clear <int32> value
+ *
+ * @return \tests\Simple
+ */
+ public function clearInt32(){
+ return $this->_clear(5);
+ }
+
+ /**
+ * Get <int32> value
+ *
+ * @return int
+ */
+ public function getInt32(){
+ return $this->_get(5);
+ }
+
+ /**
+ * Set <int32> value
+ *
+ * @param int $value
+ * @return \tests\Simple
+ */
+ public function setInt32( $value){
+ return $this->_set(5, $value);
+ }
+
+ /**
+ * Check if <fixed64> has a value
+ *
+ * @return boolean
+ */
+ public function hasFixed64(){
+ return $this->_has(6);
+ }
+
+ /**
+ * Clear <fixed64> value
+ *
+ * @return \tests\Simple
+ */
+ public function clearFixed64(){
+ return $this->_clear(6);
+ }
+
+ /**
+ * Get <fixed64> value
+ *
+ * @return int
+ */
+ public function getFixed64(){
+ return $this->_get(6);
+ }
+
+ /**
+ * Set <fixed64> value
+ *
+ * @param int $value
+ * @return \tests\Simple
+ */
+ public function setFixed64( $value){
+ return $this->_set(6, $value);
+ }
+
+ /**
+ * Check if <fixed32> has a value
+ *
+ * @return boolean
+ */
+ public function hasFixed32(){
+ return $this->_has(7);
+ }
+
+ /**
+ * Clear <fixed32> value
+ *
+ * @return \tests\Simple
+ */
+ public function clearFixed32(){
+ return $this->_clear(7);
+ }
+
+ /**
+ * Get <fixed32> value
+ *
+ * @return int
+ */
+ public function getFixed32(){
+ return $this->_get(7);
+ }
+
+ /**
+ * Set <fixed32> value
+ *
+ * @param int $value
+ * @return \tests\Simple
+ */
+ public function setFixed32( $value){
+ return $this->_set(7, $value);
+ }
+
+ /**
+ * Check if <bool> has a value
+ *
+ * @return boolean
+ */
+ public function hasBool(){
+ return $this->_has(8);
+ }
+
+ /**
+ * Clear <bool> value
+ *
+ * @return \tests\Simple
+ */
+ public function clearBool(){
+ return $this->_clear(8);
+ }
+
+ /**
+ * Get <bool> value
+ *
+ * @return boolean
+ */
+ public function getBool(){
+ return $this->_get(8);
+ }
+
+ /**
+ * Set <bool> value
+ *
+ * @param boolean $value
+ * @return \tests\Simple
+ */
+ public function setBool( $value){
+ return $this->_set(8, $value);
+ }
+
+ /**
+ * Check if <string> has a value
+ *
+ * @return boolean
+ */
+ public function hasString(){
+ return $this->_has(9);
+ }
+
+ /**
+ * Clear <string> value
+ *
+ * @return \tests\Simple
+ */
+ public function clearString(){
+ return $this->_clear(9);
+ }
+
+ /**
+ * Get <string> value
+ *
+ * @return string
+ */
+ public function getString(){
+ return $this->_get(9);
+ }
+
+ /**
+ * Set <string> value
+ *
+ * @param string $value
+ * @return \tests\Simple
+ */
+ public function setString( $value){
+ return $this->_set(9, $value);
+ }
+
+ /**
+ * Check if <bytes> has a value
+ *
+ * @return boolean
+ */
+ public function hasBytes(){
+ return $this->_has(12);
+ }
+
+ /**
+ * Clear <bytes> value
+ *
+ * @return \tests\Simple
+ */
+ public function clearBytes(){
+ return $this->_clear(12);
+ }
+
+ /**
+ * Get <bytes> value
+ *
+ * @return string
+ */
+ public function getBytes(){
+ return $this->_get(12);
+ }
+
+ /**
+ * Set <bytes> value
+ *
+ * @param string $value
+ * @return \tests\Simple
+ */
+ public function setBytes( $value){
+ return $this->_set(12, $value);
+ }
+
+ /**
+ * Check if <uint32> has a value
+ *
+ * @return boolean
+ */
+ public function hasUint32(){
+ return $this->_has(13);
+ }
+
+ /**
+ * Clear <uint32> value
+ *
+ * @return \tests\Simple
+ */
+ public function clearUint32(){
+ return $this->_clear(13);
+ }
+
+ /**
+ * Get <uint32> value
+ *
+ * @return int
+ */
+ public function getUint32(){
+ return $this->_get(13);
+ }
+
+ /**
+ * Set <uint32> value
+ *
+ * @param int $value
+ * @return \tests\Simple
+ */
+ public function setUint32( $value){
+ return $this->_set(13, $value);
+ }
+
+ /**
+ * Check if <sfixed32> has a value
+ *
+ * @return boolean
+ */
+ public function hasSfixed32(){
+ return $this->_has(15);
+ }
+
+ /**
+ * Clear <sfixed32> value
+ *
+ * @return \tests\Simple
+ */
+ public function clearSfixed32(){
+ return $this->_clear(15);
+ }
+
+ /**
+ * Get <sfixed32> value
+ *
+ * @return int
+ */
+ public function getSfixed32(){
+ return $this->_get(15);
+ }
+
+ /**
+ * Set <sfixed32> value
+ *
+ * @param int $value
+ * @return \tests\Simple
+ */
+ public function setSfixed32( $value){
+ return $this->_set(15, $value);
+ }
+
+ /**
+ * Check if <sfixed64> has a value
+ *
+ * @return boolean
+ */
+ public function hasSfixed64(){
+ return $this->_has(16);
+ }
+
+ /**
+ * Clear <sfixed64> value
+ *
+ * @return \tests\Simple
+ */
+ public function clearSfixed64(){
+ return $this->_clear(16);
+ }
+
+ /**
+ * Get <sfixed64> value
+ *
+ * @return int
+ */
+ public function getSfixed64(){
+ return $this->_get(16);
+ }
+
+ /**
+ * Set <sfixed64> value
+ *
+ * @param int $value
+ * @return \tests\Simple
+ */
+ public function setSfixed64( $value){
+ return $this->_set(16, $value);
+ }
+
+ /**
+ * Check if <sint32> has a value
+ *
+ * @return boolean
+ */
+ public function hasSint32(){
+ return $this->_has(17);
+ }
+
+ /**
+ * Clear <sint32> value
+ *
+ * @return \tests\Simple
+ */
+ public function clearSint32(){
+ return $this->_clear(17);
+ }
+
+ /**
+ * Get <sint32> value
+ *
+ * @return int
+ */
+ public function getSint32(){
+ return $this->_get(17);
+ }
+
+ /**
+ * Set <sint32> value
+ *
+ * @param int $value
+ * @return \tests\Simple
+ */
+ public function setSint32( $value){
+ return $this->_set(17, $value);
+ }
+
+ /**
+ * Check if <sint64> has a value
+ *
+ * @return boolean
+ */
+ public function hasSint64(){
+ return $this->_has(18);
+ }
+
+ /**
+ * Clear <sint64> value
+ *
+ * @return \tests\Simple
+ */
+ public function clearSint64(){
+ return $this->_clear(18);
+ }
+
+ /**
+ * Get <sint64> value
+ *
+ * @return int
+ */
+ public function getSint64(){
+ return $this->_get(18);
+ }
+
+ /**
+ * Set <sint64> value
+ *
+ * @param int $value
+ * @return \tests\Simple
+ */
+ public function setSint64( $value){
+ return $this->_set(18, $value);
+ }
+
+
+ // @@protoc_insertion_point(scope_class)
+ // @@protoc_insertion_point(class_tests.Simple)
+ }
+}
+
+
--- /dev/null
+++ b/lib/Protobuf-PHP/tests/protos/simple.proto
@@ -1,1 +1,20 @@
+package tests;
+message Simple {
+ optional double double = 1;
+ optional float float = 2;
+ optional int64 int64 = 3;
+ optional uint64 uint64 = 4;
+ optional int32 int32 = 5;
+ optional fixed64 fixed64 = 6;
+ optional fixed32 fixed32 = 7;
+ optional bool bool = 8;
+ optional string string = 9;
+ optional bytes bytes = 12;
+ optional uint32 uint32 = 13;
+ optional sfixed32 sfixed32 = 15;
+ optional sfixed64 sfixed64 = 16;
+ optional sint32 sint32 = 17;
+ optional sint64 sint64 = 18;
+}
+
--- /dev/null
+++ b/lib/Protobuf-PHP/tests/protos/simple.txt
@@ -1,1 +1,16 @@
+double: 123456789.12345
+float: 12345.123
+int64: -123456789123456789
+uint64: 123456789123456789
+int32: -123456789
+fixed64: 123456789123456789
+fixed32: 123456789
+bool: 1
+string: "foo"
+bytes: "bar"
+uint32: 123456789
+sfixed32: -123456789
+sfixed64: -123456789123456789
+sint32: -123456789
+sint64: -123456789123456789
--- /dev/null
+++ b/lib/amon-php
--- /dev/null
+++ b/lib/autocomplete.php
@@ -1,1 +1,25 @@
-
+<?php
+include ("../include/common.inc.php");
+$result = Array();
+if (isset($_REQUEST['term'])) {
+ $term = filter_var($_REQUEST['term'], FILTER_SANITIZE_STRING);
+ $query = "Select stop_name,min(stop_lat) as stop_lat,min(stop_lon) as stop_lon from stops where stop_name ILIKE :term group by stop_name";
+ $query = $conn->prepare($query);
+ $term = "$term%";
+ $query->bindParam(":term", $term);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ foreach ($query->fetchAll() as $row) {
+ $name = $row['stop_name'] . " (" . $row['stop_lat'] . "," . $row['stop_lon'] . ")";
+ $result[] = Array(
+ "id" => $name,
+ "label" => $name,
+ "value" => $name
+ );
+ }
+}
+echo json_encode($result);
+?>
--- /dev/null
+++ b/lib/openid-php/Auth/OpenID/Consumer.php
@@ -1,1 +1,2235 @@
-
+<?php
+
+/**
+ * This module documents the main interface with the OpenID consumer
+ * library. The only part of the library which has to be used and
+ * isn't documented in full here is the store required to create an
+ * Auth_OpenID_Consumer instance. More on the abstract store type and
+ * concrete implementations of it that are provided in the
+ * documentation for the Auth_OpenID_Consumer constructor.
+ *
+ * OVERVIEW
+ *
+ * The OpenID identity verification process most commonly uses the
+ * following steps, as visible to the user of this library:
+ *
+ * 1. The user enters their OpenID into a field on the consumer's
+ * site, and hits a login button.
+ * 2. The consumer site discovers the user's OpenID server using the
+ * YADIS protocol.
+ * 3. The consumer site sends the browser a redirect to the identity
+ * server. This is the authentication request as described in
+ * the OpenID specification.
+ * 4. The identity server's site sends the browser a redirect back
+ * to the consumer site. This redirect contains the server's
+ * response to the authentication request.
+ *
+ * The most important part of the flow to note is the consumer's site
+ * must handle two separate HTTP requests in order to perform the full
+ * identity check.
+ *
+ * LIBRARY DESIGN
+ *
+ * This consumer library is designed with that flow in mind. The goal
+ * is to make it as easy as possible to perform the above steps
+ * securely.
+ *
+ * At a high level, there are two important parts in the consumer
+ * library. The first important part is this module, which contains
+ * the interface to actually use this library. The second is the
+ * Auth_OpenID_Interface class, which describes the interface to use
+ * if you need to create a custom method for storing the state this
+ * library needs to maintain between requests.
+ *
+ * In general, the second part is less important for users of the
+ * library to know about, as several implementations are provided
+ * which cover a wide variety of situations in which consumers may use
+ * the library.
+ *
+ * This module contains a class, Auth_OpenID_Consumer, with methods
+ * corresponding to the actions necessary in each of steps 2, 3, and 4
+ * described in the overview. Use of this library should be as easy
+ * as creating an Auth_OpenID_Consumer instance and calling the
+ * methods appropriate for the action the site wants to take.
+ *
+ * STORES AND DUMB MODE
+ *
+ * OpenID is a protocol that works best when the consumer site is able
+ * to store some state. This is the normal mode of operation for the
+ * protocol, and is sometimes referred to as smart mode. There is
+ * also a fallback mode, known as dumb mode, which is available when
+ * the consumer site is not able to store state. This mode should be
+ * avoided when possible, as it leaves the implementation more
+ * vulnerable to replay attacks.
+ *
+ * The mode the library works in for normal operation is determined by
+ * the store that it is given. The store is an abstraction that
+ * handles the data that the consumer needs to manage between http
+ * requests in order to operate efficiently and securely.
+ *
+ * Several store implementation are provided, and the interface is
+ * fully documented so that custom stores can be used as well. See
+ * the documentation for the Auth_OpenID_Consumer class for more
+ * information on the interface for stores. The implementations that
+ * are provided allow the consumer site to store the necessary data in
+ * several different ways, including several SQL databases and normal
+ * files on disk.
+ *
+ * There is an additional concrete store provided that puts the system
+ * in dumb mode. This is not recommended, as it removes the library's
+ * ability to stop replay attacks reliably. It still uses time-based
+ * checking to make replay attacks only possible within a small
+ * window, but they remain possible within that window. This store
+ * should only be used if the consumer site has no way to retain data
+ * between requests at all.
+ *
+ * IMMEDIATE MODE
+ *
+ * In the flow described above, the user may need to confirm to the
+ * lidentity server that it's ok to authorize his or her identity.
+ * The server may draw pages asking for information from the user
+ * before it redirects the browser back to the consumer's site. This
+ * is generally transparent to the consumer site, so it is typically
+ * ignored as an implementation detail.
+ *
+ * There can be times, however, where the consumer site wants to get a
+ * response immediately. When this is the case, the consumer can put
+ * the library in immediate mode. In immediate mode, there is an
+ * extra response possible from the server, which is essentially the
+ * server reporting that it doesn't have enough information to answer
+ * the question yet.
+ *
+ * USING THIS LIBRARY
+ *
+ * Integrating this library into an application is usually a
+ * relatively straightforward process. The process should basically
+ * follow this plan:
+ *
+ * Add an OpenID login field somewhere on your site. When an OpenID
+ * is entered in that field and the form is submitted, it should make
+ * a request to the your site which includes that OpenID URL.
+ *
+ * First, the application should instantiate the Auth_OpenID_Consumer
+ * class using the store of choice (Auth_OpenID_FileStore or one of
+ * the SQL-based stores). If the application has a custom
+ * session-management implementation, an object implementing the
+ * {@link Auth_Yadis_PHPSession} interface should be passed as the
+ * second parameter. Otherwise, the default uses $_SESSION.
+ *
+ * Next, the application should call the Auth_OpenID_Consumer object's
+ * 'begin' method. This method takes the OpenID URL. The 'begin'
+ * method returns an Auth_OpenID_AuthRequest object.
+ *
+ * Next, the application should call the 'redirectURL' method of the
+ * Auth_OpenID_AuthRequest object. The 'return_to' URL parameter is
+ * the URL that the OpenID server will send the user back to after
+ * attempting to verify his or her identity. The 'trust_root' is the
+ * URL (or URL pattern) that identifies your web site to the user when
+ * he or she is authorizing it. Send a redirect to the resulting URL
+ * to the user's browser.
+ *
+ * That's the first half of the authentication process. The second
+ * half of the process is done after the user's ID server sends the
+ * user's browser a redirect back to your site to complete their
+ * login.
+ *
+ * When that happens, the user will contact your site at the URL given
+ * as the 'return_to' URL to the Auth_OpenID_AuthRequest::redirectURL
+ * call made above. The request will have several query parameters
+ * added to the URL by the identity server as the information
+ * necessary to finish the request.
+ *
+ * Lastly, instantiate an Auth_OpenID_Consumer instance as above and
+ * call its 'complete' method, passing in all the received query
+ * arguments.
+ *
+ * There are multiple possible return types possible from that
+ * method. These indicate the whether or not the login was successful,
+ * and include any additional information appropriate for their type.
+ *
+ * PHP versions 4 and 5
+ *
+ * LICENSE: See the COPYING file included in this distribution.
+ *
+ * @package OpenID
+ * @author JanRain, Inc. <openid@janrain.com>
+ * @copyright 2005-2008 Janrain, Inc.
+ * @license http://www.apache.org/licenses/LICENSE-2.0 Apache
+ */
+
+/**
+ * Require utility classes and functions for the consumer.
+ */
+require_once "Auth/OpenID.php";
+require_once "Auth/OpenID/Message.php";
+require_once "Auth/OpenID/HMAC.php";
+require_once "Auth/OpenID/Association.php";
+require_once "Auth/OpenID/CryptUtil.php";
+require_once "Auth/OpenID/DiffieHellman.php";
+require_once "Auth/OpenID/KVForm.php";
+require_once "Auth/OpenID/Nonce.php";
+require_once "Auth/OpenID/Discover.php";
+require_once "Auth/OpenID/URINorm.php";
+require_once "Auth/Yadis/Manager.php";
+require_once "Auth/Yadis/XRI.php";
+
+/**
+ * This is the status code returned when the complete method returns
+ * successfully.
+ */
+define('Auth_OpenID_SUCCESS', 'success');
+
+/**
+ * Status to indicate cancellation of OpenID authentication.
+ */
+define('Auth_OpenID_CANCEL', 'cancel');
+
+/**
+ * This is the status code completeAuth returns when the value it
+ * received indicated an invalid login.
+ */
+define('Auth_OpenID_FAILURE', 'failure');
+
+/**
+ * This is the status code completeAuth returns when the
+ * {@link Auth_OpenID_Consumer} instance is in immediate mode, and the
+ * identity server sends back a URL to send the user to to complete his
+ * or her login.
+ */
+define('Auth_OpenID_SETUP_NEEDED', 'setup needed');
+
+/**
+ * This is the status code beginAuth returns when the page fetched
+ * from the entered OpenID URL doesn't contain the necessary link tags
+ * to function as an identity page.
+ */
+define('Auth_OpenID_PARSE_ERROR', 'parse error');
+
+/**
+ * An OpenID consumer implementation that performs discovery and does
+ * session management. See the Consumer.php file documentation for
+ * more information.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_Consumer {
+
+ /**
+ * @access private
+ */
+ var $discoverMethod = 'Auth_OpenID_discover';
+
+ /**
+ * @access private
+ */
+ var $session_key_prefix = "_openid_consumer_";
+
+ /**
+ * @access private
+ */
+ var $_token_suffix = "last_token";
+
+ /**
+ * Initialize a Consumer instance.
+ *
+ * You should create a new instance of the Consumer object with
+ * every HTTP request that handles OpenID transactions.
+ *
+ * @param Auth_OpenID_OpenIDStore $store This must be an object
+ * that implements the interface in {@link
+ * Auth_OpenID_OpenIDStore}. Several concrete implementations are
+ * provided, to cover most common use cases. For stores backed by
+ * MySQL, PostgreSQL, or SQLite, see the {@link
+ * Auth_OpenID_SQLStore} class and its sublcasses. For a
+ * filesystem-backed store, see the {@link Auth_OpenID_FileStore}
+ * module. As a last resort, if it isn't possible for the server
+ * to store state at all, an instance of {@link
+ * Auth_OpenID_DumbStore} can be used.
+ *
+ * @param mixed $session An object which implements the interface
+ * of the {@link Auth_Yadis_PHPSession} class. Particularly, this
+ * object is expected to have these methods: get($key), set($key),
+ * $value), and del($key). This defaults to a session object
+ * which wraps PHP's native session machinery. You should only
+ * need to pass something here if you have your own sessioning
+ * implementation.
+ *
+ * @param str $consumer_cls The name of the class to instantiate
+ * when creating the internal consumer object. This is used for
+ * testing.
+ */
+ function Auth_OpenID_Consumer($store, $session = null,
+ $consumer_cls = null)
+ {
+ if ($session === null) {
+ $session = new Auth_Yadis_PHPSession();
+ }
+
+ $this->session = $session;
+
+ if ($consumer_cls !== null) {
+ $this->consumer = new $consumer_cls($store);
+ } else {
+ $this->consumer = new Auth_OpenID_GenericConsumer($store);
+ }
+
+ $this->_token_key = $this->session_key_prefix . $this->_token_suffix;
+ }
+
+ /**
+ * Used in testing to define the discovery mechanism.
+ *
+ * @access private
+ */
+ function getDiscoveryObject($session, $openid_url,
+ $session_key_prefix)
+ {
+ return new Auth_Yadis_Discovery($session, $openid_url,
+ $session_key_prefix);
+ }
+
+ /**
+ * Start the OpenID authentication process. See steps 1-2 in the
+ * overview at the top of this file.
+ *
+ * @param string $user_url Identity URL given by the user. This
+ * method performs a textual transformation of the URL to try and
+ * make sure it is normalized. For example, a user_url of
+ * example.com will be normalized to http://example.com/
+ * normalizing and resolving any redirects the server might issue.
+ *
+ * @param bool $anonymous True if the OpenID request is to be sent
+ * to the server without any identifier information. Use this
+ * when you want to transport data but don't want to do OpenID
+ * authentication with identifiers.
+ *
+ * @return Auth_OpenID_AuthRequest $auth_request An object
+ * containing the discovered information will be returned, with a
+ * method for building a redirect URL to the server, as described
+ * in step 3 of the overview. This object may also be used to add
+ * extension arguments to the request, using its 'addExtensionArg'
+ * method.
+ */
+ function begin($user_url, $anonymous=false)
+ {
+ $openid_url = $user_url;
+
+ $disco = $this->getDiscoveryObject($this->session,
+ $openid_url,
+ $this->session_key_prefix);
+
+ // Set the 'stale' attribute of the manager. If discovery
+ // fails in a fatal way, the stale flag will cause the manager
+ // to be cleaned up next time discovery is attempted.
+
+ $m = $disco->getManager();
+ $loader = new Auth_Yadis_ManagerLoader();
+
+ if ($m) {
+ if ($m->stale) {
+ $disco->destroyManager();
+ } else {
+ $m->stale = true;
+ $disco->session->set($disco->session_key,
+ serialize($loader->toSession($m)));
+ }
+ }
+
+ $endpoint = $disco->getNextService($this->discoverMethod,
+ $this->consumer->fetcher);
+
+ // Reset the 'stale' attribute of the manager.
+ $m = $disco->getManager();
+ if ($m) {
+ $m->stale = false;
+ $disco->session->set($disco->session_key,
+ serialize($loader->toSession($m)));
+ }
+
+ if ($endpoint === null) {
+ return null;
+ } else {
+ return $this->beginWithoutDiscovery($endpoint,
+ $anonymous);
+ }
+ }
+
+ /**
+ * Start OpenID verification without doing OpenID server
+ * discovery. This method is used internally by Consumer.begin
+ * after discovery is performed, and exists to provide an
+ * interface for library users needing to perform their own
+ * discovery.
+ *
+ * @param Auth_OpenID_ServiceEndpoint $endpoint an OpenID service
+ * endpoint descriptor.
+ *
+ * @param bool anonymous Set to true if you want to perform OpenID
+ * without identifiers.
+ *
+ * @return Auth_OpenID_AuthRequest $auth_request An OpenID
+ * authentication request object.
+ */
+ function beginWithoutDiscovery($endpoint, $anonymous=false)
+ {
+ $loader = new Auth_OpenID_ServiceEndpointLoader();
+ $auth_req = $this->consumer->begin($endpoint);
+ $this->session->set($this->_token_key,
+ $loader->toSession($auth_req->endpoint));
+ if (!$auth_req->setAnonymous($anonymous)) {
+ return new Auth_OpenID_FailureResponse(null,
+ "OpenID 1 requests MUST include the identifier " .
+ "in the request.");
+ }
+ return $auth_req;
+ }
+
+ /**
+ * Called to interpret the server's response to an OpenID
+ * request. It is called in step 4 of the flow described in the
+ * consumer overview.
+ *
+ * @param string $current_url The URL used to invoke the application.
+ * Extract the URL from your application's web
+ * request framework and specify it here to have it checked
+ * against the openid.current_url value in the response. If
+ * the current_url URL check fails, the status of the
+ * completion will be FAILURE.
+ *
+ * @param array $query An array of the query parameters (key =>
+ * value pairs) for this HTTP request. Defaults to null. If
+ * null, the GET or POST data are automatically gotten from the
+ * PHP environment. It is only useful to override $query for
+ * testing.
+ *
+ * @return Auth_OpenID_ConsumerResponse $response A instance of an
+ * Auth_OpenID_ConsumerResponse subclass. The type of response is
+ * indicated by the status attribute, which will be one of
+ * SUCCESS, CANCEL, FAILURE, or SETUP_NEEDED.
+ */
+ function complete($current_url, $query=null)
+ {
+ if ($current_url && !is_string($current_url)) {
+ // This is ugly, but we need to complain loudly when
+ // someone uses the API incorrectly.
+ trigger_error("current_url must be a string; see NEWS file " .
+ "for upgrading notes.",
+ E_USER_ERROR);
+ }
+
+ if ($query === null) {
+ $query = Auth_OpenID::getQuery();
+ }
+
+ $loader = new Auth_OpenID_ServiceEndpointLoader();
+ $endpoint_data = $this->session->get($this->_token_key);
+ $endpoint =
+ $loader->fromSession($endpoint_data);
+
+ $message = Auth_OpenID_Message::fromPostArgs($query);
+ $response = $this->consumer->complete($message, $endpoint,
+ $current_url);
+ $this->session->del($this->_token_key);
+
+ if (in_array($response->status, array(Auth_OpenID_SUCCESS,
+ Auth_OpenID_CANCEL))) {
+ if ($response->identity_url !== null) {
+ $disco = $this->getDiscoveryObject($this->session,
+ $response->identity_url,
+ $this->session_key_prefix);
+ $disco->cleanup(true);
+ }
+ }
+
+ return $response;
+ }
+}
+
+/**
+ * A class implementing HMAC/DH-SHA1 consumer sessions.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_DiffieHellmanSHA1ConsumerSession {
+ var $session_type = 'DH-SHA1';
+ var $hash_func = 'Auth_OpenID_SHA1';
+ var $secret_size = 20;
+ var $allowed_assoc_types = array('HMAC-SHA1');
+
+ function Auth_OpenID_DiffieHellmanSHA1ConsumerSession($dh = null)
+ {
+ if ($dh === null) {
+ $dh = new Auth_OpenID_DiffieHellman();
+ }
+
+ $this->dh = $dh;
+ }
+
+ function getRequest()
+ {
+ $math = Auth_OpenID_getMathLib();
+
+ $cpub = $math->longToBase64($this->dh->public);
+
+ $args = array('dh_consumer_public' => $cpub);
+
+ if (!$this->dh->usingDefaultValues()) {
+ $args = array_merge($args, array(
+ 'dh_modulus' =>
+ $math->longToBase64($this->dh->mod),
+ 'dh_gen' =>
+ $math->longToBase64($this->dh->gen)));
+ }
+
+ return $args;
+ }
+
+ function extractSecret($response)
+ {
+ if (!$response->hasKey(Auth_OpenID_OPENID_NS,
+ 'dh_server_public')) {
+ return null;
+ }
+
+ if (!$response->hasKey(Auth_OpenID_OPENID_NS,
+ 'enc_mac_key')) {
+ return null;
+ }
+
+ $math = Auth_OpenID_getMathLib();
+
+ $spub = $math->base64ToLong($response->getArg(Auth_OpenID_OPENID_NS,
+ 'dh_server_public'));
+ $enc_mac_key = base64_decode($response->getArg(Auth_OpenID_OPENID_NS,
+ 'enc_mac_key'));
+
+ return $this->dh->xorSecret($spub, $enc_mac_key, $this->hash_func);
+ }
+}
+
+/**
+ * A class implementing HMAC/DH-SHA256 consumer sessions.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_DiffieHellmanSHA256ConsumerSession extends
+ Auth_OpenID_DiffieHellmanSHA1ConsumerSession {
+ var $session_type = 'DH-SHA256';
+ var $hash_func = 'Auth_OpenID_SHA256';
+ var $secret_size = 32;
+ var $allowed_assoc_types = array('HMAC-SHA256');
+}
+
+/**
+ * A class implementing plaintext consumer sessions.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_PlainTextConsumerSession {
+ var $session_type = 'no-encryption';
+ var $allowed_assoc_types = array('HMAC-SHA1', 'HMAC-SHA256');
+
+ function getRequest()
+ {
+ return array();
+ }
+
+ function extractSecret($response)
+ {
+ if (!$response->hasKey(Auth_OpenID_OPENID_NS, 'mac_key')) {
+ return null;
+ }
+
+ return base64_decode($response->getArg(Auth_OpenID_OPENID_NS,
+ 'mac_key'));
+ }
+}
+
+/**
+ * Returns available session types.
+ */
+function Auth_OpenID_getAvailableSessionTypes()
+{
+ $types = array(
+ 'no-encryption' => 'Auth_OpenID_PlainTextConsumerSession',
+ 'DH-SHA1' => 'Auth_OpenID_DiffieHellmanSHA1ConsumerSession',
+ 'DH-SHA256' => 'Auth_OpenID_DiffieHellmanSHA256ConsumerSession');
+
+ return $types;
+}
+
+/**
+ * This class is the interface to the OpenID consumer logic.
+ * Instances of it maintain no per-request state, so they can be
+ * reused (or even used by multiple threads concurrently) as needed.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_GenericConsumer {
+ /**
+ * @access private
+ */
+ var $discoverMethod = 'Auth_OpenID_discover';
+
+ /**
+ * This consumer's store object.
+ */
+ var $store;
+
+ /**
+ * @access private
+ */
+ var $_use_assocs;
+
+ /**
+ * @access private
+ */
+ var $openid1_nonce_query_arg_name = 'janrain_nonce';
+
+ /**
+ * Another query parameter that gets added to the return_to for
+ * OpenID 1; if the user's session state is lost, use this claimed
+ * identifier to do discovery when verifying the response.
+ */
+ var $openid1_return_to_identifier_name = 'openid1_claimed_id';
+
+ /**
+ * This method initializes a new {@link Auth_OpenID_Consumer}
+ * instance to access the library.
+ *
+ * @param Auth_OpenID_OpenIDStore $store This must be an object
+ * that implements the interface in {@link Auth_OpenID_OpenIDStore}.
+ * Several concrete implementations are provided, to cover most common use
+ * cases. For stores backed by MySQL, PostgreSQL, or SQLite, see
+ * the {@link Auth_OpenID_SQLStore} class and its sublcasses. For a
+ * filesystem-backed store, see the {@link Auth_OpenID_FileStore} module.
+ * As a last resort, if it isn't possible for the server to store
+ * state at all, an instance of {@link Auth_OpenID_DumbStore} can be used.
+ *
+ * @param bool $immediate This is an optional boolean value. It
+ * controls whether the library uses immediate mode, as explained
+ * in the module description. The default value is False, which
+ * disables immediate mode.
+ */
+ function Auth_OpenID_GenericConsumer($store)
+ {
+ $this->store = $store;
+ $this->negotiator = Auth_OpenID_getDefaultNegotiator();
+ $this->_use_assocs = (is_null($this->store) ? false : true);
+
+ $this->fetcher = Auth_Yadis_Yadis::getHTTPFetcher();
+
+ $this->session_types = Auth_OpenID_getAvailableSessionTypes();
+ }
+
+ /**
+ * Called to begin OpenID authentication using the specified
+ * {@link Auth_OpenID_ServiceEndpoint}.
+ *
+ * @access private
+ */
+ function begin($service_endpoint)
+ {
+ $assoc = $this->_getAssociation($service_endpoint);
+ $r = new Auth_OpenID_AuthRequest($service_endpoint, $assoc);
+ $r->return_to_args[$this->openid1_nonce_query_arg_name] =
+ Auth_OpenID_mkNonce();
+
+ if ($r->message->isOpenID1()) {
+ $r->return_to_args[$this->openid1_return_to_identifier_name] =
+ $r->endpoint->claimed_id;
+ }
+
+ return $r;
+ }
+
+ /**
+ * Given an {@link Auth_OpenID_Message}, {@link
+ * Auth_OpenID_ServiceEndpoint} and optional return_to URL,
+ * complete OpenID authentication.
+ *
+ * @access private
+ */
+ function complete($message, $endpoint, $return_to)
+ {
+ $mode = $message->getArg(Auth_OpenID_OPENID_NS, 'mode',
+ '<no mode set>');
+
+ $mode_methods = array(
+ 'cancel' => '_complete_cancel',
+ 'error' => '_complete_error',
+ 'setup_needed' => '_complete_setup_needed',
+ 'id_res' => '_complete_id_res',
+ );
+
+ $method = Auth_OpenID::arrayGet($mode_methods, $mode,
+ '_completeInvalid');
+
+ return call_user_func_array(array($this, $method),
+ array($message, &$endpoint, $return_to));
+ }
+
+ /**
+ * @access private
+ */
+ function _completeInvalid($message, $endpoint, $unused)
+ {
+ $mode = $message->getArg(Auth_OpenID_OPENID_NS, 'mode',
+ '<No mode set>');
+
+ return new Auth_OpenID_FailureResponse($endpoint,
+ sprintf("Invalid openid.mode '%s'", $mode));
+ }
+
+ /**
+ * @access private
+ */
+ function _complete_cancel($message, $endpoint, $unused)
+ {
+ return new Auth_OpenID_CancelResponse($endpoint);
+ }
+
+ /**
+ * @access private
+ */
+ function _complete_error($message, $endpoint, $unused)
+ {
+ $error = $message->getArg(Auth_OpenID_OPENID_NS, 'error');
+ $contact = $message->getArg(Auth_OpenID_OPENID_NS, 'contact');
+ $reference = $message->getArg(Auth_OpenID_OPENID_NS, 'reference');
+
+ return new Auth_OpenID_FailureResponse($endpoint, $error,
+ $contact, $reference);
+ }
+
+ /**
+ * @access private
+ */
+ function _complete_setup_needed($message, $endpoint, $unused)
+ {
+ if (!$message->isOpenID2()) {
+ return $this->_completeInvalid($message, $endpoint);
+ }
+
+ $user_setup_url = $message->getArg(Auth_OpenID_OPENID2_NS,
+ 'user_setup_url');
+ return new Auth_OpenID_SetupNeededResponse($endpoint, $user_setup_url);
+ }
+
+ /**
+ * @access private
+ */
+ function _complete_id_res($message, $endpoint, $return_to)
+ {
+ $user_setup_url = $message->getArg(Auth_OpenID_OPENID1_NS,
+ 'user_setup_url');
+
+ if ($this->_checkSetupNeeded($message)) {
+ return new Auth_OpenID_SetupNeededResponse(
+ $endpoint, $user_setup_url);
+ } else {
+ return $this->_doIdRes($message, $endpoint, $return_to);
+ }
+ }
+
+ /**
+ * @access private
+ */
+ function _checkSetupNeeded($message)
+ {
+ // In OpenID 1, we check to see if this is a cancel from
+ // immediate mode by the presence of the user_setup_url
+ // parameter.
+ if ($message->isOpenID1()) {
+ $user_setup_url = $message->getArg(Auth_OpenID_OPENID1_NS,
+ 'user_setup_url');
+ if ($user_setup_url !== null) {
+ return true;
+ }
+ }
+
+ return false;
+ }
+
+ /**
+ * @access private
+ */
+ function _doIdRes($message, $endpoint, $return_to)
+ {
+ // Checks for presence of appropriate fields (and checks
+ // signed list fields)
+ $result = $this->_idResCheckForFields($message);
+
+ if (Auth_OpenID::isFailure($result)) {
+ return $result;
+ }
+
+ if (!$this->_checkReturnTo($message, $return_to)) {
+ return new Auth_OpenID_FailureResponse(null,
+ sprintf("return_to does not match return URL. Expected %s, got %s",
+ $return_to,
+ $message->getArg(Auth_OpenID_OPENID_NS, 'return_to')));
+ }
+
+ // Verify discovery information:
+ $result = $this->_verifyDiscoveryResults($message, $endpoint);
+
+ if (Auth_OpenID::isFailure($result)) {
+ return $result;
+ }
+
+ $endpoint = $result;
+
+ $result = $this->_idResCheckSignature($message,
+ $endpoint->server_url);
+
+ if (Auth_OpenID::isFailure($result)) {
+ return $result;
+ }
+
+ $result = $this->_idResCheckNonce($message, $endpoint);
+
+ if (Auth_OpenID::isFailure($result)) {
+ return $result;
+ }
+
+ $signed_list_str = $message->getArg(Auth_OpenID_OPENID_NS, 'signed',
+ Auth_OpenID_NO_DEFAULT);
+ if (Auth_OpenID::isFailure($signed_list_str)) {
+ return $signed_list_str;
+ }
+ $signed_list = explode(',', $signed_list_str);
+
+ $signed_fields = Auth_OpenID::addPrefix($signed_list, "openid.");
+
+ return new Auth_OpenID_SuccessResponse($endpoint, $message,
+ $signed_fields);
+
+ }
+
+ /**
+ * @access private
+ */
+ function _checkReturnTo($message, $return_to)
+ {
+ // Check an OpenID message and its openid.return_to value
+ // against a return_to URL from an application. Return True
+ // on success, False on failure.
+
+ // Check the openid.return_to args against args in the
+ // original message.
+ $result = Auth_OpenID_GenericConsumer::_verifyReturnToArgs(
+ $message->toPostArgs());
+ if (Auth_OpenID::isFailure($result)) {
+ return false;
+ }
+
+ // Check the return_to base URL against the one in the
+ // message.
+ $msg_return_to = $message->getArg(Auth_OpenID_OPENID_NS,
+ 'return_to');
+ if (Auth_OpenID::isFailure($return_to)) {
+ // XXX log me
+ return false;
+ }
+
+ $return_to_parts = parse_url(Auth_OpenID_urinorm($return_to));
+ $msg_return_to_parts = parse_url(Auth_OpenID_urinorm($msg_return_to));
+
+ // If port is absent from both, add it so it's equal in the
+ // check below.
+ if ((!array_key_exists('port', $return_to_parts)) &&
+ (!array_key_exists('port', $msg_return_to_parts))) {
+ $return_to_parts['port'] = null;
+ $msg_return_to_parts['port'] = null;
+ }
+
+ // If path is absent from both, add it so it's equal in the
+ // check below.
+ if ((!array_key_exists('path', $return_to_parts)) &&
+ (!array_key_exists('path', $msg_return_to_parts))) {
+ $return_to_parts['path'] = null;
+ $msg_return_to_parts['path'] = null;
+ }
+
+ // The URL scheme, authority, and path MUST be the same
+ // between the two URLs.
+ foreach (array('scheme', 'host', 'port', 'path') as $component) {
+ // If the url component is absent in either URL, fail.
+ // There should always be a scheme, host, port, and path.
+ if (!array_key_exists($component, $return_to_parts)) {
+ return false;
+ }
+
+ if (!array_key_exists($component, $msg_return_to_parts)) {
+ return false;
+ }
+
+ if (Auth_OpenID::arrayGet($return_to_parts, $component) !==
+ Auth_OpenID::arrayGet($msg_return_to_parts, $component)) {
+ return false;
+ }
+ }
+
+ return true;
+ }
+
+ /**
+ * @access private
+ */
+ function _verifyReturnToArgs($query)
+ {
+ // Verify that the arguments in the return_to URL are present in this
+ // response.
+
+ $message = Auth_OpenID_Message::fromPostArgs($query);
+ $return_to = $message->getArg(Auth_OpenID_OPENID_NS, 'return_to');
+
+ if (Auth_OpenID::isFailure($return_to)) {
+ return $return_to;
+ }
+ // XXX: this should be checked by _idResCheckForFields
+ if (!$return_to) {
+ return new Auth_OpenID_FailureResponse(null,
+ "Response has no return_to");
+ }
+
+ $parsed_url = parse_url($return_to);
+
+ $q = array();
+ if (array_key_exists('query', $parsed_url)) {
+ $rt_query = $parsed_url['query'];
+ $q = Auth_OpenID::parse_str($rt_query);
+ }
+
+ foreach ($q as $rt_key => $rt_value) {
+ if (!array_key_exists($rt_key, $query)) {
+ return new Auth_OpenID_FailureResponse(null,
+ sprintf("return_to parameter %s absent from query", $rt_key));
+ } else {
+ $value = $query[$rt_key];
+ if ($rt_value != $value) {
+ return new Auth_OpenID_FailureResponse(null,
+ sprintf("parameter %s value %s does not match " .
+ "return_to value %s", $rt_key,
+ $value, $rt_value));
+ }
+ }
+ }
+
+ // Make sure all non-OpenID arguments in the response are also
+ // in the signed return_to.
+ $bare_args = $message->getArgs(Auth_OpenID_BARE_NS);
+ foreach ($bare_args as $key => $value) {
+ if (Auth_OpenID::arrayGet($q, $key) != $value) {
+ return new Auth_OpenID_FailureResponse(null,
+ sprintf("Parameter %s = %s not in return_to URL",
+ $key, $value));
+ }
+ }
+
+ return true;
+ }
+
+ /**
+ * @access private
+ */
+ function _idResCheckSignature($message, $server_url)
+ {
+ $assoc_handle = $message->getArg(Auth_OpenID_OPENID_NS,
+ 'assoc_handle');
+ if (Auth_OpenID::isFailure($assoc_handle)) {
+ return $assoc_handle;
+ }
+
+ $assoc = $this->store->getAssociation($server_url, $assoc_handle);
+
+ if ($assoc) {
+ if ($assoc->getExpiresIn() <= 0) {
+ // XXX: It might be a good idea sometimes to re-start
+ // the authentication with a new association. Doing it
+ // automatically opens the possibility for
+ // denial-of-service by a server that just returns
+ // expired associations (or really short-lived
+ // associations)
+ return new Auth_OpenID_FailureResponse(null,
+ 'Association with ' . $server_url . ' expired');
+ }
+
+ if (!$assoc->checkMessageSignature($message)) {
+ // If we get a "bad signature" here, it means that the association
+ // is unrecoverabley corrupted in some way. Any futher attempts
+ // to login with this association is likely to fail. Drop it.
+ $this->store->removeAssociation($server_url, $assoc_handle);
+ return new Auth_OpenID_FailureResponse(null,
+ "Bad signature");
+ }
+ } else {
+ // It's not an association we know about. Stateless mode
+ // is our only possible path for recovery. XXX - async
+ // framework will not want to block on this call to
+ // _checkAuth.
+ if (!$this->_checkAuth($message, $server_url)) {
+ return new Auth_OpenID_FailureResponse(null,
+ "Server denied check_authentication");
+ }
+ }
+
+ return null;
+ }
+
+ /**
+ * @access private
+ */
+ function _verifyDiscoveryResults($message, $endpoint=null)
+ {
+ if ($message->getOpenIDNamespace() == Auth_OpenID_OPENID2_NS) {
+ return $this->_verifyDiscoveryResultsOpenID2($message,
+ $endpoint);
+ } else {
+ return $this->_verifyDiscoveryResultsOpenID1($message,
+ $endpoint);
+ }
+ }
+
+ /**
+ * @access private
+ */
+ function _verifyDiscoveryResultsOpenID1($message, $endpoint)
+ {
+ $claimed_id = $message->getArg(Auth_OpenID_BARE_NS,
+ $this->openid1_return_to_identifier_name);
+
+ if (($endpoint === null) && ($claimed_id === null)) {
+ return new Auth_OpenID_FailureResponse($endpoint,
+ 'When using OpenID 1, the claimed ID must be supplied, ' .
+ 'either by passing it through as a return_to parameter ' .
+ 'or by using a session, and supplied to the GenericConsumer ' .
+ 'as the argument to complete()');
+ } else if (($endpoint !== null) && ($claimed_id === null)) {
+ $claimed_id = $endpoint->claimed_id;
+ }
+
+ $to_match = new Auth_OpenID_ServiceEndpoint();
+ $to_match->type_uris = array(Auth_OpenID_TYPE_1_1);
+ $to_match->local_id = $message->getArg(Auth_OpenID_OPENID1_NS,
+ 'identity');
+
+ // Restore delegate information from the initiation phase
+ $to_match->claimed_id = $claimed_id;
+
+ if ($to_match->local_id === null) {
+ return new Auth_OpenID_FailureResponse($endpoint,
+ "Missing required field openid.identity");
+ }
+
+ $to_match_1_0 = $to_match->copy();
+ $to_match_1_0->type_uris = array(Auth_OpenID_TYPE_1_0);
+
+ if ($endpoint !== null) {
+ $result = $this->_verifyDiscoverySingle($endpoint, $to_match);
+
+ if (is_a($result, 'Auth_OpenID_TypeURIMismatch')) {
+ $result = $this->_verifyDiscoverySingle($endpoint,
+ $to_match_1_0);
+ }
+
+ if (Auth_OpenID::isFailure($result)) {
+ // oidutil.log("Error attempting to use stored
+ // discovery information: " + str(e))
+ // oidutil.log("Attempting discovery to
+ // verify endpoint")
+ } else {
+ return $endpoint;
+ }
+ }
+
+ // Endpoint is either bad (failed verification) or None
+ return $this->_discoverAndVerify($to_match->claimed_id,
+ array($to_match, $to_match_1_0));
+ }
+
+ /**
+ * @access private
+ */
+ function _verifyDiscoverySingle($endpoint, $to_match)
+ {
+ // Every type URI that's in the to_match endpoint has to be
+ // present in the discovered endpoint.
+ foreach ($to_match->type_uris as $type_uri) {
+ if (!$endpoint->usesExtension($type_uri)) {
+ return new Auth_OpenID_TypeURIMismatch($endpoint,
+ "Required type ".$type_uri." not present");
+ }
+ }
+
+ // Fragments do not influence discovery, so we can't compare a
+ // claimed identifier with a fragment to discovered
+ // information.
+ list($defragged_claimed_id, $_) =
+ Auth_OpenID::urldefrag($to_match->claimed_id);
+
+ if ($defragged_claimed_id != $endpoint->claimed_id) {
+ return new Auth_OpenID_FailureResponse($endpoint,
+ sprintf('Claimed ID does not match (different subjects!), ' .
+ 'Expected %s, got %s', $defragged_claimed_id,
+ $endpoint->claimed_id));
+ }
+
+ if ($to_match->getLocalID() != $endpoint->getLocalID()) {
+ return new Auth_OpenID_FailureResponse($endpoint,
+ sprintf('local_id mismatch. Expected %s, got %s',
+ $to_match->getLocalID(), $endpoint->getLocalID()));
+ }
+
+ // If the server URL is None, this must be an OpenID 1
+ // response, because op_endpoint is a required parameter in
+ // OpenID 2. In that case, we don't actually care what the
+ // discovered server_url is, because signature checking or
+ // check_auth should take care of that check for us.
+ if ($to_match->server_url === null) {
+ if ($to_match->preferredNamespace() != Auth_OpenID_OPENID1_NS) {
+ return new Auth_OpenID_FailureResponse($endpoint,
+ "Preferred namespace mismatch (bug)");
+ }
+ } else if ($to_match->server_url != $endpoint->server_url) {
+ return new Auth_OpenID_FailureResponse($endpoint,
+ sprintf('OP Endpoint mismatch. Expected %s, got %s',
+ $to_match->server_url, $endpoint->server_url));
+ }
+
+ return null;
+ }
+
+ /**
+ * @access private
+ */
+ function _verifyDiscoveryResultsOpenID2($message, $endpoint)
+ {
+ $to_match = new Auth_OpenID_ServiceEndpoint();
+ $to_match->type_uris = array(Auth_OpenID_TYPE_2_0);
+ $to_match->claimed_id = $message->getArg(Auth_OpenID_OPENID2_NS,
+ 'claimed_id');
+
+ $to_match->local_id = $message->getArg(Auth_OpenID_OPENID2_NS,
+ 'identity');
+
+ $to_match->server_url = $message->getArg(Auth_OpenID_OPENID2_NS,
+ 'op_endpoint');
+
+ if ($to_match->server_url === null) {
+ return new Auth_OpenID_FailureResponse($endpoint,
+ "OP Endpoint URL missing");
+ }
+
+ // claimed_id and identifier must both be present or both be
+ // absent
+ if (($to_match->claimed_id === null) &&
+ ($to_match->local_id !== null)) {
+ return new Auth_OpenID_FailureResponse($endpoint,
+ 'openid.identity is present without openid.claimed_id');
+ }
+
+ if (($to_match->claimed_id !== null) &&
+ ($to_match->local_id === null)) {
+ return new Auth_OpenID_FailureResponse($endpoint,
+ 'openid.claimed_id is present without openid.identity');
+ }
+
+ if ($to_match->claimed_id === null) {
+ // This is a response without identifiers, so there's
+ // really no checking that we can do, so return an
+ // endpoint that's for the specified `openid.op_endpoint'
+ return Auth_OpenID_ServiceEndpoint::fromOPEndpointURL(
+ $to_match->server_url);
+ }
+
+ if (!$endpoint) {
+ // The claimed ID doesn't match, so we have to do
+ // discovery again. This covers not using sessions, OP
+ // identifier endpoints and responses that didn't match
+ // the original request.
+ // oidutil.log('No pre-discovered information supplied.')
+ return $this->_discoverAndVerify($to_match->claimed_id,
+ array($to_match));
+ } else {
+
+ // The claimed ID matches, so we use the endpoint that we
+ // discovered in initiation. This should be the most
+ // common case.
+ $result = $this->_verifyDiscoverySingle($endpoint, $to_match);
+
+ if (Auth_OpenID::isFailure($result)) {
+ $endpoint = $this->_discoverAndVerify($to_match->claimed_id,
+ array($to_match));
+ if (Auth_OpenID::isFailure($endpoint)) {
+ return $endpoint;
+ }
+ }
+ }
+
+ // The endpoint we return should have the claimed ID from the
+ // message we just verified, fragment and all.
+ if ($endpoint->claimed_id != $to_match->claimed_id) {
+ $endpoint->claimed_id = $to_match->claimed_id;
+ }
+
+ return $endpoint;
+ }
+
+ /**
+ * @access private
+ */
+ function _discoverAndVerify($claimed_id, $to_match_endpoints)
+ {
+ // oidutil.log('Performing discovery on %s' % (claimed_id,))
+ list($unused, $services) = call_user_func($this->discoverMethod,
+ $claimed_id,
+ $this->fetcher);
+
+ if (!$services) {
+ return new Auth_OpenID_FailureResponse(null,
+ sprintf("No OpenID information found at %s",
+ $claimed_id));
+ }
+
+ return $this->_verifyDiscoveryServices($claimed_id, $services,
+ $to_match_endpoints);
+ }
+
+ /**
+ * @access private
+ */
+ function _verifyDiscoveryServices($claimed_id,
+ $services, $to_match_endpoints)
+ {
+ // Search the services resulting from discovery to find one
+ // that matches the information from the assertion
+
+ foreach ($services as $endpoint) {
+ foreach ($to_match_endpoints as $to_match_endpoint) {
+ $result = $this->_verifyDiscoverySingle($endpoint,
+ $to_match_endpoint);
+
+ if (!Auth_OpenID::isFailure($result)) {
+ // It matches, so discover verification has
+ // succeeded. Return this endpoint.
+ return $endpoint;
+ }
+ }
+ }
+
+ return new Auth_OpenID_FailureResponse(null,
+ sprintf('No matching endpoint found after discovering %s: %s',
+ $claimed_id, $result->message));
+ }
+
+ /**
+ * Extract the nonce from an OpenID 1 response. Return the nonce
+ * from the BARE_NS since we independently check the return_to
+ * arguments are the same as those in the response message.
+ *
+ * See the openid1_nonce_query_arg_name class variable
+ *
+ * @returns $nonce The nonce as a string or null
+ *
+ * @access private
+ */
+ function _idResGetNonceOpenID1($message, $endpoint)
+ {
+ return $message->getArg(Auth_OpenID_BARE_NS,
+ $this->openid1_nonce_query_arg_name);
+ }
+
+ /**
+ * @access private
+ */
+ function _idResCheckNonce($message, $endpoint)
+ {
+ if ($message->isOpenID1()) {
+ // This indicates that the nonce was generated by the consumer
+ $nonce = $this->_idResGetNonceOpenID1($message, $endpoint);
+ $server_url = '';
+ } else {
+ $nonce = $message->getArg(Auth_OpenID_OPENID2_NS,
+ 'response_nonce');
+
+ $server_url = $endpoint->server_url;
+ }
+
+ if ($nonce === null) {
+ return new Auth_OpenID_FailureResponse($endpoint,
+ "Nonce missing from response");
+ }
+
+ $parts = Auth_OpenID_splitNonce($nonce);
+
+ if ($parts === null) {
+ return new Auth_OpenID_FailureResponse($endpoint,
+ "Malformed nonce in response");
+ }
+
+ list($timestamp, $salt) = $parts;
+
+ if (!$this->store->useNonce($server_url, $timestamp, $salt)) {
+ return new Auth_OpenID_FailureResponse($endpoint,
+ "Nonce already used or out of range");
+ }
+
+ return null;
+ }
+
+ /**
+ * @access private
+ */
+ function _idResCheckForFields($message)
+ {
+ $basic_fields = array('return_to', 'assoc_handle', 'sig', 'signed');
+ $basic_sig_fields = array('return_to', 'identity');
+
+ $require_fields = array(
+ Auth_OpenID_OPENID2_NS => array_merge($basic_fields,
+ array('op_endpoint')),
+
+ Auth_OpenID_OPENID1_NS => array_merge($basic_fields,
+ array('identity'))
+ );
+
+ $require_sigs = array(
+ Auth_OpenID_OPENID2_NS => array_merge($basic_sig_fields,
+ array('response_nonce',
+ 'claimed_id',
+ 'assoc_handle',
+ 'op_endpoint')),
+ Auth_OpenID_OPENID1_NS => array_merge($basic_sig_fields,
+ array('nonce'))
+ );
+
+ foreach ($require_fields[$message->getOpenIDNamespace()] as $field) {
+ if (!$message->hasKey(Auth_OpenID_OPENID_NS, $field)) {
+ return new Auth_OpenID_FailureResponse(null,
+ "Missing required field '".$field."'");
+ }
+ }
+
+ $signed_list_str = $message->getArg(Auth_OpenID_OPENID_NS,
+ 'signed',
+ Auth_OpenID_NO_DEFAULT);
+ if (Auth_OpenID::isFailure($signed_list_str)) {
+ return $signed_list_str;
+ }
+ $signed_list = explode(',', $signed_list_str);
+
+ foreach ($require_sigs[$message->getOpenIDNamespace()] as $field) {
+ // Field is present and not in signed list
+ if ($message->hasKey(Auth_OpenID_OPENID_NS, $field) &&
+ (!in_array($field, $signed_list))) {
+ return new Auth_OpenID_FailureResponse(null,
+ "'".$field."' not signed");
+ }
+ }
+
+ return null;
+ }
+
+ /**
+ * @access private
+ */
+ function _checkAuth($message, $server_url)
+ {
+ $request = $this->_createCheckAuthRequest($message);
+ if ($request === null) {
+ return false;
+ }
+
+ $resp_message = $this->_makeKVPost($request, $server_url);
+ if (($resp_message === null) ||
+ (is_a($resp_message, 'Auth_OpenID_ServerErrorContainer'))) {
+ return false;
+ }
+
+ return $this->_processCheckAuthResponse($resp_message, $server_url);
+ }
+
+ /**
+ * @access private
+ */
+ function _createCheckAuthRequest($message)
+ {
+ $signed = $message->getArg(Auth_OpenID_OPENID_NS, 'signed');
+ if ($signed) {
+ foreach (explode(',', $signed) as $k) {
+ $value = $message->getAliasedArg($k);
+ if ($value === null) {
+ return null;
+ }
+ }
+ }
+ $ca_message = $message->copy();
+ $ca_message->setArg(Auth_OpenID_OPENID_NS, 'mode',
+ 'check_authentication');
+ return $ca_message;
+ }
+
+ /**
+ * @access private
+ */
+ function _processCheckAuthResponse($response, $server_url)
+ {
+ $is_valid = $response->getArg(Auth_OpenID_OPENID_NS, 'is_valid',
+ 'false');
+
+ $invalidate_handle = $response->getArg(Auth_OpenID_OPENID_NS,
+ 'invalidate_handle');
+
+ if ($invalidate_handle !== null) {
+ $this->store->removeAssociation($server_url,
+ $invalidate_handle);
+ }
+
+ if ($is_valid == 'true') {
+ return true;
+ }
+
+ return false;
+ }
+
+ /**
+ * Adapt a POST response to a Message.
+ *
+ * @param $response Result of a POST to an OpenID endpoint.
+ *
+ * @access private
+ */
+ static function _httpResponseToMessage($response, $server_url)
+ {
+ // Should this function be named Message.fromHTTPResponse instead?
+ $response_message = Auth_OpenID_Message::fromKVForm($response->body);
+
+ if ($response->status == 400) {
+ return Auth_OpenID_ServerErrorContainer::fromMessage(
+ $response_message);
+ } else if ($response->status != 200 and $response->status != 206) {
+ return null;
+ }
+
+ return $response_message;
+ }
+
+ /**
+ * @access private
+ */
+ function _makeKVPost($message, $server_url)
+ {
+ $body = $message->toURLEncoded();
+ $resp = $this->fetcher->post($server_url, $body);
+
+ if ($resp === null) {
+ return null;
+ }
+
+ return $this->_httpResponseToMessage($resp, $server_url);
+ }
+
+ /**
+ * @access private
+ */
+ function _getAssociation($endpoint)
+ {
+ if (!$this->_use_assocs) {
+ return null;
+ }
+
+ $assoc = $this->store->getAssociation($endpoint->server_url);
+
+ if (($assoc === null) ||
+ ($assoc->getExpiresIn() <= 0)) {
+
+ $assoc = $this->_negotiateAssociation($endpoint);
+
+ if ($assoc !== null) {
+ $this->store->storeAssociation($endpoint->server_url,
+ $assoc);
+ }
+ }
+
+ return $assoc;
+ }
+
+ /**
+ * Handle ServerErrors resulting from association requests.
+ *
+ * @return $result If server replied with an C{unsupported-type}
+ * error, return a tuple of supported C{association_type},
+ * C{session_type}. Otherwise logs the error and returns null.
+ *
+ * @access private
+ */
+ function _extractSupportedAssociationType($server_error, $endpoint,
+ $assoc_type)
+ {
+ // Any error message whose code is not 'unsupported-type'
+ // should be considered a total failure.
+ if (($server_error->error_code != 'unsupported-type') ||
+ ($server_error->message->isOpenID1())) {
+ return null;
+ }
+
+ // The server didn't like the association/session type that we
+ // sent, and it sent us back a message that might tell us how
+ // to handle it.
+
+ // Extract the session_type and assoc_type from the error
+ // message
+ $assoc_type = $server_error->message->getArg(Auth_OpenID_OPENID_NS,
+ 'assoc_type');
+
+ $session_type = $server_error->message->getArg(Auth_OpenID_OPENID_NS,
+ 'session_type');
+
+ if (($assoc_type === null) || ($session_type === null)) {
+ return null;
+ } else if (!$this->negotiator->isAllowed($assoc_type,
+ $session_type)) {
+ return null;
+ } else {
+ return array($assoc_type, $session_type);
+ }
+ }
+
+ /**
+ * @access private
+ */
+ function _negotiateAssociation($endpoint)
+ {
+ // Get our preferred session/association type from the negotiatior.
+ list($assoc_type, $session_type) = $this->negotiator->getAllowedType();
+
+ $assoc = $this->_requestAssociation(
+ $endpoint, $assoc_type, $session_type);
+
+ if (Auth_OpenID::isFailure($assoc)) {
+ return null;
+ }
+
+ if (is_a($assoc, 'Auth_OpenID_ServerErrorContainer')) {
+ $why = $assoc;
+
+ $supportedTypes = $this->_extractSupportedAssociationType(
+ $why, $endpoint, $assoc_type);
+
+ if ($supportedTypes !== null) {
+ list($assoc_type, $session_type) = $supportedTypes;
+
+ // Attempt to create an association from the assoc_type
+ // and session_type that the server told us it
+ // supported.
+ $assoc = $this->_requestAssociation(
+ $endpoint, $assoc_type, $session_type);
+
+ if (is_a($assoc, 'Auth_OpenID_ServerErrorContainer')) {
+ // Do not keep trying, since it rejected the
+ // association type that it told us to use.
+ // oidutil.log('Server %s refused its suggested association
+ // 'type: session_type=%s, assoc_type=%s'
+ // % (endpoint.server_url, session_type,
+ // assoc_type))
+ return null;
+ } else {
+ return $assoc;
+ }
+ } else {
+ return null;
+ }
+ } else {
+ return $assoc;
+ }
+ }
+
+ /**
+ * @access private
+ */
+ function _requestAssociation($endpoint, $assoc_type, $session_type)
+ {
+ list($assoc_session, $args) = $this->_createAssociateRequest(
+ $endpoint, $assoc_type, $session_type);
+
+ $response_message = $this->_makeKVPost($args, $endpoint->server_url);
+
+ if ($response_message === null) {
+ // oidutil.log('openid.associate request failed: %s' % (why[0],))
+ return null;
+ } else if (is_a($response_message,
+ 'Auth_OpenID_ServerErrorContainer')) {
+ return $response_message;
+ }
+
+ return $this->_extractAssociation($response_message, $assoc_session);
+ }
+
+ /**
+ * @access private
+ */
+ function _extractAssociation($assoc_response, $assoc_session)
+ {
+ // Extract the common fields from the response, raising an
+ // exception if they are not found
+ $assoc_type = $assoc_response->getArg(
+ Auth_OpenID_OPENID_NS, 'assoc_type',
+ Auth_OpenID_NO_DEFAULT);
+
+ if (Auth_OpenID::isFailure($assoc_type)) {
+ return $assoc_type;
+ }
+
+ $assoc_handle = $assoc_response->getArg(
+ Auth_OpenID_OPENID_NS, 'assoc_handle',
+ Auth_OpenID_NO_DEFAULT);
+
+ if (Auth_OpenID::isFailure($assoc_handle)) {
+ return $assoc_handle;
+ }
+
+ // expires_in is a base-10 string. The Python parsing will
+ // accept literals that have whitespace around them and will
+ // accept negative values. Neither of these are really in-spec,
+ // but we think it's OK to accept them.
+ $expires_in_str = $assoc_response->getArg(
+ Auth_OpenID_OPENID_NS, 'expires_in',
+ Auth_OpenID_NO_DEFAULT);
+
+ if (Auth_OpenID::isFailure($expires_in_str)) {
+ return $expires_in_str;
+ }
+
+ $expires_in = Auth_OpenID::intval($expires_in_str);
+ if ($expires_in === false) {
+
+ $err = sprintf("Could not parse expires_in from association ".
+ "response %s", print_r($assoc_response, true));
+ return new Auth_OpenID_FailureResponse(null, $err);
+ }
+
+ // OpenID 1 has funny association session behaviour.
+ if ($assoc_response->isOpenID1()) {
+ $session_type = $this->_getOpenID1SessionType($assoc_response);
+ } else {
+ $session_type = $assoc_response->getArg(
+ Auth_OpenID_OPENID2_NS, 'session_type',
+ Auth_OpenID_NO_DEFAULT);
+
+ if (Auth_OpenID::isFailure($session_type)) {
+ return $session_type;
+ }
+ }
+
+ // Session type mismatch
+ if ($assoc_session->session_type != $session_type) {
+ if ($assoc_response->isOpenID1() &&
+ ($session_type == 'no-encryption')) {
+ // In OpenID 1, any association request can result in
+ // a 'no-encryption' association response. Setting
+ // assoc_session to a new no-encryption session should
+ // make the rest of this function work properly for
+ // that case.
+ $assoc_session = new Auth_OpenID_PlainTextConsumerSession();
+ } else {
+ // Any other mismatch, regardless of protocol version
+ // results in the failure of the association session
+ // altogether.
+ return null;
+ }
+ }
+
+ // Make sure assoc_type is valid for session_type
+ if (!in_array($assoc_type, $assoc_session->allowed_assoc_types)) {
+ return null;
+ }
+
+ // Delegate to the association session to extract the secret
+ // from the response, however is appropriate for that session
+ // type.
+ $secret = $assoc_session->extractSecret($assoc_response);
+
+ if ($secret === null) {
+ return null;
+ }
+
+ return Auth_OpenID_Association::fromExpiresIn(
+ $expires_in, $assoc_handle, $secret, $assoc_type);
+ }
+
+ /**
+ * @access private
+ */
+ function _createAssociateRequest($endpoint, $assoc_type, $session_type)
+ {
+ if (array_key_exists($session_type, $this->session_types)) {
+ $session_type_class = $this->session_types[$session_type];
+
+ if (is_callable($session_type_class)) {
+ $assoc_session = $session_type_class();
+ } else {
+ $assoc_session = new $session_type_class();
+ }
+ } else {
+ return null;
+ }
+
+ $args = array(
+ 'mode' => 'associate',
+ 'assoc_type' => $assoc_type);
+
+ if (!$endpoint->compatibilityMode()) {
+ $args['ns'] = Auth_OpenID_OPENID2_NS;
+ }
+
+ // Leave out the session type if we're in compatibility mode
+ // *and* it's no-encryption.
+ if ((!$endpoint->compatibilityMode()) ||
+ ($assoc_session->session_type != 'no-encryption')) {
+ $args['session_type'] = $assoc_session->session_type;
+ }
+
+ $args = array_merge($args, $assoc_session->getRequest());
+ $message = Auth_OpenID_Message::fromOpenIDArgs($args);
+ return array($assoc_session, $message);
+ }
+
+ /**
+ * Given an association response message, extract the OpenID 1.X
+ * session type.
+ *
+ * This function mostly takes care of the 'no-encryption' default
+ * behavior in OpenID 1.
+ *
+ * If the association type is plain-text, this function will
+ * return 'no-encryption'
+ *
+ * @access private
+ * @return $typ The association type for this message
+ */
+ function _getOpenID1SessionType($assoc_response)
+ {
+ // If it's an OpenID 1 message, allow session_type to default
+ // to None (which signifies "no-encryption")
+ $session_type = $assoc_response->getArg(Auth_OpenID_OPENID1_NS,
+ 'session_type');
+
+ // Handle the differences between no-encryption association
+ // respones in OpenID 1 and 2:
+
+ // no-encryption is not really a valid session type for OpenID
+ // 1, but we'll accept it anyway, while issuing a warning.
+ if ($session_type == 'no-encryption') {
+ // oidutil.log('WARNING: OpenID server sent "no-encryption"'
+ // 'for OpenID 1.X')
+ } else if (($session_type == '') || ($session_type === null)) {
+ // Missing or empty session type is the way to flag a
+ // 'no-encryption' response. Change the session type to
+ // 'no-encryption' so that it can be handled in the same
+ // way as OpenID 2 'no-encryption' respones.
+ $session_type = 'no-encryption';
+ }
+
+ return $session_type;
+ }
+}
+
+/**
+ * This class represents an authentication request from a consumer to
+ * an OpenID server.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_AuthRequest {
+
+ /**
+ * Initialize an authentication request with the specified token,
+ * association, and endpoint.
+ *
+ * Users of this library should not create instances of this
+ * class. Instances of this class are created by the library when
+ * needed.
+ */
+ function Auth_OpenID_AuthRequest($endpoint, $assoc)
+ {
+ $this->assoc = $assoc;
+ $this->endpoint = $endpoint;
+ $this->return_to_args = array();
+ $this->message = new Auth_OpenID_Message(
+ $endpoint->preferredNamespace());
+ $this->_anonymous = false;
+ }
+
+ /**
+ * Add an extension to this checkid request.
+ *
+ * $extension_request: An object that implements the extension
+ * request interface for adding arguments to an OpenID message.
+ */
+ function addExtension($extension_request)
+ {
+ $extension_request->toMessage($this->message);
+ }
+
+ /**
+ * Add an extension argument to this OpenID authentication
+ * request.
+ *
+ * Use caution when adding arguments, because they will be
+ * URL-escaped and appended to the redirect URL, which can easily
+ * get quite long.
+ *
+ * @param string $namespace The namespace for the extension. For
+ * example, the simple registration extension uses the namespace
+ * 'sreg'.
+ *
+ * @param string $key The key within the extension namespace. For
+ * example, the nickname field in the simple registration
+ * extension's key is 'nickname'.
+ *
+ * @param string $value The value to provide to the server for
+ * this argument.
+ */
+ function addExtensionArg($namespace, $key, $value)
+ {
+ return $this->message->setArg($namespace, $key, $value);
+ }
+
+ /**
+ * Set whether this request should be made anonymously. If a
+ * request is anonymous, the identifier will not be sent in the
+ * request. This is only useful if you are making another kind of
+ * request with an extension in this request.
+ *
+ * Anonymous requests are not allowed when the request is made
+ * with OpenID 1.
+ */
+ function setAnonymous($is_anonymous)
+ {
+ if ($is_anonymous && $this->message->isOpenID1()) {
+ return false;
+ } else {
+ $this->_anonymous = $is_anonymous;
+ return true;
+ }
+ }
+
+ /**
+ * Produce a {@link Auth_OpenID_Message} representing this
+ * request.
+ *
+ * @param string $realm The URL (or URL pattern) that identifies
+ * your web site to the user when she is authorizing it.
+ *
+ * @param string $return_to The URL that the OpenID provider will
+ * send the user back to after attempting to verify her identity.
+ *
+ * Not specifying a return_to URL means that the user will not be
+ * returned to the site issuing the request upon its completion.
+ *
+ * @param bool $immediate If true, the OpenID provider is to send
+ * back a response immediately, useful for behind-the-scenes
+ * authentication attempts. Otherwise the OpenID provider may
+ * engage the user before providing a response. This is the
+ * default case, as the user may need to provide credentials or
+ * approve the request before a positive response can be sent.
+ */
+ function getMessage($realm, $return_to=null, $immediate=false)
+ {
+ if ($return_to) {
+ $return_to = Auth_OpenID::appendArgs($return_to,
+ $this->return_to_args);
+ } else if ($immediate) {
+ // raise ValueError(
+ // '"return_to" is mandatory when
+ //using "checkid_immediate"')
+ return new Auth_OpenID_FailureResponse(null,
+ "'return_to' is mandatory when using checkid_immediate");
+ } else if ($this->message->isOpenID1()) {
+ // raise ValueError('"return_to" is
+ // mandatory for OpenID 1 requests')
+ return new Auth_OpenID_FailureResponse(null,
+ "'return_to' is mandatory for OpenID 1 requests");
+ } else if ($this->return_to_args) {
+ // raise ValueError('extra "return_to" arguments
+ // were specified, but no return_to was specified')
+ return new Auth_OpenID_FailureResponse(null,
+ "extra 'return_to' arguments where specified, " .
+ "but no return_to was specified");
+ }
+
+ if ($immediate) {
+ $mode = 'checkid_immediate';
+ } else {
+ $mode = 'checkid_setup';
+ }
+
+ $message = $this->message->copy();
+ if ($message->isOpenID1()) {
+ $realm_key = 'trust_root';
+ } else {
+ $realm_key = 'realm';
+ }
+
+ $message->updateArgs(Auth_OpenID_OPENID_NS,
+ array(
+ $realm_key => $realm,
+ 'mode' => $mode,
+ 'return_to' => $return_to));
+
+ if (!$this->_anonymous) {
+ if ($this->endpoint->isOPIdentifier()) {
+ // This will never happen when we're in compatibility
+ // mode, as long as isOPIdentifier() returns False
+ // whenever preferredNamespace() returns OPENID1_NS.
+ $claimed_id = $request_identity =
+ Auth_OpenID_IDENTIFIER_SELECT;
+ } else {
+ $request_identity = $this->endpoint->getLocalID();
+ $claimed_id = $this->endpoint->claimed_id;
+ }
+
+ // This is true for both OpenID 1 and 2
+ $message->setArg(Auth_OpenID_OPENID_NS, 'identity',
+ $request_identity);
+
+ if ($message->isOpenID2()) {
+ $message->setArg(Auth_OpenID_OPENID2_NS, 'claimed_id',
+ $claimed_id);
+ }
+ }
+
+ if ($this->assoc) {
+ $message->setArg(Auth_OpenID_OPENID_NS, 'assoc_handle',
+ $this->assoc->handle);
+ }
+
+ return $message;
+ }
+
+ function redirectURL($realm, $return_to = null,
+ $immediate = false)
+ {
+ $message = $this->getMessage($realm, $return_to, $immediate);
+
+ if (Auth_OpenID::isFailure($message)) {
+ return $message;
+ }
+
+ return $message->toURL($this->endpoint->server_url);
+ }
+
+ /**
+ * Get html for a form to submit this request to the IDP.
+ *
+ * form_tag_attrs: An array of attributes to be added to the form
+ * tag. 'accept-charset' and 'enctype' have defaults that can be
+ * overridden. If a value is supplied for 'action' or 'method', it
+ * will be replaced.
+ */
+ function formMarkup($realm, $return_to=null, $immediate=false,
+ $form_tag_attrs=null)
+ {
+ $message = $this->getMessage($realm, $return_to, $immediate);
+
+ if (Auth_OpenID::isFailure($message)) {
+ return $message;
+ }
+
+ return $message->toFormMarkup($this->endpoint->server_url,
+ $form_tag_attrs);
+ }
+
+ /**
+ * Get a complete html document that will autosubmit the request
+ * to the IDP.
+ *
+ * Wraps formMarkup. See the documentation for that function.
+ */
+ function htmlMarkup($realm, $return_to=null, $immediate=false,
+ $form_tag_attrs=null)
+ {
+ $form = $this->formMarkup($realm, $return_to, $immediate,
+ $form_tag_attrs);
+
+ if (Auth_OpenID::isFailure($form)) {
+ return $form;
+ }
+ return Auth_OpenID::autoSubmitHTML($form);
+ }
+
+ function shouldSendRedirect()
+ {
+ return $this->endpoint->compatibilityMode();
+ }
+}
+
+/**
+ * The base class for responses from the Auth_OpenID_Consumer.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_ConsumerResponse {
+ var $status = null;
+
+ function setEndpoint($endpoint)
+ {
+ $this->endpoint = $endpoint;
+ if ($endpoint === null) {
+ $this->identity_url = null;
+ } else {
+ $this->identity_url = $endpoint->claimed_id;
+ }
+ }
+
+ /**
+ * Return the display identifier for this response.
+ *
+ * The display identifier is related to the Claimed Identifier, but the
+ * two are not always identical. The display identifier is something the
+ * user should recognize as what they entered, whereas the response's
+ * claimed identifier (in the identity_url attribute) may have extra
+ * information for better persistence.
+ *
+ * URLs will be stripped of their fragments for display. XRIs will
+ * display the human-readable identifier (i-name) instead of the
+ * persistent identifier (i-number).
+ *
+ * Use the display identifier in your user interface. Use
+ * identity_url for querying your database or authorization server.
+ *
+ */
+ function getDisplayIdentifier()
+ {
+ if ($this->endpoint !== null) {
+ return $this->endpoint->getDisplayIdentifier();
+ }
+ return null;
+ }
+}
+
+/**
+ * A response with a status of Auth_OpenID_SUCCESS. Indicates that
+ * this request is a successful acknowledgement from the OpenID server
+ * that the supplied URL is, indeed controlled by the requesting
+ * agent. This has three relevant attributes:
+ *
+ * claimed_id - The identity URL that has been authenticated
+ *
+ * signed_args - The arguments in the server's response that were
+ * signed and verified.
+ *
+ * status - Auth_OpenID_SUCCESS.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_SuccessResponse extends Auth_OpenID_ConsumerResponse {
+ var $status = Auth_OpenID_SUCCESS;
+
+ /**
+ * @access private
+ */
+ function Auth_OpenID_SuccessResponse($endpoint, $message, $signed_args=null)
+ {
+ $this->endpoint = $endpoint;
+ $this->identity_url = $endpoint->claimed_id;
+ $this->signed_args = $signed_args;
+ $this->message = $message;
+
+ if ($this->signed_args === null) {
+ $this->signed_args = array();
+ }
+ }
+
+ /**
+ * Extract signed extension data from the server's response.
+ *
+ * @param string $prefix The extension namespace from which to
+ * extract the extension data.
+ */
+ function extensionResponse($namespace_uri, $require_signed)
+ {
+ if ($require_signed) {
+ return $this->getSignedNS($namespace_uri);
+ } else {
+ return $this->message->getArgs($namespace_uri);
+ }
+ }
+
+ function isOpenID1()
+ {
+ return $this->message->isOpenID1();
+ }
+
+ function isSigned($ns_uri, $ns_key)
+ {
+ // Return whether a particular key is signed, regardless of
+ // its namespace alias
+ return in_array($this->message->getKey($ns_uri, $ns_key),
+ $this->signed_args);
+ }
+
+ function getSigned($ns_uri, $ns_key, $default = null)
+ {
+ // Return the specified signed field if available, otherwise
+ // return default
+ if ($this->isSigned($ns_uri, $ns_key)) {
+ return $this->message->getArg($ns_uri, $ns_key, $default);
+ } else {
+ return $default;
+ }
+ }
+
+ function getSignedNS($ns_uri)
+ {
+ $args = array();
+
+ $msg_args = $this->message->getArgs($ns_uri);
+ if (Auth_OpenID::isFailure($msg_args)) {
+ return null;
+ }
+
+ foreach ($msg_args as $key => $value) {
+ if (!$this->isSigned($ns_uri, $key)) {
+ unset($msg_args[$key]);
+ }
+ }
+
+ return $msg_args;
+ }
+
+ /**
+ * Get the openid.return_to argument from this response.
+ *
+ * This is useful for verifying that this request was initiated by
+ * this consumer.
+ *
+ * @return string $return_to The return_to URL supplied to the
+ * server on the initial request, or null if the response did not
+ * contain an 'openid.return_to' argument.
+ */
+ function getReturnTo()
+ {
+ return $this->getSigned(Auth_OpenID_OPENID_NS, 'return_to');
+ }
+}
+
+/**
+ * A response with a status of Auth_OpenID_FAILURE. Indicates that the
+ * OpenID protocol has failed. This could be locally or remotely
+ * triggered. This has three relevant attributes:
+ *
+ * claimed_id - The identity URL for which authentication was
+ * attempted, if it can be determined. Otherwise, null.
+ *
+ * message - A message indicating why the request failed, if one is
+ * supplied. Otherwise, null.
+ *
+ * status - Auth_OpenID_FAILURE.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_FailureResponse extends Auth_OpenID_ConsumerResponse {
+ var $status = Auth_OpenID_FAILURE;
+
+ function Auth_OpenID_FailureResponse($endpoint, $message = null,
+ $contact = null, $reference = null)
+ {
+ $this->setEndpoint($endpoint);
+ $this->message = $message;
+ $this->contact = $contact;
+ $this->reference = $reference;
+ }
+}
+
+/**
+ * A specific, internal failure used to detect type URI mismatch.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_TypeURIMismatch extends Auth_OpenID_FailureResponse {
+}
+
+/**
+ * Exception that is raised when the server returns a 400 response
+ * code to a direct request.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_ServerErrorContainer {
+ function Auth_OpenID_ServerErrorContainer($error_text,
+ $error_code,
+ $message)
+ {
+ $this->error_text = $error_text;
+ $this->error_code = $error_code;
+ $this->message = $message;
+ }
+
+ /**
+ * @access private
+ */
+ static function fromMessage($message)
+ {
+ $error_text = $message->getArg(
+ Auth_OpenID_OPENID_NS, 'error', '<no error message supplied>');
+ $error_code = $message->getArg(Auth_OpenID_OPENID_NS, 'error_code');
+ return new Auth_OpenID_ServerErrorContainer($error_text,
+ $error_code,
+ $message);
+ }
+}
+
+/**
+ * A response with a status of Auth_OpenID_CANCEL. Indicates that the
+ * user cancelled the OpenID authentication request. This has two
+ * relevant attributes:
+ *
+ * claimed_id - The identity URL for which authentication was
+ * attempted, if it can be determined. Otherwise, null.
+ *
+ * status - Auth_OpenID_SUCCESS.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_CancelResponse extends Auth_OpenID_ConsumerResponse {
+ var $status = Auth_OpenID_CANCEL;
+
+ function Auth_OpenID_CancelResponse($endpoint)
+ {
+ $this->setEndpoint($endpoint);
+ }
+}
+
+/**
+ * A response with a status of Auth_OpenID_SETUP_NEEDED. Indicates
+ * that the request was in immediate mode, and the server is unable to
+ * authenticate the user without further interaction.
+ *
+ * claimed_id - The identity URL for which authentication was
+ * attempted.
+ *
+ * setup_url - A URL that can be used to send the user to the server
+ * to set up for authentication. The user should be redirected in to
+ * the setup_url, either in the current window or in a new browser
+ * window. Null in OpenID 2.
+ *
+ * status - Auth_OpenID_SETUP_NEEDED.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_SetupNeededResponse extends Auth_OpenID_ConsumerResponse {
+ var $status = Auth_OpenID_SETUP_NEEDED;
+
+ function Auth_OpenID_SetupNeededResponse($endpoint,
+ $setup_url = null)
+ {
+ $this->setEndpoint($endpoint);
+ $this->setup_url = $setup_url;
+ }
+}
+
+
+
--- /dev/null
+++ b/lib/openid-php/Auth/OpenID/Server.php
@@ -1,1 +1,1766 @@
-
+<?php
+
+/**
+ * OpenID server protocol and logic.
+ *
+ * Overview
+ *
+ * An OpenID server must perform three tasks:
+ *
+ * 1. Examine the incoming request to determine its nature and validity.
+ * 2. Make a decision about how to respond to this request.
+ * 3. Format the response according to the protocol.
+ *
+ * The first and last of these tasks may performed by the {@link
+ * Auth_OpenID_Server::decodeRequest()} and {@link
+ * Auth_OpenID_Server::encodeResponse} methods. Who gets to do the
+ * intermediate task -- deciding how to respond to the request -- will
+ * depend on what type of request it is.
+ *
+ * If it's a request to authenticate a user (a 'checkid_setup' or
+ * 'checkid_immediate' request), you need to decide if you will assert
+ * that this user may claim the identity in question. Exactly how you
+ * do that is a matter of application policy, but it generally
+ * involves making sure the user has an account with your system and
+ * is logged in, checking to see if that identity is hers to claim,
+ * and verifying with the user that she does consent to releasing that
+ * information to the party making the request.
+ *
+ * Examine the properties of the {@link Auth_OpenID_CheckIDRequest}
+ * object, and if and when you've come to a decision, form a response
+ * by calling {@link Auth_OpenID_CheckIDRequest::answer()}.
+ *
+ * Other types of requests relate to establishing associations between
+ * client and server and verifing the authenticity of previous
+ * communications. {@link Auth_OpenID_Server} contains all the logic
+ * and data necessary to respond to such requests; just pass it to
+ * {@link Auth_OpenID_Server::handleRequest()}.
+ *
+ * OpenID Extensions
+ *
+ * Do you want to provide other information for your users in addition
+ * to authentication? Version 1.2 of the OpenID protocol allows
+ * consumers to add extensions to their requests. For example, with
+ * sites using the Simple Registration
+ * Extension
+ * (http://openid.net/specs/openid-simple-registration-extension-1_0.html),
+ * a user can agree to have their nickname and e-mail address sent to
+ * a site when they sign up.
+ *
+ * Since extensions do not change the way OpenID authentication works,
+ * code to handle extension requests may be completely separate from
+ * the {@link Auth_OpenID_Request} class here. But you'll likely want
+ * data sent back by your extension to be signed. {@link
+ * Auth_OpenID_ServerResponse} provides methods with which you can add
+ * data to it which can be signed with the other data in the OpenID
+ * signature.
+ *
+ * For example:
+ *
+ * <pre> // when request is a checkid_* request
+ * $response = $request->answer(true);
+ * // this will a signed 'openid.sreg.timezone' parameter to the response
+ * response.addField('sreg', 'timezone', 'America/Los_Angeles')</pre>
+ *
+ * Stores
+ *
+ * The OpenID server needs to maintain state between requests in order
+ * to function. Its mechanism for doing this is called a store. The
+ * store interface is defined in Interface.php. Additionally, several
+ * concrete store implementations are provided, so that most sites
+ * won't need to implement a custom store. For a store backed by flat
+ * files on disk, see {@link Auth_OpenID_FileStore}. For stores based
+ * on MySQL, SQLite, or PostgreSQL, see the {@link
+ * Auth_OpenID_SQLStore} subclasses.
+ *
+ * Upgrading
+ *
+ * The keys by which a server looks up associations in its store have
+ * changed in version 1.2 of this library. If your store has entries
+ * created from version 1.0 code, you should empty it.
+ *
+ * PHP versions 4 and 5
+ *
+ * LICENSE: See the COPYING file included in this distribution.
+ *
+ * @package OpenID
+ * @author JanRain, Inc. <openid@janrain.com>
+ * @copyright 2005-2008 Janrain, Inc.
+ * @license http://www.apache.org/licenses/LICENSE-2.0 Apache
+ */
+
+/**
+ * Required imports
+ */
+require_once "Auth/OpenID.php";
+require_once "Auth/OpenID/Association.php";
+require_once "Auth/OpenID/CryptUtil.php";
+require_once "Auth/OpenID/BigMath.php";
+require_once "Auth/OpenID/DiffieHellman.php";
+require_once "Auth/OpenID/KVForm.php";
+require_once "Auth/OpenID/TrustRoot.php";
+require_once "Auth/OpenID/ServerRequest.php";
+require_once "Auth/OpenID/Message.php";
+require_once "Auth/OpenID/Nonce.php";
+
+define('AUTH_OPENID_HTTP_OK', 200);
+define('AUTH_OPENID_HTTP_REDIRECT', 302);
+define('AUTH_OPENID_HTTP_ERROR', 400);
+
+/**
+ * @access private
+ */
+global $_Auth_OpenID_Request_Modes;
+$_Auth_OpenID_Request_Modes = array('checkid_setup',
+ 'checkid_immediate');
+
+/**
+ * @access private
+ */
+define('Auth_OpenID_ENCODE_KVFORM', 'kfvorm');
+
+/**
+ * @access private
+ */
+define('Auth_OpenID_ENCODE_URL', 'URL/redirect');
+
+/**
+ * @access private
+ */
+define('Auth_OpenID_ENCODE_HTML_FORM', 'HTML form');
+
+/**
+ * @access private
+ */
+function Auth_OpenID_isError($obj, $cls = 'Auth_OpenID_ServerError')
+{
+ return is_a($obj, $cls);
+}
+
+/**
+ * An error class which gets instantiated and returned whenever an
+ * OpenID protocol error occurs. Be prepared to use this in place of
+ * an ordinary server response.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_ServerError {
+ /**
+ * @access private
+ */
+ function Auth_OpenID_ServerError($message = null, $text = null,
+ $reference = null, $contact = null)
+ {
+ $this->message = $message;
+ $this->text = $text;
+ $this->contact = $contact;
+ $this->reference = $reference;
+ }
+
+ function getReturnTo()
+ {
+ if ($this->message &&
+ $this->message->hasKey(Auth_OpenID_OPENID_NS, 'return_to')) {
+ return $this->message->getArg(Auth_OpenID_OPENID_NS,
+ 'return_to');
+ } else {
+ return null;
+ }
+ }
+
+ /**
+ * Returns the return_to URL for the request which caused this
+ * error.
+ */
+ function hasReturnTo()
+ {
+ return $this->getReturnTo() !== null;
+ }
+
+ /**
+ * Encodes this error's response as a URL suitable for
+ * redirection. If the response has no return_to, another
+ * Auth_OpenID_ServerError is returned.
+ */
+ function encodeToURL()
+ {
+ if (!$this->message) {
+ return null;
+ }
+
+ $msg = $this->toMessage();
+ return $msg->toURL($this->getReturnTo());
+ }
+
+ /**
+ * Encodes the response to key-value form. This is a
+ * machine-readable format used to respond to messages which came
+ * directly from the consumer and not through the user-agent. See
+ * the OpenID specification.
+ */
+ function encodeToKVForm()
+ {
+ return Auth_OpenID_KVForm::fromArray(
+ array('mode' => 'error',
+ 'error' => $this->toString()));
+ }
+
+ function toFormMarkup($form_tag_attrs=null)
+ {
+ $msg = $this->toMessage();
+ return $msg->toFormMarkup($this->getReturnTo(), $form_tag_attrs);
+ }
+
+ function toHTML($form_tag_attrs=null)
+ {
+ return Auth_OpenID::autoSubmitHTML(
+ $this->toFormMarkup($form_tag_attrs));
+ }
+
+ function toMessage()
+ {
+ // Generate a Message object for sending to the relying party,
+ // after encoding.
+ $namespace = $this->message->getOpenIDNamespace();
+ $reply = new Auth_OpenID_Message($namespace);
+ $reply->setArg(Auth_OpenID_OPENID_NS, 'mode', 'error');
+ $reply->setArg(Auth_OpenID_OPENID_NS, 'error', $this->toString());
+
+ if ($this->contact !== null) {
+ $reply->setArg(Auth_OpenID_OPENID_NS, 'contact', $this->contact);
+ }
+
+ if ($this->reference !== null) {
+ $reply->setArg(Auth_OpenID_OPENID_NS, 'reference',
+ $this->reference);
+ }
+
+ return $reply;
+ }
+
+ /**
+ * Returns one of Auth_OpenID_ENCODE_URL,
+ * Auth_OpenID_ENCODE_KVFORM, or null, depending on the type of
+ * encoding expected for this error's payload.
+ */
+ function whichEncoding()
+ {
+ global $_Auth_OpenID_Request_Modes;
+
+ if ($this->hasReturnTo()) {
+ if ($this->message->isOpenID2() &&
+ (strlen($this->encodeToURL()) >
+ Auth_OpenID_OPENID1_URL_LIMIT)) {
+ return Auth_OpenID_ENCODE_HTML_FORM;
+ } else {
+ return Auth_OpenID_ENCODE_URL;
+ }
+ }
+
+ if (!$this->message) {
+ return null;
+ }
+
+ $mode = $this->message->getArg(Auth_OpenID_OPENID_NS,
+ 'mode');
+
+ if ($mode) {
+ if (!in_array($mode, $_Auth_OpenID_Request_Modes)) {
+ return Auth_OpenID_ENCODE_KVFORM;
+ }
+ }
+ return null;
+ }
+
+ /**
+ * Returns this error message.
+ */
+ function toString()
+ {
+ if ($this->text) {
+ return $this->text;
+ } else {
+ return get_class($this) . " error";
+ }
+ }
+}
+
+/**
+ * Error returned by the server code when a return_to is absent from a
+ * request.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_NoReturnToError extends Auth_OpenID_ServerError {
+ function Auth_OpenID_NoReturnToError($message = null,
+ $text = "No return_to URL available")
+ {
+ parent::Auth_OpenID_ServerError($message, $text);
+ }
+
+ function toString()
+ {
+ return "No return_to available";
+ }
+}
+
+/**
+ * An error indicating that the return_to URL is malformed.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_MalformedReturnURL extends Auth_OpenID_ServerError {
+ function Auth_OpenID_MalformedReturnURL($message, $return_to)
+ {
+ $this->return_to = $return_to;
+ parent::Auth_OpenID_ServerError($message, "malformed return_to URL");
+ }
+}
+
+/**
+ * This error is returned when the trust_root value is malformed.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_MalformedTrustRoot extends Auth_OpenID_ServerError {
+ function Auth_OpenID_MalformedTrustRoot($message = null,
+ $text = "Malformed trust root")
+ {
+ parent::Auth_OpenID_ServerError($message, $text);
+ }
+
+ function toString()
+ {
+ return "Malformed trust root";
+ }
+}
+
+/**
+ * The base class for all server request classes.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_Request {
+ var $mode = null;
+}
+
+/**
+ * A request to verify the validity of a previous response.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_CheckAuthRequest extends Auth_OpenID_Request {
+ var $mode = "check_authentication";
+ var $invalidate_handle = null;
+
+ function Auth_OpenID_CheckAuthRequest($assoc_handle, $signed,
+ $invalidate_handle = null)
+ {
+ $this->assoc_handle = $assoc_handle;
+ $this->signed = $signed;
+ if ($invalidate_handle !== null) {
+ $this->invalidate_handle = $invalidate_handle;
+ }
+ $this->namespace = Auth_OpenID_OPENID2_NS;
+ $this->message = null;
+ }
+
+ static function fromMessage($message, $server=null)
+ {
+ $required_keys = array('assoc_handle', 'sig', 'signed');
+
+ foreach ($required_keys as $k) {
+ if (!$message->getArg(Auth_OpenID_OPENID_NS, $k)) {
+ return new Auth_OpenID_ServerError($message,
+ sprintf("%s request missing required parameter %s from \
+ query", "check_authentication", $k));
+ }
+ }
+
+ $assoc_handle = $message->getArg(Auth_OpenID_OPENID_NS, 'assoc_handle');
+ $sig = $message->getArg(Auth_OpenID_OPENID_NS, 'sig');
+
+ $signed_list = $message->getArg(Auth_OpenID_OPENID_NS, 'signed');
+ $signed_list = explode(",", $signed_list);
+
+ $signed = $message;
+ if ($signed->hasKey(Auth_OpenID_OPENID_NS, 'mode')) {
+ $signed->setArg(Auth_OpenID_OPENID_NS, 'mode', 'id_res');
+ }
+
+ $result = new Auth_OpenID_CheckAuthRequest($assoc_handle, $signed);
+ $result->message = $message;
+ $result->sig = $sig;
+ $result->invalidate_handle = $message->getArg(Auth_OpenID_OPENID_NS,
+ 'invalidate_handle');
+ return $result;
+ }
+
+ function answer($signatory)
+ {
+ $is_valid = $signatory->verify($this->assoc_handle, $this->signed);
+
+ // Now invalidate that assoc_handle so it this checkAuth
+ // message cannot be replayed.
+ $signatory->invalidate($this->assoc_handle, true);
+ $response = new Auth_OpenID_ServerResponse($this);
+
+ $response->fields->setArg(Auth_OpenID_OPENID_NS,
+ 'is_valid',
+ ($is_valid ? "true" : "false"));
+
+ if ($this->invalidate_handle) {
+ $assoc = $signatory->getAssociation($this->invalidate_handle,
+ false);
+ if (!$assoc) {
+ $response->fields->setArg(Auth_OpenID_OPENID_NS,
+ 'invalidate_handle',
+ $this->invalidate_handle);
+ }
+ }
+ return $response;
+ }
+}
+
+/**
+ * A class implementing plaintext server sessions.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_PlainTextServerSession {
+ /**
+ * An object that knows how to handle association requests with no
+ * session type.
+ */
+ var $session_type = 'no-encryption';
+ var $needs_math = false;
+ var $allowed_assoc_types = array('HMAC-SHA1', 'HMAC-SHA256');
+
+ static function fromMessage($unused_request)
+ {
+ return new Auth_OpenID_PlainTextServerSession();
+ }
+
+ function answer($secret)
+ {
+ return array('mac_key' => base64_encode($secret));
+ }
+}
+
+/**
+ * A class implementing DH-SHA1 server sessions.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_DiffieHellmanSHA1ServerSession {
+ /**
+ * An object that knows how to handle association requests with
+ * the Diffie-Hellman session type.
+ */
+
+ var $session_type = 'DH-SHA1';
+ var $needs_math = true;
+ var $allowed_assoc_types = array('HMAC-SHA1');
+ var $hash_func = 'Auth_OpenID_SHA1';
+
+ function Auth_OpenID_DiffieHellmanSHA1ServerSession($dh, $consumer_pubkey)
+ {
+ $this->dh = $dh;
+ $this->consumer_pubkey = $consumer_pubkey;
+ }
+
+ static function getDH($message)
+ {
+ $dh_modulus = $message->getArg(Auth_OpenID_OPENID_NS, 'dh_modulus');
+ $dh_gen = $message->getArg(Auth_OpenID_OPENID_NS, 'dh_gen');
+
+ if ((($dh_modulus === null) && ($dh_gen !== null)) ||
+ (($dh_gen === null) && ($dh_modulus !== null))) {
+
+ if ($dh_modulus === null) {
+ $missing = 'modulus';
+ } else {
+ $missing = 'generator';
+ }
+
+ return new Auth_OpenID_ServerError($message,
+ 'If non-default modulus or generator is '.
+ 'supplied, both must be supplied. Missing '.
+ $missing);
+ }
+
+ $lib = Auth_OpenID_getMathLib();
+
+ if ($dh_modulus || $dh_gen) {
+ $dh_modulus = $lib->base64ToLong($dh_modulus);
+ $dh_gen = $lib->base64ToLong($dh_gen);
+ if ($lib->cmp($dh_modulus, 0) == 0 ||
+ $lib->cmp($dh_gen, 0) == 0) {
+ return new Auth_OpenID_ServerError(
+ $message, "Failed to parse dh_mod or dh_gen");
+ }
+ $dh = new Auth_OpenID_DiffieHellman($dh_modulus, $dh_gen);
+ } else {
+ $dh = new Auth_OpenID_DiffieHellman();
+ }
+
+ $consumer_pubkey = $message->getArg(Auth_OpenID_OPENID_NS,
+ 'dh_consumer_public');
+ if ($consumer_pubkey === null) {
+ return new Auth_OpenID_ServerError($message,
+ 'Public key for DH-SHA1 session '.
+ 'not found in query');
+ }
+
+ $consumer_pubkey =
+ $lib->base64ToLong($consumer_pubkey);
+
+ if ($consumer_pubkey === false) {
+ return new Auth_OpenID_ServerError($message,
+ "dh_consumer_public is not base64");
+ }
+
+ return array($dh, $consumer_pubkey);
+ }
+
+ static function fromMessage($message)
+ {
+ $result = Auth_OpenID_DiffieHellmanSHA1ServerSession::getDH($message);
+
+ if (is_a($result, 'Auth_OpenID_ServerError')) {
+ return $result;
+ } else {
+ list($dh, $consumer_pubkey) = $result;
+ return new Auth_OpenID_DiffieHellmanSHA1ServerSession($dh,
+ $consumer_pubkey);
+ }
+ }
+
+ function answer($secret)
+ {
+ $lib = Auth_OpenID_getMathLib();
+ $mac_key = $this->dh->xorSecret($this->consumer_pubkey, $secret,
+ $this->hash_func);
+ return array(
+ 'dh_server_public' =>
+ $lib->longToBase64($this->dh->public),
+ 'enc_mac_key' => base64_encode($mac_key));
+ }
+}
+
+/**
+ * A class implementing DH-SHA256 server sessions.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_DiffieHellmanSHA256ServerSession
+ extends Auth_OpenID_DiffieHellmanSHA1ServerSession {
+
+ var $session_type = 'DH-SHA256';
+ var $hash_func = 'Auth_OpenID_SHA256';
+ var $allowed_assoc_types = array('HMAC-SHA256');
+
+ static function fromMessage($message)
+ {
+ $result = Auth_OpenID_DiffieHellmanSHA1ServerSession::getDH($message);
+
+ if (is_a($result, 'Auth_OpenID_ServerError')) {
+ return $result;
+ } else {
+ list($dh, $consumer_pubkey) = $result;
+ return new Auth_OpenID_DiffieHellmanSHA256ServerSession($dh,
+ $consumer_pubkey);
+ }
+ }
+}
+
+/**
+ * A request to associate with the server.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_AssociateRequest extends Auth_OpenID_Request {
+ var $mode = "associate";
+
+ static function getSessionClasses()
+ {
+ return array(
+ 'no-encryption' => 'Auth_OpenID_PlainTextServerSession',
+ 'DH-SHA1' => 'Auth_OpenID_DiffieHellmanSHA1ServerSession',
+ 'DH-SHA256' => 'Auth_OpenID_DiffieHellmanSHA256ServerSession');
+ }
+
+ function Auth_OpenID_AssociateRequest($session, $assoc_type)
+ {
+ $this->session = $session;
+ $this->namespace = Auth_OpenID_OPENID2_NS;
+ $this->assoc_type = $assoc_type;
+ }
+
+ static function fromMessage($message, $server=null)
+ {
+ if ($message->isOpenID1()) {
+ $session_type = $message->getArg(Auth_OpenID_OPENID_NS,
+ 'session_type');
+
+ if ($session_type == 'no-encryption') {
+ // oidutil.log('Received OpenID 1 request with a no-encryption '
+ // 'assocaition session type. Continuing anyway.')
+ } else if (!$session_type) {
+ $session_type = 'no-encryption';
+ }
+ } else {
+ $session_type = $message->getArg(Auth_OpenID_OPENID_NS,
+ 'session_type');
+ if ($session_type === null) {
+ return new Auth_OpenID_ServerError($message,
+ "session_type missing from request");
+ }
+ }
+
+ $session_class = Auth_OpenID::arrayGet(
+ Auth_OpenID_AssociateRequest::getSessionClasses(),
+ $session_type);
+
+ if ($session_class === null) {
+ return new Auth_OpenID_ServerError($message,
+ "Unknown session type " .
+ $session_type);
+ }
+
+ $session = call_user_func(array($session_class, 'fromMessage'),
+ $message);
+ if (is_a($session, 'Auth_OpenID_ServerError')) {
+ return $session;
+ }
+
+ $assoc_type = $message->getArg(Auth_OpenID_OPENID_NS,
+ 'assoc_type', 'HMAC-SHA1');
+
+ if (!in_array($assoc_type, $session->allowed_assoc_types)) {
+ $fmt = "Session type %s does not support association type %s";
+ return new Auth_OpenID_ServerError($message,
+ sprintf($fmt, $session_type, $assoc_type));
+ }
+
+ $obj = new Auth_OpenID_AssociateRequest($session, $assoc_type);
+ $obj->message = $message;
+ $obj->namespace = $message->getOpenIDNamespace();
+ return $obj;
+ }
+
+ function answer($assoc)
+ {
+ $response = new Auth_OpenID_ServerResponse($this);
+ $response->fields->updateArgs(Auth_OpenID_OPENID_NS,
+ array(
+ 'expires_in' => sprintf('%d', $assoc->getExpiresIn()),
+ 'assoc_type' => $this->assoc_type,
+ 'assoc_handle' => $assoc->handle));
+
+ $response->fields->updateArgs(Auth_OpenID_OPENID_NS,
+ $this->session->answer($assoc->secret));
+
+ if (! ($this->session->session_type == 'no-encryption'
+ && $this->message->isOpenID1())) {
+ $response->fields->setArg(Auth_OpenID_OPENID_NS,
+ 'session_type',
+ $this->session->session_type);
+ }
+
+ return $response;
+ }
+
+ function answerUnsupported($text_message,
+ $preferred_association_type=null,
+ $preferred_session_type=null)
+ {
+ if ($this->message->isOpenID1()) {
+ return new Auth_OpenID_ServerError($this->message);
+ }
+
+ $response = new Auth_OpenID_ServerResponse($this);
+ $response->fields->setArg(Auth_OpenID_OPENID_NS,
+ 'error_code', 'unsupported-type');
+ $response->fields->setArg(Auth_OpenID_OPENID_NS,
+ 'error', $text_message);
+
+ if ($preferred_association_type) {
+ $response->fields->setArg(Auth_OpenID_OPENID_NS,
+ 'assoc_type',
+ $preferred_association_type);
+ }
+
+ if ($preferred_session_type) {
+ $response->fields->setArg(Auth_OpenID_OPENID_NS,
+ 'session_type',
+ $preferred_session_type);
+ }
+ $response->code = AUTH_OPENID_HTTP_ERROR;
+ return $response;
+ }
+}
+
+/**
+ * A request to confirm the identity of a user.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_CheckIDRequest extends Auth_OpenID_Request {
+ /**
+ * Return-to verification callback. Default is
+ * Auth_OpenID_verifyReturnTo from TrustRoot.php.
+ */
+ var $verifyReturnTo = 'Auth_OpenID_verifyReturnTo';
+
+ /**
+ * The mode of this request.
+ */
+ var $mode = "checkid_setup"; // or "checkid_immediate"
+
+ /**
+ * Whether this request is for immediate mode.
+ */
+ var $immediate = false;
+
+ /**
+ * The trust_root value for this request.
+ */
+ var $trust_root = null;
+
+ /**
+ * The OpenID namespace for this request.
+ * deprecated since version 2.0.2
+ */
+ var $namespace;
+
+ static function make($message, $identity, $return_to, $trust_root = null,
+ $immediate = false, $assoc_handle = null, $server = null)
+ {
+ if ($server === null) {
+ return new Auth_OpenID_ServerError($message,
+ "server must not be null");
+ }
+
+ if ($return_to &&
+ !Auth_OpenID_TrustRoot::_parse($return_to)) {
+ return new Auth_OpenID_MalformedReturnURL($message, $return_to);
+ }
+
+ $r = new Auth_OpenID_CheckIDRequest($identity, $return_to,
+ $trust_root, $immediate,
+ $assoc_handle, $server);
+
+ $r->namespace = $message->getOpenIDNamespace();
+ $r->message = $message;
+
+ if (!$r->trustRootValid()) {
+ return new Auth_OpenID_UntrustedReturnURL($message,
+ $return_to,
+ $trust_root);
+ } else {
+ return $r;
+ }
+ }
+
+ function Auth_OpenID_CheckIDRequest($identity, $return_to,
+ $trust_root = null, $immediate = false,
+ $assoc_handle = null, $server = null,
+ $claimed_id = null)
+ {
+ $this->namespace = Auth_OpenID_OPENID2_NS;
+ $this->assoc_handle = $assoc_handle;
+ $this->identity = $identity;
+ if ($claimed_id === null) {
+ $this->claimed_id = $identity;
+ } else {
+ $this->claimed_id = $claimed_id;
+ }
+ $this->return_to = $return_to;
+ $this->trust_root = $trust_root;
+ $this->server = $server;
+
+ if ($immediate) {
+ $this->immediate = true;
+ $this->mode = "checkid_immediate";
+ } else {
+ $this->immediate = false;
+ $this->mode = "checkid_setup";
+ }
+ }
+
+ function equals($other)
+ {
+ return (
+ (is_a($other, 'Auth_OpenID_CheckIDRequest')) &&
+ ($this->namespace == $other->namespace) &&
+ ($this->assoc_handle == $other->assoc_handle) &&
+ ($this->identity == $other->identity) &&
+ ($this->claimed_id == $other->claimed_id) &&
+ ($this->return_to == $other->return_to) &&
+ ($this->trust_root == $other->trust_root));
+ }
+
+ /*
+ * Does the relying party publish the return_to URL for this
+ * response under the realm? It is up to the provider to set a
+ * policy for what kinds of realms should be allowed. This
+ * return_to URL verification reduces vulnerability to data-theft
+ * attacks based on open proxies, corss-site-scripting, or open
+ * redirectors.
+ *
+ * This check should only be performed after making sure that the
+ * return_to URL matches the realm.
+ *
+ * @return true if the realm publishes a document with the
+ * return_to URL listed, false if not or if discovery fails
+ */
+ function returnToVerified()
+ {
+ $fetcher = Auth_Yadis_Yadis::getHTTPFetcher();
+ return call_user_func_array($this->verifyReturnTo,
+ array($this->trust_root, $this->return_to, $fetcher));
+ }
+
+ static function fromMessage($message, $server)
+ {
+ $mode = $message->getArg(Auth_OpenID_OPENID_NS, 'mode');
+ $immediate = null;
+
+ if ($mode == "checkid_immediate") {
+ $immediate = true;
+ $mode = "checkid_immediate";
+ } else {
+ $immediate = false;
+ $mode = "checkid_setup";
+ }
+
+ $return_to = $message->getArg(Auth_OpenID_OPENID_NS,
+ 'return_to');
+
+ if (($message->isOpenID1()) &&
+ (!$return_to)) {
+ $fmt = "Missing required field 'return_to' from checkid request";
+ return new Auth_OpenID_ServerError($message, $fmt);
+ }
+
+ $identity = $message->getArg(Auth_OpenID_OPENID_NS,
+ 'identity');
+ $claimed_id = $message->getArg(Auth_OpenID_OPENID_NS, 'claimed_id');
+ if ($message->isOpenID1()) {
+ if ($identity === null) {
+ $s = "OpenID 1 message did not contain openid.identity";
+ return new Auth_OpenID_ServerError($message, $s);
+ }
+ } else {
+ if ($identity && !$claimed_id) {
+ $s = "OpenID 2.0 message contained openid.identity but not " .
+ "claimed_id";
+ return new Auth_OpenID_ServerError($message, $s);
+ } else if ($claimed_id && !$identity) {
+ $s = "OpenID 2.0 message contained openid.claimed_id " .
+ "but not identity";
+ return new Auth_OpenID_ServerError($message, $s);
+ }
+ }
+
+ // There's a case for making self.trust_root be a TrustRoot
+ // here. But if TrustRoot isn't currently part of the
+ // "public" API, I'm not sure it's worth doing.
+ if ($message->isOpenID1()) {
+ $trust_root_param = 'trust_root';
+ } else {
+ $trust_root_param = 'realm';
+ }
+ $trust_root = $message->getArg(Auth_OpenID_OPENID_NS,
+ $trust_root_param);
+ if (! $trust_root) {
+ $trust_root = $return_to;
+ }
+
+ if (! $message->isOpenID1() &&
+ ($return_to === null) &&
+ ($trust_root === null)) {
+ return new Auth_OpenID_ServerError($message,
+ "openid.realm required when openid.return_to absent");
+ }
+
+ $assoc_handle = $message->getArg(Auth_OpenID_OPENID_NS,
+ 'assoc_handle');
+
+ $obj = Auth_OpenID_CheckIDRequest::make($message,
+ $identity,
+ $return_to,
+ $trust_root,
+ $immediate,
+ $assoc_handle,
+ $server);
+
+ if (is_a($obj, 'Auth_OpenID_ServerError')) {
+ return $obj;
+ }
+
+ $obj->claimed_id = $claimed_id;
+
+ return $obj;
+ }
+
+ function idSelect()
+ {
+ // Is the identifier to be selected by the IDP?
+ // So IDPs don't have to import the constant
+ return $this->identity == Auth_OpenID_IDENTIFIER_SELECT;
+ }
+
+ function trustRootValid()
+ {
+ if (!$this->trust_root) {
+ return true;
+ }
+
+ $tr = Auth_OpenID_TrustRoot::_parse($this->trust_root);
+ if ($tr === false) {
+ return new Auth_OpenID_MalformedTrustRoot($this->message,
+ $this->trust_root);
+ }
+
+ if ($this->return_to !== null) {
+ return Auth_OpenID_TrustRoot::match($this->trust_root,
+ $this->return_to);
+ } else {
+ return true;
+ }
+ }
+
+ /**
+ * Respond to this request. Return either an
+ * {@link Auth_OpenID_ServerResponse} or
+ * {@link Auth_OpenID_ServerError}.
+ *
+ * @param bool $allow Allow this user to claim this identity, and
+ * allow the consumer to have this information?
+ *
+ * @param string $server_url DEPRECATED. Passing $op_endpoint to
+ * the {@link Auth_OpenID_Server} constructor makes this optional.
+ *
+ * When an OpenID 1.x immediate mode request does not succeed, it
+ * gets back a URL where the request may be carried out in a
+ * not-so-immediate fashion. Pass my URL in here (the fully
+ * qualified address of this server's endpoint, i.e.
+ * http://example.com/server), and I will use it as a base for the
+ * URL for a new request.
+ *
+ * Optional for requests where {@link $immediate} is false or
+ * $allow is true.
+ *
+ * @param string $identity The OP-local identifier to answer with.
+ * Only for use when the relying party requested identifier
+ * selection.
+ *
+ * @param string $claimed_id The claimed identifier to answer
+ * with, for use with identifier selection in the case where the
+ * claimed identifier and the OP-local identifier differ,
+ * i.e. when the claimed_id uses delegation.
+ *
+ * If $identity is provided but this is not, $claimed_id will
+ * default to the value of $identity. When answering requests
+ * that did not ask for identifier selection, the response
+ * $claimed_id will default to that of the request.
+ *
+ * This parameter is new in OpenID 2.0.
+ *
+ * @return mixed
+ */
+ function answer($allow, $server_url = null, $identity = null,
+ $claimed_id = null)
+ {
+ if (!$this->return_to) {
+ return new Auth_OpenID_NoReturnToError();
+ }
+
+ if (!$server_url) {
+ if ((!$this->message->isOpenID1()) &&
+ (!$this->server->op_endpoint)) {
+ return new Auth_OpenID_ServerError(null,
+ "server should be constructed with op_endpoint to " .
+ "respond to OpenID 2.0 messages.");
+ }
+
+ $server_url = $this->server->op_endpoint;
+ }
+
+ if ($allow) {
+ $mode = 'id_res';
+ } else if ($this->message->isOpenID1()) {
+ if ($this->immediate) {
+ $mode = 'id_res';
+ } else {
+ $mode = 'cancel';
+ }
+ } else {
+ if ($this->immediate) {
+ $mode = 'setup_needed';
+ } else {
+ $mode = 'cancel';
+ }
+ }
+
+ if (!$this->trustRootValid()) {
+ return new Auth_OpenID_UntrustedReturnURL(null,
+ $this->return_to,
+ $this->trust_root);
+ }
+
+ $response = new Auth_OpenID_ServerResponse($this);
+
+ if ($claimed_id &&
+ ($this->message->isOpenID1())) {
+ return new Auth_OpenID_ServerError(null,
+ "claimed_id is new in OpenID 2.0 and not " .
+ "available for ".$this->namespace);
+ }
+
+ if ($identity && !$claimed_id) {
+ $claimed_id = $identity;
+ }
+
+ if ($allow) {
+
+ if ($this->identity == Auth_OpenID_IDENTIFIER_SELECT) {
+ if (!$identity) {
+ return new Auth_OpenID_ServerError(null,
+ "This request uses IdP-driven identifier selection. " .
+ "You must supply an identifier in the response.");
+ }
+
+ $response_identity = $identity;
+ $response_claimed_id = $claimed_id;
+
+ } else if ($this->identity) {
+ if ($identity &&
+ ($this->identity != $identity)) {
+ $fmt = "Request was for %s, cannot reply with identity %s";
+ return new Auth_OpenID_ServerError(null,
+ sprintf($fmt, $this->identity, $identity));
+ }
+
+ $response_identity = $this->identity;
+ $response_claimed_id = $this->claimed_id;
+ } else {
+ if ($identity) {
+ return new Auth_OpenID_ServerError(null,
+ "This request specified no identity and " .
+ "you supplied ".$identity);
+ }
+
+ $response_identity = null;
+ }
+
+ if (($this->message->isOpenID1()) &&
+ ($response_identity === null)) {
+ return new Auth_OpenID_ServerError(null,
+ "Request was an OpenID 1 request, so response must " .
+ "include an identifier.");
+ }
+
+ $response->fields->updateArgs(Auth_OpenID_OPENID_NS,
+ array('mode' => $mode,
+ 'return_to' => $this->return_to,
+ 'response_nonce' => Auth_OpenID_mkNonce()));
+
+ if (!$this->message->isOpenID1()) {
+ $response->fields->setArg(Auth_OpenID_OPENID_NS,
+ 'op_endpoint', $server_url);
+ }
+
+ if ($response_identity !== null) {
+ $response->fields->setArg(
+ Auth_OpenID_OPENID_NS,
+ 'identity',
+ $response_identity);
+ if ($this->message->isOpenID2()) {
+ $response->fields->setArg(
+ Auth_OpenID_OPENID_NS,
+ 'claimed_id',
+ $response_claimed_id);
+ }
+ }
+
+ } else {
+ $response->fields->setArg(Auth_OpenID_OPENID_NS,
+ 'mode', $mode);
+
+ if ($this->immediate) {
+ if (($this->message->isOpenID1()) &&
+ (!$server_url)) {
+ return new Auth_OpenID_ServerError(null,
+ 'setup_url is required for $allow=false \
+ in OpenID 1.x immediate mode.');
+ }
+
+ $setup_request = new Auth_OpenID_CheckIDRequest(
+ $this->identity,
+ $this->return_to,
+ $this->trust_root,
+ false,
+ $this->assoc_handle,
+ $this->server,
+ $this->claimed_id);
+ $setup_request->message = $this->message;
+
+ $setup_url = $setup_request->encodeToURL($server_url);
+
+ if ($setup_url === null) {
+ return new Auth_OpenID_NoReturnToError();
+ }
+
+ $response->fields->setArg(Auth_OpenID_OPENID_NS,
+ 'user_setup_url',
+ $setup_url);
+ }
+ }
+
+ return $response;
+ }
+
+ function encodeToURL($server_url)
+ {
+ if (!$this->return_to) {
+ return new Auth_OpenID_NoReturnToError();
+ }
+
+ // Imported from the alternate reality where these classes are
+ // used in both the client and server code, so Requests are
+ // Encodable too. That's right, code imported from alternate
+ // realities all for the love of you, id_res/user_setup_url.
+
+ $q = array('mode' => $this->mode,
+ 'identity' => $this->identity,
+ 'claimed_id' => $this->claimed_id,
+ 'return_to' => $this->return_to);
+
+ if ($this->trust_root) {
+ if ($this->message->isOpenID1()) {
+ $q['trust_root'] = $this->trust_root;
+ } else {
+ $q['realm'] = $this->trust_root;
+ }
+ }
+
+ if ($this->assoc_handle) {
+ $q['assoc_handle'] = $this->assoc_handle;
+ }
+
+ $response = new Auth_OpenID_Message(
+ $this->message->getOpenIDNamespace());
+ $response->updateArgs(Auth_OpenID_OPENID_NS, $q);
+ return $response->toURL($server_url);
+ }
+
+ function getCancelURL()
+ {
+ if (!$this->return_to) {
+ return new Auth_OpenID_NoReturnToError();
+ }
+
+ if ($this->immediate) {
+ return new Auth_OpenID_ServerError(null,
+ "Cancel is not an appropriate \
+ response to immediate mode \
+ requests.");
+ }
+
+ $response = new Auth_OpenID_Message(
+ $this->message->getOpenIDNamespace());
+ $response->setArg(Auth_OpenID_OPENID_NS, 'mode', 'cancel');
+ return $response->toURL($this->return_to);
+ }
+}
+
+/**
+ * This class encapsulates the response to an OpenID server request.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_ServerResponse {
+
+ function Auth_OpenID_ServerResponse($request)
+ {
+ $this->request = $request;
+ $this->fields = new Auth_OpenID_Message($this->request->namespace);
+ }
+
+ function whichEncoding()
+ {
+ global $_Auth_OpenID_Request_Modes;
+
+ if (in_array($this->request->mode, $_Auth_OpenID_Request_Modes)) {
+ if ($this->fields->isOpenID2() &&
+ (strlen($this->encodeToURL()) >
+ Auth_OpenID_OPENID1_URL_LIMIT)) {
+ return Auth_OpenID_ENCODE_HTML_FORM;
+ } else {
+ return Auth_OpenID_ENCODE_URL;
+ }
+ } else {
+ return Auth_OpenID_ENCODE_KVFORM;
+ }
+ }
+
+ /*
+ * Returns the form markup for this response.
+ *
+ * @return str
+ */
+ function toFormMarkup($form_tag_attrs=null)
+ {
+ return $this->fields->toFormMarkup($this->request->return_to,
+ $form_tag_attrs);
+ }
+
+ /*
+ * Returns an HTML document containing the form markup for this
+ * response that autosubmits with javascript.
+ */
+ function toHTML()
+ {
+ return Auth_OpenID::autoSubmitHTML($this->toFormMarkup());
+ }
+
+ /*
+ * Returns True if this response's encoding is ENCODE_HTML_FORM.
+ * Convenience method for server authors.
+ *
+ * @return bool
+ */
+ function renderAsForm()
+ {
+ return $this->whichEncoding() == Auth_OpenID_ENCODE_HTML_FORM;
+ }
+
+
+ function encodeToURL()
+ {
+ return $this->fields->toURL($this->request->return_to);
+ }
+
+ function addExtension($extension_response)
+ {
+ $extension_response->toMessage($this->fields);
+ }
+
+ function needsSigning()
+ {
+ return $this->fields->getArg(Auth_OpenID_OPENID_NS,
+ 'mode') == 'id_res';
+ }
+
+ function encodeToKVForm()
+ {
+ return $this->fields->toKVForm();
+ }
+}
+
+/**
+ * A web-capable response object which you can use to generate a
+ * user-agent response.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_WebResponse {
+ var $code = AUTH_OPENID_HTTP_OK;
+ var $body = "";
+
+ function Auth_OpenID_WebResponse($code = null, $headers = null,
+ $body = null)
+ {
+ if ($code) {
+ $this->code = $code;
+ }
+
+ if ($headers !== null) {
+ $this->headers = $headers;
+ } else {
+ $this->headers = array();
+ }
+
+ if ($body !== null) {
+ $this->body = $body;
+ }
+ }
+}
+
+/**
+ * Responsible for the signature of query data and the verification of
+ * OpenID signature values.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_Signatory {
+
+ // = 14 * 24 * 60 * 60; # 14 days, in seconds
+ var $SECRET_LIFETIME = 1209600;
+
+ // keys have a bogus server URL in them because the filestore
+ // really does expect that key to be a URL. This seems a little
+ // silly for the server store, since I expect there to be only one
+ // server URL.
+ var $normal_key = 'http://localhost/|normal';
+ var $dumb_key = 'http://localhost/|dumb';
+
+ /**
+ * Create a new signatory using a given store.
+ */
+ function Auth_OpenID_Signatory($store)
+ {
+ // assert store is not None
+ $this->store = $store;
+ }
+
+ /**
+ * Verify, using a given association handle, a signature with
+ * signed key-value pairs from an HTTP request.
+ */
+ function verify($assoc_handle, $message)
+ {
+ $assoc = $this->getAssociation($assoc_handle, true);
+ if (!$assoc) {
+ // oidutil.log("failed to get assoc with handle %r to verify sig %r"
+ // % (assoc_handle, sig))
+ return false;
+ }
+
+ return $assoc->checkMessageSignature($message);
+ }
+
+ /**
+ * Given a response, sign the fields in the response's 'signed'
+ * list, and insert the signature into the response.
+ */
+ function sign($response)
+ {
+ $signed_response = $response;
+ $assoc_handle = $response->request->assoc_handle;
+
+ if ($assoc_handle) {
+ // normal mode
+ $assoc = $this->getAssociation($assoc_handle, false, false);
+ if (!$assoc || ($assoc->getExpiresIn() <= 0)) {
+ // fall back to dumb mode
+ $signed_response->fields->setArg(Auth_OpenID_OPENID_NS,
+ 'invalidate_handle', $assoc_handle);
+ $assoc_type = ($assoc ? $assoc->assoc_type : 'HMAC-SHA1');
+
+ if ($assoc && ($assoc->getExpiresIn() <= 0)) {
+ $this->invalidate($assoc_handle, false);
+ }
+
+ $assoc = $this->createAssociation(true, $assoc_type);
+ }
+ } else {
+ // dumb mode.
+ $assoc = $this->createAssociation(true);
+ }
+
+ $signed_response->fields = $assoc->signMessage(
+ $signed_response->fields);
+ return $signed_response;
+ }
+
+ /**
+ * Make a new association.
+ */
+ function createAssociation($dumb = true, $assoc_type = 'HMAC-SHA1')
+ {
+ $secret = Auth_OpenID_CryptUtil::getBytes(
+ Auth_OpenID_getSecretSize($assoc_type));
+
+ $uniq = base64_encode(Auth_OpenID_CryptUtil::getBytes(4));
+ $handle = sprintf('{%s}{%x}{%s}', $assoc_type, intval(time()), $uniq);
+
+ $assoc = Auth_OpenID_Association::fromExpiresIn(
+ $this->SECRET_LIFETIME, $handle, $secret, $assoc_type);
+
+ if ($dumb) {
+ $key = $this->dumb_key;
+ } else {
+ $key = $this->normal_key;
+ }
+
+ $this->store->storeAssociation($key, $assoc);
+ return $assoc;
+ }
+
+ /**
+ * Given an association handle, get the association from the
+ * store, or return a ServerError or null if something goes wrong.
+ */
+ function getAssociation($assoc_handle, $dumb, $check_expiration=true)
+ {
+ if ($assoc_handle === null) {
+ return new Auth_OpenID_ServerError(null,
+ "assoc_handle must not be null");
+ }
+
+ if ($dumb) {
+ $key = $this->dumb_key;
+ } else {
+ $key = $this->normal_key;
+ }
+
+ $assoc = $this->store->getAssociation($key, $assoc_handle);
+
+ if (($assoc !== null) && ($assoc->getExpiresIn() <= 0)) {
+ if ($check_expiration) {
+ $this->store->removeAssociation($key, $assoc_handle);
+ $assoc = null;
+ }
+ }
+
+ return $assoc;
+ }
+
+ /**
+ * Invalidate a given association handle.
+ */
+ function invalidate($assoc_handle, $dumb)
+ {
+ if ($dumb) {
+ $key = $this->dumb_key;
+ } else {
+ $key = $this->normal_key;
+ }
+ $this->store->removeAssociation($key, $assoc_handle);
+ }
+}
+
+/**
+ * Encode an {@link Auth_OpenID_ServerResponse} to an
+ * {@link Auth_OpenID_WebResponse}.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_Encoder {
+
+ var $responseFactory = 'Auth_OpenID_WebResponse';
+
+ /**
+ * Encode an {@link Auth_OpenID_ServerResponse} and return an
+ * {@link Auth_OpenID_WebResponse}.
+ */
+ function encode($response)
+ {
+ $cls = $this->responseFactory;
+
+ $encode_as = $response->whichEncoding();
+ if ($encode_as == Auth_OpenID_ENCODE_KVFORM) {
+ $wr = new $cls(null, null, $response->encodeToKVForm());
+ if (is_a($response, 'Auth_OpenID_ServerError')) {
+ $wr->code = AUTH_OPENID_HTTP_ERROR;
+ }
+ } else if ($encode_as == Auth_OpenID_ENCODE_URL) {
+ $location = $response->encodeToURL();
+ $wr = new $cls(AUTH_OPENID_HTTP_REDIRECT,
+ array('location' => $location));
+ } else if ($encode_as == Auth_OpenID_ENCODE_HTML_FORM) {
+ $wr = new $cls(AUTH_OPENID_HTTP_OK, array(),
+ $response->toHTML());
+ } else {
+ return new Auth_OpenID_EncodingError($response);
+ }
+ /* Allow the response to carry a custom error code (ex: for Association errors) */
+ if(isset($response->code)) {
+ $wr->code = $response->code;
+ }
+ return $wr;
+ }
+}
+
+/**
+ * An encoder which also takes care of signing fields when required.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_SigningEncoder extends Auth_OpenID_Encoder {
+
+ function Auth_OpenID_SigningEncoder($signatory)
+ {
+ $this->signatory = $signatory;
+ }
+
+ /**
+ * Sign an {@link Auth_OpenID_ServerResponse} and return an
+ * {@link Auth_OpenID_WebResponse}.
+ */
+ function encode($response)
+ {
+ // the isinstance is a bit of a kludge... it means there isn't
+ // really an adapter to make the interfaces quite match.
+ if (!is_a($response, 'Auth_OpenID_ServerError') &&
+ $response->needsSigning()) {
+
+ if (!$this->signatory) {
+ return new Auth_OpenID_ServerError(null,
+ "Must have a store to sign request");
+ }
+
+ if ($response->fields->hasKey(Auth_OpenID_OPENID_NS, 'sig')) {
+ return new Auth_OpenID_AlreadySigned($response);
+ }
+ $response = $this->signatory->sign($response);
+ }
+
+ return parent::encode($response);
+ }
+}
+
+/**
+ * Decode an incoming query into an Auth_OpenID_Request.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_Decoder {
+
+ function Auth_OpenID_Decoder($server)
+ {
+ $this->server = $server;
+
+ $this->handlers = array(
+ 'checkid_setup' => 'Auth_OpenID_CheckIDRequest',
+ 'checkid_immediate' => 'Auth_OpenID_CheckIDRequest',
+ 'check_authentication' => 'Auth_OpenID_CheckAuthRequest',
+ 'associate' => 'Auth_OpenID_AssociateRequest'
+ );
+ }
+
+ /**
+ * Given an HTTP query in an array (key-value pairs), decode it
+ * into an Auth_OpenID_Request object.
+ */
+ function decode($query)
+ {
+ if (!$query) {
+ return null;
+ }
+
+ $message = Auth_OpenID_Message::fromPostArgs($query);
+
+ if ($message === null) {
+ /*
+ * It's useful to have a Message attached to a
+ * ProtocolError, so we override the bad ns value to build
+ * a Message out of it. Kinda kludgy, since it's made of
+ * lies, but the parts that aren't lies are more useful
+ * than a 'None'.
+ */
+ $old_ns = $query['openid.ns'];
+
+ $query['openid.ns'] = Auth_OpenID_OPENID2_NS;
+ $message = Auth_OpenID_Message::fromPostArgs($query);
+ return new Auth_OpenID_ServerError(
+ $message,
+ sprintf("Invalid OpenID namespace URI: %s", $old_ns));
+ }
+
+ $mode = $message->getArg(Auth_OpenID_OPENID_NS, 'mode');
+ if (!$mode) {
+ return new Auth_OpenID_ServerError($message,
+ "No mode value in message");
+ }
+
+ if (Auth_OpenID::isFailure($mode)) {
+ return new Auth_OpenID_ServerError($message,
+ $mode->message);
+ }
+
+ $handlerCls = Auth_OpenID::arrayGet($this->handlers, $mode,
+ $this->defaultDecoder($message));
+
+ if (!is_a($handlerCls, 'Auth_OpenID_ServerError')) {
+ return call_user_func_array(array($handlerCls, 'fromMessage'),
+ array($message, $this->server));
+ } else {
+ return $handlerCls;
+ }
+ }
+
+ function defaultDecoder($message)
+ {
+ $mode = $message->getArg(Auth_OpenID_OPENID_NS, 'mode');
+
+ if (Auth_OpenID::isFailure($mode)) {
+ return new Auth_OpenID_ServerError($message,
+ $mode->message);
+ }
+
+ return new Auth_OpenID_ServerError($message,
+ sprintf("Unrecognized OpenID mode %s", $mode));
+ }
+}
+
+/**
+ * An error that indicates an encoding problem occurred.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_EncodingError {
+ function Auth_OpenID_EncodingError($response)
+ {
+ $this->response = $response;
+ }
+}
+
+/**
+ * An error that indicates that a response was already signed.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_AlreadySigned extends Auth_OpenID_EncodingError {
+ // This response is already signed.
+}
+
+/**
+ * An error that indicates that the given return_to is not under the
+ * given trust_root.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_UntrustedReturnURL extends Auth_OpenID_ServerError {
+ function Auth_OpenID_UntrustedReturnURL($message, $return_to,
+ $trust_root)
+ {
+ parent::Auth_OpenID_ServerError($message, "Untrusted return_to URL");
+ $this->return_to = $return_to;
+ $this->trust_root = $trust_root;
+ }
+
+ function toString()
+ {
+ return sprintf("return_to %s not under trust_root %s",
+ $this->return_to, $this->trust_root);
+ }
+}
+
+/**
+ * I handle requests for an OpenID server.
+ *
+ * Some types of requests (those which are not checkid requests) may
+ * be handed to my {@link handleRequest} method, and I will take care
+ * of it and return a response.
+ *
+ * For your convenience, I also provide an interface to {@link
+ * Auth_OpenID_Decoder::decode()} and {@link
+ * Auth_OpenID_SigningEncoder::encode()} through my methods {@link
+ * decodeRequest} and {@link encodeResponse}.
+ *
+ * All my state is encapsulated in an {@link Auth_OpenID_OpenIDStore}.
+ *
+ * Example:
+ *
+ * <pre> $oserver = new Auth_OpenID_Server(Auth_OpenID_FileStore($data_path),
+ * "http://example.com/op");
+ * $request = $oserver->decodeRequest();
+ * if (in_array($request->mode, array('checkid_immediate',
+ * 'checkid_setup'))) {
+ * if ($app->isAuthorized($request->identity, $request->trust_root)) {
+ * $response = $request->answer(true);
+ * } else if ($request->immediate) {
+ * $response = $request->answer(false);
+ * } else {
+ * $app->showDecidePage($request);
+ * return;
+ * }
+ * } else {
+ * $response = $oserver->handleRequest($request);
+ * }
+ *
+ * $webresponse = $oserver->encode($response);</pre>
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_Server {
+ function Auth_OpenID_Server($store, $op_endpoint=null)
+ {
+ $this->store = $store;
+ $this->signatory = new Auth_OpenID_Signatory($this->store);
+ $this->encoder = new Auth_OpenID_SigningEncoder($this->signatory);
+ $this->decoder = new Auth_OpenID_Decoder($this);
+ $this->op_endpoint = $op_endpoint;
+ $this->negotiator = Auth_OpenID_getDefaultNegotiator();
+ }
+
+ /**
+ * Handle a request. Given an {@link Auth_OpenID_Request} object,
+ * call the appropriate {@link Auth_OpenID_Server} method to
+ * process the request and generate a response.
+ *
+ * @param Auth_OpenID_Request $request An {@link Auth_OpenID_Request}
+ * returned by {@link Auth_OpenID_Server::decodeRequest()}.
+ *
+ * @return Auth_OpenID_ServerResponse $response A response object
+ * capable of generating a user-agent reply.
+ */
+ function handleRequest($request)
+ {
+ if (method_exists($this, "openid_" . $request->mode)) {
+ $handler = array($this, "openid_" . $request->mode);
+ return call_user_func($handler, $request);
+ }
+ return null;
+ }
+
+ /**
+ * The callback for 'check_authentication' messages.
+ */
+ function openid_check_authentication($request)
+ {
+ return $request->answer($this->signatory);
+ }
+
+ /**
+ * The callback for 'associate' messages.
+ */
+ function openid_associate($request)
+ {
+ $assoc_type = $request->assoc_type;
+ $session_type = $request->session->session_type;
+ if ($this->negotiator->isAllowed($assoc_type, $session_type)) {
+ $assoc = $this->signatory->createAssociation(false,
+ $assoc_type);
+ return $request->answer($assoc);
+ } else {
+ $message = sprintf('Association type %s is not supported with '.
+ 'session type %s', $assoc_type, $session_type);
+ list($preferred_assoc_type, $preferred_session_type) =
+ $this->negotiator->getAllowedType();
+ return $request->answerUnsupported($message,
+ $preferred_assoc_type,
+ $preferred_session_type);
+ }
+ }
+
+ /**
+ * Encodes as response in the appropriate format suitable for
+ * sending to the user agent.
+ */
+ function encodeResponse($response)
+ {
+ return $this->encoder->encode($response);
+ }
+
+ /**
+ * Decodes a query args array into the appropriate
+ * {@link Auth_OpenID_Request} object.
+ */
+ function decodeRequest($query=null)
+ {
+ if ($query === null) {
+ $query = Auth_OpenID::getQuery();
+ }
+
+ return $this->decoder->decode($query);
+ }
+}
+
+
+
--- /dev/null
+++ b/lib/openid-php/Auth/OpenID/TrustRoot.php
@@ -1,1 +1,462 @@
-
+<?php
+/**
+ * Functions for dealing with OpenID trust roots
+ *
+ * PHP versions 4 and 5
+ *
+ * LICENSE: See the COPYING file included in this distribution.
+ *
+ * @package OpenID
+ * @author JanRain, Inc. <openid@janrain.com>
+ * @copyright 2005-2008 Janrain, Inc.
+ * @license http://www.apache.org/licenses/LICENSE-2.0 Apache
+ */
+
+require_once 'Auth/OpenID/Discover.php';
+
+/**
+ * A regular expression that matches a domain ending in a top-level domains.
+ * Used in checking trust roots for sanity.
+ *
+ * @access private
+ */
+define('Auth_OpenID___TLDs',
+ '/\.(ac|ad|ae|aero|af|ag|ai|al|am|an|ao|aq|ar|arpa|as|asia' .
+ '|at|au|aw|ax|az|ba|bb|bd|be|bf|bg|bh|bi|biz|bj|bm|bn|bo|br' .
+ '|bs|bt|bv|bw|by|bz|ca|cat|cc|cd|cf|cg|ch|ci|ck|cl|cm|cn|co' .
+ '|com|coop|cr|cu|cv|cx|cy|cz|de|dj|dk|dm|do|dz|ec|edu|ee|eg' .
+ '|er|es|et|eu|fi|fj|fk|fm|fo|fr|ga|gb|gd|ge|gf|gg|gh|gi|gl' .
+ '|gm|gn|gov|gp|gq|gr|gs|gt|gu|gw|gy|hk|hm|hn|hr|ht|hu|id|ie' .
+ '|il|im|in|info|int|io|iq|ir|is|it|je|jm|jo|jobs|jp|ke|kg|kh' .
+ '|ki|km|kn|kp|kr|kw|ky|kz|la|lb|lc|li|lk|lr|ls|lt|lu|lv|ly' .
+ '|ma|mc|md|me|mg|mh|mil|mk|ml|mm|mn|mo|mobi|mp|mq|mr|ms|mt' .
+ '|mu|museum|mv|mw|mx|my|mz|na|name|nc|ne|net|nf|ng|ni|nl|no' .
+ '|np|nr|nu|nz|om|org|pa|pe|pf|pg|ph|pk|pl|pm|pn|pr|pro|ps|pt' .
+ '|pw|py|qa|re|ro|rs|ru|rw|sa|sb|sc|sd|se|sg|sh|si|sj|sk|sl' .
+ '|sm|sn|so|sr|st|su|sv|sy|sz|tc|td|tel|tf|tg|th|tj|tk|tl|tm' .
+ '|tn|to|tp|tr|travel|tt|tv|tw|tz|ua|ug|uk|us|uy|uz|va|vc|ve' .
+ '|vg|vi|vn|vu|wf|ws|xn--0zwm56d|xn--11b5bs3a9aj6g' .
+ '|xn--80akhbyknj4f|xn--9t4b11yi5a|xn--deba0ad|xn--g6w251d' .
+ '|xn--hgbk6aj7f53bba|xn--hlcj6aya9esc7a|xn--jxalpdlp' .
+ '|xn--kgbechtv|xn--zckzah|ye|yt|yu|za|zm|zw)\.?$/');
+
+define('Auth_OpenID___HostSegmentRe',
+ "/^(?:[-a-zA-Z0-9!$&'\\(\\)\\*+,;=._~]|%[a-zA-Z0-9]{2})*$/");
+
+/**
+ * A wrapper for trust-root related functions
+ */
+class Auth_OpenID_TrustRoot {
+ /*
+ * Return a discovery URL for this realm.
+ *
+ * Return null if the realm could not be parsed or was not valid.
+ *
+ * @param return_to The relying party return URL of the OpenID
+ * authentication request
+ *
+ * @return The URL upon which relying party discovery should be
+ * run in order to verify the return_to URL
+ */
+ static function buildDiscoveryURL($realm)
+ {
+ $parsed = Auth_OpenID_TrustRoot::_parse($realm);
+
+ if ($parsed === false) {
+ return false;
+ }
+
+ if ($parsed['wildcard']) {
+ // Use "www." in place of the star
+ if ($parsed['host'][0] != '.') {
+ return false;
+ }
+
+ $www_domain = 'www' . $parsed['host'];
+
+ return sprintf('%s://%s%s', $parsed['scheme'],
+ $www_domain, $parsed['path']);
+ } else {
+ return $parsed['unparsed'];
+ }
+ }
+
+ /**
+ * Parse a URL into its trust_root parts.
+ *
+ * @static
+ *
+ * @access private
+ *
+ * @param string $trust_root The url to parse
+ *
+ * @return mixed $parsed Either an associative array of trust root
+ * parts or false if parsing failed.
+ */
+ static function _parse($trust_root)
+ {
+ $trust_root = Auth_OpenID_urinorm($trust_root);
+ if ($trust_root === null) {
+ return false;
+ }
+
+ if (preg_match("/:\/\/[^:]+(:\d+){2,}(\/|$)/", $trust_root)) {
+ return false;
+ }
+
+ $parts = @parse_url($trust_root);
+ if ($parts === false) {
+ return false;
+ }
+
+ $required_parts = array('scheme', 'host');
+ $forbidden_parts = array('user', 'pass', 'fragment');
+ $keys = array_keys($parts);
+ if (array_intersect($keys, $required_parts) != $required_parts) {
+ return false;
+ }
+
+ if (array_intersect($keys, $forbidden_parts) != array()) {
+ return false;
+ }
+
+ if (!preg_match(Auth_OpenID___HostSegmentRe, $parts['host'])) {
+ return false;
+ }
+
+ $scheme = strtolower($parts['scheme']);
+ $allowed_schemes = array('http', 'https');
+ if (!in_array($scheme, $allowed_schemes)) {
+ return false;
+ }
+ $parts['scheme'] = $scheme;
+
+ $host = strtolower($parts['host']);
+ $hostparts = explode('*', $host);
+ switch (count($hostparts)) {
+ case 1:
+ $parts['wildcard'] = false;
+ break;
+ case 2:
+ if ($hostparts[0] ||
+ ($hostparts[1] && substr($hostparts[1], 0, 1) != '.')) {
+ return false;
+ }
+ $host = $hostparts[1];
+ $parts['wildcard'] = true;
+ break;
+ default:
+ return false;
+ }
+ if (strpos($host, ':') !== false) {
+ return false;
+ }
+
+ $parts['host'] = $host;
+
+ if (isset($parts['path'])) {
+ $path = strtolower($parts['path']);
+ if (substr($path, 0, 1) != '/') {
+ return false;
+ }
+ } else {
+ $path = '/';
+ }
+
+ $parts['path'] = $path;
+ if (!isset($parts['port'])) {
+ $parts['port'] = false;
+ }
+
+
+ $parts['unparsed'] = $trust_root;
+
+ return $parts;
+ }
+
+ /**
+ * Is this trust root sane?
+ *
+ * A trust root is sane if it is syntactically valid and it has a
+ * reasonable domain name. Specifically, the domain name must be
+ * more than one level below a standard TLD or more than two
+ * levels below a two-letter tld.
+ *
+ * For example, '*.com' is not a sane trust root, but '*.foo.com'
+ * is. '*.co.uk' is not sane, but '*.bbc.co.uk' is.
+ *
+ * This check is not always correct, but it attempts to err on the
+ * side of marking sane trust roots insane instead of marking
+ * insane trust roots sane. For example, 'kink.fm' is marked as
+ * insane even though it "should" (for some meaning of should) be
+ * marked sane.
+ *
+ * This function should be used when creating OpenID servers to
+ * alert the users of the server when a consumer attempts to get
+ * the user to accept a suspicious trust root.
+ *
+ * @static
+ * @param string $trust_root The trust root to check
+ * @return bool $sanity Whether the trust root looks OK
+ */
+ static function isSane($trust_root)
+ {
+ $parts = Auth_OpenID_TrustRoot::_parse($trust_root);
+ if ($parts === false) {
+ return false;
+ }
+
+ // Localhost is a special case
+ if ($parts['host'] == 'localhost') {
+ return true;
+ }
+
+ $host_parts = explode('.', $parts['host']);
+ if ($parts['wildcard']) {
+ // Remove the empty string from the beginning of the array
+ array_shift($host_parts);
+ }
+
+ if ($host_parts && !$host_parts[count($host_parts) - 1]) {
+ array_pop($host_parts);
+ }
+
+ if (!$host_parts) {
+ return false;
+ }
+
+ // Don't allow adjacent dots
+ if (in_array('', $host_parts, true)) {
+ return false;
+ }
+
+ // Get the top-level domain of the host. If it is not a valid TLD,
+ // it's not sane.
+ preg_match(Auth_OpenID___TLDs, $parts['host'], $matches);
+ if (!$matches) {
+ return false;
+ }
+ $tld = $matches[1];
+
+ if (count($host_parts) == 1) {
+ return false;
+ }
+
+ if ($parts['wildcard']) {
+ // It's a 2-letter tld with a short second to last segment
+ // so there needs to be more than two segments specified
+ // (e.g. *.co.uk is insane)
+ $second_level = $host_parts[count($host_parts) - 2];
+ if (strlen($tld) == 2 && strlen($second_level) <= 3) {
+ return count($host_parts) > 2;
+ }
+ }
+
+ return true;
+ }
+
+ /**
+ * Does this URL match the given trust root?
+ *
+ * Return whether the URL falls under the given trust root. This
+ * does not check whether the trust root is sane. If the URL or
+ * trust root do not parse, this function will return false.
+ *
+ * @param string $trust_root The trust root to match against
+ *
+ * @param string $url The URL to check
+ *
+ * @return bool $matches Whether the URL matches against the
+ * trust root
+ */
+ static function match($trust_root, $url)
+ {
+ $trust_root_parsed = Auth_OpenID_TrustRoot::_parse($trust_root);
+ $url_parsed = Auth_OpenID_TrustRoot::_parse($url);
+ if (!$trust_root_parsed || !$url_parsed) {
+ return false;
+ }
+
+ // Check hosts matching
+ if ($url_parsed['wildcard']) {
+ return false;
+ }
+ if ($trust_root_parsed['wildcard']) {
+ $host_tail = $trust_root_parsed['host'];
+ $host = $url_parsed['host'];
+ if ($host_tail &&
+ substr($host, -(strlen($host_tail))) != $host_tail &&
+ substr($host_tail, 1) != $host) {
+ return false;
+ }
+ } else {
+ if ($trust_root_parsed['host'] != $url_parsed['host']) {
+ return false;
+ }
+ }
+
+ // Check path and query matching
+ $base_path = $trust_root_parsed['path'];
+ $path = $url_parsed['path'];
+ if (!isset($trust_root_parsed['query'])) {
+ if ($base_path != $path) {
+ if (substr($path, 0, strlen($base_path)) != $base_path) {
+ return false;
+ }
+ if (substr($base_path, strlen($base_path) - 1, 1) != '/' &&
+ substr($path, strlen($base_path), 1) != '/') {
+ return false;
+ }
+ }
+ } else {
+ $base_query = $trust_root_parsed['query'];
+ $query = @$url_parsed['query'];
+ $qplus = substr($query, 0, strlen($base_query) + 1);
+ $bqplus = $base_query . '&';
+ if ($base_path != $path ||
+ ($base_query != $query && $qplus != $bqplus)) {
+ return false;
+ }
+ }
+
+ // The port and scheme need to match exactly
+ return ($trust_root_parsed['scheme'] == $url_parsed['scheme'] &&
+ $url_parsed['port'] === $trust_root_parsed['port']);
+ }
+}
+
+/*
+ * If the endpoint is a relying party OpenID return_to endpoint,
+ * return the endpoint URL. Otherwise, return None.
+ *
+ * This function is intended to be used as a filter for the Yadis
+ * filtering interface.
+ *
+ * @see: C{L{openid.yadis.services}}
+ * @see: C{L{openid.yadis.filters}}
+ *
+ * @param endpoint: An XRDS BasicServiceEndpoint, as returned by
+ * performing Yadis dicovery.
+ *
+ * @returns: The endpoint URL or None if the endpoint is not a
+ * relying party endpoint.
+ */
+function filter_extractReturnURL($endpoint)
+{
+ if ($endpoint->matchTypes(array(Auth_OpenID_RP_RETURN_TO_URL_TYPE))) {
+ return $endpoint;
+ } else {
+ return null;
+ }
+}
+
+function &Auth_OpenID_extractReturnURL(&$endpoint_list)
+{
+ $result = array();
+
+ foreach ($endpoint_list as $endpoint) {
+ if (filter_extractReturnURL($endpoint)) {
+ $result[] = $endpoint;
+ }
+ }
+
+ return $result;
+}
+
+/*
+ * Is the return_to URL under one of the supplied allowed return_to
+ * URLs?
+ */
+function Auth_OpenID_returnToMatches($allowed_return_to_urls, $return_to)
+{
+ foreach ($allowed_return_to_urls as $allowed_return_to) {
+ // A return_to pattern works the same as a realm, except that
+ // it's not allowed to use a wildcard. We'll model this by
+ // parsing it as a realm, and not trying to match it if it has
+ // a wildcard.
+
+ $return_realm = Auth_OpenID_TrustRoot::_parse($allowed_return_to);
+ if (// Parses as a trust root
+ ($return_realm !== false) &&
+ // Does not have a wildcard
+ (!$return_realm['wildcard']) &&
+ // Matches the return_to that we passed in with it
+ (Auth_OpenID_TrustRoot::match($allowed_return_to, $return_to))) {
+ return true;
+ }
+ }
+
+ // No URL in the list matched
+ return false;
+}
+
+/*
+ * Given a relying party discovery URL return a list of return_to
+ * URLs.
+ */
+function Auth_OpenID_getAllowedReturnURLs($relying_party_url, $fetcher,
+ $discover_function=null)
+{
+ if ($discover_function === null) {
+ $discover_function = array('Auth_Yadis_Yadis', 'discover');
+ }
+
+ $xrds_parse_cb = array('Auth_OpenID_ServiceEndpoint', 'consumerFromXRDS');
+
+ list($rp_url_after_redirects, $endpoints) =
+ Auth_Yadis_getServiceEndpoints($relying_party_url, $xrds_parse_cb,
+ $discover_function, $fetcher);
+
+ if ($rp_url_after_redirects != $relying_party_url) {
+ // Verification caused a redirect
+ return false;
+ }
+
+ call_user_func_array($discover_function,
+ array($relying_party_url, $fetcher));
+
+ $return_to_urls = array();
+ $matching_endpoints = Auth_OpenID_extractReturnURL($endpoints);
+
+ foreach ($matching_endpoints as $e) {
+ $return_to_urls[] = $e->server_url;
+ }
+
+ return $return_to_urls;
+}
+
+/*
+ * Verify that a return_to URL is valid for the given realm.
+ *
+ * This function builds a discovery URL, performs Yadis discovery on
+ * it, makes sure that the URL does not redirect, parses out the
+ * return_to URLs, and finally checks to see if the current return_to
+ * URL matches the return_to.
+ *
+ * @return true if the return_to URL is valid for the realm
+ */
+function Auth_OpenID_verifyReturnTo($realm_str, $return_to, $fetcher,
+ $_vrfy='Auth_OpenID_getAllowedReturnURLs')
+{
+ $disco_url = Auth_OpenID_TrustRoot::buildDiscoveryURL($realm_str);
+
+ if ($disco_url === false) {
+ return false;
+ }
+
+ $allowable_urls = call_user_func_array($_vrfy,
+ array($disco_url, $fetcher));
+
+ // The realm_str could not be parsed.
+ if ($allowable_urls === false) {
+ return false;
+ }
+
+ if (Auth_OpenID_returnToMatches($allowable_urls, $return_to)) {
+ return true;
+ } else {
+ return false;
+ }
+}
+
+
--- /dev/null
+++ b/lib/openid-php/Auth/Yadis/Manager.php
@@ -1,1 +1,522 @@
-
+<?php
+
+/**
+ * Yadis service manager to be used during yadis-driven authentication
+ * attempts.
+ *
+ * @package OpenID
+ */
+
+/**
+ * The base session class used by the Auth_Yadis_Manager. This
+ * class wraps the default PHP session machinery and should be
+ * subclassed if your application doesn't use PHP sessioning.
+ *
+ * @package OpenID
+ */
+class Auth_Yadis_PHPSession {
+ /**
+ * Set a session key/value pair.
+ *
+ * @param string $name The name of the session key to add.
+ * @param string $value The value to add to the session.
+ */
+ function set($name, $value)
+ {
+ $_SESSION[$name] = $value;
+ }
+
+ /**
+ * Get a key's value from the session.
+ *
+ * @param string $name The name of the key to retrieve.
+ * @param string $default The optional value to return if the key
+ * is not found in the session.
+ * @return string $result The key's value in the session or
+ * $default if it isn't found.
+ */
+ function get($name, $default=null)
+ {
+ if (array_key_exists($name, $_SESSION)) {
+ return $_SESSION[$name];
+ } else {
+ return $default;
+ }
+ }
+
+ /**
+ * Remove a key/value pair from the session.
+ *
+ * @param string $name The name of the key to remove.
+ */
+ function del($name)
+ {
+ unset($_SESSION[$name]);
+ }
+
+ /**
+ * Return the contents of the session in array form.
+ */
+ function contents()
+ {
+ return $_SESSION;
+ }
+}
+
+/**
+ * A session helper class designed to translate between arrays and
+ * objects. Note that the class used must have a constructor that
+ * takes no parameters. This is not a general solution, but it works
+ * for dumb objects that just need to have attributes set. The idea
+ * is that you'll subclass this and override $this->check($data) ->
+ * bool to implement your own session data validation.
+ *
+ * @package OpenID
+ */
+class Auth_Yadis_SessionLoader {
+ /**
+ * Override this.
+ *
+ * @access private
+ */
+ function check($data)
+ {
+ return true;
+ }
+
+ /**
+ * Given a session data value (an array), this creates an object
+ * (returned by $this->newObject()) whose attributes and values
+ * are those in $data. Returns null if $data lacks keys found in
+ * $this->requiredKeys(). Returns null if $this->check($data)
+ * evaluates to false. Returns null if $this->newObject()
+ * evaluates to false.
+ *
+ * @access private
+ */
+ function fromSession($data)
+ {
+ if (!$data) {
+ return null;
+ }
+
+ $required = $this->requiredKeys();
+
+ foreach ($required as $k) {
+ if (!array_key_exists($k, $data)) {
+ return null;
+ }
+ }
+
+ if (!$this->check($data)) {
+ return null;
+ }
+
+ $data = array_merge($data, $this->prepareForLoad($data));
+ $obj = $this->newObject($data);
+
+ if (!$obj) {
+ return null;
+ }
+
+ foreach ($required as $k) {
+ $obj->$k = $data[$k];
+ }
+
+ return $obj;
+ }
+
+ /**
+ * Prepares the data array by making any necessary changes.
+ * Returns an array whose keys and values will be used to update
+ * the original data array before calling $this->newObject($data).
+ *
+ * @access private
+ */
+ function prepareForLoad($data)
+ {
+ return array();
+ }
+
+ /**
+ * Returns a new instance of this loader's class, using the
+ * session data to construct it if necessary. The object need
+ * only be created; $this->fromSession() will take care of setting
+ * the object's attributes.
+ *
+ * @access private
+ */
+ function newObject($data)
+ {
+ return null;
+ }
+
+ /**
+ * Returns an array of keys and values built from the attributes
+ * of $obj. If $this->prepareForSave($obj) returns an array, its keys
+ * and values are used to update the $data array of attributes
+ * from $obj.
+ *
+ * @access private
+ */
+ function toSession($obj)
+ {
+ $data = array();
+ foreach ($obj as $k => $v) {
+ $data[$k] = $v;
+ }
+
+ $extra = $this->prepareForSave($obj);
+
+ if ($extra && is_array($extra)) {
+ foreach ($extra as $k => $v) {
+ $data[$k] = $v;
+ }
+ }
+
+ return $data;
+ }
+
+ /**
+ * Override this.
+ *
+ * @access private
+ */
+ function prepareForSave($obj)
+ {
+ return array();
+ }
+}
+
+/**
+ * A concrete loader implementation for Auth_OpenID_ServiceEndpoints.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_ServiceEndpointLoader extends Auth_Yadis_SessionLoader {
+ function newObject($data)
+ {
+ return new Auth_OpenID_ServiceEndpoint();
+ }
+
+ function requiredKeys()
+ {
+ $obj = new Auth_OpenID_ServiceEndpoint();
+ $data = array();
+ foreach ($obj as $k => $v) {
+ $data[] = $k;
+ }
+ return $data;
+ }
+
+ function check($data)
+ {
+ return is_array($data['type_uris']);
+ }
+}
+
+/**
+ * A concrete loader implementation for Auth_Yadis_Managers.
+ *
+ * @package OpenID
+ */
+class Auth_Yadis_ManagerLoader extends Auth_Yadis_SessionLoader {
+ function requiredKeys()
+ {
+ return array('starting_url',
+ 'yadis_url',
+ 'services',
+ 'session_key',
+ '_current',
+ 'stale');
+ }
+
+ function newObject($data)
+ {
+ return new Auth_Yadis_Manager($data['starting_url'],
+ $data['yadis_url'],
+ $data['services'],
+ $data['session_key']);
+ }
+
+ function check($data)
+ {
+ return is_array($data['services']);
+ }
+
+ function prepareForLoad($data)
+ {
+ $loader = new Auth_OpenID_ServiceEndpointLoader();
+ $services = array();
+ foreach ($data['services'] as $s) {
+ $services[] = $loader->fromSession($s);
+ }
+ return array('services' => $services);
+ }
+
+ function prepareForSave($obj)
+ {
+ $loader = new Auth_OpenID_ServiceEndpointLoader();
+ $services = array();
+ foreach ($obj->services as $s) {
+ $services[] = $loader->toSession($s);
+ }
+ return array('services' => $services);
+ }
+}
+
+/**
+ * The Yadis service manager which stores state in a session and
+ * iterates over <Service> elements in a Yadis XRDS document and lets
+ * a caller attempt to use each one. This is used by the Yadis
+ * library internally.
+ *
+ * @package OpenID
+ */
+class Auth_Yadis_Manager {
+
+ /**
+ * Intialize a new yadis service manager.
+ *
+ * @access private
+ */
+ function Auth_Yadis_Manager($starting_url, $yadis_url,
+ $services, $session_key)
+ {
+ // The URL that was used to initiate the Yadis protocol
+ $this->starting_url = $starting_url;
+
+ // The URL after following redirects (the identifier)
+ $this->yadis_url = $yadis_url;
+
+ // List of service elements
+ $this->services = $services;
+
+ $this->session_key = $session_key;
+
+ // Reference to the current service object
+ $this->_current = null;
+
+ // Stale flag for cleanup if PHP lib has trouble.
+ $this->stale = false;
+ }
+
+ /**
+ * @access private
+ */
+ function length()
+ {
+ // How many untried services remain?
+ return count($this->services);
+ }
+
+ /**
+ * Return the next service
+ *
+ * $this->current() will continue to return that service until the
+ * next call to this method.
+ */
+ function nextService()
+ {
+
+ if ($this->services) {
+ $this->_current = array_shift($this->services);
+ } else {
+ $this->_current = null;
+ }
+
+ return $this->_current;
+ }
+
+ /**
+ * @access private
+ */
+ function current()
+ {
+ // Return the current service.
+ // Returns None if there are no services left.
+ return $this->_current;
+ }
+
+ /**
+ * @access private
+ */
+ function forURL($url)
+ {
+ return in_array($url, array($this->starting_url, $this->yadis_url));
+ }
+
+ /**
+ * @access private
+ */
+ function started()
+ {
+ // Has the first service been returned?
+ return $this->_current !== null;
+ }
+}
+
+/**
+ * State management for discovery.
+ *
+ * High-level usage pattern is to call .getNextService(discover) in
+ * order to find the next available service for this user for this
+ * session. Once a request completes, call .cleanup() to clean up the
+ * session state.
+ *
+ * @package OpenID
+ */
+class Auth_Yadis_Discovery {
+
+ /**
+ * @access private
+ */
+ var $DEFAULT_SUFFIX = 'auth';
+
+ /**
+ * @access private
+ */
+ var $PREFIX = '_yadis_services_';
+
+ /**
+ * Initialize a discovery object.
+ *
+ * @param Auth_Yadis_PHPSession $session An object which
+ * implements the Auth_Yadis_PHPSession API.
+ * @param string $url The URL on which to attempt discovery.
+ * @param string $session_key_suffix The optional session key
+ * suffix override.
+ */
+ function Auth_Yadis_Discovery($session, $url,
+ $session_key_suffix = null)
+ {
+ /// Initialize a discovery object
+ $this->session = $session;
+ $this->url = $url;
+ if ($session_key_suffix === null) {
+ $session_key_suffix = $this->DEFAULT_SUFFIX;
+ }
+
+ $this->session_key_suffix = $session_key_suffix;
+ $this->session_key = $this->PREFIX . $this->session_key_suffix;
+ }
+
+ /**
+ * Return the next authentication service for the pair of
+ * user_input and session. This function handles fallback.
+ */
+ function getNextService($discover_cb, $fetcher)
+ {
+ $manager = $this->getManager();
+ if (!$manager || (!$manager->services)) {
+ $this->destroyManager();
+
+ list($yadis_url, $services) = call_user_func($discover_cb,
+ $this->url,
+ $fetcher);
+
+ $manager = $this->createManager($services, $yadis_url);
+ }
+
+ if ($manager) {
+ $loader = new Auth_Yadis_ManagerLoader();
+ $service = $manager->nextService();
+ $this->session->set($this->session_key,
+ serialize($loader->toSession($manager)));
+ } else {
+ $service = null;
+ }
+
+ return $service;
+ }
+
+ /**
+ * Clean up Yadis-related services in the session and return the
+ * most-recently-attempted service from the manager, if one
+ * exists.
+ *
+ * @param $force True if the manager should be deleted regardless
+ * of whether it's a manager for $this->url.
+ */
+ function cleanup($force=false)
+ {
+ $manager = $this->getManager($force);
+ if ($manager) {
+ $service = $manager->current();
+ $this->destroyManager($force);
+ } else {
+ $service = null;
+ }
+
+ return $service;
+ }
+
+ /**
+ * @access private
+ */
+ function getSessionKey()
+ {
+ // Get the session key for this starting URL and suffix
+ return $this->PREFIX . $this->session_key_suffix;
+ }
+
+ /**
+ * @access private
+ *
+ * @param $force True if the manager should be returned regardless
+ * of whether it's a manager for $this->url.
+ */
+ function getManager($force=false)
+ {
+ // Extract the YadisServiceManager for this object's URL and
+ // suffix from the session.
+
+ $manager_str = $this->session->get($this->getSessionKey());
+ $manager = null;
+
+ if ($manager_str !== null) {
+ $loader = new Auth_Yadis_ManagerLoader();
+ $manager = $loader->fromSession(unserialize($manager_str));
+ }
+
+ if ($manager && ($manager->forURL($this->url) || $force)) {
+ return $manager;
+ }
+ }
+
+ /**
+ * @access private
+ */
+ function createManager($services, $yadis_url = null)
+ {
+ $key = $this->getSessionKey();
+ if ($this->getManager()) {
+ return $this->getManager();
+ }
+
+ if ($services) {
+ $loader = new Auth_Yadis_ManagerLoader();
+ $manager = new Auth_Yadis_Manager($this->url, $yadis_url,
+ $services, $key);
+ $this->session->set($this->session_key,
+ serialize($loader->toSession($manager)));
+ return $manager;
+ }
+ }
+
+ /**
+ * @access private
+ *
+ * @param $force True if the manager should be deleted regardless
+ * of whether it's a manager for $this->url.
+ */
+ function destroyManager($force=false)
+ {
+ if ($this->getManager($force) !== null) {
+ $key = $this->getSessionKey();
+ $this->session->del($key);
+ }
+ }
+}
+
+
--- /dev/null
+++ b/lib/openid-php/Auth/Yadis/XRDS.php
@@ -1,1 +1,479 @@
-
+<?php
+
+/**
+ * This module contains the XRDS parsing code.
+ *
+ * PHP versions 4 and 5
+ *
+ * LICENSE: See the COPYING file included in this distribution.
+ *
+ * @package OpenID
+ * @author JanRain, Inc. <openid@janrain.com>
+ * @copyright 2005-2008 Janrain, Inc.
+ * @license http://www.apache.org/licenses/LICENSE-2.0 Apache
+ */
+
+/**
+ * Require the XPath implementation.
+ */
+require_once 'Auth/Yadis/XML.php';
+
+/**
+ * This match mode means a given service must match ALL filters passed
+ * to the Auth_Yadis_XRDS::services() call.
+ */
+define('SERVICES_YADIS_MATCH_ALL', 101);
+
+/**
+ * This match mode means a given service must match ANY filters (at
+ * least one) passed to the Auth_Yadis_XRDS::services() call.
+ */
+define('SERVICES_YADIS_MATCH_ANY', 102);
+
+/**
+ * The priority value used for service elements with no priority
+ * specified.
+ */
+define('SERVICES_YADIS_MAX_PRIORITY', pow(2, 30));
+
+/**
+ * XRD XML namespace
+ */
+define('Auth_Yadis_XMLNS_XRD_2_0', 'xri://$xrd*($v*2.0)');
+
+/**
+ * XRDS XML namespace
+ */
+define('Auth_Yadis_XMLNS_XRDS', 'xri://$xrds');
+
+function Auth_Yadis_getNSMap()
+{
+ return array('xrds' => Auth_Yadis_XMLNS_XRDS,
+ 'xrd' => Auth_Yadis_XMLNS_XRD_2_0);
+}
+
+/**
+ * @access private
+ */
+function Auth_Yadis_array_scramble($arr)
+{
+ $result = array();
+
+ while (count($arr)) {
+ $index = array_rand($arr, 1);
+ $result[] = $arr[$index];
+ unset($arr[$index]);
+ }
+
+ return $result;
+}
+
+/**
+ * This class represents a <Service> element in an XRDS document.
+ * Objects of this type are returned by
+ * Auth_Yadis_XRDS::services() and
+ * Auth_Yadis_Yadis::services(). Each object corresponds directly
+ * to a <Service> element in the XRDS and supplies a
+ * getElements($name) method which you should use to inspect the
+ * element's contents. See {@link Auth_Yadis_Yadis} for more
+ * information on the role this class plays in Yadis discovery.
+ *
+ * @package OpenID
+ */
+class Auth_Yadis_Service {
+
+ /**
+ * Creates an empty service object.
+ */
+ function Auth_Yadis_Service()
+ {
+ $this->element = null;
+ $this->parser = null;
+ }
+
+ /**
+ * Return the URIs in the "Type" elements, if any, of this Service
+ * element.
+ *
+ * @return array $type_uris An array of Type URI strings.
+ */
+ function getTypes()
+ {
+ $t = array();
+ foreach ($this->getElements('xrd:Type') as $elem) {
+ $c = $this->parser->content($elem);
+ if ($c) {
+ $t[] = $c;
+ }
+ }
+ return $t;
+ }
+
+ function matchTypes($type_uris)
+ {
+ $result = array();
+
+ foreach ($this->getTypes() as $typ) {
+ if (in_array($typ, $type_uris)) {
+ $result[] = $typ;
+ }
+ }
+
+ return $result;
+ }
+
+ /**
+ * Return the URIs in the "URI" elements, if any, of this Service
+ * element. The URIs are returned sorted in priority order.
+ *
+ * @return array $uris An array of URI strings.
+ */
+ function getURIs()
+ {
+ $uris = array();
+ $last = array();
+
+ foreach ($this->getElements('xrd:URI') as $elem) {
+ $uri_string = $this->parser->content($elem);
+ $attrs = $this->parser->attributes($elem);
+ if ($attrs &&
+ array_key_exists('priority', $attrs)) {
+ $priority = intval($attrs['priority']);
+ if (!array_key_exists($priority, $uris)) {
+ $uris[$priority] = array();
+ }
+
+ $uris[$priority][] = $uri_string;
+ } else {
+ $last[] = $uri_string;
+ }
+ }
+
+ $keys = array_keys($uris);
+ sort($keys);
+
+ // Rebuild array of URIs.
+ $result = array();
+ foreach ($keys as $k) {
+ $new_uris = Auth_Yadis_array_scramble($uris[$k]);
+ $result = array_merge($result, $new_uris);
+ }
+
+ $result = array_merge($result,
+ Auth_Yadis_array_scramble($last));
+
+ return $result;
+ }
+
+ /**
+ * Returns the "priority" attribute value of this <Service>
+ * element, if the attribute is present. Returns null if not.
+ *
+ * @return mixed $result Null or integer, depending on whether
+ * this Service element has a 'priority' attribute.
+ */
+ function getPriority()
+ {
+ $attributes = $this->parser->attributes($this->element);
+
+ if (array_key_exists('priority', $attributes)) {
+ return intval($attributes['priority']);
+ }
+
+ return null;
+ }
+
+ /**
+ * Used to get XML elements from this object's <Service> element.
+ *
+ * This is what you should use to get all custom information out
+ * of this element. This is used by service filter functions to
+ * determine whether a service element contains specific tags,
+ * etc. NOTE: this only considers elements which are direct
+ * children of the <Service> element for this object.
+ *
+ * @param string $name The name of the element to look for
+ * @return array $list An array of elements with the specified
+ * name which are direct children of the <Service> element. The
+ * nodes returned by this function can be passed to $this->parser
+ * methods (see {@link Auth_Yadis_XMLParser}).
+ */
+ function getElements($name)
+ {
+ return $this->parser->evalXPath($name, $this->element);
+ }
+}
+
+/*
+ * Return the expiration date of this XRD element, or None if no
+ * expiration was specified.
+ *
+ * @param $default The value to use as the expiration if no expiration
+ * was specified in the XRD.
+ */
+function Auth_Yadis_getXRDExpiration($xrd_element, $default=null)
+{
+ $expires_element = $xrd_element->$parser->evalXPath('/xrd:Expires');
+ if ($expires_element === null) {
+ return $default;
+ } else {
+ $expires_string = $expires_element->text;
+
+ // Will raise ValueError if the string is not the expected
+ // format
+ $t = strptime($expires_string, "%Y-%m-%dT%H:%M:%SZ");
+
+ if ($t === false) {
+ return false;
+ }
+
+ // [int $hour [, int $minute [, int $second [,
+ // int $month [, int $day [, int $year ]]]]]]
+ return mktime($t['tm_hour'], $t['tm_min'], $t['tm_sec'],
+ $t['tm_mon'], $t['tm_day'], $t['tm_year']);
+ }
+}
+
+/**
+ * This class performs parsing of XRDS documents.
+ *
+ * You should not instantiate this class directly; rather, call
+ * parseXRDS statically:
+ *
+ * <pre> $xrds = Auth_Yadis_XRDS::parseXRDS($xml_string);</pre>
+ *
+ * If the XRDS can be parsed and is valid, an instance of
+ * Auth_Yadis_XRDS will be returned. Otherwise, null will be
+ * returned. This class is used by the Auth_Yadis_Yadis::discover
+ * method.
+ *
+ * @package OpenID
+ */
+class Auth_Yadis_XRDS {
+
+ /**
+ * Instantiate a Auth_Yadis_XRDS object. Requires an XPath
+ * instance which has been used to parse a valid XRDS document.
+ */
+ function Auth_Yadis_XRDS($xmlParser, $xrdNodes)
+ {
+ $this->parser = $xmlParser;
+ $this->xrdNode = $xrdNodes[count($xrdNodes) - 1];
+ $this->allXrdNodes = $xrdNodes;
+ $this->serviceList = array();
+ $this->_parse();
+ }
+
+ /**
+ * Parse an XML string (XRDS document) and return either a
+ * Auth_Yadis_XRDS object or null, depending on whether the
+ * XRDS XML is valid.
+ *
+ * @param string $xml_string An XRDS XML string.
+ * @return mixed $xrds An instance of Auth_Yadis_XRDS or null,
+ * depending on the validity of $xml_string
+ */
+ static function parseXRDS($xml_string, $extra_ns_map = null)
+ {
+ $_null = null;
+
+ if (!$xml_string) {
+ return $_null;
+ }
+
+ $parser = Auth_Yadis_getXMLParser();
+
+ $ns_map = Auth_Yadis_getNSMap();
+
+ if ($extra_ns_map && is_array($extra_ns_map)) {
+ $ns_map = array_merge($ns_map, $extra_ns_map);
+ }
+
+ if (!($parser && $parser->init($xml_string, $ns_map))) {
+ return $_null;
+ }
+
+ // Try to get root element.
+ $root = $parser->evalXPath('/xrds:XRDS[1]');
+ if (!$root) {
+ return $_null;
+ }
+
+ if (is_array($root)) {
+ $root = $root[0];
+ }
+
+ $attrs = $parser->attributes($root);
+
+ if (array_key_exists('xmlns:xrd', $attrs) &&
+ $attrs['xmlns:xrd'] != Auth_Yadis_XMLNS_XRDS) {
+ return $_null;
+ } else if (array_key_exists('xmlns', $attrs) &&
+ preg_match('/xri/', $attrs['xmlns']) &&
+ $attrs['xmlns'] != Auth_Yadis_XMLNS_XRD_2_0) {
+ return $_null;
+ }
+
+ // Get the last XRD node.
+ $xrd_nodes = $parser->evalXPath('/xrds:XRDS[1]/xrd:XRD');
+
+ if (!$xrd_nodes) {
+ return $_null;
+ }
+
+ $xrds = new Auth_Yadis_XRDS($parser, $xrd_nodes);
+ return $xrds;
+ }
+
+ /**
+ * @access private
+ */
+ function _addService($priority, $service)
+ {
+ $priority = intval($priority);
+
+ if (!array_key_exists($priority, $this->serviceList)) {
+ $this->serviceList[$priority] = array();
+ }
+
+ $this->serviceList[$priority][] = $service;
+ }
+
+ /**
+ * Creates the service list using nodes from the XRDS XML
+ * document.
+ *
+ * @access private
+ */
+ function _parse()
+ {
+ $this->serviceList = array();
+
+ $services = $this->parser->evalXPath('xrd:Service', $this->xrdNode);
+
+ foreach ($services as $node) {
+ $s = new Auth_Yadis_Service();
+ $s->element = $node;
+ $s->parser = $this->parser;
+
+ $priority = $s->getPriority();
+
+ if ($priority === null) {
+ $priority = SERVICES_YADIS_MAX_PRIORITY;
+ }
+
+ $this->_addService($priority, $s);
+ }
+ }
+
+ /**
+ * Returns a list of service objects which correspond to <Service>
+ * elements in the XRDS XML document for this object.
+ *
+ * Optionally, an array of filter callbacks may be given to limit
+ * the list of returned service objects. Furthermore, the default
+ * mode is to return all service objects which match ANY of the
+ * specified filters, but $filter_mode may be
+ * SERVICES_YADIS_MATCH_ALL if you want to be sure that the
+ * returned services match all the given filters. See {@link
+ * Auth_Yadis_Yadis} for detailed usage information on filter
+ * functions.
+ *
+ * @param mixed $filters An array of callbacks to filter the
+ * returned services, or null if all services are to be returned.
+ * @param integer $filter_mode SERVICES_YADIS_MATCH_ALL or
+ * SERVICES_YADIS_MATCH_ANY, depending on whether the returned
+ * services should match ALL or ANY of the specified filters,
+ * respectively.
+ * @return mixed $services An array of {@link
+ * Auth_Yadis_Service} objects if $filter_mode is a valid
+ * mode; null if $filter_mode is an invalid mode (i.e., not
+ * SERVICES_YADIS_MATCH_ANY or SERVICES_YADIS_MATCH_ALL).
+ */
+ function services($filters = null,
+ $filter_mode = SERVICES_YADIS_MATCH_ANY)
+ {
+
+ $pri_keys = array_keys($this->serviceList);
+ sort($pri_keys, SORT_NUMERIC);
+
+ // If no filters are specified, return the entire service
+ // list, ordered by priority.
+ if (!$filters ||
+ (!is_array($filters))) {
+
+ $result = array();
+ foreach ($pri_keys as $pri) {
+ $result = array_merge($result, $this->serviceList[$pri]);
+ }
+
+ return $result;
+ }
+
+ // If a bad filter mode is specified, return null.
+ if (!in_array($filter_mode, array(SERVICES_YADIS_MATCH_ANY,
+ SERVICES_YADIS_MATCH_ALL))) {
+ return null;
+ }
+
+ // Otherwise, use the callbacks in the filter list to
+ // determine which services are returned.
+ $filtered = array();
+
+ foreach ($pri_keys as $priority_value) {
+ $service_obj_list = $this->serviceList[$priority_value];
+
+ foreach ($service_obj_list as $service) {
+
+ $matches = 0;
+
+ foreach ($filters as $filter) {
+
+ if (call_user_func_array($filter, array($service))) {
+ $matches++;
+
+ if ($filter_mode == SERVICES_YADIS_MATCH_ANY) {
+ $pri = $service->getPriority();
+ if ($pri === null) {
+ $pri = SERVICES_YADIS_MAX_PRIORITY;
+ }
+
+ if (!array_key_exists($pri, $filtered)) {
+ $filtered[$pri] = array();
+ }
+
+ $filtered[$pri][] = $service;
+ break;
+ }
+ }
+ }
+
+ if (($filter_mode == SERVICES_YADIS_MATCH_ALL) &&
+ ($matches == count($filters))) {
+
+ $pri = $service->getPriority();
+ if ($pri === null) {
+ $pri = SERVICES_YADIS_MAX_PRIORITY;
+ }
+
+ if (!array_key_exists($pri, $filtered)) {
+ $filtered[$pri] = array();
+ }
+ $filtered[$pri][] = $service;
+ }
+ }
+ }
+
+ $pri_keys = array_keys($filtered);
+ sort($pri_keys, SORT_NUMERIC);
+
+ $result = array();
+ foreach ($pri_keys as $pri) {
+ $result = array_merge($result, $filtered[$pri]);
+ }
+
+ return $result;
+ }
+}
+
+
--- /dev/null
+++ b/lib/openid.php
@@ -1,1 +1,782 @@
-
+<?php
+/**
+ * This class provides a simple interface for OpenID (1.1 and 2.0) authentication.
+ * Supports Yadis discovery.
+ * The authentication process is stateless/dumb.
+ *
+ * Usage:
+ * Sign-on with OpenID is a two step process:
+ * Step one is authentication with the provider:
+ * <code>
+ * $openid = new LightOpenID('my-host.example.org');
+ * $openid->identity = 'ID supplied by user';
+ * header('Location: ' . $openid->authUrl());
+ * </code>
+ * The provider then sends various parameters via GET, one of them is openid_mode.
+ * Step two is verification:
+ * <code>
+ * if ($this->data['openid_mode']) {
+ * $openid = new LightOpenID('my-host.example.org');
+ * echo $openid->validate() ? 'Logged in.' : 'Failed';
+ * }
+ * </code>
+ *
+ * Change the 'my-host.example.org' to your domain name. Do NOT use $_SERVER['HTTP_HOST']
+ * for that, unless you know what you are doing.
+ *
+ * Optionally, you can set $returnUrl and $realm (or $trustRoot, which is an alias).
+ * The default values for those are:
+ * $openid->realm = (!empty($_SERVER['HTTPS']) ? 'https' : 'http') . '://' . $_SERVER['HTTP_HOST'];
+ * $openid->returnUrl = $openid->realm . $_SERVER['REQUEST_URI'];
+ * If you don't know their meaning, refer to any openid tutorial, or specification. Or just guess.
+ *
+ * AX and SREG extensions are supported.
+ * To use them, specify $openid->required and/or $openid->optional before calling $openid->authUrl().
+ * These are arrays, with values being AX schema paths (the 'path' part of the URL).
+ * For example:
+ * $openid->required = array('namePerson/friendly', 'contact/email');
+ * $openid->optional = array('namePerson/first');
+ * If the server supports only SREG or OpenID 1.1, these are automaticaly
+ * mapped to SREG names, so that user doesn't have to know anything about the server.
+ *
+ * To get the values, use $openid->getAttributes().
+ *
+ *
+ * The library requires PHP >= 5.1.2 with curl or http/https stream wrappers enabled.
+ * @author Mewp
+ * @copyright Copyright (c) 2010, Mewp
+ * @license http://www.opensource.org/licenses/mit-license.php MIT
+ */
+class LightOpenID
+{
+ public $returnUrl
+ , $required = array()
+ , $optional = array()
+ , $verify_peer = null
+ , $capath = null
+ , $cainfo = null
+ , $data;
+ private $identity, $claimed_id;
+ protected $server, $version, $trustRoot, $aliases, $identifier_select = false
+ , $ax = false, $sreg = false, $setup_url = null;
+ static protected $ax_to_sreg = array(
+ 'namePerson/friendly' => 'nickname',
+ 'contact/email' => 'email',
+ 'namePerson' => 'fullname',
+ 'birthDate' => 'dob',
+ 'person/gender' => 'gender',
+ 'contact/postalCode/home' => 'postcode',
+ 'contact/country/home' => 'country',
+ 'pref/language' => 'language',
+ 'pref/timezone' => 'timezone',
+ );
+
+ function __construct($host)
+ {
+ $this->trustRoot = (strpos($host, '://') ? $host : 'http://' . $host);
+ if ((!empty($_SERVER['HTTPS']) && $_SERVER['HTTPS'] != 'off')
+ || (isset($_SERVER['HTTP_X_FORWARDED_PROTO'])
+ && $_SERVER['HTTP_X_FORWARDED_PROTO'] == 'https')
+ ) {
+ $this->trustRoot = (strpos($host, '://') ? $host : 'https://' . $host);
+ }
+
+ if(($host_end = strpos($this->trustRoot, '/', 8)) !== false) {
+ $this->trustRoot = substr($this->trustRoot, 0, $host_end);
+ }
+
+ $uri = rtrim(preg_replace('#((?<=\?)|&)openid\.[^&]+#', '', $_SERVER['REQUEST_URI']), '?');
+ $this->returnUrl = $this->trustRoot . $uri;
+
+ $this->data = ($_SERVER['REQUEST_METHOD'] === 'POST') ? $_POST : $_GET;
+
+ if(!function_exists('curl_init') && !in_array('https', stream_get_wrappers())) {
+ throw new ErrorException('You must have either https wrappers or curl enabled.');
+ }
+ }
+
+ function __set($name, $value)
+ {
+ switch ($name) {
+ case 'identity':
+ if (strlen($value = trim((String) $value))) {
+ if (preg_match('#^xri:/*#i', $value, $m)) {
+ $value = substr($value, strlen($m[0]));
+ } elseif (!preg_match('/^(?:[=@+\$!\(]|https?:)/i', $value)) {
+ $value = "http://$value";
+ }
+ if (preg_match('#^https?://[^/]+$#i', $value, $m)) {
+ $value .= '/';
+ }
+ }
+ $this->$name = $this->claimed_id = $value;
+ break;
+ case 'trustRoot':
+ case 'realm':
+ $this->trustRoot = trim($value);
+ }
+ }
+
+ function __get($name)
+ {
+ switch ($name) {
+ case 'identity':
+ # We return claimed_id instead of identity,
+ # because the developer should see the claimed identifier,
+ # i.e. what he set as identity, not the op-local identifier (which is what we verify)
+ return $this->claimed_id;
+ case 'trustRoot':
+ case 'realm':
+ return $this->trustRoot;
+ case 'mode':
+ return empty($this->data['openid_mode']) ? null : $this->data['openid_mode'];
+ }
+ }
+
+ /**
+ * Checks if the server specified in the url exists.
+ *
+ * @param $url url to check
+ * @return true, if the server exists; false otherwise
+ */
+ function hostExists($url)
+ {
+ if (strpos($url, '/') === false) {
+ $server = $url;
+ } else {
+ $server = @parse_url($url, PHP_URL_HOST);
+ }
+
+ if (!$server) {
+ return false;
+ }
+
+ return !!gethostbynamel($server);
+ }
+
+ protected function request_curl($url, $method='GET', $params=array())
+ {
+ $params = http_build_query($params, '', '&');
+ $curl = curl_init($url . ($method == 'GET' && $params ? '?' . $params : ''));
+ curl_setopt($curl, CURLOPT_FOLLOWLOCATION, true);
+ curl_setopt($curl, CURLOPT_HEADER, false);
+ curl_setopt($curl, CURLOPT_SSL_VERIFYPEER, false);
+ curl_setopt($curl, CURLOPT_RETURNTRANSFER, true);
+ curl_setopt($curl, CURLOPT_HTTPHEADER, array('Accept: application/xrds+xml, */*'));
+
+ if($this->verify_peer !== null) {
+ curl_setopt($curl, CURLOPT_SSL_VERIFYPEER, $this->verify_peer);
+ if($this->capath) {
+ curl_setopt($curl, CURLOPT_CAPATH, $this->capath);
+ }
+
+ if($this->cainfo) {
+ curl_setopt($curl, CURLOPT_CAINFO, $this->cainfo);
+ }
+ }
+
+ if ($method == 'POST') {
+ curl_setopt($curl, CURLOPT_POST, true);
+ curl_setopt($curl, CURLOPT_POSTFIELDS, $params);
+ } elseif ($method == 'HEAD') {
+ curl_setopt($curl, CURLOPT_HEADER, true);
+ curl_setopt($curl, CURLOPT_NOBODY, true);
+ } else {
+ curl_setopt($curl, CURLOPT_HTTPGET, true);
+ }
+ $response = curl_exec($curl);
+
+ if($method == 'HEAD') {
+ $headers = array();
+ foreach(explode("\n", $response) as $header) {
+ $pos = strpos($header,':');
+ $name = strtolower(trim(substr($header, 0, $pos)));
+ $headers[$name] = trim(substr($header, $pos+1));
+ }
+
+ # Updating claimed_id in case of redirections.
+ $effective_url = curl_getinfo($curl, CURLINFO_EFFECTIVE_URL);
+ if($effective_url != $url) {
+ $this->identity = $this->claimed_id = $effective_url;
+ }
+
+ return $headers;
+ }
+
+ if (curl_errno($curl)) {
+ throw new ErrorException(curl_error($curl), curl_errno($curl));
+ }
+
+ return $response;
+ }
+
+ protected function request_streams($url, $method='GET', $params=array())
+ {
+ if(!$this->hostExists($url)) {
+ throw new ErrorException("Could not connect to $url.", 404);
+ }
+
+ $params = http_build_query($params, '', '&');
+ switch($method) {
+ case 'GET':
+ $opts = array(
+ 'http' => array(
+ 'method' => 'GET',
+ 'header' => 'Accept: application/xrds+xml, */*',
+ 'ignore_errors' => true,
+ ), 'ssl' => array(
+ 'CN_match' => parse_url($url, PHP_URL_HOST),
+ ),
+ );
+ $url = $url . ($params ? '?' . $params : '');
+ break;
+ case 'POST':
+ $opts = array(
+ 'http' => array(
+ 'method' => 'POST',
+ 'header' => 'Content-type: application/x-www-form-urlencoded',
+ 'content' => $params,
+ 'ignore_errors' => true,
+ ), 'ssl' => array(
+ 'CN_match' => parse_url($url, PHP_URL_HOST),
+ ),
+ );
+ break;
+ case 'HEAD':
+ # We want to send a HEAD request,
+ # but since get_headers doesn't accept $context parameter,
+ # we have to change the defaults.
+ $default = stream_context_get_options(stream_context_get_default());
+ stream_context_get_default(
+ array(
+ 'http' => array(
+ 'method' => 'HEAD',
+ 'header' => 'Accept: application/xrds+xml, */*',
+ 'ignore_errors' => true,
+ ), 'ssl' => array(
+ 'CN_match' => parse_url($url, PHP_URL_HOST),
+ ),
+ )
+ );
+
+ $url = $url . ($params ? '?' . $params : '');
+ $headers_tmp = get_headers ($url);
+ if(!$headers_tmp) {
+ return array();
+ }
+
+ # Parsing headers.
+ $headers = array();
+ foreach($headers_tmp as $header) {
+ $pos = strpos($header,':');
+ $name = strtolower(trim(substr($header, 0, $pos)));
+ $headers[$name] = trim(substr($header, $pos+1));
+
+ # Following possible redirections. The point is just to have
+ # claimed_id change with them, because get_headers() will
+ # follow redirections automatically.
+ # We ignore redirections with relative paths.
+ # If any known provider uses them, file a bug report.
+ if($name == 'location') {
+ if(strpos($headers[$name], 'http') === 0) {
+ $this->identity = $this->claimed_id = $headers[$name];
+ } elseif($headers[$name][0] == '/') {
+ $parsed_url = parse_url($this->claimed_id);
+ $this->identity =
+ $this->claimed_id = $parsed_url['scheme'] . '://'
+ . $parsed_url['host']
+ . $headers[$name];
+ }
+ }
+ }
+
+ # And restore them.
+ stream_context_get_default($default);
+ return $headers;
+ }
+
+ if($this->verify_peer) {
+ $opts['ssl'] += array(
+ 'verify_peer' => true,
+ 'capath' => $this->capath,
+ 'cafile' => $this->cainfo,
+ );
+ }
+
+ $context = stream_context_create ($opts);
+
+ return file_get_contents($url, false, $context);
+ }
+
+ protected function request($url, $method='GET', $params=array())
+ {
+ if (function_exists('curl_init')
+ && (!in_array('https', stream_get_wrappers()) || !ini_get('safe_mode') && !ini_get('open_basedir'))
+ ) {
+ return $this->request_curl($url, $method, $params);
+ }
+ return $this->request_streams($url, $method, $params);
+ }
+
+ protected function build_url($url, $parts)
+ {
+ if (isset($url['query'], $parts['query'])) {
+ $parts['query'] = $url['query'] . '&' . $parts['query'];
+ }
+
+ $url = $parts + $url;
+ $url = $url['scheme'] . '://'
+ . (empty($url['username'])?''
+ :(empty($url['password'])? "{$url['username']}@"
+ :"{$url['username']}:{$url['password']}@"))
+ . $url['host']
+ . (empty($url['port'])?'':":{$url['port']}")
+ . (empty($url['path'])?'':$url['path'])
+ . (empty($url['query'])?'':"?{$url['query']}")
+ . (empty($url['fragment'])?'':"#{$url['fragment']}");
+ return $url;
+ }
+
+ /**
+ * Helper function used to scan for <meta>/<link> tags and extract information
+ * from them
+ */
+ protected function htmlTag($content, $tag, $attrName, $attrValue, $valueName)
+ {
+ preg_match_all("#<{$tag}[^>]*$attrName=['\"].*?$attrValue.*?['\"][^>]*$valueName=['\"](.+?)['\"][^>]*/?>#i", $content, $matches1);
+ preg_match_all("#<{$tag}[^>]*$valueName=['\"](.+?)['\"][^>]*$attrName=['\"].*?$attrValue.*?['\"][^>]*/?>#i", $content, $matches2);
+
+ $result = array_merge($matches1[1], $matches2[1]);
+ return empty($result)?false:$result[0];
+ }
+
+ /**
+ * Performs Yadis and HTML discovery. Normally not used.
+ * @param $url Identity URL.
+ * @return String OP Endpoint (i.e. OpenID provider address).
+ * @throws ErrorException
+ */
+ function discover($url)
+ {
+ if (!$url) throw new ErrorException('No identity supplied.');
+ # Use xri.net proxy to resolve i-name identities
+ if (!preg_match('#^https?:#', $url)) {
+ $url = "https://xri.net/$url";
+ }
+
+ # We save the original url in case of Yadis discovery failure.
+ # It can happen when we'll be lead to an XRDS document
+ # which does not have any OpenID2 services.
+ $originalUrl = $url;
+
+ # A flag to disable yadis discovery in case of failure in headers.
+ $yadis = true;
+
+ # We'll jump a maximum of 5 times, to avoid endless redirections.
+ for ($i = 0; $i < 5; $i ++) {
+ if ($yadis) {
+ $headers = $this->request($url, 'HEAD');
+
+ $next = false;
+ if (isset($headers['x-xrds-location'])) {
+ $url = $this->build_url(parse_url($url), parse_url(trim($headers['x-xrds-location'])));
+ $next = true;
+ }
+
+ if (isset($headers['content-type'])
+ && (strpos($headers['content-type'], 'application/xrds+xml') !== false
+ || strpos($headers['content-type'], 'text/xml') !== false)
+ ) {
+ # Apparently, some providers return XRDS documents as text/html.
+ # While it is against the spec, allowing this here shouldn't break
+ # compatibility with anything.
+ # ---
+ # Found an XRDS document, now let's find the server, and optionally delegate.
+ $content = $this->request($url, 'GET');
+
+ preg_match_all('#<Service.*?>(.*?)</Service>#s', $content, $m);
+ foreach($m[1] as $content) {
+ $content = ' ' . $content; # The space is added, so that strpos doesn't return 0.
+
+ # OpenID 2
+ $ns = preg_quote('http://specs.openid.net/auth/2.0/');
+ if(preg_match('#<Type>\s*'.$ns.'(server|signon)\s*</Type>#s', $content, $type)) {
+ if ($type[1] == 'server') $this->identifier_select = true;
+
+ preg_match('#<URI.*?>(.*)</URI>#', $content, $server);
+ preg_match('#<(Local|Canonical)ID>(.*)</\1ID>#', $content, $delegate);
+ if (empty($server)) {
+ return false;
+ }
+ # Does the server advertise support for either AX or SREG?
+ $this->ax = (bool) strpos($content, '<Type>http://openid.net/srv/ax/1.0</Type>');
+ $this->sreg = strpos($content, '<Type>http://openid.net/sreg/1.0</Type>')
+ || strpos($content, '<Type>http://openid.net/extensions/sreg/1.1</Type>');
+
+ $server = $server[1];
+ if (isset($delegate[2])) $this->identity = trim($delegate[2]);
+ $this->version = 2;
+
+ $this->server = $server;
+ return $server;
+ }
+
+ # OpenID 1.1
+ $ns = preg_quote('http://openid.net/signon/1.1');
+ if (preg_match('#<Type>\s*'.$ns.'\s*</Type>#s', $content)) {
+
+ preg_match('#<URI.*?>(.*)</URI>#', $content, $server);
+ preg_match('#<.*?Delegate>(.*)</.*?Delegate>#', $content, $delegate);
+ if (empty($server)) {
+ return false;
+ }
+ # AX can be used only with OpenID 2.0, so checking only SREG
+ $this->sreg = strpos($content, '<Type>http://openid.net/sreg/1.0</Type>')
+ || strpos($content, '<Type>http://openid.net/extensions/sreg/1.1</Type>');
+
+ $server = $server[1];
+ if (isset($delegate[1])) $this->identity = $delegate[1];
+ $this->version = 1;
+
+ $this->server = $server;
+ return $server;
+ }
+ }
+
+ $next = true;
+ $yadis = false;
+ $url = $originalUrl;
+ $content = null;
+ break;
+ }
+ if ($next) continue;
+
+ # There are no relevant information in headers, so we search the body.
+ $content = $this->request($url, 'GET');
+ $location = $this->htmlTag($content, 'meta', 'http-equiv', 'X-XRDS-Location', 'content');
+ if ($location) {
+ $url = $this->build_url(parse_url($url), parse_url($location));
+ continue;
+ }
+ }
+
+ if (!$content) $content = $this->request($url, 'GET');
+
+ # At this point, the YADIS Discovery has failed, so we'll switch
+ # to openid2 HTML discovery, then fallback to openid 1.1 discovery.
+ $server = $this->htmlTag($content, 'link', 'rel', 'openid2.provider', 'href');
+ $delegate = $this->htmlTag($content, 'link', 'rel', 'openid2.local_id', 'href');
+ $this->version = 2;
+
+ if (!$server) {
+ # The same with openid 1.1
+ $server = $this->htmlTag($content, 'link', 'rel', 'openid.server', 'href');
+ $delegate = $this->htmlTag($content, 'link', 'rel', 'openid.delegate', 'href');
+ $this->version = 1;
+ }
+
+ if ($server) {
+ # We found an OpenID2 OP Endpoint
+ if ($delegate) {
+ # We have also found an OP-Local ID.
+ $this->identity = $delegate;
+ }
+ $this->server = $server;
+ return $server;
+ }
+
+ throw new ErrorException("No OpenID Server found at $url", 404);
+ }
+ throw new ErrorException('Endless redirection!', 500);
+ }
+
+ protected function sregParams()
+ {
+ $params = array();
+ # We always use SREG 1.1, even if the server is advertising only support for 1.0.
+ # That's because it's fully backwards compatibile with 1.0, and some providers
+ # advertise 1.0 even if they accept only 1.1. One such provider is myopenid.com
+ $params['openid.ns.sreg'] = 'http://openid.net/extensions/sreg/1.1';
+ if ($this->required) {
+ $params['openid.sreg.required'] = array();
+ foreach ($this->required as $required) {
+ if (!isset(self::$ax_to_sreg[$required])) continue;
+ $params['openid.sreg.required'][] = self::$ax_to_sreg[$required];
+ }
+ $params['openid.sreg.required'] = implode(',', $params['openid.sreg.required']);
+ }
+
+ if ($this->optional) {
+ $params['openid.sreg.optional'] = array();
+ foreach ($this->optional as $optional) {
+ if (!isset(self::$ax_to_sreg[$optional])) continue;
+ $params['openid.sreg.optional'][] = self::$ax_to_sreg[$optional];
+ }
+ $params['openid.sreg.optional'] = implode(',', $params['openid.sreg.optional']);
+ }
+ return $params;
+ }
+
+ protected function axParams()
+ {
+ $params = array();
+ if ($this->required || $this->optional) {
+ $params['openid.ns.ax'] = 'http://openid.net/srv/ax/1.0';
+ $params['openid.ax.mode'] = 'fetch_request';
+ $this->aliases = array();
+ $counts = array();
+ $required = array();
+ $optional = array();
+ foreach (array('required','optional') as $type) {
+ foreach ($this->$type as $alias => $field) {
+ if (is_int($alias)) $alias = strtr($field, '/', '_');
+ $this->aliases[$alias] = 'http://axschema.org/' . $field;
+ if (empty($counts[$alias])) $counts[$alias] = 0;
+ $counts[$alias] += 1;
+ ${$type}[] = $alias;
+ }
+ }
+ foreach ($this->aliases as $alias => $ns) {
+ $params['openid.ax.type.' . $alias] = $ns;
+ }
+ foreach ($counts as $alias => $count) {
+ if ($count == 1) continue;
+ $params['openid.ax.count.' . $alias] = $count;
+ }
+
+ # Don't send empty ax.requied and ax.if_available.
+ # Google and possibly other providers refuse to support ax when one of these is empty.
+ if($required) {
+ $params['openid.ax.required'] = implode(',', $required);
+ }
+ if($optional) {
+ $params['openid.ax.if_available'] = implode(',', $optional);
+ }
+ }
+ return $params;
+ }
+
+ protected function authUrl_v1($immediate)
+ {
+ $returnUrl = $this->returnUrl;
+ # If we have an openid.delegate that is different from our claimed id,
+ # we need to somehow preserve the claimed id between requests.
+ # The simplest way is to just send it along with the return_to url.
+ if($this->identity != $this->claimed_id) {
+ $returnUrl .= (strpos($returnUrl, '?') ? '&' : '?') . 'openid.claimed_id=' . $this->claimed_id;
+ }
+
+ $params = array(
+ 'openid.return_to' => $returnUrl,
+ 'openid.mode' => $immediate ? 'checkid_immediate' : 'checkid_setup',
+ 'openid.identity' => $this->identity,
+ 'openid.trust_root' => $this->trustRoot,
+ ) + $this->sregParams();
+
+ return $this->build_url(parse_url($this->server)
+ , array('query' => http_build_query($params, '', '&')));
+ }
+
+ protected function authUrl_v2($immediate)
+ {
+ $params = array(
+ 'openid.ns' => 'http://specs.openid.net/auth/2.0',
+ 'openid.mode' => $immediate ? 'checkid_immediate' : 'checkid_setup',
+ 'openid.return_to' => $this->returnUrl,
+ 'openid.realm' => $this->trustRoot,
+ );
+ if ($this->ax) {
+ $params += $this->axParams();
+ }
+ if ($this->sreg) {
+ $params += $this->sregParams();
+ }
+ if (!$this->ax && !$this->sreg) {
+ # If OP doesn't advertise either SREG, nor AX, let's send them both
+ # in worst case we don't get anything in return.
+ $params += $this->axParams() + $this->sregParams();
+ }
+
+ if ($this->identifier_select) {
+ $params['openid.identity'] = $params['openid.claimed_id']
+ = 'http://specs.openid.net/auth/2.0/identifier_select';
+ } else {
+ $params['openid.identity'] = $this->identity;
+ $params['openid.claimed_id'] = $this->claimed_id;
+ }
+
+ return $this->build_url(parse_url($this->server)
+ , array('query' => http_build_query($params, '', '&')));
+ }
+
+ /**
+ * Returns authentication url. Usually, you want to redirect your user to it.
+ * @return String The authentication url.
+ * @param String $select_identifier Whether to request OP to select identity for an user in OpenID 2. Does not affect OpenID 1.
+ * @throws ErrorException
+ */
+ function authUrl($immediate = false)
+ {
+ if ($this->setup_url && !$immediate) return $this->setup_url;
+ if (!$this->server) $this->discover($this->identity);
+
+ if ($this->version == 2) {
+ return $this->authUrl_v2($immediate);
+ }
+ return $this->authUrl_v1($immediate);
+ }
+
+ /**
+ * Performs OpenID verification with the OP.
+ * @return Bool Whether the verification was successful.
+ * @throws ErrorException
+ */
+ function validate()
+ {
+ # If the request was using immediate mode, a failure may be reported
+ # by presenting user_setup_url (for 1.1) or reporting
+ # mode 'setup_needed' (for 2.0). Also catching all modes other than
+ # id_res, in order to avoid throwing errors.
+ if(isset($this->data['openid_user_setup_url'])) {
+ $this->setup_url = $this->data['openid_user_setup_url'];
+ return false;
+ }
+ if($this->mode != 'id_res') {
+ return false;
+ }
+
+ $this->claimed_id = isset($this->data['openid_claimed_id'])?$this->data['openid_claimed_id']:$this->data['openid_identity'];
+ $params = array(
+ 'openid.assoc_handle' => $this->data['openid_assoc_handle'],
+ 'openid.signed' => $this->data['openid_signed'],
+ 'openid.sig' => $this->data['openid_sig'],
+ );
+
+ if (isset($this->data['openid_ns'])) {
+ # We're dealing with an OpenID 2.0 server, so let's set an ns
+ # Even though we should know location of the endpoint,
+ # we still need to verify it by discovery, so $server is not set here
+ $params['openid.ns'] = 'http://specs.openid.net/auth/2.0';
+ } elseif (isset($this->data['openid_claimed_id'])
+ && $this->data['openid_claimed_id'] != $this->data['openid_identity']
+ ) {
+ # If it's an OpenID 1 provider, and we've got claimed_id,
+ # we have to append it to the returnUrl, like authUrl_v1 does.
+ $this->returnUrl .= (strpos($this->returnUrl, '?') ? '&' : '?')
+ . 'openid.claimed_id=' . $this->claimed_id;
+ }
+
+ if ($this->data['openid_return_to'] != $this->returnUrl) {
+ # The return_to url must match the url of current request.
+ # I'm assuing that noone will set the returnUrl to something that doesn't make sense.
+ return false;
+ }
+
+ $server = $this->discover($this->claimed_id);
+
+ foreach (explode(',', $this->data['openid_signed']) as $item) {
+ # Checking whether magic_quotes_gpc is turned on, because
+ # the function may fail if it is. For example, when fetching
+ # AX namePerson, it might containg an apostrophe, which will be escaped.
+ # In such case, validation would fail, since we'd send different data than OP
+ # wants to verify. stripslashes() should solve that problem, but we can't
+ # use it when magic_quotes is off.
+ $value = $this->data['openid_' . str_replace('.','_',$item)];
+ $params['openid.' . $item] = get_magic_quotes_gpc() ? stripslashes($value) : $value;
+
+ }
+
+ $params['openid.mode'] = 'check_authentication';
+
+ $response = $this->request($server, 'POST', $params);
+
+ return preg_match('/is_valid\s*:\s*true/i', $response);
+ }
+
+ protected function getAxAttributes()
+ {
+ $alias = null;
+ if (isset($this->data['openid_ns_ax'])
+ && $this->data['openid_ns_ax'] != 'http://openid.net/srv/ax/1.0'
+ ) { # It's the most likely case, so we'll check it before
+ $alias = 'ax';
+ } else {
+ # 'ax' prefix is either undefined, or points to another extension,
+ # so we search for another prefix
+ foreach ($this->data as $key => $val) {
+ if (substr($key, 0, strlen('openid_ns_')) == 'openid_ns_'
+ && $val == 'http://openid.net/srv/ax/1.0'
+ ) {
+ $alias = substr($key, strlen('openid_ns_'));
+ break;
+ }
+ }
+ }
+ if (!$alias) {
+ # An alias for AX schema has not been found,
+ # so there is no AX data in the OP's response
+ return array();
+ }
+
+ $attributes = array();
+ foreach (explode(',', $this->data['openid_signed']) as $key) {
+ $keyMatch = $alias . '.value.';
+ if (substr($key, 0, strlen($keyMatch)) != $keyMatch) {
+ continue;
+ }
+ $key = substr($key, strlen($keyMatch));
+ if (!isset($this->data['openid_' . $alias . '_type_' . $key])) {
+ # OP is breaking the spec by returning a field without
+ # associated ns. This shouldn't happen, but it's better
+ # to check, than cause an E_NOTICE.
+ continue;
+ }
+ $value = $this->data['openid_' . $alias . '_value_' . $key];
+ $key = substr($this->data['openid_' . $alias . '_type_' . $key],
+ strlen('http://axschema.org/'));
+
+ $attributes[$key] = $value;
+ }
+ return $attributes;
+ }
+
+ protected function getSregAttributes()
+ {
+ $attributes = array();
+ $sreg_to_ax = array_flip(self::$ax_to_sreg);
+ foreach (explode(',', $this->data['openid_signed']) as $key) {
+ $keyMatch = 'sreg.';
+ if (substr($key, 0, strlen($keyMatch)) != $keyMatch) {
+ continue;
+ }
+ $key = substr($key, strlen($keyMatch));
+ if (!isset($sreg_to_ax[$key])) {
+ # The field name isn't part of the SREG spec, so we ignore it.
+ continue;
+ }
+ $attributes[$sreg_to_ax[$key]] = $this->data['openid_sreg_' . $key];
+ }
+ return $attributes;
+ }
+
+ /**
+ * Gets AX/SREG attributes provided by OP. should be used only after successful validaton.
+ * Note that it does not guarantee that any of the required/optional parameters will be present,
+ * or that there will be no other attributes besides those specified.
+ * In other words. OP may provide whatever information it wants to.
+ * * SREG names will be mapped to AX names.
+ * * @return Array Array of attributes with keys being the AX schema names, e.g. 'contact/email'
+ * @see http://www.axschema.org/types/
+ */
+ function getAttributes()
+ {
+ if (isset($this->data['openid_ns'])
+ && $this->data['openid_ns'] == 'http://specs.openid.net/auth/2.0'
+ ) { # OpenID 2.0
+ # We search for both AX and SREG attributes, with AX taking precedence.
+ return $this->getAxAttributes() + $this->getSregAttributes();
+ }
+ return $this->getSregAttributes();
+ }
+}
+
--- /dev/null
+++ b/lib/rolling-curl/.svn/all-wcprops
@@ -1,1 +1,42 @@
+K 25
+svn:wc:ra_dav:version-url
+V 22
+/svn/!svn/ver/20/trunk
+END
+RollingCurlGroup.php
+K 25
+svn:wc:ra_dav:version-url
+V 43
+/svn/!svn/ver/20/trunk/RollingCurlGroup.php
+END
+example_groups.php
+K 25
+svn:wc:ra_dav:version-url
+V 41
+/svn/!svn/ver/20/trunk/example_groups.php
+END
+example.php
+K 25
+svn:wc:ra_dav:version-url
+V 34
+/svn/!svn/ver/20/trunk/example.php
+END
+RollingCurl.php
+K 25
+svn:wc:ra_dav:version-url
+V 38
+/svn/!svn/ver/20/trunk/RollingCurl.php
+END
+CHANGELOG.txt
+K 25
+svn:wc:ra_dav:version-url
+V 36
+/svn/!svn/ver/20/trunk/CHANGELOG.txt
+END
+README.txt
+K 25
+svn:wc:ra_dav:version-url
+V 33
+/svn/!svn/ver/20/trunk/README.txt
+END
--- /dev/null
+++ b/lib/rolling-curl/.svn/entries
@@ -1,1 +1,233 @@
-
+10
+
+dir
+20
+http://rolling-curl.googlecode.com/svn/trunk
+http://rolling-curl.googlecode.com/svn
+
+
+
+2010-09-12T20:39:22.711474Z
+20
+alexander.makarow
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+74aa2acc-2e27-11de-b2a4-4f96ceaaac44
+
+RollingCurlGroup.php
+file
+
+
+
+
+2011-04-10T08:32:48.081650Z
+73c08d9e9e24b4adc89816624c7aca30
+2010-09-12T20:39:22.711474Z
+20
+alexander.makarow
+has-props
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+5152
+
+example_groups.php
+file
+
+
+
+
+2011-04-10T08:32:48.082650Z
+907ed82a47d346c39acbd5578e1d0230
+2010-09-12T20:39:22.711474Z
+20
+alexander.makarow
+has-props
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+1367
+
+example.php
+file
+
+
+
+
+2011-04-10T08:32:48.083650Z
+87aa845abfaffc09ed4eca024f2a8b8a
+2010-09-12T20:39:22.711474Z
+20
+alexander.makarow
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+1860
+
+RollingCurl.php
+file
+
+
+
+
+2011-04-10T08:32:48.084650Z
+205391c449f3f3ee050004dadc374dc8
+2010-09-12T20:39:22.711474Z
+20
+alexander.makarow
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+10444
+
+CHANGELOG.txt
+file
+
+
+
+
+2011-04-10T08:32:48.085650Z
+d0452f6f9530ed04580159121d0fd5f7
+2010-09-12T20:39:22.711474Z
+20
+alexander.makarow
+has-props
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+662
+
+README.txt
+file
+
+
+
+
+2011-04-10T08:32:48.085650Z
+60dd357081431c0f2b82989cdbce8615
+2010-09-12T20:39:22.711474Z
+20
+alexander.makarow
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+6355
+
+
--- /dev/null
+++ b/lib/rolling-curl/.svn/prop-base/CHANGELOG.txt.svn-base
@@ -1,1 +1,6 @@
+K 13
+svn:eol-style
+V 6
+native
+END
--- /dev/null
+++ b/lib/rolling-curl/.svn/prop-base/RollingCurlGroup.php.svn-base
@@ -1,1 +1,6 @@
+K 13
+svn:eol-style
+V 6
+native
+END
--- /dev/null
+++ b/lib/rolling-curl/.svn/prop-base/example_groups.php.svn-base
@@ -1,1 +1,6 @@
+K 13
+svn:eol-style
+V 6
+native
+END
--- /dev/null
+++ b/lib/rolling-curl/.svn/text-base/CHANGELOG.txt.svn-base
@@ -1,1 +1,15 @@
+Rolling Curl changelog
+======================
+September 13, 2010
+------------------
+- Bug #12, #14: Fixed default options overriding (LionsAd)
+- Bug #10: Added use of curl_multi_select to avoid burning CPU (LionsAd)
+- Enh #6, #9: Added $request as parameter to callback function (LionsAd)
+- Chg: Request renamed to RollingCurlRequest (LionsAd)
+- Added RollingCurlGroup class that allows processing groups of requests (LionsAd)
+- More cleanup at unsetting a class (LionsAd)
+- Timeout parameter for curl_multi_select is now configurable (LionsAd)
+- single_curl now returns true (LionsAd)
+- Readme corrections (Alexander Makarov)
+- Code cleanup (Alexander Makarov)
--- /dev/null
+++ b/lib/rolling-curl/.svn/text-base/README.txt.svn-base
@@ -1,1 +1,210 @@
-
+Rolling Curl
+============
+
+RollingCurl allows you to process multiple HTTP requests in parallel using CURL PHP library.
+
+Released under the Apache License 2.0.
+
+Authors
+-------
+- Was originally written by [Josh Fraser](joshfraser.com).
+- Currently maintained by [Alexander Makarov](http://rmcreative.ru/).
+- Received significant updates and patched from [LionsAd](http://github.com/LionsAd/rolling-curl).
+
+Overview
+--------
+RollingCurl is a more efficient implementation of curl_multi() curl_multi is a great way to process multiple HTTP requests in parallel in PHP.
+curl_multi is particularly handy when working with large data sets (like fetching thousands of RSS feeds at one time). Unfortunately there is
+very little documentation on the best way to implement curl_multi. As a result, most of the examples around the web are either inefficient or
+fail entirely when asked to handle more than a few hundred requests.
+
+The problem is that most implementations of curl_multi wait for each set of requests to complete before processing them. If there are too many requests
+to process at once, they usually get broken into groups that are then processed one at a time. The problem with this is that each group has to wait for
+the slowest request to download. In a group of 100 requests, all it takes is one slow one to delay the processing of 99 others. The larger the number of
+requests you are dealing with, the more noticeable this latency becomes.
+
+The solution is to process each request as soon as it completes. This eliminates the wasted CPU cycles from busy waiting. Also there is a queue of
+cURL requests to allow for maximum throughput. Each time a request is completed, a new one is added from the queue. By dynamically adding and removing
+links, we keep a constant number of links downloading at all times. This gives us a way to throttle the amount of simultaneous requests we are sending.
+The result is a faster and more efficient way of processing large quantities of cURL requests in parallel.
+
+Callbacks
+---------
+
+Each of requests usually do have a callback to process results that is being executed when request is done
+(both successfully or not).
+
+Callback accepts three parameters and can look like the following one:
+~~~
+[php]
+function request_callback($response, $info, $request){
+ // doing something with the data received
+}
+~~~
+
+- $response contains received page body.
+- $info is an associative array that holds various information about response such as HTTP response code, content type,
+time taken to make request etc.
+- $request contains RollingCurlRequest that was used to make request.
+
+Examples
+--------
+### Hello world
+
+~~~
+[php]
+// an array of URL's to fetch
+$urls = array("http://www.google.com",
+ "http://www.facebook.com",
+ "http://www.yahoo.com");
+
+// a function that will process the returned responses
+function request_callback($response, $info, $request) {
+ // parse the page title out of the returned HTML
+ if (preg_match("~<title>(.*?)</title>~i", $response, $out)) {
+ $title = $out[1];
+ }
+ echo "<b>$title</b><br />";
+ print_r($info);
+ echo "<hr>";
+}
+
+// create a new RollingCurl object and pass it the name of your custom callback function
+$rc = new RollingCurl("request_callback");
+// the window size determines how many simultaneous requests to allow.
+$rc->window_size = 20;
+foreach ($urls as $url) {
+ // add each request to the RollingCurl object
+ $request = new RollingCurlRequest($url);
+ $rc->add($request);
+}
+$rc->execute();
+~~~
+
+
+### Setting custom options
+
+Set custom options for EVERY request:
+
+~~~
+[php]
+$rc = new RollingCurl("request_callback");
+$rc->options = array(CURLOPT_HEADER => true, CURLOPT_NOBODY => true);
+$rc->execute();
+~~~
+
+Set custom options for A SINGLE request:
+
+~~~
+[php]
+$rc = new RollingCurl("request_callback");
+$request = new RollingCurlRequest($url);
+$request->options = array(CURLOPT_HEADER => true, CURLOPT_NOBODY => true);
+$rc->add($request);
+$rc->execute();
+~~~
+
+### Shortcuts
+
+~~~
+[php]
+$rc = new RollingCurl("request_callback");
+$rc->get("http://www.google.com");
+$rc->get("http://www.yahoo.com");
+$rc->execute();
+~~~
+
+### Class callbacks
+
+~~~
+[php]
+class MyInfoCollector {
+ private $rc;
+
+ function __construct(){
+ $this->rc = new RollingCurl(array($this, 'processPage'));
+ }
+
+ function processPage($response, $info, $request){
+ //...
+ }
+
+ function run($urls){
+ foreach ($urls as $url){
+ $request = new RollingCurlRequest($url);
+ $this->rc->add($request);
+ }
+ $this->rc->execute();
+ }
+}
+
+$collector = new MyInfoCollector();
+$collector->run(array(
+ 'http://google.com/',
+ 'http://yahoo.com/'
+));
+~~~
+
+### Using RollingCurlGroup
+
+~~~
+[php]
+class TestCurlRequest extends RollingCurlGroupRequest {
+ public $test_verbose = true;
+
+ function process($output, $info) {
+ echo "Processing " . $this->url . "\n";
+ if ($this->test_verbose)
+ print_r($info);
+
+ parent::process($output, $info);
+ }
+}
+
+class TestCurlGroup extends RollingCurlGroup {
+ function process($output, $info, $request) {
+ echo "Group CB: Progress " . $this->name . " (" . ($this->finished_requests + 1) . "/" . $this->num_requests . ")\n";
+ parent::process($output, $info, $request);
+ }
+
+ function finished() {
+ echo "Group CB: Finished" . $this->name . "\n";
+ parent::finished();
+ }
+}
+
+$group = new TestCurlGroup("High");
+$group->add(new TestCurlRequest("www.google.de"));
+$group->add(new TestCurlRequest("www.yahoo.de"));
+$group->add(new TestCurlRequest("www.newyorktimes.com"));
+$reqs[] = $group;
+
+$group = new TestCurlGroup("Normal");
+$group->add(new TestCurlRequest("twitter.com"));
+$group->add(new TestCurlRequest("www.bing.com"));
+$group->add(new TestCurlRequest("m.facebook.com"));
+$reqs[] = $group;
+
+$reqs[] = new TestCurlRequest("www.kernel.org");
+
+// No callback here, as its done in Request class
+$rc = new GroupRollingCurl();
+
+foreach ($reqs as $req)
+$rc->add($req);
+
+$rc->execute();
+~~~
+
+The same function (add) can be used both for adding requests and groups of requests.
+The "callback" in request and groups is:
+
+process($output, $info)
+
+and
+
+process($output, $info, $request)
+
+Also you can override RollingCurlGroup::finished() that will be executed right after finishing group processing.
+
+$Id$
--- /dev/null
+++ b/lib/rolling-curl/.svn/text-base/RollingCurl.php.svn-base
@@ -1,1 +1,375 @@
-
+<?php
+/*
+Authored by Josh Fraser (www.joshfraser.com)
+Released under Apache License 2.0
+
+Maintained by Alexander Makarov, http://rmcreative.ru/
+
+$Id$
+*/
+
+/**
+ * Class that represent a single curl request
+ */
+class RollingCurlRequest {
+ public $url = false;
+ public $method = 'GET';
+ public $post_data = null;
+ public $headers = null;
+ public $options = null;
+
+ /**
+ * @param string $url
+ * @param string $method
+ * @param $post_data
+ * @param $headers
+ * @param $options
+ * @return void
+ */
+ function __construct($url, $method = "GET", $post_data = null, $headers = null, $options = null) {
+ $this->url = $url;
+ $this->method = $method;
+ $this->post_data = $post_data;
+ $this->headers = $headers;
+ $this->options = $options;
+ }
+
+ /**
+ * @return void
+ */
+ public function __destruct() {
+ unset($this->url, $this->method, $this->post_data, $this->headers, $this->options);
+ }
+}
+
+/**
+ * RollingCurl custom exception
+ */
+class RollingCurlException extends Exception {
+}
+
+/**
+ * Class that holds a rolling queue of curl requests.
+ *
+ * @throws RollingCurlException
+ */
+class RollingCurl {
+ /**
+ * @var int
+ *
+ * Window size is the max number of simultaneous connections allowed.
+ *
+ * REMEMBER TO RESPECT THE SERVERS:
+ * Sending too many requests at one time can easily be perceived
+ * as a DOS attack. Increase this window_size if you are making requests
+ * to multiple servers or have permission from the receving server admins.
+ */
+ private $window_size = 5;
+
+ /**
+ * @var float
+ *
+ * Timeout is the timeout used for curl_multi_select.
+ */
+ private $timeout = 10;
+
+ /**
+ * @var string|array
+ *
+ * Callback function to be applied to each result.
+ */
+ private $callback;
+
+ /**
+ * @var array
+ *
+ * Set your base options that you want to be used with EVERY request.
+ */
+ protected $options = array(
+ CURLOPT_SSL_VERIFYPEER => 0,
+ CURLOPT_RETURNTRANSFER => 1,
+ CURLOPT_CONNECTTIMEOUT => 30,
+ CURLOPT_TIMEOUT => 30
+ );
+
+ /**
+ * @var array
+ */
+ private $headers = array();
+
+ /**
+ * @var Request[]
+ *
+ * The request queue
+ */
+ private $requests = array();
+
+ /**
+ * @var RequestMap[]
+ *
+ * Maps handles to request indexes
+ */
+ private $requestMap = array();
+
+ /**
+ * @param $callback
+ * Callback function to be applied to each result.
+ *
+ * Can be specified as 'my_callback_function'
+ * or array($object, 'my_callback_method').
+ *
+ * Function should take three parameters: $response, $info, $request.
+ * $response is response body, $info is additional curl info.
+ * $request is the original request
+ *
+ * @return void
+ */
+ function __construct($callback = null) {
+ $this->callback = $callback;
+ }
+
+ /**
+ * @param string $name
+ * @return mixed
+ */
+ public function __get($name) {
+ return (isset($this->{$name})) ? $this->{$name} : null;
+ }
+
+ /**
+ * @param string $name
+ * @param mixed $value
+ * @return bool
+ */
+ public function __set($name, $value) {
+ // append the base options & headers
+ if ($name == "options" || $name == "headers") {
+ $this->{$name} = $value + $this->{$name};
+ } else {
+ $this->{$name} = $value;
+ }
+ return true;
+ }
+
+ /**
+ * Add a request to the request queue
+ *
+ * @param Request $request
+ * @return bool
+ */
+ public function add($request) {
+ $this->requests[] = $request;
+ return true;
+ }
+
+ /**
+ * Create new Request and add it to the request queue
+ *
+ * @param string $url
+ * @param string $method
+ * @param $post_data
+ * @param $headers
+ * @param $options
+ * @return bool
+ */
+ public function request($url, $method = "GET", $post_data = null, $headers = null, $options = null) {
+ $this->requests[] = new RollingCurlRequest($url, $method, $post_data, $headers, $options);
+ return true;
+ }
+
+ /**
+ * Perform GET request
+ *
+ * @param string $url
+ * @param $headers
+ * @param $options
+ * @return bool
+ */
+ public function get($url, $headers = null, $options = null) {
+ return $this->request($url, "GET", null, $headers, $options);
+ }
+
+ /**
+ * Perform POST request
+ *
+ * @param string $url
+ * @param $post_data
+ * @param $headers
+ * @param $options
+ * @return bool
+ */
+ public function post($url, $post_data = null, $headers = null, $options = null) {
+ return $this->request($url, "POST", $post_data, $headers, $options);
+ }
+
+ /**
+ * Execute processing
+ *
+ * @param int $window_size Max number of simultaneous connections
+ * @return string|bool
+ */
+ public function execute($window_size = null) {
+ // rolling curl window must always be greater than 1
+ if (sizeof($this->requests) == 1) {
+ return $this->single_curl();
+ } else {
+ // start the rolling curl. window_size is the max number of simultaneous connections
+ return $this->rolling_curl($window_size);
+ }
+ }
+
+ /**
+ * Performs a single curl request
+ *
+ * @access private
+ * @return string
+ */
+ private function single_curl() {
+ $ch = curl_init();
+ $request = array_shift($this->requests);
+ $options = $this->get_options($request);
+ curl_setopt_array($ch, $options);
+ $output = curl_exec($ch);
+ $info = curl_getinfo($ch);
+
+ // it's not neccesary to set a callback for one-off requests
+ if ($this->callback) {
+ $callback = $this->callback;
+ if (is_callable($this->callback)) {
+ call_user_func($callback, $output, $info, $request);
+ }
+ }
+ else
+ return $output;
+ return true;
+ }
+
+ /**
+ * Performs multiple curl requests
+ *
+ * @access private
+ * @throws RollingCurlException
+ * @param int $window_size Max number of simultaneous connections
+ * @return bool
+ */
+ private function rolling_curl($window_size = null) {
+ if ($window_size)
+ $this->window_size = $window_size;
+
+ // make sure the rolling window isn't greater than the # of urls
+ if (sizeof($this->requests) < $this->window_size)
+ $this->window_size = sizeof($this->requests);
+
+ if ($this->window_size < 2) {
+ throw new RollingCurlException("Window size must be greater than 1");
+ }
+
+ $master = curl_multi_init();
+
+ // start the first batch of requests
+ for ($i = 0; $i < $this->window_size; $i++) {
+ $ch = curl_init();
+
+ $options = $this->get_options($this->requests[$i]);
+
+ curl_setopt_array($ch, $options);
+ curl_multi_add_handle($master, $ch);
+
+ // Add to our request Maps
+ $key = (string) $ch;
+ $this->requestMap[$key] = $i;
+ }
+
+ do {
+ while (($execrun = curl_multi_exec($master, $running)) == CURLM_CALL_MULTI_PERFORM) ;
+ if ($execrun != CURLM_OK)
+ break;
+ // a request was just completed -- find out which one
+ while ($done = curl_multi_info_read($master)) {
+
+ // get the info and content returned on the request
+ $info = curl_getinfo($done['handle']);
+ $output = curl_multi_getcontent($done['handle']);
+
+ // send the return values to the callback function.
+ $callback = $this->callback;
+ if (is_callable($callback)) {
+ $key = (string) $done['handle'];
+ $request = $this->requests[$this->requestMap[$key]];
+ unset($this->requestMap[$key]);
+ call_user_func($callback, $output, $info, $request);
+ }
+
+ // start a new request (it's important to do this before removing the old one)
+ if ($i < sizeof($this->requests) && isset($this->requests[$i]) && $i < count($this->requests)) {
+ $ch = curl_init();
+ $options = $this->get_options($this->requests[$i]);
+ curl_setopt_array($ch, $options);
+ curl_multi_add_handle($master, $ch);
+
+ // Add to our request Maps
+ $key = (string) $ch;
+ $this->requestMap[$key] = $i;
+ $i++;
+ }
+
+ // remove the curl handle that just completed
+ curl_multi_remove_handle($master, $done['handle']);
+
+ }
+
+ // Block for data in / output; error handling is done by curl_multi_exec
+ if ($running)
+ curl_multi_select($master, $this->timeout);
+
+ } while ($running);
+ curl_multi_close($master);
+ return true;
+ }
+
+
+ /**
+ * Helper function to set up a new request by setting the appropriate options
+ *
+ * @access private
+ * @param Request $request
+ * @return array
+ */
+ private function get_options($request) {
+ // options for this entire curl object
+ $options = $this->__get('options');
+ if (ini_get('safe_mode') == 'Off' || !ini_get('safe_mode')) {
+ $options[CURLOPT_FOLLOWLOCATION] = 1;
+ $options[CURLOPT_MAXREDIRS] = 5;
+ }
+ $headers = $this->__get('headers');
+
+ // append custom options for this specific request
+ if ($request->options) {
+ $options = $request->options + $options;
+ }
+
+ // set the request URL
+ $options[CURLOPT_URL] = $request->url;
+
+ // posting data w/ this request?
+ if ($request->post_data) {
+ $options[CURLOPT_POST] = 1;
+ $options[CURLOPT_POSTFIELDS] = $request->post_data;
+ }
+ if ($headers) {
+ $options[CURLOPT_HEADER] = 0;
+ $options[CURLOPT_HTTPHEADER] = $headers;
+ }
+
+ return $options;
+ }
+
+ /**
+ * @return void
+ */
+ public function __destruct() {
+ unset($this->window_size, $this->callback, $this->options, $this->headers, $this->requests);
+ }
+}
+
--- /dev/null
+++ b/lib/rolling-curl/.svn/text-base/RollingCurlGroup.php.svn-base
@@ -1,1 +1,218 @@
-
+<?php
+/*
+
+ Authored by Fabian Franz (www.lionsad.de)
+ Released under Apache License 2.0
+
+$Id$
+*/
+
+class RollingCurlGroupException extends Exception {}
+
+/**
+ * @throws RollingCurlGroupException
+ */
+abstract class RollingCurlGroupRequest extends RollingCurlRequest {
+ private $group = null;
+
+ /**
+ * Set group for this request
+ *
+ * @param group The group to be set
+ */
+ function setGroup($group) {
+ if (!($group instanceof RollingCurlGroup))
+ throw new RollingCurlGroupException("setGroup: group needs to be of instance RollingCurlGroup");
+
+ $this->group = $group;
+ }
+
+ /**
+ * Process the request
+ *
+ *
+ */
+ function process($output, $info) {
+ if ($this->group)
+ $this->group->process($output, $info, $this);
+ }
+
+ /**
+ * @return void
+ */
+ public function __destruct() {
+ unset($this->group);
+ parent::__destruct();
+ }
+
+}
+
+/**
+ * A group of curl requests.
+ *
+ * @throws RollingCurlGroupException *
+ */
+class RollingCurlGroup {
+ /**
+ * @var string group name
+ */
+ protected $name;
+
+ /**
+ * @var int total number of requests in a group
+ */
+ protected $num_requests = 0;
+
+ /**
+ * @var int total number of finished requests in a group
+ */
+ protected $finished_requests = 0;
+
+ /**
+ * @var array requests array
+ */
+ private $requests = array();
+
+ /**
+ * @param string $name group name
+ * @return void
+ */
+ function __construct($name) {
+ $this->name = $name;
+ }
+
+ /**
+ * @return void
+ */
+ public function __destruct() {
+ unset($this->name, $this->num_requests, $this->finished_requests, $this->requests);
+ }
+
+ /**
+ * Adds request to a group
+ *
+ * @throws RollingCurlGroupException
+ * @param RollingCurlGroupRequest|array $request
+ * @return bool
+ */
+ function add($request) {
+ if ($request instanceof RollingCurlGroupRequest) {
+ $request->setGroup($this);
+ $this->num_requests++;
+ $this->requests[] = $request;
+ }
+ else if (is_array($request)) {
+ foreach ($request as $req)
+ $this->add($req);
+ }
+ else
+ throw new RollingCurlGroupException("add: Request needs to be of instance RollingCurlGroupRequest");
+
+ return true;
+ }
+
+ /**
+ * @throws RollingCurlGroupException
+ * @param RollingCurl $rc
+ * @return bool
+ */
+ function addToRC(RollingCurl $rc){
+ $ret = true;
+
+ while (count($this->requests) > 0){
+ $ret1 = $rc->add(array_shift($this->requests));
+ if (!$ret1)
+ $ret = false;
+ }
+
+ return $ret;
+ }
+
+ /**
+ * Override to implement custom response processing.
+ *
+ * Don't forget to call parent::process().
+ *
+ * @param string $output received page body
+ * @param array $info holds various information about response such as HTTP response code, content type, time taken to make request etc.
+ * @param RollingCurlRequest $request request used
+ * @return void
+ */
+ function process($output, $info, $request) {
+ $this->finished_requests++;
+
+ if ($this->finished_requests >= $this->num_requests)
+ $this->finished();
+ }
+
+ /**
+ * Override to execute code after all requests in a group are processed.
+ *
+ * @return void
+ */
+ function finished() {
+ }
+
+}
+
+/**
+ * Group version of rolling curl
+ */
+class GroupRollingCurl extends RollingCurl {
+
+ /**
+ * @var mixed common callback for all groups
+ */
+ private $group_callback = null;
+
+ /**
+ * @param string $output received page body
+ * @param array $info holds various information about response such as HTTP response code, content type, time taken to make request etc.
+ * @param RollingCurlRequest $request request used
+ * @return void
+ */
+ protected function process($output, $info, $request) {
+ if ($request instanceof RollingCurlGroupRequest)
+ $request->process($output, $info);
+
+ if (is_callable($this->group_callback))
+ call_user_func($this->group_callback, $output, $info, $request);
+ }
+
+ /**
+ * @param mixed $callback common callback for all groups
+ * @return void
+ */
+ function __construct($callback = null) {
+ $this->group_callback = $callback;
+
+ parent::__construct(array(&$this, "process"));
+ }
+
+ /**
+ * Adds a group to processing queue
+ *
+ * @param RollingCurlGroup|Request $request
+ * @return bool
+ */
+ public function add($request) {
+ if ($request instanceof RollingCurlGroup)
+ return $request->addToRC($this);
+ else
+ return parent::add($request);
+ }
+
+ /**
+ * Execute processing
+ *
+ * @param int $window_size Max number of simultaneous connections
+ * @return bool|string
+ */
+ public function execute($window_size = null) {
+ if (count($this->requests) == 0)
+ return false;
+
+ return parent::execute($window_size);
+ }
+}
+
--- /dev/null
+++ b/lib/rolling-curl/.svn/text-base/example.php.svn-base
@@ -1,1 +1,66 @@
+<?php
+/*
+authored by Josh Fraser (www.joshfraser.com)
+released under Apache License 2.0
+Maintained by Alexander Makarov, http://rmcreative.ru/
+
+$Id$
+*/
+
+require("RollingCurl.php");
+
+// a little example that fetches a bunch of sites in parallel and echos the page title and response info for each request
+function request_callback($response, $info, $request) {
+ // parse the page title out of the returned HTML
+ if (preg_match("~<title>(.*?)</title>~i", $response, $out)) {
+ $title = $out[1];
+ }
+ echo "<b>$title</b><br />";
+ print_r($info);
+ print_r($request);
+ echo "<hr>";
+}
+
+// single curl request
+$rc = new RollingCurl("request_callback");
+$rc->request("http://www.msn.com");
+$rc->execute();
+
+// another single curl request
+$rc = new RollingCurl("request_callback");
+$rc->request("http://www.google.com");
+$rc->execute();
+
+echo "<hr>";
+
+// top 20 sites according to alexa (11/5/09)
+$urls = array("http://www.google.com",
+ "http://www.facebook.com",
+ "http://www.yahoo.com",
+ "http://www.youtube.com",
+ "http://www.live.com",
+ "http://www.wikipedia.com",
+ "http://www.blogger.com",
+ "http://www.msn.com",
+ "http://www.baidu.com",
+ "http://www.yahoo.co.jp",
+ "http://www.myspace.com",
+ "http://www.qq.com",
+ "http://www.google.co.in",
+ "http://www.twitter.com",
+ "http://www.google.de",
+ "http://www.microsoft.com",
+ "http://www.google.cn",
+ "http://www.sina.com.cn",
+ "http://www.wordpress.com",
+ "http://www.google.co.uk");
+
+$rc = new RollingCurl("request_callback");
+$rc->window_size = 20;
+foreach ($urls as $url) {
+ $request = new RollingCurlRequest($url);
+ $rc->add($request);
+}
+$rc->execute();
+
--- /dev/null
+++ b/lib/rolling-curl/.svn/text-base/example_groups.php.svn-base
@@ -1,1 +1,49 @@
+<?php
+require 'RollingCurl.php';
+require 'RollingCurlGroup.php';
+class TestCurlRequest extends RollingCurlGroupRequest {
+ public $test_verbose = true;
+
+ function process($output, $info) {
+ echo "Processing " . $this->url . "\n";
+ if ($this->test_verbose)
+ print_r($info);
+
+ parent::process($output, $info);
+ }
+}
+
+class TestCurlGroup extends RollingCurlGroup {
+ function process($output, $info, $request) {
+ echo "Group CB: Progress " . $this->name . " (" . ($this->finished_requests + 1) . "/" . $this->num_requests . ")\n";
+ parent::process($output, $info, $request);
+ }
+
+ function finished() {
+ echo "Group CB: Finished" . $this->name . "\n";
+ parent::finished();
+ }
+}
+
+$group = new TestCurlGroup("High");
+$group->add(new TestCurlRequest("www.google.de"));
+$group->add(new TestCurlRequest("www.yahoo.de"));
+$group->add(new TestCurlRequest("www.newyorktimes.com"));
+$reqs[] = $group;
+
+$group = new TestCurlGroup("Normal");
+$group->add(new TestCurlRequest("twitter.com"));
+$group->add(new TestCurlRequest("www.bing.com"));
+$group->add(new TestCurlRequest("m.facebook.com"));
+$reqs[] = $group;
+
+$reqs[] = new TestCurlRequest("www.kernel.org");
+
+// No callback here, as its done in Request class
+$rc = new GroupRollingCurl();
+
+foreach ($reqs as $req)
+ $rc->add($req);
+
+$rc->execute();
--- /dev/null
+++ b/lib/rolling-curl/CHANGELOG.txt
@@ -1,1 +1,15 @@
+Rolling Curl changelog
+======================
+September 13, 2010
+------------------
+- Bug #12, #14: Fixed default options overriding (LionsAd)
+- Bug #10: Added use of curl_multi_select to avoid burning CPU (LionsAd)
+- Enh #6, #9: Added $request as parameter to callback function (LionsAd)
+- Chg: Request renamed to RollingCurlRequest (LionsAd)
+- Added RollingCurlGroup class that allows processing groups of requests (LionsAd)
+- More cleanup at unsetting a class (LionsAd)
+- Timeout parameter for curl_multi_select is now configurable (LionsAd)
+- single_curl now returns true (LionsAd)
+- Readme corrections (Alexander Makarov)
+- Code cleanup (Alexander Makarov)
--- /dev/null
+++ b/lib/rolling-curl/README.txt
@@ -1,1 +1,210 @@
-
+Rolling Curl
+============
+
+RollingCurl allows you to process multiple HTTP requests in parallel using CURL PHP library.
+
+Released under the Apache License 2.0.
+
+Authors
+-------
+- Was originally written by [Josh Fraser](joshfraser.com).
+- Currently maintained by [Alexander Makarov](http://rmcreative.ru/).
+- Received significant updates and patched from [LionsAd](http://github.com/LionsAd/rolling-curl).
+
+Overview
+--------
+RollingCurl is a more efficient implementation of curl_multi() curl_multi is a great way to process multiple HTTP requests in parallel in PHP.
+curl_multi is particularly handy when working with large data sets (like fetching thousands of RSS feeds at one time). Unfortunately there is
+very little documentation on the best way to implement curl_multi. As a result, most of the examples around the web are either inefficient or
+fail entirely when asked to handle more than a few hundred requests.
+
+The problem is that most implementations of curl_multi wait for each set of requests to complete before processing them. If there are too many requests
+to process at once, they usually get broken into groups that are then processed one at a time. The problem with this is that each group has to wait for
+the slowest request to download. In a group of 100 requests, all it takes is one slow one to delay the processing of 99 others. The larger the number of
+requests you are dealing with, the more noticeable this latency becomes.
+
+The solution is to process each request as soon as it completes. This eliminates the wasted CPU cycles from busy waiting. Also there is a queue of
+cURL requests to allow for maximum throughput. Each time a request is completed, a new one is added from the queue. By dynamically adding and removing
+links, we keep a constant number of links downloading at all times. This gives us a way to throttle the amount of simultaneous requests we are sending.
+The result is a faster and more efficient way of processing large quantities of cURL requests in parallel.
+
+Callbacks
+---------
+
+Each of requests usually do have a callback to process results that is being executed when request is done
+(both successfully or not).
+
+Callback accepts three parameters and can look like the following one:
+~~~
+[php]
+function request_callback($response, $info, $request){
+ // doing something with the data received
+}
+~~~
+
+- $response contains received page body.
+- $info is an associative array that holds various information about response such as HTTP response code, content type,
+time taken to make request etc.
+- $request contains RollingCurlRequest that was used to make request.
+
+Examples
+--------
+### Hello world
+
+~~~
+[php]
+// an array of URL's to fetch
+$urls = array("http://www.google.com",
+ "http://www.facebook.com",
+ "http://www.yahoo.com");
+
+// a function that will process the returned responses
+function request_callback($response, $info, $request) {
+ // parse the page title out of the returned HTML
+ if (preg_match("~<title>(.*?)</title>~i", $response, $out)) {
+ $title = $out[1];
+ }
+ echo "<b>$title</b><br />";
+ print_r($info);
+ echo "<hr>";
+}
+
+// create a new RollingCurl object and pass it the name of your custom callback function
+$rc = new RollingCurl("request_callback");
+// the window size determines how many simultaneous requests to allow.
+$rc->window_size = 20;
+foreach ($urls as $url) {
+ // add each request to the RollingCurl object
+ $request = new RollingCurlRequest($url);
+ $rc->add($request);
+}
+$rc->execute();
+~~~
+
+
+### Setting custom options
+
+Set custom options for EVERY request:
+
+~~~
+[php]
+$rc = new RollingCurl("request_callback");
+$rc->options = array(CURLOPT_HEADER => true, CURLOPT_NOBODY => true);
+$rc->execute();
+~~~
+
+Set custom options for A SINGLE request:
+
+~~~
+[php]
+$rc = new RollingCurl("request_callback");
+$request = new RollingCurlRequest($url);
+$request->options = array(CURLOPT_HEADER => true, CURLOPT_NOBODY => true);
+$rc->add($request);
+$rc->execute();
+~~~
+
+### Shortcuts
+
+~~~
+[php]
+$rc = new RollingCurl("request_callback");
+$rc->get("http://www.google.com");
+$rc->get("http://www.yahoo.com");
+$rc->execute();
+~~~
+
+### Class callbacks
+
+~~~
+[php]
+class MyInfoCollector {
+ private $rc;
+
+ function __construct(){
+ $this->rc = new RollingCurl(array($this, 'processPage'));
+ }
+
+ function processPage($response, $info, $request){
+ //...
+ }
+
+ function run($urls){
+ foreach ($urls as $url){
+ $request = new RollingCurlRequest($url);
+ $this->rc->add($request);
+ }
+ $this->rc->execute();
+ }
+}
+
+$collector = new MyInfoCollector();
+$collector->run(array(
+ 'http://google.com/',
+ 'http://yahoo.com/'
+));
+~~~
+
+### Using RollingCurlGroup
+
+~~~
+[php]
+class TestCurlRequest extends RollingCurlGroupRequest {
+ public $test_verbose = true;
+
+ function process($output, $info) {
+ echo "Processing " . $this->url . "\n";
+ if ($this->test_verbose)
+ print_r($info);
+
+ parent::process($output, $info);
+ }
+}
+
+class TestCurlGroup extends RollingCurlGroup {
+ function process($output, $info, $request) {
+ echo "Group CB: Progress " . $this->name . " (" . ($this->finished_requests + 1) . "/" . $this->num_requests . ")\n";
+ parent::process($output, $info, $request);
+ }
+
+ function finished() {
+ echo "Group CB: Finished" . $this->name . "\n";
+ parent::finished();
+ }
+}
+
+$group = new TestCurlGroup("High");
+$group->add(new TestCurlRequest("www.google.de"));
+$group->add(new TestCurlRequest("www.yahoo.de"));
+$group->add(new TestCurlRequest("www.newyorktimes.com"));
+$reqs[] = $group;
+
+$group = new TestCurlGroup("Normal");
+$group->add(new TestCurlRequest("twitter.com"));
+$group->add(new TestCurlRequest("www.bing.com"));
+$group->add(new TestCurlRequest("m.facebook.com"));
+$reqs[] = $group;
+
+$reqs[] = new TestCurlRequest("www.kernel.org");
+
+// No callback here, as its done in Request class
+$rc = new GroupRollingCurl();
+
+foreach ($reqs as $req)
+$rc->add($req);
+
+$rc->execute();
+~~~
+
+The same function (add) can be used both for adding requests and groups of requests.
+The "callback" in request and groups is:
+
+process($output, $info)
+
+and
+
+process($output, $info, $request)
+
+Also you can override RollingCurlGroup::finished() that will be executed right after finishing group processing.
+
+$Id$
--- /dev/null
+++ b/lib/rolling-curl/RollingCurl.php
@@ -1,1 +1,376 @@
-
+<?php
+/*
+Authored by Josh Fraser (www.joshfraser.com)
+Released under Apache License 2.0
+
+Maintained by Alexander Makarov, http://rmcreative.ru/
+
+$Id$
+*/
+
+/**
+ * Class that represent a single curl request
+ */
+class RollingCurlRequest {
+ public $url = false;
+ public $method = 'GET';
+ public $post_data = null;
+ public $headers = null;
+ public $options = null;
+ public $metadata = Array();
+
+ /**
+ * @param string $url
+ * @param string $method
+ * @param $post_data
+ * @param $headers
+ * @param $options
+ * @return void
+ */
+ function __construct($url, $method = "GET", $post_data = null, $headers = null, $options = null) {
+ $this->url = $url;
+ $this->method = $method;
+ $this->post_data = $post_data;
+ $this->headers = $headers;
+ $this->options = $options;
+ }
+
+ /**
+ * @return void
+ */
+ public function __destruct() {
+ unset($this->url, $this->method, $this->post_data, $this->headers, $this->options);
+ }
+}
+
+/**
+ * RollingCurl custom exception
+ */
+class RollingCurlException extends Exception {
+}
+
+/**
+ * Class that holds a rolling queue of curl requests.
+ *
+ * @throws RollingCurlException
+ */
+class RollingCurl {
+ /**
+ * @var int
+ *
+ * Window size is the max number of simultaneous connections allowed.
+ *
+ * REMEMBER TO RESPECT THE SERVERS:
+ * Sending too many requests at one time can easily be perceived
+ * as a DOS attack. Increase this window_size if you are making requests
+ * to multiple servers or have permission from the receving server admins.
+ */
+ private $window_size = 5;
+
+ /**
+ * @var float
+ *
+ * Timeout is the timeout used for curl_multi_select.
+ */
+ private $timeout = 10;
+
+ /**
+ * @var string|array
+ *
+ * Callback function to be applied to each result.
+ */
+ private $callback;
+
+ /**
+ * @var array
+ *
+ * Set your base options that you want to be used with EVERY request.
+ */
+ protected $options = array(
+ CURLOPT_SSL_VERIFYPEER => 0,
+ CURLOPT_RETURNTRANSFER => 1,
+ CURLOPT_CONNECTTIMEOUT => 60,
+ CURLOPT_TIMEOUT => 60
+ );
+
+ /**
+ * @var array
+ */
+ private $headers = array();
+
+ /**
+ * @var Request[]
+ *
+ * The request queue
+ */
+ private $requests = array();
+
+ /**
+ * @var RequestMap[]
+ *
+ * Maps handles to request indexes
+ */
+ private $requestMap = array();
+
+ /**
+ * @param $callback
+ * Callback function to be applied to each result.
+ *
+ * Can be specified as 'my_callback_function'
+ * or array($object, 'my_callback_method').
+ *
+ * Function should take three parameters: $response, $info, $request.
+ * $response is response body, $info is additional curl info.
+ * $request is the original request
+ *
+ * @return void
+ */
+ function __construct($callback = null) {
+ $this->callback = $callback;
+ }
+
+ /**
+ * @param string $name
+ * @return mixed
+ */
+ public function __get($name) {
+ return (isset($this->{$name})) ? $this->{$name} : null;
+ }
+
+ /**
+ * @param string $name
+ * @param mixed $value
+ * @return bool
+ */
+ public function __set($name, $value) {
+ // append the base options & headers
+ if ($name == "options" || $name == "headers") {
+ $this->{$name} = $value + $this->{$name};
+ } else {
+ $this->{$name} = $value;
+ }
+ return true;
+ }
+
+ /**
+ * Add a request to the request queue
+ *
+ * @param Request $request
+ * @return bool
+ */
+ public function add($request) {
+ $this->requests[] = $request;
+ return true;
+ }
+
+ /**
+ * Create new Request and add it to the request queue
+ *
+ * @param string $url
+ * @param string $method
+ * @param $post_data
+ * @param $headers
+ * @param $options
+ * @return bool
+ */
+ public function request($url, $method = "GET", $post_data = null, $headers = null, $options = null) {
+ $this->requests[] = new RollingCurlRequest($url, $method, $post_data, $headers, $options);
+ return true;
+ }
+
+ /**
+ * Perform GET request
+ *
+ * @param string $url
+ * @param $headers
+ * @param $options
+ * @return bool
+ */
+ public function get($url, $headers = null, $options = null) {
+ return $this->request($url, "GET", null, $headers, $options);
+ }
+
+ /**
+ * Perform POST request
+ *
+ * @param string $url
+ * @param $post_data
+ * @param $headers
+ * @param $options
+ * @return bool
+ */
+ public function post($url, $post_data = null, $headers = null, $options = null) {
+ return $this->request($url, "POST", $post_data, $headers, $options);
+ }
+
+ /**
+ * Execute processing
+ *
+ * @param int $window_size Max number of simultaneous connections
+ * @return string|bool
+ */
+ public function execute($window_size = null) {
+ // rolling curl window must always be greater than 1
+ if (sizeof($this->requests) == 1) {
+ return $this->single_curl();
+ } else {
+ // start the rolling curl. window_size is the max number of simultaneous connections
+ return $this->rolling_curl($window_size);
+ }
+ }
+
+ /**
+ * Performs a single curl request
+ *
+ * @access private
+ * @return string
+ */
+ private function single_curl() {
+ $ch = curl_init();
+ $request = array_shift($this->requests);
+ $options = $this->get_options($request);
+ curl_setopt_array($ch, $options);
+ $output = curl_exec($ch);
+ $info = curl_getinfo($ch);
+
+ // it's not neccesary to set a callback for one-off requests
+ if ($this->callback) {
+ $callback = $this->callback;
+ if (is_callable($this->callback)) {
+ call_user_func($callback, $output, $info, $request);
+ }
+ }
+ else
+ return $output;
+ return true;
+ }
+
+ /**
+ * Performs multiple curl requests
+ *
+ * @access private
+ * @throws RollingCurlException
+ * @param int $window_size Max number of simultaneous connections
+ * @return bool
+ */
+ private function rolling_curl($window_size = null) {
+ if ($window_size)
+ $this->window_size = $window_size;
+
+ // make sure the rolling window isn't greater than the # of urls
+ if (sizeof($this->requests) < $this->window_size)
+ $this->window_size = sizeof($this->requests);
+
+ if ($this->window_size < 2) {
+ throw new RollingCurlException("Window size must be greater than 1");
+ }
+
+ $master = curl_multi_init();
+
+ // start the first batch of requests
+ for ($i = 0; $i < $this->window_size; $i++) {
+ $ch = curl_init();
+
+ $options = $this->get_options($this->requests[$i]);
+
+ curl_setopt_array($ch, $options);
+ curl_multi_add_handle($master, $ch);
+
+ // Add to our request Maps
+ $key = (string) $ch;
+ $this->requestMap[$key] = $i;
+ }
+
+ do {
+ while (($execrun = curl_multi_exec($master, $running)) == CURLM_CALL_MULTI_PERFORM) ;
+ if ($execrun != CURLM_OK)
+ break;
+ // a request was just completed -- find out which one
+ while ($done = curl_multi_info_read($master)) {
+
+ // get the info and content returned on the request
+ $info = curl_getinfo($done['handle']);
+ $output = curl_multi_getcontent($done['handle']);
+
+ // send the return values to the callback function.
+ $callback = $this->callback;
+ if (is_callable($callback)) {
+ $key = (string) $done['handle'];
+ $request = $this->requests[$this->requestMap[$key]];
+ unset($this->requestMap[$key]);
+ call_user_func($callback, $output, $info, $request);
+ }
+
+ // start a new request (it's important to do this before removing the old one)
+ if ($i < sizeof($this->requests) && isset($this->requests[$i]) && $i < count($this->requests)) {
+ $ch = curl_init();
+ $options = $this->get_options($this->requests[$i]);
+ curl_setopt_array($ch, $options);
+ curl_multi_add_handle($master, $ch);
+
+ // Add to our request Maps
+ $key = (string) $ch;
+ $this->requestMap[$key] = $i;
+ $i++;
+ }
+
+ // remove the curl handle that just completed
+ curl_multi_remove_handle($master, $done['handle']);
+
+ }
+
+ // Block for data in / output; error handling is done by curl_multi_exec
+ if ($running)
+ curl_multi_select($master, $this->timeout);
+
+ } while ($running);
+ curl_multi_close($master);
+ return true;
+ }
+
+
+ /**
+ * Helper function to set up a new request by setting the appropriate options
+ *
+ * @access private
+ * @param Request $request
+ * @return array
+ */
+ private function get_options($request) {
+ // options for this entire curl object
+ $options = $this->__get('options');
+ if (ini_get('safe_mode') == 'Off' || !ini_get('safe_mode')) {
+ $options[CURLOPT_FOLLOWLOCATION] = 1;
+ $options[CURLOPT_MAXREDIRS] = 5;
+ }
+ $headers = $this->__get('headers');
+
+ // append custom options for this specific request
+ if ($request->options) {
+ $options = $request->options + $options;
+ }
+
+ // set the request URL
+ $options[CURLOPT_URL] = $request->url;
+
+ // posting data w/ this request?
+ if ($request->post_data) {
+ $options[CURLOPT_POST] = 1;
+ $options[CURLOPT_POSTFIELDS] = $request->post_data;
+ }
+ if ($headers) {
+ $options[CURLOPT_HEADER] = 0;
+ $options[CURLOPT_HTTPHEADER] = $headers;
+ }
+
+ return $options;
+ }
+
+ /**
+ * @return void
+ */
+ public function __destruct() {
+ unset($this->window_size, $this->callback, $this->options, $this->headers, $this->requests);
+ }
+}
+
--- /dev/null
+++ b/lib/rolling-curl/RollingCurlGroup.php
@@ -1,1 +1,218 @@
-
+<?php
+/*
+
+ Authored by Fabian Franz (www.lionsad.de)
+ Released under Apache License 2.0
+
+$Id$
+*/
+
+class RollingCurlGroupException extends Exception {}
+
+/**
+ * @throws RollingCurlGroupException
+ */
+abstract class RollingCurlGroupRequest extends RollingCurlRequest {
+ private $group = null;
+
+ /**
+ * Set group for this request
+ *
+ * @param group The group to be set
+ */
+ function setGroup($group) {
+ if (!($group instanceof RollingCurlGroup))
+ throw new RollingCurlGroupException("setGroup: group needs to be of instance RollingCurlGroup");
+
+ $this->group = $group;
+ }
+
+ /**
+ * Process the request
+ *
+ *
+ */
+ function process($output, $info) {
+ if ($this->group)
+ $this->group->process($output, $info, $this);
+ }
+
+ /**
+ * @return void
+ */
+ public function __destruct() {
+ unset($this->group);
+ parent::__destruct();
+ }
+
+}
+
+/**
+ * A group of curl requests.
+ *
+ * @throws RollingCurlGroupException *
+ */
+class RollingCurlGroup {
+ /**
+ * @var string group name
+ */
+ protected $name;
+
+ /**
+ * @var int total number of requests in a group
+ */
+ protected $num_requests = 0;
+
+ /**
+ * @var int total number of finished requests in a group
+ */
+ protected $finished_requests = 0;
+
+ /**
+ * @var array requests array
+ */
+ private $requests = array();
+
+ /**
+ * @param string $name group name
+ * @return void
+ */
+ function __construct($name) {
+ $this->name = $name;
+ }
+
+ /**
+ * @return void
+ */
+ public function __destruct() {
+ unset($this->name, $this->num_requests, $this->finished_requests, $this->requests);
+ }
+
+ /**
+ * Adds request to a group
+ *
+ * @throws RollingCurlGroupException
+ * @param RollingCurlGroupRequest|array $request
+ * @return bool
+ */
+ function add($request) {
+ if ($request instanceof RollingCurlGroupRequest) {
+ $request->setGroup($this);
+ $this->num_requests++;
+ $this->requests[] = $request;
+ }
+ else if (is_array($request)) {
+ foreach ($request as $req)
+ $this->add($req);
+ }
+ else
+ throw new RollingCurlGroupException("add: Request needs to be of instance RollingCurlGroupRequest");
+
+ return true;
+ }
+
+ /**
+ * @throws RollingCurlGroupException
+ * @param RollingCurl $rc
+ * @return bool
+ */
+ function addToRC(RollingCurl $rc){
+ $ret = true;
+
+ while (count($this->requests) > 0){
+ $ret1 = $rc->add(array_shift($this->requests));
+ if (!$ret1)
+ $ret = false;
+ }
+
+ return $ret;
+ }
+
+ /**
+ * Override to implement custom response processing.
+ *
+ * Don't forget to call parent::process().
+ *
+ * @param string $output received page body
+ * @param array $info holds various information about response such as HTTP response code, content type, time taken to make request etc.
+ * @param RollingCurlRequest $request request used
+ * @return void
+ */
+ function process($output, $info, $request) {
+ $this->finished_requests++;
+
+ if ($this->finished_requests >= $this->num_requests)
+ $this->finished();
+ }
+
+ /**
+ * Override to execute code after all requests in a group are processed.
+ *
+ * @return void
+ */
+ function finished() {
+ }
+
+}
+
+/**
+ * Group version of rolling curl
+ */
+class GroupRollingCurl extends RollingCurl {
+
+ /**
+ * @var mixed common callback for all groups
+ */
+ private $group_callback = null;
+
+ /**
+ * @param string $output received page body
+ * @param array $info holds various information about response such as HTTP response code, content type, time taken to make request etc.
+ * @param RollingCurlRequest $request request used
+ * @return void
+ */
+ protected function process($output, $info, $request) {
+ if ($request instanceof RollingCurlGroupRequest)
+ $request->process($output, $info);
+
+ if (is_callable($this->group_callback))
+ call_user_func($this->group_callback, $output, $info, $request);
+ }
+
+ /**
+ * @param mixed $callback common callback for all groups
+ * @return void
+ */
+ function __construct($callback = null) {
+ $this->group_callback = $callback;
+
+ parent::__construct(array(&$this, "process"));
+ }
+
+ /**
+ * Adds a group to processing queue
+ *
+ * @param RollingCurlGroup|Request $request
+ * @return bool
+ */
+ public function add($request) {
+ if ($request instanceof RollingCurlGroup)
+ return $request->addToRC($this);
+ else
+ return parent::add($request);
+ }
+
+ /**
+ * Execute processing
+ *
+ * @param int $window_size Max number of simultaneous connections
+ * @return bool|string
+ */
+ public function execute($window_size = null) {
+ if (count($this->requests) == 0)
+ return false;
+
+ return parent::execute($window_size);
+ }
+}
+
--- /dev/null
+++ b/lib/rolling-curl/example.php
@@ -1,1 +1,66 @@
+<?php
+/*
+authored by Josh Fraser (www.joshfraser.com)
+released under Apache License 2.0
+Maintained by Alexander Makarov, http://rmcreative.ru/
+
+$Id$
+*/
+
+require("RollingCurl.php");
+
+// a little example that fetches a bunch of sites in parallel and echos the page title and response info for each request
+function request_callback($response, $info, $request) {
+ // parse the page title out of the returned HTML
+ if (preg_match("~<title>(.*?)</title>~i", $response, $out)) {
+ $title = $out[1];
+ }
+ echo "<b>$title</b><br />";
+ print_r($info);
+ print_r($request);
+ echo "<hr>";
+}
+
+// single curl request
+$rc = new RollingCurl("request_callback");
+$rc->request("http://www.msn.com");
+$rc->execute();
+
+// another single curl request
+$rc = new RollingCurl("request_callback");
+$rc->request("http://www.google.com");
+$rc->execute();
+
+echo "<hr>";
+
+// top 20 sites according to alexa (11/5/09)
+$urls = array("http://www.google.com",
+ "http://www.facebook.com",
+ "http://www.yahoo.com",
+ "http://www.youtube.com",
+ "http://www.live.com",
+ "http://www.wikipedia.com",
+ "http://www.blogger.com",
+ "http://www.msn.com",
+ "http://www.baidu.com",
+ "http://www.yahoo.co.jp",
+ "http://www.myspace.com",
+ "http://www.qq.com",
+ "http://www.google.co.in",
+ "http://www.twitter.com",
+ "http://www.google.de",
+ "http://www.microsoft.com",
+ "http://www.google.cn",
+ "http://www.sina.com.cn",
+ "http://www.wordpress.com",
+ "http://www.google.co.uk");
+
+$rc = new RollingCurl("request_callback");
+$rc->window_size = 20;
+foreach ($urls as $url) {
+ $request = new RollingCurlRequest($url);
+ $rc->add($request);
+}
+$rc->execute();
+
--- /dev/null
+++ b/lib/rolling-curl/example_groups.php
@@ -1,1 +1,49 @@
+<?php
+require 'RollingCurl.php';
+require 'RollingCurlGroup.php';
+class TestCurlRequest extends RollingCurlGroupRequest {
+ public $test_verbose = true;
+
+ function process($output, $info) {
+ echo "Processing " . $this->url . "\n";
+ if ($this->test_verbose)
+ print_r($info);
+
+ parent::process($output, $info);
+ }
+}
+
+class TestCurlGroup extends RollingCurlGroup {
+ function process($output, $info, $request) {
+ echo "Group CB: Progress " . $this->name . " (" . ($this->finished_requests + 1) . "/" . $this->num_requests . ")\n";
+ parent::process($output, $info, $request);
+ }
+
+ function finished() {
+ echo "Group CB: Finished" . $this->name . "\n";
+ parent::finished();
+ }
+}
+
+$group = new TestCurlGroup("High");
+$group->add(new TestCurlRequest("www.google.de"));
+$group->add(new TestCurlRequest("www.yahoo.de"));
+$group->add(new TestCurlRequest("www.newyorktimes.com"));
+$reqs[] = $group;
+
+$group = new TestCurlGroup("Normal");
+$group->add(new TestCurlRequest("twitter.com"));
+$group->add(new TestCurlRequest("www.bing.com"));
+$group->add(new TestCurlRequest("m.facebook.com"));
+$reqs[] = $group;
+
+$reqs[] = new TestCurlRequest("www.kernel.org");
+
+// No callback here, as its done in Request class
+$rc = new GroupRollingCurl();
+
+foreach ($reqs as $req)
+ $rc->add($req);
+
+$rc->execute();
--- a/lib/ses.php
+++ /dev/null
@@ -1,704 +1,1 @@
-<?php
-/**
-*
-* Copyright (c) 2011, Dan Myers.
-* Parts copyright (c) 2008, Donovan Schonknecht.
-* All rights reserved.
-*
-* Redistribution and use in source and binary forms, with or without
-* modification, are permitted provided that the following conditions are met:
-*
-* - Redistributions of source code must retain the above copyright notice,
-* this list of conditions and the following disclaimer.
-* - Redistributions in binary form must reproduce the above copyright
-* notice, this list of conditions and the following disclaimer in the
-* documentation and/or other materials provided with the distribution.
-*
-* THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS"
-* AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE
-* IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE
-* ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE
-* LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR
-* CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF
-* SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS
-* INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN
-* CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE)
-* ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE
-* POSSIBILITY OF SUCH DAMAGE.
-*
-* This is a modified BSD license (the third clause has been removed).
-* The BSD license may be found here:
-* http://www.opensource.org/licenses/bsd-license.php
-*
-* Amazon Simple Email Service is a trademark of Amazon.com, Inc. or its affiliates.
-*
-* SimpleEmailService is based on Donovan Schonknecht's Amazon S3 PHP class, found here:
-* http://undesigned.org.za/2007/10/22/amazon-s3-php-class
-*
-*/
-/**
-* Amazon SimpleEmailService PHP class
-*
-* @link http://sourceforge.net/projects/php-aws-ses/
-* version 0.8.1
-*
-*/
-class SimpleEmailService
-{
- protected $__accessKey; // AWS Access key
- protected $__secretKey; // AWS Secret key
- protected $__host;
-
- public function getAccessKey() { return $this->__accessKey; }
- public function getSecretKey() { return $this->__secretKey; }
- public function getHost() { return $this->__host; }
-
- protected $__verifyHost = 1;
- protected $__verifyPeer = 1;
-
- // verifyHost and verifyPeer determine whether curl verifies ssl certificates.
- // It may be necessary to disable these checks on certain systems.
- // These only have an effect if SSL is enabled.
- public function verifyHost() { return $this->__verifyHost; }
- public function enableVerifyHost($enable = true) { $this->__verifyHost = $enable; }
-
- public function verifyPeer() { return $this->__verifyPeer; }
- public function enableVerifyPeer($enable = true) { $this->__verifyPeer = $enable; }
-
- /**
- * Constructor
- *
- * @param string $accessKey Access key
- * @param string $secretKey Secret key
- * @return void
- */
- public function __construct($accessKey = null, $secretKey = null, $host = 'email.us-east-1.amazonaws.com') {
- if ($accessKey !== null && $secretKey !== null) {
- $this->setAuth($accessKey, $secretKey);
- }
- $this->__host = $host;
- }
-
- /**
- * Set AWS access key and secret key
- *
- * @param string $accessKey Access key
- * @param string $secretKey Secret key
- * @return void
- */
- public function setAuth($accessKey, $secretKey) {
- $this->__accessKey = $accessKey;
- $this->__secretKey = $secretKey;
- }
-
- /**
- * Lists the email addresses that have been verified and can be used as the 'From' address
- *
- * @return An array containing two items: a list of verified email addresses, and the request id.
- */
- public function listVerifiedEmailAddresses() {
- $rest = new SimpleEmailServiceRequest($this, 'GET');
- $rest->setParameter('Action', 'ListVerifiedEmailAddresses');
-
- $rest = $rest->getResponse();
- if($rest->error === false && $rest->code !== 200) {
- $rest->error = array('code' => $rest->code, 'message' => 'Unexpected HTTP status');
- }
- if($rest->error !== false) {
- $this->__triggerError('listVerifiedEmailAddresses', $rest->error);
- return false;
- }
-
- $response = array();
- if(!isset($rest->body)) {
- return $response;
- }
-
- $addresses = array();
- foreach($rest->body->ListVerifiedEmailAddressesResult->VerifiedEmailAddresses->member as $address) {
- $addresses[] = (string)$address;
- }
-
- $response['Addresses'] = $addresses;
- $response['RequestId'] = (string)$rest->body->ResponseMetadata->RequestId;
-
- return $response;
- }
-
- /**
- * Requests verification of the provided email address, so it can be used
- * as the 'From' address when sending emails through SimpleEmailService.
- *
- * After submitting this request, you should receive a verification email
- * from Amazon at the specified address containing instructions to follow.
- *
- * @param string email The email address to get verified
- * @return The request id for this request.
- */
- public function verifyEmailAddress($email) {
- $rest = new SimpleEmailServiceRequest($this, 'POST');
- $rest->setParameter('Action', 'VerifyEmailAddress');
- $rest->setParameter('EmailAddress', $email);
-
- $rest = $rest->getResponse();
- if($rest->error === false && $rest->code !== 200) {
- $rest->error = array('code' => $rest->code, 'message' => 'Unexpected HTTP status');
- }
- if($rest->error !== false) {
- $this->__triggerError('verifyEmailAddress', $rest->error);
- return false;
- }
-
- $response['RequestId'] = (string)$rest->body->ResponseMetadata->RequestId;
- return $response;
- }
-
- /**
- * Removes the specified email address from the list of verified addresses.
- *
- * @param string email The email address to remove
- * @return The request id for this request.
- */
- public function deleteVerifiedEmailAddress($email) {
- $rest = new SimpleEmailServiceRequest($this, 'DELETE');
- $rest->setParameter('Action', 'DeleteVerifiedEmailAddress');
- $rest->setParameter('EmailAddress', $email);
-
- $rest = $rest->getResponse();
- if($rest->error === false && $rest->code !== 200) {
- $rest->error = array('code' => $rest->code, 'message' => 'Unexpected HTTP status');
- }
- if($rest->error !== false) {
- $this->__triggerError('deleteVerifiedEmailAddress', $rest->error);
- return false;
- }
-
- $response['RequestId'] = (string)$rest->body->ResponseMetadata->RequestId;
- return $response;
- }
-
- /**
- * Retrieves information on the current activity limits for this account.
- * See http://docs.amazonwebservices.com/ses/latest/APIReference/API_GetSendQuota.html
- *
- * @return An array containing information on this account's activity limits.
- */
- public function getSendQuota() {
- $rest = new SimpleEmailServiceRequest($this, 'GET');
- $rest->setParameter('Action', 'GetSendQuota');
-
- $rest = $rest->getResponse();
- if($rest->error === false && $rest->code !== 200) {
- $rest->error = array('code' => $rest->code, 'message' => 'Unexpected HTTP status');
- }
- if($rest->error !== false) {
- $this->__triggerError('getSendQuota', $rest->error);
- return false;
- }
-
- $response = array();
- if(!isset($rest->body)) {
- return $response;
- }
-
- $response['Max24HourSend'] = (string)$rest->body->GetSendQuotaResult->Max24HourSend;
- $response['MaxSendRate'] = (string)$rest->body->GetSendQuotaResult->MaxSendRate;
- $response['SentLast24Hours'] = (string)$rest->body->GetSendQuotaResult->SentLast24Hours;
- $response['RequestId'] = (string)$rest->body->ResponseMetadata->RequestId;
-
- return $response;
- }
-
- /**
- * Retrieves statistics for the last two weeks of activity on this account.
- * See http://docs.amazonwebservices.com/ses/latest/APIReference/API_GetSendStatistics.html
- *
- * @return An array of activity statistics. Each array item covers a 15-minute period.
- */
- public function getSendStatistics() {
- $rest = new SimpleEmailServiceRequest($this, 'GET');
- $rest->setParameter('Action', 'GetSendStatistics');
-
- $rest = $rest->getResponse();
- if($rest->error === false && $rest->code !== 200) {
- $rest->error = array('code' => $rest->code, 'message' => 'Unexpected HTTP status');
- }
- if($rest->error !== false) {
- $this->__triggerError('getSendStatistics', $rest->error);
- return false;
- }
-
- $response = array();
- if(!isset($rest->body)) {
- return $response;
- }
-
- $datapoints = array();
- foreach($rest->body->GetSendStatisticsResult->SendDataPoints->member as $datapoint) {
- $p = array();
- $p['Bounces'] = (string)$datapoint->Bounces;
- $p['Complaints'] = (string)$datapoint->Complaints;
- $p['DeliveryAttempts'] = (string)$datapoint->DeliveryAttempts;
- $p['Rejects'] = (string)$datapoint->Rejects;
- $p['Timestamp'] = (string)$datapoint->Timestamp;
-
- $datapoints[] = $p;
- }
-
- $response['SendDataPoints'] = $datapoints;
- $response['RequestId'] = (string)$rest->body->ResponseMetadata->RequestId;
-
- return $response;
- }
-
-
- /**
- * Given a SimpleEmailServiceMessage object, submits the message to the service for sending.
- *
- * @return An array containing the unique identifier for this message and a separate request id.
- * Returns false if the provided message is missing any required fields.
- */
- public function sendEmail($sesMessage) {
- if(!$sesMessage->validate()) {
- return false;
- }
-
- $rest = new SimpleEmailServiceRequest($this, 'POST');
- $rest->setParameter('Action', 'SendEmail');
-
- $i = 1;
- foreach($sesMessage->to as $to) {
- $rest->setParameter('Destination.ToAddresses.member.'.$i, $to);
- $i++;
- }
-
- if(is_array($sesMessage->cc)) {
- $i = 1;
- foreach($sesMessage->cc as $cc) {
- $rest->setParameter('Destination.CcAddresses.member.'.$i, $cc);
- $i++;
- }
- }
-
- if(is_array($sesMessage->bcc)) {
- $i = 1;
- foreach($sesMessage->bcc as $bcc) {
- $rest->setParameter('Destination.BccAddresses.member.'.$i, $bcc);
- $i++;
- }
- }
-
- if(is_array($sesMessage->replyto)) {
- $i = 1;
- foreach($sesMessage->replyto as $replyto) {
- $rest->setParameter('ReplyToAddresses.member.'.$i, $replyto);
- $i++;
- }
- }
-
- $rest->setParameter('Source', $sesMessage->from);
-
- if($sesMessage->returnpath != null) {
- $rest->setParameter('ReturnPath', $sesMessage->returnpath);
- }
-
- if($sesMessage->subject != null && strlen($sesMessage->subject) > 0) {
- $rest->setParameter('Message.Subject.Data', $sesMessage->subject);
- if($sesMessage->subjectCharset != null && strlen($sesMessage->subjectCharset) > 0) {
- $rest->setParameter('Message.Subject.Charset', $sesMessage->subjectCharset);
- }
- }
-
-
- if($sesMessage->messagetext != null && strlen($sesMessage->messagetext) > 0) {
- $rest->setParameter('Message.Body.Text.Data', $sesMessage->messagetext);
- if($sesMessage->messageTextCharset != null && strlen($sesMessage->messageTextCharset) > 0) {
- $rest->setParameter('Message.Body.Text.Charset', $sesMessage->messageTextCharset);
- }
- }
-
- if($sesMessage->messagehtml != null && strlen($sesMessage->messagehtml) > 0) {
- $rest->setParameter('Message.Body.Html.Data', $sesMessage->messagehtml);
- if($sesMessage->messageHtmlCharset != null && strlen($sesMessage->messageHtmlCharset) > 0) {
- $rest->setParameter('Message.Body.Html.Charset', $sesMessage->messageHtmlCharset);
- }
- }
-
- $rest = $rest->getResponse();
- if($rest->error === false && $rest->code !== 200) {
- $rest->error = array('code' => $rest->code, 'message' => 'Unexpected HTTP status');
- }
- if($rest->error !== false) {
- $this->__triggerError('sendEmail', $rest->error);
- return false;
- }
-
- $response['MessageId'] = (string)$rest->body->SendEmailResult->MessageId;
- $response['RequestId'] = (string)$rest->body->ResponseMetadata->RequestId;
- return $response;
- }
-
- /**
- * Trigger an error message
- *
- * @internal Used by member functions to output errors
- * @param array $error Array containing error information
- * @return string
- */
- public function __triggerError($functionname, $error)
- {
- if($error == false) {
- trigger_error(sprintf("SimpleEmailService::%s(): Encountered an error, but no description given", $functionname), E_USER_WARNING);
- }
- else if(isset($error['curl']) && $error['curl'])
- {
- trigger_error(sprintf("SimpleEmailService::%s(): %s %s", $functionname, $error['code'], $error['message']), E_USER_WARNING);
- }
- else if(isset($error['Error']))
- {
- $e = $error['Error'];
- $message = sprintf("SimpleEmailService::%s(): %s - %s: %s\nRequest Id: %s\n", $functionname, $e['Type'], $e['Code'], $e['Message'], $error['RequestId']);
- trigger_error($message, E_USER_WARNING);
- }
- }
-
- /**
- * Callback handler for 503 retries.
- *
- * @internal Used by SimpleDBRequest to call the user-specified callback, if set
- * @param $attempt The number of failed attempts so far
- * @return The retry delay in microseconds, or 0 to stop retrying.
- */
- public function __executeServiceTemporarilyUnavailableRetryDelay($attempt)
- {
- if(is_callable($this->__serviceUnavailableRetryDelayCallback)) {
- $callback = $this->__serviceUnavailableRetryDelayCallback;
- return $callback($attempt);
- }
- return 0;
- }
-}
-
-final class SimpleEmailServiceRequest
-{
- private $ses, $verb, $parameters = array();
- public $response;
-
- /**
- * Constructor
- *
- * @param string $ses The SimpleEmailService object making this request
- * @param string $action action
- * @param string $verb HTTP verb
- * @return mixed
- */
- function __construct($ses, $verb) {
- $this->ses = $ses;
- $this->verb = $verb;
- $this->response = new STDClass;
- $this->response->error = false;
- }
-
- /**
- * Set request parameter
- *
- * @param string $key Key
- * @param string $value Value
- * @param boolean $replace Whether to replace the key if it already exists (default true)
- * @return void
- */
- public function setParameter($key, $value, $replace = true) {
- if(!$replace && isset($this->parameters[$key]))
- {
- $temp = (array)($this->parameters[$key]);
- $temp[] = $value;
- $this->parameters[$key] = $temp;
- }
- else
- {
- $this->parameters[$key] = $value;
- }
- }
-
- /**
- * Get the response
- *
- * @return object | false
- */
- public function getResponse() {
-
- $params = array();
- foreach ($this->parameters as $var => $value)
- {
- if(is_array($value))
- {
- foreach($value as $v)
- {
- $params[] = $var.'='.$this->__customUrlEncode($v);
- }
- }
- else
- {
- $params[] = $var.'='.$this->__customUrlEncode($value);
- }
- }
-
- sort($params, SORT_STRING);
-
- // must be in format 'Sun, 06 Nov 1994 08:49:37 GMT'
- $date = gmdate('D, d M Y H:i:s e');
-
- $query = implode('&', $params);
-
- $headers = array();
- $headers[] = 'Date: '.$date;
- $headers[] = 'Host: '.$this->ses->getHost();
-
- $auth = 'AWS3-HTTPS AWSAccessKeyId='.$this->ses->getAccessKey();
- $auth .= ',Algorithm=HmacSHA256,Signature='.$this->__getSignature($date);
- $headers[] = 'X-Amzn-Authorization: '.$auth;
-
- $url = 'https://'.$this->ses->getHost().'/';
-
- // Basic setup
- $curl = curl_init();
- curl_setopt($curl, CURLOPT_USERAGENT, 'SimpleEmailService/php');
-
- curl_setopt($curl, CURLOPT_SSL_VERIFYHOST, ($this->ses->verifyHost() ? 1 : 0));
- curl_setopt($curl, CURLOPT_SSL_VERIFYPEER, ($this->ses->verifyPeer() ? 1 : 0));
-
- // Request types
- switch ($this->verb) {
- case 'GET':
- $url .= '?'.$query;
- break;
- case 'POST':
- curl_setopt($curl, CURLOPT_CUSTOMREQUEST, $this->verb);
- curl_setopt($curl, CURLOPT_POSTFIELDS, $query);
- $headers[] = 'Content-Type: application/x-www-form-urlencoded';
- break;
- case 'DELETE':
- $url .= '?'.$query;
- curl_setopt($curl, CURLOPT_CUSTOMREQUEST, 'DELETE');
- break;
- default: break;
- }
- curl_setopt($curl, CURLOPT_HTTPHEADER, $headers);
- curl_setopt($curl, CURLOPT_HEADER, false);
-
- curl_setopt($curl, CURLOPT_URL, $url);
- curl_setopt($curl, CURLOPT_RETURNTRANSFER, false);
- curl_setopt($curl, CURLOPT_WRITEFUNCTION, array(&$this, '__responseWriteCallback'));
- curl_setopt($curl, CURLOPT_FOLLOWLOCATION, true);
-
- // Execute, grab errors
- if (curl_exec($curl)) {
- $this->response->code = curl_getinfo($curl, CURLINFO_HTTP_CODE);
- } else {
- $this->response->error = array(
- 'curl' => true,
- 'code' => curl_errno($curl),
- 'message' => curl_error($curl),
- 'resource' => $this->resource
- );
- }
-
- @curl_close($curl);
-
- // Parse body into XML
- if ($this->response->error === false && isset($this->response->body)) {
- $this->response->body = simplexml_load_string($this->response->body);
-
- // Grab SES errors
- if (!in_array($this->response->code, array(200, 201, 202, 204))
- && isset($this->response->body->Error)) {
- $error = $this->response->body->Error;
- $output = array();
- $output['curl'] = false;
- $output['Error'] = array();
- $output['Error']['Type'] = (string)$error->Type;
- $output['Error']['Code'] = (string)$error->Code;
- $output['Error']['Message'] = (string)$error->Message;
- $output['RequestId'] = (string)$this->response->body->RequestId;
-
- $this->response->error = $output;
- unset($this->response->body);
- }
- }
-
- return $this->response;
- }
-
- /**
- * CURL write callback
- *
- * @param resource &$curl CURL resource
- * @param string &$data Data
- * @return integer
- */
- private function __responseWriteCallback(&$curl, &$data) {
- $this->response->body .= $data;
- return strlen($data);
- }
-
- /**
- * Contributed by afx114
- * URL encode the parameters as per http://docs.amazonwebservices.com/AWSECommerceService/latest/DG/index.html?Query_QueryAuth.html
- * PHP's rawurlencode() follows RFC 1738, not RFC 3986 as required by Amazon. The only difference is the tilde (~), so convert it back after rawurlencode
- * See: http://www.morganney.com/blog/API/AWS-Product-Advertising-API-Requires-a-Signed-Request.php
- *
- * @param string $var String to encode
- * @return string
- */
- private function __customUrlEncode($var) {
- return str_replace('%7E', '~', rawurlencode($var));
- }
-
- /**
- * Generate the auth string using Hmac-SHA256
- *
- * @internal Used by SimpleDBRequest::getResponse()
- * @param string $string String to sign
- * @return string
- */
- private function __getSignature($string) {
- return base64_encode(hash_hmac('sha256', $string, $this->ses->getSecretKey(), true));
- }
-}
-
-
-final class SimpleEmailServiceMessage {
-
- // these are public for convenience only
- // these are not to be used outside of the SimpleEmailService class!
- public $to, $cc, $bcc, $replyto;
- public $from, $returnpath;
- public $subject, $messagetext, $messagehtml;
- public $subjectCharset, $messageTextCharset, $messageHtmlCharset;
-
- function __construct() {
- $to = array();
- $cc = array();
- $bcc = array();
- $replyto = array();
-
- $from = null;
- $returnpath = null;
-
- $subject = null;
- $messagetext = null;
- $messagehtml = null;
-
- $subjectCharset = null;
- $messageTextCharset = null;
- $messageHtmlCharset = null;
- }
-
-
- /**
- * addTo, addCC, addBCC, and addReplyTo have the following behavior:
- * If a single address is passed, it is appended to the current list of addresses.
- * If an array of addresses is passed, that array is merged into the current list.
- */
- function addTo($to) {
- if(!is_array($to)) {
- $this->to[] = $to;
- }
- else {
- $this->to = array_merge($this->to, $to);
- }
- }
-
- function addCC($cc) {
- if(!is_array($cc)) {
- $this->cc[] = $cc;
- }
- else {
- $this->cc = array_merge($this->cc, $cc);
- }
- }
-
- function addBCC($bcc) {
- if(!is_array($bcc)) {
- $this->bcc[] = $bcc;
- }
- else {
- $this->bcc = array_merge($this->bcc, $bcc);
- }
- }
-
- function addReplyTo($replyto) {
- if(!is_array($replyto)) {
- $this->replyto[] = $replyto;
- }
- else {
- $this->replyto = array_merge($this->replyto, $replyto);
- }
- }
-
- function setFrom($from) {
- $this->from = $from;
- }
-
- function setReturnPath($returnpath) {
- $this->returnpath = $returnpath;
- }
-
- function setSubject($subject) {
- $this->subject = $subject;
- }
-
- function setSubjectCharset($charset) {
- $this->subjectCharset = $charset;
- }
-
- function setMessageFromString($text, $html = null) {
- $this->messagetext = $text;
- $this->messagehtml = $html;
- }
-
- function setMessageFromFile($textfile, $htmlfile = null) {
- if(file_exists($textfile) && is_file($textfile) && is_readable($textfile)) {
- $this->messagetext = file_get_contents($textfile);
- }
- if(file_exists($htmlfile) && is_file($htmlfile) && is_readable($htmlfile)) {
- $this->messagehtml = file_get_contents($htmlfile);
- }
- }
-
- function setMessageFromURL($texturl, $htmlurl = null) {
- $this->messagetext = file_get_contents($texturl);
- if($htmlurl !== null) {
- $this->messagehtml = file_get_contents($htmlurl);
- }
- }
-
- function setMessageCharset($textCharset, $htmlCharset = null) {
- $this->messageTextCharset = $textCharset;
- $this->messageHtmlCharset = $htmlCharset;
- }
-
- /**
- * Validates whether the message object has sufficient information to submit a request to SES.
- * This does not guarantee the message will arrive, nor that the request will succeed;
- * instead, it makes sure that no required fields are missing.
- *
- * This is used internally before attempting a SendEmail or SendRawEmail request,
- * but it can be used outside of this file if verification is desired.
- * May be useful if e.g. the data is being populated from a form; developers can generally
- * use this function to verify completeness instead of writing custom logic.
- *
- * @return boolean
- */
- public function validate() {
- if(count($this->to) == 0)
- return false;
- if($this->from == null || strlen($this->from) == 0)
- return false;
- if($this->messagetext == null)
- return false;
- return true;
- }
-}
-
--- a/lib/staticmaplite/.gitignore
+++ /dev/null
@@ -1,4 +1,1 @@
-cache/tiles
-cache/map
-cache/maps
--- a/lib/staticmaplite/images/markers/GPlotter - Make Google Maps Easily.URL
+++ /dev/null
@@ -1,3 +1,1 @@
-[InternetShortcut]
-URL=http://gplotter.offwhite.net/
--- a/lib/staticmaplite/images/markers/Google Maps Icons, Free!.URL
+++ /dev/null
@@ -1,3 +1,1 @@
-[InternetShortcut]
-URL=http://brennan.offwhite.net/blog/2005/07/23/new-google-maps-icons-free/
Binary files a/lib/staticmaplite/images/markers/Thumbs.db and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconb.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconb1.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconb10.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconb11.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconb12.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconb13.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconb14.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconb15.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconb16.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconb17.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconb18.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconb19.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconb2.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconb20.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconb21.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconb22.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconb23.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconb24.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconb25.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconb3.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconb4.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconb5.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconb6.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconb7.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconb8.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconb9.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/icong.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/icong1.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/icong10.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/icong11.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/icong12.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/icong13.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/icong14.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/icong15.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/icong16.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/icong17.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/icong18.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/icong19.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/icong2.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/icong20.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/icong21.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/icong22.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/icong23.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/icong24.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/icong25.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/icong3.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/icong4.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/icong5.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/icong6.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/icong7.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/icong8.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/icong9.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconr.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconr1.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconr10.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconr11.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconr12.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconr13.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconr14.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconr15.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconr16.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconr17.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconr18.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconr19.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconr2.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconr20.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconr21.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconr22.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconr23.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconr24.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconr25.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconr3.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconr4.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconr5.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconr6.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconr7.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconr8.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/iconr9.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/icons.psd and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/lightblue1.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/lightblue2.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/lightblue3.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/lightblue4.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/lightblue5.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/ol-marker-blue.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/ol-marker-gold.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/ol-marker-green.png and /dev/null differ
Binary files a/lib/staticmaplite/images/markers/ol-marker.png and /dev/null differ
Binary files a/lib/staticmaplite/images/osm_logo.png and /dev/null differ
--- a/lib/staticmaplite/index.html
+++ /dev/null
@@ -1,122 +1,1 @@
-<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN"
- "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
-<html xmlns="http://www.w3.org/1999/xhtml" xml:lang="de-de" lang="de-de">
-<head>
- <!--
- CSS based on template of Dandelion wiki engine by Radomir Dopieralski who released this
- template under the terms of GNU GPL. http://dandelion.sheep.art.pl/
- -->
- <meta http-equiv="content-type" content="text/html; charset=utf-8" />
- <title>staticMapLite</title>
- <style type="text/css">
-html{font:96% sans-serif;color:#000;background:#f7f7f7;line-height:1.4;}
-body{color:#333;}
-#wrapper{margin:auto;width:60em;position:relative;}
-#header{padding:0px 0px 7px 0px; height: 1em;}
-#header h1 { float:left; width: 40%; }
-#content{background:white;padding:1em;border:1px solid #e0d78a;outline:0.5em solid #fef4a4; margin:0.5em 0;padding:20px;min-height:20em;}
-h1{margin-top:0px;}
-h1,h2,h3,h4,h5,h6{letter-spacing:0.05em;color:#1474CA;font-weight:normal;}
-h1 a:hover,h2 a:hover,h3 a:hover,h4 a:hover,h5 a:hover,h6 a:hover{text-decoration:none;}
-a{color:#1474CA;text-decoration:none;}
-a:visited{color:#1474CA;}
-a.pending{color:#c174a0;}
-a:hover{text-decoration:underline;}
-a img{border:none;}
-input,textarea{font-size:94%;border:1px solid #999;background:#fff;color:#666;outline:0.2em solid #eee;padding:0px;line-height:1.2;margin:0.5em;vertical-align:middle;}
-textarea{display:block;margin:0.5em auto;width:100%;}
-pre{outline:0.4em solid #eee;padding:0.5em;margin:0.5em;border:1px solid #e0d78a;background:#fef4a4;color:#644e22;}
-img{border:1px solid #ccc;outline:0.25em solid #eee;padding:0.25em;margin:0.25em 0 0.25em 0.5em;background:#fff;}
-hr{height:0;border:none;color:#fff;background:transparent;border-bottom:1px solid #ccc; margin:0.5em 0;}
-#diff {outline:none;border:none;}
-#diff ins{color:green;text-decoration:none;font-weight:bold;}
-#diff del{color:red;text-decoration:line-through;}
-#diff{background:#fff;line-height:1.25;padding:1em;white-space:pre-wrap;word-wrap:break-word; white-space:-moz-pre-wrap;white-space:-pre-wrap;white-space:-o-pre-wrap;width:97%;}
-hr{margin:10px 0 10px 0;height:0px;overflow:hidden;border:0px;border-top:2px solid #ccc;}
-.error{color:#F25A5A;font-weight:bold;}
-form{display:inline;}
-#contentTextarea{height:44em;}
-#toc{margin:5px 0 5px 10px;padding:6px 5px 7px 0px;float:right;list-style:none;outline:0.4em solid #eee;background:#fef4a4;border:1px solid #e0d78a;}
-#toc ul{list-style:none;padding:3px 0 3px 10px;}
-#toc li{font-size:11px;padding-left:10px;}
-#toc ul li{font-size:10px;}
-#toc ul ul li{font-size:9px;}
-#toc ul ul ul li{font-size:8px;}
-#toc ul ul ul ul li{font-size:7px;}
-.pageVersionsList{letter-spacing:0px;font-variant:normal;font-size:12px;}
-#renameForm{float:left;}
-.clear{clear:both;}
-.tagList{padding:0.2em 0.4em 0.2em 0.4em;margin-top:0.5em;border:1px dashed #e0d78a;background:#fef4a4;color:#644e22;}
-.tagCloud{float:right;width:200px;padding:0.5em;margin:1em;border:1px dashed #e0d78a;background:#fef4a4;color:#644e22;}
-#fileTable{border-collapse:collapse;}
-#fileTable td{border:1px solid #FEF4A4;padding:2px 6px 2px 6px;}
-h2 span.par-edit, h3 span.par-edit, h4 span.par-edit, h5 span.par-edit, h6 span.par-edit {display:none;}
-h2:hover span.par-edit, h3:hover span.par-edit, h4:hover span.par-edit, h5:hover span.par-edit, h6:hover span.par-edit {display:inline;font-size:x-small;}
-.comment-item { border:1px solid #999;color:#666;outline:0.2em solid #eee; }
-.resizeTextareaDiv { margin-top: 5px;}
-a.toolbarTextareaItem { padding-right: 10px; }
-a.external:after { content: "\2197";}
- </style>
- </head>
-<body>
- <div id="wrapper">
- <div id="header">
- </div>
- <div id="content">
-
- <div class="par-div">
- <h2>
- staticMapLite - simple map for your website
- </h2>
- <p>
- <img src="staticmap.php?center=40.714728,-73.998672&zoom=14&size=865x512&maptype=mapnik" width="865" height="512" /></p>
- <p>
- This image was created using the following simple <img> tag:
-<pre><img src="staticmap.php?center=40.714728,-73.998672&zoom=14&size=865x512&maptype=mapnik" /></pre>
- </p>
- </div>
- <hr />
- <div class="par-div">
- <h3>
- Place Markers
- </h3>
-
- <p>
- <img src="staticmap.php?center=40.714728,-73.998672&zoom=14&size=865x512&maptype=mapnik&markers=40.702147,-74.015794,lightblue1|40.711614,-74.012318,lightblue2|40.718217,-73.998284,lightblue3" width="865" height="512" />
-</p><p> Add markers by appending them to the image URL:
-<pre>markers=40.702147,-74.015794,lightblue1|40.711614,-74.012318,lightblue2|40.718217,-73.998284,lightblue3</pre>
- </p>
- </div>
- <hr />
- <div class="par-div">
- <h3>
- Use Different Map Styles (Tile Sources)
- </h3>
-
- <p>
- <div style="float:left; margin-right: 10px">
- <img src="staticmap.php?center=40.714728,-73.998672&zoom=14&size=256x256&maptype=mapnik" width="256" height="256" />
- <pre>maptype=mapnik</pre>
- </div>
- <div style="float:left; margin-right: 10px">
- <img src="staticmap.php?center=40.714728,-73.998672&zoom=14&size=256x256&maptype=osmarenderer" width="256" height="256" />
- <pre>maptype=osmarenderer</pre>
- </div>
- <div style="float:left; margin-right: 10px">
- <img src="staticmap.php?center=40.714728,-73.998672&zoom=14&size=256x256&maptype=cycle" width="256" height="256" />
- <pre>maptype=cycle</pre>
- </div>
- <br style="clear:both" />
- </p>
- </div>
-
- </div>
- <div id="footer">
- <div style="text-align:center;padding:7px;color:#ccc">
- sponsored by <a href="http://dfacts.de">dFacts Network</a>
- </div>
- </div>
-</div>
-</body>
-</html>
--- a/lib/staticmaplite/selinux-fix.sh
+++ /dev/null
@@ -1,3 +1,1 @@
-chcon -R -t httpd_sys_content_rw_t cache
-
--- a/lib/staticmaplite/staticmap.php
+++ /dev/null
@@ -1,273 +1,1 @@
-<?php
-/**
- * staticMapLite 0.02
- *
- * Copyright 2009 Gerhard Koch
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- * http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- *
- * @author Gerhard Koch <gerhard.koch AT ymail.com>
- *
- * USAGE:
- *
- * staticmap.php?center=40.714728,-73.998672&zoom=14&size=512x512&maptype=mapnik&markers=40.702147,-74.015794,blues|40.711614,-74.012318,greeng|40.718217,-73.998284,redc
- *
- */
-
-error_reporting(0);
-ini_set('display_errors','off');
-
-Class staticMapLite {
-
- protected $tileSize = 256;
- protected $tileSrcUrl = array( 'mapnik' => 'http://tile.openstreetmap.org/{Z}/{X}/{Y}.png',
- 'osmarenderer' => 'http://c.tah.openstreetmap.org/Tiles/tile/{Z}/{X}/{Y}.png',
- 'cycle' => 'http://c.andy.sandbox.cloudmade.com/tiles/cycle/{Z}/{X}/{Y}.png'
- );
-
- protected $tileDefaultSrc = 'mapnik';
- protected $markerBaseDir = 'images/markers';
- protected $osmLogo = 'images/osm_logo.png';
-
- protected $useTileCache = true;
- protected $tileCacheBaseDir = './cache/tiles';
-
- protected $useMapCache = true;
- protected $mapCacheBaseDir = './cache/maps';
- protected $mapCacheID = '';
- protected $mapCacheFile = '';
- protected $mapCacheExtension = 'png';
-
- protected $zoom, $lat, $lon, $width, $height, $markers, $image, $maptype;
- protected $centerX, $centerY, $offsetX, $offsetY;
-
- public function __construct(){
- $this->zoom = 0;
- $this->lat = 0;
- $this->lon = 0;
- $this->width = 500;
- $this->height = 350;
- $this->markers = array();
- $this->maptype = $this->tileDefaultSrc;
- }
-
- public function parseParams(){
- global $_GET;
-
- // get zoom from GET paramter
- $this->zoom = $_GET['zoom']?intval($_GET['zoom']):0;
- if($this->zoom>18)$this->zoom = 18;
-
- // get lat and lon from GET paramter
- list($this->lat,$this->lon) = split(',',$_GET['center']);
- $this->lat = floatval($this->lat);
- $this->lon = floatval($this->lon);
-
- // get zoom from GET paramter
- if($_GET['size']){
- list($this->width, $this->height) = split('x',$_GET['size']);
- $this->width = intval($this->width);
- $this->height = intval($this->height);
- }
- if($_GET['markers']){
- $markers = split('%7C|\|',$_GET['markers']);
- foreach($markers as $marker){
- list($markerLat, $markerLon, $markerImage) = split(',',$marker);
- $markerLat = floatval($markerLat);
- $markerLon = floatval($markerLon);
- $markerImage = basename($markerImage);
- $this->markers[] = array('lat'=>$markerLat, 'lon'=>$markerLon, 'image'=>$markerImage);
- }
-
- }
- if($_GET['maptype']){
- if(array_key_exists($_GET['maptype'],$this->tileSrcUrl)) $this->maptype = $_GET['maptype'];
- }
- }
-
- public function lonToTile($long, $zoom){
- return (($long + 180) / 360) * pow(2, $zoom);
- }
-
- public function latToTile($lat, $zoom){
- return (1 - log(tan($lat * pi()/180) + 1 / cos($lat* pi()/180)) / pi()) /2 * pow(2, $zoom);
- }
-
- public function initCoords(){
- $this->centerX = $this->lonToTile($this->lon, $this->zoom);
- $this->centerY = $this->latToTile($this->lat, $this->zoom);
- $this->offsetX = floor((floor($this->centerX)-$this->centerX)*$this->tileSize);
- $this->offsetY = floor((floor($this->centerY)-$this->centerY)*$this->tileSize);
- }
-
- public function createBaseMap(){
- $this->image = imagecreatetruecolor($this->width, $this->height);
- $startX = floor($this->centerX-($this->width/$this->tileSize)/2);
- $startY = floor($this->centerY-($this->height/$this->tileSize)/2);
- $endX = ceil($this->centerX+($this->width/$this->tileSize)/2);
- $endY = ceil($this->centerY+($this->height/$this->tileSize)/2);
- $this->offsetX = -floor(($this->centerX-floor($this->centerX))*$this->tileSize);
- $this->offsetY = -floor(($this->centerY-floor($this->centerY))*$this->tileSize);
- $this->offsetX += floor($this->width/2);
- $this->offsetY += floor($this->height/2);
- $this->offsetX += floor($startX-floor($this->centerX))*$this->tileSize;
- $this->offsetY += floor($startY-floor($this->centerY))*$this->tileSize;
-
- for($x=$startX; $x<=$endX; $x++){
- for($y=$startY; $y<=$endY; $y++){
- $url = str_replace(array('{Z}','{X}','{Y}'),array($this->zoom, $x, $y), $this->tileSrcUrl[$this->maptype]);
- $tileImage = imagecreatefromstring($this->fetchTile($url));
- $destX = ($x-$startX)*$this->tileSize+$this->offsetX;
- $destY = ($y-$startY)*$this->tileSize+$this->offsetY;
- imagecopy($this->image, $tileImage, $destX, $destY, 0, 0, $this->tileSize, $this->tileSize);
- }
- }
- }
-
-
- public function placeMarkers(){
- foreach($this->markers as $marker){
- $markerLat = $marker['lat'];
- $markerLon = $marker['lon'];
- $markerImage = $marker['image'];
- $markerIndex++;
- $markerFilename = $markerImage?(file_exists($this->markerBaseDir.'/'.$markerImage.".png")?$markerImage:'lightblue'.$markerIndex):'lightblue'.$markerIndex;
- if(file_exists($this->markerBaseDir.'/'.$markerFilename.".png")){
- $markerImg = imagecreatefrompng($this->markerBaseDir.'/'.$markerFilename.".png");
- } else {
- $markerImg = imagecreatefrompng($this->markerBaseDir.'/lightblue1.png');
- }
- $destX = floor(($this->width/2)-$this->tileSize*($this->centerX-$this->lonToTile($markerLon, $this->zoom)));
- $destY = floor(($this->height/2)-$this->tileSize*($this->centerY-$this->latToTile($markerLat, $this->zoom)));
- $destY = $destY - imagesy($markerImg);
-
- imagecopy($this->image, $markerImg, $destX, $destY, 0, 0, imagesx($markerImg), imagesy($markerImg));
-
- };
-}
-
-
-
- public function tileUrlToFilename($url){
- return $this->tileCacheBaseDir."/".str_replace(array('http://'),'',$url);
- }
-
- public function checkTileCache($url){
- $filename = $this->tileUrlToFilename($url);
- if(file_exists($filename)){
- return file_get_contents($filename);
- }
- }
-
- public function checkMapCache(){
- $this->mapCacheID = md5($this->serializeParams());
- $filename = $this->mapCacheIDToFilename();
- if(file_exists($filename)) return true;
- }
-
- public function serializeParams(){
- return join("&",array($this->zoom,$this->lat,$this->lon,$this->width,$this->height, serialize($this->markers),$this->maptype));
- }
-
- public function mapCacheIDToFilename(){
- if(!$this->mapCacheFile){
- $this->mapCacheFile = $this->mapCacheBaseDir."/".substr($this->mapCacheID,0,2)."/".substr($this->mapCacheID,2,2)."/".substr($this->mapCacheID,4);
- }
- return $this->mapCacheFile.".".$this->mapCacheExtension;
- }
-
-
-
- public function mkdir_recursive($pathname, $mode){
- return mkdir($pathname, $mode, true);
- }
- public function writeTileToCache($url, $data){
- $filename = $this->tileUrlToFilename($url);
- $this->mkdir_recursive(dirname($filename),0777);
- file_put_contents($filename, $data);
- }
-
- public function fetchTile($url){
- if($this->useTileCache && ($cached = $this->checkTileCache($url))) return $cached;
- $ch = curl_init();
- curl_setopt($ch, CURLOPT_RETURNTRANSFER, 1);
- curl_setopt($ch, CURLOPT_USERAGENT, "Mozilla/4.0");
- curl_setopt($ch, CURLOPT_URL, $url);
- $tile = curl_exec($ch);
- curl_close($ch);
- if($this->useTileCache){
- $this->writeTileToCache($url,$tile);
- }
- return $tile;
-
- }
-
- public function copyrightNotice(){
- $logoImg = imagecreatefrompng($this->osmLogo);
- imagecopy($this->image, $logoImg, imagesx($this->image)-imagesx($logoImg), imagesy($this->image)-imagesy($logoImg), 0, 0, imagesx($logoImg), imagesy($logoImg));
-
- }
-
- public function sendHeader(){
- header('Content-Type: image/png');
- $expires = 60*60*24*14;
- header("Pragma: public");
- header("Cache-Control: maxage=".$expires);
- header('Expires: ' . gmdate('D, d M Y H:i:s', time()+$expires) . ' GMT');
- }
-
- public function makeMap(){
- $this->initCoords();
- $this->createBaseMap();
- if(count($this->markers))$this->placeMarkers();
- if($this->osmLogo) $this->copyrightNotice();
- }
-
- public function showMap(){
- $this->parseParams();
- if($this->useMapCache){
- // use map cache, so check cache for map
- if(!$this->checkMapCache()){
- // map is not in cache, needs to be build
- $this->makeMap();
- $this->mkdir_recursive(dirname($this->mapCacheIDToFilename()),0777);
- imagepng($this->image,$this->mapCacheIDToFilename(),9);
- $this->sendHeader();
- if(file_exists($this->mapCacheIDToFilename())){
- return file_get_contents($this->mapCacheIDToFilename());
- } else {
- return imagepng($this->image);
- }
- } else {
- // map is in cache
- $this->sendHeader();
- return file_get_contents($this->mapCacheIDToFilename());
- }
-
- } else {
- // no cache, make map, send headers and deliver png
- $this->makeMap();
- $this->sendHeader();
- return imagepng($this->image);
-
- }
- }
-
-}
-
-$map = new staticMapLite();
-print $map->showMap();
-
-?>
-
--- /dev/null
+++ b/myway/index.php
@@ -1,1 +1,55 @@
+<?php
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
+include ('../include/common.inc.php');
+
+include_header("MyWay Balance and Timeliness Survey Results", "index");
+if ($_SESSION['authed'] == true) {
+ echo '<ul data-role="listview" data-theme="e" data-groupingtheme="e">
+ <li data-role="list-divider" > Admin Features </li>
+ <li><a href="myway_timeliness_calculate.php"><h3>myway_timeliness_calculate</h3>
+ <p>myway_timeliness_calculate</p></a></li>
+ <li><a href="myway_timeliness_reconcile.php"><h3>myway_timeliness_reconcile</h3>
+ <p>myway_timeliness_reconcile</p></a></li>
+ </ul>';
+}
+?>
+<ul data-role="listview" data-theme="e" data-groupingtheme="e">
+ <li data-role="list-divider" >MyWay Balance </li>
+ <li><a href="mywaybalance.php"><h3>Mobile viewer for MyWay balance</h3>
+ <p>Warning! No HTTPS security.</p></a></li>
+</ul>
+<ul data-role="listview" data-theme="e" data-groupingtheme="e">
+
+ <li data-role="list-divider" > MyWay Timeliness Graphs </li>
+
+ <li><a href="myway_timeliness_overview.php"><h3>Timeliness Overview</h3>
+ <p>Displays statistics on timeliness split by day/time/month/stop etc.</p></a></li>
+ <li><a href="myway_timeliness.php"><h3>Timeliness over Day</h3>
+ <p>Displays the deviation from the timetable over the day</p></a></li>
+ <li><a href="myway_timeliness_freqdist.php"><h3>Frequency Distribution of Time Deviation</h3>
+ <p>Displays spread of time deviations</p></a></li>
+ <li><a href="myway_timeliness_route.php"><h3>Timeliness over Route</h3>
+ <p>Displays the deviation from timetable as a specific route progresses</p></a></li>
+ <li><a href="myway_timeliness_stop.php"><h3>Timeliness at Stop</h3>
+ <p>Displays the deviation from the timetable at a specific stop</p></a></li>
+</ul>
+</div>
+<?php
+include_footer()
+?>
+
+
--- /dev/null
+++ b/myway/myway_api.json.php
@@ -1,1 +1,164 @@
+<?php
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
+
+function cleanString($subject) {
+ $subject = str_replace(" ", " ", $subject);
+ $subject = str_replace("&", "&", $subject);
+ $subject = preg_replace('/[^\r\n\t\x20-\x7E\xA0-\xFF]/', '', $subject);
+ $subject = str_replace(" ", " ", $subject);
+ return trim($subject);
+}
+
+$return = Array();
+/* if (file_exists("mywayresponse.txt")) {
+ @$fh = fopen("mywayresponse.txt", 'r');
+ if ($fh) {
+ $pageHTML = fread($fh, filesize("mywayresponse.txt"));
+ fclose($fh);
+ }
+ } */
+//set POST variables
+$url = 'https://www.transport.act.gov.au/ARTS/use_Funcs.asp';
+//$url = 'http://localhost/myway.html';
+$field_mapping = Array(
+ "card_number" => "SRNO",
+ "DOBmonth" => "month",
+ "DOBday" => "day",
+ "DOByear" => "year",
+ "secret_answer" => "pwrd",
+ "button" => "Submit"
+);
+foreach (Array(
+"card_number",
+ "DOBday",
+ "DOBmonth",
+ "DOByear"
+) as $field_name) {
+ if (isset($_REQUEST[$field_name])) {
+ $fields[$field_name] = filter_var($_REQUEST[$field_name], FILTER_SANITIZE_NUMBER_INT);
+ } else {
+ $return["error"][] = $field_name . " parameter invalid or unspecified";
+ }
+}
+if (isset($_REQUEST['secret_answer'])) {
+ $fields['secret_answer'] = filter_var($_REQUEST['secret_answer'], FILTER_SANITIZE_STRING, Array(
+ FILTER_FLAG_NO_ENCODE_QUOTES,
+ FILTER_FLAG_STRIP_HIGH,
+ FILTER_FLAG_STRIP_LOW
+ ));
+} else {
+ $return["error"][] = "secret_answer parameter invalid or unspecified";
+}
+$fields['button'] = 'Submit';
+$fields_string = "";
+//url-ify the data for the POST
+foreach ($fields as $key => $value) {
+ if (sizeof($value) === 0)
+ $return['error'][] = $key . " parameter invalid or unspecified";
+ $fields_string.= $field_mapping[$key] . '=' . $value . '&';
+}
+$fields_string = rtrim($fields_string, '&');
+if (!isset($return['error'])) {
+ //open connection
+ $ch = curl_init();
+ //set the url, number of POST vars, POST data
+ curl_setopt($ch, CURLOPT_URL, $url);
+ curl_setopt($ch, CURLOPT_POST, count($fields));
+ curl_setopt($ch, CURLOPT_POSTFIELDS, $fields_string);
+ curl_setopt($ch, CURLOPT_RETURNTRANSFER, 1);
+ curl_setopt($ch, CURLOPT_REFERER, "https://www.transport.act.gov.au/ARTS/getbalance.asp");
+ curl_setopt($ch, CURLOPT_HEADER, 0);
+ curl_setopt($ch, CURLOPT_TIMEOUT, 30);
+ // ssl ignore
+ curl_setopt($ch, CURLOPT_SSL_VERIFYPEER, false);
+ curl_setopt($ch, CURLOPT_SSL_VERIFYHOST, 2);
+ //execute post
+ $pageHTML = curl_exec($ch);
+ if (curl_errno($ch))
+ $return["error"][] = "Network error " . curl_errno($ch) . " " . curl_error($ch) . " " . $url . $fields_string;
+ //close connection
+ curl_close($ch);
+}
+
+function parseTable($table,$tableName) {
+ global $return;
+ $tableColumns = Array();
+ $tableColumnNum = 0;
+ foreach ($table->find("th") as $th) {
+ $tableColumns[$tableColumnNum] = cleanString($th->plaintext);
+ $tableColumnNum++;
+ }
+ //print_r($tableColumns);
+ $tableRowNum = 0;
+ foreach ($table->find("tr") as $tr) {
+ $tableColumnNum = 0;
+ foreach ($tr->find("td") as $td) {
+ if ($tableName == "myway_carddetails") {
+ // first table has card/cardholder details
+ $return[$tableName][$tableColumns[$tableColumnNum]] = cleanString($td->plaintext);
+ } else {
+ // second table has transactions
+
+ if ($tableColumns[$tableColumnNum] == "TX Reference No / Type") {
+ $return[$tableName][$tableRowNum]["TX Reference No"] = substr(cleanString($td->plaintext), 0, 6);
+ $return[$tableName][$tableRowNum]["TX Type"] = substr(cleanString($td->plaintext), 7);
+ } else {
+ $return[$tableName][$tableRowNum][$tableColumns[$tableColumnNum]] = cleanString($td->plaintext);
+ }
+ }
+ //print_r($return);
+ $tableColumnNum++;
+ }
+ $tableRowNum++;
+ }
+}
+
+if (!isset($return['error'])) {
+ include_once ('../lib/simple_html_dom.php');
+ //print_r($pageHTML);
+ $page = str_get_html($pageHTML);
+ $pageAlerts = $page->find(".smartCardAlert");
+ if (sizeof($pageAlerts) > 0) {
+ $return['error'][] = $pageAlerts[0]->plaintext;
+ }
+ if (!isset($return['error'])) {
+ $tables = $page->find(".type3");
+ parseTable($tables[0], "myway_carddetails");
+
+ $tables = $page->find(".type2");
+ parseTable($tables[0], "myway_transactions");
+
+ }
+}
+if (sizeof($return) == 0) {
+ $return['error'][] = "No data extracted from MyWay website - API may be out of date";
+}
+if (basename(__FILE__) == "myway_api.json.php") {
+ header('Content-Type: text/javascript; charset=utf8');
+// header('Access-Control-Allow-Origin: http://bus.lambdacomplex.org/');
+ header('Access-Control-Max-Age: 3628800');
+ header('Access-Control-Allow-Methods: GET, POST, PUT, DELETE');
+ if (isset($_GET['callback'])) {
+ $json = '(' . json_encode($return) . ');'; //must wrap in parens and end with semicolon
+ print_r($_GET['callback'] . $json); //callback is prepended for json-p
+ }
+ else
+ echo json_encode($return);
+}
+?>
+
--- /dev/null
+++ b/myway/myway_timeliness.php
@@ -1,1 +1,114 @@
+<?php
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
+include ('../include/common.inc.php');
+include_header("MyWay Deltas", "mywayDelta");
+?>
+<!--[if lt IE 9]>
+ <script type="text/javascript" src="../js/FlashCanvas/bin/flashcanvas.js"></script>
+ <![endif]-->
+ <script type="text/javascript" src="../js/flotr2/flotr2.min.js"></script>
+<center><div id="placeholder" style="width:900px;height:550px"></div></center>
+<script type="text/javascript">
+ $(function () {
+ var d = new Date();
+ d.setUTCMinutes(0);
+ d.setUTCHours(0);
+ var midnight = d.getTime();
+
+<?php
+$query = "select * from myway_timingdeltas where abs(timing_delta) < 2*(select stddev(timing_delta) from myway_timingdeltas) order by route_name;";
+$query = $conn->prepare($query);
+$query->execute();
+if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+}
+$i = 0;
+$labels = Array();
+$lastRoute = "";
+foreach ($query->fetchAll() as $delta) {
+ /*$routeIDParts = explode(" ",$delta['route_name']);
+ $routeNumber = $routeIDParts[0];
+ $routeDirection = $routeIDParts[1];
+ if (preg_match('/31./',$routeName)) {
+ $routeName = "312-319"." ".$routeDirection;
+ } else {
+ $routeName = $delta['route_name'];
+ }*/
+
+ $routeName = $delta['route_name'];
+
+ if (preg_match('/31./',$routeName)) {
+ $routeName = "312-319";
+ } else {
+ $routeName = preg_replace('/\D/', '', $routeName);
+ }
+ if ($routeName != $lastRoute) {
+ $i++;
+ echo " var d$i = [];";
+ $lastRoute = $routeName;
+ $labels[$i] = $routeName;
+ }
+ echo "d$i.push([ midnight+ (1000*" . midnight_seconds(strtotime($delta['time'])) . "), " . intval($delta['timing_delta']) . "]); \n";
+};
+?>
+
+ var placeholder = document.getElementById("placeholder");
+
+ var plot = Flotr.draw(placeholder, [
+<?php
+foreach ($labels as $key => $label) {
+ echo " {
+ data: d$key,
+ points: { show: true },
+ label: '$label'
+ },";
+}
+?>
+ ],
+ {
+ xaxis: {
+ mode: "time",
+ min: midnight + (1000*60*60*5.6),
+ max: midnight + (1000*60*60*23.5)
+
+ },
+ yaxis: {
+ tickFormatter: yformatter,
+ min: -60*8,
+ max: 60*8
+ },
+ mouse: { track: true, relative: true, trackFormatter: showTooltip}
+ });
+
+ });
+ function yformatter(v) {
+ if (Math.floor(v/60) < -9) return "";
+ return Math.abs(Math.floor(v/60)) + " min " + (v == 0 ? "" : (v >0 ? "early":"late"))
+ }
+ function showTooltip(point) {
+
+
+ var d = new Date();
+ d.setTime(point.x);
+ var time = d.getUTCHours() +':'+ (d.getUTCMinutes().toString().length == 1 ? '0'+ d.getMinutes(): d.getUTCMinutes())
+
+
+ return point.series.label + " at "+ time +" = " + Math.abs(new Number(point.y/60).toFixed(2))+" minutes "+(point.y >0 ? "early":"late");
+ }
+
+</script>
--- /dev/null
+++ b/myway/myway_timeliness_calculate.php
@@ -1,1 +1,183 @@
+<?php
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
+include ('../include/common.inc.php');
+include_header("MyWay Delta Calculate", "mywayDeltaCalc");
+flush();
+ob_flush();
+
+function abssort($a, $b) {
+ if ($a['timeDiff'] == $b['timeDiff']) {
+ return 0;
+ }
+ return (abs($a['timeDiff']) < abs($b['timeDiff'])) ? -1 : 1;
+}
+
+//collect all observation not in delta
+$query = "select * from myway_observations INNER JOIN myway_stops
+ON myway_observations.myway_stop=myway_stops.myway_stop INNER JOIN myway_routes
+ON myway_observations.myway_route=myway_routes.myway_route
+ WHERE observation_id NOT IN
+(
+SELECT observation_id
+FROM myway_timingdeltas
+)";
+debug($query, "database");
+$query = $conn->prepare($query);
+$query->execute();
+if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+}
+$uncalcdObservations = $query->fetchAll();
+//Display count
+echo "<h3>" . sizeof($uncalcdObservations) . " observations not yet processed</h2>";
+//foreach observation not in delta
+foreach ($uncalcdObservations as $obsv) {
+ //var_dump($obsv);
+ echo "<h3>Observation {$obsv['observation_id']}:</h1>
+<small>{$obsv['myway_stop']} @ {$obsv['time']} on {$obsv['myway_route']}</small><br>";
+ // convert timestamp into time of day and date
+// timezones from http://www.postgresql.org/docs/8.0/static/datetime-keywords.html
+ $time = date("H:i:s", strtotime($obsv['time']));
+ $time_tz = date("H:i:s", strtotime($obsv['time'])) . " AESST";
+ $search_time = date("H:i:s", strtotime($obsv['time']) - (60 * 60)); // 30 minutes margin
+ $date = date("c", strtotime($obsv['time']));
+ $timing_period = service_period(strtotime($date));
+
+ // little hack for public holidays nolonger active; weekdays and 900+ route numbers don't make sense
+ if ($timing_period == "weekday" && preg_match('/9../',$obsv["route_short_name"])) {
+ echo "Potential public holiday detected, trying Sunday timetable.<br>";
+
+ $timing_period = "sunday";
+ }
+
+ if (isset($obsv["stop_id"]) && $obsv["stop_id"] != "" && $obsv["stop_id"] != "*") {
+ $potentialStops = Array(getStop($obsv["stop_id"]));
+ } else {
+ echo "No stop_id recorded for this stop_name, potential stops are a bus station<br>";
+ $potentialStops = getStops("", trim(str_replace(Array("Arrival","Arrivals","Arrive Platform 3 Set down only.","Arrive","Set Down Only"), "", $obsv["myway_stop"])));
+ }
+ //:get myway_stops records
+ //:search by starts with stopcode and starts with street if street is not null
+ //no result, skip and display error
+ if (sizeof($potentialStops) < 1) {
+ echo "error, potential stops for stopid {$obsv["stop_id"]} unknown";
+ continue;
+ }
+ //print out stops
+ echo "Matched stops: ";
+ foreach ($potentialStops as $potentialStop) {
+ echo $potentialStop['stop_id'] . " " . $potentialStop['stop_name'] . " ";
+ }
+ echo "<br>";
+ //:get myway_route record
+ //no result, skip and display error
+ //print out route
+ $potentialRoutes = getRoutesByShortName($obsv["route_short_name"]);
+ if (sizeof($potentialRoutes) < 1) {
+ echo "error, route '{$obsv["myway_route"]}' unknown";
+ continue;
+ }
+ $timeDeltas = Array();
+ foreach ($potentialRoutes as $potentialRoute) {
+ echo "Matched route: {$potentialRoute['route_id']} {$potentialRoute['route_short_name']} {$timing_period}<br>";
+ foreach ($potentialStops as $potentialStop) {
+ $stopRoutes = getStopRoutes($potentialStop['stop_id'], $timing_period);
+ $foundRoute = Array();
+ foreach ($stopRoutes as $stopRoute) {
+ //Check if this route stops at each stop
+ if ($stopRoute['route_id'] == $potentialRoute['route_id']) {
+ echo "Matching route {$stopRoute['route_id']} found at stop #{$potentialStop['stop_id']}<br>";
+ $foundRoute = $stopRoute;
+ //if does get tripstoptimes for this route
+ $trips = getStopTrips($potentialStop['stop_id'], $timing_period, $search_time, 10, $potentialRoute['route_short_name']);
+ foreach ($trips as $trip) {
+ //echo $trip['route_id']." ".$stopRoute['route_id'].";";
+ if ($trip['route_id'] == $stopRoute['route_id']) {
+ $timedTrip = getTripAtStop($trip['trip_id'], $trip['stop_sequence']);
+ $actual_time = strtotime($time);
+ $trip_time = strtotime($timedTrip['arrival_time']);
+ $timeDiff = $actual_time - $trip_time;
+ //work out time delta, put into array with index of delta
+ $timeDeltas[] = Array(
+ "timeDiff" => $timeDiff,
+ "stop_id" => $potentialStop['stop_id'],
+ "stop_sequence" => $trip['stop_sequence'],
+ "route_name" => "{$trip['route_short_name']} {$trip['trip_headsign']}",
+ "route_id" => $trip['route_id']
+ );
+ echo "Found trip {$trip['trip_id']} at stop {$potentialStop['stop_id']} (#{$potentialStop['stop_name']}, sequence #{$trip['stop_sequence']})<br>";
+ echo "Arriving at {$timedTrip['arrival_time']}, difference of " . round($timeDiff / 60, 2) . " minutes<br>";
+ } else {
+ echo "{$trip['route_id']} != {$stopRoute['route_id']}<br>";
+ }
+ }
+ if (sizeof($timeDeltas) == 0) echo "Error, no trips found.<bR>";
+ break; // because have found route
+ }
+ }
+ if (sizeof($foundRoute) < 1) {
+ //print out that stops/does not stop
+ echo "No matching routes found at {$potentialStop['stop_id']}<br>";
+ //var_dump($stopRoutes);
+ flush();
+ }
+ }
+ }
+
+ // lowest delta is recorded delta
+ usort($timeDeltas, "abssort");
+ $lowestDelta = $timeDeltas[0]["timeDiff"];
+ if (sizeof($timeDeltas) != 0) {
+ if (abs($lowestDelta) > 9999) {
+ echo "Difference of " . round($lowestDelta / 60, 2) . " minutes is too high. Will not record this observation<br>";
+ } else {
+ echo "Lowest difference of " . round($lowestDelta / 60, 2) . " minutes will be recorded for this observation<br>";
+
+ $observation_id = $obsv['observation_id'];
+
+ $route_name = $timeDeltas[0]["route_name"];
+ $route_id = $timeDeltas[0]["route_id"];
+ $stop_id = $timeDeltas[0]["stop_id"];
+ $myway_stop = $obsv["myway_stop"];
+ $stop_sequence = $timeDeltas[0]["stop_sequence"];
+ $stmt = $conn->prepare("insert into myway_timingdeltas (observation_id, route_id, stop_id, timing_delta, time, date, timing_period, stop_sequence,myway_stop,route_name)
+ values (:observation_id, :route_id, :stop_id, :timing_delta, :time, :date, :timing_period, :stop_sequence,:myway_stop,:route_name)");
+ $stmt->bindParam(':observation_id', $observation_id);
+ $stmt->bindParam(':route_id', $route_id);
+ $stmt->bindParam(':route_name', $route_name);
+ $stmt->bindParam(':stop_id', $stop_id);
+ $stmt->bindParam(':myway_stop', $myway_stop);
+ $stmt->bindParam(':timing_delta', $lowestDelta);
+ $stmt->bindParam(':time', $time_tz);
+ $stmt->bindParam(':date', $date);
+ $stmt->bindParam(':timing_period', $timing_period);
+ $stmt->bindParam(':stop_sequence', $stop_sequence);
+ // insert a record
+ $stmt->execute();
+ if ($stmt->rowCount() > 0) {
+ echo "Recorded.<br>";
+ }
+ var_dump($conn->errorInfo());
+ flush();
+
+ }
+ }
+ flush();
+}
+
--- /dev/null
+++ b/myway/myway_timeliness_freqdist.php
@@ -1,1 +1,60 @@
+<?php
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
+include ('../include/common.inc.php');
+include_header("MyWay Deltas", "mywayDelta");
+?>
+<!--[if lt IE 9]>
+ <script type="text/javascript" src="../js/FlashCanvas/bin/flashcanvas.js"></script>
+ <![endif]-->
+ <script type="text/javascript" src="../js/flotr2/flotr2.min.js"></script>
+<center><div id="placeholder" style="width:900px;height:550px"></div></center>
+<script type="text/javascript">
+ $(function () {
+
+ var d1 = [];
+<?php
+$query = "select td, count(*) from (select (timing_delta - MOD(timing_delta,10)) as td from myway_timingdeltas where abs(timing_delta) < 2*(select stddev(timing_delta) from myway_timingdeltas)) as a group by td order by td";
+$query = $conn->prepare($query);
+$query->execute();
+if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+}
+
+foreach ($query->fetchAll() as $delta) {
+
+ echo "d1.push([ " . intval($delta['td']) . ", " . intval($delta['count']) . "]); \n";
+};
+?>
+
+
+ var placeholder = document.getElementById("placeholder");
+
+ var plot = Flotr.draw(placeholder, [
+ {
+ data: d1,
+ bars: { show: true }
+ },
+ ],
+ {
+
+ });
+
+ });
+
+
+</script>
--- /dev/null
+++ b/myway/myway_timeliness_overview.php
@@ -1,1 +1,111 @@
+<?php
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
+include ('../include/common.inc.php');
+include_header("MyWay Deltas", "mywayDelta");
+?>
+<table>
+ <tr><td></td><td>Mean</td><td>Standard<br>Deviation</td><td>Sample Size</td></tr>
+ <th> Overall </th>
+ <?php
+ $query = "select '', avg(timing_delta), stddev(timing_delta), count(*) from myway_timingdeltas ";
+ $query = $conn->prepare($query);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ foreach ($query->fetchAll() as $row) {
+ echo "<tr><td>{$row[0]}</td><td>" . floor($row[1]) . "</td><td>" . floor($row[2]) . "</td><td>{$row[3]}</td></tr>";
+ };
+ ?>
+
+
+ <th> Hour of Day </th>
+ <?php
+ $query = "select extract(hour from time), avg(timing_delta), stddev(timing_delta), count(*) from myway_timingdeltas group by extract(hour from time) order by extract(hour from time)";
+ $query = $conn->prepare($query);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ foreach ($query->fetchAll() as $row) {
+ echo "<tr><td>{$row[0]}</td><td>" . floor($row[1]) . "</td><td>" . floor($row[2]) . "</td><td>{$row[3]}</td></tr>";
+ };
+ ?>
+
+ <th> Day of Week </th>
+ <?php
+ $query = "select to_char(date, 'Day'), avg(timing_delta), stddev(timing_delta), count(*) from myway_timingdeltas group by to_char(date, 'Day') order by to_char(date, 'Day')";
+ $query = $conn->prepare($query);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ foreach ($query->fetchAll() as $row) {
+ echo "<tr><td>{$row[0]}</td><td>" . floor($row[1]) . "</td><td>" . floor($row[2]) . "</td><td>{$row[3]}</td></tr>";
+ };
+ ?>
+ <th>Month </th>
+ <?php
+ $query = "select to_char(date, 'Month'), avg(timing_delta), stddev(timing_delta), count(*) from myway_timingdeltas group by to_char(date, 'Month') order by to_char(date, 'Month')";
+ $query = $conn->prepare($query);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ foreach ($query->fetchAll() as $row) {
+ echo "<tr><td>{$row[0]}</td><td>" . floor($row[1]) . "</td><td>" . floor($row[2]) . "</td><td>{$row[3]}</td></tr>";
+ };
+ ?>
+
+ <th>Stop </th>
+ <?php
+ $query = "select myway_stop, avg(timing_delta), stddev(timing_delta), count(*) from myway_timingdeltas group by myway_stop having count(*) > 1 order by myway_stop";
+ $query = $conn->prepare($query);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ foreach ($query->fetchAll() as $row) {
+ echo "<tr><td>{$row[0]}</td><td>" . floor($row[1]) . "</td><td>" . floor($row[2]) . "</td><td>{$row[3]}</td></tr>";
+ };
+ ?>
+ <th>Route </th>
+ <?php
+ $query = "select route_name, avg(timing_delta), stddev(timing_delta), count(*) from myway_timingdeltas group by route_name having count(*) > 1 order by route_name";
+ $query = $conn->prepare($query);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ foreach ($query->fetchAll() as $row) {
+ echo "<tr><td>{$row[0]}</td><td>" . floor($row[1]) . "</td><td>" . floor($row[2]) . "</td><td>{$row[3]}</td></tr>";
+ };
+ ?>
+
+
+</table>
+
+<?php
+include_footer();
+?>
+
--- /dev/null
+++ b/myway/myway_timeliness_reconcile.php
@@ -1,1 +1,149 @@
+<?php
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
+include ('../include/common.inc.php');
+auth();
+foreach ($_REQUEST as $key => $value) {
+ if (strstr($key, "route") && !strstr($value, "Select")) {
+ $myway_route = str_replace("route", "", $key);
+ $vparts = explode("-",$value);
+ $route_short_name = $vparts[0];
+ $trip_headsign = $vparts[1];
+ $query = "update myway_routes set route_short_name = :route_short_name, trip_headsign = :trip_headsign where myway_route = :myway_route";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":myway_route", $myway_route, PDO::PARAM_STR, 5);
+
+ $query->bindParam(":route_short_name", $route_short_name, PDO::PARAM_STR, 42);
+ $query->bindParam(":trip_headsign", $trip_headsign, PDO::PARAM_STR, 42);
+ $query->execute();
+ die(print_r($conn->errorInfo(), true));
+ }
+ if (strstr($key, "myway_stop")) {
+ $myway_stop = $value;
+ $stop_id = $_REQUEST['stop_id'];
+ $query = "update myway_stops set stop_id = :stop_id where myway_stop = :myway_stop";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":myway_stop", $myway_stop, PDO::PARAM_STR, 25);
+ $query->bindParam(":stop_id", $stop_id, PDO::PARAM_STR, 32);
+ $query->execute();
+ die(print_r($conn->errorInfo(), true));
+ }
+}
+include_header("MyWay Data Reconcile", "mywayTimeRec");
+// initialise
+$count = $conn->exec("insert into myway_stops
+ select distinct myway_stop from myway_observations
+ WHERE myway_stop NOT IN
+ (
+ SELECT myway_stop
+ FROM myway_stops
+ )");
+echo "$count new stops.<br>";
+if (!$count) {
+ print_r($conn->errorInfo());
+}
+$count = $conn->exec("insert into myway_routes select distinct myway_route from myway_observations
+ WHERE myway_route NOT IN
+ (
+ SELECT myway_route
+ FROM myway_routes
+ )");
+echo "$count new routes.<br>";
+if (!$count) {
+ print_r($conn->errorInfo());
+}
+echo "<h2>Stops</h2>";
+/* stops
+ search start of name, display map and table nuimbered, two text boxes */
+$query = "Select * from myway_stops where stop_id is NUll;";
+debug($query, "database");
+$query = $conn->prepare($query);
+$query->execute();
+if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+}
+foreach ($query->fetchAll() as $myway_stop) {
+ echo "<h3>{$myway_stop[0]}</h3>";
+ $markers = array();
+ $stopKey = 0;
+ $foundStops = getStops("",$myway_stop[0]);
+ if (sizeof($foundStops) > 0) {
+ echo "<table>";
+ foreach ($foundStops as $stopResult) {
+ $markers[] = array(
+ $stopResult['stop_lat'],
+ $stopResult['stop_lon']
+ );
+ echo "<tr><td>" . $stopKey++ . "</td><td>" . $stopResult['stop_name'] . "</td><td>" . $stopResult['stop_id'] . "</td></tr>";
+ }
+ echo '</table>';
+ echo "" . staticmap($markers,false,false,false,true) . "<br>\n";
+ }
+ echo '<form id="inputform' . md5($myway_stop[0]) . '">
+ <input type="hidden" name="myway_stop" value="' . $myway_stop[0] . '">
+ <div data-role="fieldcontain">
+ <label for="stop_id">Stop ID</label>
+ <input type="text" name="stop_id" id="stop_id" value="' . $foundStops[0]['stop_id'] . '" />
+ </div> <input type="button" onclick="$.post(\'myway_timeliness_reconcile.php\', $(\'#inputform' . md5($myway_stop[0]) . '\').serialize())" value="Go!"></form>
+';
+ echo '<hr>';
+}
+echo '<h2>Routes</h2>';
+/* routes
+ remove alpha char, search present dropdown */
+$query = "Select * from myway_routes where route_short_name is NUll;";
+debug($query, "database");
+$query = $conn->prepare($query);
+$query->execute();
+if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+}
+foreach ($query->fetchAll() as $myway_route) {
+ echo "<h3>{$myway_route[0]}</h3>";
+ $query = "Select * from myway_observations where myway_route = :route order by time";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":route", $myway_route[0]);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ foreach ($query->fetchAll() as $myway_obvs) {
+ echo $myway_obvs['myway_stop'] . $myway_obvs['time'] . "<br>";
+ }
+ $searchRouteNo = preg_replace("/[A-Z]/", "", $myway_route[0]);
+ echo $searchRouteNo;
+ echo '<form id="inputform' . $myway_route[0] . '">
+<select name="route' . $myway_route[0] . '" onchange=\'$.post("myway_timeliness_reconcile.php", $("#inputform' . $myway_route[0] . '").serialize())\'>
+<option>Select a from/to pair...</option>';
+ foreach (getRoutesByShortName($searchRouteNo) as $routeResult) {
+ foreach(getRouteHeadsigns($routeResult['route_id']) as $headsign ) {
+ echo "<option value=\"{$routeResult['route_short_name']}-{$headsign['trip_headsign']}\">
+ {$routeResult['route_short_name']}{$routeResult['route_long_name']} - {$headsign['trip_headsign']} {$headsign['direction_id']} @ {$headsign['stop_name']} </option>\n";
+ }
+
+ }
+ echo "</select></form>";
+ echo '<hr>';
+}
+include_footer();
+?>
+
--- /dev/null
+++ b/myway/myway_timeliness_route.json.php
@@ -1,1 +1,43 @@
+<?php
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
+include ('../include/common.inc.php');
+header('Content-Type: text/javascript; charset=utf8');
+// header('Access-Control-Allow-Origin: http://bus.lambdacomplex.org/');
+header('Access-Control-Max-Age: 3628800');
+header('Access-Control-Allow-Methods: GET, POST, PUT, DELETE');
+?>
+{
+"label": "<?php echo $routename; ?>",
+"data": <?php
+$query = "select * from myway_timingdeltas where route_name = :route_name
+AND abs(timing_delta) < 2*(select stddev(timing_delta) from myway_timingdeltas) order by stop_sequence;";
+$query = $conn->prepare($query);
+$query->bindParam(':route_name', $routename, PDO::PARAM_STR);
+
+$query->execute();
+if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+}
+foreach ($query->fetchAll() as $delta) {
+ $points[] = "[{$delta['stop_sequence']}, {$delta['timing_delta']}]";
+};
+echo "[" . implode(",", $points) . '],';
+?>
+"points": { "show" : true }
+}
+
--- /dev/null
+++ b/myway/myway_timeliness_route.php
@@ -1,1 +1,105 @@
+<?php
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
+include ('../include/common.inc.php');
+include_header("MyWay Deltas", "mywayDelta");
+?>
+<!--[if lt IE 9]>
+ <script type="text/javascript" src="../js/FlashCanvas/bin/flashcanvas.js"></script>
+ <![endif]-->
+ <script type="text/javascript" src="../js/flotr2/flotr2.min.js"></script>
+<form method="get" action="">
+ <select id="routename" name="routename">
+ <?php
+ $query = "select distinct route_name from myway_timingdeltas order by route_name";
+ $query = $conn->prepare($query);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ foreach ($query->fetchAll() as $route) {
+ echo "<option value=\"{$route['route_name']}\">{$route['route_name']}</option>";
+ };
+ ?> </select>
+ <center><div id="placeholder" style="width:900px;height:550px"></div></center>
+ <script type="text/javascript">
+ $(function () {
+ var placeholder = document.getElementById("placeholder");
+
+
+ var data = [];
+ var options = {
+ xaxis: {
+ },
+ yaxis: {
+ tickFormatter: yformatter
+ },
+ mouse: { track: true, relative: true, trackFormatter: showTooltip}
+
+ };
+
+ Flotr.draw(placeholder, data, options);
+
+ // fetch one series, adding to what we got
+ var alreadyFetched = {};
+
+ $("#routename").change(function () {
+ var select = $(this);
+
+ // find the URL in the link right next to us
+ // var dataurl = button.siblings('a').attr('href');
+ var dataurl = "myway_timeliness_route.json.php?routename=" + select.val();
+ // then fetch the data with jQuery
+ function onDataReceived(series) {
+
+
+ // let's add it to our current data
+ if (!alreadyFetched[series.label]) {
+ alreadyFetched[series.label] = true;
+ data.push(series);
+ }
+
+ // and plot all we got
+ Flotr.draw(placeholder, data, options);
+ }
+
+ $.ajax({
+ url: dataurl,
+ method: 'GET',
+ dataType: 'json',
+ success: onDataReceived
+ });
+ });
+
+
+ });
+
+
+
+ function yformatter(v) {
+ if (Math.floor(v/60) < -9) return "";
+ return Math.abs(Math.floor(v/60)) + " min " + (v == 0 ? "" : (v >0 ? "early":"late"))
+ }
+ function showTooltip(point) {
+
+
+ return point.series.label + "<br> at stop sequence "+ point.x +" = " + Math.abs(new Number(point.y/60).toFixed(2))+" minutes "+(point.y >0 ? "early":"late");
+ }
+
+
+ </script>
+
--- /dev/null
+++ b/myway/myway_timeliness_stop.json.php
@@ -1,1 +1,50 @@
+<?php
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
+include ('../include/common.inc.php');
+header('Content-Type: text/javascript; charset=utf8');
+// header('Access-Control-Allow-Origin: http://bus.lambdacomplex.org/');
+header('Access-Control-Max-Age: 3628800');
+header('Access-Control-Allow-Methods: GET, POST, PUT, DELETE');
+?>
+{
+"label": "<?php echo $_REQUEST['stopid']; ?>",
+"data": <?php
+$query = "select * from myway_timingdeltas
+ where myway_stop = :myway_stop
+ AND abs(timing_delta) < 2*(select stddev(timing_delta) from myway_timingdeltas)
+ order by time;";
+$query = $conn->prepare($query);
+$query->bindParam(':myway_stop', $_REQUEST['stopid'], PDO::PARAM_STR, 42);
+
+$query->execute();
+if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+}
+foreach ($query->fetchAll() as $delta) {
+ $points[] = "[" . ((strtotime("00:00Z") + midnight_seconds(strtotime($delta['time']))) * 1000) . ", {$delta['timing_delta']}]";
+};
+if (count($points) == 0) {
+ echo "[]";
+}
+else
+ echo "[" . implode(",", $points) . "],";
+?>
+
+"points": { "show" : true }
+}
+
--- /dev/null
+++ b/myway/myway_timeliness_stop.php
@@ -1,1 +1,106 @@
+<?php
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
+include ('../include/common.inc.php');
+include_header("MyWay Deltas", "mywayDelta");
+?>
+<!--[if lt IE 9]>
+ <script type="text/javascript" src="../js/FlashCanvas/bin/flashcanvas.js"></script>
+ <![endif]-->
+ <script type="text/javascript" src="../js/flotr2/flotr2.min.js"></script>
+<form method="get" action="">
+ <select id="stopid" name="stopid">
+ <?php
+ $query = "select distinct myway_stop from myway_timingdeltas where myway_stop != '' order by myway_stop";
+ $query = $conn->prepare($query);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ foreach ($query->fetchAll() as $stop) {
+ echo "<option value=\"{$stop['myway_stop']}\">{$stop['myway_stop']}</option>";
+ };
+ ?> </select> <center><div id="placeholder" style="width:900px;height:550px"></div></center>
+ <script type="text/javascript">
+ $(function () {
+ var d = new Date();
+ d.setUTCMinutes(0);
+ d.setUTCHours(0);
+ var midnight = d.getTime();
+ var placeholder = document.getElementById("placeholder");
+ var data = [];
+ var options = {
+ xaxis: {
+ mode: "time"
+ },
+ yaxis: {
+ tickFormatter: yformatter
+ },
+ mouse: { track: true, relative: true, trackFormatter: showTooltip}
+
+ };
+
+
+ Flotr.draw(placeholder, data, options);
+ // fetch one series, adding to what we got
+ var alreadyFetched = {};
+
+ $("#stopid").change(function () {
+ var select = $(this);
+
+ // find the URL in the link right next to us
+ // var dataurl = button.siblings('a').attr('href');
+ var dataurl = "myway_timeliness_stop.json.php?stopid=" + select.val();
+ // then fetch the data with jQuery
+ function onDataReceived(series) {
+ // let's add it to our current data
+ if (!alreadyFetched[series.label]) {
+ alreadyFetched[series.label] = true;
+ data.push(series);
+ }
+
+ // and plot all we got
+
+ Flotr.draw(placeholder, data, options);
+ }
+
+ $.ajax({
+ url: dataurl,
+ method: 'GET',
+ dataType: 'json',
+ success: onDataReceived
+ });
+ });
+
+ });
+ function yformatter(v) {
+ if (Math.floor(v/60) < -9) return "";
+ return Math.abs(Math.floor(v/60)) + " min " + (v == 0 ? "" : (v >0 ? "early":"late"))
+ }
+ function showTooltip(point) {
+
+
+ var d = new Date();
+ d.setTime(point.x);
+ var time = d.getUTCHours() +':'+ (d.getUTCMinutes().toString().length == 1 ? '0'+ d.getMinutes(): d.getUTCMinutes())
+
+
+ return point.series.label + " at "+ time +" = " + Math.abs(new Number(point.y/60).toFixed(2))+" minutes "+(point.y >0 ? "early":"late");
+ }
+
+ </script>
+
--- /dev/null
+++ b/myway/mywaybalance.php
@@ -1,1 +1,144 @@
+<?php
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
+include ('../include/common.inc.php');
+include_header("MyWay Balance", "mywayBalance", false, false, true);
+echo '<div data-role="page">
+ <div data-role="header" data-position="inline">
+ <a href="' . $_SERVER["HTTP_REFERER"] . '" data-icon="arrow-l" data-rel="back" class="ui-btn-left">Back</a>
+ <h1>MyWay Balance</h1>
+ <a href="mywaybalance.php?logout=yes" data-icon="delete" class="ui-btn-right">Logout</a>
+ </div><!-- /header -->
+ <a name="maincontent" id="maincontent"></a>
+ <div data-role="content"> ';
+$return = Array();
+
+function logout() {
+ setcookie("card_number", "", time() - 60 * 60 * 24 * 100, "/");
+ setcookie("date", "", time() - 60 * 60 * 24 * 100, "/");
+ setcookie("secret_answer", "", time() - 60 * 60 * 24 * 100, "/");
+ setcookie("contribute_myway", "", time() - 60 * 60 * 24 * 100, "/");
+}
+
+function printBalance($mywayResult) {
+ if (isset($mywayResult['error'])) {
+ logout();
+ echo '<h3><font color="red">' . $mywayResult['error'][0] . "</font></h3>";
+ } else {
+ echo "<h2>Balance: " . $mywayResult['myway_carddetails']['Card Balance'] . "</h2>";
+ echo '<ul data-role="listview" data-inset="true"><li data-role="list-divider"> Recent Transactions </li>';
+ $txCount = 0;
+ foreach ($mywayResult['myway_transactions'] as $transaction) {
+ echo "<li>";
+ if ($transaction["Deduction Type"] == "DEFAULT")
+ echo '<img src="css/images/warning.png" alt="Failed to tap off: " class="ui-li-icon">';
+ echo "<b>" . $transaction["Date / Time"] . "</b>";
+ echo "<br><small>" . $transaction["Route"] . " at " . $transaction["Stop Name"] . "<br>";
+ echo $transaction["TX Reference No"] . " " . $transaction["TX Type"] . "</small>";
+ echo '<p class="ui-li-aside">' . $transaction["TX Amount"] . '</p>';
+ echo "</li>";
+ $txCount++;
+ if ($txCount > 10)
+ break;
+ }
+ echo "</ul>";
+ }
+}
+
+function recordMyWayObservations($mywayResult) {
+ global $conn;
+ if (!isset($mywayResult['error'])) {
+ $stmt = $conn->prepare("insert into myway_observations (observation_id, myway_stop, time, myway_route)
+ values (:observation_id, :myway_stop, :time, :myway_route)");
+ $stmt->bindParam(':observation_id', $observation_hash);
+ $stmt->bindParam(':myway_stop', $myway_stop);
+ $stmt->bindParam(':time', $timestamp);
+ $stmt->bindParam(':myway_route', $myway_route);
+ // insert a record
+ $resultCount = 0;
+ foreach ($mywayResult['myway_transactions'] as $transaction) {
+ if ($transaction["Stop Name"] != "" && $transaction["Deduction Type"] != "DEFAULT") {
+ $observation_hash = md5($mywayResult['myway_carddetails']['MyWay Number'] . $transaction["TX Reference No"]);
+ $timestamp = date("c", strtotime($transaction["Date / Time"]));
+ $myway_stop = $transaction["Stop Name"];
+ $myway_route = $transaction["Route"];
+ if ($stmt->execute())
+ $resultCount++;
+ }
+ }
+ echo "<h3>Thanks for participating in the study! $resultCount transactions were recorded</h3>";
+ }
+}
+
+if (isset($_REQUEST['card_number']) && isset($_REQUEST['date']) && isset($_REQUEST['secret_answer'])) {
+ $cardNumber = $_REQUEST['card_number'];
+ $date = explode("/", $_REQUEST['date']);
+ $pwrd = $_REQUEST['secret_answer'];
+ if ($_REQUEST['remember'] == "on") {
+ setcookie("card_number", $cardNumber, time() + 60 * 60 * 24 * 100, "/");
+ setcookie("date", $_REQUEST['date'], time() + 60 * 60 * 24 * 100, "/");
+ setcookie("contribute_myway", $_REQUEST['contribute_myway'], time() + 60 * 60 * 24 * 100, "/");
+ setcookie("secret_answer", $pwrd, time() + 60 * 60 * 24 * 100, "/");
+ }
+ $mywayResult = json_decode(getPage(curPageURL() . "/myway_api.json.php?card_number=$cardNumber&DOBday={$date[0]}&DOBmonth={$date[1]}&DOByear={$date[2]}&secret_answer=$pwrd"), true);
+ if ($_REQUEST['contribute_myway'] == "on")
+ recordMyWayObservations($mywayResult);
+ printBalance($mywayResult);
+}
+else if (isset($_REQUEST['logout'])) {
+ echo '<center><h3> Logged out of MyWay balance </h3><a href="/index.php">Back to main menu...</a><center>';
+} else if (isset($_COOKIE['card_number']) && isset($_COOKIE['date']) && isset($_COOKIE['secret_answer'])) {
+ $cardNumber = $_COOKIE['card_number'];
+ $date = explode("/", $_COOKIE['date']);
+ $pwrd = $_COOKIE['secret_answer'];
+ $mywayResult = json_decode(getPage(curPageURL() . "/myway_api.json.php?card_number=$cardNumber&DOBday={$date[0]}&DOBmonth={$date[1]}&DOByear={$date[2]}&secret_answer=$pwrd"), true);
+ if ($_COOKIE['contribute_myway'] == "on")
+ recordMyWayObservations($mywayResult);
+ printBalance($mywayResult);
+}
+else {
+ $date = (isset($_REQUEST['date']) ? filter_var($_REQUEST['date'], FILTER_SANITIZE_STRING) : date("m/d/Y"));
+ echo '<form action="" method="post">
+ <div data-role="fieldcontain">
+ <label for="card_number">Card number</label>
+ <input type="text" name="card_number" id="card_number" value="' . $card_number . '" />
+ </div>
+ <div data-role="fieldcontain">
+ <label for="date"> Date of birth </label>
+ <input type="text" name="date" id="date" value="' . $date . '" />
+ </div>
+ <div data-role="fieldcontain">
+ <label for="secret_answer"> Secret question answer </label>
+ <input type="text" name="secret_answer" id="secret_answer" value="' . $secret_answer . '" />
+ </div>
+ <div data-role="fieldcontain">
+ <label for="remember"> Remember these details? </label>
+ <input type="checkbox" name="remember" id="remember" checked="yes" />
+ </div>
+ <div data-role="fieldcontain">
+ <label for="contribute_myway">Contribute MyWay records to timeliness study? </label>
+ <input type="checkbox" name="contribute_myway" id="contribute_myway" defaultChecked="no" />
+ </div>
+ <div data-role="fieldcontain">
+ <label for="accept_warning">I accept that Transport for Canberra <a href="http://transport.act.gov.au/myway/protect.html">advise against the use of third party MyWay applications</a> </label>
+ <input type="checkbox" name="accept_warning" id="accept_warning" defaultChecked="no" />
+ </div>
+ <input type="submit" value="Go!"></form>';
+}
+include_footer();
+?>
+
--- /dev/null
+++ b/nbproject/project.properties
@@ -1,1 +1,8 @@
+include.path=${php.global.include.path}
+php.version=PHP_53
+source.encoding=UTF-8
+src.dir=.
+tags.asp=false
+tags.short=true
+web.root=.
--- /dev/null
+++ b/nbproject/project.xml
@@ -1,1 +1,10 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<project xmlns="http://www.netbeans.org/ns/project/1">
+ <type>org.netbeans.modules.php.project</type>
+ <configuration>
+ <data xmlns="http://www.netbeans.org/ns/php-project/1">
+ <name>busui</name>
+ </data>
+ </configuration>
+</project>
--- /dev/null
+++ b/privacy.php
@@ -1,1 +1,55 @@
+<?php
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
+include ('include/common.inc.php');
+include_header("Privacy Policy", "privacy")
+?>
+<h2>Information collected</a></h2>
+<p>When you browse this web site, our system automatically makes a record of your visit and logs the following information for statistical purposes:</p>
+<ul>
+ <li>your server address; </li>
+ <li>top level domain name (e.g.: .com, .net, .gov, .au, etc); </li>
+ <li>the type of browser and operating system you used; </li>
+ <li>date and time of your visit; </li>
+ <li>the previous site visited; </li>
+ <li>which pages are accessed; </li>
+ <li>the time spent on individual pages and the site overall; </li>
+ <li>which files were downloaded.</li>
+</ul>
+
+<p>This information is analysed to determine this web site’s usage statistics.</p>
+<p>However, no attempt will be made to identify individual users or their browsing activities except, in the event of an investigation, where a law enforcement agency (e.g. the Australian Federal Police) exercises a warrant to inspect our service provider's log files.</p>
+<p>We collect no personal information about you unless you voluntarily choose to participate in an activity through this web site that involves the provision of personal information, such as:</p>
+<ul>
+ <li>sending feedback to this web site;</li>
+ <li>using geographic features of this web site;</li>
+ <li>participating in the MyWay Timeliness study on this web site;</li>
+</ul>
+<p>If you choose not to participate in these activities, your choice will in no way affect your ability to use this web site.</p>
+<h2>Use of personal information collected</a></h2>
+<p>Any personal information you choose to provide will only be used for the purpose for which it was provided and will not be disclosed to other persons or organisations without your prior consent or if required by law.</p>
+<p>The Internet is an insecure medium and users should be aware that there are inherent risks transmitting information across the Internet.</p>
+<p>Information submitted unencrypted via electronic mail or web forms may be at risk of being intercepted, read or modified.</p>
+<h2>Cookies<a name="cookies" id="cookies"></a></h2>
+<p>This website uses Google Analytics, a web analytics service provided by Google Inc. (Google). Google Analytics uses cookies and JavaScript code to enable analysis on usage of this website. The data collected about your use of this website, (including your IP address) will be transmitted to and stored on Google's servers. Google will use this data for the purpose of compiling reports on website activity for us and providing other services relating to website activity and internet usage.</p>
+<p>Google will not collect personal information about you and the reports provided by Google to us will only contain aggregate non personal data about your use of this website. (These reports may contain data relating to pages viewed, files downloaded or the completion of online subscriptions). We will use the data collected by Google Analytics to improve how this website functions. For example we can use the data to check whether customers are having problems finding information and make access to information as easy as we can.</p>
+<p>Google may transfer this data to third parties where required to do so by law, or where third parties process this data on Google's behalf. Google will not associate your IP address with any personal information you may have previously provided to Google. You may refuse the use of cookies by selecting the appropriate settings on your browser. Please note that if you do this, you may not be able to fully use this website. By using this website, you consent to the processing of data about you by Google in the manner and for the purposes set out above.</p>
+<p>If you do not wish to participate in Google Analytics, you may download the tool at http://tools.google.com/dlpage/gaoptout to opt out</p>
+
+<?php
+include_footer();
+?>
+
--- a/readme.txt
+++ b/readme.txt
@@ -2,14 +2,46 @@
Based on the maxious-canberra-transit-feed @ http://s3-ap-southeast-1.amazonaws.com/busresources/cbrfeed.zip
Source code for the https://github.com/maxious/ACTBus-data transit
feed and https://github.com/maxious/ACTBus-ui this site available from github.
-Uses jQuery Mobile, PHP, Ruby, Python, Google Transit Feed Specification
-tools, OpenTripPlanner, OpenLayers, OpenStreetMap, Cloudmade Geocoder
+Uses jQuery Mobile, PHP, PostgreSQL, OpenTripPlanner, OpenLayers, OpenStreetMap, Cloudmade Geocoder
and Tile Service
-Must have view.sh running on port 8765 for this webapp to work
+ Copyright 2010,2011 Alexander Sadleir
-For static maps, may have to do
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+
+See aws/awsStartup.sh for example startup steps. You need to load the included database dump;
+for other transit networks you can use the updatedb.php script to load.
+
+For openstreetmap static maps, may have to do
/usr/sbin/setsebool -P httpd_can_network_connect=1
-on fedora
+on Fedora and other SELinux systems.
-
+To enter a service override, you can use the psql tool. eg.
+transitdata=# COPY calendar_dates (service_id, date, exception_type) FROM stdin;
+Enter data to be copied [spaced with tabs] followed by a newline.
+End with a backslash and a period on a line by itself.
+>> saturday 20110416 2
+>> sunday 20110416 1
+>> saturday 20110423 2
+>> sunday 20110423 1
+>> weekday 20110425 2
+>> sunday 20110425 1
+>> weekday 20110422 2
+>> noservice 20110422 1
+>> weekday 20110426 2
+>> noservice 20110426 1
+>> sunday 20110424 2
+>> noservice 20110424 1
+>> weekday 20110613 2
+>> sunday 20110613 1
+>> \.
--- a/robots.txt
+++ b/robots.txt
@@ -1,4 +1,6 @@
User-agent: *
Allow: /
+User-agent: *
+Disallow: /lib/ga.php
sitemap: http://bus.lambdacomplex.org/sitemap.xml.php
--- a/routeList.php
+++ b/routeList.php
@@ -1,139 +1,167 @@
<?php
+
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
include ('include/common.inc.php');
-function navbar()
-{
- echo '
+
+function navbar() {
+
+ echo '
<div data-role="navbar">
<ul>
<li><a href="routeList.php">By Final Destination...</a></li>
<li><a href="routeList.php?bynumber=yes">By Number... </a></li>
- <li><a href="routeList.php?bysuburb=yes">By Suburb... </a></li>
+ <li><a href="routeList.php?bysuburbs=yes">By Suburb... </a></li>
<li><a href="routeList.php?nearby=yes">Nearby... </a></li>
</ul>
</div>
';
}
-if ($_REQUEST['bysuburb']) {
- include_header("Routes by Suburb", "routeList");
- navbar();
- echo ' <ul data-role="listview" data-filter="true" data-inset="true" >';
- if (!isset($_REQUEST['firstLetter'])) {
- foreach (range('A', 'Z') as $letter) {
- echo "<li><a href=\"routeList.php?firstLetter=$letter&bysuburb=yes\">$letter...</a></li>\n";
- }
- }
- else {
- foreach ($suburbs as $suburb) {
- if (startsWith($suburb, $_REQUEST['firstLetter'])) {
- echo '<li><a href="routeList.php?suburb=' . urlencode($suburb) . '">' . $suburb . '</a></li>';
- }
- }
- }
- echo '</ul>';
+
+function displayRoutes($routes) {
+ echo ' <ul data-role="listview" data-filter="true" data-inset="true" >';
+ foreach ($routes as $route) {
+ foreach (getRouteHeadsigns($route['route_id']) as $headsign) {
+
+ //print_r($route);
+ echo '<li> <a href="trip.php?routeid=' . $route['route_id'] . '&directionid=' . $headsign['direction_id'] . '"><h3>' . $route['route_id'] . "</h3>
+
+ <p>" . $headsign['trip_headsign'] . (strstr($headsign['trip_headsign'], "bound") === false ? "bound" : "") . ", starting at " . $headsign['stop_name'] . " (" . ucwords($headsign['service_id']) . ")</p>";
+
+ echo" </a></li>\n";
+ }
+ }
}
-else if ($_REQUEST['nearby'] || $_REQUEST['suburb']) {
- if ($_REQUEST['suburb']) {
- $suburb = filter_var($_REQUEST['suburb'], FILTER_SANITIZE_STRING);
- $url = $APIurl . "/json/stopzonesearch?q=" . $suburb;
- include_header("Routes by Suburb", "routeList");
- trackEvent("Route Lists","Routes By Suburb", $suburb);
- }
- if ($_REQUEST['nearby']) {
- $url = $APIurl . "/json/neareststops?lat={$_SESSION['lat']}&lon={$_SESSION['lon']}&limit=15";
- include_header("Routes Nearby", "routeList", true, true);
- timePlaceSettings(true);
- if (!isset($_SESSION['lat']) || !isset($_SESSION['lat']) || $_SESSION['lat'] == "" || $_SESSION['lon'] == "") {
- include_footer();
- die();
+
+function displayNearbyRoutes($routes) {
+ echo ' <ul data-role="listview" data-filter="true" data-inset="true" >';
+ foreach ($routes as $route) {
+ $time = getRouteAtStop($route['route_id'], $route['direction_id'], $route['stop_id']);
+ $start = getTripStartingPoint($time['trip_id']);
+ $end = getTripDestination($time['trip_id']);
+ //print_r($route);
+ echo '<li> <a href="trip.php?routeid=' . $route['route_id'] . '&directionid=' . $route['direction_id'] . '"><h3>' . $route['route_short_name'] . "</h3>
+
+ <p>" . $time['trip_headsign'] . (strstr($time['trip_headsign'], "bound") === false ? "bound" : "") . " from " . $start['stop_name'] . " to " . $end['stop_name'] . " (" . ucwords($time['service_id']) . ")</p>";
+ $stop = getStop($route['stop_id']);
+ echo "<p>Board at " . $stop['stop_name'] . "</p>";
+ echo '<span class="ui-li-count">' . ($time['arrival_time'] ? $time['arrival_time'] : "No more trips today") . "<br>" . floor($route['distance']) . 'm away</span>';
+
+ echo" </a></li>\n";
+ }
+}
+
+if (isset($bysuburbs)) {
+ include_header("Routes by Suburb", "routeList");
+ navbar();
+ echo ' <ul data-role="listview" data-filter="true" data-inset="true" >';
+ if (!isset($firstLetter)) {
+ foreach (range('A', 'Z') as $letter) {
+ echo "<li><a href=\"routeList.php?firstLetter=$letter&bysuburbs=yes\">$letter...</a></li>\n";
+ }
+ } else {
+ foreach ($suburbs as $suburb) {
+ if (startsWith($suburb, $firstLetter)) {
+ echo '<li><a href="routeList.php?suburb=' . urlencode($suburb) . '">' . $suburb . '</a></li>';
+ }
+ }
+ }
+ echo '</ul>';
+} else if (isset($suburb)) {
+
+ if ($suburb) {
+ include_header($suburb . " - " . ucwords(service_period()), "routeList");
+ navbar();
+ timeSettings();
+ trackEvent("Route Lists", "Routes By Suburb", $suburb);
+ displayRoutes(getRoutesBySuburb($suburb));
+ }
+} else if (isset($nearby)) {
+ $routes = Array();
+ include_header("Routes Nearby", "routeList", true, true);
+ if (isset($_SESSION['lat']))
+ trackEvent("Route Lists", "Routes Nearby", $_SESSION['lat'] . "," . $_SESSION['lon']);
+ navbar();
+ placeSettings();
+ if (!isset($_SESSION['lat']) || !isset($_SESSION['lat']) || $_SESSION['lat'] == "" || $_SESSION['lon'] == "") {
+ include_footer();
+ die();
+ }
+ $routes = getRoutesNearby($_SESSION['lat'], $_SESSION['lon']);
+
+
+ if (sizeof($routes) > 0) {
+ displayNearbyRoutes($routes);
+ } else {
+ echo ' <ul data-role="listview" data-filter="true" data-inset="true" >';
+ echo "<li style='text-align: center;'> No routes nearby.</li>";
+ }
+} else if (isset($bynumber) || isset($numberSeries)) {
+ include_header("Routes by Number", "routeList");
+ navbar();
+ echo ' <ul data-role="listview" data-inset="true">';
+ if (isset($bynumber)) {
+ $routes = getRoutes();
+ $routeSeries = Array();
+ $seriesRange = Array();
+ foreach ($routes as $key => $routeNumber) {
+ foreach (explode(" ", $routeNumber['route_short_name']) as $routeNumber) {
+ $seriesNum = substr($routeNumber, 0, -1) . "0";
+ if ($seriesNum == "0")
+ $seriesNum = $routeNumber;
+ $finalDigit = substr($routeNumber, sizeof($routeNumber) - 1, 1);
+ if (isset($seriesRange[$seriesNum])) {
+ if ($finalDigit < $seriesRange[$seriesNum]['max'])
+ $seriesRange[$seriesNum]['max'] = $routeNumber;
+ if ($finalDigit > $seriesRange[$seriesNum]['min'])
+ $seriesRange[$seriesNum]['min'] = $routeNumber;
}
- }
- $stops = json_decode(getPage($url));
- $routes = Array();
- foreach ($stops as $stop) {
- $url = $APIurl . "/json/stoproutes?stop=" . $stop[0];
- $stoproutes = json_decode(getPage($url));
- foreach ($stoproutes as $route) {
- if (!isset($routes[$route[0]])) $routes[$route[0]] = $route;
- }
- }
- navbar();
- echo ' <ul data-role="listview" data-filter="true" data-inset="true" >';
- sksort($routes, 1, true);
- foreach ($routes as $row) {
- echo '<li>' . $row[1] . ' <a href="trip.php?routeid=' . $row[0] . '">' . $row[2] . " (" . ucwords($row[4]) . ")</a></li>\n";
- }
-}
-else if ($_REQUEST['bynumber']) {
- include_header("Routes by Number", "routeList");
- navbar();
- echo ' <ul data-role="listview" data-inset="true">';
- $url = $APIurl . "/json/routes";
- $contents = json_decode(getPage($url));
- $routeSeries = Array();
- $seriesRange = Array();
- foreach ($contents as $key => $row) {
- foreach (explode(" ", $row[1]) as $routeNumber) {
- $seriesNum = substr($routeNumber, 0, -1) . "0";
- if ($seriesNum == "0") $seriesNum = $routeNumber;
- $finalDigit = substr($routeNumber, sizeof($routeNumber) - 1, 1);
- if (isset($seriesRange[$seriesNum])) {
- if ($finalDigit < $seriesRange[$seriesNum]['max']) $seriesRange[$seriesNum]['max'] = $routeNumber;
- if ($finalDigit > $seriesRange[$seriesNum]['min']) $seriesRange[$seriesNum]['min'] = $routeNumber;
- }
- else {
- $seriesRange[$seriesNum]['max'] = $routeNumber;
- $seriesRange[$seriesNum]['min'] = $routeNumber;
- }
- $routeSeries[$seriesNum][$seriesNum . "-" . $row[1] . "-" . $row[0]] = $row;
- }
- }
- ksort($routeSeries);
- ksort($seriesRange);
- echo '<div class="noscriptnav"> Go to route numbers: ';
- foreach ($seriesRange as $series => $range) {
- if ($range['min'] == $range['max']) echo "<a href=\"#$series\">$series</a> ";
- else echo "<a href=\"#$series\">{$range['min']}-{$range['max']}</a> ";
- }
- echo "</div>
- <script>
- $('.noscriptnav').hide();
- </script>";
- foreach ($routeSeries as $series => $routes) {
- echo '<a name="' . $series . '"></a>';
- if ($series <= 9) echo '<li>' . $series . "<ul>\n";
- else echo "<li>{$seriesRange[$series]['min']}-{$seriesRange[$series]['max']}<ul>\n";
- foreach ($routes as $row) {
- echo '<li>' . $row[1] . ' <a href="trip.php?routeid=' . $row[0] . '">' . $row[2] . " (" . ucwords($row[3]) . ")</a></li>\n";
- }
- echo "</ul></li>\n";
- }
-}
-else {
- include_header("Routes by Destination", "routeList");
- navbar();
- echo ' <ul data-role="listview" data-inset="true">';
- $url = $APIurl . "/json/routes";
- $contents = json_decode(getPage($url));
- // by destination!
- foreach ($contents as $key => $row) {
- $routeDestinations[$row[2]][] = $row;
- }
- echo '<div class="noscriptnav"> Go to Destination: ';
- foreach (ksort($routeDestinations) as $destination => $routes) {
- echo "<a href=\"#$destination\">$destination</a> ";
- }
- echo "</div>
- <script>
- $('.noscriptnav').hide();
- </script>";
- foreach ($routeDestinations as $destination => $routes) {
- echo '<a name="' . $destination . '"></a>';
- echo '<li>' . $destination . "... <ul>\n";
- foreach ($routes as $row) {
- echo '<li>' . $row[1] . ' <a href="trip.php?routeid=' . $row[0] . '">' . $row[2] . " (" . ucwords($row[3]) . ")</a></li>\n";
- }
- echo "</ul></li>\n";
- }
+ else {
+ $seriesRange[$seriesNum]['max'] = $routeNumber;
+ $seriesRange[$seriesNum]['min'] = $routeNumber;
+ }
+ $routeSeries[$seriesNum][] = null;
+ }
+ }
+ ksort($routeSeries);
+ ksort($seriesRange);
+ foreach ($routeSeries as $series => $routes) {
+ echo '<li><a href="' . curPageURL() . '/routeList.php?numberSeries=' . $series . '">';
+ if ($series <= 9)
+ echo $series;
+ else
+ echo "{$seriesRange[$series]['min']}-{$seriesRange[$series]['max']}";
+ echo "</a></li>\n";
+ }
+ }
+ else if ($numberSeries) {
+ displayRoutes(getRoutesByNumberSeries($numberSeries));
+ }
+} else {
+ include_header("Routes by Destination", "routeList");
+ navbar();
+ echo ' <ul data-role="listview" data-inset="true">';
+ if (isset($routeDestination)) {
+ displayRoutes(getRoutesByDestination($routeDestination));
+ } else {
+ foreach (getRoutesByDestination() as $destination) {
+ echo '<li><a href="' . curPageURL() . '/routeList.php?routeDestination='
+ . urlencode($destination['stop_name']) . '">' . $destination['stop_name'] . "... </a></li>\n";
+ }
+ }
}
echo "</ul>\n";
include_footer();
--- /dev/null
+++ b/rtpis/gtfs-realtime.php
@@ -1,1 +1,85 @@
+<?php
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
+include ('../include/common.inc.php');
+function accept_header($header = false) {
+ // http://jrgns.net/parse_http_accept_header
+ $toret = null;
+ $header = $header ? $header : (array_key_exists('HTTP_ACCEPT', $_SERVER) ? $_SERVER['HTTP_ACCEPT']: false);
+ if ($header) {
+ $types = explode(',', $header);
+ $types = array_map('trim', $types);
+ foreach ($types as $one_type) {
+ $one_type = explode(';', $one_type);
+ $type = array_shift($one_type);
+ if ($type) {
+ list($precedence, $tokens) = self::accept_header_options($one_type);
+ list($main_type, $sub_type) = array_map('trim', explode('/', $type));
+ $toret[] = array('main_type' => $main_type, 'sub_type' => $sub_type, 'precedence' => (float)$precedence, 'tokens' => $tokens);
+ }
+ }
+ usort($toret, array('Parser', 'compare_media_ranges'));
+ }
+ return $toret;
+}
+function usage() {
+echo "Usage notes: Must specify format json/protobuf and gtfs-realtime feedtype alerts/updates. If callback is specified, will provide jsonp. Can filter with parmaters filter_class route/stop and filter_id with the id specified in GTFS.";
+die();
+}
+
+$filter_class = (isset($_REQUEST['filter_class']) ? $_REQUEST['filter_class'] : "");
+$filter_id = (isset($_REQUEST['filter_id']) ? $_REQUEST['filter_id']:"");
+
+$json_types = Array("application/json","application/x-javascript","text/javascript","text/x-javascript","text/x-json");
+if ($_REQUEST['json']) {
+if ($_REQUEST['alerts']) {
+ $return = getServiceAlertsAsJSON($filter_class,$filter_id);
+} else if ($_REQUEST['updates']) {
+ $return = getTripUpdatesAsJSON($filter_class,$filter_id);
+} else {
+ usage();
+}
+ header('Content-Type: application/json; charset=utf8');
+// header('Access-Control-Allow-Origin: http://bus.lambdacomplex.org/');
+ header('Access-Control-Max-Age: 3628800');
+ header('Access-Control-Allow-Methods: GET, POST, PUT, DELETE');
+ if (isset($_GET['callback'])) {
+ $json = '(' . $return . ');'; //must wrap in parens and end with semicolon
+ //print_r($_GET['callback'] . $json); //callback is prepended for json-p
+ }
+ else {
+ echo $return;
+ }
+} else if ($_REQUEST['protobuf']) {
+if ($_REQUEST['alerts']) {
+ $return = getServiceAlertsAsBinary($filter_class,$filter_id);
+} else if ($_REQUEST['updates']) {
+ $return = getTripUpdatesAsBinary($filter_class,$filter_id);
+} else {
+ usage();
+}
+ header('Content-Type: application/x-protobuf');
+header('Content-Disposition: attachment; filename="'.(isset($_REQUEST['updates'])?"updates.":"alerts.").date("c").'.protobuf"');
+// header('Access-Control-Allow-Origin: http://bus.lambdacomplex.org/');
+ header('Access-Control-Max-Age: 3628800');
+ header('Access-Control-Allow-Methods: GET, POST, PUT, DELETE');
+ echo $return;
+} else {
+usage();
+}
+?>
+
--- /dev/null
+++ b/rtpis/importer.py
@@ -1,1 +1,104 @@
+# info
+# http://stackoverflow.com/questions/4206882/named-entity-recognition-with-preset-list-of-names-for-python-php/4207128#4207128
+# http://alias-i.com/lingpipe/demos/tutorial/ne/read-me.html approximate dist
+# http://streamhacker.com/2008/12/29/how-to-train-a-nltk-chunker/ more training
+# http://www.postgresql.org/docs/9.1/static/pgtrgm.html
+# data sources
+# http://twitter.com/#!/ACTEmergencyInf instant site wide
+# http://twitter.com/#!/ACTPol_Traffic
+# http://esa.act.gov.au/feeds/currentincidents.xml
+
+# source: https://gist.github.com/322906/90dea659c04570757cccf0ce1e6d26c9d06f9283
+# to install python -m nltk.downloader punkt
+import nltk
+import tweepy
+import psycopg2
+import pickle
+
+from iniparse import INIConfig
+
+def insert_service_alert_sitewide(heading, message, url):
+ print "NaN"
+
+def insert_service_alert_for_street(streets, heading, message, url):
+ conn_string = "host='localhost' dbname='energymapper' user='postgres' password='snmc'"
+ # print the connection string we will use to connect
+ print "Connecting to database\n ->%s" % (conn_string)
+ try:
+ # get a connection, if a connect cannot be made an exception will be raised here
+ conn = psycopg2.connect(conn_string)
+
+ # conn.cursor will return a cursor object, you can use this cursor to perform queries
+ cursor = conn.cursor()
+
+ # execute our Query
+ cursor.execute("")
+
+ # retrieve the records from the database
+ records = cursor.fetchall()
+
+ for record in records:
+ ys.append(record[0])
+ # >>> cur.execute("INSERT INTO test (num, data) VALUES (%s, %s)", (42, 'bar'))
+ #>>> cur.statusmessage
+ #'INSERT 0 1'
+ except:
+ # Get the most recent exception
+ exceptionType, exceptionValue, exceptionTraceback = sys.exc_info()
+ # Exit the script and print an error telling what happened.
+ sys.exit("Database connection failed!\n ->%s" % (exceptionValue))
+
+
+def extract_entity_names(t):
+ entity_names = []
+
+ if hasattr(t, 'node') and t.node:
+ if t.node == 'NE':
+ entity_names.append(' '.join([child[0] for child in t]))
+ else:
+ for child in t:
+ entity_names.extend(extract_entity_names(child))
+
+ return entity_names
+
+def extract_names(sample):
+ sentences = nltk.sent_tokenize(sample)
+ tokenized_sentences = [nltk.word_tokenize(sentence) for sentence in sentences]
+ tagged_sentences = [nltk.pos_tag(sentence) for sentence in tokenized_sentences]
+ chunked_sentences = nltk.batch_ne_chunk(tagged_sentences, binary=True)
+ # chunked/tagged may be enough to just find and match the nouns
+
+ entity_names = []
+ for tree in chunked_sentences:
+ # Print results per sentence
+ # print extract_entity_names(tree)
+
+ entity_names.extend(extract_entity_names(tree))
+
+ # Print all entity names
+ #print entity_names
+
+ # Print unique entity names
+ print set(entity_names)
+
+cfg = INIConfig(open('/tmp/aws.ini'))
+
+auth = tweepy.OAuthHandler(cfg.api_keys.twitter_consumer_key, cfg.api_keys.twitter_consumer_secret)
+auth.set_access_token(cfg.api_keys.twitter_access_token, cfg.api_keys.twitter_access_token_secret)
+
+#api = tweepy.API(auth)
+api = tweepy.API()
+# If the authentication was successful, you should
+# see the name of the account print out
+#print api.me().name
+# https://github.com/tweepy/tweepy/blob/master/tweepy/api.py
+for status in api.user_timeline(screen_name="ACTPol_Traffic",exclude_replies='true'):
+ print status.text
+ print status.created_at
+ print extract_names(status.text)
+# print api.update_status(status="test")
+
+last_tweet_ids = { "lion": "111", "kitty": "2222" }
+pickle.dump( last_tweet_ids, open( "save.p", "wb" ) )
+last_tweet_ids = pickle.load( open( "save.p", "rb" ) )
--- /dev/null
+++ b/rtpis/index.php
@@ -1,1 +1,21 @@
+<?php
+include ('../include/common.inc.php');
+include_header("Service Alerts", "index");
+echo '<ul data-role="listview" data-theme="e" data-groupingtheme="e">';
+
+ if ($_SESSION['authed'] == true) {
+ echo' <li><a href="servicealert_editor.php"><h3>servicealert_editor</h3>
+ <p>servicealert_editor</p></a></li>';
+ }
+ echo' <li><a href="servicealert_viewer.php"><h3>Service Alert Viewer</h3>
+ <p>Browse current network alerts</p></a></li>';
+
+ echo' </ul>';
+
+?> </div>
+<?php
+include_footer()
+?>
+
+
--- /dev/null
+++ b/rtpis/punkt.zip
--- /dev/null
+++ b/rtpis/servicealert_editor.php
@@ -1,1 +1,189 @@
+<?php
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
+include ('../include/common.inc.php');
+auth();
+include_header("Service Alert Editor", "serviceAlertEditor");
+/**
+ * Currently support:
+ * network inform
+ * stop remove: route patch, stop remove
+ * - stop search
+ * street inform: route inform, stop inform
+ * - street search
+ */
+if (isset($_REQUEST['saveedit'])) {
+
+ if ($_REQUEST['saveedit'] != "") {
+ updateServiceAlert($_REQUEST['saveedit'], $_REQUEST);
+ } else {
+ addServiceAlert($_REQUEST);
+ }
+ echo "Saved " . $_REQUEST['saveedit'];
+ die();
+}
+if (isset($_REQUEST['delete'])) {
+ $deleteParts = explode(";", $_REQUEST['delete']);
+ deleteInformedAlert($deleteParts[0], $deleteParts[1], $deleteParts[2]);
+ echo "Deleted network inform for {$deleteParts[0]} ({$deleteParts[1]},{$deleteParts[2]})<br>\n";
+ die();
+}
+if (isset($_REQUEST['networkinform'])) {
+ addInformedAlert($_REQUEST['networkinform'], "agency", "0", "inform");
+ echo "Added network inform for" . $_REQUEST['networkinform'];
+ die();
+}
+if (isset($_REQUEST['stopsearch'])) {
+ addInformedAlert($_REQUEST['stopsearch'], "stop", $_REQUEST['stopid'], "remove");
+ echo "Added stop remove for" . $_REQUEST['stopsearch'] . ", stop" . $_REQUEST['stopid'] . "<br>\n";
+
+ foreach ($service_periods as $sp) {
+ echo "Remove from $sp routes<br>\n";
+ foreach (getStopRoutes($_REQUEST['stopid'], $sp) as $route) {
+ addInformedAlert($_REQUEST['stopsearch'], "route", $route['route_id'], "patch");
+ echo "Added route patch for" . $_REQUEST['stopsearch'] . ", route" . $route['route_id'] . "<br>\n";
+ }
+ }
+ die();
+}
+if (isset($_REQUEST['streetsearch'])) {
+
+ echo "Informing stops of street<br>\n";
+ foreach (getStopsByName($_REQUEST['street']) as $stop) {
+ addInformedAlert($_REQUEST['streetsearch'], "stop", $stop['stop_id'], "inform");
+ echo "Added stop inform for" . $_REQUEST['streetsearch'] . ", stop" . $stop['stop_id'] . " ". $stop['stop_name']."<br>\n";
+
+ foreach ($service_periods as $sp) {
+ echo "Informing $sp routes<br>\n";
+ foreach (getStopRoutes($stop['stop_id'], $sp) as $route) {
+ addInformedAlert($_REQUEST['streetsearch'], "route", $route['route_id'], "inform");
+ echo "Added route inform for stop" . $_REQUEST['streetsearch'] . ", route" . $route['route_id'] . "<br>\n";
+ }
+ }
+ }
+
+ die();
+}
+?>
+Active and Future Alerts:
+<table>
+ <?php
+ foreach (getFutureAlerts() as $alert) {
+ echo "<tr><td>" . date("c", $alert['start']) . "</td><td>" . date("c", $alert['end']) . "</td><td>" . substr($alert['description'], 0, 999) . '</td><td><a href="?edit=' . $alert['id'] . '">edit</a></td></tr>';
+ }
+ ?>
+</table>
+<?php
+$alert = getServiceAlert((isset($_REQUEST['edit'])?$_REQUEST['edit']:""));
+?>
+<form action="<?php echo basename(__FILE__);
+?>" method="get">
+
+ <div data-role="fieldcontain">
+ <label for="startdate"> Start Date</label>
+ <input type="text" name="startdate" id="startdate" value="<?php
+ if ($alert['start']) {
+ echo date("c", $alert['start']);
+ } else {
+ echo date("c", strtotime("0:00"));
+}
+?>" />
+ </div>
+ <div data-role="fieldcontain">
+ <label for="enddate"> End Date </label>
+ <input type="text" name="enddate" id="enddate" value="<?php
+ if ($alert['end']) {
+ echo date("c", $alert['end']);
+ } else {
+ echo date("c", strtotime("23:59"));
+}
+?>" />
+ </div>
+ <div data-role="fieldcontain">
+ <label for="header">Header</label>
+ <input type="text" name="header" id="header" value="<?php echo $alert['header']; ?>" />
+ </div>
+ <div data-role="fieldcontain">
+ <label for="description">Description</label>
+ <textarea name="description"><?php echo $alert['description']; ?></textarea>
+ </div>
+ <div data-role="fieldcontain">
+ <label for="url">URL</label>
+ <input type="text" name="url" id="url" value="<?php echo $alert['url']; ?>" />
+ </div>
+ <div data-role="fieldcontain">
+ <label for="cause"> Cause: </label>
+ <select name="cause" id="cause">
+
+ <?php
+ foreach ($serviceAlertCause as $key => $value) {
+ echo "<option value=\"$key\"" . ($key === $alert['cause'] ? " SELECTED" : "") . '>' . $value . '</option>';
+ }
+ ?>
+ </select></div>
+ <div data-role="fieldcontain">
+ <label for="effect"> Effect: </label>
+ <select name="effect" id="effect">
+ <?php
+ foreach ($serviceAlertEffect as $key => $value) {
+ echo "<option value=\"$key\"" . ($key === $alert['effect'] ? " SELECTED" : "") . '>' . $value . '</option>';
+ }
+ ?>
+ </select></div>
+ <input type="hidden" name="saveedit" value="<?php if (isset($_REQUEST['edit']))echo $_REQUEST['edit']; ?>"/>
+ <input type="submit" value="Save"/>
+</div></form>
+
+<?php
+if (isset($_REQUEST['edit'])) {
+ echo "Informed Entities for ID {$_REQUEST['edit']}:";
+ echo '<table>';
+ foreach (getInformedAlerts($_REQUEST['edit'], "", "") as $informed) {
+ echo "<tr><td>{$informed['informed_class']}</td><td>{$informed['informed_id']}</td><td>{$informed['informed_action']}" . '</td><td><a href="?delete=' . $_REQUEST['edit'] . ';' . $informed['informed_class'] . ';' . $informed['informed_id'] . '">delete</a></td></tr>';
+ }
+ echo '</table>';
+ ?>
+ <form action="<?php echo basename(__FILE__);
+ ?>" method="get">
+ <input type="hidden" name="networkinform" value="<?php echo $_REQUEST['edit'];
+ ?>"/>
+ <input type="submit" value="Add Network Inform"/>
+ </form>
+ <form action="<?php echo basename(__FILE__);
+ ?>" method="get">
+ <div data-role="fieldcontain">
+ <label for="stopid">StopID to remove</label>
+ <input type="text" name="stopid" />
+ </div>
+ <input type="hidden" name="stopsearch" value="<?php echo $_REQUEST['edit'];
+ ?>"/>
+ <input type="submit" value="Stop Search"/>
+ </form>
+ <form action="<?php echo basename(__FILE__);
+ ?>" method="get">
+ <div data-role="fieldcontain">
+ <label for="street">Street to inform</label>
+ <input type="text" name="street" />
+ </div>
+ <input type="hidden" name="streetsearch" value="<?php echo $_REQUEST['edit'];
+ ?>"/>
+ <input type="submit" value="Street Search"/>
+ </form>
+ <?php
+}
+include_footer();
+?>
+
--- /dev/null
+++ b/rtpis/servicealert_viewer.php
@@ -1,1 +1,53 @@
+<?php
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
+include ('../include/common.inc.php');
+include_header("Service Alert Viewer", "serviceAlertViewer");
+/**
+ * Currently support:
+ * network inform
+ * stop remove: route patch, stop remove
+ * - stop search
+ * street inform: route inform, stop inform
+ * - street search
+ */
+if (!isset($_REQUEST['view'])) {
+
+?>
+Active and Future Alerts:
+<table>
+ <?php
+ foreach (getFutureAlerts() as $alert) {
+ echo "<tr><td>{$alert['header']}</td><td>" . substr($alert['description'], 0, 999) . '</td><td><a href="?view=' . $alert['id'] . '">View</a></td></tr>';
+ }
+ ?>
+</table>
+<?php
+} else {
+$alert = getServiceAlert($_REQUEST['view']);
+echo "<h1>{$alert['header']}</h1>
+<h2> From ".date("c",$alert['start'])." to ".date("c",$alert['end'])."</h2>
+<small>{$alert['description']}</small><br>
+Source: <A href='{$alert['url']}'>{$alert['url']}</a><br>";
+ echo "Informed Entities for ID {$_REQUEST['view']}:";
+ echo '<table>';
+ foreach (getInformedAlerts($_REQUEST['view'], "", "") as $informed) {
+ echo "<tr><td>{$informed['informed_class']}</td><td>{$informed['informed_id']}</td><td>{$informed['informed_action']}" . '</td></tr>';
+ }
+ echo '</table>';
+}
+include_footer();
+?>
--- /dev/null
+++ b/rtpis/siri.php
@@ -1,1 +1,80 @@
+<?php
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
+include ('include/common.inc.php');
+function accept_header($header = false) {
+ // http://jrgns.net/parse_http_accept_header
+ $toret = null;
+ $header = $header ? $header : (array_key_exists('HTTP_ACCEPT', $_SERVER) ? $_SERVER['HTTP_ACCEPT']: false);
+ if ($header) {
+ $types = explode(',', $header);
+ $types = array_map('trim', $types);
+ foreach ($types as $one_type) {
+ $one_type = explode(';', $one_type);
+ $type = array_shift($one_type);
+ if ($type) {
+ list($precedence, $tokens) = self::accept_header_options($one_type);
+ list($main_type, $sub_type) = array_map('trim', explode('/', $type));
+ $toret[] = array('main_type' => $main_type, 'sub_type' => $sub_type, 'precedence' => (float)$precedence, 'tokens' => $tokens);
+ }
+ }
+ usort($toret, array('Parser', 'compare_media_ranges'));
+ }
+ return $toret;
+}
+function usage() {
+echo "Usage notes: Must specify format json/xml. If callback is specified, will provide jsonp. Can filter with parmaters filter_class route/stop and filter_id with the id specified in GTFS."
+die();
+}
+$json_types = Array("application/json","application/x-javascript","text/javascript","text/x-javascript","text/x-json");
+if ($_REQUEST['json']) {
+if ($_REQUEST['alerts']) {
+ $return = getServiceAlertsAsJSON($_REQUEST['filter_class'], $_REQUEST['filter_id']);
+} else if ($_REQUEST['updates']) {
+ $return = getTripUpdatesAsJSON($_REQUEST['filter_class'], $_REQUEST['filter_id']);
+} else {
+ usage();
+}
+ header('Content-Type: application/json; charset=utf8');
+// header('Access-Control-Allow-Origin: http://bus.lambdacomplex.org/');
+ header('Access-Control-Max-Age: 3628800');
+ header('Access-Control-Allow-Methods: GET, POST, PUT, DELETE');
+ if (isset($_GET['callback'])) {
+ $json = '(' . $return . ');'; //must wrap in parens and end with semicolon
+ //print_r($_GET['callback'] . $json); //callback is prepended for json-p
+ }
+ else {
+ echo $return;
+ }
+} else if ($_REQUEST['xml']) {
+if ($_REQUEST['alerts']) {
+ $return = getServiceAlertsAsBinary($_REQUEST['filter_class'], $_REQUEST['filter_id']);
+} else if ($_REQUEST['updates']) {
+ $return = getTripUpdatesAsBinary($_REQUEST['filter_class'], $_REQUEST['filter_id']);
+} else {
+ usage();
+}
+ header('Content-Type: application/json; charset=utf8');
+// header('Access-Control-Allow-Origin: http://bus.lambdacomplex.org/');
+ header('Access-Control-Max-Age: 3628800');
+ header('Access-Control-Allow-Methods: GET, POST, PUT, DELETE');
+ echo $return;
+} else {
+usage();
+}
+?>
+
--- a/schedule_viewer.py
+++ /dev/null
@@ -1,722 +1,1 @@
-#!/usr/bin/python2.5
-# Copyright (C) 2007 Google Inc.
-#
-# Licensed under the Apache License, Version 2.0 (the "License");
-# you may not use this file except in compliance with the License.
-# You may obtain a copy of the License at
-#
-# http://www.apache.org/licenses/LICENSE-2.0
-#
-# Unless required by applicable law or agreed to in writing, software
-# distributed under the License is distributed on an "AS IS" BASIS,
-# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
-# See the License for the specific language governing permissions and
-# limitations under the License.
-
-"""
-An example application that uses the transitfeed module.
-
-You must provide a Google Maps API key.
-"""
-
-
-import BaseHTTPServer, sys, urlparse
-import bisect
-from gtfsscheduleviewer.marey_graph import MareyGraph
-import gtfsscheduleviewer
-import mimetypes
-import os.path
-import re
-import signal
-import simplejson
-import socket
-import time
-import datetime
-import transitfeed
-from transitfeed import util
-import urllib
-
-
-# By default Windows kills Python with Ctrl+Break. Instead make Ctrl+Break
-# raise a KeyboardInterrupt.
-if hasattr(signal, 'SIGBREAK'):
- signal.signal(signal.SIGBREAK, signal.default_int_handler)
-
-
-mimetypes.add_type('text/plain', '.vbs')
-
-
-class ResultEncoder(simplejson.JSONEncoder):
- def default(self, obj):
- try:
- iterable = iter(obj)
- except TypeError:
- pass
- else:
- return list(iterable)
- return simplejson.JSONEncoder.default(self, obj)
-
-# Code taken from
-# http://aspn.activestate.com/ASPN/Cookbook/Python/Recipe/425210/index_txt
-# An alternate approach is shown at
-# http://mail.python.org/pipermail/python-list/2003-July/212751.html
-# but it requires multiple threads. A sqlite object can only be used from one
-# thread.
-class StoppableHTTPServer(BaseHTTPServer.HTTPServer):
- def server_bind(self):
- BaseHTTPServer.HTTPServer.server_bind(self)
- self.socket.settimeout(1)
- self._run = True
-
- def get_request(self):
- while self._run:
- try:
- sock, addr = self.socket.accept()
- sock.settimeout(None)
- return (sock, addr)
- except socket.timeout:
- pass
-
- def stop(self):
- self._run = False
-
- def serve(self):
- while self._run:
- self.handle_request()
-
-
-def StopToTuple(stop):
- """Return tuple as expected by javascript function addStopMarkerFromList"""
- return (stop.stop_id, stop.stop_name, float(stop.stop_lat),
- float(stop.stop_lon), stop.location_type, stop.stop_code)
-def StopZoneToTuple(stop):
- """Return tuple as expected by javascript function addStopMarkerFromList"""
- return (stop.stop_id, stop.stop_name, float(stop.stop_lat),
- float(stop.stop_lon), stop.location_type, stop.stop_code, stop.zone_id)
-
-class ScheduleRequestHandler(BaseHTTPServer.BaseHTTPRequestHandler):
- cache = {}
-
- def do_GET(self):
- scheme, host, path, x, params, fragment = urlparse.urlparse(self.path)
- parsed_params = {}
- for k in params.split('&'):
- k = urllib.unquote(k)
- if '=' in k:
- k, v = k.split('=', 1)
- parsed_params[k] = unicode(v, 'utf8')
- else:
- parsed_params[k] = ''
-
- if path == '/':
- return self.handle_GET_home()
-
- m = re.match(r'/json/([a-z]{1,64})', path)
- if m:
- handler_name = 'handle_json_GET_%s' % m.group(1)
- handler = getattr(self, handler_name, None)
- if callable(handler):
- return self.handle_json_wrapper_GET(handler, parsed_params, handler_name)
-
- # Restrict allowable file names to prevent relative path attacks etc
- m = re.match(r'/file/([a-z0-9_-]{1,64}\.?[a-z0-9_-]{1,64})$', path)
- if m and m.group(1):
- try:
- f, mime_type = self.OpenFile(m.group(1))
- return self.handle_static_file_GET(f, mime_type)
- except IOError, e:
- print "Error: unable to open %s" % m.group(1)
- # Ignore and treat as 404
-
- m = re.match(r'/([a-z]{1,64})', path)
- if m:
- handler_name = 'handle_GET_%s' % m.group(1)
- handler = getattr(self, handler_name, None)
- if callable(handler):
- return handler(parsed_params)
-
- return self.handle_GET_default(parsed_params, path)
-
- def OpenFile(self, filename):
- """Try to open filename in the static files directory of this server.
- Return a tuple (file object, string mime_type) or raise an exception."""
- (mime_type, encoding) = mimetypes.guess_type(filename)
- assert mime_type
- # A crude guess of when we should use binary mode. Without it non-unix
- # platforms may corrupt binary files.
- if mime_type.startswith('text/'):
- mode = 'r'
- else:
- mode = 'rb'
- return open(os.path.join(self.server.file_dir, filename), mode), mime_type
-
- def handle_GET_default(self, parsed_params, path):
- self.send_error(404)
-
- def handle_static_file_GET(self, fh, mime_type):
- content = fh.read()
- self.send_response(200)
- self.send_header('Content-Type', mime_type)
- self.send_header('Content-Length', str(len(content)))
- self.end_headers()
- self.wfile.write(content)
-
- def AllowEditMode(self):
- return False
-
- def handle_GET_home(self):
- schedule = self.server.schedule
- (min_lat, min_lon, max_lat, max_lon) = schedule.GetStopBoundingBox()
- forbid_editing = ('true', 'false')[self.AllowEditMode()]
-
- agency = ', '.join(a.agency_name for a in schedule.GetAgencyList()).encode('utf-8')
-
- key = self.server.key
- host = self.server.host
-
- # A very simple template system. For a fixed set of values replace [xxx]
- # with the value of local variable xxx
- f, _ = self.OpenFile('index.html')
- content = f.read()
- for v in ('agency', 'min_lat', 'min_lon', 'max_lat', 'max_lon', 'key',
- 'host', 'forbid_editing'):
- content = content.replace('[%s]' % v, str(locals()[v]))
-
- self.send_response(200)
- self.send_header('Content-Type', 'text/html')
- self.send_header('Content-Length', str(len(content)))
- self.end_headers()
- self.wfile.write(content)
-
- def handle_json_GET_routepatterns(self, params):
- """Given a route_id generate a list of patterns of the route. For each
- pattern include some basic information and a few sample trips."""
- schedule = self.server.schedule
- route = schedule.GetRoute(params.get('route', None))
- if not route:
- self.send_error(404)
- return
- time = int(params.get('time', 0))
- sample_size = 10 # For each pattern return the start time for this many trips
-
- pattern_id_trip_dict = route.GetPatternIdTripDict()
- patterns = []
-
- for pattern_id, trips in pattern_id_trip_dict.items():
- time_stops = trips[0].GetTimeStops()
- if not time_stops:
- continue
- has_non_zero_trip_type = False;
- for trip in trips:
- if trip['trip_type'] and trip['trip_type'] != '0':
- has_non_zero_trip_type = True
- name = u'%s to %s, %d stops' % (time_stops[0][2].stop_name, time_stops[-1][2].stop_name, len(time_stops))
- transitfeed.SortListOfTripByTime(trips)
-
- num_trips = len(trips)
- if num_trips <= sample_size:
- start_sample_index = 0
- num_after_sample = 0
- else:
- # Will return sample_size trips that start after the 'time' param.
-
- # Linear search because I couldn't find a built-in way to do a binary
- # search with a custom key.
- start_sample_index = len(trips)
- for i, trip in enumerate(trips):
- if trip.GetStartTime() >= time:
- start_sample_index = i
- break
-
- num_after_sample = num_trips - (start_sample_index + sample_size)
- if num_after_sample < 0:
- # Less than sample_size trips start after 'time' so return all the
- # last sample_size trips.
- num_after_sample = 0
- start_sample_index = num_trips - sample_size
-
- sample = []
- for t in trips[start_sample_index:start_sample_index + sample_size]:
- sample.append( (t.GetStartTime(), t.trip_id) )
-
- patterns.append((name, pattern_id, start_sample_index, sample,
- num_after_sample, (0,1)[has_non_zero_trip_type]))
-
- patterns.sort()
- return patterns
-
- def handle_json_wrapper_GET(self, handler, parsed_params, handler_name):
- """Call handler and output the return value in JSON."""
- schedule = self.server.schedule
- # round times to nearest 100 seconds
- if "time" in parsed_params:
- parsed_params['time'] = int(round(float(parsed_params['time']),-2))
- paramkey = tuple(sorted(parsed_params.items()))
- if handler_name in self.cache and paramkey in self.cache[handler_name] :
- print ("Cache hit for ",handler_name," params ",parsed_params)
- else:
- print ("Cache miss for ",handler_name," params ",parsed_params)
- result = handler(parsed_params)
- if not handler_name in self.cache:
- self.cache[handler_name] = {}
- self.cache[handler_name][paramkey] = ResultEncoder().encode(result)
- content = self.cache[handler_name][paramkey]
- self.send_response(200)
- self.send_header('Content-Type', 'text/plain')
- self.send_header('Content-Length', str(len(content)))
- self.end_headers()
- self.wfile.write(content)
-
- def handle_json_GET_routes(self, params):
- """Return a list of all routes."""
- schedule = self.server.schedule
- result = []
- for r in schedule.GetRouteList():
- servicep = None
- for t in schedule.GetTripList():
- if t.route_id == r.route_id:
- servicep = t.service_period
- break
- result.append( (r.route_id, r.route_short_name, r.route_long_name, servicep.service_id) )
- result.sort(key = lambda x: x[1:3])
- return result
-
- def handle_json_GET_routesearch(self, params):
- """Return a list of routes with matching short name."""
- schedule = self.server.schedule
- routeshortname = params.get('routeshortname', None)
- result = []
- for r in schedule.GetRouteList():
- if r.route_short_name == routeshortname:
- servicep = None
- for t in schedule.GetTripList():
- if t.route_id == r.route_id:
- servicep = t.service_period
- break
- result.append( (r.route_id, r.route_short_name, r.route_long_name, servicep.service_id) )
- result.sort(key = lambda x: x[1:3])
- return result
-
-
- def handle_json_GET_routerow(self, params):
- schedule = self.server.schedule
- route = schedule.GetRoute(params.get('route', None))
- return [transitfeed.Route._FIELD_NAMES, route.GetFieldValuesTuple()]
-
- def handle_json_GET_routetrips(self, params):
- """ Get a trip for a route_id (preferablly the next one) """
- schedule = self.server.schedule
- query = params.get('route_id', None).lower()
- result = []
- for t in schedule.GetTripList():
- if t.route_id == query:
- try:
- starttime = t.GetStartTime()
- except:
- print "Error for GetStartTime of trip #" + t.trip_id + sys.exc_info()[0]
- else:
- result.append ( (starttime, t.trip_id) )
- return sorted(result, key=lambda trip: trip[0])
-
- def handle_json_GET_triprows(self, params):
- """Return a list of rows from the feed file that are related to this
- trip."""
- schedule = self.server.schedule
- try:
- trip = schedule.GetTrip(params.get('trip', None))
- except KeyError:
- # if a non-existent trip is searched for, the return nothing
- return
- route = schedule.GetRoute(trip.route_id)
- trip_row = dict(trip.iteritems())
- route_row = dict(route.iteritems())
- return [['trips.txt', trip_row], ['routes.txt', route_row]]
-
- def handle_json_GET_tripstoptimes(self, params):
- schedule = self.server.schedule
- try:
- trip = schedule.GetTrip(params.get('trip'))
- except KeyError:
- # if a non-existent trip is searched for, the return nothing
- return
- time_stops = trip.GetTimeInterpolatedStops()
- stops = []
- times = []
- for arr,ts,is_timingpoint in time_stops:
- stops.append(StopToTuple(ts.stop))
- times.append(arr)
- return [stops, times]
-
- def handle_json_GET_tripshape(self, params):
- schedule = self.server.schedule
- try:
- trip = schedule.GetTrip(params.get('trip'))
- except KeyError:
- # if a non-existent trip is searched for, the return nothing
- return
- points = []
- if trip.shape_id:
- shape = schedule.GetShape(trip.shape_id)
- for (lat, lon, dist) in shape.points:
- points.append((lat, lon))
- else:
- time_stops = trip.GetTimeStops()
- for arr,dep,stop in time_stops:
- points.append((stop.stop_lat, stop.stop_lon))
- return points
-
-#
-# GeoPo Encode in Python
-# @author : Shintaro Inagaki
-# @param location (Dictionary) [lat (Float), lng (Float), scale(Int)]
-# @return geopo (String)
-#
-
- def handle_json_GET_neareststops(self, params):
- """Return a list of the nearest 'limit' stops to 'lat', 'lon'"""
- schedule = self.server.schedule
- lat = float(params.get('lat'))
- lon = float(params.get('lon'))
- limit = int(params.get('limit',5))
- scale = int(params.get('scale',5)) # 5 = neighbourhood ~ 1km, 4= town 5 by 7km
- stops = []
-
- # 64characters (number + big and small letter + hyphen + underscore)
- chars = "0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ-_"
-
- geopo = ""
-
- # Change a degree measure to a decimal number
- lat = (lat + 90.0) / 180 * 8 ** 10 # 90.0 is forced FLOAT type when lat is INT
- lon = (lon + 180.0) / 360 * 8 ** 10 # 180.0 is same
-
- # Compute a GeoPo code from head and concatenate
- for i in range(scale):
- order = int(lat / (8 ** (9 - i)) % 8) + int(lon / (8 ** (9 - i)) % 8) * 8
- geopo = geopo + chars[order]
-
-
- for s in schedule.GetStopList():
- if s.stop_code.find(geopo) != -1:
- stops.append(s)
-
- if scale == 5:
- print stops
- return [StopToTuple(s) for s in stops]
- else:
- dist_stop_list = []
- for s in stops:
- # TODO: Use util.ApproximateDistanceBetweenStops?
- dist = (s.stop_lat - lat)**2 + (s.stop_lon - lon)**2
- if len(dist_stop_list) < limit:
- bisect.insort(dist_stop_list, (dist, s))
- elif dist < dist_stop_list[-1][0]:
- bisect.insort(dist_stop_list, (dist, s))
- dist_stop_list.pop() # Remove stop with greatest distance
- print dist_stop_list
- return [StopToTuple(s) for dist, s in dist_stop_list]
-
- def handle_json_GET_boundboxstops(self, params):
- """Return a list of up to 'limit' stops within bounding box with 'n','e'
- and 's','w' in the NE and SW corners. Does not handle boxes crossing
- longitude line 180."""
- schedule = self.server.schedule
- n = float(params.get('n'))
- e = float(params.get('e'))
- s = float(params.get('s'))
- w = float(params.get('w'))
- limit = int(params.get('limit'))
- stops = schedule.GetStopsInBoundingBox(north=n, east=e, south=s, west=w, n=limit)
- return [StopToTuple(s) for s in stops]
-
- def handle_json_GET_stops(self, params):
- schedule = self.server.schedule
- return [StopToTuple(s) for s in schedule.GetStopList()]
-
- def handle_json_GET_timingpoints(self, params):
- schedule = self.server.schedule
- matches = []
- for s in schedule.GetStopList():
- if s.stop_code.find("Wj") == -1:
- matches.append(StopToTuple(s))
- return matches
-
- def handle_json_GET_stopsearch(self, params):
- schedule = self.server.schedule
- query = params.get('q', None).lower()
- matches = []
- for s in schedule.GetStopList():
- if s.stop_name.lower().find(query) != -1 or s.stop_code.lower().find(query) != -1:
- matches.append(StopToTuple(s))
- return matches
-
- def handle_json_GET_stopnamesearch(self, params):
- schedule = self.server.schedule
- query = params.get('q', None).lower()
- matches = []
- for s in schedule.GetStopList():
- if s.stop_name.lower().find(query) != -1:
- matches.append(StopToTuple(s))
- return matches
-
- def handle_json_GET_stopcodesearch(self, params):
- schedule = self.server.schedule
- query = params.get('q', None).lower()
- matches = []
- for s in schedule.GetStopList():
- if s.stop_code.lower().find(query) != -1:
- matches.append(StopToTuple(s))
- return matches
-
- def handle_json_GET_stopzonesearch(self, params):
- schedule = self.server.schedule
- query = params.get('q', None).lower()
- matches = []
- for s in schedule.GetStopList():
- if s.zone_id != None and s.zone_id.lower().find(query) != -1:
- matches.append(StopToTuple(s))
- return matches
-
- def handle_json_GET_stop(self, params):
- schedule = self.server.schedule
- query = params.get('stop_id', None).lower()
- for s in schedule.GetStopList():
- if s.stop_id.lower() == query:
- return StopToTuple(s)
- return []
- def handle_json_GET_stoproutes(self, params):
- """Given a stop_id return all routes to visit the stop."""
- schedule = self.server.schedule
- stop = schedule.GetStop(params.get('stop', None))
- service_period = params.get('service_period', None)
- trips = stop.GetTrips(schedule)
- result = {}
- for trip in trips:
- route = schedule.GetRoute(trip.route_id)
- if not route.route_short_name+route.route_long_name+trip.service_id in result:
- result[route.route_short_name+route.route_long_name+trip.service_id] = (route.route_id, route.route_short_name, route.route_long_name, trip.trip_id, trip.service_id)
- return result
-
- def handle_json_GET_stopalltrips(self, params):
- """Given a stop_id return all trips to visit the stop."""
- schedule = self.server.schedule
- stop = schedule.GetStop(params.get('stop', None))
- service_period = params.get('service_period', None)
- time_trips = stop.GetStopTimeTrips(schedule)
- result = []
- for time, (trip, index), tp in time_trips:
- headsign = None
- # Find the most recent headsign from the StopTime objects
- for stoptime in trip.GetStopTimes()[index::-1]:
- if stoptime.stop_headsign:
- headsign = stoptime.stop_headsign
- break
- # If stop_headsign isn't found, look for a trip_headsign
- if not headsign:
- headsign = trip.trip_headsign
- route = schedule.GetRoute(trip.route_id)
- trip_name = ''
- if route.route_short_name:
- trip_name += route.route_short_name
- if route.route_long_name:
- if len(trip_name):
- trip_name += " - "
- trip_name += route.route_long_name
- if service_period == None or trip.service_id == service_period:
- result.append((time, (trip.trip_id, trip_name, trip.service_id), tp))
- return result
-
-
-
- def handle_json_GET_stoptrips(self, params):
- """Given a stop_id and time in seconds since midnight return the next
- trips to visit the stop."""
- schedule = self.server.schedule
- stop = schedule.GetStop(params.get('stop', None))
- requested_time = int(params.get('time', 0))
- limit = int(params.get('limit', 15))
- service_period = params.get('service_period', None)
- time_range = int(params.get('time_range', 24*60*60))
-
-
- filtered_time_trips = []
- for trip, index in stop._GetTripIndex(schedule):
- tripstarttime = trip.GetStartTime()
- if tripstarttime > requested_time and tripstarttime < (requested_time + time_range):
- time, stoptime, tp = trip.GetTimeInterpolatedStops()[index]
- if time > requested_time and time < (requested_time + time_range):
- bisect.insort(filtered_time_trips, (time, (trip, index), tp))
-
- result = []
- for time, (trip, index), tp in filtered_time_trips:
- if len(result) > limit:
- break
- headsign = None
- # Find the most recent headsign from the StopTime objects
- for stoptime in trip.GetStopTimes()[index::-1]:
- if stoptime.stop_headsign:
- headsign = stoptime.stop_headsign
- break
- # If stop_headsign isn't found, look for a trip_headsign
- if not headsign:
- headsign = trip.trip_headsign
- route = schedule.GetRoute(trip.route_id)
- trip_name = ''
- if route.route_short_name:
- trip_name += route.route_short_name
- if route.route_long_name:
- if len(trip_name):
- trip_name += " - "
- trip_name += route.route_long_name
- # comment out directions because we already have them in the long name
- #if headsign:
- # trip_name += " (Direction: %s)" % headsign
- if service_period == None or trip.service_id == service_period:
- result.append((time, (trip.trip_id, trip_name, trip.service_id), tp))
- return result
-
- def handle_GET_ttablegraph(self,params):
- """Draw a Marey graph in SVG for a pattern (collection of trips in a route
- that visit the same sequence of stops)."""
- schedule = self.server.schedule
- marey = MareyGraph()
- trip = schedule.GetTrip(params.get('trip', None))
- route = schedule.GetRoute(trip.route_id)
- height = int(params.get('height', 300))
-
- if not route:
- print 'no such route'
- self.send_error(404)
- return
-
- pattern_id_trip_dict = route.GetPatternIdTripDict()
- pattern_id = trip.pattern_id
- if pattern_id not in pattern_id_trip_dict:
- print 'no pattern %s found in %s' % (pattern_id, pattern_id_trip_dict.keys())
- self.send_error(404)
- return
- triplist = pattern_id_trip_dict[pattern_id]
-
- pattern_start_time = min((t.GetStartTime() for t in triplist))
- pattern_end_time = max((t.GetEndTime() for t in triplist))
-
- marey.SetSpan(pattern_start_time,pattern_end_time)
- marey.Draw(triplist[0].GetPattern(), triplist, height)
-
- content = marey.Draw()
-
- self.send_response(200)
- self.send_header('Content-Type', 'image/svg+xml')
- self.send_header('Content-Length', str(len(content)))
- self.end_headers()
- self.wfile.write(content)
-
-
-def FindPy2ExeBase():
- """If this is running in py2exe return the install directory else return
- None"""
- # py2exe puts gtfsscheduleviewer in library.zip. For py2exe setup.py is
- # configured to put the data next to library.zip.
- windows_ending = gtfsscheduleviewer.__file__.find('\\library.zip\\')
- if windows_ending != -1:
- return transitfeed.__file__[:windows_ending]
- else:
- return None
-
-
-def FindDefaultFileDir():
- """Return the path of the directory containing the static files. By default
- the directory is called 'files'. The location depends on where setup.py put
- it."""
- base = FindPy2ExeBase()
- if base:
- return os.path.join(base, 'schedule_viewer_files')
- else:
- # For all other distributions 'files' is in the gtfsscheduleviewer
- # directory.
- base = os.path.dirname(gtfsscheduleviewer.__file__) # Strip __init__.py
- return os.path.join(base, 'files')
-
-
-def GetDefaultKeyFilePath():
- """In py2exe return absolute path of file in the base directory and in all
- other distributions return relative path 'key.txt'"""
- windows_base = FindPy2ExeBase()
- if windows_base:
- return os.path.join(windows_base, 'key.txt')
- else:
- return 'key.txt'
-
-
-def main(RequestHandlerClass = ScheduleRequestHandler):
- usage = \
-'''%prog [options] [<input GTFS.zip>]
-
-Runs a webserver that lets you explore a <input GTFS.zip> in your browser.
-
-If <input GTFS.zip> is omited the filename is read from the console. Dragging
-a file into the console may enter the filename.
-'''
- parser = util.OptionParserLongError(
- usage=usage, version='%prog '+transitfeed.__version__)
- parser.add_option('--feed_filename', '--feed', dest='feed_filename',
- help='file name of feed to load')
- parser.add_option('--key', dest='key',
- help='Google Maps API key or the name '
- 'of a text file that contains an API key')
- parser.add_option('--host', dest='host', help='Host name of Google Maps')
- parser.add_option('--port', dest='port', type='int',
- help='port on which to listen')
- parser.add_option('--file_dir', dest='file_dir',
- help='directory containing static files')
- parser.add_option('-n', '--noprompt', action='store_false',
- dest='manual_entry',
- help='disable interactive prompts')
- parser.set_defaults(port=8765,
- host='maps.google.com',
- file_dir=FindDefaultFileDir(),
- manual_entry=True)
- (options, args) = parser.parse_args()
-
- if not os.path.isfile(os.path.join(options.file_dir, 'index.html')):
- print "Can't find index.html with --file_dir=%s" % options.file_dir
- exit(1)
-
- if not options.feed_filename and len(args) == 1:
- options.feed_filename = args[0]
-
- if not options.feed_filename and options.manual_entry:
- options.feed_filename = raw_input('Enter Feed Location: ').strip('"')
-
- default_key_file = GetDefaultKeyFilePath()
- if not options.key and os.path.isfile(default_key_file):
- options.key = open(default_key_file).read().strip()
-
- if options.key and os.path.isfile(options.key):
- options.key = open(options.key).read().strip()
-
- schedule = transitfeed.Schedule(problem_reporter=transitfeed.ProblemReporter())
- print 'Loading data from feed "%s"...' % options.feed_filename
- print '(this may take a few minutes for larger cities)'
- t0 = datetime.datetime.now()
- schedule.Load(options.feed_filename)
- print ("Loaded in", (datetime.datetime.now() - t0).seconds , "seconds")
- server = StoppableHTTPServer(server_address=('', options.port),
- RequestHandlerClass=RequestHandlerClass)
- server.key = options.key
- server.schedule = schedule
- server.file_dir = options.file_dir
- server.host = options.host
- server.feed_path = options.feed_filename
-
-
-
- print ("To view, point your browser at http://localhost:%d/" %
- (server.server_port))
- server.serve_forever()
-
-
-if __name__ == '__main__':
- main()
-
--- /dev/null
+++ b/setup/busuidb.sh
@@ -1,1 +1,19 @@
+createdb transitdata
+createlang -d transitdata plpgsql
+psql -d transitdata -f /var/www/lib/postgis.sql
+# curl https://github.com/maxious/ACTBus-ui/raw/master/transitdata.cbrfeed.sql.gz -o transitdata.cbrfeed.sql.gz
+#made with pg_dump transitdata | gzip -c > transitdata.cbrfeed.sql.gz
+gunzip /var/www/transitdata.cbrfeed.sql.gz
+psql -d transitdata -f /var/www/transitdata.cbrfeed.sql
+#createuser transitdata -SDRP
+#password transitdata
+#psql -d transitdata -c "GRANT SELECT ON TABLE agency,calendar,calendar_dates,routes,stop_times,stops,trips TO transitdata;"
+#psql -d transitdata -c "GRANT SELECT,INSERT ON TABLE myway_observations,myway_timingdeltas,myway_routes,myway_stops TO transitdata;"
+#psql -d transitdata -c "GRANT SELECT,INSERT,UPDATE ON TABLE servicealerts_alerts,servicealerts_informed TO transitdata;"
+#psql -d transitdata -c "GRANT USAGE,SELECT ON SEQUENCE servicealerts_alerts_id_seq TO transitdata;"
+##psql -d transitdata -c "GRANT SELECT ON ALL TABLES IN SCHEMA public TO transitdata;"
+## INSERT INTO geometry_columns(f_table_catalog, f_table_schema, f_table_name, f_geometry_column, coord_dimension, srid, "type")
+##SELECT '', 'public', 'shapes', 'shape_pt', ST_CoordDim(shape_pt), ST_SRID(shape_pt), GeometryType(shape_pt)
+##FROM shapes LIMIT 1;
+php /var/www/updatedb.php
--- /dev/null
+++ b/setup/busuiotp.sh
@@ -1,1 +1,10 @@
+wget http://s3-ap-southeast-1.amazonaws.com/busresources/Graph.obj \
+-O /tmp/Graph.obj
+/etc/init.d/tomcat6 stop
+rm -rfv /usr/share/tomcat6/webapps/opentripplanner*
+wget http://s3-ap-southeast-1.amazonaws.com/busresources/opentripplanner-webapp.war \
+-O /usr/share/tomcat6/webapps/opentripplanner-webapp.war
+wget http://s3-ap-southeast-1.amazonaws.com/busresources/opentripplanner-api-webapp.war \
+-O /usr/share/tomcat6/webapps/opentripplanner-api-webapp.war
+/etc/init.d/tomcat6 restart
--- /dev/null
+++ b/setup/busuiotp.testing.sh
@@ -1,1 +1,10 @@
+wget http://s3-ap-southeast-1.amazonaws.com/busresources/testing/Graph.obj \
+-O /tmp/Graph.obj
+/etc/init.d/tomcat6 stop
+rm -rfv /usr/share/tomcat6/webapps/opentripplanner*
+wget http://s3-ap-southeast-1.amazonaws.com/busresources/testing/opentripplanner-webapp.war \
+-O /usr/share/tomcat6/webapps/opentripplanner-webapp.war
+wget http://s3-ap-southeast-1.amazonaws.com/busresources/testing/opentripplanner-api-webapp.war \
+-O /usr/share/tomcat6/webapps/opentripplanner-api-webapp.war
+/etc/init.d/tomcat6 restart
--- /dev/null
+++ b/setup/busuiphp.sh
@@ -1,1 +1,12 @@
+cp /root/aws.php /tmp/
+chmod 777 /var/cache/lighttpd/compress/
+chcon -h system_u:object_r:httpd_sys_content_t /var/www
+chcon -R -h root:object_r:httpd_sys_content_t /var/www/*
+
+chcon -R -t httpd_sys_content_rw_t /var/www/labs/tiles
+chmod -R 777 /var/www/labs/tiles
+
+wget http://s3-ap-southeast-1.amazonaws.com/busresources/cbrfeed.zip \
+-O /var/www/cbrfeed.zip
+
--- /dev/null
+++ b/setup/compress.conf
@@ -1,1 +1,33 @@
+#######################################################################
+##
+## Output Compression
+## --------------------
+##
+## see http://www.lighttpd.net/documentation/compress.html
+##
+server.modules += ( "mod_compress" )
+##
+## where should the compressed files be cached?
+## see the base config for the declaration of the variable.
+##
+## This directory should be changed per vhost otherwise you can
+## run into trouble with overlapping filenames
+##
+compress.cache-dir = cache_dir + "/compress"
+
+##
+## FileTypes to compress.
+##
+#compress.filetype = ("text/plain", "text/html")
+compress.filetype = ("text/plain", "text/html", "text/javascript", "text/css", "text/xml")
+
+##
+## Maximum filesize that will be compressed.
+## Default is 0, which means unlimited file size.
+##
+#compress.max-filesize = 0
+
+##
+#######################################################################
+
--- /dev/null
+++ b/setup/data-sources.xml
@@ -1,1 +1,13 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<beans xmlns="http://www.springframework.org/schema/beans" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance"
+ xsi:schemaLocation="http://www.springframework.org/schema/beans http://www.springframework.org/schema/beans/spring-beans-2.5.xsd">
+ <!-- Single graph -->
+ <import resource="classpath:org/opentripplanner/api/application-context.xml" />
+
+ <bean id="graphBundle" class="org.opentripplanner.model.GraphBundle">
+ <property name="path" value="/tmp/" />
+ </bean>
+
+</beans>
+
--- /dev/null
+++ b/setup/expire.conf
@@ -1,1 +1,29 @@
+#######################################################################
+##
+## Expire Module
+## ---------------
+##
+## See http://www.lighttpd.net/documentation/expire.html
+##
+server.modules += ( "mod_expire" )
+##
+## assignes a expiration to all files below the specified path. The
+## specification of the time is made up of:
+##
+## <access|modification> <number> <years|months|days|hours|minutes|seconds>
+##
+#expire.url = (
+# "/buggy/" => "access 2 hours",
+# "/images/" => "access plus 1 seconds 2 minutes"
+#)
+etag.use-mtime = "enable"
+etag.use-inode = "disable"
+static-file.etags = "enable"
+$HTTP["url"] =~ "\.(css|js|png|jpg|ico|gif)$" {
+ expire.url = ( "" => "access 7 days" )
+}
+
+##
+#######################################################################
+
--- /dev/null
+++ b/setup/fastcgi.conf
@@ -1,1 +1,144 @@
+#######################################################################
+##
+## FastCGI Module
+## ---------------
+##
+## http://www.lighttpd.net/documentation/fastcgi.html
+##
+server.modules += ( "mod_fastcgi" )
+fastcgi.server = ( ".php" =>
+ ( "localhost" =>
+ (
+ "socket" =>
+"/var/run/lighttpd/php-fastcgi.socket",
+ "bin-path" => "/usr/bin/php-cgi"
+ )
+ )
+ )
+##
+## PHP Example
+## For PHP don't forget to set cgi.fix_pathinfo = 1 in the php.ini.
+##
+## The number of php processes you will get can be easily calculated:
+##
+## num-procs = max-procs * ( 1 + PHP_FCGI_CHILDREN )
+##
+## for the php-num-procs example it means you will get 17*5 = 85 php
+## processes. you always should need this high number for your very
+## busy sites. And if you have a lot of RAM. :)
+##
+#fastcgi.server = ( ".php" =>
+# ( "php-local" =>
+# (
+# "socket" => socket_dir + "/php-fastcgi-1.socket",
+# "bin-path" => server_root + "/php-cgi",
+# "max-procs" => 1,
+# "broken-scriptfilename" => "enable",
+# )
+# ),
+# ( "php-tcp" =>
+# (
+# "host" => "127.0.0.1",
+# "port" => 9999,
+# "check-local" => "disable",
+# "broken-scriptfilename" => "enable",
+# )
+# ),
+#
+# ( "php-num-procs" =>
+# (
+# "socket" => socket_dir + "/php-fastcgi-2.socket",
+# "bin-path" => server_root + "/php-cgi",
+# "bin-environment" => (
+# "PHP_FCGI_CHILDREN" => "16",
+# "PHP_FCGI_MAX_REQUESTS" => "10000",
+# ),
+# "max-procs" => 5,
+# "broken-scriptfilename" => "enable",
+# )
+# ),
+# )
+##
+## Ruby on Rails Example
+##
+## Normally you only run one Rails application on one vhost.
+##
+#$HTTP["host"] == "rails1.example.com" {
+# server.document-root = server_root + "/rails/someapp/public"
+# server.error-handler-404 = "/dispatch.fcgi"
+# fastcgi.server = ( ".fcgi" =>
+# ("someapp" =>
+# ( "socket" => socket_dir + "/someapp-fcgi.socket",
+# "bin-path" => server_root + "/rails/someapp/public/dispatch.fcgi",
+# "bin-environment" => (
+# "RAILS_ENV" => "production",
+# "TMP" => home_dir + "/rails/someapp",
+# ),
+# )
+# )
+# )
+#}
+
+##
+## Another example with multiple rails applications on one vhost.
+##
+## http://blog.lighttpd.net/articles/2005/11/23/lighttpd-1-4-8-and-multiple-rails-apps
+##
+#$HTTP["host"] == "rails2.example.com" {
+# $HTTP["url"] =~ "^/someapp1" {
+# server.document-root = server_root + "/rails/someapp1/public"
+# server.error-handler-404 = "/dispatch.fcgi"
+# fastcgi.server = ( ".fcgi" =>
+# ("someapp1" =>
+# ( "socket" => socket_dir + "/someapp1-fcgi.socket",
+# "bin-path" => server_root + "/rails/someapp1/public/dispatch.fcgi",
+# "bin-environment" => (
+# "RAILS_ENV" => "production",
+# "TMP" => home_dir + "/rails/someapp1",
+# ),
+# "strip-request-uri" => "/someapp1/"
+# )
+# )
+# )
+# }
+#
+# $HTTP["url"] =~ "^/someapp2" {
+# server.document-root = server_root + "/rails/someapp2/public"
+# server.error-handler-404 = "/dispatch.fcgi"
+# fastcgi.server = ( ".fcgi" =>
+# ("someapp2" =>
+# ( "socket" => socket_dir + "/someapp2-fcgi.socket",
+# "bin-path" => server_root + "/rails/someapp2/public/dispatch.fcgi",
+# "bin-environment" => (
+# "RAILS_ENV" => "production",
+# "TMP" => home_dir + "/rails/someapp2",
+# ),
+# "strip-request-uri" => "/someapp2/"
+# )
+# )
+# )
+# }
+#}
+
+## chrooted webserver + external PHP
+##
+## $ spawn-fcgi -f /usr/bin/php-cgi -p 2000 -a 127.0.0.1 -C 8
+##
+## webserver chrooted to /srv/www/
+## php running outside the chroot
+#
+#fastcgi.server = (
+# ".php" => ((
+# "host" => "127.0.0.1",
+# "port" => "2000",
+# "docroot" => "/srv/www/servers/www.example.org/htdocs/"
+# )))
+#
+#server.chroot = "/srv/www"
+#server.document-root = "/servers/wwww.example.org/htdocs/"
+#
+
+##
+#######################################################################
+
--- /dev/null
+++ b/setup/modules.conf
@@ -1,1 +1,173 @@
+#######################################################################
+##
+## Modules to load
+## -----------------
+##
+## at least mod_access and mod_accesslog should be loaded
+## all other module should only be loaded if really neccesary
+##
+## - saves some time
+## - saves memory
+##
+## the default module set contains:
+##
+## "mod_indexfile", "mod_dirlisting", "mod_staticfile"
+##
+## you dont have to include those modules in your list
+##
+## Modules, which are pulled in via conf.d/*.conf
+##
+## NOTE: the order of modules is important.
+##
+## - mod_accesslog -> conf.d/access_log.conf
+## - mod_compress -> conf.d/compress.conf
+## - mod_status -> conf.d/status.conf
+## - mod_webdav -> conf.d/webdav.conf
+## - mod_cml -> conf.d/cml.conf
+## - mod_evhost -> conf.d/evhost.conf
+## - mod_simple_vhost -> conf.d/simple_vhost.conf
+## - mod_mysql_vhost -> conf.d/mysql_vhost.conf
+## - mod_trigger_b4_dl -> conf.d/trigger_b4_dl.conf
+## - mod_userdir -> conf.d/userdir.conf
+## - mod_rrdtool -> conf.d/rrdtool.conf
+## - mod_ssi -> conf.d/ssi.conf
+## - mod_cgi -> conf.d/cgi.conf
+## - mod_scgi -> conf.d/scgi.conf
+## - mod_fastcgi -> conf.d/fastcgi.conf
+## - mod_proxy -> conf.d/proxy.conf
+## - mod_secdownload -> conf.d/secdownload.conf
+## - mod_expire -> conf.d/expire.conf
+##
+server.modules = (
+ "mod_access",
+# "mod_alias",
+# "mod_auth",
+# "mod_evasive",
+# "mod_redirect",
+# "mod_rewrite",
+# "mod_setenv",
+# "mod_usertrack",
+)
+
+##
+#######################################################################
+
+#######################################################################
+##
+## Config for various Modules
+##
+
+##
+## mod_ssi
+##
+#include "conf.d/ssi.conf"
+
+##
+## mod_status
+##
+#include "conf.d/status.conf"
+
+##
+## mod_webdav
+##
+#include "conf.d/webdav.conf"
+
+##
+## mod_compress
+##
+include "conf.d/compress.conf"
+
+##
+## mod_userdir
+##
+#include "conf.d/userdir.conf"
+
+##
+## mod_magnet
+##
+#include "conf.d/magnet.conf"
+
+##
+## mod_cml
+##
+#include "conf.d/cml.conf"
+
+##
+## mod_rrdtool
+##
+#include "conf.d/rrdtool.conf"
+
+##
+## mod_proxy
+##
+#include "conf.d/proxy.conf"
+
+##
+## mod_expire
+##
+include "conf.d/expire.conf"
+
+##
+## mod_secdownload
+##
+#include "conf.d/secdownload.conf"
+
+##
+#######################################################################
+
+#######################################################################
+##
+## CGI modules
+##
+
+##
+## SCGI (mod_scgi)
+##
+#include "conf.d/scgi.conf"
+
+##
+## FastCGI (mod_fastcgi)
+##
+include "conf.d/fastcgi.conf"
+
+##
+## plain old CGI (mod_cgi)
+##
+#include "conf.d/cgi.conf"
+
+##
+#######################################################################
+
+#######################################################################
+##
+## VHost Modules
+##
+## Only load ONE of them!
+## ========================
+##
+
+##
+## You can use conditionals for vhosts aswell.
+##
+## see http://www.lighttpd.net/documentation/configuration.html
+##
+
+##
+## mod_evhost
+##
+#include "conf.d/evhost.conf"
+
+##
+## mod_simple_vhost
+##
+#include "conf.d/simple_vhost.conf"
+
+##
+## mod_mysql_vhost
+##
+#include "conf.d/mysql_vhost.conf"
+
+##
+#######################################################################
+
--- /dev/null
+++ b/setup/pg_hba.conf
@@ -1,1 +1,77 @@
+# PostgreSQL Client Authentication Configuration File
+# ===================================================
+#
+# Refer to the "Client Authentication" section in the
+# PostgreSQL documentation for a complete description
+# of this file. A short synopsis follows.
+#
+# This file controls: which hosts are allowed to connect, how clients
+# are authenticated, which PostgreSQL user names they can use, which
+# databases they can access. Records take one of these forms:
+#
+# local DATABASE USER METHOD [OPTIONS]
+# host DATABASE USER CIDR-ADDRESS METHOD [OPTIONS]
+# hostssl DATABASE USER CIDR-ADDRESS METHOD [OPTIONS]
+# hostnossl DATABASE USER CIDR-ADDRESS METHOD [OPTIONS]
+#
+# (The uppercase items must be replaced by actual values.)
+#
+# The first field is the connection type: "local" is a Unix-domain socket,
+# "host" is either a plain or SSL-encrypted TCP/IP socket, "hostssl" is an
+# SSL-encrypted TCP/IP socket, and "hostnossl" is a plain TCP/IP socket.
+#
+# DATABASE can be "all", "sameuser", "samerole", a database name, or
+# a comma-separated list thereof.
+#
+# USER can be "all", a user name, a group name prefixed with "+", or
+# a comma-separated list thereof. In both the DATABASE and USER fields
+# you can also write a file name prefixed with "@" to include names from
+# a separate file.
+#
+# CIDR-ADDRESS specifies the set of hosts the record matches.
+# It is made up of an IP address and a CIDR mask that is an integer
+# (between 0 and 32 (IPv4) or 128 (IPv6) inclusive) that specifies
+# the number of significant bits in the mask. Alternatively, you can write
+# an IP address and netmask in separate columns to specify the set of hosts.
+#
+# METHOD can be "trust", "reject", "md5", "password", "gss", "sspi", "krb5",
+# "ident", "pam", "ldap" or "cert". Note that "password" sends passwords
+# in clear text; "md5" is preferred since it sends encrypted passwords.
+#
+# OPTIONS are a set of options for the authentication in the format
+# NAME=VALUE. The available options depend on the different authentication
+# methods - refer to the "Client Authentication" section in the documentation
+# for a list of which options are available for which authentication methods.
+#
+# Database and user names containing spaces, commas, quotes and other special
+# characters must be quoted. Quoting one of the keywords "all", "sameuser" or
+# "samerole" makes the name lose its special character, and just match a
+# database or username with that name.
+#
+# This file is read on server startup and when the postmaster receives
+# a SIGHUP signal. If you edit the file on a running system, you have
+# to SIGHUP the postmaster for the changes to take effect. You can use
+# "pg_ctl reload" to do that.
+# Put your actual configuration here
+# ----------------------------------
+#
+# If you want to allow non-local connections, you need to add more
+# "host" records. In that case you will also need to make PostgreSQL listen
+# on a non-local interface via the listen_addresses configuration parameter,
+# or via the -i or -h command line switches.
+#
+
+
+
+# TYPE DATABASE USER CIDR-ADDRESS METHOD
+
+# "local" is for Unix domain socket connections only
+local all all trust
+# IPv4 local connections:
+host all all 127.0.0.1/32 trust
+# IPv6 local connections:
+host all all ::1/128 trust
+#Allow any IP to connect, with a password:
+host all all 0.0.0.0 0.0.0.0 md5
+
--- /dev/null
+++ b/setup/php.ini
@@ -1,1 +1,1662 @@
-
+[PHP]
+
+date.timezone = "Australia/Sydney"
+
+;;;;;;;;;;;;;;;;;;;
+; About php.ini ;
+;;;;;;;;;;;;;;;;;;;
+; PHP's initialization file, generally called php.ini, is responsible for
+; configuring many of the aspects of PHP's behavior.
+
+; PHP attempts to find and load this configuration from a number of locations.
+; The following is a summary of its search order:
+; 1. SAPI module specific location.
+; 2. The PHPRC environment variable. (As of PHP 5.2.0)
+; 3. A number of predefined registry keys on Windows (As of PHP 5.2.0)
+; 4. Current working directory (except CLI)
+; 5. The web server's directory (for SAPI modules), or directory of PHP
+; (otherwise in Windows)
+; 6. The directory from the --with-config-file-path compile time option, or the
+; Windows directory (C:\windows or C:\winnt)
+; See the PHP docs for more specific information.
+; http://www.php.net/manual/en/configuration.file.php
+
+; The syntax of the file is extremely simple. Whitespace and Lines
+; beginning with a semicolon are silently ignored (as you probably guessed).
+; Section headers (e.g. [Foo]) are also silently ignored, even though
+; they might mean something in the future.
+
+; Directives following the section heading [PATH=/www/mysite] only
+; apply to PHP files in the /www/mysite directory. Directives
+; following the section heading [HOST=www.example.com] only apply to
+; PHP files served from www.example.com. Directives set in these
+; special sections cannot be overridden by user-defined INI files or
+; at runtime. Currently, [PATH=] and [HOST=] sections only work under
+; CGI/FastCGI.
+; http://www.php.net/manual/en/ini.sections.php
+
+; Directives are specified using the following syntax:
+; directive = value
+; Directive names are *case sensitive* - foo=bar is different from FOO=bar.
+; Directives are variables used to configure PHP or PHP extensions.
+; There is no name validation. If PHP can't find an expected
+; directive because it is not set or is mistyped, a default value will be used.
+
+; The value can be a string, a number, a PHP constant (e.g. E_ALL or M_PI), one
+; of the INI constants (On, Off, True, False, Yes, No and None) or an expression
+; (e.g. E_ALL & ~E_NOTICE), a quoted string ("bar"), or a reference to a
+; previously set variable or directive (e.g. ${foo})
+
+; Expressions in the INI file are limited to bitwise operators and parentheses:
+; | bitwise OR
+; ^ bitwise XOR
+; & bitwise AND
+; ~ bitwise NOT
+; ! boolean NOT
+
+; Boolean flags can be turned on using the values 1, On, True or Yes.
+; They can be turned off using the values 0, Off, False or No.
+
+; An empty string can be denoted by simply not writing anything after the equal
+; sign, or by using the None keyword:
+
+; foo = ; sets foo to an empty string
+; foo = None ; sets foo to an empty string
+; foo = "None" ; sets foo to the string 'None'
+
+; If you use constants in your value, and these constants belong to a
+; dynamically loaded extension (either a PHP extension or a Zend extension),
+; you may only use these constants *after* the line that loads the extension.
+
+;;;;;;;;;;;;;;;;;;;
+; About this file ;
+;;;;;;;;;;;;;;;;;;;
+; PHP comes packaged with two INI files. One that is recommended to be used
+; in production environments and one that is recommended to be used in
+; development environments.
+
+; php.ini-production contains settings which hold security, performance and
+; best practices at its core. But please be aware, these settings may break
+; compatibility with older or less security conscience applications. We
+; recommending using the production ini in production and testing environments.
+
+; php.ini-development is very similar to its production variant, except it's
+; much more verbose when it comes to errors. We recommending using the
+; development version only in development environments as errors shown to
+; application users can inadvertently leak otherwise secure information.
+
+; This 2 files are provided, by RPM, in /usr/share/doc/php-common-*/
+; File used by RPM (the /etc/php.ini) is mainly the php.ini-production
+
+;;;;;;;;;;;;;;;;;;;
+; Quick Reference ;
+;;;;;;;;;;;;;;;;;;;
+; The following are all the settings which are different in either the production
+; or development versions of the INIs with respect to PHP's default behavior.
+; Please see the actual settings later in the document for more details as to why
+; we recommend these changes in PHP's behavior.
+
+; allow_call_time_pass_reference
+; Default Value: On
+; Development Value: Off
+; Production Value: Off
+
+; display_errors
+; Default Value: On
+; Development Value: On
+; Production Value: Off
+
+; display_startup_errors
+; Default Value: Off
+; Development Value: On
+; Production Value: Off
+
+; error_reporting
+; Default Value: E_ALL & ~E_NOTICE
+; Development Value: E_ALL | E_STRICT
+; Production Value: E_ALL & ~E_DEPRECATED
+
+; html_errors
+; Default Value: On
+; Development Value: On
+; Production value: Off
+
+; log_errors
+; Default Value: Off
+; Development Value: On
+; Production Value: On
+
+; magic_quotes_gpc
+; Default Value: On
+; Development Value: Off
+; Production Value: Off
+
+; max_input_time
+; Default Value: -1 (Unlimited)
+; Development Value: 60 (60 seconds)
+; Production Value: 60 (60 seconds)
+
+; output_buffering
+; Default Value: Off
+; Development Value: 4096
+; Production Value: 4096
+
+; register_argc_argv
+; Default Value: On
+; Development Value: Off
+; Production Value: Off
+
+; register_long_arrays
+; Default Value: On
+; Development Value: Off
+; Production Value: Off
+
+; request_order
+; Default Value: None
+; Development Value: "GP"
+; Production Value: "GP"
+
+; session.bug_compat_42
+; Default Value: On
+; Development Value: On
+; Production Value: Off
+
+; session.bug_compat_warn
+; Default Value: On
+; Development Value: On
+; Production Value: Off
+
+; session.gc_divisor
+; Default Value: 100
+; Development Value: 1000
+; Production Value: 1000
+
+; session.hash_bits_per_character
+; Default Value: 4
+; Development Value: 5
+; Production Value: 5
+
+; short_open_tag
+; Default Value: On
+; Development Value: Off
+; Production Value: Off
+
+; track_errors
+; Default Value: Off
+; Development Value: On
+; Production Value: Off
+
+; url_rewriter.tags
+; Default Value: "a=href,area=href,frame=src,form=,fieldset="
+; Development Value: "a=href,area=href,frame=src,input=src,form=fakeentry"
+; Production Value: "a=href,area=href,frame=src,input=src,form=fakeentry"
+
+; variables_order
+; Default Value: "EGPCS"
+; Development Value: "GPCS"
+; Production Value: "GPCS"
+
+;;;;;;;;;;;;;;;;;;;;
+; php.ini Options ;
+;;;;;;;;;;;;;;;;;;;;
+; Name for user-defined php.ini (.htaccess) files. Default is ".user.ini"
+;user_ini.filename = ".user.ini"
+
+; To disable this feature set this option to empty value
+;user_ini.filename =
+
+; TTL for user-defined php.ini files (time-to-live) in seconds. Default is 300 seconds (5 minutes)
+;user_ini.cache_ttl = 300
+
+;;;;;;;;;;;;;;;;;;;;
+; Language Options ;
+;;;;;;;;;;;;;;;;;;;;
+
+; Enable the PHP scripting language engine under Apache.
+; http://www.php.net/manual/en/apache.configuration.php#ini.engine
+engine = On
+
+; This directive determines whether or not PHP will recognize code between
+; <? and ?> tags as PHP source which should be processed as such. It's been
+; recommended for several years that you not use the short tag "short cut" and
+; instead to use the full <?php and ?> tag combination. With the wide spread use
+; of XML and use of these tags by other languages, the server can become easily
+; confused and end up parsing the wrong code in the wrong context. But because
+; this short cut has been a feature for such a long time, it's currently still
+; supported for backwards compatibility, but we recommend you don't use them.
+; Default Value: On
+; Development Value: Off
+; Production Value: Off
+; http://www.php.net/manual/en/ini.core.php#ini.short-open-tag
+short_open_tag = Off
+
+; Allow ASP-style <% %> tags.
+; http://www.php.net/manual/en/ini.core.php#ini.asp-tags
+asp_tags = Off
+
+; The number of significant digits displayed in floating point numbers.
+; http://www.php.net/manual/en/ini.core.php#ini.precision
+precision = 14
+
+; Enforce year 2000 compliance (will cause problems with non-compliant browsers)
+; http://www.php.net/manual/en/ini.core.php#ini.y2k-compliance
+y2k_compliance = On
+
+; Output buffering is a mechanism for controlling how much output data
+; (excluding headers and cookies) PHP should keep internally before pushing that
+; data to the client. If your application's output exceeds this setting, PHP
+; will send that data in chunks of roughly the size you specify.
+; Turning on this setting and managing its maximum buffer size can yield some
+; interesting side-effects depending on your application and web server.
+; You may be able to send headers and cookies after you've already sent output
+; through print or echo. You also may see performance benefits if your server is
+; emitting less packets due to buffered output versus PHP streaming the output
+; as it gets it. On production servers, 4096 bytes is a good setting for performance
+; reasons.
+; Note: Output buffering can also be controlled via Output Buffering Control
+; functions.
+; Possible Values:
+; On = Enabled and buffer is unlimited. (Use with caution)
+; Off = Disabled
+; Integer = Enables the buffer and sets its maximum size in bytes.
+; Default Value: Off
+; Development Value: 4096
+; Production Value: 4096
+; http://www.php.net/manual/en/outcontrol.configuration.php#ini.output-buffering
+output_buffering = 4096
+
+; You can redirect all of the output of your scripts to a function. For
+; example, if you set output_handler to "mb_output_handler", character
+; encoding will be transparently converted to the specified encoding.
+; Setting any output handler automatically turns on output buffering.
+; Note: People who wrote portable scripts should not depend on this ini
+; directive. Instead, explicitly set the output handler using ob_start().
+; Using this ini directive may cause problems unless you know what script
+; is doing.
+; Note: You cannot use both "mb_output_handler" with "ob_iconv_handler"
+; and you cannot use both "ob_gzhandler" and "zlib.output_compression".
+; Note: output_handler must be empty if this is set 'On' !!!!
+; Instead you must use zlib.output_handler.
+; http://www.php.net/manual/en/outcontrol.configuration.php#ini.output-handler
+;output_handler =
+
+; Transparent output compression using the zlib library
+; Valid values for this option are 'off', 'on', or a specific buffer size
+; to be used for compression (default is 4KB)
+; Note: Resulting chunk size may vary due to nature of compression. PHP
+; outputs chunks that are few hundreds bytes each as a result of
+; compression. If you prefer a larger chunk size for better
+; performance, enable output_buffering in addition.
+; Note: You need to use zlib.output_handler instead of the standard
+; output_handler, or otherwise the output will be corrupted.
+; http://www.php.net/manual/en/zlib.configuration.php#ini.zlib.output-compression
+zlib.output_compression = on
+
+; http://www.php.net/manual/en/zlib.configuration.php#ini.zlib.output-compression-level
+;zlib.output_compression_level = -1
+
+; You cannot specify additional output handlers if zlib.output_compression
+; is activated here. This setting does the same as output_handler but in
+; a different order.
+; http://www.php.net/manual/en/zlib.configuration.php#ini.zlib.output-handler
+;zlib.output_handler =
+
+; Implicit flush tells PHP to tell the output layer to flush itself
+; automatically after every output block. This is equivalent to calling the
+; PHP function flush() after each and every call to print() or echo() and each
+; and every HTML block. Turning this option on has serious performance
+; implications and is generally recommended for debugging purposes only.
+; http://www.php.net/manual/en/outcontrol.configuration.php#ini.implicit-flush
+implicit_flush = Off
+
+; The unserialize callback function will be called (with the undefined class'
+; name as parameter), if the unserializer finds an undefined class
+; which should be instantiated. A warning appears if the specified function is
+; not defined, or if the function doesn't include/implement the missing class.
+; So only set this entry, if you really want to implement such a
+; callback-function.
+unserialize_callback_func =
+
+; When floats & doubles are serialized store serialize_precision significant
+; digits after the floating point. The default value ensures that when floats
+; are decoded with unserialize, the data will remain the same.
+serialize_precision = 100
+
+; This directive allows you to enable and disable warnings which PHP will issue
+; if you pass a value by reference at function call time. Passing values by
+; reference at function call time is a deprecated feature which will be removed
+; from PHP at some point in the near future. The acceptable method for passing a
+; value by reference to a function is by declaring the reference in the functions
+; definition, not at call time. This directive does not disable this feature, it
+; only determines whether PHP will warn you about it or not. These warnings
+; should enabled in development environments only.
+; Default Value: On (Suppress warnings)
+; Development Value: Off (Issue warnings)
+; Production Value: Off (Issue warnings)
+; http://www.php.net/manual/en/ini.core.php#ini.allow-call-time-pass-reference
+allow_call_time_pass_reference = Off
+
+; Safe Mode
+; http://www.php.net/manual/en/ini.sect.safe-mode.php#ini.safe-mode
+safe_mode = Off
+
+; By default, Safe Mode does a UID compare check when
+; opening files. If you want to relax this to a GID compare,
+; then turn on safe_mode_gid.
+; http://www.php.net/manual/en/ini.sect.safe-mode.php#ini.safe-mode-gid
+safe_mode_gid = Off
+
+; When safe_mode is on, UID/GID checks are bypassed when
+; including files from this directory and its subdirectories.
+; (directory must also be in include_path or full path must
+; be used when including)
+; http://www.php.net/manual/en/ini.sect.safe-mode.php#ini.safe-mode-include-dir
+safe_mode_include_dir =
+
+; When safe_mode is on, only executables located in the safe_mode_exec_dir
+; will be allowed to be executed via the exec family of functions.
+; http://www.php.net/manual/en/ini.sect.safe-mode.php#ini.safe-mode-exec-dir
+safe_mode_exec_dir =
+
+; Setting certain environment variables may be a potential security breach.
+; This directive contains a comma-delimited list of prefixes. In Safe Mode,
+; the user may only alter environment variables whose names begin with the
+; prefixes supplied here. By default, users will only be able to set
+; environment variables that begin with PHP_ (e.g. PHP_FOO=BAR).
+; Note: If this directive is empty, PHP will let the user modify ANY
+; environment variable!
+; http://www.php.net/manual/en/ini.sect.safe-mode.php#ini.safe-mode-allowed-env-vars
+safe_mode_allowed_env_vars = PHP_
+
+; This directive contains a comma-delimited list of environment variables that
+; the end user won't be able to change using putenv(). These variables will be
+; protected even if safe_mode_allowed_env_vars is set to allow to change them.
+; http://www.php.net/manual/en/ini.sect.safe-mode.php#ini.safe-mode-protected-env-vars
+safe_mode_protected_env_vars = LD_LIBRARY_PATH
+
+; open_basedir, if set, limits all file operations to the defined directory
+; and below. This directive makes most sense if used in a per-directory
+; or per-virtualhost web server configuration file. This directive is
+; *NOT* affected by whether Safe Mode is turned On or Off.
+; http://www.php.net/manual/en/ini.sect.safe-mode.php#ini.open-basedir
+;open_basedir =
+
+; This directive allows you to disable certain functions for security reasons.
+; It receives a comma-delimited list of function names. This directive is
+; *NOT* affected by whether Safe Mode is turned On or Off.
+; http://www.php.net/manual/en/ini.sect.safe-mode.php#ini.disable-functions
+disable_functions =
+
+; This directive allows you to disable certain classes for security reasons.
+; It receives a comma-delimited list of class names. This directive is
+; *NOT* affected by whether Safe Mode is turned On or Off.
+; http://www.php.net/manual/en/ini.sect.safe-mode.php#ini.disable-classes
+disable_classes =
+
+; Colors for Syntax Highlighting mode. Anything that's acceptable in
+; <span style="color: ???????"> would work.
+; http://www.php.net/manual/en/misc.configuration.php#ini.syntax-highlighting
+;highlight.string = #DD0000
+;highlight.comment = #FF9900
+;highlight.keyword = #007700
+;highlight.bg = #FFFFFF
+;highlight.default = #0000BB
+;highlight.html = #000000
+
+; If enabled, the request will be allowed to complete even if the user aborts
+; the request. Consider enabling it if executing long requests, which may end up
+; being interrupted by the user or a browser timing out. PHP's default behavior
+; is to disable this feature.
+; http://www.php.net/manual/en/misc.configuration.php#ini.ignore-user-abort
+;ignore_user_abort = On
+
+; Determines the size of the realpath cache to be used by PHP. This value should
+; be increased on systems where PHP opens many files to reflect the quantity of
+; the file operations performed.
+; http://www.php.net/manual/en/ini.core.php#ini.realpath-cache-size
+;realpath_cache_size = 16k
+
+; Duration of time, in seconds for which to cache realpath information for a given
+; file or directory. For systems with rarely changing files, consider increasing this
+; value.
+; http://www.php.net/manual/en/ini.core.php#ini.realpath-cache-ttl
+;realpath_cache_ttl = 120
+
+;;;;;;;;;;;;;;;;;
+; Miscellaneous ;
+;;;;;;;;;;;;;;;;;
+
+; Decides whether PHP may expose the fact that it is installed on the server
+; (e.g. by adding its signature to the Web server header). It is no security
+; threat in any way, but it makes it possible to determine whether you use PHP
+; on your server or not.
+; http://www.php.net/manual/en/ini.core.php#ini.expose-php
+expose_php = On
+
+;;;;;;;;;;;;;;;;;;;
+; Resource Limits ;
+;;;;;;;;;;;;;;;;;;;
+
+; Maximum execution time of each script, in seconds
+; http://www.php.net/manual/en/info.configuration.php#ini.max-execution-time
+max_execution_time = 30
+
+; Maximum amount of time each script may spend parsing request data. It's a good
+; idea to limit this time on productions servers in order to eliminate unexpectedly
+; long running scripts.
+; Default Value: -1 (Unlimited)
+; Development Value: 60 (60 seconds)
+; Production Value: 60 (60 seconds)
+; http://www.php.net/manual/en/info.configuration.php#ini.max-input-time
+max_input_time = 60
+
+; Maximum input variable nesting level
+; http://www.php.net/manual/en/info.configuration.php#ini.max-input-nesting-level
+;max_input_nesting_level = 64
+
+; Maximum amount of memory a script may consume (128MB)
+; http://www.php.net/manual/en/ini.core.php#ini.memory-limit
+memory_limit = 128M
+
+;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;
+; Error handling and logging ;
+;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;
+
+; This directive informs PHP of which errors, warnings and notices you would like
+; it to take action for. The recommended way of setting values for this
+; directive is through the use of the error level constants and bitwise
+; operators. The error level constants are below here for convenience as well as
+; some common settings and their meanings.
+; By default, PHP is set to take action on all errors, notices and warnings EXCEPT
+; those related to E_NOTICE and E_STRICT, which together cover best practices and
+; recommended coding standards in PHP. For performance reasons, this is the
+; recommend error reporting setting. Your production server shouldn't be wasting
+; resources complaining about best practices and coding standards. That's what
+; development servers and development settings are for.
+; Note: The php.ini-development file has this setting as E_ALL | E_STRICT. This
+; means it pretty much reports everything which is exactly what you want during
+; development and early testing.
+;
+; Error Level Constants:
+; E_ALL - All errors and warnings (includes E_STRICT as of PHP 6.0.0)
+; E_ERROR - fatal run-time errors
+; E_RECOVERABLE_ERROR - almost fatal run-time errors
+; E_WARNING - run-time warnings (non-fatal errors)
+; E_PARSE - compile-time parse errors
+; E_NOTICE - run-time notices (these are warnings which often result
+; from a bug in your code, but it's possible that it was
+; intentional (e.g., using an uninitialized variable and
+; relying on the fact it's automatically initialized to an
+; empty string)
+; E_STRICT - run-time notices, enable to have PHP suggest changes
+; to your code which will ensure the best interoperability
+; and forward compatibility of your code
+; E_CORE_ERROR - fatal errors that occur during PHP's initial startup
+; E_CORE_WARNING - warnings (non-fatal errors) that occur during PHP's
+; initial startup
+; E_COMPILE_ERROR - fatal compile-time errors
+; E_COMPILE_WARNING - compile-time warnings (non-fatal errors)
+; E_USER_ERROR - user-generated error message
+; E_USER_WARNING - user-generated warning message
+; E_USER_NOTICE - user-generated notice message
+; E_DEPRECATED - warn about code that will not work in future versions
+; of PHP
+; E_USER_DEPRECATED - user-generated deprecation warnings
+;
+; Common Values:
+; E_ALL & ~E_NOTICE (Show all errors, except for notices and coding standards warnings.)
+; E_ALL & ~E_NOTICE | E_STRICT (Show all errors, except for notices)
+; E_COMPILE_ERROR|E_RECOVERABLE_ERROR|E_ERROR|E_CORE_ERROR (Show only errors)
+; E_ALL | E_STRICT (Show all errors, warnings and notices including coding standards.)
+; Default Value: E_ALL & ~E_NOTICE
+; Development Value: E_ALL | E_STRICT
+; Production Value: E_ALL & ~E_DEPRECATED
+; http://www.php.net/manual/en/errorfunc.configuration.php#ini.error-reporting
+error_reporting = E_ALL & ~E_DEPRECATED
+
+; This directive controls whether or not and where PHP will output errors,
+; notices and warnings too. Error output is very useful during development, but
+; it could be very dangerous in production environments. Depending on the code
+; which is triggering the error, sensitive information could potentially leak
+; out of your application such as database usernames and passwords or worse.
+; It's recommended that errors be logged on production servers rather than
+; having the errors sent to STDOUT.
+; Possible Values:
+; Off = Do not display any errors
+; stderr = Display errors to STDERR (affects only CGI/CLI binaries!)
+; On or stdout = Display errors to STDOUT
+; Default Value: On
+; Development Value: On
+; Production Value: Off
+; http://www.php.net/manual/en/errorfunc.configuration.php#ini.display-errors
+display_errors = Off
+
+; The display of errors which occur during PHP's startup sequence are handled
+; separately from display_errors. PHP's default behavior is to suppress those
+; errors from clients. Turning the display of startup errors on can be useful in
+; debugging configuration problems. But, it's strongly recommended that you
+; leave this setting off on production servers.
+; Default Value: Off
+; Development Value: On
+; Production Value: Off
+; http://www.php.net/manual/en/errorfunc.configuration.php#ini.display-startup-errors
+display_startup_errors = Off
+
+; Besides displaying errors, PHP can also log errors to locations such as a
+; server-specific log, STDERR, or a location specified by the error_log
+; directive found below. While errors should not be displayed on productions
+; servers they should still be monitored and logging is a great way to do that.
+; Default Value: Off
+; Development Value: On
+; Production Value: On
+; http://www.php.net/manual/en/errorfunc.configuration.php#ini.log-errors
+log_errors = On
+
+; Set maximum length of log_errors. In error_log information about the source is
+; added. The default is 1024 and 0 allows to not apply any maximum length at all.
+; http://www.php.net/manual/en/errorfunc.configuration.php#ini.log-errors-max-len
+log_errors_max_len = 1024
+
+; Do not log repeated messages. Repeated errors must occur in same file on same
+; line unless ignore_repeated_source is set true.
+; http://www.php.net/manual/en/errorfunc.configuration.php#ini.ignore-repeated-errors
+ignore_repeated_errors = Off
+
+; Ignore source of message when ignoring repeated messages. When this setting
+; is On you will not log errors with repeated messages from different files or
+; source lines.
+; http://www.php.net/manual/en/errorfunc.configuration.php#ini.ignore-repeated-source
+ignore_repeated_source = Off
+
+; If this parameter is set to Off, then memory leaks will not be shown (on
+; stdout or in the log). This has only effect in a debug compile, and if
+; error reporting includes E_WARNING in the allowed list
+; http://www.php.net/manual/en/errorfunc.configuration.php#ini.report-memleaks
+report_memleaks = On
+
+; This setting is on by default.
+;report_zend_debug = 0
+
+; Store the last error/warning message in $php_errormsg (boolean). Setting this value
+; to On can assist in debugging and is appropriate for development servers. It should
+; however be disabled on production servers.
+; Default Value: Off
+; Development Value: On
+; Production Value: Off
+; http://www.php.net/manual/en/errorfunc.configuration.php#ini.track-errors
+track_errors = Off
+
+; Turn off normal error reporting and emit XML-RPC error XML
+; http://www.php.net/manual/en/errorfunc.configuration.php#ini.xmlrpc-errors
+;xmlrpc_errors = 0
+
+; An XML-RPC faultCode
+;xmlrpc_error_number = 0
+
+; When PHP displays or logs an error, it has the capability of inserting html
+; links to documentation related to that error. This directive controls whether
+; those HTML links appear in error messages or not. For performance and security
+; reasons, it's recommended you disable this on production servers.
+; Default Value: On
+; Development Value: On
+; Production value: Off
+; http://www.php.net/manual/en/errorfunc.configuration.php#ini.html-errors
+html_errors = Off
+
+; If html_errors is set On PHP produces clickable error messages that direct
+; to a page describing the error or function causing the error in detail.
+; You can download a copy of the PHP manual from http://www.php.net/docs.php
+; and change docref_root to the base URL of your local copy including the
+; leading '/'. You must also specify the file extension being used including
+; the dot. PHP's default behavior is to leave these settings empty.
+; Note: Never use this feature for production boxes.
+; http://www.php.net/manual/en/errorfunc.configuration.php#ini.docref-root
+; Examples
+;docref_root = "/phpmanual/"
+
+; http://www.php.net/manual/en/errorfunc.configuration.php#ini.docref-ext
+;docref_ext = .html
+
+; String to output before an error message. PHP's default behavior is to leave
+; this setting blank.
+; http://www.php.net/manual/en/errorfunc.configuration.php#ini.error-prepend-string
+; Example:
+;error_prepend_string = "<font color=#ff0000>"
+
+; String to output after an error message. PHP's default behavior is to leave
+; this setting blank.
+; http://www.php.net/manual/en/errorfunc.configuration.php#ini.error-append-string
+; Example:
+;error_append_string = "</font>"
+
+; Log errors to specified file. PHP's default behavior is to leave this value
+; empty.
+; http://www.php.net/manual/en/errorfunc.configuration.php#ini.error-log
+; Example:
+;error_log = php_errors.log
+; Log errors to syslog (Event Log on NT, not valid in Windows 95).
+;error_log = syslog
+
+;;;;;;;;;;;;;;;;;
+; Data Handling ;
+;;;;;;;;;;;;;;;;;
+
+; Note - track_vars is ALWAYS enabled as of PHP 4.0.3
+
+; The separator used in PHP generated URLs to separate arguments.
+; PHP's default setting is "&".
+; http://www.php.net/manual/en/ini.core.php#ini.arg-separator.output
+; Example:
+;arg_separator.output = "&"
+
+; List of separator(s) used by PHP to parse input URLs into variables.
+; PHP's default setting is "&".
+; NOTE: Every character in this directive is considered as separator!
+; http://www.php.net/manual/en/ini.core.php#ini.arg-separator.input
+; Example:
+;arg_separator.input = ";&"
+
+; This directive determines which super global arrays are registered when PHP
+; starts up. If the register_globals directive is enabled, it also determines
+; what order variables are populated into the global space. G,P,C,E & S are
+; abbreviations for the following respective super globals: GET, POST, COOKIE,
+; ENV and SERVER. There is a performance penalty paid for the registration of
+; these arrays and because ENV is not as commonly used as the others, ENV is
+; is not recommended on productions servers. You can still get access to
+; the environment variables through getenv() should you need to.
+; Default Value: "EGPCS"
+; Development Value: "GPCS"
+; Production Value: "GPCS";
+; http://www.php.net/manual/en/ini.core.php#ini.variables-order
+variables_order = "GPCS"
+
+; This directive determines which super global data (G,P,C,E & S) should
+; be registered into the super global array REQUEST. If so, it also determines
+; the order in which that data is registered. The values for this directive are
+; specified in the same manner as the variables_order directive, EXCEPT one.
+; Leaving this value empty will cause PHP to use the value set in the
+; variables_order directive. It does not mean it will leave the super globals
+; array REQUEST empty.
+; Default Value: None
+; Development Value: "GP"
+; Production Value: "GP"
+; http://www.php.net/manual/en/ini.core.php#ini.request-order
+request_order = "GP"
+
+; Whether or not to register the EGPCS variables as global variables. You may
+; want to turn this off if you don't want to clutter your scripts' global scope
+; with user data. This makes most sense when coupled with track_vars - in which
+; case you can access all of the GPC variables through the $HTTP_*_VARS[],
+; variables.
+; You should do your best to write your scripts so that they do not require
+; register_globals to be on; Using form variables as globals can easily lead
+; to possible security problems, if the code is not very well thought of.
+; http://www.php.net/manual/en/ini.core.php#ini.register-globals
+register_globals = Off
+
+; Determines whether the deprecated long $HTTP_*_VARS type predefined variables
+; are registered by PHP or not. As they are deprecated, we obviously don't
+; recommend you use them. They are on by default for compatibility reasons but
+; they are not recommended on production servers.
+; Default Value: On
+; Development Value: Off
+; Production Value: Off
+; http://www.php.net/manual/en/ini.core.php#ini.register-long-arrays
+register_long_arrays = Off
+
+; This directive determines whether PHP registers $argv & $argc each time it
+; runs. $argv contains an array of all the arguments passed to PHP when a script
+; is invoked. $argc contains an integer representing the number of arguments
+; that were passed when the script was invoked. These arrays are extremely
+; useful when running scripts from the command line. When this directive is
+; enabled, registering these variables consumes CPU cycles and memory each time
+; a script is executed. For performance reasons, this feature should be disabled
+; on production servers.
+; Default Value: On
+; Development Value: Off
+; Production Value: Off
+; http://www.php.net/manual/en/ini.core.php#ini.register-argc-argv
+register_argc_argv = Off
+
+; When enabled, the SERVER and ENV variables are created when they're first
+; used (Just In Time) instead of when the script starts. If these variables
+; are not used within a script, having this directive on will result in a
+; performance gain. The PHP directives register_globals, register_long_arrays,
+; and register_argc_argv must be disabled for this directive to have any affect.
+; http://www.php.net/manual/en/ini.core.php#ini.auto-globals-jit
+auto_globals_jit = On
+
+; Maximum size of POST data that PHP will accept.
+; http://www.php.net/manual/en/ini.core.php#ini.post-max-size
+post_max_size = 8M
+
+; Magic quotes are a preprocessing feature of PHP where PHP will attempt to
+; escape any character sequences in GET, POST, COOKIE and ENV data which might
+; otherwise corrupt data being placed in resources such as databases before
+; making that data available to you. Because of character encoding issues and
+; non-standard SQL implementations across many databases, it's not currently
+; possible for this feature to be 100% accurate. PHP's default behavior is to
+; enable the feature. We strongly recommend you use the escaping mechanisms
+; designed specifically for the database your using instead of relying on this
+; feature. Also note, this feature has been deprecated as of PHP 5.3.0 and is
+; scheduled for removal in PHP 6.
+; Default Value: On
+; Development Value: Off
+; Production Value: Off
+; http://www.php.net/manual/en/info.configuration.php#ini.magic-quotes-gpc
+magic_quotes_gpc = Off
+
+; Magic quotes for runtime-generated data, e.g. data from SQL, from exec(), etc.
+; http://www.php.net/manual/en/info.configuration.php#ini.magic-quotes-runtime
+magic_quotes_runtime = Off
+
+; Use Sybase-style magic quotes (escape ' with '' instead of \').
+; http://www.php.net/manual/en/sybase.configuration.php#ini.magic-quotes-sybase
+magic_quotes_sybase = Off
+
+; Automatically add files before PHP document.
+; http://www.php.net/manual/en/ini.core.php#ini.auto-prepend-file
+auto_prepend_file =
+
+; Automatically add files after PHP document.
+; http://www.php.net/manual/en/ini.core.php#ini.auto-append-file
+auto_append_file =
+
+; As of 4.0b4, PHP always outputs a character encoding by default in
+; the Content-type: header. To disable sending of the charset, simply
+; set it to be empty.
+;
+; PHP's built-in default is text/html
+; http://www.php.net/manual/en/ini.core.php#ini.default-mimetype
+default_mimetype = "text/html"
+
+; PHP's default character set is set to empty.
+; http://www.php.net/manual/en/ini.core.php#ini.default-charset
+;default_charset = "iso-8859-1"
+
+; Always populate the $HTTP_RAW_POST_DATA variable. PHP's default behavior is
+; to disable this feature.
+; http://www.php.net/manual/en/ini.core.php#ini.always-populate-raw-post-data
+;always_populate_raw_post_data = On
+
+;;;;;;;;;;;;;;;;;;;;;;;;;
+; Paths and Directories ;
+;;;;;;;;;;;;;;;;;;;;;;;;;
+
+; UNIX: "/path1:/path2"
+;include_path = ".:/php/includes"
+;
+; Windows: "\path1;\path2"
+;include_path = ".;c:\php\includes"
+;
+; PHP's default setting for include_path is ".;/path/to/php/pear"
+; http://www.php.net/manual/en/ini.core.php#ini.include-path
+
+; The root of the PHP pages, used only if nonempty.
+; if PHP was not compiled with FORCE_REDIRECT, you SHOULD set doc_root
+; if you are running php as a CGI under any web server (other than IIS)
+; see documentation for security issues. The alternate is to use the
+; cgi.force_redirect configuration below
+; http://www.php.net/manual/en/ini.core.php#ini.doc-root
+doc_root =
+
+; The directory under which PHP opens the script using /~username used only
+; if nonempty.
+; http://www.php.net/manual/en/ini.core.php#ini.user-dir
+user_dir =
+
+; Directory in which the loadable extensions (modules) reside.
+; http://www.php.net/manual/en/ini.core.php#ini.extension-dir
+; extension_dir = "./"
+
+; Whether or not to enable the dl() function. The dl() function does NOT work
+; properly in multithreaded servers, such as IIS or Zeus, and is automatically
+; disabled on them.
+; http://www.php.net/manual/en/info.configuration.php#ini.enable-dl
+enable_dl = Off
+
+; cgi.force_redirect is necessary to provide security running PHP as a CGI under
+; most web servers. Left undefined, PHP turns this on by default. You can
+; turn it off here AT YOUR OWN RISK
+; **You CAN safely turn this off for IIS, in fact, you MUST.**
+; http://www.php.net/manual/en/ini.core.php#ini.cgi.force-redirect
+;cgi.force_redirect = 1
+
+; if cgi.nph is enabled it will force cgi to always sent Status: 200 with
+; every request. PHP's default behavior is to disable this feature.
+;cgi.nph = 1
+
+; if cgi.force_redirect is turned on, and you are not running under Apache or Netscape
+; (iPlanet) web servers, you MAY need to set an environment variable name that PHP
+; will look for to know it is OK to continue execution. Setting this variable MAY
+; cause security issues, KNOW WHAT YOU ARE DOING FIRST.
+; http://www.php.net/manual/en/ini.core.php#ini.cgi.redirect-status-env
+;cgi.redirect_status_env = ;
+
+; cgi.fix_pathinfo provides *real* PATH_INFO/PATH_TRANSLATED support for CGI. PHP's
+; previous behaviour was to set PATH_TRANSLATED to SCRIPT_FILENAME, and to not grok
+; what PATH_INFO is. For more information on PATH_INFO, see the cgi specs. Setting
+; this to 1 will cause PHP CGI to fix its paths to conform to the spec. A setting
+; of zero causes PHP to behave as before. Default is 1. You should fix your scripts
+; to use SCRIPT_FILENAME rather than PATH_TRANSLATED.
+; http://www.php.net/manual/en/ini.core.php#ini.cgi.fix-pathinfo
+cgi.fix_pathinfo=1
+
+; FastCGI under IIS (on WINNT based OS) supports the ability to impersonate
+; security tokens of the calling client. This allows IIS to define the
+; security context that the request runs under. mod_fastcgi under Apache
+; does not currently support this feature (03/17/2002)
+; Set to 1 if running under IIS. Default is zero.
+; http://www.php.net/manual/en/ini.core.php#ini.fastcgi.impersonate
+;fastcgi.impersonate = 1;
+
+; Disable logging through FastCGI connection. PHP's default behavior is to enable
+; this feature.
+;fastcgi.logging = 0
+
+; cgi.rfc2616_headers configuration option tells PHP what type of headers to
+; use when sending HTTP response code. If it's set 0 PHP sends Status: header that
+; is supported by Apache. When this option is set to 1 PHP will send
+; RFC2616 compliant header.
+; Default is zero.
+; http://www.php.net/manual/en/ini.core.php#ini.cgi.rfc2616-headers
+;cgi.rfc2616_headers = 0
+
+;;;;;;;;;;;;;;;;
+; File Uploads ;
+;;;;;;;;;;;;;;;;
+
+; Whether to allow HTTP file uploads.
+; http://www.php.net/manual/en/ini.core.php#ini.file-uploads
+file_uploads = On
+
+; Temporary directory for HTTP uploaded files (will use system default if not
+; specified).
+; http://www.php.net/manual/en/ini.core.php#ini.upload-tmp-dir
+;upload_tmp_dir =
+
+; Maximum allowed size for uploaded files.
+; http://www.php.net/manual/en/ini.core.php#ini.upload-max-filesize
+upload_max_filesize = 2M
+
+;;;;;;;;;;;;;;;;;;
+; Fopen wrappers ;
+;;;;;;;;;;;;;;;;;;
+
+; Whether to allow the treatment of URLs (like http:// or ftp://) as files.
+; http://www.php.net/manual/en/filesystem.configuration.php#ini.allow-url-fopen
+allow_url_fopen = On
+
+; Whether to allow include/require to open URLs (like http:// or ftp://) as files.
+; http://www.php.net/manual/en/filesystem.configuration.php#ini.allow-url-include
+allow_url_include = Off
+
+; Define the anonymous ftp password (your email address). PHP's default setting
+; for this is empty.
+; http://www.php.net/manual/en/filesystem.configuration.php#ini.from
+;from="john@doe.com"
+
+; Define the User-Agent string. PHP's default setting for this is empty.
+; http://www.php.net/manual/en/filesystem.configuration.php#ini.user-agent
+;user_agent="PHP"
+
+; Default timeout for socket based streams (seconds)
+; http://www.php.net/manual/en/filesystem.configuration.php#ini.default-socket-timeout
+default_socket_timeout = 60
+
+; If your scripts have to deal with files from Macintosh systems,
+; or you are running on a Mac and need to deal with files from
+; unix or win32 systems, setting this flag will cause PHP to
+; automatically detect the EOL character in those files so that
+; fgets() and file() will work regardless of the source of the file.
+; http://www.php.net/manual/en/filesystem.configuration.php#ini.auto-detect-line-endings
+;auto_detect_line_endings = Off
+
+;;;;;;;;;;;;;;;;;;;;;;
+; Dynamic Extensions ;
+;;;;;;;;;;;;;;;;;;;;;;
+
+; If you wish to have an extension loaded automatically, use the following
+; syntax:
+;
+; extension=modulename.extension
+;
+; For example
+;
+; extension=msql.so
+;
+; ... or with a path:
+;
+; extension=/path/to/extension/msql.so
+;
+; If you only provide the name of the extension, PHP will look for it in its
+; default extension directory.
+
+;;;;
+; Note: packaged extension modules are now loaded via the .ini files
+; found in the directory /etc/php.d; these are loaded by default.
+;;;;
+
+
+;;;;;;;;;;;;;;;;;;;
+; Module Settings ;
+;;;;;;;;;;;;;;;;;;;
+
+[Date]
+; Defines the default timezone used by the date functions
+; http://www.php.net/manual/en/datetime.configuration.php#ini.date.timezone
+;date.timezone =
+
+; http://www.php.net/manual/en/datetime.configuration.php#ini.date.default-latitude
+;date.default_latitude = 31.7667
+
+; http://www.php.net/manual/en/datetime.configuration.php#ini.date.default-longitude
+;date.default_longitude = 35.2333
+
+; http://www.php.net/manual/en/datetime.configuration.php#ini.date.sunrise-zenith
+;date.sunrise_zenith = 90.583333
+
+; http://www.php.net/manual/en/datetime.configuration.php#ini.date.sunset-zenith
+;date.sunset_zenith = 90.583333
+
+[filter]
+; http://www.php.net/manual/en/filter.configuration.php#ini.filter.default
+;filter.default = unsafe_raw
+
+; http://www.php.net/manual/en/filter.configuration.php#ini.filter.default-flags
+;filter.default_flags =
+
+[iconv]
+;iconv.input_encoding = ISO-8859-1
+;iconv.internal_encoding = ISO-8859-1
+;iconv.output_encoding = ISO-8859-1
+
+[intl]
+;intl.default_locale =
+
+[sqlite]
+; http://www.php.net/manual/en/sqlite.configuration.php#ini.sqlite.assoc-case
+;sqlite.assoc_case = 0
+
+[sqlite3]
+;sqlite3.extension_dir =
+
+[Pcre]
+;PCRE library backtracking limit.
+; http://www.php.net/manual/en/pcre.configuration.php#ini.pcre.backtrack-limit
+;pcre.backtrack_limit=100000
+
+;PCRE library recursion limit.
+;Please note that if you set this value to a high number you may consume all
+;the available process stack and eventually crash PHP (due to reaching the
+;stack size limit imposed by the Operating System).
+; http://www.php.net/manual/en/pcre.configuration.php#ini.pcre.recursion-limit
+;pcre.recursion_limit=100000
+
+[Pdo]
+; Whether to pool ODBC connections. Can be one of "strict", "relaxed" or "off"
+; http://www.php.net/manual/en/ref.pdo-odbc.php#ini.pdo-odbc.connection-pooling
+;pdo_odbc.connection_pooling=strict
+
+[Phar]
+; http://www.php.net/manual/en/phar.configuration.php#ini.phar.readonly
+;phar.readonly = On
+
+; http://www.php.net/manual/en/phar.configuration.php#ini.phar.require-hash
+;phar.require_hash = On
+
+;phar.cache_list =
+
+[Syslog]
+; Whether or not to define the various syslog variables (e.g. $LOG_PID,
+; $LOG_CRON, etc.). Turning it off is a good idea performance-wise. In
+; runtime, you can define these variables by calling define_syslog_variables().
+; http://www.php.net/manual/en/network.configuration.php#ini.define-syslog-variables
+define_syslog_variables = Off
+
+[mail function]
+; For Win32 only.
+; http://www.php.net/manual/en/mail.configuration.php#ini.smtp
+SMTP = localhost
+; http://www.php.net/manual/en/mail.configuration.php#ini.smtp-port
+smtp_port = 25
+
+; For Win32 only.
+; http://www.php.net/manual/en/mail.configuration.php#ini.sendmail-from
+;sendmail_from = me@example.com
+
+; For Unix only. You may supply arguments as well (default: "sendmail -t -i").
+; http://www.php.net/manual/en/mail.configuration.php#ini.sendmail-path
+sendmail_path = /usr/sbin/sendmail -t -i
+
+; Force the addition of the specified parameters to be passed as extra parameters
+; to the sendmail binary. These parameters will always replace the value of
+; the 5th parameter to mail(), even in safe mode.
+;mail.force_extra_parameters =
+
+; Add X-PHP-Originaiting-Script: that will include uid of the script followed by the filename
+mail.add_x_header = On
+
+; Log all mail() calls including the full path of the script, line #, to address and headers
+;mail.log =
+
+[SQL]
+; http://www.php.net/manual/en/ini.core.php#ini.sql.safe-mode
+sql.safe_mode = Off
+
+[ODBC]
+; http://www.php.net/manual/en/odbc.configuration.php#ini.uodbc.default-db
+;odbc.default_db = Not yet implemented
+
+; http://www.php.net/manual/en/odbc.configuration.php#ini.uodbc.default-user
+;odbc.default_user = Not yet implemented
+
+; http://www.php.net/manual/en/odbc.configuration.php#ini.uodbc.default-pw
+;odbc.default_pw = Not yet implemented
+
+; Allow or prevent persistent links.
+; http://www.php.net/manual/en/odbc.configuration.php#ini.uodbc.allow-persistent
+odbc.allow_persistent = On
+
+; Check that a connection is still valid before reuse.
+; http://www.php.net/manual/en/odbc.configuration.php#ini.uodbc.check-persistent
+odbc.check_persistent = On
+
+; Maximum number of persistent links. -1 means no limit.
+; http://www.php.net/manual/en/odbc.configuration.php#ini.uodbc.max-persistent
+odbc.max_persistent = -1
+
+; Maximum number of links (persistent + non-persistent). -1 means no limit.
+; http://www.php.net/manual/en/odbc.configuration.php#ini.uodbc.max-links
+odbc.max_links = -1
+
+; Handling of LONG fields. Returns number of bytes to variables. 0 means
+; passthru.
+; http://www.php.net/manual/en/odbc.configuration.php#ini.uodbc.defaultlrl
+odbc.defaultlrl = 4096
+
+; Handling of binary data. 0 means passthru, 1 return as is, 2 convert to char.
+; See the documentation on odbc_binmode and odbc_longreadlen for an explanation
+; of uodbc.defaultlrl and uodbc.defaultbinmode
+; http://www.php.net/manual/en/odbc.configuration.php#ini.uodbc.defaultbinmode
+odbc.defaultbinmode = 1
+
+;birdstep.max_links = -1
+
+[MySQL]
+; Allow or prevent persistent links.
+; http://www.php.net/manual/en/mysql.configuration.php#ini.mysql.allow-persistent
+mysql.allow_persistent = On
+
+; Maximum number of persistent links. -1 means no limit.
+; http://www.php.net/manual/en/mysql.configuration.php#ini.mysql.max-persistent
+mysql.max_persistent = -1
+
+; Maximum number of links (persistent + non-persistent). -1 means no limit.
+; http://www.php.net/manual/en/mysql.configuration.php#ini.mysql.max-links
+mysql.max_links = -1
+
+; Default port number for mysql_connect(). If unset, mysql_connect() will use
+; the $MYSQL_TCP_PORT or the mysql-tcp entry in /etc/services or the
+; compile-time value defined MYSQL_PORT (in that order). Win32 will only look
+; at MYSQL_PORT.
+; http://www.php.net/manual/en/mysql.configuration.php#ini.mysql.default-port
+mysql.default_port =
+
+; Default socket name for local MySQL connects. If empty, uses the built-in
+; MySQL defaults.
+; http://www.php.net/manual/en/mysql.configuration.php#ini.mysql.default-socket
+mysql.default_socket =
+
+; Default host for mysql_connect() (doesn't apply in safe mode).
+; http://www.php.net/manual/en/mysql.configuration.php#ini.mysql.default-host
+mysql.default_host =
+
+; Default user for mysql_connect() (doesn't apply in safe mode).
+; http://www.php.net/manual/en/mysql.configuration.php#ini.mysql.default-user
+mysql.default_user =
+
+; Default password for mysql_connect() (doesn't apply in safe mode).
+; Note that this is generally a *bad* idea to store passwords in this file.
+; *Any* user with PHP access can run 'echo get_cfg_var("mysql.default_password")
+; and reveal this password! And of course, any users with read access to this
+; file will be able to reveal the password as well.
+; http://www.php.net/manual/en/mysql.configuration.php#ini.mysql.default-password
+mysql.default_password =
+
+; Maximum time (in seconds) for connect timeout. -1 means no limit
+; http://www.php.net/manual/en/mysql.configuration.php#ini.mysql.connect-timeout
+mysql.connect_timeout = 60
+
+; Trace mode. When trace_mode is active (=On), warnings for table/index scans and
+; SQL-Errors will be displayed.
+; http://www.php.net/manual/en/mysql.configuration.php#ini.mysql.trace-mode
+mysql.trace_mode = Off
+
+[MySQLi]
+
+; Maximum number of links. -1 means no limit.
+; http://www.php.net/manual/en/mysqli.configuration.php#ini.mysqli.max-links
+mysqli.max_links = -1
+
+; Default port number for mysqli_connect(). If unset, mysqli_connect() will use
+; the $MYSQL_TCP_PORT or the mysql-tcp entry in /etc/services or the
+; compile-time value defined MYSQL_PORT (in that order). Win32 will only look
+; at MYSQL_PORT.
+; http://www.php.net/manual/en/mysqli.configuration.php#ini.mysqli.default-port
+mysqli.default_port = 3306
+
+; Default socket name for local MySQL connects. If empty, uses the built-in
+; MySQL defaults.
+; http://www.php.net/manual/en/mysqli.configuration.php#ini.mysqli.default-socket
+mysqli.default_socket =
+
+; Default host for mysql_connect() (doesn't apply in safe mode).
+; http://www.php.net/manual/en/mysqli.configuration.php#ini.mysqli.default-host
+mysqli.default_host =
+
+; Default user for mysql_connect() (doesn't apply in safe mode).
+; http://www.php.net/manual/en/mysqli.configuration.php#ini.mysqli.default-user
+mysqli.default_user =
+
+; Default password for mysqli_connect() (doesn't apply in safe mode).
+; Note that this is generally a *bad* idea to store passwords in this file.
+; *Any* user with PHP access can run 'echo get_cfg_var("mysqli.default_pw")
+; and reveal this password! And of course, any users with read access to this
+; file will be able to reveal the password as well.
+; http://www.php.net/manual/en/mysqli.configuration.php#ini.mysqli.default-pw
+mysqli.default_pw =
+
+; Allow or prevent reconnect
+mysqli.reconnect = Off
+
+[PostgresSQL]
+; Allow or prevent persistent links.
+; http://www.php.net/manual/en/pgsql.configuration.php#ini.pgsql.allow-persistent
+pgsql.allow_persistent = On
+
+; Detect broken persistent links always with pg_pconnect().
+; Auto reset feature requires a little overheads.
+; http://www.php.net/manual/en/pgsql.configuration.php#ini.pgsql.auto-reset-persistent
+pgsql.auto_reset_persistent = Off
+
+; Maximum number of persistent links. -1 means no limit.
+; http://www.php.net/manual/en/pgsql.configuration.php#ini.pgsql.max-persistent
+pgsql.max_persistent = -1
+
+; Maximum number of links (persistent+non persistent). -1 means no limit.
+; http://www.php.net/manual/en/pgsql.configuration.php#ini.pgsql.max-links
+pgsql.max_links = -1
+
+; Ignore PostgreSQL backends Notice message or not.
+; Notice message logging require a little overheads.
+; http://www.php.net/manual/en/pgsql.configuration.php#ini.pgsql.ignore-notice
+pgsql.ignore_notice = 0
+
+; Log PostgreSQL backends Noitce message or not.
+; Unless pgsql.ignore_notice=0, module cannot log notice message.
+; http://www.php.net/manual/en/pgsql.configuration.php#ini.pgsql.log-notice
+pgsql.log_notice = 0
+
+[Sybase-CT]
+; Allow or prevent persistent links.
+; http://www.php.net/manual/en/sybase.configuration.php#ini.sybct.allow-persistent
+sybct.allow_persistent = On
+
+; Maximum number of persistent links. -1 means no limit.
+; http://www.php.net/manual/en/sybase.configuration.php#ini.sybct.max-persistent
+sybct.max_persistent = -1
+
+; Maximum number of links (persistent + non-persistent). -1 means no limit.
+; http://www.php.net/manual/en/sybase.configuration.php#ini.sybct.max-links
+sybct.max_links = -1
+
+; Minimum server message severity to display.
+; http://www.php.net/manual/en/sybase.configuration.php#ini.sybct.min-server-severity
+sybct.min_server_severity = 10
+
+; Minimum client message severity to display.
+; http://www.php.net/manual/en/sybase.configuration.php#ini.sybct.min-client-severity
+sybct.min_client_severity = 10
+
+; Set per-context timeout
+; http://www.php.net/manual/en/sybase.configuration.php#ini.sybct.timeout
+;sybct.timeout=
+
+;sybct.packet_size
+
+[bcmath]
+; Number of decimal digits for all bcmath functions.
+; http://www.php.net/manual/en/bc.configuration.php#ini.bcmath.scale
+bcmath.scale = 0
+
+[browscap]
+; http://www.php.net/manual/en/misc.configuration.php#ini.browscap
+;browscap = extra/browscap.ini
+
+[Session]
+; Handler used to store/retrieve data.
+; http://www.php.net/manual/en/session.configuration.php#ini.session.save-handler
+session.save_handler = files
+
+; Argument passed to save_handler. In the case of files, this is the path
+; where data files are stored. Note: Windows users have to change this
+; variable in order to use PHP's session functions.
+;
+; As of PHP 4.0.1, you can define the path as:
+;
+; session.save_path = "N;/path"
+;
+; where N is an integer. Instead of storing all the session files in
+; /path, what this will do is use subdirectories N-levels deep, and
+; store the session data in those directories. This is useful if you
+; or your OS have problems with lots of files in one directory, and is
+; a more efficient layout for servers that handle lots of sessions.
+;
+; NOTE 1: PHP will not create this directory structure automatically.
+; You can use the script in the ext/session dir for that purpose.
+; NOTE 2: See the section on garbage collection below if you choose to
+; use subdirectories for session storage
+;
+; The file storage module creates files using mode 600 by default.
+; You can change that by using
+;
+; session.save_path = "N;MODE;/path"
+;
+; where MODE is the octal representation of the mode. Note that this
+; does not overwrite the process's umask.
+; http://www.php.net/manual/en/session.configuration.php#ini.session.save-path
+session.save_path = "/tmp"
+
+; Whether to use cookies.
+; http://www.php.net/manual/en/session.configuration.php#ini.session.use-cookies
+session.use_cookies = 1
+
+; http://www.php.net/manual/en/session.configuration.php#ini.session.cookie-secure
+;session.cookie_secure =
+
+; This option forces PHP to fetch and use a cookie for storing and maintaining
+; the session id. We encourage this operation as it's very helpful in combatting
+; session hijacking when not specifying and managing your own session id. It is
+; not the end all be all of session hijacking defense, but it's a good start.
+; http://www.php.net/manual/en/session.configuration.php#ini.session.use-only-cookies
+session.use_only_cookies = 1
+
+; Name of the session (used as cookie name).
+; http://www.php.net/manual/en/session.configuration.php#ini.session.name
+session.name = PHPSESSID
+
+; Initialize session on request startup.
+; http://www.php.net/manual/en/session.configuration.php#ini.session.auto-start
+session.auto_start = 0
+
+; Lifetime in seconds of cookie or, if 0, until browser is restarted.
+; http://www.php.net/manual/en/session.configuration.php#ini.session.cookie-lifetime
+session.cookie_lifetime = 0
+
+; The path for which the cookie is valid.
+; http://www.php.net/manual/en/session.configuration.php#ini.session.cookie-path
+session.cookie_path = /
+
+; The domain for which the cookie is valid.
+; http://www.php.net/manual/en/session.configuration.php#ini.session.cookie-domain
+session.cookie_domain =
+
+; Whether or not to add the httpOnly flag to the cookie, which makes it inaccessible to browser scripting languages such as JavaScript.
+; http://www.php.net/manual/en/session.configuration.php#ini.session.cookie-httponly
+session.cookie_httponly =
+
+; Handler used to serialize data. php is the standard serializer of PHP.
+; http://www.php.net/manual/en/session.configuration.php#ini.session.serialize-handler
+session.serialize_handler = php
+
+; Defines the probability that the 'garbage collection' process is started
+; on every session initialization. The probability is calculated by using
+; gc_probability/gc_divisor. Where session.gc_probability is the numerator
+; and gc_divisor is the denominator in the equation. Setting this value to 1
+; when the session.gc_divisor value is 100 will give you approximately a 1% chance
+; the gc will run on any give request.
+; Default Value: 1
+; Development Value: 1
+; Production Value: 1
+; http://www.php.net/manual/en/session.configuration.php#ini.session.gc-probability
+session.gc_probability = 1
+
+; Defines the probability that the 'garbage collection' process is started on every
+; session initialization. The probability is calculated by using the following equation:
+; gc_probability/gc_divisor. Where session.gc_probability is the numerator and
+; session.gc_divisor is the denominator in the equation. Setting this value to 1
+; when the session.gc_divisor value is 100 will give you approximately a 1% chance
+; the gc will run on any give request. Increasing this value to 1000 will give you
+; a 0.1% chance the gc will run on any give request. For high volume production servers,
+; this is a more efficient approach.
+; Default Value: 100
+; Development Value: 1000
+; Production Value: 1000
+; http://www.php.net/manual/en/session.configuration.php#ini.session.gc-divisor
+session.gc_divisor = 1000
+
+; After this number of seconds, stored data will be seen as 'garbage' and
+; cleaned up by the garbage collection process.
+; http://www.php.net/manual/en/session.configuration.php#ini.session.gc-maxlifetime
+session.gc_maxlifetime = 1440
+
+; NOTE: If you are using the subdirectory option for storing session files
+; (see session.save_path above), then garbage collection does *not*
+; happen automatically. You will need to do your own garbage
+; collection through a shell script, cron entry, or some other method.
+; For example, the following script would is the equivalent of
+; setting session.gc_maxlifetime to 1440 (1440 seconds = 24 minutes):
+; cd /path/to/sessions; find -cmin +24 | xargs rm
+
+; PHP 4.2 and less have an undocumented feature/bug that allows you to
+; to initialize a session variable in the global scope, even when register_globals
+; is disabled. PHP 4.3 and later will warn you, if this feature is used.
+; You can disable the feature and the warning separately. At this time,
+; the warning is only displayed, if bug_compat_42 is enabled. This feature
+; introduces some serious security problems if not handled correctly. It's
+; recommended that you do not use this feature on production servers. But you
+; should enable this on development servers and enable the warning as well. If you
+; do not enable the feature on development servers, you won't be warned when it's
+; used and debugging errors caused by this can be difficult to track down.
+; Default Value: On
+; Development Value: On
+; Production Value: Off
+; http://www.php.net/manual/en/session.configuration.php#ini.session.bug-compat-42
+session.bug_compat_42 = Off
+
+; This setting controls whether or not you are warned by PHP when initializing a
+; session value into the global space. session.bug_compat_42 must be enabled before
+; these warnings can be issued by PHP. See the directive above for more information.
+; Default Value: On
+; Development Value: On
+; Production Value: Off
+; http://www.php.net/manual/en/session.configuration.php#ini.session.bug-compat-warn
+session.bug_compat_warn = Off
+
+; Check HTTP Referer to invalidate externally stored URLs containing ids.
+; HTTP_REFERER has to contain this substring for the session to be
+; considered as valid.
+; http://www.php.net/manual/en/session.configuration.php#ini.session.referer-check
+session.referer_check =
+
+; How many bytes to read from the file.
+; http://www.php.net/manual/en/session.configuration.php#ini.session.entropy-length
+session.entropy_length = 0
+
+; Specified here to create the session id.
+; http://www.php.net/manual/en/session.configuration.php#ini.session.entropy-file
+;session.entropy_file = /dev/urandom
+session.entropy_file =
+
+; http://www.php.net/manual/en/session.configuration.php#ini.session.entropy-length
+;session.entropy_length = 16
+
+; Set to {nocache,private,public,} to determine HTTP caching aspects
+; or leave this empty to avoid sending anti-caching headers.
+; http://www.php.net/manual/en/session.configuration.php#ini.session.cache-limiter
+session.cache_limiter = nocache
+
+; Document expires after n minutes.
+; http://www.php.net/manual/en/session.configuration.php#ini.session.cache-expire
+session.cache_expire = 180
+
+; trans sid support is disabled by default.
+; Use of trans sid may risk your users security.
+; Use this option with caution.
+; - User may send URL contains active session ID
+; to other person via. email/irc/etc.
+; - URL that contains active session ID may be stored
+; in publically accessible computer.
+; - User may access your site with the same session ID
+; always using URL stored in browser's history or bookmarks.
+; http://www.php.net/manual/en/session.configuration.php#ini.session.use-trans-sid
+session.use_trans_sid = 0
+
+; Select a hash function for use in generating session ids.
+; Possible Values
+; 0 (MD5 128 bits)
+; 1 (SHA-1 160 bits)
+; http://www.php.net/manual/en/session.configuration.php#ini.session.hash-function
+session.hash_function = 0
+
+; Define how many bits are stored in each character when converting
+; the binary hash data to something readable.
+; Possible values:
+; 4 (4 bits: 0-9, a-f)
+; 5 (5 bits: 0-9, a-v)
+; 6 (6 bits: 0-9, a-z, A-Z, "-", ",")
+; Default Value: 4
+; Development Value: 5
+; Production Value: 5
+; http://www.php.net/manual/en/session.configuration.php#ini.session.hash-bits-per-character
+session.hash_bits_per_character = 5
+
+; The URL rewriter will look for URLs in a defined set of HTML tags.
+; form/fieldset are special; if you include them here, the rewriter will
+; add a hidden <input> field with the info which is otherwise appended
+; to URLs. If you want XHTML conformity, remove the form entry.
+; Note that all valid entries require a "=", even if no value follows.
+; Default Value: "a=href,area=href,frame=src,form=,fieldset="
+; Development Value: "a=href,area=href,frame=src,input=src,form=fakeentry"
+; Production Value: "a=href,area=href,frame=src,input=src,form=fakeentry"
+; http://www.php.net/manual/en/session.configuration.php#ini.url-rewriter.tags
+url_rewriter.tags = "a=href,area=href,frame=src,input=src,form=fakeentry"
+
+[MSSQL]
+; Allow or prevent persistent links.
+mssql.allow_persistent = On
+
+; Maximum number of persistent links. -1 means no limit.
+mssql.max_persistent = -1
+
+; Maximum number of links (persistent+non persistent). -1 means no limit.
+mssql.max_links = -1
+
+; Minimum error severity to display.
+mssql.min_error_severity = 10
+
+; Minimum message severity to display.
+mssql.min_message_severity = 10
+
+; Compatibility mode with old versions of PHP 3.0.
+mssql.compatability_mode = Off
+
+; Connect timeout
+;mssql.connect_timeout = 5
+
+; Query timeout
+;mssql.timeout = 60
+
+; Valid range 0 - 2147483647. Default = 4096.
+;mssql.textlimit = 4096
+
+; Valid range 0 - 2147483647. Default = 4096.
+;mssql.textsize = 4096
+
+; Limits the number of records in each batch. 0 = all records in one batch.
+;mssql.batchsize = 0
+
+; Specify how datetime and datetim4 columns are returned
+; On => Returns data converted to SQL server settings
+; Off => Returns values as YYYY-MM-DD hh:mm:ss
+;mssql.datetimeconvert = On
+
+; Use NT authentication when connecting to the server
+mssql.secure_connection = Off
+
+; Specify max number of processes. -1 = library default
+; msdlib defaults to 25
+; FreeTDS defaults to 4096
+;mssql.max_procs = -1
+
+; Specify client character set.
+; If empty or not set the client charset from freetds.comf is used
+; This is only used when compiled with FreeTDS
+;mssql.charset = "ISO-8859-1"
+
+[Assertion]
+; Assert(expr); active by default.
+; http://www.php.net/manual/en/info.configuration.php#ini.assert.active
+;assert.active = On
+
+; Issue a PHP warning for each failed assertion.
+; http://www.php.net/manual/en/info.configuration.php#ini.assert.warning
+;assert.warning = On
+
+; Don't bail out by default.
+; http://www.php.net/manual/en/info.configuration.php#ini.assert.bail
+;assert.bail = Off
+
+; User-function to be called if an assertion fails.
+; http://www.php.net/manual/en/info.configuration.php#ini.assert.callback
+;assert.callback = 0
+
+; Eval the expression with current error_reporting(). Set to true if you want
+; error_reporting(0) around the eval().
+; http://www.php.net/manual/en/info.configuration.php#ini.assert.quiet-eval
+;assert.quiet_eval = 0
+
+[COM]
+; path to a file containing GUIDs, IIDs or filenames of files with TypeLibs
+; http://www.php.net/manual/en/com.configuration.php#ini.com.typelib-file
+;com.typelib_file =
+
+; allow Distributed-COM calls
+; http://www.php.net/manual/en/com.configuration.php#ini.com.allow-dcom
+;com.allow_dcom = true
+
+; autoregister constants of a components typlib on com_load()
+; http://www.php.net/manual/en/com.configuration.php#ini.com.autoregister-typelib
+;com.autoregister_typelib = true
+
+; register constants casesensitive
+; http://www.php.net/manual/en/com.configuration.php#ini.com.autoregister-casesensitive
+;com.autoregister_casesensitive = false
+
+; show warnings on duplicate constant registrations
+; http://www.php.net/manual/en/com.configuration.php#ini.com.autoregister-verbose
+;com.autoregister_verbose = true
+
+[mbstring]
+; language for internal character representation.
+; http://www.php.net/manual/en/mbstring.configuration.php#ini.mbstring.language
+;mbstring.language = Japanese
+
+; internal/script encoding.
+; Some encoding cannot work as internal encoding.
+; (e.g. SJIS, BIG5, ISO-2022-*)
+; http://www.php.net/manual/en/mbstring.configuration.php#ini.mbstring.internal-encoding
+;mbstring.internal_encoding = EUC-JP
+
+; http input encoding.
+; http://www.php.net/manual/en/mbstring.configuration.php#ini.mbstring.http-input
+;mbstring.http_input = auto
+
+; http output encoding. mb_output_handler must be
+; registered as output buffer to function
+; http://www.php.net/manual/en/mbstring.configuration.php#ini.mbstring.http-output
+;mbstring.http_output = SJIS
+
+; enable automatic encoding translation according to
+; mbstring.internal_encoding setting. Input chars are
+; converted to internal encoding by setting this to On.
+; Note: Do _not_ use automatic encoding translation for
+; portable libs/applications.
+; http://www.php.net/manual/en/mbstring.configuration.php#ini.mbstring.encoding-translation
+;mbstring.encoding_translation = Off
+
+; automatic encoding detection order.
+; auto means
+; http://www.php.net/manual/en/mbstring.configuration.php#ini.mbstring.detect-order
+;mbstring.detect_order = auto
+
+; substitute_character used when character cannot be converted
+; one from another
+; http://www.php.net/manual/en/mbstring.configuration.php#ini.mbstring.substitute-character
+;mbstring.substitute_character = none;
+
+; overload(replace) single byte functions by mbstring functions.
+; mail(), ereg(), etc are overloaded by mb_send_mail(), mb_ereg(),
+; etc. Possible values are 0,1,2,4 or combination of them.
+; For example, 7 for overload everything.
+; 0: No overload
+; 1: Overload mail() function
+; 2: Overload str*() functions
+; 4: Overload ereg*() functions
+; http://www.php.net/manual/en/mbstring.configuration.php#ini.mbstring.func-overload
+;mbstring.func_overload = 0
+
+; enable strict encoding detection.
+;mbstring.strict_detection = Off
+
+; This directive specifies the regex pattern of content types for which mb_output_handler()
+; is activated.
+; Default: mbstring.http_output_conv_mimetype=^(text/|application/xhtml\+xml)
+;mbstring.http_output_conv_mimetype=
+
+[gd]
+; Tell the jpeg decode to ignore warnings and try to create
+; a gd image. The warning will then be displayed as notices
+; disabled by default
+; http://www.php.net/manual/en/image.configuration.php#ini.image.jpeg-ignore-warning
+;gd.jpeg_ignore_warning = 0
+
+[exif]
+; Exif UNICODE user comments are handled as UCS-2BE/UCS-2LE and JIS as JIS.
+; With mbstring support this will automatically be converted into the encoding
+; given by corresponding encode setting. When empty mbstring.internal_encoding
+; is used. For the decode settings you can distinguish between motorola and
+; intel byte order. A decode setting cannot be empty.
+; http://www.php.net/manual/en/exif.configuration.php#ini.exif.encode-unicode
+;exif.encode_unicode = ISO-8859-15
+
+; http://www.php.net/manual/en/exif.configuration.php#ini.exif.decode-unicode-motorola
+;exif.decode_unicode_motorola = UCS-2BE
+
+; http://www.php.net/manual/en/exif.configuration.php#ini.exif.decode-unicode-intel
+;exif.decode_unicode_intel = UCS-2LE
+
+; http://www.php.net/manual/en/exif.configuration.php#ini.exif.encode-jis
+;exif.encode_jis =
+
+; http://www.php.net/manual/en/exif.configuration.php#ini.exif.decode-jis-motorola
+;exif.decode_jis_motorola = JIS
+
+; http://www.php.net/manual/en/exif.configuration.php#ini.exif.decode-jis-intel
+;exif.decode_jis_intel = JIS
+
+[Tidy]
+; The path to a default tidy configuration file to use when using tidy
+; http://www.php.net/manual/en/tidy.configuration.php#ini.tidy.default-config
+;tidy.default_config = /usr/local/lib/php/default.tcfg
+
+; Should tidy clean and repair output automatically?
+; WARNING: Do not use this option if you are generating non-html content
+; such as dynamic images
+; http://www.php.net/manual/en/tidy.configuration.php#ini.tidy.clean-output
+tidy.clean_output = Off
+
+[soap]
+; Enables or disables WSDL caching feature.
+; http://www.php.net/manual/en/soap.configuration.php#ini.soap.wsdl-cache-enabled
+soap.wsdl_cache_enabled=1
+
+; Sets the directory name where SOAP extension will put cache files.
+; http://www.php.net/manual/en/soap.configuration.php#ini.soap.wsdl-cache-dir
+soap.wsdl_cache_dir="/tmp"
+
+; (time to live) Sets the number of second while cached file will be used
+; instead of original one.
+; http://www.php.net/manual/en/soap.configuration.php#ini.soap.wsdl-cache-ttl
+soap.wsdl_cache_ttl=86400
+
+[sysvshm]
+; A default size of the shared memory segment
+;sysvshm.init_mem = 10000
+
+
+; Local Variables:
+; tab-width: 4
+; End:
+
--- /dev/null
+++ b/setup/postgresql.conf
@@ -1,1 +1,502 @@
-
+# -----------------------------
+# PostgreSQL configuration file
+# -----------------------------
+#
+# This file consists of lines of the form:
+#
+# name = value
+#
+# (The "=" is optional.) Whitespace may be used. Comments are introduced with
+# "#" anywhere on a line. The complete list of parameter names and allowed
+# values can be found in the PostgreSQL documentation.
+#
+# The commented-out settings shown in this file represent the default values.
+# Re-commenting a setting is NOT sufficient to revert it to the default value;
+# you need to reload the server.
+#
+# This file is read on server startup and when the server receives a SIGHUP
+# signal. If you edit the file on a running system, you have to SIGHUP the
+# server for the changes to take effect, or use "pg_ctl reload". Some
+# parameters, which are marked below, require a server shutdown and restart to
+# take effect.
+#
+# Any parameter can also be given as a command-line option to the server, e.g.,
+# "postgres -c log_connections=on". Some parameters can be changed at run time
+# with the "SET" SQL command.
+#
+# Memory units: kB = kilobytes Time units: ms = milliseconds
+# MB = megabytes s = seconds
+# GB = gigabytes min = minutes
+# h = hours
+# d = days
+
+
+#------------------------------------------------------------------------------
+# FILE LOCATIONS
+#------------------------------------------------------------------------------
+
+# The default values of these variables are driven from the -D command-line
+# option or PGDATA environment variable, represented here as ConfigDir.
+
+#data_directory = 'ConfigDir' # use data in another directory
+ # (change requires restart)
+#hba_file = 'ConfigDir/pg_hba.conf' # host-based authentication file
+ # (change requires restart)
+#ident_file = 'ConfigDir/pg_ident.conf' # ident configuration file
+ # (change requires restart)
+
+# If external_pid_file is not explicitly set, no extra PID file is written.
+#external_pid_file = '(none)' # write an extra PID file
+ # (change requires restart)
+
+
+#------------------------------------------------------------------------------
+# CONNECTIONS AND AUTHENTICATION
+#------------------------------------------------------------------------------
+
+# - Connection Settings -
+
+listen_addresses = '*' # what IP address(es) to listen on;
+ # comma-separated list of addresses;
+ # defaults to 'localhost', '*' = all
+ # (change requires restart)
+#port = 5432 # (change requires restart)
+max_connections = 100 # (change requires restart)
+# Note: Increasing max_connections costs ~400 bytes of shared memory per
+# connection slot, plus lock space (see max_locks_per_transaction).
+#superuser_reserved_connections = 3 # (change requires restart)
+#unix_socket_directory = '' # (change requires restart)
+#unix_socket_group = '' # (change requires restart)
+#unix_socket_permissions = 0777 # begin with 0 to use octal notation
+ # (change requires restart)
+#bonjour_name = '' # defaults to the computer name
+ # (change requires restart)
+
+# - Security and Authentication -
+
+#authentication_timeout = 1min # 1s-600s
+#ssl = off # (change requires restart)
+#ssl_ciphers = 'ALL:!ADH:!LOW:!EXP:!MD5:@STRENGTH' # allowed SSL ciphers
+ # (change requires restart)
+#ssl_renegotiation_limit = 512MB # amount of data between renegotiations
+#password_encryption = on
+#db_user_namespace = off
+
+# Kerberos and GSSAPI
+#krb_server_keyfile = ''
+#krb_srvname = 'postgres' # (Kerberos only)
+#krb_caseins_users = off
+
+# - TCP Keepalives -
+# see "man 7 tcp" for details
+
+#tcp_keepalives_idle = 0 # TCP_KEEPIDLE, in seconds;
+ # 0 selects the system default
+#tcp_keepalives_interval = 0 # TCP_KEEPINTVL, in seconds;
+ # 0 selects the system default
+#tcp_keepalives_count = 0 # TCP_KEEPCNT;
+ # 0 selects the system default
+
+
+#------------------------------------------------------------------------------
+# RESOURCE USAGE (except WAL)
+#------------------------------------------------------------------------------
+
+# - Memory -
+
+shared_buffers = 32MB # min 128kB
+ # (change requires restart)
+#temp_buffers = 8MB # min 800kB
+#max_prepared_transactions = 0 # zero disables the feature
+ # (change requires restart)
+# Note: Increasing max_prepared_transactions costs ~600 bytes of shared memory
+# per transaction slot, plus lock space (see max_locks_per_transaction).
+# It is not advisable to set max_prepared_transactions nonzero unless you
+# actively intend to use prepared transactions.
+#work_mem = 1MB # min 64kB
+#maintenance_work_mem = 16MB # min 1MB
+#max_stack_depth = 2MB # min 100kB
+
+# - Kernel Resource Usage -
+
+#max_files_per_process = 1000 # min 25
+ # (change requires restart)
+#shared_preload_libraries = '' # (change requires restart)
+
+# - Cost-Based Vacuum Delay -
+
+#vacuum_cost_delay = 0ms # 0-100 milliseconds
+#vacuum_cost_page_hit = 1 # 0-10000 credits
+#vacuum_cost_page_miss = 10 # 0-10000 credits
+#vacuum_cost_page_dirty = 20 # 0-10000 credits
+#vacuum_cost_limit = 200 # 1-10000 credits
+
+# - Background Writer -
+
+#bgwriter_delay = 200ms # 10-10000ms between rounds
+#bgwriter_lru_maxpages = 100 # 0-1000 max buffers written/round
+#bgwriter_lru_multiplier = 2.0 # 0-10.0 multipler on buffers scanned/round
+
+# - Asynchronous Behavior -
+
+#effective_io_concurrency = 1 # 1-1000. 0 disables prefetching
+
+
+#------------------------------------------------------------------------------
+# WRITE AHEAD LOG
+#------------------------------------------------------------------------------
+
+# - Settings -
+
+#fsync = on # turns forced synchronization on or off
+#synchronous_commit = on # immediate fsync at commit
+#wal_sync_method = fsync # the default is the first option
+ # supported by the operating system:
+ # open_datasync
+ # fdatasync
+ # fsync
+ # fsync_writethrough
+ # open_sync
+#full_page_writes = on # recover from partial page writes
+#wal_buffers = 64kB # min 32kB
+ # (change requires restart)
+#wal_writer_delay = 200ms # 1-10000 milliseconds
+
+#commit_delay = 0 # range 0-100000, in microseconds
+#commit_siblings = 5 # range 1-1000
+
+# - Checkpoints -
+
+#checkpoint_segments = 3 # in logfile segments, min 1, 16MB each
+#checkpoint_timeout = 5min # range 30s-1h
+#checkpoint_completion_target = 0.5 # checkpoint target duration, 0.0 - 1.0
+#checkpoint_warning = 30s # 0 disables
+
+# - Archiving -
+
+#archive_mode = off # allows archiving to be done
+ # (change requires restart)
+#archive_command = '' # command to use to archive a logfile segment
+#archive_timeout = 0 # force a logfile segment switch after this
+ # number of seconds; 0 disables
+
+
+#------------------------------------------------------------------------------
+# QUERY TUNING
+#------------------------------------------------------------------------------
+
+# - Planner Method Configuration -
+
+#enable_bitmapscan = on
+#enable_hashagg = on
+#enable_hashjoin = on
+#enable_indexscan = on
+#enable_mergejoin = on
+#enable_nestloop = on
+#enable_seqscan = on
+#enable_sort = on
+#enable_tidscan = on
+
+# - Planner Cost Constants -
+
+#seq_page_cost = 1.0 # measured on an arbitrary scale
+#random_page_cost = 4.0 # same scale as above
+#cpu_tuple_cost = 0.01 # same scale as above
+#cpu_index_tuple_cost = 0.005 # same scale as above
+#cpu_operator_cost = 0.0025 # same scale as above
+#effective_cache_size = 128MB
+
+# - Genetic Query Optimizer -
+
+#geqo = on
+#geqo_threshold = 12
+#geqo_effort = 5 # range 1-10
+#geqo_pool_size = 0 # selects default based on effort
+#geqo_generations = 0 # selects default based on effort
+#geqo_selection_bias = 2.0 # range 1.5-2.0
+
+# - Other Planner Options -
+
+#default_statistics_target = 100 # range 1-10000
+#constraint_exclusion = partition # on, off, or partition
+#cursor_tuple_fraction = 0.1 # range 0.0-1.0
+#from_collapse_limit = 8
+#join_collapse_limit = 8 # 1 disables collapsing of explicit
+ # JOIN clauses
+
+
+#------------------------------------------------------------------------------
+# ERROR REPORTING AND LOGGING
+#------------------------------------------------------------------------------
+
+# - Where to Log -
+
+#log_destination = 'stderr' # Valid values are combinations of
+ # stderr, csvlog, syslog and eventlog,
+ # depending on platform. csvlog
+ # requires logging_collector to be on.
+
+# This is used when logging to stderr:
+logging_collector = on # Enable capturing of stderr and csvlog
+ # into log files. Required to be on for
+ # csvlogs.
+ # (change requires restart)
+
+# These are only used if logging_collector is on:
+log_directory = 'pg_log' # directory where log files are written,
+ # can be absolute or relative to PGDATA
+log_filename = 'postgresql-%a.log' # log file name pattern,
+ # can include strftime() escapes
+log_truncate_on_rotation = on # If on, an existing log file of the
+ # same name as the new log file will be
+ # truncated rather than appended to.
+ # But such truncation only occurs on
+ # time-driven rotation, not on restarts
+ # or size-driven rotation. Default is
+ # off, meaning append to existing files
+ # in all cases.
+log_rotation_age = 1d # Automatic rotation of logfiles will
+ # happen after that time. 0 disables.
+log_rotation_size = 0 # Automatic rotation of logfiles will
+ # happen after that much log output.
+ # 0 disables.
+
+# These are relevant when logging to syslog:
+#syslog_facility = 'LOCAL0'
+#syslog_ident = 'postgres'
+
+#silent_mode = off # Run server silently.
+ # DO NOT USE without syslog or
+ # logging_collector
+ # (change requires restart)
+
+
+# - When to Log -
+
+#client_min_messages = notice # values in order of decreasing detail:
+ # debug5
+ # debug4
+ # debug3
+ # debug2
+ # debug1
+ # log
+ # notice
+ # warning
+ # error
+
+#log_min_messages = warning # values in order of decreasing detail:
+ # debug5
+ # debug4
+ # debug3
+ # debug2
+ # debug1
+ # info
+ # notice
+ # warning
+ # error
+ # log
+ # fatal
+ # panic
+
+#log_error_verbosity = default # terse, default, or verbose messages
+
+#log_min_error_statement = error # values in order of decreasing detail:
+ # debug5
+ # debug4
+ # debug3
+ # debug2
+ # debug1
+ # info
+ # notice
+ # warning
+ # error
+ # log
+ # fatal
+ # panic (effectively off)
+
+#log_min_duration_statement = -1 # -1 is disabled, 0 logs all statements
+ # and their durations, > 0 logs only
+ # statements running at least this number
+ # of milliseconds
+
+
+# - What to Log -
+
+#debug_print_parse = off
+#debug_print_rewritten = off
+#debug_print_plan = off
+#debug_pretty_print = on
+#log_checkpoints = off
+#log_connections = off
+#log_disconnections = off
+#log_duration = off
+#log_hostname = off
+#log_line_prefix = '' # special values:
+ # %u = user name
+ # %d = database name
+ # %r = remote host and port
+ # %h = remote host
+ # %p = process ID
+ # %t = timestamp without milliseconds
+ # %m = timestamp with milliseconds
+ # %i = command tag
+ # %c = session ID
+ # %l = session line number
+ # %s = session start timestamp
+ # %v = virtual transaction ID
+ # %x = transaction ID (0 if none)
+ # %q = stop here in non-session
+ # processes
+ # %% = '%'
+ # e.g. '<%u%%%d> '
+#log_lock_waits = off # log lock waits >= deadlock_timeout
+#log_statement = 'none' # none, ddl, mod, all
+#log_temp_files = -1 # log temporary files equal or larger
+ # than the specified size in kilobytes;
+ # -1 disables, 0 logs all temp files
+#log_timezone = unknown # actually, defaults to TZ environment
+ # setting
+
+
+#------------------------------------------------------------------------------
+# RUNTIME STATISTICS
+#------------------------------------------------------------------------------
+
+# - Query/Index Statistics Collector -
+
+#track_activities = on
+#track_counts = on
+#track_functions = none # none, pl, all
+#track_activity_query_size = 1024
+#update_process_title = on
+#stats_temp_directory = 'pg_stat_tmp'
+
+
+# - Statistics Monitoring -
+
+#log_parser_stats = off
+#log_planner_stats = off
+#log_executor_stats = off
+#log_statement_stats = off
+
+
+#------------------------------------------------------------------------------
+# AUTOVACUUM PARAMETERS
+#------------------------------------------------------------------------------
+
+#autovacuum = on # Enable autovacuum subprocess? 'on'
+ # requires track_counts to also be on.
+#log_autovacuum_min_duration = -1 # -1 disables, 0 logs all actions and
+ # their durations, > 0 logs only
+ # actions running at least this number
+ # of milliseconds.
+#autovacuum_max_workers = 3 # max number of autovacuum subprocesses
+#autovacuum_naptime = 1min # time between autovacuum runs
+#autovacuum_vacuum_threshold = 50 # min number of row updates before
+ # vacuum
+#autovacuum_analyze_threshold = 50 # min number of row updates before
+ # analyze
+#autovacuum_vacuum_scale_factor = 0.2 # fraction of table size before vacuum
+#autovacuum_analyze_scale_factor = 0.1 # fraction of table size before analyze
+#autovacuum_freeze_max_age = 200000000 # maximum XID age before forced vacuum
+ # (change requires restart)
+#autovacuum_vacuum_cost_delay = 20ms # default vacuum cost delay for
+ # autovacuum, in milliseconds;
+ # -1 means use vacuum_cost_delay
+#autovacuum_vacuum_cost_limit = -1 # default vacuum cost limit for
+ # autovacuum, -1 means use
+ # vacuum_cost_limit
+
+
+#------------------------------------------------------------------------------
+# CLIENT CONNECTION DEFAULTS
+#------------------------------------------------------------------------------
+
+# - Statement Behavior -
+
+#search_path = '"$user",public' # schema names
+#default_tablespace = '' # a tablespace name, '' uses the default
+#temp_tablespaces = '' # a list of tablespace names, '' uses
+ # only default tablespace
+#check_function_bodies = on
+#default_transaction_isolation = 'read committed'
+#default_transaction_read_only = off
+#session_replication_role = 'origin'
+#statement_timeout = 0 # in milliseconds, 0 is disabled
+#vacuum_freeze_min_age = 50000000
+#vacuum_freeze_table_age = 150000000
+#xmlbinary = 'base64'
+#xmloption = 'content'
+
+# - Locale and Formatting -
+
+datestyle = 'iso, mdy'
+#intervalstyle = 'postgres'
+#timezone = unknown # actually, defaults to TZ environment
+ # setting
+#timezone_abbreviations = 'Default' # Select the set of available time zone
+ # abbreviations. Currently, there are
+ # Default
+ # Australia
+ # India
+ # You can create your own file in
+ # share/timezonesets/.
+#extra_float_digits = 0 # min -15, max 2
+#client_encoding = sql_ascii # actually, defaults to database
+ # encoding
+
+# These settings are initialized by initdb, but they can be changed.
+lc_messages = 'en_US.UTF-8' # locale for system error message
+ # strings
+lc_monetary = 'en_US.UTF-8' # locale for monetary formatting
+lc_numeric = 'en_US.UTF-8' # locale for number formatting
+lc_time = 'en_US.UTF-8' # locale for time formatting
+
+# default configuration for text search
+default_text_search_config = 'pg_catalog.english'
+
+# - Other Defaults -
+
+#dynamic_library_path = '$libdir'
+#local_preload_libraries = ''
+
+
+#------------------------------------------------------------------------------
+# LOCK MANAGEMENT
+#------------------------------------------------------------------------------
+
+#deadlock_timeout = 1s
+#max_locks_per_transaction = 64 # min 10
+ # (change requires restart)
+# Note: Each lock table slot uses ~270 bytes of shared memory, and there are
+# max_locks_per_transaction * (max_connections + max_prepared_transactions)
+# lock table slots.
+
+
+#------------------------------------------------------------------------------
+# VERSION/PLATFORM COMPATIBILITY
+#------------------------------------------------------------------------------
+
+# - Previous PostgreSQL Versions -
+
+#add_missing_from = off
+#array_nulls = on
+#backslash_quote = safe_encoding # on, off, or safe_encoding
+#default_with_oids = off
+#escape_string_warning = on
+#regex_flavor = advanced # advanced, extended, or basic
+#sql_inheritance = on
+#standard_conforming_strings = off
+#synchronize_seqscans = on
+
+# - Other Platforms and Clients -
+
+#transform_null_equals = off
+
+
+#------------------------------------------------------------------------------
+# CUSTOMIZED OPTIONS
+#------------------------------------------------------------------------------
+
+#custom_variable_classes = '' # list of custom variable class names
+
--- /dev/null
+++ b/setup/rc.local
@@ -1,1 +1,14 @@
+#!/bin/sh
+#
+# This script will be executed *after* all the other init scripts.
+# You can put your own initialization stuff in here if you don't
+# want to do the full Sys V style init stuff.
+touch /var/lock/subsys/local
+cd /tmp
+rm -rfv busui
+git clone http://maxious.lambdacomplex.org/busui/git
+sh busui/aws/awsStartup.sh
+
+
+
--- /dev/null
+++ b/setup/systemStartup.sh
@@ -1,1 +1,13 @@
+#!/bin/bash
+#this script should be run from a fresh git checkout from github
+#ami base must have yum install lighttpd-fastcgi, git, tomcat6
+#php-cli php-gd tomcat6-webapps tomcat6-admin-webapps svn maven2
+#postgres postgres-server php-pg
+#http://www.how2forge.org/installing-lighttpd-with-php5-and-mysql-support-on-fedora-12
+sh busuiphp.sh
+sh busuidb.sh
+sh busuiotp.sh
+
+
+
--- /dev/null
+++ b/setup/transitdata.sql
@@ -1,1 +1,1260 @@
+--
+-- PostgreSQL database dump
+--
+
+SET statement_timeout = 0;
+SET client_encoding = 'UTF8';
+SET standard_conforming_strings = on;
+SET check_function_bodies = false;
+SET client_min_messages = warning;
+
+--
+-- Name: topology; Type: SCHEMA; Schema: -; Owner: postgres
+--
+
+CREATE SCHEMA topology;
+
+
+ALTER SCHEMA topology OWNER TO postgres;
+
+--
+-- Name: plpgsql; Type: EXTENSION; Schema: -; Owner:
+--
+
+CREATE EXTENSION IF NOT EXISTS plpgsql WITH SCHEMA pg_catalog;
+
+
+--
+-- Name: EXTENSION plpgsql; Type: COMMENT; Schema: -; Owner:
+--
+
+COMMENT ON EXTENSION plpgsql IS 'PL/pgSQL procedural language';
+
+
+--
+-- Name: postgis; Type: EXTENSION; Schema: -; Owner:
+--
+
+CREATE EXTENSION IF NOT EXISTS postgis WITH SCHEMA public;
+
+
+--
+-- Name: EXTENSION postgis; Type: COMMENT; Schema: -; Owner:
+--
+
+COMMENT ON EXTENSION postgis IS 'postgis geometry,geography, and raster spatial types and functions';
+
+
+--
+-- Name: postgis_topology; Type: EXTENSION; Schema: -; Owner:
+--
+
+CREATE EXTENSION IF NOT EXISTS postgis_topology WITH SCHEMA topology;
+
+
+--
+-- Name: EXTENSION postgis_topology; Type: COMMENT; Schema: -; Owner:
+--
+
+COMMENT ON EXTENSION postgis_topology IS 'postgis topology spatial types and functions';
+
+
+SET search_path = public, pg_catalog;
+
+--
+-- Name: linefromtext(text); Type: FUNCTION; Schema: public; Owner: postgres
+--
+
+CREATE FUNCTION linefromtext(text) RETURNS geometry
+ LANGUAGE sql IMMUTABLE STRICT
+ AS $_$
+ SELECT CASE WHEN geometrytype(GeomFromText($1)) = 'LINESTRING'
+ THEN GeomFromText($1)
+ ELSE NULL END
+ $_$;
+
+
+ALTER FUNCTION public.linefromtext(text) OWNER TO postgres;
+
+--
+-- Name: linefromtext(text, integer); Type: FUNCTION; Schema: public; Owner: postgres
+--
+
+CREATE FUNCTION linefromtext(text, integer) RETURNS geometry
+ LANGUAGE sql IMMUTABLE STRICT
+ AS $_$
+ SELECT CASE WHEN geometrytype(GeomFromText($1, $2)) = 'LINESTRING'
+ THEN GeomFromText($1,$2)
+ ELSE NULL END
+ $_$;
+
+
+ALTER FUNCTION public.linefromtext(text, integer) OWNER TO postgres;
+
+--
+-- Name: linefromwkb(bytea); Type: FUNCTION; Schema: public; Owner: postgres
+--
+
+CREATE FUNCTION linefromwkb(bytea) RETURNS geometry
+ LANGUAGE sql IMMUTABLE STRICT
+ AS $_$
+ SELECT CASE WHEN geometrytype(GeomFromWKB($1)) = 'LINESTRING'
+ THEN GeomFromWKB($1)
+ ELSE NULL END
+ $_$;
+
+
+ALTER FUNCTION public.linefromwkb(bytea) OWNER TO postgres;
+
+--
+-- Name: linefromwkb(bytea, integer); Type: FUNCTION; Schema: public; Owner: postgres
+--
+
+CREATE FUNCTION linefromwkb(bytea, integer) RETURNS geometry
+ LANGUAGE sql IMMUTABLE STRICT
+ AS $_$
+ SELECT CASE WHEN geometrytype(GeomFromWKB($1, $2)) = 'LINESTRING'
+ THEN GeomFromWKB($1, $2)
+ ELSE NULL END
+ $_$;
+
+
+ALTER FUNCTION public.linefromwkb(bytea, integer) OWNER TO postgres;
+
+--
+-- Name: linestringfromtext(text); Type: FUNCTION; Schema: public; Owner: postgres
+--
+
+CREATE FUNCTION linestringfromtext(text) RETURNS geometry
+ LANGUAGE sql IMMUTABLE STRICT
+ AS $_$SELECT LineFromText($1)$_$;
+
+
+ALTER FUNCTION public.linestringfromtext(text) OWNER TO postgres;
+
+--
+-- Name: linestringfromtext(text, integer); Type: FUNCTION; Schema: public; Owner: postgres
+--
+
+CREATE FUNCTION linestringfromtext(text, integer) RETURNS geometry
+ LANGUAGE sql IMMUTABLE STRICT
+ AS $_$SELECT LineFromText($1, $2)$_$;
+
+
+ALTER FUNCTION public.linestringfromtext(text, integer) OWNER TO postgres;
+
+--
+-- Name: linestringfromwkb(bytea); Type: FUNCTION; Schema: public; Owner: postgres
+--
+
+CREATE FUNCTION linestringfromwkb(bytea) RETURNS geometry
+ LANGUAGE sql IMMUTABLE STRICT
+ AS $_$
+ SELECT CASE WHEN geometrytype(GeomFromWKB($1)) = 'LINESTRING'
+ THEN GeomFromWKB($1)
+ ELSE NULL END
+ $_$;
+
+
+ALTER FUNCTION public.linestringfromwkb(bytea) OWNER TO postgres;
+
+--
+-- Name: linestringfromwkb(bytea, integer); Type: FUNCTION; Schema: public; Owner: postgres
+--
+
+CREATE FUNCTION linestringfromwkb(bytea, integer) RETURNS geometry
+ LANGUAGE sql IMMUTABLE STRICT
+ AS $_$
+ SELECT CASE WHEN geometrytype(GeomFromWKB($1, $2)) = 'LINESTRING'
+ THEN GeomFromWKB($1, $2)
+ ELSE NULL END
+ $_$;
+
+
+ALTER FUNCTION public.linestringfromwkb(bytea, integer) OWNER TO postgres;
+
+--
+-- Name: mlinefromtext(text); Type: FUNCTION; Schema: public; Owner: postgres
+--
+
+CREATE FUNCTION mlinefromtext(text) RETURNS geometry
+ LANGUAGE sql IMMUTABLE STRICT
+ AS $_$
+ SELECT CASE WHEN geometrytype(GeomFromText($1)) = 'MULTILINESTRING'
+ THEN GeomFromText($1)
+ ELSE NULL END
+ $_$;
+
+
+ALTER FUNCTION public.mlinefromtext(text) OWNER TO postgres;
+
+--
+-- Name: mlinefromtext(text, integer); Type: FUNCTION; Schema: public; Owner: postgres
+--
+
+CREATE FUNCTION mlinefromtext(text, integer) RETURNS geometry
+ LANGUAGE sql IMMUTABLE STRICT
+ AS $_$
+ SELECT CASE
+ WHEN geometrytype(GeomFromText($1, $2)) = 'MULTILINESTRING'
+ THEN GeomFromText($1,$2)
+ ELSE NULL END
+ $_$;
+
+
+ALTER FUNCTION public.mlinefromtext(text, integer) OWNER TO postgres;
+
+--
+-- Name: mlinefromwkb(bytea); Type: FUNCTION; Schema: public; Owner: postgres
+--
+
+CREATE FUNCTION mlinefromwkb(bytea) RETURNS geometry
+ LANGUAGE sql IMMUTABLE STRICT
+ AS $_$
+ SELECT CASE WHEN geometrytype(GeomFromWKB($1)) = 'MULTILINESTRING'
+ THEN GeomFromWKB($1)
+ ELSE NULL END
+ $_$;
+
+
+ALTER FUNCTION public.mlinefromwkb(bytea) OWNER TO postgres;
+
+--
+-- Name: mlinefromwkb(bytea, integer); Type: FUNCTION; Schema: public; Owner: postgres
+--
+
+CREATE FUNCTION mlinefromwkb(bytea, integer) RETURNS geometry
+ LANGUAGE sql IMMUTABLE STRICT
+ AS $_$
+ SELECT CASE WHEN geometrytype(GeomFromWKB($1, $2)) = 'MULTILINESTRING'
+ THEN GeomFromWKB($1, $2)
+ ELSE NULL END
+ $_$;
+
+
+ALTER FUNCTION public.mlinefromwkb(bytea, integer) OWNER TO postgres;
+
+--
+-- Name: mpointfromtext(text); Type: FUNCTION; Schema: public; Owner: postgres
+--
+
+CREATE FUNCTION mpointfromtext(text) RETURNS geometry
+ LANGUAGE sql IMMUTABLE STRICT
+ AS $_$
+ SELECT CASE WHEN geometrytype(GeomFromText($1)) = 'MULTIPOINT'
+ THEN GeomFromText($1)
+ ELSE NULL END
+ $_$;
+
+
+ALTER FUNCTION public.mpointfromtext(text) OWNER TO postgres;
+
+--
+-- Name: mpointfromtext(text, integer); Type: FUNCTION; Schema: public; Owner: postgres
+--
+
+CREATE FUNCTION mpointfromtext(text, integer) RETURNS geometry
+ LANGUAGE sql IMMUTABLE STRICT
+ AS $_$
+ SELECT CASE WHEN geometrytype(GeomFromText($1,$2)) = 'MULTIPOINT'
+ THEN GeomFromText($1,$2)
+ ELSE NULL END
+ $_$;
+
+
+ALTER FUNCTION public.mpointfromtext(text, integer) OWNER TO postgres;
+
+--
+-- Name: mpointfromwkb(bytea); Type: FUNCTION; Schema: public; Owner: postgres
+--
+
+CREATE FUNCTION mpointfromwkb(bytea) RETURNS geometry
+ LANGUAGE sql IMMUTABLE STRICT
+ AS $_$
+ SELECT CASE WHEN geometrytype(GeomFromWKB($1)) = 'MULTIPOINT'
+ THEN GeomFromWKB($1)
+ ELSE NULL END
+ $_$;
+
+
+ALTER FUNCTION public.mpointfromwkb(bytea) OWNER TO postgres;
+
+--
+-- Name: mpointfromwkb(bytea, integer); Type: FUNCTION; Schema: public; Owner: postgres
+--
+
+CREATE FUNCTION mpointfromwkb(bytea, integer) RETURNS geometry
+ LANGUAGE sql IMMUTABLE STRICT
+ AS $_$
+ SELECT CASE WHEN geometrytype(GeomFromWKB($1,$2)) = 'MULTIPOINT'
+ THEN GeomFromWKB($1, $2)
+ ELSE NULL END
+ $_$;
+
+
+ALTER FUNCTION public.mpointfromwkb(bytea, integer) OWNER TO postgres;
+
+--
+-- Name: mpolyfromtext(text); Type: FUNCTION; Schema: public; Owner: postgres
+--
+
+CREATE FUNCTION mpolyfromtext(text) RETURNS geometry
+ LANGUAGE sql IMMUTABLE STRICT
+ AS $_$
+ SELECT CASE WHEN geometrytype(GeomFromText($1)) = 'MULTIPOLYGON'
+ THEN GeomFromText($1)
+ ELSE NULL END
+ $_$;
+
+
+ALTER FUNCTION public.mpolyfromtext(text) OWNER TO postgres;
+
+--
+-- Name: mpolyfromtext(text, integer); Type: FUNCTION; Schema: public; Owner: postgres
+--
+
+CREATE FUNCTION mpolyfromtext(text, integer) RETURNS geometry
+ LANGUAGE sql IMMUTABLE STRICT
+ AS $_$
+ SELECT CASE WHEN geometrytype(GeomFromText($1, $2)) = 'MULTIPOLYGON'
+ THEN GeomFromText($1,$2)
+ ELSE NULL END
+ $_$;
+
+
+ALTER FUNCTION public.mpolyfromtext(text, integer) OWNER TO postgres;
+
+--
+-- Name: mpolyfromwkb(bytea, integer); Type: FUNCTION; Schema: public; Owner: postgres
+--
+
+CREATE FUNCTION mpolyfromwkb(bytea, integer) RETURNS geometry
+ LANGUAGE sql IMMUTABLE STRICT
+ AS $_$
+ SELECT CASE WHEN geometrytype(GeomFromWKB($1, $2)) = 'MULTIPOLYGON'
+ THEN GeomFromWKB($1, $2)
+ ELSE NULL END
+ $_$;
+
+
+ALTER FUNCTION public.mpolyfromwkb(bytea, integer) OWNER TO postgres;
+
+--
+-- Name: multilinefromwkb(bytea); Type: FUNCTION; Schema: public; Owner: postgres
+--
+
+CREATE FUNCTION multilinefromwkb(bytea) RETURNS geometry
+ LANGUAGE sql IMMUTABLE STRICT
+ AS $_$
+ SELECT CASE WHEN geometrytype(GeomFromWKB($1)) = 'MULTILINESTRING'
+ THEN GeomFromWKB($1)
+ ELSE NULL END
+ $_$;
+
+
+ALTER FUNCTION public.multilinefromwkb(bytea) OWNER TO postgres;
+
+--
+-- Name: multilinefromwkb(bytea, integer); Type: FUNCTION; Schema: public; Owner: postgres
+--
+
+CREATE FUNCTION multilinefromwkb(bytea, integer) RETURNS geometry
+ LANGUAGE sql IMMUTABLE STRICT
+ AS $_$
+ SELECT CASE WHEN geometrytype(GeomFromWKB($1, $2)) = 'MULTILINESTRING'
+ THEN GeomFromWKB($1, $2)
+ ELSE NULL END
+ $_$;
+
+
+ALTER FUNCTION public.multilinefromwkb(bytea, integer) OWNER TO postgres;
+
+--
+-- Name: multilinestringfromtext(text); Type: FUNCTION; Schema: public; Owner: postgres
+--
+
+CREATE FUNCTION multilinestringfromtext(text) RETURNS geometry
+ LANGUAGE sql IMMUTABLE STRICT
+ AS $_$SELECT ST_MLineFromText($1)$_$;
+
+
+ALTER FUNCTION public.multilinestringfromtext(text) OWNER TO postgres;
+
+--
+-- Name: multilinestringfromtext(text, integer); Type: FUNCTION; Schema: public; Owner: postgres
+--
+
+CREATE FUNCTION multilinestringfromtext(text, integer) RETURNS geometry
+ LANGUAGE sql IMMUTABLE STRICT
+ AS $_$SELECT MLineFromText($1, $2)$_$;
+
+
+ALTER FUNCTION public.multilinestringfromtext(text, integer) OWNER TO postgres;
+
+--
+-- Name: multipointfromtext(text); Type: FUNCTION; Schema: public; Owner: postgres
+--
+
+CREATE FUNCTION multipointfromtext(text) RETURNS geometry
+ LANGUAGE sql IMMUTABLE STRICT
+ AS $_$SELECT MPointFromText($1)$_$;
+
+
+ALTER FUNCTION public.multipointfromtext(text) OWNER TO postgres;
+
+--
+-- Name: multipointfromtext(text, integer); Type: FUNCTION; Schema: public; Owner: postgres
+--
+
+CREATE FUNCTION multipointfromtext(text, integer) RETURNS geometry
+ LANGUAGE sql IMMUTABLE STRICT
+ AS $_$SELECT MPointFromText($1, $2)$_$;
+
+
+ALTER FUNCTION public.multipointfromtext(text, integer) OWNER TO postgres;
+
+--
+-- Name: multipointfromwkb(bytea); Type: FUNCTION; Schema: public; Owner: postgres
+--
+
+CREATE FUNCTION multipointfromwkb(bytea) RETURNS geometry
+ LANGUAGE sql IMMUTABLE STRICT
+ AS $_$
+ SELECT CASE WHEN geometrytype(GeomFromWKB($1)) = 'MULTIPOINT'
+ THEN GeomFromWKB($1)
+ ELSE NULL END
+ $_$;
+
+
+ALTER FUNCTION public.multipointfromwkb(bytea) OWNER TO postgres;
+
+--
+-- Name: multipointfromwkb(bytea, integer); Type: FUNCTION; Schema: public; Owner: postgres
+--
+
+CREATE FUNCTION multipointfromwkb(bytea, integer) RETURNS geometry
+ LANGUAGE sql IMMUTABLE STRICT
+ AS $_$
+ SELECT CASE WHEN geometrytype(GeomFromWKB($1,$2)) = 'MULTIPOINT'
+ THEN GeomFromWKB($1, $2)
+ ELSE NULL END
+ $_$;
+
+
+ALTER FUNCTION public.multipointfromwkb(bytea, integer) OWNER TO postgres;
+
+--
+-- Name: multipolyfromwkb(bytea); Type: FUNCTION; Schema: public; Owner: postgres
+--
+
+CREATE FUNCTION multipolyfromwkb(bytea) RETURNS geometry
+ LANGUAGE sql IMMUTABLE STRICT
+ AS $_$
+ SELECT CASE WHEN geometrytype(GeomFromWKB($1)) = 'MULTIPOLYGON'
+ THEN GeomFromWKB($1)
+ ELSE NULL END
+ $_$;
+
+
+ALTER FUNCTION public.multipolyfromwkb(bytea) OWNER TO postgres;
+
+--
+-- Name: multipolyfromwkb(bytea, integer); Type: FUNCTION; Schema: public; Owner: postgres
+--
+
+CREATE FUNCTION multipolyfromwkb(bytea, integer) RETURNS geometry
+ LANGUAGE sql IMMUTABLE STRICT
+ AS $_$
+ SELECT CASE WHEN geometrytype(GeomFromWKB($1, $2)) = 'MULTIPOLYGON'
+ THEN GeomFromWKB($1, $2)
+ ELSE NULL END
+ $_$;
+
+
+ALTER FUNCTION public.multipolyfromwkb(bytea, integer) OWNER TO postgres;
+
+--
+-- Name: multipolygonfromtext(text); Type: FUNCTION; Schema: public; Owner: postgres
+--
+
+CREATE FUNCTION multipolygonfromtext(text) RETURNS geometry
+ LANGUAGE sql IMMUTABLE STRICT
+ AS $_$SELECT MPolyFromText($1)$_$;
+
+
+ALTER FUNCTION public.multipolygonfromtext(text) OWNER TO postgres;
+
+--
+-- Name: multipolygonfromtext(text, integer); Type: FUNCTION; Schema: public; Owner: postgres
+--
+
+CREATE FUNCTION multipolygonfromtext(text, integer) RETURNS geometry
+ LANGUAGE sql IMMUTABLE STRICT
+ AS $_$SELECT MPolyFromText($1, $2)$_$;
+
+
+ALTER FUNCTION public.multipolygonfromtext(text, integer) OWNER TO postgres;
+
+--
+-- Name: pointfromtext(text); Type: FUNCTION; Schema: public; Owner: postgres
+--
+
+CREATE FUNCTION pointfromtext(text) RETURNS geometry
+ LANGUAGE sql IMMUTABLE STRICT
+ AS $_$
+ SELECT CASE WHEN geometrytype(GeomFromText($1)) = 'POINT'
+ THEN GeomFromText($1)
+ ELSE NULL END
+ $_$;
+
+
+ALTER FUNCTION public.pointfromtext(text) OWNER TO postgres;
+
+--
+-- Name: pointfromtext(text, integer); Type: FUNCTION; Schema: public; Owner: postgres
+--
+
+CREATE FUNCTION pointfromtext(text, integer) RETURNS geometry
+ LANGUAGE sql IMMUTABLE STRICT
+ AS $_$
+ SELECT CASE WHEN geometrytype(GeomFromText($1, $2)) = 'POINT'
+ THEN GeomFromText($1,$2)
+ ELSE NULL END
+ $_$;
+
+
+ALTER FUNCTION public.pointfromtext(text, integer) OWNER TO postgres;
+
+--
+-- Name: pointfromwkb(bytea); Type: FUNCTION; Schema: public; Owner: postgres
+--
+
+CREATE FUNCTION pointfromwkb(bytea) RETURNS geometry
+ LANGUAGE sql IMMUTABLE STRICT
+ AS $_$
+ SELECT CASE WHEN geometrytype(GeomFromWKB($1)) = 'POINT'
+ THEN GeomFromWKB($1)
+ ELSE NULL END
+ $_$;
+
+
+ALTER FUNCTION public.pointfromwkb(bytea) OWNER TO postgres;
+
+--
+-- Name: pointfromwkb(bytea, integer); Type: FUNCTION; Schema: public; Owner: postgres
+--
+
+CREATE FUNCTION pointfromwkb(bytea, integer) RETURNS geometry
+ LANGUAGE sql IMMUTABLE STRICT
+ AS $_$
+ SELECT CASE WHEN geometrytype(GeomFromWKB($1, $2)) = 'POINT'
+ THEN GeomFromWKB($1, $2)
+ ELSE NULL END
+ $_$;
+
+
+ALTER FUNCTION public.pointfromwkb(bytea, integer) OWNER TO postgres;
+
+--
+-- Name: polyfromtext(text); Type: FUNCTION; Schema: public; Owner: postgres
+--
+
+CREATE FUNCTION polyfromtext(text) RETURNS geometry
+ LANGUAGE sql IMMUTABLE STRICT
+ AS $_$
+ SELECT CASE WHEN geometrytype(GeomFromText($1)) = 'POLYGON'
+ THEN GeomFromText($1)
+ ELSE NULL END
+ $_$;
+
+
+ALTER FUNCTION public.polyfromtext(text) OWNER TO postgres;
+
+--
+-- Name: polyfromtext(text, integer); Type: FUNCTION; Schema: public; Owner: postgres
+--
+
+CREATE FUNCTION polyfromtext(text, integer) RETURNS geometry
+ LANGUAGE sql IMMUTABLE STRICT
+ AS $_$
+ SELECT CASE WHEN geometrytype(GeomFromText($1, $2)) = 'POLYGON'
+ THEN GeomFromText($1,$2)
+ ELSE NULL END
+ $_$;
+
+
+ALTER FUNCTION public.polyfromtext(text, integer) OWNER TO postgres;
+
+--
+-- Name: polyfromwkb(bytea); Type: FUNCTION; Schema: public; Owner: postgres
+--
+
+CREATE FUNCTION polyfromwkb(bytea) RETURNS geometry
+ LANGUAGE sql IMMUTABLE STRICT
+ AS $_$
+ SELECT CASE WHEN geometrytype(GeomFromWKB($1)) = 'POLYGON'
+ THEN GeomFromWKB($1)
+ ELSE NULL END
+ $_$;
+
+
+ALTER FUNCTION public.polyfromwkb(bytea) OWNER TO postgres;
+
+--
+-- Name: polyfromwkb(bytea, integer); Type: FUNCTION; Schema: public; Owner: postgres
+--
+
+CREATE FUNCTION polyfromwkb(bytea, integer) RETURNS geometry
+ LANGUAGE sql IMMUTABLE STRICT
+ AS $_$
+ SELECT CASE WHEN geometrytype(GeomFromWKB($1, $2)) = 'POLYGON'
+ THEN GeomFromWKB($1, $2)
+ ELSE NULL END
+ $_$;
+
+
+ALTER FUNCTION public.polyfromwkb(bytea, integer) OWNER TO postgres;
+
+--
+-- Name: polygonfromtext(text); Type: FUNCTION; Schema: public; Owner: postgres
+--
+
+CREATE FUNCTION polygonfromtext(text) RETURNS geometry
+ LANGUAGE sql IMMUTABLE STRICT
+ AS $_$SELECT PolyFromText($1)$_$;
+
+
+ALTER FUNCTION public.polygonfromtext(text) OWNER TO postgres;
+
+--
+-- Name: polygonfromtext(text, integer); Type: FUNCTION; Schema: public; Owner: postgres
+--
+
+CREATE FUNCTION polygonfromtext(text, integer) RETURNS geometry
+ LANGUAGE sql IMMUTABLE STRICT
+ AS $_$SELECT PolyFromText($1, $2)$_$;
+
+
+ALTER FUNCTION public.polygonfromtext(text, integer) OWNER TO postgres;
+
+--
+-- Name: polygonfromwkb(bytea); Type: FUNCTION; Schema: public; Owner: postgres
+--
+
+CREATE FUNCTION polygonfromwkb(bytea) RETURNS geometry
+ LANGUAGE sql IMMUTABLE STRICT
+ AS $_$
+ SELECT CASE WHEN geometrytype(GeomFromWKB($1)) = 'POLYGON'
+ THEN GeomFromWKB($1)
+ ELSE NULL END
+ $_$;
+
+
+ALTER FUNCTION public.polygonfromwkb(bytea) OWNER TO postgres;
+
+--
+-- Name: polygonfromwkb(bytea, integer); Type: FUNCTION; Schema: public; Owner: postgres
+--
+
+CREATE FUNCTION polygonfromwkb(bytea, integer) RETURNS geometry
+ LANGUAGE sql IMMUTABLE STRICT
+ AS $_$
+ SELECT CASE WHEN geometrytype(GeomFromWKB($1,$2)) = 'POLYGON'
+ THEN GeomFromWKB($1, $2)
+ ELSE NULL END
+ $_$;
+
+
+ALTER FUNCTION public.polygonfromwkb(bytea, integer) OWNER TO postgres;
+
+--
+-- Name: st_askml(integer, geometry); Type: FUNCTION; Schema: public; Owner: postgres
+--
+
+CREATE FUNCTION st_askml(integer, geometry) RETURNS text
+ LANGUAGE sql IMMUTABLE STRICT
+ AS $_$SELECT _ST_AsKML($1, ST_Transform($2,4326), 15)$_$;
+
+
+ALTER FUNCTION public.st_askml(integer, geometry) OWNER TO postgres;
+
+--
+-- Name: st_askml(integer, geography); Type: FUNCTION; Schema: public; Owner: postgres
+--
+
+CREATE FUNCTION st_askml(integer, geography) RETURNS text
+ LANGUAGE sql IMMUTABLE STRICT
+ AS $_$SELECT _ST_AsKML($1, $2, 15)$_$;
+
+
+ALTER FUNCTION public.st_askml(integer, geography) OWNER TO postgres;
+
+--
+-- Name: memcollect(geometry); Type: AGGREGATE; Schema: public; Owner: postgres
+--
+
+CREATE AGGREGATE memcollect(geometry) (
+ SFUNC = public.st_collect,
+ STYPE = geometry
+);
+
+
+ALTER AGGREGATE public.memcollect(geometry) OWNER TO postgres;
+
+--
+-- Name: st_extent3d(geometry); Type: AGGREGATE; Schema: public; Owner: postgres
+--
+
+CREATE AGGREGATE st_extent3d(geometry) (
+ SFUNC = public.st_combine_bbox,
+ STYPE = box3d
+);
+
+
+ALTER AGGREGATE public.st_extent3d(geometry) OWNER TO postgres;
+
+SET default_tablespace = '';
+
+SET default_with_oids = false;
+
+--
+-- Name: agency; Type: TABLE; Schema: public; Owner: postgres; Tablespace:
+--
+
+CREATE TABLE agency (
+ agency_name text NOT NULL,
+ agency_url text,
+ agency_timezone text,
+ agency_lang text,
+ agency_phone text,
+ agency_fare_url text,
+ agency_id integer
+);
+
+
+ALTER TABLE public.agency OWNER TO postgres;
+
+--
+-- Name: calendar; Type: TABLE; Schema: public; Owner: postgres; Tablespace:
+--
+
+CREATE TABLE calendar (
+ service_id text NOT NULL,
+ start_date text,
+ end_date text,
+ monday integer,
+ tuesday integer,
+ wednesday integer,
+ thursday integer,
+ friday integer,
+ saturday integer,
+ sunday integer
+);
+
+
+ALTER TABLE public.calendar OWNER TO postgres;
+
+--
+-- Name: calendar_dates; Type: TABLE; Schema: public; Owner: postgres; Tablespace:
+--
+
+CREATE TABLE calendar_dates (
+ service_id text NOT NULL,
+ date text NOT NULL,
+ exception_type text
+);
+
+
+ALTER TABLE public.calendar_dates OWNER TO postgres;
+
+--
+-- Name: fare_attributes; Type: TABLE; Schema: public; Owner: postgres; Tablespace:
+--
+
+CREATE TABLE fare_attributes (
+ fare_id text NOT NULL,
+ price double precision,
+ currency_type text,
+ payment_method integer,
+ transfers text,
+ transfer_duration integer
+);
+
+
+ALTER TABLE public.fare_attributes OWNER TO postgres;
+
+--
+-- Name: feed_info; Type: TABLE; Schema: public; Owner: postgres; Tablespace:
+--
+
+CREATE TABLE feed_info (
+ feed_publisher_name text NOT NULL,
+ feed_publisher_url text,
+ feed_lang text,
+ feed_start_date text,
+ feed_end_date text,
+ feed_version text
+);
+
+
+ALTER TABLE public.feed_info OWNER TO postgres;
+
+--
+-- Name: myway_observations; Type: TABLE; Schema: public; Owner: postgres; Tablespace:
+--
+
+CREATE TABLE myway_observations (
+ observation_id text NOT NULL,
+ myway_stop text,
+ "time" timestamp with time zone,
+ myway_route text
+);
+
+
+ALTER TABLE public.myway_observations OWNER TO postgres;
+
+--
+-- Name: myway_routes; Type: TABLE; Schema: public; Owner: postgres; Tablespace:
+--
+
+CREATE TABLE myway_routes (
+ myway_route text NOT NULL,
+ route_short_name text,
+ trip_headsign text
+);
+
+
+ALTER TABLE public.myway_routes OWNER TO postgres;
+
+--
+-- Name: myway_stops; Type: TABLE; Schema: public; Owner: postgres; Tablespace:
+--
+
+CREATE TABLE myway_stops (
+ myway_stop text NOT NULL,
+ stop_id text
+);
+
+
+ALTER TABLE public.myway_stops OWNER TO postgres;
+
+--
+-- Name: myway_timingdeltas; Type: TABLE; Schema: public; Owner: postgres; Tablespace:
+--
+
+CREATE TABLE myway_timingdeltas (
+ observation_id text NOT NULL,
+ route_id text,
+ stop_id text,
+ timing_delta integer,
+ "time" time with time zone,
+ date date,
+ timing_period text,
+ stop_sequence integer,
+ myway_stop text,
+ route_name text
+);
+
+
+ALTER TABLE public.myway_timingdeltas OWNER TO postgres;
+
+--
+-- Name: myway_timingdeltas_timing_period_seq; Type: SEQUENCE; Schema: public; Owner: postgres
+--
+
+CREATE SEQUENCE myway_timingdeltas_timing_period_seq
+ START WITH 1
+ INCREMENT BY 1
+ NO MINVALUE
+ NO MAXVALUE
+ CACHE 1;
+
+
+ALTER TABLE public.myway_timingdeltas_timing_period_seq OWNER TO postgres;
+
+--
+-- Name: myway_timingdeltas_timing_period_seq; Type: SEQUENCE OWNED BY; Schema: public; Owner: postgres
+--
+
+ALTER SEQUENCE myway_timingdeltas_timing_period_seq OWNED BY myway_timingdeltas.timing_period;
+
+
+--
+-- Name: routes; Type: TABLE; Schema: public; Owner: postgres; Tablespace:
+--
+
+CREATE TABLE routes (
+ route_id text NOT NULL,
+ route_short_name text,
+ route_long_name text,
+ route_desc text,
+ route_type integer,
+ route_url text,
+ route_text_color text,
+ route_color text,
+ agency_id text
+);
+
+
+ALTER TABLE public.routes OWNER TO postgres;
+
+--
+-- Name: servicealerts_alerts; Type: TABLE; Schema: public; Owner: postgres; Tablespace:
+--
+
+CREATE TABLE servicealerts_alerts (
+ id integer NOT NULL,
+ url text,
+ description text,
+ start timestamp with time zone,
+ "end" timestamp with time zone,
+ cause text,
+ effect text,
+ header text
+);
+
+
+ALTER TABLE public.servicealerts_alerts OWNER TO postgres;
+
+--
+-- Name: servicealerts_alerts_id_seq; Type: SEQUENCE; Schema: public; Owner: postgres
+--
+
+CREATE SEQUENCE servicealerts_alerts_id_seq
+ START WITH 1
+ INCREMENT BY 1
+ NO MINVALUE
+ NO MAXVALUE
+ CACHE 1;
+
+
+ALTER TABLE public.servicealerts_alerts_id_seq OWNER TO postgres;
+
+--
+-- Name: servicealerts_alerts_id_seq; Type: SEQUENCE OWNED BY; Schema: public; Owner: postgres
+--
+
+ALTER SEQUENCE servicealerts_alerts_id_seq OWNED BY servicealerts_alerts.id;
+
+
+--
+-- Name: servicealerts_informed; Type: TABLE; Schema: public; Owner: postgres; Tablespace:
+--
+
+CREATE TABLE servicealerts_informed (
+ servicealert_id integer NOT NULL,
+ informed_class text NOT NULL,
+ informed_id text NOT NULL,
+ informed_action text
+);
+
+
+ALTER TABLE public.servicealerts_informed OWNER TO postgres;
+
+--
+-- Name: shapes; Type: TABLE; Schema: public; Owner: postgres; Tablespace:
+--
+
+CREATE TABLE shapes (
+ shape_id text NOT NULL,
+ shape_pt_lat double precision,
+ shape_pt_lon double precision,
+ shape_pt_sequence integer NOT NULL,
+ shape_dist_traveled integer,
+ shape_pt geography
+);
+
+
+ALTER TABLE public.shapes OWNER TO postgres;
+
+--
+-- Name: stop_times; Type: TABLE; Schema: public; Owner: postgres; Tablespace:
+--
+
+CREATE TABLE stop_times (
+ trip_id text NOT NULL,
+ arrival_time time without time zone,
+ departure_time time without time zone,
+ stop_id text,
+ stop_sequence integer NOT NULL,
+ stop_headsign text,
+ pickup_type text,
+ drop_off_type text,
+ shape_dist_traveled text
+);
+
+
+ALTER TABLE public.stop_times OWNER TO postgres;
+
+--
+-- Name: stops; Type: TABLE; Schema: public; Owner: postgres; Tablespace:
+--
+
+CREATE TABLE stops (
+ stop_id text NOT NULL,
+ stop_code text,
+ stop_name text,
+ stop_desc text,
+ stop_lat double precision,
+ stop_lon double precision,
+ zone_id text,
+ stop_url text,
+ location_type integer,
+ "position" geography
+);
+
+
+ALTER TABLE public.stops OWNER TO postgres;
+
+--
+-- Name: trips; Type: TABLE; Schema: public; Owner: postgres; Tablespace:
+--
+
+CREATE TABLE trips (
+ route_id text,
+ service_id text,
+ trip_id text NOT NULL,
+ trip_headsign text,
+ direction_id text,
+ block_id text,
+ shape_id text
+);
+
+
+ALTER TABLE public.trips OWNER TO postgres;
+
+--
+-- Name: id; Type: DEFAULT; Schema: public; Owner: postgres
+--
+
+ALTER TABLE servicealerts_alerts ALTER COLUMN id SET DEFAULT nextval('servicealerts_alerts_id_seq'::regclass);
+
+
+--
+-- Name: agency_pkey; Type: CONSTRAINT; Schema: public; Owner: postgres; Tablespace:
+--
+
+ALTER TABLE ONLY agency
+ ADD CONSTRAINT agency_pkey PRIMARY KEY (agency_name);
+
+
+--
+-- Name: calendar_dates_pkey; Type: CONSTRAINT; Schema: public; Owner: postgres; Tablespace:
+--
+
+ALTER TABLE ONLY calendar_dates
+ ADD CONSTRAINT calendar_dates_pkey PRIMARY KEY (service_id, date);
+
+
+--
+-- Name: calendar_pkey; Type: CONSTRAINT; Schema: public; Owner: postgres; Tablespace:
+--
+
+ALTER TABLE ONLY calendar
+ ADD CONSTRAINT calendar_pkey PRIMARY KEY (service_id);
+
+
+--
+-- Name: fare_attributes_pkey; Type: CONSTRAINT; Schema: public; Owner: postgres; Tablespace:
+--
+
+ALTER TABLE ONLY fare_attributes
+ ADD CONSTRAINT fare_attributes_pkey PRIMARY KEY (fare_id);
+
+
+--
+-- Name: feed_info_pkey; Type: CONSTRAINT; Schema: public; Owner: postgres; Tablespace:
+--
+
+ALTER TABLE ONLY feed_info
+ ADD CONSTRAINT feed_info_pkey PRIMARY KEY (feed_publisher_name);
+
+
+--
+-- Name: myway_observations_pkey; Type: CONSTRAINT; Schema: public; Owner: postgres; Tablespace:
+--
+
+ALTER TABLE ONLY myway_observations
+ ADD CONSTRAINT myway_observations_pkey PRIMARY KEY (observation_id);
+
+
+--
+-- Name: myway_routes_pkey; Type: CONSTRAINT; Schema: public; Owner: postgres; Tablespace:
+--
+
+ALTER TABLE ONLY myway_routes
+ ADD CONSTRAINT myway_routes_pkey PRIMARY KEY (myway_route);
+
+
+--
+-- Name: myway_timingdeltas_pkey; Type: CONSTRAINT; Schema: public; Owner: postgres; Tablespace:
+--
+
+ALTER TABLE ONLY myway_timingdeltas
+ ADD CONSTRAINT myway_timingdeltas_pkey PRIMARY KEY (observation_id);
+
+
+--
+-- Name: mywaystops_pkey; Type: CONSTRAINT; Schema: public; Owner: postgres; Tablespace:
+--
+
+ALTER TABLE ONLY myway_stops
+ ADD CONSTRAINT mywaystops_pkey PRIMARY KEY (myway_stop);
+
+
+--
+-- Name: routes_pkey; Type: CONSTRAINT; Schema: public; Owner: postgres; Tablespace:
+--
+
+ALTER TABLE ONLY routes
+ ADD CONSTRAINT routes_pkey PRIMARY KEY (route_id);
+
+
+--
+-- Name: servicealerts_alerts_pkey; Type: CONSTRAINT; Schema: public; Owner: postgres; Tablespace:
+--
+
+ALTER TABLE ONLY servicealerts_alerts
+ ADD CONSTRAINT servicealerts_alerts_pkey PRIMARY KEY (id);
+
+
+--
+-- Name: servicealerts_informed_pkey; Type: CONSTRAINT; Schema: public; Owner: postgres; Tablespace:
+--
+
+ALTER TABLE ONLY servicealerts_informed
+ ADD CONSTRAINT servicealerts_informed_pkey PRIMARY KEY (servicealert_id, informed_class, informed_id);
+
+
+--
+-- Name: shapes_pkey; Type: CONSTRAINT; Schema: public; Owner: postgres; Tablespace:
+--
+
+ALTER TABLE ONLY shapes
+ ADD CONSTRAINT shapes_pkey PRIMARY KEY (shape_id, shape_pt_sequence);
+
+
+--
+-- Name: stop_times_pkey; Type: CONSTRAINT; Schema: public; Owner: postgres; Tablespace:
+--
+
+ALTER TABLE ONLY stop_times
+ ADD CONSTRAINT stop_times_pkey PRIMARY KEY (trip_id, stop_sequence);
+
+
+--
+-- Name: stops_pkey; Type: CONSTRAINT; Schema: public; Owner: postgres; Tablespace:
+--
+
+ALTER TABLE ONLY stops
+ ADD CONSTRAINT stops_pkey PRIMARY KEY (stop_id);
+
+
+--
+-- Name: stops_stop_code_key; Type: CONSTRAINT; Schema: public; Owner: postgres; Tablespace:
+--
+
+ALTER TABLE ONLY stops
+ ADD CONSTRAINT stops_stop_code_key UNIQUE (stop_code);
+
+
+--
+-- Name: trips_pkey; Type: CONSTRAINT; Schema: public; Owner: postgres; Tablespace:
+--
+
+ALTER TABLE ONLY trips
+ ADD CONSTRAINT trips_pkey PRIMARY KEY (trip_id);
+
+
+--
+-- Name: routenumber; Type: INDEX; Schema: public; Owner: postgres; Tablespace:
+--
+
+CREATE INDEX routenumber ON routes USING btree (route_short_name);
+
+
+--
+-- Name: routetrips; Type: INDEX; Schema: public; Owner: postgres; Tablespace:
+--
+
+CREATE INDEX routetrips ON trips USING btree (route_id);
+
+
+--
+-- Name: starttime; Type: INDEX; Schema: public; Owner: postgres; Tablespace:
+--
+
+CREATE UNIQUE INDEX starttime ON stop_times USING btree (trip_id, stop_id, stop_sequence);
+
+
+--
+-- Name: stops_position_idx; Type: INDEX; Schema: public; Owner: postgres; Tablespace:
+--
+
+CREATE INDEX stops_position_idx ON stops USING gist ("position");
+
+
+--
+-- Name: stoptimes; Type: INDEX; Schema: public; Owner: postgres; Tablespace:
+--
+
+CREATE INDEX stoptimes ON stop_times USING btree (arrival_time, stop_id);
+
+
+--
+-- Name: times; Type: INDEX; Schema: public; Owner: postgres; Tablespace:
+--
+
+CREATE INDEX times ON stop_times USING btree (arrival_time);
+
+
+--
+-- Name: triptimes; Type: INDEX; Schema: public; Owner: postgres; Tablespace:
+--
+
+CREATE INDEX triptimes ON stop_times USING btree (trip_id, arrival_time);
+
+
+--
+-- Name: servicealerts_alertid; Type: FK CONSTRAINT; Schema: public; Owner: postgres
+--
+
+ALTER TABLE ONLY servicealerts_informed
+ ADD CONSTRAINT servicealerts_alertid FOREIGN KEY (servicealert_id) REFERENCES servicealerts_alerts(id);
+
+
+--
+-- Name: public; Type: ACL; Schema: -; Owner: postgres
+--
+
+REVOKE ALL ON SCHEMA public FROM PUBLIC;
+REVOKE ALL ON SCHEMA public FROM postgres;
+GRANT ALL ON SCHEMA public TO postgres;
+GRANT ALL ON SCHEMA public TO PUBLIC;
+
+
+--
+-- Name: myway_observations; Type: ACL; Schema: public; Owner: postgres
+--
+
+REVOKE ALL ON TABLE myway_observations FROM PUBLIC;
+REVOKE ALL ON TABLE myway_observations FROM postgres;
+GRANT ALL ON TABLE myway_observations TO postgres;
+
+
+--
+-- Name: stops; Type: ACL; Schema: public; Owner: postgres
+--
+
+REVOKE ALL ON TABLE stops FROM PUBLIC;
+REVOKE ALL ON TABLE stops FROM postgres;
+GRANT ALL ON TABLE stops TO postgres;
+GRANT SELECT ON TABLE stops TO transitdata;
+
+
+--
+-- PostgreSQL database dump complete
+--
+
+
--- a/sitemap.xml.php
+++ b/sitemap.xml.php
@@ -1,32 +1,63 @@
<?php
+
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
include ('include/common.inc.php');
-$last_updated = date('Y-m-d',@filemtime('cbrfeed.zip'));
+$last_updated = date('Y-m-d', @filemtime('cbrfeed.zip'));
header("Content-Type: text/xml");
echo "<?xml version='1.0' encoding='UTF-8'?>";
- echo '<urlset xmlns="http://www.sitemaps.org/schemas/sitemap/0.9">' . "\n";
- echo " <url><loc>".curPageURL()."index.php</loc><priority>1.0</priority></url>\n";
+echo '<urlset xmlns="http://www.sitemaps.org/schemas/sitemap/0.9" xmlns:geo="http://www.google.com/geo/schemas/sitemap/1.0">' . "\n";
+echo " <url><loc>" . curPageURL() . "index.php</loc><priority>1.0</priority></url>\n";
foreach (scandir("./") as $file) {
- if (strpos($file,".php") !== false && $file != "index.php" && $file != "sitemap.xml.php") echo " <url><loc>".curPageURL()."$file</loc><priority>0.3</priority></url>\n";
+ if (strpos($file, ".php") !== false && $file != "index.php" && $file != "sitemap.xml.php")
+ echo " <url><loc>" . curPageURL() . "$file</loc><priority>0.3</priority></url>\n";
}
-$url = $APIurl . "/json/stops";
-$stops = json_decode(getPage($url));
-foreach ($stops as $stop) {
- echo " <url><loc>".curPageURL()."stop.php?stopid=".htmlspecialchars ($stop[0])."</loc>";
- echo "<lastmod>" . $last_updated . "</lastmod>";
- echo "<changefreq>monthly</changefreq>";
- echo "<priority>0.9</priority>";
- echo "</url>\n";
- }
-$url = $APIurl . "/json/routes";
-$routes = json_decode(getPage($url));
-foreach ($routes as $route) {
- echo " <url><loc>".curPageURL()."trip.php?routeid=".htmlspecialchars ($route[0])."</loc>";
- echo "<lastmod>" . $last_updated . "</lastmod>";
- echo "<changefreq>monthly</changefreq>";
- echo "<priority>0.9</priority>";
- echo "</url>\n";
- }
- echo '</urlset>';
+foreach (scandir("./labs") as $file) {
+ if (strpos($file, ".php") !== false)
+ echo " <url><loc>" . curPageURL() . "/labs/$file</loc><priority>0.3</priority></url>\n";
+}
+foreach (scandir("./myway") as $file) {
+ if (strpos($file, ".php") !== false)
+ echo " <url><loc>" . curPageURL() . "/myway/$file</loc><priority>0.3</priority></url>\n";
+}
+foreach (getStops() as $stop) {
+ echo " <url><loc>" . curPageURL() . "stop.php?stopid=" . htmlspecialchars($stop["stop_id"]) . "</loc>";
+ echo "<lastmod>" . $last_updated . "</lastmod>";
+ echo "<changefreq>monthly</changefreq>";
+ echo "<priority>0.9</priority>";
+ echo "</url>\n";
+}
+foreach (getRoutes() as $route) {
+ echo " <url><loc>" . curPageURL() . "trip.php?routeid=" . htmlspecialchars($route["route_id"]) . "</loc>";
+ echo "<lastmod>" . $last_updated . "</lastmod>";
+ echo "<changefreq>monthly</changefreq>";
+ echo "<priority>0.9</priority>";
+ echo "</url>\n";
+}
+// geosite map
+foreach (getRoutes() as $route) {
+ echo " <url><loc>" . curPageURL() . "geo/route.kml.php?routeid=" . htmlspecialchars($route["route_id"]) . "</loc>";
+ echo "<lastmod>" . $last_updated . "</lastmod>";
+ echo "<geo:geo>
+ <geo:format>kml</geo:format>
+ </geo:geo>";
+ echo "</url>\n";
+}
+
+echo '</urlset>';
?>
--- a/stop.php
+++ b/stop.php
@@ -1,95 +1,180 @@
<?php
+
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
include ('include/common.inc.php');
-$stopid = filter_var($_REQUEST['stopid'], FILTER_SANITIZE_NUMBER_INT);
-$stopcode = filter_var($_REQUEST['stopcode'], FILTER_SANITIZE_STRING);
-$url = $APIurl . "/json/stop?stop_id=" . $stopid;
-$stop = json_decode(getPage($url));
-if ($stopcode != "" && $stop[5] != $stopcode) {
- $url = $APIurl . "/json/stopcodesearch?q=" . $stopcode;
- $stopsearch = json_decode(getPage($url));
- $stopid = $stopsearch[0][0];
- $url = $APIurl . "/json/stop?stop_id=" . $stopid;
- $stop = json_decode(getPage($url));
+if (isset($stopid)) {
+ $stop = getStop($stopid);
}
-if (!startsWith($stop[5], "Wj") && strpos($stop[1], "Platform") === false) {
- // expand out to all platforms
-
-}
+/* if ($stopcode != "" && $stop[5] != $stopcode) {
+ $url = $APIurl . "/json/stopcodesearch?q=" . $stopcode;
+ $stopsearch = json_decode(getPage($url));
+ $stopid = $stopsearch[0][0];
+ $url = $APIurl . "/json/stop?stop_id=" . $stopid;
+ $stop = json_decode(getPage($url));
+ }
+ if (!startsWith($stop[5], "Wj") && strpos($stop[1], "Platform") === false) {
+ // expand out to all platforms
+
+ } */
+
$stops = Array();
$stopPositions = Array();
$stopNames = Array();
$tripStopNumbers = Array();
$allStopsTrips = Array();
+$fetchedTripSequences = Array();
$stopLinks = "";
-if (isset($_REQUEST['stopids'])) {
- $stopids = explode(",", filter_var($_REQUEST['stopids'], FILTER_SANITIZE_STRING));
- foreach ($stopids as $sub_stopid) {
- $url = $APIurl . "/json/stop?stop_id=" . $sub_stopid;
- $stop = json_decode(getPage($url));
- $stops[] = $stop;
- }
- $stop = $stops[0];
- $stopid = $stops[0][0];
- $stopLinks.= "Individual stop pages: ";
- foreach ($stops as $key => $sub_stop) {
- $stopNames[$key] = $sub_stop[1] . ' Stop #' . ($key + 1);
- $stopLinks.= '<a href="stop.php?stopid=' . $sub_stop[0] . '&stopcode=' . $sub_stop[5] . '">' . $stopNames[$key] . '</a> ';
- $stopPositions[$key] = Array(
- $sub_stop[2],
- $sub_stop[3]
- );
- $url = $APIurl . "/json/stoptrips?stop=" . $sub_stop[0] . "&time=" . midnight_seconds() . "&service_period=" . service_period();
- $trips = json_decode(getPage($url));
- foreach ($trips as $trip) {
- if (!isset($allStopsTrips[$trip[1][0]])) $allStopsTrips[$trip[1][0]] = $trip;
- $tripStopNumbers[$trip[1][0]][] = $key;
- }
- }
+if (isset($stopids)) {
+ foreach ($stopids as $sub_stopid) {
+ $stops[] = getStop($sub_stopid);
+ }
+ $stop = $stops[0];
+ $stopid = $stops[0]["stop_id"];
+ $stopLinks.= "Individual stop pages: <br>";
+ foreach ($stops as $key => $sub_stop) {
+
+ $stopNames[$key] = $sub_stop["stop_name"];
+ $stopLinks.= '<a href="stop.php?stopid=' . $sub_stop["stop_id"] . '&stopcode=' . $sub_stop["stop_code"] . '">' . $sub_stop["stop_name"] . '</a> ';
+
+ $stopPositions[$key] = Array(
+ $sub_stop["stop_lat"],
+ $sub_stop["stop_lon"]
+ );
+ $trips = getStopTrips($sub_stop["stop_id"]);
+ $tripSequence = "";
+ foreach ($trips as $trip) {
+ $tripSequence.= "{$trip['trip_id']},";
+ $tripStopNumbers[$trip['trip_id']][] = $key;
+ }
+ if (!in_array($tripSequence, $fetchedTripSequences)) {
+ // only fetch new trip sequences
+ $fetchedTripSequences[] = $tripSequence;
+ $trips = getStopTripsWithTimes($sub_stop["stop_id"]);
+ foreach ($trips as $trip) {
+ if (!isset($allStopsTrips[$trip["trip_id"]]))
+ $allStopsTrips[$trip["trip_id"]] = $trip;
+ }
+ }
+ //else {
+ // echo "skipped sequence $tripSequence";
+ //}
+ }
}
-include_header($stop[1], "stop");
-timePlaceSettings();
-echo '<div data-role="content" class="ui-content" role="main"> <a name="maincontent" id="maincontent"></a>';
+if (sizeof($stops) > 0) {
+ $stopDescParts = explode("<br>", $stop['stop_desc']);
+ include_header(trim(str_replace("Street: ", "", $stopDescParts[0])), "stop");
+} else {
+ include_header($stop['stop_name'], "stop");
+}
+/* $serviceAlerts = json_decode(getPage(curPageURL() . "/servicealerts_api.php?filter_class=stop&filter_id=".$stopid) , true);
+
+ foreach($serviceAlerts['entities'] as $serviceAlert) {
+ echo '<div id="servicewarning">'.$serviceAlert['alert']['description']['translation'].'</div>';
+ } */
+
+echo '<div class="content-secondary">';
echo $stopLinks;
if (sizeof($stops) > 0) {
- trackEvent("View Stops","View Combined Stops", $stop[1], $stop[0]);
+ trackEvent("View Stops", "View Combined Stops", $stop["stop_name"], $stop["stop_id"]);
+ echo staticmap($stopPositions);
+} else {
+ trackEvent("View Stops", "View Single Stop", $stop["stop_name"], $stop["stop_id"]);
+ echo staticmap(Array(
+ 0 => Array(
+ $stop["stop_lat"],
+ $stop["stop_lon"]
+ )
+ ));
+}
- echo '<p>' . staticmap($stopPositions) . '</p>';
-}
-else {
- trackEvent("View Stops","View Single Stop", $stop[1], $stop[0]);
- echo '<p>' . staticmap(Array(
- 0 => Array(
- $stop[2],
- $stop[3]
- )
- )) . '</p>';
-}
+timeSettings();
+
+echo '</div><div class="content-primary">';
echo ' <ul data-role="listview" data-inset="true">';
if (sizeof($allStopsTrips) > 0) {
- $trips = $allStopsTrips;
+ sktimesort($allStopsTrips, "arrival_time", true);
+ $trips = $allStopsTrips;
+} else {
+ $trips = getStopTripsWithTimes($stopid, "", "", "", (isset($filterIncludeRoutes) || isset($filterHasStop) ? "75" : ""));
}
-else {
- $url = $APIurl . "/json/stoptrips?stop=" . $stopid . "&time=" . midnight_seconds() . "&service_period=" . service_period();
- $trips = json_decode(getPage($url));
+
+echo "<div class='ui-header' style='overflow: visible; height: 2.5em'>";
+// if we have too many trips, cut down to size.
+if (!isset($filterIncludeRoutes) && !isset($filterHasStop) && sizeof($trips) > 10) {
+ $trips = array_splice($trips, 0, 10);
}
-foreach ($trips as $row) {
- echo '<li>';
- echo '<h3><a href="trip.php?stopid=' . $stopid . '&tripid=' . $row[1][0] . '">' . $row[1][1];
- $viaPoints = viaPointNames($row[1][0], $stopid);
- if ($viaPoints != "") echo '<div class="viaPoints">Via: ' . $viaPoints . '</div>';
- if (sizeof($tripStopNumbers) > 0) {
- echo '<br><small>Boarding At: ';
- foreach ($tripStopNumbers[$row[1][0]] as $key) {
- echo $stopNames[$key] .' ';
+
+// later/earlier button setup
+if (sizeof($trips) == 0) {
+ $time = isset($_REQUEST['time']) ? strtotime($_REQUEST['time']) : time();
+ $earlierTime = $time - (90 * 60);
+ $laterTime = $time + (90 * 60);
+} else {
+ $tripsKeys = array_keys($trips);
+ $earlierTime = strtotime($trips[$tripsKeys[0]]['arrival_time']) - (90 * 60);
+ $laterTime = strtotime($trips[$tripsKeys[sizeof($trips) - 1]]['arrival_time']) - 60;
+}
+if (isset($stopids) && sizeof($stopids) > 0) {
+ $stopidurl = "stopids=" . implode(",", $stopids);
+} else {
+ $stopidurl = "stopid=$stopid";
+}
+if (sizeof($trips) >= 10) {
+ echo '<a href="stop.php?' . $stopidurl . '&service_period=' . service_period() . '&time=' . date("H:i", $laterTime) . '" data-icon="arrow-r" class="ui-btn-right">Later Trips</a>';
+}
+echo '<a href="stop.php?' . $stopidurl . '&service_period=' . service_period() . '&time=' . date("H:i", $earlierTime) . '" data-icon="arrow-l" class="ui-btn-left">Earlier Trips</a>';
+echo "</div>";
+if (sizeof($trips) == 0) {
+ echo "<li style='text-align: center;'>No trips in the near future.</li>";
+} else {
+ foreach ($trips as $trip) {
+ if (
+ isset($filterHasStop) && (getTripHasStop($trip['trip_id'], $filterHasStop) == 1)
+ || (isset($filterIncludeRoutes) && in_array($trip["route_short_name"], $filterIncludeRoutes))
+ || (!isset($filterIncludeRoutes) && !isset($filterHasStop))
+ ) {
+ echo '<li>';
+
+ $destination = getTripDestination($trip['trip_id']);
+ echo '<a href="trip.php?stopid=' . $stopid . '&tripid=' . $trip['trip_id'] . '"><h3>' . $trip['route_short_name'] . " towards " . $destination['stop_name'] . "</h3><p>";
+ $viaPoints = viaPointNames($trip['trip_id'], $trip['stop_sequence']);
+ if ($viaPoints != "")
+ echo '<br><span class="viaPoints">Via: ' . $viaPoints . '</span>';
+ if (sizeof($tripStopNumbers) > 0) {
+ echo '<br><small>Boarding At: ';
+ if (sizeof($tripStopNumbers[$trip['trip_id']]) == sizeof($stopids)) {
+ echo "All Stops";
+ } else {
+ foreach ($tripStopNumbers[$trip['trip_id']] as $key) {
+ echo $stopNames[$key] . ', ';
+ }
+ }
+ echo '</small>';
}
- echo '</small>';
+ echo '</p>';
+ echo '<p class="ui-li-aside"><strong>' . $trip['arrival_time'] . '</strong></p>';
+ echo '</a></li>';
+ flush();
+ @ob_flush();
}
- echo '</a></h3>';
- echo '<p class="ui-li-aside"><strong>' . midnight_seconds_to_time($row[0]) . '</strong></p>';
- echo '</li>';
+ }
}
-if (sizeof($trips) == 0) echo "<li> <center>No trips in the near future.</center> </li>";
-echo '</ul></div>';
+echo '</ul>';
+echo '</div>';
include_footer();
?>
--- a/stopList.php
+++ b/stopList.php
@@ -1,142 +1,152 @@
<?php
+
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
include ('include/common.inc.php');
-function filterByFirstLetter($var)
-{
- return $var[1][0] == $_REQUEST['firstLetter'];
-}
-function navbar()
-{
- echo '
+$stops = Array();
+
+function navbar() {
+ echo '
<div data-role="navbar">
<ul>
- <li><a href="stopList.php">Timing Points</a></li>
- <li><a href="stopList.php?suburbs=yes">By Suburb</a></li>
+ <li><a href="stopList.php">Stops by Name</a></li>
+ <li><a href="stopList.php?bysuburbs=yes">By Suburb</a></li>
<li><a href="stopList.php?nearby=yes">Nearby Stops</a></li>
- <li><a href="stopList.php?allstops=yes">All Stops</a></li>
</ul>
</div>
';
}
+
// By suburb
-if (isset($_REQUEST['suburbs'])) {
- include_header("Stops by Suburb", "stopList");
- navbar();
- echo ' <ul data-role="listview" data-filter="true" data-inset="true" >';
- if (!isset($_REQUEST['firstLetter'])) {
- foreach (range('A', 'Z') as $letter) {
- echo "<li><a href=\"stopList.php?firstLetter=$letter&suburbs=yes\">$letter...</a></li>\n";
- }
- }
- else {
- foreach ($suburbs as $suburb) {
- if (startsWith($suburb, $_REQUEST['firstLetter'])) {
- echo '<li><a href="stopList.php?suburb=' . urlencode($suburb) . '">' . $suburb . '</a></li>';
- }
- }
- }
- echo '</ul>';
+if (isset($bysuburbs)) {
+ include_header("Stops by Suburb", "stopList");
+ navbar();
+ echo ' <ul data-role="listview" data-filter="true" data-inset="true" >';
+ if (!isset($firstLetter)) {
+ foreach (range('A', 'Y') as $letter) { // no suburbs start with J, Q, U, V, X or Z
+ if ($letter != "J" && $letter != "Q" && $letter != "U" && $letter != "V" && $letter != "X") echo "<li><a href=\"stopList.php?firstLetter=$letter&bysuburbs=yes\">$letter...</a></li>\n";
+ }
+ } else {
+ foreach ($suburbs as $suburb) {
+ if (startsWith($suburb, $firstLetter)) {
+ echo '<li><a href="stopList.php?suburb=' . urlencode($suburb) . '">' . $suburb . '</a></li>';
+ }
+ }
+ }
+ echo '</ul>';
+} else {
+ // Timing Points / All stops
+ if (isset($nearby)) {
+ $listType = 'nearby=yes';
+ include_header("Nearby Stops", "stopList", true, true);
+ trackEvent("Stop Lists", "Stops Nearby", $_SESSION['lat'] . "," . $_SESSION['lon']);
+ navbar();
+ if (!isset($_SESSION['lat']) || !isset($_SESSION['lat']) || $_SESSION['lat'] == "" || $_SESSION['lon'] == "") {
+ placeSettings();
+ include_footer();
+ die();
+ }
+ $stops = getNearbyStops($_SESSION['lat'], $_SESSION['lon'], 15);
+ echo '<div class="content-secondary">';
+ $stopPositions[] = Array(
+ $_SESSION['lat'],
+ $_SESSION['lon']
+ );
+ foreach ($stops as $sub_stop) {
+ $stopPositions[] = Array(
+ $sub_stop["stop_lat"],
+ $sub_stop["stop_lon"]
+ );
+ }
+ echo staticmap($stopPositions, true, true);
+ placeSettings();
+ echo '</div><div class="content-primary">';
+ } else if (isset($suburb)) {
+ $stops = getStopsBySuburb($suburb);
+ include_header("Stops in " . ucwords($suburb), "stopList");
+ navbar();
+ trackEvent("Stop Lists", "Stops By Suburb", $suburb);
+ } else {
+ $listType = 'allstops=yes';
+ $stops = getStops($firstLetter);
+ include_header("Stops by Name", "stopList");
+ navbar();
+ }
+ echo ' <ul data-role="listview" data-filter="true" data-inset="true" >';
+ if (!isset($firstLetter) && !isset($suburb) && !isset($nearby)) { // all stops by letter
+ foreach (range('A', 'Y') as $letter) { // no streets start with X or Z
+ if ($letter != "X") echo "<li><a href=\"stopList.php?firstLetter=$letter&$listType\">$letter...</a></li>\n";
+ }
+ } else {
+ //var_dump($stops);
+ $stopsGrouped = Array();
+ foreach ($stops as $key => $stop) {
+ if ($key + 1 >= sizeof($stops) ||
+ stopCompare($stops[$key]["stop_name"]) != stopCompare($stops[$key + 1]["stop_name"])) {
+ if (sizeof($stopsGrouped) > 0) {
+ // print and empty grouped stops
+ // subsequent duplicates
+ $stopsGrouped["stop_ids"][] = $stop['stop_id'];
+ echo '<li>';
+ echo '<a href="stop.php?stopids=' . implode(",", $stopsGrouped['stop_ids']) . '&stopcodes=' . implode(",", $stopsGrouped['stop_codes']) . '">';
+ if (isset($_SESSION['lat']) && isset($_SESSION['lon'])) {
+ echo '<span class="ui-li-count">' . distance($stop['stop_lat'], $stop['stop_lon'], $_SESSION['lat'], $_SESSION['lon'], true) . 'm away</span>';
+ }
+ echo stopGroupTitle($stop['stop_name'],$stop['stop_desc']) . '<br><small>' . sizeof($stopsGrouped["stop_ids"]) . ' stops</small>';
+ echo "</a></li>\n";
+ flush();
+ @ob_flush();
+ $stopsGrouped = Array();
+ } else {
+ // just a normal stop
+ echo '<li>';
+ echo '<a href="stop.php?stopid=' . $stop['stop_id'] . '&stopcode=' . $stop['stop_code'] . '">';
+ if (isset($_SESSION['lat']) && isset($_SESSION['lon'])) {
+ echo '<span class="ui-li-count">' . distance($stop['stop_lat'], $stop['stop_lon'], $_SESSION['lat'], $_SESSION['lon'], true) . 'm away</span>';
+ }
+ echo $stop['stop_name'];
+ echo "</a></li>\n";
+ flush();
+ @ob_flush();
+ }
+ } else {
+ // this is a duplicated line item
+ if ($key - 1 <= 0 || stopCompare($stops[$key]['stop_name']) != stopCompare($stops[$key - 1]['stop_name'])) {
+ // first duplicate
+ $stopsGrouped = Array(
+ "name" => trim(preg_replace("/\(Platform.*/", "", $stop['stop_name'])),
+ "stop_ids" => Array(
+ $stop['stop_id']
+ ),
+ "stop_codes" => Array(
+ $stop['stop_code']
+ )
+ );
+ } else {
+ // subsequent duplicates
+ $stopsGrouped["stop_ids"][] = $stop['stop_id'];
+
+ }
+ }
+ }
+ }
+ echo '</ul>';
+ if (isset($nearby)) {
+ echo '</div>';
}
-else {
- // Timing Points / All stops
- if ($_REQUEST['allstops']) {
- $listType = 'allstops=yes';
- $url = $APIurl . "/json/stops";
- include_header("All Stops", "stopList");
- navbar();
- timePlaceSettings();
- }
- else if ($_REQUEST['nearby']) {
- $listType = 'nearby=yes';
- $url = $APIurl . "/json/neareststops?lat={$_SESSION['lat']}&lon={$_SESSION['lon']}&limit=15";
- include_header("Nearby Stops", "stopList", true, true);
- navbar();
- timePlaceSettings(true);
- if (!isset($_SESSION['lat']) || !isset($_SESSION['lat']) || $_SESSION['lat'] == "" || $_SESSION['lon'] == "") {
- include_footer();
- die();
- }
- }
- else if ($_REQUEST['suburb']) {
- $suburb = filter_var($_REQUEST['suburb'], FILTER_SANITIZE_STRING);
- $listType = "suburb=$suburb";
- $url = $APIurl . "/json/stopzonesearch?q=" . $suburb;
- include_header("Stops in " . ucwords($suburb) , "stopList");
- navbar();
- trackEvent("Stop Lists","Stops By Suburb", $suburb);
- }
- else {
- $url = $APIurl . "/json/timingpoints";
- include_header("Timing Points / Major Stops", "stopList");
- navbar();
- timePlaceSettings();
- }
- echo ' <ul data-role="listview" data-filter="true" data-inset="true" >';
- if (!isset($_REQUEST['firstLetter']) && !$_REQUEST['suburb'] && !$_REQUEST['nearby']) {
- foreach (range('A', 'Z') as $letter) {
- echo "<li><a href=\"stopList.php?firstLetter=$letter&$listType\">$letter...</a></li>\n";
- }
- }
- else {
- $stops = json_decode(getPage($url));
- foreach ($stops as $key => $row) {
- $stopName[$key] = $row[1];
- }
- // Sort the stops by name
- array_multisort($stopName, SORT_ASC, $stops);
- if (!isset($_REQUEST['suburb']) && !isset($_REQUEST['nearby'])) {
- $stops = array_filter($stops, "filterByFirstLetter");
- }
- $stopsGrouped = Array();
- foreach ($stops as $key => $row) {
- if ((trim(preg_replace("/\(Platform.*/", "", $stops[$key][1])) != trim(preg_replace("/\(Platform.*/", "", $stops[$key + 1][1]))) || $key + 1 >= sizeof($stops)) {
- if (sizeof($stopsGrouped) > 0) {
- // print and empty grouped stops
- // subsequent duplicates
- $stopsGrouped["stop_ids"][] = $row[0];
- echo '<li>';
- if (!startsWith($stopsGrouped['stop_codes'][0], "Wj")) echo '<img src="css/images/time.png" alt="Timing Point: " class="ui-li-icon">';
- echo '<a href="stop.php?stopids=' . implode(",", $stopsGrouped['stop_ids']) . '">';
- if (isset($_SESSION['lat']) && isset($_SESSION['lon'])) {
- echo '<span class="ui-li-count">' . distance($row[2], $row[3], $_SESSION['lat'], $_SESSION['lon'], true) . 'm away</span>';
- }
- echo bracketsMeanNewLine(trim(preg_replace("/\(Platform.*/", "", $row[1])) . '(' . sizeof($stopsGrouped["stop_ids"]) . ' stops)');
- echo "</a></li>\n";
- $stopsGrouped = Array();
- }
- else {
- // just a normal stop
- echo '<li>';
- if (!startsWith($row[5], "Wj")) echo '<img src="css/images/time.png" alt="Timing Point" class="ui-li-icon">';
- echo '<a href="stop.php?stopid=' . $row[0] . (startsWith($row[5], "Wj") ? '&stopcode=' . $row[5] : "") . '">';
- if (isset($_SESSION['lat']) && isset($_SESSION['lon'])) {
- echo '<span class="ui-li-count">' . distance($row[2], $row[3], $_SESSION['lat'], $_SESSION['lon'], true) . 'm away</span>';
- }
- echo bracketsMeanNewLine($row[1]);
- echo "</a></li>\n";
- }
- }
- else {
- // this is a duplicated line item
- if ($key - 1 <= 0 || (trim(preg_replace("/\(Platform.*/", "", $stops[$key][1])) != trim(preg_replace("/\(Platform.*/", "", $stops[$key - 1][1])))) {
- // first duplicate
- $stopsGrouped = Array(
- "name" => trim(preg_replace("/\(Platform.*/", "", $row[1])) ,
- "stop_ids" => Array(
- $row[0]
- ) ,
- "stop_codes" => Array(
- $row[5]
- )
- );
- }
- else {
- // subsequent duplicates
- $stopsGrouped["stop_ids"][] = $row[0];
- }
- }
- }
- }
- echo '</ul>';
}
include_footer();
?>
--- a/trip.php
+++ b/trip.php
@@ -1,97 +1,140 @@
<?php
+
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
include ('include/common.inc.php');
-$tripid = filter_var($_REQUEST['tripid'], FILTER_SANITIZE_NUMBER_INT);
-$stopid = filter_var($_REQUEST['stopid'], FILTER_SANITIZE_NUMBER_INT);
-$routeid = filter_var($_REQUEST['routeid'], FILTER_SANITIZE_NUMBER_INT);
$routetrips = Array();
-if ($_REQUEST['routeid'] && !$_REQUEST['tripid']) {
- $tripid = 0;
- $url = $APIurl . "/json/routetrips?route_id=" . $routeid;
- $routetrips = json_decode(getPage($url));
- foreach ($routetrips as $trip) {
- if ($trip[0] > midnight_seconds()) {
- $tripid = $trip[1];
- break;
- }
- }
- if ($tripid == 0) $tripid = $routetrips[0][1];
+if (isset($routeid) && !isset($tripid)) {
+ $trip = getRouteNextTrip($routeid,$directionid);
+
+ if (!($trip)) {
+ $trip = getRouteFirstTrip($routeid,$directionid);
+ }
+ $tripid = $trip['trip_id'];
+} else {
+ $trip = getTrip($tripid);
+ $routeid = $trip['route_id'];
}
-$url = $APIurl . "/json/triprows?trip=" . $tripid;
-$trips = array_flatten(json_decode(getPage($url)));
-if (sizeof($routetrips) == 0) {
- $routeid = $trips[1]->route_id;
- $url = $APIurl . "/json/routetrips?route_id=" . $trips[1]->route_id;
- $routetrips = json_decode(getPage($url));
+$directionid = $trip['direction_id'];
+$service_period = strtolower($trip["service_id"]);
+$destination = getTripDestination($trip['trip_id']);
+include_header("Route " . $trip['route_id'] . ' to ' . $destination['stop_name'], "trip");
+trackEvent("Route/Trip View", "View Route", $trip['route_id'] . ' ' . $destination['stop_name'], $routeid);
+echo '<div class="content-secondary">';
+echo '<a href="' . $trip['route_url'] . '">View Original Timetable/Map</a> ';
+echo '<a href="geo/trip.kml.php?tripid='.$tripid.'">View Trip in Google Earth</a> ';
+echo '<a href="geo/route.kml.php?routeid='.$routeid.'">View Route in Google Earth</a>';
+echo '<h2>Via:</h2> <small>' . viaPointNames($tripid) . '</small>';
+echo '<h2>Other Trips:</h2> ';
+$routeTrips = getRouteTrips($routeid, $trip['direction_id'], $service_period);
+foreach ($routeTrips as $key => $othertrip) {
+ // if ($othertrip['trip_id'] != $tripid) {
+ echo '<a href="trip.php?tripid=' . $othertrip['trip_id'] . "&routeid=" . $routeid . '">' . str_replace(" ", ":00", str_replace(":00", " ", $othertrip['arrival_time'])) . '</a> ';
+ // } else {
+ // skip this trip but look forward/back
+ if ($key - 1 > 0)
+ $prevTrip = $routeTrips[$key - 1]['trip_id'];
+ if ($key + 1 < sizeof($routeTrips))
+ $nextTrip = $routeTrips[$key + 1]['trip_id'];
+ // }
}
-include_header("Stops on " . $trips[1]->route_short_name . ' ' . $trips[1]->route_long_name, "trip");
-trackEvent("Route/Trip View","View Route", $trips[1]->route_short_name . ' ' . $trips[1]->route_long_name, $trips[1]->route_id);
-$url = $APIurl . "/json/tripstoptimes?trip=" . $tripid;
-$json = json_decode(getPage($url));
-$stops = $json[0];
-$times = $json[1];
-$viaPoints = Array();
-foreach ($stops as $stop) {
- if (!startsWith($stop[5], "Wj")) {
- $viaPoints[] = $stop[1];
- }
+flush();
+@ob_flush();
+echo '<h2>Other directions/timing periods:</h2> ';
+$otherDir = 0;
+
+ foreach (getRouteHeadsigns($routeid) as $headsign) {
+ if ($headsign['direction_id'] != $directionid || strtolower($headsign['service_id']) != $service_period) {
+
+ echo '<a href="trip.php?routeid=' . $routeid . '&directionid=' . $headsign['direction_id'] . '&service_period=' . $headsign['service_id'] . '"> Starting at ' . $headsign['stop_name'] . ' (' . $headsign['service_id'] . ')</a> ';
+ $otherDir++;
+ }
+ }
+
+if ($otherDir == 0) {
+ echo "None";
}
-echo '<p><h2>Via:</h2> ' . implode(", ", $viaPoints) . '</small></p>';
-echo '<p><h2>Other Trips:</h2> ';
-foreach ($routetrips as $othertrip) {
- echo '<a href="trip.php?tripid=' . $othertrip[1] . "&routeid=" . $routeid . '">' . midnight_seconds_to_time($othertrip[0]) . '</a> ';
+echo '</div><div class="content-primary">';
+flush();
+@ob_flush();
+echo "<div class='ui-header' style='overflow: visible; height: 1.5em'>";
+if (isset($nextTrip)) {
+ echo '<a href="trip.php?tripid=' . $nextTrip . "&routeid=" . $routeid . '" data-icon="arrow-r" class="ui-btn-right">Next Trip</a>';
}
-echo '</p><p><h2>Other directions/timing periods:</h2> ';
-$url = $APIurl . "/json/routesearch?routeshortname=" . rawurlencode($trips[1]->route_short_name);
-$json = json_decode(getPage($url));
-foreach ($json as $row) {
- if ($row[0] != $routeid) echo '<a href="trip.php?routeid=' . $row[0] . '">' . $row[2] . ' (' . ucwords($row[3]) . ')</a> ';
+if (isset($prevTrip)) {
+ echo '<a href="trip.php?tripid=' . $prevTrip . "&routeid=" . $routeid . '" data-icon="arrow-l" class="ui-btn-left">Previous Trip</a>';
}
+echo "</div>";
echo ' <ul data-role="listview" data-inset="true">';
-echo '<li data-role="list-divider">' . midnight_seconds_to_time($times[0]) . '-' . midnight_seconds_to_time($times[sizeof($times) - 1]) . ' ' . $trips[1]->route_long_name . '</li>';
$stopsGrouped = Array();
-foreach ($stops as $key => $row) {
- if (($stops[$key][1] != $stops[$key + 1][1]) || $key + 1 >= sizeof($stops)) {
- echo '<li>';
- if (!startsWith($row[5], "Wj")) echo '<img src="css/images/time.png" alt="Timing Point" class="ui-li-icon">';
- if (sizeof($stopsGrouped) > 0) {
- // print and empty grouped stops
- // subsequent duplicates
- $stopsGrouped["stop_ids"][] = $row[0];
- $stopsGrouped["endTime"] = $times[$key];
- echo '<a href="stop.php?stopids=' . implode(",", $stopsGrouped['stop_ids']) . '">';
- echo '<p class="ui-li-aside">' . midnight_seconds_to_time($stopsGrouped['startTime']) . ' to ' . midnight_seconds_to_time($stopsGrouped['endTime']) . '</p>';
- echo bracketsMeanNewLine($row[1]);
- echo '</a></li>';
- $stopsGrouped = Array();
- }
- else {
- // just a normal stop
- echo '<a href="stop.php?stopid=' . $row[0] . (startsWith($row[5], "Wj") ? '&stopcode=' . $row[5] : "") . '">';
- echo '<p class="ui-li-aside">' . midnight_seconds_to_time($times[$key]) . '</p>';
- echo bracketsMeanNewLine($row[1]);
- echo '</a></li>';
- }
- }
- else {
- // this is a duplicated line item
- if ($key - 1 <= 0 || ($stops[$key][1] != $stops[$key - 1][1])) {
- // first duplicate
- $stopsGrouped = Array(
- "name" => $row[1],
- "startTime" => $times[$key],
- "stop_ids" => Array(
- $row[0]
- )
- );
- }
- else {
- // subsequent duplicates
- $stopsGrouped["stop_ids"][] = $row[0];
- $stopsGrouped["endTime"] = $times[$key];
- }
- }
+$tripStopTimes = getTripStopTimes($tripid);
+echo '<li data-role="list-divider">' . $tripStopTimes[0]['arrival_time'] . ' to ' . $tripStopTimes[sizeof($tripStopTimes) - 1]['arrival_time'] . ' towards ' . $destination['stop_name'] . ' (' . ucwords(strtolower($tripStopTimes[0]['service_id'])) . ')</li>';
+foreach ($tripStopTimes as $key => $tripStopTime) {
+ if ($key + 1 >= sizeof($tripStopTimes) || stopCompare($tripStopTimes[$key]["stop_name"]) != stopCompare($tripStopTimes[$key + 1]["stop_name"])) {
+ echo '<li>';
+
+ if (sizeof($stopsGrouped) > 0) {
+ // print and empty grouped stops
+ // subsequent duplicates
+ $stopsGrouped["stop_ids"][] = $tripStopTime['stop_id'];
+ $stopsGrouped["endTime"] = $tripStopTime['arrival_time'];
+ echo '<a href="stop.php?stopids=' . implode(",", $stopsGrouped['stop_ids']) . '">';
+ echo '<p class="ui-li-aside">' . $stopsGrouped['startTime'] . ' to ' . $stopsGrouped['endTime'];
+ if (isset($_SESSION['lat']) && isset($_SESSION['lon'])) {
+ echo '<br>' . distance($tripStopTime['stop_lat'], $tripStopTime['stop_lon'], $_SESSION['lat'], $_SESSION['lon'], true) . 'm away';
+ }
+ echo '</p>';
+ echo stopGroupTitle($tripStopTime['stop_name'], $tripStopTime['stop_desc']) . '<br><small>' . sizeof($stopsGrouped["stop_ids"]) . ' stops</small>';
+
+ echo '</a></li>';
+ flush();
+ @ob_flush();
+ $stopsGrouped = Array();
+ } else {
+ // just a normal stop
+ echo '<a href="stop.php?stopid=' . $tripStopTime['stop_id'] . (startsWith($tripStopTime['stop_code'], "Wj") ? '&stopcode=' . $tripStopTime['stop_code'] : "") . '">';
+ echo '<p class="ui-li-aside">' . $tripStopTime['arrival_time'];
+ if (isset($_SESSION['lat']) && isset($_SESSION['lon'])) {
+ echo '<br>' . distance($tripStopTime['stop_lat'], $tripStopTime['stop_lon'], $_SESSION['lat'], $_SESSION['lon'], true) . 'm away';
+ }
+ echo '</p>';
+ echo $tripStopTime['stop_name'];
+ echo '</a></li>';
+ flush();
+ @ob_flush();
+ }
+ } else {
+ // this is a duplicated line item
+ if ($key - 1 <= 0 || stopCompare($tripStopTimes[$key]['stop_name']) != stopCompare($tripStopTimes[$key - 1]['stop_name'])) {
+ // first duplicate
+ $stopsGrouped = Array(
+ "startTime" => $tripStopTime['arrival_time'],
+ "stop_ids" => Array(
+ $tripStopTime['stop_id']
+ )
+ );
+ } else {
+ // subsequent duplicates
+ $stopsGrouped["stop_ids"][] = $tripStopTime['stop_id'];
+ $stopsGrouped["endTime"] = $tripStopTime['arrival_time'];
+ }
+ }
}
echo '</ul>';
+echo '</div>';
include_footer();
?>
--- a/tripPlanner.php
+++ b/tripPlanner.php
@@ -1,29 +1,45 @@
<?php
+
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
include ('include/common.inc.php');
-include_header("Trip Planner", "tripPlanner", true, true, true);
-$from = (isset($_REQUEST['from']) ? filter_var($_REQUEST['from'], FILTER_SANITIZE_STRING) : "Brigalow");
-$to = (isset($_REQUEST['to']) ? filter_var($_REQUEST['to'], FILTER_SANITIZE_STRING) : "Barry");
+include_header("Trip Planner", "tripPlanner", true, false, true);
+$from = (isset($_REQUEST['from']) ? filter_var($_REQUEST['from'], FILTER_SANITIZE_STRING) : "");
+$to = (isset($_REQUEST['to']) ? filter_var($_REQUEST['to'], FILTER_SANITIZE_STRING) : "");
$date = (isset($_REQUEST['date']) ? filter_var($_REQUEST['date'], FILTER_SANITIZE_STRING) : date("m/d/Y"));
$time = (isset($_REQUEST['time']) ? filter_var($_REQUEST['time'], FILTER_SANITIZE_STRING) : date("H:i"));
+
function formatTime($timeString) {
- $timeParts = explode("T",$timeString);
- return str_replace("Z","",$timeParts[1]);
-}
-function tripPlanForm($errorMessage = "")
-{
-
- global $date, $time, $from, $to;
- echo "<font color=red>$errorMessage</font>";
- echo '<form action="tripPlanner.php" method="post">
+ $timeParts = explode("T", $timeString);
+ return str_replace("Z", "", $timeParts[1]);
+}
+
+function tripPlanForm($errorMessage = "") {
+ global $date, $time, $from, $to;
+ echo "<div class='error'>$errorMessage</font>";
+ echo '<form action="tripPlanner.php" method="post">
<div data-role="fieldcontain">
<label for="from">I would like to go from</label>
<input type="text" name="from" id="from" value="' . $from . '" />
- <a href="#" style="display:none" name="fromHere" id="fromHere"/>Here?</a>
+ <a href="#" style="display:none" name="fromHere" id="fromHere">Here?</a>
</div>
<div data-role="fieldcontain">
<label for="to"> to </label>
<input type="text" name="to" id="to" value="' . $to . '" />
- <a href="#" style="display:none" name="toHere" id="toHere"/>Here?</a>
+ <a href="#" style="display:none" name="toHere" id="toHere">Here?</a>
</div>
<div data-role="fieldcontain">
<label for="date"> on </label>
@@ -34,131 +50,231 @@
<input type="time" name="time" id="time" value="' . $time . '" />
</div>
<input type="submit" value="Go!"></form>';
- echo "<script>
-$('#toHere').click(function(event) { $('#to').val(getCookie('geolocate')); return false;});
-$('#toHere').show();
-$('#fromHere').click(function(event) { $('#from').val(getCookie('geolocate')); return false;});
-$('#fromHere').show();
-
- </script>";
-}
-function processItinerary($itineraryNumber, $itinerary)
-{
- echo '<div data-role="collapsible" ' . ($itineraryNumber > 0 ? 'data-collapsed="true"' : "") . '> <h3> Option #' . ($itineraryNumber + 1) . ": " . floor($itinerary->duration / 60000) . " minutes (".formatTime($itinerary->startTime)." to ".formatTime($itinerary->endTime).")</h3><p>";
- echo "Walking time: " . floor($itinerary->walkTime / 60000) . " minutes (" . floor($itinerary->walkDistance) . " meters)<br>\n";
- echo "Transit time: " . floor($itinerary->transitTime / 60000) . " minutes<br>\n";
- echo "Waiting time: " . floor($itinerary->waitingTime / 60000) . " minutes<br>\n";
- if (is_array($itinerary->legs->leg)) {
- $legMarkers = array();
- foreach ($itinerary->legs->leg as $legNumber => $leg) {
- $legMarkers[] = array(
- $leg->from->lat,
- $leg->from->lon
- );
- }
- echo '' . staticmap($legMarkers, 0, "iconb", false) . "<br>\n";
- echo '<ul>';
- foreach ($itinerary->legs->leg as $legNumber => $leg) {
- echo '<li>';
- processLeg($legNumber, $leg);
- echo "</li>";
- }
- echo "</ul>";
- }
- else {
- echo '' . staticmap(array(
- array(
- $itinerary->legs->leg->from->lat,
- $itinerary->legs->leg->from->lon
- )
- ) , 0, "iconb", false) . "<br>\n";
- processLeg(0, $itinerary->legs->leg);
- }
- echo "</p></div>";
-}
-function processLeg($legNumber, $leg)
-{
- $legArray = object2array($leg);
- echo '<h3>Leg #' . ($legNumber + 1) . " ( {$legArray['@mode']} from: {$leg->from->name} to {$leg->to->name}, " . floor($leg->duration / 60000) . " minutes) </h3>\n";
- if ($legArray["@mode"] === "BUS") {
- echo "Take bus {$legArray['@route']} " . str_replace("To", "towards", $legArray['@headsign']) . "<br>";
- }
- else {
- $walkStepMarkers = array();
- foreach ($leg->steps->walkSteps as $stepNumber => $step) {
- $walkStepMarkers[] = array(
- $step->lat,
- $step->lon
- );
- }
- echo "" . staticmap($walkStepMarkers, 0, "icong", false) . "<br>\n";
- foreach ($leg->steps->walkSteps as $stepNumber => $step) {
- echo "Walking step " . ($stepNumber + 1) . ": ";
- if ($step->relativeDirection == "CONTINUE") {
- echo "Continue, ";
- } else if ($step->relativeDirection) echo "Turn ".ucwords(strtolower(str_replace("_"," ",$step->relativeDirection))).", ";
- echo "Go ".ucwords(strtolower($step->absoluteDirection))." on ";
- if (strpos($step->streetName,"from") !== false && strpos($step->streetName,"way") !== false) {
- echo "footpath";
- } else {
- echo $step->streetName;
- }
- echo " for " . floor($step->distance) . " meters<br>\n";
- }
- }
-}
+}
+
+function processItinerary($itineraryNumber, $itinerary) {
+ echo '<div data-role="collapsible" ' . ($itineraryNumber > 0 ? 'data-collapsed="true"' : "") . '> <h3> Option #' . ($itineraryNumber + 1) . ": " . floor($itinerary->duration / 60000) . " minutes (" . formatTime($itinerary->startTime) . " to " . formatTime($itinerary->endTime) . ")</h3><p>";
+ echo "Walking time: " . floor($itinerary->walkTime / 60000) . " minutes (" . floor($itinerary->walkDistance) . " meters)<br>\n";
+ echo "Transit time: " . floor($itinerary->transitTime / 60000) . " minutes<br>\n";
+ echo "Waiting time: " . floor($itinerary->waitingTime / 60000) . " minutes<br>\n";
+ if (is_array($itinerary->legs->leg)) {
+ $legMarkers = array();
+ foreach ($itinerary->legs->leg as $legNumber => $leg) {
+ $legMarkers[] = array(
+ $leg->from->lat,
+ $leg->from->lon
+ );
+ }
+ echo '' . staticmap($legMarkers, false, false, true) . "<br>\n";
+ echo '<ul>';
+ foreach ($itinerary->legs->leg as $legNumber => $leg) {
+ echo '<li>';
+ processLeg($legNumber, $leg);
+ echo "</li>";
+ flush();
+ @ob_flush();
+ }
+ echo "</ul>";
+ } else {
+ echo '' . staticmap(array(
+ array(
+ $itinerary->legs->leg->from->lat,
+ $itinerary->legs->leg->from->lon
+ )
+ ), false, false, true) . "<br>\n";
+ processLeg(0, $itinerary->legs->leg);
+ }
+ echo "</p></div>";
+}
+
+function processLeg($legNumber, $leg) {
+ $legArray = object2array($leg);
+ echo '<h3>Leg #' . ($legNumber + 1) . " ( {$legArray['@mode']} from: {$leg->from->name} to {$leg->to->name}, " . floor($leg->duration / 60000) . " minutes) </h3>\n";
+ if ($legArray["@mode"] === "BUS") {
+ echo "Take bus {$legArray['@route']} " . str_replace("To", "towards", $legArray['@headsign']) . " departing at " . formatTime($leg->startTime) . "<br>";
+ } else {
+ $walkStepMarkers = array();
+ foreach ($leg->steps->walkSteps as $stepNumber => $step) {
+ $walkStepMarkers[] = array(
+ $step->lat,
+ $step->lon
+ );
+ }
+ echo "" . staticmap($walkStepMarkers, false, false, true) . "<br>\n";
+ foreach ($leg->steps->walkSteps as $stepNumber => $step) {
+ echo "Walking step " . ($stepNumber + 1) . ": ";
+ if ($step->relativeDirection == "CONTINUE") {
+ echo "Continue, ";
+ } else if ($step->relativeDirection)
+ echo "Turn " . ucwords(strtolower(str_replace("_", " ", $step->relativeDirection))) . ", ";
+ echo "Go " . ucwords(strtolower($step->absoluteDirection)) . " on ";
+ if (strpos($step->streetName, "from") !== false && strpos($step->streetName, "way") !== false) {
+ echo "footpath";
+ } else {
+ echo $step->streetName;
+ }
+ echo " for " . floor($step->distance) . " meters<br>\n";
+ }
+ }
+}
+
if ($_REQUEST['time']) {
- $toPlace = (startsWith($to, "-") ? $to : geocode($to, false));
- $fromPlace = (startsWith($from, "-") ? $from : geocode($from, false));
- if ($toPlace == "" || $fromPlace == "") {
- $errorMessage = "";
- if ($toPlace === "") {
- $errorMessage.= urlencode($to) . " not found.<br>\n";
- trackEvent("Trip Planner","Geocoder Failed", $to);
+ if (startsWith($to, "-")) {
+ $toPlace = $to;
+ } else if (strpos($to, "(") !== false) {
+ $toParts = explode("(", $to);
+ $toPlace = str_replace(")", "", $toParts[1]);
+ } else {
+ $toPlace = geocode($to, false);
+ }
+
+ if (startsWith($from, "-")) {
+ $fromPlace = $from;
+ } else if (strpos($from, "(") !== false) {
+ $fromParts = explode("(", urldecode($from));
+ $fromPlace = str_replace(")", "", $fromParts[1]);
+ } else {
+ $fromPlace = geocode($from, false);
+ }
+
+ if ($toPlace == "" || $fromPlace == "") {
+ $errorMessage = "";
+ if ($toPlace == "") {
+ $errorMessage.= urlencode($to) . " not found.<br>\n";
+ trackEvent("Trip Planner", "Geocoder Failed", $to);
+ }
+ if ($fromPlace == "") {
+ $errorMessage.= urlencode($from) . " not found.<br>\n";
+ trackEvent("Trip Planner", "Geocoder Failed", $from);
+ }
+ tripPlanForm($errorMessage);
+ } else {
+ $url = $otpAPIurl . "ws/plan?date=" . urlencode($_REQUEST['date']) . "&time=" . urlencode($_REQUEST['time']) . "&mode=TRANSIT%2CWALK&optimize=QUICK&maxWalkDistance=840&wheelchair=false&toPlace=$toPlace&fromPlace=$fromPlace&intermediatePlaces=";
+ debug($url);
+ $ch = curl_init($url);
+ curl_setopt($ch, CURLOPT_RETURNTRANSFER, 1);
+ curl_setopt($ch, CURLOPT_HEADER, 0);
+ curl_setopt($ch, CURLOPT_HTTPHEADER, array(
+ "Accept: application/json"
+ ));
+ curl_setopt($ch, CURLOPT_TIMEOUT, 10);
+ $page = curl_exec($ch);
+ if (curl_errno($ch) || curl_getinfo($ch, CURLINFO_HTTP_CODE) != 200) {
+ tripPlanForm("Trip planner temporarily unavailable: " . curl_errno($ch) . " " . curl_error($ch) . " " . curl_getinfo($ch, CURLINFO_HTTP_CODE) . (isDebug() ? "<br>" . $url : ""));
+ trackEvent("Trip Planner", "Trip Planner Failed", $url);
+ } else {
+ trackEvent("Trip Planner", "Plan Trip From", $from);
+ trackEvent("Trip Planner", "Plan Trip To", $to);
+ $tripplan = json_decode($page);
+ debug(print_r($tripplan, true));
+ echo "<h1> From: {$tripplan->plan->from->name} To: {$tripplan->plan->to->name} </h1>";
+ echo "<h1> At: " . formatTime($tripplan->plan->date) . " </h1>";
+ if (is_array($tripplan->plan->itineraries->itinerary)) {
+ echo '<div data-role="collapsible-set">';
+ foreach ($tripplan->plan->itineraries->itinerary as $itineraryNumber => $itinerary) {
+ processItinerary($itineraryNumber, $itinerary);
}
- if ($fromPlace === "") {
- $errorMessage.= urlencode($from) . " not found.<br>\n";
- trackEvent("Trip Planner","Geocoder Failed", $from);
- }
- tripPlanForm($errorMessage);
- }
- else {
- $url = $otpAPIurl . "ws/plan?date=" . urlencode($_REQUEST['date']) . "&time=" . urlencode($_REQUEST['time']) . "&mode=TRANSIT%2CWALK&optimize=QUICK&maxWalkDistance=840&wheelchair=false&toPlace=$toPlace&fromPlace=$fromPlace&intermediatePlaces=";
- $ch = curl_init($url);
- curl_setopt($ch, CURLOPT_RETURNTRANSFER, 1);
- curl_setopt($ch, CURLOPT_HEADER, 0);
- curl_setopt($ch, CURLOPT_HTTPHEADER, array(
- "Accept: application/json"
- ));
- curl_setopt($ch, CURLOPT_TIMEOUT, 5);
- $page = curl_exec($ch);
- if (curl_errno($ch)) {
- tripPlanForm("Trip planner temporarily unavailable: " . curl_errno($ch) . " " . curl_error($ch) .(isDebug() ? $url : ""));
- trackEvent("Trip Planner","Trip Planner Failed", $url);
- }
- else {
- trackEvent("Trip Planner","Plan Trip From", $from);
- trackEvent("Trip Planner","Plan Trip To", $to);
- $tripplan = json_decode($page);
- debug(print_r($triplan, true));
- echo "<h1> From: {$tripplan->plan->from->name} To: {$tripplan->plan->to->name} </h1>";
- echo "<h1> At: ".formatTime($tripplan->plan->date)." </h1>";
- if (is_array($tripplan->plan->itineraries->itinerary)) {
- echo '<div data-role="collapsible-set">';
- foreach ($tripplan->plan->itineraries->itinerary as $itineraryNumber => $itinerary) {
- processItinerary($itineraryNumber, $itinerary);
- }
- echo "</div>";
- }
- else {
- processItinerary(0, $tripplan->plan->itineraries->itinerary);
- }
- }
- curl_close($ch);
- }
-}
-else {
- tripPlanForm();
+ echo "</div>";
+ } else {
+ processItinerary(0, $tripplan->plan->itineraries->itinerary);
+ }
+ }
+ curl_close($ch);
+ }
+} else {
+ $overrides = getServiceOverride();
+ if (isset($overrides['service_id'])) {
+ echo "Sorry, due to the modified timetable, this trip planner won't work correctly today. Instead, use the Google Maps one below:";
+ echo '
+<script language="javascript">
+ // make some ezamples
+ var startExample = "Gungahlin, ACT";
+ var endExample = "Bunda St, Canberra";
+ var zip = "2600";
+ var urlToGoTo = "http://www.google.com/maps?ie=UTF8&f=d&" ;
+
+ function buildURL(){
+ document.getElementById(\'linkOut\').href = urlToGoTo + "&saddr=" + document.getElementById(\'saddr\').value + "&daddr=" + document.getElementById(\'daddr\').value + "&dirflg=r";
+ }
+
+</script>
+
+<form action="https://www.action.act.gov.au/googletransit/redir_to_google.asp" method="post" name="GoogleTransit" target="_blank" id="GoogleTransit">
+ <table width="226" cellspacing="1" border="1">
+ <tr>
+ <td colspan="2" valign="middle"><a href="http://google.com/transit"><img src="/maps_logo_small_blue.png"width="150" height="55" border="0" alt="Link to Google Transit Trip Planner" align="middle"></a> <br />
+ <B>Transit Trip Planner</B></td>
+ </tr>
+ <tr>
+ <td colspan="2" nowrap><strong>Start</strong> (e.g.
+ <script language="javascript">document.write(startExample)</script>)<br />
+ <input type="text" size="27" name="saddr" id="saddr" maxlength="2048" title="Enter the Origin Address" value="" onFocus="this.value=\'\';" onBlur="if(this.value==\'\')this.value=startExample">
+ <br /><br /> <strong>End</strong> (e.g.
+ <script language="javascript">document.write(endExample)</script>)
+ <BR>
+ <input type="text" size="27" name="daddr" id="daddr" maxlength="2048" title="Enter the Destination Address" onfocus="this.value=\'\';" onBlur="if(this.value==\'\')this.value=endExample">
+ <br>
+ <table>
+ <tr>
+ <td><strong>Date</strong></td>
+ <td><strong>Time</strong></td>
+ </tr>
+ <tr>
+ <td nowrap=""><input type="text" title="Enter the Date in DD/MM/YY format" maxlength="10" value="" name="date" size="10" id="fdate"></td>
+ <td nowrap="nowrap"><input type="text" title="Enter the Time in HH:MM AM or PM format" maxlength="8" value="" name="time" size="5" id="ftime"></td>
+ </tr>
+ </table>
+Plan by:
+ <select name="ttype">
+ <option value="dep">Departure Time</option>
+ <option value="arr">Arrival Time</option>
+ </select>
+ <center>
+ <input name="Submit" type="submit" value="Get directions">
+ </center></td>
+ </tr>
+ </table>
+</form>
+
+<script language="javascript">
+
+// calculate the current time
+
+ var currentTime = new Date() ;
+ var hours = currentTime.getHours() ;
+ var minutes = currentTime.getMinutes() ;
+
+ var currentDay = currentTime.getDate() ;
+ var currentMonth = currentTime.getMonth() + 1 ;
+// var currentYear = currentTime.getYear() ; 07/10/2011 by Vlad
+ var currentYear = currentTime.getFullYear() ;
+
+// account for leading zero
+ if (minutes < 10)
+ minutes = "0" + minutes
+// 07/10/2011 by Vlad
+ if (hours < 10)
+ hours = "0" + hours
+ if (currentDay < 10)
+ currentDay = "0" + currentDay
+ if (currentMonth < 10)
+ currentMonth = "0" + currentMonth
+
+ var displayTime = hours + ":" + minutes ;
+
+// populate the current time
+ document.getElementById(\'ftime\').value = displayTime ;
+
+// populate the address examplates
+ document.getElementById(\'saddr\').value = startExample ;
+ document.getElementById(\'daddr\').value = endExample ;
+ document.getElementById(\'fdate\').value = currentDay + \'/\' + currentMonth + \'/\' + currentYear ;
+
+</script>
+';
+ } else {
+ tripPlanForm();
+ }
}
include_footer();
?>
--- /dev/null
+++ b/updatedb.php
@@ -1,1 +1,140 @@
+<?php
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
+if (php_sapi_name() == "cli") {
+ include ('include/common.inc.php');
+ $pdconn = new PDO("pgsql:dbname=transitdata;user=postgres;password=snmc;host=localhost");
+
+ /*
+ delete from agency;
+ delete from calendar;
+ delete from calendar_dates;
+ delete from routes;
+ delete from shapes;
+ delete from stop_times;
+ delete from stops;
+ delete from trips;
+ */
+
+// Unzip cbrfeed.zip, import all csv files to database
+ $unzip = false;
+ $zip = zip_open(dirname(__FILE__) . "/cbrfeed.zip");
+ $tmpdir = "c:/tmp/cbrfeed/";
+ mkdir($tmpdir);
+ if ($unzip) {
+ if (is_resource($zip)) {
+ while ($zip_entry = zip_read($zip)) {
+ $fp = fopen($tmpdir . zip_entry_name($zip_entry), "w");
+ if (zip_entry_open($zip, $zip_entry, "r")) {
+ echo "Extracting " . zip_entry_name($zip_entry) . "\n";
+ $buf = zip_entry_read($zip_entry, zip_entry_filesize($zip_entry));
+ fwrite($fp, "$buf");
+ zip_entry_close($zip_entry);
+ fclose($fp);
+ }
+ }
+ zip_close($zip);
+ }
+ }
+
+ foreach (scandir($tmpdir) as $file) {
+ $headers = Array();
+ if (!strpos($file, ".txt") === false) {
+ $fieldseparator = ",";
+ $lineseparator = "\n";
+ $tablename = str_replace(".txt", "", $file);
+ echo "Opening $file \n";
+ $line = 0;
+ $handle = fopen($tmpdir . $file, "r");
+
+ $distance = 0;
+ $lastshape = 0;
+ $lastlat = 0;
+ $lastlon = 0;
+ $stmt = null;
+ while (($data = fgetcsv($handle, 1000, ",")) !== FALSE) {
+ if ($line == 0) {
+ $headers = array_values($data);
+ if ($tablename == "stops") {
+ $headers[] = "position";
+ }
+ if ($tablename == "shapes") {
+ $headers[] = "shape_pt";
+ }
+ $query = "insert into $tablename (";
+ $valueCount = 0;
+ foreach ($headers as $value) {
+ $query.=($valueCount > 0 ? "," : "") . pg_escape_string($value);
+ $valueCount++;
+ }
+ $query.= ") values( ";
+ $valueCount = 0;
+ foreach ($data as $value) {
+ $query.=($valueCount > 0 ? "," : "") . '?';
+ $valueCount++;
+ }
+ if ($tablename == "stops") {
+ $query.= ", ST_GeographyFromText(?));";
+ } else if ($tablename == "shapes") {
+ $query.= ", ST_GeographyFromText(?));";
+ } else {
+ $query.= ");";
+ }
+
+ echo $query;
+ $stmt = $pdconn->prepare($query);
+ } else {
+ $values = array_values($data);
+ if ($tablename == "stops") {
+ // Coordinate values are out of range [-180 -90, 180 90]
+ $values[] = 'SRID=4326;POINT('.$values[5].' '.$values[4].')';
+ }
+ if ($tablename == "shapes") {
+ if ($data[0] != $lastshape) {
+ $distance = 0;
+ $lastshape = $data[0];
+ } else {
+ $distance += distance($lastlat, $lastlon, $data[1], $data[2]);
+ }
+ $lastlat = $data[1];
+ $lastlon = $data[2];
+
+ $values[4] = $distance;
+ $values[] = 'SRID=4326;POINT('.$values[2].' '.$values[1].')';
+ }
+if (substr($values[1],0,2) == '24') $values[1] = "23:59:59";
+if (substr($values[2],0,2) == '24') $values[2] = "23:59:59";
+ $stmt->execute($values);
+ $err = $pdconn->errorInfo();
+ if ($err[2] != "" && strpos($err[2], "duplicate key") === false) {
+ print_r($values);
+ print_r($err);
+ die("terminated import due to db error above");
+ }
+ }
+ $line++;
+ if ($line % 10000 == 0)
+ echo "$line records... " . date('c') . "\n";
+ }
+ fclose($handle);
+ $stmt->closeCursor();
+ echo "Found a total of $line records in $file.\n";
+ }
+ }
+}
+?>
+
--- a/view.sh
+++ /dev/null
@@ -1,6 +1,1 @@
- #!/bin/sh
- f=`dirname $0`
- cd $f
- python schedule_viewer.py --feed=/var/www/cbrfeed.zip \
---key=ABQIAAAA95XYXN0cki3Yj_Sb71CFvBTPaLd08ONybQDjcH_VdYtHHLgZvRTw2INzI_m17_IoOUqH3RNNmlTk1Q
