Sanitize timeliness data more
--- /dev/null
+++ b/about.php
@@ -1,1 +1,31 @@
+<?php
+include ('include/common.inc.php');
+include_header("About", "about")
+?>
+<p>
+Busness Time - An ACT bus timetable webapp<br />
+Based on the maxious-canberra-transit-feed (<a
+href="http://s3-ap-southeast-1.amazonaws.com/busresources/cbrfeed.zip">download</a>,
+last updated <?php
+echo date("F d Y.", @filemtime('cbrfeed.zip')); ?>)<br />
+Source code for the <a
+href="https://github.com/maxious/ACTBus-data">transit
+feed</a> and <a href="https://github.com/maxious/ACTBus-ui">this
+site</a> available from github.<br />
+Uses jQuery Mobile, PHP, PostgreSQL, OpenTripPlanner, OpenLayers, OpenStreetMap, Cloudmade Geocoder and Tile Service<br />
+<br />
+Feedback encouraged; contact maxious@lambdacomplex.org<br />
+ <br />
+Some icons by Joseph Wain / glyphish.com<br />
+<br />
+<small>Disclaimer: The content of this website is of a general and informative nature. Please check with printed timetables or those available on http://action.act.gov.au before your trip.
+Whilst every effort has been made to ensure the high quality and accuracy of the Site, the Author makes no warranty,
+express or implied concerning the topicality, correctness, completeness or quality of the information, which is provided
+"as is". The Author expressly disclaims all warranties, including but not limited to warranties of fitness for a particular purpose and warranties of merchantability.
+All offers are not binding and without obligation. The Author expressly reserves the right, in his discretion, to suspend,
+change, modify, add or remove portions of the Site and to restrict or terminate the use and accessibility of the Site
+without prior notice. </small>
+<?php
+include_footer();
+?>
--- /dev/null
+++ b/aws/awsStartup.sh
@@ -1,1 +1,42 @@
+#!/bin/bash
+#this script should be run from a fresh git checkout from github
+#ami base must have yum install lighttpd-fastcgi, git, tomcat6
+#php-cli php-gd tomcat6-webapps tomcat6-admin-webapps svn maven2
+#postgres postgres-server php-pg
+#http://www.how2forge.org/installing-lighttpd-with-php5-and-mysql-support-on-fedora-12
+cp /root/aws.php /tmp/
+mkdir /var/www/lib/staticmaplite/cache
+chcon -h system_u:object_r:httpd_sys_content_t /var/www
+chcon -R -h root:object_r:httpd_sys_content_t /var/www/*
+chcon -R -t httpd_sys_content_rw_t /var/www/lib/staticmaplite/cache
+chmod -R 777 /var/www/lib/staticmaplite/cache
+chcon -R -t httpd_sys_content_rw_t /var/www/labs/tiles
+chmod -R 777 /var/www/labs/tiles
+wget http://s3-ap-southeast-1.amazonaws.com/busresources/cbrfeed.zip \
+-O /var/www/cbrfeed.zip
+
+createdb transitdata
+createlang -d transitdata plpgsql
+psql -d transitdata -f /var/www/lib/postgis.sql
+# curl https://github.com/maxious/ACTBus-ui/raw/master/transitdata.cbrfeed.sql.gz -o transitdata.cbrfeed.sql.gz
+#made with pg_dump transitdata | gzip -c > transitdata.cbrfeed.sql.gz
+gunzip /var/www/transitdata.cbrfeed.sql.gz
+psql -d transitdata -f /var/www/transitdata.cbrfeed.sql
+#createuser transitdata -SDRP
+#password transitdata
+#psql -d transitdata -c \"GRANT SELECT ON TABLE agency,calendar,calendar_dates,routes,stop_times,stops,trips TO transitdata;\"
+#psql -d transitdata -c "GRANT SELECT,INSERT ON TABLE myway_observations,myway_routes,myway_stops,myway_timingdeltas TO transitdata;"
+#psql -d transitdata -c "GRANT SELECT,INSERT,UPDATE ON TABLE myway_routes,myway_stops TO transitdata;"
+##psql -d transitdata -c "GRANT SELECT ON ALL TABLES IN SCHEMA public TO transitdata;"
+php /var/www/updatedb.php
+
+wget http://s3-ap-southeast-1.amazonaws.com/busresources/Graph.obj \
+-O /tmp/Graph.obj
+rm -rfv /usr/share/tomcat6/webapps/opentripplanner*
+wget http://s3-ap-southeast-1.amazonaws.com/busresources/opentripplanner-webapp.war \
+-O /usr/share/tomcat6/webapps/opentripplanner-webapp.war
+wget http://s3-ap-southeast-1.amazonaws.com/busresources/opentripplanner-api-webapp.war \
+-O /usr/share/tomcat6/webapps/opentripplanner-api-webapp.war
+/etc/init.d/tomcat6 restart
+
--- /dev/null
+++ b/aws/compress.conf
@@ -1,1 +1,33 @@
+#######################################################################
+##
+## Output Compression
+## --------------------
+##
+## see http://www.lighttpd.net/documentation/compress.html
+##
+server.modules += ( "mod_compress" )
+##
+## where should the compressed files be cached?
+## see the base config for the declaration of the variable.
+##
+## This directory should be changed per vhost otherwise you can
+## run into trouble with overlapping filenames
+##
+compress.cache-dir = cache_dir + "/compress"
+
+##
+## FileTypes to compress.
+##
+#compress.filetype = ("text/plain", "text/html")
+compress.filetype = ("text/plain", "text/html", "text/javascript", "text/css", "text/xml")
+
+##
+## Maximum filesize that will be compressed.
+## Default is 0, which means unlimited file size.
+##
+#compress.max-filesize = 0
+
+##
+#######################################################################
+
--- /dev/null
+++ b/aws/expire.conf
@@ -1,1 +1,29 @@
+#######################################################################
+##
+## Expire Module
+## ---------------
+##
+## See http://www.lighttpd.net/documentation/expire.html
+##
+server.modules += ( "mod_expire" )
+##
+## assignes a expiration to all files below the specified path. The
+## specification of the time is made up of:
+##
+## <access|modification> <number> <years|months|days|hours|minutes|seconds>
+##
+#expire.url = (
+# "/buggy/" => "access 2 hours",
+# "/images/" => "access plus 1 seconds 2 minutes"
+#)
+etag.use-mtime = "enable"
+etag.use-inode = "disable"
+static-file.etags = "enable"
+$HTTP["url"] =~ "\.(css|js|png|jpg|ico|gif)$" {
+ expire.url = ( "" => "access 7 days" )
+}
+
+##
+#######################################################################
+
--- /dev/null
+++ b/aws/fastcgi.conf
@@ -1,1 +1,144 @@
+#######################################################################
+##
+## FastCGI Module
+## ---------------
+##
+## http://www.lighttpd.net/documentation/fastcgi.html
+##
+server.modules += ( "mod_fastcgi" )
+fastcgi.server = ( ".php" =>
+ ( "localhost" =>
+ (
+ "socket" =>
+"/var/run/lighttpd/php-fastcgi.socket",
+ "bin-path" => "/usr/bin/php-cgi"
+ )
+ )
+ )
+##
+## PHP Example
+## For PHP don't forget to set cgi.fix_pathinfo = 1 in the php.ini.
+##
+## The number of php processes you will get can be easily calculated:
+##
+## num-procs = max-procs * ( 1 + PHP_FCGI_CHILDREN )
+##
+## for the php-num-procs example it means you will get 17*5 = 85 php
+## processes. you always should need this high number for your very
+## busy sites. And if you have a lot of RAM. :)
+##
+#fastcgi.server = ( ".php" =>
+# ( "php-local" =>
+# (
+# "socket" => socket_dir + "/php-fastcgi-1.socket",
+# "bin-path" => server_root + "/php-cgi",
+# "max-procs" => 1,
+# "broken-scriptfilename" => "enable",
+# )
+# ),
+# ( "php-tcp" =>
+# (
+# "host" => "127.0.0.1",
+# "port" => 9999,
+# "check-local" => "disable",
+# "broken-scriptfilename" => "enable",
+# )
+# ),
+#
+# ( "php-num-procs" =>
+# (
+# "socket" => socket_dir + "/php-fastcgi-2.socket",
+# "bin-path" => server_root + "/php-cgi",
+# "bin-environment" => (
+# "PHP_FCGI_CHILDREN" => "16",
+# "PHP_FCGI_MAX_REQUESTS" => "10000",
+# ),
+# "max-procs" => 5,
+# "broken-scriptfilename" => "enable",
+# )
+# ),
+# )
+##
+## Ruby on Rails Example
+##
+## Normally you only run one Rails application on one vhost.
+##
+#$HTTP["host"] == "rails1.example.com" {
+# server.document-root = server_root + "/rails/someapp/public"
+# server.error-handler-404 = "/dispatch.fcgi"
+# fastcgi.server = ( ".fcgi" =>
+# ("someapp" =>
+# ( "socket" => socket_dir + "/someapp-fcgi.socket",
+# "bin-path" => server_root + "/rails/someapp/public/dispatch.fcgi",
+# "bin-environment" => (
+# "RAILS_ENV" => "production",
+# "TMP" => home_dir + "/rails/someapp",
+# ),
+# )
+# )
+# )
+#}
+
+##
+## Another example with multiple rails applications on one vhost.
+##
+## http://blog.lighttpd.net/articles/2005/11/23/lighttpd-1-4-8-and-multiple-rails-apps
+##
+#$HTTP["host"] == "rails2.example.com" {
+# $HTTP["url"] =~ "^/someapp1" {
+# server.document-root = server_root + "/rails/someapp1/public"
+# server.error-handler-404 = "/dispatch.fcgi"
+# fastcgi.server = ( ".fcgi" =>
+# ("someapp1" =>
+# ( "socket" => socket_dir + "/someapp1-fcgi.socket",
+# "bin-path" => server_root + "/rails/someapp1/public/dispatch.fcgi",
+# "bin-environment" => (
+# "RAILS_ENV" => "production",
+# "TMP" => home_dir + "/rails/someapp1",
+# ),
+# "strip-request-uri" => "/someapp1/"
+# )
+# )
+# )
+# }
+#
+# $HTTP["url"] =~ "^/someapp2" {
+# server.document-root = server_root + "/rails/someapp2/public"
+# server.error-handler-404 = "/dispatch.fcgi"
+# fastcgi.server = ( ".fcgi" =>
+# ("someapp2" =>
+# ( "socket" => socket_dir + "/someapp2-fcgi.socket",
+# "bin-path" => server_root + "/rails/someapp2/public/dispatch.fcgi",
+# "bin-environment" => (
+# "RAILS_ENV" => "production",
+# "TMP" => home_dir + "/rails/someapp2",
+# ),
+# "strip-request-uri" => "/someapp2/"
+# )
+# )
+# )
+# }
+#}
+
+## chrooted webserver + external PHP
+##
+## $ spawn-fcgi -f /usr/bin/php-cgi -p 2000 -a 127.0.0.1 -C 8
+##
+## webserver chrooted to /srv/www/
+## php running outside the chroot
+#
+#fastcgi.server = (
+# ".php" => ((
+# "host" => "127.0.0.1",
+# "port" => "2000",
+# "docroot" => "/srv/www/servers/www.example.org/htdocs/"
+# )))
+#
+#server.chroot = "/srv/www"
+#server.document-root = "/servers/wwww.example.org/htdocs/"
+#
+
+##
+#######################################################################
+
--- /dev/null
+++ b/aws/modules.conf
@@ -1,1 +1,173 @@
+#######################################################################
+##
+## Modules to load
+## -----------------
+##
+## at least mod_access and mod_accesslog should be loaded
+## all other module should only be loaded if really neccesary
+##
+## - saves some time
+## - saves memory
+##
+## the default module set contains:
+##
+## "mod_indexfile", "mod_dirlisting", "mod_staticfile"
+##
+## you dont have to include those modules in your list
+##
+## Modules, which are pulled in via conf.d/*.conf
+##
+## NOTE: the order of modules is important.
+##
+## - mod_accesslog -> conf.d/access_log.conf
+## - mod_compress -> conf.d/compress.conf
+## - mod_status -> conf.d/status.conf
+## - mod_webdav -> conf.d/webdav.conf
+## - mod_cml -> conf.d/cml.conf
+## - mod_evhost -> conf.d/evhost.conf
+## - mod_simple_vhost -> conf.d/simple_vhost.conf
+## - mod_mysql_vhost -> conf.d/mysql_vhost.conf
+## - mod_trigger_b4_dl -> conf.d/trigger_b4_dl.conf
+## - mod_userdir -> conf.d/userdir.conf
+## - mod_rrdtool -> conf.d/rrdtool.conf
+## - mod_ssi -> conf.d/ssi.conf
+## - mod_cgi -> conf.d/cgi.conf
+## - mod_scgi -> conf.d/scgi.conf
+## - mod_fastcgi -> conf.d/fastcgi.conf
+## - mod_proxy -> conf.d/proxy.conf
+## - mod_secdownload -> conf.d/secdownload.conf
+## - mod_expire -> conf.d/expire.conf
+##
+server.modules = (
+ "mod_access",
+# "mod_alias",
+# "mod_auth",
+# "mod_evasive",
+# "mod_redirect",
+# "mod_rewrite",
+# "mod_setenv",
+# "mod_usertrack",
+)
+
+##
+#######################################################################
+
+#######################################################################
+##
+## Config for various Modules
+##
+
+##
+## mod_ssi
+##
+#include "conf.d/ssi.conf"
+
+##
+## mod_status
+##
+#include "conf.d/status.conf"
+
+##
+## mod_webdav
+##
+#include "conf.d/webdav.conf"
+
+##
+## mod_compress
+##
+include "conf.d/compress.conf"
+
+##
+## mod_userdir
+##
+#include "conf.d/userdir.conf"
+
+##
+## mod_magnet
+##
+#include "conf.d/magnet.conf"
+
+##
+## mod_cml
+##
+#include "conf.d/cml.conf"
+
+##
+## mod_rrdtool
+##
+#include "conf.d/rrdtool.conf"
+
+##
+## mod_proxy
+##
+#include "conf.d/proxy.conf"
+
+##
+## mod_expire
+##
+include "conf.d/expire.conf"
+
+##
+## mod_secdownload
+##
+#include "conf.d/secdownload.conf"
+
+##
+#######################################################################
+
+#######################################################################
+##
+## CGI modules
+##
+
+##
+## SCGI (mod_scgi)
+##
+#include "conf.d/scgi.conf"
+
+##
+## FastCGI (mod_fastcgi)
+##
+include "conf.d/fastcgi.conf"
+
+##
+## plain old CGI (mod_cgi)
+##
+#include "conf.d/cgi.conf"
+
+##
+#######################################################################
+
+#######################################################################
+##
+## VHost Modules
+##
+## Only load ONE of them!
+## ========================
+##
+
+##
+## You can use conditionals for vhosts aswell.
+##
+## see http://www.lighttpd.net/documentation/configuration.html
+##
+
+##
+## mod_evhost
+##
+#include "conf.d/evhost.conf"
+
+##
+## mod_simple_vhost
+##
+#include "conf.d/simple_vhost.conf"
+
+##
+## mod_mysql_vhost
+##
+#include "conf.d/mysql_vhost.conf"
+
+##
+#######################################################################
+
--- /dev/null
+++ b/aws/pg_hba.conf
@@ -1,1 +1,77 @@
+# PostgreSQL Client Authentication Configuration File
+# ===================================================
+#
+# Refer to the "Client Authentication" section in the
+# PostgreSQL documentation for a complete description
+# of this file. A short synopsis follows.
+#
+# This file controls: which hosts are allowed to connect, how clients
+# are authenticated, which PostgreSQL user names they can use, which
+# databases they can access. Records take one of these forms:
+#
+# local DATABASE USER METHOD [OPTIONS]
+# host DATABASE USER CIDR-ADDRESS METHOD [OPTIONS]
+# hostssl DATABASE USER CIDR-ADDRESS METHOD [OPTIONS]
+# hostnossl DATABASE USER CIDR-ADDRESS METHOD [OPTIONS]
+#
+# (The uppercase items must be replaced by actual values.)
+#
+# The first field is the connection type: "local" is a Unix-domain socket,
+# "host" is either a plain or SSL-encrypted TCP/IP socket, "hostssl" is an
+# SSL-encrypted TCP/IP socket, and "hostnossl" is a plain TCP/IP socket.
+#
+# DATABASE can be "all", "sameuser", "samerole", a database name, or
+# a comma-separated list thereof.
+#
+# USER can be "all", a user name, a group name prefixed with "+", or
+# a comma-separated list thereof. In both the DATABASE and USER fields
+# you can also write a file name prefixed with "@" to include names from
+# a separate file.
+#
+# CIDR-ADDRESS specifies the set of hosts the record matches.
+# It is made up of an IP address and a CIDR mask that is an integer
+# (between 0 and 32 (IPv4) or 128 (IPv6) inclusive) that specifies
+# the number of significant bits in the mask. Alternatively, you can write
+# an IP address and netmask in separate columns to specify the set of hosts.
+#
+# METHOD can be "trust", "reject", "md5", "password", "gss", "sspi", "krb5",
+# "ident", "pam", "ldap" or "cert". Note that "password" sends passwords
+# in clear text; "md5" is preferred since it sends encrypted passwords.
+#
+# OPTIONS are a set of options for the authentication in the format
+# NAME=VALUE. The available options depend on the different authentication
+# methods - refer to the "Client Authentication" section in the documentation
+# for a list of which options are available for which authentication methods.
+#
+# Database and user names containing spaces, commas, quotes and other special
+# characters must be quoted. Quoting one of the keywords "all", "sameuser" or
+# "samerole" makes the name lose its special character, and just match a
+# database or username with that name.
+#
+# This file is read on server startup and when the postmaster receives
+# a SIGHUP signal. If you edit the file on a running system, you have
+# to SIGHUP the postmaster for the changes to take effect. You can use
+# "pg_ctl reload" to do that.
+# Put your actual configuration here
+# ----------------------------------
+#
+# If you want to allow non-local connections, you need to add more
+# "host" records. In that case you will also need to make PostgreSQL listen
+# on a non-local interface via the listen_addresses configuration parameter,
+# or via the -i or -h command line switches.
+#
+
+
+
+# TYPE DATABASE USER CIDR-ADDRESS METHOD
+
+# "local" is for Unix domain socket connections only
+local all all trust
+# IPv4 local connections:
+host all all 127.0.0.1/32 trust
+# IPv6 local connections:
+host all all ::1/128 trust
+#Allow any IP to connect, with a password:
+host all all 0.0.0.0 0.0.0.0 md5
+
--- /dev/null
+++ b/aws/php.ini
@@ -1,1 +1,1662 @@
-
+[PHP]
+
+date.timezone = "Australia/Sydney"
+
+;;;;;;;;;;;;;;;;;;;
+; About php.ini ;
+;;;;;;;;;;;;;;;;;;;
+; PHP's initialization file, generally called php.ini, is responsible for
+; configuring many of the aspects of PHP's behavior.
+
+; PHP attempts to find and load this configuration from a number of locations.
+; The following is a summary of its search order:
+; 1. SAPI module specific location.
+; 2. The PHPRC environment variable. (As of PHP 5.2.0)
+; 3. A number of predefined registry keys on Windows (As of PHP 5.2.0)
+; 4. Current working directory (except CLI)
+; 5. The web server's directory (for SAPI modules), or directory of PHP
+; (otherwise in Windows)
+; 6. The directory from the --with-config-file-path compile time option, or the
+; Windows directory (C:\windows or C:\winnt)
+; See the PHP docs for more specific information.
+; http://www.php.net/manual/en/configuration.file.php
+
+; The syntax of the file is extremely simple. Whitespace and Lines
+; beginning with a semicolon are silently ignored (as you probably guessed).
+; Section headers (e.g. [Foo]) are also silently ignored, even though
+; they might mean something in the future.
+
+; Directives following the section heading [PATH=/www/mysite] only
+; apply to PHP files in the /www/mysite directory. Directives
+; following the section heading [HOST=www.example.com] only apply to
+; PHP files served from www.example.com. Directives set in these
+; special sections cannot be overridden by user-defined INI files or
+; at runtime. Currently, [PATH=] and [HOST=] sections only work under
+; CGI/FastCGI.
+; http://www.php.net/manual/en/ini.sections.php
+
+; Directives are specified using the following syntax:
+; directive = value
+; Directive names are *case sensitive* - foo=bar is different from FOO=bar.
+; Directives are variables used to configure PHP or PHP extensions.
+; There is no name validation. If PHP can't find an expected
+; directive because it is not set or is mistyped, a default value will be used.
+
+; The value can be a string, a number, a PHP constant (e.g. E_ALL or M_PI), one
+; of the INI constants (On, Off, True, False, Yes, No and None) or an expression
+; (e.g. E_ALL & ~E_NOTICE), a quoted string ("bar"), or a reference to a
+; previously set variable or directive (e.g. ${foo})
+
+; Expressions in the INI file are limited to bitwise operators and parentheses:
+; | bitwise OR
+; ^ bitwise XOR
+; & bitwise AND
+; ~ bitwise NOT
+; ! boolean NOT
+
+; Boolean flags can be turned on using the values 1, On, True or Yes.
+; They can be turned off using the values 0, Off, False or No.
+
+; An empty string can be denoted by simply not writing anything after the equal
+; sign, or by using the None keyword:
+
+; foo = ; sets foo to an empty string
+; foo = None ; sets foo to an empty string
+; foo = "None" ; sets foo to the string 'None'
+
+; If you use constants in your value, and these constants belong to a
+; dynamically loaded extension (either a PHP extension or a Zend extension),
+; you may only use these constants *after* the line that loads the extension.
+
+;;;;;;;;;;;;;;;;;;;
+; About this file ;
+;;;;;;;;;;;;;;;;;;;
+; PHP comes packaged with two INI files. One that is recommended to be used
+; in production environments and one that is recommended to be used in
+; development environments.
+
+; php.ini-production contains settings which hold security, performance and
+; best practices at its core. But please be aware, these settings may break
+; compatibility with older or less security conscience applications. We
+; recommending using the production ini in production and testing environments.
+
+; php.ini-development is very similar to its production variant, except it's
+; much more verbose when it comes to errors. We recommending using the
+; development version only in development environments as errors shown to
+; application users can inadvertently leak otherwise secure information.
+
+; This 2 files are provided, by RPM, in /usr/share/doc/php-common-*/
+; File used by RPM (the /etc/php.ini) is mainly the php.ini-production
+
+;;;;;;;;;;;;;;;;;;;
+; Quick Reference ;
+;;;;;;;;;;;;;;;;;;;
+; The following are all the settings which are different in either the production
+; or development versions of the INIs with respect to PHP's default behavior.
+; Please see the actual settings later in the document for more details as to why
+; we recommend these changes in PHP's behavior.
+
+; allow_call_time_pass_reference
+; Default Value: On
+; Development Value: Off
+; Production Value: Off
+
+; display_errors
+; Default Value: On
+; Development Value: On
+; Production Value: Off
+
+; display_startup_errors
+; Default Value: Off
+; Development Value: On
+; Production Value: Off
+
+; error_reporting
+; Default Value: E_ALL & ~E_NOTICE
+; Development Value: E_ALL | E_STRICT
+; Production Value: E_ALL & ~E_DEPRECATED
+
+; html_errors
+; Default Value: On
+; Development Value: On
+; Production value: Off
+
+; log_errors
+; Default Value: Off
+; Development Value: On
+; Production Value: On
+
+; magic_quotes_gpc
+; Default Value: On
+; Development Value: Off
+; Production Value: Off
+
+; max_input_time
+; Default Value: -1 (Unlimited)
+; Development Value: 60 (60 seconds)
+; Production Value: 60 (60 seconds)
+
+; output_buffering
+; Default Value: Off
+; Development Value: 4096
+; Production Value: 4096
+
+; register_argc_argv
+; Default Value: On
+; Development Value: Off
+; Production Value: Off
+
+; register_long_arrays
+; Default Value: On
+; Development Value: Off
+; Production Value: Off
+
+; request_order
+; Default Value: None
+; Development Value: "GP"
+; Production Value: "GP"
+
+; session.bug_compat_42
+; Default Value: On
+; Development Value: On
+; Production Value: Off
+
+; session.bug_compat_warn
+; Default Value: On
+; Development Value: On
+; Production Value: Off
+
+; session.gc_divisor
+; Default Value: 100
+; Development Value: 1000
+; Production Value: 1000
+
+; session.hash_bits_per_character
+; Default Value: 4
+; Development Value: 5
+; Production Value: 5
+
+; short_open_tag
+; Default Value: On
+; Development Value: Off
+; Production Value: Off
+
+; track_errors
+; Default Value: Off
+; Development Value: On
+; Production Value: Off
+
+; url_rewriter.tags
+; Default Value: "a=href,area=href,frame=src,form=,fieldset="
+; Development Value: "a=href,area=href,frame=src,input=src,form=fakeentry"
+; Production Value: "a=href,area=href,frame=src,input=src,form=fakeentry"
+
+; variables_order
+; Default Value: "EGPCS"
+; Development Value: "GPCS"
+; Production Value: "GPCS"
+
+;;;;;;;;;;;;;;;;;;;;
+; php.ini Options ;
+;;;;;;;;;;;;;;;;;;;;
+; Name for user-defined php.ini (.htaccess) files. Default is ".user.ini"
+;user_ini.filename = ".user.ini"
+
+; To disable this feature set this option to empty value
+;user_ini.filename =
+
+; TTL for user-defined php.ini files (time-to-live) in seconds. Default is 300 seconds (5 minutes)
+;user_ini.cache_ttl = 300
+
+;;;;;;;;;;;;;;;;;;;;
+; Language Options ;
+;;;;;;;;;;;;;;;;;;;;
+
+; Enable the PHP scripting language engine under Apache.
+; http://www.php.net/manual/en/apache.configuration.php#ini.engine
+engine = On
+
+; This directive determines whether or not PHP will recognize code between
+; <? and ?> tags as PHP source which should be processed as such. It's been
+; recommended for several years that you not use the short tag "short cut" and
+; instead to use the full <?php and ?> tag combination. With the wide spread use
+; of XML and use of these tags by other languages, the server can become easily
+; confused and end up parsing the wrong code in the wrong context. But because
+; this short cut has been a feature for such a long time, it's currently still
+; supported for backwards compatibility, but we recommend you don't use them.
+; Default Value: On
+; Development Value: Off
+; Production Value: Off
+; http://www.php.net/manual/en/ini.core.php#ini.short-open-tag
+short_open_tag = Off
+
+; Allow ASP-style <% %> tags.
+; http://www.php.net/manual/en/ini.core.php#ini.asp-tags
+asp_tags = Off
+
+; The number of significant digits displayed in floating point numbers.
+; http://www.php.net/manual/en/ini.core.php#ini.precision
+precision = 14
+
+; Enforce year 2000 compliance (will cause problems with non-compliant browsers)
+; http://www.php.net/manual/en/ini.core.php#ini.y2k-compliance
+y2k_compliance = On
+
+; Output buffering is a mechanism for controlling how much output data
+; (excluding headers and cookies) PHP should keep internally before pushing that
+; data to the client. If your application's output exceeds this setting, PHP
+; will send that data in chunks of roughly the size you specify.
+; Turning on this setting and managing its maximum buffer size can yield some
+; interesting side-effects depending on your application and web server.
+; You may be able to send headers and cookies after you've already sent output
+; through print or echo. You also may see performance benefits if your server is
+; emitting less packets due to buffered output versus PHP streaming the output
+; as it gets it. On production servers, 4096 bytes is a good setting for performance
+; reasons.
+; Note: Output buffering can also be controlled via Output Buffering Control
+; functions.
+; Possible Values:
+; On = Enabled and buffer is unlimited. (Use with caution)
+; Off = Disabled
+; Integer = Enables the buffer and sets its maximum size in bytes.
+; Default Value: Off
+; Development Value: 4096
+; Production Value: 4096
+; http://www.php.net/manual/en/outcontrol.configuration.php#ini.output-buffering
+output_buffering = 4096
+
+; You can redirect all of the output of your scripts to a function. For
+; example, if you set output_handler to "mb_output_handler", character
+; encoding will be transparently converted to the specified encoding.
+; Setting any output handler automatically turns on output buffering.
+; Note: People who wrote portable scripts should not depend on this ini
+; directive. Instead, explicitly set the output handler using ob_start().
+; Using this ini directive may cause problems unless you know what script
+; is doing.
+; Note: You cannot use both "mb_output_handler" with "ob_iconv_handler"
+; and you cannot use both "ob_gzhandler" and "zlib.output_compression".
+; Note: output_handler must be empty if this is set 'On' !!!!
+; Instead you must use zlib.output_handler.
+; http://www.php.net/manual/en/outcontrol.configuration.php#ini.output-handler
+;output_handler =
+
+; Transparent output compression using the zlib library
+; Valid values for this option are 'off', 'on', or a specific buffer size
+; to be used for compression (default is 4KB)
+; Note: Resulting chunk size may vary due to nature of compression. PHP
+; outputs chunks that are few hundreds bytes each as a result of
+; compression. If you prefer a larger chunk size for better
+; performance, enable output_buffering in addition.
+; Note: You need to use zlib.output_handler instead of the standard
+; output_handler, or otherwise the output will be corrupted.
+; http://www.php.net/manual/en/zlib.configuration.php#ini.zlib.output-compression
+zlib.output_compression = on
+
+; http://www.php.net/manual/en/zlib.configuration.php#ini.zlib.output-compression-level
+;zlib.output_compression_level = -1
+
+; You cannot specify additional output handlers if zlib.output_compression
+; is activated here. This setting does the same as output_handler but in
+; a different order.
+; http://www.php.net/manual/en/zlib.configuration.php#ini.zlib.output-handler
+;zlib.output_handler =
+
+; Implicit flush tells PHP to tell the output layer to flush itself
+; automatically after every output block. This is equivalent to calling the
+; PHP function flush() after each and every call to print() or echo() and each
+; and every HTML block. Turning this option on has serious performance
+; implications and is generally recommended for debugging purposes only.
+; http://www.php.net/manual/en/outcontrol.configuration.php#ini.implicit-flush
+implicit_flush = Off
+
+; The unserialize callback function will be called (with the undefined class'
+; name as parameter), if the unserializer finds an undefined class
+; which should be instantiated. A warning appears if the specified function is
+; not defined, or if the function doesn't include/implement the missing class.
+; So only set this entry, if you really want to implement such a
+; callback-function.
+unserialize_callback_func =
+
+; When floats & doubles are serialized store serialize_precision significant
+; digits after the floating point. The default value ensures that when floats
+; are decoded with unserialize, the data will remain the same.
+serialize_precision = 100
+
+; This directive allows you to enable and disable warnings which PHP will issue
+; if you pass a value by reference at function call time. Passing values by
+; reference at function call time is a deprecated feature which will be removed
+; from PHP at some point in the near future. The acceptable method for passing a
+; value by reference to a function is by declaring the reference in the functions
+; definition, not at call time. This directive does not disable this feature, it
+; only determines whether PHP will warn you about it or not. These warnings
+; should enabled in development environments only.
+; Default Value: On (Suppress warnings)
+; Development Value: Off (Issue warnings)
+; Production Value: Off (Issue warnings)
+; http://www.php.net/manual/en/ini.core.php#ini.allow-call-time-pass-reference
+allow_call_time_pass_reference = Off
+
+; Safe Mode
+; http://www.php.net/manual/en/ini.sect.safe-mode.php#ini.safe-mode
+safe_mode = Off
+
+; By default, Safe Mode does a UID compare check when
+; opening files. If you want to relax this to a GID compare,
+; then turn on safe_mode_gid.
+; http://www.php.net/manual/en/ini.sect.safe-mode.php#ini.safe-mode-gid
+safe_mode_gid = Off
+
+; When safe_mode is on, UID/GID checks are bypassed when
+; including files from this directory and its subdirectories.
+; (directory must also be in include_path or full path must
+; be used when including)
+; http://www.php.net/manual/en/ini.sect.safe-mode.php#ini.safe-mode-include-dir
+safe_mode_include_dir =
+
+; When safe_mode is on, only executables located in the safe_mode_exec_dir
+; will be allowed to be executed via the exec family of functions.
+; http://www.php.net/manual/en/ini.sect.safe-mode.php#ini.safe-mode-exec-dir
+safe_mode_exec_dir =
+
+; Setting certain environment variables may be a potential security breach.
+; This directive contains a comma-delimited list of prefixes. In Safe Mode,
+; the user may only alter environment variables whose names begin with the
+; prefixes supplied here. By default, users will only be able to set
+; environment variables that begin with PHP_ (e.g. PHP_FOO=BAR).
+; Note: If this directive is empty, PHP will let the user modify ANY
+; environment variable!
+; http://www.php.net/manual/en/ini.sect.safe-mode.php#ini.safe-mode-allowed-env-vars
+safe_mode_allowed_env_vars = PHP_
+
+; This directive contains a comma-delimited list of environment variables that
+; the end user won't be able to change using putenv(). These variables will be
+; protected even if safe_mode_allowed_env_vars is set to allow to change them.
+; http://www.php.net/manual/en/ini.sect.safe-mode.php#ini.safe-mode-protected-env-vars
+safe_mode_protected_env_vars = LD_LIBRARY_PATH
+
+; open_basedir, if set, limits all file operations to the defined directory
+; and below. This directive makes most sense if used in a per-directory
+; or per-virtualhost web server configuration file. This directive is
+; *NOT* affected by whether Safe Mode is turned On or Off.
+; http://www.php.net/manual/en/ini.sect.safe-mode.php#ini.open-basedir
+;open_basedir =
+
+; This directive allows you to disable certain functions for security reasons.
+; It receives a comma-delimited list of function names. This directive is
+; *NOT* affected by whether Safe Mode is turned On or Off.
+; http://www.php.net/manual/en/ini.sect.safe-mode.php#ini.disable-functions
+disable_functions =
+
+; This directive allows you to disable certain classes for security reasons.
+; It receives a comma-delimited list of class names. This directive is
+; *NOT* affected by whether Safe Mode is turned On or Off.
+; http://www.php.net/manual/en/ini.sect.safe-mode.php#ini.disable-classes
+disable_classes =
+
+; Colors for Syntax Highlighting mode. Anything that's acceptable in
+; <span style="color: ???????"> would work.
+; http://www.php.net/manual/en/misc.configuration.php#ini.syntax-highlighting
+;highlight.string = #DD0000
+;highlight.comment = #FF9900
+;highlight.keyword = #007700
+;highlight.bg = #FFFFFF
+;highlight.default = #0000BB
+;highlight.html = #000000
+
+; If enabled, the request will be allowed to complete even if the user aborts
+; the request. Consider enabling it if executing long requests, which may end up
+; being interrupted by the user or a browser timing out. PHP's default behavior
+; is to disable this feature.
+; http://www.php.net/manual/en/misc.configuration.php#ini.ignore-user-abort
+;ignore_user_abort = On
+
+; Determines the size of the realpath cache to be used by PHP. This value should
+; be increased on systems where PHP opens many files to reflect the quantity of
+; the file operations performed.
+; http://www.php.net/manual/en/ini.core.php#ini.realpath-cache-size
+;realpath_cache_size = 16k
+
+; Duration of time, in seconds for which to cache realpath information for a given
+; file or directory. For systems with rarely changing files, consider increasing this
+; value.
+; http://www.php.net/manual/en/ini.core.php#ini.realpath-cache-ttl
+;realpath_cache_ttl = 120
+
+;;;;;;;;;;;;;;;;;
+; Miscellaneous ;
+;;;;;;;;;;;;;;;;;
+
+; Decides whether PHP may expose the fact that it is installed on the server
+; (e.g. by adding its signature to the Web server header). It is no security
+; threat in any way, but it makes it possible to determine whether you use PHP
+; on your server or not.
+; http://www.php.net/manual/en/ini.core.php#ini.expose-php
+expose_php = On
+
+;;;;;;;;;;;;;;;;;;;
+; Resource Limits ;
+;;;;;;;;;;;;;;;;;;;
+
+; Maximum execution time of each script, in seconds
+; http://www.php.net/manual/en/info.configuration.php#ini.max-execution-time
+max_execution_time = 30
+
+; Maximum amount of time each script may spend parsing request data. It's a good
+; idea to limit this time on productions servers in order to eliminate unexpectedly
+; long running scripts.
+; Default Value: -1 (Unlimited)
+; Development Value: 60 (60 seconds)
+; Production Value: 60 (60 seconds)
+; http://www.php.net/manual/en/info.configuration.php#ini.max-input-time
+max_input_time = 60
+
+; Maximum input variable nesting level
+; http://www.php.net/manual/en/info.configuration.php#ini.max-input-nesting-level
+;max_input_nesting_level = 64
+
+; Maximum amount of memory a script may consume (128MB)
+; http://www.php.net/manual/en/ini.core.php#ini.memory-limit
+memory_limit = 128M
+
+;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;
+; Error handling and logging ;
+;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;
+
+; This directive informs PHP of which errors, warnings and notices you would like
+; it to take action for. The recommended way of setting values for this
+; directive is through the use of the error level constants and bitwise
+; operators. The error level constants are below here for convenience as well as
+; some common settings and their meanings.
+; By default, PHP is set to take action on all errors, notices and warnings EXCEPT
+; those related to E_NOTICE and E_STRICT, which together cover best practices and
+; recommended coding standards in PHP. For performance reasons, this is the
+; recommend error reporting setting. Your production server shouldn't be wasting
+; resources complaining about best practices and coding standards. That's what
+; development servers and development settings are for.
+; Note: The php.ini-development file has this setting as E_ALL | E_STRICT. This
+; means it pretty much reports everything which is exactly what you want during
+; development and early testing.
+;
+; Error Level Constants:
+; E_ALL - All errors and warnings (includes E_STRICT as of PHP 6.0.0)
+; E_ERROR - fatal run-time errors
+; E_RECOVERABLE_ERROR - almost fatal run-time errors
+; E_WARNING - run-time warnings (non-fatal errors)
+; E_PARSE - compile-time parse errors
+; E_NOTICE - run-time notices (these are warnings which often result
+; from a bug in your code, but it's possible that it was
+; intentional (e.g., using an uninitialized variable and
+; relying on the fact it's automatically initialized to an
+; empty string)
+; E_STRICT - run-time notices, enable to have PHP suggest changes
+; to your code which will ensure the best interoperability
+; and forward compatibility of your code
+; E_CORE_ERROR - fatal errors that occur during PHP's initial startup
+; E_CORE_WARNING - warnings (non-fatal errors) that occur during PHP's
+; initial startup
+; E_COMPILE_ERROR - fatal compile-time errors
+; E_COMPILE_WARNING - compile-time warnings (non-fatal errors)
+; E_USER_ERROR - user-generated error message
+; E_USER_WARNING - user-generated warning message
+; E_USER_NOTICE - user-generated notice message
+; E_DEPRECATED - warn about code that will not work in future versions
+; of PHP
+; E_USER_DEPRECATED - user-generated deprecation warnings
+;
+; Common Values:
+; E_ALL & ~E_NOTICE (Show all errors, except for notices and coding standards warnings.)
+; E_ALL & ~E_NOTICE | E_STRICT (Show all errors, except for notices)
+; E_COMPILE_ERROR|E_RECOVERABLE_ERROR|E_ERROR|E_CORE_ERROR (Show only errors)
+; E_ALL | E_STRICT (Show all errors, warnings and notices including coding standards.)
+; Default Value: E_ALL & ~E_NOTICE
+; Development Value: E_ALL | E_STRICT
+; Production Value: E_ALL & ~E_DEPRECATED
+; http://www.php.net/manual/en/errorfunc.configuration.php#ini.error-reporting
+error_reporting = E_ALL & ~E_DEPRECATED
+
+; This directive controls whether or not and where PHP will output errors,
+; notices and warnings too. Error output is very useful during development, but
+; it could be very dangerous in production environments. Depending on the code
+; which is triggering the error, sensitive information could potentially leak
+; out of your application such as database usernames and passwords or worse.
+; It's recommended that errors be logged on production servers rather than
+; having the errors sent to STDOUT.
+; Possible Values:
+; Off = Do not display any errors
+; stderr = Display errors to STDERR (affects only CGI/CLI binaries!)
+; On or stdout = Display errors to STDOUT
+; Default Value: On
+; Development Value: On
+; Production Value: Off
+; http://www.php.net/manual/en/errorfunc.configuration.php#ini.display-errors
+display_errors = Off
+
+; The display of errors which occur during PHP's startup sequence are handled
+; separately from display_errors. PHP's default behavior is to suppress those
+; errors from clients. Turning the display of startup errors on can be useful in
+; debugging configuration problems. But, it's strongly recommended that you
+; leave this setting off on production servers.
+; Default Value: Off
+; Development Value: On
+; Production Value: Off
+; http://www.php.net/manual/en/errorfunc.configuration.php#ini.display-startup-errors
+display_startup_errors = Off
+
+; Besides displaying errors, PHP can also log errors to locations such as a
+; server-specific log, STDERR, or a location specified by the error_log
+; directive found below. While errors should not be displayed on productions
+; servers they should still be monitored and logging is a great way to do that.
+; Default Value: Off
+; Development Value: On
+; Production Value: On
+; http://www.php.net/manual/en/errorfunc.configuration.php#ini.log-errors
+log_errors = On
+
+; Set maximum length of log_errors. In error_log information about the source is
+; added. The default is 1024 and 0 allows to not apply any maximum length at all.
+; http://www.php.net/manual/en/errorfunc.configuration.php#ini.log-errors-max-len
+log_errors_max_len = 1024
+
+; Do not log repeated messages. Repeated errors must occur in same file on same
+; line unless ignore_repeated_source is set true.
+; http://www.php.net/manual/en/errorfunc.configuration.php#ini.ignore-repeated-errors
+ignore_repeated_errors = Off
+
+; Ignore source of message when ignoring repeated messages. When this setting
+; is On you will not log errors with repeated messages from different files or
+; source lines.
+; http://www.php.net/manual/en/errorfunc.configuration.php#ini.ignore-repeated-source
+ignore_repeated_source = Off
+
+; If this parameter is set to Off, then memory leaks will not be shown (on
+; stdout or in the log). This has only effect in a debug compile, and if
+; error reporting includes E_WARNING in the allowed list
+; http://www.php.net/manual/en/errorfunc.configuration.php#ini.report-memleaks
+report_memleaks = On
+
+; This setting is on by default.
+;report_zend_debug = 0
+
+; Store the last error/warning message in $php_errormsg (boolean). Setting this value
+; to On can assist in debugging and is appropriate for development servers. It should
+; however be disabled on production servers.
+; Default Value: Off
+; Development Value: On
+; Production Value: Off
+; http://www.php.net/manual/en/errorfunc.configuration.php#ini.track-errors
+track_errors = Off
+
+; Turn off normal error reporting and emit XML-RPC error XML
+; http://www.php.net/manual/en/errorfunc.configuration.php#ini.xmlrpc-errors
+;xmlrpc_errors = 0
+
+; An XML-RPC faultCode
+;xmlrpc_error_number = 0
+
+; When PHP displays or logs an error, it has the capability of inserting html
+; links to documentation related to that error. This directive controls whether
+; those HTML links appear in error messages or not. For performance and security
+; reasons, it's recommended you disable this on production servers.
+; Default Value: On
+; Development Value: On
+; Production value: Off
+; http://www.php.net/manual/en/errorfunc.configuration.php#ini.html-errors
+html_errors = Off
+
+; If html_errors is set On PHP produces clickable error messages that direct
+; to a page describing the error or function causing the error in detail.
+; You can download a copy of the PHP manual from http://www.php.net/docs.php
+; and change docref_root to the base URL of your local copy including the
+; leading '/'. You must also specify the file extension being used including
+; the dot. PHP's default behavior is to leave these settings empty.
+; Note: Never use this feature for production boxes.
+; http://www.php.net/manual/en/errorfunc.configuration.php#ini.docref-root
+; Examples
+;docref_root = "/phpmanual/"
+
+; http://www.php.net/manual/en/errorfunc.configuration.php#ini.docref-ext
+;docref_ext = .html
+
+; String to output before an error message. PHP's default behavior is to leave
+; this setting blank.
+; http://www.php.net/manual/en/errorfunc.configuration.php#ini.error-prepend-string
+; Example:
+;error_prepend_string = "<font color=#ff0000>"
+
+; String to output after an error message. PHP's default behavior is to leave
+; this setting blank.
+; http://www.php.net/manual/en/errorfunc.configuration.php#ini.error-append-string
+; Example:
+;error_append_string = "</font>"
+
+; Log errors to specified file. PHP's default behavior is to leave this value
+; empty.
+; http://www.php.net/manual/en/errorfunc.configuration.php#ini.error-log
+; Example:
+;error_log = php_errors.log
+; Log errors to syslog (Event Log on NT, not valid in Windows 95).
+;error_log = syslog
+
+;;;;;;;;;;;;;;;;;
+; Data Handling ;
+;;;;;;;;;;;;;;;;;
+
+; Note - track_vars is ALWAYS enabled as of PHP 4.0.3
+
+; The separator used in PHP generated URLs to separate arguments.
+; PHP's default setting is "&".
+; http://www.php.net/manual/en/ini.core.php#ini.arg-separator.output
+; Example:
+;arg_separator.output = "&"
+
+; List of separator(s) used by PHP to parse input URLs into variables.
+; PHP's default setting is "&".
+; NOTE: Every character in this directive is considered as separator!
+; http://www.php.net/manual/en/ini.core.php#ini.arg-separator.input
+; Example:
+;arg_separator.input = ";&"
+
+; This directive determines which super global arrays are registered when PHP
+; starts up. If the register_globals directive is enabled, it also determines
+; what order variables are populated into the global space. G,P,C,E & S are
+; abbreviations for the following respective super globals: GET, POST, COOKIE,
+; ENV and SERVER. There is a performance penalty paid for the registration of
+; these arrays and because ENV is not as commonly used as the others, ENV is
+; is not recommended on productions servers. You can still get access to
+; the environment variables through getenv() should you need to.
+; Default Value: "EGPCS"
+; Development Value: "GPCS"
+; Production Value: "GPCS";
+; http://www.php.net/manual/en/ini.core.php#ini.variables-order
+variables_order = "GPCS"
+
+; This directive determines which super global data (G,P,C,E & S) should
+; be registered into the super global array REQUEST. If so, it also determines
+; the order in which that data is registered. The values for this directive are
+; specified in the same manner as the variables_order directive, EXCEPT one.
+; Leaving this value empty will cause PHP to use the value set in the
+; variables_order directive. It does not mean it will leave the super globals
+; array REQUEST empty.
+; Default Value: None
+; Development Value: "GP"
+; Production Value: "GP"
+; http://www.php.net/manual/en/ini.core.php#ini.request-order
+request_order = "GP"
+
+; Whether or not to register the EGPCS variables as global variables. You may
+; want to turn this off if you don't want to clutter your scripts' global scope
+; with user data. This makes most sense when coupled with track_vars - in which
+; case you can access all of the GPC variables through the $HTTP_*_VARS[],
+; variables.
+; You should do your best to write your scripts so that they do not require
+; register_globals to be on; Using form variables as globals can easily lead
+; to possible security problems, if the code is not very well thought of.
+; http://www.php.net/manual/en/ini.core.php#ini.register-globals
+register_globals = Off
+
+; Determines whether the deprecated long $HTTP_*_VARS type predefined variables
+; are registered by PHP or not. As they are deprecated, we obviously don't
+; recommend you use them. They are on by default for compatibility reasons but
+; they are not recommended on production servers.
+; Default Value: On
+; Development Value: Off
+; Production Value: Off
+; http://www.php.net/manual/en/ini.core.php#ini.register-long-arrays
+register_long_arrays = Off
+
+; This directive determines whether PHP registers $argv & $argc each time it
+; runs. $argv contains an array of all the arguments passed to PHP when a script
+; is invoked. $argc contains an integer representing the number of arguments
+; that were passed when the script was invoked. These arrays are extremely
+; useful when running scripts from the command line. When this directive is
+; enabled, registering these variables consumes CPU cycles and memory each time
+; a script is executed. For performance reasons, this feature should be disabled
+; on production servers.
+; Default Value: On
+; Development Value: Off
+; Production Value: Off
+; http://www.php.net/manual/en/ini.core.php#ini.register-argc-argv
+register_argc_argv = Off
+
+; When enabled, the SERVER and ENV variables are created when they're first
+; used (Just In Time) instead of when the script starts. If these variables
+; are not used within a script, having this directive on will result in a
+; performance gain. The PHP directives register_globals, register_long_arrays,
+; and register_argc_argv must be disabled for this directive to have any affect.
+; http://www.php.net/manual/en/ini.core.php#ini.auto-globals-jit
+auto_globals_jit = On
+
+; Maximum size of POST data that PHP will accept.
+; http://www.php.net/manual/en/ini.core.php#ini.post-max-size
+post_max_size = 8M
+
+; Magic quotes are a preprocessing feature of PHP where PHP will attempt to
+; escape any character sequences in GET, POST, COOKIE and ENV data which might
+; otherwise corrupt data being placed in resources such as databases before
+; making that data available to you. Because of character encoding issues and
+; non-standard SQL implementations across many databases, it's not currently
+; possible for this feature to be 100% accurate. PHP's default behavior is to
+; enable the feature. We strongly recommend you use the escaping mechanisms
+; designed specifically for the database your using instead of relying on this
+; feature. Also note, this feature has been deprecated as of PHP 5.3.0 and is
+; scheduled for removal in PHP 6.
+; Default Value: On
+; Development Value: Off
+; Production Value: Off
+; http://www.php.net/manual/en/info.configuration.php#ini.magic-quotes-gpc
+magic_quotes_gpc = Off
+
+; Magic quotes for runtime-generated data, e.g. data from SQL, from exec(), etc.
+; http://www.php.net/manual/en/info.configuration.php#ini.magic-quotes-runtime
+magic_quotes_runtime = Off
+
+; Use Sybase-style magic quotes (escape ' with '' instead of \').
+; http://www.php.net/manual/en/sybase.configuration.php#ini.magic-quotes-sybase
+magic_quotes_sybase = Off
+
+; Automatically add files before PHP document.
+; http://www.php.net/manual/en/ini.core.php#ini.auto-prepend-file
+auto_prepend_file =
+
+; Automatically add files after PHP document.
+; http://www.php.net/manual/en/ini.core.php#ini.auto-append-file
+auto_append_file =
+
+; As of 4.0b4, PHP always outputs a character encoding by default in
+; the Content-type: header. To disable sending of the charset, simply
+; set it to be empty.
+;
+; PHP's built-in default is text/html
+; http://www.php.net/manual/en/ini.core.php#ini.default-mimetype
+default_mimetype = "text/html"
+
+; PHP's default character set is set to empty.
+; http://www.php.net/manual/en/ini.core.php#ini.default-charset
+;default_charset = "iso-8859-1"
+
+; Always populate the $HTTP_RAW_POST_DATA variable. PHP's default behavior is
+; to disable this feature.
+; http://www.php.net/manual/en/ini.core.php#ini.always-populate-raw-post-data
+;always_populate_raw_post_data = On
+
+;;;;;;;;;;;;;;;;;;;;;;;;;
+; Paths and Directories ;
+;;;;;;;;;;;;;;;;;;;;;;;;;
+
+; UNIX: "/path1:/path2"
+;include_path = ".:/php/includes"
+;
+; Windows: "\path1;\path2"
+;include_path = ".;c:\php\includes"
+;
+; PHP's default setting for include_path is ".;/path/to/php/pear"
+; http://www.php.net/manual/en/ini.core.php#ini.include-path
+
+; The root of the PHP pages, used only if nonempty.
+; if PHP was not compiled with FORCE_REDIRECT, you SHOULD set doc_root
+; if you are running php as a CGI under any web server (other than IIS)
+; see documentation for security issues. The alternate is to use the
+; cgi.force_redirect configuration below
+; http://www.php.net/manual/en/ini.core.php#ini.doc-root
+doc_root =
+
+; The directory under which PHP opens the script using /~username used only
+; if nonempty.
+; http://www.php.net/manual/en/ini.core.php#ini.user-dir
+user_dir =
+
+; Directory in which the loadable extensions (modules) reside.
+; http://www.php.net/manual/en/ini.core.php#ini.extension-dir
+; extension_dir = "./"
+
+; Whether or not to enable the dl() function. The dl() function does NOT work
+; properly in multithreaded servers, such as IIS or Zeus, and is automatically
+; disabled on them.
+; http://www.php.net/manual/en/info.configuration.php#ini.enable-dl
+enable_dl = Off
+
+; cgi.force_redirect is necessary to provide security running PHP as a CGI under
+; most web servers. Left undefined, PHP turns this on by default. You can
+; turn it off here AT YOUR OWN RISK
+; **You CAN safely turn this off for IIS, in fact, you MUST.**
+; http://www.php.net/manual/en/ini.core.php#ini.cgi.force-redirect
+;cgi.force_redirect = 1
+
+; if cgi.nph is enabled it will force cgi to always sent Status: 200 with
+; every request. PHP's default behavior is to disable this feature.
+;cgi.nph = 1
+
+; if cgi.force_redirect is turned on, and you are not running under Apache or Netscape
+; (iPlanet) web servers, you MAY need to set an environment variable name that PHP
+; will look for to know it is OK to continue execution. Setting this variable MAY
+; cause security issues, KNOW WHAT YOU ARE DOING FIRST.
+; http://www.php.net/manual/en/ini.core.php#ini.cgi.redirect-status-env
+;cgi.redirect_status_env = ;
+
+; cgi.fix_pathinfo provides *real* PATH_INFO/PATH_TRANSLATED support for CGI. PHP's
+; previous behaviour was to set PATH_TRANSLATED to SCRIPT_FILENAME, and to not grok
+; what PATH_INFO is. For more information on PATH_INFO, see the cgi specs. Setting
+; this to 1 will cause PHP CGI to fix its paths to conform to the spec. A setting
+; of zero causes PHP to behave as before. Default is 1. You should fix your scripts
+; to use SCRIPT_FILENAME rather than PATH_TRANSLATED.
+; http://www.php.net/manual/en/ini.core.php#ini.cgi.fix-pathinfo
+cgi.fix_pathinfo=1
+
+; FastCGI under IIS (on WINNT based OS) supports the ability to impersonate
+; security tokens of the calling client. This allows IIS to define the
+; security context that the request runs under. mod_fastcgi under Apache
+; does not currently support this feature (03/17/2002)
+; Set to 1 if running under IIS. Default is zero.
+; http://www.php.net/manual/en/ini.core.php#ini.fastcgi.impersonate
+;fastcgi.impersonate = 1;
+
+; Disable logging through FastCGI connection. PHP's default behavior is to enable
+; this feature.
+;fastcgi.logging = 0
+
+; cgi.rfc2616_headers configuration option tells PHP what type of headers to
+; use when sending HTTP response code. If it's set 0 PHP sends Status: header that
+; is supported by Apache. When this option is set to 1 PHP will send
+; RFC2616 compliant header.
+; Default is zero.
+; http://www.php.net/manual/en/ini.core.php#ini.cgi.rfc2616-headers
+;cgi.rfc2616_headers = 0
+
+;;;;;;;;;;;;;;;;
+; File Uploads ;
+;;;;;;;;;;;;;;;;
+
+; Whether to allow HTTP file uploads.
+; http://www.php.net/manual/en/ini.core.php#ini.file-uploads
+file_uploads = On
+
+; Temporary directory for HTTP uploaded files (will use system default if not
+; specified).
+; http://www.php.net/manual/en/ini.core.php#ini.upload-tmp-dir
+;upload_tmp_dir =
+
+; Maximum allowed size for uploaded files.
+; http://www.php.net/manual/en/ini.core.php#ini.upload-max-filesize
+upload_max_filesize = 2M
+
+;;;;;;;;;;;;;;;;;;
+; Fopen wrappers ;
+;;;;;;;;;;;;;;;;;;
+
+; Whether to allow the treatment of URLs (like http:// or ftp://) as files.
+; http://www.php.net/manual/en/filesystem.configuration.php#ini.allow-url-fopen
+allow_url_fopen = On
+
+; Whether to allow include/require to open URLs (like http:// or ftp://) as files.
+; http://www.php.net/manual/en/filesystem.configuration.php#ini.allow-url-include
+allow_url_include = Off
+
+; Define the anonymous ftp password (your email address). PHP's default setting
+; for this is empty.
+; http://www.php.net/manual/en/filesystem.configuration.php#ini.from
+;from="john@doe.com"
+
+; Define the User-Agent string. PHP's default setting for this is empty.
+; http://www.php.net/manual/en/filesystem.configuration.php#ini.user-agent
+;user_agent="PHP"
+
+; Default timeout for socket based streams (seconds)
+; http://www.php.net/manual/en/filesystem.configuration.php#ini.default-socket-timeout
+default_socket_timeout = 60
+
+; If your scripts have to deal with files from Macintosh systems,
+; or you are running on a Mac and need to deal with files from
+; unix or win32 systems, setting this flag will cause PHP to
+; automatically detect the EOL character in those files so that
+; fgets() and file() will work regardless of the source of the file.
+; http://www.php.net/manual/en/filesystem.configuration.php#ini.auto-detect-line-endings
+;auto_detect_line_endings = Off
+
+;;;;;;;;;;;;;;;;;;;;;;
+; Dynamic Extensions ;
+;;;;;;;;;;;;;;;;;;;;;;
+
+; If you wish to have an extension loaded automatically, use the following
+; syntax:
+;
+; extension=modulename.extension
+;
+; For example
+;
+; extension=msql.so
+;
+; ... or with a path:
+;
+; extension=/path/to/extension/msql.so
+;
+; If you only provide the name of the extension, PHP will look for it in its
+; default extension directory.
+
+;;;;
+; Note: packaged extension modules are now loaded via the .ini files
+; found in the directory /etc/php.d; these are loaded by default.
+;;;;
+
+
+;;;;;;;;;;;;;;;;;;;
+; Module Settings ;
+;;;;;;;;;;;;;;;;;;;
+
+[Date]
+; Defines the default timezone used by the date functions
+; http://www.php.net/manual/en/datetime.configuration.php#ini.date.timezone
+;date.timezone =
+
+; http://www.php.net/manual/en/datetime.configuration.php#ini.date.default-latitude
+;date.default_latitude = 31.7667
+
+; http://www.php.net/manual/en/datetime.configuration.php#ini.date.default-longitude
+;date.default_longitude = 35.2333
+
+; http://www.php.net/manual/en/datetime.configuration.php#ini.date.sunrise-zenith
+;date.sunrise_zenith = 90.583333
+
+; http://www.php.net/manual/en/datetime.configuration.php#ini.date.sunset-zenith
+;date.sunset_zenith = 90.583333
+
+[filter]
+; http://www.php.net/manual/en/filter.configuration.php#ini.filter.default
+;filter.default = unsafe_raw
+
+; http://www.php.net/manual/en/filter.configuration.php#ini.filter.default-flags
+;filter.default_flags =
+
+[iconv]
+;iconv.input_encoding = ISO-8859-1
+;iconv.internal_encoding = ISO-8859-1
+;iconv.output_encoding = ISO-8859-1
+
+[intl]
+;intl.default_locale =
+
+[sqlite]
+; http://www.php.net/manual/en/sqlite.configuration.php#ini.sqlite.assoc-case
+;sqlite.assoc_case = 0
+
+[sqlite3]
+;sqlite3.extension_dir =
+
+[Pcre]
+;PCRE library backtracking limit.
+; http://www.php.net/manual/en/pcre.configuration.php#ini.pcre.backtrack-limit
+;pcre.backtrack_limit=100000
+
+;PCRE library recursion limit.
+;Please note that if you set this value to a high number you may consume all
+;the available process stack and eventually crash PHP (due to reaching the
+;stack size limit imposed by the Operating System).
+; http://www.php.net/manual/en/pcre.configuration.php#ini.pcre.recursion-limit
+;pcre.recursion_limit=100000
+
+[Pdo]
+; Whether to pool ODBC connections. Can be one of "strict", "relaxed" or "off"
+; http://www.php.net/manual/en/ref.pdo-odbc.php#ini.pdo-odbc.connection-pooling
+;pdo_odbc.connection_pooling=strict
+
+[Phar]
+; http://www.php.net/manual/en/phar.configuration.php#ini.phar.readonly
+;phar.readonly = On
+
+; http://www.php.net/manual/en/phar.configuration.php#ini.phar.require-hash
+;phar.require_hash = On
+
+;phar.cache_list =
+
+[Syslog]
+; Whether or not to define the various syslog variables (e.g. $LOG_PID,
+; $LOG_CRON, etc.). Turning it off is a good idea performance-wise. In
+; runtime, you can define these variables by calling define_syslog_variables().
+; http://www.php.net/manual/en/network.configuration.php#ini.define-syslog-variables
+define_syslog_variables = Off
+
+[mail function]
+; For Win32 only.
+; http://www.php.net/manual/en/mail.configuration.php#ini.smtp
+SMTP = localhost
+; http://www.php.net/manual/en/mail.configuration.php#ini.smtp-port
+smtp_port = 25
+
+; For Win32 only.
+; http://www.php.net/manual/en/mail.configuration.php#ini.sendmail-from
+;sendmail_from = me@example.com
+
+; For Unix only. You may supply arguments as well (default: "sendmail -t -i").
+; http://www.php.net/manual/en/mail.configuration.php#ini.sendmail-path
+sendmail_path = /usr/sbin/sendmail -t -i
+
+; Force the addition of the specified parameters to be passed as extra parameters
+; to the sendmail binary. These parameters will always replace the value of
+; the 5th parameter to mail(), even in safe mode.
+;mail.force_extra_parameters =
+
+; Add X-PHP-Originaiting-Script: that will include uid of the script followed by the filename
+mail.add_x_header = On
+
+; Log all mail() calls including the full path of the script, line #, to address and headers
+;mail.log =
+
+[SQL]
+; http://www.php.net/manual/en/ini.core.php#ini.sql.safe-mode
+sql.safe_mode = Off
+
+[ODBC]
+; http://www.php.net/manual/en/odbc.configuration.php#ini.uodbc.default-db
+;odbc.default_db = Not yet implemented
+
+; http://www.php.net/manual/en/odbc.configuration.php#ini.uodbc.default-user
+;odbc.default_user = Not yet implemented
+
+; http://www.php.net/manual/en/odbc.configuration.php#ini.uodbc.default-pw
+;odbc.default_pw = Not yet implemented
+
+; Allow or prevent persistent links.
+; http://www.php.net/manual/en/odbc.configuration.php#ini.uodbc.allow-persistent
+odbc.allow_persistent = On
+
+; Check that a connection is still valid before reuse.
+; http://www.php.net/manual/en/odbc.configuration.php#ini.uodbc.check-persistent
+odbc.check_persistent = On
+
+; Maximum number of persistent links. -1 means no limit.
+; http://www.php.net/manual/en/odbc.configuration.php#ini.uodbc.max-persistent
+odbc.max_persistent = -1
+
+; Maximum number of links (persistent + non-persistent). -1 means no limit.
+; http://www.php.net/manual/en/odbc.configuration.php#ini.uodbc.max-links
+odbc.max_links = -1
+
+; Handling of LONG fields. Returns number of bytes to variables. 0 means
+; passthru.
+; http://www.php.net/manual/en/odbc.configuration.php#ini.uodbc.defaultlrl
+odbc.defaultlrl = 4096
+
+; Handling of binary data. 0 means passthru, 1 return as is, 2 convert to char.
+; See the documentation on odbc_binmode and odbc_longreadlen for an explanation
+; of uodbc.defaultlrl and uodbc.defaultbinmode
+; http://www.php.net/manual/en/odbc.configuration.php#ini.uodbc.defaultbinmode
+odbc.defaultbinmode = 1
+
+;birdstep.max_links = -1
+
+[MySQL]
+; Allow or prevent persistent links.
+; http://www.php.net/manual/en/mysql.configuration.php#ini.mysql.allow-persistent
+mysql.allow_persistent = On
+
+; Maximum number of persistent links. -1 means no limit.
+; http://www.php.net/manual/en/mysql.configuration.php#ini.mysql.max-persistent
+mysql.max_persistent = -1
+
+; Maximum number of links (persistent + non-persistent). -1 means no limit.
+; http://www.php.net/manual/en/mysql.configuration.php#ini.mysql.max-links
+mysql.max_links = -1
+
+; Default port number for mysql_connect(). If unset, mysql_connect() will use
+; the $MYSQL_TCP_PORT or the mysql-tcp entry in /etc/services or the
+; compile-time value defined MYSQL_PORT (in that order). Win32 will only look
+; at MYSQL_PORT.
+; http://www.php.net/manual/en/mysql.configuration.php#ini.mysql.default-port
+mysql.default_port =
+
+; Default socket name for local MySQL connects. If empty, uses the built-in
+; MySQL defaults.
+; http://www.php.net/manual/en/mysql.configuration.php#ini.mysql.default-socket
+mysql.default_socket =
+
+; Default host for mysql_connect() (doesn't apply in safe mode).
+; http://www.php.net/manual/en/mysql.configuration.php#ini.mysql.default-host
+mysql.default_host =
+
+; Default user for mysql_connect() (doesn't apply in safe mode).
+; http://www.php.net/manual/en/mysql.configuration.php#ini.mysql.default-user
+mysql.default_user =
+
+; Default password for mysql_connect() (doesn't apply in safe mode).
+; Note that this is generally a *bad* idea to store passwords in this file.
+; *Any* user with PHP access can run 'echo get_cfg_var("mysql.default_password")
+; and reveal this password! And of course, any users with read access to this
+; file will be able to reveal the password as well.
+; http://www.php.net/manual/en/mysql.configuration.php#ini.mysql.default-password
+mysql.default_password =
+
+; Maximum time (in seconds) for connect timeout. -1 means no limit
+; http://www.php.net/manual/en/mysql.configuration.php#ini.mysql.connect-timeout
+mysql.connect_timeout = 60
+
+; Trace mode. When trace_mode is active (=On), warnings for table/index scans and
+; SQL-Errors will be displayed.
+; http://www.php.net/manual/en/mysql.configuration.php#ini.mysql.trace-mode
+mysql.trace_mode = Off
+
+[MySQLi]
+
+; Maximum number of links. -1 means no limit.
+; http://www.php.net/manual/en/mysqli.configuration.php#ini.mysqli.max-links
+mysqli.max_links = -1
+
+; Default port number for mysqli_connect(). If unset, mysqli_connect() will use
+; the $MYSQL_TCP_PORT or the mysql-tcp entry in /etc/services or the
+; compile-time value defined MYSQL_PORT (in that order). Win32 will only look
+; at MYSQL_PORT.
+; http://www.php.net/manual/en/mysqli.configuration.php#ini.mysqli.default-port
+mysqli.default_port = 3306
+
+; Default socket name for local MySQL connects. If empty, uses the built-in
+; MySQL defaults.
+; http://www.php.net/manual/en/mysqli.configuration.php#ini.mysqli.default-socket
+mysqli.default_socket =
+
+; Default host for mysql_connect() (doesn't apply in safe mode).
+; http://www.php.net/manual/en/mysqli.configuration.php#ini.mysqli.default-host
+mysqli.default_host =
+
+; Default user for mysql_connect() (doesn't apply in safe mode).
+; http://www.php.net/manual/en/mysqli.configuration.php#ini.mysqli.default-user
+mysqli.default_user =
+
+; Default password for mysqli_connect() (doesn't apply in safe mode).
+; Note that this is generally a *bad* idea to store passwords in this file.
+; *Any* user with PHP access can run 'echo get_cfg_var("mysqli.default_pw")
+; and reveal this password! And of course, any users with read access to this
+; file will be able to reveal the password as well.
+; http://www.php.net/manual/en/mysqli.configuration.php#ini.mysqli.default-pw
+mysqli.default_pw =
+
+; Allow or prevent reconnect
+mysqli.reconnect = Off
+
+[PostgresSQL]
+; Allow or prevent persistent links.
+; http://www.php.net/manual/en/pgsql.configuration.php#ini.pgsql.allow-persistent
+pgsql.allow_persistent = On
+
+; Detect broken persistent links always with pg_pconnect().
+; Auto reset feature requires a little overheads.
+; http://www.php.net/manual/en/pgsql.configuration.php#ini.pgsql.auto-reset-persistent
+pgsql.auto_reset_persistent = Off
+
+; Maximum number of persistent links. -1 means no limit.
+; http://www.php.net/manual/en/pgsql.configuration.php#ini.pgsql.max-persistent
+pgsql.max_persistent = -1
+
+; Maximum number of links (persistent+non persistent). -1 means no limit.
+; http://www.php.net/manual/en/pgsql.configuration.php#ini.pgsql.max-links
+pgsql.max_links = -1
+
+; Ignore PostgreSQL backends Notice message or not.
+; Notice message logging require a little overheads.
+; http://www.php.net/manual/en/pgsql.configuration.php#ini.pgsql.ignore-notice
+pgsql.ignore_notice = 0
+
+; Log PostgreSQL backends Noitce message or not.
+; Unless pgsql.ignore_notice=0, module cannot log notice message.
+; http://www.php.net/manual/en/pgsql.configuration.php#ini.pgsql.log-notice
+pgsql.log_notice = 0
+
+[Sybase-CT]
+; Allow or prevent persistent links.
+; http://www.php.net/manual/en/sybase.configuration.php#ini.sybct.allow-persistent
+sybct.allow_persistent = On
+
+; Maximum number of persistent links. -1 means no limit.
+; http://www.php.net/manual/en/sybase.configuration.php#ini.sybct.max-persistent
+sybct.max_persistent = -1
+
+; Maximum number of links (persistent + non-persistent). -1 means no limit.
+; http://www.php.net/manual/en/sybase.configuration.php#ini.sybct.max-links
+sybct.max_links = -1
+
+; Minimum server message severity to display.
+; http://www.php.net/manual/en/sybase.configuration.php#ini.sybct.min-server-severity
+sybct.min_server_severity = 10
+
+; Minimum client message severity to display.
+; http://www.php.net/manual/en/sybase.configuration.php#ini.sybct.min-client-severity
+sybct.min_client_severity = 10
+
+; Set per-context timeout
+; http://www.php.net/manual/en/sybase.configuration.php#ini.sybct.timeout
+;sybct.timeout=
+
+;sybct.packet_size
+
+[bcmath]
+; Number of decimal digits for all bcmath functions.
+; http://www.php.net/manual/en/bc.configuration.php#ini.bcmath.scale
+bcmath.scale = 0
+
+[browscap]
+; http://www.php.net/manual/en/misc.configuration.php#ini.browscap
+;browscap = extra/browscap.ini
+
+[Session]
+; Handler used to store/retrieve data.
+; http://www.php.net/manual/en/session.configuration.php#ini.session.save-handler
+session.save_handler = files
+
+; Argument passed to save_handler. In the case of files, this is the path
+; where data files are stored. Note: Windows users have to change this
+; variable in order to use PHP's session functions.
+;
+; As of PHP 4.0.1, you can define the path as:
+;
+; session.save_path = "N;/path"
+;
+; where N is an integer. Instead of storing all the session files in
+; /path, what this will do is use subdirectories N-levels deep, and
+; store the session data in those directories. This is useful if you
+; or your OS have problems with lots of files in one directory, and is
+; a more efficient layout for servers that handle lots of sessions.
+;
+; NOTE 1: PHP will not create this directory structure automatically.
+; You can use the script in the ext/session dir for that purpose.
+; NOTE 2: See the section on garbage collection below if you choose to
+; use subdirectories for session storage
+;
+; The file storage module creates files using mode 600 by default.
+; You can change that by using
+;
+; session.save_path = "N;MODE;/path"
+;
+; where MODE is the octal representation of the mode. Note that this
+; does not overwrite the process's umask.
+; http://www.php.net/manual/en/session.configuration.php#ini.session.save-path
+session.save_path = "/tmp"
+
+; Whether to use cookies.
+; http://www.php.net/manual/en/session.configuration.php#ini.session.use-cookies
+session.use_cookies = 1
+
+; http://www.php.net/manual/en/session.configuration.php#ini.session.cookie-secure
+;session.cookie_secure =
+
+; This option forces PHP to fetch and use a cookie for storing and maintaining
+; the session id. We encourage this operation as it's very helpful in combatting
+; session hijacking when not specifying and managing your own session id. It is
+; not the end all be all of session hijacking defense, but it's a good start.
+; http://www.php.net/manual/en/session.configuration.php#ini.session.use-only-cookies
+session.use_only_cookies = 1
+
+; Name of the session (used as cookie name).
+; http://www.php.net/manual/en/session.configuration.php#ini.session.name
+session.name = PHPSESSID
+
+; Initialize session on request startup.
+; http://www.php.net/manual/en/session.configuration.php#ini.session.auto-start
+session.auto_start = 0
+
+; Lifetime in seconds of cookie or, if 0, until browser is restarted.
+; http://www.php.net/manual/en/session.configuration.php#ini.session.cookie-lifetime
+session.cookie_lifetime = 0
+
+; The path for which the cookie is valid.
+; http://www.php.net/manual/en/session.configuration.php#ini.session.cookie-path
+session.cookie_path = /
+
+; The domain for which the cookie is valid.
+; http://www.php.net/manual/en/session.configuration.php#ini.session.cookie-domain
+session.cookie_domain =
+
+; Whether or not to add the httpOnly flag to the cookie, which makes it inaccessible to browser scripting languages such as JavaScript.
+; http://www.php.net/manual/en/session.configuration.php#ini.session.cookie-httponly
+session.cookie_httponly =
+
+; Handler used to serialize data. php is the standard serializer of PHP.
+; http://www.php.net/manual/en/session.configuration.php#ini.session.serialize-handler
+session.serialize_handler = php
+
+; Defines the probability that the 'garbage collection' process is started
+; on every session initialization. The probability is calculated by using
+; gc_probability/gc_divisor. Where session.gc_probability is the numerator
+; and gc_divisor is the denominator in the equation. Setting this value to 1
+; when the session.gc_divisor value is 100 will give you approximately a 1% chance
+; the gc will run on any give request.
+; Default Value: 1
+; Development Value: 1
+; Production Value: 1
+; http://www.php.net/manual/en/session.configuration.php#ini.session.gc-probability
+session.gc_probability = 1
+
+; Defines the probability that the 'garbage collection' process is started on every
+; session initialization. The probability is calculated by using the following equation:
+; gc_probability/gc_divisor. Where session.gc_probability is the numerator and
+; session.gc_divisor is the denominator in the equation. Setting this value to 1
+; when the session.gc_divisor value is 100 will give you approximately a 1% chance
+; the gc will run on any give request. Increasing this value to 1000 will give you
+; a 0.1% chance the gc will run on any give request. For high volume production servers,
+; this is a more efficient approach.
+; Default Value: 100
+; Development Value: 1000
+; Production Value: 1000
+; http://www.php.net/manual/en/session.configuration.php#ini.session.gc-divisor
+session.gc_divisor = 1000
+
+; After this number of seconds, stored data will be seen as 'garbage' and
+; cleaned up by the garbage collection process.
+; http://www.php.net/manual/en/session.configuration.php#ini.session.gc-maxlifetime
+session.gc_maxlifetime = 1440
+
+; NOTE: If you are using the subdirectory option for storing session files
+; (see session.save_path above), then garbage collection does *not*
+; happen automatically. You will need to do your own garbage
+; collection through a shell script, cron entry, or some other method.
+; For example, the following script would is the equivalent of
+; setting session.gc_maxlifetime to 1440 (1440 seconds = 24 minutes):
+; cd /path/to/sessions; find -cmin +24 | xargs rm
+
+; PHP 4.2 and less have an undocumented feature/bug that allows you to
+; to initialize a session variable in the global scope, even when register_globals
+; is disabled. PHP 4.3 and later will warn you, if this feature is used.
+; You can disable the feature and the warning separately. At this time,
+; the warning is only displayed, if bug_compat_42 is enabled. This feature
+; introduces some serious security problems if not handled correctly. It's
+; recommended that you do not use this feature on production servers. But you
+; should enable this on development servers and enable the warning as well. If you
+; do not enable the feature on development servers, you won't be warned when it's
+; used and debugging errors caused by this can be difficult to track down.
+; Default Value: On
+; Development Value: On
+; Production Value: Off
+; http://www.php.net/manual/en/session.configuration.php#ini.session.bug-compat-42
+session.bug_compat_42 = Off
+
+; This setting controls whether or not you are warned by PHP when initializing a
+; session value into the global space. session.bug_compat_42 must be enabled before
+; these warnings can be issued by PHP. See the directive above for more information.
+; Default Value: On
+; Development Value: On
+; Production Value: Off
+; http://www.php.net/manual/en/session.configuration.php#ini.session.bug-compat-warn
+session.bug_compat_warn = Off
+
+; Check HTTP Referer to invalidate externally stored URLs containing ids.
+; HTTP_REFERER has to contain this substring for the session to be
+; considered as valid.
+; http://www.php.net/manual/en/session.configuration.php#ini.session.referer-check
+session.referer_check =
+
+; How many bytes to read from the file.
+; http://www.php.net/manual/en/session.configuration.php#ini.session.entropy-length
+session.entropy_length = 0
+
+; Specified here to create the session id.
+; http://www.php.net/manual/en/session.configuration.php#ini.session.entropy-file
+;session.entropy_file = /dev/urandom
+session.entropy_file =
+
+; http://www.php.net/manual/en/session.configuration.php#ini.session.entropy-length
+;session.entropy_length = 16
+
+; Set to {nocache,private,public,} to determine HTTP caching aspects
+; or leave this empty to avoid sending anti-caching headers.
+; http://www.php.net/manual/en/session.configuration.php#ini.session.cache-limiter
+session.cache_limiter = nocache
+
+; Document expires after n minutes.
+; http://www.php.net/manual/en/session.configuration.php#ini.session.cache-expire
+session.cache_expire = 180
+
+; trans sid support is disabled by default.
+; Use of trans sid may risk your users security.
+; Use this option with caution.
+; - User may send URL contains active session ID
+; to other person via. email/irc/etc.
+; - URL that contains active session ID may be stored
+; in publically accessible computer.
+; - User may access your site with the same session ID
+; always using URL stored in browser's history or bookmarks.
+; http://www.php.net/manual/en/session.configuration.php#ini.session.use-trans-sid
+session.use_trans_sid = 0
+
+; Select a hash function for use in generating session ids.
+; Possible Values
+; 0 (MD5 128 bits)
+; 1 (SHA-1 160 bits)
+; http://www.php.net/manual/en/session.configuration.php#ini.session.hash-function
+session.hash_function = 0
+
+; Define how many bits are stored in each character when converting
+; the binary hash data to something readable.
+; Possible values:
+; 4 (4 bits: 0-9, a-f)
+; 5 (5 bits: 0-9, a-v)
+; 6 (6 bits: 0-9, a-z, A-Z, "-", ",")
+; Default Value: 4
+; Development Value: 5
+; Production Value: 5
+; http://www.php.net/manual/en/session.configuration.php#ini.session.hash-bits-per-character
+session.hash_bits_per_character = 5
+
+; The URL rewriter will look for URLs in a defined set of HTML tags.
+; form/fieldset are special; if you include them here, the rewriter will
+; add a hidden <input> field with the info which is otherwise appended
+; to URLs. If you want XHTML conformity, remove the form entry.
+; Note that all valid entries require a "=", even if no value follows.
+; Default Value: "a=href,area=href,frame=src,form=,fieldset="
+; Development Value: "a=href,area=href,frame=src,input=src,form=fakeentry"
+; Production Value: "a=href,area=href,frame=src,input=src,form=fakeentry"
+; http://www.php.net/manual/en/session.configuration.php#ini.url-rewriter.tags
+url_rewriter.tags = "a=href,area=href,frame=src,input=src,form=fakeentry"
+
+[MSSQL]
+; Allow or prevent persistent links.
+mssql.allow_persistent = On
+
+; Maximum number of persistent links. -1 means no limit.
+mssql.max_persistent = -1
+
+; Maximum number of links (persistent+non persistent). -1 means no limit.
+mssql.max_links = -1
+
+; Minimum error severity to display.
+mssql.min_error_severity = 10
+
+; Minimum message severity to display.
+mssql.min_message_severity = 10
+
+; Compatibility mode with old versions of PHP 3.0.
+mssql.compatability_mode = Off
+
+; Connect timeout
+;mssql.connect_timeout = 5
+
+; Query timeout
+;mssql.timeout = 60
+
+; Valid range 0 - 2147483647. Default = 4096.
+;mssql.textlimit = 4096
+
+; Valid range 0 - 2147483647. Default = 4096.
+;mssql.textsize = 4096
+
+; Limits the number of records in each batch. 0 = all records in one batch.
+;mssql.batchsize = 0
+
+; Specify how datetime and datetim4 columns are returned
+; On => Returns data converted to SQL server settings
+; Off => Returns values as YYYY-MM-DD hh:mm:ss
+;mssql.datetimeconvert = On
+
+; Use NT authentication when connecting to the server
+mssql.secure_connection = Off
+
+; Specify max number of processes. -1 = library default
+; msdlib defaults to 25
+; FreeTDS defaults to 4096
+;mssql.max_procs = -1
+
+; Specify client character set.
+; If empty or not set the client charset from freetds.comf is used
+; This is only used when compiled with FreeTDS
+;mssql.charset = "ISO-8859-1"
+
+[Assertion]
+; Assert(expr); active by default.
+; http://www.php.net/manual/en/info.configuration.php#ini.assert.active
+;assert.active = On
+
+; Issue a PHP warning for each failed assertion.
+; http://www.php.net/manual/en/info.configuration.php#ini.assert.warning
+;assert.warning = On
+
+; Don't bail out by default.
+; http://www.php.net/manual/en/info.configuration.php#ini.assert.bail
+;assert.bail = Off
+
+; User-function to be called if an assertion fails.
+; http://www.php.net/manual/en/info.configuration.php#ini.assert.callback
+;assert.callback = 0
+
+; Eval the expression with current error_reporting(). Set to true if you want
+; error_reporting(0) around the eval().
+; http://www.php.net/manual/en/info.configuration.php#ini.assert.quiet-eval
+;assert.quiet_eval = 0
+
+[COM]
+; path to a file containing GUIDs, IIDs or filenames of files with TypeLibs
+; http://www.php.net/manual/en/com.configuration.php#ini.com.typelib-file
+;com.typelib_file =
+
+; allow Distributed-COM calls
+; http://www.php.net/manual/en/com.configuration.php#ini.com.allow-dcom
+;com.allow_dcom = true
+
+; autoregister constants of a components typlib on com_load()
+; http://www.php.net/manual/en/com.configuration.php#ini.com.autoregister-typelib
+;com.autoregister_typelib = true
+
+; register constants casesensitive
+; http://www.php.net/manual/en/com.configuration.php#ini.com.autoregister-casesensitive
+;com.autoregister_casesensitive = false
+
+; show warnings on duplicate constant registrations
+; http://www.php.net/manual/en/com.configuration.php#ini.com.autoregister-verbose
+;com.autoregister_verbose = true
+
+[mbstring]
+; language for internal character representation.
+; http://www.php.net/manual/en/mbstring.configuration.php#ini.mbstring.language
+;mbstring.language = Japanese
+
+; internal/script encoding.
+; Some encoding cannot work as internal encoding.
+; (e.g. SJIS, BIG5, ISO-2022-*)
+; http://www.php.net/manual/en/mbstring.configuration.php#ini.mbstring.internal-encoding
+;mbstring.internal_encoding = EUC-JP
+
+; http input encoding.
+; http://www.php.net/manual/en/mbstring.configuration.php#ini.mbstring.http-input
+;mbstring.http_input = auto
+
+; http output encoding. mb_output_handler must be
+; registered as output buffer to function
+; http://www.php.net/manual/en/mbstring.configuration.php#ini.mbstring.http-output
+;mbstring.http_output = SJIS
+
+; enable automatic encoding translation according to
+; mbstring.internal_encoding setting. Input chars are
+; converted to internal encoding by setting this to On.
+; Note: Do _not_ use automatic encoding translation for
+; portable libs/applications.
+; http://www.php.net/manual/en/mbstring.configuration.php#ini.mbstring.encoding-translation
+;mbstring.encoding_translation = Off
+
+; automatic encoding detection order.
+; auto means
+; http://www.php.net/manual/en/mbstring.configuration.php#ini.mbstring.detect-order
+;mbstring.detect_order = auto
+
+; substitute_character used when character cannot be converted
+; one from another
+; http://www.php.net/manual/en/mbstring.configuration.php#ini.mbstring.substitute-character
+;mbstring.substitute_character = none;
+
+; overload(replace) single byte functions by mbstring functions.
+; mail(), ereg(), etc are overloaded by mb_send_mail(), mb_ereg(),
+; etc. Possible values are 0,1,2,4 or combination of them.
+; For example, 7 for overload everything.
+; 0: No overload
+; 1: Overload mail() function
+; 2: Overload str*() functions
+; 4: Overload ereg*() functions
+; http://www.php.net/manual/en/mbstring.configuration.php#ini.mbstring.func-overload
+;mbstring.func_overload = 0
+
+; enable strict encoding detection.
+;mbstring.strict_detection = Off
+
+; This directive specifies the regex pattern of content types for which mb_output_handler()
+; is activated.
+; Default: mbstring.http_output_conv_mimetype=^(text/|application/xhtml\+xml)
+;mbstring.http_output_conv_mimetype=
+
+[gd]
+; Tell the jpeg decode to ignore warnings and try to create
+; a gd image. The warning will then be displayed as notices
+; disabled by default
+; http://www.php.net/manual/en/image.configuration.php#ini.image.jpeg-ignore-warning
+;gd.jpeg_ignore_warning = 0
+
+[exif]
+; Exif UNICODE user comments are handled as UCS-2BE/UCS-2LE and JIS as JIS.
+; With mbstring support this will automatically be converted into the encoding
+; given by corresponding encode setting. When empty mbstring.internal_encoding
+; is used. For the decode settings you can distinguish between motorola and
+; intel byte order. A decode setting cannot be empty.
+; http://www.php.net/manual/en/exif.configuration.php#ini.exif.encode-unicode
+;exif.encode_unicode = ISO-8859-15
+
+; http://www.php.net/manual/en/exif.configuration.php#ini.exif.decode-unicode-motorola
+;exif.decode_unicode_motorola = UCS-2BE
+
+; http://www.php.net/manual/en/exif.configuration.php#ini.exif.decode-unicode-intel
+;exif.decode_unicode_intel = UCS-2LE
+
+; http://www.php.net/manual/en/exif.configuration.php#ini.exif.encode-jis
+;exif.encode_jis =
+
+; http://www.php.net/manual/en/exif.configuration.php#ini.exif.decode-jis-motorola
+;exif.decode_jis_motorola = JIS
+
+; http://www.php.net/manual/en/exif.configuration.php#ini.exif.decode-jis-intel
+;exif.decode_jis_intel = JIS
+
+[Tidy]
+; The path to a default tidy configuration file to use when using tidy
+; http://www.php.net/manual/en/tidy.configuration.php#ini.tidy.default-config
+;tidy.default_config = /usr/local/lib/php/default.tcfg
+
+; Should tidy clean and repair output automatically?
+; WARNING: Do not use this option if you are generating non-html content
+; such as dynamic images
+; http://www.php.net/manual/en/tidy.configuration.php#ini.tidy.clean-output
+tidy.clean_output = Off
+
+[soap]
+; Enables or disables WSDL caching feature.
+; http://www.php.net/manual/en/soap.configuration.php#ini.soap.wsdl-cache-enabled
+soap.wsdl_cache_enabled=1
+
+; Sets the directory name where SOAP extension will put cache files.
+; http://www.php.net/manual/en/soap.configuration.php#ini.soap.wsdl-cache-dir
+soap.wsdl_cache_dir="/tmp"
+
+; (time to live) Sets the number of second while cached file will be used
+; instead of original one.
+; http://www.php.net/manual/en/soap.configuration.php#ini.soap.wsdl-cache-ttl
+soap.wsdl_cache_ttl=86400
+
+[sysvshm]
+; A default size of the shared memory segment
+;sysvshm.init_mem = 10000
+
+
+; Local Variables:
+; tab-width: 4
+; End:
+
--- /dev/null
+++ b/aws/postgresql.conf
@@ -1,1 +1,502 @@
-
+# -----------------------------
+# PostgreSQL configuration file
+# -----------------------------
+#
+# This file consists of lines of the form:
+#
+# name = value
+#
+# (The "=" is optional.) Whitespace may be used. Comments are introduced with
+# "#" anywhere on a line. The complete list of parameter names and allowed
+# values can be found in the PostgreSQL documentation.
+#
+# The commented-out settings shown in this file represent the default values.
+# Re-commenting a setting is NOT sufficient to revert it to the default value;
+# you need to reload the server.
+#
+# This file is read on server startup and when the server receives a SIGHUP
+# signal. If you edit the file on a running system, you have to SIGHUP the
+# server for the changes to take effect, or use "pg_ctl reload". Some
+# parameters, which are marked below, require a server shutdown and restart to
+# take effect.
+#
+# Any parameter can also be given as a command-line option to the server, e.g.,
+# "postgres -c log_connections=on". Some parameters can be changed at run time
+# with the "SET" SQL command.
+#
+# Memory units: kB = kilobytes Time units: ms = milliseconds
+# MB = megabytes s = seconds
+# GB = gigabytes min = minutes
+# h = hours
+# d = days
+
+
+#------------------------------------------------------------------------------
+# FILE LOCATIONS
+#------------------------------------------------------------------------------
+
+# The default values of these variables are driven from the -D command-line
+# option or PGDATA environment variable, represented here as ConfigDir.
+
+#data_directory = 'ConfigDir' # use data in another directory
+ # (change requires restart)
+#hba_file = 'ConfigDir/pg_hba.conf' # host-based authentication file
+ # (change requires restart)
+#ident_file = 'ConfigDir/pg_ident.conf' # ident configuration file
+ # (change requires restart)
+
+# If external_pid_file is not explicitly set, no extra PID file is written.
+#external_pid_file = '(none)' # write an extra PID file
+ # (change requires restart)
+
+
+#------------------------------------------------------------------------------
+# CONNECTIONS AND AUTHENTICATION
+#------------------------------------------------------------------------------
+
+# - Connection Settings -
+
+listen_addresses = '*' # what IP address(es) to listen on;
+ # comma-separated list of addresses;
+ # defaults to 'localhost', '*' = all
+ # (change requires restart)
+#port = 5432 # (change requires restart)
+max_connections = 100 # (change requires restart)
+# Note: Increasing max_connections costs ~400 bytes of shared memory per
+# connection slot, plus lock space (see max_locks_per_transaction).
+#superuser_reserved_connections = 3 # (change requires restart)
+#unix_socket_directory = '' # (change requires restart)
+#unix_socket_group = '' # (change requires restart)
+#unix_socket_permissions = 0777 # begin with 0 to use octal notation
+ # (change requires restart)
+#bonjour_name = '' # defaults to the computer name
+ # (change requires restart)
+
+# - Security and Authentication -
+
+#authentication_timeout = 1min # 1s-600s
+#ssl = off # (change requires restart)
+#ssl_ciphers = 'ALL:!ADH:!LOW:!EXP:!MD5:@STRENGTH' # allowed SSL ciphers
+ # (change requires restart)
+#ssl_renegotiation_limit = 512MB # amount of data between renegotiations
+#password_encryption = on
+#db_user_namespace = off
+
+# Kerberos and GSSAPI
+#krb_server_keyfile = ''
+#krb_srvname = 'postgres' # (Kerberos only)
+#krb_caseins_users = off
+
+# - TCP Keepalives -
+# see "man 7 tcp" for details
+
+#tcp_keepalives_idle = 0 # TCP_KEEPIDLE, in seconds;
+ # 0 selects the system default
+#tcp_keepalives_interval = 0 # TCP_KEEPINTVL, in seconds;
+ # 0 selects the system default
+#tcp_keepalives_count = 0 # TCP_KEEPCNT;
+ # 0 selects the system default
+
+
+#------------------------------------------------------------------------------
+# RESOURCE USAGE (except WAL)
+#------------------------------------------------------------------------------
+
+# - Memory -
+
+shared_buffers = 32MB # min 128kB
+ # (change requires restart)
+#temp_buffers = 8MB # min 800kB
+#max_prepared_transactions = 0 # zero disables the feature
+ # (change requires restart)
+# Note: Increasing max_prepared_transactions costs ~600 bytes of shared memory
+# per transaction slot, plus lock space (see max_locks_per_transaction).
+# It is not advisable to set max_prepared_transactions nonzero unless you
+# actively intend to use prepared transactions.
+#work_mem = 1MB # min 64kB
+#maintenance_work_mem = 16MB # min 1MB
+#max_stack_depth = 2MB # min 100kB
+
+# - Kernel Resource Usage -
+
+#max_files_per_process = 1000 # min 25
+ # (change requires restart)
+#shared_preload_libraries = '' # (change requires restart)
+
+# - Cost-Based Vacuum Delay -
+
+#vacuum_cost_delay = 0ms # 0-100 milliseconds
+#vacuum_cost_page_hit = 1 # 0-10000 credits
+#vacuum_cost_page_miss = 10 # 0-10000 credits
+#vacuum_cost_page_dirty = 20 # 0-10000 credits
+#vacuum_cost_limit = 200 # 1-10000 credits
+
+# - Background Writer -
+
+#bgwriter_delay = 200ms # 10-10000ms between rounds
+#bgwriter_lru_maxpages = 100 # 0-1000 max buffers written/round
+#bgwriter_lru_multiplier = 2.0 # 0-10.0 multipler on buffers scanned/round
+
+# - Asynchronous Behavior -
+
+#effective_io_concurrency = 1 # 1-1000. 0 disables prefetching
+
+
+#------------------------------------------------------------------------------
+# WRITE AHEAD LOG
+#------------------------------------------------------------------------------
+
+# - Settings -
+
+#fsync = on # turns forced synchronization on or off
+#synchronous_commit = on # immediate fsync at commit
+#wal_sync_method = fsync # the default is the first option
+ # supported by the operating system:
+ # open_datasync
+ # fdatasync
+ # fsync
+ # fsync_writethrough
+ # open_sync
+#full_page_writes = on # recover from partial page writes
+#wal_buffers = 64kB # min 32kB
+ # (change requires restart)
+#wal_writer_delay = 200ms # 1-10000 milliseconds
+
+#commit_delay = 0 # range 0-100000, in microseconds
+#commit_siblings = 5 # range 1-1000
+
+# - Checkpoints -
+
+#checkpoint_segments = 3 # in logfile segments, min 1, 16MB each
+#checkpoint_timeout = 5min # range 30s-1h
+#checkpoint_completion_target = 0.5 # checkpoint target duration, 0.0 - 1.0
+#checkpoint_warning = 30s # 0 disables
+
+# - Archiving -
+
+#archive_mode = off # allows archiving to be done
+ # (change requires restart)
+#archive_command = '' # command to use to archive a logfile segment
+#archive_timeout = 0 # force a logfile segment switch after this
+ # number of seconds; 0 disables
+
+
+#------------------------------------------------------------------------------
+# QUERY TUNING
+#------------------------------------------------------------------------------
+
+# - Planner Method Configuration -
+
+#enable_bitmapscan = on
+#enable_hashagg = on
+#enable_hashjoin = on
+#enable_indexscan = on
+#enable_mergejoin = on
+#enable_nestloop = on
+#enable_seqscan = on
+#enable_sort = on
+#enable_tidscan = on
+
+# - Planner Cost Constants -
+
+#seq_page_cost = 1.0 # measured on an arbitrary scale
+#random_page_cost = 4.0 # same scale as above
+#cpu_tuple_cost = 0.01 # same scale as above
+#cpu_index_tuple_cost = 0.005 # same scale as above
+#cpu_operator_cost = 0.0025 # same scale as above
+#effective_cache_size = 128MB
+
+# - Genetic Query Optimizer -
+
+#geqo = on
+#geqo_threshold = 12
+#geqo_effort = 5 # range 1-10
+#geqo_pool_size = 0 # selects default based on effort
+#geqo_generations = 0 # selects default based on effort
+#geqo_selection_bias = 2.0 # range 1.5-2.0
+
+# - Other Planner Options -
+
+#default_statistics_target = 100 # range 1-10000
+#constraint_exclusion = partition # on, off, or partition
+#cursor_tuple_fraction = 0.1 # range 0.0-1.0
+#from_collapse_limit = 8
+#join_collapse_limit = 8 # 1 disables collapsing of explicit
+ # JOIN clauses
+
+
+#------------------------------------------------------------------------------
+# ERROR REPORTING AND LOGGING
+#------------------------------------------------------------------------------
+
+# - Where to Log -
+
+#log_destination = 'stderr' # Valid values are combinations of
+ # stderr, csvlog, syslog and eventlog,
+ # depending on platform. csvlog
+ # requires logging_collector to be on.
+
+# This is used when logging to stderr:
+logging_collector = on # Enable capturing of stderr and csvlog
+ # into log files. Required to be on for
+ # csvlogs.
+ # (change requires restart)
+
+# These are only used if logging_collector is on:
+log_directory = 'pg_log' # directory where log files are written,
+ # can be absolute or relative to PGDATA
+log_filename = 'postgresql-%a.log' # log file name pattern,
+ # can include strftime() escapes
+log_truncate_on_rotation = on # If on, an existing log file of the
+ # same name as the new log file will be
+ # truncated rather than appended to.
+ # But such truncation only occurs on
+ # time-driven rotation, not on restarts
+ # or size-driven rotation. Default is
+ # off, meaning append to existing files
+ # in all cases.
+log_rotation_age = 1d # Automatic rotation of logfiles will
+ # happen after that time. 0 disables.
+log_rotation_size = 0 # Automatic rotation of logfiles will
+ # happen after that much log output.
+ # 0 disables.
+
+# These are relevant when logging to syslog:
+#syslog_facility = 'LOCAL0'
+#syslog_ident = 'postgres'
+
+#silent_mode = off # Run server silently.
+ # DO NOT USE without syslog or
+ # logging_collector
+ # (change requires restart)
+
+
+# - When to Log -
+
+#client_min_messages = notice # values in order of decreasing detail:
+ # debug5
+ # debug4
+ # debug3
+ # debug2
+ # debug1
+ # log
+ # notice
+ # warning
+ # error
+
+#log_min_messages = warning # values in order of decreasing detail:
+ # debug5
+ # debug4
+ # debug3
+ # debug2
+ # debug1
+ # info
+ # notice
+ # warning
+ # error
+ # log
+ # fatal
+ # panic
+
+#log_error_verbosity = default # terse, default, or verbose messages
+
+#log_min_error_statement = error # values in order of decreasing detail:
+ # debug5
+ # debug4
+ # debug3
+ # debug2
+ # debug1
+ # info
+ # notice
+ # warning
+ # error
+ # log
+ # fatal
+ # panic (effectively off)
+
+#log_min_duration_statement = -1 # -1 is disabled, 0 logs all statements
+ # and their durations, > 0 logs only
+ # statements running at least this number
+ # of milliseconds
+
+
+# - What to Log -
+
+#debug_print_parse = off
+#debug_print_rewritten = off
+#debug_print_plan = off
+#debug_pretty_print = on
+#log_checkpoints = off
+#log_connections = off
+#log_disconnections = off
+#log_duration = off
+#log_hostname = off
+#log_line_prefix = '' # special values:
+ # %u = user name
+ # %d = database name
+ # %r = remote host and port
+ # %h = remote host
+ # %p = process ID
+ # %t = timestamp without milliseconds
+ # %m = timestamp with milliseconds
+ # %i = command tag
+ # %c = session ID
+ # %l = session line number
+ # %s = session start timestamp
+ # %v = virtual transaction ID
+ # %x = transaction ID (0 if none)
+ # %q = stop here in non-session
+ # processes
+ # %% = '%'
+ # e.g. '<%u%%%d> '
+#log_lock_waits = off # log lock waits >= deadlock_timeout
+#log_statement = 'none' # none, ddl, mod, all
+#log_temp_files = -1 # log temporary files equal or larger
+ # than the specified size in kilobytes;
+ # -1 disables, 0 logs all temp files
+#log_timezone = unknown # actually, defaults to TZ environment
+ # setting
+
+
+#------------------------------------------------------------------------------
+# RUNTIME STATISTICS
+#------------------------------------------------------------------------------
+
+# - Query/Index Statistics Collector -
+
+#track_activities = on
+#track_counts = on
+#track_functions = none # none, pl, all
+#track_activity_query_size = 1024
+#update_process_title = on
+#stats_temp_directory = 'pg_stat_tmp'
+
+
+# - Statistics Monitoring -
+
+#log_parser_stats = off
+#log_planner_stats = off
+#log_executor_stats = off
+#log_statement_stats = off
+
+
+#------------------------------------------------------------------------------
+# AUTOVACUUM PARAMETERS
+#------------------------------------------------------------------------------
+
+#autovacuum = on # Enable autovacuum subprocess? 'on'
+ # requires track_counts to also be on.
+#log_autovacuum_min_duration = -1 # -1 disables, 0 logs all actions and
+ # their durations, > 0 logs only
+ # actions running at least this number
+ # of milliseconds.
+#autovacuum_max_workers = 3 # max number of autovacuum subprocesses
+#autovacuum_naptime = 1min # time between autovacuum runs
+#autovacuum_vacuum_threshold = 50 # min number of row updates before
+ # vacuum
+#autovacuum_analyze_threshold = 50 # min number of row updates before
+ # analyze
+#autovacuum_vacuum_scale_factor = 0.2 # fraction of table size before vacuum
+#autovacuum_analyze_scale_factor = 0.1 # fraction of table size before analyze
+#autovacuum_freeze_max_age = 200000000 # maximum XID age before forced vacuum
+ # (change requires restart)
+#autovacuum_vacuum_cost_delay = 20ms # default vacuum cost delay for
+ # autovacuum, in milliseconds;
+ # -1 means use vacuum_cost_delay
+#autovacuum_vacuum_cost_limit = -1 # default vacuum cost limit for
+ # autovacuum, -1 means use
+ # vacuum_cost_limit
+
+
+#------------------------------------------------------------------------------
+# CLIENT CONNECTION DEFAULTS
+#------------------------------------------------------------------------------
+
+# - Statement Behavior -
+
+#search_path = '"$user",public' # schema names
+#default_tablespace = '' # a tablespace name, '' uses the default
+#temp_tablespaces = '' # a list of tablespace names, '' uses
+ # only default tablespace
+#check_function_bodies = on
+#default_transaction_isolation = 'read committed'
+#default_transaction_read_only = off
+#session_replication_role = 'origin'
+#statement_timeout = 0 # in milliseconds, 0 is disabled
+#vacuum_freeze_min_age = 50000000
+#vacuum_freeze_table_age = 150000000
+#xmlbinary = 'base64'
+#xmloption = 'content'
+
+# - Locale and Formatting -
+
+datestyle = 'iso, mdy'
+#intervalstyle = 'postgres'
+#timezone = unknown # actually, defaults to TZ environment
+ # setting
+#timezone_abbreviations = 'Default' # Select the set of available time zone
+ # abbreviations. Currently, there are
+ # Default
+ # Australia
+ # India
+ # You can create your own file in
+ # share/timezonesets/.
+#extra_float_digits = 0 # min -15, max 2
+#client_encoding = sql_ascii # actually, defaults to database
+ # encoding
+
+# These settings are initialized by initdb, but they can be changed.
+lc_messages = 'en_US.UTF-8' # locale for system error message
+ # strings
+lc_monetary = 'en_US.UTF-8' # locale for monetary formatting
+lc_numeric = 'en_US.UTF-8' # locale for number formatting
+lc_time = 'en_US.UTF-8' # locale for time formatting
+
+# default configuration for text search
+default_text_search_config = 'pg_catalog.english'
+
+# - Other Defaults -
+
+#dynamic_library_path = '$libdir'
+#local_preload_libraries = ''
+
+
+#------------------------------------------------------------------------------
+# LOCK MANAGEMENT
+#------------------------------------------------------------------------------
+
+#deadlock_timeout = 1s
+#max_locks_per_transaction = 64 # min 10
+ # (change requires restart)
+# Note: Each lock table slot uses ~270 bytes of shared memory, and there are
+# max_locks_per_transaction * (max_connections + max_prepared_transactions)
+# lock table slots.
+
+
+#------------------------------------------------------------------------------
+# VERSION/PLATFORM COMPATIBILITY
+#------------------------------------------------------------------------------
+
+# - Previous PostgreSQL Versions -
+
+#add_missing_from = off
+#array_nulls = on
+#backslash_quote = safe_encoding # on, off, or safe_encoding
+#default_with_oids = off
+#escape_string_warning = on
+#regex_flavor = advanced # advanced, extended, or basic
+#sql_inheritance = on
+#standard_conforming_strings = off
+#synchronize_seqscans = on
+
+# - Other Platforms and Clients -
+
+#transform_null_equals = off
+
+
+#------------------------------------------------------------------------------
+# CUSTOMIZED OPTIONS
+#------------------------------------------------------------------------------
+
+#custom_variable_classes = '' # list of custom variable class names
+
--- /dev/null
+++ b/aws/rc.local
@@ -1,1 +1,14 @@
+#!/bin/sh
+#
+# This script will be executed *after* all the other init scripts.
+# You can put your own initialization stuff in here if you don't
+# want to do the full Sys V style init stuff.
+touch /var/lock/subsys/local
+cd /tmp
+rm -rfv busui
+git clone http://maxious.lambdacomplex.org/busui/git
+sh busui/aws/awsStartup.sh
+
+
+
Binary files /dev/null and b/css/images/113-navigation.png differ
Binary files /dev/null and b/css/images/91-beaker-2.png differ
Binary files /dev/null and b/css/images/ajax-loader.png differ
Binary files /dev/null and b/css/images/form-check-off.png differ
Binary files /dev/null and b/css/images/form-check-on.png differ
Binary files /dev/null and b/css/images/form-radio-off.png differ
Binary files /dev/null and b/css/images/form-radio-on.png differ
Binary files /dev/null and b/css/images/icon-search-black.png differ
Binary files /dev/null and b/css/images/icons-18-black.png differ
Binary files /dev/null and b/css/images/icons-18-white.png differ
Binary files /dev/null and b/css/images/icons-36-black.png differ
Binary files /dev/null and b/css/images/icons-36-white.png differ
Binary files /dev/null and b/css/images/time.png differ
Binary files /dev/null and b/css/images/ui-bg_diagonals-thick_18_b81900_40x40.png differ
Binary files /dev/null and b/css/images/ui-bg_diagonals-thick_20_666666_40x40.png differ
Binary files /dev/null and b/css/images/ui-bg_flat_10_000000_40x100.png differ
Binary files /dev/null and b/css/images/ui-bg_glass_100_f6f6f6_1x400.png differ
Binary files /dev/null and b/css/images/ui-bg_glass_100_fdf5ce_1x400.png differ
Binary files /dev/null and b/css/images/ui-bg_glass_65_ffffff_1x400.png differ
Binary files /dev/null and b/css/images/ui-bg_gloss-wave_35_f6a828_500x100.png differ
Binary files /dev/null and b/css/images/ui-bg_highlight-soft_100_eeeeee_1x100.png differ
Binary files /dev/null and b/css/images/ui-bg_highlight-soft_75_ffe45c_1x100.png differ
Binary files /dev/null and b/css/images/ui-icons_222222_256x240.png differ
Binary files /dev/null and b/css/images/ui-icons_228ef1_256x240.png differ
Binary files /dev/null and b/css/images/ui-icons_ef8c08_256x240.png differ
Binary files /dev/null and b/css/images/ui-icons_ffd27a_256x240.png differ
Binary files /dev/null and b/css/images/ui-icons_ffffff_256x240.png differ
Binary files /dev/null and b/css/images/warning.png differ
--- /dev/null
+++ b/css/jquery-ui-1.8.12.custom.css
@@ -1,1 +1,348 @@
-
+/*
+ * jQuery UI CSS Framework 1.8.12
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Theming/API
+ */
+
+/* Layout helpers
+----------------------------------*/
+.ui-helper-hidden { display: none; }
+.ui-helper-hidden-accessible { position: absolute !important; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); }
+.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; }
+.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; }
+.ui-helper-clearfix { display: inline-block; }
+/* required comment for clearfix to work in Opera \*/
+* html .ui-helper-clearfix { height:1%; }
+.ui-helper-clearfix { display:block; }
+/* end clearfix */
+.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); }
+
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-disabled { cursor: default !important; }
+
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Overlays */
+.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; }
+
+
+/*
+ * jQuery UI CSS Framework 1.8.12
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Theming/API
+ *
+ * To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Trebuchet%20MS,%20Tahoma,%20Verdana,%20Arial,%20sans-serif&fwDefault=bold&fsDefault=1.1em&cornerRadius=4px&bgColorHeader=f6a828&bgTextureHeader=12_gloss_wave.png&bgImgOpacityHeader=35&borderColorHeader=e78f08&fcHeader=ffffff&iconColorHeader=ffffff&bgColorContent=eeeeee&bgTextureContent=03_highlight_soft.png&bgImgOpacityContent=100&borderColorContent=dddddd&fcContent=333333&iconColorContent=222222&bgColorDefault=f6f6f6&bgTextureDefault=02_glass.png&bgImgOpacityDefault=100&borderColorDefault=cccccc&fcDefault=1c94c4&iconColorDefault=ef8c08&bgColorHover=fdf5ce&bgTextureHover=02_glass.png&bgImgOpacityHover=100&borderColorHover=fbcb09&fcHover=c77405&iconColorHover=ef8c08&bgColorActive=ffffff&bgTextureActive=02_glass.png&bgImgOpacityActive=65&borderColorActive=fbd850&fcActive=eb8f00&iconColorActive=ef8c08&bgColorHighlight=ffe45c&bgTextureHighlight=03_highlight_soft.png&bgImgOpacityHighlight=75&borderColorHighlight=fed22f&fcHighlight=363636&iconColorHighlight=228ef1&bgColorError=b81900&bgTextureError=08_diagonals_thick.png&bgImgOpacityError=18&borderColorError=cd0a0a&fcError=ffffff&iconColorError=ffd27a&bgColorOverlay=666666&bgTextureOverlay=08_diagonals_thick.png&bgImgOpacityOverlay=20&opacityOverlay=50&bgColorShadow=000000&bgTextureShadow=01_flat.png&bgImgOpacityShadow=10&opacityShadow=20&thicknessShadow=5px&offsetTopShadow=-5px&offsetLeftShadow=-5px&cornerRadiusShadow=5px
+ */
+
+
+/* Component containers
+----------------------------------*/
+.ui-widget { font-family: Trebuchet MS, Tahoma, Verdana, Arial, sans-serif; font-size: 1.1em; }
+.ui-widget .ui-widget { font-size: 1em; }
+.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Trebuchet MS, Tahoma, Verdana, Arial, sans-serif; font-size: 1em; }
+.ui-widget-content { border: 1px solid #dddddd; background: #eeeeee url(images/ui-bg_highlight-soft_100_eeeeee_1x100.png) 50% top repeat-x; color: #333333; }
+.ui-widget-content a { color: #333333; }
+.ui-widget-header { border: 1px solid #e78f08; background: #f6a828 url(images/ui-bg_gloss-wave_35_f6a828_500x100.png) 50% 50% repeat-x; color: #ffffff; font-weight: bold; }
+.ui-widget-header a { color: #ffffff; }
+
+/* Interaction states
+----------------------------------*/
+.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #cccccc; background: #f6f6f6 url(images/ui-bg_glass_100_f6f6f6_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #1c94c4; }
+.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #1c94c4; text-decoration: none; }
+.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #fbcb09; background: #fdf5ce url(images/ui-bg_glass_100_fdf5ce_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #c77405; }
+.ui-state-hover a, .ui-state-hover a:hover { color: #c77405; text-decoration: none; }
+.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #fbd850; background: #ffffff url(images/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #eb8f00; }
+.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #eb8f00; text-decoration: none; }
+.ui-widget :active { outline: none; }
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #fed22f; background: #ffe45c url(images/ui-bg_highlight-soft_75_ffe45c_1x100.png) 50% top repeat-x; color: #363636; }
+.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636; }
+.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a; background: #b81900 url(images/ui-bg_diagonals-thick_18_b81900_40x40.png) 50% 50% repeat; color: #ffffff; }
+.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #ffffff; }
+.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #ffffff; }
+.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; }
+.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; }
+.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; }
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png); }
+.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); }
+.ui-widget-header .ui-icon {background-image: url(images/ui-icons_ffffff_256x240.png); }
+.ui-state-default .ui-icon { background-image: url(images/ui-icons_ef8c08_256x240.png); }
+.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_ef8c08_256x240.png); }
+.ui-state-active .ui-icon {background-image: url(images/ui-icons_ef8c08_256x240.png); }
+.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_228ef1_256x240.png); }
+.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_ffd27a_256x240.png); }
+
+/* positioning */
+.ui-icon-carat-1-n { background-position: 0 0; }
+.ui-icon-carat-1-ne { background-position: -16px 0; }
+.ui-icon-carat-1-e { background-position: -32px 0; }
+.ui-icon-carat-1-se { background-position: -48px 0; }
+.ui-icon-carat-1-s { background-position: -64px 0; }
+.ui-icon-carat-1-sw { background-position: -80px 0; }
+.ui-icon-carat-1-w { background-position: -96px 0; }
+.ui-icon-carat-1-nw { background-position: -112px 0; }
+.ui-icon-carat-2-n-s { background-position: -128px 0; }
+.ui-icon-carat-2-e-w { background-position: -144px 0; }
+.ui-icon-triangle-1-n { background-position: 0 -16px; }
+.ui-icon-triangle-1-ne { background-position: -16px -16px; }
+.ui-icon-triangle-1-e { background-position: -32px -16px; }
+.ui-icon-triangle-1-se { background-position: -48px -16px; }
+.ui-icon-triangle-1-s { background-position: -64px -16px; }
+.ui-icon-triangle-1-sw { background-position: -80px -16px; }
+.ui-icon-triangle-1-w { background-position: -96px -16px; }
+.ui-icon-triangle-1-nw { background-position: -112px -16px; }
+.ui-icon-triangle-2-n-s { background-position: -128px -16px; }
+.ui-icon-triangle-2-e-w { background-position: -144px -16px; }
+.ui-icon-arrow-1-n { background-position: 0 -32px; }
+.ui-icon-arrow-1-ne { background-position: -16px -32px; }
+.ui-icon-arrow-1-e { background-position: -32px -32px; }
+.ui-icon-arrow-1-se { background-position: -48px -32px; }
+.ui-icon-arrow-1-s { background-position: -64px -32px; }
+.ui-icon-arrow-1-sw { background-position: -80px -32px; }
+.ui-icon-arrow-1-w { background-position: -96px -32px; }
+.ui-icon-arrow-1-nw { background-position: -112px -32px; }
+.ui-icon-arrow-2-n-s { background-position: -128px -32px; }
+.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; }
+.ui-icon-arrow-2-e-w { background-position: -160px -32px; }
+.ui-icon-arrow-2-se-nw { background-position: -176px -32px; }
+.ui-icon-arrowstop-1-n { background-position: -192px -32px; }
+.ui-icon-arrowstop-1-e { background-position: -208px -32px; }
+.ui-icon-arrowstop-1-s { background-position: -224px -32px; }
+.ui-icon-arrowstop-1-w { background-position: -240px -32px; }
+.ui-icon-arrowthick-1-n { background-position: 0 -48px; }
+.ui-icon-arrowthick-1-ne { background-position: -16px -48px; }
+.ui-icon-arrowthick-1-e { background-position: -32px -48px; }
+.ui-icon-arrowthick-1-se { background-position: -48px -48px; }
+.ui-icon-arrowthick-1-s { background-position: -64px -48px; }
+.ui-icon-arrowthick-1-sw { background-position: -80px -48px; }
+.ui-icon-arrowthick-1-w { background-position: -96px -48px; }
+.ui-icon-arrowthick-1-nw { background-position: -112px -48px; }
+.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; }
+.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; }
+.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; }
+.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; }
+.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; }
+.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; }
+.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; }
+.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; }
+.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; }
+.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; }
+.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; }
+.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; }
+.ui-icon-arrowreturn-1-w { background-position: -64px -64px; }
+.ui-icon-arrowreturn-1-n { background-position: -80px -64px; }
+.ui-icon-arrowreturn-1-e { background-position: -96px -64px; }
+.ui-icon-arrowreturn-1-s { background-position: -112px -64px; }
+.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; }
+.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; }
+.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; }
+.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; }
+.ui-icon-arrow-4 { background-position: 0 -80px; }
+.ui-icon-arrow-4-diag { background-position: -16px -80px; }
+.ui-icon-extlink { background-position: -32px -80px; }
+.ui-icon-newwin { background-position: -48px -80px; }
+.ui-icon-refresh { background-position: -64px -80px; }
+.ui-icon-shuffle { background-position: -80px -80px; }
+.ui-icon-transfer-e-w { background-position: -96px -80px; }
+.ui-icon-transferthick-e-w { background-position: -112px -80px; }
+.ui-icon-folder-collapsed { background-position: 0 -96px; }
+.ui-icon-folder-open { background-position: -16px -96px; }
+.ui-icon-document { background-position: -32px -96px; }
+.ui-icon-document-b { background-position: -48px -96px; }
+.ui-icon-note { background-position: -64px -96px; }
+.ui-icon-mail-closed { background-position: -80px -96px; }
+.ui-icon-mail-open { background-position: -96px -96px; }
+.ui-icon-suitcase { background-position: -112px -96px; }
+.ui-icon-comment { background-position: -128px -96px; }
+.ui-icon-person { background-position: -144px -96px; }
+.ui-icon-print { background-position: -160px -96px; }
+.ui-icon-trash { background-position: -176px -96px; }
+.ui-icon-locked { background-position: -192px -96px; }
+.ui-icon-unlocked { background-position: -208px -96px; }
+.ui-icon-bookmark { background-position: -224px -96px; }
+.ui-icon-tag { background-position: -240px -96px; }
+.ui-icon-home { background-position: 0 -112px; }
+.ui-icon-flag { background-position: -16px -112px; }
+.ui-icon-calendar { background-position: -32px -112px; }
+.ui-icon-cart { background-position: -48px -112px; }
+.ui-icon-pencil { background-position: -64px -112px; }
+.ui-icon-clock { background-position: -80px -112px; }
+.ui-icon-disk { background-position: -96px -112px; }
+.ui-icon-calculator { background-position: -112px -112px; }
+.ui-icon-zoomin { background-position: -128px -112px; }
+.ui-icon-zoomout { background-position: -144px -112px; }
+.ui-icon-search { background-position: -160px -112px; }
+.ui-icon-wrench { background-position: -176px -112px; }
+.ui-icon-gear { background-position: -192px -112px; }
+.ui-icon-heart { background-position: -208px -112px; }
+.ui-icon-star { background-position: -224px -112px; }
+.ui-icon-link { background-position: -240px -112px; }
+.ui-icon-cancel { background-position: 0 -128px; }
+.ui-icon-plus { background-position: -16px -128px; }
+.ui-icon-plusthick { background-position: -32px -128px; }
+.ui-icon-minus { background-position: -48px -128px; }
+.ui-icon-minusthick { background-position: -64px -128px; }
+.ui-icon-close { background-position: -80px -128px; }
+.ui-icon-closethick { background-position: -96px -128px; }
+.ui-icon-key { background-position: -112px -128px; }
+.ui-icon-lightbulb { background-position: -128px -128px; }
+.ui-icon-scissors { background-position: -144px -128px; }
+.ui-icon-clipboard { background-position: -160px -128px; }
+.ui-icon-copy { background-position: -176px -128px; }
+.ui-icon-contact { background-position: -192px -128px; }
+.ui-icon-image { background-position: -208px -128px; }
+.ui-icon-video { background-position: -224px -128px; }
+.ui-icon-script { background-position: -240px -128px; }
+.ui-icon-alert { background-position: 0 -144px; }
+.ui-icon-info { background-position: -16px -144px; }
+.ui-icon-notice { background-position: -32px -144px; }
+.ui-icon-help { background-position: -48px -144px; }
+.ui-icon-check { background-position: -64px -144px; }
+.ui-icon-bullet { background-position: -80px -144px; }
+.ui-icon-radio-off { background-position: -96px -144px; }
+.ui-icon-radio-on { background-position: -112px -144px; }
+.ui-icon-pin-w { background-position: -128px -144px; }
+.ui-icon-pin-s { background-position: -144px -144px; }
+.ui-icon-play { background-position: 0 -160px; }
+.ui-icon-pause { background-position: -16px -160px; }
+.ui-icon-seek-next { background-position: -32px -160px; }
+.ui-icon-seek-prev { background-position: -48px -160px; }
+.ui-icon-seek-end { background-position: -64px -160px; }
+.ui-icon-seek-start { background-position: -80px -160px; }
+/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */
+.ui-icon-seek-first { background-position: -80px -160px; }
+.ui-icon-stop { background-position: -96px -160px; }
+.ui-icon-eject { background-position: -112px -160px; }
+.ui-icon-volume-off { background-position: -128px -160px; }
+.ui-icon-volume-on { background-position: -144px -160px; }
+.ui-icon-power { background-position: 0 -176px; }
+.ui-icon-signal-diag { background-position: -16px -176px; }
+.ui-icon-signal { background-position: -32px -176px; }
+.ui-icon-battery-0 { background-position: -48px -176px; }
+.ui-icon-battery-1 { background-position: -64px -176px; }
+.ui-icon-battery-2 { background-position: -80px -176px; }
+.ui-icon-battery-3 { background-position: -96px -176px; }
+.ui-icon-circle-plus { background-position: 0 -192px; }
+.ui-icon-circle-minus { background-position: -16px -192px; }
+.ui-icon-circle-close { background-position: -32px -192px; }
+.ui-icon-circle-triangle-e { background-position: -48px -192px; }
+.ui-icon-circle-triangle-s { background-position: -64px -192px; }
+.ui-icon-circle-triangle-w { background-position: -80px -192px; }
+.ui-icon-circle-triangle-n { background-position: -96px -192px; }
+.ui-icon-circle-arrow-e { background-position: -112px -192px; }
+.ui-icon-circle-arrow-s { background-position: -128px -192px; }
+.ui-icon-circle-arrow-w { background-position: -144px -192px; }
+.ui-icon-circle-arrow-n { background-position: -160px -192px; }
+.ui-icon-circle-zoomin { background-position: -176px -192px; }
+.ui-icon-circle-zoomout { background-position: -192px -192px; }
+.ui-icon-circle-check { background-position: -208px -192px; }
+.ui-icon-circlesmall-plus { background-position: 0 -208px; }
+.ui-icon-circlesmall-minus { background-position: -16px -208px; }
+.ui-icon-circlesmall-close { background-position: -32px -208px; }
+.ui-icon-squaresmall-plus { background-position: -48px -208px; }
+.ui-icon-squaresmall-minus { background-position: -64px -208px; }
+.ui-icon-squaresmall-close { background-position: -80px -208px; }
+.ui-icon-grip-dotted-vertical { background-position: 0 -224px; }
+.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; }
+.ui-icon-grip-solid-vertical { background-position: -32px -224px; }
+.ui-icon-grip-solid-horizontal { background-position: -48px -224px; }
+.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; }
+.ui-icon-grip-diagonal-se { background-position: -80px -224px; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Corner radius */
+.ui-corner-tl { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; }
+.ui-corner-tr { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; }
+.ui-corner-bl { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; }
+.ui-corner-br { -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
+.ui-corner-top { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; }
+.ui-corner-bottom { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
+.ui-corner-right { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
+.ui-corner-left { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; }
+.ui-corner-all { -moz-border-radius: 4px; -webkit-border-radius: 4px; border-radius: 4px; }
+
+/* Overlays */
+.ui-widget-overlay { background: #666666 url(images/ui-bg_diagonals-thick_20_666666_40x40.png) 50% 50% repeat; opacity: .50;filter:Alpha(Opacity=50); }
+.ui-widget-shadow { margin: -5px 0 0 -5px; padding: 5px; background: #000000 url(images/ui-bg_flat_10_000000_40x100.png) 50% 50% repeat-x; opacity: .20;filter:Alpha(Opacity=20); -moz-border-radius: 5px; -webkit-border-radius: 5px; border-radius: 5px; }/*
+ * jQuery UI Autocomplete 1.8.12
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Autocomplete#theming
+ */
+.ui-autocomplete { position: absolute; cursor: default; }
+
+/* workarounds */
+* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */
+
+/*
+ * jQuery UI Menu 1.8.12
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Menu#theming
+ */
+.ui-menu {
+ list-style:none;
+ padding: 2px;
+ margin: 0;
+ display:block;
+ float: left;
+}
+.ui-menu .ui-menu {
+ margin-top: -3px;
+}
+.ui-menu .ui-menu-item {
+ margin:0;
+ padding: 0;
+ zoom: 1;
+ float: left;
+ clear: left;
+ width: 100%;
+}
+.ui-menu .ui-menu-item a {
+ text-decoration:none;
+ display:block;
+ padding:.2em .4em;
+ line-height:1.5;
+ zoom:1;
+}
+.ui-menu .ui-menu-item a.ui-state-hover,
+.ui-menu .ui-menu-item a.ui-state-active {
+ font-weight: normal;
+ margin: -1px;
+}
+
--- /dev/null
+++ b/css/jquery.mobile-1.0b1.css
@@ -1,1 +1,1662 @@
-
+/*!
+ * jQuery Mobile v1.0b1
+ * http://jquerymobile.com/
+ *
+ * Copyright 2010, jQuery Project
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ */
+/*
+* jQuery Mobile Framework
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.
+* Note: Code is in draft form and is subject to change
+*/
+
+
+/* A
+-----------------------------------------------------------------------------------------------------------*/
+
+.ui-bar-a {
+ border: 1px solid #2A2A2A;
+ background: #111111;
+ color: #ffffff;
+ font-weight: bold;
+ text-shadow: 0 -1px 1px #000000;
+ background-image: -moz-linear-gradient(top,
+ #3c3c3c,
+ #111111);
+ background-image: -webkit-gradient(linear,left top,left bottom,
+ color-stop(0, #3c3c3c),
+ color-stop(1, #111111));
+ -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#3c3c3c', EndColorStr='#111111')";
+}
+.ui-bar-a,
+.ui-bar-a input,
+.ui-bar-a select,
+.ui-bar-a textarea,
+.ui-bar-a button {
+ font-family: Helvetica, Arial, sans-serif;
+}
+.ui-bar-a .ui-link-inherit {
+ color: #fff;
+}
+.ui-bar-a .ui-link {
+ color: #7cc4e7;
+ font-weight: bold;
+}
+.ui-body-a {
+ border: 1px solid #2A2A2A;
+ background: #222222;
+ color: #fff;
+ text-shadow: 0 1px 0 #000;
+ font-weight: normal;
+ background-image: -moz-linear-gradient(top,
+ #666666,
+ #222222);
+ background-image: -webkit-gradient(linear,left top,left bottom,
+ color-stop(0, #666666),
+ color-stop(1, #222222));
+ -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#666666', EndColorStr='#222222)')";
+}
+.ui-body-a,
+.ui-body-a input,
+.ui-body-a select,
+.ui-body-a textarea,
+.ui-body-a button {
+ font-family: Helvetica, Arial, sans-serif;
+}
+.ui-body-a .ui-link-inherit {
+ color: #fff;
+}
+.ui-body-a .ui-link {
+ color: #2489CE;
+ font-weight: bold;
+}
+.ui-br {
+ border-bottom: rgb(130,130,130);
+ border-bottom: rgba(130,130,130,.3);
+ border-bottom-width: 1px;
+ border-bottom-style: solid;
+}
+.ui-btn-up-a {
+ border: 1px solid #222;
+ background: #333333;
+ font-weight: bold;
+ color: #fff;
+ text-shadow: 0 -1px 1px #000;
+ background-image: -moz-linear-gradient(top,
+ #555555,
+ #333333);
+ background-image: -webkit-gradient(linear,left top,left bottom,
+ color-stop(0, #555555),
+ color-stop(1, #333333));
+ -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#555555', EndColorStr='#333333')";
+}
+.ui-btn-up-a a.ui-link-inherit {
+ color: #fff;
+}
+.ui-btn-hover-a {
+ border: 1px solid #000;
+ background: #444444;
+ font-weight: bold;
+ color: #fff;
+ text-shadow: 0 -1px 1px #000;
+ background-image: -moz-linear-gradient(top,
+ #666666,
+ #444444);
+ background-image: -webkit-gradient(linear,left top,left bottom,
+ color-stop(0, #666666),
+ color-stop(1, #444444));
+ -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#666666', EndColorStr='#444444')";
+}
+.ui-btn-hover-a a.ui-link-inherit {
+ color: #fff;
+}
+.ui-btn-down-a {
+ border: 1px solid #000;
+ background: #3d3d3d;
+ font-weight: bold;
+ color: #fff;
+ text-shadow: 0 -1px 1px #000;
+ background-image: -moz-linear-gradient(top,
+ #333333,
+ #5a5a5a);
+ background-image: -webkit-gradient(linear,left top,left bottom,
+ color-stop(0, #333333),
+ color-stop(1, #5a5a5a));
+ -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#333333', EndColorStr='#5a5a5a')";
+}
+.ui-btn-down-a a.ui-link-inherit {
+ color: #fff;
+}
+.ui-btn-up-a,
+.ui-btn-hover-a,
+.ui-btn-down-a {
+ font-family: Helvetica, Arial, sans-serif;
+ text-decoration: none;
+}
+
+
+/* B
+-----------------------------------------------------------------------------------------------------------*/
+
+.ui-bar-b {
+ border: 1px solid #456f9a;
+ background: #5e87b0;
+ color: #fff;
+ font-weight: bold;
+ text-shadow: 0 -1px 1px #254f7a;
+ background-image: -moz-linear-gradient(top,
+ #81a8ce,
+ #5e87b0);
+ background-image: -webkit-gradient(linear,left top,left bottom,
+ color-stop(0, #81a8ce),
+ color-stop(1, #5e87b0));
+ -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#81a8ce', EndColorStr='#5e87b0')";
+}
+.ui-bar-b,
+.ui-bar-b input,
+.ui-bar-b select,
+.ui-bar-b textarea,
+.ui-bar-b button {
+ font-family: Helvetica, Arial, sans-serif;
+}
+.ui-bar-b .ui-link-inherit {
+ color: #fff;
+}
+.ui-bar-b .ui-link {
+ color: #7cc4e7;
+ font-weight: bold;
+}
+
+.ui-body-b {
+ border: 1px solid #C6C6C6;
+ background: #cccccc;
+ color: #333333;
+ text-shadow: 0 1px 0 #fff;
+ font-weight: normal;
+ background-image: -moz-linear-gradient(top,
+ #e6e6e6,
+ #cccccc);
+ background-image: -webkit-gradient(linear,left top,left bottom,
+ color-stop(0, #e6e6e6),
+ color-stop(1, #cccccc));
+ -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#e6e6e6', EndColorStr='#cccccc')";
+}
+.ui-body-b,
+.ui-body-b input,
+.ui-body-b select,
+.ui-body-b textarea,
+.ui-body-b button {
+ font-family: Helvetica, Arial, sans-serif;
+}
+.ui-body-b .ui-link-inherit {
+ color: #333333;
+}
+.ui-body-b .ui-link {
+ color: #2489CE;
+ font-weight: bold;
+}
+.ui-btn-up-b {
+ border: 1px solid #145072;
+ background: #2567ab;
+ font-weight: bold;
+ color: #fff;
+ text-shadow: 0 -1px 1px #145072;
+ background-image: -moz-linear-gradient(top,
+ #4e89c5,
+ #2567ab);
+ background-image: -webkit-gradient(linear,left top,left bottom,
+ color-stop(0, #5f9cc5),
+ color-stop(1, #396b9e));
+ -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#4e89c5', EndColorStr='#2567ab')";
+}
+.ui-btn-up-b a.ui-link-inherit {
+ color: #fff;
+}
+.ui-btn-hover-b {
+ border: 1px solid #00516e;
+ background: #4b88b6;
+ font-weight: bold;
+ color: #fff;
+ text-shadow: 0 -1px 1px #014D68;
+ background-image: -moz-linear-gradient(top,
+ #72b0d4,
+ #4b88b6);
+ background-image: -webkit-gradient(linear,left top,left bottom,
+ color-stop(0, #72b0d4),
+ color-stop(1, #4b88b6));
+ -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#72b0d4', EndColorStr='#4b88b6')";
+}
+.ui-btn-hover-b a.ui-link-inherit {
+ color: #fff;
+}
+.ui-btn-down-b {
+ border: 1px solid #225377;
+ background: #4e89c5;
+ font-weight: bold;
+ color: #fff;
+ text-shadow: 0 -1px 1px #225377;
+ background-image: -moz-linear-gradient(top,
+ #396b9e,
+ #4e89c5);
+ background-image: -webkit-gradient(linear,left top,left bottom,
+ color-stop(0, #396b9e),
+ color-stop(1, #4e89c5));
+ -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#396b9e', EndColorStr='#4e89c5')";
+}
+.ui-btn-down-b a.ui-link-inherit {
+ color: #fff;
+}
+.ui-btn-up-b,
+.ui-btn-hover-b,
+.ui-btn-down-b {
+ font-family: Helvetica, Arial, sans-serif;
+ text-decoration: none;
+}
+
+
+/* C
+-----------------------------------------------------------------------------------------------------------*/
+
+.ui-bar-c {
+ border: 1px solid #B3B3B3;
+ background: #e9eaeb;
+ color: #3E3E3E;
+ font-weight: bold;
+ text-shadow: 0 1px 1px #fff;
+ background-image: -moz-linear-gradient(top,
+ #f0f0f0,
+ #e9eaeb);
+ background-image: -webkit-gradient(linear,left top,left bottom,
+ color-stop(0, #f0f0f0),
+ color-stop(1, #e9eaeb));
+ -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#f0f0f0', EndColorStr='#e9eaeb')";
+}
+.ui-bar-c,
+.ui-bar-c input,
+.ui-bar-c select,
+.ui-bar-c textarea,
+.ui-bar-c button {
+ font-family: Helvetica, Arial, sans-serif;
+}
+.ui-body-c {
+ border: 1px solid #B3B3B3;
+ color: #333333;
+ text-shadow: 0 1px 0 #fff;
+ background: #f0f0f0;
+ background-image: -moz-linear-gradient(top,
+ #eeeeee,
+ #dddddd);
+ background-image: -webkit-gradient(linear,left top,left bottom,
+ color-stop(0, #eeeeee),
+ color-stop(1, #dddddd));
+ -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#eeeeee', EndColorStr='#dddddd')";
+}
+.ui-body-c,
+.ui-body-c input,
+.ui-body-c select,
+.ui-body-c textarea,
+.ui-body-c button {
+ font-family: Helvetica, Arial, sans-serif;
+}
+.ui-body-c .ui-link-inherit {
+ color: #333333;
+}
+.ui-body-c .ui-link {
+ color: #2489CE;
+ font-weight: bold;
+}
+
+.ui-btn-up-c {
+ border: 1px solid #ccc;
+ background: #eee;
+ font-weight: bold;
+ color: #444;
+ text-shadow: 0 1px 1px #f6f6f6;
+ background-image: -moz-linear-gradient(top,
+ #fefefe,
+ #eeeeee);
+ background-image: -webkit-gradient(linear,left top,left bottom,
+ color-stop(0, #fdfdfd),
+ color-stop(1, #eeeeee));
+ -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#fdfdfd', EndColorStr='#eeeeee')";
+}
+.ui-btn-up-c a.ui-link-inherit {
+ color: #2F3E46;
+}
+
+.ui-btn-hover-c {
+ border: 1px solid #bbb;
+ background: #dadada;
+ font-weight: bold;
+ color: #101010;
+ text-shadow: 0 1px 1px #fff;
+ background-image: -moz-linear-gradient(top,
+ #ededed,
+ #dadada);
+ background-image: -webkit-gradient(linear,left top,left bottom,
+ color-stop(0, #ededed),
+ color-stop(1, #dadada));
+ -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#ededed', EndColorStr='#dadada')";
+}
+.ui-btn-hover-c a.ui-link-inherit {
+ color: #2F3E46;
+}
+.ui-btn-down-c {
+ border: 1px solid #808080;
+ background: #fdfdfd;
+ font-weight: bold;
+ color: #111111;
+ text-shadow: 0 1px 1px #ffffff;
+ background-image: -moz-linear-gradient(top,
+ #eeeeee,
+ #fdfdfd);
+ background-image: -webkit-gradient(linear,left top,left bottom,
+ color-stop(0, #eeeeee),
+ color-stop(1, #fdfdfd));
+ -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#eeeeee', EndColorStr='#fdfdfd')";
+}
+.ui-btn-down-c a.ui-link-inherit {
+ color: #2F3E46;
+}
+.ui-btn-up-c,
+.ui-btn-hover-c,
+.ui-btn-down-c {
+ font-family: Helvetica, Arial, sans-serif;
+ text-decoration: none;
+}
+
+
+/* D
+-----------------------------------------------------------------------------------------------------------*/
+
+.ui-bar-d {
+ border: 1px solid #ccc;
+ background: #bbb;
+ color: #333;
+ text-shadow: 0 1px 0 #eee;
+ background-image: -moz-linear-gradient(top,
+ #ddd,
+ #bbb);
+ background-image: -webkit-gradient(linear,left top,left bottom,
+ color-stop(0, #ddd),
+ color-stop(1, #bbb));
+ -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#dddddd', EndColorStr='#bbbbbb')";
+}
+.ui-bar-d,
+.ui-bar-d input,
+.ui-bar-d select,
+.ui-bar-d textarea,
+.ui-bar-d button {
+ font-family: Helvetica, Arial, sans-serif;
+}
+.ui-bar-d .ui-link-inherit {
+ color: #333;
+}
+.ui-bar-d .ui-link {
+ color: #2489CE;
+ font-weight: bold;
+}
+.ui-body-d {
+ border: 1px solid #ccc;
+ color: #333333;
+ text-shadow: 0 1px 0 #fff;
+ background: #ffffff;
+}
+.ui-body-d,
+.ui-body-d input,
+.ui-body-d select,
+.ui-body-d textarea,
+.ui-body-d button {
+ font-family: Helvetica, Arial, sans-serif;
+}
+.ui-body-d .ui-link-inherit {
+ color: #333333;
+}
+.ui-body-d .ui-link {
+ color: #2489CE;
+ font-weight: bold;
+}
+.ui-btn-up-d {
+ border: 1px solid #ccc;
+ background: #fff;
+ font-weight: bold;
+ color: #444;
+ text-shadow: 0 1px 1px #fff;
+}
+.ui-btn-up-d a.ui-link-inherit {
+ color: #333;
+}
+.ui-btn-hover-d {
+ border: 1px solid #aaa;
+ background: #eeeeee;
+ font-weight: bold;
+ color: #222;
+ cursor: pointer;
+ text-shadow: 0 1px 1px #fff;
+ background-image: -moz-linear-gradient(top,
+ #fdfdfd,
+ #eeeeee);
+ background-image: -webkit-gradient(linear,left top,left bottom,
+ color-stop(0, #fdfdfd),
+ color-stop(1, #eeeeee));
+ -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#fdfdfd', EndColorStr='#eeeeee')";
+}
+.ui-btn-hover-d a.ui-link-inherit {
+ color: #222;
+}
+.ui-btn-down-d {
+ border: 1px solid #aaaaaa;
+ background: #ffffff;
+ font-weight: bold;
+ color: #111;
+ text-shadow: 0 1px 1px #ffffff;
+ background-image: -moz-linear-gradient(top,
+ #eeeeee,
+ #ffffff);
+ background-image: -webkit-gradient(linear,left top,left bottom,
+ color-stop(0, #eeeeee),
+ color-stop(1, #ffffff));
+ -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#eeeeee', EndColorStr='#ffffff')";
+}
+.ui-btn-down-d a.ui-link-inherit {
+ color: #111;
+}
+.ui-btn-up-d,
+.ui-btn-hover-d,
+.ui-btn-down-d {
+ font-family: Helvetica, Arial, sans-serif;
+ text-decoration: none;
+}
+
+
+/* E
+-----------------------------------------------------------------------------------------------------------*/
+
+.ui-bar-e {
+ border: 1px solid #F7C942;
+ background: #fadb4e;
+ color: #333;
+ text-shadow: 0 1px 0 #fff;
+ background-image: -moz-linear-gradient(top,
+ #fceda7,
+ #fadb4e);
+ background-image: -webkit-gradient(linear,left top,left bottom,
+ color-stop(0, #fceda7),
+ color-stop(1, #fadb4e));
+ -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#fceda7', EndColorStr='#fadb4e')";
+}
+.ui-bar-e,
+.ui-bar-e input,
+.ui-bar-e select,
+.ui-bar-e textarea,
+.ui-bar-d button {
+ font-family: Helvetica, Arial, sans-serif;
+}
+.ui-bar-e .ui-link-inherit {
+ color: #333;
+}
+.ui-bar-e .ui-link {
+ color: #2489CE;
+ font-weight: bold;
+}
+.ui-body-e {
+ border: 1px solid #F7C942;
+ color: #333333;
+ text-shadow: 0 1px 0 #fff;
+ background: #faeb9e;
+ background-image: -moz-linear-gradient(top,
+ #fff,
+ #faeb9e);
+ background-image: -webkit-gradient(linear,left top,left bottom,
+ color-stop(0, #fff),
+ color-stop(1, #faeb9e));
+ -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#ffffff', EndColorStr='#faeb9e')";
+}
+.ui-body-e,
+.ui-body-e input,
+.ui-body-e select,
+.ui-body-e textarea,
+.ui-body-e button {
+ font-family: Helvetica, Arial, sans-serif;
+}
+.ui-body-e .ui-link-inherit {
+ color: #333333;
+}
+.ui-body-e .ui-link {
+ color: #2489CE;
+ font-weight: bold;
+}
+.ui-btn-up-e {
+ border: 1px solid #F7C942;
+ background: #fadb4e;
+ font-weight: bold;
+ color: #333;
+ text-shadow: 0 1px 0 #fff;
+ background-image: -moz-linear-gradient(top,
+ #fceda7,
+ #fadb4e);
+ background-image: -webkit-gradient(linear,left top,left bottom,
+ color-stop(0, #fceda7),
+ color-stop(1, #fadb4e));
+ -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#fceda7', EndColorStr='#fadb4e')";
+}
+.ui-btn-up-e a.ui-link-inherit {
+ color: #333;
+}
+.ui-btn-hover-e {
+ border: 1px solid #e79952;
+ background: #fbe26f;
+ font-weight: bold;
+ color: #111;
+ text-shadow: 0 1px 1px #fff;
+ background-image: -moz-linear-gradient(top,
+ #fcf0b5,
+ #fbe26f);
+ background-image: -webkit-gradient(linear,left top,left bottom,
+ color-stop(0, #fcf0b5),
+ color-stop(1, #fbe26f));
+ -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#fcf0b5', EndColorStr='#fbe26f')";
+}
+
+.ui-btn-hover-e a.ui-link-inherit {
+ color: #333;
+}
+.ui-btn-down-e {
+ border: 1px solid #F7C942;
+ background: #fceda7;
+ font-weight: bold;
+ color: #111;
+ text-shadow: 0 1px 1px #ffffff;
+ background-image: -moz-linear-gradient(top,
+ #fadb4e,
+ #fceda7);
+ background-image: -webkit-gradient(linear,left top,left bottom,
+ color-stop(0, #fadb4e),
+ color-stop(1, #fceda7));
+ -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#fadb4e', EndColorStr='#fceda7')";
+}
+.ui-btn-down-e a.ui-link-inherit {
+ color: #333;
+}
+.ui-btn-up-e,
+.ui-btn-hover-e,
+.ui-btn-down-e {
+ font-family: Helvetica, Arial, sans-serif;
+ text-decoration: none;
+}
+
+
+/* links within "buttons"
+-----------------------------------------------------------------------------------------------------------*/
+
+a.ui-link-inherit {
+ text-decoration: none !important;
+}
+
+
+/* Active class used as the "on" state across all themes
+-----------------------------------------------------------------------------------------------------------*/
+
+.ui-btn-active {
+ border: 1px solid #155678;
+ background: #4596ce;
+ font-weight: bold;
+ color: #fff;
+ cursor: pointer;
+ text-shadow: 0 -1px 1px #145072;
+ text-decoration: none;
+ background-image: -moz-linear-gradient(top,
+ #85bae4,
+ #5393c5);
+ background-image: -webkit-gradient(linear,left top,left bottom,
+ color-stop(0, #85bae4),
+ color-stop(1, #5393c5));
+ -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#85bae4', EndColorStr='#5393c5')";
+ outline: none;
+}
+.ui-btn-active a.ui-link-inherit {
+ color: #fff;
+}
+
+
+/* button inner top highlight
+-----------------------------------------------------------------------------------------------------------*/
+
+.ui-btn-inner {
+ border-top: 1px solid #fff;
+ border-color: rgba(255,255,255,.3);
+}
+
+
+/* corner rounding classes
+-----------------------------------------------------------------------------------------------------------*/
+
+.ui-corner-tl {
+ -moz-border-radius-topleft: .6em;
+ -webkit-border-top-left-radius: .6em;
+ border-top-left-radius: .6em;
+}
+.ui-corner-tr {
+ -moz-border-radius-topright: .6em;
+ -webkit-border-top-right-radius: .6em;
+ border-top-right-radius: .6em;
+}
+.ui-corner-bl {
+ -moz-border-radius-bottomleft: .6em;
+ -webkit-border-bottom-left-radius: .6em;
+ border-bottom-left-radius: .6em;
+}
+.ui-corner-br {
+ -moz-border-radius-bottomright: .6em;
+ -webkit-border-bottom-right-radius: .6em;
+ border-bottom-right-radius: .6em;
+}
+.ui-corner-top {
+ -moz-border-radius-topleft: .6em;
+ -webkit-border-top-left-radius: .6em;
+ border-top-left-radius: .6em;
+ -moz-border-radius-topright: .6em;
+ -webkit-border-top-right-radius: .6em;
+ border-top-right-radius: .6em;
+}
+.ui-corner-bottom {
+ -moz-border-radius-bottomleft: .6em;
+ -webkit-border-bottom-left-radius: .6em;
+ border-bottom-left-radius: .6em;
+ -moz-border-radius-bottomright: .6em;
+ -webkit-border-bottom-right-radius: .6em;
+ border-bottom-right-radius: .6em;
+ }
+.ui-corner-right {
+ -moz-border-radius-topright: .6em;
+ -webkit-border-top-right-radius: .6em;
+ border-top-right-radius: .6em;
+ -moz-border-radius-bottomright: .6em;
+ -webkit-border-bottom-right-radius: .6em;
+ border-bottom-right-radius: .6em;
+}
+.ui-corner-left {
+ -moz-border-radius-topleft: .6em;
+ -webkit-border-top-left-radius: .6em;
+ border-top-left-radius: .6em;
+ -moz-border-radius-bottomleft: .6em;
+ -webkit-border-bottom-left-radius: .6em;
+ border-bottom-left-radius: .6em;
+}
+.ui-corner-all {
+ -moz-border-radius: .6em;
+ -webkit-border-radius: .6em;
+ border-radius: .6em;
+}
+
+
+
+/* Interaction cues
+-----------------------------------------------------------------------------------------------------------*/
+.ui-disabled {
+ opacity: .3;
+}
+.ui-disabled,
+.ui-disabled a {
+ cursor: default;
+}
+
+/* Icons
+-----------------------------------------------------------------------------------------------------------*/
+
+.ui-icon {
+ background: #666;
+ background: rgba(0,0,0,.4);
+ background-image: url(images/icons-18-white.png);
+ background-repeat: no-repeat;
+ -moz-border-radius: 9px;
+ -webkit-border-radius: 9px;
+ border-radius: 9px;
+}
+
+
+/* Alt icon color
+-----------------------------------------------------------------------------------------------------------*/
+
+.ui-icon-alt {
+ background: #fff;
+ background: rgba(255,255,255,.3);
+ background-image: url(images/icons-18-black.png);
+ background-repeat: no-repeat;
+}
+
+/* HD/"retina" sprite
+-----------------------------------------------------------------------------------------------------------*/
+
+@media only screen and (-webkit-min-device-pixel-ratio: 1.5),
+ only screen and (min--moz-device-pixel-ratio: 1.5),
+ only screen and (min-resolution: 240dpi) {
+
+ .ui-icon-plus, .ui-icon-minus, .ui-icon-delete, .ui-icon-arrow-r,
+ .ui-icon-arrow-l, .ui-icon-arrow-u, .ui-icon-arrow-d, .ui-icon-check,
+ .ui-icon-gear, .ui-icon-refresh, .ui-icon-forward, .ui-icon-back,
+ .ui-icon-grid, .ui-icon-star, .ui-icon-alert, .ui-icon-info, .ui-icon-home, .ui-icon-search,
+ .ui-icon-checkbox-off, .ui-icon-checkbox-on, .ui-icon-radio-off, .ui-icon-radio-on {
+ background-image: url(images/icons-36-white.png);
+ -moz-background-size: 776px 18px;
+ -o-background-size: 776px 18px;
+ -webkit-background-size: 776px 18px;
+ background-size: 776px 18px;
+ }
+ .ui-icon-alt {
+ background-image: url(images/icons-36-black.png);
+ }
+}
+
+/* plus minus */
+.ui-icon-plus {
+ background-position: -0 50%;
+}
+.ui-icon-minus {
+ background-position: -36px 50%;
+}
+
+/* delete/close */
+.ui-icon-delete {
+ background-position: -72px 50%;
+}
+
+/* arrows */
+.ui-icon-arrow-r {
+ background-position: -108px 50%;
+}
+.ui-icon-arrow-l {
+ background-position: -144px 50%;
+}
+.ui-icon-arrow-u {
+ background-position: -180px 50%;
+}
+.ui-icon-arrow-d {
+ background-position: -216px 50%;
+}
+
+/* misc */
+.ui-icon-check {
+ background-position: -252px 50%;
+}
+.ui-icon-gear {
+ background-position: -288px 50%;
+}
+.ui-icon-refresh {
+ background-position: -324px 50%;
+}
+.ui-icon-forward {
+ background-position: -360px 50%;
+}
+.ui-icon-back {
+ background-position: -396px 50%;
+}
+.ui-icon-grid {
+ background-position: -432px 50%;
+}
+.ui-icon-star {
+ background-position: -468px 50%;
+}
+.ui-icon-alert {
+ background-position: -504px 50%;
+}
+.ui-icon-info {
+ background-position: -540px 50%;
+}
+.ui-icon-home {
+ background-position: -576px 50%;
+}
+.ui-icon-search {
+ background-position: -612px 50%;
+}
+.ui-icon-checkbox-off {
+ background-position: -684px 50%;
+}
+.ui-icon-checkbox-on {
+ background-position: -648px 50%;
+}
+.ui-icon-radio-off {
+ background-position: -756px 50%;
+}
+.ui-icon-radio-on {
+ background-position: -720px 50%;
+}
+
+
+/* checks,radios */
+.ui-icon-checkbox-off,
+.ui-icon-checkbox-on,
+.ui-icon-radio-off,
+.ui-icon-radio-on {
+ background-color: transparent;
+ -moz-border-radius: 0;
+ -webkit-border-radius: 0;
+ border-radius: 0;
+}
+.ui-icon-searchfield {
+ background-image: url(images/icon-search-black.png);
+ background-size: 16px 16px;
+}
+
+/* loading icon */
+.ui-icon-loading {
+ background-image: url(images/ajax-loader.png);
+ width: 40px;
+ height: 40px;
+ -moz-border-radius: 20px;
+ -webkit-border-radius: 20px;
+ border-radius: 20px;
+ background-size: 35px 35px;
+}
+
+
+/* Button corner classes
+-----------------------------------------------------------------------------------------------------------*/
+
+.ui-btn-corner-tl {
+ -moz-border-radius-topleft: 1em;
+ -webkit-border-top-left-radius: 1em;
+ border-top-left-radius: 1em;
+}
+.ui-btn-corner-tr {
+ -moz-border-radius-topright: 1em;
+ -webkit-border-top-right-radius: 1em;
+ border-top-right-radius: 1em;
+}
+.ui-btn-corner-bl {
+ -moz-border-radius-bottomleft: 1em;
+ -webkit-border-bottom-left-radius: 1em;
+ border-bottom-left-radius: 1em;
+}
+.ui-btn-corner-br {
+ -moz-border-radius-bottomright: 1em;
+ -webkit-border-bottom-right-radius: 1em;
+ border-bottom-right-radius: 1em;
+}
+.ui-btn-corner-top {
+ -moz-border-radius-topleft: 1em;
+ -webkit-border-top-left-radius: 1em;
+ border-top-left-radius: 1em;
+ -moz-border-radius-topright: 1em;
+ -webkit-border-top-right-radius: 1em;
+ border-top-right-radius: 1em;
+}
+.ui-btn-corner-bottom {
+ -moz-border-radius-bottomleft: 1em;
+ -webkit-border-bottom-left-radius: 1em;
+ border-bottom-left-radius: 1em;
+ -moz-border-radius-bottomright: 1em;
+ -webkit-border-bottom-right-radius: 1em;
+ border-bottom-right-radius: 1em;
+}
+.ui-btn-corner-right {
+ -moz-border-radius-topright: 1em;
+ -webkit-border-top-right-radius: 1em;
+ border-top-right-radius: 1em;
+ -moz-border-radius-bottomright: 1em;
+ -webkit-border-bottom-right-radius: 1em;
+ border-bottom-right-radius: 1em;
+}
+.ui-btn-corner-left {
+ -moz-border-radius-topleft: 1em;
+ -webkit-border-top-left-radius: 1em;
+ border-top-left-radius: 1em;
+ -moz-border-radius-bottomleft: 1em;
+ -webkit-border-bottom-left-radius: 1em;
+ border-bottom-left-radius: 1em;
+}
+.ui-btn-corner-all {
+ -moz-border-radius: 1em;
+ -webkit-border-radius: 1em;
+ border-radius: 1em;
+}
+
+/* radius clip workaround for cleaning up corner trapping */
+.ui-corner-tl,
+.ui-corner-tr,
+.ui-corner-bl,
+.ui-corner-br,
+.ui-corner-top,
+.ui-corner-bottom,
+.ui-corner-right,
+.ui-corner-left,
+.ui-corner-all,
+.ui-btn-corner-tl,
+.ui-btn-corner-tr,
+.ui-btn-corner-bl,
+.ui-btn-corner-br,
+.ui-btn-corner-top,
+.ui-btn-corner-bottom,
+.ui-btn-corner-right,
+.ui-btn-corner-left,
+.ui-btn-corner-all {
+ -webkit-background-clip: padding-box;
+ -moz-background-clip: padding-box;
+ background-clip: padding-box;
+}
+
+/* Overlay / modal
+-----------------------------------------------------------------------------------------------------------*/
+
+.ui-overlay {
+ background: #666;
+ opacity: .5;
+ filter: Alpha(Opacity=50);
+ position: absolute;
+ width: 100%;
+ height: 100%;
+}
+.ui-overlay-shadow {
+ -moz-box-shadow: 0px 0px 12px rgba(0,0,0,.6);
+ -webkit-box-shadow: 0px 0px 12px rgba(0,0,0,.6);
+ box-shadow: 0px 0px 12px rgba(0,0,0,.6);
+}
+.ui-shadow {
+ -moz-box-shadow: 0px 1px 4px rgba(0,0,0,.3);
+ -webkit-box-shadow: 0px 1px 4px rgba(0,0,0,.3);
+ box-shadow: 0px 1px 4px rgba(0,0,0,.3);
+}
+.ui-bar-a .ui-shadow,
+.ui-bar-b .ui-shadow ,
+.ui-bar-c .ui-shadow {
+ -moz-box-shadow: 0px 1px 0 rgba(255,255,255,.3);
+ -webkit-box-shadow: 0px 1px 0 rgba(255,255,255,.3);
+ box-shadow: 0px 1px 0 rgba(255,255,255,.3);
+}
+.ui-shadow-inset {
+ -moz-box-shadow: inset 0px 1px 4px rgba(0,0,0,.2);
+ -webkit-box-shadow: inset 0px 1px 4px rgba(0,0,0,.2);
+ box-shadow: inset 0px 1px 4px rgba(0,0,0,.2);
+}
+.ui-icon-shadow {
+ -moz-box-shadow: 0px 1px 0 rgba(255,255,255,.4);
+ -webkit-box-shadow: 0px 1px 0 rgba(255,255,255,.4);
+ box-shadow: 0px 1px 0 rgba(255,255,255,.4);
+}
+
+
+/* Focus state - set here for specificity
+-----------------------------------------------------------------------------------------------------------*/
+
+.ui-focus {
+ -moz-box-shadow: 0px 0px 12px #387bbe;
+ -webkit-box-shadow: 0px 0px 12px #387bbe;
+ box-shadow: 0px 0px 12px #387bbe;
+}
+
+/* unset box shadow in browsers that don't do it right
+-----------------------------------------------------------------------------------------------------------*/
+
+.ui-mobile-nosupport-boxshadow * {
+ -moz-box-shadow: none !important;
+ -webkit-box-shadow: none !important;
+ box-shadow: none !important;
+}
+
+/* ...and bring back focus */
+.ui-mobile-nosupport-boxshadow .ui-focus {
+ outline-width: 2px;
+}/*
+* jQuery Mobile Framework
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.
+* Note: Code is in draft form and is subject to change
+*/
+
+/* some unsets - more probably needed */
+.ui-mobile, .ui-mobile body { height: 100%; }
+.ui-mobile fieldset, .ui-page { padding: 0; margin: 0; }
+.ui-mobile a img, .ui-mobile fieldset { border: 0; }
+
+/* responsive page widths */
+.ui-mobile-viewport { margin: 0; overflow-x: hidden; -webkit-text-size-adjust: none; -ms-text-size-adjust:none; -webkit-tap-highlight-color: rgba(0, 0, 0, 0); }
+
+/* "page" containers - full-screen views, one should always be in view post-pageload */
+.ui-mobile [data-role=page], .ui-mobile [data-role=dialog], .ui-page { top: 0; left: 0; width: 100%; min-height: 100%; position: absolute; display: none; border: 0; }
+.ui-mobile .ui-page-active { display: block; overflow: visible; }
+
+/*orientations from js are available */
+.portrait,
+.portrait .ui-page { min-height: 420px; }
+.landscape,
+.landscape .ui-page { min-height: 300px; }
+
+/* loading screen */
+.ui-loading .ui-mobile-viewport { overflow: hidden !important; }
+.ui-loading .ui-loader { display: block; }
+.ui-loading .ui-page { overflow: hidden; }
+.ui-loader { display: none; position: absolute; opacity: .85; z-index: 100; left: 50%; width: 200px; margin-left: -130px; margin-top: -35px; padding: 10px 30px; }
+.ui-loader h1 { font-size: 15px; text-align: center; }
+.ui-loader .ui-icon { position: static; display: block; opacity: .9; margin: 0 auto; width: 35px; height: 35px; background-color: transparent; }
+
+/*fouc*/
+.ui-mobile-rendering > * { visibility: hidden; }
+
+/*headers, content panels*/
+.ui-bar, .ui-body { position: relative; padding: .4em 15px; overflow: hidden; display: block; clear:both; }
+.ui-bar { font-size: 16px; margin: 0; }
+.ui-bar h1, .ui-bar h2, .ui-bar h3, .ui-bar h4, .ui-bar h5, .ui-bar h6 { margin: 0; padding: 0; font-size: 16px; display: inline-block; }
+
+.ui-header, .ui-footer { display: block; }
+.ui-page .ui-header, .ui-page .ui-footer { position: relative; }
+.ui-header .ui-btn-left { position: absolute; left: 10px; top: .4em; }
+.ui-header .ui-btn-right { position: absolute; right: 10px; top: .4em; }
+.ui-header .ui-title, .ui-footer .ui-title { min-height: 1.1em; text-align: center; font-size: 16px; display: block; margin: .6em 90px .8em; padding: 0; text-overflow: ellipsis; overflow: hidden; white-space: nowrap; outline: 0 !important; }
+
+/*content area*/
+.ui-content { border-width: 0; overflow: visible; overflow-x: hidden; padding: 15px; }
+.ui-page-fullscreen .ui-content { padding:0; }
+
+/* icons sizing */
+.ui-icon { width: 18px; height: 18px; }
+
+/* fullscreen class on ui-content div */
+.ui-fullscreen { }
+.ui-fullscreen img { max-width: 100%; }
+
+/* non-js content hiding */
+.ui-nojs { position: absolute; left: -9999px; }
+/*
+* jQuery Mobile Framework
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
+*/
+.spin {
+ -webkit-transform: rotate(360deg);
+ -webkit-animation-name: spin;
+ -webkit-animation-duration: 1s;
+ -webkit-animation-iteration-count: infinite;
+}
+@-webkit-keyframes spin {
+ from {-webkit-transform: rotate(0deg);}
+ to {-webkit-transform: rotate(360deg);}
+}
+
+/* Transitions from jQtouch (with small modifications): http://www.jqtouch.com/
+Built by David Kaneda and maintained by Jonathan Stark.
+*/
+.in, .out {
+ -webkit-animation-timing-function: ease-in-out;
+ -webkit-animation-duration: 350ms;
+}
+
+.slide.in {
+ -webkit-transform: translateX(0);
+ -webkit-animation-name: slideinfromright;
+}
+
+.slide.out {
+ -webkit-transform: translateX(-100%);
+ -webkit-animation-name: slideouttoleft;
+}
+
+.slide.in.reverse {
+ -webkit-transform: translateX(0);
+ -webkit-animation-name: slideinfromleft;
+}
+
+.slide.out.reverse {
+ -webkit-transform: translateX(100%);
+ -webkit-animation-name: slideouttoright;
+}
+
+.slideup.in {
+ -webkit-transform: translateY(0);
+ -webkit-animation-name: slideinfrombottom;
+ z-index: 10;
+}
+
+.slideup.out {
+ -webkit-animation-name: dontmove;
+ z-index: 0;
+}
+
+.slideup.out.reverse {
+ -webkit-transform: translateY(100%);
+ z-index: 10;
+ -webkit-animation-name: slideouttobottom;
+}
+
+.slideup.in.reverse {
+ z-index: 0;
+ -webkit-animation-name: dontmove;
+}
+.slidedown.in {
+ -webkit-transform: translateY(0);
+ -webkit-animation-name: slideinfromtop;
+ z-index: 10;
+}
+
+.slidedown.out {
+ -webkit-animation-name: dontmove;
+ z-index: 0;
+}
+
+.slidedown.out.reverse {
+ -webkit-transform: translateY(-100%);
+ z-index: 10;
+ -webkit-animation-name: slideouttotop;
+}
+
+.slidedown.in.reverse {
+ z-index: 0;
+ -webkit-animation-name: dontmove;
+}
+
+@-webkit-keyframes slideinfromright {
+ from { -webkit-transform: translateX(100%); }
+ to { -webkit-transform: translateX(0); }
+}
+
+@-webkit-keyframes slideinfromleft {
+ from { -webkit-transform: translateX(-100%); }
+ to { -webkit-transform: translateX(0); }
+}
+
+@-webkit-keyframes slideouttoleft {
+ from { -webkit-transform: translateX(0); }
+ to { -webkit-transform: translateX(-100%); }
+}
+
+@-webkit-keyframes slideouttoright {
+ from { -webkit-transform: translateX(0); }
+ to { -webkit-transform: translateX(100%); }
+}
+
+
+@-webkit-keyframes slideinfromtop {
+ from { -webkit-transform: translateY(-100%); }
+ to { -webkit-transform: translateY(0); }
+}
+
+@-webkit-keyframes slideinfrombottom {
+ from { -webkit-transform: translateY(100%); }
+ to { -webkit-transform: translateY(0); }
+}
+
+@-webkit-keyframes slideouttobottom {
+ from { -webkit-transform: translateY(0); }
+ to { -webkit-transform: translateY(100%); }
+}
+
+@-webkit-keyframes slideouttotop {
+ from { -webkit-transform: translateY(0); }
+ to { -webkit-transform: translateY(-100%); }
+}
+@-webkit-keyframes fadein {
+ from { opacity: 0; }
+ to { opacity: 1; }
+}
+
+@-webkit-keyframes fadeout {
+ from { opacity: 1; }
+ to { opacity: 0; }
+}
+
+.fade.in {
+ opacity: 1;
+ z-index: 10;
+ -webkit-animation-name: fadein;
+}
+.fade.out {
+ z-index: 0;
+ -webkit-animation-name: fadeout;
+}
+
+/* The properties in this rule are only necessary for the 'flip' transition.
+ * We need specify the perspective to create a projection matrix. This will add
+ * some depth as the element flips. The depth number represents the distance of
+ * the viewer from the z-plane. According to the CSS3 spec, 1000 is a moderate
+ * value.
+ */
+.viewport-flip {
+ -webkit-perspective: 1000;
+ position: absolute;
+}
+
+.ui-mobile-viewport-transitioning,
+.ui-mobile-viewport-transitioning .ui-page {
+ width: 100%;
+ height: 100%;
+ overflow: hidden;
+}
+
+.flip {
+ -webkit-animation-duration: .65s;
+ -webkit-backface-visibility:hidden;
+ -webkit-transform:translateX(0); /* Needed to work around an iOS 3.1 bug that causes listview thumbs to disappear when -webkit-visibility:hidden is used. */
+}
+
+.flip.in {
+ -webkit-transform: rotateY(0) scale(1);
+ -webkit-animation-name: flipinfromleft;
+}
+
+.flip.out {
+ -webkit-transform: rotateY(-180deg) scale(.8);
+ -webkit-animation-name: flipouttoleft;
+}
+
+/* Shake it all about */
+
+.flip.in.reverse {
+ -webkit-transform: rotateY(0) scale(1);
+ -webkit-animation-name: flipinfromright;
+}
+
+.flip.out.reverse {
+ -webkit-transform: rotateY(180deg) scale(.8);
+ -webkit-animation-name: flipouttoright;
+}
+
+@-webkit-keyframes flipinfromright {
+ from { -webkit-transform: rotateY(-180deg) scale(.8); }
+ to { -webkit-transform: rotateY(0) scale(1); }
+}
+
+@-webkit-keyframes flipinfromleft {
+ from { -webkit-transform: rotateY(180deg) scale(.8); }
+ to { -webkit-transform: rotateY(0) scale(1); }
+}
+
+@-webkit-keyframes flipouttoleft {
+ from { -webkit-transform: rotateY(0) scale(1); }
+ to { -webkit-transform: rotateY(-180deg) scale(.8); }
+}
+
+@-webkit-keyframes flipouttoright {
+ from { -webkit-transform: rotateY(0) scale(1); }
+ to { -webkit-transform: rotateY(180deg) scale(.8); }
+}
+
+
+/* Hackish, but reliable. */
+
+@-webkit-keyframes dontmove {
+ from { opacity: 1; }
+ to { opacity: 1; }
+}
+
+.pop {
+ -webkit-transform-origin: 50% 50%;
+}
+
+.pop.in {
+ -webkit-transform: scale(1);
+ opacity: 1;
+ -webkit-animation-name: popin;
+ z-index: 10;
+}
+
+.pop.out.reverse {
+ -webkit-transform: scale(.2);
+ opacity: 0;
+ -webkit-animation-name: popout;
+ z-index: 10;
+}
+
+.pop.in.reverse {
+ z-index: 0;
+ -webkit-animation-name: dontmove;
+}
+
+@-webkit-keyframes popin {
+ from {
+ -webkit-transform: scale(.2);
+ opacity: 0;
+ }
+ to {
+ -webkit-transform: scale(1);
+ opacity: 1;
+ }
+}
+
+@-webkit-keyframes popout {
+ from {
+ -webkit-transform: scale(1);
+ opacity: 1;
+ }
+ to {
+ -webkit-transform: scale(.2);
+ opacity: 0;
+ }
+}/*
+* jQuery Mobile Framework
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
+*/
+
+/* content configurations. */
+.ui-grid-a, .ui-grid-b, .ui-grid-c, .ui-grid-d { overflow: hidden; }
+.ui-block-a, .ui-block-b, .ui-block-c, .ui-block-d, .ui-block-e { margin: 0; padding: 0; border: 0; float: left; min-height:1px;}
+
+/* grid solo: 100 - single item fallback */
+.ui-grid-solo .ui-block-a { width: 100%; float: none; }
+
+/* grid a: 50/50 */
+.ui-grid-a .ui-block-a, .ui-grid-a .ui-block-b { width: 50%; }
+.ui-grid-a .ui-block-a { clear: left; }
+
+/* grid b: 33/33/33 */
+.ui-grid-b .ui-block-a, .ui-grid-b .ui-block-b, .ui-grid-b .ui-block-c { width: 33.333%; }
+.ui-grid-b .ui-block-a { clear: left; }
+
+/* grid c: 25/25/25/25 */
+.ui-grid-c .ui-block-a, .ui-grid-c .ui-block-b, .ui-grid-c .ui-block-c, .ui-grid-c .ui-block-d { width: 25%; }
+.ui-grid-c .ui-block-a { clear: left; }
+
+/* grid d: 20/20/20/20/20 */
+.ui-grid-d .ui-block-a, .ui-grid-d .ui-block-b, .ui-grid-d .ui-block-c, .ui-grid-d .ui-block-d, .ui-grid-d .ui-block-e { width: 20%; }
+.ui-grid-d .ui-block-a { clear: left; }
+/*
+* jQuery Mobile Framework
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
+*/
+/* fixed page header & footer configuration */
+.ui-header, .ui-footer, .ui-page-fullscreen .ui-header, .ui-page-fullscreen .ui-footer { position: absolute; overflow: hidden; width: 100%; border-left-width: 0; border-right-width: 0; }
+.ui-header-fixed, .ui-footer-fixed {
+ z-index: 1000;
+ -webkit-transform: translateZ(0); /* Force header/footer rendering to go through the same rendering pipeline as native page scrolling. */
+}
+.ui-footer-duplicate, .ui-page-fullscreen .ui-fixed-inline { display: none; }
+.ui-page-fullscreen .ui-header, .ui-page-fullscreen .ui-footer { opacity: .9; }
+/*
+* jQuery Mobile Framework
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
+*/
+.ui-navbar { overflow: hidden; }
+.ui-navbar ul, .ui-navbar-expanded ul { list-style:none; padding: 0; margin: 0; position: relative; display: block; border: 0;}
+.ui-navbar-collapsed ul { float: left; width: 75%; margin-right: -2px; }
+.ui-navbar-collapsed .ui-navbar-toggle { float: left; width: 25%; }
+.ui-navbar li.ui-navbar-truncate { position: absolute; left: -9999px; top: -9999px; }
+.ui-navbar li .ui-btn, .ui-navbar .ui-navbar-toggle .ui-btn { display: block; font-size: 12px; text-align: center; margin: 0; border-right-width: 0; }
+.ui-navbar li .ui-btn { margin-right: -1px; }
+.ui-navbar li .ui-btn:last-child { margin-right: 0; }
+.ui-header .ui-navbar li .ui-btn, .ui-header .ui-navbar .ui-navbar-toggle .ui-btn,
+.ui-footer .ui-navbar li .ui-btn, .ui-footer .ui-navbar .ui-navbar-toggle .ui-btn { border-top-width: 0; border-bottom-width: 0; }
+.ui-navbar .ui-btn-inner { padding-left: 2px; padding-right: 2px; }
+.ui-navbar-noicons li .ui-btn .ui-btn-inner, .ui-navbar-noicons .ui-navbar-toggle .ui-btn-inner { padding-top: .8em; padding-bottom: .9em; }
+/*expanded page styles*/
+.ui-navbar-expanded .ui-btn { margin: 0; font-size: 14px; }
+.ui-navbar-expanded .ui-btn-inner { padding-left: 5px; padding-right: 5px; }
+.ui-navbar-expanded .ui-btn-icon-top .ui-btn-inner { padding: 45px 5px 15px; text-align: center; }
+.ui-navbar-expanded .ui-btn-icon-top .ui-icon { top: 15px; }
+.ui-navbar-expanded .ui-btn-icon-bottom .ui-btn-inner { padding: 15px 5px 45px; text-align: center; }
+.ui-navbar-expanded .ui-btn-icon-bottom .ui-icon { bottom: 15px; }
+.ui-navbar-expanded li .ui-btn .ui-btn-inner { min-height: 2.5em; }
+.ui-navbar-expanded .ui-navbar-noicons .ui-btn .ui-btn-inner { padding-top: 1.8em; padding-bottom: 1.9em; }
+/*
+* jQuery Mobile Framework
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
+*/
+.ui-btn { display: block; text-align: center; cursor:pointer; position: relative; margin: .5em 5px; padding: 0; }
+.ui-btn:focus, .ui-btn:active { outline: none; }
+.ui-header .ui-btn, .ui-footer .ui-btn, .ui-bar .ui-btn { display: inline-block; font-size: 13px; margin: 0; }
+.ui-btn-inline { display: inline-block; }
+.ui-btn-inner { padding: .6em 25px; display: block; text-overflow: ellipsis; overflow: hidden; white-space: nowrap; position: relative; }
+.ui-header .ui-btn-inner, .ui-footer .ui-btn-inner, .ui-bar .ui-btn-inner { padding: .4em 8px .5em; }
+.ui-btn-icon-notext { display: inline-block; width: 20px; height: 20px; padding: 2px 1px 2px 3px; text-indent: -9999px; }
+.ui-btn-icon-notext .ui-btn-inner { padding: 0; }
+.ui-btn-icon-notext .ui-btn-text { position: absolute; left: -999px; }
+.ui-btn-icon-left .ui-btn-inner { padding-left: 33px; }
+.ui-header .ui-btn-icon-left .ui-btn-inner,
+.ui-footer .ui-btn-icon-left .ui-btn-inner,
+.ui-bar .ui-btn-icon-left .ui-btn-inner { padding-left: 27px; }
+.ui-btn-icon-right .ui-btn-inner { padding-right: 33px; }
+.ui-header .ui-btn-icon-right .ui-btn-inner,
+.ui-footer .ui-btn-icon-right .ui-btn-inner,
+.ui-bar .ui-btn-icon-right .ui-btn-inner { padding-right: 27px; }
+.ui-btn-icon-top .ui-btn-inner { padding-top: 33px; }
+.ui-header .ui-btn-icon-top .ui-btn-inner,
+.ui-footer .ui-btn-icon-top .ui-btn-inner,
+.ui-bar .ui-btn-icon-top .ui-btn-inner { padding-top: 27px; }
+.ui-btn-icon-bottom .ui-btn-inner { padding-bottom: 33px; }
+.ui-header .ui-btn-icon-bottom .ui-btn-inner,
+.ui-footer .ui-btn-icon-bottom .ui-btn-inner,
+.ui-bar .ui-btn-icon-bottom .ui-btn-inner { padding-bottom: 27px; }
+
+/*btn icon positioning*/
+.ui-btn-icon-notext .ui-icon { display: block; }
+.ui-btn-icon-left .ui-icon, .ui-btn-icon-right .ui-icon { position: absolute; top: 50%; margin-top: -9px; }
+.ui-btn-icon-top .ui-icon, .ui-btn-icon-bottom .ui-icon { position: absolute; left: 50%; margin-left: -9px; }
+.ui-btn-icon-left .ui-icon { left: 10px; }
+.ui-btn-icon-right .ui-icon {right: 10px; }
+.ui-header .ui-btn-icon-left .ui-icon,
+.ui-footer .ui-btn-icon-left .ui-icon,
+.ui-bar .ui-btn-icon-left .ui-icon { left: 4px; }
+.ui-header .ui-btn-icon-right .ui-icon,
+.ui-footer .ui-btn-icon-right .ui-icon,
+.ui-bar .ui-btn-icon-right .ui-icon { right: 4px; }
+.ui-header .ui-btn-icon-top .ui-icon,
+.ui-footer .ui-btn-icon-top .ui-icon,
+.ui-bar .ui-btn-icon-top .ui-icon { top: 4px; }
+.ui-header .ui-btn-icon-bottom .ui-icon,
+.ui-footer .ui-btn-icon-bottom .ui-icon,
+.ui-bar .ui-btn-icon-bottom .ui-icon { bottom: 4px; }
+.ui-btn-icon-top .ui-icon { top: 5px; }
+.ui-btn-icon-bottom .ui-icon { bottom: 5px; }
+/*hiding native button,inputs */
+.ui-btn-hidden { position: absolute; top: 0; left: 0; width: 100%; height: 100%; -webkit-appearance: button; opacity: 0; cursor: pointer; -ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=0)"; filter: alpha(opacity=0); background: transparent; }
+/*
+* jQuery Mobile Framework
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
+*/
+.ui-collapsible-contain { margin: .5em 0; }
+.ui-collapsible-heading { font-size: 16px; display: block; margin: 0 -8px; padding: 0; border-width: 0 0 1px 0; position: relative; }
+.ui-collapsible-heading a { text-align: left; margin: 0; }
+.ui-collapsible-heading a .ui-btn-inner { padding-left: 40px; }
+.ui-collapsible-heading a span.ui-btn { position: absolute; left: 6px; top: 50%; margin: -12px 0 0 0; width: 20px; height: 20px; padding: 1px 0px 1px 2px; text-indent: -9999px; }
+.ui-collapsible-heading a span.ui-btn .ui-btn-inner { padding: 10px 0; }
+.ui-collapsible-heading a span.ui-btn .ui-icon { left: 0; margin-top: -10px; }
+.ui-collapsible-heading-status { position:absolute; left:-9999px; }
+.ui-collapsible-content { display: block; padding: 10px 0 10px 8px; }
+.ui-collapsible-content-collapsed { display: none; }
+
+.ui-collapsible-set { margin: .5em 0; }
+.ui-collapsible-set .ui-collapsible-contain { margin: -1px 0 0; }
+/*
+* jQuery Mobile Framework
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
+*/
+.ui-controlgroup, fieldset.ui-controlgroup { padding: 0; margin: .5em 0 1em; }
+.ui-bar .ui-controlgroup { margin: 0 .3em; }
+.ui-controlgroup-label { font-size: 16px; line-height: 1.4; font-weight: normal; margin: 0 0 .3em; }
+.ui-controlgroup-controls { display: block; width: 95%;}
+.ui-controlgroup li { list-style: none; }
+.ui-controlgroup-vertical .ui-btn,
+.ui-controlgroup-vertical .ui-checkbox, .ui-controlgroup-vertical .ui-radio { margin: 0; border-bottom-width: 0; }
+.ui-controlgroup-vertical .ui-controlgroup-last { border-bottom-width: 1px; }
+.ui-controlgroup-horizontal { padding: 0; }
+.ui-controlgroup-horizontal .ui-btn,
+.ui-controlgroup-horizontal .ui-checkbox, .ui-controlgroup-horizontal .ui-radio { display: inline-block; margin: 0 -5px 0 0; }
+.ui-controlgroup-horizontal .ui-checkbox, .ui-controlgroup-horizontal .ui-radio { display: inline; }
+.ui-controlgroup-horizontal .ui-checkbox .ui-btn, .ui-controlgroup-horizontal .ui-radio .ui-btn,
+.ui-controlgroup-horizontal .ui-checkbox:last-child, .ui-controlgroup-horizontal .ui-radio:last-child { margin-right: 0; }
+.ui-controlgroup-horizontal .ui-controlgroup-last { margin-right: 0; }
+.ui-controlgroup .ui-checkbox label, .ui-controlgroup .ui-radio label { font-size: 16px; }
+/* conflicts with listview..
+.ui-controlgroup .ui-btn-icon-notext { width: 30px; height: 30px; text-indent: -9999px; }
+.ui-controlgroup .ui-btn-icon-notext .ui-btn-inner { padding: 5px 6px 5px 5px; }
+*/
+
+@media all and (min-width: 450px){
+ .ui-controlgroup-label { vertical-align: top; display: inline-block; width: 20%; margin: 0 2% 0 0; }
+ .ui-controlgroup-controls { width: 60%; display: inline-block; }
+} /*
+* jQuery Mobile Framework
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
+*/
+.ui-dialog { min-height: 480px; }
+.ui-dialog .ui-header, .ui-dialog .ui-content, .ui-dialog .ui-footer { margin: 15px; position: relative; }
+.ui-dialog .ui-header, .ui-dialog .ui-footer { z-index: 10; width: auto; }
+.ui-dialog .ui-content, .ui-dialog .ui-footer { margin-top: -15px; }/*
+* jQuery Mobile Framework
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
+*/
+.ui-checkbox, .ui-radio { position:relative; margin: .2em 0 .5em; z-index: 1; }
+.ui-checkbox .ui-btn, .ui-radio .ui-btn { margin: 0; text-align: left; z-index: 2; }
+.ui-checkbox .ui-btn-inner, .ui-radio .ui-btn-inner { white-space: normal; }
+.ui-checkbox .ui-btn-icon-left .ui-btn-inner,.ui-radio .ui-btn-icon-left .ui-btn-inner { padding-left: 45px; }
+.ui-checkbox .ui-btn-icon-right .ui-btn-inner, .ui-radio .ui-btn-icon-right .ui-btn-inner { padding-right: 45px; }
+.ui-checkbox .ui-icon, .ui-radio .ui-icon { top: 1.1em; }
+.ui-checkbox .ui-btn-icon-left .ui-icon, .ui-radio .ui-btn-icon-left .ui-icon {left: 15px; }
+.ui-checkbox .ui-btn-icon-right .ui-icon, .ui-radio .ui-btn-icon-right .ui-icon {right: 15px; }
+/* input, label positioning */
+.ui-checkbox input,.ui-radio input { position:absolute; left:20px; top:50%; width: 10px; height: 10px; margin:-5px 0 0 0; outline: 0 !important; z-index: 1; }/*
+* jQuery Mobile Framework
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
+*/
+.ui-field-contain { background: none; padding: 1.5em 0; margin: 0; border-bottom-width: 1px; overflow: visible; }
+.ui-field-contain:first-child { border-top-width: 0; }
+@media all and (min-width: 450px){
+ .ui-field-contain { border-width: 0; padding: 0; margin: 1em 0; }
+} /*
+* jQuery Mobile Framework
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
+*/
+.ui-select { display: block; position: relative; }
+.ui-select select { position: absolute; left: -9999px; top: -9999px; }
+.ui-select .ui-btn { overflow: hidden; }
+.ui-select .ui-btn select { cursor: pointer; -webkit-appearance: button; left: 0; top:0; width: 100%; height: 100%; opacity: 0; -ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=0)"; filter: alpha(opacity=0); }
+@-moz-document url-prefix() {.ui-select .ui-btn select { opacity: 0.0001; }}
+.ui-select .ui-btn select.ui-select-nativeonly { opacity: 1; text-indent: 0; }
+
+.ui-select .ui-btn-icon-right .ui-btn-inner { padding-right: 45px; }
+.ui-select .ui-btn-icon-right .ui-icon { right: 15px; }
+
+/* labels */
+label.ui-select { font-size: 16px; line-height: 1.4; font-weight: normal; margin: 0 0 .3em; display: block; }
+
+/*listbox*/
+.ui-select .ui-btn-text, .ui-selectmenu .ui-btn-text { display: inline-block; min-height: 1em; }
+.ui-select .ui-btn-text { text-overflow: ellipsis; overflow: hidden; display: block;}
+
+.ui-selectmenu { position: absolute; padding: 0; z-index: 100 !important; width: 80%; max-width: 350px; padding: 6px; }
+.ui-selectmenu .ui-listview { margin: 0; }
+.ui-selectmenu .ui-btn.ui-li-divider { cursor: default; }
+.ui-selectmenu-hidden { top: -9999px; left: -9999px; }
+.ui-selectmenu-screen { position: absolute; top: 0; left: 0; width: 100%; height: 100%; z-index: 99; }
+.ui-screen-hidden, .ui-selectmenu-list .ui-li .ui-icon { display: none; }
+.ui-selectmenu-list .ui-li .ui-icon { display: block; }
+.ui-li.ui-selectmenu-placeholder { display: none; }
+.ui-selectmenu .ui-header .ui-title { margin: 0.6em 46px 0.8em; }
+
+@media all and (min-width: 450px){
+ label.ui-select { display: inline-block; width: 20%; margin: 0 2% 0 0; }
+ .ui-select { width: 60%; display: inline-block; }
+}
+
+/* when no placeholder is defined in a multiple select, the header height doesn't even extend past the close button. this shim's content in there */
+.ui-selectmenu .ui-header h1:after { content: '.'; visibility: hidden; }/*
+* jQuery Mobile Framework
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
+*/
+label.ui-input-text { font-size: 16px; line-height: 1.4; display: block; font-weight: normal; margin: 0 0 .3em; }
+input.ui-input-text, textarea.ui-input-text { background-image: none; padding: .4em; line-height: 1.4; font-size: 16px; display: block; width: 95%; }
+input.ui-input-text { -webkit-appearance: none; }
+textarea.ui-input-text { height: 50px; -webkit-transition: height 200ms linear; -moz-transition: height 200ms linear; -o-transition: height 200ms linear; transition: height 200ms linear; }
+.ui-input-search { padding: 0 30px; width: 77%; background-position: 8px 50%; background-repeat: no-repeat; position: relative; }
+.ui-input-search input.ui-input-text { border: none; width: 98%; padding: .4em 0; margin: 0; display: block; background: transparent none; outline: 0 !important; }
+.ui-input-search .ui-input-clear { position: absolute; right: 0; top: 50%; margin-top: -14px; }
+.ui-input-search .ui-input-clear-hidden { display: none; }
+
+/* orientation adjustments - incomplete!*/
+@media all and (min-width: 450px){
+ label.ui-input-text { vertical-align: top; display: inline-block; width: 20%; margin: 0 2% 0 0 }
+ input.ui-input-text,
+ textarea.ui-input-text,
+ .ui-input-search { width: 60%; display: inline-block; }
+ .ui-input-search { width: 50%; }
+ .ui-input-search input.ui-input-text { width: 98%; /*echos rule from above*/ }
+}/*
+* jQuery Mobile Framework
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
+*/
+.ui-listview { margin: 0; counter-reset: listnumbering; }
+.ui-content .ui-listview { margin: -15px; }
+.ui-content .ui-listview-inset { margin: 1em 0; }
+.ui-listview, .ui-li { list-style:none; padding:0; }
+.ui-li, .ui-li.ui-field-contain { display: block; margin:0; position: relative; overflow: visible; text-align: left; border-width: 0; border-top-width: 1px; }
+.ui-li .ui-btn-text a.ui-link-inherit { text-overflow: ellipsis; overflow: hidden; white-space: nowrap; }
+.ui-li-divider, .ui-li-static { padding: .5em 15px; font-size: 14px; font-weight: bold; }
+.ui-li-divider { counter-reset: listnumbering; }
+ol.ui-listview .ui-link-inherit:before, ol.ui-listview .ui-li-static:before, .ui-li-dec { font-size: .8em; display: inline-block; padding-right: .3em; font-weight: normal;counter-increment: listnumbering; content: counter(listnumbering) ". "; }
+ol.ui-listview .ui-li-jsnumbering:before { content: "" !important; } /* to avoid chance of duplication */
+.ui-listview-inset .ui-li { border-right-width: 1px; border-left-width: 1px; }
+.ui-li:last-child, .ui-li.ui-field-contain:last-child { border-bottom-width: 1px; }
+.ui-li>.ui-btn-inner { display: block; position: relative; padding: 0; }
+.ui-li .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li { padding: .7em 75px .7em 15px; display: block; }
+.ui-li-has-thumb .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li-has-thumb { min-height: 60px; padding-left: 100px; }
+.ui-li-has-icon .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li-has-icon { min-height: 20px; padding-left: 40px; }
+.ui-li-heading { font-size: 16px; font-weight: bold; display: block; margin: .6em 0; text-overflow: ellipsis; overflow: hidden; white-space: nowrap; }
+.ui-li-desc { font-size: 12px; font-weight: normal; display: block; margin: -.5em 0 .6em; text-overflow: ellipsis; overflow: hidden; white-space: nowrap; }
+.ui-li-thumb, .ui-li-icon { position: absolute; left: 1px; top: 0; max-height: 80px; max-width: 80px; }
+.ui-li-icon { max-height: 40px; max-width: 40px; left: 10px; top: .9em; }
+.ui-li-thumb, .ui-li-icon, .ui-li-content { float: left; margin-right: 10px; }
+
+.ui-li-aside { float: right; width: 50%; text-align: right; margin: .3em 0; }
+@media all and (min-width: 480px){
+ .ui-li-aside { width: 45%; }
+}
+.ui-li-divider { cursor: default; }
+.ui-li-has-alt .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li-has-alt { padding-right: 95px; }
+.ui-li-count { position: absolute; font-size: 11px; font-weight: bold; padding: .2em .5em; top: 50%; margin-top: -.9em; right: 38px; }
+.ui-li-divider .ui-li-count, .ui-li-static .ui-li-count { right: 10px; }
+.ui-li-has-alt .ui-li-count { right: 55px; }
+.ui-li-link-alt { position: absolute; width: 40px; height: 100%; border-width: 0; border-left-width: 1px; top: 0; right: 0; margin: 0; padding: 0; }
+.ui-li-link-alt .ui-btn { overflow: hidden; position: absolute; right: 8px; top: 50%; margin: -11px 0 0 0; border-bottom-width: 1px; }
+.ui-li-link-alt .ui-btn-inner { padding: 0; position: static; }
+.ui-li-link-alt .ui-btn .ui-icon { right: 50%; margin-right: -9px; }
+
+.ui-listview-filter { border-width: 0; overflow: hidden; margin: -15px -15px 15px -15px }
+.ui-listview-filter .ui-input-search { margin: 5px; width: auto; display: block; }
+
+.ui-listview-filter-inset { margin: -15px -5px -15px -5px; background: transparent; }
+.ui-li.ui-screen-hidden{display:none;}
+/* Odd iPad positioning issue. */
+@media only screen and (min-device-width: 768px) and (max-device-width: 1024px) {
+ .ui-li .ui-btn-text { overflow: visible; }
+}/*
+* jQuery Mobile Framework
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
+*/
+label.ui-slider { display: block; }
+input.ui-slider-input { display: inline-block; width: 50px; }
+select.ui-slider-switch { display: none; }
+div.ui-slider { position: relative; display: inline-block; overflow: visible; height: 15px; padding: 0; margin: 0 2% 0 20px; top: 4px; width: 66%; }
+a.ui-slider-handle { position: absolute; z-index: 10; top: 50%; width: 28px; height: 28px; margin-top: -15px; margin-left: -15px; }
+a.ui-slider-handle .ui-btn-inner { padding-left: 0; padding-right: 0; }
+@media all and (min-width: 480px){
+ label.ui-slider { display: inline-block; width: 20%; margin: 0 2% 0 0; }
+ div.ui-slider { width: 45%; }
+}
+
+div.ui-slider-switch { height: 32px; overflow: hidden; margin-left: 0; }
+div.ui-slider-inneroffset { margin-left: 50%; position: absolute; top: 1px; height: 100%; width: 50%; }
+div.ui-slider-handle-snapping { -webkit-transition: left 100ms linear; }
+div.ui-slider-labelbg { position: absolute; top:0; margin: 0; border-width: 0; }
+div.ui-slider-switch div.ui-slider-labelbg-a { width: 60%; height: 100%; left: 0; }
+div.ui-slider-switch div.ui-slider-labelbg-b { width: 60%; height: 100%; right: 0; }
+.ui-slider-switch-a div.ui-slider-labelbg-a, .ui-slider-switch-b div.ui-slider-labelbg-b { z-index: -1; }
+.ui-slider-switch-a div.ui-slider-labelbg-b, .ui-slider-switch-b div.ui-slider-labelbg-a { z-index: 0; }
+
+div.ui-slider-switch a.ui-slider-handle { z-index: 20; width: 101%; height: 32px; margin-top: -18px; margin-left: -101%; }
+span.ui-slider-label { width: 100%; position: absolute;height: 32px; font-size: 16px; text-align: center; line-height: 2; background: none; border-color: transparent; }
+span.ui-slider-label-a { left: -100%; margin-right: -1px }
+span.ui-slider-label-b { right: -100%; margin-left: -1px }
+
--- /dev/null
+++ b/css/local.css.php
@@ -1,1 +1,216 @@
-
+<?php
+ header('Content-type: text/css');
+ ob_start("compress");
+ function compress($buffer) {
+ /* remove comments */
+ $buffer = preg_replace('!/\*[^*]*\*+([^/][^*]*\*+)*/!', '', $buffer);
+ /* remove tabs, spaces, newlines, etc. */
+ $buffer = str_replace(array("\r\n", "\r", "\n", "\t", ' ', ' ', ' '), '', $buffer);
+ return $buffer;
+ }
+
+echo '
+.ui-li-thumb, .ui-li-icon { position: relative; }
+
+ .ui-navbar {
+ width: 100%;
+ }
+ .ui-btn-inner {
+ white-space: normal !important;
+ }
+ .ui-li-heading {
+ white-space: normal !important;
+ }
+ .ui-listview-filter {
+ margin: 0 !important;
+ }
+ .ui-icon-navigation {
+ background-image: url('.$_REQUEST['labsPath'].'css/images/113-navigation.png);
+ background-position: 1px 0;
+ }
+ .ui-icon-beaker {
+ background-image: url('.$_REQUEST['labsPath'].'css/images/91-beaker-2.png);
+ background-position: 1px 0;
+ }
+ #footer {
+ text-size: 0.75em;
+ text-align: center;
+ }
+ body {
+ background-color: #F0F0F0;
+ }
+ #jqm-homeheader {
+ text-align: center;
+ }
+ .viaPoints {
+ display: none;
+ text-size: 0.2em;
+ }
+ .min-width-480px .viaPoints {
+ display: inline;
+ }
+ #extrainfo {
+ visibility: hidden;
+ display: none;
+ }
+ #servicewarning {
+ padding: 1em;
+ margin-bottom: 0.5em;
+ text-size: 0.2em;
+ background-color: #FF9;
+ -moz-border-radius: 15px;
+border-radius: 15px;
+ }
+
+
+#footer {
+clear:both;
+text-align:center;
+}
+ // source http://webaim.org/techniques/skipnav/
+ #skip a, #skip a:hover, #skip a:visited
+{
+position:absolute;
+left:0px;
+top:-500px;
+width:1px;
+height:1px;
+overflow:hidden;
+}
+
+#skip a:active, #skip a:focus
+{
+position:static;
+width:auto;
+height:auto;
+}';
+
+//if (false)
+ echo '
+// adaptive layout from jQuery Mobile docs site
+.type-interior .content-secondary {
+ border-right: 0;
+ border-left: 0;
+ margin: 10px -15px 0;
+ background: #fff;
+ border-top: 1px solid #ccc;
+}
+.type-home .ui-content {
+ margin-top: 5px;
+}
+.type-interior .ui-content {
+ padding-bottom: 0;
+}
+.content-secondary .ui-collapsible-contain {
+ padding: 10px 15px;
+
+}
+.content-secondary .ui-collapsible-heading {
+ margin: 0 0 30px;
+}
+.content-secondary .ui-collapsible-heading-collapsed,
+.content-secondary .ui-collapsible-content {
+ padding:0;
+ margin: 0;
+}
+@media all and (min-width: 650px){
+.content-secondary {
+ text-align: left;
+ float: left;
+ width: 45%;
+ background: none;
+ border-top: 0;
+ }
+ .content-secondary,
+ .type-interior .content-secondary {
+ margin: 30px 0 20px 2%;
+ padding: 20px 4% 0 0;
+ background: none;
+ }
+ .type-index .content-secondary {
+ padding: 0;
+ }
+ .type-index .content-secondary .ui-listview {
+ margin: 0;
+ }
+ .content-primary {
+ width: 45%;
+ float: right;
+ margin-top: 30px;
+ margin-right: 1%;
+ padding-right: 1%;
+ }
+ .content-primary ul:first-child {
+ margin-top: 0;
+ }
+
+ .type-interior .content-primary {
+ padding: 1.5em 6% 3em 0;
+ margin: 0;
+ }
+ /* fix up the collapsibles - expanded on desktop */
+ .content-secondary .ui-collapsible-heading {
+ display: none;
+ }
+ .content-secondary .ui-collapsible-contain {
+ margin:0;
+ }
+ .content-secondary .ui-collapsible-content {
+ display: block;
+ margin: 0;
+ padding: 0;
+ }
+ .type-interior .content-secondary .ui-li-divider {
+ padding-top: 1em;
+ padding-bottom: 1em;
+ }
+ .type-interior .content-secondary {
+ margin: 0;
+ padding: 0;
+ }
+}
+@media all and (min-width: 750px){
+ .type-home .ui-content,
+ .type-interior .ui-content {
+ background-position: 39%;
+ }
+ .content-secondary {
+ width: 34%;
+ }
+ .content-primary {
+ width: 56%;
+ padding-right: 1%;
+ }
+ .type-interior .ui-content {
+ background-position: 34%;
+ }
+}
+
+@media all and (min-width: 1200px){
+ .type-home .ui-content{
+ background-position: 38.5%;
+ }
+ .type-interior .ui-content {
+ background-position: 30%;
+ }
+ .content-secondary {
+ width: 30%;
+ padding-right:6%;
+ margin: 30px 0 20px 5%;
+ }
+ .type-interior .content-secondary {
+ margin: 0;
+ padding: 0;
+ }
+ .content-primary {
+ width: 50%;
+ margin-right: 5%;
+ padding-right: 3%;
+ }
+ .type-interior .content-primary {
+ width: 60%;
+ }
+}';
+ ob_end_flush();
+?>
+
--- /dev/null
+++ b/dotcloud/postinstall
@@ -1,1 +1,19 @@
+#!/bin/bash
+#dotcloud postinstall
+curl http://s3-ap-southeast-1.amazonaws.com/busresources/cbrfeed.zip \
+-o /home/dotcloud/current/cbrfeed.zip
+curl http://s3-ap-southeast-1.amazonaws.com/busresources/Graph.obj \
+-o /tmp/Graph.obj
+
+#db setup
+#curl https://github.com/maxious/ACTBus-ui/raw/master/transitdata.cbrfeed.sql.gz -o transitdata.cbrfeed.sql.gz
+#curl https://github.com/maxious/ACTBus-ui/raw/master/lib/postgis.sql -o postgis.sql
+#createlang -d transitdata plpgsql
+#psql -d transitdata -f postgis.sql
+#gunzip /var/www/transitdata.cbrfeed.sql.gz
+#psql -d transitdata -f transitdata.cbrfeed.sql
+#createuser transitdata -SDRP
+#password transitdata
+#psql -c \"GRANT SELECT ON TABLE agency,calendar,calendar_dates,routes,stop_times,stops,trips TO transitdata;\"
+
--- /dev/null
+++ b/dotcloud/push.sh
@@ -1,1 +1,7 @@
+#wget http://s3-ap-southeast-1.amazonaws.com/busresources/opentripplanner-webapp.war
+cp ~/workspace/opentripplanner/maven.1277125291275/opentripplanner-webapp/target/opentripplanner-webapp.war ./
+#wget http://s3-ap-southeast-1.amazonaws.com/busresources/opentripplanner-api-webapp.war
+cp ~/workspace/opentripplanner/maven.1277125291275/opentripplanner-api-webapp/target/opentripplanner-api-webapp.war ./
+dotcloud push actbus.otp ./
+
--- /dev/null
+++ b/feedback.php
@@ -1,1 +1,81 @@
+<?php
+include ("include/common.inc.php");
+include_header("Feedback", "feedback");
+function sendEmail($topic, $message)
+{
+ $address = "maxious@lambdacomplex.org";
+ if (file_exists("/tmp/aws.php")) {
+ include_once ("lib/ses.php");
+ include_once ("/tmp/aws.php");
+ $con = new SimpleEmailService($accessKey, $secretKey);
+ //$con->verifyEmailAddress($address);
+ //$con->listVerifiedEmailAddresses();
+ $m = new SimpleEmailServiceMessage();
+ $m->addTo($address);
+ $m->setFrom($address);
+ $m->setSubject($topic);
+ $m->setMessageFromString($message);
+ $con->sendEmail($m);
+ }
+ else {
+ // In case any of our lines are larger than 70 characters, we should use wordwrap()
+ $message = wordwrap($message, 70);
+ // Send
+ mail($address, $topic, $message);
+ }
+}
+if (isset($_REQUEST['feedback']) || isset($_REQUEST['newlocation'])){
+ sendEmail("bus.lambda feedback",print_r($_REQUEST,true));
+ echo "<h2 style='text-align: center;'>Thank you for your feedback!</h2>";
+} else {
+$stopid = "";
+$stopcode = "";
+$urlparts = explode("?",$_SERVER["HTTP_REFERER"]);
+if (isset($urlparts[1])) {
+ $getparams = explode("&",$urlparts[1]);
+ foreach ($getparams as $param) {
+ $paramparts=explode("=",$param);
+ if ($paramparts[0] == "stopid") $stopid = $paramparts[1];
+ if ($paramparts[0] == "stopcode") $stopcode = $paramparts[1];
+ }
+}
+?>
+<h3>Add/Move/Delete a Bus Stop Location</h3>
+<form action="feedback.php" method="post">
+StopID: <input type="text" name="stopid" value="<?php echo $stopid ?>"/><br>
+or StopCode: <input type="text" name="stopcode" value="<?php echo $stopcode ?>"/><br>
+<small> if you click on feedback from a stop page, these will get filled in automatically. else describe the location/street of the stop in one of these boxes </small><br>
+
+Suggested Stop Location (lat/long or words): <input type="text" name="newlocation"/><br>
+<!--<small> if your device supports javascript, you can pick a location from the map above</small><br>-->
+
+<input type="submit" value="Submit!"/>
+</form>
+<h3>Bug Report/Feedback</h3>
+Please leave feedback about bugs/errors or general suggestions about improvements that could be made to the way the data is presented!
+<form action="feedback.php" method="post">
+<textarea name="feedback">
+</textarea>
+<textarea name="extrainfo" id="extrainfo">
+<?php
+ echo "Referrer URL: ".$_SERVER["HTTP_REFERER"];
+ echo "\nCurrent page URL: ".curPageURL();
+ echo "\nUser Agent: ".$_SERVER["HTTP_USER_AGENT"];
+ echo "\nUser host/IP: ".$_SERVER["HTTP_X_FORWARDED_FOR"]." ".$_SERVER["REMOTE_ADDR"];
+ echo "\nServer host/IP: ".php_uname("n");
+ echo "\nCurrent date/time: ". date("c");
+ echo "\nCurrent code revision: ".exec("git rev-parse --short HEAD");
+ echo "\nCurrent timetables version: ".date("c",@filemtime('cbrfeed.zip'));
+ echo "\nDump of session: ".print_r($_SESSION,true);
+?>
+</textarea>
+
+<input type="submit" value="Submit!"/>
+</form>
+<?php
+}
+include_footer();
+?>
+
+
--- /dev/null
+++ b/geo/route.kml.php
@@ -1,1 +1,30 @@
+<?php
+header('Content-Type: application/vnd.google-earth.kml+xml');
+include ('../include/common.inc.php');
+echo '<?xml version="1.0" encoding="UTF-8"?>
+<kml xmlns="http://www.opengis.net/kml/2.2" xmlns:atom="http://www.w3.org/2005/Atom"><Document>';
+echo '
+ <Style id="yellowLineGreenPoly">
+ <LineStyle>
+ <color>7f00ff00</color>
+ <width>4</width>
+ </LineStyle>
+ <PolyStyle>
+ <color>7f00ffff</color>
+ </PolyStyle>
+ </Style>';
+$route = getRoute($routeid);
+ echo "\n<Placemark>\n";
+ $link = curPageURL()."/../trip.php?routeid=".htmlspecialchars ($route["route_id"]);
+ echo "<name>".$route['route_short_name']."</name>";
+ echo '<atom:link href="'.$link.'"/>';
+ echo '<description><![CDATA[ <a href="'.$link.'">'.$route['route_short_name']." ".$route['route_long_name']."</a>]]> </description>";
+echo "<styleUrl>#yellowLineGreenPoly</styleUrl>";
+ $trips = getRouteTrips($routeid);
+ echo getTripShape($trips[0]['trip_id']);
+
+echo "</Placemark>\n</Document></kml>\n";
+?>
+
+
--- /dev/null
+++ b/geo/stops.kml.php
@@ -1,1 +1,36 @@
-
+<?php
+header('Content-type: application/vnd.google-earth.kml+xml');
+//http://wiki.openstreetmap.org/wiki/OpenLayers_Dynamic_KML
+// Creates the KML/XML Document.
+$dom = new DOMDocument('1.0', 'UTF-8');
+// Creates the root KML element and appends it to the root document.
+$node = $dom->createElementNS('http://earth.google.com/kml/2.1', 'kml');
+$parNode = $dom->appendChild($node);
+// Creates a KML Document element and append it to the KML element.
+$dnode = $dom->createElement('Document');
+$docNode = $parNode->appendChild($dnode);
+if ($suburb != "") $result_stops = getStopsBySuburb($suburb);
+else $result_stops = getStops();
+foreach ($result_stops as $stop) {
+ $description = 'http://bus.lambdacomplex.org/' . 'stop.php?stopid=' . $stop['stop_id'] . " <br>";
+ // Creates a Placemark and append it to the Document.
+ $node = $dom->createElement('Placemark');
+ $placeNode = $docNode->appendChild($node);
+ // Creates an id attribute and assign it the value of id column.
+ $placeNode->setAttribute('id', 'placemark' . $stop['stop_id']);
+ // Create name, and description elements and assigns them the values of the name and address columns from the results.
+ $nameNode = $dom->createElement('name', htmlentities($stop['stop_name']));
+ $descriptionNode = $dom->createElement('description', $description);
+ $placeNode->appendChild($nameNode);
+ $placeNode->appendChild($descriptionNode);
+ // Creates a Point element.
+ $pointNode = $dom->createElement('Point');
+ $placeNode->appendChild($pointNode);
+ // Creates a coordinates element and gives it the value of the lng and lat columns from the results.
+ $coorStr = $stop['stop_lon'] . ',' . $stop['stop_lat'];
+ $coorNode = $dom->createElement('coordinates', $coorStr);
+ $pointNode->appendChild($coorNode);
+}
+$kmlOutput = $dom->saveXML();
+echo $kmlOutput;
+?>
--- /dev/null
+++ b/include/common-db.inc.php
@@ -1,1 +1,23 @@
+<?php
+if (php_uname('n') == "actbus-www") {
+ $conn = new PDO("pgsql:dbname=transitdata;user=transitdata;password=transitdata;host=bus-main.lambdacomplex.org");
+}
+else if (isDebugServer()) {
+ $conn = new PDO("pgsql:dbname=transitdata;user=postgres;password=snmc;host=localhost");
+}
+else {
+ $conn = new PDO("pgsql:dbname=transitdata;user=transitdata;password=transitdata;host=localhost");
+}
+if (!$conn) {
+ die("A database error occurred.\n");
+}
+function databaseError($errMsg)
+{
+ die($errMsg);
+}
+include ('db/route-dao.inc.php');
+include ('db/trip-dao.inc.php');
+include ('db/stop-dao.inc.php');
+include ('db/servicealert-dao.inc.php');
+?>
--- /dev/null
+++ b/include/common-geo.inc.php
@@ -1,1 +1,153 @@
+<?php
+// SELECT array_to_string(array(SELECT REPLACE(name_2006, ',', '\,') as name FROM suburbs order by name), ',')
+$suburbs = explode(",", "Acton,Ainslie,Amaroo,Aranda,Banks,Barton,Belconnen,Bonner,Bonython,Braddon,Bruce,Calwell,Campbell,Chapman,Charnwood,Chifley,Chisholm,City,Conder,Cook,Curtin,Deakin,Dickson,Downer,Duffy,Dunlop,Evatt,Fadden,Farrer,Fisher,Florey,Flynn,Forrest,Franklin,Fraser,Fyshwick,Garran,Gilmore,Giralang,Gordon,Gowrie,Greenway,Griffith,Gungahlin,Hackett,Hall,Harrison,Hawker,Higgins,Holder,Holt,Hughes,Hume,Isaacs,Isabella Plains,Kaleen,Kambah,Kingston,Latham,Lawson,Lyneham,Lyons,Macarthur,Macgregor,Macquarie,Mawson,McKellar,Melba,Mitchell,Monash,Narrabundah,Ngunnawal,Nicholls,Oaks Estate,O'Connor,O'Malley,Oxley,Page,Palmerston,Parkes,Pearce,Phillip,Pialligo,Red Hill,Reid,Richardson,Rivett,Russell,Scullin,Spence,Stirling,Symonston,Tharwa,Theodore,Torrens,Turner,Wanniassa,Waramanga,Watson,Weetangera,Weston,Yarralumla");
+function staticmap($mapPoints, $zoom = 0, $markerImage = "iconb", $collapsible = true, $twotone = false)
+{
+ global $labsPath;
+ $width = 300;
+ $height = 300;
+ $metersperpixel[9] = 305.492 * $width;
+ $metersperpixel[10] = 152.746 * $width;
+ $metersperpixel[11] = 76.373 * $width;
+ $metersperpixel[12] = 38.187 * $width;
+ $metersperpixel[13] = 19.093 * $width;
+ $metersperpixel[14] = 9.547 * $width;
+ $metersperpixel[15] = 4.773 * $width;
+ //$metersperpixel[16] = 2.387 * $width;
+ // $metersperpixel[17]=1.193*$width;
+ $center = "";
+ $markers = "";
+ $mapwidthinmeters = 50;
+ if (sizeof($mapPoints) < 1) return "map error";
+ if (sizeof($mapPoints) === 1) {
+ if ($zoom == 0) $zoom = 14;
+ $markers.= "{$mapPoints[0][0]},{$mapPoints[0][1]},$markerimage";
+ $center = "{$mapPoints[0][0]},{$mapPoints[0][1]}";
+ }
+ else {
+ foreach ($mapPoints as $index => $mapPoint) {
+ if ($twotone && $index == 0) {
+ $markers.= $mapPoint[0] . "," . $mapPoint[1] . "," . "iconr" . ($index + 1);
+ $center = "{$mapPoints[0][0]},{$mapPoints[0][1]}";
+ }
+ else {
+ $markers.= $mapPoint[0] . "," . $mapPoint[1] . "," . $markerImage . ($index + 1);
+ }
+ if ($index + 1 != sizeof($mapPoints)) $markers.= "|";
+ $dist = distance($mapPoints[0][0], $mapPoint[0][1], $mapPoint[0], $mapPoint[1]);
+ $mapwidthinmeters = ($dist > $mapwidthinmeters ? $dist : $mapwidthinmeters);
+ $totalLat+= $mapPoint[0];
+ $totalLon+= $mapPoint[1];
+ }
+ if ($zoom == 0) {
+ $mapwidthinmeters = distance($minlat, $minlon, $minlat, $maxlon);
+ foreach (array_reverse($metersperpixel, true) as $zoomLevel => $maxdistance) {
+ if ($zoom == 0 && $mapwidthinmeters * 1.5 < ($maxdistance)) $zoom = $zoomLevel;
+ }
+ }
+ $center = $totalLat / sizeof($mapPoints) . "," . $totalLon / sizeof($mapPoints);
+ }
+ $output = "";
+ if ($collapsible) $output.= '<div class="map" data-role="collapsible" data-collapsed="true"><h3>Open Map...</h3>';
+ $output.= '<img class="map" src="' . curPageURL() . '/' . $labsPath . '/lib/staticmaplite/staticmap.php?center=' . $center . '&zoom=' . $zoom . '&size=' . $width . 'x' . $height . '&markers=' . $markers . '" width=' . $width . ' height=' . $height . '>';
+ if ($collapsible) $output.= '</div>';
+ return $output;
+}
+function distance($lat1, $lng1, $lat2, $lng2, $roundLargeValues = false)
+{
+ $pi80 = M_PI / 180;
+ $lat1*= $pi80;
+ $lng1*= $pi80;
+ $lat2*= $pi80;
+ $lng2*= $pi80;
+ $r = 6372.797; // mean radius of Earth in km
+ $dlat = $lat2 - $lat1;
+ $dlng = $lng2 - $lng1;
+ $a = sin($dlat / 2) * sin($dlat / 2) + cos($lat1) * cos($lat2) * sin($dlng / 2) * sin($dlng / 2);
+ $c = 2 * atan2(sqrt($a) , sqrt(1 - $a));
+ $km = $r * $c;
+ if ($roundLargeValues) {
+ if ($km < 1) return floor($km * 1000);
+ else return round($km, 2) . "k";
+ }
+ else return floor($km * 1000);
+}
+function decodePolylineToArray($encoded)
+{
+ // source: http://latlongeeks.com/forum/viewtopic.php?f=4&t=5
+ $length = strlen($encoded);
+ $index = 0;
+ $points = array();
+ $lat = 0;
+ $lng = 0;
+ while ($index < $length) {
+ // Temporary variable to hold each ASCII byte.
+ $b = 0;
+ // The encoded polyline consists of a latitude value followed by a
+ // longitude value. They should always come in pairs. Read the
+ // latitude value first.
+ $shift = 0;
+ $result = 0;
+ do {
+ // The `ord(substr($encoded, $index++))` statement returns the ASCII
+ // code for the character at $index. Subtract 63 to get the original
+ // value. (63 was added to ensure proper ASCII characters are displayed
+ // in the encoded polyline string, which is `human` readable)
+ $b = ord(substr($encoded, $index++)) - 63;
+ // AND the bits of the byte with 0x1f to get the original 5-bit `chunk.
+ // Then left shift the bits by the required amount, which increases
+ // by 5 bits each time.
+ // OR the value into $results, which sums up the individual 5-bit chunks
+ // into the original value. Since the 5-bit chunks were reversed in
+ // order during encoding, reading them in this way ensures proper
+ // summation.
+ $result|= ($b & 0x1f) << $shift;
+ $shift+= 5;
+ }
+ // Continue while the read byte is >= 0x20 since the last `chunk`
+ // was not OR'd with 0x20 during the conversion process. (Signals the end)
+ while ($b >= 0x20);
+ // Check if negative, and convert. (All negative values have the last bit
+ // set)
+ $dlat = (($result & 1) ? ~($result >> 1) : ($result >> 1));
+ // Compute actual latitude since value is offset from previous value.
+ $lat+= $dlat;
+ // The next values will correspond to the longitude for this point.
+ $shift = 0;
+ $result = 0;
+ do {
+ $b = ord(substr($encoded, $index++)) - 63;
+ $result|= ($b & 0x1f) << $shift;
+ $shift+= 5;
+ } while ($b >= 0x20);
+ $dlng = (($result & 1) ? ~($result >> 1) : ($result >> 1));
+ $lng+= $dlng;
+ // The actual latitude and longitude values were multiplied by
+ // 1e5 before encoding so that they could be converted to a 32-bit
+ // integer representation. (With a decimal accuracy of 5 places)
+ // Convert back to original values.
+ $points[] = array(
+ $lat * 1e-5,
+ $lng * 1e-5
+ );
+ }
+ return $points;
+}
+function geocode($query, $giveOptions)
+{
+ global $cloudmadeAPIkey;
+ $url = "http://geocoding.cloudmade.com/$cloudmadeAPIkey/geocoding/v2/find.js?query=" . urlencode($query) . "&bbox=-35.5,149.00,-35.15,149.1930&return_location=true&bbox_only=true";
+ $contents = json_decode(getPage($url));
+ if ($giveOptions) return $contents->features;
+ elseif (isset($contents->features[0]->centroid)) return $contents->features[0]->centroid->coordinates[0] . "," . $contents->features[0]->centroid->coordinates[1];
+ else return "";
+}
+function reverseGeocode($lat, $lng)
+{
+ global $cloudmadeAPIkey;
+ $url = "http://geocoding.cloudmade.com/$cloudmadeAPIkey/geocoding/v2/find.js?around=" . $lat . "," . $lng . "&distance=closest&object_type=road";
+ $contents = json_decode(getPage($url));
+ return $contents->features[0]->properties->name;
+}
+?>
--- /dev/null
+++ b/include/common-net.inc.php
@@ -1,1 +1,31 @@
+<?php
+function getPage($url)
+{
+ debug($url, "json");
+ $ch = curl_init($url);
+ curl_setopt($ch, CURLOPT_RETURNTRANSFER, 1);
+ curl_setopt($ch, CURLOPT_HEADER, 0);
+ curl_setopt($ch, CURLOPT_TIMEOUT, 45);
+ $page = curl_exec($ch);
+ if (curl_errno($ch)) {
+ echo "<font color=red> Database temporarily unavailable: ";
+ echo curl_errno($ch) . " " . curl_error($ch);
+ if (isDebug()) {
+ echo $url;
+ }
+ echo "</font><br>";
+ }
+ curl_close($ch);
+ debug(print_r($page,true),"json");
+ return $page;
+}
+function curPageURL()
+{
+ $isHTTPS = (isset($_SERVER["HTTPS"]) && $_SERVER["HTTPS"] == "on");
+ $port = (isset($_SERVER["SERVER_PORT"]) && ((!$isHTTPS && $_SERVER["SERVER_PORT"] != "80") || ($isHTTPS && $_SERVER["SERVER_PORT"] != "443")));
+ $port = ($port) ? ':' . $_SERVER["SERVER_PORT"] : '';
+ $url = ($isHTTPS ? 'https://' : 'http://') . $_SERVER["SERVER_NAME"] . $port . htmlentities(dirname($_SERVER['PHP_SELF']) , ENT_QUOTES);
+ return $url;
+}
+?>
--- /dev/null
+++ b/include/common-request.inc.php
@@ -1,1 +1,48 @@
-
+<?php
+if (isset($_REQUEST['firstLetter'])) {
+ $firstLetter = filter_var($_REQUEST['firstLetter'], FILTER_SANITIZE_STRING);
+}
+if (isset($_REQUEST['bysuburbs'])) {
+ $bysuburbs = true;
+}
+if (isset($_REQUEST['bynumber'])) {
+ $bynumber = true;
+}
+if (isset($_REQUEST['allstops'])) {
+ $allstops = true;
+}
+if (isset($_REQUEST['nearby'])) {
+ $nearby = true;
+}
+if (isset($_REQUEST['suburb'])) {
+ $suburb = $_REQUEST['suburb'];
+}
+$pageKey = filter_var($_REQUEST['pageKey'], FILTER_SANITIZE_NUMBER_INT);
+$lat = filter_var($_REQUEST['lat'], FILTER_SANITIZE_NUMBER_FLOAT, FILTER_FLAG_ALLOW_FRACTION);
+$lon = filter_var($_REQUEST['lon'], FILTER_SANITIZE_NUMBER_FLOAT, FILTER_FLAG_ALLOW_FRACTION);
+$max_distance = filter_var($_REQUEST['radius'], FILTER_SANITIZE_NUMBER_INT);
+if (isset($_REQUEST['numberSeries'])) {
+ $numberSeries = filter_var($_REQUEST['numberSeries'], FILTER_SANITIZE_NUMBER_INT);
+}
+if (isset($_REQUEST['routeDestination'])) {
+ $routeDestination = urldecode(filter_var($_REQUEST['routeDestination'], FILTER_SANITIZE_ENCODED));
+}
+if (isset($_REQUEST['stopcode'])) {
+ $stopcode = filter_var($_REQUEST['stopcode'], FILTER_SANITIZE_STRING);
+}
+if (isset($_REQUEST['stopids'])) {
+ $stopids = explode(",", filter_var($_REQUEST['stopids'], FILTER_SANITIZE_STRING));
+}
+if (isset($_REQUEST['tripid'])) {
+ $tripid = filter_var($_REQUEST['tripid'], FILTER_SANITIZE_NUMBER_INT);
+}
+if (isset($_REQUEST['stopid'])) {
+ $stopid = filter_var($_REQUEST['stopid'], FILTER_SANITIZE_NUMBER_INT);
+}
+if (isset($_REQUEST['routeid'])) {
+ $routeid = filter_var($_REQUEST['routeid'], FILTER_SANITIZE_NUMBER_INT);
+}
+if (isset($_REQUEST['geolocate'])) {
+$geolocate = filter_var($_REQUEST['geolocate'], FILTER_SANITIZE_URL);
+}
+?>
--- /dev/null
+++ b/include/common-session.inc.php
@@ -1,1 +1,63 @@
+<?php
+// you have to open the session to be able to modify or remove it
+session_start();
+if (isset($_REQUEST['service_period'])) {
+ $_SESSION['service_period'] = filter_var($_REQUEST['service_period'], FILTER_SANITIZE_STRING);
+ sessionUpdated();
+}
+if (isset($_REQUEST['time'])) {
+ $_SESSION['time'] = filter_var($_REQUEST['time'], FILTER_SANITIZE_STRING);
+ sessionUpdated();
+}
+if (isset($_REQUEST['geolocate']) && $_REQUEST['geolocate'] != "Enter co-ordinates or address here") {
+ $geocoded = false;
+ if (isset($_REQUEST['lat']) && isset($_REQUEST['lon'])) {
+ $_SESSION['lat'] = trim(filter_var($_REQUEST['lat'], FILTER_SANITIZE_NUMBER_FLOAT, FILTER_FLAG_ALLOW_FRACTION));
+ $_SESSION['lon'] = trim(filter_var($_REQUEST['lon'], FILTER_SANITIZE_NUMBER_FLOAT, FILTER_FLAG_ALLOW_FRACTION));
+ }
+ else {
+ if (startsWith($geolocate, "-")) {
+ $locateparts = explode(",", $geolocate);
+ $_SESSION['lat'] = $locateparts[0];
+ $_SESSION['lon'] = $locateparts[1];
+ }
+ else if (strpos($geolocate, "(") !== false) {
+ $geoParts = explode("(", $geolocate);
+ $locateparts = explode(",", str_replace(")", "",$geoParts[1]));
+ $_SESSION['lat'] = $locateparts[0];
+ $_SESSION['lon'] = $locateparts[1];
+ }
+ else {
+ $contents = geocode($geolocate, true);
+ print_r($contents);
+ if (isset($contents[0]->centroid)) {
+ $geocoded = true;
+ $_SESSION['lat'] = $contents[0]->centroid->coordinates[0];
+ $_SESSION['lon'] = $contents[0]->centroid->coordinates[1];
+ }
+ else {
+ $_SESSION['lat'] = "";
+ $_SESSION['lon'] = "";
+ }
+ }
+ }
+ sessionUpdated();
+}
+function sessionUpdated()
+{
+ $_SESSION['lastUpdated'] = time();
+}
+// timeoutSession
+$TIMEOUT_LIMIT = 60 * 5; // 5 minutes
+if (isset($_SESSION['lastUpdated']) && $_SESSION['lastUpdated'] + $TIMEOUT_LIMIT < time()) {
+ debug("Session timeout " . ($_SESSION['lastUpdated'] + $TIMEOUT_LIMIT) . ">" . time() , "session");
+ session_destroy();
+ session_start();
+}
+//debug(print_r($_SESSION, true) , "session");
+function current_time()
+{
+ return ($_SESSION['time'] ? $_SESSION['time'] : date("H:i:s"));
+}
+?>
--- /dev/null
+++ b/include/common-template.inc.php
@@ -1,1 +1,238 @@
-
+<?php
+// Copyright 2009 Google Inc. All Rights Reserved.
+$GA_ACCOUNT = "MO-22173039-1";
+$GA_PIXEL = "/lib/ga.php";
+function googleAnalyticsGetImageUrl()
+{
+ global $GA_ACCOUNT, $GA_PIXEL;
+ //if (stristr($_SERVER['HTTP_USER_AGENT'], 'Googlebot') return "";
+ $url = "";
+ $url.= $GA_PIXEL . "?";
+ $url.= "utmac=" . $GA_ACCOUNT;
+ $url.= "&utmn=" . rand(0, 0x7fffffff);
+ $referer = $_SERVER["HTTP_REFERER"];
+ $query = $_SERVER["QUERY_STRING"];
+ $path = $_SERVER["REQUEST_URI"];
+ if (empty($referer)) {
+ $referer = "-";
+ }
+ $url.= "&utmr=" . urlencode($referer);
+ if (!empty($path)) {
+ $url.= "&utmp=" . urlencode($path);
+ }
+ $url.= "&guid=ON";
+ return str_replace("&", "&", $url);
+}
+
+function include_header($pageTitle, $pageType, $opendiv = true, $geolocate = false, $datepicker = false)
+{
+global $labsPath;
+ echo '
+<!DOCTYPE html>
+<html lang="en">
+ <head>
+ <meta charset="UTF-8">
+<meta name="viewport" content="width=device-width, initial-scale=1">
+<title>' . $pageTitle . '</title>
+ <meta name="google-site-verification"
+content="-53T5Qn4TB_de1NyfR_ZZkEVdUNcNFSaYKSFkWKx-sY" />
+ <link rel="stylesheet" href="'.$labsPath.'css/jquery-ui-1.8.12.custom.css" />';
+ if (isDebugServer()) {
+ echo '<link rel="stylesheet" href="'.$labsPath.'css/jquery.mobile-1.0b1.css" />
+
+ <script type="text/javascript" src="'.$labsPath.'js/jquery-1.6.1.min.js"></script>
+ <script>$(document).bind("mobileinit", function(){
+ $.mobile.ajaxEnabled = false;
+});
+</script>
+ <script type="text/javascript" src="'.$labsPath.'js/jquery.mobile-1.0b1.js"></script>';
+ }
+ else {
+ echo '<link rel="stylesheet" href="http://code.jquery.com/mobile/1.0b1/jquery.mobile-1.0b1.min.css" />
+ <script type="text/javascript" src="http://ajax.googleapis.com/ajax/libs/jquery/1.6.1/jquery.min.js"></script>
+ <script>$(document).bind("mobileinit", function(){
+ $.mobile.ajaxEnabled = false;
+});
+</script>
+ <script type="text/javascript" src="http://code.jquery.com/mobile/1.0b1/jquery.mobile-1.0b1.min.js"></script>';
+ }
+ echo '
+ <script src="'.$labsPath.'js/jquery.ui.autocomplete.min.js"></script>
+<script src="'.$labsPath.'js/jquery.ui.core.min.js"></script>
+<script src="'.$labsPath.'js/jquery.ui.position.min.js"></script>
+<script src="'.$labsPath.'js/jquery.ui.widget.min.js"></script>
+ <script>
+ $(function() {
+ $( "#geolocate" ).autocomplete({
+ source: "lib/autocomplete.php",
+ minLength: 2
+ });
+ $( "#from" ).autocomplete({
+ source: "lib/autocomplete.php",
+ minLength: 2
+ });
+ $( "#to" ).autocomplete({
+ source: "lib/autocomplete.php",
+ minLength: 2
+ });
+ });
+ </script>
+ ';
+ echo '<style type="text/css">';
+
+if (strstr($_SERVER['HTTP_USER_AGENT'], 'Android')) echo '.ui-shadow,.ui-btn-up-a,.ui-btn-hover-a,.ui-btn-down-a,.ui-body-b,.ui-btn-up-b,.ui-btn-hover-b,
+.ui-btn-down-b,.ui-bar-c,.ui-body-c,.ui-btn-up-c,.ui-btn-hover-c,.ui-btn-down-c,.ui-bar-c,.ui-body-d,
+.ui-btn-up-d,.ui-btn-hover-d,.ui-btn-down-d,.ui-bar-d,.ui-body-e,.ui-btn-up-e,.ui-btn-hover-e,
+.ui-btn-down-e,.ui-bar-e,.ui-overlay-shadow,.ui-shadow,.ui-btn-active,.ui-body-a,.ui-bar-a {
+ text-shadow: none;
+ box-shadow: none;
+ -webkit-box-shadow: none;
+}';
+echo '</style>';
+
+echo '<link rel="stylesheet" href="'.$labsPath.'css/local.css.php?labsPath='.$labsPath.'" />';
+
+
+ if (strstr($_SERVER['HTTP_USER_AGENT'], 'iPhone') || strstr($_SERVER['HTTP_USER_AGENT'], 'iPod') || strstr($_SERVER['HTTP_USER_AGENT'], 'iPad')) {
+ echo '<meta name="apple-mobile-web-app-capable" content="yes" />
+ <meta name="apple-mobile-web-app-status-bar-style" content="black" />
+ <link rel="apple-touch-startup-image" href="startup.png" />
+ <link rel="apple-touch-icon" href="apple-touch-icon.png" />';
+ }
+ if ($geolocate) {
+ echo "<script>
+
+function success(position) {
+$('#error').val('Location now detected. Please wait for data to load.');
+$('#geolocate').val(position.coords.latitude+','+position.coords.longitude);
+$.ajax({ url: \"include/common.inc.php?geolocate=yes&lat=\"+position.coords.latitude+\"&lon=\"+position.coords.longitude });
+location.reload(true);
+}
+function error(msg) {
+$('#error').val('Error: '+msg);
+}
+
+function geolocate() {
+if (navigator.geolocation) {
+var options = {
+ enableHighAccuracy: true,
+ timeout: 60000,
+ maximumAge: 10000
+}
+ navigator.geolocation.getCurrentPosition(success, error, options);
+}
+}
+$(document).ready(function() {
+ $('#here').click(function(event) { $('#geolocate').val(geolocate()); return false;});
+ $('#here').show();
+});
+";
+ if (!isset($_SESSION['lat']) || $_SESSION['lat'] == "") echo "geolocate();";
+ echo "</script> ";
+ }
+ if (isAnalyticsOn()) echo '
+<script type="text/javascript">' . "
+
+ var _gaq = _gaq || [];
+ _gaq.push(['_setAccount', 'UA-22173039-1']);
+ _gaq.push(['_trackPageview']);
+ _gaq.push(['_trackPageLoadTime']);
+</script>";
+ echo '</head>
+<body>
+ <div id="skip">
+ <a href="#maincontent">Skip to content</a>
+ </div>
+ ';
+ if ($opendiv) {
+ echo '<div data-role="page">
+ <div data-role="header" data-position="inline">
+ <a href="' . (isset($_SERVER["HTTP_REFERER"]) ? $_SERVER["HTTP_REFERER"] : "javascript:history.go(-1)") . '" data-icon="arrow-l" data-rel="back" class="ui-btn-left">Back</a>
+ <h1>' . $pageTitle . '</h1>
+ <a href="'.$labsPath.'/index.php" data-icon="home" class="ui-btn-right">Home</a>
+ </div><!-- /header -->
+ <a name="maincontent" id="maincontent"></a>
+ <div data-role="content"> ';
+ $overrides = getServiceOverride();
+ if ($overrides['service_id']) {
+ if ($overrides['service_id'] == "noservice") {
+ echo '<div id="servicewarning">Buses are <strong>not running today</strong> due to industrial action/public holiday. See <a
+href="http://www.action.act.gov.au">http://www.action.act.gov.au</a> for details.</div>';
+ }
+ else {
+ echo '<div id="servicewarning">Buses are running on an altered timetable today due to industrial action/public holiday. See <a href="http://www.action.act.gov.au">http://www.action.act.gov.au</a> for details.</div>';
+ }
+ }
+ }
+
+}
+function include_footer()
+{
+
+global $labsPath;
+ echo '<div id="footer"><a href="'.$labsPath.'about.php">About/Contact Us</a> <a href="'.$labsPath.'feedback.php">Feedback/Bug Report</a> <a href="'.$labsPath.'privacy.php">Privacy Policy</a>';
+ echo '</div>';
+ if (isAnalyticsOn()) {
+ echo "<script> (function() {
+ var ga = document.createElement('script'); ga.type =
+'text/javascript'; ga.async = true;
+ ga.src = ('https:' == document.location.protocol ?
+'https://ssl' : 'http://www') + '.google-analytics.com/ga.js';
+ var s = document.getElementsByTagName('script')[0];
+s.parentNode.insertBefore(ga, s);
+ })();</script>";
+ $googleAnalyticsImageUrl = googleAnalyticsGetImageUrl();
+ echo '<noscript><img src="' . $googleAnalyticsImageUrl . '" /></noscript>';
+
+ }
+ echo "\n</div></div></body></html>";
+}
+function timePlaceSettings($geolocate = false)
+{
+ global $service_periods;
+ $geoerror = false;
+ if ($geolocate == true) {
+ $geoerror = !isset($_SESSION['lat']) || !isset($_SESSION['lat']) || $_SESSION['lat'] == "" || $_SESSION['lon'] == "";
+ }
+ echo '<div id="error">';
+ if ($geoerror) {
+ echo 'Sorry, but your location could not currently be detected.
+ Please allow location permission, wait for your location to be detected,
+ or enter an address/co-ordinates in the box below.';
+ }
+ echo '</div>';
+ echo '<div id="settings" data-role="collapsible" data-collapsed="' . !$geoerror . '">
+ <h3>Change Time/Place (' . (isset($_SESSION['time']) ? $_SESSION['time'] : "Current Time,") . ' ' . ucwords(service_period()) . ')...</h3>
+ <form action="' . basename($_SERVER['PHP_SELF']) . "?" . $_SERVER['QUERY_STRING'] . '" method="post">
+ <div class="ui-body">
+ <div data-role="fieldcontain">
+ <label for="geolocate"> Current Location: </label>
+ <input type="text" id="geolocate" name="geolocate" value="' . (isset($_SESSION['lat']) && isset($_SESSION['lon']) ? $_SESSION['lat'] . "," . $_SESSION['lon'] : "Enter co-ordinates or address here") . '"/> <a href="#" style="display:none" name="here" id="here">Here?</a>
+ </div>
+ <div data-role="fieldcontain">
+ <label for="time"> Time: </label>
+ <input type="time" name="time" id="time" value="' . (isset($_SESSION['time']) ? $_SESSION['time'] : date("H:i")) . '"/>
+ <a href="#" name="currentTime" id="currentTime" onClick="var d = new Date();' . "$('#time').val(d.getHours() +':'+ (d.getMinutes().toString().length == 1 ? '0'+ d.getMinutes(): d.getMinutes()));" . '">Current Time?</a>
+ </div>
+ <div data-role="fieldcontain">
+ <label for="service_period"> Service Period: </label>
+ <select name="service_period" id="service_period">';
+ foreach ($service_periods as $service_period) {
+ echo "<option value=\"$service_period\"" . (service_period() === $service_period ? " SELECTED" : "") . '>' . ucwords($service_period) . '</option>';
+ }
+ echo '</select>
+ <a href="#" style="display:none" name="currentPeriod" id="currentPeriod">Current Period?</a>
+ </div>
+
+ <input type="submit" value="Update"/>
+ </div></form>
+ </div>';
+}
+function trackEvent($category, $action, $label = "", $value = - 1)
+{
+ if (isAnalyticsOn()) {
+ echo "\n<script> _gaq.push(['_trackEvent', '$category', '$action'" . ($label != "" ? ", '$label'" : "") . ($value != - 1 ? ", $value" : "") . "]);</script>";
+ }
+}
+?>
+
--- /dev/null
+++ b/include/common-transit.inc.php
@@ -1,1 +1,49 @@
+<?php
+$service_periods = Array(
+ 'sunday',
+ 'saturday',
+ 'weekday'
+);
+function service_period($date = "")
+{
+
+ if (isset($_SESSION['service_period'])) return $_SESSION['service_period'];
+ $override = getServiceOverride($date);
+ if ($override['service_id']){
+ return $override['service_id'];
+ }
+
+ switch (date('w',($date != "" ? $date : time()))) {
+ case 0:
+ return 'sunday';
+ case 6:
+ return 'saturday';
+ default:
+ return 'weekday';
+ }
+}
+function midnight_seconds($time = "")
+{
+ // from http://www.perturb.org/display/Perlfunc__Seconds_Since_Midnight.html
+ if ($time != "") {
+ return (date("G", $time) * 3600) + (date("i", $time) * 60) + date("s", $time);
+ }
+ if (isset($_SESSION['time'])) {
+ $time = strtotime($_SESSION['time']);
+ return (date("G", $time) * 3600) + (date("i", $time) * 60) + date("s", $time);
+ }
+ return (date("G") * 3600) + (date("i") * 60) + date("s");
+}
+function midnight_seconds_to_time($seconds)
+{
+ if ($seconds > 0) {
+ $midnight = mktime(0, 0, 0, date("n") , date("j") , date("Y"));
+ return date("h:ia", $midnight + $seconds);
+ }
+ else {
+ return "";
+ }
+}
+?>
+
--- /dev/null
+++ b/include/common.inc.php
@@ -1,1 +1,189 @@
+<?php
+date_default_timezone_set('Australia/ACT');
+$debugOkay = Array(
+ "session",
+ "json",
+ "phperror",
+ "awsotp",
+ //"squallotp",
+ //"vanilleotp",
+ "database",
+ "other"
+);
+$cloudmadeAPIkey = "daa03470bb8740298d4b10e3f03d63e6";
+$googleMapsAPIkey = "ABQIAAAA95XYXN0cki3Yj_Sb71CFvBTPaLd08ONybQDjcH_VdYtHHLgZvRTw2INzI_m17_IoOUqH3RNNmlTk1Q";
+$otpAPIurl = 'http://localhost:8080/opentripplanner-api-webapp/';
+if (isDebug("awsotp") || php_uname('n') == "maxious.xen.prgmr.com") {
+ $otpAPIurl = 'http://bus-main.lambdacomplex.org:8080/opentripplanner-api-webapp/';
+}
+if (isDebug("dotcloudotp") || php_uname('n') == "actbus-www") {
+ $otpAPIurl = 'http://otp.actbus.dotcloud.com/opentripplanner-api-webapp/';
+}
+if (isDebug("squallotp")) {
+ $otpAPIurl = 'http://10.0.1.108:5080/opentripplanner-api-webapp/';
+}
+if (isDebug("vanilleotp")) {
+ $otpAPIurl = 'http://10.0.1.135:8080/opentripplanner-api-webapp/';
+}
+if (isDebug("phperror")) error_reporting(E_ALL ^ E_NOTICE);
+$labsPath = "";
+if (strstr($_SERVER['PHP_SELF'],"labs")) $labsPath = "../";
+function isDebugServer()
+{
+ return !isset($_SERVER['SERVER_NAME']) || $_SERVER['SERVER_NAME'] == "10.0.1.154" || $_SERVER['SERVER_NAME'] == "10.1.0.4" || $_SERVER['SERVER_NAME'] == "localhost" || $_SERVER['SERVER_NAME'] == "127.0.0.1" ;
+}
+
+include_once ("common-geo.inc.php");
+include_once ("common-net.inc.php");
+include_once ("common-transit.inc.php");
+include_once ("common-db.inc.php");
+
+include_once ("common-request.inc.php");
+include_once ("common-session.inc.php");
+include_once ("common-template.inc.php");
+
+
+function isAnalyticsOn()
+{
+ return !isDebugServer();
+}
+function isDebug($debugReason = "other")
+{
+ global $debugOkay;
+ return in_array($debugReason, $debugOkay, false) && isDebugServer();
+}
+function debug($msg, $debugReason = "other")
+{
+ if (isDebug($debugReason)) echo "\n<!-- " . date(DATE_RFC822) . "\n $msg -->\n";
+}
+function isJQueryMobileDevice()
+{
+ // http://forum.jquery.com/topic/what-is-the-best-way-to-detect-all-useragents-which-can-handle-jquery-mobile#14737000002087897
+ $user_agent = $_SERVER['HTTP_USER_AGENT'];
+ return preg_match('/iphone/i', $user_agent) || preg_match('/android/i', $user_agent) || preg_match('/webos/i', $user_agent) || preg_match('/ios/i', $user_agent) || preg_match('/bada/i', $user_agent) || preg_match('/maemo/i', $user_agent) || preg_match('/meego/i', $user_agent) || preg_match('/fennec/i', $user_agent) || (preg_match('/symbian/i', $user_agent) && preg_match('/s60/i', $user_agent) && $browser['majorver'] >= 5) || (preg_match('/symbian/i', $user_agent) && preg_match('/platform/i', $user_agent) && $browser['majorver'] >= 3) || (preg_match('/blackberry/i', $user_agent) && $browser['majorver'] >= 5) || (preg_match('/opera mobile/i', $user_agent) && $browser['majorver'] >= 10) || (preg_match('/opera mini/i', $user_agent) && $browser['majorver'] >= 5);
+}
+function isFastDevice()
+{
+ $ua = $_SERVER['HTTP_USER_AGENT'];
+ $fastDevices = Array(
+ "Mozilla/5.0 (X11;",
+ "Mozilla/5.0 (Windows;",
+ "Mozilla/5.0 (iP",
+ "Mozilla/5.0 (Linux; U; Android",
+ "Mozilla/4.0 (compatible; MSIE"
+ );
+ $slowDevices = Array(
+ "J2ME",
+ "MIDP",
+ "Opera/",
+ "Mozilla/2.0 (compatible;",
+ "Mozilla/3.0 (compatible;"
+ );
+ return true;
+}
+function array_flatten($a, $f = array())
+{
+ if (!$a || !is_array($a)) return '';
+ foreach ($a as $k => $v) {
+ if (is_array($v)) $f = array_flatten($v, $f);
+ else $f[$k] = $v;
+ }
+ return $f;
+}
+function remove_spaces($string)
+{
+ return str_replace(' ', '', $string);
+}
+function object2array($object)
+{
+ if (is_object($object)) {
+ foreach ($object as $key => $value) {
+ $array[$key] = $value;
+ }
+ }
+ else {
+ $array = $object;
+ }
+ return $array;
+}
+function startsWith($haystack, $needle, $case = true)
+{
+ if ($case) {
+ return (strcmp(substr($haystack, 0, strlen($needle)) , $needle) === 0);
+ }
+ return (strcasecmp(substr($haystack, 0, strlen($needle)) , $needle) === 0);
+}
+
+function endsWith($haystack, $needle, $case = true)
+{
+ if ($case) {
+ return (strcmp(substr($haystack, strlen($haystack) - strlen($needle)) , $needle) === 0);
+ }
+ return (strcasecmp(substr($haystack, strlen($haystack) - strlen($needle)) , $needle) === 0);
+}
+function bracketsMeanNewLine($input)
+{
+ return str_replace(")", "</small>", str_replace("(", "<br><small>", $input));
+}
+function sksort(&$array, $subkey = "id", $sort_ascending = false)
+{
+ if (count($array)) $temp_array[key($array) ] = array_shift($array);
+ foreach ($array as $key => $val) {
+ $offset = 0;
+ $found = false;
+ foreach ($temp_array as $tmp_key => $tmp_val) {
+ if (!$found and strtolower($val[$subkey]) > strtolower($tmp_val[$subkey])) {
+ $temp_array = array_merge((array)array_slice($temp_array, 0, $offset) , array(
+ $key => $val
+ ) , array_slice($temp_array, $offset));
+ $found = true;
+ }
+ $offset++;
+ }
+ if (!$found) $temp_array = array_merge($temp_array, array(
+ $key => $val
+ ));
+ }
+ if ($sort_ascending) $array = array_reverse($temp_array);
+ else $array = $temp_array;
+}
+function sktimesort(&$array, $subkey = "id", $sort_ascending = false)
+{
+ if (count($array)) $temp_array[key($array) ] = array_shift($array);
+ foreach ($array as $key => $val) {
+ $offset = 0;
+ $found = false;
+ foreach ($temp_array as $tmp_key => $tmp_val) {
+ if (!$found and strtotime($val[$subkey]) > strtotime($tmp_val[$subkey])) {
+ $temp_array = array_merge((array)array_slice($temp_array, 0, $offset) , array(
+ $key => $val
+ ) , array_slice($temp_array, $offset));
+ $found = true;
+ }
+ $offset++;
+ }
+ if (!$found) $temp_array = array_merge($temp_array, array(
+ $key => $val
+ ));
+ }
+ if ($sort_ascending && isset($temp_array)) $array = array_reverse($temp_array);
+ else $array = $temp_array;
+}
+function r_implode( $glue, $pieces )
+{
+ foreach( $pieces as $r_pieces )
+ {
+ if( is_array( $r_pieces ) )
+ {
+ $retVal[] = r_implode( $glue, $r_pieces );
+ }
+ else
+ {
+ $retVal[] = $r_pieces;
+ }
+ }
+ return implode( $glue, $retVal );
+}
+?>
+
--- /dev/null
+++ b/include/db/route-dao.inc.php
@@ -1,1 +1,230 @@
+<?php
+function getRoute($routeID)
+{
+ global $conn;
+ $query = "Select * from routes where route_id = :routeID LIMIT 1";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":routeID", $routeID);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetch(PDO::FETCH_ASSOC);
+}
+function getRouteByFullName($routeFullName)
+{
+ global $conn;
+ $query = "Select * from routes where route_short_name||route_long_name = :routeFullName LIMIT 1";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":routeFullName", $routeFullName);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetch(PDO::FETCH_ASSOC);
+}
+
+function getRoutes()
+{
+ global $conn;
+ $query = "Select * from routes order by route_short_name;";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+function getRoutesByNumber($routeNumber = "")
+{
+ global $conn;
+ if ($routeNumber != "") {
+ $query = "Select distinct routes.route_id,routes.route_short_name,routes.route_long_name,service_id from routes join trips on trips.route_id =
+routes.route_id join stop_times on stop_times.trip_id = trips.trip_id
+where route_short_name = :routeNumber OR route_short_name LIKE :routeNumber2 order by route_short_name;";
+ }
+ else {
+ $query = "SELECT DISTINCT route_short_name from routes order by route_short_name";
+ }
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ if ($routeNumber != "") {
+ $query->bindParam(":routeNumber", $routeNumber);
+ $routeNumber2 = "% ".$routeNumber;
+ $query->bindParam(":routeNumber2", $routeNumber2);
+ }
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+function getRoutesByNumberSeries($routeNumberSeries = "")
+{
+ global $conn;
+ if (strlen($routeNumberSeries) == 1) {
+ return getRoutesByNumber($routeNumberSeries);
+ }
+ $seriesMin = substr($routeNumberSeries, 0, -1) . "0";
+ $seriesMax = substr($routeNumberSeries, 0, -1) . "9";
+ $query = "Select distinct routes.route_id,routes.route_short_name,routes.route_long_name,service_id from routes join trips on trips.route_id =
+routes.route_id join stop_times on stop_times.trip_id = trips.trip_id where to_number(route_short_name, 'FM999') between :seriesMin and :seriesMax OR route_short_name LIKE :routeNumberSeries order by route_short_name;";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":seriesMin", $seriesMin);
+ $query->bindParam(":seriesMax", $seriesMax);
+ $routeNumberSeries = "% ".substr($routeNumberSeries, 0, -1)."%";
+ $query->bindParam(":routeNumberSeries", $routeNumberSeries);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+function getRouteNextTrip($routeID)
+{
+ global $conn;
+ $query = "select * from routes join trips on trips.route_id = routes.route_id
+join stop_times on stop_times.trip_id = trips.trip_id where
+arrival_time > :currentTime and routes.route_id = :routeID order by
+arrival_time limit 1";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":currentTime", current_time());
+ $query->bindParam(":routeID", $routeID);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ $r = $query->fetch(PDO::FETCH_ASSOC);
+
+ // past last trip of the day special case
+ if (sizeof($r) < 16) {
+ $query = "select * from routes join trips on trips.route_id = routes.route_id
+join stop_times on stop_times.trip_id = trips.trip_id where routes.route_id = :routeID order by
+arrival_time DESC limit 1";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":routeID", $routeID);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+
+ $r = $query->fetch(PDO::FETCH_ASSOC);
+ }
+ return $r;
+}
+function getTimeInterpolatedRouteAtStop($routeID, $stop_id)
+{
+ $nextTrip = getRouteNextTrip($routeID);
+ if ($nextTrip['trip_id']) {
+ foreach (getTimeInterpolatedTrip($nextTrip['trip_id']) as $tripStop) {
+ if ($tripStop['stop_id'] == $stop_id) return $tripStop;
+ }
+ }
+ return Array();
+}
+function getRouteTrips($routeID)
+{
+ global $conn;
+ $query = "select routes.route_id,trips.trip_id,service_id,arrival_time, stop_id, stop_sequence from routes join trips on trips.route_id = routes.route_id
+join stop_times on stop_times.trip_id = trips.trip_id where routes.route_id = :routeID and stop_sequence = '1' order by
+arrival_time ";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":routeID", $routeID);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+function getRoutesByDestination($destination = "", $service_period = "")
+{
+ global $conn;
+ if ($service_period == "") $service_period = service_period();
+ if ($destination != "") {
+ $query = "SELECT DISTINCT trips.route_id,route_short_name,route_long_name, service_id
+FROM stop_times join trips on trips.trip_id =
+stop_times.trip_id join routes on trips.route_id = routes.route_id
+WHERE route_long_name = :destination AND service_id=:service_period order by route_short_name";
+ }
+ else {
+ $query = "SELECT DISTINCT route_long_name
+FROM stop_times join trips on trips.trip_id =
+stop_times.trip_id join routes on trips.route_id = routes.route_id
+WHERE service_id= :service_period order by route_long_name";
+ }
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":service_period", $service_period);
+ if ($destination != "") $query->bindParam(":destination", $destination);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+function getRoutesBySuburb($suburb, $service_period = "")
+{
+ if ($service_period == "") $service_period = service_period();
+ global $conn;
+ $query = "SELECT DISTINCT service_id,trips.route_id,route_short_name,route_long_name
+FROM stop_times join trips on trips.trip_id = stop_times.trip_id
+join routes on trips.route_id = routes.route_id
+join stops on stops.stop_id = stop_times.stop_id
+WHERE zone_id LIKE ':suburb AND service_id=:service_period ORDER BY route_short_name";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":service_period", $service_period);
+ $suburb = "%" . $suburb . ";%";
+ $query->bindParam(":suburb", $suburb);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+function getRoutesNearby($lat, $lng, $limit = "", $distance = 500)
+{
+ if ($service_period == "") $service_period = service_period();
+ if ($limit != "") $limitSQL = " LIMIT :limit ";
+ global $conn;
+ $query = "SELECT service_id,trips.route_id,route_short_name,route_long_name,min(stops.stop_id) as stop_id,
+ min(ST_Distance(position, ST_GeographyFromText('SRID=4326;POINT($lng $lat)'), FALSE)) as distance
+FROM stop_times
+join trips on trips.trip_id = stop_times.trip_id
+join routes on trips.route_id = routes.route_id
+join stops on stops.stop_id = stop_times.stop_id
+WHERE service_id=:service_period
+AND ST_DWithin(position, ST_GeographyFromText('SRID=4326;POINT($lng $lat)'), :distance, FALSE)
+ group by service_id,trips.route_id,route_short_name,route_long_name
+ order by distance $limitSQL";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":service_period", $service_period);
+ $query->bindParam(":distance", $distance);
+ if ($limit != "") $query->bindParam(":limit", $limit);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+?>
--- /dev/null
+++ b/include/db/servicealert-dao.inc.php
@@ -1,1 +1,53 @@
+<?php
+function getServiceOverride($date="") {
+ global $conn;
+ $query = "Select * from calendar_dates where date = :date and exception_type = '1' LIMIT 1";
+ // debug($query,"database");
+ $query = $conn->prepare($query); // Create a prepared statement
+ $query->bindParam(":date", date("Ymd",($date != "" ? $date : time())));
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetch(PDO::FETCH_ASSOC);
+}
+function getCurrentAlerts() {
+ global $conn;
+ $query = "SELECT * from servicealerts_alerts";
+ //debug($query, "database");
+ $query = $conn->prepare($query);
+ //if ($stop_sequence != "") $query->bindParam(":stop_sequence", $stop_sequence);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+function getInformedAlerts($id,$filter_class,$filter_id) {
+
+ global $conn;
+ $query = "SELECT * from servicealerts_informed where servicealert_id = :servicealert_id";
+
+ if ($filter_class != "" && $filter_id != "") {
+ $query .= " AND (informed_class = :informed_class OR informed_class = 'network') AND informed_id = :informed_id";
+
+ }
+ //debug($query, "database");
+ $query = $conn->prepare($query);
+ if ($filter_class != "" && $filter_id != "") {
+ $query->bindParam(":informed_class", $filter_class);
+ $query->bindParam(":informed_id", $filter_id);
+ }
+ $query->bindParam(":servicealert_id", $id);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+
+?>
--- /dev/null
+++ b/include/db/stop-dao.inc.php
@@ -1,1 +1,190 @@
+<?php
+function getStop($stopID)
+{
+ global $conn;
+ $query = "Select * from stops where stop_id = :stopID LIMIT 1";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":stopID", $stopID);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetch(PDO::FETCH_ASSOC);
+}
+function getStops($timingPointsOnly = false, $firstLetter = "", $startsWith = "")
+{
+ global $conn;
+ $conditions = Array();
+ if ($timingPointsOnly) $conditions[] = "substr(stop_code,1,2) != 'Wj'";
+ if ($firstLetter != "") $conditions[] = "substr(stop_name,1,1) = :firstLetter";
+ if ($startsWith != "") $conditions[] = "stop_name like :startsWith";
+ $query = "Select * from stops";
+ if (sizeof($conditions) > 0) {
+ if (sizeof($conditions) > 1) {
+ $query.= " Where " . implode(" AND ", $conditions) . " ";
+ }
+ else {
+ $query.= " Where " . $conditions[0] . " ";
+ }
+ }
+ $query.= " order by stop_name;";
+ $query = $conn->prepare($query);
+ if ($firstLetter != "") $query->bindParam(":firstLetter", $firstLetter);
+
+ if ($startsWith != "") {
+ $startsWith = $startsWith."%";
+ $query->bindParam(":startsWith", $startsWith);
+ }
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+function getNearbyStops($lat, $lng, $limit = "", $distance = 1000)
+{
+ if ($lat == null || $lng == null) return Array();
+ if ($limit != "") $limitSQL = " LIMIT :limit ";
+ global $conn;
+ $query = "Select *, ST_Distance(position, ST_GeographyFromText('SRID=4326;POINT($lng $lat)'), FALSE) as distance
+ from stops WHERE ST_DWithin(position, ST_GeographyFromText('SRID=4326;POINT($lng $lat)'), :distance, FALSE)
+ order by distance $limitSQL;";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":distance", $distance);
+ $query->bindParam(":limit", $limit);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+function getStopsBySuburb($suburb)
+{
+ global $conn;
+ $query = "Select * from stops where zone_id LIKE :suburb order by stop_name;";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $suburb = "%" . $suburb . ";%";
+ $query->bindParam(":suburb", $suburb);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+function getStopsByStopCode($stop_code,$startsWith = "")
+{
+ global $conn;
+ $query = "Select * from stops where (stop_code = :stop_code OR stop_code LIKE :stop_code2)";
+ if ($startsWith != "") $query .= " AND stop_name like :startsWith";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+
+ $query->bindParam(":stop_code", $stop_code);
+ $stop_code2 = $stop_code . "%";
+ $query->bindParam(":stop_code2", $stop_code2);
+ if ($startsWith != "") {
+ $startsWith = $startsWith."%";
+ $query->bindParam(":startsWith", $startsWith);
+ }
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+function getStopRoutes($stopID, $service_period)
+{
+ if ($service_period == "") $service_period = service_period();
+ global $conn;
+ $query = "SELECT distinct service_id,trips.route_id,route_short_name,route_long_name
+FROM stop_times join trips on trips.trip_id =
+stop_times.trip_id join routes on trips.route_id = routes.route_id WHERE stop_id = :stopID AND service_id=:service_period";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":service_period", $service_period);
+ $query->bindParam(":stopID", $stopID);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+function getStopTrips($stopID, $service_period = "", $afterTime = "", $limit = "")
+{
+ if ($service_period == "") $service_period = service_period();
+ if ($limit != "") $limitSQL = " LIMIT :limit ";
+ global $conn;
+ if ($afterTime != "") {
+ $query = " SELECT stop_times.trip_id,stop_times.arrival_time,stop_times.stop_id,stop_sequence,service_id,trips.route_id,route_short_name,route_long_name, end_times.arrival_time as end_time
+FROM stop_times
+join trips on trips.trip_id =
+stop_times.trip_id
+join routes on trips.route_id = routes.route_id , (SELECT trip_id,max(arrival_time) as arrival_time from stop_times
+ WHERE stop_times.arrival_time IS NOT NULL group by trip_id) as end_times
+WHERE stop_times.stop_id = :stopID
+AND stop_times.trip_id = end_times.trip_id
+AND service_id=:service_period
+AND end_times.arrival_time > :afterTime
+ORDER BY end_time $limitSQL";
+ }
+ else {
+ $query = "SELECT stop_times.trip_id,arrival_time,stop_times.stop_id,stop_sequence,service_id,trips.route_id,route_short_name,route_long_name
+FROM stop_times
+join trips on trips.trip_id =
+stop_times.trip_id
+join routes on trips.route_id = routes.route_id
+WHERE stop_times.stop_id = :stopID
+AND service_id=:service_period
+ORDER BY arrival_time $limitSQL";
+ }
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":service_period", $service_period);
+ $query->bindParam(":stopID", $stopID);
+ if ($limit != "") $query->bindParam(":limit", $limit);
+ if ($afterTime != "") $query->bindParam(":afterTime", $afterTime);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+function getStopTripsWithTimes($stopID, $time = "", $service_period = "", $time_range = "", $limit = "")
+{
+ if ($service_period == "") $service_period = service_period();
+ if ($time_range == "") $time_range = (24 * 60 * 60);
+ if ($time == "") $time = current_time();
+ if ($limit == "") $limit = 10;
+ $trips = getStopTrips($stopID, $service_period, $time);
+ $timedTrips = Array();
+ if ($trips && sizeof($trips) > 0) {
+ foreach ($trips as $trip) {
+ if ($trip['arrival_time'] != "") {
+ if (strtotime($trip['arrival_time']) > strtotime($time) and strtotime($trip['arrival_time']) < (strtotime($time) + $time_range)) {
+ $timedTrips[] = $trip;
+ }
+ }
+ else {
+ $timedTrip = getTimeInterpolatedTripAtStop($trip['trip_id'], $trip['stop_sequence']);
+ if ($timedTrip['arrival_time'] > $time and strtotime($timedTrip['arrival_time']) < (strtotime($time) + $time_range)) {
+ $timedTrips[] = $timedTrip;
+ }
+ }
+ if (sizeof($timedTrips) > $limit) break;
+ }
+ sktimesort($timedTrips, "arrival_time", true);
+ }
+ return $timedTrips;
+}
+?>
--- /dev/null
+++ b/include/db/trip-dao.inc.php
@@ -1,1 +1,224 @@
-
+<?php
+function getTrip($tripID)
+{
+ global $conn;
+ $query = "Select * from trips
+ join routes on trips.route_id = routes.route_id
+ where trip_id = :tripID
+ LIMIT 1";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":tripID", $tripID);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetch(PDO::FETCH_ASSOC);
+}
+function getTripShape($tripID)
+{
+ global $conn;
+ $query = "SELECT ST_AsKML(ST_MakeLine(geometry(a.position))) as the_route
+FROM (SELECT position,
+ stop_sequence, trips.trip_id
+FROM stop_times
+join trips on trips.trip_id = stop_times.trip_id
+join stops on stops.stop_id = stop_times.stop_id
+WHERE trips.trip_id = :tripID ORDER BY stop_sequence) as a group by a.trip_id";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":tripID", $tripID);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchColumn(0);
+}
+function getTimeInterpolatedTrip($tripID, $range = "")
+{
+ global $conn;
+ $query = "SELECT stop_times.trip_id,arrival_time,stop_times.stop_id,stop_lat,stop_lon,stop_name,stop_code,
+ stop_sequence,service_id,trips.route_id,route_short_name,route_long_name
+FROM stop_times
+join trips on trips.trip_id = stop_times.trip_id
+join routes on trips.route_id = routes.route_id
+join stops on stops.stop_id = stop_times.stop_id
+WHERE trips.trip_id = :tripID $range ORDER BY stop_sequence";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":tripID", $tripID);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ $stopTimes = $query->fetchAll();
+ $cur_timepoint = Array();
+ $next_timepoint = Array();
+ $distance_between_timepoints = 0.0;
+ $distance_traveled_between_timepoints = 0.0;
+ $rv = Array();
+ foreach ($stopTimes as $i => $stopTime) {
+ if ($stopTime['arrival_time'] != "") {
+ // is timepoint
+ $cur_timepoint = $stopTime;
+ $distance_between_timepoints = 0.0;
+ $distance_traveled_between_timepoints = 0.0;
+ if ($i + 1 < sizeof($stopTimes)) {
+ $k = $i + 1;
+ $distance_between_timepoints+= distance($stopTimes[$k - 1]["stop_lat"], $stopTimes[$k - 1]["stop_lon"], $stopTimes[$k]["stop_lat"], $stopTimes[$k]["stop_lon"]);
+ while ($stopTimes[$k]["arrival_time"] == "" && $k + 1 < sizeof($stopTimes)) {
+ $k+= 1;
+ //echo "k".$k;
+ $distance_between_timepoints+= distance($stopTimes[$k - 1]["stop_lat"], $stopTimes[$k - 1]["stop_lon"], $stopTimes[$k]["stop_lat"], $stopTimes[$k]["stop_lon"]);
+ }
+ $next_timepoint = $stopTimes[$k];
+
+ }
+ $rv[] = $stopTime;
+ }
+ else {
+ // is untimed point
+ //echo "i".$i;
+ $distance_traveled_between_timepoints+= distance($stopTimes[$i - 1]["stop_lat"], $stopTimes[$i - 1]["stop_lon"], $stopTimes[$i]["stop_lat"], $stopTimes[$i]["stop_lon"]);
+ //echo "$distance_traveled_between_timepoints / $distance_between_timepoints<br>";
+ $distance_percent = $distance_traveled_between_timepoints / $distance_between_timepoints;
+ if ($next_timepoint["arrival_time"] != "") {
+ $total_time = strtotime($next_timepoint["arrival_time"]) - strtotime($cur_timepoint["arrival_time"]);
+ //echo strtotime($next_timepoint["arrival_time"])." - ".strtotime($cur_timepoint["arrival_time"])."<br>";
+ $time_estimate = ($distance_percent * $total_time) + strtotime($cur_timepoint["arrival_time"]);
+ $stopTime["arrival_time"] = date("H:i:s", $time_estimate);
+ }
+ else {
+ $stopTime["arrival_time"] = $cur_timepoint["arrival_time"];
+ }
+ $rv[] = $stopTime;
+
+
+ }
+ }
+ //var_dump($rv);
+ return $rv;
+}
+function getTripPreviousTimePoint($tripID, $stop_sequence)
+{
+ global $conn;
+ $query = " SELECT trip_id,stop_id,
+ stop_sequence
+FROM stop_times
+WHERE trip_id = :tripID and stop_sequence < :stop_sequence
+and stop_times.arrival_time IS NOT NULL ORDER BY stop_sequence DESC LIMIT 1";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":tripID", $tripID);
+ $query->bindParam(":stop_sequence", $stop_sequence);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetch(PDO::FETCH_ASSOC);
+}
+function getTripNextTimePoint($tripID, $stop_sequence)
+{
+ global $conn;
+ $query = " SELECT trip_id,stop_id,
+ stop_sequence
+FROM stop_times
+WHERE trip_id = :tripID and stop_sequence > :stop_sequence
+and stop_times.arrival_time IS NOT NULL ORDER BY stop_sequence LIMIT 1";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":tripID", $tripID);
+ $query->bindParam(":stop_sequence", $stop_sequence);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetch(PDO::FETCH_ASSOC);
+}
+function getTimeInterpolatedTripAtStop($tripID, $stop_sequence)
+{
+ global $conn;
+ // limit interpolation to between nearest actual points.
+ $prevTimePoint = getTripPreviousTimePoint($tripID, $stop_sequence);
+ $nextTimePoint = getTripNextTimePoint($tripID, $stop_sequence);
+ //echo " prev {$lowestDelta['stop_sequence']} next {$nextTimePoint['stop_sequence']} ";
+ $range = "";
+ if ($prevTimePoint != "") $range .= " AND stop_sequence >= '{$prevTimePoint['stop_sequence']}'";
+ if ($nextTimePoint != "") $range .= " AND stop_sequence <= '{$nextTimePoint['stop_sequence']}'";
+ foreach (getTimeInterpolatedTrip($tripID, $range) as $tripStop) {
+ if ($tripStop['stop_sequence'] == $stop_sequence) return $tripStop;
+ }
+ return Array();
+}
+function getTripStartTime($tripID)
+{
+ global $conn;
+ $query = "Select * from stop_times
+ where trip_id = :tripID
+ AND arrival_time IS NOT NULL
+ AND stop_sequence = '1'";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":tripID", $tripID);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ $r = $query->fetch(PDO::FETCH_ASSOC);
+ return $r['arrival_time'];
+}
+function getActiveTrips($time)
+{
+ global $conn;
+ if ($time == "") $time = current_time();
+ $query = "Select distinct stop_times.trip_id, start_times.arrival_time as start_time, end_times.arrival_time as end_time from stop_times, (SELECT trip_id,arrival_time from stop_times WHERE stop_times.arrival_time IS NOT NULL
+AND stop_sequence = '1') as start_times, (SELECT trip_id,max(arrival_time) as arrival_time from stop_times WHERE stop_times.arrival_time IS NOT NULL group by trip_id) as end_times
+WHERE start_times.trip_id = end_times.trip_id AND stop_times.trip_id = end_times.trip_id AND :time > start_times.arrival_time AND :time < end_times.arrival_time";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":time", $time);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+function viaPoints($tripID, $stop_sequence = "")
+{
+ global $conn;
+ $query = "SELECT stops.stop_id, stop_name, arrival_time
+FROM stop_times join stops on stops.stop_id = stop_times.stop_id
+WHERE stop_times.trip_id = :tripID
+" . ($stop_sequence != "" ? " AND stop_sequence > :stop_sequence " : "") . "AND substr(stop_code,1,2) != 'Wj' ORDER BY stop_sequence";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ if ($stop_sequence != "") $query->bindParam(":stop_sequence", $stop_sequence);
+ $query->bindParam(":tripID", $tripID);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+function viaPointNames($tripid, $stop_sequence = "")
+{
+ $viaPointNames = Array();
+ foreach (viaPoints($tripid, $stop_sequence) as $point) {
+ $viaPointNames[] = $point['stop_name'];
+ }
+ if (sizeof($viaPointNames) > 0) {
+ return r_implode(", ", $viaPointNames);
+ }
+ else {
+ return "";
+ }
+}
+?>
--- a/index.php
+++ b/index.php
@@ -1,2 +1,31 @@
-<?php echo "Hello world!"; ?>
+<?php
+include ('include/common.inc.php');
+include_header("bus.lambdacomplex.org", "index", false)
+?>
+<div data-role="page">
+ <div data-role="content">
+ <div id="jqm-homeheader">
+ <h1>busness time</h1><br><small>Canberra Bus Timetables and Trip Planner</small>
+ </div>
+ <a name="maincontent" id="maincontent"></a>
+ <a href="tripPlanner.php" data-role="button" data-icon="navigation">Launch Trip Planner...</a>
+ <ul data-role="listview" data-inset="true" data-theme="c" data-dividertheme="b">
+ <li data-role="list-divider">Timetables - Stops</li>
+ <li><a href="stopList.php">Major (Timing Point) Stops</a></li>
+ <li><a href="stopList.php?allstops=yes">All Stops</a></li>
+ <li><a href="stopList.php?bysuburbs=yes">Stops By Suburb</a></li>
+ <li><a class="nearby" href="stopList.php?nearby=yes">Nearby Stops</a></li>
+ </ul>
+ <ul data-role="listview" data-inset="true" data-theme="c" data-dividertheme="b">
+ <li data-role="list-divider">Timetables - Routes</li>
+ <li><a href="routeList.php">Routes By Final Destination</a></li>
+ <li><a href="routeList.php?bynumber=yes">Routes By Number</a></li>
+ <li><a href="routeList.php?bysuburbs=yes">Routes By Suburb</a></li>
+ <li><a class="nearby" href="routeList.php?nearby=yes">Nearby Routes</a></li>
+ </ul>
+<?php
+echo timePlaceSettings();
+echo ' <a href="labs/index.php" data-role="button" data-icon="beaker">Busness R&D</a>';
+include_footer(true)
+?>
--- /dev/null
+++ b/js/flot/excanvas.js
@@ -1,1 +1,1428 @@
-
+// Copyright 2006 Google Inc.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+
+// Known Issues:
+//
+// * Patterns only support repeat.
+// * Radial gradient are not implemented. The VML version of these look very
+// different from the canvas one.
+// * Clipping paths are not implemented.
+// * Coordsize. The width and height attribute have higher priority than the
+// width and height style values which isn't correct.
+// * Painting mode isn't implemented.
+// * Canvas width/height should is using content-box by default. IE in
+// Quirks mode will draw the canvas using border-box. Either change your
+// doctype to HTML5
+// (http://www.whatwg.org/specs/web-apps/current-work/#the-doctype)
+// or use Box Sizing Behavior from WebFX
+// (http://webfx.eae.net/dhtml/boxsizing/boxsizing.html)
+// * Non uniform scaling does not correctly scale strokes.
+// * Filling very large shapes (above 5000 points) is buggy.
+// * Optimize. There is always room for speed improvements.
+
+// Only add this code if we do not already have a canvas implementation
+if (!document.createElement('canvas').getContext) {
+
+(function() {
+
+ // alias some functions to make (compiled) code shorter
+ var m = Math;
+ var mr = m.round;
+ var ms = m.sin;
+ var mc = m.cos;
+ var abs = m.abs;
+ var sqrt = m.sqrt;
+
+ // this is used for sub pixel precision
+ var Z = 10;
+ var Z2 = Z / 2;
+
+ /**
+ * This funtion is assigned to the <canvas> elements as element.getContext().
+ * @this {HTMLElement}
+ * @return {CanvasRenderingContext2D_}
+ */
+ function getContext() {
+ return this.context_ ||
+ (this.context_ = new CanvasRenderingContext2D_(this));
+ }
+
+ var slice = Array.prototype.slice;
+
+ /**
+ * Binds a function to an object. The returned function will always use the
+ * passed in {@code obj} as {@code this}.
+ *
+ * Example:
+ *
+ * g = bind(f, obj, a, b)
+ * g(c, d) // will do f.call(obj, a, b, c, d)
+ *
+ * @param {Function} f The function to bind the object to
+ * @param {Object} obj The object that should act as this when the function
+ * is called
+ * @param {*} var_args Rest arguments that will be used as the initial
+ * arguments when the function is called
+ * @return {Function} A new function that has bound this
+ */
+ function bind(f, obj, var_args) {
+ var a = slice.call(arguments, 2);
+ return function() {
+ return f.apply(obj, a.concat(slice.call(arguments)));
+ };
+ }
+
+ function encodeHtmlAttribute(s) {
+ return String(s).replace(/&/g, '&').replace(/"/g, '"');
+ }
+
+ function addNamespacesAndStylesheet(doc) {
+ // create xmlns
+ if (!doc.namespaces['g_vml_']) {
+ doc.namespaces.add('g_vml_', 'urn:schemas-microsoft-com:vml',
+ '#default#VML');
+
+ }
+ if (!doc.namespaces['g_o_']) {
+ doc.namespaces.add('g_o_', 'urn:schemas-microsoft-com:office:office',
+ '#default#VML');
+ }
+
+ // Setup default CSS. Only add one style sheet per document
+ if (!doc.styleSheets['ex_canvas_']) {
+ var ss = doc.createStyleSheet();
+ ss.owningElement.id = 'ex_canvas_';
+ ss.cssText = 'canvas{display:inline-block;overflow:hidden;' +
+ // default size is 300x150 in Gecko and Opera
+ 'text-align:left;width:300px;height:150px}';
+ }
+ }
+
+ // Add namespaces and stylesheet at startup.
+ addNamespacesAndStylesheet(document);
+
+ var G_vmlCanvasManager_ = {
+ init: function(opt_doc) {
+ if (/MSIE/.test(navigator.userAgent) && !window.opera) {
+ var doc = opt_doc || document;
+ // Create a dummy element so that IE will allow canvas elements to be
+ // recognized.
+ doc.createElement('canvas');
+ doc.attachEvent('onreadystatechange', bind(this.init_, this, doc));
+ }
+ },
+
+ init_: function(doc) {
+ // find all canvas elements
+ var els = doc.getElementsByTagName('canvas');
+ for (var i = 0; i < els.length; i++) {
+ this.initElement(els[i]);
+ }
+ },
+
+ /**
+ * Public initializes a canvas element so that it can be used as canvas
+ * element from now on. This is called automatically before the page is
+ * loaded but if you are creating elements using createElement you need to
+ * make sure this is called on the element.
+ * @param {HTMLElement} el The canvas element to initialize.
+ * @return {HTMLElement} the element that was created.
+ */
+ initElement: function(el) {
+ if (!el.getContext) {
+ el.getContext = getContext;
+
+ // Add namespaces and stylesheet to document of the element.
+ addNamespacesAndStylesheet(el.ownerDocument);
+
+ // Remove fallback content. There is no way to hide text nodes so we
+ // just remove all childNodes. We could hide all elements and remove
+ // text nodes but who really cares about the fallback content.
+ el.innerHTML = '';
+
+ // do not use inline function because that will leak memory
+ el.attachEvent('onpropertychange', onPropertyChange);
+ el.attachEvent('onresize', onResize);
+
+ var attrs = el.attributes;
+ if (attrs.width && attrs.width.specified) {
+ // TODO: use runtimeStyle and coordsize
+ // el.getContext().setWidth_(attrs.width.nodeValue);
+ el.style.width = attrs.width.nodeValue + 'px';
+ } else {
+ el.width = el.clientWidth;
+ }
+ if (attrs.height && attrs.height.specified) {
+ // TODO: use runtimeStyle and coordsize
+ // el.getContext().setHeight_(attrs.height.nodeValue);
+ el.style.height = attrs.height.nodeValue + 'px';
+ } else {
+ el.height = el.clientHeight;
+ }
+ //el.getContext().setCoordsize_()
+ }
+ return el;
+ }
+ };
+
+ function onPropertyChange(e) {
+ var el = e.srcElement;
+
+ switch (e.propertyName) {
+ case 'width':
+ el.getContext().clearRect();
+ el.style.width = el.attributes.width.nodeValue + 'px';
+ // In IE8 this does not trigger onresize.
+ el.firstChild.style.width = el.clientWidth + 'px';
+ break;
+ case 'height':
+ el.getContext().clearRect();
+ el.style.height = el.attributes.height.nodeValue + 'px';
+ el.firstChild.style.height = el.clientHeight + 'px';
+ break;
+ }
+ }
+
+ function onResize(e) {
+ var el = e.srcElement;
+ if (el.firstChild) {
+ el.firstChild.style.width = el.clientWidth + 'px';
+ el.firstChild.style.height = el.clientHeight + 'px';
+ }
+ }
+
+ G_vmlCanvasManager_.init();
+
+ // precompute "00" to "FF"
+ var decToHex = [];
+ for (var i = 0; i < 16; i++) {
+ for (var j = 0; j < 16; j++) {
+ decToHex[i * 16 + j] = i.toString(16) + j.toString(16);
+ }
+ }
+
+ function createMatrixIdentity() {
+ return [
+ [1, 0, 0],
+ [0, 1, 0],
+ [0, 0, 1]
+ ];
+ }
+
+ function matrixMultiply(m1, m2) {
+ var result = createMatrixIdentity();
+
+ for (var x = 0; x < 3; x++) {
+ for (var y = 0; y < 3; y++) {
+ var sum = 0;
+
+ for (var z = 0; z < 3; z++) {
+ sum += m1[x][z] * m2[z][y];
+ }
+
+ result[x][y] = sum;
+ }
+ }
+ return result;
+ }
+
+ function copyState(o1, o2) {
+ o2.fillStyle = o1.fillStyle;
+ o2.lineCap = o1.lineCap;
+ o2.lineJoin = o1.lineJoin;
+ o2.lineWidth = o1.lineWidth;
+ o2.miterLimit = o1.miterLimit;
+ o2.shadowBlur = o1.shadowBlur;
+ o2.shadowColor = o1.shadowColor;
+ o2.shadowOffsetX = o1.shadowOffsetX;
+ o2.shadowOffsetY = o1.shadowOffsetY;
+ o2.strokeStyle = o1.strokeStyle;
+ o2.globalAlpha = o1.globalAlpha;
+ o2.font = o1.font;
+ o2.textAlign = o1.textAlign;
+ o2.textBaseline = o1.textBaseline;
+ o2.arcScaleX_ = o1.arcScaleX_;
+ o2.arcScaleY_ = o1.arcScaleY_;
+ o2.lineScale_ = o1.lineScale_;
+ }
+
+ var colorData = {
+ aliceblue: '#F0F8FF',
+ antiquewhite: '#FAEBD7',
+ aquamarine: '#7FFFD4',
+ azure: '#F0FFFF',
+ beige: '#F5F5DC',
+ bisque: '#FFE4C4',
+ black: '#000000',
+ blanchedalmond: '#FFEBCD',
+ blueviolet: '#8A2BE2',
+ brown: '#A52A2A',
+ burlywood: '#DEB887',
+ cadetblue: '#5F9EA0',
+ chartreuse: '#7FFF00',
+ chocolate: '#D2691E',
+ coral: '#FF7F50',
+ cornflowerblue: '#6495ED',
+ cornsilk: '#FFF8DC',
+ crimson: '#DC143C',
+ cyan: '#00FFFF',
+ darkblue: '#00008B',
+ darkcyan: '#008B8B',
+ darkgoldenrod: '#B8860B',
+ darkgray: '#A9A9A9',
+ darkgreen: '#006400',
+ darkgrey: '#A9A9A9',
+ darkkhaki: '#BDB76B',
+ darkmagenta: '#8B008B',
+ darkolivegreen: '#556B2F',
+ darkorange: '#FF8C00',
+ darkorchid: '#9932CC',
+ darkred: '#8B0000',
+ darksalmon: '#E9967A',
+ darkseagreen: '#8FBC8F',
+ darkslateblue: '#483D8B',
+ darkslategray: '#2F4F4F',
+ darkslategrey: '#2F4F4F',
+ darkturquoise: '#00CED1',
+ darkviolet: '#9400D3',
+ deeppink: '#FF1493',
+ deepskyblue: '#00BFFF',
+ dimgray: '#696969',
+ dimgrey: '#696969',
+ dodgerblue: '#1E90FF',
+ firebrick: '#B22222',
+ floralwhite: '#FFFAF0',
+ forestgreen: '#228B22',
+ gainsboro: '#DCDCDC',
+ ghostwhite: '#F8F8FF',
+ gold: '#FFD700',
+ goldenrod: '#DAA520',
+ grey: '#808080',
+ greenyellow: '#ADFF2F',
+ honeydew: '#F0FFF0',
+ hotpink: '#FF69B4',
+ indianred: '#CD5C5C',
+ indigo: '#4B0082',
+ ivory: '#FFFFF0',
+ khaki: '#F0E68C',
+ lavender: '#E6E6FA',
+ lavenderblush: '#FFF0F5',
+ lawngreen: '#7CFC00',
+ lemonchiffon: '#FFFACD',
+ lightblue: '#ADD8E6',
+ lightcoral: '#F08080',
+ lightcyan: '#E0FFFF',
+ lightgoldenrodyellow: '#FAFAD2',
+ lightgreen: '#90EE90',
+ lightgrey: '#D3D3D3',
+ lightpink: '#FFB6C1',
+ lightsalmon: '#FFA07A',
+ lightseagreen: '#20B2AA',
+ lightskyblue: '#87CEFA',
+ lightslategray: '#778899',
+ lightslategrey: '#778899',
+ lightsteelblue: '#B0C4DE',
+ lightyellow: '#FFFFE0',
+ limegreen: '#32CD32',
+ linen: '#FAF0E6',
+ magenta: '#FF00FF',
+ mediumaquamarine: '#66CDAA',
+ mediumblue: '#0000CD',
+ mediumorchid: '#BA55D3',
+ mediumpurple: '#9370DB',
+ mediumseagreen: '#3CB371',
+ mediumslateblue: '#7B68EE',
+ mediumspringgreen: '#00FA9A',
+ mediumturquoise: '#48D1CC',
+ mediumvioletred: '#C71585',
+ midnightblue: '#191970',
+ mintcream: '#F5FFFA',
+ mistyrose: '#FFE4E1',
+ moccasin: '#FFE4B5',
+ navajowhite: '#FFDEAD',
+ oldlace: '#FDF5E6',
+ olivedrab: '#6B8E23',
+ orange: '#FFA500',
+ orangered: '#FF4500',
+ orchid: '#DA70D6',
+ palegoldenrod: '#EEE8AA',
+ palegreen: '#98FB98',
+ paleturquoise: '#AFEEEE',
+ palevioletred: '#DB7093',
+ papayawhip: '#FFEFD5',
+ peachpuff: '#FFDAB9',
+ peru: '#CD853F',
+ pink: '#FFC0CB',
+ plum: '#DDA0DD',
+ powderblue: '#B0E0E6',
+ rosybrown: '#BC8F8F',
+ royalblue: '#4169E1',
+ saddlebrown: '#8B4513',
+ salmon: '#FA8072',
+ sandybrown: '#F4A460',
+ seagreen: '#2E8B57',
+ seashell: '#FFF5EE',
+ sienna: '#A0522D',
+ skyblue: '#87CEEB',
+ slateblue: '#6A5ACD',
+ slategray: '#708090',
+ slategrey: '#708090',
+ snow: '#FFFAFA',
+ springgreen: '#00FF7F',
+ steelblue: '#4682B4',
+ tan: '#D2B48C',
+ thistle: '#D8BFD8',
+ tomato: '#FF6347',
+ turquoise: '#40E0D0',
+ violet: '#EE82EE',
+ wheat: '#F5DEB3',
+ whitesmoke: '#F5F5F5',
+ yellowgreen: '#9ACD32'
+ };
+
+
+ function getRgbHslContent(styleString) {
+ var start = styleString.indexOf('(', 3);
+ var end = styleString.indexOf(')', start + 1);
+ var parts = styleString.substring(start + 1, end).split(',');
+ // add alpha if needed
+ if (parts.length == 4 && styleString.substr(3, 1) == 'a') {
+ alpha = Number(parts[3]);
+ } else {
+ parts[3] = 1;
+ }
+ return parts;
+ }
+
+ function percent(s) {
+ return parseFloat(s) / 100;
+ }
+
+ function clamp(v, min, max) {
+ return Math.min(max, Math.max(min, v));
+ }
+
+ function hslToRgb(parts){
+ var r, g, b;
+ h = parseFloat(parts[0]) / 360 % 360;
+ if (h < 0)
+ h++;
+ s = clamp(percent(parts[1]), 0, 1);
+ l = clamp(percent(parts[2]), 0, 1);
+ if (s == 0) {
+ r = g = b = l; // achromatic
+ } else {
+ var q = l < 0.5 ? l * (1 + s) : l + s - l * s;
+ var p = 2 * l - q;
+ r = hueToRgb(p, q, h + 1 / 3);
+ g = hueToRgb(p, q, h);
+ b = hueToRgb(p, q, h - 1 / 3);
+ }
+
+ return '#' + decToHex[Math.floor(r * 255)] +
+ decToHex[Math.floor(g * 255)] +
+ decToHex[Math.floor(b * 255)];
+ }
+
+ function hueToRgb(m1, m2, h) {
+ if (h < 0)
+ h++;
+ if (h > 1)
+ h--;
+
+ if (6 * h < 1)
+ return m1 + (m2 - m1) * 6 * h;
+ else if (2 * h < 1)
+ return m2;
+ else if (3 * h < 2)
+ return m1 + (m2 - m1) * (2 / 3 - h) * 6;
+ else
+ return m1;
+ }
+
+ function processStyle(styleString) {
+ var str, alpha = 1;
+
+ styleString = String(styleString);
+ if (styleString.charAt(0) == '#') {
+ str = styleString;
+ } else if (/^rgb/.test(styleString)) {
+ var parts = getRgbHslContent(styleString);
+ var str = '#', n;
+ for (var i = 0; i < 3; i++) {
+ if (parts[i].indexOf('%') != -1) {
+ n = Math.floor(percent(parts[i]) * 255);
+ } else {
+ n = Number(parts[i]);
+ }
+ str += decToHex[clamp(n, 0, 255)];
+ }
+ alpha = parts[3];
+ } else if (/^hsl/.test(styleString)) {
+ var parts = getRgbHslContent(styleString);
+ str = hslToRgb(parts);
+ alpha = parts[3];
+ } else {
+ str = colorData[styleString] || styleString;
+ }
+ return {color: str, alpha: alpha};
+ }
+
+ var DEFAULT_STYLE = {
+ style: 'normal',
+ variant: 'normal',
+ weight: 'normal',
+ size: 10,
+ family: 'sans-serif'
+ };
+
+ // Internal text style cache
+ var fontStyleCache = {};
+
+ function processFontStyle(styleString) {
+ if (fontStyleCache[styleString]) {
+ return fontStyleCache[styleString];
+ }
+
+ var el = document.createElement('div');
+ var style = el.style;
+ try {
+ style.font = styleString;
+ } catch (ex) {
+ // Ignore failures to set to invalid font.
+ }
+
+ return fontStyleCache[styleString] = {
+ style: style.fontStyle || DEFAULT_STYLE.style,
+ variant: style.fontVariant || DEFAULT_STYLE.variant,
+ weight: style.fontWeight || DEFAULT_STYLE.weight,
+ size: style.fontSize || DEFAULT_STYLE.size,
+ family: style.fontFamily || DEFAULT_STYLE.family
+ };
+ }
+
+ function getComputedStyle(style, element) {
+ var computedStyle = {};
+
+ for (var p in style) {
+ computedStyle[p] = style[p];
+ }
+
+ // Compute the size
+ var canvasFontSize = parseFloat(element.currentStyle.fontSize),
+ fontSize = parseFloat(style.size);
+
+ if (typeof style.size == 'number') {
+ computedStyle.size = style.size;
+ } else if (style.size.indexOf('px') != -1) {
+ computedStyle.size = fontSize;
+ } else if (style.size.indexOf('em') != -1) {
+ computedStyle.size = canvasFontSize * fontSize;
+ } else if(style.size.indexOf('%') != -1) {
+ computedStyle.size = (canvasFontSize / 100) * fontSize;
+ } else if (style.size.indexOf('pt') != -1) {
+ computedStyle.size = fontSize / .75;
+ } else {
+ computedStyle.size = canvasFontSize;
+ }
+
+ // Different scaling between normal text and VML text. This was found using
+ // trial and error to get the same size as non VML text.
+ computedStyle.size *= 0.981;
+
+ return computedStyle;
+ }
+
+ function buildStyle(style) {
+ return style.style + ' ' + style.variant + ' ' + style.weight + ' ' +
+ style.size + 'px ' + style.family;
+ }
+
+ function processLineCap(lineCap) {
+ switch (lineCap) {
+ case 'butt':
+ return 'flat';
+ case 'round':
+ return 'round';
+ case 'square':
+ default:
+ return 'square';
+ }
+ }
+
+ /**
+ * This class implements CanvasRenderingContext2D interface as described by
+ * the WHATWG.
+ * @param {HTMLElement} surfaceElement The element that the 2D context should
+ * be associated with
+ */
+ function CanvasRenderingContext2D_(surfaceElement) {
+ this.m_ = createMatrixIdentity();
+
+ this.mStack_ = [];
+ this.aStack_ = [];
+ this.currentPath_ = [];
+
+ // Canvas context properties
+ this.strokeStyle = '#000';
+ this.fillStyle = '#000';
+
+ this.lineWidth = 1;
+ this.lineJoin = 'miter';
+ this.lineCap = 'butt';
+ this.miterLimit = Z * 1;
+ this.globalAlpha = 1;
+ this.font = '10px sans-serif';
+ this.textAlign = 'left';
+ this.textBaseline = 'alphabetic';
+ this.canvas = surfaceElement;
+
+ var el = surfaceElement.ownerDocument.createElement('div');
+ el.style.width = surfaceElement.clientWidth + 'px';
+ el.style.height = surfaceElement.clientHeight + 'px';
+ el.style.overflow = 'hidden';
+ el.style.position = 'absolute';
+ surfaceElement.appendChild(el);
+
+ this.element_ = el;
+ this.arcScaleX_ = 1;
+ this.arcScaleY_ = 1;
+ this.lineScale_ = 1;
+ }
+
+ var contextPrototype = CanvasRenderingContext2D_.prototype;
+ contextPrototype.clearRect = function() {
+ if (this.textMeasureEl_) {
+ this.textMeasureEl_.removeNode(true);
+ this.textMeasureEl_ = null;
+ }
+ this.element_.innerHTML = '';
+ };
+
+ contextPrototype.beginPath = function() {
+ // TODO: Branch current matrix so that save/restore has no effect
+ // as per safari docs.
+ this.currentPath_ = [];
+ };
+
+ contextPrototype.moveTo = function(aX, aY) {
+ var p = this.getCoords_(aX, aY);
+ this.currentPath_.push({type: 'moveTo', x: p.x, y: p.y});
+ this.currentX_ = p.x;
+ this.currentY_ = p.y;
+ };
+
+ contextPrototype.lineTo = function(aX, aY) {
+ var p = this.getCoords_(aX, aY);
+ this.currentPath_.push({type: 'lineTo', x: p.x, y: p.y});
+
+ this.currentX_ = p.x;
+ this.currentY_ = p.y;
+ };
+
+ contextPrototype.bezierCurveTo = function(aCP1x, aCP1y,
+ aCP2x, aCP2y,
+ aX, aY) {
+ var p = this.getCoords_(aX, aY);
+ var cp1 = this.getCoords_(aCP1x, aCP1y);
+ var cp2 = this.getCoords_(aCP2x, aCP2y);
+ bezierCurveTo(this, cp1, cp2, p);
+ };
+
+ // Helper function that takes the already fixed cordinates.
+ function bezierCurveTo(self, cp1, cp2, p) {
+ self.currentPath_.push({
+ type: 'bezierCurveTo',
+ cp1x: cp1.x,
+ cp1y: cp1.y,
+ cp2x: cp2.x,
+ cp2y: cp2.y,
+ x: p.x,
+ y: p.y
+ });
+ self.currentX_ = p.x;
+ self.currentY_ = p.y;
+ }
+
+ contextPrototype.quadraticCurveTo = function(aCPx, aCPy, aX, aY) {
+ // the following is lifted almost directly from
+ // http://developer.mozilla.org/en/docs/Canvas_tutorial:Drawing_shapes
+
+ var cp = this.getCoords_(aCPx, aCPy);
+ var p = this.getCoords_(aX, aY);
+
+ var cp1 = {
+ x: this.currentX_ + 2.0 / 3.0 * (cp.x - this.currentX_),
+ y: this.currentY_ + 2.0 / 3.0 * (cp.y - this.currentY_)
+ };
+ var cp2 = {
+ x: cp1.x + (p.x - this.currentX_) / 3.0,
+ y: cp1.y + (p.y - this.currentY_) / 3.0
+ };
+
+ bezierCurveTo(this, cp1, cp2, p);
+ };
+
+ contextPrototype.arc = function(aX, aY, aRadius,
+ aStartAngle, aEndAngle, aClockwise) {
+ aRadius *= Z;
+ var arcType = aClockwise ? 'at' : 'wa';
+
+ var xStart = aX + mc(aStartAngle) * aRadius - Z2;
+ var yStart = aY + ms(aStartAngle) * aRadius - Z2;
+
+ var xEnd = aX + mc(aEndAngle) * aRadius - Z2;
+ var yEnd = aY + ms(aEndAngle) * aRadius - Z2;
+
+ // IE won't render arches drawn counter clockwise if xStart == xEnd.
+ if (xStart == xEnd && !aClockwise) {
+ xStart += 0.125; // Offset xStart by 1/80 of a pixel. Use something
+ // that can be represented in binary
+ }
+
+ var p = this.getCoords_(aX, aY);
+ var pStart = this.getCoords_(xStart, yStart);
+ var pEnd = this.getCoords_(xEnd, yEnd);
+
+ this.currentPath_.push({type: arcType,
+ x: p.x,
+ y: p.y,
+ radius: aRadius,
+ xStart: pStart.x,
+ yStart: pStart.y,
+ xEnd: pEnd.x,
+ yEnd: pEnd.y});
+
+ };
+
+ contextPrototype.rect = function(aX, aY, aWidth, aHeight) {
+ this.moveTo(aX, aY);
+ this.lineTo(aX + aWidth, aY);
+ this.lineTo(aX + aWidth, aY + aHeight);
+ this.lineTo(aX, aY + aHeight);
+ this.closePath();
+ };
+
+ contextPrototype.strokeRect = function(aX, aY, aWidth, aHeight) {
+ var oldPath = this.currentPath_;
+ this.beginPath();
+
+ this.moveTo(aX, aY);
+ this.lineTo(aX + aWidth, aY);
+ this.lineTo(aX + aWidth, aY + aHeight);
+ this.lineTo(aX, aY + aHeight);
+ this.closePath();
+ this.stroke();
+
+ this.currentPath_ = oldPath;
+ };
+
+ contextPrototype.fillRect = function(aX, aY, aWidth, aHeight) {
+ var oldPath = this.currentPath_;
+ this.beginPath();
+
+ this.moveTo(aX, aY);
+ this.lineTo(aX + aWidth, aY);
+ this.lineTo(aX + aWidth, aY + aHeight);
+ this.lineTo(aX, aY + aHeight);
+ this.closePath();
+ this.fill();
+
+ this.currentPath_ = oldPath;
+ };
+
+ contextPrototype.createLinearGradient = function(aX0, aY0, aX1, aY1) {
+ var gradient = new CanvasGradient_('gradient');
+ gradient.x0_ = aX0;
+ gradient.y0_ = aY0;
+ gradient.x1_ = aX1;
+ gradient.y1_ = aY1;
+ return gradient;
+ };
+
+ contextPrototype.createRadialGradient = function(aX0, aY0, aR0,
+ aX1, aY1, aR1) {
+ var gradient = new CanvasGradient_('gradientradial');
+ gradient.x0_ = aX0;
+ gradient.y0_ = aY0;
+ gradient.r0_ = aR0;
+ gradient.x1_ = aX1;
+ gradient.y1_ = aY1;
+ gradient.r1_ = aR1;
+ return gradient;
+ };
+
+ contextPrototype.drawImage = function(image, var_args) {
+ var dx, dy, dw, dh, sx, sy, sw, sh;
+
+ // to find the original width we overide the width and height
+ var oldRuntimeWidth = image.runtimeStyle.width;
+ var oldRuntimeHeight = image.runtimeStyle.height;
+ image.runtimeStyle.width = 'auto';
+ image.runtimeStyle.height = 'auto';
+
+ // get the original size
+ var w = image.width;
+ var h = image.height;
+
+ // and remove overides
+ image.runtimeStyle.width = oldRuntimeWidth;
+ image.runtimeStyle.height = oldRuntimeHeight;
+
+ if (arguments.length == 3) {
+ dx = arguments[1];
+ dy = arguments[2];
+ sx = sy = 0;
+ sw = dw = w;
+ sh = dh = h;
+ } else if (arguments.length == 5) {
+ dx = arguments[1];
+ dy = arguments[2];
+ dw = arguments[3];
+ dh = arguments[4];
+ sx = sy = 0;
+ sw = w;
+ sh = h;
+ } else if (arguments.length == 9) {
+ sx = arguments[1];
+ sy = arguments[2];
+ sw = arguments[3];
+ sh = arguments[4];
+ dx = arguments[5];
+ dy = arguments[6];
+ dw = arguments[7];
+ dh = arguments[8];
+ } else {
+ throw Error('Invalid number of arguments');
+ }
+
+ var d = this.getCoords_(dx, dy);
+
+ var w2 = sw / 2;
+ var h2 = sh / 2;
+
+ var vmlStr = [];
+
+ var W = 10;
+ var H = 10;
+
+ // For some reason that I've now forgotten, using divs didn't work
+ vmlStr.push(' <g_vml_:group',
+ ' coordsize="', Z * W, ',', Z * H, '"',
+ ' coordorigin="0,0"' ,
+ ' style="width:', W, 'px;height:', H, 'px;position:absolute;');
+
+ // If filters are necessary (rotation exists), create them
+ // filters are bog-slow, so only create them if abbsolutely necessary
+ // The following check doesn't account for skews (which don't exist
+ // in the canvas spec (yet) anyway.
+
+ if (this.m_[0][0] != 1 || this.m_[0][1] ||
+ this.m_[1][1] != 1 || this.m_[1][0]) {
+ var filter = [];
+
+ // Note the 12/21 reversal
+ filter.push('M11=', this.m_[0][0], ',',
+ 'M12=', this.m_[1][0], ',',
+ 'M21=', this.m_[0][1], ',',
+ 'M22=', this.m_[1][1], ',',
+ 'Dx=', mr(d.x / Z), ',',
+ 'Dy=', mr(d.y / Z), '');
+
+ // Bounding box calculation (need to minimize displayed area so that
+ // filters don't waste time on unused pixels.
+ var max = d;
+ var c2 = this.getCoords_(dx + dw, dy);
+ var c3 = this.getCoords_(dx, dy + dh);
+ var c4 = this.getCoords_(dx + dw, dy + dh);
+
+ max.x = m.max(max.x, c2.x, c3.x, c4.x);
+ max.y = m.max(max.y, c2.y, c3.y, c4.y);
+
+ vmlStr.push('padding:0 ', mr(max.x / Z), 'px ', mr(max.y / Z),
+ 'px 0;filter:progid:DXImageTransform.Microsoft.Matrix(',
+ filter.join(''), ", sizingmethod='clip');");
+
+ } else {
+ vmlStr.push('top:', mr(d.y / Z), 'px;left:', mr(d.x / Z), 'px;');
+ }
+
+ vmlStr.push(' ">' ,
+ '<g_vml_:image src="', image.src, '"',
+ ' style="width:', Z * dw, 'px;',
+ ' height:', Z * dh, 'px"',
+ ' cropleft="', sx / w, '"',
+ ' croptop="', sy / h, '"',
+ ' cropright="', (w - sx - sw) / w, '"',
+ ' cropbottom="', (h - sy - sh) / h, '"',
+ ' />',
+ '</g_vml_:group>');
+
+ this.element_.insertAdjacentHTML('BeforeEnd', vmlStr.join(''));
+ };
+
+ contextPrototype.stroke = function(aFill) {
+ var W = 10;
+ var H = 10;
+ // Divide the shape into chunks if it's too long because IE has a limit
+ // somewhere for how long a VML shape can be. This simple division does
+ // not work with fills, only strokes, unfortunately.
+ var chunkSize = 5000;
+
+ var min = {x: null, y: null};
+ var max = {x: null, y: null};
+
+ for (var j = 0; j < this.currentPath_.length; j += chunkSize) {
+ var lineStr = [];
+ var lineOpen = false;
+
+ lineStr.push('<g_vml_:shape',
+ ' filled="', !!aFill, '"',
+ ' style="position:absolute;width:', W, 'px;height:', H, 'px;"',
+ ' coordorigin="0,0"',
+ ' coordsize="', Z * W, ',', Z * H, '"',
+ ' stroked="', !aFill, '"',
+ ' path="');
+
+ var newSeq = false;
+
+ for (var i = j; i < Math.min(j + chunkSize, this.currentPath_.length); i++) {
+ if (i % chunkSize == 0 && i > 0) { // move into position for next chunk
+ lineStr.push(' m ', mr(this.currentPath_[i-1].x), ',', mr(this.currentPath_[i-1].y));
+ }
+
+ var p = this.currentPath_[i];
+ var c;
+
+ switch (p.type) {
+ case 'moveTo':
+ c = p;
+ lineStr.push(' m ', mr(p.x), ',', mr(p.y));
+ break;
+ case 'lineTo':
+ lineStr.push(' l ', mr(p.x), ',', mr(p.y));
+ break;
+ case 'close':
+ lineStr.push(' x ');
+ p = null;
+ break;
+ case 'bezierCurveTo':
+ lineStr.push(' c ',
+ mr(p.cp1x), ',', mr(p.cp1y), ',',
+ mr(p.cp2x), ',', mr(p.cp2y), ',',
+ mr(p.x), ',', mr(p.y));
+ break;
+ case 'at':
+ case 'wa':
+ lineStr.push(' ', p.type, ' ',
+ mr(p.x - this.arcScaleX_ * p.radius), ',',
+ mr(p.y - this.arcScaleY_ * p.radius), ' ',
+ mr(p.x + this.arcScaleX_ * p.radius), ',',
+ mr(p.y + this.arcScaleY_ * p.radius), ' ',
+ mr(p.xStart), ',', mr(p.yStart), ' ',
+ mr(p.xEnd), ',', mr(p.yEnd));
+ break;
+ }
+
+
+ // TODO: Following is broken for curves due to
+ // move to proper paths.
+
+ // Figure out dimensions so we can do gradient fills
+ // properly
+ if (p) {
+ if (min.x == null || p.x < min.x) {
+ min.x = p.x;
+ }
+ if (max.x == null || p.x > max.x) {
+ max.x = p.x;
+ }
+ if (min.y == null || p.y < min.y) {
+ min.y = p.y;
+ }
+ if (max.y == null || p.y > max.y) {
+ max.y = p.y;
+ }
+ }
+ }
+ lineStr.push(' ">');
+
+ if (!aFill) {
+ appendStroke(this, lineStr);
+ } else {
+ appendFill(this, lineStr, min, max);
+ }
+
+ lineStr.push('</g_vml_:shape>');
+
+ this.element_.insertAdjacentHTML('beforeEnd', lineStr.join(''));
+ }
+ };
+
+ function appendStroke(ctx, lineStr) {
+ var a = processStyle(ctx.strokeStyle);
+ var color = a.color;
+ var opacity = a.alpha * ctx.globalAlpha;
+ var lineWidth = ctx.lineScale_ * ctx.lineWidth;
+
+ // VML cannot correctly render a line if the width is less than 1px.
+ // In that case, we dilute the color to make the line look thinner.
+ if (lineWidth < 1) {
+ opacity *= lineWidth;
+ }
+
+ lineStr.push(
+ '<g_vml_:stroke',
+ ' opacity="', opacity, '"',
+ ' joinstyle="', ctx.lineJoin, '"',
+ ' miterlimit="', ctx.miterLimit, '"',
+ ' endcap="', processLineCap(ctx.lineCap), '"',
+ ' weight="', lineWidth, 'px"',
+ ' color="', color, '" />'
+ );
+ }
+
+ function appendFill(ctx, lineStr, min, max) {
+ var fillStyle = ctx.fillStyle;
+ var arcScaleX = ctx.arcScaleX_;
+ var arcScaleY = ctx.arcScaleY_;
+ var width = max.x - min.x;
+ var height = max.y - min.y;
+ if (fillStyle instanceof CanvasGradient_) {
+ // TODO: Gradients transformed with the transformation matrix.
+ var angle = 0;
+ var focus = {x: 0, y: 0};
+
+ // additional offset
+ var shift = 0;
+ // scale factor for offset
+ var expansion = 1;
+
+ if (fillStyle.type_ == 'gradient') {
+ var x0 = fillStyle.x0_ / arcScaleX;
+ var y0 = fillStyle.y0_ / arcScaleY;
+ var x1 = fillStyle.x1_ / arcScaleX;
+ var y1 = fillStyle.y1_ / arcScaleY;
+ var p0 = ctx.getCoords_(x0, y0);
+ var p1 = ctx.getCoords_(x1, y1);
+ var dx = p1.x - p0.x;
+ var dy = p1.y - p0.y;
+ angle = Math.atan2(dx, dy) * 180 / Math.PI;
+
+ // The angle should be a non-negative number.
+ if (angle < 0) {
+ angle += 360;
+ }
+
+ // Very small angles produce an unexpected result because they are
+ // converted to a scientific notation string.
+ if (angle < 1e-6) {
+ angle = 0;
+ }
+ } else {
+ var p0 = ctx.getCoords_(fillStyle.x0_, fillStyle.y0_);
+ focus = {
+ x: (p0.x - min.x) / width,
+ y: (p0.y - min.y) / height
+ };
+
+ width /= arcScaleX * Z;
+ height /= arcScaleY * Z;
+ var dimension = m.max(width, height);
+ shift = 2 * fillStyle.r0_ / dimension;
+ expansion = 2 * fillStyle.r1_ / dimension - shift;
+ }
+
+ // We need to sort the color stops in ascending order by offset,
+ // otherwise IE won't interpret it correctly.
+ var stops = fillStyle.colors_;
+ stops.sort(function(cs1, cs2) {
+ return cs1.offset - cs2.offset;
+ });
+
+ var length = stops.length;
+ var color1 = stops[0].color;
+ var color2 = stops[length - 1].color;
+ var opacity1 = stops[0].alpha * ctx.globalAlpha;
+ var opacity2 = stops[length - 1].alpha * ctx.globalAlpha;
+
+ var colors = [];
+ for (var i = 0; i < length; i++) {
+ var stop = stops[i];
+ colors.push(stop.offset * expansion + shift + ' ' + stop.color);
+ }
+
+ // When colors attribute is used, the meanings of opacity and o:opacity2
+ // are reversed.
+ lineStr.push('<g_vml_:fill type="', fillStyle.type_, '"',
+ ' method="none" focus="100%"',
+ ' color="', color1, '"',
+ ' color2="', color2, '"',
+ ' colors="', colors.join(','), '"',
+ ' opacity="', opacity2, '"',
+ ' g_o_:opacity2="', opacity1, '"',
+ ' angle="', angle, '"',
+ ' focusposition="', focus.x, ',', focus.y, '" />');
+ } else if (fillStyle instanceof CanvasPattern_) {
+ if (width && height) {
+ var deltaLeft = -min.x;
+ var deltaTop = -min.y;
+ lineStr.push('<g_vml_:fill',
+ ' position="',
+ deltaLeft / width * arcScaleX * arcScaleX, ',',
+ deltaTop / height * arcScaleY * arcScaleY, '"',
+ ' type="tile"',
+ // TODO: Figure out the correct size to fit the scale.
+ //' size="', w, 'px ', h, 'px"',
+ ' src="', fillStyle.src_, '" />');
+ }
+ } else {
+ var a = processStyle(ctx.fillStyle);
+ var color = a.color;
+ var opacity = a.alpha * ctx.globalAlpha;
+ lineStr.push('<g_vml_:fill color="', color, '" opacity="', opacity,
+ '" />');
+ }
+ }
+
+ contextPrototype.fill = function() {
+ this.stroke(true);
+ };
+
+ contextPrototype.closePath = function() {
+ this.currentPath_.push({type: 'close'});
+ };
+
+ /**
+ * @private
+ */
+ contextPrototype.getCoords_ = function(aX, aY) {
+ var m = this.m_;
+ return {
+ x: Z * (aX * m[0][0] + aY * m[1][0] + m[2][0]) - Z2,
+ y: Z * (aX * m[0][1] + aY * m[1][1] + m[2][1]) - Z2
+ };
+ };
+
+ contextPrototype.save = function() {
+ var o = {};
+ copyState(this, o);
+ this.aStack_.push(o);
+ this.mStack_.push(this.m_);
+ this.m_ = matrixMultiply(createMatrixIdentity(), this.m_);
+ };
+
+ contextPrototype.restore = function() {
+ if (this.aStack_.length) {
+ copyState(this.aStack_.pop(), this);
+ this.m_ = this.mStack_.pop();
+ }
+ };
+
+ function matrixIsFinite(m) {
+ return isFinite(m[0][0]) && isFinite(m[0][1]) &&
+ isFinite(m[1][0]) && isFinite(m[1][1]) &&
+ isFinite(m[2][0]) && isFinite(m[2][1]);
+ }
+
+ function setM(ctx, m, updateLineScale) {
+ if (!matrixIsFinite(m)) {
+ return;
+ }
+ ctx.m_ = m;
+
+ if (updateLineScale) {
+ // Get the line scale.
+ // Determinant of this.m_ means how much the area is enlarged by the
+ // transformation. So its square root can be used as a scale factor
+ // for width.
+ var det = m[0][0] * m[1][1] - m[0][1] * m[1][0];
+ ctx.lineScale_ = sqrt(abs(det));
+ }
+ }
+
+ contextPrototype.translate = function(aX, aY) {
+ var m1 = [
+ [1, 0, 0],
+ [0, 1, 0],
+ [aX, aY, 1]
+ ];
+
+ setM(this, matrixMultiply(m1, this.m_), false);
+ };
+
+ contextPrototype.rotate = function(aRot) {
+ var c = mc(aRot);
+ var s = ms(aRot);
+
+ var m1 = [
+ [c, s, 0],
+ [-s, c, 0],
+ [0, 0, 1]
+ ];
+
+ setM(this, matrixMultiply(m1, this.m_), false);
+ };
+
+ contextPrototype.scale = function(aX, aY) {
+ this.arcScaleX_ *= aX;
+ this.arcScaleY_ *= aY;
+ var m1 = [
+ [aX, 0, 0],
+ [0, aY, 0],
+ [0, 0, 1]
+ ];
+
+ setM(this, matrixMultiply(m1, this.m_), true);
+ };
+
+ contextPrototype.transform = function(m11, m12, m21, m22, dx, dy) {
+ var m1 = [
+ [m11, m12, 0],
+ [m21, m22, 0],
+ [dx, dy, 1]
+ ];
+
+ setM(this, matrixMultiply(m1, this.m_), true);
+ };
+
+ contextPrototype.setTransform = function(m11, m12, m21, m22, dx, dy) {
+ var m = [
+ [m11, m12, 0],
+ [m21, m22, 0],
+ [dx, dy, 1]
+ ];
+
+ setM(this, m, true);
+ };
+
+ /**
+ * The text drawing function.
+ * The maxWidth argument isn't taken in account, since no browser supports
+ * it yet.
+ */
+ contextPrototype.drawText_ = function(text, x, y, maxWidth, stroke) {
+ var m = this.m_,
+ delta = 1000,
+ left = 0,
+ right = delta,
+ offset = {x: 0, y: 0},
+ lineStr = [];
+
+ var fontStyle = getComputedStyle(processFontStyle(this.font),
+ this.element_);
+
+ var fontStyleString = buildStyle(fontStyle);
+
+ var elementStyle = this.element_.currentStyle;
+ var textAlign = this.textAlign.toLowerCase();
+ switch (textAlign) {
+ case 'left':
+ case 'center':
+ case 'right':
+ break;
+ case 'end':
+ textAlign = elementStyle.direction == 'ltr' ? 'right' : 'left';
+ break;
+ case 'start':
+ textAlign = elementStyle.direction == 'rtl' ? 'right' : 'left';
+ break;
+ default:
+ textAlign = 'left';
+ }
+
+ // 1.75 is an arbitrary number, as there is no info about the text baseline
+ switch (this.textBaseline) {
+ case 'hanging':
+ case 'top':
+ offset.y = fontStyle.size / 1.75;
+ break;
+ case 'middle':
+ break;
+ default:
+ case null:
+ case 'alphabetic':
+ case 'ideographic':
+ case 'bottom':
+ offset.y = -fontStyle.size / 2.25;
+ break;
+ }
+
+ switch(textAlign) {
+ case 'right':
+ left = delta;
+ right = 0.05;
+ break;
+ case 'center':
+ left = right = delta / 2;
+ break;
+ }
+
+ var d = this.getCoords_(x + offset.x, y + offset.y);
+
+ lineStr.push('<g_vml_:line from="', -left ,' 0" to="', right ,' 0.05" ',
+ ' coordsize="100 100" coordorigin="0 0"',
+ ' filled="', !stroke, '" stroked="', !!stroke,
+ '" style="position:absolute;width:1px;height:1px;">');
+
+ if (stroke) {
+ appendStroke(this, lineStr);
+ } else {
+ // TODO: Fix the min and max params.
+ appendFill(this, lineStr, {x: -left, y: 0},
+ {x: right, y: fontStyle.size});
+ }
+
+ var skewM = m[0][0].toFixed(3) + ',' + m[1][0].toFixed(3) + ',' +
+ m[0][1].toFixed(3) + ',' + m[1][1].toFixed(3) + ',0,0';
+
+ var skewOffset = mr(d.x / Z) + ',' + mr(d.y / Z);
+
+ lineStr.push('<g_vml_:skew on="t" matrix="', skewM ,'" ',
+ ' offset="', skewOffset, '" origin="', left ,' 0" />',
+ '<g_vml_:path textpathok="true" />',
+ '<g_vml_:textpath on="true" string="',
+ encodeHtmlAttribute(text),
+ '" style="v-text-align:', textAlign,
+ ';font:', encodeHtmlAttribute(fontStyleString),
+ '" /></g_vml_:line>');
+
+ this.element_.insertAdjacentHTML('beforeEnd', lineStr.join(''));
+ };
+
+ contextPrototype.fillText = function(text, x, y, maxWidth) {
+ this.drawText_(text, x, y, maxWidth, false);
+ };
+
+ contextPrototype.strokeText = function(text, x, y, maxWidth) {
+ this.drawText_(text, x, y, maxWidth, true);
+ };
+
+ contextPrototype.measureText = function(text) {
+ if (!this.textMeasureEl_) {
+ var s = '<span style="position:absolute;' +
+ 'top:-20000px;left:0;padding:0;margin:0;border:none;' +
+ 'white-space:pre;"></span>';
+ this.element_.insertAdjacentHTML('beforeEnd', s);
+ this.textMeasureEl_ = this.element_.lastChild;
+ }
+ var doc = this.element_.ownerDocument;
+ this.textMeasureEl_.innerHTML = '';
+ this.textMeasureEl_.style.font = this.font;
+ // Don't use innerHTML or innerText because they allow markup/whitespace.
+ this.textMeasureEl_.appendChild(doc.createTextNode(text));
+ return {width: this.textMeasureEl_.offsetWidth};
+ };
+
+ /******** STUBS ********/
+ contextPrototype.clip = function() {
+ // TODO: Implement
+ };
+
+ contextPrototype.arcTo = function() {
+ // TODO: Implement
+ };
+
+ contextPrototype.createPattern = function(image, repetition) {
+ return new CanvasPattern_(image, repetition);
+ };
+
+ // Gradient / Pattern Stubs
+ function CanvasGradient_(aType) {
+ this.type_ = aType;
+ this.x0_ = 0;
+ this.y0_ = 0;
+ this.r0_ = 0;
+ this.x1_ = 0;
+ this.y1_ = 0;
+ this.r1_ = 0;
+ this.colors_ = [];
+ }
+
+ CanvasGradient_.prototype.addColorStop = function(aOffset, aColor) {
+ aColor = processStyle(aColor);
+ this.colors_.push({offset: aOffset,
+ color: aColor.color,
+ alpha: aColor.alpha});
+ };
+
+ function CanvasPattern_(image, repetition) {
+ assertImageIsValid(image);
+ switch (repetition) {
+ case 'repeat':
+ case null:
+ case '':
+ this.repetition_ = 'repeat';
+ break
+ case 'repeat-x':
+ case 'repeat-y':
+ case 'no-repeat':
+ this.repetition_ = repetition;
+ break;
+ default:
+ throwException('SYNTAX_ERR');
+ }
+
+ this.src_ = image.src;
+ this.width_ = image.width;
+ this.height_ = image.height;
+ }
+
+ function throwException(s) {
+ throw new DOMException_(s);
+ }
+
+ function assertImageIsValid(img) {
+ if (!img || img.nodeType != 1 || img.tagName != 'IMG') {
+ throwException('TYPE_MISMATCH_ERR');
+ }
+ if (img.readyState != 'complete') {
+ throwException('INVALID_STATE_ERR');
+ }
+ }
+
+ function DOMException_(s) {
+ this.code = this[s];
+ this.message = s +': DOM Exception ' + this.code;
+ }
+ var p = DOMException_.prototype = new Error;
+ p.INDEX_SIZE_ERR = 1;
+ p.DOMSTRING_SIZE_ERR = 2;
+ p.HIERARCHY_REQUEST_ERR = 3;
+ p.WRONG_DOCUMENT_ERR = 4;
+ p.INVALID_CHARACTER_ERR = 5;
+ p.NO_DATA_ALLOWED_ERR = 6;
+ p.NO_MODIFICATION_ALLOWED_ERR = 7;
+ p.NOT_FOUND_ERR = 8;
+ p.NOT_SUPPORTED_ERR = 9;
+ p.INUSE_ATTRIBUTE_ERR = 10;
+ p.INVALID_STATE_ERR = 11;
+ p.SYNTAX_ERR = 12;
+ p.INVALID_MODIFICATION_ERR = 13;
+ p.NAMESPACE_ERR = 14;
+ p.INVALID_ACCESS_ERR = 15;
+ p.VALIDATION_ERR = 16;
+ p.TYPE_MISMATCH_ERR = 17;
+
+ // set up externs
+ G_vmlCanvasManager = G_vmlCanvasManager_;
+ CanvasRenderingContext2D = CanvasRenderingContext2D_;
+ CanvasGradient = CanvasGradient_;
+ CanvasPattern = CanvasPattern_;
+ DOMException = DOMException_;
+})();
+
+} // if
+
--- /dev/null
+++ b/js/flot/excanvas.min.js
@@ -1,1 +1,1 @@
-
+if(!document.createElement("canvas").getContext){(function(){var z=Math;var K=z.round;var J=z.sin;var U=z.cos;var b=z.abs;var k=z.sqrt;var D=10;var F=D/2;function T(){return this.context_||(this.context_=new W(this))}var O=Array.prototype.slice;function G(i,j,m){var Z=O.call(arguments,2);return function(){return i.apply(j,Z.concat(O.call(arguments)))}}function AD(Z){return String(Z).replace(/&/g,"&").replace(/"/g,""")}function r(i){if(!i.namespaces.g_vml_){i.namespaces.add("g_vml_","urn:schemas-microsoft-com:vml","#default#VML")}if(!i.namespaces.g_o_){i.namespaces.add("g_o_","urn:schemas-microsoft-com:office:office","#default#VML")}if(!i.styleSheets.ex_canvas_){var Z=i.createStyleSheet();Z.owningElement.id="ex_canvas_";Z.cssText="canvas{display:inline-block;overflow:hidden;text-align:left;width:300px;height:150px}"}}r(document);var E={init:function(Z){if(/MSIE/.test(navigator.userAgent)&&!window.opera){var i=Z||document;i.createElement("canvas");i.attachEvent("onreadystatechange",G(this.init_,this,i))}},init_:function(m){var j=m.getElementsByTagName("canvas");for(var Z=0;Z<j.length;Z++){this.initElement(j[Z])}},initElement:function(i){if(!i.getContext){i.getContext=T;r(i.ownerDocument);i.innerHTML="";i.attachEvent("onpropertychange",S);i.attachEvent("onresize",w);var Z=i.attributes;if(Z.width&&Z.width.specified){i.style.width=Z.width.nodeValue+"px"}else{i.width=i.clientWidth}if(Z.height&&Z.height.specified){i.style.height=Z.height.nodeValue+"px"}else{i.height=i.clientHeight}}return i}};function S(i){var Z=i.srcElement;switch(i.propertyName){case"width":Z.getContext().clearRect();Z.style.width=Z.attributes.width.nodeValue+"px";Z.firstChild.style.width=Z.clientWidth+"px";break;case"height":Z.getContext().clearRect();Z.style.height=Z.attributes.height.nodeValue+"px";Z.firstChild.style.height=Z.clientHeight+"px";break}}function w(i){var Z=i.srcElement;if(Z.firstChild){Z.firstChild.style.width=Z.clientWidth+"px";Z.firstChild.style.height=Z.clientHeight+"px"}}E.init();var I=[];for(var AC=0;AC<16;AC++){for(var AB=0;AB<16;AB++){I[AC*16+AB]=AC.toString(16)+AB.toString(16)}}function V(){return[[1,0,0],[0,1,0],[0,0,1]]}function d(m,j){var i=V();for(var Z=0;Z<3;Z++){for(var AF=0;AF<3;AF++){var p=0;for(var AE=0;AE<3;AE++){p+=m[Z][AE]*j[AE][AF]}i[Z][AF]=p}}return i}function Q(i,Z){Z.fillStyle=i.fillStyle;Z.lineCap=i.lineCap;Z.lineJoin=i.lineJoin;Z.lineWidth=i.lineWidth;Z.miterLimit=i.miterLimit;Z.shadowBlur=i.shadowBlur;Z.shadowColor=i.shadowColor;Z.shadowOffsetX=i.shadowOffsetX;Z.shadowOffsetY=i.shadowOffsetY;Z.strokeStyle=i.strokeStyle;Z.globalAlpha=i.globalAlpha;Z.font=i.font;Z.textAlign=i.textAlign;Z.textBaseline=i.textBaseline;Z.arcScaleX_=i.arcScaleX_;Z.arcScaleY_=i.arcScaleY_;Z.lineScale_=i.lineScale_}var B={aliceblue:"#F0F8FF",antiquewhite:"#FAEBD7",aquamarine:"#7FFFD4",azure:"#F0FFFF",beige:"#F5F5DC",bisque:"#FFE4C4",black:"#000000",blanchedalmond:"#FFEBCD",blueviolet:"#8A2BE2",brown:"#A52A2A",burlywood:"#DEB887",cadetblue:"#5F9EA0",chartreuse:"#7FFF00",chocolate:"#D2691E",coral:"#FF7F50",cornflowerblue:"#6495ED",cornsilk:"#FFF8DC",crimson:"#DC143C",cyan:"#00FFFF",darkblue:"#00008B",darkcyan:"#008B8B",darkgoldenrod:"#B8860B",darkgray:"#A9A9A9",darkgreen:"#006400",darkgrey:"#A9A9A9",darkkhaki:"#BDB76B",darkmagenta:"#8B008B",darkolivegreen:"#556B2F",darkorange:"#FF8C00",darkorchid:"#9932CC",darkred:"#8B0000",darksalmon:"#E9967A",darkseagreen:"#8FBC8F",darkslateblue:"#483D8B",darkslategray:"#2F4F4F",darkslategrey:"#2F4F4F",darkturquoise:"#00CED1",darkviolet:"#9400D3",deeppink:"#FF1493",deepskyblue:"#00BFFF",dimgray:"#696969",dimgrey:"#696969",dodgerblue:"#1E90FF",firebrick:"#B22222",floralwhite:"#FFFAF0",forestgreen:"#228B22",gainsboro:"#DCDCDC",ghostwhite:"#F8F8FF",gold:"#FFD700",goldenrod:"#DAA520",grey:"#808080",greenyellow:"#ADFF2F",honeydew:"#F0FFF0",hotpink:"#FF69B4",indianred:"#CD5C5C",indigo:"#4B0082",ivory:"#FFFFF0",khaki:"#F0E68C",lavender:"#E6E6FA",lavenderblush:"#FFF0F5",lawngreen:"#7CFC00",lemonchiffon:"#FFFACD",lightblue:"#ADD8E6",lightcoral:"#F08080",lightcyan:"#E0FFFF",lightgoldenrodyellow:"#FAFAD2",lightgreen:"#90EE90",lightgrey:"#D3D3D3",lightpink:"#FFB6C1",lightsalmon:"#FFA07A",lightseagreen:"#20B2AA",lightskyblue:"#87CEFA",lightslategray:"#778899",lightslategrey:"#778899",lightsteelblue:"#B0C4DE",lightyellow:"#FFFFE0",limegreen:"#32CD32",linen:"#FAF0E6",magenta:"#FF00FF",mediumaquamarine:"#66CDAA",mediumblue:"#0000CD",mediumorchid:"#BA55D3",mediumpurple:"#9370DB",mediumseagreen:"#3CB371",mediumslateblue:"#7B68EE",mediumspringgreen:"#00FA9A",mediumturquoise:"#48D1CC",mediumvioletred:"#C71585",midnightblue:"#191970",mintcream:"#F5FFFA",mistyrose:"#FFE4E1",moccasin:"#FFE4B5",navajowhite:"#FFDEAD",oldlace:"#FDF5E6",olivedrab:"#6B8E23",orange:"#FFA500",orangered:"#FF4500",orchid:"#DA70D6",palegoldenrod:"#EEE8AA",palegreen:"#98FB98",paleturquoise:"#AFEEEE",palevioletred:"#DB7093",papayawhip:"#FFEFD5",peachpuff:"#FFDAB9",peru:"#CD853F",pink:"#FFC0CB",plum:"#DDA0DD",powderblue:"#B0E0E6",rosybrown:"#BC8F8F",royalblue:"#4169E1",saddlebrown:"#8B4513",salmon:"#FA8072",sandybrown:"#F4A460",seagreen:"#2E8B57",seashell:"#FFF5EE",sienna:"#A0522D",skyblue:"#87CEEB",slateblue:"#6A5ACD",slategray:"#708090",slategrey:"#708090",snow:"#FFFAFA",springgreen:"#00FF7F",steelblue:"#4682B4",tan:"#D2B48C",thistle:"#D8BFD8",tomato:"#FF6347",turquoise:"#40E0D0",violet:"#EE82EE",wheat:"#F5DEB3",whitesmoke:"#F5F5F5",yellowgreen:"#9ACD32"};function g(i){var m=i.indexOf("(",3);var Z=i.indexOf(")",m+1);var j=i.substring(m+1,Z).split(",");if(j.length==4&&i.substr(3,1)=="a"){alpha=Number(j[3])}else{j[3]=1}return j}function C(Z){return parseFloat(Z)/100}function N(i,j,Z){return Math.min(Z,Math.max(j,i))}function c(AF){var j,i,Z;h=parseFloat(AF[0])/360%360;if(h<0){h++}s=N(C(AF[1]),0,1);l=N(C(AF[2]),0,1);if(s==0){j=i=Z=l}else{var m=l<0.5?l*(1+s):l+s-l*s;var AE=2*l-m;j=A(AE,m,h+1/3);i=A(AE,m,h);Z=A(AE,m,h-1/3)}return"#"+I[Math.floor(j*255)]+I[Math.floor(i*255)]+I[Math.floor(Z*255)]}function A(i,Z,j){if(j<0){j++}if(j>1){j--}if(6*j<1){return i+(Z-i)*6*j}else{if(2*j<1){return Z}else{if(3*j<2){return i+(Z-i)*(2/3-j)*6}else{return i}}}}function Y(Z){var AE,p=1;Z=String(Z);if(Z.charAt(0)=="#"){AE=Z}else{if(/^rgb/.test(Z)){var m=g(Z);var AE="#",AF;for(var j=0;j<3;j++){if(m[j].indexOf("%")!=-1){AF=Math.floor(C(m[j])*255)}else{AF=Number(m[j])}AE+=I[N(AF,0,255)]}p=m[3]}else{if(/^hsl/.test(Z)){var m=g(Z);AE=c(m);p=m[3]}else{AE=B[Z]||Z}}}return{color:AE,alpha:p}}var L={style:"normal",variant:"normal",weight:"normal",size:10,family:"sans-serif"};var f={};function X(Z){if(f[Z]){return f[Z]}var m=document.createElement("div");var j=m.style;try{j.font=Z}catch(i){}return f[Z]={style:j.fontStyle||L.style,variant:j.fontVariant||L.variant,weight:j.fontWeight||L.weight,size:j.fontSize||L.size,family:j.fontFamily||L.family}}function P(j,i){var Z={};for(var AF in j){Z[AF]=j[AF]}var AE=parseFloat(i.currentStyle.fontSize),m=parseFloat(j.size);if(typeof j.size=="number"){Z.size=j.size}else{if(j.size.indexOf("px")!=-1){Z.size=m}else{if(j.size.indexOf("em")!=-1){Z.size=AE*m}else{if(j.size.indexOf("%")!=-1){Z.size=(AE/100)*m}else{if(j.size.indexOf("pt")!=-1){Z.size=m/0.75}else{Z.size=AE}}}}}Z.size*=0.981;return Z}function AA(Z){return Z.style+" "+Z.variant+" "+Z.weight+" "+Z.size+"px "+Z.family}function t(Z){switch(Z){case"butt":return"flat";case"round":return"round";case"square":default:return"square"}}function W(i){this.m_=V();this.mStack_=[];this.aStack_=[];this.currentPath_=[];this.strokeStyle="#000";this.fillStyle="#000";this.lineWidth=1;this.lineJoin="miter";this.lineCap="butt";this.miterLimit=D*1;this.globalAlpha=1;this.font="10px sans-serif";this.textAlign="left";this.textBaseline="alphabetic";this.canvas=i;var Z=i.ownerDocument.createElement("div");Z.style.width=i.clientWidth+"px";Z.style.height=i.clientHeight+"px";Z.style.overflow="hidden";Z.style.position="absolute";i.appendChild(Z);this.element_=Z;this.arcScaleX_=1;this.arcScaleY_=1;this.lineScale_=1}var M=W.prototype;M.clearRect=function(){if(this.textMeasureEl_){this.textMeasureEl_.removeNode(true);this.textMeasureEl_=null}this.element_.innerHTML=""};M.beginPath=function(){this.currentPath_=[]};M.moveTo=function(i,Z){var j=this.getCoords_(i,Z);this.currentPath_.push({type:"moveTo",x:j.x,y:j.y});this.currentX_=j.x;this.currentY_=j.y};M.lineTo=function(i,Z){var j=this.getCoords_(i,Z);this.currentPath_.push({type:"lineTo",x:j.x,y:j.y});this.currentX_=j.x;this.currentY_=j.y};M.bezierCurveTo=function(j,i,AI,AH,AG,AE){var Z=this.getCoords_(AG,AE);var AF=this.getCoords_(j,i);var m=this.getCoords_(AI,AH);e(this,AF,m,Z)};function e(Z,m,j,i){Z.currentPath_.push({type:"bezierCurveTo",cp1x:m.x,cp1y:m.y,cp2x:j.x,cp2y:j.y,x:i.x,y:i.y});Z.currentX_=i.x;Z.currentY_=i.y}M.quadraticCurveTo=function(AG,j,i,Z){var AF=this.getCoords_(AG,j);var AE=this.getCoords_(i,Z);var AH={x:this.currentX_+2/3*(AF.x-this.currentX_),y:this.currentY_+2/3*(AF.y-this.currentY_)};var m={x:AH.x+(AE.x-this.currentX_)/3,y:AH.y+(AE.y-this.currentY_)/3};e(this,AH,m,AE)};M.arc=function(AJ,AH,AI,AE,i,j){AI*=D;var AN=j?"at":"wa";var AK=AJ+U(AE)*AI-F;var AM=AH+J(AE)*AI-F;var Z=AJ+U(i)*AI-F;var AL=AH+J(i)*AI-F;if(AK==Z&&!j){AK+=0.125}var m=this.getCoords_(AJ,AH);var AG=this.getCoords_(AK,AM);var AF=this.getCoords_(Z,AL);this.currentPath_.push({type:AN,x:m.x,y:m.y,radius:AI,xStart:AG.x,yStart:AG.y,xEnd:AF.x,yEnd:AF.y})};M.rect=function(j,i,Z,m){this.moveTo(j,i);this.lineTo(j+Z,i);this.lineTo(j+Z,i+m);this.lineTo(j,i+m);this.closePath()};M.strokeRect=function(j,i,Z,m){var p=this.currentPath_;this.beginPath();this.moveTo(j,i);this.lineTo(j+Z,i);this.lineTo(j+Z,i+m);this.lineTo(j,i+m);this.closePath();this.stroke();this.currentPath_=p};M.fillRect=function(j,i,Z,m){var p=this.currentPath_;this.beginPath();this.moveTo(j,i);this.lineTo(j+Z,i);this.lineTo(j+Z,i+m);this.lineTo(j,i+m);this.closePath();this.fill();this.currentPath_=p};M.createLinearGradient=function(i,m,Z,j){var p=new v("gradient");p.x0_=i;p.y0_=m;p.x1_=Z;p.y1_=j;return p};M.createRadialGradient=function(m,AE,j,i,p,Z){var AF=new v("gradientradial");AF.x0_=m;AF.y0_=AE;AF.r0_=j;AF.x1_=i;AF.y1_=p;AF.r1_=Z;return AF};M.drawImage=function(AO,j){var AH,AF,AJ,AV,AM,AK,AQ,AX;var AI=AO.runtimeStyle.width;var AN=AO.runtimeStyle.height;AO.runtimeStyle.width="auto";AO.runtimeStyle.height="auto";var AG=AO.width;var AT=AO.height;AO.runtimeStyle.width=AI;AO.runtimeStyle.height=AN;if(arguments.length==3){AH=arguments[1];AF=arguments[2];AM=AK=0;AQ=AJ=AG;AX=AV=AT}else{if(arguments.length==5){AH=arguments[1];AF=arguments[2];AJ=arguments[3];AV=arguments[4];AM=AK=0;AQ=AG;AX=AT}else{if(arguments.length==9){AM=arguments[1];AK=arguments[2];AQ=arguments[3];AX=arguments[4];AH=arguments[5];AF=arguments[6];AJ=arguments[7];AV=arguments[8]}else{throw Error("Invalid number of arguments")}}}var AW=this.getCoords_(AH,AF);var m=AQ/2;var i=AX/2;var AU=[];var Z=10;var AE=10;AU.push(" <g_vml_:group",' coordsize="',D*Z,",",D*AE,'"',' coordorigin="0,0"',' style="width:',Z,"px;height:",AE,"px;position:absolute;");if(this.m_[0][0]!=1||this.m_[0][1]||this.m_[1][1]!=1||this.m_[1][0]){var p=[];p.push("M11=",this.m_[0][0],",","M12=",this.m_[1][0],",","M21=",this.m_[0][1],",","M22=",this.m_[1][1],",","Dx=",K(AW.x/D),",","Dy=",K(AW.y/D),"");var AS=AW;var AR=this.getCoords_(AH+AJ,AF);var AP=this.getCoords_(AH,AF+AV);var AL=this.getCoords_(AH+AJ,AF+AV);AS.x=z.max(AS.x,AR.x,AP.x,AL.x);AS.y=z.max(AS.y,AR.y,AP.y,AL.y);AU.push("padding:0 ",K(AS.x/D),"px ",K(AS.y/D),"px 0;filter:progid:DXImageTransform.Microsoft.Matrix(",p.join(""),", sizingmethod='clip');")}else{AU.push("top:",K(AW.y/D),"px;left:",K(AW.x/D),"px;")}AU.push(' ">','<g_vml_:image src="',AO.src,'"',' style="width:',D*AJ,"px;"," height:",D*AV,'px"',' cropleft="',AM/AG,'"',' croptop="',AK/AT,'"',' cropright="',(AG-AM-AQ)/AG,'"',' cropbottom="',(AT-AK-AX)/AT,'"'," />","</g_vml_:group>");this.element_.insertAdjacentHTML("BeforeEnd",AU.join(""))};M.stroke=function(AM){var m=10;var AN=10;var AE=5000;var AG={x:null,y:null};var AL={x:null,y:null};for(var AH=0;AH<this.currentPath_.length;AH+=AE){var AK=[];var AF=false;AK.push("<g_vml_:shape",' filled="',!!AM,'"',' style="position:absolute;width:',m,"px;height:",AN,'px;"',' coordorigin="0,0"',' coordsize="',D*m,",",D*AN,'"',' stroked="',!AM,'"',' path="');var AO=false;for(var AI=AH;AI<Math.min(AH+AE,this.currentPath_.length);AI++){if(AI%AE==0&&AI>0){AK.push(" m ",K(this.currentPath_[AI-1].x),",",K(this.currentPath_[AI-1].y))}var Z=this.currentPath_[AI];var AJ;switch(Z.type){case"moveTo":AJ=Z;AK.push(" m ",K(Z.x),",",K(Z.y));break;case"lineTo":AK.push(" l ",K(Z.x),",",K(Z.y));break;case"close":AK.push(" x ");Z=null;break;case"bezierCurveTo":AK.push(" c ",K(Z.cp1x),",",K(Z.cp1y),",",K(Z.cp2x),",",K(Z.cp2y),",",K(Z.x),",",K(Z.y));break;case"at":case"wa":AK.push(" ",Z.type," ",K(Z.x-this.arcScaleX_*Z.radius),",",K(Z.y-this.arcScaleY_*Z.radius)," ",K(Z.x+this.arcScaleX_*Z.radius),",",K(Z.y+this.arcScaleY_*Z.radius)," ",K(Z.xStart),",",K(Z.yStart)," ",K(Z.xEnd),",",K(Z.yEnd));break}if(Z){if(AG.x==null||Z.x<AG.x){AG.x=Z.x}if(AL.x==null||Z.x>AL.x){AL.x=Z.x}if(AG.y==null||Z.y<AG.y){AG.y=Z.y}if(AL.y==null||Z.y>AL.y){AL.y=Z.y}}}AK.push(' ">');if(!AM){R(this,AK)}else{a(this,AK,AG,AL)}AK.push("</g_vml_:shape>");this.element_.insertAdjacentHTML("beforeEnd",AK.join(""))}};function R(j,AE){var i=Y(j.strokeStyle);var m=i.color;var p=i.alpha*j.globalAlpha;var Z=j.lineScale_*j.lineWidth;if(Z<1){p*=Z}AE.push("<g_vml_:stroke",' opacity="',p,'"',' joinstyle="',j.lineJoin,'"',' miterlimit="',j.miterLimit,'"',' endcap="',t(j.lineCap),'"',' weight="',Z,'px"',' color="',m,'" />')}function a(AO,AG,Ah,AP){var AH=AO.fillStyle;var AY=AO.arcScaleX_;var AX=AO.arcScaleY_;var Z=AP.x-Ah.x;var m=AP.y-Ah.y;if(AH instanceof v){var AL=0;var Ac={x:0,y:0};var AU=0;var AK=1;if(AH.type_=="gradient"){var AJ=AH.x0_/AY;var j=AH.y0_/AX;var AI=AH.x1_/AY;var Aj=AH.y1_/AX;var Ag=AO.getCoords_(AJ,j);var Af=AO.getCoords_(AI,Aj);var AE=Af.x-Ag.x;var p=Af.y-Ag.y;AL=Math.atan2(AE,p)*180/Math.PI;if(AL<0){AL+=360}if(AL<0.000001){AL=0}}else{var Ag=AO.getCoords_(AH.x0_,AH.y0_);Ac={x:(Ag.x-Ah.x)/Z,y:(Ag.y-Ah.y)/m};Z/=AY*D;m/=AX*D;var Aa=z.max(Z,m);AU=2*AH.r0_/Aa;AK=2*AH.r1_/Aa-AU}var AS=AH.colors_;AS.sort(function(Ak,i){return Ak.offset-i.offset});var AN=AS.length;var AR=AS[0].color;var AQ=AS[AN-1].color;var AW=AS[0].alpha*AO.globalAlpha;var AV=AS[AN-1].alpha*AO.globalAlpha;var Ab=[];for(var Ae=0;Ae<AN;Ae++){var AM=AS[Ae];Ab.push(AM.offset*AK+AU+" "+AM.color)}AG.push('<g_vml_:fill type="',AH.type_,'"',' method="none" focus="100%"',' color="',AR,'"',' color2="',AQ,'"',' colors="',Ab.join(","),'"',' opacity="',AV,'"',' g_o_:opacity2="',AW,'"',' angle="',AL,'"',' focusposition="',Ac.x,",",Ac.y,'" />')}else{if(AH instanceof u){if(Z&&m){var AF=-Ah.x;var AZ=-Ah.y;AG.push("<g_vml_:fill",' position="',AF/Z*AY*AY,",",AZ/m*AX*AX,'"',' type="tile"',' src="',AH.src_,'" />')}}else{var Ai=Y(AO.fillStyle);var AT=Ai.color;var Ad=Ai.alpha*AO.globalAlpha;AG.push('<g_vml_:fill color="',AT,'" opacity="',Ad,'" />')}}}M.fill=function(){this.stroke(true)};M.closePath=function(){this.currentPath_.push({type:"close"})};M.getCoords_=function(j,i){var Z=this.m_;return{x:D*(j*Z[0][0]+i*Z[1][0]+Z[2][0])-F,y:D*(j*Z[0][1]+i*Z[1][1]+Z[2][1])-F}};M.save=function(){var Z={};Q(this,Z);this.aStack_.push(Z);this.mStack_.push(this.m_);this.m_=d(V(),this.m_)};M.restore=function(){if(this.aStack_.length){Q(this.aStack_.pop(),this);this.m_=this.mStack_.pop()}};function H(Z){return isFinite(Z[0][0])&&isFinite(Z[0][1])&&isFinite(Z[1][0])&&isFinite(Z[1][1])&&isFinite(Z[2][0])&&isFinite(Z[2][1])}function y(i,Z,j){if(!H(Z)){return }i.m_=Z;if(j){var p=Z[0][0]*Z[1][1]-Z[0][1]*Z[1][0];i.lineScale_=k(b(p))}}M.translate=function(j,i){var Z=[[1,0,0],[0,1,0],[j,i,1]];y(this,d(Z,this.m_),false)};M.rotate=function(i){var m=U(i);var j=J(i);var Z=[[m,j,0],[-j,m,0],[0,0,1]];y(this,d(Z,this.m_),false)};M.scale=function(j,i){this.arcScaleX_*=j;this.arcScaleY_*=i;var Z=[[j,0,0],[0,i,0],[0,0,1]];y(this,d(Z,this.m_),true)};M.transform=function(p,m,AF,AE,i,Z){var j=[[p,m,0],[AF,AE,0],[i,Z,1]];y(this,d(j,this.m_),true)};M.setTransform=function(AE,p,AG,AF,j,i){var Z=[[AE,p,0],[AG,AF,0],[j,i,1]];y(this,Z,true)};M.drawText_=function(AK,AI,AH,AN,AG){var AM=this.m_,AQ=1000,i=0,AP=AQ,AF={x:0,y:0},AE=[];var Z=P(X(this.font),this.element_);var j=AA(Z);var AR=this.element_.currentStyle;var p=this.textAlign.toLowerCase();switch(p){case"left":case"center":case"right":break;case"end":p=AR.direction=="ltr"?"right":"left";break;case"start":p=AR.direction=="rtl"?"right":"left";break;default:p="left"}switch(this.textBaseline){case"hanging":case"top":AF.y=Z.size/1.75;break;case"middle":break;default:case null:case"alphabetic":case"ideographic":case"bottom":AF.y=-Z.size/2.25;break}switch(p){case"right":i=AQ;AP=0.05;break;case"center":i=AP=AQ/2;break}var AO=this.getCoords_(AI+AF.x,AH+AF.y);AE.push('<g_vml_:line from="',-i,' 0" to="',AP,' 0.05" ',' coordsize="100 100" coordorigin="0 0"',' filled="',!AG,'" stroked="',!!AG,'" style="position:absolute;width:1px;height:1px;">');if(AG){R(this,AE)}else{a(this,AE,{x:-i,y:0},{x:AP,y:Z.size})}var AL=AM[0][0].toFixed(3)+","+AM[1][0].toFixed(3)+","+AM[0][1].toFixed(3)+","+AM[1][1].toFixed(3)+",0,0";var AJ=K(AO.x/D)+","+K(AO.y/D);AE.push('<g_vml_:skew on="t" matrix="',AL,'" ',' offset="',AJ,'" origin="',i,' 0" />','<g_vml_:path textpathok="true" />','<g_vml_:textpath on="true" string="',AD(AK),'" style="v-text-align:',p,";font:",AD(j),'" /></g_vml_:line>');this.element_.insertAdjacentHTML("beforeEnd",AE.join(""))};M.fillText=function(j,Z,m,i){this.drawText_(j,Z,m,i,false)};M.strokeText=function(j,Z,m,i){this.drawText_(j,Z,m,i,true)};M.measureText=function(j){if(!this.textMeasureEl_){var Z='<span style="position:absolute;top:-20000px;left:0;padding:0;margin:0;border:none;white-space:pre;"></span>';this.element_.insertAdjacentHTML("beforeEnd",Z);this.textMeasureEl_=this.element_.lastChild}var i=this.element_.ownerDocument;this.textMeasureEl_.innerHTML="";this.textMeasureEl_.style.font=this.font;this.textMeasureEl_.appendChild(i.createTextNode(j));return{width:this.textMeasureEl_.offsetWidth}};M.clip=function(){};M.arcTo=function(){};M.createPattern=function(i,Z){return new u(i,Z)};function v(Z){this.type_=Z;this.x0_=0;this.y0_=0;this.r0_=0;this.x1_=0;this.y1_=0;this.r1_=0;this.colors_=[]}v.prototype.addColorStop=function(i,Z){Z=Y(Z);this.colors_.push({offset:i,color:Z.color,alpha:Z.alpha})};function u(i,Z){q(i);switch(Z){case"repeat":case null:case"":this.repetition_="repeat";break;case"repeat-x":case"repeat-y":case"no-repeat":this.repetition_=Z;break;default:n("SYNTAX_ERR")}this.src_=i.src;this.width_=i.width;this.height_=i.height}function n(Z){throw new o(Z)}function q(Z){if(!Z||Z.nodeType!=1||Z.tagName!="IMG"){n("TYPE_MISMATCH_ERR")}if(Z.readyState!="complete"){n("INVALID_STATE_ERR")}}function o(Z){this.code=this[Z];this.message=Z+": DOM Exception "+this.code}var x=o.prototype=new Error;x.INDEX_SIZE_ERR=1;x.DOMSTRING_SIZE_ERR=2;x.HIERARCHY_REQUEST_ERR=3;x.WRONG_DOCUMENT_ERR=4;x.INVALID_CHARACTER_ERR=5;x.NO_DATA_ALLOWED_ERR=6;x.NO_MODIFICATION_ALLOWED_ERR=7;x.NOT_FOUND_ERR=8;x.NOT_SUPPORTED_ERR=9;x.INUSE_ATTRIBUTE_ERR=10;x.INVALID_STATE_ERR=11;x.SYNTAX_ERR=12;x.INVALID_MODIFICATION_ERR=13;x.NAMESPACE_ERR=14;x.INVALID_ACCESS_ERR=15;x.VALIDATION_ERR=16;x.TYPE_MISMATCH_ERR=17;G_vmlCanvasManager=E;CanvasRenderingContext2D=W;CanvasGradient=v;CanvasPattern=u;DOMException=o})()};
--- /dev/null
+++ b/js/flot/jquery.colorhelpers.js
@@ -1,1 +1,180 @@
+/* Plugin for jQuery for working with colors.
+ *
+ * Version 1.1.
+ *
+ * Inspiration from jQuery color animation plugin by John Resig.
+ *
+ * Released under the MIT license by Ole Laursen, October 2009.
+ *
+ * Examples:
+ *
+ * $.color.parse("#fff").scale('rgb', 0.25).add('a', -0.5).toString()
+ * var c = $.color.extract($("#mydiv"), 'background-color');
+ * console.log(c.r, c.g, c.b, c.a);
+ * $.color.make(100, 50, 25, 0.4).toString() // returns "rgba(100,50,25,0.4)"
+ *
+ * Note that .scale() and .add() return the same modified object
+ * instead of making a new one.
+ *
+ * V. 1.1: Fix error handling so e.g. parsing an empty string does
+ * produce a color rather than just crashing.
+ */
+(function($) {
+ $.color = {};
+
+ // construct color object with some convenient chainable helpers
+ $.color.make = function (r, g, b, a) {
+ var o = {};
+ o.r = r || 0;
+ o.g = g || 0;
+ o.b = b || 0;
+ o.a = a != null ? a : 1;
+
+ o.add = function (c, d) {
+ for (var i = 0; i < c.length; ++i)
+ o[c.charAt(i)] += d;
+ return o.normalize();
+ };
+
+ o.scale = function (c, f) {
+ for (var i = 0; i < c.length; ++i)
+ o[c.charAt(i)] *= f;
+ return o.normalize();
+ };
+
+ o.toString = function () {
+ if (o.a >= 1.0) {
+ return "rgb("+[o.r, o.g, o.b].join(",")+")";
+ } else {
+ return "rgba("+[o.r, o.g, o.b, o.a].join(",")+")";
+ }
+ };
+
+ o.normalize = function () {
+ function clamp(min, value, max) {
+ return value < min ? min: (value > max ? max: value);
+ }
+
+ o.r = clamp(0, parseInt(o.r), 255);
+ o.g = clamp(0, parseInt(o.g), 255);
+ o.b = clamp(0, parseInt(o.b), 255);
+ o.a = clamp(0, o.a, 1);
+ return o;
+ };
+
+ o.clone = function () {
+ return $.color.make(o.r, o.b, o.g, o.a);
+ };
+
+ return o.normalize();
+ }
+
+ // extract CSS color property from element, going up in the DOM
+ // if it's "transparent"
+ $.color.extract = function (elem, css) {
+ var c;
+ do {
+ c = elem.css(css).toLowerCase();
+ // keep going until we find an element that has color, or
+ // we hit the body
+ if (c != '' && c != 'transparent')
+ break;
+ elem = elem.parent();
+ } while (!$.nodeName(elem.get(0), "body"));
+
+ // catch Safari's way of signalling transparent
+ if (c == "rgba(0, 0, 0, 0)")
+ c = "transparent";
+
+ return $.color.parse(c);
+ }
+
+ // parse CSS color string (like "rgb(10, 32, 43)" or "#fff"),
+ // returns color object, if parsing failed, you get black (0, 0,
+ // 0) out
+ $.color.parse = function (str) {
+ var res, m = $.color.make;
+
+ // Look for rgb(num,num,num)
+ if (res = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(str))
+ return m(parseInt(res[1], 10), parseInt(res[2], 10), parseInt(res[3], 10));
+
+ // Look for rgba(num,num,num,num)
+ if (res = /rgba\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(str))
+ return m(parseInt(res[1], 10), parseInt(res[2], 10), parseInt(res[3], 10), parseFloat(res[4]));
+
+ // Look for rgb(num%,num%,num%)
+ if (res = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(str))
+ return m(parseFloat(res[1])*2.55, parseFloat(res[2])*2.55, parseFloat(res[3])*2.55);
+
+ // Look for rgba(num%,num%,num%,num)
+ if (res = /rgba\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(str))
+ return m(parseFloat(res[1])*2.55, parseFloat(res[2])*2.55, parseFloat(res[3])*2.55, parseFloat(res[4]));
+
+ // Look for #a0b1c2
+ if (res = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(str))
+ return m(parseInt(res[1], 16), parseInt(res[2], 16), parseInt(res[3], 16));
+
+ // Look for #fff
+ if (res = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(str))
+ return m(parseInt(res[1]+res[1], 16), parseInt(res[2]+res[2], 16), parseInt(res[3]+res[3], 16));
+
+ // Otherwise, we're most likely dealing with a named color
+ var name = $.trim(str).toLowerCase();
+ if (name == "transparent")
+ return m(255, 255, 255, 0);
+ else {
+ // default to black
+ res = lookupColors[name] || [0, 0, 0];
+ return m(res[0], res[1], res[2]);
+ }
+ }
+
+ var lookupColors = {
+ aqua:[0,255,255],
+ azure:[240,255,255],
+ beige:[245,245,220],
+ black:[0,0,0],
+ blue:[0,0,255],
+ brown:[165,42,42],
+ cyan:[0,255,255],
+ darkblue:[0,0,139],
+ darkcyan:[0,139,139],
+ darkgrey:[169,169,169],
+ darkgreen:[0,100,0],
+ darkkhaki:[189,183,107],
+ darkmagenta:[139,0,139],
+ darkolivegreen:[85,107,47],
+ darkorange:[255,140,0],
+ darkorchid:[153,50,204],
+ darkred:[139,0,0],
+ darksalmon:[233,150,122],
+ darkviolet:[148,0,211],
+ fuchsia:[255,0,255],
+ gold:[255,215,0],
+ green:[0,128,0],
+ indigo:[75,0,130],
+ khaki:[240,230,140],
+ lightblue:[173,216,230],
+ lightcyan:[224,255,255],
+ lightgreen:[144,238,144],
+ lightgrey:[211,211,211],
+ lightpink:[255,182,193],
+ lightyellow:[255,255,224],
+ lime:[0,255,0],
+ magenta:[255,0,255],
+ maroon:[128,0,0],
+ navy:[0,0,128],
+ olive:[128,128,0],
+ orange:[255,165,0],
+ pink:[255,192,203],
+ purple:[128,0,128],
+ violet:[128,0,128],
+ red:[255,0,0],
+ silver:[192,192,192],
+ white:[255,255,255],
+ yellow:[255,255,0]
+ };
+})(jQuery);
+
--- /dev/null
+++ b/js/flot/jquery.colorhelpers.min.js
@@ -1,1 +1,1 @@
-
+(function(b){b.color={};b.color.make=function(f,e,c,d){var h={};h.r=f||0;h.g=e||0;h.b=c||0;h.a=d!=null?d:1;h.add=function(k,j){for(var g=0;g<k.length;++g){h[k.charAt(g)]+=j}return h.normalize()};h.scale=function(k,j){for(var g=0;g<k.length;++g){h[k.charAt(g)]*=j}return h.normalize()};h.toString=function(){if(h.a>=1){return"rgb("+[h.r,h.g,h.b].join(",")+")"}else{return"rgba("+[h.r,h.g,h.b,h.a].join(",")+")"}};h.normalize=function(){function g(j,k,i){return k<j?j:(k>i?i:k)}h.r=g(0,parseInt(h.r),255);h.g=g(0,parseInt(h.g),255);h.b=g(0,parseInt(h.b),255);h.a=g(0,h.a,1);return h};h.clone=function(){return b.color.make(h.r,h.b,h.g,h.a)};return h.normalize()};b.color.extract=function(e,d){var f;do{f=e.css(d).toLowerCase();if(f!=""&&f!="transparent"){break}e=e.parent()}while(!b.nodeName(e.get(0),"body"));if(f=="rgba(0, 0, 0, 0)"){f="transparent"}return b.color.parse(f)};b.color.parse=function(f){var e,c=b.color.make;if(e=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(f)){return c(parseInt(e[1],10),parseInt(e[2],10),parseInt(e[3],10))}if(e=/rgba\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(f)){return c(parseInt(e[1],10),parseInt(e[2],10),parseInt(e[3],10),parseFloat(e[4]))}if(e=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(f)){return c(parseFloat(e[1])*2.55,parseFloat(e[2])*2.55,parseFloat(e[3])*2.55)}if(e=/rgba\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(f)){return c(parseFloat(e[1])*2.55,parseFloat(e[2])*2.55,parseFloat(e[3])*2.55,parseFloat(e[4]))}if(e=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(f)){return c(parseInt(e[1],16),parseInt(e[2],16),parseInt(e[3],16))}if(e=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(f)){return c(parseInt(e[1]+e[1],16),parseInt(e[2]+e[2],16),parseInt(e[3]+e[3],16))}var d=b.trim(f).toLowerCase();if(d=="transparent"){return c(255,255,255,0)}else{e=a[d]||[0,0,0];return c(e[0],e[1],e[2])}};var a={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0]}})(jQuery);
--- /dev/null
+++ b/js/flot/jquery.flot.crosshair.js
@@ -1,1 +1,168 @@
+/*
+Flot plugin for showing crosshairs, thin lines, when the mouse hovers
+over the plot.
+ crosshair: {
+ mode: null or "x" or "y" or "xy"
+ color: color
+ lineWidth: number
+ }
+
+Set the mode to one of "x", "y" or "xy". The "x" mode enables a
+vertical crosshair that lets you trace the values on the x axis, "y"
+enables a horizontal crosshair and "xy" enables them both. "color" is
+the color of the crosshair (default is "rgba(170, 0, 0, 0.80)"),
+"lineWidth" is the width of the drawn lines (default is 1).
+
+The plugin also adds four public methods:
+
+ - setCrosshair(pos)
+
+ Set the position of the crosshair. Note that this is cleared if
+ the user moves the mouse. "pos" is in coordinates of the plot and
+ should be on the form { x: xpos, y: ypos } (you can use x2/x3/...
+ if you're using multiple axes), which is coincidentally the same
+ format as what you get from a "plothover" event. If "pos" is null,
+ the crosshair is cleared.
+
+ - clearCrosshair()
+
+ Clear the crosshair.
+
+ - lockCrosshair(pos)
+
+ Cause the crosshair to lock to the current location, no longer
+ updating if the user moves the mouse. Optionally supply a position
+ (passed on to setCrosshair()) to move it to.
+
+ Example usage:
+ var myFlot = $.plot( $("#graph"), ..., { crosshair: { mode: "x" } } };
+ $("#graph").bind("plothover", function (evt, position, item) {
+ if (item) {
+ // Lock the crosshair to the data point being hovered
+ myFlot.lockCrosshair({ x: item.datapoint[0], y: item.datapoint[1] });
+ }
+ else {
+ // Return normal crosshair operation
+ myFlot.unlockCrosshair();
+ }
+ });
+
+ - unlockCrosshair()
+
+ Free the crosshair to move again after locking it.
+*/
+
+(function ($) {
+ var options = {
+ crosshair: {
+ mode: null, // one of null, "x", "y" or "xy",
+ color: "rgba(170, 0, 0, 0.80)",
+ lineWidth: 1
+ }
+ };
+
+ function init(plot) {
+ // position of crosshair in pixels
+ var crosshair = { x: -1, y: -1, locked: false };
+
+ plot.setCrosshair = function setCrosshair(pos) {
+ if (!pos)
+ crosshair.x = -1;
+ else {
+ var o = plot.p2c(pos);
+ crosshair.x = Math.max(0, Math.min(o.left, plot.width()));
+ crosshair.y = Math.max(0, Math.min(o.top, plot.height()));
+ }
+
+ plot.triggerRedrawOverlay();
+ };
+
+ plot.clearCrosshair = plot.setCrosshair; // passes null for pos
+
+ plot.lockCrosshair = function lockCrosshair(pos) {
+ if (pos)
+ plot.setCrosshair(pos);
+ crosshair.locked = true;
+ }
+
+ plot.unlockCrosshair = function unlockCrosshair() {
+ crosshair.locked = false;
+ }
+
+ function onMouseOut(e) {
+ if (crosshair.locked)
+ return;
+
+ if (crosshair.x != -1) {
+ crosshair.x = -1;
+ plot.triggerRedrawOverlay();
+ }
+ }
+
+ function onMouseMove(e) {
+ if (crosshair.locked)
+ return;
+
+ if (plot.getSelection && plot.getSelection()) {
+ crosshair.x = -1; // hide the crosshair while selecting
+ return;
+ }
+
+ var offset = plot.offset();
+ crosshair.x = Math.max(0, Math.min(e.pageX - offset.left, plot.width()));
+ crosshair.y = Math.max(0, Math.min(e.pageY - offset.top, plot.height()));
+ plot.triggerRedrawOverlay();
+ }
+
+ plot.hooks.bindEvents.push(function (plot, eventHolder) {
+ if (!plot.getOptions().crosshair.mode)
+ return;
+
+ eventHolder.mouseout(onMouseOut);
+ eventHolder.mousemove(onMouseMove);
+ });
+
+ plot.hooks.drawOverlay.push(function (plot, ctx) {
+ var c = plot.getOptions().crosshair;
+ if (!c.mode)
+ return;
+
+ var plotOffset = plot.getPlotOffset();
+
+ ctx.save();
+ ctx.translate(plotOffset.left, plotOffset.top);
+
+ if (crosshair.x != -1) {
+ ctx.strokeStyle = c.color;
+ ctx.lineWidth = c.lineWidth;
+ ctx.lineJoin = "round";
+
+ ctx.beginPath();
+ if (c.mode.indexOf("x") != -1) {
+ ctx.moveTo(crosshair.x, 0);
+ ctx.lineTo(crosshair.x, plot.height());
+ }
+ if (c.mode.indexOf("y") != -1) {
+ ctx.moveTo(0, crosshair.y);
+ ctx.lineTo(plot.width(), crosshair.y);
+ }
+ ctx.stroke();
+ }
+ ctx.restore();
+ });
+
+ plot.hooks.shutdown.push(function (plot, eventHolder) {
+ eventHolder.unbind("mouseout", onMouseOut);
+ eventHolder.unbind("mousemove", onMouseMove);
+ });
+ }
+
+ $.plot.plugins.push({
+ init: init,
+ options: options,
+ name: 'crosshair',
+ version: '1.0'
+ });
+})(jQuery);
+
--- /dev/null
+++ b/js/flot/jquery.flot.crosshair.min.js
@@ -1,1 +1,1 @@
-
+(function(b){var a={crosshair:{mode:null,color:"rgba(170, 0, 0, 0.80)",lineWidth:1}};function c(h){var j={x:-1,y:-1,locked:false};h.setCrosshair=function e(l){if(!l){j.x=-1}else{var k=h.p2c(l);j.x=Math.max(0,Math.min(k.left,h.width()));j.y=Math.max(0,Math.min(k.top,h.height()))}h.triggerRedrawOverlay()};h.clearCrosshair=h.setCrosshair;h.lockCrosshair=function f(k){if(k){h.setCrosshair(k)}j.locked=true};h.unlockCrosshair=function g(){j.locked=false};function d(k){if(j.locked){return}if(j.x!=-1){j.x=-1;h.triggerRedrawOverlay()}}function i(k){if(j.locked){return}if(h.getSelection&&h.getSelection()){j.x=-1;return}var l=h.offset();j.x=Math.max(0,Math.min(k.pageX-l.left,h.width()));j.y=Math.max(0,Math.min(k.pageY-l.top,h.height()));h.triggerRedrawOverlay()}h.hooks.bindEvents.push(function(l,k){if(!l.getOptions().crosshair.mode){return}k.mouseout(d);k.mousemove(i)});h.hooks.drawOverlay.push(function(m,k){var n=m.getOptions().crosshair;if(!n.mode){return}var l=m.getPlotOffset();k.save();k.translate(l.left,l.top);if(j.x!=-1){k.strokeStyle=n.color;k.lineWidth=n.lineWidth;k.lineJoin="round";k.beginPath();if(n.mode.indexOf("x")!=-1){k.moveTo(j.x,0);k.lineTo(j.x,m.height())}if(n.mode.indexOf("y")!=-1){k.moveTo(0,j.y);k.lineTo(m.width(),j.y)}k.stroke()}k.restore()});h.hooks.shutdown.push(function(l,k){k.unbind("mouseout",d);k.unbind("mousemove",i)})}b.plot.plugins.push({init:c,options:a,name:"crosshair",version:"1.0"})})(jQuery);
--- /dev/null
+++ b/js/flot/jquery.flot.fillbetween.js
@@ -1,1 +1,184 @@
+/*
+Flot plugin for computing bottoms for filled line and bar charts.
+The case: you've got two series that you want to fill the area
+between. In Flot terms, you need to use one as the fill bottom of the
+other. You can specify the bottom of each data point as the third
+coordinate manually, or you can use this plugin to compute it for you.
+
+In order to name the other series, you need to give it an id, like this
+
+ var dataset = [
+ { data: [ ... ], id: "foo" } , // use default bottom
+ { data: [ ... ], fillBetween: "foo" }, // use first dataset as bottom
+ ];
+
+ $.plot($("#placeholder"), dataset, { line: { show: true, fill: true }});
+
+As a convenience, if the id given is a number that doesn't appear as
+an id in the series, it is interpreted as the index in the array
+instead (so fillBetween: 0 can also mean the first series).
+
+Internally, the plugin modifies the datapoints in each series. For
+line series, extra data points might be inserted through
+interpolation. Note that at points where the bottom line is not
+defined (due to a null point or start/end of line), the current line
+will show a gap too. The algorithm comes from the jquery.flot.stack.js
+plugin, possibly some code could be shared.
+*/
+
+(function ($) {
+ var options = {
+ series: { fillBetween: null } // or number
+ };
+
+ function init(plot) {
+ function findBottomSeries(s, allseries) {
+ var i;
+ for (i = 0; i < allseries.length; ++i) {
+ if (allseries[i].id == s.fillBetween)
+ return allseries[i];
+ }
+
+ if (typeof s.fillBetween == "number") {
+ i = s.fillBetween;
+
+ if (i < 0 || i >= allseries.length)
+ return null;
+
+ return allseries[i];
+ }
+
+ return null;
+ }
+
+ function computeFillBottoms(plot, s, datapoints) {
+ if (s.fillBetween == null)
+ return;
+
+ var other = findBottomSeries(s, plot.getData());
+ if (!other)
+ return;
+
+ var ps = datapoints.pointsize,
+ points = datapoints.points,
+ otherps = other.datapoints.pointsize,
+ otherpoints = other.datapoints.points,
+ newpoints = [],
+ px, py, intery, qx, qy, bottom,
+ withlines = s.lines.show,
+ withbottom = ps > 2 && datapoints.format[2].y,
+ withsteps = withlines && s.lines.steps,
+ fromgap = true,
+ i = 0, j = 0, l;
+
+ while (true) {
+ if (i >= points.length)
+ break;
+
+ l = newpoints.length;
+
+ if (points[i] == null) {
+ // copy gaps
+ for (m = 0; m < ps; ++m)
+ newpoints.push(points[i + m]);
+ i += ps;
+ }
+ else if (j >= otherpoints.length) {
+ // for lines, we can't use the rest of the points
+ if (!withlines) {
+ for (m = 0; m < ps; ++m)
+ newpoints.push(points[i + m]);
+ }
+ i += ps;
+ }
+ else if (otherpoints[j] == null) {
+ // oops, got a gap
+ for (m = 0; m < ps; ++m)
+ newpoints.push(null);
+ fromgap = true;
+ j += otherps;
+ }
+ else {
+ // cases where we actually got two points
+ px = points[i];
+ py = points[i + 1];
+ qx = otherpoints[j];
+ qy = otherpoints[j + 1];
+ bottom = 0;
+
+ if (px == qx) {
+ for (m = 0; m < ps; ++m)
+ newpoints.push(points[i + m]);
+
+ //newpoints[l + 1] += qy;
+ bottom = qy;
+
+ i += ps;
+ j += otherps;
+ }
+ else if (px > qx) {
+ // we got past point below, might need to
+ // insert interpolated extra point
+ if (withlines && i > 0 && points[i - ps] != null) {
+ intery = py + (points[i - ps + 1] - py) * (qx - px) / (points[i - ps] - px);
+ newpoints.push(qx);
+ newpoints.push(intery)
+ for (m = 2; m < ps; ++m)
+ newpoints.push(points[i + m]);
+ bottom = qy;
+ }
+
+ j += otherps;
+ }
+ else { // px < qx
+ if (fromgap && withlines) {
+ // if we come from a gap, we just skip this point
+ i += ps;
+ continue;
+ }
+
+ for (m = 0; m < ps; ++m)
+ newpoints.push(points[i + m]);
+
+ // we might be able to interpolate a point below,
+ // this can give us a better y
+ if (withlines && j > 0 && otherpoints[j - otherps] != null)
+ bottom = qy + (otherpoints[j - otherps + 1] - qy) * (px - qx) / (otherpoints[j - otherps] - qx);
+
+ //newpoints[l + 1] += bottom;
+
+ i += ps;
+ }
+
+ fromgap = false;
+
+ if (l != newpoints.length && withbottom)
+ newpoints[l + 2] = bottom;
+ }
+
+ // maintain the line steps invariant
+ if (withsteps && l != newpoints.length && l > 0
+ && newpoints[l] != null
+ && newpoints[l] != newpoints[l - ps]
+ && newpoints[l + 1] != newpoints[l - ps + 1]) {
+ for (m = 0; m < ps; ++m)
+ newpoints[l + ps + m] = newpoints[l + m];
+ newpoints[l + 1] = newpoints[l - ps + 1];
+ }
+ }
+
+ datapoints.points = newpoints;
+ }
+
+ plot.hooks.processDatapoints.push(computeFillBottoms);
+ }
+
+ $.plot.plugins.push({
+ init: init,
+ options: options,
+ name: 'fillbetween',
+ version: '1.0'
+ });
+})(jQuery);
+
--- /dev/null
+++ b/js/flot/jquery.flot.fillbetween.min.js
@@ -1,1 +1,1 @@
-
+(function(b){var a={series:{fillBetween:null}};function c(f){function d(j,h){var g;for(g=0;g<h.length;++g){if(h[g].id==j.fillBetween){return h[g]}}if(typeof j.fillBetween=="number"){g=j.fillBetween;if(g<0||g>=h.length){return null}return h[g]}return null}function e(B,u,g){if(u.fillBetween==null){return}var p=d(u,B.getData());if(!p){return}var y=g.pointsize,E=g.points,h=p.datapoints.pointsize,x=p.datapoints.points,r=[],w,v,k,G,F,q,t=u.lines.show,o=y>2&&g.format[2].y,n=t&&u.lines.steps,D=true,C=0,A=0,z;while(true){if(C>=E.length){break}z=r.length;if(E[C]==null){for(m=0;m<y;++m){r.push(E[C+m])}C+=y}else{if(A>=x.length){if(!t){for(m=0;m<y;++m){r.push(E[C+m])}}C+=y}else{if(x[A]==null){for(m=0;m<y;++m){r.push(null)}D=true;A+=h}else{w=E[C];v=E[C+1];G=x[A];F=x[A+1];q=0;if(w==G){for(m=0;m<y;++m){r.push(E[C+m])}q=F;C+=y;A+=h}else{if(w>G){if(t&&C>0&&E[C-y]!=null){k=v+(E[C-y+1]-v)*(G-w)/(E[C-y]-w);r.push(G);r.push(k);for(m=2;m<y;++m){r.push(E[C+m])}q=F}A+=h}else{if(D&&t){C+=y;continue}for(m=0;m<y;++m){r.push(E[C+m])}if(t&&A>0&&x[A-h]!=null){q=F+(x[A-h+1]-F)*(w-G)/(x[A-h]-G)}C+=y}}D=false;if(z!=r.length&&o){r[z+2]=q}}}}if(n&&z!=r.length&&z>0&&r[z]!=null&&r[z]!=r[z-y]&&r[z+1]!=r[z-y+1]){for(m=0;m<y;++m){r[z+y+m]=r[z+m]}r[z+1]=r[z-y+1]}}g.points=r}f.hooks.processDatapoints.push(e)}b.plot.plugins.push({init:c,options:a,name:"fillbetween",version:"1.0"})})(jQuery);
--- /dev/null
+++ b/js/flot/jquery.flot.image.js
@@ -1,1 +1,239 @@
-
+/*
+Flot plugin for plotting images, e.g. useful for putting ticks on a
+prerendered complex visualization.
+
+The data syntax is [[image, x1, y1, x2, y2], ...] where (x1, y1) and
+(x2, y2) are where you intend the two opposite corners of the image to
+end up in the plot. Image must be a fully loaded Javascript image (you
+can make one with new Image()). If the image is not complete, it's
+skipped when plotting.
+
+There are two helpers included for retrieving images. The easiest work
+the way that you put in URLs instead of images in the data (like
+["myimage.png", 0, 0, 10, 10]), then call $.plot.image.loadData(data,
+options, callback) where data and options are the same as you pass in
+to $.plot. This loads the images, replaces the URLs in the data with
+the corresponding images and calls "callback" when all images are
+loaded (or failed loading). In the callback, you can then call $.plot
+with the data set. See the included example.
+
+A more low-level helper, $.plot.image.load(urls, callback) is also
+included. Given a list of URLs, it calls callback with an object
+mapping from URL to Image object when all images are loaded or have
+failed loading.
+
+Options for the plugin are
+
+ series: {
+ images: {
+ show: boolean
+ anchor: "corner" or "center"
+ alpha: [0,1]
+ }
+ }
+
+which can be specified for a specific series
+
+ $.plot($("#placeholder"), [{ data: [ ... ], images: { ... } ])
+
+Note that because the data format is different from usual data points,
+you can't use images with anything else in a specific data series.
+
+Setting "anchor" to "center" causes the pixels in the image to be
+anchored at the corner pixel centers inside of at the pixel corners,
+effectively letting half a pixel stick out to each side in the plot.
+
+
+A possible future direction could be support for tiling for large
+images (like Google Maps).
+
+*/
+
+(function ($) {
+ var options = {
+ series: {
+ images: {
+ show: false,
+ alpha: 1,
+ anchor: "corner" // or "center"
+ }
+ }
+ };
+
+ $.plot.image = {};
+
+ $.plot.image.loadDataImages = function (series, options, callback) {
+ var urls = [], points = [];
+
+ var defaultShow = options.series.images.show;
+
+ $.each(series, function (i, s) {
+ if (!(defaultShow || s.images.show))
+ return;
+
+ if (s.data)
+ s = s.data;
+
+ $.each(s, function (i, p) {
+ if (typeof p[0] == "string") {
+ urls.push(p[0]);
+ points.push(p);
+ }
+ });
+ });
+
+ $.plot.image.load(urls, function (loadedImages) {
+ $.each(points, function (i, p) {
+ var url = p[0];
+ if (loadedImages[url])
+ p[0] = loadedImages[url];
+ });
+
+ callback();
+ });
+ }
+
+ $.plot.image.load = function (urls, callback) {
+ var missing = urls.length, loaded = {};
+ if (missing == 0)
+ callback({});
+
+ $.each(urls, function (i, url) {
+ var handler = function () {
+ --missing;
+
+ loaded[url] = this;
+
+ if (missing == 0)
+ callback(loaded);
+ };
+
+ $('<img />').load(handler).error(handler).attr('src', url);
+ });
+ }
+
+ function drawSeries(plot, ctx, series) {
+ var plotOffset = plot.getPlotOffset();
+
+ if (!series.images || !series.images.show)
+ return;
+
+ var points = series.datapoints.points,
+ ps = series.datapoints.pointsize;
+
+ for (var i = 0; i < points.length; i += ps) {
+ var img = points[i],
+ x1 = points[i + 1], y1 = points[i + 2],
+ x2 = points[i + 3], y2 = points[i + 4],
+ xaxis = series.xaxis, yaxis = series.yaxis,
+ tmp;
+
+ // actually we should check img.complete, but it
+ // appears to be a somewhat unreliable indicator in
+ // IE6 (false even after load event)
+ if (!img || img.width <= 0 || img.height <= 0)
+ continue;
+
+ if (x1 > x2) {
+ tmp = x2;
+ x2 = x1;
+ x1 = tmp;
+ }
+ if (y1 > y2) {
+ tmp = y2;
+ y2 = y1;
+ y1 = tmp;
+ }
+
+ // if the anchor is at the center of the pixel, expand the
+ // image by 1/2 pixel in each direction
+ if (series.images.anchor == "center") {
+ tmp = 0.5 * (x2-x1) / (img.width - 1);
+ x1 -= tmp;
+ x2 += tmp;
+ tmp = 0.5 * (y2-y1) / (img.height - 1);
+ y1 -= tmp;
+ y2 += tmp;
+ }
+
+ // clip
+ if (x1 == x2 || y1 == y2 ||
+ x1 >= xaxis.max || x2 <= xaxis.min ||
+ y1 >= yaxis.max || y2 <= yaxis.min)
+ continue;
+
+ var sx1 = 0, sy1 = 0, sx2 = img.width, sy2 = img.height;
+ if (x1 < xaxis.min) {
+ sx1 += (sx2 - sx1) * (xaxis.min - x1) / (x2 - x1);
+ x1 = xaxis.min;
+ }
+
+ if (x2 > xaxis.max) {
+ sx2 += (sx2 - sx1) * (xaxis.max - x2) / (x2 - x1);
+ x2 = xaxis.max;
+ }
+
+ if (y1 < yaxis.min) {
+ sy2 += (sy1 - sy2) * (yaxis.min - y1) / (y2 - y1);
+ y1 = yaxis.min;
+ }
+
+ if (y2 > yaxis.max) {
+ sy1 += (sy1 - sy2) * (yaxis.max - y2) / (y2 - y1);
+ y2 = yaxis.max;
+ }
+
+ x1 = xaxis.p2c(x1);
+ x2 = xaxis.p2c(x2);
+ y1 = yaxis.p2c(y1);
+ y2 = yaxis.p2c(y2);
+
+ // the transformation may have swapped us
+ if (x1 > x2) {
+ tmp = x2;
+ x2 = x1;
+ x1 = tmp;
+ }
+ if (y1 > y2) {
+ tmp = y2;
+ y2 = y1;
+ y1 = tmp;
+ }
+
+ tmp = ctx.globalAlpha;
+ ctx.globalAlpha *= series.images.alpha;
+ ctx.drawImage(img,
+ sx1, sy1, sx2 - sx1, sy2 - sy1,
+ x1 + plotOffset.left, y1 + plotOffset.top,
+ x2 - x1, y2 - y1);
+ ctx.globalAlpha = tmp;
+ }
+ }
+
+ function processRawData(plot, series, data, datapoints) {
+ if (!series.images.show)
+ return;
+
+ // format is Image, x1, y1, x2, y2 (opposite corners)
+ datapoints.format = [
+ { required: true },
+ { x: true, number: true, required: true },
+ { y: true, number: true, required: true },
+ { x: true, number: true, required: true },
+ { y: true, number: true, required: true }
+ ];
+ }
+
+ function init(plot) {
+ plot.hooks.processRawData.push(processRawData);
+ plot.hooks.drawSeries.push(drawSeries);
+ }
+
+ $.plot.plugins.push({
+ init: init,
+ options: options,
+ name: 'image',
+ version: '1.1'
+ });
+})(jQuery);
+
--- /dev/null
+++ b/js/flot/jquery.flot.image.min.js
@@ -1,1 +1,1 @@
-
+(function(c){var a={series:{images:{show:false,alpha:1,anchor:"corner"}}};c.plot.image={};c.plot.image.loadDataImages=function(g,f,k){var j=[],h=[];var i=f.series.images.show;c.each(g,function(l,m){if(!(i||m.images.show)){return}if(m.data){m=m.data}c.each(m,function(n,o){if(typeof o[0]=="string"){j.push(o[0]);h.push(o)}})});c.plot.image.load(j,function(l){c.each(h,function(n,o){var m=o[0];if(l[m]){o[0]=l[m]}});k()})};c.plot.image.load=function(h,i){var g=h.length,f={};if(g==0){i({})}c.each(h,function(k,j){var l=function(){--g;f[j]=this;if(g==0){i(f)}};c("<img />").load(l).error(l).attr("src",j)})};function d(q,o,l){var m=q.getPlotOffset();if(!l.images||!l.images.show){return}var r=l.datapoints.points,n=l.datapoints.pointsize;for(var t=0;t<r.length;t+=n){var y=r[t],w=r[t+1],g=r[t+2],v=r[t+3],f=r[t+4],h=l.xaxis,u=l.yaxis,x;if(!y||y.width<=0||y.height<=0){continue}if(w>v){x=v;v=w;w=x}if(g>f){x=f;f=g;g=x}if(l.images.anchor=="center"){x=0.5*(v-w)/(y.width-1);w-=x;v+=x;x=0.5*(f-g)/(y.height-1);g-=x;f+=x}if(w==v||g==f||w>=h.max||v<=h.min||g>=u.max||f<=u.min){continue}var k=0,s=0,j=y.width,p=y.height;if(w<h.min){k+=(j-k)*(h.min-w)/(v-w);w=h.min}if(v>h.max){j+=(j-k)*(h.max-v)/(v-w);v=h.max}if(g<u.min){p+=(s-p)*(u.min-g)/(f-g);g=u.min}if(f>u.max){s+=(s-p)*(u.max-f)/(f-g);f=u.max}w=h.p2c(w);v=h.p2c(v);g=u.p2c(g);f=u.p2c(f);if(w>v){x=v;v=w;w=x}if(g>f){x=f;f=g;g=x}x=o.globalAlpha;o.globalAlpha*=l.images.alpha;o.drawImage(y,k,s,j-k,p-s,w+m.left,g+m.top,v-w,f-g);o.globalAlpha=x}}function b(i,f,g,h){if(!f.images.show){return}h.format=[{required:true},{x:true,number:true,required:true},{y:true,number:true,required:true},{x:true,number:true,required:true},{y:true,number:true,required:true}]}function e(f){f.hooks.processRawData.push(b);f.hooks.drawSeries.push(d)}c.plot.plugins.push({init:e,options:a,name:"image",version:"1.1"})})(jQuery);
--- /dev/null
+++ b/js/flot/jquery.flot.js
@@ -1,1 +1,2600 @@
-
+/*! Javascript plotting library for jQuery, v. 0.7.
+ *
+ * Released under the MIT license by IOLA, December 2007.
+ *
+ */
+
+// first an inline dependency, jquery.colorhelpers.js, we inline it here
+// for convenience
+
+/* Plugin for jQuery for working with colors.
+ *
+ * Version 1.1.
+ *
+ * Inspiration from jQuery color animation plugin by John Resig.
+ *
+ * Released under the MIT license by Ole Laursen, October 2009.
+ *
+ * Examples:
+ *
+ * $.color.parse("#fff").scale('rgb', 0.25).add('a', -0.5).toString()
+ * var c = $.color.extract($("#mydiv"), 'background-color');
+ * console.log(c.r, c.g, c.b, c.a);
+ * $.color.make(100, 50, 25, 0.4).toString() // returns "rgba(100,50,25,0.4)"
+ *
+ * Note that .scale() and .add() return the same modified object
+ * instead of making a new one.
+ *
+ * V. 1.1: Fix error handling so e.g. parsing an empty string does
+ * produce a color rather than just crashing.
+ */
+(function(B){B.color={};B.color.make=function(F,E,C,D){var G={};G.r=F||0;G.g=E||0;G.b=C||0;G.a=D!=null?D:1;G.add=function(J,I){for(var H=0;H<J.length;++H){G[J.charAt(H)]+=I}return G.normalize()};G.scale=function(J,I){for(var H=0;H<J.length;++H){G[J.charAt(H)]*=I}return G.normalize()};G.toString=function(){if(G.a>=1){return"rgb("+[G.r,G.g,G.b].join(",")+")"}else{return"rgba("+[G.r,G.g,G.b,G.a].join(",")+")"}};G.normalize=function(){function H(J,K,I){return K<J?J:(K>I?I:K)}G.r=H(0,parseInt(G.r),255);G.g=H(0,parseInt(G.g),255);G.b=H(0,parseInt(G.b),255);G.a=H(0,G.a,1);return G};G.clone=function(){return B.color.make(G.r,G.b,G.g,G.a)};return G.normalize()};B.color.extract=function(D,C){var E;do{E=D.css(C).toLowerCase();if(E!=""&&E!="transparent"){break}D=D.parent()}while(!B.nodeName(D.get(0),"body"));if(E=="rgba(0, 0, 0, 0)"){E="transparent"}return B.color.parse(E)};B.color.parse=function(F){var E,C=B.color.make;if(E=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(F)){return C(parseInt(E[1],10),parseInt(E[2],10),parseInt(E[3],10))}if(E=/rgba\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(F)){return C(parseInt(E[1],10),parseInt(E[2],10),parseInt(E[3],10),parseFloat(E[4]))}if(E=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(F)){return C(parseFloat(E[1])*2.55,parseFloat(E[2])*2.55,parseFloat(E[3])*2.55)}if(E=/rgba\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(F)){return C(parseFloat(E[1])*2.55,parseFloat(E[2])*2.55,parseFloat(E[3])*2.55,parseFloat(E[4]))}if(E=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(F)){return C(parseInt(E[1],16),parseInt(E[2],16),parseInt(E[3],16))}if(E=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(F)){return C(parseInt(E[1]+E[1],16),parseInt(E[2]+E[2],16),parseInt(E[3]+E[3],16))}var D=B.trim(F).toLowerCase();if(D=="transparent"){return C(255,255,255,0)}else{E=A[D]||[0,0,0];return C(E[0],E[1],E[2])}};var A={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0]}})(jQuery);
+
+// the actual Flot code
+(function($) {
+ function Plot(placeholder, data_, options_, plugins) {
+ // data is on the form:
+ // [ series1, series2 ... ]
+ // where series is either just the data as [ [x1, y1], [x2, y2], ... ]
+ // or { data: [ [x1, y1], [x2, y2], ... ], label: "some label", ... }
+
+ var series = [],
+ options = {
+ // the color theme used for graphs
+ colors: ["#edc240", "#afd8f8", "#cb4b4b", "#4da74d", "#9440ed"],
+ legend: {
+ show: true,
+ noColumns: 1, // number of colums in legend table
+ labelFormatter: null, // fn: string -> string
+ labelBoxBorderColor: "#ccc", // border color for the little label boxes
+ container: null, // container (as jQuery object) to put legend in, null means default on top of graph
+ position: "ne", // position of default legend container within plot
+ margin: 5, // distance from grid edge to default legend container within plot
+ backgroundColor: null, // null means auto-detect
+ backgroundOpacity: 0.85 // set to 0 to avoid background
+ },
+ xaxis: {
+ show: null, // null = auto-detect, true = always, false = never
+ position: "bottom", // or "top"
+ mode: null, // null or "time"
+ color: null, // base color, labels, ticks
+ tickColor: null, // possibly different color of ticks, e.g. "rgba(0,0,0,0.15)"
+ transform: null, // null or f: number -> number to transform axis
+ inverseTransform: null, // if transform is set, this should be the inverse function
+ min: null, // min. value to show, null means set automatically
+ max: null, // max. value to show, null means set automatically
+ autoscaleMargin: null, // margin in % to add if auto-setting min/max
+ ticks: null, // either [1, 3] or [[1, "a"], 3] or (fn: axis info -> ticks) or app. number of ticks for auto-ticks
+ tickFormatter: null, // fn: number -> string
+ labelWidth: null, // size of tick labels in pixels
+ labelHeight: null,
+ reserveSpace: null, // whether to reserve space even if axis isn't shown
+ tickLength: null, // size in pixels of ticks, or "full" for whole line
+ alignTicksWithAxis: null, // axis number or null for no sync
+
+ // mode specific options
+ tickDecimals: null, // no. of decimals, null means auto
+ tickSize: null, // number or [number, "unit"]
+ minTickSize: null, // number or [number, "unit"]
+ monthNames: null, // list of names of months
+ timeformat: null, // format string to use
+ twelveHourClock: false // 12 or 24 time in time mode
+ },
+ yaxis: {
+ autoscaleMargin: 0.02,
+ position: "left" // or "right"
+ },
+ xaxes: [],
+ yaxes: [],
+ series: {
+ points: {
+ show: false,
+ radius: 3,
+ lineWidth: 2, // in pixels
+ fill: true,
+ fillColor: "#ffffff",
+ symbol: "circle" // or callback
+ },
+ lines: {
+ // we don't put in show: false so we can see
+ // whether lines were actively disabled
+ lineWidth: 2, // in pixels
+ fill: false,
+ fillColor: null,
+ steps: false
+ },
+ bars: {
+ show: false,
+ lineWidth: 2, // in pixels
+ barWidth: 1, // in units of the x axis
+ fill: true,
+ fillColor: null,
+ align: "left", // or "center"
+ horizontal: false
+ },
+ shadowSize: 3
+ },
+ grid: {
+ show: true,
+ aboveData: false,
+ color: "#545454", // primary color used for outline and labels
+ backgroundColor: null, // null for transparent, else color
+ borderColor: null, // set if different from the grid color
+ tickColor: null, // color for the ticks, e.g. "rgba(0,0,0,0.15)"
+ labelMargin: 5, // in pixels
+ axisMargin: 8, // in pixels
+ borderWidth: 2, // in pixels
+ minBorderMargin: null, // in pixels, null means taken from points radius
+ markings: null, // array of ranges or fn: axes -> array of ranges
+ markingsColor: "#f4f4f4",
+ markingsLineWidth: 2,
+ // interactive stuff
+ clickable: false,
+ hoverable: false,
+ autoHighlight: true, // highlight in case mouse is near
+ mouseActiveRadius: 10 // how far the mouse can be away to activate an item
+ },
+ hooks: {}
+ },
+ canvas = null, // the canvas for the plot itself
+ overlay = null, // canvas for interactive stuff on top of plot
+ eventHolder = null, // jQuery object that events should be bound to
+ ctx = null, octx = null,
+ xaxes = [], yaxes = [],
+ plotOffset = { left: 0, right: 0, top: 0, bottom: 0},
+ canvasWidth = 0, canvasHeight = 0,
+ plotWidth = 0, plotHeight = 0,
+ hooks = {
+ processOptions: [],
+ processRawData: [],
+ processDatapoints: [],
+ drawSeries: [],
+ draw: [],
+ bindEvents: [],
+ drawOverlay: [],
+ shutdown: []
+ },
+ plot = this;
+
+ // public functions
+ plot.setData = setData;
+ plot.setupGrid = setupGrid;
+ plot.draw = draw;
+ plot.getPlaceholder = function() { return placeholder; };
+ plot.getCanvas = function() { return canvas; };
+ plot.getPlotOffset = function() { return plotOffset; };
+ plot.width = function () { return plotWidth; };
+ plot.height = function () { return plotHeight; };
+ plot.offset = function () {
+ var o = eventHolder.offset();
+ o.left += plotOffset.left;
+ o.top += plotOffset.top;
+ return o;
+ };
+ plot.getData = function () { return series; };
+ plot.getAxes = function () {
+ var res = {}, i;
+ $.each(xaxes.concat(yaxes), function (_, axis) {
+ if (axis)
+ res[axis.direction + (axis.n != 1 ? axis.n : "") + "axis"] = axis;
+ });
+ return res;
+ };
+ plot.getXAxes = function () { return xaxes; };
+ plot.getYAxes = function () { return yaxes; };
+ plot.c2p = canvasToAxisCoords;
+ plot.p2c = axisToCanvasCoords;
+ plot.getOptions = function () { return options; };
+ plot.highlight = highlight;
+ plot.unhighlight = unhighlight;
+ plot.triggerRedrawOverlay = triggerRedrawOverlay;
+ plot.pointOffset = function(point) {
+ return {
+ left: parseInt(xaxes[axisNumber(point, "x") - 1].p2c(+point.x) + plotOffset.left),
+ top: parseInt(yaxes[axisNumber(point, "y") - 1].p2c(+point.y) + plotOffset.top)
+ };
+ };
+ plot.shutdown = shutdown;
+ plot.resize = function () {
+ getCanvasDimensions();
+ resizeCanvas(canvas);
+ resizeCanvas(overlay);
+ };
+
+ // public attributes
+ plot.hooks = hooks;
+
+ // initialize
+ initPlugins(plot);
+ parseOptions(options_);
+ setupCanvases();
+ setData(data_);
+ setupGrid();
+ draw();
+ bindEvents();
+
+
+ function executeHooks(hook, args) {
+ args = [plot].concat(args);
+ for (var i = 0; i < hook.length; ++i)
+ hook[i].apply(this, args);
+ }
+
+ function initPlugins() {
+ for (var i = 0; i < plugins.length; ++i) {
+ var p = plugins[i];
+ p.init(plot);
+ if (p.options)
+ $.extend(true, options, p.options);
+ }
+ }
+
+ function parseOptions(opts) {
+ var i;
+
+ $.extend(true, options, opts);
+
+ if (options.xaxis.color == null)
+ options.xaxis.color = options.grid.color;
+ if (options.yaxis.color == null)
+ options.yaxis.color = options.grid.color;
+
+ if (options.xaxis.tickColor == null) // backwards-compatibility
+ options.xaxis.tickColor = options.grid.tickColor;
+ if (options.yaxis.tickColor == null) // backwards-compatibility
+ options.yaxis.tickColor = options.grid.tickColor;
+
+ if (options.grid.borderColor == null)
+ options.grid.borderColor = options.grid.color;
+ if (options.grid.tickColor == null)
+ options.grid.tickColor = $.color.parse(options.grid.color).scale('a', 0.22).toString();
+
+ // fill in defaults in axes, copy at least always the
+ // first as the rest of the code assumes it'll be there
+ for (i = 0; i < Math.max(1, options.xaxes.length); ++i)
+ options.xaxes[i] = $.extend(true, {}, options.xaxis, options.xaxes[i]);
+ for (i = 0; i < Math.max(1, options.yaxes.length); ++i)
+ options.yaxes[i] = $.extend(true, {}, options.yaxis, options.yaxes[i]);
+
+ // backwards compatibility, to be removed in future
+ if (options.xaxis.noTicks && options.xaxis.ticks == null)
+ options.xaxis.ticks = options.xaxis.noTicks;
+ if (options.yaxis.noTicks && options.yaxis.ticks == null)
+ options.yaxis.ticks = options.yaxis.noTicks;
+ if (options.x2axis) {
+ options.xaxes[1] = $.extend(true, {}, options.xaxis, options.x2axis);
+ options.xaxes[1].position = "top";
+ }
+ if (options.y2axis) {
+ options.yaxes[1] = $.extend(true, {}, options.yaxis, options.y2axis);
+ options.yaxes[1].position = "right";
+ }
+ if (options.grid.coloredAreas)
+ options.grid.markings = options.grid.coloredAreas;
+ if (options.grid.coloredAreasColor)
+ options.grid.markingsColor = options.grid.coloredAreasColor;
+ if (options.lines)
+ $.extend(true, options.series.lines, options.lines);
+ if (options.points)
+ $.extend(true, options.series.points, options.points);
+ if (options.bars)
+ $.extend(true, options.series.bars, options.bars);
+ if (options.shadowSize != null)
+ options.series.shadowSize = options.shadowSize;
+
+ // save options on axes for future reference
+ for (i = 0; i < options.xaxes.length; ++i)
+ getOrCreateAxis(xaxes, i + 1).options = options.xaxes[i];
+ for (i = 0; i < options.yaxes.length; ++i)
+ getOrCreateAxis(yaxes, i + 1).options = options.yaxes[i];
+
+ // add hooks from options
+ for (var n in hooks)
+ if (options.hooks[n] && options.hooks[n].length)
+ hooks[n] = hooks[n].concat(options.hooks[n]);
+
+ executeHooks(hooks.processOptions, [options]);
+ }
+
+ function setData(d) {
+ series = parseData(d);
+ fillInSeriesOptions();
+ processData();
+ }
+
+ function parseData(d) {
+ var res = [];
+ for (var i = 0; i < d.length; ++i) {
+ var s = $.extend(true, {}, options.series);
+
+ if (d[i].data != null) {
+ s.data = d[i].data; // move the data instead of deep-copy
+ delete d[i].data;
+
+ $.extend(true, s, d[i]);
+
+ d[i].data = s.data;
+ }
+ else
+ s.data = d[i];
+ res.push(s);
+ }
+
+ return res;
+ }
+
+ function axisNumber(obj, coord) {
+ var a = obj[coord + "axis"];
+ if (typeof a == "object") // if we got a real axis, extract number
+ a = a.n;
+ if (typeof a != "number")
+ a = 1; // default to first axis
+ return a;
+ }
+
+ function allAxes() {
+ // return flat array without annoying null entries
+ return $.grep(xaxes.concat(yaxes), function (a) { return a; });
+ }
+
+ function canvasToAxisCoords(pos) {
+ // return an object with x/y corresponding to all used axes
+ var res = {}, i, axis;
+ for (i = 0; i < xaxes.length; ++i) {
+ axis = xaxes[i];
+ if (axis && axis.used)
+ res["x" + axis.n] = axis.c2p(pos.left);
+ }
+
+ for (i = 0; i < yaxes.length; ++i) {
+ axis = yaxes[i];
+ if (axis && axis.used)
+ res["y" + axis.n] = axis.c2p(pos.top);
+ }
+
+ if (res.x1 !== undefined)
+ res.x = res.x1;
+ if (res.y1 !== undefined)
+ res.y = res.y1;
+
+ return res;
+ }
+
+ function axisToCanvasCoords(pos) {
+ // get canvas coords from the first pair of x/y found in pos
+ var res = {}, i, axis, key;
+
+ for (i = 0; i < xaxes.length; ++i) {
+ axis = xaxes[i];
+ if (axis && axis.used) {
+ key = "x" + axis.n;
+ if (pos[key] == null && axis.n == 1)
+ key = "x";
+
+ if (pos[key] != null) {
+ res.left = axis.p2c(pos[key]);
+ break;
+ }
+ }
+ }
+
+ for (i = 0; i < yaxes.length; ++i) {
+ axis = yaxes[i];
+ if (axis && axis.used) {
+ key = "y" + axis.n;
+ if (pos[key] == null && axis.n == 1)
+ key = "y";
+
+ if (pos[key] != null) {
+ res.top = axis.p2c(pos[key]);
+ break;
+ }
+ }
+ }
+
+ return res;
+ }
+
+ function getOrCreateAxis(axes, number) {
+ if (!axes[number - 1])
+ axes[number - 1] = {
+ n: number, // save the number for future reference
+ direction: axes == xaxes ? "x" : "y",
+ options: $.extend(true, {}, axes == xaxes ? options.xaxis : options.yaxis)
+ };
+
+ return axes[number - 1];
+ }
+
+ function fillInSeriesOptions() {
+ var i;
+
+ // collect what we already got of colors
+ var neededColors = series.length,
+ usedColors = [],
+ assignedColors = [];
+ for (i = 0; i < series.length; ++i) {
+ var sc = series[i].color;
+ if (sc != null) {
+ --neededColors;
+ if (typeof sc == "number")
+ assignedColors.push(sc);
+ else
+ usedColors.push($.color.parse(series[i].color));
+ }
+ }
+
+ // we might need to generate more colors if higher indices
+ // are assigned
+ for (i = 0; i < assignedColors.length; ++i) {
+ neededColors = Math.max(neededColors, assignedColors[i] + 1);
+ }
+
+ // produce colors as needed
+ var colors = [], variation = 0;
+ i = 0;
+ while (colors.length < neededColors) {
+ var c;
+ if (options.colors.length == i) // check degenerate case
+ c = $.color.make(100, 100, 100);
+ else
+ c = $.color.parse(options.colors[i]);
+
+ // vary color if needed
+ var sign = variation % 2 == 1 ? -1 : 1;
+ c.scale('rgb', 1 + sign * Math.ceil(variation / 2) * 0.2)
+
+ // FIXME: if we're getting to close to something else,
+ // we should probably skip this one
+ colors.push(c);
+
+ ++i;
+ if (i >= options.colors.length) {
+ i = 0;
+ ++variation;
+ }
+ }
+
+ // fill in the options
+ var colori = 0, s;
+ for (i = 0; i < series.length; ++i) {
+ s = series[i];
+
+ // assign colors
+ if (s.color == null) {
+ s.color = colors[colori].toString();
+ ++colori;
+ }
+ else if (typeof s.color == "number")
+ s.color = colors[s.color].toString();
+
+ // turn on lines automatically in case nothing is set
+ if (s.lines.show == null) {
+ var v, show = true;
+ for (v in s)
+ if (s[v] && s[v].show) {
+ show = false;
+ break;
+ }
+ if (show)
+ s.lines.show = true;
+ }
+
+ // setup axes
+ s.xaxis = getOrCreateAxis(xaxes, axisNumber(s, "x"));
+ s.yaxis = getOrCreateAxis(yaxes, axisNumber(s, "y"));
+ }
+ }
+
+ function processData() {
+ var topSentry = Number.POSITIVE_INFINITY,
+ bottomSentry = Number.NEGATIVE_INFINITY,
+ fakeInfinity = Number.MAX_VALUE,
+ i, j, k, m, length,
+ s, points, ps, x, y, axis, val, f, p;
+
+ function updateAxis(axis, min, max) {
+ if (min < axis.datamin && min != -fakeInfinity)
+ axis.datamin = min;
+ if (max > axis.datamax && max != fakeInfinity)
+ axis.datamax = max;
+ }
+
+ $.each(allAxes(), function (_, axis) {
+ // init axis
+ axis.datamin = topSentry;
+ axis.datamax = bottomSentry;
+ axis.used = false;
+ });
+
+ for (i = 0; i < series.length; ++i) {
+ s = series[i];
+ s.datapoints = { points: [] };
+
+ executeHooks(hooks.processRawData, [ s, s.data, s.datapoints ]);
+ }
+
+ // first pass: clean and copy data
+ for (i = 0; i < series.length; ++i) {
+ s = series[i];
+
+ var data = s.data, format = s.datapoints.format;
+
+ if (!format) {
+ format = [];
+ // find out how to copy
+ format.push({ x: true, number: true, required: true });
+ format.push({ y: true, number: true, required: true });
+
+ if (s.bars.show || (s.lines.show && s.lines.fill)) {
+ format.push({ y: true, number: true, required: false, defaultValue: 0 });
+ if (s.bars.horizontal) {
+ delete format[format.length - 1].y;
+ format[format.length - 1].x = true;
+ }
+ }
+
+ s.datapoints.format = format;
+ }
+
+ if (s.datapoints.pointsize != null)
+ continue; // already filled in
+
+ s.datapoints.pointsize = format.length;
+
+ ps = s.datapoints.pointsize;
+ points = s.datapoints.points;
+
+ insertSteps = s.lines.show && s.lines.steps;
+ s.xaxis.used = s.yaxis.used = true;
+
+ for (j = k = 0; j < data.length; ++j, k += ps) {
+ p = data[j];
+
+ var nullify = p == null;
+ if (!nullify) {
+ for (m = 0; m < ps; ++m) {
+ val = p[m];
+ f = format[m];
+
+ if (f) {
+ if (f.number && val != null) {
+ val = +val; // convert to number
+ if (isNaN(val))
+ val = null;
+ else if (val == Infinity)
+ val = fakeInfinity;
+ else if (val == -Infinity)
+ val = -fakeInfinity;
+ }
+
+ if (val == null) {
+ if (f.required)
+ nullify = true;
+
+ if (f.defaultValue != null)
+ val = f.defaultValue;
+ }
+ }
+
+ points[k + m] = val;
+ }
+ }
+
+ if (nullify) {
+ for (m = 0; m < ps; ++m) {
+ val = points[k + m];
+ if (val != null) {
+ f = format[m];
+ // extract min/max info
+ if (f.x)
+ updateAxis(s.xaxis, val, val);
+ if (f.y)
+ updateAxis(s.yaxis, val, val);
+ }
+ points[k + m] = null;
+ }
+ }
+ else {
+ // a little bit of line specific stuff that
+ // perhaps shouldn't be here, but lacking
+ // better means...
+ if (insertSteps && k > 0
+ && points[k - ps] != null
+ && points[k - ps] != points[k]
+ && points[k - ps + 1] != points[k + 1]) {
+ // copy the point to make room for a middle point
+ for (m = 0; m < ps; ++m)
+ points[k + ps + m] = points[k + m];
+
+ // middle point has same y
+ points[k + 1] = points[k - ps + 1];
+
+ // we've added a point, better reflect that
+ k += ps;
+ }
+ }
+ }
+ }
+
+ // give the hooks a chance to run
+ for (i = 0; i < series.length; ++i) {
+ s = series[i];
+
+ executeHooks(hooks.processDatapoints, [ s, s.datapoints]);
+ }
+
+ // second pass: find datamax/datamin for auto-scaling
+ for (i = 0; i < series.length; ++i) {
+ s = series[i];
+ points = s.datapoints.points,
+ ps = s.datapoints.pointsize;
+
+ var xmin = topSentry, ymin = topSentry,
+ xmax = bottomSentry, ymax = bottomSentry;
+
+ for (j = 0; j < points.length; j += ps) {
+ if (points[j] == null)
+ continue;
+
+ for (m = 0; m < ps; ++m) {
+ val = points[j + m];
+ f = format[m];
+ if (!f || val == fakeInfinity || val == -fakeInfinity)
+ continue;
+
+ if (f.x) {
+ if (val < xmin)
+ xmin = val;
+ if (val > xmax)
+ xmax = val;
+ }
+ if (f.y) {
+ if (val < ymin)
+ ymin = val;
+ if (val > ymax)
+ ymax = val;
+ }
+ }
+ }
+
+ if (s.bars.show) {
+ // make sure we got room for the bar on the dancing floor
+ var delta = s.bars.align == "left" ? 0 : -s.bars.barWidth/2;
+ if (s.bars.horizontal) {
+ ymin += delta;
+ ymax += delta + s.bars.barWidth;
+ }
+ else {
+ xmin += delta;
+ xmax += delta + s.bars.barWidth;
+ }
+ }
+
+ updateAxis(s.xaxis, xmin, xmax);
+ updateAxis(s.yaxis, ymin, ymax);
+ }
+
+ $.each(allAxes(), function (_, axis) {
+ if (axis.datamin == topSentry)
+ axis.datamin = null;
+ if (axis.datamax == bottomSentry)
+ axis.datamax = null;
+ });
+ }
+
+ function makeCanvas(skipPositioning, cls) {
+ var c = document.createElement('canvas');
+ c.className = cls;
+ c.width = canvasWidth;
+ c.height = canvasHeight;
+
+ if (!skipPositioning)
+ $(c).css({ position: 'absolute', left: 0, top: 0 });
+
+ $(c).appendTo(placeholder);
+
+ if (!c.getContext) // excanvas hack
+ c = window.G_vmlCanvasManager.initElement(c);
+
+ // used for resetting in case we get replotted
+ c.getContext("2d").save();
+
+ return c;
+ }
+
+ function getCanvasDimensions() {
+ canvasWidth = placeholder.width();
+ canvasHeight = placeholder.height();
+
+ if (canvasWidth <= 0 || canvasHeight <= 0)
+ throw "Invalid dimensions for plot, width = " + canvasWidth + ", height = " + canvasHeight;
+ }
+
+ function resizeCanvas(c) {
+ // resizing should reset the state (excanvas seems to be
+ // buggy though)
+ if (c.width != canvasWidth)
+ c.width = canvasWidth;
+
+ if (c.height != canvasHeight)
+ c.height = canvasHeight;
+
+ // so try to get back to the initial state (even if it's
+ // gone now, this should be safe according to the spec)
+ var cctx = c.getContext("2d");
+ cctx.restore();
+
+ // and save again
+ cctx.save();
+ }
+
+ function setupCanvases() {
+ var reused,
+ existingCanvas = placeholder.children("canvas.base"),
+ existingOverlay = placeholder.children("canvas.overlay");
+
+ if (existingCanvas.length == 0 || existingOverlay == 0) {
+ // init everything
+
+ placeholder.html(""); // make sure placeholder is clear
+
+ placeholder.css({ padding: 0 }); // padding messes up the positioning
+
+ if (placeholder.css("position") == 'static')
+ placeholder.css("position", "relative"); // for positioning labels and overlay
+
+ getCanvasDimensions();
+
+ canvas = makeCanvas(true, "base");
+ overlay = makeCanvas(false, "overlay"); // overlay canvas for interactive features
+
+ reused = false;
+ }
+ else {
+ // reuse existing elements
+
+ canvas = existingCanvas.get(0);
+ overlay = existingOverlay.get(0);
+
+ reused = true;
+ }
+
+ ctx = canvas.getContext("2d");
+ octx = overlay.getContext("2d");
+
+ // we include the canvas in the event holder too, because IE 7
+ // sometimes has trouble with the stacking order
+ eventHolder = $([overlay, canvas]);
+
+ if (reused) {
+ // run shutdown in the old plot object
+ placeholder.data("plot").shutdown();
+
+ // reset reused canvases
+ plot.resize();
+
+ // make sure overlay pixels are cleared (canvas is cleared when we redraw)
+ octx.clearRect(0, 0, canvasWidth, canvasHeight);
+
+ // then whack any remaining obvious garbage left
+ eventHolder.unbind();
+ placeholder.children().not([canvas, overlay]).remove();
+ }
+
+ // save in case we get replotted
+ placeholder.data("plot", plot);
+ }
+
+ function bindEvents() {
+ // bind events
+ if (options.grid.hoverable) {
+ eventHolder.mousemove(onMouseMove);
+ eventHolder.mouseleave(onMouseLeave);
+ }
+
+ if (options.grid.clickable)
+ eventHolder.click(onClick);
+
+ executeHooks(hooks.bindEvents, [eventHolder]);
+ }
+
+ function shutdown() {
+ if (redrawTimeout)
+ clearTimeout(redrawTimeout);
+
+ eventHolder.unbind("mousemove", onMouseMove);
+ eventHolder.unbind("mouseleave", onMouseLeave);
+ eventHolder.unbind("click", onClick);
+
+ executeHooks(hooks.shutdown, [eventHolder]);
+ }
+
+ function setTransformationHelpers(axis) {
+ // set helper functions on the axis, assumes plot area
+ // has been computed already
+
+ function identity(x) { return x; }
+
+ var s, m, t = axis.options.transform || identity,
+ it = axis.options.inverseTransform;
+
+ // precompute how much the axis is scaling a point
+ // in canvas space
+ if (axis.direction == "x") {
+ s = axis.scale = plotWidth / Math.abs(t(axis.max) - t(axis.min));
+ m = Math.min(t(axis.max), t(axis.min));
+ }
+ else {
+ s = axis.scale = plotHeight / Math.abs(t(axis.max) - t(axis.min));
+ s = -s;
+ m = Math.max(t(axis.max), t(axis.min));
+ }
+
+ // data point to canvas coordinate
+ if (t == identity) // slight optimization
+ axis.p2c = function (p) { return (p - m) * s; };
+ else
+ axis.p2c = function (p) { return (t(p) - m) * s; };
+ // canvas coordinate to data point
+ if (!it)
+ axis.c2p = function (c) { return m + c / s; };
+ else
+ axis.c2p = function (c) { return it(m + c / s); };
+ }
+
+ function measureTickLabels(axis) {
+ var opts = axis.options, i, ticks = axis.ticks || [], labels = [],
+ l, w = opts.labelWidth, h = opts.labelHeight, dummyDiv;
+
+ function makeDummyDiv(labels, width) {
+ return $('<div style="position:absolute;top:-10000px;' + width + 'font-size:smaller">' +
+ '<div class="' + axis.direction + 'Axis ' + axis.direction + axis.n + 'Axis">'
+ + labels.join("") + '</div></div>')
+ .appendTo(placeholder);
+ }
+
+ if (axis.direction == "x") {
+ // to avoid measuring the widths of the labels (it's slow), we
+ // construct fixed-size boxes and put the labels inside
+ // them, we don't need the exact figures and the
+ // fixed-size box content is easy to center
+ if (w == null)
+ w = Math.floor(canvasWidth / (ticks.length > 0 ? ticks.length : 1));
+
+ // measure x label heights
+ if (h == null) {
+ labels = [];
+ for (i = 0; i < ticks.length; ++i) {
+ l = ticks[i].label;
+ if (l)
+ labels.push('<div class="tickLabel" style="float:left;width:' + w + 'px">' + l + '</div>');
+ }
+
+ if (labels.length > 0) {
+ // stick them all in the same div and measure
+ // collective height
+ labels.push('<div style="clear:left"></div>');
+ dummyDiv = makeDummyDiv(labels, "width:10000px;");
+ h = dummyDiv.height();
+ dummyDiv.remove();
+ }
+ }
+ }
+ else if (w == null || h == null) {
+ // calculate y label dimensions
+ for (i = 0; i < ticks.length; ++i) {
+ l = ticks[i].label;
+ if (l)
+ labels.push('<div class="tickLabel">' + l + '</div>');
+ }
+
+ if (labels.length > 0) {
+ dummyDiv = makeDummyDiv(labels, "");
+ if (w == null)
+ w = dummyDiv.children().width();
+ if (h == null)
+ h = dummyDiv.find("div.tickLabel").height();
+ dummyDiv.remove();
+ }
+ }
+
+ if (w == null)
+ w = 0;
+ if (h == null)
+ h = 0;
+
+ axis.labelWidth = w;
+ axis.labelHeight = h;
+ }
+
+ function allocateAxisBoxFirstPhase(axis) {
+ // find the bounding box of the axis by looking at label
+ // widths/heights and ticks, make room by diminishing the
+ // plotOffset
+
+ var lw = axis.labelWidth,
+ lh = axis.labelHeight,
+ pos = axis.options.position,
+ tickLength = axis.options.tickLength,
+ axismargin = options.grid.axisMargin,
+ padding = options.grid.labelMargin,
+ all = axis.direction == "x" ? xaxes : yaxes,
+ index;
+
+ // determine axis margin
+ var samePosition = $.grep(all, function (a) {
+ return a && a.options.position == pos && a.reserveSpace;
+ });
+ if ($.inArray(axis, samePosition) == samePosition.length - 1)
+ axismargin = 0; // outermost
+
+ // determine tick length - if we're innermost, we can use "full"
+ if (tickLength == null)
+ tickLength = "full";
+
+ var sameDirection = $.grep(all, function (a) {
+ return a && a.reserveSpace;
+ });
+
+ var innermost = $.inArray(axis, sameDirection) == 0;
+ if (!innermost && tickLength == "full")
+ tickLength = 5;
+
+ if (!isNaN(+tickLength))
+ padding += +tickLength;
+
+ // compute box
+ if (axis.direction == "x") {
+ lh += padding;
+
+ if (pos == "bottom") {
+ plotOffset.bottom += lh + axismargin;
+ axis.box = { top: canvasHeight - plotOffset.bottom, height: lh };
+ }
+ else {
+ axis.box = { top: plotOffset.top + axismargin, height: lh };
+ plotOffset.top += lh + axismargin;
+ }
+ }
+ else {
+ lw += padding;
+
+ if (pos == "left") {
+ axis.box = { left: plotOffset.left + axismargin, width: lw };
+ plotOffset.left += lw + axismargin;
+ }
+ else {
+ plotOffset.right += lw + axismargin;
+ axis.box = { left: canvasWidth - plotOffset.right, width: lw };
+ }
+ }
+
+ // save for future reference
+ axis.position = pos;
+ axis.tickLength = tickLength;
+ axis.box.padding = padding;
+ axis.innermost = innermost;
+ }
+
+ function allocateAxisBoxSecondPhase(axis) {
+ // set remaining bounding box coordinates
+ if (axis.direction == "x") {
+ axis.box.left = plotOffset.left;
+ axis.box.width = plotWidth;
+ }
+ else {
+ axis.box.top = plotOffset.top;
+ axis.box.height = plotHeight;
+ }
+ }
+
+ function setupGrid() {
+ var i, axes = allAxes();
+
+ // first calculate the plot and axis box dimensions
+
+ $.each(axes, function (_, axis) {
+ axis.show = axis.options.show;
+ if (axis.show == null)
+ axis.show = axis.used; // by default an axis is visible if it's got data
+
+ axis.reserveSpace = axis.show || axis.options.reserveSpace;
+
+ setRange(axis);
+ });
+
+ allocatedAxes = $.grep(axes, function (axis) { return axis.reserveSpace; });
+
+ plotOffset.left = plotOffset.right = plotOffset.top = plotOffset.bottom = 0;
+ if (options.grid.show) {
+ $.each(allocatedAxes, function (_, axis) {
+ // make the ticks
+ setupTickGeneration(axis);
+ setTicks(axis);
+ snapRangeToTicks(axis, axis.ticks);
+
+ // find labelWidth/Height for axis
+ measureTickLabels(axis);
+ });
+
+ // with all dimensions in house, we can compute the
+ // axis boxes, start from the outside (reverse order)
+ for (i = allocatedAxes.length - 1; i >= 0; --i)
+ allocateAxisBoxFirstPhase(allocatedAxes[i]);
+
+ // make sure we've got enough space for things that
+ // might stick out
+ var minMargin = options.grid.minBorderMargin;
+ if (minMargin == null) {
+ minMargin = 0;
+ for (i = 0; i < series.length; ++i)
+ minMargin = Math.max(minMargin, series[i].points.radius + series[i].points.lineWidth/2);
+ }
+
+ for (var a in plotOffset) {
+ plotOffset[a] += options.grid.borderWidth;
+ plotOffset[a] = Math.max(minMargin, plotOffset[a]);
+ }
+ }
+
+ plotWidth = canvasWidth - plotOffset.left - plotOffset.right;
+ plotHeight = canvasHeight - plotOffset.bottom - plotOffset.top;
+
+ // now we got the proper plotWidth/Height, we can compute the scaling
+ $.each(axes, function (_, axis) {
+ setTransformationHelpers(axis);
+ });
+
+ if (options.grid.show) {
+ $.each(allocatedAxes, function (_, axis) {
+ allocateAxisBoxSecondPhase(axis);
+ });
+
+ insertAxisLabels();
+ }
+
+ insertLegend();
+ }
+
+ function setRange(axis) {
+ var opts = axis.options,
+ min = +(opts.min != null ? opts.min : axis.datamin),
+ max = +(opts.max != null ? opts.max : axis.datamax),
+ delta = max - min;
+
+ if (delta == 0.0) {
+ // degenerate case
+ var widen = max == 0 ? 1 : 0.01;
+
+ if (opts.min == null)
+ min -= widen;
+ // always widen max if we couldn't widen min to ensure we
+ // don't fall into min == max which doesn't work
+ if (opts.max == null || opts.min != null)
+ max += widen;
+ }
+ else {
+ // consider autoscaling
+ var margin = opts.autoscaleMargin;
+ if (margin != null) {
+ if (opts.min == null) {
+ min -= delta * margin;
+ // make sure we don't go below zero if all values
+ // are positive
+ if (min < 0 && axis.datamin != null && axis.datamin >= 0)
+ min = 0;
+ }
+ if (opts.max == null) {
+ max += delta * margin;
+ if (max > 0 && axis.datamax != null && axis.datamax <= 0)
+ max = 0;
+ }
+ }
+ }
+ axis.min = min;
+ axis.max = max;
+ }
+
+ function setupTickGeneration(axis) {
+ var opts = axis.options;
+
+ // estimate number of ticks
+ var noTicks;
+ if (typeof opts.ticks == "number" && opts.ticks > 0)
+ noTicks = opts.ticks;
+ else
+ // heuristic based on the model a*sqrt(x) fitted to
+ // some data points that seemed reasonable
+ noTicks = 0.3 * Math.sqrt(axis.direction == "x" ? canvasWidth : canvasHeight);
+
+ var delta = (axis.max - axis.min) / noTicks,
+ size, generator, unit, formatter, i, magn, norm;
+
+ if (opts.mode == "time") {
+ // pretty handling of time
+
+ // map of app. size of time units in milliseconds
+ var timeUnitSize = {
+ "second": 1000,
+ "minute": 60 * 1000,
+ "hour": 60 * 60 * 1000,
+ "day": 24 * 60 * 60 * 1000,
+ "month": 30 * 24 * 60 * 60 * 1000,
+ "year": 365.2425 * 24 * 60 * 60 * 1000
+ };
+
+
+ // the allowed tick sizes, after 1 year we use
+ // an integer algorithm
+ var spec = [
+ [1, "second"], [2, "second"], [5, "second"], [10, "second"],
+ [30, "second"],
+ [1, "minute"], [2, "minute"], [5, "minute"], [10, "minute"],
+ [30, "minute"],
+ [1, "hour"], [2, "hour"], [4, "hour"],
+ [8, "hour"], [12, "hour"],
+ [1, "day"], [2, "day"], [3, "day"],
+ [0.25, "month"], [0.5, "month"], [1, "month"],
+ [2, "month"], [3, "month"], [6, "month"],
+ [1, "year"]
+ ];
+
+ var minSize = 0;
+ if (opts.minTickSize != null) {
+ if (typeof opts.tickSize == "number")
+ minSize = opts.tickSize;
+ else
+ minSize = opts.minTickSize[0] * timeUnitSize[opts.minTickSize[1]];
+ }
+
+ for (var i = 0; i < spec.length - 1; ++i)
+ if (delta < (spec[i][0] * timeUnitSize[spec[i][1]]
+ + spec[i + 1][0] * timeUnitSize[spec[i + 1][1]]) / 2
+ && spec[i][0] * timeUnitSize[spec[i][1]] >= minSize)
+ break;
+ size = spec[i][0];
+ unit = spec[i][1];
+
+ // special-case the possibility of several years
+ if (unit == "year") {
+ magn = Math.pow(10, Math.floor(Math.log(delta / timeUnitSize.year) / Math.LN10));
+ norm = (delta / timeUnitSize.year) / magn;
+ if (norm < 1.5)
+ size = 1;
+ else if (norm < 3)
+ size = 2;
+ else if (norm < 7.5)
+ size = 5;
+ else
+ size = 10;
+
+ size *= magn;
+ }
+
+ axis.tickSize = opts.tickSize || [size, unit];
+
+ generator = function(axis) {
+ var ticks = [],
+ tickSize = axis.tickSize[0], unit = axis.tickSize[1],
+ d = new Date(axis.min);
+
+ var step = tickSize * timeUnitSize[unit];
+
+ if (unit == "second")
+ d.setUTCSeconds(floorInBase(d.getUTCSeconds(), tickSize));
+ if (unit == "minute")
+ d.setUTCMinutes(floorInBase(d.getUTCMinutes(), tickSize));
+ if (unit == "hour")
+ d.setUTCHours(floorInBase(d.getUTCHours(), tickSize));
+ if (unit == "month")
+ d.setUTCMonth(floorInBase(d.getUTCMonth(), tickSize));
+ if (unit == "year")
+ d.setUTCFullYear(floorInBase(d.getUTCFullYear(), tickSize));
+
+ // reset smaller components
+ d.setUTCMilliseconds(0);
+ if (step >= timeUnitSize.minute)
+ d.setUTCSeconds(0);
+ if (step >= timeUnitSize.hour)
+ d.setUTCMinutes(0);
+ if (step >= timeUnitSize.day)
+ d.setUTCHours(0);
+ if (step >= timeUnitSize.day * 4)
+ d.setUTCDate(1);
+ if (step >= timeUnitSize.year)
+ d.setUTCMonth(0);
+
+
+ var carry = 0, v = Number.NaN, prev;
+ do {
+ prev = v;
+ v = d.getTime();
+ ticks.push(v);
+ if (unit == "month") {
+ if (tickSize < 1) {
+ // a bit complicated - we'll divide the month
+ // up but we need to take care of fractions
+ // so we don't end up in the middle of a day
+ d.setUTCDate(1);
+ var start = d.getTime();
+ d.setUTCMonth(d.getUTCMonth() + 1);
+ var end = d.getTime();
+ d.setTime(v + carry * timeUnitSize.hour + (end - start) * tickSize);
+ carry = d.getUTCHours();
+ d.setUTCHours(0);
+ }
+ else
+ d.setUTCMonth(d.getUTCMonth() + tickSize);
+ }
+ else if (unit == "year") {
+ d.setUTCFullYear(d.getUTCFullYear() + tickSize);
+ }
+ else
+ d.setTime(v + step);
+ } while (v < axis.max && v != prev);
+
+ return ticks;
+ };
+
+ formatter = function (v, axis) {
+ var d = new Date(v);
+
+ // first check global format
+ if (opts.timeformat != null)
+ return $.plot.formatDate(d, opts.timeformat, opts.monthNames);
+
+ var t = axis.tickSize[0] * timeUnitSize[axis.tickSize[1]];
+ var span = axis.max - axis.min;
+ var suffix = (opts.twelveHourClock) ? " %p" : "";
+
+ if (t < timeUnitSize.minute)
+ fmt = "%h:%M:%S" + suffix;
+ else if (t < timeUnitSize.day) {
+ if (span < 2 * timeUnitSize.day)
+ fmt = "%h:%M" + suffix;
+ else
+ fmt = "%b %d %h:%M" + suffix;
+ }
+ else if (t < timeUnitSize.month)
+ fmt = "%b %d";
+ else if (t < timeUnitSize.year) {
+ if (span < timeUnitSize.year)
+ fmt = "%b";
+ else
+ fmt = "%b %y";
+ }
+ else
+ fmt = "%y";
+
+ return $.plot.formatDate(d, fmt, opts.monthNames);
+ };
+ }
+ else {
+ // pretty rounding of base-10 numbers
+ var maxDec = opts.tickDecimals;
+ var dec = -Math.floor(Math.log(delta) / Math.LN10);
+ if (maxDec != null && dec > maxDec)
+ dec = maxDec;
+
+ magn = Math.pow(10, -dec);
+ norm = delta / magn; // norm is between 1.0 and 10.0
+
+ if (norm < 1.5)
+ size = 1;
+ else if (norm < 3) {
+ size = 2;
+ // special case for 2.5, requires an extra decimal
+ if (norm > 2.25 && (maxDec == null || dec + 1 <= maxDec)) {
+ size = 2.5;
+ ++dec;
+ }
+ }
+ else if (norm < 7.5)
+ size = 5;
+ else
+ size = 10;
+
+ size *= magn;
+
+ if (opts.minTickSize != null && size < opts.minTickSize)
+ size = opts.minTickSize;
+
+ axis.tickDecimals = Math.max(0, maxDec != null ? maxDec : dec);
+ axis.tickSize = opts.tickSize || size;
+
+ generator = function (axis) {
+ var ticks = [];
+
+ // spew out all possible ticks
+ var start = floorInBase(axis.min, axis.tickSize),
+ i = 0, v = Number.NaN, prev;
+ do {
+ prev = v;
+ v = start + i * axis.tickSize;
+ ticks.push(v);
+ ++i;
+ } while (v < axis.max && v != prev);
+ return ticks;
+ };
+
+ formatter = function (v, axis) {
+ return v.toFixed(axis.tickDecimals);
+ };
+ }
+
+ if (opts.alignTicksWithAxis != null) {
+ var otherAxis = (axis.direction == "x" ? xaxes : yaxes)[opts.alignTicksWithAxis - 1];
+ if (otherAxis && otherAxis.used && otherAxis != axis) {
+ // consider snapping min/max to outermost nice ticks
+ var niceTicks = generator(axis);
+ if (niceTicks.length > 0) {
+ if (opts.min == null)
+ axis.min = Math.min(axis.min, niceTicks[0]);
+ if (opts.max == null && niceTicks.length > 1)
+ axis.max = Math.max(axis.max, niceTicks[niceTicks.length - 1]);
+ }
+
+ generator = function (axis) {
+ // copy ticks, scaled to this axis
+ var ticks = [], v, i;
+ for (i = 0; i < otherAxis.ticks.length; ++i) {
+ v = (otherAxis.ticks[i].v - otherAxis.min) / (otherAxis.max - otherAxis.min);
+ v = axis.min + v * (axis.max - axis.min);
+ ticks.push(v);
+ }
+ return ticks;
+ };
+
+ // we might need an extra decimal since forced
+ // ticks don't necessarily fit naturally
+ if (axis.mode != "time" && opts.tickDecimals == null) {
+ var extraDec = Math.max(0, -Math.floor(Math.log(delta) / Math.LN10) + 1),
+ ts = generator(axis);
+
+ // only proceed if the tick interval rounded
+ // with an extra decimal doesn't give us a
+ // zero at end
+ if (!(ts.length > 1 && /\..*0$/.test((ts[1] - ts[0]).toFixed(extraDec))))
+ axis.tickDecimals = extraDec;
+ }
+ }
+ }
+
+ axis.tickGenerator = generator;
+ if ($.isFunction(opts.tickFormatter))
+ axis.tickFormatter = function (v, axis) { return "" + opts.tickFormatter(v, axis); };
+ else
+ axis.tickFormatter = formatter;
+ }
+
+ function setTicks(axis) {
+ var oticks = axis.options.ticks, ticks = [];
+ if (oticks == null || (typeof oticks == "number" && oticks > 0))
+ ticks = axis.tickGenerator(axis);
+ else if (oticks) {
+ if ($.isFunction(oticks))
+ // generate the ticks
+ ticks = oticks({ min: axis.min, max: axis.max });
+ else
+ ticks = oticks;
+ }
+
+ // clean up/labelify the supplied ticks, copy them over
+ var i, v;
+ axis.ticks = [];
+ for (i = 0; i < ticks.length; ++i) {
+ var label = null;
+ var t = ticks[i];
+ if (typeof t == "object") {
+ v = +t[0];
+ if (t.length > 1)
+ label = t[1];
+ }
+ else
+ v = +t;
+ if (label == null)
+ label = axis.tickFormatter(v, axis);
+ if (!isNaN(v))
+ axis.ticks.push({ v: v, label: label });
+ }
+ }
+
+ function snapRangeToTicks(axis, ticks) {
+ if (axis.options.autoscaleMargin && ticks.length > 0) {
+ // snap to ticks
+ if (axis.options.min == null)
+ axis.min = Math.min(axis.min, ticks[0].v);
+ if (axis.options.max == null && ticks.length > 1)
+ axis.max = Math.max(axis.max, ticks[ticks.length - 1].v);
+ }
+ }
+
+ function draw() {
+ ctx.clearRect(0, 0, canvasWidth, canvasHeight);
+
+ var grid = options.grid;
+
+ // draw background, if any
+ if (grid.show && grid.backgroundColor)
+ drawBackground();
+
+ if (grid.show && !grid.aboveData)
+ drawGrid();
+
+ for (var i = 0; i < series.length; ++i) {
+ executeHooks(hooks.drawSeries, [ctx, series[i]]);
+ drawSeries(series[i]);
+ }
+
+ executeHooks(hooks.draw, [ctx]);
+
+ if (grid.show && grid.aboveData)
+ drawGrid();
+ }
+
+ function extractRange(ranges, coord) {
+ var axis, from, to, key, axes = allAxes();
+
+ for (i = 0; i < axes.length; ++i) {
+ axis = axes[i];
+ if (axis.direction == coord) {
+ key = coord + axis.n + "axis";
+ if (!ranges[key] && axis.n == 1)
+ key = coord + "axis"; // support x1axis as xaxis
+ if (ranges[key]) {
+ from = ranges[key].from;
+ to = ranges[key].to;
+ break;
+ }
+ }
+ }
+
+ // backwards-compat stuff - to be removed in future
+ if (!ranges[key]) {
+ axis = coord == "x" ? xaxes[0] : yaxes[0];
+ from = ranges[coord + "1"];
+ to = ranges[coord + "2"];
+ }
+
+ // auto-reverse as an added bonus
+ if (from != null && to != null && from > to) {
+ var tmp = from;
+ from = to;
+ to = tmp;
+ }
+
+ return { from: from, to: to, axis: axis };
+ }
+
+ function drawBackground() {
+ ctx.save();
+ ctx.translate(plotOffset.left, plotOffset.top);
+
+ ctx.fillStyle = getColorOrGradient(options.grid.backgroundColor, plotHeight, 0, "rgba(255, 255, 255, 0)");
+ ctx.fillRect(0, 0, plotWidth, plotHeight);
+ ctx.restore();
+ }
+
+ function drawGrid() {
+ var i;
+
+ ctx.save();
+ ctx.translate(plotOffset.left, plotOffset.top);
+
+ // draw markings
+ var markings = options.grid.markings;
+ if (markings) {
+ if ($.isFunction(markings)) {
+ var axes = plot.getAxes();
+ // xmin etc. is backwards compatibility, to be
+ // removed in the future
+ axes.xmin = axes.xaxis.min;
+ axes.xmax = axes.xaxis.max;
+ axes.ymin = axes.yaxis.min;
+ axes.ymax = axes.yaxis.max;
+
+ markings = markings(axes);
+ }
+
+ for (i = 0; i < markings.length; ++i) {
+ var m = markings[i],
+ xrange = extractRange(m, "x"),
+ yrange = extractRange(m, "y");
+
+ // fill in missing
+ if (xrange.from == null)
+ xrange.from = xrange.axis.min;
+ if (xrange.to == null)
+ xrange.to = xrange.axis.max;
+ if (yrange.from == null)
+ yrange.from = yrange.axis.min;
+ if (yrange.to == null)
+ yrange.to = yrange.axis.max;
+
+ // clip
+ if (xrange.to < xrange.axis.min || xrange.from > xrange.axis.max ||
+ yrange.to < yrange.axis.min || yrange.from > yrange.axis.max)
+ continue;
+
+ xrange.from = Math.max(xrange.from, xrange.axis.min);
+ xrange.to = Math.min(xrange.to, xrange.axis.max);
+ yrange.from = Math.max(yrange.from, yrange.axis.min);
+ yrange.to = Math.min(yrange.to, yrange.axis.max);
+
+ if (xrange.from == xrange.to && yrange.from == yrange.to)
+ continue;
+
+ // then draw
+ xrange.from = xrange.axis.p2c(xrange.from);
+ xrange.to = xrange.axis.p2c(xrange.to);
+ yrange.from = yrange.axis.p2c(yrange.from);
+ yrange.to = yrange.axis.p2c(yrange.to);
+
+ if (xrange.from == xrange.to || yrange.from == yrange.to) {
+ // draw line
+ ctx.beginPath();
+ ctx.strokeStyle = m.color || options.grid.markingsColor;
+ ctx.lineWidth = m.lineWidth || options.grid.markingsLineWidth;
+ ctx.moveTo(xrange.from, yrange.from);
+ ctx.lineTo(xrange.to, yrange.to);
+ ctx.stroke();
+ }
+ else {
+ // fill area
+ ctx.fillStyle = m.color || options.grid.markingsColor;
+ ctx.fillRect(xrange.from, yrange.to,
+ xrange.to - xrange.from,
+ yrange.from - yrange.to);
+ }
+ }
+ }
+
+ // draw the ticks
+ var axes = allAxes(), bw = options.grid.borderWidth;
+
+ for (var j = 0; j < axes.length; ++j) {
+ var axis = axes[j], box = axis.box,
+ t = axis.tickLength, x, y, xoff, yoff;
+ if (!axis.show || axis.ticks.length == 0)
+ continue
+
+ ctx.strokeStyle = axis.options.tickColor || $.color.parse(axis.options.color).scale('a', 0.22).toString();
+ ctx.lineWidth = 1;
+
+ // find the edges
+ if (axis.direction == "x") {
+ x = 0;
+ if (t == "full")
+ y = (axis.position == "top" ? 0 : plotHeight);
+ else
+ y = box.top - plotOffset.top + (axis.position == "top" ? box.height : 0);
+ }
+ else {
+ y = 0;
+ if (t == "full")
+ x = (axis.position == "left" ? 0 : plotWidth);
+ else
+ x = box.left - plotOffset.left + (axis.position == "left" ? box.width : 0);
+ }
+
+ // draw tick bar
+ if (!axis.innermost) {
+ ctx.beginPath();
+ xoff = yoff = 0;
+ if (axis.direction == "x")
+ xoff = plotWidth;
+ else
+ yoff = plotHeight;
+
+ if (ctx.lineWidth == 1) {
+ x = Math.floor(x) + 0.5;
+ y = Math.floor(y) + 0.5;
+ }
+
+ ctx.moveTo(x, y);
+ ctx.lineTo(x + xoff, y + yoff);
+ ctx.stroke();
+ }
+
+ // draw ticks
+ ctx.beginPath();
+ for (i = 0; i < axis.ticks.length; ++i) {
+ var v = axis.ticks[i].v;
+
+ xoff = yoff = 0;
+
+ if (v < axis.min || v > axis.max
+ // skip those lying on the axes if we got a border
+ || (t == "full" && bw > 0
+ && (v == axis.min || v == axis.max)))
+ continue;
+
+ if (axis.direction == "x") {
+ x = axis.p2c(v);
+ yoff = t == "full" ? -plotHeight : t;
+
+ if (axis.position == "top")
+ yoff = -yoff;
+ }
+ else {
+ y = axis.p2c(v);
+ xoff = t == "full" ? -plotWidth : t;
+
+ if (axis.position == "left")
+ xoff = -xoff;
+ }
+
+ if (ctx.lineWidth == 1) {
+ if (axis.direction == "x")
+ x = Math.floor(x) + 0.5;
+ else
+ y = Math.floor(y) + 0.5;
+ }
+
+ ctx.moveTo(x, y);
+ ctx.lineTo(x + xoff, y + yoff);
+ }
+
+ ctx.stroke();
+ }
+
+
+ // draw border
+ if (bw) {
+ ctx.lineWidth = bw;
+ ctx.strokeStyle = options.grid.borderColor;
+ ctx.strokeRect(-bw/2, -bw/2, plotWidth + bw, plotHeight + bw);
+ }
+
+ ctx.restore();
+ }
+
+ function insertAxisLabels() {
+ placeholder.find(".tickLabels").remove();
+
+ var html = ['<div class="tickLabels" style="font-size:smaller">'];
+
+ var axes = allAxes();
+ for (var j = 0; j < axes.length; ++j) {
+ var axis = axes[j], box = axis.box;
+ if (!axis.show)
+ continue;
+ //debug: html.push('<div style="position:absolute;opacity:0.10;background-color:red;left:' + box.left + 'px;top:' + box.top + 'px;width:' + box.width + 'px;height:' + box.height + 'px"></div>')
+ html.push('<div class="' + axis.direction + 'Axis ' + axis.direction + axis.n + 'Axis" style="color:' + axis.options.color + '">');
+ for (var i = 0; i < axis.ticks.length; ++i) {
+ var tick = axis.ticks[i];
+ if (!tick.label || tick.v < axis.min || tick.v > axis.max)
+ continue;
+
+ var pos = {}, align;
+
+ if (axis.direction == "x") {
+ align = "center";
+ pos.left = Math.round(plotOffset.left + axis.p2c(tick.v) - axis.labelWidth/2);
+ if (axis.position == "bottom")
+ pos.top = box.top + box.padding;
+ else
+ pos.bottom = canvasHeight - (box.top + box.height - box.padding);
+ }
+ else {
+ pos.top = Math.round(plotOffset.top + axis.p2c(tick.v) - axis.labelHeight/2);
+ if (axis.position == "left") {
+ pos.right = canvasWidth - (box.left + box.width - box.padding)
+ align = "right";
+ }
+ else {
+ pos.left = box.left + box.padding;
+ align = "left";
+ }
+ }
+
+ pos.width = axis.labelWidth;
+
+ var style = ["position:absolute", "text-align:" + align ];
+ for (var a in pos)
+ style.push(a + ":" + pos[a] + "px")
+
+ html.push('<div class="tickLabel" style="' + style.join(';') + '">' + tick.label + '</div>');
+ }
+ html.push('</div>');
+ }
+
+ html.push('</div>');
+
+ placeholder.append(html.join(""));
+ }
+
+ function drawSeries(series) {
+ if (series.lines.show)
+ drawSeriesLines(series);
+ if (series.bars.show)
+ drawSeriesBars(series);
+ if (series.points.show)
+ drawSeriesPoints(series);
+ }
+
+ function drawSeriesLines(series) {
+ function plotLine(datapoints, xoffset, yoffset, axisx, axisy) {
+ var points = datapoints.points,
+ ps = datapoints.pointsize,
+ prevx = null, prevy = null;
+
+ ctx.beginPath();
+ for (var i = ps; i < points.length; i += ps) {
+ var x1 = points[i - ps], y1 = points[i - ps + 1],
+ x2 = points[i], y2 = points[i + 1];
+
+ if (x1 == null || x2 == null)
+ continue;
+
+ // clip with ymin
+ if (y1 <= y2 && y1 < axisy.min) {
+ if (y2 < axisy.min)
+ continue; // line segment is outside
+ // compute new intersection point
+ x1 = (axisy.min - y1) / (y2 - y1) * (x2 - x1) + x1;
+ y1 = axisy.min;
+ }
+ else if (y2 <= y1 && y2 < axisy.min) {
+ if (y1 < axisy.min)
+ continue;
+ x2 = (axisy.min - y1) / (y2 - y1) * (x2 - x1) + x1;
+ y2 = axisy.min;
+ }
+
+ // clip with ymax
+ if (y1 >= y2 && y1 > axisy.max) {
+ if (y2 > axisy.max)
+ continue;
+ x1 = (axisy.max - y1) / (y2 - y1) * (x2 - x1) + x1;
+ y1 = axisy.max;
+ }
+ else if (y2 >= y1 && y2 > axisy.max) {
+ if (y1 > axisy.max)
+ continue;
+ x2 = (axisy.max - y1) / (y2 - y1) * (x2 - x1) + x1;
+ y2 = axisy.max;
+ }
+
+ // clip with xmin
+ if (x1 <= x2 && x1 < axisx.min) {
+ if (x2 < axisx.min)
+ continue;
+ y1 = (axisx.min - x1) / (x2 - x1) * (y2 - y1) + y1;
+ x1 = axisx.min;
+ }
+ else if (x2 <= x1 && x2 < axisx.min) {
+ if (x1 < axisx.min)
+ continue;
+ y2 = (axisx.min - x1) / (x2 - x1) * (y2 - y1) + y1;
+ x2 = axisx.min;
+ }
+
+ // clip with xmax
+ if (x1 >= x2 && x1 > axisx.max) {
+ if (x2 > axisx.max)
+ continue;
+ y1 = (axisx.max - x1) / (x2 - x1) * (y2 - y1) + y1;
+ x1 = axisx.max;
+ }
+ else if (x2 >= x1 && x2 > axisx.max) {
+ if (x1 > axisx.max)
+ continue;
+ y2 = (axisx.max - x1) / (x2 - x1) * (y2 - y1) + y1;
+ x2 = axisx.max;
+ }
+
+ if (x1 != prevx || y1 != prevy)
+ ctx.moveTo(axisx.p2c(x1) + xoffset, axisy.p2c(y1) + yoffset);
+
+ prevx = x2;
+ prevy = y2;
+ ctx.lineTo(axisx.p2c(x2) + xoffset, axisy.p2c(y2) + yoffset);
+ }
+ ctx.stroke();
+ }
+
+ function plotLineArea(datapoints, axisx, axisy) {
+ var points = datapoints.points,
+ ps = datapoints.pointsize,
+ bottom = Math.min(Math.max(0, axisy.min), axisy.max),
+ i = 0, top, areaOpen = false,
+ ypos = 1, segmentStart = 0, segmentEnd = 0;
+
+ // we process each segment in two turns, first forward
+ // direction to sketch out top, then once we hit the
+ // end we go backwards to sketch the bottom
+ while (true) {
+ if (ps > 0 && i > points.length + ps)
+ break;
+
+ i += ps; // ps is negative if going backwards
+
+ var x1 = points[i - ps],
+ y1 = points[i - ps + ypos],
+ x2 = points[i], y2 = points[i + ypos];
+
+ if (areaOpen) {
+ if (ps > 0 && x1 != null && x2 == null) {
+ // at turning point
+ segmentEnd = i;
+ ps = -ps;
+ ypos = 2;
+ continue;
+ }
+
+ if (ps < 0 && i == segmentStart + ps) {
+ // done with the reverse sweep
+ ctx.fill();
+ areaOpen = false;
+ ps = -ps;
+ ypos = 1;
+ i = segmentStart = segmentEnd + ps;
+ continue;
+ }
+ }
+
+ if (x1 == null || x2 == null)
+ continue;
+
+ // clip x values
+
+ // clip with xmin
+ if (x1 <= x2 && x1 < axisx.min) {
+ if (x2 < axisx.min)
+ continue;
+ y1 = (axisx.min - x1) / (x2 - x1) * (y2 - y1) + y1;
+ x1 = axisx.min;
+ }
+ else if (x2 <= x1 && x2 < axisx.min) {
+ if (x1 < axisx.min)
+ continue;
+ y2 = (axisx.min - x1) / (x2 - x1) * (y2 - y1) + y1;
+ x2 = axisx.min;
+ }
+
+ // clip with xmax
+ if (x1 >= x2 && x1 > axisx.max) {
+ if (x2 > axisx.max)
+ continue;
+ y1 = (axisx.max - x1) / (x2 - x1) * (y2 - y1) + y1;
+ x1 = axisx.max;
+ }
+ else if (x2 >= x1 && x2 > axisx.max) {
+ if (x1 > axisx.max)
+ continue;
+ y2 = (axisx.max - x1) / (x2 - x1) * (y2 - y1) + y1;
+ x2 = axisx.max;
+ }
+
+ if (!areaOpen) {
+ // open area
+ ctx.beginPath();
+ ctx.moveTo(axisx.p2c(x1), axisy.p2c(bottom));
+ areaOpen = true;
+ }
+
+ // now first check the case where both is outside
+ if (y1 >= axisy.max && y2 >= axisy.max) {
+ ctx.lineTo(axisx.p2c(x1), axisy.p2c(axisy.max));
+ ctx.lineTo(axisx.p2c(x2), axisy.p2c(axisy.max));
+ continue;
+ }
+ else if (y1 <= axisy.min && y2 <= axisy.min) {
+ ctx.lineTo(axisx.p2c(x1), axisy.p2c(axisy.min));
+ ctx.lineTo(axisx.p2c(x2), axisy.p2c(axisy.min));
+ continue;
+ }
+
+ // else it's a bit more complicated, there might
+ // be a flat maxed out rectangle first, then a
+ // triangular cutout or reverse; to find these
+ // keep track of the current x values
+ var x1old = x1, x2old = x2;
+
+ // clip the y values, without shortcutting, we
+ // go through all cases in turn
+
+ // clip with ymin
+ if (y1 <= y2 && y1 < axisy.min && y2 >= axisy.min) {
+ x1 = (axisy.min - y1) / (y2 - y1) * (x2 - x1) + x1;
+ y1 = axisy.min;
+ }
+ else if (y2 <= y1 && y2 < axisy.min && y1 >= axisy.min) {
+ x2 = (axisy.min - y1) / (y2 - y1) * (x2 - x1) + x1;
+ y2 = axisy.min;
+ }
+
+ // clip with ymax
+ if (y1 >= y2 && y1 > axisy.max && y2 <= axisy.max) {
+ x1 = (axisy.max - y1) / (y2 - y1) * (x2 - x1) + x1;
+ y1 = axisy.max;
+ }
+ else if (y2 >= y1 && y2 > axisy.max && y1 <= axisy.max) {
+ x2 = (axisy.max - y1) / (y2 - y1) * (x2 - x1) + x1;
+ y2 = axisy.max;
+ }
+
+ // if the x value was changed we got a rectangle
+ // to fill
+ if (x1 != x1old) {
+ ctx.lineTo(axisx.p2c(x1old), axisy.p2c(y1));
+ // it goes to (x1, y1), but we fill that below
+ }
+
+ // fill triangular section, this sometimes result
+ // in redundant points if (x1, y1) hasn't changed
+ // from previous line to, but we just ignore that
+ ctx.lineTo(axisx.p2c(x1), axisy.p2c(y1));
+ ctx.lineTo(axisx.p2c(x2), axisy.p2c(y2));
+
+ // fill the other rectangle if it's there
+ if (x2 != x2old) {
+ ctx.lineTo(axisx.p2c(x2), axisy.p2c(y2));
+ ctx.lineTo(axisx.p2c(x2old), axisy.p2c(y2));
+ }
+ }
+ }
+
+ ctx.save();
+ ctx.translate(plotOffset.left, plotOffset.top);
+ ctx.lineJoin = "round";
+
+ var lw = series.lines.lineWidth,
+ sw = series.shadowSize;
+ // FIXME: consider another form of shadow when filling is turned on
+ if (lw > 0 && sw > 0) {
+ // draw shadow as a thick and thin line with transparency
+ ctx.lineWidth = sw;
+ ctx.strokeStyle = "rgba(0,0,0,0.1)";
+ // position shadow at angle from the mid of line
+ var angle = Math.PI/18;
+ plotLine(series.datapoints, Math.sin(angle) * (lw/2 + sw/2), Math.cos(angle) * (lw/2 + sw/2), series.xaxis, series.yaxis);
+ ctx.lineWidth = sw/2;
+ plotLine(series.datapoints, Math.sin(angle) * (lw/2 + sw/4), Math.cos(angle) * (lw/2 + sw/4), series.xaxis, series.yaxis);
+ }
+
+ ctx.lineWidth = lw;
+ ctx.strokeStyle = series.color;
+ var fillStyle = getFillStyle(series.lines, series.color, 0, plotHeight);
+ if (fillStyle) {
+ ctx.fillStyle = fillStyle;
+ plotLineArea(series.datapoints, series.xaxis, series.yaxis);
+ }
+
+ if (lw > 0)
+ plotLine(series.datapoints, 0, 0, series.xaxis, series.yaxis);
+ ctx.restore();
+ }
+
+ function drawSeriesPoints(series) {
+ function plotPoints(datapoints, radius, fillStyle, offset, shadow, axisx, axisy, symbol) {
+ var points = datapoints.points, ps = datapoints.pointsize;
+
+ for (var i = 0; i < points.length; i += ps) {
+ var x = points[i], y = points[i + 1];
+ if (x == null || x < axisx.min || x > axisx.max || y < axisy.min || y > axisy.max)
+ continue;
+
+ ctx.beginPath();
+ x = axisx.p2c(x);
+ y = axisy.p2c(y) + offset;
+ if (symbol == "circle")
+ ctx.arc(x, y, radius, 0, shadow ? Math.PI : Math.PI * 2, false);
+ else
+ symbol(ctx, x, y, radius, shadow);
+ ctx.closePath();
+
+ if (fillStyle) {
+ ctx.fillStyle = fillStyle;
+ ctx.fill();
+ }
+ ctx.stroke();
+ }
+ }
+
+ ctx.save();
+ ctx.translate(plotOffset.left, plotOffset.top);
+
+ var lw = series.points.lineWidth,
+ sw = series.shadowSize,
+ radius = series.points.radius,
+ symbol = series.points.symbol;
+ if (lw > 0 && sw > 0) {
+ // draw shadow in two steps
+ var w = sw / 2;
+ ctx.lineWidth = w;
+ ctx.strokeStyle = "rgba(0,0,0,0.1)";
+ plotPoints(series.datapoints, radius, null, w + w/2, true,
+ series.xaxis, series.yaxis, symbol);
+
+ ctx.strokeStyle = "rgba(0,0,0,0.2)";
+ plotPoints(series.datapoints, radius, null, w/2, true,
+ series.xaxis, series.yaxis, symbol);
+ }
+
+ ctx.lineWidth = lw;
+ ctx.strokeStyle = series.color;
+ plotPoints(series.datapoints, radius,
+ getFillStyle(series.points, series.color), 0, false,
+ series.xaxis, series.yaxis, symbol);
+ ctx.restore();
+ }
+
+ function drawBar(x, y, b, barLeft, barRight, offset, fillStyleCallback, axisx, axisy, c, horizontal, lineWidth) {
+ var left, right, bottom, top,
+ drawLeft, drawRight, drawTop, drawBottom,
+ tmp;
+
+ // in horizontal mode, we start the bar from the left
+ // instead of from the bottom so it appears to be
+ // horizontal rather than vertical
+ if (horizontal) {
+ drawBottom = drawRight = drawTop = true;
+ drawLeft = false;
+ left = b;
+ right = x;
+ top = y + barLeft;
+ bottom = y + barRight;
+
+ // account for negative bars
+ if (right < left) {
+ tmp = right;
+ right = left;
+ left = tmp;
+ drawLeft = true;
+ drawRight = false;
+ }
+ }
+ else {
+ drawLeft = drawRight = drawTop = true;
+ drawBottom = false;
+ left = x + barLeft;
+ right = x + barRight;
+ bottom = b;
+ top = y;
+
+ // account for negative bars
+ if (top < bottom) {
+ tmp = top;
+ top = bottom;
+ bottom = tmp;
+ drawBottom = true;
+ drawTop = false;
+ }
+ }
+
+ // clip
+ if (right < axisx.min || left > axisx.max ||
+ top < axisy.min || bottom > axisy.max)
+ return;
+
+ if (left < axisx.min) {
+ left = axisx.min;
+ drawLeft = false;
+ }
+
+ if (right > axisx.max) {
+ right = axisx.max;
+ drawRight = false;
+ }
+
+ if (bottom < axisy.min) {
+ bottom = axisy.min;
+ drawBottom = false;
+ }
+
+ if (top > axisy.max) {
+ top = axisy.max;
+ drawTop = false;
+ }
+
+ left = axisx.p2c(left);
+ bottom = axisy.p2c(bottom);
+ right = axisx.p2c(right);
+ top = axisy.p2c(top);
+
+ // fill the bar
+ if (fillStyleCallback) {
+ c.beginPath();
+ c.moveTo(left, bottom);
+ c.lineTo(left, top);
+ c.lineTo(right, top);
+ c.lineTo(right, bottom);
+ c.fillStyle = fillStyleCallback(bottom, top);
+ c.fill();
+ }
+
+ // draw outline
+ if (lineWidth > 0 && (drawLeft || drawRight || drawTop || drawBottom)) {
+ c.beginPath();
+
+ // FIXME: inline moveTo is buggy with excanvas
+ c.moveTo(left, bottom + offset);
+ if (drawLeft)
+ c.lineTo(left, top + offset);
+ else
+ c.moveTo(left, top + offset);
+ if (drawTop)
+ c.lineTo(right, top + offset);
+ else
+ c.moveTo(right, top + offset);
+ if (drawRight)
+ c.lineTo(right, bottom + offset);
+ else
+ c.moveTo(right, bottom + offset);
+ if (drawBottom)
+ c.lineTo(left, bottom + offset);
+ else
+ c.moveTo(left, bottom + offset);
+ c.stroke();
+ }
+ }
+
+ function drawSeriesBars(series) {
+ function plotBars(datapoints, barLeft, barRight, offset, fillStyleCallback, axisx, axisy) {
+ var points = datapoints.points, ps = datapoints.pointsize;
+
+ for (var i = 0; i < points.length; i += ps) {
+ if (points[i] == null)
+ continue;
+ drawBar(points[i], points[i + 1], points[i + 2], barLeft, barRight, offset, fillStyleCallback, axisx, axisy, ctx, series.bars.horizontal, series.bars.lineWidth);
+ }
+ }
+
+ ctx.save();
+ ctx.translate(plotOffset.left, plotOffset.top);
+
+ // FIXME: figure out a way to add shadows (for instance along the right edge)
+ ctx.lineWidth = series.bars.lineWidth;
+ ctx.strokeStyle = series.color;
+ var barLeft = series.bars.align == "left" ? 0 : -series.bars.barWidth/2;
+ var fillStyleCallback = series.bars.fill ? function (bottom, top) { return getFillStyle(series.bars, series.color, bottom, top); } : null;
+ plotBars(series.datapoints, barLeft, barLeft + series.bars.barWidth, 0, fillStyleCallback, series.xaxis, series.yaxis);
+ ctx.restore();
+ }
+
+ function getFillStyle(filloptions, seriesColor, bottom, top) {
+ var fill = filloptions.fill;
+ if (!fill)
+ return null;
+
+ if (filloptions.fillColor)
+ return getColorOrGradient(filloptions.fillColor, bottom, top, seriesColor);
+
+ var c = $.color.parse(seriesColor);
+ c.a = typeof fill == "number" ? fill : 0.4;
+ c.normalize();
+ return c.toString();
+ }
+
+ function insertLegend() {
+ placeholder.find(".legend").remove();
+
+ if (!options.legend.show)
+ return;
+
+ var fragments = [], rowStarted = false,
+ lf = options.legend.labelFormatter, s, label;
+ for (var i = 0; i < series.length; ++i) {
+ s = series[i];
+ label = s.label;
+ if (!label)
+ continue;
+
+ if (i % options.legend.noColumns == 0) {
+ if (rowStarted)
+ fragments.push('</tr>');
+ fragments.push('<tr>');
+ rowStarted = true;
+ }
+
+ if (lf)
+ label = lf(label, s);
+
+ fragments.push(
+ '<td class="legendColorBox"><div style="border:1px solid ' + options.legend.labelBoxBorderColor + ';padding:1px"><div style="width:4px;height:0;border:5px solid ' + s.color + ';overflow:hidden"></div></div></td>' +
+ '<td class="legendLabel">' + label + '</td>');
+ }
+ if (rowStarted)
+ fragments.push('</tr>');
+
+ if (fragments.length == 0)
+ return;
+
+ var table = '<table style="font-size:smaller;color:' + options.grid.color + '">' + fragments.join("") + '</table>';
+ if (options.legend.container != null)
+ $(options.legend.container).html(table);
+ else {
+ var pos = "",
+ p = options.legend.position,
+ m = options.legend.margin;
+ if (m[0] == null)
+ m = [m, m];
+ if (p.charAt(0) == "n")
+ pos += 'top:' + (m[1] + plotOffset.top) + 'px;';
+ else if (p.charAt(0) == "s")
+ pos += 'bottom:' + (m[1] + plotOffset.bottom) + 'px;';
+ if (p.charAt(1) == "e")
+ pos += 'right:' + (m[0] + plotOffset.right) + 'px;';
+ else if (p.charAt(1) == "w")
+ pos += 'left:' + (m[0] + plotOffset.left) + 'px;';
+ var legend = $('<div class="legend">' + table.replace('style="', 'style="position:absolute;' + pos +';') + '</div>').appendTo(placeholder);
+ if (options.legend.backgroundOpacity != 0.0) {
+ // put in the transparent background
+ // separately to avoid blended labels and
+ // label boxes
+ var c = options.legend.backgroundColor;
+ if (c == null) {
+ c = options.grid.backgroundColor;
+ if (c && typeof c == "string")
+ c = $.color.parse(c);
+ else
+ c = $.color.extract(legend, 'background-color');
+ c.a = 1;
+ c = c.toString();
+ }
+ var div = legend.children();
+ $('<div style="position:absolute;width:' + div.width() + 'px;height:' + div.height() + 'px;' + pos +'background-color:' + c + ';"> </div>').prependTo(legend).css('opacity', options.legend.backgroundOpacity);
+ }
+ }
+ }
+
+
+ // interactive features
+
+ var highlights = [],
+ redrawTimeout = null;
+
+ // returns the data item the mouse is over, or null if none is found
+ function findNearbyItem(mouseX, mouseY, seriesFilter) {
+ var maxDistance = options.grid.mouseActiveRadius,
+ smallestDistance = maxDistance * maxDistance + 1,
+ item = null, foundPoint = false, i, j;
+
+ for (i = series.length - 1; i >= 0; --i) {
+ if (!seriesFilter(series[i]))
+ continue;
+
+ var s = series[i],
+ axisx = s.xaxis,
+ axisy = s.yaxis,
+ points = s.datapoints.points,
+ ps = s.datapoints.pointsize,
+ mx = axisx.c2p(mouseX), // precompute some stuff to make the loop faster
+ my = axisy.c2p(mouseY),
+ maxx = maxDistance / axisx.scale,
+ maxy = maxDistance / axisy.scale;
+
+ // with inverse transforms, we can't use the maxx/maxy
+ // optimization, sadly
+ if (axisx.options.inverseTransform)
+ maxx = Number.MAX_VALUE;
+ if (axisy.options.inverseTransform)
+ maxy = Number.MAX_VALUE;
+
+ if (s.lines.show || s.points.show) {
+ for (j = 0; j < points.length; j += ps) {
+ var x = points[j], y = points[j + 1];
+ if (x == null)
+ continue;
+
+ // For points and lines, the cursor must be within a
+ // certain distance to the data point
+ if (x - mx > maxx || x - mx < -maxx ||
+ y - my > maxy || y - my < -maxy)
+ continue;
+
+ // We have to calculate distances in pixels, not in
+ // data units, because the scales of the axes may be different
+ var dx = Math.abs(axisx.p2c(x) - mouseX),
+ dy = Math.abs(axisy.p2c(y) - mouseY),
+ dist = dx * dx + dy * dy; // we save the sqrt
+
+ // use <= to ensure last point takes precedence
+ // (last generally means on top of)
+ if (dist < smallestDistance) {
+ smallestDistance = dist;
+ item = [i, j / ps];
+ }
+ }
+ }
+
+ if (s.bars.show && !item) { // no other point can be nearby
+ var barLeft = s.bars.align == "left" ? 0 : -s.bars.barWidth/2,
+ barRight = barLeft + s.bars.barWidth;
+
+ for (j = 0; j < points.length; j += ps) {
+ var x = points[j], y = points[j + 1], b = points[j + 2];
+ if (x == null)
+ continue;
+
+ // for a bar graph, the cursor must be inside the bar
+ if (series[i].bars.horizontal ?
+ (mx <= Math.max(b, x) && mx >= Math.min(b, x) &&
+ my >= y + barLeft && my <= y + barRight) :
+ (mx >= x + barLeft && mx <= x + barRight &&
+ my >= Math.min(b, y) && my <= Math.max(b, y)))
+ item = [i, j / ps];
+ }
+ }
+ }
+
+ if (item) {
+ i = item[0];
+ j = item[1];
+ ps = series[i].datapoints.pointsize;
+
+ return { datapoint: series[i].datapoints.points.slice(j * ps, (j + 1) * ps),
+ dataIndex: j,
+ series: series[i],
+ seriesIndex: i };
+ }
+
+ return null;
+ }
+
+ function onMouseMove(e) {
+ if (options.grid.hoverable)
+ triggerClickHoverEvent("plothover", e,
+ function (s) { return s["hoverable"] != false; });
+ }
+
+ function onMouseLeave(e) {
+ if (options.grid.hoverable)
+ triggerClickHoverEvent("plothover", e,
+ function (s) { return false; });
+ }
+
+ function onClick(e) {
+ triggerClickHoverEvent("plotclick", e,
+ function (s) { return s["clickable"] != false; });
+ }
+
+ // trigger click or hover event (they send the same parameters
+ // so we share their code)
+ function triggerClickHoverEvent(eventname, event, seriesFilter) {
+ var offset = eventHolder.offset(),
+ canvasX = event.pageX - offset.left - plotOffset.left,
+ canvasY = event.pageY - offset.top - plotOffset.top,
+ pos = canvasToAxisCoords({ left: canvasX, top: canvasY });
+
+ pos.pageX = event.pageX;
+ pos.pageY = event.pageY;
+
+ var item = findNearbyItem(canvasX, canvasY, seriesFilter);
+
+ if (item) {
+ // fill in mouse pos for any listeners out there
+ item.pageX = parseInt(item.series.xaxis.p2c(item.datapoint[0]) + offset.left + plotOffset.left);
+ item.pageY = parseInt(item.series.yaxis.p2c(item.datapoint[1]) + offset.top + plotOffset.top);
+ }
+
+ if (options.grid.autoHighlight) {
+ // clear auto-highlights
+ for (var i = 0; i < highlights.length; ++i) {
+ var h = highlights[i];
+ if (h.auto == eventname &&
+ !(item && h.series == item.series &&
+ h.point[0] == item.datapoint[0] &&
+ h.point[1] == item.datapoint[1]))
+ unhighlight(h.series, h.point);
+ }
+
+ if (item)
+ highlight(item.series, item.datapoint, eventname);
+ }
+
+ placeholder.trigger(eventname, [ pos, item ]);
+ }
+
+ function triggerRedrawOverlay() {
+ if (!redrawTimeout)
+ redrawTimeout = setTimeout(drawOverlay, 30);
+ }
+
+ function drawOverlay() {
+ redrawTimeout = null;
+
+ // draw highlights
+ octx.save();
+ octx.clearRect(0, 0, canvasWidth, canvasHeight);
+ octx.translate(plotOffset.left, plotOffset.top);
+
+ var i, hi;
+ for (i = 0; i < highlights.length; ++i) {
+ hi = highlights[i];
+
+ if (hi.series.bars.show)
+ drawBarHighlight(hi.series, hi.point);
+ else
+ drawPointHighlight(hi.series, hi.point);
+ }
+ octx.restore();
+
+ executeHooks(hooks.drawOverlay, [octx]);
+ }
+
+ function highlight(s, point, auto) {
+ if (typeof s == "number")
+ s = series[s];
+
+ if (typeof point == "number") {
+ var ps = s.datapoints.pointsize;
+ point = s.datapoints.points.slice(ps * point, ps * (point + 1));
+ }
+
+ var i = indexOfHighlight(s, point);
+ if (i == -1) {
+ highlights.push({ series: s, point: point, auto: auto });
+
+ triggerRedrawOverlay();
+ }
+ else if (!auto)
+ highlights[i].auto = false;
+ }
+
+ function unhighlight(s, point) {
+ if (s == null && point == null) {
+ highlights = [];
+ triggerRedrawOverlay();
+ }
+
+ if (typeof s == "number")
+ s = series[s];
+
+ if (typeof point == "number")
+ point = s.data[point];
+
+ var i = indexOfHighlight(s, point);
+ if (i != -1) {
+ highlights.splice(i, 1);
+
+ triggerRedrawOverlay();
+ }
+ }
+
+ function indexOfHighlight(s, p) {
+ for (var i = 0; i < highlights.length; ++i) {
+ var h = highlights[i];
+ if (h.series == s && h.point[0] == p[0]
+ && h.point[1] == p[1])
+ return i;
+ }
+ return -1;
+ }
+
+ function drawPointHighlight(series, point) {
+ var x = point[0], y = point[1],
+ axisx = series.xaxis, axisy = series.yaxis;
+
+ if (x < axisx.min || x > axisx.max || y < axisy.min || y > axisy.max)
+ return;
+
+ var pointRadius = series.points.radius + series.points.lineWidth / 2;
+ octx.lineWidth = pointRadius;
+ octx.strokeStyle = $.color.parse(series.color).scale('a', 0.5).toString();
+ var radius = 1.5 * pointRadius,
+ x = axisx.p2c(x),
+ y = axisy.p2c(y);
+
+ octx.beginPath();
+ if (series.points.symbol == "circle")
+ octx.arc(x, y, radius, 0, 2 * Math.PI, false);
+ else
+ series.points.symbol(octx, x, y, radius, false);
+ octx.closePath();
+ octx.stroke();
+ }
+
+ function drawBarHighlight(series, point) {
+ octx.lineWidth = series.bars.lineWidth;
+ octx.strokeStyle = $.color.parse(series.color).scale('a', 0.5).toString();
+ var fillStyle = $.color.parse(series.color).scale('a', 0.5).toString();
+ var barLeft = series.bars.align == "left" ? 0 : -series.bars.barWidth/2;
+ drawBar(point[0], point[1], point[2] || 0, barLeft, barLeft + series.bars.barWidth,
+ 0, function () { return fillStyle; }, series.xaxis, series.yaxis, octx, series.bars.horizontal, series.bars.lineWidth);
+ }
+
+ function getColorOrGradient(spec, bottom, top, defaultColor) {
+ if (typeof spec == "string")
+ return spec;
+ else {
+ // assume this is a gradient spec; IE currently only
+ // supports a simple vertical gradient properly, so that's
+ // what we support too
+ var gradient = ctx.createLinearGradient(0, top, 0, bottom);
+
+ for (var i = 0, l = spec.colors.length; i < l; ++i) {
+ var c = spec.colors[i];
+ if (typeof c != "string") {
+ var co = $.color.parse(defaultColor);
+ if (c.brightness != null)
+ co = co.scale('rgb', c.brightness)
+ if (c.opacity != null)
+ co.a *= c.opacity;
+ c = co.toString();
+ }
+ gradient.addColorStop(i / (l - 1), c);
+ }
+
+ return gradient;
+ }
+ }
+ }
+
+ $.plot = function(placeholder, data, options) {
+ //var t0 = new Date();
+ var plot = new Plot($(placeholder), data, options, $.plot.plugins);
+ //(window.console ? console.log : alert)("time used (msecs): " + ((new Date()).getTime() - t0.getTime()));
+ return plot;
+ };
+
+ $.plot.version = "0.7";
+
+ $.plot.plugins = [];
+
+ // returns a string with the date d formatted according to fmt
+ $.plot.formatDate = function(d, fmt, monthNames) {
+ var leftPad = function(n) {
+ n = "" + n;
+ return n.length == 1 ? "0" + n : n;
+ };
+
+ var r = [];
+ var escape = false, padNext = false;
+ var hours = d.getUTCHours();
+ var isAM = hours < 12;
+ if (monthNames == null)
+ monthNames = ["Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug", "Sep", "Oct", "Nov", "Dec"];
+
+ if (fmt.search(/%p|%P/) != -1) {
+ if (hours > 12) {
+ hours = hours - 12;
+ } else if (hours == 0) {
+ hours = 12;
+ }
+ }
+ for (var i = 0; i < fmt.length; ++i) {
+ var c = fmt.charAt(i);
+
+ if (escape) {
+ switch (c) {
+ case 'h': c = "" + hours; break;
+ case 'H': c = leftPad(hours); break;
+ case 'M': c = leftPad(d.getUTCMinutes()); break;
+ case 'S': c = leftPad(d.getUTCSeconds()); break;
+ case 'd': c = "" + d.getUTCDate(); break;
+ case 'm': c = "" + (d.getUTCMonth() + 1); break;
+ case 'y': c = "" + d.getUTCFullYear(); break;
+ case 'b': c = "" + monthNames[d.getUTCMonth()]; break;
+ case 'p': c = (isAM) ? ("" + "am") : ("" + "pm"); break;
+ case 'P': c = (isAM) ? ("" + "AM") : ("" + "PM"); break;
+ case '0': c = ""; padNext = true; break;
+ }
+ if (c && padNext) {
+ c = leftPad(c);
+ padNext = false;
+ }
+ r.push(c);
+ if (!padNext)
+ escape = false;
+ }
+ else {
+ if (c == "%")
+ escape = true;
+ else
+ r.push(c);
+ }
+ }
+ return r.join("");
+ };
+
+ // round to nearby lower multiple of base
+ function floorInBase(n, base) {
+ return base * Math.floor(n / base);
+ }
+
+})(jQuery);
+
--- /dev/null
+++ b/js/flot/jquery.flot.min.js
@@ -1,1 +1,6 @@
-
+/* Javascript plotting library for jQuery, v. 0.7.
+ *
+ * Released under the MIT license by IOLA, December 2007.
+ *
+ */
+(function(b){b.color={};b.color.make=function(d,e,g,f){var c={};c.r=d||0;c.g=e||0;c.b=g||0;c.a=f!=null?f:1;c.add=function(h,j){for(var k=0;k<h.length;++k){c[h.charAt(k)]+=j}return c.normalize()};c.scale=function(h,j){for(var k=0;k<h.length;++k){c[h.charAt(k)]*=j}return c.normalize()};c.toString=function(){if(c.a>=1){return"rgb("+[c.r,c.g,c.b].join(",")+")"}else{return"rgba("+[c.r,c.g,c.b,c.a].join(",")+")"}};c.normalize=function(){function h(k,j,l){return j<k?k:(j>l?l:j)}c.r=h(0,parseInt(c.r),255);c.g=h(0,parseInt(c.g),255);c.b=h(0,parseInt(c.b),255);c.a=h(0,c.a,1);return c};c.clone=function(){return b.color.make(c.r,c.b,c.g,c.a)};return c.normalize()};b.color.extract=function(d,e){var c;do{c=d.css(e).toLowerCase();if(c!=""&&c!="transparent"){break}d=d.parent()}while(!b.nodeName(d.get(0),"body"));if(c=="rgba(0, 0, 0, 0)"){c="transparent"}return b.color.parse(c)};b.color.parse=function(c){var d,f=b.color.make;if(d=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(c)){return f(parseInt(d[1],10),parseInt(d[2],10),parseInt(d[3],10))}if(d=/rgba\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(c)){return f(parseInt(d[1],10),parseInt(d[2],10),parseInt(d[3],10),parseFloat(d[4]))}if(d=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(c)){return f(parseFloat(d[1])*2.55,parseFloat(d[2])*2.55,parseFloat(d[3])*2.55)}if(d=/rgba\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(c)){return f(parseFloat(d[1])*2.55,parseFloat(d[2])*2.55,parseFloat(d[3])*2.55,parseFloat(d[4]))}if(d=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(c)){return f(parseInt(d[1],16),parseInt(d[2],16),parseInt(d[3],16))}if(d=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(c)){return f(parseInt(d[1]+d[1],16),parseInt(d[2]+d[2],16),parseInt(d[3]+d[3],16))}var e=b.trim(c).toLowerCase();if(e=="transparent"){return f(255,255,255,0)}else{d=a[e]||[0,0,0];return f(d[0],d[1],d[2])}};var a={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0]}})(jQuery);(function(c){function b(av,ai,J,af){var Q=[],O={colors:["#edc240","#afd8f8","#cb4b4b","#4da74d","#9440ed"],legend:{show:true,noColumns:1,labelFormatter:null,labelBoxBorderColor:"#ccc",container:null,position:"ne",margin:5,backgroundColor:null,backgroundOpacity:0.85},xaxis:{show:null,position:"bottom",mode:null,color:null,tickColor:null,transform:null,inverseTransform:null,min:null,max:null,autoscaleMargin:null,ticks:null,tickFormatter:null,labelWidth:null,labelHeight:null,reserveSpace:null,tickLength:null,alignTicksWithAxis:null,tickDecimals:null,tickSize:null,minTickSize:null,monthNames:null,timeformat:null,twelveHourClock:false},yaxis:{autoscaleMargin:0.02,position:"left"},xaxes:[],yaxes:[],series:{points:{show:false,radius:3,lineWidth:2,fill:true,fillColor:"#ffffff",symbol:"circle"},lines:{lineWidth:2,fill:false,fillColor:null,steps:false},bars:{show:false,lineWidth:2,barWidth:1,fill:true,fillColor:null,align:"left",horizontal:false},shadowSize:3},grid:{show:true,aboveData:false,color:"#545454",backgroundColor:null,borderColor:null,tickColor:null,labelMargin:5,axisMargin:8,borderWidth:2,minBorderMargin:null,markings:null,markingsColor:"#f4f4f4",markingsLineWidth:2,clickable:false,hoverable:false,autoHighlight:true,mouseActiveRadius:10},hooks:{}},az=null,ad=null,y=null,H=null,A=null,p=[],aw=[],q={left:0,right:0,top:0,bottom:0},G=0,I=0,h=0,w=0,ak={processOptions:[],processRawData:[],processDatapoints:[],drawSeries:[],draw:[],bindEvents:[],drawOverlay:[],shutdown:[]},aq=this;aq.setData=aj;aq.setupGrid=t;aq.draw=W;aq.getPlaceholder=function(){return av};aq.getCanvas=function(){return az};aq.getPlotOffset=function(){return q};aq.width=function(){return h};aq.height=function(){return w};aq.offset=function(){var aB=y.offset();aB.left+=q.left;aB.top+=q.top;return aB};aq.getData=function(){return Q};aq.getAxes=function(){var aC={},aB;c.each(p.concat(aw),function(aD,aE){if(aE){aC[aE.direction+(aE.n!=1?aE.n:"")+"axis"]=aE}});return aC};aq.getXAxes=function(){return p};aq.getYAxes=function(){return aw};aq.c2p=C;aq.p2c=ar;aq.getOptions=function(){return O};aq.highlight=x;aq.unhighlight=T;aq.triggerRedrawOverlay=f;aq.pointOffset=function(aB){return{left:parseInt(p[aA(aB,"x")-1].p2c(+aB.x)+q.left),top:parseInt(aw[aA(aB,"y")-1].p2c(+aB.y)+q.top)}};aq.shutdown=ag;aq.resize=function(){B();g(az);g(ad)};aq.hooks=ak;F(aq);Z(J);X();aj(ai);t();W();ah();function an(aD,aB){aB=[aq].concat(aB);for(var aC=0;aC<aD.length;++aC){aD[aC].apply(this,aB)}}function F(){for(var aB=0;aB<af.length;++aB){var aC=af[aB];aC.init(aq);if(aC.options){c.extend(true,O,aC.options)}}}function Z(aC){var aB;c.extend(true,O,aC);if(O.xaxis.color==null){O.xaxis.color=O.grid.color}if(O.yaxis.color==null){O.yaxis.color=O.grid.color}if(O.xaxis.tickColor==null){O.xaxis.tickColor=O.grid.tickColor}if(O.yaxis.tickColor==null){O.yaxis.tickColor=O.grid.tickColor}if(O.grid.borderColor==null){O.grid.borderColor=O.grid.color}if(O.grid.tickColor==null){O.grid.tickColor=c.color.parse(O.grid.color).scale("a",0.22).toString()}for(aB=0;aB<Math.max(1,O.xaxes.length);++aB){O.xaxes[aB]=c.extend(true,{},O.xaxis,O.xaxes[aB])}for(aB=0;aB<Math.max(1,O.yaxes.length);++aB){O.yaxes[aB]=c.extend(true,{},O.yaxis,O.yaxes[aB])}if(O.xaxis.noTicks&&O.xaxis.ticks==null){O.xaxis.ticks=O.xaxis.noTicks}if(O.yaxis.noTicks&&O.yaxis.ticks==null){O.yaxis.ticks=O.yaxis.noTicks}if(O.x2axis){O.xaxes[1]=c.extend(true,{},O.xaxis,O.x2axis);O.xaxes[1].position="top"}if(O.y2axis){O.yaxes[1]=c.extend(true,{},O.yaxis,O.y2axis);O.yaxes[1].position="right"}if(O.grid.coloredAreas){O.grid.markings=O.grid.coloredAreas}if(O.grid.coloredAreasColor){O.grid.markingsColor=O.grid.coloredAreasColor}if(O.lines){c.extend(true,O.series.lines,O.lines)}if(O.points){c.extend(true,O.series.points,O.points)}if(O.bars){c.extend(true,O.series.bars,O.bars)}if(O.shadowSize!=null){O.series.shadowSize=O.shadowSize}for(aB=0;aB<O.xaxes.length;++aB){V(p,aB+1).options=O.xaxes[aB]}for(aB=0;aB<O.yaxes.length;++aB){V(aw,aB+1).options=O.yaxes[aB]}for(var aD in ak){if(O.hooks[aD]&&O.hooks[aD].length){ak[aD]=ak[aD].concat(O.hooks[aD])}}an(ak.processOptions,[O])}function aj(aB){Q=Y(aB);ax();z()}function Y(aE){var aC=[];for(var aB=0;aB<aE.length;++aB){var aD=c.extend(true,{},O.series);if(aE[aB].data!=null){aD.data=aE[aB].data;delete aE[aB].data;c.extend(true,aD,aE[aB]);aE[aB].data=aD.data}else{aD.data=aE[aB]}aC.push(aD)}return aC}function aA(aC,aD){var aB=aC[aD+"axis"];if(typeof aB=="object"){aB=aB.n}if(typeof aB!="number"){aB=1}return aB}function m(){return c.grep(p.concat(aw),function(aB){return aB})}function C(aE){var aC={},aB,aD;for(aB=0;aB<p.length;++aB){aD=p[aB];if(aD&&aD.used){aC["x"+aD.n]=aD.c2p(aE.left)}}for(aB=0;aB<aw.length;++aB){aD=aw[aB];if(aD&&aD.used){aC["y"+aD.n]=aD.c2p(aE.top)}}if(aC.x1!==undefined){aC.x=aC.x1}if(aC.y1!==undefined){aC.y=aC.y1}return aC}function ar(aF){var aD={},aC,aE,aB;for(aC=0;aC<p.length;++aC){aE=p[aC];if(aE&&aE.used){aB="x"+aE.n;if(aF[aB]==null&&aE.n==1){aB="x"}if(aF[aB]!=null){aD.left=aE.p2c(aF[aB]);break}}}for(aC=0;aC<aw.length;++aC){aE=aw[aC];if(aE&&aE.used){aB="y"+aE.n;if(aF[aB]==null&&aE.n==1){aB="y"}if(aF[aB]!=null){aD.top=aE.p2c(aF[aB]);break}}}return aD}function V(aC,aB){if(!aC[aB-1]){aC[aB-1]={n:aB,direction:aC==p?"x":"y",options:c.extend(true,{},aC==p?O.xaxis:O.yaxis)}}return aC[aB-1]}function ax(){var aG;var aM=Q.length,aB=[],aE=[];for(aG=0;aG<Q.length;++aG){var aJ=Q[aG].color;if(aJ!=null){--aM;if(typeof aJ=="number"){aE.push(aJ)}else{aB.push(c.color.parse(Q[aG].color))}}}for(aG=0;aG<aE.length;++aG){aM=Math.max(aM,aE[aG]+1)}var aC=[],aF=0;aG=0;while(aC.length<aM){var aI;if(O.colors.length==aG){aI=c.color.make(100,100,100)}else{aI=c.color.parse(O.colors[aG])}var aD=aF%2==1?-1:1;aI.scale("rgb",1+aD*Math.ceil(aF/2)*0.2);aC.push(aI);++aG;if(aG>=O.colors.length){aG=0;++aF}}var aH=0,aN;for(aG=0;aG<Q.length;++aG){aN=Q[aG];if(aN.color==null){aN.color=aC[aH].toString();++aH}else{if(typeof aN.color=="number"){aN.color=aC[aN.color].toString()}}if(aN.lines.show==null){var aL,aK=true;for(aL in aN){if(aN[aL]&&aN[aL].show){aK=false;break}}if(aK){aN.lines.show=true}}aN.xaxis=V(p,aA(aN,"x"));aN.yaxis=V(aw,aA(aN,"y"))}}function z(){var aO=Number.POSITIVE_INFINITY,aI=Number.NEGATIVE_INFINITY,aB=Number.MAX_VALUE,aU,aS,aR,aN,aD,aJ,aT,aP,aH,aG,aC,a0,aX,aL;function aF(a3,a2,a1){if(a2<a3.datamin&&a2!=-aB){a3.datamin=a2}if(a1>a3.datamax&&a1!=aB){a3.datamax=a1}}c.each(m(),function(a1,a2){a2.datamin=aO;a2.datamax=aI;a2.used=false});for(aU=0;aU<Q.length;++aU){aJ=Q[aU];aJ.datapoints={points:[]};an(ak.processRawData,[aJ,aJ.data,aJ.datapoints])}for(aU=0;aU<Q.length;++aU){aJ=Q[aU];var aZ=aJ.data,aW=aJ.datapoints.format;if(!aW){aW=[];aW.push({x:true,number:true,required:true});aW.push({y:true,number:true,required:true});if(aJ.bars.show||(aJ.lines.show&&aJ.lines.fill)){aW.push({y:true,number:true,required:false,defaultValue:0});if(aJ.bars.horizontal){delete aW[aW.length-1].y;aW[aW.length-1].x=true}}aJ.datapoints.format=aW}if(aJ.datapoints.pointsize!=null){continue}aJ.datapoints.pointsize=aW.length;aP=aJ.datapoints.pointsize;aT=aJ.datapoints.points;insertSteps=aJ.lines.show&&aJ.lines.steps;aJ.xaxis.used=aJ.yaxis.used=true;for(aS=aR=0;aS<aZ.length;++aS,aR+=aP){aL=aZ[aS];var aE=aL==null;if(!aE){for(aN=0;aN<aP;++aN){a0=aL[aN];aX=aW[aN];if(aX){if(aX.number&&a0!=null){a0=+a0;if(isNaN(a0)){a0=null}else{if(a0==Infinity){a0=aB}else{if(a0==-Infinity){a0=-aB}}}}if(a0==null){if(aX.required){aE=true}if(aX.defaultValue!=null){a0=aX.defaultValue}}}aT[aR+aN]=a0}}if(aE){for(aN=0;aN<aP;++aN){a0=aT[aR+aN];if(a0!=null){aX=aW[aN];if(aX.x){aF(aJ.xaxis,a0,a0)}if(aX.y){aF(aJ.yaxis,a0,a0)}}aT[aR+aN]=null}}else{if(insertSteps&&aR>0&&aT[aR-aP]!=null&&aT[aR-aP]!=aT[aR]&&aT[aR-aP+1]!=aT[aR+1]){for(aN=0;aN<aP;++aN){aT[aR+aP+aN]=aT[aR+aN]}aT[aR+1]=aT[aR-aP+1];aR+=aP}}}}for(aU=0;aU<Q.length;++aU){aJ=Q[aU];an(ak.processDatapoints,[aJ,aJ.datapoints])}for(aU=0;aU<Q.length;++aU){aJ=Q[aU];aT=aJ.datapoints.points,aP=aJ.datapoints.pointsize;var aK=aO,aQ=aO,aM=aI,aV=aI;for(aS=0;aS<aT.length;aS+=aP){if(aT[aS]==null){continue}for(aN=0;aN<aP;++aN){a0=aT[aS+aN];aX=aW[aN];if(!aX||a0==aB||a0==-aB){continue}if(aX.x){if(a0<aK){aK=a0}if(a0>aM){aM=a0}}if(aX.y){if(a0<aQ){aQ=a0}if(a0>aV){aV=a0}}}}if(aJ.bars.show){var aY=aJ.bars.align=="left"?0:-aJ.bars.barWidth/2;if(aJ.bars.horizontal){aQ+=aY;aV+=aY+aJ.bars.barWidth}else{aK+=aY;aM+=aY+aJ.bars.barWidth}}aF(aJ.xaxis,aK,aM);aF(aJ.yaxis,aQ,aV)}c.each(m(),function(a1,a2){if(a2.datamin==aO){a2.datamin=null}if(a2.datamax==aI){a2.datamax=null}})}function j(aB,aC){var aD=document.createElement("canvas");aD.className=aC;aD.width=G;aD.height=I;if(!aB){c(aD).css({position:"absolute",left:0,top:0})}c(aD).appendTo(av);if(!aD.getContext){aD=window.G_vmlCanvasManager.initElement(aD)}aD.getContext("2d").save();return aD}function B(){G=av.width();I=av.height();if(G<=0||I<=0){throw"Invalid dimensions for plot, width = "+G+", height = "+I}}function g(aC){if(aC.width!=G){aC.width=G}if(aC.height!=I){aC.height=I}var aB=aC.getContext("2d");aB.restore();aB.save()}function X(){var aC,aB=av.children("canvas.base"),aD=av.children("canvas.overlay");if(aB.length==0||aD==0){av.html("");av.css({padding:0});if(av.css("position")=="static"){av.css("position","relative")}B();az=j(true,"base");ad=j(false,"overlay");aC=false}else{az=aB.get(0);ad=aD.get(0);aC=true}H=az.getContext("2d");A=ad.getContext("2d");y=c([ad,az]);if(aC){av.data("plot").shutdown();aq.resize();A.clearRect(0,0,G,I);y.unbind();av.children().not([az,ad]).remove()}av.data("plot",aq)}function ah(){if(O.grid.hoverable){y.mousemove(aa);y.mouseleave(l)}if(O.grid.clickable){y.click(R)}an(ak.bindEvents,[y])}function ag(){if(M){clearTimeout(M)}y.unbind("mousemove",aa);y.unbind("mouseleave",l);y.unbind("click",R);an(ak.shutdown,[y])}function r(aG){function aC(aH){return aH}var aF,aB,aD=aG.options.transform||aC,aE=aG.options.inverseTransform;if(aG.direction=="x"){aF=aG.scale=h/Math.abs(aD(aG.max)-aD(aG.min));aB=Math.min(aD(aG.max),aD(aG.min))}else{aF=aG.scale=w/Math.abs(aD(aG.max)-aD(aG.min));aF=-aF;aB=Math.max(aD(aG.max),aD(aG.min))}if(aD==aC){aG.p2c=function(aH){return(aH-aB)*aF}}else{aG.p2c=function(aH){return(aD(aH)-aB)*aF}}if(!aE){aG.c2p=function(aH){return aB+aH/aF}}else{aG.c2p=function(aH){return aE(aB+aH/aF)}}}function L(aD){var aB=aD.options,aF,aJ=aD.ticks||[],aI=[],aE,aK=aB.labelWidth,aG=aB.labelHeight,aC;function aH(aM,aL){return c('<div style="position:absolute;top:-10000px;'+aL+'font-size:smaller"><div class="'+aD.direction+"Axis "+aD.direction+aD.n+'Axis">'+aM.join("")+"</div></div>").appendTo(av)}if(aD.direction=="x"){if(aK==null){aK=Math.floor(G/(aJ.length>0?aJ.length:1))}if(aG==null){aI=[];for(aF=0;aF<aJ.length;++aF){aE=aJ[aF].label;if(aE){aI.push('<div class="tickLabel" style="float:left;width:'+aK+'px">'+aE+"</div>")}}if(aI.length>0){aI.push('<div style="clear:left"></div>');aC=aH(aI,"width:10000px;");aG=aC.height();aC.remove()}}}else{if(aK==null||aG==null){for(aF=0;aF<aJ.length;++aF){aE=aJ[aF].label;if(aE){aI.push('<div class="tickLabel">'+aE+"</div>")}}if(aI.length>0){aC=aH(aI,"");if(aK==null){aK=aC.children().width()}if(aG==null){aG=aC.find("div.tickLabel").height()}aC.remove()}}}if(aK==null){aK=0}if(aG==null){aG=0}aD.labelWidth=aK;aD.labelHeight=aG}function au(aD){var aC=aD.labelWidth,aL=aD.labelHeight,aH=aD.options.position,aF=aD.options.tickLength,aG=O.grid.axisMargin,aJ=O.grid.labelMargin,aK=aD.direction=="x"?p:aw,aE;var aB=c.grep(aK,function(aN){return aN&&aN.options.position==aH&&aN.reserveSpace});if(c.inArray(aD,aB)==aB.length-1){aG=0}if(aF==null){aF="full"}var aI=c.grep(aK,function(aN){return aN&&aN.reserveSpace});var aM=c.inArray(aD,aI)==0;if(!aM&&aF=="full"){aF=5}if(!isNaN(+aF)){aJ+=+aF}if(aD.direction=="x"){aL+=aJ;if(aH=="bottom"){q.bottom+=aL+aG;aD.box={top:I-q.bottom,height:aL}}else{aD.box={top:q.top+aG,height:aL};q.top+=aL+aG}}else{aC+=aJ;if(aH=="left"){aD.box={left:q.left+aG,width:aC};q.left+=aC+aG}else{q.right+=aC+aG;aD.box={left:G-q.right,width:aC}}}aD.position=aH;aD.tickLength=aF;aD.box.padding=aJ;aD.innermost=aM}function U(aB){if(aB.direction=="x"){aB.box.left=q.left;aB.box.width=h}else{aB.box.top=q.top;aB.box.height=w}}function t(){var aC,aE=m();c.each(aE,function(aF,aG){aG.show=aG.options.show;if(aG.show==null){aG.show=aG.used}aG.reserveSpace=aG.show||aG.options.reserveSpace;n(aG)});allocatedAxes=c.grep(aE,function(aF){return aF.reserveSpace});q.left=q.right=q.top=q.bottom=0;if(O.grid.show){c.each(allocatedAxes,function(aF,aG){S(aG);P(aG);ap(aG,aG.ticks);L(aG)});for(aC=allocatedAxes.length-1;aC>=0;--aC){au(allocatedAxes[aC])}var aD=O.grid.minBorderMargin;if(aD==null){aD=0;for(aC=0;aC<Q.length;++aC){aD=Math.max(aD,Q[aC].points.radius+Q[aC].points.lineWidth/2)}}for(var aB in q){q[aB]+=O.grid.borderWidth;q[aB]=Math.max(aD,q[aB])}}h=G-q.left-q.right;w=I-q.bottom-q.top;c.each(aE,function(aF,aG){r(aG)});if(O.grid.show){c.each(allocatedAxes,function(aF,aG){U(aG)});k()}o()}function n(aE){var aF=aE.options,aD=+(aF.min!=null?aF.min:aE.datamin),aB=+(aF.max!=null?aF.max:aE.datamax),aH=aB-aD;if(aH==0){var aC=aB==0?1:0.01;if(aF.min==null){aD-=aC}if(aF.max==null||aF.min!=null){aB+=aC}}else{var aG=aF.autoscaleMargin;if(aG!=null){if(aF.min==null){aD-=aH*aG;if(aD<0&&aE.datamin!=null&&aE.datamin>=0){aD=0}}if(aF.max==null){aB+=aH*aG;if(aB>0&&aE.datamax!=null&&aE.datamax<=0){aB=0}}}}aE.min=aD;aE.max=aB}function S(aG){var aM=aG.options;var aH;if(typeof aM.ticks=="number"&&aM.ticks>0){aH=aM.ticks}else{aH=0.3*Math.sqrt(aG.direction=="x"?G:I)}var aT=(aG.max-aG.min)/aH,aO,aB,aN,aR,aS,aQ,aI;if(aM.mode=="time"){var aJ={second:1000,minute:60*1000,hour:60*60*1000,day:24*60*60*1000,month:30*24*60*60*1000,year:365.2425*24*60*60*1000};var aK=[[1,"second"],[2,"second"],[5,"second"],[10,"second"],[30,"second"],[1,"minute"],[2,"minute"],[5,"minute"],[10,"minute"],[30,"minute"],[1,"hour"],[2,"hour"],[4,"hour"],[8,"hour"],[12,"hour"],[1,"day"],[2,"day"],[3,"day"],[0.25,"month"],[0.5,"month"],[1,"month"],[2,"month"],[3,"month"],[6,"month"],[1,"year"]];var aC=0;if(aM.minTickSize!=null){if(typeof aM.tickSize=="number"){aC=aM.tickSize}else{aC=aM.minTickSize[0]*aJ[aM.minTickSize[1]]}}for(var aS=0;aS<aK.length-1;++aS){if(aT<(aK[aS][0]*aJ[aK[aS][1]]+aK[aS+1][0]*aJ[aK[aS+1][1]])/2&&aK[aS][0]*aJ[aK[aS][1]]>=aC){break}}aO=aK[aS][0];aN=aK[aS][1];if(aN=="year"){aQ=Math.pow(10,Math.floor(Math.log(aT/aJ.year)/Math.LN10));aI=(aT/aJ.year)/aQ;if(aI<1.5){aO=1}else{if(aI<3){aO=2}else{if(aI<7.5){aO=5}else{aO=10}}}aO*=aQ}aG.tickSize=aM.tickSize||[aO,aN];aB=function(aX){var a2=[],a0=aX.tickSize[0],a3=aX.tickSize[1],a1=new Date(aX.min);var aW=a0*aJ[a3];if(a3=="second"){a1.setUTCSeconds(a(a1.getUTCSeconds(),a0))}if(a3=="minute"){a1.setUTCMinutes(a(a1.getUTCMinutes(),a0))}if(a3=="hour"){a1.setUTCHours(a(a1.getUTCHours(),a0))}if(a3=="month"){a1.setUTCMonth(a(a1.getUTCMonth(),a0))}if(a3=="year"){a1.setUTCFullYear(a(a1.getUTCFullYear(),a0))}a1.setUTCMilliseconds(0);if(aW>=aJ.minute){a1.setUTCSeconds(0)}if(aW>=aJ.hour){a1.setUTCMinutes(0)}if(aW>=aJ.day){a1.setUTCHours(0)}if(aW>=aJ.day*4){a1.setUTCDate(1)}if(aW>=aJ.year){a1.setUTCMonth(0)}var a5=0,a4=Number.NaN,aY;do{aY=a4;a4=a1.getTime();a2.push(a4);if(a3=="month"){if(a0<1){a1.setUTCDate(1);var aV=a1.getTime();a1.setUTCMonth(a1.getUTCMonth()+1);var aZ=a1.getTime();a1.setTime(a4+a5*aJ.hour+(aZ-aV)*a0);a5=a1.getUTCHours();a1.setUTCHours(0)}else{a1.setUTCMonth(a1.getUTCMonth()+a0)}}else{if(a3=="year"){a1.setUTCFullYear(a1.getUTCFullYear()+a0)}else{a1.setTime(a4+aW)}}}while(a4<aX.max&&a4!=aY);return a2};aR=function(aV,aY){var a0=new Date(aV);if(aM.timeformat!=null){return c.plot.formatDate(a0,aM.timeformat,aM.monthNames)}var aW=aY.tickSize[0]*aJ[aY.tickSize[1]];var aX=aY.max-aY.min;var aZ=(aM.twelveHourClock)?" %p":"";if(aW<aJ.minute){fmt="%h:%M:%S"+aZ}else{if(aW<aJ.day){if(aX<2*aJ.day){fmt="%h:%M"+aZ}else{fmt="%b %d %h:%M"+aZ}}else{if(aW<aJ.month){fmt="%b %d"}else{if(aW<aJ.year){if(aX<aJ.year){fmt="%b"}else{fmt="%b %y"}}else{fmt="%y"}}}}return c.plot.formatDate(a0,fmt,aM.monthNames)}}else{var aU=aM.tickDecimals;var aP=-Math.floor(Math.log(aT)/Math.LN10);if(aU!=null&&aP>aU){aP=aU}aQ=Math.pow(10,-aP);aI=aT/aQ;if(aI<1.5){aO=1}else{if(aI<3){aO=2;if(aI>2.25&&(aU==null||aP+1<=aU)){aO=2.5;++aP}}else{if(aI<7.5){aO=5}else{aO=10}}}aO*=aQ;if(aM.minTickSize!=null&&aO<aM.minTickSize){aO=aM.minTickSize}aG.tickDecimals=Math.max(0,aU!=null?aU:aP);aG.tickSize=aM.tickSize||aO;aB=function(aX){var aZ=[];var a0=a(aX.min,aX.tickSize),aW=0,aV=Number.NaN,aY;do{aY=aV;aV=a0+aW*aX.tickSize;aZ.push(aV);++aW}while(aV<aX.max&&aV!=aY);return aZ};aR=function(aV,aW){return aV.toFixed(aW.tickDecimals)}}if(aM.alignTicksWithAxis!=null){var aF=(aG.direction=="x"?p:aw)[aM.alignTicksWithAxis-1];if(aF&&aF.used&&aF!=aG){var aL=aB(aG);if(aL.length>0){if(aM.min==null){aG.min=Math.min(aG.min,aL[0])}if(aM.max==null&&aL.length>1){aG.max=Math.max(aG.max,aL[aL.length-1])}}aB=function(aX){var aY=[],aV,aW;for(aW=0;aW<aF.ticks.length;++aW){aV=(aF.ticks[aW].v-aF.min)/(aF.max-aF.min);aV=aX.min+aV*(aX.max-aX.min);aY.push(aV)}return aY};if(aG.mode!="time"&&aM.tickDecimals==null){var aE=Math.max(0,-Math.floor(Math.log(aT)/Math.LN10)+1),aD=aB(aG);if(!(aD.length>1&&/\..*0$/.test((aD[1]-aD[0]).toFixed(aE)))){aG.tickDecimals=aE}}}}aG.tickGenerator=aB;if(c.isFunction(aM.tickFormatter)){aG.tickFormatter=function(aV,aW){return""+aM.tickFormatter(aV,aW)}}else{aG.tickFormatter=aR}}function P(aF){var aH=aF.options.ticks,aG=[];if(aH==null||(typeof aH=="number"&&aH>0)){aG=aF.tickGenerator(aF)}else{if(aH){if(c.isFunction(aH)){aG=aH({min:aF.min,max:aF.max})}else{aG=aH}}}var aE,aB;aF.ticks=[];for(aE=0;aE<aG.length;++aE){var aC=null;var aD=aG[aE];if(typeof aD=="object"){aB=+aD[0];if(aD.length>1){aC=aD[1]}}else{aB=+aD}if(aC==null){aC=aF.tickFormatter(aB,aF)}if(!isNaN(aB)){aF.ticks.push({v:aB,label:aC})}}}function ap(aB,aC){if(aB.options.autoscaleMargin&&aC.length>0){if(aB.options.min==null){aB.min=Math.min(aB.min,aC[0].v)}if(aB.options.max==null&&aC.length>1){aB.max=Math.max(aB.max,aC[aC.length-1].v)}}}function W(){H.clearRect(0,0,G,I);var aC=O.grid;if(aC.show&&aC.backgroundColor){N()}if(aC.show&&!aC.aboveData){ac()}for(var aB=0;aB<Q.length;++aB){an(ak.drawSeries,[H,Q[aB]]);d(Q[aB])}an(ak.draw,[H]);if(aC.show&&aC.aboveData){ac()}}function D(aB,aI){var aE,aH,aG,aD,aF=m();for(i=0;i<aF.length;++i){aE=aF[i];if(aE.direction==aI){aD=aI+aE.n+"axis";if(!aB[aD]&&aE.n==1){aD=aI+"axis"}if(aB[aD]){aH=aB[aD].from;aG=aB[aD].to;break}}}if(!aB[aD]){aE=aI=="x"?p[0]:aw[0];aH=aB[aI+"1"];aG=aB[aI+"2"]}if(aH!=null&&aG!=null&&aH>aG){var aC=aH;aH=aG;aG=aC}return{from:aH,to:aG,axis:aE}}function N(){H.save();H.translate(q.left,q.top);H.fillStyle=am(O.grid.backgroundColor,w,0,"rgba(255, 255, 255, 0)");H.fillRect(0,0,h,w);H.restore()}function ac(){var aF;H.save();H.translate(q.left,q.top);var aH=O.grid.markings;if(aH){if(c.isFunction(aH)){var aK=aq.getAxes();aK.xmin=aK.xaxis.min;aK.xmax=aK.xaxis.max;aK.ymin=aK.yaxis.min;aK.ymax=aK.yaxis.max;aH=aH(aK)}for(aF=0;aF<aH.length;++aF){var aD=aH[aF],aC=D(aD,"x"),aI=D(aD,"y");if(aC.from==null){aC.from=aC.axis.min}if(aC.to==null){aC.to=aC.axis.max}if(aI.from==null){aI.from=aI.axis.min}if(aI.to==null){aI.to=aI.axis.max}if(aC.to<aC.axis.min||aC.from>aC.axis.max||aI.to<aI.axis.min||aI.from>aI.axis.max){continue}aC.from=Math.max(aC.from,aC.axis.min);aC.to=Math.min(aC.to,aC.axis.max);aI.from=Math.max(aI.from,aI.axis.min);aI.to=Math.min(aI.to,aI.axis.max);if(aC.from==aC.to&&aI.from==aI.to){continue}aC.from=aC.axis.p2c(aC.from);aC.to=aC.axis.p2c(aC.to);aI.from=aI.axis.p2c(aI.from);aI.to=aI.axis.p2c(aI.to);if(aC.from==aC.to||aI.from==aI.to){H.beginPath();H.strokeStyle=aD.color||O.grid.markingsColor;H.lineWidth=aD.lineWidth||O.grid.markingsLineWidth;H.moveTo(aC.from,aI.from);H.lineTo(aC.to,aI.to);H.stroke()}else{H.fillStyle=aD.color||O.grid.markingsColor;H.fillRect(aC.from,aI.to,aC.to-aC.from,aI.from-aI.to)}}}var aK=m(),aM=O.grid.borderWidth;for(var aE=0;aE<aK.length;++aE){var aB=aK[aE],aG=aB.box,aQ=aB.tickLength,aN,aL,aP,aJ;if(!aB.show||aB.ticks.length==0){continue}H.strokeStyle=aB.options.tickColor||c.color.parse(aB.options.color).scale("a",0.22).toString();H.lineWidth=1;if(aB.direction=="x"){aN=0;if(aQ=="full"){aL=(aB.position=="top"?0:w)}else{aL=aG.top-q.top+(aB.position=="top"?aG.height:0)}}else{aL=0;if(aQ=="full"){aN=(aB.position=="left"?0:h)}else{aN=aG.left-q.left+(aB.position=="left"?aG.width:0)}}if(!aB.innermost){H.beginPath();aP=aJ=0;if(aB.direction=="x"){aP=h}else{aJ=w}if(H.lineWidth==1){aN=Math.floor(aN)+0.5;aL=Math.floor(aL)+0.5}H.moveTo(aN,aL);H.lineTo(aN+aP,aL+aJ);H.stroke()}H.beginPath();for(aF=0;aF<aB.ticks.length;++aF){var aO=aB.ticks[aF].v;aP=aJ=0;if(aO<aB.min||aO>aB.max||(aQ=="full"&&aM>0&&(aO==aB.min||aO==aB.max))){continue}if(aB.direction=="x"){aN=aB.p2c(aO);aJ=aQ=="full"?-w:aQ;if(aB.position=="top"){aJ=-aJ}}else{aL=aB.p2c(aO);aP=aQ=="full"?-h:aQ;if(aB.position=="left"){aP=-aP}}if(H.lineWidth==1){if(aB.direction=="x"){aN=Math.floor(aN)+0.5}else{aL=Math.floor(aL)+0.5}}H.moveTo(aN,aL);H.lineTo(aN+aP,aL+aJ)}H.stroke()}if(aM){H.lineWidth=aM;H.strokeStyle=O.grid.borderColor;H.strokeRect(-aM/2,-aM/2,h+aM,w+aM)}H.restore()}function k(){av.find(".tickLabels").remove();var aG=['<div class="tickLabels" style="font-size:smaller">'];var aJ=m();for(var aD=0;aD<aJ.length;++aD){var aC=aJ[aD],aF=aC.box;if(!aC.show){continue}aG.push('<div class="'+aC.direction+"Axis "+aC.direction+aC.n+'Axis" style="color:'+aC.options.color+'">');for(var aE=0;aE<aC.ticks.length;++aE){var aH=aC.ticks[aE];if(!aH.label||aH.v<aC.min||aH.v>aC.max){continue}var aK={},aI;if(aC.direction=="x"){aI="center";aK.left=Math.round(q.left+aC.p2c(aH.v)-aC.labelWidth/2);if(aC.position=="bottom"){aK.top=aF.top+aF.padding}else{aK.bottom=I-(aF.top+aF.height-aF.padding)}}else{aK.top=Math.round(q.top+aC.p2c(aH.v)-aC.labelHeight/2);if(aC.position=="left"){aK.right=G-(aF.left+aF.width-aF.padding);aI="right"}else{aK.left=aF.left+aF.padding;aI="left"}}aK.width=aC.labelWidth;var aB=["position:absolute","text-align:"+aI];for(var aL in aK){aB.push(aL+":"+aK[aL]+"px")}aG.push('<div class="tickLabel" style="'+aB.join(";")+'">'+aH.label+"</div>")}aG.push("</div>")}aG.push("</div>");av.append(aG.join(""))}function d(aB){if(aB.lines.show){at(aB)}if(aB.bars.show){e(aB)}if(aB.points.show){ao(aB)}}function at(aE){function aD(aP,aQ,aI,aU,aT){var aV=aP.points,aJ=aP.pointsize,aN=null,aM=null;H.beginPath();for(var aO=aJ;aO<aV.length;aO+=aJ){var aL=aV[aO-aJ],aS=aV[aO-aJ+1],aK=aV[aO],aR=aV[aO+1];if(aL==null||aK==null){continue}if(aS<=aR&&aS<aT.min){if(aR<aT.min){continue}aL=(aT.min-aS)/(aR-aS)*(aK-aL)+aL;aS=aT.min}else{if(aR<=aS&&aR<aT.min){if(aS<aT.min){continue}aK=(aT.min-aS)/(aR-aS)*(aK-aL)+aL;aR=aT.min}}if(aS>=aR&&aS>aT.max){if(aR>aT.max){continue}aL=(aT.max-aS)/(aR-aS)*(aK-aL)+aL;aS=aT.max}else{if(aR>=aS&&aR>aT.max){if(aS>aT.max){continue}aK=(aT.max-aS)/(aR-aS)*(aK-aL)+aL;aR=aT.max}}if(aL<=aK&&aL<aU.min){if(aK<aU.min){continue}aS=(aU.min-aL)/(aK-aL)*(aR-aS)+aS;aL=aU.min}else{if(aK<=aL&&aK<aU.min){if(aL<aU.min){continue}aR=(aU.min-aL)/(aK-aL)*(aR-aS)+aS;aK=aU.min}}if(aL>=aK&&aL>aU.max){if(aK>aU.max){continue}aS=(aU.max-aL)/(aK-aL)*(aR-aS)+aS;aL=aU.max}else{if(aK>=aL&&aK>aU.max){if(aL>aU.max){continue}aR=(aU.max-aL)/(aK-aL)*(aR-aS)+aS;aK=aU.max}}if(aL!=aN||aS!=aM){H.moveTo(aU.p2c(aL)+aQ,aT.p2c(aS)+aI)}aN=aK;aM=aR;H.lineTo(aU.p2c(aK)+aQ,aT.p2c(aR)+aI)}H.stroke()}function aF(aI,aQ,aP){var aW=aI.points,aV=aI.pointsize,aN=Math.min(Math.max(0,aP.min),aP.max),aX=0,aU,aT=false,aM=1,aL=0,aR=0;while(true){if(aV>0&&aX>aW.length+aV){break}aX+=aV;var aZ=aW[aX-aV],aK=aW[aX-aV+aM],aY=aW[aX],aJ=aW[aX+aM];if(aT){if(aV>0&&aZ!=null&&aY==null){aR=aX;aV=-aV;aM=2;continue}if(aV<0&&aX==aL+aV){H.fill();aT=false;aV=-aV;aM=1;aX=aL=aR+aV;continue}}if(aZ==null||aY==null){continue}if(aZ<=aY&&aZ<aQ.min){if(aY<aQ.min){continue}aK=(aQ.min-aZ)/(aY-aZ)*(aJ-aK)+aK;aZ=aQ.min}else{if(aY<=aZ&&aY<aQ.min){if(aZ<aQ.min){continue}aJ=(aQ.min-aZ)/(aY-aZ)*(aJ-aK)+aK;aY=aQ.min}}if(aZ>=aY&&aZ>aQ.max){if(aY>aQ.max){continue}aK=(aQ.max-aZ)/(aY-aZ)*(aJ-aK)+aK;aZ=aQ.max}else{if(aY>=aZ&&aY>aQ.max){if(aZ>aQ.max){continue}aJ=(aQ.max-aZ)/(aY-aZ)*(aJ-aK)+aK;aY=aQ.max}}if(!aT){H.beginPath();H.moveTo(aQ.p2c(aZ),aP.p2c(aN));aT=true}if(aK>=aP.max&&aJ>=aP.max){H.lineTo(aQ.p2c(aZ),aP.p2c(aP.max));H.lineTo(aQ.p2c(aY),aP.p2c(aP.max));continue}else{if(aK<=aP.min&&aJ<=aP.min){H.lineTo(aQ.p2c(aZ),aP.p2c(aP.min));H.lineTo(aQ.p2c(aY),aP.p2c(aP.min));continue}}var aO=aZ,aS=aY;if(aK<=aJ&&aK<aP.min&&aJ>=aP.min){aZ=(aP.min-aK)/(aJ-aK)*(aY-aZ)+aZ;aK=aP.min}else{if(aJ<=aK&&aJ<aP.min&&aK>=aP.min){aY=(aP.min-aK)/(aJ-aK)*(aY-aZ)+aZ;aJ=aP.min}}if(aK>=aJ&&aK>aP.max&&aJ<=aP.max){aZ=(aP.max-aK)/(aJ-aK)*(aY-aZ)+aZ;aK=aP.max}else{if(aJ>=aK&&aJ>aP.max&&aK<=aP.max){aY=(aP.max-aK)/(aJ-aK)*(aY-aZ)+aZ;aJ=aP.max}}if(aZ!=aO){H.lineTo(aQ.p2c(aO),aP.p2c(aK))}H.lineTo(aQ.p2c(aZ),aP.p2c(aK));H.lineTo(aQ.p2c(aY),aP.p2c(aJ));if(aY!=aS){H.lineTo(aQ.p2c(aY),aP.p2c(aJ));H.lineTo(aQ.p2c(aS),aP.p2c(aJ))}}}H.save();H.translate(q.left,q.top);H.lineJoin="round";var aG=aE.lines.lineWidth,aB=aE.shadowSize;if(aG>0&&aB>0){H.lineWidth=aB;H.strokeStyle="rgba(0,0,0,0.1)";var aH=Math.PI/18;aD(aE.datapoints,Math.sin(aH)*(aG/2+aB/2),Math.cos(aH)*(aG/2+aB/2),aE.xaxis,aE.yaxis);H.lineWidth=aB/2;aD(aE.datapoints,Math.sin(aH)*(aG/2+aB/4),Math.cos(aH)*(aG/2+aB/4),aE.xaxis,aE.yaxis)}H.lineWidth=aG;H.strokeStyle=aE.color;var aC=ae(aE.lines,aE.color,0,w);if(aC){H.fillStyle=aC;aF(aE.datapoints,aE.xaxis,aE.yaxis)}if(aG>0){aD(aE.datapoints,0,0,aE.xaxis,aE.yaxis)}H.restore()}function ao(aE){function aH(aN,aM,aU,aK,aS,aT,aQ,aJ){var aR=aN.points,aI=aN.pointsize;for(var aL=0;aL<aR.length;aL+=aI){var aP=aR[aL],aO=aR[aL+1];if(aP==null||aP<aT.min||aP>aT.max||aO<aQ.min||aO>aQ.max){continue}H.beginPath();aP=aT.p2c(aP);aO=aQ.p2c(aO)+aK;if(aJ=="circle"){H.arc(aP,aO,aM,0,aS?Math.PI:Math.PI*2,false)}else{aJ(H,aP,aO,aM,aS)}H.closePath();if(aU){H.fillStyle=aU;H.fill()}H.stroke()}}H.save();H.translate(q.left,q.top);var aG=aE.points.lineWidth,aC=aE.shadowSize,aB=aE.points.radius,aF=aE.points.symbol;if(aG>0&&aC>0){var aD=aC/2;H.lineWidth=aD;H.strokeStyle="rgba(0,0,0,0.1)";aH(aE.datapoints,aB,null,aD+aD/2,true,aE.xaxis,aE.yaxis,aF);H.strokeStyle="rgba(0,0,0,0.2)";aH(aE.datapoints,aB,null,aD/2,true,aE.xaxis,aE.yaxis,aF)}H.lineWidth=aG;H.strokeStyle=aE.color;aH(aE.datapoints,aB,ae(aE.points,aE.color),0,false,aE.xaxis,aE.yaxis,aF);H.restore()}function E(aN,aM,aV,aI,aQ,aF,aD,aL,aK,aU,aR,aC){var aE,aT,aJ,aP,aG,aB,aO,aH,aS;if(aR){aH=aB=aO=true;aG=false;aE=aV;aT=aN;aP=aM+aI;aJ=aM+aQ;if(aT<aE){aS=aT;aT=aE;aE=aS;aG=true;aB=false}}else{aG=aB=aO=true;aH=false;aE=aN+aI;aT=aN+aQ;aJ=aV;aP=aM;if(aP<aJ){aS=aP;aP=aJ;aJ=aS;aH=true;aO=false}}if(aT<aL.min||aE>aL.max||aP<aK.min||aJ>aK.max){return}if(aE<aL.min){aE=aL.min;aG=false}if(aT>aL.max){aT=aL.max;aB=false}if(aJ<aK.min){aJ=aK.min;aH=false}if(aP>aK.max){aP=aK.max;aO=false}aE=aL.p2c(aE);aJ=aK.p2c(aJ);aT=aL.p2c(aT);aP=aK.p2c(aP);if(aD){aU.beginPath();aU.moveTo(aE,aJ);aU.lineTo(aE,aP);aU.lineTo(aT,aP);aU.lineTo(aT,aJ);aU.fillStyle=aD(aJ,aP);aU.fill()}if(aC>0&&(aG||aB||aO||aH)){aU.beginPath();aU.moveTo(aE,aJ+aF);if(aG){aU.lineTo(aE,aP+aF)}else{aU.moveTo(aE,aP+aF)}if(aO){aU.lineTo(aT,aP+aF)}else{aU.moveTo(aT,aP+aF)}if(aB){aU.lineTo(aT,aJ+aF)}else{aU.moveTo(aT,aJ+aF)}if(aH){aU.lineTo(aE,aJ+aF)}else{aU.moveTo(aE,aJ+aF)}aU.stroke()}}function e(aD){function aC(aJ,aI,aL,aG,aK,aN,aM){var aO=aJ.points,aF=aJ.pointsize;for(var aH=0;aH<aO.length;aH+=aF){if(aO[aH]==null){continue}E(aO[aH],aO[aH+1],aO[aH+2],aI,aL,aG,aK,aN,aM,H,aD.bars.horizontal,aD.bars.lineWidth)}}H.save();H.translate(q.left,q.top);H.lineWidth=aD.bars.lineWidth;H.strokeStyle=aD.color;var aB=aD.bars.align=="left"?0:-aD.bars.barWidth/2;var aE=aD.bars.fill?function(aF,aG){return ae(aD.bars,aD.color,aF,aG)}:null;aC(aD.datapoints,aB,aB+aD.bars.barWidth,0,aE,aD.xaxis,aD.yaxis);H.restore()}function ae(aD,aB,aC,aF){var aE=aD.fill;if(!aE){return null}if(aD.fillColor){return am(aD.fillColor,aC,aF,aB)}var aG=c.color.parse(aB);aG.a=typeof aE=="number"?aE:0.4;aG.normalize();return aG.toString()}function o(){av.find(".legend").remove();if(!O.legend.show){return}var aH=[],aF=false,aN=O.legend.labelFormatter,aM,aJ;for(var aE=0;aE<Q.length;++aE){aM=Q[aE];aJ=aM.label;if(!aJ){continue}if(aE%O.legend.noColumns==0){if(aF){aH.push("</tr>")}aH.push("<tr>");aF=true}if(aN){aJ=aN(aJ,aM)}aH.push('<td class="legendColorBox"><div style="border:1px solid '+O.legend.labelBoxBorderColor+';padding:1px"><div style="width:4px;height:0;border:5px solid '+aM.color+';overflow:hidden"></div></div></td><td class="legendLabel">'+aJ+"</td>")}if(aF){aH.push("</tr>")}if(aH.length==0){return}var aL='<table style="font-size:smaller;color:'+O.grid.color+'">'+aH.join("")+"</table>";if(O.legend.container!=null){c(O.legend.container).html(aL)}else{var aI="",aC=O.legend.position,aD=O.legend.margin;if(aD[0]==null){aD=[aD,aD]}if(aC.charAt(0)=="n"){aI+="top:"+(aD[1]+q.top)+"px;"}else{if(aC.charAt(0)=="s"){aI+="bottom:"+(aD[1]+q.bottom)+"px;"}}if(aC.charAt(1)=="e"){aI+="right:"+(aD[0]+q.right)+"px;"}else{if(aC.charAt(1)=="w"){aI+="left:"+(aD[0]+q.left)+"px;"}}var aK=c('<div class="legend">'+aL.replace('style="','style="position:absolute;'+aI+";")+"</div>").appendTo(av);if(O.legend.backgroundOpacity!=0){var aG=O.legend.backgroundColor;if(aG==null){aG=O.grid.backgroundColor;if(aG&&typeof aG=="string"){aG=c.color.parse(aG)}else{aG=c.color.extract(aK,"background-color")}aG.a=1;aG=aG.toString()}var aB=aK.children();c('<div style="position:absolute;width:'+aB.width()+"px;height:"+aB.height()+"px;"+aI+"background-color:"+aG+';"> </div>').prependTo(aK).css("opacity",O.legend.backgroundOpacity)}}}var ab=[],M=null;function K(aI,aG,aD){var aO=O.grid.mouseActiveRadius,a0=aO*aO+1,aY=null,aR=false,aW,aU;for(aW=Q.length-1;aW>=0;--aW){if(!aD(Q[aW])){continue}var aP=Q[aW],aH=aP.xaxis,aF=aP.yaxis,aV=aP.datapoints.points,aT=aP.datapoints.pointsize,aQ=aH.c2p(aI),aN=aF.c2p(aG),aC=aO/aH.scale,aB=aO/aF.scale;if(aH.options.inverseTransform){aC=Number.MAX_VALUE}if(aF.options.inverseTransform){aB=Number.MAX_VALUE}if(aP.lines.show||aP.points.show){for(aU=0;aU<aV.length;aU+=aT){var aK=aV[aU],aJ=aV[aU+1];if(aK==null){continue}if(aK-aQ>aC||aK-aQ<-aC||aJ-aN>aB||aJ-aN<-aB){continue}var aM=Math.abs(aH.p2c(aK)-aI),aL=Math.abs(aF.p2c(aJ)-aG),aS=aM*aM+aL*aL;if(aS<a0){a0=aS;aY=[aW,aU/aT]}}}if(aP.bars.show&&!aY){var aE=aP.bars.align=="left"?0:-aP.bars.barWidth/2,aX=aE+aP.bars.barWidth;for(aU=0;aU<aV.length;aU+=aT){var aK=aV[aU],aJ=aV[aU+1],aZ=aV[aU+2];if(aK==null){continue}if(Q[aW].bars.horizontal?(aQ<=Math.max(aZ,aK)&&aQ>=Math.min(aZ,aK)&&aN>=aJ+aE&&aN<=aJ+aX):(aQ>=aK+aE&&aQ<=aK+aX&&aN>=Math.min(aZ,aJ)&&aN<=Math.max(aZ,aJ))){aY=[aW,aU/aT]}}}}if(aY){aW=aY[0];aU=aY[1];aT=Q[aW].datapoints.pointsize;return{datapoint:Q[aW].datapoints.points.slice(aU*aT,(aU+1)*aT),dataIndex:aU,series:Q[aW],seriesIndex:aW}}return null}function aa(aB){if(O.grid.hoverable){u("plothover",aB,function(aC){return aC.hoverable!=false})}}function l(aB){if(O.grid.hoverable){u("plothover",aB,function(aC){return false})}}function R(aB){u("plotclick",aB,function(aC){return aC.clickable!=false})}function u(aC,aB,aD){var aE=y.offset(),aH=aB.pageX-aE.left-q.left,aF=aB.pageY-aE.top-q.top,aJ=C({left:aH,top:aF});aJ.pageX=aB.pageX;aJ.pageY=aB.pageY;var aK=K(aH,aF,aD);if(aK){aK.pageX=parseInt(aK.series.xaxis.p2c(aK.datapoint[0])+aE.left+q.left);aK.pageY=parseInt(aK.series.yaxis.p2c(aK.datapoint[1])+aE.top+q.top)}if(O.grid.autoHighlight){for(var aG=0;aG<ab.length;++aG){var aI=ab[aG];if(aI.auto==aC&&!(aK&&aI.series==aK.series&&aI.point[0]==aK.datapoint[0]&&aI.point[1]==aK.datapoint[1])){T(aI.series,aI.point)}}if(aK){x(aK.series,aK.datapoint,aC)}}av.trigger(aC,[aJ,aK])}function f(){if(!M){M=setTimeout(s,30)}}function s(){M=null;A.save();A.clearRect(0,0,G,I);A.translate(q.left,q.top);var aC,aB;for(aC=0;aC<ab.length;++aC){aB=ab[aC];if(aB.series.bars.show){v(aB.series,aB.point)}else{ay(aB.series,aB.point)}}A.restore();an(ak.drawOverlay,[A])}function x(aD,aB,aF){if(typeof aD=="number"){aD=Q[aD]}if(typeof aB=="number"){var aE=aD.datapoints.pointsize;aB=aD.datapoints.points.slice(aE*aB,aE*(aB+1))}var aC=al(aD,aB);if(aC==-1){ab.push({series:aD,point:aB,auto:aF});f()}else{if(!aF){ab[aC].auto=false}}}function T(aD,aB){if(aD==null&&aB==null){ab=[];f()}if(typeof aD=="number"){aD=Q[aD]}if(typeof aB=="number"){aB=aD.data[aB]}var aC=al(aD,aB);if(aC!=-1){ab.splice(aC,1);f()}}function al(aD,aE){for(var aB=0;aB<ab.length;++aB){var aC=ab[aB];if(aC.series==aD&&aC.point[0]==aE[0]&&aC.point[1]==aE[1]){return aB}}return -1}function ay(aE,aD){var aC=aD[0],aI=aD[1],aH=aE.xaxis,aG=aE.yaxis;if(aC<aH.min||aC>aH.max||aI<aG.min||aI>aG.max){return}var aF=aE.points.radius+aE.points.lineWidth/2;A.lineWidth=aF;A.strokeStyle=c.color.parse(aE.color).scale("a",0.5).toString();var aB=1.5*aF,aC=aH.p2c(aC),aI=aG.p2c(aI);A.beginPath();if(aE.points.symbol=="circle"){A.arc(aC,aI,aB,0,2*Math.PI,false)}else{aE.points.symbol(A,aC,aI,aB,false)}A.closePath();A.stroke()}function v(aE,aB){A.lineWidth=aE.bars.lineWidth;A.strokeStyle=c.color.parse(aE.color).scale("a",0.5).toString();var aD=c.color.parse(aE.color).scale("a",0.5).toString();var aC=aE.bars.align=="left"?0:-aE.bars.barWidth/2;E(aB[0],aB[1],aB[2]||0,aC,aC+aE.bars.barWidth,0,function(){return aD},aE.xaxis,aE.yaxis,A,aE.bars.horizontal,aE.bars.lineWidth)}function am(aJ,aB,aH,aC){if(typeof aJ=="string"){return aJ}else{var aI=H.createLinearGradient(0,aH,0,aB);for(var aE=0,aD=aJ.colors.length;aE<aD;++aE){var aF=aJ.colors[aE];if(typeof aF!="string"){var aG=c.color.parse(aC);if(aF.brightness!=null){aG=aG.scale("rgb",aF.brightness)}if(aF.opacity!=null){aG.a*=aF.opacity}aF=aG.toString()}aI.addColorStop(aE/(aD-1),aF)}return aI}}}c.plot=function(g,e,d){var f=new b(c(g),e,d,c.plot.plugins);return f};c.plot.version="0.7";c.plot.plugins=[];c.plot.formatDate=function(l,f,h){var o=function(d){d=""+d;return d.length==1?"0"+d:d};var e=[];var p=false,j=false;var n=l.getUTCHours();var k=n<12;if(h==null){h=["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"]}if(f.search(/%p|%P/)!=-1){if(n>12){n=n-12}else{if(n==0){n=12}}}for(var g=0;g<f.length;++g){var m=f.charAt(g);if(p){switch(m){case"h":m=""+n;break;case"H":m=o(n);break;case"M":m=o(l.getUTCMinutes());break;case"S":m=o(l.getUTCSeconds());break;case"d":m=""+l.getUTCDate();break;case"m":m=""+(l.getUTCMonth()+1);break;case"y":m=""+l.getUTCFullYear();break;case"b":m=""+h[l.getUTCMonth()];break;case"p":m=(k)?("am"):("pm");break;case"P":m=(k)?("AM"):("PM");break;case"0":m="";j=true;break}if(m&&j){m=o(m);j=false}e.push(m);if(!j){p=false}}else{if(m=="%"){p=true}else{e.push(m)}}}return e.join("")};function a(e,d){return d*Math.floor(e/d)}})(jQuery);
--- /dev/null
+++ b/js/flot/jquery.flot.navigate.js
@@ -1,1 +1,337 @@
-
+/*
+Flot plugin for adding panning and zooming capabilities to a plot.
+
+The default behaviour is double click and scrollwheel up/down to zoom
+in, drag to pan. The plugin defines plot.zoom({ center }),
+plot.zoomOut() and plot.pan(offset) so you easily can add custom
+controls. It also fires a "plotpan" and "plotzoom" event when
+something happens, useful for synchronizing plots.
+
+Options:
+
+ zoom: {
+ interactive: false
+ trigger: "dblclick" // or "click" for single click
+ amount: 1.5 // 2 = 200% (zoom in), 0.5 = 50% (zoom out)
+ }
+
+ pan: {
+ interactive: false
+ cursor: "move" // CSS mouse cursor value used when dragging, e.g. "pointer"
+ frameRate: 20
+ }
+
+ xaxis, yaxis, x2axis, y2axis: {
+ zoomRange: null // or [number, number] (min range, max range) or false
+ panRange: null // or [number, number] (min, max) or false
+ }
+
+"interactive" enables the built-in drag/click behaviour. If you enable
+interactive for pan, then you'll have a basic plot that supports
+moving around; the same for zoom.
+
+"amount" specifies the default amount to zoom in (so 1.5 = 150%)
+relative to the current viewport.
+
+"cursor" is a standard CSS mouse cursor string used for visual
+feedback to the user when dragging.
+
+"frameRate" specifies the maximum number of times per second the plot
+will update itself while the user is panning around on it (set to null
+to disable intermediate pans, the plot will then not update until the
+mouse button is released).
+
+"zoomRange" is the interval in which zooming can happen, e.g. with
+zoomRange: [1, 100] the zoom will never scale the axis so that the
+difference between min and max is smaller than 1 or larger than 100.
+You can set either end to null to ignore, e.g. [1, null]. If you set
+zoomRange to false, zooming on that axis will be disabled.
+
+"panRange" confines the panning to stay within a range, e.g. with
+panRange: [-10, 20] panning stops at -10 in one end and at 20 in the
+other. Either can be null, e.g. [-10, null]. If you set
+panRange to false, panning on that axis will be disabled.
+
+Example API usage:
+
+ plot = $.plot(...);
+
+ // zoom default amount in on the pixel (10, 20)
+ plot.zoom({ center: { left: 10, top: 20 } });
+
+ // zoom out again
+ plot.zoomOut({ center: { left: 10, top: 20 } });
+
+ // zoom 200% in on the pixel (10, 20)
+ plot.zoom({ amount: 2, center: { left: 10, top: 20 } });
+
+ // pan 100 pixels to the left and 20 down
+ plot.pan({ left: -100, top: 20 })
+
+Here, "center" specifies where the center of the zooming should
+happen. Note that this is defined in pixel space, not the space of the
+data points (you can use the p2c helpers on the axes in Flot to help
+you convert between these).
+
+"amount" is the amount to zoom the viewport relative to the current
+range, so 1 is 100% (i.e. no change), 1.5 is 150% (zoom in), 0.7 is
+70% (zoom out). You can set the default in the options.
+
+*/
+
+
+// First two dependencies, jquery.event.drag.js and
+// jquery.mousewheel.js, we put them inline here to save people the
+// effort of downloading them.
+
+/*
+jquery.event.drag.js ~ v1.5 ~ Copyright (c) 2008, Three Dub Media (http://threedubmedia.com)
+Licensed under the MIT License ~ http://threedubmedia.googlecode.com/files/MIT-LICENSE.txt
+*/
+(function(E){E.fn.drag=function(L,K,J){if(K){this.bind("dragstart",L)}if(J){this.bind("dragend",J)}return !L?this.trigger("drag"):this.bind("drag",K?K:L)};var A=E.event,B=A.special,F=B.drag={not:":input",distance:0,which:1,dragging:false,setup:function(J){J=E.extend({distance:F.distance,which:F.which,not:F.not},J||{});J.distance=I(J.distance);A.add(this,"mousedown",H,J);if(this.attachEvent){this.attachEvent("ondragstart",D)}},teardown:function(){A.remove(this,"mousedown",H);if(this===F.dragging){F.dragging=F.proxy=false}G(this,true);if(this.detachEvent){this.detachEvent("ondragstart",D)}}};B.dragstart=B.dragend={setup:function(){},teardown:function(){}};function H(L){var K=this,J,M=L.data||{};if(M.elem){K=L.dragTarget=M.elem;L.dragProxy=F.proxy||K;L.cursorOffsetX=M.pageX-M.left;L.cursorOffsetY=M.pageY-M.top;L.offsetX=L.pageX-L.cursorOffsetX;L.offsetY=L.pageY-L.cursorOffsetY}else{if(F.dragging||(M.which>0&&L.which!=M.which)||E(L.target).is(M.not)){return }}switch(L.type){case"mousedown":E.extend(M,E(K).offset(),{elem:K,target:L.target,pageX:L.pageX,pageY:L.pageY});A.add(document,"mousemove mouseup",H,M);G(K,false);F.dragging=null;return false;case !F.dragging&&"mousemove":if(I(L.pageX-M.pageX)+I(L.pageY-M.pageY)<M.distance){break}L.target=M.target;J=C(L,"dragstart",K);if(J!==false){F.dragging=K;F.proxy=L.dragProxy=E(J||K)[0]}case"mousemove":if(F.dragging){J=C(L,"drag",K);if(B.drop){B.drop.allowed=(J!==false);B.drop.handler(L)}if(J!==false){break}L.type="mouseup"}case"mouseup":A.remove(document,"mousemove mouseup",H);if(F.dragging){if(B.drop){B.drop.handler(L)}C(L,"dragend",K)}G(K,true);F.dragging=F.proxy=M.elem=false;break}return true}function C(M,K,L){M.type=K;var J=E.event.handle.call(L,M);return J===false?false:J||M.result}function I(J){return Math.pow(J,2)}function D(){return(F.dragging===false)}function G(K,J){if(!K){return }K.unselectable=J?"off":"on";K.onselectstart=function(){return J};if(K.style){K.style.MozUserSelect=J?"":"none"}}})(jQuery);
+
+
+/* jquery.mousewheel.min.js
+ * Copyright (c) 2009 Brandon Aaron (http://brandonaaron.net)
+ * Dual licensed under the MIT (http://www.opensource.org/licenses/mit-license.php)
+ * and GPL (http://www.opensource.org/licenses/gpl-license.php) licenses.
+ * Thanks to: http://adomas.org/javascript-mouse-wheel/ for some pointers.
+ * Thanks to: Mathias Bank(http://www.mathias-bank.de) for a scope bug fix.
+ *
+ * Version: 3.0.2
+ *
+ * Requires: 1.2.2+
+ */
+(function(c){var a=["DOMMouseScroll","mousewheel"];c.event.special.mousewheel={setup:function(){if(this.addEventListener){for(var d=a.length;d;){this.addEventListener(a[--d],b,false)}}else{this.onmousewheel=b}},teardown:function(){if(this.removeEventListener){for(var d=a.length;d;){this.removeEventListener(a[--d],b,false)}}else{this.onmousewheel=null}}};c.fn.extend({mousewheel:function(d){return d?this.bind("mousewheel",d):this.trigger("mousewheel")},unmousewheel:function(d){return this.unbind("mousewheel",d)}});function b(f){var d=[].slice.call(arguments,1),g=0,e=true;f=c.event.fix(f||window.event);f.type="mousewheel";if(f.wheelDelta){g=f.wheelDelta/120}if(f.detail){g=-f.detail/3}d.unshift(f,g);return c.event.handle.apply(this,d)}})(jQuery);
+
+
+
+
+(function ($) {
+ var options = {
+ xaxis: {
+ zoomRange: null, // or [number, number] (min range, max range)
+ panRange: null // or [number, number] (min, max)
+ },
+ zoom: {
+ interactive: false,
+ trigger: "dblclick", // or "click" for single click
+ amount: 1.5 // how much to zoom relative to current position, 2 = 200% (zoom in), 0.5 = 50% (zoom out)
+ },
+ pan: {
+ interactive: false,
+ cursor: "move",
+ frameRate: 20
+ }
+ };
+
+ function init(plot) {
+ function onZoomClick(e, zoomOut) {
+ var c = plot.offset();
+ c.left = e.pageX - c.left;
+ c.top = e.pageY - c.top;
+ if (zoomOut)
+ plot.zoomOut({ center: c });
+ else
+ plot.zoom({ center: c });
+ }
+
+ function onMouseWheel(e, delta) {
+ onZoomClick(e, delta < 0);
+ return false;
+ }
+
+ var prevCursor = 'default', prevPageX = 0, prevPageY = 0,
+ panTimeout = null;
+
+ function onDragStart(e) {
+ if (e.which != 1) // only accept left-click
+ return false;
+ var c = plot.getPlaceholder().css('cursor');
+ if (c)
+ prevCursor = c;
+ plot.getPlaceholder().css('cursor', plot.getOptions().pan.cursor);
+ prevPageX = e.pageX;
+ prevPageY = e.pageY;
+ }
+
+ function onDrag(e) {
+ var frameRate = plot.getOptions().pan.frameRate;
+ if (panTimeout || !frameRate)
+ return;
+
+ panTimeout = setTimeout(function () {
+ plot.pan({ left: prevPageX - e.pageX,
+ top: prevPageY - e.pageY });
+ prevPageX = e.pageX;
+ prevPageY = e.pageY;
+
+ panTimeout = null;
+ }, 1 / frameRate * 1000);
+ }
+
+ function onDragEnd(e) {
+ if (panTimeout) {
+ clearTimeout(panTimeout);
+ panTimeout = null;
+ }
+
+ plot.getPlaceholder().css('cursor', prevCursor);
+ plot.pan({ left: prevPageX - e.pageX,
+ top: prevPageY - e.pageY });
+ }
+
+ function bindEvents(plot, eventHolder) {
+ var o = plot.getOptions();
+ if (o.zoom.interactive) {
+ eventHolder[o.zoom.trigger](onZoomClick);
+ eventHolder.mousewheel(onMouseWheel);
+ }
+
+ if (o.pan.interactive) {
+ eventHolder.bind("dragstart", { distance: 10 }, onDragStart);
+ eventHolder.bind("drag", onDrag);
+ eventHolder.bind("dragend", onDragEnd);
+ }
+ }
+
+ plot.zoomOut = function (args) {
+ if (!args)
+ args = {};
+
+ if (!args.amount)
+ args.amount = plot.getOptions().zoom.amount
+
+ args.amount = 1 / args.amount;
+ plot.zoom(args);
+ }
+
+ plot.zoom = function (args) {
+ if (!args)
+ args = {};
+
+ var c = args.center,
+ amount = args.amount || plot.getOptions().zoom.amount,
+ w = plot.width(), h = plot.height();
+
+ if (!c)
+ c = { left: w / 2, top: h / 2 };
+
+ var xf = c.left / w,
+ yf = c.top / h,
+ minmax = {
+ x: {
+ min: c.left - xf * w / amount,
+ max: c.left + (1 - xf) * w / amount
+ },
+ y: {
+ min: c.top - yf * h / amount,
+ max: c.top + (1 - yf) * h / amount
+ }
+ };
+
+ $.each(plot.getAxes(), function(_, axis) {
+ var opts = axis.options,
+ min = minmax[axis.direction].min,
+ max = minmax[axis.direction].max,
+ zr = opts.zoomRange;
+
+ if (zr === false) // no zooming on this axis
+ return;
+
+ min = axis.c2p(min);
+ max = axis.c2p(max);
+ if (min > max) {
+ // make sure min < max
+ var tmp = min;
+ min = max;
+ max = tmp;
+ }
+
+ var range = max - min;
+ if (zr &&
+ ((zr[0] != null && range < zr[0]) ||
+ (zr[1] != null && range > zr[1])))
+ return;
+
+ opts.min = min;
+ opts.max = max;
+ });
+
+ plot.setupGrid();
+ plot.draw();
+
+ if (!args.preventEvent)
+ plot.getPlaceholder().trigger("plotzoom", [ plot ]);
+ }
+
+ plot.pan = function (args) {
+ var delta = {
+ x: +args.left,
+ y: +args.top
+ };
+
+ if (isNaN(delta.x))
+ delta.x = 0;
+ if (isNaN(delta.y))
+ delta.y = 0;
+
+ $.each(plot.getAxes(), function (_, axis) {
+ var opts = axis.options,
+ min, max, d = delta[axis.direction];
+
+ min = axis.c2p(axis.p2c(axis.min) + d),
+ max = axis.c2p(axis.p2c(axis.max) + d);
+
+ var pr = opts.panRange;
+ if (pr === false) // no panning on this axis
+ return;
+
+ if (pr) {
+ // check whether we hit the wall
+ if (pr[0] != null && pr[0] > min) {
+ d = pr[0] - min;
+ min += d;
+ max += d;
+ }
+
+ if (pr[1] != null && pr[1] < max) {
+ d = pr[1] - max;
+ min += d;
+ max += d;
+ }
+ }
+
+ opts.min = min;
+ opts.max = max;
+ });
+
+ plot.setupGrid();
+ plot.draw();
+
+ if (!args.preventEvent)
+ plot.getPlaceholder().trigger("plotpan", [ plot ]);
+ }
+
+ function shutdown(plot, eventHolder) {
+ eventHolder.unbind(plot.getOptions().zoom.trigger, onZoomClick);
+ eventHolder.unbind("mousewheel", onMouseWheel);
+ eventHolder.unbind("dragstart", onDragStart);
+ eventHolder.unbind("drag", onDrag);
+ eventHolder.unbind("dragend", onDragEnd);
+ if (panTimeout)
+ clearTimeout(panTimeout);
+ }
+
+ plot.hooks.bindEvents.push(bindEvents);
+ plot.hooks.shutdown.push(shutdown);
+ }
+
+ $.plot.plugins.push({
+ init: init,
+ options: options,
+ name: 'navigate',
+ version: '1.3'
+ });
+})(jQuery);
+
--- /dev/null
+++ b/js/flot/jquery.flot.navigate.min.js
@@ -1,1 +1,1 @@
-
+(function(i){i.fn.drag=function(j,k,l){if(k){this.bind("dragstart",j)}if(l){this.bind("dragend",l)}return !j?this.trigger("drag"):this.bind("drag",k?k:j)};var d=i.event,c=d.special,h=c.drag={not:":input",distance:0,which:1,dragging:false,setup:function(j){j=i.extend({distance:h.distance,which:h.which,not:h.not},j||{});j.distance=e(j.distance);d.add(this,"mousedown",f,j);if(this.attachEvent){this.attachEvent("ondragstart",a)}},teardown:function(){d.remove(this,"mousedown",f);if(this===h.dragging){h.dragging=h.proxy=false}g(this,true);if(this.detachEvent){this.detachEvent("ondragstart",a)}}};c.dragstart=c.dragend={setup:function(){},teardown:function(){}};function f(j){var k=this,l,m=j.data||{};if(m.elem){k=j.dragTarget=m.elem;j.dragProxy=h.proxy||k;j.cursorOffsetX=m.pageX-m.left;j.cursorOffsetY=m.pageY-m.top;j.offsetX=j.pageX-j.cursorOffsetX;j.offsetY=j.pageY-j.cursorOffsetY}else{if(h.dragging||(m.which>0&&j.which!=m.which)||i(j.target).is(m.not)){return}}switch(j.type){case"mousedown":i.extend(m,i(k).offset(),{elem:k,target:j.target,pageX:j.pageX,pageY:j.pageY});d.add(document,"mousemove mouseup",f,m);g(k,false);h.dragging=null;return false;case !h.dragging&&"mousemove":if(e(j.pageX-m.pageX)+e(j.pageY-m.pageY)<m.distance){break}j.target=m.target;l=b(j,"dragstart",k);if(l!==false){h.dragging=k;h.proxy=j.dragProxy=i(l||k)[0]}case"mousemove":if(h.dragging){l=b(j,"drag",k);if(c.drop){c.drop.allowed=(l!==false);c.drop.handler(j)}if(l!==false){break}j.type="mouseup"}case"mouseup":d.remove(document,"mousemove mouseup",f);if(h.dragging){if(c.drop){c.drop.handler(j)}b(j,"dragend",k)}g(k,true);h.dragging=h.proxy=m.elem=false;break}return true}function b(m,k,j){m.type=k;var l=i.event.handle.call(j,m);return l===false?false:l||m.result}function e(j){return Math.pow(j,2)}function a(){return(h.dragging===false)}function g(j,k){if(!j){return}j.unselectable=k?"off":"on";j.onselectstart=function(){return k};if(j.style){j.style.MozUserSelect=k?"":"none"}}})(jQuery);(function(f){var e=["DOMMouseScroll","mousewheel"];f.event.special.mousewheel={setup:function(){if(this.addEventListener){for(var a=e.length;a;){this.addEventListener(e[--a],d,false)}}else{this.onmousewheel=d}},teardown:function(){if(this.removeEventListener){for(var a=e.length;a;){this.removeEventListener(e[--a],d,false)}}else{this.onmousewheel=null}}};f.fn.extend({mousewheel:function(a){return a?this.bind("mousewheel",a):this.trigger("mousewheel")},unmousewheel:function(a){return this.unbind("mousewheel",a)}});function d(b){var h=[].slice.call(arguments,1),a=0,c=true;b=f.event.fix(b||window.event);b.type="mousewheel";if(b.wheelDelta){a=b.wheelDelta/120}if(b.detail){a=-b.detail/3}h.unshift(b,a);return f.event.handle.apply(this,h)}})(jQuery);(function(b){var a={xaxis:{zoomRange:null,panRange:null},zoom:{interactive:false,trigger:"dblclick",amount:1.5},pan:{interactive:false,cursor:"move",frameRate:20}};function c(o){function m(q,p){var r=o.offset();r.left=q.pageX-r.left;r.top=q.pageY-r.top;if(p){o.zoomOut({center:r})}else{o.zoom({center:r})}}function d(p,q){m(p,q<0);return false}var i="default",g=0,e=0,n=null;function f(p){if(p.which!=1){return false}var q=o.getPlaceholder().css("cursor");if(q){i=q}o.getPlaceholder().css("cursor",o.getOptions().pan.cursor);g=p.pageX;e=p.pageY}function j(q){var p=o.getOptions().pan.frameRate;if(n||!p){return}n=setTimeout(function(){o.pan({left:g-q.pageX,top:e-q.pageY});g=q.pageX;e=q.pageY;n=null},1/p*1000)}function h(p){if(n){clearTimeout(n);n=null}o.getPlaceholder().css("cursor",i);o.pan({left:g-p.pageX,top:e-p.pageY})}function l(q,p){var r=q.getOptions();if(r.zoom.interactive){p[r.zoom.trigger](m);p.mousewheel(d)}if(r.pan.interactive){p.bind("dragstart",{distance:10},f);p.bind("drag",j);p.bind("dragend",h)}}o.zoomOut=function(p){if(!p){p={}}if(!p.amount){p.amount=o.getOptions().zoom.amount}p.amount=1/p.amount;o.zoom(p)};o.zoom=function(q){if(!q){q={}}var x=q.center,r=q.amount||o.getOptions().zoom.amount,p=o.width(),t=o.height();if(!x){x={left:p/2,top:t/2}}var s=x.left/p,v=x.top/t,u={x:{min:x.left-s*p/r,max:x.left+(1-s)*p/r},y:{min:x.top-v*t/r,max:x.top+(1-v)*t/r}};b.each(o.getAxes(),function(z,C){var D=C.options,B=u[C.direction].min,w=u[C.direction].max,E=D.zoomRange;if(E===false){return}B=C.c2p(B);w=C.c2p(w);if(B>w){var A=B;B=w;w=A}var y=w-B;if(E&&((E[0]!=null&&y<E[0])||(E[1]!=null&&y>E[1]))){return}D.min=B;D.max=w});o.setupGrid();o.draw();if(!q.preventEvent){o.getPlaceholder().trigger("plotzoom",[o])}};o.pan=function(p){var q={x:+p.left,y:+p.top};if(isNaN(q.x)){q.x=0}if(isNaN(q.y)){q.y=0}b.each(o.getAxes(),function(s,u){var v=u.options,t,r,w=q[u.direction];t=u.c2p(u.p2c(u.min)+w),r=u.c2p(u.p2c(u.max)+w);var x=v.panRange;if(x===false){return}if(x){if(x[0]!=null&&x[0]>t){w=x[0]-t;t+=w;r+=w}if(x[1]!=null&&x[1]<r){w=x[1]-r;t+=w;r+=w}}v.min=t;v.max=r});o.setupGrid();o.draw();if(!p.preventEvent){o.getPlaceholder().trigger("plotpan",[o])}};function k(q,p){p.unbind(q.getOptions().zoom.trigger,m);p.unbind("mousewheel",d);p.unbind("dragstart",f);p.unbind("drag",j);p.unbind("dragend",h);if(n){clearTimeout(n)}}o.hooks.bindEvents.push(l);o.hooks.shutdown.push(k)}b.plot.plugins.push({init:c,options:a,name:"navigate",version:"1.3"})})(jQuery);
--- /dev/null
+++ b/js/flot/jquery.flot.pie.js
@@ -1,1 +1,751 @@
+/*
+Flot plugin for rendering pie charts. The plugin assumes the data is
+coming is as a single data value for each series, and each of those
+values is a positive value or zero (negative numbers don't make
+any sense and will cause strange effects). The data values do
+NOT need to be passed in as percentage values because it
+internally calculates the total and percentages.
+
+* Created by Brian Medendorp, June 2009
+* Updated November 2009 with contributions from: btburnett3, Anthony Aragues and Xavi Ivars
+
+* Changes:
+ 2009-10-22: lineJoin set to round
+ 2009-10-23: IE full circle fix, donut
+ 2009-11-11: Added basic hover from btburnett3 - does not work in IE, and center is off in Chrome and Opera
+ 2009-11-17: Added IE hover capability submitted by Anthony Aragues
+ 2009-11-18: Added bug fix submitted by Xavi Ivars (issues with arrays when other JS libraries are included as well)
+
+
+Available options are:
+series: {
+ pie: {
+ show: true/false
+ radius: 0-1 for percentage of fullsize, or a specified pixel length, or 'auto'
+ innerRadius: 0-1 for percentage of fullsize or a specified pixel length, for creating a donut effect
+ startAngle: 0-2 factor of PI used for starting angle (in radians) i.e 3/2 starts at the top, 0 and 2 have the same result
+ tilt: 0-1 for percentage to tilt the pie, where 1 is no tilt, and 0 is completely flat (nothing will show)
+ offset: {
+ top: integer value to move the pie up or down
+ left: integer value to move the pie left or right, or 'auto'
+ },
+ stroke: {
+ color: any hexidecimal color value (other formats may or may not work, so best to stick with something like '#FFF')
+ width: integer pixel width of the stroke
+ },
+ label: {
+ show: true/false, or 'auto'
+ formatter: a user-defined function that modifies the text/style of the label text
+ radius: 0-1 for percentage of fullsize, or a specified pixel length
+ background: {
+ color: any hexidecimal color value (other formats may or may not work, so best to stick with something like '#000')
+ opacity: 0-1
+ },
+ threshold: 0-1 for the percentage value at which to hide labels (if they're too small)
+ },
+ combine: {
+ threshold: 0-1 for the percentage value at which to combine slices (if they're too small)
+ color: any hexidecimal color value (other formats may or may not work, so best to stick with something like '#CCC'), if null, the plugin will automatically use the color of the first slice to be combined
+ label: any text value of what the combined slice should be labeled
+ }
+ highlight: {
+ opacity: 0-1
+ }
+ }
+}
+
+More detail and specific examples can be found in the included HTML file.
+
+*/
+
+(function ($)
+{
+ function init(plot) // this is the "body" of the plugin
+ {
+ var canvas = null;
+ var target = null;
+ var maxRadius = null;
+ var centerLeft = null;
+ var centerTop = null;
+ var total = 0;
+ var redraw = true;
+ var redrawAttempts = 10;
+ var shrink = 0.95;
+ var legendWidth = 0;
+ var processed = false;
+ var raw = false;
+
+ // interactive variables
+ var highlights = [];
+
+ // add hook to determine if pie plugin in enabled, and then perform necessary operations
+ plot.hooks.processOptions.push(checkPieEnabled);
+ plot.hooks.bindEvents.push(bindEvents);
+
+ // check to see if the pie plugin is enabled
+ function checkPieEnabled(plot, options)
+ {
+ if (options.series.pie.show)
+ {
+ //disable grid
+ options.grid.show = false;
+
+ // set labels.show
+ if (options.series.pie.label.show=='auto')
+ if (options.legend.show)
+ options.series.pie.label.show = false;
+ else
+ options.series.pie.label.show = true;
+
+ // set radius
+ if (options.series.pie.radius=='auto')
+ if (options.series.pie.label.show)
+ options.series.pie.radius = 3/4;
+ else
+ options.series.pie.radius = 1;
+
+ // ensure sane tilt
+ if (options.series.pie.tilt>1)
+ options.series.pie.tilt=1;
+ if (options.series.pie.tilt<0)
+ options.series.pie.tilt=0;
+
+ // add processData hook to do transformations on the data
+ plot.hooks.processDatapoints.push(processDatapoints);
+ plot.hooks.drawOverlay.push(drawOverlay);
+
+ // add draw hook
+ plot.hooks.draw.push(draw);
+ }
+ }
+
+ // bind hoverable events
+ function bindEvents(plot, eventHolder)
+ {
+ var options = plot.getOptions();
+
+ if (options.series.pie.show && options.grid.hoverable)
+ eventHolder.unbind('mousemove').mousemove(onMouseMove);
+
+ if (options.series.pie.show && options.grid.clickable)
+ eventHolder.unbind('click').click(onClick);
+ }
+
+
+ // debugging function that prints out an object
+ function alertObject(obj)
+ {
+ var msg = '';
+ function traverse(obj, depth)
+ {
+ if (!depth)
+ depth = 0;
+ for (var i = 0; i < obj.length; ++i)
+ {
+ for (var j=0; j<depth; j++)
+ msg += '\t';
+
+ if( typeof obj[i] == "object")
+ { // its an object
+ msg += ''+i+':\n';
+ traverse(obj[i], depth+1);
+ }
+ else
+ { // its a value
+ msg += ''+i+': '+obj[i]+'\n';
+ }
+ }
+ }
+ traverse(obj);
+ alert(msg);
+ }
+
+ function calcTotal(data)
+ {
+ for (var i = 0; i < data.length; ++i)
+ {
+ var item = parseFloat(data[i].data[0][1]);
+ if (item)
+ total += item;
+ }
+ }
+
+ function processDatapoints(plot, series, data, datapoints)
+ {
+ if (!processed)
+ {
+ processed = true;
+
+ canvas = plot.getCanvas();
+ target = $(canvas).parent();
+ options = plot.getOptions();
+
+ plot.setData(combine(plot.getData()));
+ }
+ }
+
+ function setupPie()
+ {
+ legendWidth = target.children().filter('.legend').children().width();
+
+ // calculate maximum radius and center point
+ maxRadius = Math.min(canvas.width,(canvas.height/options.series.pie.tilt))/2;
+ centerTop = (canvas.height/2)+options.series.pie.offset.top;
+ centerLeft = (canvas.width/2);
+
+ if (options.series.pie.offset.left=='auto')
+ if (options.legend.position.match('w'))
+ centerLeft += legendWidth/2;
+ else
+ centerLeft -= legendWidth/2;
+ else
+ centerLeft += options.series.pie.offset.left;
+
+ if (centerLeft<maxRadius)
+ centerLeft = maxRadius;
+ else if (centerLeft>canvas.width-maxRadius)
+ centerLeft = canvas.width-maxRadius;
+ }
+
+ function fixData(data)
+ {
+ for (var i = 0; i < data.length; ++i)
+ {
+ if (typeof(data[i].data)=='number')
+ data[i].data = [[1,data[i].data]];
+ else if (typeof(data[i].data)=='undefined' || typeof(data[i].data[0])=='undefined')
+ {
+ if (typeof(data[i].data)!='undefined' && typeof(data[i].data.label)!='undefined')
+ data[i].label = data[i].data.label; // fix weirdness coming from flot
+ data[i].data = [[1,0]];
+
+ }
+ }
+ return data;
+ }
+
+ function combine(data)
+ {
+ data = fixData(data);
+ calcTotal(data);
+ var combined = 0;
+ var numCombined = 0;
+ var color = options.series.pie.combine.color;
+
+ var newdata = [];
+ for (var i = 0; i < data.length; ++i)
+ {
+ // make sure its a number
+ data[i].data[0][1] = parseFloat(data[i].data[0][1]);
+ if (!data[i].data[0][1])
+ data[i].data[0][1] = 0;
+
+ if (data[i].data[0][1]/total<=options.series.pie.combine.threshold)
+ {
+ combined += data[i].data[0][1];
+ numCombined++;
+ if (!color)
+ color = data[i].color;
+ }
+ else
+ {
+ newdata.push({
+ data: [[1,data[i].data[0][1]]],
+ color: data[i].color,
+ label: data[i].label,
+ angle: (data[i].data[0][1]*(Math.PI*2))/total,
+ percent: (data[i].data[0][1]/total*100)
+ });
+ }
+ }
+ if (numCombined>0)
+ newdata.push({
+ data: [[1,combined]],
+ color: color,
+ label: options.series.pie.combine.label,
+ angle: (combined*(Math.PI*2))/total,
+ percent: (combined/total*100)
+ });
+ return newdata;
+ }
+
+ function draw(plot, newCtx)
+ {
+ if (!target) return; // if no series were passed
+ ctx = newCtx;
+
+ setupPie();
+ var slices = plot.getData();
+
+ var attempts = 0;
+ while (redraw && attempts<redrawAttempts)
+ {
+ redraw = false;
+ if (attempts>0)
+ maxRadius *= shrink;
+ attempts += 1;
+ clear();
+ if (options.series.pie.tilt<=0.8)
+ drawShadow();
+ drawPie();
+ }
+ if (attempts >= redrawAttempts) {
+ clear();
+ target.prepend('<div class="error">Could not draw pie with labels contained inside canvas</div>');
+ }
+
+ if ( plot.setSeries && plot.insertLegend )
+ {
+ plot.setSeries(slices);
+ plot.insertLegend();
+ }
+
+ // we're actually done at this point, just defining internal functions at this point
+
+ function clear()
+ {
+ ctx.clearRect(0,0,canvas.width,canvas.height);
+ target.children().filter('.pieLabel, .pieLabelBackground').remove();
+ }
+
+ function drawShadow()
+ {
+ var shadowLeft = 5;
+ var shadowTop = 15;
+ var edge = 10;
+ var alpha = 0.02;
+
+ // set radius
+ if (options.series.pie.radius>1)
+ var radius = options.series.pie.radius;
+ else
+ var radius = maxRadius * options.series.pie.radius;
+
+ if (radius>=(canvas.width/2)-shadowLeft || radius*options.series.pie.tilt>=(canvas.height/2)-shadowTop || radius<=edge)
+ return; // shadow would be outside canvas, so don't draw it
+
+ ctx.save();
+ ctx.translate(shadowLeft,shadowTop);
+ ctx.globalAlpha = alpha;
+ ctx.fillStyle = '#000';
+
+ // center and rotate to starting position
+ ctx.translate(centerLeft,centerTop);
+ ctx.scale(1, options.series.pie.tilt);
+
+ //radius -= edge;
+ for (var i=1; i<=edge; i++)
+ {
+ ctx.beginPath();
+ ctx.arc(0,0,radius,0,Math.PI*2,false);
+ ctx.fill();
+ radius -= i;
+ }
+
+ ctx.restore();
+ }
+
+ function drawPie()
+ {
+ startAngle = Math.PI*options.series.pie.startAngle;
+
+ // set radius
+ if (options.series.pie.radius>1)
+ var radius = options.series.pie.radius;
+ else
+ var radius = maxRadius * options.series.pie.radius;
+
+ // center and rotate to starting position
+ ctx.save();
+ ctx.translate(centerLeft,centerTop);
+ ctx.scale(1, options.series.pie.tilt);
+ //ctx.rotate(startAngle); // start at top; -- This doesn't work properly in Opera
+
+ // draw slices
+ ctx.save();
+ var currentAngle = startAngle;
+ for (var i = 0; i < slices.length; ++i)
+ {
+ slices[i].startAngle = currentAngle;
+ drawSlice(slices[i].angle, slices[i].color, true);
+ }
+ ctx.restore();
+
+ // draw slice outlines
+ ctx.save();
+ ctx.lineWidth = options.series.pie.stroke.width;
+ currentAngle = startAngle;
+ for (var i = 0; i < slices.length; ++i)
+ drawSlice(slices[i].angle, options.series.pie.stroke.color, false);
+ ctx.restore();
+
+ // draw donut hole
+ drawDonutHole(ctx);
+
+ // draw labels
+ if (options.series.pie.label.show)
+ drawLabels();
+
+ // restore to original state
+ ctx.restore();
+
+ function drawSlice(angle, color, fill)
+ {
+ if (angle<=0)
+ return;
+
+ if (fill)
+ ctx.fillStyle = color;
+ else
+ {
+ ctx.strokeStyle = color;
+ ctx.lineJoin = 'round';
+ }
+
+ ctx.beginPath();
+ if (Math.abs(angle - Math.PI*2) > 0.000000001)
+ ctx.moveTo(0,0); // Center of the pie
+ else if ($.browser.msie)
+ angle -= 0.0001;
+ //ctx.arc(0,0,radius,0,angle,false); // This doesn't work properly in Opera
+ ctx.arc(0,0,radius,currentAngle,currentAngle+angle,false);
+ ctx.closePath();
+ //ctx.rotate(angle); // This doesn't work properly in Opera
+ currentAngle += angle;
+
+ if (fill)
+ ctx.fill();
+ else
+ ctx.stroke();
+ }
+
+ function drawLabels()
+ {
+ var currentAngle = startAngle;
+
+ // set radius
+ if (options.series.pie.label.radius>1)
+ var radius = options.series.pie.label.radius;
+ else
+ var radius = maxRadius * options.series.pie.label.radius;
+
+ for (var i = 0; i < slices.length; ++i)
+ {
+ if (slices[i].percent >= options.series.pie.label.threshold*100)
+ drawLabel(slices[i], currentAngle, i);
+ currentAngle += slices[i].angle;
+ }
+
+ function drawLabel(slice, startAngle, index)
+ {
+ if (slice.data[0][1]==0)
+ return;
+
+ // format label text
+ var lf = options.legend.labelFormatter, text, plf = options.series.pie.label.formatter;
+ if (lf)
+ text = lf(slice.label, slice);
+ else
+ text = slice.label;
+ if (plf)
+ text = plf(text, slice);
+
+ var halfAngle = ((startAngle+slice.angle) + startAngle)/2;
+ var x = centerLeft + Math.round(Math.cos(halfAngle) * radius);
+ var y = centerTop + Math.round(Math.sin(halfAngle) * radius) * options.series.pie.tilt;
+
+ var html = '<span class="pieLabel" id="pieLabel'+index+'" style="position:absolute;top:' + y + 'px;left:' + x + 'px;">' + text + "</span>";
+ target.append(html);
+ var label = target.children('#pieLabel'+index);
+ var labelTop = (y - label.height()/2);
+ var labelLeft = (x - label.width()/2);
+ label.css('top', labelTop);
+ label.css('left', labelLeft);
+
+ // check to make sure that the label is not outside the canvas
+ if (0-labelTop>0 || 0-labelLeft>0 || canvas.height-(labelTop+label.height())<0 || canvas.width-(labelLeft+label.width())<0)
+ redraw = true;
+
+ if (options.series.pie.label.background.opacity != 0) {
+ // put in the transparent background separately to avoid blended labels and label boxes
+ var c = options.series.pie.label.background.color;
+ if (c == null) {
+ c = slice.color;
+ }
+ var pos = 'top:'+labelTop+'px;left:'+labelLeft+'px;';
+ $('<div class="pieLabelBackground" style="position:absolute;width:' + label.width() + 'px;height:' + label.height() + 'px;' + pos +'background-color:' + c + ';"> </div>').insertBefore(label).css('opacity', options.series.pie.label.background.opacity);
+ }
+ } // end individual label function
+ } // end drawLabels function
+ } // end drawPie function
+ } // end draw function
+
+ // Placed here because it needs to be accessed from multiple locations
+ function drawDonutHole(layer)
+ {
+ // draw donut hole
+ if(options.series.pie.innerRadius > 0)
+ {
+ // subtract the center
+ layer.save();
+ innerRadius = options.series.pie.innerRadius > 1 ? options.series.pie.innerRadius : maxRadius * options.series.pie.innerRadius;
+ layer.globalCompositeOperation = 'destination-out'; // this does not work with excanvas, but it will fall back to using the stroke color
+ layer.beginPath();
+ layer.fillStyle = options.series.pie.stroke.color;
+ layer.arc(0,0,innerRadius,0,Math.PI*2,false);
+ layer.fill();
+ layer.closePath();
+ layer.restore();
+
+ // add inner stroke
+ layer.save();
+ layer.beginPath();
+ layer.strokeStyle = options.series.pie.stroke.color;
+ layer.arc(0,0,innerRadius,0,Math.PI*2,false);
+ layer.stroke();
+ layer.closePath();
+ layer.restore();
+ // TODO: add extra shadow inside hole (with a mask) if the pie is tilted.
+ }
+ }
+
+ //-- Additional Interactive related functions --
+
+ function isPointInPoly(poly, pt)
+ {
+ for(var c = false, i = -1, l = poly.length, j = l - 1; ++i < l; j = i)
+ ((poly[i][1] <= pt[1] && pt[1] < poly[j][1]) || (poly[j][1] <= pt[1] && pt[1]< poly[i][1]))
+ && (pt[0] < (poly[j][0] - poly[i][0]) * (pt[1] - poly[i][1]) / (poly[j][1] - poly[i][1]) + poly[i][0])
+ && (c = !c);
+ return c;
+ }
+
+ function findNearbySlice(mouseX, mouseY)
+ {
+ var slices = plot.getData(),
+ options = plot.getOptions(),
+ radius = options.series.pie.radius > 1 ? options.series.pie.radius : maxRadius * options.series.pie.radius;
+
+ for (var i = 0; i < slices.length; ++i)
+ {
+ var s = slices[i];
+
+ if(s.pie.show)
+ {
+ ctx.save();
+ ctx.beginPath();
+ ctx.moveTo(0,0); // Center of the pie
+ //ctx.scale(1, options.series.pie.tilt); // this actually seems to break everything when here.
+ ctx.arc(0,0,radius,s.startAngle,s.startAngle+s.angle,false);
+ ctx.closePath();
+ x = mouseX-centerLeft;
+ y = mouseY-centerTop;
+ if(ctx.isPointInPath)
+ {
+ if (ctx.isPointInPath(mouseX-centerLeft, mouseY-centerTop))
+ {
+ //alert('found slice!');
+ ctx.restore();
+ return {datapoint: [s.percent, s.data], dataIndex: 0, series: s, seriesIndex: i};
+ }
+ }
+ else
+ {
+ // excanvas for IE doesn;t support isPointInPath, this is a workaround.
+ p1X = (radius * Math.cos(s.startAngle));
+ p1Y = (radius * Math.sin(s.startAngle));
+ p2X = (radius * Math.cos(s.startAngle+(s.angle/4)));
+ p2Y = (radius * Math.sin(s.startAngle+(s.angle/4)));
+ p3X = (radius * Math.cos(s.startAngle+(s.angle/2)));
+ p3Y = (radius * Math.sin(s.startAngle+(s.angle/2)));
+ p4X = (radius * Math.cos(s.startAngle+(s.angle/1.5)));
+ p4Y = (radius * Math.sin(s.startAngle+(s.angle/1.5)));
+ p5X = (radius * Math.cos(s.startAngle+s.angle));
+ p5Y = (radius * Math.sin(s.startAngle+s.angle));
+ arrPoly = [[0,0],[p1X,p1Y],[p2X,p2Y],[p3X,p3Y],[p4X,p4Y],[p5X,p5Y]];
+ arrPoint = [x,y];
+ // TODO: perhaps do some mathmatical trickery here with the Y-coordinate to compensate for pie tilt?
+ if(isPointInPoly(arrPoly, arrPoint))
+ {
+ ctx.restore();
+ return {datapoint: [s.percent, s.data], dataIndex: 0, series: s, seriesIndex: i};
+ }
+ }
+ ctx.restore();
+ }
+ }
+
+ return null;
+ }
+
+ function onMouseMove(e)
+ {
+ triggerClickHoverEvent('plothover', e);
+ }
+
+ function onClick(e)
+ {
+ triggerClickHoverEvent('plotclick', e);
+ }
+
+ // trigger click or hover event (they send the same parameters so we share their code)
+ function triggerClickHoverEvent(eventname, e)
+ {
+ var offset = plot.offset(),
+ canvasX = parseInt(e.pageX - offset.left),
+ canvasY = parseInt(e.pageY - offset.top),
+ item = findNearbySlice(canvasX, canvasY);
+
+ if (options.grid.autoHighlight)
+ {
+ // clear auto-highlights
+ for (var i = 0; i < highlights.length; ++i)
+ {
+ var h = highlights[i];
+ if (h.auto == eventname && !(item && h.series == item.series))
+ unhighlight(h.series);
+ }
+ }
+
+ // highlight the slice
+ if (item)
+ highlight(item.series, eventname);
+
+ // trigger any hover bind events
+ var pos = { pageX: e.pageX, pageY: e.pageY };
+ target.trigger(eventname, [ pos, item ]);
+ }
+
+ function highlight(s, auto)
+ {
+ if (typeof s == "number")
+ s = series[s];
+
+ var i = indexOfHighlight(s);
+ if (i == -1)
+ {
+ highlights.push({ series: s, auto: auto });
+ plot.triggerRedrawOverlay();
+ }
+ else if (!auto)
+ highlights[i].auto = false;
+ }
+
+ function unhighlight(s)
+ {
+ if (s == null)
+ {
+ highlights = [];
+ plot.triggerRedrawOverlay();
+ }
+
+ if (typeof s == "number")
+ s = series[s];
+
+ var i = indexOfHighlight(s);
+ if (i != -1)
+ {
+ highlights.splice(i, 1);
+ plot.triggerRedrawOverlay();
+ }
+ }
+
+ function indexOfHighlight(s)
+ {
+ for (var i = 0; i < highlights.length; ++i)
+ {
+ var h = highlights[i];
+ if (h.series == s)
+ return i;
+ }
+ return -1;
+ }
+
+ function drawOverlay(plot, octx)
+ {
+ //alert(options.series.pie.radius);
+ var options = plot.getOptions();
+ //alert(options.series.pie.radius);
+
+ var radius = options.series.pie.radius > 1 ? options.series.pie.radius : maxRadius * options.series.pie.radius;
+
+ octx.save();
+ octx.translate(centerLeft, centerTop);
+ octx.scale(1, options.series.pie.tilt);
+
+ for (i = 0; i < highlights.length; ++i)
+ drawHighlight(highlights[i].series);
+
+ drawDonutHole(octx);
+
+ octx.restore();
+
+ function drawHighlight(series)
+ {
+ if (series.angle < 0) return;
+
+ //octx.fillStyle = parseColor(options.series.pie.highlight.color).scale(null, null, null, options.series.pie.highlight.opacity).toString();
+ octx.fillStyle = "rgba(255, 255, 255, "+options.series.pie.highlight.opacity+")"; // this is temporary until we have access to parseColor
+
+ octx.beginPath();
+ if (Math.abs(series.angle - Math.PI*2) > 0.000000001)
+ octx.moveTo(0,0); // Center of the pie
+ octx.arc(0,0,radius,series.startAngle,series.startAngle+series.angle,false);
+ octx.closePath();
+ octx.fill();
+ }
+
+ }
+
+ } // end init (plugin body)
+
+ // define pie specific options and their default values
+ var options = {
+ series: {
+ pie: {
+ show: false,
+ radius: 'auto', // actual radius of the visible pie (based on full calculated radius if <=1, or hard pixel value)
+ innerRadius:0, /* for donut */
+ startAngle: 3/2,
+ tilt: 1,
+ offset: {
+ top: 0,
+ left: 'auto'
+ },
+ stroke: {
+ color: '#FFF',
+ width: 1
+ },
+ label: {
+ show: 'auto',
+ formatter: function(label, slice){
+ return '<div style="font-size:x-small;text-align:center;padding:2px;color:'+slice.color+';">'+label+'<br/>'+Math.round(slice.percent)+'%</div>';
+ }, // formatter function
+ radius: 1, // radius at which to place the labels (based on full calculated radius if <=1, or hard pixel value)
+ background: {
+ color: null,
+ opacity: 0
+ },
+ threshold: 0 // percentage at which to hide the label (i.e. the slice is too narrow)
+ },
+ combine: {
+ threshold: -1, // percentage at which to combine little slices into one larger slice
+ color: null, // color to give the new slice (auto-generated if null)
+ label: 'Other' // label to give the new slice
+ },
+ highlight: {
+ //color: '#FFF', // will add this functionality once parseColor is available
+ opacity: 0.5
+ }
+ }
+ }
+ };
+
+ $.plot.plugins.push({
+ init: init,
+ options: options,
+ name: "pie",
+ version: "1.0"
+ });
+})(jQuery);
--- /dev/null
+++ b/js/flot/jquery.flot.pie.min.js
@@ -1,1 +1,1 @@
-
+(function(b){function c(D){var h=null;var L=null;var n=null;var B=null;var p=null;var M=0;var F=true;var o=10;var w=0.95;var A=0;var d=false;var z=false;var j=[];D.hooks.processOptions.push(g);D.hooks.bindEvents.push(e);function g(O,N){if(N.series.pie.show){N.grid.show=false;if(N.series.pie.label.show=="auto"){if(N.legend.show){N.series.pie.label.show=false}else{N.series.pie.label.show=true}}if(N.series.pie.radius=="auto"){if(N.series.pie.label.show){N.series.pie.radius=3/4}else{N.series.pie.radius=1}}if(N.series.pie.tilt>1){N.series.pie.tilt=1}if(N.series.pie.tilt<0){N.series.pie.tilt=0}O.hooks.processDatapoints.push(E);O.hooks.drawOverlay.push(H);O.hooks.draw.push(r)}}function e(P,N){var O=P.getOptions();if(O.series.pie.show&&O.grid.hoverable){N.unbind("mousemove").mousemove(t)}if(O.series.pie.show&&O.grid.clickable){N.unbind("click").click(l)}}function G(O){var P="";function N(S,T){if(!T){T=0}for(var R=0;R<S.length;++R){for(var Q=0;Q<T;Q++){P+="\t"}if(typeof S[R]=="object"){P+=""+R+":\n";N(S[R],T+1)}else{P+=""+R+": "+S[R]+"\n"}}}N(O);alert(P)}function q(P){for(var N=0;N<P.length;++N){var O=parseFloat(P[N].data[0][1]);if(O){M+=O}}}function E(Q,N,O,P){if(!d){d=true;h=Q.getCanvas();L=b(h).parent();a=Q.getOptions();Q.setData(K(Q.getData()))}}function I(){A=L.children().filter(".legend").children().width();n=Math.min(h.width,(h.height/a.series.pie.tilt))/2;p=(h.height/2)+a.series.pie.offset.top;B=(h.width/2);if(a.series.pie.offset.left=="auto"){if(a.legend.position.match("w")){B+=A/2}else{B-=A/2}}else{B+=a.series.pie.offset.left}if(B<n){B=n}else{if(B>h.width-n){B=h.width-n}}}function v(O){for(var N=0;N<O.length;++N){if(typeof(O[N].data)=="number"){O[N].data=[[1,O[N].data]]}else{if(typeof(O[N].data)=="undefined"||typeof(O[N].data[0])=="undefined"){if(typeof(O[N].data)!="undefined"&&typeof(O[N].data.label)!="undefined"){O[N].label=O[N].data.label}O[N].data=[[1,0]]}}}return O}function K(Q){Q=v(Q);q(Q);var P=0;var S=0;var N=a.series.pie.combine.color;var R=[];for(var O=0;O<Q.length;++O){Q[O].data[0][1]=parseFloat(Q[O].data[0][1]);if(!Q[O].data[0][1]){Q[O].data[0][1]=0}if(Q[O].data[0][1]/M<=a.series.pie.combine.threshold){P+=Q[O].data[0][1];S++;if(!N){N=Q[O].color}}else{R.push({data:[[1,Q[O].data[0][1]]],color:Q[O].color,label:Q[O].label,angle:(Q[O].data[0][1]*(Math.PI*2))/M,percent:(Q[O].data[0][1]/M*100)})}}if(S>0){R.push({data:[[1,P]],color:N,label:a.series.pie.combine.label,angle:(P*(Math.PI*2))/M,percent:(P/M*100)})}return R}function r(S,Q){if(!L){return}ctx=Q;I();var T=S.getData();var P=0;while(F&&P<o){F=false;if(P>0){n*=w}P+=1;N();if(a.series.pie.tilt<=0.8){O()}R()}if(P>=o){N();L.prepend('<div class="error">Could not draw pie with labels contained inside canvas</div>')}if(S.setSeries&&S.insertLegend){S.setSeries(T);S.insertLegend()}function N(){ctx.clearRect(0,0,h.width,h.height);L.children().filter(".pieLabel, .pieLabelBackground").remove()}function O(){var Z=5;var Y=15;var W=10;var X=0.02;if(a.series.pie.radius>1){var U=a.series.pie.radius}else{var U=n*a.series.pie.radius}if(U>=(h.width/2)-Z||U*a.series.pie.tilt>=(h.height/2)-Y||U<=W){return}ctx.save();ctx.translate(Z,Y);ctx.globalAlpha=X;ctx.fillStyle="#000";ctx.translate(B,p);ctx.scale(1,a.series.pie.tilt);for(var V=1;V<=W;V++){ctx.beginPath();ctx.arc(0,0,U,0,Math.PI*2,false);ctx.fill();U-=V}ctx.restore()}function R(){startAngle=Math.PI*a.series.pie.startAngle;if(a.series.pie.radius>1){var U=a.series.pie.radius}else{var U=n*a.series.pie.radius}ctx.save();ctx.translate(B,p);ctx.scale(1,a.series.pie.tilt);ctx.save();var Y=startAngle;for(var W=0;W<T.length;++W){T[W].startAngle=Y;X(T[W].angle,T[W].color,true)}ctx.restore();ctx.save();ctx.lineWidth=a.series.pie.stroke.width;Y=startAngle;for(var W=0;W<T.length;++W){X(T[W].angle,a.series.pie.stroke.color,false)}ctx.restore();J(ctx);if(a.series.pie.label.show){V()}ctx.restore();function X(ab,Z,aa){if(ab<=0){return}if(aa){ctx.fillStyle=Z}else{ctx.strokeStyle=Z;ctx.lineJoin="round"}ctx.beginPath();if(Math.abs(ab-Math.PI*2)>1e-9){ctx.moveTo(0,0)}else{if(b.browser.msie){ab-=0.0001}}ctx.arc(0,0,U,Y,Y+ab,false);ctx.closePath();Y+=ab;if(aa){ctx.fill()}else{ctx.stroke()}}function V(){var ac=startAngle;if(a.series.pie.label.radius>1){var Z=a.series.pie.label.radius}else{var Z=n*a.series.pie.label.radius}for(var ab=0;ab<T.length;++ab){if(T[ab].percent>=a.series.pie.label.threshold*100){aa(T[ab],ac,ab)}ac+=T[ab].angle}function aa(ap,ai,ag){if(ap.data[0][1]==0){return}var ar=a.legend.labelFormatter,aq,ae=a.series.pie.label.formatter;if(ar){aq=ar(ap.label,ap)}else{aq=ap.label}if(ae){aq=ae(aq,ap)}var aj=((ai+ap.angle)+ai)/2;var ao=B+Math.round(Math.cos(aj)*Z);var am=p+Math.round(Math.sin(aj)*Z)*a.series.pie.tilt;var af='<span class="pieLabel" id="pieLabel'+ag+'" style="position:absolute;top:'+am+"px;left:"+ao+'px;">'+aq+"</span>";L.append(af);var an=L.children("#pieLabel"+ag);var ad=(am-an.height()/2);var ah=(ao-an.width()/2);an.css("top",ad);an.css("left",ah);if(0-ad>0||0-ah>0||h.height-(ad+an.height())<0||h.width-(ah+an.width())<0){F=true}if(a.series.pie.label.background.opacity!=0){var ak=a.series.pie.label.background.color;if(ak==null){ak=ap.color}var al="top:"+ad+"px;left:"+ah+"px;";b('<div class="pieLabelBackground" style="position:absolute;width:'+an.width()+"px;height:"+an.height()+"px;"+al+"background-color:"+ak+';"> </div>').insertBefore(an).css("opacity",a.series.pie.label.background.opacity)}}}}}function J(N){if(a.series.pie.innerRadius>0){N.save();innerRadius=a.series.pie.innerRadius>1?a.series.pie.innerRadius:n*a.series.pie.innerRadius;N.globalCompositeOperation="destination-out";N.beginPath();N.fillStyle=a.series.pie.stroke.color;N.arc(0,0,innerRadius,0,Math.PI*2,false);N.fill();N.closePath();N.restore();N.save();N.beginPath();N.strokeStyle=a.series.pie.stroke.color;N.arc(0,0,innerRadius,0,Math.PI*2,false);N.stroke();N.closePath();N.restore()}}function s(Q,R){for(var S=false,P=-1,N=Q.length,O=N-1;++P<N;O=P){((Q[P][1]<=R[1]&&R[1]<Q[O][1])||(Q[O][1]<=R[1]&&R[1]<Q[P][1]))&&(R[0]<(Q[O][0]-Q[P][0])*(R[1]-Q[P][1])/(Q[O][1]-Q[P][1])+Q[P][0])&&(S=!S)}return S}function u(R,P){var T=D.getData(),O=D.getOptions(),N=O.series.pie.radius>1?O.series.pie.radius:n*O.series.pie.radius;for(var Q=0;Q<T.length;++Q){var S=T[Q];if(S.pie.show){ctx.save();ctx.beginPath();ctx.moveTo(0,0);ctx.arc(0,0,N,S.startAngle,S.startAngle+S.angle,false);ctx.closePath();x=R-B;y=P-p;if(ctx.isPointInPath){if(ctx.isPointInPath(R-B,P-p)){ctx.restore();return{datapoint:[S.percent,S.data],dataIndex:0,series:S,seriesIndex:Q}}}else{p1X=(N*Math.cos(S.startAngle));p1Y=(N*Math.sin(S.startAngle));p2X=(N*Math.cos(S.startAngle+(S.angle/4)));p2Y=(N*Math.sin(S.startAngle+(S.angle/4)));p3X=(N*Math.cos(S.startAngle+(S.angle/2)));p3Y=(N*Math.sin(S.startAngle+(S.angle/2)));p4X=(N*Math.cos(S.startAngle+(S.angle/1.5)));p4Y=(N*Math.sin(S.startAngle+(S.angle/1.5)));p5X=(N*Math.cos(S.startAngle+S.angle));p5Y=(N*Math.sin(S.startAngle+S.angle));arrPoly=[[0,0],[p1X,p1Y],[p2X,p2Y],[p3X,p3Y],[p4X,p4Y],[p5X,p5Y]];arrPoint=[x,y];if(s(arrPoly,arrPoint)){ctx.restore();return{datapoint:[S.percent,S.data],dataIndex:0,series:S,seriesIndex:Q}}}ctx.restore()}}return null}function t(N){m("plothover",N)}function l(N){m("plotclick",N)}function m(N,T){var O=D.offset(),R=parseInt(T.pageX-O.left),P=parseInt(T.pageY-O.top),V=u(R,P);if(a.grid.autoHighlight){for(var Q=0;Q<j.length;++Q){var S=j[Q];if(S.auto==N&&!(V&&S.series==V.series)){f(S.series)}}}if(V){k(V.series,N)}var U={pageX:T.pageX,pageY:T.pageY};L.trigger(N,[U,V])}function k(O,P){if(typeof O=="number"){O=series[O]}var N=C(O);if(N==-1){j.push({series:O,auto:P});D.triggerRedrawOverlay()}else{if(!P){j[N].auto=false}}}function f(O){if(O==null){j=[];D.triggerRedrawOverlay()}if(typeof O=="number"){O=series[O]}var N=C(O);if(N!=-1){j.splice(N,1);D.triggerRedrawOverlay()}}function C(P){for(var N=0;N<j.length;++N){var O=j[N];if(O.series==P){return N}}return -1}function H(Q,R){var P=Q.getOptions();var N=P.series.pie.radius>1?P.series.pie.radius:n*P.series.pie.radius;R.save();R.translate(B,p);R.scale(1,P.series.pie.tilt);for(i=0;i<j.length;++i){O(j[i].series)}J(R);R.restore();function O(S){if(S.angle<0){return}R.fillStyle="rgba(255, 255, 255, "+P.series.pie.highlight.opacity+")";R.beginPath();if(Math.abs(S.angle-Math.PI*2)>1e-9){R.moveTo(0,0)}R.arc(0,0,N,S.startAngle,S.startAngle+S.angle,false);R.closePath();R.fill()}}}var a={series:{pie:{show:false,radius:"auto",innerRadius:0,startAngle:3/2,tilt:1,offset:{top:0,left:"auto"},stroke:{color:"#FFF",width:1},label:{show:"auto",formatter:function(d,e){return'<div style="font-size:x-small;text-align:center;padding:2px;color:'+e.color+';">'+d+"<br/>"+Math.round(e.percent)+"%</div>"},radius:1,background:{color:null,opacity:0},threshold:0},combine:{threshold:-1,color:null,label:"Other"},highlight:{opacity:0.5}}}};b.plot.plugins.push({init:c,options:a,name:"pie",version:"1.0"})})(jQuery);
--- /dev/null
+++ b/js/flot/jquery.flot.resize.js
@@ -1,1 +1,61 @@
+/*
+Flot plugin for automatically redrawing plots when the placeholder
+size changes, e.g. on window resizes.
+It works by listening for changes on the placeholder div (through the
+jQuery resize event plugin) - if the size changes, it will redraw the
+plot.
+
+There are no options. If you need to disable the plugin for some
+plots, you can just fix the size of their placeholders.
+*/
+
+
+/* Inline dependency:
+ * jQuery resize event - v1.1 - 3/14/2010
+ * http://benalman.com/projects/jquery-resize-plugin/
+ *
+ * Copyright (c) 2010 "Cowboy" Ben Alman
+ * Dual licensed under the MIT and GPL licenses.
+ * http://benalman.com/about/license/
+ */
+(function($,h,c){var a=$([]),e=$.resize=$.extend($.resize,{}),i,k="setTimeout",j="resize",d=j+"-special-event",b="delay",f="throttleWindow";e[b]=250;e[f]=true;$.event.special[j]={setup:function(){if(!e[f]&&this[k]){return false}var l=$(this);a=a.add(l);$.data(this,d,{w:l.width(),h:l.height()});if(a.length===1){g()}},teardown:function(){if(!e[f]&&this[k]){return false}var l=$(this);a=a.not(l);l.removeData(d);if(!a.length){clearTimeout(i)}},add:function(l){if(!e[f]&&this[k]){return false}var n;function m(s,o,p){var q=$(this),r=$.data(this,d);r.w=o!==c?o:q.width();r.h=p!==c?p:q.height();n.apply(this,arguments)}if($.isFunction(l)){n=l;return m}else{n=l.handler;l.handler=m}}};function g(){i=h[k](function(){a.each(function(){var n=$(this),m=n.width(),l=n.height(),o=$.data(this,d);if(m!==o.w||l!==o.h){n.trigger(j,[o.w=m,o.h=l])}});g()},e[b])}})(jQuery,this);
+
+
+(function ($) {
+ var options = { }; // no options
+
+ function init(plot) {
+ function onResize() {
+ var placeholder = plot.getPlaceholder();
+
+ // somebody might have hidden us and we can't plot
+ // when we don't have the dimensions
+ if (placeholder.width() == 0 || placeholder.height() == 0)
+ return;
+
+ plot.resize();
+ plot.setupGrid();
+ plot.draw();
+ }
+
+ function bindEvents(plot, eventHolder) {
+ plot.getPlaceholder().resize(onResize);
+ }
+
+ function shutdown(plot, eventHolder) {
+ plot.getPlaceholder().unbind("resize", onResize);
+ }
+
+ plot.hooks.bindEvents.push(bindEvents);
+ plot.hooks.shutdown.push(shutdown);
+ }
+
+ $.plot.plugins.push({
+ init: init,
+ options: options,
+ name: 'resize',
+ version: '1.0'
+ });
+})(jQuery);
+
--- /dev/null
+++ b/js/flot/jquery.flot.resize.min.js
@@ -1,1 +1,1 @@
-
+(function(n,p,u){var w=n([]),s=n.resize=n.extend(n.resize,{}),o,l="setTimeout",m="resize",t=m+"-special-event",v="delay",r="throttleWindow";s[v]=250;s[r]=true;n.event.special[m]={setup:function(){if(!s[r]&&this[l]){return false}var a=n(this);w=w.add(a);n.data(this,t,{w:a.width(),h:a.height()});if(w.length===1){q()}},teardown:function(){if(!s[r]&&this[l]){return false}var a=n(this);w=w.not(a);a.removeData(t);if(!w.length){clearTimeout(o)}},add:function(b){if(!s[r]&&this[l]){return false}var c;function a(d,h,g){var f=n(this),e=n.data(this,t);e.w=h!==u?h:f.width();e.h=g!==u?g:f.height();c.apply(this,arguments)}if(n.isFunction(b)){c=b;return a}else{c=b.handler;b.handler=a}}};function q(){o=p[l](function(){w.each(function(){var d=n(this),a=d.width(),b=d.height(),c=n.data(this,t);if(a!==c.w||b!==c.h){d.trigger(m,[c.w=a,c.h=b])}});q()},s[v])}})(jQuery,this);(function(b){var a={};function c(f){function e(){var h=f.getPlaceholder();if(h.width()==0||h.height()==0){return}f.resize();f.setupGrid();f.draw()}function g(i,h){i.getPlaceholder().resize(e)}function d(i,h){i.getPlaceholder().unbind("resize",e)}f.hooks.bindEvents.push(g);f.hooks.shutdown.push(d)}b.plot.plugins.push({init:c,options:a,name:"resize",version:"1.0"})})(jQuery);
--- /dev/null
+++ b/js/flot/jquery.flot.selection.js
@@ -1,1 +1,345 @@
-
+/*
+Flot plugin for selecting regions.
+
+The plugin defines the following options:
+
+ selection: {
+ mode: null or "x" or "y" or "xy",
+ color: color
+ }
+
+Selection support is enabled by setting the mode to one of "x", "y" or
+"xy". In "x" mode, the user will only be able to specify the x range,
+similarly for "y" mode. For "xy", the selection becomes a rectangle
+where both ranges can be specified. "color" is color of the selection
+(if you need to change the color later on, you can get to it with
+plot.getOptions().selection.color).
+
+When selection support is enabled, a "plotselected" event will be
+emitted on the DOM element you passed into the plot function. The
+event handler gets a parameter with the ranges selected on the axes,
+like this:
+
+ placeholder.bind("plotselected", function(event, ranges) {
+ alert("You selected " + ranges.xaxis.from + " to " + ranges.xaxis.to)
+ // similar for yaxis - with multiple axes, the extra ones are in
+ // x2axis, x3axis, ...
+ });
+
+The "plotselected" event is only fired when the user has finished
+making the selection. A "plotselecting" event is fired during the
+process with the same parameters as the "plotselected" event, in case
+you want to know what's happening while it's happening,
+
+A "plotunselected" event with no arguments is emitted when the user
+clicks the mouse to remove the selection.
+
+The plugin allso adds the following methods to the plot object:
+
+- setSelection(ranges, preventEvent)
+
+ Set the selection rectangle. The passed in ranges is on the same
+ form as returned in the "plotselected" event. If the selection mode
+ is "x", you should put in either an xaxis range, if the mode is "y"
+ you need to put in an yaxis range and both xaxis and yaxis if the
+ selection mode is "xy", like this:
+
+ setSelection({ xaxis: { from: 0, to: 10 }, yaxis: { from: 40, to: 60 } });
+
+ setSelection will trigger the "plotselected" event when called. If
+ you don't want that to happen, e.g. if you're inside a
+ "plotselected" handler, pass true as the second parameter. If you
+ are using multiple axes, you can specify the ranges on any of those,
+ e.g. as x2axis/x3axis/... instead of xaxis, the plugin picks the
+ first one it sees.
+
+- clearSelection(preventEvent)
+
+ Clear the selection rectangle. Pass in true to avoid getting a
+ "plotunselected" event.
+
+- getSelection()
+
+ Returns the current selection in the same format as the
+ "plotselected" event. If there's currently no selection, the
+ function returns null.
+
+*/
+
+(function ($) {
+ function init(plot) {
+ var selection = {
+ first: { x: -1, y: -1}, second: { x: -1, y: -1},
+ show: false,
+ active: false
+ };
+
+ // FIXME: The drag handling implemented here should be
+ // abstracted out, there's some similar code from a library in
+ // the navigation plugin, this should be massaged a bit to fit
+ // the Flot cases here better and reused. Doing this would
+ // make this plugin much slimmer.
+ var savedhandlers = {};
+
+ var mouseUpHandler = null;
+
+ function onMouseMove(e) {
+ if (selection.active) {
+ updateSelection(e);
+
+ plot.getPlaceholder().trigger("plotselecting", [ getSelection() ]);
+ }
+ }
+
+ function onMouseDown(e) {
+ if (e.which != 1) // only accept left-click
+ return;
+
+ // cancel out any text selections
+ document.body.focus();
+
+ // prevent text selection and drag in old-school browsers
+ if (document.onselectstart !== undefined && savedhandlers.onselectstart == null) {
+ savedhandlers.onselectstart = document.onselectstart;
+ document.onselectstart = function () { return false; };
+ }
+ if (document.ondrag !== undefined && savedhandlers.ondrag == null) {
+ savedhandlers.ondrag = document.ondrag;
+ document.ondrag = function () { return false; };
+ }
+
+ setSelectionPos(selection.first, e);
+
+ selection.active = true;
+
+ // this is a bit silly, but we have to use a closure to be
+ // able to whack the same handler again
+ mouseUpHandler = function (e) { onMouseUp(e); };
+
+ $(document).one("mouseup", mouseUpHandler);
+ }
+
+ function onMouseUp(e) {
+ mouseUpHandler = null;
+
+ // revert drag stuff for old-school browsers
+ if (document.onselectstart !== undefined)
+ document.onselectstart = savedhandlers.onselectstart;
+ if (document.ondrag !== undefined)
+ document.ondrag = savedhandlers.ondrag;
+
+ // no more dragging
+ selection.active = false;
+ updateSelection(e);
+
+ if (selectionIsSane())
+ triggerSelectedEvent();
+ else {
+ // this counts as a clear
+ plot.getPlaceholder().trigger("plotunselected", [ ]);
+ plot.getPlaceholder().trigger("plotselecting", [ null ]);
+ }
+
+ return false;
+ }
+
+ function getSelection() {
+ if (!selectionIsSane())
+ return null;
+
+ var r = {}, c1 = selection.first, c2 = selection.second;
+ $.each(plot.getAxes(), function (name, axis) {
+ if (axis.used) {
+ var p1 = axis.c2p(c1[axis.direction]), p2 = axis.c2p(c2[axis.direction]);
+ r[name] = { from: Math.min(p1, p2), to: Math.max(p1, p2) };
+ }
+ });
+ return r;
+ }
+
+ function triggerSelectedEvent() {
+ var r = getSelection();
+
+ plot.getPlaceholder().trigger("plotselected", [ r ]);
+
+ // backwards-compat stuff, to be removed in future
+ if (r.xaxis && r.yaxis)
+ plot.getPlaceholder().trigger("selected", [ { x1: r.xaxis.from, y1: r.yaxis.from, x2: r.xaxis.to, y2: r.yaxis.to } ]);
+ }
+
+ function clamp(min, value, max) {
+ return value < min ? min: (value > max ? max: value);
+ }
+
+ function setSelectionPos(pos, e) {
+ var o = plot.getOptions();
+ var offset = plot.getPlaceholder().offset();
+ var plotOffset = plot.getPlotOffset();
+ pos.x = clamp(0, e.pageX - offset.left - plotOffset.left, plot.width());
+ pos.y = clamp(0, e.pageY - offset.top - plotOffset.top, plot.height());
+
+ if (o.selection.mode == "y")
+ pos.x = pos == selection.first ? 0 : plot.width();
+
+ if (o.selection.mode == "x")
+ pos.y = pos == selection.first ? 0 : plot.height();
+ }
+
+ function updateSelection(pos) {
+ if (pos.pageX == null)
+ return;
+
+ setSelectionPos(selection.second, pos);
+ if (selectionIsSane()) {
+ selection.show = true;
+ plot.triggerRedrawOverlay();
+ }
+ else
+ clearSelection(true);
+ }
+
+ function clearSelection(preventEvent) {
+ if (selection.show) {
+ selection.show = false;
+ plot.triggerRedrawOverlay();
+ if (!preventEvent)
+ plot.getPlaceholder().trigger("plotunselected", [ ]);
+ }
+ }
+
+ // function taken from markings support in Flot
+ function extractRange(ranges, coord) {
+ var axis, from, to, key, axes = plot.getAxes();
+
+ for (var k in axes) {
+ axis = axes[k];
+ if (axis.direction == coord) {
+ key = coord + axis.n + "axis";
+ if (!ranges[key] && axis.n == 1)
+ key = coord + "axis"; // support x1axis as xaxis
+ if (ranges[key]) {
+ from = ranges[key].from;
+ to = ranges[key].to;
+ break;
+ }
+ }
+ }
+
+ // backwards-compat stuff - to be removed in future
+ if (!ranges[key]) {
+ axis = coord == "x" ? plot.getXAxes()[0] : plot.getYAxes()[0];
+ from = ranges[coord + "1"];
+ to = ranges[coord + "2"];
+ }
+
+ // auto-reverse as an added bonus
+ if (from != null && to != null && from > to) {
+ var tmp = from;
+ from = to;
+ to = tmp;
+ }
+
+ return { from: from, to: to, axis: axis };
+ }
+
+ function setSelection(ranges, preventEvent) {
+ var axis, range, o = plot.getOptions();
+
+ if (o.selection.mode == "y") {
+ selection.first.x = 0;
+ selection.second.x = plot.width();
+ }
+ else {
+ range = extractRange(ranges, "x");
+
+ selection.first.x = range.axis.p2c(range.from);
+ selection.second.x = range.axis.p2c(range.to);
+ }
+
+ if (o.selection.mode == "x") {
+ selection.first.y = 0;
+ selection.second.y = plot.height();
+ }
+ else {
+ range = extractRange(ranges, "y");
+
+ selection.first.y = range.axis.p2c(range.from);
+ selection.second.y = range.axis.p2c(range.to);
+ }
+
+ selection.show = true;
+ plot.triggerRedrawOverlay();
+ if (!preventEvent && selectionIsSane())
+ triggerSelectedEvent();
+ }
+
+ function selectionIsSane() {
+ var minSize = 5;
+ return Math.abs(selection.second.x - selection.first.x) >= minSize &&
+ Math.abs(selection.second.y - selection.first.y) >= minSize;
+ }
+
+ plot.clearSelection = clearSelection;
+ plot.setSelection = setSelection;
+ plot.getSelection = getSelection;
+
+ plot.hooks.bindEvents.push(function(plot, eventHolder) {
+ var o = plot.getOptions();
+ if (o.selection.mode != null) {
+ eventHolder.mousemove(onMouseMove);
+ eventHolder.mousedown(onMouseDown);
+ }
+ });
+
+
+ plot.hooks.drawOverlay.push(function (plot, ctx) {
+ // draw selection
+ if (selection.show && selectionIsSane()) {
+ var plotOffset = plot.getPlotOffset();
+ var o = plot.getOptions();
+
+ ctx.save();
+ ctx.translate(plotOffset.left, plotOffset.top);
+
+ var c = $.color.parse(o.selection.color);
+
+ ctx.strokeStyle = c.scale('a', 0.8).toString();
+ ctx.lineWidth = 1;
+ ctx.lineJoin = "round";
+ ctx.fillStyle = c.scale('a', 0.4).toString();
+
+ var x = Math.min(selection.first.x, selection.second.x),
+ y = Math.min(selection.first.y, selection.second.y),
+ w = Math.abs(selection.second.x - selection.first.x),
+ h = Math.abs(selection.second.y - selection.first.y);
+
+ ctx.fillRect(x, y, w, h);
+ ctx.strokeRect(x, y, w, h);
+
+ ctx.restore();
+ }
+ });
+
+ plot.hooks.shutdown.push(function (plot, eventHolder) {
+ eventHolder.unbind("mousemove", onMouseMove);
+ eventHolder.unbind("mousedown", onMouseDown);
+
+ if (mouseUpHandler)
+ $(document).unbind("mouseup", mouseUpHandler);
+ });
+
+ }
+
+ $.plot.plugins.push({
+ init: init,
+ options: {
+ selection: {
+ mode: null, // one of null, "x", "y" or "xy"
+ color: "#e8cfac"
+ }
+ },
+ name: 'selection',
+ version: '1.1'
+ });
+})(jQuery);
+
--- /dev/null
+++ b/js/flot/jquery.flot.selection.min.js
@@ -1,1 +1,1 @@
-
+(function(a){function b(k){var p={first:{x:-1,y:-1},second:{x:-1,y:-1},show:false,active:false};var m={};var r=null;function e(s){if(p.active){l(s);k.getPlaceholder().trigger("plotselecting",[g()])}}function n(s){if(s.which!=1){return}document.body.focus();if(document.onselectstart!==undefined&&m.onselectstart==null){m.onselectstart=document.onselectstart;document.onselectstart=function(){return false}}if(document.ondrag!==undefined&&m.ondrag==null){m.ondrag=document.ondrag;document.ondrag=function(){return false}}d(p.first,s);p.active=true;r=function(t){j(t)};a(document).one("mouseup",r)}function j(s){r=null;if(document.onselectstart!==undefined){document.onselectstart=m.onselectstart}if(document.ondrag!==undefined){document.ondrag=m.ondrag}p.active=false;l(s);if(f()){i()}else{k.getPlaceholder().trigger("plotunselected",[]);k.getPlaceholder().trigger("plotselecting",[null])}return false}function g(){if(!f()){return null}var u={},t=p.first,s=p.second;a.each(k.getAxes(),function(v,w){if(w.used){var y=w.c2p(t[w.direction]),x=w.c2p(s[w.direction]);u[v]={from:Math.min(y,x),to:Math.max(y,x)}}});return u}function i(){var s=g();k.getPlaceholder().trigger("plotselected",[s]);if(s.xaxis&&s.yaxis){k.getPlaceholder().trigger("selected",[{x1:s.xaxis.from,y1:s.yaxis.from,x2:s.xaxis.to,y2:s.yaxis.to}])}}function h(t,u,s){return u<t?t:(u>s?s:u)}function d(w,t){var v=k.getOptions();var u=k.getPlaceholder().offset();var s=k.getPlotOffset();w.x=h(0,t.pageX-u.left-s.left,k.width());w.y=h(0,t.pageY-u.top-s.top,k.height());if(v.selection.mode=="y"){w.x=w==p.first?0:k.width()}if(v.selection.mode=="x"){w.y=w==p.first?0:k.height()}}function l(s){if(s.pageX==null){return}d(p.second,s);if(f()){p.show=true;k.triggerRedrawOverlay()}else{q(true)}}function q(s){if(p.show){p.show=false;k.triggerRedrawOverlay();if(!s){k.getPlaceholder().trigger("plotunselected",[])}}}function c(s,w){var t,y,z,A,x=k.getAxes();for(var u in x){t=x[u];if(t.direction==w){A=w+t.n+"axis";if(!s[A]&&t.n==1){A=w+"axis"}if(s[A]){y=s[A].from;z=s[A].to;break}}}if(!s[A]){t=w=="x"?k.getXAxes()[0]:k.getYAxes()[0];y=s[w+"1"];z=s[w+"2"]}if(y!=null&&z!=null&&y>z){var v=y;y=z;z=v}return{from:y,to:z,axis:t}}function o(t,s){var v,u,w=k.getOptions();if(w.selection.mode=="y"){p.first.x=0;p.second.x=k.width()}else{u=c(t,"x");p.first.x=u.axis.p2c(u.from);p.second.x=u.axis.p2c(u.to)}if(w.selection.mode=="x"){p.first.y=0;p.second.y=k.height()}else{u=c(t,"y");p.first.y=u.axis.p2c(u.from);p.second.y=u.axis.p2c(u.to)}p.show=true;k.triggerRedrawOverlay();if(!s&&f()){i()}}function f(){var s=5;return Math.abs(p.second.x-p.first.x)>=s&&Math.abs(p.second.y-p.first.y)>=s}k.clearSelection=q;k.setSelection=o;k.getSelection=g;k.hooks.bindEvents.push(function(t,s){var u=t.getOptions();if(u.selection.mode!=null){s.mousemove(e);s.mousedown(n)}});k.hooks.drawOverlay.push(function(v,D){if(p.show&&f()){var t=v.getPlotOffset();var s=v.getOptions();D.save();D.translate(t.left,t.top);var z=a.color.parse(s.selection.color);D.strokeStyle=z.scale("a",0.8).toString();D.lineWidth=1;D.lineJoin="round";D.fillStyle=z.scale("a",0.4).toString();var B=Math.min(p.first.x,p.second.x),A=Math.min(p.first.y,p.second.y),C=Math.abs(p.second.x-p.first.x),u=Math.abs(p.second.y-p.first.y);D.fillRect(B,A,C,u);D.strokeRect(B,A,C,u);D.restore()}});k.hooks.shutdown.push(function(t,s){s.unbind("mousemove",e);s.unbind("mousedown",n);if(r){a(document).unbind("mouseup",r)}})}a.plot.plugins.push({init:b,options:{selection:{mode:null,color:"#e8cfac"}},name:"selection",version:"1.1"})})(jQuery);
--- /dev/null
+++ b/js/flot/jquery.flot.stack.js
@@ -1,1 +1,185 @@
+/*
+Flot plugin for stacking data sets, i.e. putting them on top of each
+other, for accumulative graphs.
+The plugin assumes the data is sorted on x (or y if stacking
+horizontally). For line charts, it is assumed that if a line has an
+undefined gap (from a null point), then the line above it should have
+the same gap - insert zeros instead of "null" if you want another
+behaviour. This also holds for the start and end of the chart. Note
+that stacking a mix of positive and negative values in most instances
+doesn't make sense (so it looks weird).
+
+Two or more series are stacked when their "stack" attribute is set to
+the same key (which can be any number or string or just "true"). To
+specify the default stack, you can set
+
+ series: {
+ stack: null or true or key (number/string)
+ }
+
+or specify it for a specific series
+
+ $.plot($("#placeholder"), [{ data: [ ... ], stack: true }])
+
+The stacking order is determined by the order of the data series in
+the array (later series end up on top of the previous).
+
+Internally, the plugin modifies the datapoints in each series, adding
+an offset to the y value. For line series, extra data points are
+inserted through interpolation. If there's a second y value, it's also
+adjusted (e.g for bar charts or filled areas).
+*/
+
+(function ($) {
+ var options = {
+ series: { stack: null } // or number/string
+ };
+
+ function init(plot) {
+ function findMatchingSeries(s, allseries) {
+ var res = null
+ for (var i = 0; i < allseries.length; ++i) {
+ if (s == allseries[i])
+ break;
+
+ if (allseries[i].stack == s.stack)
+ res = allseries[i];
+ }
+
+ return res;
+ }
+
+ function stackData(plot, s, datapoints) {
+ if (s.stack == null)
+ return;
+
+ var other = findMatchingSeries(s, plot.getData());
+ if (!other)
+ return;
+
+ var ps = datapoints.pointsize,
+ points = datapoints.points,
+ otherps = other.datapoints.pointsize,
+ otherpoints = other.datapoints.points,
+ newpoints = [],
+ px, py, intery, qx, qy, bottom,
+ withlines = s.lines.show,
+ horizontal = s.bars.horizontal,
+ withbottom = ps > 2 && (horizontal ? datapoints.format[2].x : datapoints.format[2].y),
+ withsteps = withlines && s.lines.steps,
+ fromgap = true,
+ keyOffset = horizontal ? 1 : 0,
+ accumulateOffset = horizontal ? 0 : 1,
+ i = 0, j = 0, l;
+
+ while (true) {
+ if (i >= points.length)
+ break;
+
+ l = newpoints.length;
+
+ if (points[i] == null) {
+ // copy gaps
+ for (m = 0; m < ps; ++m)
+ newpoints.push(points[i + m]);
+ i += ps;
+ }
+ else if (j >= otherpoints.length) {
+ // for lines, we can't use the rest of the points
+ if (!withlines) {
+ for (m = 0; m < ps; ++m)
+ newpoints.push(points[i + m]);
+ }
+ i += ps;
+ }
+ else if (otherpoints[j] == null) {
+ // oops, got a gap
+ for (m = 0; m < ps; ++m)
+ newpoints.push(null);
+ fromgap = true;
+ j += otherps;
+ }
+ else {
+ // cases where we actually got two points
+ px = points[i + keyOffset];
+ py = points[i + accumulateOffset];
+ qx = otherpoints[j + keyOffset];
+ qy = otherpoints[j + accumulateOffset];
+ bottom = 0;
+
+ if (px == qx) {
+ for (m = 0; m < ps; ++m)
+ newpoints.push(points[i + m]);
+
+ newpoints[l + accumulateOffset] += qy;
+ bottom = qy;
+
+ i += ps;
+ j += otherps;
+ }
+ else if (px > qx) {
+ // we got past point below, might need to
+ // insert interpolated extra point
+ if (withlines && i > 0 && points[i - ps] != null) {
+ intery = py + (points[i - ps + accumulateOffset] - py) * (qx - px) / (points[i - ps + keyOffset] - px);
+ newpoints.push(qx);
+ newpoints.push(intery + qy);
+ for (m = 2; m < ps; ++m)
+ newpoints.push(points[i + m]);
+ bottom = qy;
+ }
+
+ j += otherps;
+ }
+ else { // px < qx
+ if (fromgap && withlines) {
+ // if we come from a gap, we just skip this point
+ i += ps;
+ continue;
+ }
+
+ for (m = 0; m < ps; ++m)
+ newpoints.push(points[i + m]);
+
+ // we might be able to interpolate a point below,
+ // this can give us a better y
+ if (withlines && j > 0 && otherpoints[j - otherps] != null)
+ bottom = qy + (otherpoints[j - otherps + accumulateOffset] - qy) * (px - qx) / (otherpoints[j - otherps + keyOffset] - qx);
+
+ newpoints[l + accumulateOffset] += bottom;
+
+ i += ps;
+ }
+
+ fromgap = false;
+
+ if (l != newpoints.length && withbottom)
+ newpoints[l + 2] += bottom;
+ }
+
+ // maintain the line steps invariant
+ if (withsteps && l != newpoints.length && l > 0
+ && newpoints[l] != null
+ && newpoints[l] != newpoints[l - ps]
+ && newpoints[l + 1] != newpoints[l - ps + 1]) {
+ for (m = 0; m < ps; ++m)
+ newpoints[l + ps + m] = newpoints[l + m];
+ newpoints[l + 1] = newpoints[l - ps + 1];
+ }
+ }
+
+ datapoints.points = newpoints;
+ }
+
+ plot.hooks.processDatapoints.push(stackData);
+ }
+
+ $.plot.plugins.push({
+ init: init,
+ options: options,
+ name: 'stack',
+ version: '1.2'
+ });
+})(jQuery);
+
--- /dev/null
+++ b/js/flot/jquery.flot.stack.min.js
@@ -1,1 +1,1 @@
-
+(function(b){var a={series:{stack:null}};function c(f){function d(k,j){var h=null;for(var g=0;g<j.length;++g){if(k==j[g]){break}if(j[g].stack==k.stack){h=j[g]}}return h}function e(C,v,g){if(v.stack==null){return}var p=d(v,C.getData());if(!p){return}var z=g.pointsize,F=g.points,h=p.datapoints.pointsize,y=p.datapoints.points,t=[],x,w,k,J,I,r,u=v.lines.show,G=v.bars.horizontal,o=z>2&&(G?g.format[2].x:g.format[2].y),n=u&&v.lines.steps,E=true,q=G?1:0,H=G?0:1,D=0,B=0,A;while(true){if(D>=F.length){break}A=t.length;if(F[D]==null){for(m=0;m<z;++m){t.push(F[D+m])}D+=z}else{if(B>=y.length){if(!u){for(m=0;m<z;++m){t.push(F[D+m])}}D+=z}else{if(y[B]==null){for(m=0;m<z;++m){t.push(null)}E=true;B+=h}else{x=F[D+q];w=F[D+H];J=y[B+q];I=y[B+H];r=0;if(x==J){for(m=0;m<z;++m){t.push(F[D+m])}t[A+H]+=I;r=I;D+=z;B+=h}else{if(x>J){if(u&&D>0&&F[D-z]!=null){k=w+(F[D-z+H]-w)*(J-x)/(F[D-z+q]-x);t.push(J);t.push(k+I);for(m=2;m<z;++m){t.push(F[D+m])}r=I}B+=h}else{if(E&&u){D+=z;continue}for(m=0;m<z;++m){t.push(F[D+m])}if(u&&B>0&&y[B-h]!=null){r=I+(y[B-h+H]-I)*(x-J)/(y[B-h+q]-J)}t[A+H]+=r;D+=z}}E=false;if(A!=t.length&&o){t[A+2]+=r}}}}if(n&&A!=t.length&&A>0&&t[A]!=null&&t[A]!=t[A-z]&&t[A+1]!=t[A-z+1]){for(m=0;m<z;++m){t[A+z+m]=t[A+m]}t[A+1]=t[A-z+1]}}g.points=t}f.hooks.processDatapoints.push(e)}b.plot.plugins.push({init:c,options:a,name:"stack",version:"1.2"})})(jQuery);
--- /dev/null
+++ b/js/flot/jquery.flot.symbol.js
@@ -1,1 +1,71 @@
+/*
+Flot plugin that adds some extra symbols for plotting points.
+The symbols are accessed as strings through the standard symbol
+choice:
+
+ series: {
+ points: {
+ symbol: "square" // or "diamond", "triangle", "cross"
+ }
+ }
+
+*/
+
+(function ($) {
+ function processRawData(plot, series, datapoints) {
+ // we normalize the area of each symbol so it is approximately the
+ // same as a circle of the given radius
+
+ var handlers = {
+ square: function (ctx, x, y, radius, shadow) {
+ // pi * r^2 = (2s)^2 => s = r * sqrt(pi)/2
+ var size = radius * Math.sqrt(Math.PI) / 2;
+ ctx.rect(x - size, y - size, size + size, size + size);
+ },
+ diamond: function (ctx, x, y, radius, shadow) {
+ // pi * r^2 = 2s^2 => s = r * sqrt(pi/2)
+ var size = radius * Math.sqrt(Math.PI / 2);
+ ctx.moveTo(x - size, y);
+ ctx.lineTo(x, y - size);
+ ctx.lineTo(x + size, y);
+ ctx.lineTo(x, y + size);
+ ctx.lineTo(x - size, y);
+ },
+ triangle: function (ctx, x, y, radius, shadow) {
+ // pi * r^2 = 1/2 * s^2 * sin (pi / 3) => s = r * sqrt(2 * pi / sin(pi / 3))
+ var size = radius * Math.sqrt(2 * Math.PI / Math.sin(Math.PI / 3));
+ var height = size * Math.sin(Math.PI / 3);
+ ctx.moveTo(x - size/2, y + height/2);
+ ctx.lineTo(x + size/2, y + height/2);
+ if (!shadow) {
+ ctx.lineTo(x, y - height/2);
+ ctx.lineTo(x - size/2, y + height/2);
+ }
+ },
+ cross: function (ctx, x, y, radius, shadow) {
+ // pi * r^2 = (2s)^2 => s = r * sqrt(pi)/2
+ var size = radius * Math.sqrt(Math.PI) / 2;
+ ctx.moveTo(x - size, y - size);
+ ctx.lineTo(x + size, y + size);
+ ctx.moveTo(x - size, y + size);
+ ctx.lineTo(x + size, y - size);
+ }
+ }
+
+ var s = series.points.symbol;
+ if (handlers[s])
+ series.points.symbol = handlers[s];
+ }
+
+ function init(plot) {
+ plot.hooks.processDatapoints.push(processRawData);
+ }
+
+ $.plot.plugins.push({
+ init: init,
+ name: 'symbols',
+ version: '1.0'
+ });
+})(jQuery);
+
--- /dev/null
+++ b/js/flot/jquery.flot.symbol.min.js
@@ -1,1 +1,1 @@
-
+(function(b){function a(h,e,g){var d={square:function(k,j,n,i,m){var l=i*Math.sqrt(Math.PI)/2;k.rect(j-l,n-l,l+l,l+l)},diamond:function(k,j,n,i,m){var l=i*Math.sqrt(Math.PI/2);k.moveTo(j-l,n);k.lineTo(j,n-l);k.lineTo(j+l,n);k.lineTo(j,n+l);k.lineTo(j-l,n)},triangle:function(l,k,o,j,n){var m=j*Math.sqrt(2*Math.PI/Math.sin(Math.PI/3));var i=m*Math.sin(Math.PI/3);l.moveTo(k-m/2,o+i/2);l.lineTo(k+m/2,o+i/2);if(!n){l.lineTo(k,o-i/2);l.lineTo(k-m/2,o+i/2)}},cross:function(k,j,n,i,m){var l=i*Math.sqrt(Math.PI)/2;k.moveTo(j-l,n-l);k.lineTo(j+l,n+l);k.moveTo(j-l,n+l);k.lineTo(j+l,n-l)}};var f=e.points.symbol;if(d[f]){e.points.symbol=d[f]}}function c(d){d.hooks.processDatapoints.push(a)}b.plot.plugins.push({init:c,name:"symbols",version:"1.0"})})(jQuery);
--- /dev/null
+++ b/js/flot/jquery.flot.threshold.js
@@ -1,1 +1,104 @@
+/*
+Flot plugin for thresholding data. Controlled through the option
+"threshold" in either the global series options
+ series: {
+ threshold: {
+ below: number
+ color: colorspec
+ }
+ }
+
+or in a specific series
+
+ $.plot($("#placeholder"), [{ data: [ ... ], threshold: { ... }}])
+
+The data points below "below" are drawn with the specified color. This
+makes it easy to mark points below 0, e.g. for budget data.
+
+Internally, the plugin works by splitting the data into two series,
+above and below the threshold. The extra series below the threshold
+will have its label cleared and the special "originSeries" attribute
+set to the original series. You may need to check for this in hover
+events.
+*/
+
+(function ($) {
+ var options = {
+ series: { threshold: null } // or { below: number, color: color spec}
+ };
+
+ function init(plot) {
+ function thresholdData(plot, s, datapoints) {
+ if (!s.threshold)
+ return;
+
+ var ps = datapoints.pointsize, i, x, y, p, prevp,
+ thresholded = $.extend({}, s); // note: shallow copy
+
+ thresholded.datapoints = { points: [], pointsize: ps };
+ thresholded.label = null;
+ thresholded.color = s.threshold.color;
+ thresholded.threshold = null;
+ thresholded.originSeries = s;
+ thresholded.data = [];
+
+ var below = s.threshold.below,
+ origpoints = datapoints.points,
+ addCrossingPoints = s.lines.show;
+
+ threspoints = [];
+ newpoints = [];
+
+ for (i = 0; i < origpoints.length; i += ps) {
+ x = origpoints[i]
+ y = origpoints[i + 1];
+
+ prevp = p;
+ if (y < below)
+ p = threspoints;
+ else
+ p = newpoints;
+
+ if (addCrossingPoints && prevp != p && x != null
+ && i > 0 && origpoints[i - ps] != null) {
+ var interx = (x - origpoints[i - ps]) / (y - origpoints[i - ps + 1]) * (below - y) + x;
+ prevp.push(interx);
+ prevp.push(below);
+ for (m = 2; m < ps; ++m)
+ prevp.push(origpoints[i + m]);
+
+ p.push(null); // start new segment
+ p.push(null);
+ for (m = 2; m < ps; ++m)
+ p.push(origpoints[i + m]);
+ p.push(interx);
+ p.push(below);
+ for (m = 2; m < ps; ++m)
+ p.push(origpoints[i + m]);
+ }
+
+ p.push(x);
+ p.push(y);
+ }
+
+ datapoints.points = newpoints;
+ thresholded.datapoints.points = threspoints;
+
+ if (thresholded.datapoints.points.length > 0)
+ plot.getData().push(thresholded);
+
+ // FIXME: there are probably some edge cases left in bars
+ }
+
+ plot.hooks.processDatapoints.push(thresholdData);
+ }
+
+ $.plot.plugins.push({
+ init: init,
+ options: options,
+ name: 'threshold',
+ version: '1.0'
+ });
+})(jQuery);
+
--- /dev/null
+++ b/js/flot/jquery.flot.threshold.min.js
@@ -1,1 +1,1 @@
-
+(function(B){var A={series:{threshold:null}};function C(D){function E(L,S,M){if(!S.threshold){return }var F=M.pointsize,I,O,N,G,K,H=B.extend({},S);H.datapoints={points:[],pointsize:F};H.label=null;H.color=S.threshold.color;H.threshold=null;H.originSeries=S;H.data=[];var P=S.threshold.below,Q=M.points,R=S.lines.show;threspoints=[];newpoints=[];for(I=0;I<Q.length;I+=F){O=Q[I];N=Q[I+1];K=G;if(N<P){G=threspoints}else{G=newpoints}if(R&&K!=G&&O!=null&&I>0&&Q[I-F]!=null){var J=(O-Q[I-F])/(N-Q[I-F+1])*(P-N)+O;K.push(J);K.push(P);for(m=2;m<F;++m){K.push(Q[I+m])}G.push(null);G.push(null);for(m=2;m<F;++m){G.push(Q[I+m])}G.push(J);G.push(P);for(m=2;m<F;++m){G.push(Q[I+m])}}G.push(O);G.push(N)}M.points=newpoints;H.datapoints.points=threspoints;if(H.datapoints.points.length>0){L.getData().push(H)}}D.hooks.processDatapoints.push(E)}B.plot.plugins.push({init:C,options:A,name:"threshold",version:"1.0"})})(jQuery);
--- /dev/null
+++ b/js/jquery-1.6.1.min.js
@@ -1,1 +1,18 @@
-
+/*!
+ * jQuery JavaScript Library v1.6.1
+ * http://jquery.com/
+ *
+ * Copyright 2011, John Resig
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * Includes Sizzle.js
+ * http://sizzlejs.com/
+ * Copyright 2011, The Dojo Foundation
+ * Released under the MIT, BSD, and GPL Licenses.
+ *
+ * Date: Thu May 12 15:04:36 2011 -0400
+ */
+(function(a,b){function cy(a){return f.isWindow(a)?a:a.nodeType===9?a.defaultView||a.parentWindow:!1}function cv(a){if(!cj[a]){var b=f("<"+a+">").appendTo("body"),d=b.css("display");b.remove();if(d==="none"||d===""){ck||(ck=c.createElement("iframe"),ck.frameBorder=ck.width=ck.height=0),c.body.appendChild(ck);if(!cl||!ck.createElement)cl=(ck.contentWindow||ck.contentDocument).document,cl.write("<!doctype><html><body></body></html>");b=cl.createElement(a),cl.body.appendChild(b),d=f.css(b,"display"),c.body.removeChild(ck)}cj[a]=d}return cj[a]}function cu(a,b){var c={};f.each(cp.concat.apply([],cp.slice(0,b)),function(){c[this]=a});return c}function ct(){cq=b}function cs(){setTimeout(ct,0);return cq=f.now()}function ci(){try{return new a.ActiveXObject("Microsoft.XMLHTTP")}catch(b){}}function ch(){try{return new a.XMLHttpRequest}catch(b){}}function cb(a,c){a.dataFilter&&(c=a.dataFilter(c,a.dataType));var d=a.dataTypes,e={},g,h,i=d.length,j,k=d[0],l,m,n,o,p;for(g=1;g<i;g++){if(g===1)for(h in a.converters)typeof h=="string"&&(e[h.toLowerCase()]=a.converters[h]);l=k,k=d[g];if(k==="*")k=l;else if(l!=="*"&&l!==k){m=l+" "+k,n=e[m]||e["* "+k];if(!n){p=b;for(o in e){j=o.split(" ");if(j[0]===l||j[0]==="*"){p=e[j[1]+" "+k];if(p){o=e[o],o===!0?n=p:p===!0&&(n=o);break}}}}!n&&!p&&f.error("No conversion from "+m.replace(" "," to ")),n!==!0&&(c=n?n(c):p(o(c)))}}return c}function ca(a,c,d){var e=a.contents,f=a.dataTypes,g=a.responseFields,h,i,j,k;for(i in g)i in d&&(c[g[i]]=d[i]);while(f[0]==="*")f.shift(),h===b&&(h=a.mimeType||c.getResponseHeader("content-type"));if(h)for(i in e)if(e[i]&&e[i].test(h)){f.unshift(i);break}if(f[0]in d)j=f[0];else{for(i in d){if(!f[0]||a.converters[i+" "+f[0]]){j=i;break}k||(k=i)}j=j||k}if(j){j!==f[0]&&f.unshift(j);return d[j]}}function b_(a,b,c,d){if(f.isArray(b))f.each(b,function(b,e){c||bF.test(a)?d(a,e):b_(a+"["+(typeof e=="object"||f.isArray(e)?b:"")+"]",e,c,d)});else if(!c&&b!=null&&typeof b=="object")for(var e in b)b_(a+"["+e+"]",b[e],c,d);else d(a,b)}function b$(a,c,d,e,f,g){f=f||c.dataTypes[0],g=g||{},g[f]=!0;var h=a[f],i=0,j=h?h.length:0,k=a===bU,l;for(;i<j&&(k||!l);i++)l=h[i](c,d,e),typeof l=="string"&&(!k||g[l]?l=b:(c.dataTypes.unshift(l),l=b$(a,c,d,e,l,g)));(k||!l)&&!g["*"]&&(l=b$(a,c,d,e,"*",g));return l}function bZ(a){return function(b,c){typeof b!="string"&&(c=b,b="*");if(f.isFunction(c)){var d=b.toLowerCase().split(bQ),e=0,g=d.length,h,i,j;for(;e<g;e++)h=d[e],j=/^\+/.test(h),j&&(h=h.substr(1)||"*"),i=a[h]=a[h]||[],i[j?"unshift":"push"](c)}}}function bD(a,b,c){var d=b==="width"?bx:by,e=b==="width"?a.offsetWidth:a.offsetHeight;if(c==="border")return e;f.each(d,function(){c||(e-=parseFloat(f.css(a,"padding"+this))||0),c==="margin"?e+=parseFloat(f.css(a,"margin"+this))||0:e-=parseFloat(f.css(a,"border"+this+"Width"))||0});return e}function bn(a,b){b.src?f.ajax({url:b.src,async:!1,dataType:"script"}):f.globalEval((b.text||b.textContent||b.innerHTML||"").replace(bf,"/*$0*/")),b.parentNode&&b.parentNode.removeChild(b)}function bm(a){f.nodeName(a,"input")?bl(a):a.getElementsByTagName&&f.grep(a.getElementsByTagName("input"),bl)}function bl(a){if(a.type==="checkbox"||a.type==="radio")a.defaultChecked=a.checked}function bk(a){return"getElementsByTagName"in a?a.getElementsByTagName("*"):"querySelectorAll"in a?a.querySelectorAll("*"):[]}function bj(a,b){var c;if(b.nodeType===1){b.clearAttributes&&b.clearAttributes(),b.mergeAttributes&&b.mergeAttributes(a),c=b.nodeName.toLowerCase();if(c==="object")b.outerHTML=a.outerHTML;else if(c!=="input"||a.type!=="checkbox"&&a.type!=="radio"){if(c==="option")b.selected=a.defaultSelected;else if(c==="input"||c==="textarea")b.defaultValue=a.defaultValue}else a.checked&&(b.defaultChecked=b.checked=a.checked),b.value!==a.value&&(b.value=a.value);b.removeAttribute(f.expando)}}function bi(a,b){if(b.nodeType===1&&!!f.hasData(a)){var c=f.expando,d=f.data(a),e=f.data(b,d);if(d=d[c]){var g=d.events;e=e[c]=f.extend({},d);if(g){delete e.handle,e.events={};for(var h in g)for(var i=0,j=g[h].length;i<j;i++)f.event.add(b,h+(g[h][i].namespace?".":"")+g[h][i].namespace,g[h][i],g[h][i].data)}}}}function bh(a,b){return f.nodeName(a,"table")?a.getElementsByTagName("tbody")[0]||a.appendChild(a.ownerDocument.createElement("tbody")):a}function X(a,b,c){b=b||0;if(f.isFunction(b))return f.grep(a,function(a,d){var e=!!b.call(a,d,a);return e===c});if(b.nodeType)return f.grep(a,function(a,d){return a===b===c});if(typeof b=="string"){var d=f.grep(a,function(a){return a.nodeType===1});if(S.test(b))return f.filter(b,d,!c);b=f.filter(b,d)}return f.grep(a,function(a,d){return f.inArray(a,b)>=0===c})}function W(a){return!a||!a.parentNode||a.parentNode.nodeType===11}function O(a,b){return(a&&a!=="*"?a+".":"")+b.replace(A,"`").replace(B,"&")}function N(a){var b,c,d,e,g,h,i,j,k,l,m,n,o,p=[],q=[],r=f._data(this,"events");if(!(a.liveFired===this||!r||!r.live||a.target.disabled||a.button&&a.type==="click")){a.namespace&&(n=new RegExp("(^|\\.)"+a.namespace.split(".").join("\\.(?:.*\\.)?")+"(\\.|$)")),a.liveFired=this;var s=r.live.slice(0);for(i=0;i<s.length;i++)g=s[i],g.origType.replace(y,"")===a.type?q.push(g.selector):s.splice(i--,1);e=f(a.target).closest(q,a.currentTarget);for(j=0,k=e.length;j<k;j++){m=e[j];for(i=0;i<s.length;i++){g=s[i];if(m.selector===g.selector&&(!n||n.test(g.namespace))&&!m.elem.disabled){h=m.elem,d=null;if(g.preType==="mouseenter"||g.preType==="mouseleave")a.type=g.preType,d=f(a.relatedTarget).closest(g.selector)[0],d&&f.contains(h,d)&&(d=h);(!d||d!==h)&&p.push({elem:h,handleObj:g,level:m.level})}}}for(j=0,k=p.length;j<k;j++){e=p[j];if(c&&e.level>c)break;a.currentTarget=e.elem,a.data=e.handleObj.data,a.handleObj=e.handleObj,o=e.handleObj.origHandler.apply(e.elem,arguments);if(o===!1||a.isPropagationStopped()){c=e.level,o===!1&&(b=!1);if(a.isImmediatePropagationStopped())break}}return b}}function L(a,c,d){var e=f.extend({},d[0]);e.type=a,e.originalEvent={},e.liveFired=b,f.event.handle.call(c,e),e.isDefaultPrevented()&&d[0].preventDefault()}function F(){return!0}function E(){return!1}function m(a,c,d){var e=c+"defer",g=c+"queue",h=c+"mark",i=f.data(a,e,b,!0);i&&(d==="queue"||!f.data(a,g,b,!0))&&(d==="mark"||!f.data(a,h,b,!0))&&setTimeout(function(){!f.data(a,g,b,!0)&&!f.data(a,h,b,!0)&&(f.removeData(a,e,!0),i.resolve())},0)}function l(a){for(var b in a)if(b!=="toJSON")return!1;return!0}function k(a,c,d){if(d===b&&a.nodeType===1){var e="data-"+c.replace(j,"$1-$2").toLowerCase();d=a.getAttribute(e);if(typeof d=="string"){try{d=d==="true"?!0:d==="false"?!1:d==="null"?null:f.isNaN(d)?i.test(d)?f.parseJSON(d):d:parseFloat(d)}catch(g){}f.data(a,c,d)}else d=b}return d}var c=a.document,d=a.navigator,e=a.location,f=function(){function H(){if(!e.isReady){try{c.documentElement.doScroll("left")}catch(a){setTimeout(H,1);return}e.ready()}}var e=function(a,b){return new e.fn.init(a,b,h)},f=a.jQuery,g=a.$,h,i=/^(?:[^<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/,j=/\S/,k=/^\s+/,l=/\s+$/,m=/\d/,n=/^<(\w+)\s*\/?>(?:<\/\1>)?$/,o=/^[\],:{}\s]*$/,p=/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,q=/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,r=/(?:^|:|,)(?:\s*\[)+/g,s=/(webkit)[ \/]([\w.]+)/,t=/(opera)(?:.*version)?[ \/]([\w.]+)/,u=/(msie) ([\w.]+)/,v=/(mozilla)(?:.*? rv:([\w.]+))?/,w=d.userAgent,x,y,z,A=Object.prototype.toString,B=Object.prototype.hasOwnProperty,C=Array.prototype.push,D=Array.prototype.slice,E=String.prototype.trim,F=Array.prototype.indexOf,G={};e.fn=e.prototype={constructor:e,init:function(a,d,f){var g,h,j,k;if(!a)return this;if(a.nodeType){this.context=this[0]=a,this.length=1;return this}if(a==="body"&&!d&&c.body){this.context=c,this[0]=c.body,this.selector=a,this.length=1;return this}if(typeof a=="string"){a.charAt(0)!=="<"||a.charAt(a.length-1)!==">"||a.length<3?g=i.exec(a):g=[null,a,null];if(g&&(g[1]||!d)){if(g[1]){d=d instanceof e?d[0]:d,k=d?d.ownerDocument||d:c,j=n.exec(a),j?e.isPlainObject(d)?(a=[c.createElement(j[1])],e.fn.attr.call(a,d,!0)):a=[k.createElement(j[1])]:(j=e.buildFragment([g[1]],[k]),a=(j.cacheable?e.clone(j.fragment):j.fragment).childNodes);return e.merge(this,a)}h=c.getElementById(g[2]);if(h&&h.parentNode){if(h.id!==g[2])return f.find(a);this.length=1,this[0]=h}this.context=c,this.selector=a;return this}return!d||d.jquery?(d||f).find(a):this.constructor(d).find(a)}if(e.isFunction(a))return f.ready(a);a.selector!==b&&(this.selector=a.selector,this.context=a.context);return e.makeArray(a,this)},selector:"",jquery:"1.6.1",length:0,size:function(){return this.length},toArray:function(){return D.call(this,0)},get:function(a){return a==null?this.toArray():a<0?this[this.length+a]:this[a]},pushStack:function(a,b,c){var d=this.constructor();e.isArray(a)?C.apply(d,a):e.merge(d,a),d.prevObject=this,d.context=this.context,b==="find"?d.selector=this.selector+(this.selector?" ":"")+c:b&&(d.selector=this.selector+"."+b+"("+c+")");return d},each:function(a,b){return e.each(this,a,b)},ready:function(a){e.bindReady(),y.done(a);return this},eq:function(a){return a===-1?this.slice(a):this.slice(a,+a+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(D.apply(this,arguments),"slice",D.call(arguments).join(","))},map:function(a){return this.pushStack(e.map(this,function(b,c){return a.call(b,c,b)}))},end:function(){return this.prevObject||this.constructor(null)},push:C,sort:[].sort,splice:[].splice},e.fn.init.prototype=e.fn,e.extend=e.fn.extend=function(){var a,c,d,f,g,h,i=arguments[0]||{},j=1,k=arguments.length,l=!1;typeof i=="boolean"&&(l=i,i=arguments[1]||{},j=2),typeof i!="object"&&!e.isFunction(i)&&(i={}),k===j&&(i=this,--j);for(;j<k;j++)if((a=arguments[j])!=null)for(c in a){d=i[c],f=a[c];if(i===f)continue;l&&f&&(e.isPlainObject(f)||(g=e.isArray(f)))?(g?(g=!1,h=d&&e.isArray(d)?d:[]):h=d&&e.isPlainObject(d)?d:{},i[c]=e.extend(l,h,f)):f!==b&&(i[c]=f)}return i},e.extend({noConflict:function(b){a.$===e&&(a.$=g),b&&a.jQuery===e&&(a.jQuery=f);return e},isReady:!1,readyWait:1,holdReady:function(a){a?e.readyWait++:e.ready(!0)},ready:function(a){if(a===!0&&!--e.readyWait||a!==!0&&!e.isReady){if(!c.body)return setTimeout(e.ready,1);e.isReady=!0;if(a!==!0&&--e.readyWait>0)return;y.resolveWith(c,[e]),e.fn.trigger&&e(c).trigger("ready").unbind("ready")}},bindReady:function(){if(!y){y=e._Deferred();if(c.readyState==="complete")return setTimeout(e.ready,1);if(c.addEventListener)c.addEventListener("DOMContentLoaded",z,!1),a.addEventListener("load",e.ready,!1);else if(c.attachEvent){c.attachEvent("onreadystatechange",z),a.attachEvent("onload",e.ready);var b=!1;try{b=a.frameElement==null}catch(d){}c.documentElement.doScroll&&b&&H()}}},isFunction:function(a){return e.type(a)==="function"},isArray:Array.isArray||function(a){return e.type(a)==="array"},isWindow:function(a){return a&&typeof a=="object"&&"setInterval"in a},isNaN:function(a){return a==null||!m.test(a)||isNaN(a)},type:function(a){return a==null?String(a):G[A.call(a)]||"object"},isPlainObject:function(a){if(!a||e.type(a)!=="object"||a.nodeType||e.isWindow(a))return!1;if(a.constructor&&!B.call(a,"constructor")&&!B.call(a.constructor.prototype,"isPrototypeOf"))return!1;var c;for(c in a);return c===b||B.call(a,c)},isEmptyObject:function(a){for(var b in a)return!1;return!0},error:function(a){throw a},parseJSON:function(b){if(typeof b!="string"||!b)return null;b=e.trim(b);if(a.JSON&&a.JSON.parse)return a.JSON.parse(b);if(o.test(b.replace(p,"@").replace(q,"]").replace(r,"")))return(new Function("return "+b))();e.error("Invalid JSON: "+b)},parseXML:function(b,c,d){a.DOMParser?(d=new DOMParser,c=d.parseFromString(b,"text/xml")):(c=new ActiveXObject("Microsoft.XMLDOM"),c.async="false",c.loadXML(b)),d=c.documentElement,(!d||!d.nodeName||d.nodeName==="parsererror")&&e.error("Invalid XML: "+b);return c},noop:function(){},globalEval:function(b){b&&j.test(b)&&(a.execScript||function(b){a.eval.call(a,b)})(b)},nodeName:function(a,b){return a.nodeName&&a.nodeName.toUpperCase()===b.toUpperCase()},each:function(a,c,d){var f,g=0,h=a.length,i=h===b||e.isFunction(a);if(d){if(i){for(f in a)if(c.apply(a[f],d)===!1)break}else for(;g<h;)if(c.apply(a[g++],d)===!1)break}else if(i){for(f in a)if(c.call(a[f],f,a[f])===!1)break}else for(;g<h;)if(c.call(a[g],g,a[g++])===!1)break;return a},trim:E?function(a){return a==null?"":E.call(a)}:function(a){return a==null?"":(a+"").replace(k,"").replace(l,"")},makeArray:function(a,b){var c=b||[];if(a!=null){var d=e.type(a);a.length==null||d==="string"||d==="function"||d==="regexp"||e.isWindow(a)?C.call(c,a):e.merge(c,a)}return c},inArray:function(a,b){if(F)return F.call(b,a);for(var c=0,d=b.length;c<d;c++)if(b[c]===a)return c;return-1},merge:function(a,c){var d=a.length,e=0;if(typeof c.length=="number")for(var f=c.length;e<f;e++)a[d++]=c[e];else while(c[e]!==b)a[d++]=c[e++];a.length=d;return a},grep:function(a,b,c){var d=[],e;c=!!c;for(var f=0,g=a.length;f<g;f++)e=!!b(a[f],f),c!==e&&d.push(a[f]);return d},map:function(a,c,d){var f,g,h=[],i=0,j=a.length,k=a instanceof e||j!==b&&typeof j=="number"&&(j>0&&a[0]&&a[j-1]||j===0||e.isArray(a));if(k)for(;i<j;i++)f=c(a[i],i,d),f!=null&&(h[h.length]=f);else for(g in a)f=c(a[g],g,d),f!=null&&(h[h.length]=f);return h.concat.apply([],h)},guid:1,proxy:function(a,c){if(typeof c=="string"){var d=a[c];c=a,a=d}if(!e.isFunction(a))return b;var f=D.call(arguments,2),g=function(){return a.apply(c,f.concat(D.call(arguments)))};g.guid=a.guid=a.guid||g.guid||e.guid++;return g},access:function(a,c,d,f,g,h){var i=a.length;if(typeof c=="object"){for(var j in c)e.access(a,j,c[j],f,g,d);return a}if(d!==b){f=!h&&f&&e.isFunction(d);for(var k=0;k<i;k++)g(a[k],c,f?d.call(a[k],k,g(a[k],c)):d,h);return a}return i?g(a[0],c):b},now:function(){return(new Date).getTime()},uaMatch:function(a){a=a.toLowerCase();var b=s.exec(a)||t.exec(a)||u.exec(a)||a.indexOf("compatible")<0&&v.exec(a)||[];return{browser:b[1]||"",version:b[2]||"0"}},sub:function(){function a(b,c){return new a.fn.init(b,c)}e.extend(!0,a,this),a.superclass=this,a.fn=a.prototype=this(),a.fn.constructor=a,a.sub=this.sub,a.fn.init=function(d,f){f&&f instanceof e&&!(f instanceof a)&&(f=a(f));return e.fn.init.call(this,d,f,b)},a.fn.init.prototype=a.fn;var b=a(c);return a},browser:{}}),e.each("Boolean Number String Function Array Date RegExp Object".split(" "),function(a,b){G["[object "+b+"]"]=b.toLowerCase()}),x=e.uaMatch(w),x.browser&&(e.browser[x.browser]=!0,e.browser.version=x.version),e.browser.webkit&&(e.browser.safari=!0),j.test(" ")&&(k=/^[\s\xA0]+/,l=/[\s\xA0]+$/),h=e(c),c.addEventListener?z=function(){c.removeEventListener("DOMContentLoaded",z,!1),e.ready()}:c.attachEvent&&(z=function(){c.readyState==="complete"&&(c.detachEvent("onreadystatechange",z),e.ready())});return e}(),g="done fail isResolved isRejected promise then always pipe".split(" "),h=[].slice;f.extend({_Deferred:function(){var a=[],b,c,d,e={done:function(){if(!d){var c=arguments,g,h,i,j,k;b&&(k=b,b=0);for(g=0,h=c.length;g<h;g++)i=c[g],j=f.type(i),j==="array"?e.done.apply(e,i):j==="function"&&a.push(i);k&&e.resolveWith(k[0],k[1])}return this},resolveWith:function(e,f){if(!d&&!b&&!c){f=f||[],c=1;try{while(a[0])a.shift().apply(e,f)}finally{b=[e,f],c=0}}return this},resolve:function(){e.resolveWith(this,arguments);return this},isResolved:function(){return!!c||!!b},cancel:function(){d=1,a=[];return this}};return e},Deferred:function(a){var b=f._Deferred(),c=f._Deferred(),d;f.extend(b,{then:function(a,c){b.done(a).fail(c);return this},always:function(){return b.done.apply(b,arguments).fail.apply(this,arguments)},fail:c.done,rejectWith:c.resolveWith,reject:c.resolve,isRejected:c.isResolved,pipe:function(a,c){return f.Deferred(function(d){f.each({done:[a,"resolve"],fail:[c,"reject"]},function(a,c){var e=c[0],g=c[1],h;f.isFunction(e)?b[a](function(){h=e.apply(this,arguments),h&&f.isFunction(h.promise)?h.promise().then(d.resolve,d.reject):d[g](h)}):b[a](d[g])})}).promise()},promise:function(a){if(a==null){if(d)return d;d=a={}}var c=g.length;while(c--)a[g[c]]=b[g[c]];return a}}),b.done(c.cancel).fail(b.cancel),delete b.cancel,a&&a.call(b,b);return b},when:function(a){function i(a){return function(c){b[a]=arguments.length>1?h.call(arguments,0):c,--e||g.resolveWith(g,h.call(b,0))}}var b=arguments,c=0,d=b.length,e=d,g=d<=1&&a&&f.isFunction(a.promise)?a:f.Deferred();if(d>1){for(;c<d;c++)b[c]&&f.isFunction(b[c].promise)?b[c].promise().then(i(c),g.reject):--e;e||g.resolveWith(g,b)}else g!==a&&g.resolveWith(g,d?[a]:[]);return g.promise()}}),f.support=function(){var a=c.createElement("div"),b=c.documentElement,d,e,f,g,h,i,j,k,l,m,n,o,p,q,r;a.setAttribute("className","t"),a.innerHTML=" <link/><table></table><a href='/a' style='top:1px;float:left;opacity:.55;'>a</a><input type='checkbox'/>",d=a.getElementsByTagName("*"),e=a.getElementsByTagName("a")[0];if(!d||!d.length||!e)return{};f=c.createElement("select"),g=f.appendChild(c.createElement("option")),h=a.getElementsByTagName("input")[0],j={leadingWhitespace:a.firstChild.nodeType===3,tbody:!a.getElementsByTagName("tbody").length,htmlSerialize:!!a.getElementsByTagName("link").length,style:/top/.test(e.getAttribute("style")),hrefNormalized:e.getAttribute("href")==="/a",opacity:/^0.55$/.test(e.style.opacity),cssFloat:!!e.style.cssFloat,checkOn:h.value==="on",optSelected:g.selected,getSetAttribute:a.className!=="t",submitBubbles:!0,changeBubbles:!0,focusinBubbles:!1,deleteExpando:!0,noCloneEvent:!0,inlineBlockNeedsLayout:!1,shrinkWrapBlocks:!1,reliableMarginRight:!0},h.checked=!0,j.noCloneChecked=h.cloneNode(!0).checked,f.disabled=!0,j.optDisabled=!g.disabled;try{delete a.test}catch(s){j.deleteExpando=!1}!a.addEventListener&&a.attachEvent&&a.fireEvent&&(a.attachEvent("onclick",function b(){j.noCloneEvent=!1,a.detachEvent("onclick",b)}),a.cloneNode(!0).fireEvent("onclick")),h=c.createElement("input"),h.value="t",h.setAttribute("type","radio"),j.radioValue=h.value==="t",h.setAttribute("checked","checked"),a.appendChild(h),k=c.createDocumentFragment(),k.appendChild(a.firstChild),j.checkClone=k.cloneNode(!0).cloneNode(!0).lastChild.checked,a.innerHTML="",a.style.width=a.style.paddingLeft="1px",l=c.createElement("body"),m={visibility:"hidden",width:0,height:0,border:0,margin:0,background:"none"};for(q in m)l.style[q]=m[q];l.appendChild(a),b.insertBefore(l,b.firstChild),j.appendChecked=h.checked,j.boxModel=a.offsetWidth===2,"zoom"in a.style&&(a.style.display="inline",a.style.zoom=1,j.inlineBlockNeedsLayout=a.offsetWidth===2,a.style.display="",a.innerHTML="<div style='width:4px;'></div>",j.shrinkWrapBlocks=a.offsetWidth!==2),a.innerHTML="<table><tr><td style='padding:0;border:0;display:none'></td><td>t</td></tr></table>",n=a.getElementsByTagName("td"),r=n[0].offsetHeight===0,n[0].style.display="",n[1].style.display="none",j.reliableHiddenOffsets=r&&n[0].offsetHeight===0,a.innerHTML="",c.defaultView&&c.defaultView.getComputedStyle&&(i=c.createElement("div"),i.style.width="0",i.style.marginRight="0",a.appendChild(i),j.reliableMarginRight=(parseInt((c.defaultView.getComputedStyle(i,null)||{marginRight:0}).marginRight,10)||0)===0),l.innerHTML="",b.removeChild(l);if(a.attachEvent)for(q in{submit:1,change:1,focusin:1})p="on"+q,r=p in a,r||(a.setAttribute(p,"return;"),r=typeof a[p]=="function"),j[q+"Bubbles"]=r;return j}(),f.boxModel=f.support.boxModel;var i=/^(?:\{.*\}|\[.*\])$/,j=/([a-z])([A-Z])/g;f.extend({cache:{},uuid:0,expando:"jQuery"+(f.fn.jquery+Math.random()).replace(/\D/g,""),noData:{embed:!0,object:"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",applet:!0},hasData:function(a){a=a.nodeType?f.cache[a[f.expando]]:a[f.expando];return!!a&&!l(a)},data:function(a,c,d,e){if(!!f.acceptData(a)){var g=f.expando,h=typeof c=="string",i,j=a.nodeType,k=j?f.cache:a,l=j?a[f.expando]:a[f.expando]&&f.expando;if((!l||e&&l&&!k[l][g])&&h&&d===b)return;l||(j?a[f.expando]=l=++f.uuid:l=f.expando),k[l]||(k[l]={},j||(k[l].toJSON=f.noop));if(typeof c=="object"||typeof c=="function")e?k[l][g]=f.extend(k[l][g],c):k[l]=f.extend(k[l],c);i=k[l],e&&(i[g]||(i[g]={}),i=i[g]),d!==b&&(i[f.camelCase(c)]=d);if(c==="events"&&!i[c])return i[g]&&i[g].events;return h?i[f.camelCase(c)]:i}},removeData:function(b,c,d){if(!!f.acceptData(b)){var e=f.expando,g=b.nodeType,h=g?f.cache:b,i=g?b[f.expando]:f.expando;if(!h[i])return;if(c){var j=d?h[i][e]:h[i];if(j){delete j[c];if(!l(j))return}}if(d){delete h[i][e];if(!l(h[i]))return}var k=h[i][e];f.support.deleteExpando||h!=a?delete h[i]:h[i]=null,k?(h[i]={},g||(h[i].toJSON=f.noop),h[i][e]=k):g&&(f.support.deleteExpando?delete b[f.expando]:b.removeAttribute?b.removeAttribute(f.expando):b[f.expando]=null)}},_data:function(a,b,c){return f.data(a,b,c,!0)},acceptData:function(a){if(a.nodeName){var b=f.noData[a.nodeName.toLowerCase()];if(b)return b!==!0&&a.getAttribute("classid")===b}return!0}}),f.fn.extend({data:function(a,c){var d=null;if(typeof a=="undefined"){if(this.length){d=f.data(this[0]);if(this[0].nodeType===1){var e=this[0].attributes,g;for(var h=0,i=e.length;h<i;h++)g=e[h].name,g.indexOf("data-")===0&&(g=f.camelCase(g.substring(5)),k(this[0],g,d[g]))}}return d}if(typeof a=="object")return this.each(function(){f.data(this,a)});var j=a.split(".");j[1]=j[1]?"."+j[1]:"";if(c===b){d=this.triggerHandler("getData"+j[1]+"!",[j[0]]),d===b&&this.length&&(d=f.data(this[0],a),d=k(this[0],a,d));return d===b&&j[1]?this.data(j[0]):d}return this.each(function(){var b=f(this),d=[j[0],c];b.triggerHandler("setData"+j[1]+"!",d),f.data(this,a,c),b.triggerHandler("changeData"+j[1]+"!",d)})},removeData:function(a){return this.each(function(){f.removeData(this,a)})}}),f.extend({_mark:function(a,c){a&&(c=(c||"fx")+"mark",f.data(a,c,(f.data(a,c,b,!0)||0)+1,!0))},_unmark:function(a,c,d){a!==!0&&(d=c,c=a,a=!1);if(c){d=d||"fx";var e=d+"mark",g=a?0:(f.data(c,e,b,!0)||1)-1;g?f.data(c,e,g,!0):(f.removeData(c,e,!0),m(c,d,"mark"))}},queue:function(a,c,d){if(a){c=(c||"fx")+"queue";var e=f.data(a,c,b,!0);d&&(!e||f.isArray(d)?e=f.data(a,c,f.makeArray(d),!0):e.push(d));return e||[]}},dequeue:function(a,b){b=b||"fx";var c=f.queue(a,b),d=c.shift(),e;d==="inprogress"&&(d=c.shift()),d&&(b==="fx"&&c.unshift("inprogress"),d.call(a,function(){f.dequeue(a,b)})),c.length||(f.removeData(a,b+"queue",!0),m(a,b,"queue"))}}),f.fn.extend({queue:function(a,c){typeof a!="string"&&(c=a,a="fx");if(c===b)return f.queue(this[0],a);return this.each(function(){var b=f.queue(this,a,c);a==="fx"&&b[0]!=="inprogress"&&f.dequeue(this,a)})},dequeue:function(a){return this.each(function(){f.dequeue(this,a)})},delay:function(a,b){a=f.fx?f.fx.speeds[a]||a:a,b=b||"fx";return this.queue(b,function(){var c=this;setTimeout(function(){f.dequeue(c,b)},a)})},clearQueue:function(a){return this.queue(a||"fx",[])},promise:function(a,c){function m(){--h||d.resolveWith(e,[e])}typeof a!="string"&&(c=a,a=b),a=a||"fx";var d=f.Deferred(),e=this,g=e.length,h=1,i=a+"defer",j=a+"queue",k=a+"mark",l;while(g--)if(l=f.data(e[g],i,b,!0)||(f.data(e[g],j,b,!0)||f.data(e[g],k,b,!0))&&f.data(e[g],i,f._Deferred(),!0))h++,l.done(m);m();return d.promise()}});var n=/[\n\t\r]/g,o=/\s+/,p=/\r/g,q=/^(?:button|input)$/i,r=/^(?:button|input|object|select|textarea)$/i,s=/^a(?:rea)?$/i,t=/^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i,u=/\:/,v,w;f.fn.extend({attr:function(a,b){return f.access(this,a,b,!0,f.attr)},removeAttr:function(a){return this.each(function(){f.removeAttr(this,a)})},prop:function(a,b){return f.access(this,a,b,!0,f.prop)},removeProp:function(a){a=f.propFix[a]||a;return this.each(function(){try{this[a]=b,delete this[a]}catch(c){}})},addClass:function(a){if(f.isFunction(a))return this.each(function(b){var c=f(this);c.addClass(a.call(this,b,c.attr("class")||""))});if(a&&typeof a=="string"){var b=(a||"").split(o);for(var c=0,d=this.length;c<d;c++){var e=this[c];if(e.nodeType===1)if(!e.className)e.className=a;else{var g=" "+e.className+" ",h=e.className;for(var i=0,j=b.length;i<j;i++)g.indexOf(" "+b[i]+" ")<0&&(h+=" "+b[i]);e.className=f.trim(h)}}}return this},removeClass:function(a){if(f.isFunction(a))return this.each(function(b){var c=f(this);c.removeClass(a.call(this,b,c.attr("class")))});if(a&&typeof a=="string"||a===b){var c=(a||"").split(o);for(var d=0,e=this.length;d<e;d++){var g=this[d];if(g.nodeType===1&&g.className)if(a){var h=(" "+g.className+" ").replace(n," ");for(var i=0,j=c.length;i<j;i++)h=h.replace(" "+c[i]+" "," ");g.className=f.trim(h)}else g.className=""}}return this},toggleClass:function(a,b){var c=typeof a,d=typeof b=="boolean";if(f.isFunction(a))return this.each(function(c){var d=f(this);d.toggleClass(a.call(this,c,d.attr("class"),b),b)});return this.each(function(){if(c==="string"){var e,g=0,h=f(this),i=b,j=a.split(o);while(e=j[g++])i=d?i:!h.hasClass(e),h[i?"addClass":"removeClass"](e)}else if(c==="undefined"||c==="boolean")this.className&&f._data(this,"__className__",this.className),this.className=this.className||a===!1?"":f._data(this,"__className__")||""})},hasClass:function(a){var b=" "+a+" ";for(var c=0,d=this.length;c<d;c++)if((" "+this[c].className+" ").replace(n," ").indexOf(b)>-1)return!0;return!1},val:function(a){var c,d,e=this[0];if(!arguments.length){if(e){c=f.valHooks[e.nodeName.toLowerCase()]||f.valHooks[e.type];if(c&&"get"in c&&(d=c.get(e,"value"))!==b)return d;return(e.value||"").replace(p,"")}return b}var g=f.isFunction(a);return this.each(function(d){var e=f(this),h;if(this.nodeType===1){g?h=a.call(this,d,e.val()):h=a,h==null?h="":typeof h=="number"?h+="":f.isArray(h)&&(h=f.map(h,function(a){return a==null?"":a+""})),c=f.valHooks[this.nodeName.toLowerCase()]||f.valHooks[this.type];if(!c||!("set"in c)||c.set(this,h,"value")===b)this.value=h}})}}),f.extend({valHooks:{option:{get:function(a){var b=a.attributes.value;return!b||b.specified?a.value:a.text}},select:{get:function(a){var b,c=a.selectedIndex,d=[],e=a.options,g=a.type==="select-one";if(c<0)return null;for(var h=g?c:0,i=g?c+1:e.length;h<i;h++){var j=e[h];if(j.selected&&(f.support.optDisabled?!j.disabled:j.getAttribute("disabled")===null)&&(!j.parentNode.disabled||!f.nodeName(j.parentNode,"optgroup"))){b=f(j).val();if(g)return b;d.push(b)}}if(g&&!d.length&&e.length)return f(e[c]).val();return d},set:function(a,b){var c=f.makeArray(b);f(a).find("option").each(function(){this.selected=f.inArray(f(this).val(),c)>=0}),c.length||(a.selectedIndex=-1);return c}}},attrFn:{val:!0,css:!0,html:!0,text:!0,data:!0,width:!0,height:!0,offset:!0},attrFix:{tabindex:"tabIndex"},attr:function(a,c,d,e){var g=a.nodeType;if(!a||g===3||g===8||g===2)return b;if(e&&c in f.attrFn)return f(a)[c](d);if(!("getAttribute"in a))return f.prop(a,c,d);var h,i,j=g!==1||!f.isXMLDoc(a);c=j&&f.attrFix[c]||c,i=f.attrHooks[c],i||(!t.test(c)||typeof d!="boolean"&&d!==b&&d.toLowerCase()!==c.toLowerCase()?v&&(f.nodeName(a,"form")||u.test(c))&&(i=v):i=w);if(d!==b){if(d===null){f.removeAttr(a,c);return b}if(i&&"set"in i&&j&&(h=i.set(a,d,c))!==b)return h;a.setAttribute(c,""+d);return d}if(i&&"get"in i&&j)return i.get(a,c);h=a.getAttribute(c);return h===null?b:h},removeAttr:function(a,b){var c;a.nodeType===1&&(b=f.attrFix[b]||b,f.support.getSetAttribute?a.removeAttribute(b):(f.attr(a,b,""),a.removeAttributeNode(a.getAttributeNode(b))),t.test(b)&&(c=f.propFix[b]||b)in a&&(a[c]=!1))},attrHooks:{type:{set:function(a,b){if(q.test(a.nodeName)&&a.parentNode)f.error("type property can't be changed");else if(!f.support.radioValue&&b==="radio"&&f.nodeName(a,"input")){var c=a.value;a.setAttribute("type",b),c&&(a.value=c);return b}}},tabIndex:{get:function(a){var c=a.getAttributeNode("tabIndex");return c&&c.specified?parseInt(c.value,10):r.test(a.nodeName)||s.test(a.nodeName)&&a.href?0:b}}},propFix:{tabindex:"tabIndex",readonly:"readOnly","for":"htmlFor","class":"className",maxlength:"maxLength",cellspacing:"cellSpacing",cellpadding:"cellPadding",rowspan:"rowSpan",colspan:"colSpan",usemap:"useMap",frameborder:"frameBorder",contenteditable:"contentEditable"},prop:function(a,c,d){var e=a.nodeType;if(!a||e===3||e===8||e===2)return b;var g,h,i=e!==1||!f.isXMLDoc(a);c=i&&f.propFix[c]||c,h=f.propHooks[c];return d!==b?h&&"set"in h&&(g=h.set(a,d,c))!==b?g:a[c]=d:h&&"get"in h&&(g=h.get(a,c))!==b?g:a[c]},propHooks:{}}),w={get:function(a,c){return a[f.propFix[c]||c]?c.toLowerCase():b},set:function(a,b,c){var d;b===!1?f.removeAttr(a,c):(d=f.propFix[c]||c,d in a&&(a[d]=b),a.setAttribute(c,c.toLowerCase()));return c}},f.attrHooks.value={get:function(a,b){if(v&&f.nodeName(a,"button"))return v.get(a,b);return a.value},set:function(a,b,c){if(v&&f.nodeName(a,"button"))return v.set(a,b,c);a.value=b}},f.support.getSetAttribute||(f.attrFix=f.propFix,v=f.attrHooks.name=f.valHooks.button={get:function(a,c){var d;d=a.getAttributeNode(c);return d&&d.nodeValue!==""?d.nodeValue:b},set:function(a,b,c){var d=a.getAttributeNode(c);if(d){d.nodeValue=b;return b}}},f.each(["width","height"],function(a,b){f.attrHooks[b]=f.extend(f.attrHooks[b],{set:function(a,c){if(c===""){a.setAttribute(b,"auto");return c}}})})),f.support.hrefNormalized||f.each(["href","src","width","height"],function(a,c){f.attrHooks[c]=f.extend(f.attrHooks[c],{get:function(a){var d=a.getAttribute(c,2);return d===null?b:d}})}),f.support.style||(f.attrHooks.style={get:function(a){return a.style.cssText.toLowerCase()||b},set:function(a,b){return a.style.cssText=""+b}}),f.support.optSelected||(f.propHooks.selected=f.extend(f.propHooks.selected,{get:function(a){var b=a.parentNode;b&&(b.selectedIndex,b.parentNode&&b.parentNode.selectedIndex)}})),f.support.checkOn||f.each(["radio","checkbox"],function(){f.valHooks[this]={get:function(a){return a.getAttribute("value")===null?"on":a.value}}}),f.each(["radio","checkbox"],function(){f.valHooks[this]=f.extend(f.valHooks[this],{set:function(a,b){if(f.isArray(b))return a.checked=f.inArray(f(a).val(),b)>=0}})});var x=Object.prototype.hasOwnProperty,y=/\.(.*)$/,z=/^(?:textarea|input|select)$/i,A=/\./g,B=/ /g,C=/[^\w\s.|`]/g,D=function(a){return a.replace(C,"\\$&")};f.event={add:function(a,c,d,e){if(a.nodeType!==3&&a.nodeType!==8){if(d===!1)d=E;else if(!d)return;var g,h;d.handler&&(g=d,d=g.handler),d.guid||(d.guid=f.guid++);var i=f._data(a);if(!i)return;var j=i.events,k=i.handle;j||(i.events=j={}),k||(i.handle=k=function(a){return typeof f!="undefined"&&(!a||f.event.triggered!==a.type)?f.event.handle.apply(k.elem,arguments):b}),k.elem=a,c=c.split(" ");var l,m=0,n;while(l=c[m++]){h=g?f.extend({},g):{handler:d,data:e},l.indexOf(".")>-1?(n=l.split("."),l=n.shift(),h.namespace=n.slice(0).sort().join(".")):(n=[],h.namespace=""),h.type=l,h.guid||(h.guid=d.guid);var o=j[l],p=f.event.special[l]||{};if(!o){o=j[l]=[];if(!p.setup||p.setup.call(a,e,n,k)===!1)a.addEventListener?a.addEventListener(l,k,!1):a.attachEvent&&a.attachEvent("on"+l,k)}p.add&&(p.add.call(a,h),h.handler.guid||(h.handler.guid=d.guid)),o.push(h),f.event.global[l]=!0}a=null}},global:{},remove:function(a,c,d,e){if(a.nodeType!==3&&a.nodeType!==8){d===!1&&(d=E);var g,h,i,j,k=0,l,m,n,o,p,q,r,s=f.hasData(a)&&f._data(a),t=s&&s.events;if(!s||!t)return;c&&c.type&&(d=c.handler,c=c.type);if(!c||typeof c=="string"&&c.charAt(0)==="."){c=c||"";for(h in t)f.event.remove(a,h+c);return}c=c.split(" ");while(h=c[k++]){r=h,q=null,l=h.indexOf(".")<0,m=[],l||(m=h.split("."),h=m.shift(),n=new RegExp("(^|\\.)"+f.map(m.slice(0).sort(),D).join("\\.(?:.*\\.)?")+"(\\.|$)")),p=t[h];if(!p)continue;if(!d){for(j=0;j<p.length;j++){q=p[j];if(l||n.test(q.namespace))f.event.remove(a,r,q.handler,j),p.splice(j--,1)}continue}o=f.event.special[h]||{};for(j=e||0;j<p.length;j++){q=p[j];if(d.guid===q.guid){if(l||n.test(q.namespace))e==null&&p.splice(j--,1),o.remove&&o.remove.call(a,q);if(e!=null)break}}if(p.length===0||e!=null&&p.length===1)(!o.teardown||o.teardown.call(a,m)===!1)&&f.removeEvent(a,h,s.handle),g=null,delete t[h]}if(f.isEmptyObject(t)){var u=s.handle;u&&(u.elem=null),delete s.events,delete s.handle,f.isEmptyObject(s)&&f.removeData(a,b,!0)}}},customEvent:{getData:!0,setData:!0,changeData:!0},trigger:function(c,d,e,g){var h=c.type||c,i=[],j;h.indexOf("!")>=0&&(h=h.slice(0,-1),j=!0),h.indexOf(".")>=0&&(i=h.split("."),h=i.shift(),i.sort());if(!!e&&!f.event.customEvent[h]||!!f.event.global[h]){c=typeof c=="object"?c[f.expando]?c:new f.Event(h,c):new f.Event(h),c.type=h,c.exclusive=j,c.namespace=i.join("."),c.namespace_re=new RegExp("(^|\\.)"+i.join("\\.(?:.*\\.)?")+"(\\.|$)");if(g||!e)c.preventDefault(),c.stopPropagation();if(!e){f.each(f.cache,function(){var a=f.expando,b=this[a];b&&b.events&&b.events[h]&&f.event.trigger(c,d,b.handle.elem
+)});return}if(e.nodeType===3||e.nodeType===8)return;c.result=b,c.target=e,d=d?f.makeArray(d):[],d.unshift(c);var k=e,l=h.indexOf(":")<0?"on"+h:"";do{var m=f._data(k,"handle");c.currentTarget=k,m&&m.apply(k,d),l&&f.acceptData(k)&&k[l]&&k[l].apply(k,d)===!1&&(c.result=!1,c.preventDefault()),k=k.parentNode||k.ownerDocument||k===c.target.ownerDocument&&a}while(k&&!c.isPropagationStopped());if(!c.isDefaultPrevented()){var n,o=f.event.special[h]||{};if((!o._default||o._default.call(e.ownerDocument,c)===!1)&&(h!=="click"||!f.nodeName(e,"a"))&&f.acceptData(e)){try{l&&e[h]&&(n=e[l],n&&(e[l]=null),f.event.triggered=h,e[h]())}catch(p){}n&&(e[l]=n),f.event.triggered=b}}return c.result}},handle:function(c){c=f.event.fix(c||a.event);var d=((f._data(this,"events")||{})[c.type]||[]).slice(0),e=!c.exclusive&&!c.namespace,g=Array.prototype.slice.call(arguments,0);g[0]=c,c.currentTarget=this;for(var h=0,i=d.length;h<i;h++){var j=d[h];if(e||c.namespace_re.test(j.namespace)){c.handler=j.handler,c.data=j.data,c.handleObj=j;var k=j.handler.apply(this,g);k!==b&&(c.result=k,k===!1&&(c.preventDefault(),c.stopPropagation()));if(c.isImmediatePropagationStopped())break}}return c.result},props:"altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode layerX layerY metaKey newValue offsetX offsetY pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "),fix:function(a){if(a[f.expando])return a;var d=a;a=f.Event(d);for(var e=this.props.length,g;e;)g=this.props[--e],a[g]=d[g];a.target||(a.target=a.srcElement||c),a.target.nodeType===3&&(a.target=a.target.parentNode),!a.relatedTarget&&a.fromElement&&(a.relatedTarget=a.fromElement===a.target?a.toElement:a.fromElement);if(a.pageX==null&&a.clientX!=null){var h=a.target.ownerDocument||c,i=h.documentElement,j=h.body;a.pageX=a.clientX+(i&&i.scrollLeft||j&&j.scrollLeft||0)-(i&&i.clientLeft||j&&j.clientLeft||0),a.pageY=a.clientY+(i&&i.scrollTop||j&&j.scrollTop||0)-(i&&i.clientTop||j&&j.clientTop||0)}a.which==null&&(a.charCode!=null||a.keyCode!=null)&&(a.which=a.charCode!=null?a.charCode:a.keyCode),!a.metaKey&&a.ctrlKey&&(a.metaKey=a.ctrlKey),!a.which&&a.button!==b&&(a.which=a.button&1?1:a.button&2?3:a.button&4?2:0);return a},guid:1e8,proxy:f.proxy,special:{ready:{setup:f.bindReady,teardown:f.noop},live:{add:function(a){f.event.add(this,O(a.origType,a.selector),f.extend({},a,{handler:N,guid:a.handler.guid}))},remove:function(a){f.event.remove(this,O(a.origType,a.selector),a)}},beforeunload:{setup:function(a,b,c){f.isWindow(this)&&(this.onbeforeunload=c)},teardown:function(a,b){this.onbeforeunload===b&&(this.onbeforeunload=null)}}}},f.removeEvent=c.removeEventListener?function(a,b,c){a.removeEventListener&&a.removeEventListener(b,c,!1)}:function(a,b,c){a.detachEvent&&a.detachEvent("on"+b,c)},f.Event=function(a,b){if(!this.preventDefault)return new f.Event(a,b);a&&a.type?(this.originalEvent=a,this.type=a.type,this.isDefaultPrevented=a.defaultPrevented||a.returnValue===!1||a.getPreventDefault&&a.getPreventDefault()?F:E):this.type=a,b&&f.extend(this,b),this.timeStamp=f.now(),this[f.expando]=!0},f.Event.prototype={preventDefault:function(){this.isDefaultPrevented=F;var a=this.originalEvent;!a||(a.preventDefault?a.preventDefault():a.returnValue=!1)},stopPropagation:function(){this.isPropagationStopped=F;var a=this.originalEvent;!a||(a.stopPropagation&&a.stopPropagation(),a.cancelBubble=!0)},stopImmediatePropagation:function(){this.isImmediatePropagationStopped=F,this.stopPropagation()},isDefaultPrevented:E,isPropagationStopped:E,isImmediatePropagationStopped:E};var G=function(a){var b=a.relatedTarget;a.type=a.data;try{if(b&&b!==c&&!b.parentNode)return;while(b&&b!==this)b=b.parentNode;b!==this&&f.event.handle.apply(this,arguments)}catch(d){}},H=function(a){a.type=a.data,f.event.handle.apply(this,arguments)};f.each({mouseenter:"mouseover",mouseleave:"mouseout"},function(a,b){f.event.special[a]={setup:function(c){f.event.add(this,b,c&&c.selector?H:G,a)},teardown:function(a){f.event.remove(this,b,a&&a.selector?H:G)}}}),f.support.submitBubbles||(f.event.special.submit={setup:function(a,b){if(!f.nodeName(this,"form"))f.event.add(this,"click.specialSubmit",function(a){var b=a.target,c=b.type;(c==="submit"||c==="image")&&f(b).closest("form").length&&L("submit",this,arguments)}),f.event.add(this,"keypress.specialSubmit",function(a){var b=a.target,c=b.type;(c==="text"||c==="password")&&f(b).closest("form").length&&a.keyCode===13&&L("submit",this,arguments)});else return!1},teardown:function(a){f.event.remove(this,".specialSubmit")}});if(!f.support.changeBubbles){var I,J=function(a){var b=a.type,c=a.value;b==="radio"||b==="checkbox"?c=a.checked:b==="select-multiple"?c=a.selectedIndex>-1?f.map(a.options,function(a){return a.selected}).join("-"):"":f.nodeName(a,"select")&&(c=a.selectedIndex);return c},K=function(c){var d=c.target,e,g;if(!!z.test(d.nodeName)&&!d.readOnly){e=f._data(d,"_change_data"),g=J(d),(c.type!=="focusout"||d.type!=="radio")&&f._data(d,"_change_data",g);if(e===b||g===e)return;if(e!=null||g)c.type="change",c.liveFired=b,f.event.trigger(c,arguments[1],d)}};f.event.special.change={filters:{focusout:K,beforedeactivate:K,click:function(a){var b=a.target,c=f.nodeName(b,"input")?b.type:"";(c==="radio"||c==="checkbox"||f.nodeName(b,"select"))&&K.call(this,a)},keydown:function(a){var b=a.target,c=f.nodeName(b,"input")?b.type:"";(a.keyCode===13&&!f.nodeName(b,"textarea")||a.keyCode===32&&(c==="checkbox"||c==="radio")||c==="select-multiple")&&K.call(this,a)},beforeactivate:function(a){var b=a.target;f._data(b,"_change_data",J(b))}},setup:function(a,b){if(this.type==="file")return!1;for(var c in I)f.event.add(this,c+".specialChange",I[c]);return z.test(this.nodeName)},teardown:function(a){f.event.remove(this,".specialChange");return z.test(this.nodeName)}},I=f.event.special.change.filters,I.focus=I.beforeactivate}f.support.focusinBubbles||f.each({focus:"focusin",blur:"focusout"},function(a,b){function e(a){var c=f.event.fix(a);c.type=b,c.originalEvent={},f.event.trigger(c,null,c.target),c.isDefaultPrevented()&&a.preventDefault()}var d=0;f.event.special[b]={setup:function(){d++===0&&c.addEventListener(a,e,!0)},teardown:function(){--d===0&&c.removeEventListener(a,e,!0)}}}),f.each(["bind","one"],function(a,c){f.fn[c]=function(a,d,e){var g;if(typeof a=="object"){for(var h in a)this[c](h,d,a[h],e);return this}if(arguments.length===2||d===!1)e=d,d=b;c==="one"?(g=function(a){f(this).unbind(a,g);return e.apply(this,arguments)},g.guid=e.guid||f.guid++):g=e;if(a==="unload"&&c!=="one")this.one(a,d,e);else for(var i=0,j=this.length;i<j;i++)f.event.add(this[i],a,g,d);return this}}),f.fn.extend({unbind:function(a,b){if(typeof a=="object"&&!a.preventDefault)for(var c in a)this.unbind(c,a[c]);else for(var d=0,e=this.length;d<e;d++)f.event.remove(this[d],a,b);return this},delegate:function(a,b,c,d){return this.live(b,c,d,a)},undelegate:function(a,b,c){return arguments.length===0?this.unbind("live"):this.die(b,null,c,a)},trigger:function(a,b){return this.each(function(){f.event.trigger(a,b,this)})},triggerHandler:function(a,b){if(this[0])return f.event.trigger(a,b,this[0],!0)},toggle:function(a){var b=arguments,c=a.guid||f.guid++,d=0,e=function(c){var e=(f.data(this,"lastToggle"+a.guid)||0)%d;f.data(this,"lastToggle"+a.guid,e+1),c.preventDefault();return b[e].apply(this,arguments)||!1};e.guid=c;while(d<b.length)b[d++].guid=c;return this.click(e)},hover:function(a,b){return this.mouseenter(a).mouseleave(b||a)}});var M={focus:"focusin",blur:"focusout",mouseenter:"mouseover",mouseleave:"mouseout"};f.each(["live","die"],function(a,c){f.fn[c]=function(a,d,e,g){var h,i=0,j,k,l,m=g||this.selector,n=g?this:f(this.context);if(typeof a=="object"&&!a.preventDefault){for(var o in a)n[c](o,d,a[o],m);return this}if(c==="die"&&!a&&g&&g.charAt(0)==="."){n.unbind(g);return this}if(d===!1||f.isFunction(d))e=d||E,d=b;a=(a||"").split(" ");while((h=a[i++])!=null){j=y.exec(h),k="",j&&(k=j[0],h=h.replace(y,""));if(h==="hover"){a.push("mouseenter"+k,"mouseleave"+k);continue}l=h,M[h]?(a.push(M[h]+k),h=h+k):h=(M[h]||h)+k;if(c==="live")for(var p=0,q=n.length;p<q;p++)f.event.add(n[p],"live."+O(h,m),{data:d,selector:m,handler:e,origType:h,origHandler:e,preType:l});else n.unbind("live."+O(h,m),e)}return this}}),f.each("blur focus focusin focusout load resize scroll unload click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup error".split(" "),function(a,b){f.fn[b]=function(a,c){c==null&&(c=a,a=null);return arguments.length>0?this.bind(b,a,c):this.trigger(b)},f.attrFn&&(f.attrFn[b]=!0)}),function(){function u(a,b,c,d,e,f){for(var g=0,h=d.length;g<h;g++){var i=d[g];if(i){var j=!1;i=i[a];while(i){if(i.sizcache===c){j=d[i.sizset];break}if(i.nodeType===1){f||(i.sizcache=c,i.sizset=g);if(typeof b!="string"){if(i===b){j=!0;break}}else if(k.filter(b,[i]).length>0){j=i;break}}i=i[a]}d[g]=j}}}function t(a,b,c,d,e,f){for(var g=0,h=d.length;g<h;g++){var i=d[g];if(i){var j=!1;i=i[a];while(i){if(i.sizcache===c){j=d[i.sizset];break}i.nodeType===1&&!f&&(i.sizcache=c,i.sizset=g);if(i.nodeName.toLowerCase()===b){j=i;break}i=i[a]}d[g]=j}}}var a=/((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,d=0,e=Object.prototype.toString,g=!1,h=!0,i=/\\/g,j=/\W/;[0,0].sort(function(){h=!1;return 0});var k=function(b,d,f,g){f=f||[],d=d||c;var h=d;if(d.nodeType!==1&&d.nodeType!==9)return[];if(!b||typeof b!="string")return f;var i,j,n,o,q,r,s,t,u=!0,w=k.isXML(d),x=[],y=b;do{a.exec(""),i=a.exec(y);if(i){y=i[3],x.push(i[1]);if(i[2]){o=i[3];break}}}while(i);if(x.length>1&&m.exec(b))if(x.length===2&&l.relative[x[0]])j=v(x[0]+x[1],d);else{j=l.relative[x[0]]?[d]:k(x.shift(),d);while(x.length)b=x.shift(),l.relative[b]&&(b+=x.shift()),j=v(b,j)}else{!g&&x.length>1&&d.nodeType===9&&!w&&l.match.ID.test(x[0])&&!l.match.ID.test(x[x.length-1])&&(q=k.find(x.shift(),d,w),d=q.expr?k.filter(q.expr,q.set)[0]:q.set[0]);if(d){q=g?{expr:x.pop(),set:p(g)}:k.find(x.pop(),x.length===1&&(x[0]==="~"||x[0]==="+")&&d.parentNode?d.parentNode:d,w),j=q.expr?k.filter(q.expr,q.set):q.set,x.length>0?n=p(j):u=!1;while(x.length)r=x.pop(),s=r,l.relative[r]?s=x.pop():r="",s==null&&(s=d),l.relative[r](n,s,w)}else n=x=[]}n||(n=j),n||k.error(r||b);if(e.call(n)==="[object Array]")if(!u)f.push.apply(f,n);else if(d&&d.nodeType===1)for(t=0;n[t]!=null;t++)n[t]&&(n[t]===!0||n[t].nodeType===1&&k.contains(d,n[t]))&&f.push(j[t]);else for(t=0;n[t]!=null;t++)n[t]&&n[t].nodeType===1&&f.push(j[t]);else p(n,f);o&&(k(o,h,f,g),k.uniqueSort(f));return f};k.uniqueSort=function(a){if(r){g=h,a.sort(r);if(g)for(var b=1;b<a.length;b++)a[b]===a[b-1]&&a.splice(b--,1)}return a},k.matches=function(a,b){return k(a,null,null,b)},k.matchesSelector=function(a,b){return k(b,null,null,[a]).length>0},k.find=function(a,b,c){var d;if(!a)return[];for(var e=0,f=l.order.length;e<f;e++){var g,h=l.order[e];if(g=l.leftMatch[h].exec(a)){var j=g[1];g.splice(1,1);if(j.substr(j.length-1)!=="\\"){g[1]=(g[1]||"").replace(i,""),d=l.find[h](g,b,c);if(d!=null){a=a.replace(l.match[h],"");break}}}}d||(d=typeof b.getElementsByTagName!="undefined"?b.getElementsByTagName("*"):[]);return{set:d,expr:a}},k.filter=function(a,c,d,e){var f,g,h=a,i=[],j=c,m=c&&c[0]&&k.isXML(c[0]);while(a&&c.length){for(var n in l.filter)if((f=l.leftMatch[n].exec(a))!=null&&f[2]){var o,p,q=l.filter[n],r=f[1];g=!1,f.splice(1,1);if(r.substr(r.length-1)==="\\")continue;j===i&&(i=[]);if(l.preFilter[n]){f=l.preFilter[n](f,j,d,i,e,m);if(!f)g=o=!0;else if(f===!0)continue}if(f)for(var s=0;(p=j[s])!=null;s++)if(p){o=q(p,f,s,j);var t=e^!!o;d&&o!=null?t?g=!0:j[s]=!1:t&&(i.push(p),g=!0)}if(o!==b){d||(j=i),a=a.replace(l.match[n],"");if(!g)return[];break}}if(a===h)if(g==null)k.error(a);else break;h=a}return j},k.error=function(a){throw"Syntax error, unrecognized expression: "+a};var l=k.selectors={order:["ID","NAME","TAG"],match:{ID:/#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,CLASS:/\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,NAME:/\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/,ATTR:/\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(?:(['"])(.*?)\3|(#?(?:[\w\u00c0-\uFFFF\-]|\\.)*)|)|)\s*\]/,TAG:/^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/,CHILD:/:(only|nth|last|first)-child(?:\(\s*(even|odd|(?:[+\-]?\d+|(?:[+\-]?\d*)?n\s*(?:[+\-]\s*\d+)?))\s*\))?/,POS:/:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/,PSEUDO:/:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/},leftMatch:{},attrMap:{"class":"className","for":"htmlFor"},attrHandle:{href:function(a){return a.getAttribute("href")},type:function(a){return a.getAttribute("type")}},relative:{"+":function(a,b){var c=typeof b=="string",d=c&&!j.test(b),e=c&&!d;d&&(b=b.toLowerCase());for(var f=0,g=a.length,h;f<g;f++)if(h=a[f]){while((h=h.previousSibling)&&h.nodeType!==1);a[f]=e||h&&h.nodeName.toLowerCase()===b?h||!1:h===b}e&&k.filter(b,a,!0)},">":function(a,b){var c,d=typeof b=="string",e=0,f=a.length;if(d&&!j.test(b)){b=b.toLowerCase();for(;e<f;e++){c=a[e];if(c){var g=c.parentNode;a[e]=g.nodeName.toLowerCase()===b?g:!1}}}else{for(;e<f;e++)c=a[e],c&&(a[e]=d?c.parentNode:c.parentNode===b);d&&k.filter(b,a,!0)}},"":function(a,b,c){var e,f=d++,g=u;typeof b=="string"&&!j.test(b)&&(b=b.toLowerCase(),e=b,g=t),g("parentNode",b,f,a,e,c)},"~":function(a,b,c){var e,f=d++,g=u;typeof b=="string"&&!j.test(b)&&(b=b.toLowerCase(),e=b,g=t),g("previousSibling",b,f,a,e,c)}},find:{ID:function(a,b,c){if(typeof b.getElementById!="undefined"&&!c){var d=b.getElementById(a[1]);return d&&d.parentNode?[d]:[]}},NAME:function(a,b){if(typeof b.getElementsByName!="undefined"){var c=[],d=b.getElementsByName(a[1]);for(var e=0,f=d.length;e<f;e++)d[e].getAttribute("name")===a[1]&&c.push(d[e]);return c.length===0?null:c}},TAG:function(a,b){if(typeof b.getElementsByTagName!="undefined")return b.getElementsByTagName(a[1])}},preFilter:{CLASS:function(a,b,c,d,e,f){a=" "+a[1].replace(i,"")+" ";if(f)return a;for(var g=0,h;(h=b[g])!=null;g++)h&&(e^(h.className&&(" "+h.className+" ").replace(/[\t\n\r]/g," ").indexOf(a)>=0)?c||d.push(h):c&&(b[g]=!1));return!1},ID:function(a){return a[1].replace(i,"")},TAG:function(a,b){return a[1].replace(i,"").toLowerCase()},CHILD:function(a){if(a[1]==="nth"){a[2]||k.error(a[0]),a[2]=a[2].replace(/^\+|\s*/g,"");var b=/(-?)(\d*)(?:n([+\-]?\d*))?/.exec(a[2]==="even"&&"2n"||a[2]==="odd"&&"2n+1"||!/\D/.test(a[2])&&"0n+"+a[2]||a[2]);a[2]=b[1]+(b[2]||1)-0,a[3]=b[3]-0}else a[2]&&k.error(a[0]);a[0]=d++;return a},ATTR:function(a,b,c,d,e,f){var g=a[1]=a[1].replace(i,"");!f&&l.attrMap[g]&&(a[1]=l.attrMap[g]),a[4]=(a[4]||a[5]||"").replace(i,""),a[2]==="~="&&(a[4]=" "+a[4]+" ");return a},PSEUDO:function(b,c,d,e,f){if(b[1]==="not")if((a.exec(b[3])||"").length>1||/^\w/.test(b[3]))b[3]=k(b[3],null,null,c);else{var g=k.filter(b[3],c,d,!0^f);d||e.push.apply(e,g);return!1}else if(l.match.POS.test(b[0])||l.match.CHILD.test(b[0]))return!0;return b},POS:function(a){a.unshift(!0);return a}},filters:{enabled:function(a){return a.disabled===!1&&a.type!=="hidden"},disabled:function(a){return a.disabled===!0},checked:function(a){return a.checked===!0},selected:function(a){a.parentNode&&a.parentNode.selectedIndex;return a.selected===!0},parent:function(a){return!!a.firstChild},empty:function(a){return!a.firstChild},has:function(a,b,c){return!!k(c[3],a).length},header:function(a){return/h\d/i.test(a.nodeName)},text:function(a){var b=a.getAttribute("type"),c=a.type;return a.nodeName.toLowerCase()==="input"&&"text"===c&&(b===c||b===null)},radio:function(a){return a.nodeName.toLowerCase()==="input"&&"radio"===a.type},checkbox:function(a){return a.nodeName.toLowerCase()==="input"&&"checkbox"===a.type},file:function(a){return a.nodeName.toLowerCase()==="input"&&"file"===a.type},password:function(a){return a.nodeName.toLowerCase()==="input"&&"password"===a.type},submit:function(a){var b=a.nodeName.toLowerCase();return(b==="input"||b==="button")&&"submit"===a.type},image:function(a){return a.nodeName.toLowerCase()==="input"&&"image"===a.type},reset:function(a){var b=a.nodeName.toLowerCase();return(b==="input"||b==="button")&&"reset"===a.type},button:function(a){var b=a.nodeName.toLowerCase();return b==="input"&&"button"===a.type||b==="button"},input:function(a){return/input|select|textarea|button/i.test(a.nodeName)},focus:function(a){return a===a.ownerDocument.activeElement}},setFilters:{first:function(a,b){return b===0},last:function(a,b,c,d){return b===d.length-1},even:function(a,b){return b%2===0},odd:function(a,b){return b%2===1},lt:function(a,b,c){return b<c[3]-0},gt:function(a,b,c){return b>c[3]-0},nth:function(a,b,c){return c[3]-0===b},eq:function(a,b,c){return c[3]-0===b}},filter:{PSEUDO:function(a,b,c,d){var e=b[1],f=l.filters[e];if(f)return f(a,c,b,d);if(e==="contains")return(a.textContent||a.innerText||k.getText([a])||"").indexOf(b[3])>=0;if(e==="not"){var g=b[3];for(var h=0,i=g.length;h<i;h++)if(g[h]===a)return!1;return!0}k.error(e)},CHILD:function(a,b){var c=b[1],d=a;switch(c){case"only":case"first":while(d=d.previousSibling)if(d.nodeType===1)return!1;if(c==="first")return!0;d=a;case"last":while(d=d.nextSibling)if(d.nodeType===1)return!1;return!0;case"nth":var e=b[2],f=b[3];if(e===1&&f===0)return!0;var g=b[0],h=a.parentNode;if(h&&(h.sizcache!==g||!a.nodeIndex)){var i=0;for(d=h.firstChild;d;d=d.nextSibling)d.nodeType===1&&(d.nodeIndex=++i);h.sizcache=g}var j=a.nodeIndex-f;return e===0?j===0:j%e===0&&j/e>=0}},ID:function(a,b){return a.nodeType===1&&a.getAttribute("id")===b},TAG:function(a,b){return b==="*"&&a.nodeType===1||a.nodeName.toLowerCase()===b},CLASS:function(a,b){return(" "+(a.className||a.getAttribute("class"))+" ").indexOf(b)>-1},ATTR:function(a,b){var c=b[1],d=l.attrHandle[c]?l.attrHandle[c](a):a[c]!=null?a[c]:a.getAttribute(c),e=d+"",f=b[2],g=b[4];return d==null?f==="!=":f==="="?e===g:f==="*="?e.indexOf(g)>=0:f==="~="?(" "+e+" ").indexOf(g)>=0:g?f==="!="?e!==g:f==="^="?e.indexOf(g)===0:f==="$="?e.substr(e.length-g.length)===g:f==="|="?e===g||e.substr(0,g.length+1)===g+"-":!1:e&&d!==!1},POS:function(a,b,c,d){var e=b[2],f=l.setFilters[e];if(f)return f(a,c,b,d)}}},m=l.match.POS,n=function(a,b){return"\\"+(b-0+1)};for(var o in l.match)l.match[o]=new RegExp(l.match[o].source+/(?![^\[]*\])(?![^\(]*\))/.source),l.leftMatch[o]=new RegExp(/(^(?:.|\r|\n)*?)/.source+l.match[o].source.replace(/\\(\d+)/g,n));var p=function(a,b){a=Array.prototype.slice.call(a,0);if(b){b.push.apply(b,a);return b}return a};try{Array.prototype.slice.call(c.documentElement.childNodes,0)[0].nodeType}catch(q){p=function(a,b){var c=0,d=b||[];if(e.call(a)==="[object Array]")Array.prototype.push.apply(d,a);else if(typeof a.length=="number")for(var f=a.length;c<f;c++)d.push(a[c]);else for(;a[c];c++)d.push(a[c]);return d}}var r,s;c.documentElement.compareDocumentPosition?r=function(a,b){if(a===b){g=!0;return 0}if(!a.compareDocumentPosition||!b.compareDocumentPosition)return a.compareDocumentPosition?-1:1;return a.compareDocumentPosition(b)&4?-1:1}:(r=function(a,b){if(a===b){g=!0;return 0}if(a.sourceIndex&&b.sourceIndex)return a.sourceIndex-b.sourceIndex;var c,d,e=[],f=[],h=a.parentNode,i=b.parentNode,j=h;if(h===i)return s(a,b);if(!h)return-1;if(!i)return 1;while(j)e.unshift(j),j=j.parentNode;j=i;while(j)f.unshift(j),j=j.parentNode;c=e.length,d=f.length;for(var k=0;k<c&&k<d;k++)if(e[k]!==f[k])return s(e[k],f[k]);return k===c?s(a,f[k],-1):s(e[k],b,1)},s=function(a,b,c){if(a===b)return c;var d=a.nextSibling;while(d){if(d===b)return-1;d=d.nextSibling}return 1}),k.getText=function(a){var b="",c;for(var d=0;a[d];d++)c=a[d],c.nodeType===3||c.nodeType===4?b+=c.nodeValue:c.nodeType!==8&&(b+=k.getText(c.childNodes));return b},function(){var a=c.createElement("div"),d="script"+(new Date).getTime(),e=c.documentElement;a.innerHTML="<a name='"+d+"'/>",e.insertBefore(a,e.firstChild),c.getElementById(d)&&(l.find.ID=function(a,c,d){if(typeof c.getElementById!="undefined"&&!d){var e=c.getElementById(a[1]);return e?e.id===a[1]||typeof e.getAttributeNode!="undefined"&&e.getAttributeNode("id").nodeValue===a[1]?[e]:b:[]}},l.filter.ID=function(a,b){var c=typeof a.getAttributeNode!="undefined"&&a.getAttributeNode("id");return a.nodeType===1&&c&&c.nodeValue===b}),e.removeChild(a),e=a=null}(),function(){var a=c.createElement("div");a.appendChild(c.createComment("")),a.getElementsByTagName("*").length>0&&(l.find.TAG=function(a,b){var c=b.getElementsByTagName(a[1]);if(a[1]==="*"){var d=[];for(var e=0;c[e];e++)c[e].nodeType===1&&d.push(c[e]);c=d}return c}),a.innerHTML="<a href='#'></a>",a.firstChild&&typeof a.firstChild.getAttribute!="undefined"&&a.firstChild.getAttribute("href")!=="#"&&(l.attrHandle.href=function(a){return a.getAttribute("href",2)}),a=null}(),c.querySelectorAll&&function(){var a=k,b=c.createElement("div"),d="__sizzle__";b.innerHTML="<p class='TEST'></p>";if(!b.querySelectorAll||b.querySelectorAll(".TEST").length!==0){k=function(b,e,f,g){e=e||c;if(!g&&!k.isXML(e)){var h=/^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec(b);if(h&&(e.nodeType===1||e.nodeType===9)){if(h[1])return p(e.getElementsByTagName(b),f);if(h[2]&&l.find.CLASS&&e.getElementsByClassName)return p(e.getElementsByClassName(h[2]),f)}if(e.nodeType===9){if(b==="body"&&e.body)return p([e.body],f);if(h&&h[3]){var i=e.getElementById(h[3]);if(!i||!i.parentNode)return p([],f);if(i.id===h[3])return p([i],f)}try{return p(e.querySelectorAll(b),f)}catch(j){}}else if(e.nodeType===1&&e.nodeName.toLowerCase()!=="object"){var m=e,n=e.getAttribute("id"),o=n||d,q=e.parentNode,r=/^\s*[+~]/.test(b);n?o=o.replace(/'/g,"\\$&"):e.setAttribute("id",o),r&&q&&(e=e.parentNode);try{if(!r||q)return p(e.querySelectorAll("[id='"+o+"'] "+b),f)}catch(s){}finally{n||m.removeAttribute("id")}}}return a(b,e,f,g)};for(var e in a)k[e]=a[e];b=null}}(),function(){var a=c.documentElement,b=a.matchesSelector||a.mozMatchesSelector||a.webkitMatchesSelector||a.msMatchesSelector;if(b){var d=!b.call(c.createElement("div"),"div"),e=!1;try{b.call(c.documentElement,"[test!='']:sizzle")}catch(f){e=!0}k.matchesSelector=function(a,c){c=c.replace(/\=\s*([^'"\]]*)\s*\]/g,"='$1']");if(!k.isXML(a))try{if(e||!l.match.PSEUDO.test(c)&&!/!=/.test(c)){var f=b.call(a,c);if(f||!d||a.document&&a.document.nodeType!==11)return f}}catch(g){}return k(c,null,null,[a]).length>0}}}(),function(){var a=c.createElement("div");a.innerHTML="<div class='test e'></div><div class='test'></div>";if(!!a.getElementsByClassName&&a.getElementsByClassName("e").length!==0){a.lastChild.className="e";if(a.getElementsByClassName("e").length===1)return;l.order.splice(1,0,"CLASS"),l.find.CLASS=function(a,b,c){if(typeof b.getElementsByClassName!="undefined"&&!c)return b.getElementsByClassName(a[1])},a=null}}(),c.documentElement.contains?k.contains=function(a,b){return a!==b&&(a.contains?a.contains(b):!0)}:c.documentElement.compareDocumentPosition?k.contains=function(a,b){return!!(a.compareDocumentPosition(b)&16)}:k.contains=function(){return!1},k.isXML=function(a){var b=(a?a.ownerDocument||a:0).documentElement;return b?b.nodeName!=="HTML":!1};var v=function(a,b){var c,d=[],e="",f=b.nodeType?[b]:b;while(c=l.match.PSEUDO.exec(a))e+=c[0],a=a.replace(l.match.PSEUDO,"");a=l.relative[a]?a+"*":a;for(var g=0,h=f.length;g<h;g++)k(a,f[g],d);return k.filter(e,d)};f.find=k,f.expr=k.selectors,f.expr[":"]=f.expr.filters,f.unique=k.uniqueSort,f.text=k.getText,f.isXMLDoc=k.isXML,f.contains=k.contains}();var P=/Until$/,Q=/^(?:parents|prevUntil|prevAll)/,R=/,/,S=/^.[^:#\[\.,]*$/,T=Array.prototype.slice,U=f.expr.match.POS,V={children:!0,contents:!0,next:!0,prev:!0};f.fn.extend({find:function(a){var b=this,c,d;if(typeof a!="string")return f(a).filter(function(){for(c=0,d=b.length;c<d;c++)if(f.contains(b[c],this))return!0});var e=this.pushStack("","find",a),g,h,i;for(c=0,d=this.length;c<d;c++){g=e.length,f.find(a,this[c],e);if(c>0)for(h=g;h<e.length;h++)for(i=0;i<g;i++)if(e[i]===e[h]){e.splice(h--,1);break}}return e},has:function(a){var b=f(a);return this.filter(function(){for(var a=0,c=b.length;a<c;a++)if(f.contains(this,b[a]))return!0})},not:function(a){return this.pushStack(X(this,a,!1),"not",a)},filter:function(a){return this.pushStack(X(this,a,!0),"filter",a)},is:function(a){return!!a&&(typeof a=="string"?f.filter(a,this).length>0:this.filter(a).length>0)},closest:function(a,b){var c=[],d,e,g=this[0];if(f.isArray(a)){var h,i,j={},k=1;if(g&&a.length){for(d=0,e=a.length;d<e;d++)i=a[d],j[i]||(j[i]=U.test(i)?f(i,b||this.context):i);while(g&&g.ownerDocument&&g!==b){for(i in j)h=j[i],(h.jquery?h.index(g)>-1:f(g).is(h))&&c.push({selector:i,elem:g,level:k});g=g.parentNode,k++}}return c}var l=U.test(a)||typeof a!="string"?f(a,b||this.context):0;for(d=0,e=this.length;d<e;d++){g=this[d];while(g){if(l?l.index(g)>-1:f.find.matchesSelector(g,a)){c.push(g);break}g=g.parentNode;if(!g||!g.ownerDocument||g===b||g.nodeType===11)break}}c=c.length>1?f.unique(c):c;return this.pushStack(c,"closest",a)},index:function(a){if(!a||typeof a=="string")return f.inArray(this[0],a?f(a):this.parent().children());return f.inArray(a.jquery?a[0]:a,this)},add:function(a,b){var c=typeof a=="string"?f(a,b):f.makeArray(a&&a.nodeType?[a]:a),d=f.merge(this.get(),c);return this.pushStack(W(c[0])||W(d[0])?d:f.unique(d))},andSelf:function(){return this.add(this.prevObject)}}),f.each({parent:function(a){var b=a.parentNode;return b&&b.nodeType!==11?b:null},parents:function(a){return f.dir(a,"parentNode")},parentsUntil:function(a,b,c){return f.dir(a,"parentNode",c)},next:function(a){return f.nth(a,2,"nextSibling")},prev:function(a){return f.nth(a,2,"previousSibling")},nextAll:function(a){return f.dir(a,"nextSibling")},prevAll:function(a){return f.dir(a,"previousSibling")},nextUntil:function(a,b,c){return f.dir(a,"nextSibling",c)},prevUntil:function(a,b,c){return f.dir(a,"previousSibling",c)},siblings:function(a){return f.sibling(a.parentNode.firstChild,a)},children:function(a){return f.sibling(a.firstChild)},contents:function(a){return f.nodeName(a,"iframe")?a.contentDocument||a.contentWindow.document:f.makeArray(a.childNodes)}},function(a,b){f.fn[a]=function(c,d){var e=f.map(this,b,c),g=T.call(arguments);P.test(a)||(d=c),d&&typeof d=="string"&&(e=f.filter(d,e)),e=this.length>1&&!V[a]?f.unique(e):e,(this.length>1||R.test(d))&&Q.test(a)&&(e=e.reverse());return this.pushStack(e,a,g.join(","))}}),f.extend({filter:function(a,b,c){c&&(a=":not("+a+")");return b.length===1?f.find.matchesSelector(b[0],a)?[b[0]]:[]:f.find.matches(a,b)},dir:function(a,c,d){var e=[],g=a[c];while(g&&g.nodeType!==9&&(d===b||g.nodeType!==1||!f(g).is(d)))g.nodeType===1&&e.push(g),g=g[c];return e},nth:function(a,b,c,d){b=b||1;var e=0;for(;a;a=a[c])if(a.nodeType===1&&++e===b)break;return a},sibling:function(a,b){var c=[];for(;a;a=a.nextSibling)a.nodeType===1&&a!==b&&c.push(a);return c}});var Y=/ jQuery\d+="(?:\d+|null)"/g,Z=/^\s+/,$=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig,_=/<([\w:]+)/,ba=/<tbody/i,bb=/<|&#?\w+;/,bc=/<(?:script|object|embed|option|style)/i,bd=/checked\s*(?:[^=]|=\s*.checked.)/i,be=/\/(java|ecma)script/i,bf=/^\s*<!(?:\[CDATA\[|\-\-)/,bg={option:[1,"<select multiple='multiple'>","</select>"],legend:[1,"<fieldset>","</fieldset>"],thead:[1,"<table>","</table>"],tr:[2,"<table><tbody>","</tbody></table>"],td:[3,"<table><tbody><tr>","</tr></tbody></table>"],col:[2,"<table><tbody></tbody><colgroup>","</colgroup></table>"],area:[1,"<map>","</map>"],_default:[0,"",""]};bg.optgroup=bg.option,bg.tbody=bg.tfoot=bg.colgroup=bg.caption=bg.thead,bg.th=bg.td,f.support.htmlSerialize||(bg._default=[1,"div<div>","</div>"]),f.fn.extend({text:function(a){if(f.isFunction(a))return this.each(function(b){var c=f(this);c.text(a.call(this,b,c.text()))});if(typeof a!="object"&&a!==b)return this.empty().append((this[0]&&this[0].ownerDocument||c).createTextNode(a));return f.text(this)},wrapAll:function(a){if(f.isFunction(a))return this.each(function(b){f(this).wrapAll(a.call(this,b))});if(this[0]){var b=f(a,this[0].ownerDocument).eq(0).clone(!0);this[0].parentNode&&b.insertBefore(this[0]),b.map(function(){var a=this;while(a.firstChild&&a.firstChild.nodeType===1)a=a.firstChild;return a}).append(this)}return this},wrapInner:function(a){if(f.isFunction(a))return this.each(function(b){f(this).wrapInner(a.call(this,b))});return this.each(function(){var b=f(this),c=b.contents();c.length?c.wrapAll(a):b.append(a)})},wrap:function(a){return this.each(function(){f(this).wrapAll(a)})},unwrap:function(){return this.parent().each(function(){f.nodeName(this,"body")||f(this).replaceWith(this.childNodes)}).end()},append:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.appendChild(a)})},prepend:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.insertBefore(a,this.firstChild)})},before:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this)});if(arguments.length){var a=f(arguments[0]);a.push.apply(a,this.toArray());return this.pushStack(a,"before",arguments)}},after:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this.nextSibling)});if(arguments.length){var a=this.pushStack(this,"after",arguments);a.push.apply(a,f(arguments[0]).toArray());return a}},remove:function(a,b){for(var c=0,d;(d=this[c])!=null;c++)if(!a||f.filter(a,[d]).length)!b&&d.nodeType===1&&(f.cleanData(d.getElementsByTagName("*")),f.cleanData([d])),d.parentNode&&d.parentNode.removeChild(d);return this},empty:function(){for(var a=0,b;(b=this[a])!=null;a++){b.nodeType===1&&f.cleanData(b.getElementsByTagName("*"));while(b.firstChild)b.removeChild(b.firstChild)}return this},clone:function(a,b){a=a==null?!1:a,b=b==null?a:b;return this.map(function(){return f.clone(this,a,b)})},html:function(a){if(a===b)return this[0]&&this[0].nodeType===1?this[0].innerHTML.replace(Y,""):null;if(typeof a=="string"&&!bc.test(a)&&(f.support.leadingWhitespace||!Z.test(a))&&!bg[(_.exec(a)||["",""])[1].toLowerCase()]){a=a.replace($,"<$1></$2>");try{for(var c=0,d=this.length;c<d;c++)this[c].nodeType===1&&(f.cleanData(this[c].getElementsByTagName("*")),this[c].innerHTML=a)}catch(e){this.empty().append(a)}}else f.isFunction(a)?this.each(function(b){var c=f(this);c.html(a.call(this,b,c.html()))}):this.empty().append(a);return this},replaceWith:function(a){if(this[0]&&this[0].parentNode){if(f.isFunction(a))return this.each(function(b){var c=f(this),d=c.html();c.replaceWith(a.call(this,b,d))});typeof a!="string"&&(a=f(a).detach());return this.each(function(){var b=this.nextSibling,c=this.parentNode;f(this).remove(),b?f(b).before(a):f(c).append(a)})}return this.length?this.pushStack(f(f.isFunction(a)?a():a),"replaceWith",a):this},detach:function(a){return this.remove(a,!0)},domManip:function(a,c,d){var e,g,h,i,j=a[0],k=[];if(!f.support.checkClone&&arguments.length===3&&typeof j=="string"&&bd.test(j))return this.each(function(){f(this).domManip(a,c,d,!0)});if(f.isFunction(j))return this.each(function(e){var g=f(this);a[0]=j.call(this,e,c?g.html():b),g.domManip(a,c,d)});if(this[0]){i=j&&j.parentNode,f.support.parentNode&&i&&i.nodeType===11&&i.childNodes.length===this.length?e={fragment:i}:e=f.buildFragment(a,this,k),h=e.fragment,h.childNodes.length===1?g=h=h.firstChild:g=h.firstChild;if(g){c=c&&f.nodeName(g,"tr");for(var l=0,m=this.length,n=m-1;l<m;l++)d.call(c?bh(this[l],g):this[l],e.cacheable||m>1&&l<n?f.clone(h,!0,!0):h)}k.length&&f.each(k,bn)}return this}}),f.buildFragment=function(a,b,d){var e,g,h,i=b&&b[0]?b[0].ownerDocument||b[0]:c;a.length===1&&typeof a[0]=="string"&&a[0].length<512&&i===c&&a[0].charAt(0)==="<"&&!bc.test(a[0])&&(f.support.checkClone||!bd.test(a[0]))&&(g=!0,h=f.fragments[a[0]],h&&h!==1&&(e=h)),e||(e=i.createDocumentFragment(),f.clean(a,i,e,d)),g&&(f.fragments[a[0]]=h?e:1);return{fragment:e,cacheable:g}},f.fragments={},f.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(a,b){f.fn[a]=function(c){var d=[],e=f(c),g=this.length===1&&this[0].parentNode;if(g&&g.nodeType===11&&g.childNodes.length===1&&e.length===1){e[b](this[0]);return this}for(var h=0,i=e.length;h<i;h++){var j=(h>0?this.clone(!0):this).get();f(e[h])[b](j),d=d.concat(j)}return this.pushStack(d,a,e.selector)}}),f.extend({clone:function(a,b,c){var d=a.cloneNode(!0),e,g,h;if((!f.support.noCloneEvent||!f.support.noCloneChecked)&&(a.nodeType===1||a.nodeType===11)&&!f.isXMLDoc(a)){bj(a,d),e=bk(a),g=bk(d);for(h=0;e[h];++h)bj(e[h],g[h])}if(b){bi(a,d);if(c){e=bk(a),g=bk(d);for(h=0;e[h];++h)bi(e[h],g[h])}}return d},clean:function(a,b,d,e){var g;b=b||c,typeof b.createElement=="undefined"&&(b=b.ownerDocument||
+b[0]&&b[0].ownerDocument||c);var h=[],i;for(var j=0,k;(k=a[j])!=null;j++){typeof k=="number"&&(k+="");if(!k)continue;if(typeof k=="string")if(!bb.test(k))k=b.createTextNode(k);else{k=k.replace($,"<$1></$2>");var l=(_.exec(k)||["",""])[1].toLowerCase(),m=bg[l]||bg._default,n=m[0],o=b.createElement("div");o.innerHTML=m[1]+k+m[2];while(n--)o=o.lastChild;if(!f.support.tbody){var p=ba.test(k),q=l==="table"&&!p?o.firstChild&&o.firstChild.childNodes:m[1]==="<table>"&&!p?o.childNodes:[];for(i=q.length-1;i>=0;--i)f.nodeName(q[i],"tbody")&&!q[i].childNodes.length&&q[i].parentNode.removeChild(q[i])}!f.support.leadingWhitespace&&Z.test(k)&&o.insertBefore(b.createTextNode(Z.exec(k)[0]),o.firstChild),k=o.childNodes}var r;if(!f.support.appendChecked)if(k[0]&&typeof (r=k.length)=="number")for(i=0;i<r;i++)bm(k[i]);else bm(k);k.nodeType?h.push(k):h=f.merge(h,k)}if(d){g=function(a){return!a.type||be.test(a.type)};for(j=0;h[j];j++)if(e&&f.nodeName(h[j],"script")&&(!h[j].type||h[j].type.toLowerCase()==="text/javascript"))e.push(h[j].parentNode?h[j].parentNode.removeChild(h[j]):h[j]);else{if(h[j].nodeType===1){var s=f.grep(h[j].getElementsByTagName("script"),g);h.splice.apply(h,[j+1,0].concat(s))}d.appendChild(h[j])}}return h},cleanData:function(a){var b,c,d=f.cache,e=f.expando,g=f.event.special,h=f.support.deleteExpando;for(var i=0,j;(j=a[i])!=null;i++){if(j.nodeName&&f.noData[j.nodeName.toLowerCase()])continue;c=j[f.expando];if(c){b=d[c]&&d[c][e];if(b&&b.events){for(var k in b.events)g[k]?f.event.remove(j,k):f.removeEvent(j,k,b.handle);b.handle&&(b.handle.elem=null)}h?delete j[f.expando]:j.removeAttribute&&j.removeAttribute(f.expando),delete d[c]}}}});var bo=/alpha\([^)]*\)/i,bp=/opacity=([^)]*)/,bq=/-([a-z])/ig,br=/([A-Z]|^ms)/g,bs=/^-?\d+(?:px)?$/i,bt=/^-?\d/,bu=/^[+\-]=/,bv=/[^+\-\.\de]+/g,bw={position:"absolute",visibility:"hidden",display:"block"},bx=["Left","Right"],by=["Top","Bottom"],bz,bA,bB,bC=function(a,b){return b.toUpperCase()};f.fn.css=function(a,c){if(arguments.length===2&&c===b)return this;return f.access(this,a,c,!0,function(a,c,d){return d!==b?f.style(a,c,d):f.css(a,c)})},f.extend({cssHooks:{opacity:{get:function(a,b){if(b){var c=bz(a,"opacity","opacity");return c===""?"1":c}return a.style.opacity}}},cssNumber:{zIndex:!0,fontWeight:!0,opacity:!0,zoom:!0,lineHeight:!0,widows:!0,orphans:!0},cssProps:{"float":f.support.cssFloat?"cssFloat":"styleFloat"},style:function(a,c,d,e){if(!!a&&a.nodeType!==3&&a.nodeType!==8&&!!a.style){var g,h,i=f.camelCase(c),j=a.style,k=f.cssHooks[i];c=f.cssProps[i]||i;if(d===b){if(k&&"get"in k&&(g=k.get(a,!1,e))!==b)return g;return j[c]}h=typeof d;if(h==="number"&&isNaN(d)||d==null)return;h==="string"&&bu.test(d)&&(d=+d.replace(bv,"")+parseFloat(f.css(a,c))),h==="number"&&!f.cssNumber[i]&&(d+="px");if(!k||!("set"in k)||(d=k.set(a,d))!==b)try{j[c]=d}catch(l){}}},css:function(a,c,d){var e,g;c=f.camelCase(c),g=f.cssHooks[c],c=f.cssProps[c]||c,c==="cssFloat"&&(c="float");if(g&&"get"in g&&(e=g.get(a,!0,d))!==b)return e;if(bz)return bz(a,c)},swap:function(a,b,c){var d={};for(var e in b)d[e]=a.style[e],a.style[e]=b[e];c.call(a);for(e in b)a.style[e]=d[e]},camelCase:function(a){return a.replace(bq,bC)}}),f.curCSS=f.css,f.each(["height","width"],function(a,b){f.cssHooks[b]={get:function(a,c,d){var e;if(c){a.offsetWidth!==0?e=bD(a,b,d):f.swap(a,bw,function(){e=bD(a,b,d)});if(e<=0){e=bz(a,b,b),e==="0px"&&bB&&(e=bB(a,b,b));if(e!=null)return e===""||e==="auto"?"0px":e}if(e<0||e==null){e=a.style[b];return e===""||e==="auto"?"0px":e}return typeof e=="string"?e:e+"px"}},set:function(a,b){if(!bs.test(b))return b;b=parseFloat(b);if(b>=0)return b+"px"}}}),f.support.opacity||(f.cssHooks.opacity={get:function(a,b){return bp.test((b&&a.currentStyle?a.currentStyle.filter:a.style.filter)||"")?parseFloat(RegExp.$1)/100+"":b?"1":""},set:function(a,b){var c=a.style,d=a.currentStyle;c.zoom=1;var e=f.isNaN(b)?"":"alpha(opacity="+b*100+")",g=d&&d.filter||c.filter||"";c.filter=bo.test(g)?g.replace(bo,e):g+" "+e}}),f(function(){f.support.reliableMarginRight||(f.cssHooks.marginRight={get:function(a,b){var c;f.swap(a,{display:"inline-block"},function(){b?c=bz(a,"margin-right","marginRight"):c=a.style.marginRight});return c}})}),c.defaultView&&c.defaultView.getComputedStyle&&(bA=function(a,c){var d,e,g;c=c.replace(br,"-$1").toLowerCase();if(!(e=a.ownerDocument.defaultView))return b;if(g=e.getComputedStyle(a,null))d=g.getPropertyValue(c),d===""&&!f.contains(a.ownerDocument.documentElement,a)&&(d=f.style(a,c));return d}),c.documentElement.currentStyle&&(bB=function(a,b){var c,d=a.currentStyle&&a.currentStyle[b],e=a.runtimeStyle&&a.runtimeStyle[b],f=a.style;!bs.test(d)&&bt.test(d)&&(c=f.left,e&&(a.runtimeStyle.left=a.currentStyle.left),f.left=b==="fontSize"?"1em":d||0,d=f.pixelLeft+"px",f.left=c,e&&(a.runtimeStyle.left=e));return d===""?"auto":d}),bz=bA||bB,f.expr&&f.expr.filters&&(f.expr.filters.hidden=function(a){var b=a.offsetWidth,c=a.offsetHeight;return b===0&&c===0||!f.support.reliableHiddenOffsets&&(a.style.display||f.css(a,"display"))==="none"},f.expr.filters.visible=function(a){return!f.expr.filters.hidden(a)});var bE=/%20/g,bF=/\[\]$/,bG=/\r?\n/g,bH=/#.*$/,bI=/^(.*?):[ \t]*([^\r\n]*)\r?$/mg,bJ=/^(?:color|date|datetime|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i,bK=/^(?:about|app|app\-storage|.+\-extension|file|widget):$/,bL=/^(?:GET|HEAD)$/,bM=/^\/\//,bN=/\?/,bO=/<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi,bP=/^(?:select|textarea)/i,bQ=/\s+/,bR=/([?&])_=[^&]*/,bS=/^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+))?)?/,bT=f.fn.load,bU={},bV={},bW,bX;try{bW=e.href}catch(bY){bW=c.createElement("a"),bW.href="",bW=bW.href}bX=bS.exec(bW.toLowerCase())||[],f.fn.extend({load:function(a,c,d){if(typeof a!="string"&&bT)return bT.apply(this,arguments);if(!this.length)return this;var e=a.indexOf(" ");if(e>=0){var g=a.slice(e,a.length);a=a.slice(0,e)}var h="GET";c&&(f.isFunction(c)?(d=c,c=b):typeof c=="object"&&(c=f.param(c,f.ajaxSettings.traditional),h="POST"));var i=this;f.ajax({url:a,type:h,dataType:"html",data:c,complete:function(a,b,c){c=a.responseText,a.isResolved()&&(a.done(function(a){c=a}),i.html(g?f("<div>").append(c.replace(bO,"")).find(g):c)),d&&i.each(d,[c,b,a])}});return this},serialize:function(){return f.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?f.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||bP.test(this.nodeName)||bJ.test(this.type))}).map(function(a,b){var c=f(this).val();return c==null?null:f.isArray(c)?f.map(c,function(a,c){return{name:b.name,value:a.replace(bG,"\r\n")}}):{name:b.name,value:c.replace(bG,"\r\n")}}).get()}}),f.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),function(a,b){f.fn[b]=function(a){return this.bind(b,a)}}),f.each(["get","post"],function(a,c){f[c]=function(a,d,e,g){f.isFunction(d)&&(g=g||e,e=d,d=b);return f.ajax({type:c,url:a,data:d,success:e,dataType:g})}}),f.extend({getScript:function(a,c){return f.get(a,b,c,"script")},getJSON:function(a,b,c){return f.get(a,b,c,"json")},ajaxSetup:function(a,b){b?f.extend(!0,a,f.ajaxSettings,b):(b=a,a=f.extend(!0,f.ajaxSettings,b));for(var c in{context:1,url:1})c in b?a[c]=b[c]:c in f.ajaxSettings&&(a[c]=f.ajaxSettings[c]);return a},ajaxSettings:{url:bW,isLocal:bK.test(bX[1]),global:!0,type:"GET",contentType:"application/x-www-form-urlencoded",processData:!0,async:!0,accepts:{xml:"application/xml, text/xml",html:"text/html",text:"text/plain",json:"application/json, text/javascript","*":"*/*"},contents:{xml:/xml/,html:/html/,json:/json/},responseFields:{xml:"responseXML",text:"responseText"},converters:{"* text":a.String,"text html":!0,"text json":f.parseJSON,"text xml":f.parseXML}},ajaxPrefilter:bZ(bU),ajaxTransport:bZ(bV),ajax:function(a,c){function w(a,c,l,m){if(s!==2){s=2,q&&clearTimeout(q),p=b,n=m||"",v.readyState=a?4:0;var o,r,u,w=l?ca(d,v,l):b,x,y;if(a>=200&&a<300||a===304){if(d.ifModified){if(x=v.getResponseHeader("Last-Modified"))f.lastModified[k]=x;if(y=v.getResponseHeader("Etag"))f.etag[k]=y}if(a===304)c="notmodified",o=!0;else try{r=cb(d,w),c="success",o=!0}catch(z){c="parsererror",u=z}}else{u=c;if(!c||a)c="error",a<0&&(a=0)}v.status=a,v.statusText=c,o?h.resolveWith(e,[r,c,v]):h.rejectWith(e,[v,c,u]),v.statusCode(j),j=b,t&&g.trigger("ajax"+(o?"Success":"Error"),[v,d,o?r:u]),i.resolveWith(e,[v,c]),t&&(g.trigger("ajaxComplete",[v,d]),--f.active||f.event.trigger("ajaxStop"))}}typeof a=="object"&&(c=a,a=b),c=c||{};var d=f.ajaxSetup({},c),e=d.context||d,g=e!==d&&(e.nodeType||e instanceof f)?f(e):f.event,h=f.Deferred(),i=f._Deferred(),j=d.statusCode||{},k,l={},m={},n,o,p,q,r,s=0,t,u,v={readyState:0,setRequestHeader:function(a,b){if(!s){var c=a.toLowerCase();a=m[c]=m[c]||a,l[a]=b}return this},getAllResponseHeaders:function(){return s===2?n:null},getResponseHeader:function(a){var c;if(s===2){if(!o){o={};while(c=bI.exec(n))o[c[1].toLowerCase()]=c[2]}c=o[a.toLowerCase()]}return c===b?null:c},overrideMimeType:function(a){s||(d.mimeType=a);return this},abort:function(a){a=a||"abort",p&&p.abort(a),w(0,a);return this}};h.promise(v),v.success=v.done,v.error=v.fail,v.complete=i.done,v.statusCode=function(a){if(a){var b;if(s<2)for(b in a)j[b]=[j[b],a[b]];else b=a[v.status],v.then(b,b)}return this},d.url=((a||d.url)+"").replace(bH,"").replace(bM,bX[1]+"//"),d.dataTypes=f.trim(d.dataType||"*").toLowerCase().split(bQ),d.crossDomain==null&&(r=bS.exec(d.url.toLowerCase()),d.crossDomain=!(!r||r[1]==bX[1]&&r[2]==bX[2]&&(r[3]||(r[1]==="http:"?80:443))==(bX[3]||(bX[1]==="http:"?80:443)))),d.data&&d.processData&&typeof d.data!="string"&&(d.data=f.param(d.data,d.traditional)),b$(bU,d,c,v);if(s===2)return!1;t=d.global,d.type=d.type.toUpperCase(),d.hasContent=!bL.test(d.type),t&&f.active++===0&&f.event.trigger("ajaxStart");if(!d.hasContent){d.data&&(d.url+=(bN.test(d.url)?"&":"?")+d.data),k=d.url;if(d.cache===!1){var x=f.now(),y=d.url.replace(bR,"$1_="+x);d.url=y+(y===d.url?(bN.test(d.url)?"&":"?")+"_="+x:"")}}(d.data&&d.hasContent&&d.contentType!==!1||c.contentType)&&v.setRequestHeader("Content-Type",d.contentType),d.ifModified&&(k=k||d.url,f.lastModified[k]&&v.setRequestHeader("If-Modified-Since",f.lastModified[k]),f.etag[k]&&v.setRequestHeader("If-None-Match",f.etag[k])),v.setRequestHeader("Accept",d.dataTypes[0]&&d.accepts[d.dataTypes[0]]?d.accepts[d.dataTypes[0]]+(d.dataTypes[0]!=="*"?", */*; q=0.01":""):d.accepts["*"]);for(u in d.headers)v.setRequestHeader(u,d.headers[u]);if(d.beforeSend&&(d.beforeSend.call(e,v,d)===!1||s===2)){v.abort();return!1}for(u in{success:1,error:1,complete:1})v[u](d[u]);p=b$(bV,d,c,v);if(!p)w(-1,"No Transport");else{v.readyState=1,t&&g.trigger("ajaxSend",[v,d]),d.async&&d.timeout>0&&(q=setTimeout(function(){v.abort("timeout")},d.timeout));try{s=1,p.send(l,w)}catch(z){status<2?w(-1,z):f.error(z)}}return v},param:function(a,c){var d=[],e=function(a,b){b=f.isFunction(b)?b():b,d[d.length]=encodeURIComponent(a)+"="+encodeURIComponent(b)};c===b&&(c=f.ajaxSettings.traditional);if(f.isArray(a)||a.jquery&&!f.isPlainObject(a))f.each(a,function(){e(this.name,this.value)});else for(var g in a)b_(g,a[g],c,e);return d.join("&").replace(bE,"+")}}),f.extend({active:0,lastModified:{},etag:{}});var cc=f.now(),cd=/(\=)\?(&|$)|\?\?/i;f.ajaxSetup({jsonp:"callback",jsonpCallback:function(){return f.expando+"_"+cc++}}),f.ajaxPrefilter("json jsonp",function(b,c,d){var e=b.contentType==="application/x-www-form-urlencoded"&&typeof b.data=="string";if(b.dataTypes[0]==="jsonp"||b.jsonp!==!1&&(cd.test(b.url)||e&&cd.test(b.data))){var g,h=b.jsonpCallback=f.isFunction(b.jsonpCallback)?b.jsonpCallback():b.jsonpCallback,i=a[h],j=b.url,k=b.data,l="$1"+h+"$2";b.jsonp!==!1&&(j=j.replace(cd,l),b.url===j&&(e&&(k=k.replace(cd,l)),b.data===k&&(j+=(/\?/.test(j)?"&":"?")+b.jsonp+"="+h))),b.url=j,b.data=k,a[h]=function(a){g=[a]},d.always(function(){a[h]=i,g&&f.isFunction(i)&&a[h](g[0])}),b.converters["script json"]=function(){g||f.error(h+" was not called");return g[0]},b.dataTypes[0]="json";return"script"}}),f.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/javascript|ecmascript/},converters:{"text script":function(a){f.globalEval(a);return a}}}),f.ajaxPrefilter("script",function(a){a.cache===b&&(a.cache=!1),a.crossDomain&&(a.type="GET",a.global=!1)}),f.ajaxTransport("script",function(a){if(a.crossDomain){var d,e=c.head||c.getElementsByTagName("head")[0]||c.documentElement;return{send:function(f,g){d=c.createElement("script"),d.async="async",a.scriptCharset&&(d.charset=a.scriptCharset),d.src=a.url,d.onload=d.onreadystatechange=function(a,c){if(c||!d.readyState||/loaded|complete/.test(d.readyState))d.onload=d.onreadystatechange=null,e&&d.parentNode&&e.removeChild(d),d=b,c||g(200,"success")},e.insertBefore(d,e.firstChild)},abort:function(){d&&d.onload(0,1)}}}});var ce=a.ActiveXObject?function(){for(var a in cg)cg[a](0,1)}:!1,cf=0,cg;f.ajaxSettings.xhr=a.ActiveXObject?function(){return!this.isLocal&&ch()||ci()}:ch,function(a){f.extend(f.support,{ajax:!!a,cors:!!a&&"withCredentials"in a})}(f.ajaxSettings.xhr()),f.support.ajax&&f.ajaxTransport(function(c){if(!c.crossDomain||f.support.cors){var d;return{send:function(e,g){var h=c.xhr(),i,j;c.username?h.open(c.type,c.url,c.async,c.username,c.password):h.open(c.type,c.url,c.async);if(c.xhrFields)for(j in c.xhrFields)h[j]=c.xhrFields[j];c.mimeType&&h.overrideMimeType&&h.overrideMimeType(c.mimeType),!c.crossDomain&&!e["X-Requested-With"]&&(e["X-Requested-With"]="XMLHttpRequest");try{for(j in e)h.setRequestHeader(j,e[j])}catch(k){}h.send(c.hasContent&&c.data||null),d=function(a,e){var j,k,l,m,n;try{if(d&&(e||h.readyState===4)){d=b,i&&(h.onreadystatechange=f.noop,ce&&delete cg[i]);if(e)h.readyState!==4&&h.abort();else{j=h.status,l=h.getAllResponseHeaders(),m={},n=h.responseXML,n&&n.documentElement&&(m.xml=n),m.text=h.responseText;try{k=h.statusText}catch(o){k=""}!j&&c.isLocal&&!c.crossDomain?j=m.text?200:404:j===1223&&(j=204)}}}catch(p){e||g(-1,p)}m&&g(j,k,m,l)},!c.async||h.readyState===4?d():(i=++cf,ce&&(cg||(cg={},f(a).unload(ce)),cg[i]=d),h.onreadystatechange=d)},abort:function(){d&&d(0,1)}}}});var cj={},ck,cl,cm=/^(?:toggle|show|hide)$/,cn=/^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i,co,cp=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]],cq,cr=a.webkitRequestAnimationFrame||a.mozRequestAnimationFrame||a.oRequestAnimationFrame;f.fn.extend({show:function(a,b,c){var d,e;if(a||a===0)return this.animate(cu("show",3),a,b,c);for(var g=0,h=this.length;g<h;g++)d=this[g],d.style&&(e=d.style.display,!f._data(d,"olddisplay")&&e==="none"&&(e=d.style.display=""),e===""&&f.css(d,"display")==="none"&&f._data(d,"olddisplay",cv(d.nodeName)));for(g=0;g<h;g++){d=this[g];if(d.style){e=d.style.display;if(e===""||e==="none")d.style.display=f._data(d,"olddisplay")||""}}return this},hide:function(a,b,c){if(a||a===0)return this.animate(cu("hide",3),a,b,c);for(var d=0,e=this.length;d<e;d++)if(this[d].style){var g=f.css(this[d],"display");g!=="none"&&!f._data(this[d],"olddisplay")&&f._data(this[d],"olddisplay",g)}for(d=0;d<e;d++)this[d].style&&(this[d].style.display="none");return this},_toggle:f.fn.toggle,toggle:function(a,b,c){var d=typeof a=="boolean";f.isFunction(a)&&f.isFunction(b)?this._toggle.apply(this,arguments):a==null||d?this.each(function(){var b=d?a:f(this).is(":hidden");f(this)[b?"show":"hide"]()}):this.animate(cu("toggle",3),a,b,c);return this},fadeTo:function(a,b,c,d){return this.filter(":hidden").css("opacity",0).show().end().animate({opacity:b},a,c,d)},animate:function(a,b,c,d){var e=f.speed(b,c,d);if(f.isEmptyObject(a))return this.each(e.complete,[!1]);a=f.extend({},a);return this[e.queue===!1?"each":"queue"](function(){e.queue===!1&&f._mark(this);var b=f.extend({},e),c=this.nodeType===1,d=c&&f(this).is(":hidden"),g,h,i,j,k,l,m,n,o;b.animatedProperties={};for(i in a){g=f.camelCase(i),i!==g&&(a[g]=a[i],delete a[i]),h=a[g],f.isArray(h)?(b.animatedProperties[g]=h[1],h=a[g]=h[0]):b.animatedProperties[g]=b.specialEasing&&b.specialEasing[g]||b.easing||"swing";if(h==="hide"&&d||h==="show"&&!d)return b.complete.call(this);c&&(g==="height"||g==="width")&&(b.overflow=[this.style.overflow,this.style.overflowX,this.style.overflowY],f.css(this,"display")==="inline"&&f.css(this,"float")==="none"&&(f.support.inlineBlockNeedsLayout?(j=cv(this.nodeName),j==="inline"?this.style.display="inline-block":(this.style.display="inline",this.style.zoom=1)):this.style.display="inline-block"))}b.overflow!=null&&(this.style.overflow="hidden");for(i in a)k=new f.fx(this,b,i),h=a[i],cm.test(h)?k[h==="toggle"?d?"show":"hide":h]():(l=cn.exec(h),m=k.cur(),l?(n=parseFloat(l[2]),o=l[3]||(f.cssNumber[i]?"":"px"),o!=="px"&&(f.style(this,i,(n||1)+o),m=(n||1)/k.cur()*m,f.style(this,i,m+o)),l[1]&&(n=(l[1]==="-="?-1:1)*n+m),k.custom(m,n,o)):k.custom(m,h,""));return!0})},stop:function(a,b){a&&this.queue([]),this.each(function(){var a=f.timers,c=a.length;b||f._unmark(!0,this);while(c--)a[c].elem===this&&(b&&a[c](!0),a.splice(c,1))}),b||this.dequeue();return this}}),f.each({slideDown:cu("show",1),slideUp:cu("hide",1),slideToggle:cu("toggle",1),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"},fadeToggle:{opacity:"toggle"}},function(a,b){f.fn[a]=function(a,c,d){return this.animate(b,a,c,d)}}),f.extend({speed:function(a,b,c){var d=a&&typeof a=="object"?f.extend({},a):{complete:c||!c&&b||f.isFunction(a)&&a,duration:a,easing:c&&b||b&&!f.isFunction(b)&&b};d.duration=f.fx.off?0:typeof d.duration=="number"?d.duration:d.duration in f.fx.speeds?f.fx.speeds[d.duration]:f.fx.speeds._default,d.old=d.complete,d.complete=function(a){d.queue!==!1?f.dequeue(this):a!==!1&&f._unmark(this),f.isFunction(d.old)&&d.old.call(this)};return d},easing:{linear:function(a,b,c,d){return c+d*a},swing:function(a,b,c,d){return(-Math.cos(a*Math.PI)/2+.5)*d+c}},timers:[],fx:function(a,b,c){this.options=b,this.elem=a,this.prop=c,b.orig=b.orig||{}}}),f.fx.prototype={update:function(){this.options.step&&this.options.step.call(this.elem,this.now,this),(f.fx.step[this.prop]||f.fx.step._default)(this)},cur:function(){if(this.elem[this.prop]!=null&&(!this.elem.style||this.elem.style[this.prop]==null))return this.elem[this.prop];var a,b=f.css(this.elem,this.prop);return isNaN(a=parseFloat(b))?!b||b==="auto"?0:b:a},custom:function(a,b,c){function h(a){return d.step(a)}var d=this,e=f.fx,g;this.startTime=cq||cs(),this.start=a,this.end=b,this.unit=c||this.unit||(f.cssNumber[this.prop]?"":"px"),this.now=this.start,this.pos=this.state=0,h.elem=this.elem,h()&&f.timers.push(h)&&!co&&(cr?(co=1,g=function(){co&&(cr(g),e.tick())},cr(g)):co=setInterval(e.tick,e.interval))},show:function(){this.options.orig[this.prop]=f.style(this.elem,this.prop),this.options.show=!0,this.custom(this.prop==="width"||this.prop==="height"?1:0,this.cur()),f(this.elem).show()},hide:function(){this.options.orig[this.prop]=f.style(this.elem,this.prop),this.options.hide=!0,this.custom(this.cur(),0)},step:function(a){var b=cq||cs(),c=!0,d=this.elem,e=this.options,g,h;if(a||b>=e.duration+this.startTime){this.now=this.end,this.pos=this.state=1,this.update(),e.animatedProperties[this.prop]=!0;for(g in e.animatedProperties)e.animatedProperties[g]!==!0&&(c=!1);if(c){e.overflow!=null&&!f.support.shrinkWrapBlocks&&f.each(["","X","Y"],function(a,b){d.style["overflow"+b]=e.overflow[a]}),e.hide&&f(d).hide();if(e.hide||e.show)for(var i in e.animatedProperties)f.style(d,i,e.orig[i]);e.complete.call(d)}return!1}e.duration==Infinity?this.now=b:(h=b-this.startTime,this.state=h/e.duration,this.pos=f.easing[e.animatedProperties[this.prop]](this.state,h,0,1,e.duration),this.now=this.start+(this.end-this.start)*this.pos),this.update();return!0}},f.extend(f.fx,{tick:function(){for(var a=f.timers,b=0;b<a.length;++b)a[b]()||a.splice(b--,1);a.length||f.fx.stop()},interval:13,stop:function(){clearInterval(co),co=null},speeds:{slow:600,fast:200,_default:400},step:{opacity:function(a){f.style(a.elem,"opacity",a.now)},_default:function(a){a.elem.style&&a.elem.style[a.prop]!=null?a.elem.style[a.prop]=(a.prop==="width"||a.prop==="height"?Math.max(0,a.now):a.now)+a.unit:a.elem[a.prop]=a.now}}}),f.expr&&f.expr.filters&&(f.expr.filters.animated=function(a){return f.grep(f.timers,function(b){return a===b.elem}).length});var cw=/^t(?:able|d|h)$/i,cx=/^(?:body|html)$/i;"getBoundingClientRect"in c.documentElement?f.fn.offset=function(a){var b=this[0],c;if(a)return this.each(function(b){f.offset.setOffset(this,a,b)});if(!b||!b.ownerDocument)return null;if(b===b.ownerDocument.body)return f.offset.bodyOffset(b);try{c=b.getBoundingClientRect()}catch(d){}var e=b.ownerDocument,g=e.documentElement;if(!c||!f.contains(g,b))return c?{top:c.top,left:c.left}:{top:0,left:0};var h=e.body,i=cy(e),j=g.clientTop||h.clientTop||0,k=g.clientLeft||h.clientLeft||0,l=i.pageYOffset||f.support.boxModel&&g.scrollTop||h.scrollTop,m=i.pageXOffset||f.support.boxModel&&g.scrollLeft||h.scrollLeft,n=c.top+l-j,o=c.left+m-k;return{top:n,left:o}}:f.fn.offset=function(a){var b=this[0];if(a)return this.each(function(b){f.offset.setOffset(this,a,b)});if(!b||!b.ownerDocument)return null;if(b===b.ownerDocument.body)return f.offset.bodyOffset(b);f.offset.initialize();var c,d=b.offsetParent,e=b,g=b.ownerDocument,h=g.documentElement,i=g.body,j=g.defaultView,k=j?j.getComputedStyle(b,null):b.currentStyle,l=b.offsetTop,m=b.offsetLeft;while((b=b.parentNode)&&b!==i&&b!==h){if(f.offset.supportsFixedPosition&&k.position==="fixed")break;c=j?j.getComputedStyle(b,null):b.currentStyle,l-=b.scrollTop,m-=b.scrollLeft,b===d&&(l+=b.offsetTop,m+=b.offsetLeft,f.offset.doesNotAddBorder&&(!f.offset.doesAddBorderForTableAndCells||!cw.test(b.nodeName))&&(l+=parseFloat(c.borderTopWidth)||0,m+=parseFloat(c.borderLeftWidth)||0),e=d,d=b.offsetParent),f.offset.subtractsBorderForOverflowNotVisible&&c.overflow!=="visible"&&(l+=parseFloat(c.borderTopWidth)||0,m+=parseFloat(c.borderLeftWidth)||0),k=c}if(k.position==="relative"||k.position==="static")l+=i.offsetTop,m+=i.offsetLeft;f.offset.supportsFixedPosition&&k.position==="fixed"&&(l+=Math.max(h.scrollTop,i.scrollTop),m+=Math.max(h.scrollLeft,i.scrollLeft));return{top:l,left:m}},f.offset={initialize:function(){var a=c.body,b=c.createElement("div"),d,e,g,h,i=parseFloat(f.css(a,"marginTop"))||0,j="<div style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;'><div></div></div><table style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;' cellpadding='0' cellspacing='0'><tr><td></td></tr></table>";f.extend(b.style,{position:"absolute",top:0,left:0,margin:0,border:0,width:"1px",height:"1px",visibility:"hidden"}),b.innerHTML=j,a.insertBefore(b,a.firstChild),d=b.firstChild,e=d.firstChild,h=d.nextSibling.firstChild.firstChild,this.doesNotAddBorder=e.offsetTop!==5,this.doesAddBorderForTableAndCells=h.offsetTop===5,e.style.position="fixed",e.style.top="20px",this.supportsFixedPosition=e.offsetTop===20||e.offsetTop===15,e.style.position=e.style.top="",d.style.overflow="hidden",d.style.position="relative",this.subtractsBorderForOverflowNotVisible=e.offsetTop===-5,this.doesNotIncludeMarginInBodyOffset=a.offsetTop!==i,a.removeChild(b),f.offset.initialize=f.noop},bodyOffset:function(a){var b=a.offsetTop,c=a.offsetLeft;f.offset.initialize(),f.offset.doesNotIncludeMarginInBodyOffset&&(b+=parseFloat(f.css(a,"marginTop"))||0,c+=parseFloat(f.css(a,"marginLeft"))||0);return{top:b,left:c}},setOffset:function(a,b,c){var d=f.css(a,"position");d==="static"&&(a.style.position="relative");var e=f(a),g=e.offset(),h=f.css(a,"top"),i=f.css(a,"left"),j=(d==="absolute"||d==="fixed")&&f.inArray("auto",[h,i])>-1,k={},l={},m,n;j?(l=e.position(),m=l.top,n=l.left):(m=parseFloat(h)||0,n=parseFloat(i)||0),f.isFunction(b)&&(b=b.call(a,c,g)),b.top!=null&&(k.top=b.top-g.top+m),b.left!=null&&(k.left=b.left-g.left+n),"using"in b?b.using.call(a,k):e.css(k)}},f.fn.extend({position:function(){if(!this[0])return null;var a=this[0],b=this.offsetParent(),c=this.offset(),d=cx.test(b[0].nodeName)?{top:0,left:0}:b.offset();c.top-=parseFloat(f.css(a,"marginTop"))||0,c.left-=parseFloat(f.css(a,"marginLeft"))||0,d.top+=parseFloat(f.css(b[0],"borderTopWidth"))||0,d.left+=parseFloat(f.css(b[0],"borderLeftWidth"))||0;return{top:c.top-d.top,left:c.left-d.left}},offsetParent:function(){return this.map(function(){var a=this.offsetParent||c.body;while(a&&!cx.test(a.nodeName)&&f.css(a,"position")==="static")a=a.offsetParent;return a})}}),f.each(["Left","Top"],function(a,c){var d="scroll"+c;f.fn[d]=function(c){var e,g;if(c===b){e=this[0];if(!e)return null;g=cy(e);return g?"pageXOffset"in g?g[a?"pageYOffset":"pageXOffset"]:f.support.boxModel&&g.document.documentElement[d]||g.document.body[d]:e[d]}return this.each(function(){g=cy(this),g?g.scrollTo(a?f(g).scrollLeft():c,a?c:f(g).scrollTop()):this[d]=c})}}),f.each(["Height","Width"],function(a,c){var d=c.toLowerCase();f.fn["inner"+c]=function(){return this[0]?parseFloat(f.css(this[0],d,"padding")):null},f.fn["outer"+c]=function(a){return this[0]?parseFloat(f.css(this[0],d,a?"margin":"border")):null},f.fn[d]=function(a){var e=this[0];if(!e)return a==null?null:this;if(f.isFunction(a))return this.each(function(b){var c=f(this);c[d](a.call(this,b,c[d]()))});if(f.isWindow(e)){var g=e.document.documentElement["client"+c];return e.document.compatMode==="CSS1Compat"&&g||e.document.body["client"+c]||g}if(e.nodeType===9)return Math.max(e.documentElement["client"+c],e.body["scroll"+c],e.documentElement["scroll"+c],e.body["offset"+c],e.documentElement["offset"+c]);if(a===b){var h=f.css(e,d),i=parseFloat(h);return f.isNaN(i)?h:i}return this.css(d,typeof a=="string"?a:a+"px")}}),a.jQuery=a.$=f})(window);
--- /dev/null
+++ b/js/jquery.mobile-1.0b1.js
@@ -1,1 +1,5627 @@
-
+/*!
+ * jQuery Mobile v1.0b1
+ * http://jquerymobile.com/
+ *
+ * Copyright 2010, jQuery Project
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ */
+/*!
+ * jQuery UI Widget @VERSION
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Widget
+ */
+(function( $, undefined ) {
+
+// jQuery 1.4+
+if ( $.cleanData ) {
+ var _cleanData = $.cleanData;
+ $.cleanData = function( elems ) {
+ for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) {
+ $( elem ).triggerHandler( "remove" );
+ }
+ _cleanData( elems );
+ };
+} else {
+ var _remove = $.fn.remove;
+ $.fn.remove = function( selector, keepData ) {
+ return this.each(function() {
+ if ( !keepData ) {
+ if ( !selector || $.filter( selector, [ this ] ).length ) {
+ $( "*", this ).add( [ this ] ).each(function() {
+ $( this ).triggerHandler( "remove" );
+ });
+ }
+ }
+ return _remove.call( $(this), selector, keepData );
+ });
+ };
+}
+
+$.widget = function( name, base, prototype ) {
+ var namespace = name.split( "." )[ 0 ],
+ fullName;
+ name = name.split( "." )[ 1 ];
+ fullName = namespace + "-" + name;
+
+ if ( !prototype ) {
+ prototype = base;
+ base = $.Widget;
+ }
+
+ // create selector for plugin
+ $.expr[ ":" ][ fullName ] = function( elem ) {
+ return !!$.data( elem, name );
+ };
+
+ $[ namespace ] = $[ namespace ] || {};
+ $[ namespace ][ name ] = function( options, element ) {
+ // allow instantiation without initializing for simple inheritance
+ if ( arguments.length ) {
+ this._createWidget( options, element );
+ }
+ };
+
+ var basePrototype = new base();
+ // we need to make the options hash a property directly on the new instance
+ // otherwise we'll modify the options hash on the prototype that we're
+ // inheriting from
+// $.each( basePrototype, function( key, val ) {
+// if ( $.isPlainObject(val) ) {
+// basePrototype[ key ] = $.extend( {}, val );
+// }
+// });
+ basePrototype.options = $.extend( true, {}, basePrototype.options );
+ $[ namespace ][ name ].prototype = $.extend( true, basePrototype, {
+ namespace: namespace,
+ widgetName: name,
+ widgetEventPrefix: $[ namespace ][ name ].prototype.widgetEventPrefix || name,
+ widgetBaseClass: fullName
+ }, prototype );
+
+ $.widget.bridge( name, $[ namespace ][ name ] );
+};
+
+$.widget.bridge = function( name, object ) {
+ $.fn[ name ] = function( options ) {
+ var isMethodCall = typeof options === "string",
+ args = Array.prototype.slice.call( arguments, 1 ),
+ returnValue = this;
+
+ // allow multiple hashes to be passed on init
+ options = !isMethodCall && args.length ?
+ $.extend.apply( null, [ true, options ].concat(args) ) :
+ options;
+
+ // prevent calls to internal methods
+ if ( isMethodCall && options.charAt( 0 ) === "_" ) {
+ return returnValue;
+ }
+
+ if ( isMethodCall ) {
+ this.each(function() {
+ var instance = $.data( this, name );
+ if ( !instance ) {
+ throw "cannot call methods on " + name + " prior to initialization; " +
+ "attempted to call method '" + options + "'";
+ }
+ if ( !$.isFunction( instance[options] ) ) {
+ throw "no such method '" + options + "' for " + name + " widget instance";
+ }
+ var methodValue = instance[ options ].apply( instance, args );
+ if ( methodValue !== instance && methodValue !== undefined ) {
+ returnValue = methodValue;
+ return false;
+ }
+ });
+ } else {
+ this.each(function() {
+ var instance = $.data( this, name );
+ if ( instance ) {
+ instance.option( options || {} )._init();
+ } else {
+ $.data( this, name, new object( options, this ) );
+ }
+ });
+ }
+
+ return returnValue;
+ };
+};
+
+$.Widget = function( options, element ) {
+ // allow instantiation without initializing for simple inheritance
+ if ( arguments.length ) {
+ this._createWidget( options, element );
+ }
+};
+
+$.Widget.prototype = {
+ widgetName: "widget",
+ widgetEventPrefix: "",
+ options: {
+ disabled: false
+ },
+ _createWidget: function( options, element ) {
+ // $.widget.bridge stores the plugin instance, but we do it anyway
+ // so that it's stored even before the _create function runs
+ $.data( element, this.widgetName, this );
+ this.element = $( element );
+ this.options = $.extend( true, {},
+ this.options,
+ this._getCreateOptions(),
+ options );
+
+ var self = this;
+ this.element.bind( "remove." + this.widgetName, function() {
+ self.destroy();
+ });
+
+ this._create();
+ this._trigger( "create" );
+ this._init();
+ },
+ _getCreateOptions: function() {
+ var options = {};
+ if ( $.metadata ) {
+ options = $.metadata.get( element )[ this.widgetName ];
+ }
+ return options;
+ },
+ _create: function() {},
+ _init: function() {},
+
+ destroy: function() {
+ this.element
+ .unbind( "." + this.widgetName )
+ .removeData( this.widgetName );
+ this.widget()
+ .unbind( "." + this.widgetName )
+ .removeAttr( "aria-disabled" )
+ .removeClass(
+ this.widgetBaseClass + "-disabled " +
+ "ui-state-disabled" );
+ },
+
+ widget: function() {
+ return this.element;
+ },
+
+ option: function( key, value ) {
+ var options = key;
+
+ if ( arguments.length === 0 ) {
+ // don't return a reference to the internal hash
+ return $.extend( {}, this.options );
+ }
+
+ if (typeof key === "string" ) {
+ if ( value === undefined ) {
+ return this.options[ key ];
+ }
+ options = {};
+ options[ key ] = value;
+ }
+
+ this._setOptions( options );
+
+ return this;
+ },
+ _setOptions: function( options ) {
+ var self = this;
+ $.each( options, function( key, value ) {
+ self._setOption( key, value );
+ });
+
+ return this;
+ },
+ _setOption: function( key, value ) {
+ this.options[ key ] = value;
+
+ if ( key === "disabled" ) {
+ this.widget()
+ [ value ? "addClass" : "removeClass"](
+ this.widgetBaseClass + "-disabled" + " " +
+ "ui-state-disabled" )
+ .attr( "aria-disabled", value );
+ }
+
+ return this;
+ },
+
+ enable: function() {
+ return this._setOption( "disabled", false );
+ },
+ disable: function() {
+ return this._setOption( "disabled", true );
+ },
+
+ _trigger: function( type, event, data ) {
+ var callback = this.options[ type ];
+
+ event = $.Event( event );
+ event.type = ( type === this.widgetEventPrefix ?
+ type :
+ this.widgetEventPrefix + type ).toLowerCase();
+ data = data || {};
+
+ // copy original event properties over to the new event
+ // this would happen if we could call $.event.fix instead of $.Event
+ // but we don't have a way to force an event to be fixed multiple times
+ if ( event.originalEvent ) {
+ for ( var i = $.event.props.length, prop; i; ) {
+ prop = $.event.props[ --i ];
+ event[ prop ] = event.originalEvent[ prop ];
+ }
+ }
+
+ this.element.trigger( event, data );
+
+ return !( $.isFunction(callback) &&
+ callback.call( this.element[0], event, data ) === false ||
+ event.isDefaultPrevented() );
+ }
+};
+
+})( jQuery );
+/*
+* jQuery Mobile Framework : widget factory extentions for mobile
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT or GPL Version 2 licenses.
+* http://jquery.org/license
+*/
+(function($, undefined ) {
+
+$.widget( "mobile.widget", {
+ _getCreateOptions: function() {
+ var elem = this.element,
+ options = {};
+ $.each( this.options, function( option ) {
+ var value = elem.jqmData( option.replace( /[A-Z]/g, function( c ) {
+ return "-" + c.toLowerCase();
+ } ) );
+ if ( value !== undefined ) {
+ options[ option ] = value;
+ }
+ });
+ return options;
+ }
+});
+
+})( jQuery );
+/*
+* jQuery Mobile Framework : resolution and CSS media query related helpers and behavior
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT or GPL Version 2 licenses.
+* http://jquery.org/license
+*/
+(function($, undefined ) {
+
+var $window = $(window),
+ $html = $( "html" ),
+
+ //media-query-like width breakpoints, which are translated to classes on the html element
+ resolutionBreakpoints = [320,480,768,1024];
+
+
+/* $.mobile.media method: pass a CSS media type or query and get a bool return
+ note: this feature relies on actual media query support for media queries, though types will work most anywhere
+ examples:
+ $.mobile.media('screen') //>> tests for screen media type
+ $.mobile.media('screen and (min-width: 480px)') //>> tests for screen media type with window width > 480px
+ $.mobile.media('@media screen and (-webkit-min-device-pixel-ratio: 2)') //>> tests for webkit 2x pixel ratio (iPhone 4)
+*/
+$.mobile.media = (function() {
+ // TODO: use window.matchMedia once at least one UA implements it
+ var cache = {},
+ testDiv = $( "<div id='jquery-mediatest'>" ),
+ fakeBody = $( "<body>" ).append( testDiv );
+
+ return function( query ) {
+ if ( !( query in cache ) ) {
+ var styleBlock = document.createElement('style'),
+ cssrule = "@media " + query + " { #jquery-mediatest { position:absolute; } }";
+ //must set type for IE!
+ styleBlock.type = "text/css";
+ if (styleBlock.styleSheet){
+ styleBlock.styleSheet.cssText = cssrule;
+ }
+ else {
+ styleBlock.appendChild(document.createTextNode(cssrule));
+ }
+
+ $html.prepend( fakeBody ).prepend( styleBlock );
+ cache[ query ] = testDiv.css( "position" ) === "absolute";
+ fakeBody.add( styleBlock ).remove();
+ }
+ return cache[ query ];
+ };
+})();
+
+/*
+ private function for adding/removing breakpoint classes to HTML element for faux media-query support
+ It does not require media query support, instead using JS to detect screen width > cross-browser support
+ This function is called on orientationchange, resize, and mobileinit, and is bound via the 'htmlclass' event namespace
+*/
+function detectResolutionBreakpoints(){
+ var currWidth = $window.width(),
+ minPrefix = "min-width-",
+ maxPrefix = "max-width-",
+ minBreakpoints = [],
+ maxBreakpoints = [],
+ unit = "px",
+ breakpointClasses;
+
+ $html.removeClass( minPrefix + resolutionBreakpoints.join(unit + " " + minPrefix) + unit + " " +
+ maxPrefix + resolutionBreakpoints.join( unit + " " + maxPrefix) + unit );
+
+ $.each(resolutionBreakpoints,function( i, breakPoint ){
+ if( currWidth >= breakPoint ){
+ minBreakpoints.push( minPrefix + breakPoint + unit );
+ }
+ if( currWidth <= breakPoint ){
+ maxBreakpoints.push( maxPrefix + breakPoint + unit );
+ }
+ });
+
+ if( minBreakpoints.length ){ breakpointClasses = minBreakpoints.join(" "); }
+ if( maxBreakpoints.length ){ breakpointClasses += " " + maxBreakpoints.join(" "); }
+
+ $html.addClass( breakpointClasses );
+};
+
+/* $.mobile.addResolutionBreakpoints method:
+ pass either a number or an array of numbers and they'll be added to the min/max breakpoint classes
+ Examples:
+ $.mobile.addResolutionBreakpoints( 500 );
+ $.mobile.addResolutionBreakpoints( [500, 1200] );
+*/
+$.mobile.addResolutionBreakpoints = function( newbps ){
+ if( $.type( newbps ) === "array" ){
+ resolutionBreakpoints = resolutionBreakpoints.concat( newbps );
+ }
+ else {
+ resolutionBreakpoints.push( newbps );
+ }
+ resolutionBreakpoints.sort(function(a,b){ return a-b; });
+ detectResolutionBreakpoints();
+};
+
+/* on mobileinit, add classes to HTML element
+ and set handlers to update those on orientationchange and resize*/
+$(document).bind("mobileinit.htmlclass", function(){
+ /* bind to orientationchange and resize
+ to add classes to HTML element for min/max breakpoints and orientation */
+ var ev = $.support.orientation;
+ $window.bind("orientationchange.htmlclass throttledResize.htmlclass", function(event){
+ //add orientation class to HTML element on flip/resize.
+ if(event.orientation){
+ $html.removeClass( "portrait landscape" ).addClass( event.orientation );
+ }
+ //add classes to HTML element for min/max breakpoints
+ detectResolutionBreakpoints();
+ });
+});
+
+/* Manually trigger an orientationchange event when the dom ready event fires.
+ This will ensure that any viewport meta tag that may have been injected
+ has taken effect already, allowing us to properly calculate the width of the
+ document.
+*/
+$(function(){
+ //trigger event manually
+ $window.trigger( "orientationchange.htmlclass" );
+});
+
+})(jQuery);/*
+* jQuery Mobile Framework : support tests
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.
+* Note: Code is in draft form and is subject to change
+*/
+( function( $, undefined ) {
+
+var fakeBody = $( "<body>" ).prependTo( "html" ),
+ fbCSS = fakeBody[ 0 ].style,
+ vendors = [ "webkit", "moz", "o" ],
+ webos = "palmGetResource" in window, //only used to rule out scrollTop
+ bb = window.blackberry; //only used to rule out box shadow, as it's filled opaque on BB
+
+// thx Modernizr
+function propExists( prop ){
+ var uc_prop = prop.charAt( 0 ).toUpperCase() + prop.substr( 1 ),
+ props = ( prop + " " + vendors.join( uc_prop + " " ) + uc_prop ).split( " " );
+ for( var v in props ){
+ if( fbCSS[ v ] !== undefined ){
+ return true;
+ }
+ }
+}
+
+// test for dynamic-updating base tag support ( allows us to avoid href,src attr rewriting )
+function baseTagTest(){
+ var fauxBase = location.protocol + "//" + location.host + location.pathname + "ui-dir/",
+ base = $( "head base" ),
+ fauxEle = null,
+ href = "";
+ if ( !base.length ) {
+ base = fauxEle = $( "<base>", { "href": fauxBase} ).appendTo( "head" );
+ }
+ else {
+ href = base.attr( "href" );
+ }
+ var link = $( "<a href='testurl'></a>" ).prependTo( fakeBody ),
+ rebase = link[ 0 ].href;
+ base[ 0 ].href = href ? href : location.pathname;
+ if ( fauxEle ) {
+ fauxEle.remove();
+ }
+ return rebase.indexOf( fauxBase ) === 0;
+}
+
+
+// non-UA-based IE version check by James Padolsey, modified by jdalton - from http://gist.github.com/527683
+// allows for inclusion of IE 6+, including Windows Mobile 7
+$.mobile.browser = {};
+$.mobile.browser.ie = ( function() {
+ var v = 3,
+ div = document.createElement( "div" ),
+ a = div.all || [];
+ while ( div.innerHTML = "<!--[if gt IE " + ( ++v ) + "]><br><![endif]-->", a[ 0 ] );
+ return v > 4 ? v : !v;
+}() );
+
+
+$.extend( $.support, {
+ orientation: "orientation" in window,
+ touch: "ontouchend" in document,
+ cssTransitions: "WebKitTransitionEvent" in window,
+ pushState: !!history.pushState,
+ mediaquery: $.mobile.media( "only all" ),
+ cssPseudoElement: !!propExists( "content" ),
+ boxShadow: !!propExists( "boxShadow" ) && !bb,
+ scrollTop: ( "pageXOffset" in window || "scrollTop" in document.documentElement || "scrollTop" in fakeBody[ 0 ] ) && !webos,
+ dynamicBaseTag: baseTagTest(),
+ eventCapture: ( "addEventListener" in document ) // This is a weak test. We may want to beef this up later.
+} );
+
+fakeBody.remove();
+
+// for ruling out shadows via css
+if( !$.support.boxShadow ){ $( "html" ).addClass( "ui-mobile-nosupport-boxshadow" ); }
+
+} )( jQuery );/*
+* jQuery Mobile Framework : "mouse" plugin
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT or GPL Version 2 licenses.
+* http://jquery.org/license
+*/
+
+// This plugin is an experiment for abstracting away the touch and mouse
+// events so that developers don't have to worry about which method of input
+// the device their document is loaded on supports.
+//
+// The idea here is to allow the developer to register listeners for the
+// basic mouse events, such as mousedown, mousemove, mouseup, and click,
+// and the plugin will take care of registering the correct listeners
+// behind the scenes to invoke the listener at the fastest possible time
+// for that device, while still retaining the order of event firing in
+// the traditional mouse environment, should multiple handlers be registered
+// on the same element for different events.
+//
+// The current version exposes the following virtual events to jQuery bind methods:
+// "vmouseover vmousedown vmousemove vmouseup vclick vmouseout vmousecancel"
+
+(function($, window, document, undefined) {
+
+var dataPropertyName = "virtualMouseBindings",
+ touchTargetPropertyName = "virtualTouchID",
+ virtualEventNames = "vmouseover vmousedown vmousemove vmouseup vclick vmouseout vmousecancel".split(" "),
+ touchEventProps = "clientX clientY pageX pageY screenX screenY".split(" "),
+ activeDocHandlers = {},
+ resetTimerID = 0,
+ startX = 0,
+ startY = 0,
+ didScroll = false,
+ clickBlockList = [],
+ blockMouseTriggers = false,
+ blockTouchTriggers = false,
+ eventCaptureSupported = $.support.eventCapture,
+ $document = $(document),
+ nextTouchID = 1,
+ lastTouchID = 0;
+
+$.vmouse = {
+ moveDistanceThreshold: 10,
+ clickDistanceThreshold: 10,
+ resetTimerDuration: 1500
+};
+
+function getNativeEvent(event)
+{
+ while (event && typeof event.originalEvent !== "undefined") {
+ event = event.originalEvent;
+ }
+ return event;
+}
+
+function createVirtualEvent(event, eventType)
+{
+ var t = event.type;
+ event = $.Event(event);
+ event.type = eventType;
+
+ var oe = event.originalEvent;
+ var props = $.event.props;
+
+ // copy original event properties over to the new event
+ // this would happen if we could call $.event.fix instead of $.Event
+ // but we don't have a way to force an event to be fixed multiple times
+ if (oe) {
+ for ( var i = props.length, prop; i; ) {
+ prop = props[ --i ];
+ event[prop] = oe[prop];
+ }
+ }
+
+ if (t.search(/^touch/) !== -1){
+ var ne = getNativeEvent(oe),
+ t = ne.touches,
+ ct = ne.changedTouches,
+ touch = (t && t.length) ? t[0] : ((ct && ct.length) ? ct[0] : undefined);
+ if (touch){
+ for (var i = 0, len = touchEventProps.length; i < len; i++){
+ var prop = touchEventProps[i];
+ event[prop] = touch[prop];
+ }
+ }
+ }
+
+ return event;
+}
+
+function getVirtualBindingFlags(element)
+{
+ var flags = {};
+ while (element){
+ var b = $.data(element, dataPropertyName);
+ for (var k in b) {
+ if (b[k]){
+ flags[k] = flags.hasVirtualBinding = true;
+ }
+ }
+ element = element.parentNode;
+ }
+ return flags;
+}
+
+function getClosestElementWithVirtualBinding(element, eventType)
+{
+ while (element){
+ var b = $.data(element, dataPropertyName);
+ if (b && (!eventType || b[eventType])) {
+ return element;
+ }
+ element = element.parentNode;
+ }
+ return null;
+}
+
+function enableTouchBindings()
+{
+ blockTouchTriggers = false;
+}
+
+function disableTouchBindings()
+{
+ blockTouchTriggers = true;
+}
+
+function enableMouseBindings()
+{
+ lastTouchID = 0;
+ clickBlockList.length = 0;
+ blockMouseTriggers = false;
+
+ // When mouse bindings are enabled, our
+ // touch bindings are disabled.
+ disableTouchBindings();
+}
+
+function disableMouseBindings()
+{
+ // When mouse bindings are disabled, our
+ // touch bindings are enabled.
+ enableTouchBindings();
+}
+
+function startResetTimer()
+{
+ clearResetTimer();
+ resetTimerID = setTimeout(function(){
+ resetTimerID = 0;
+ enableMouseBindings();
+ }, $.vmouse.resetTimerDuration);
+}
+
+function clearResetTimer()
+{
+ if (resetTimerID){
+ clearTimeout(resetTimerID);
+ resetTimerID = 0;
+ }
+}
+
+function triggerVirtualEvent(eventType, event, flags)
+{
+ var defaultPrevented = false;
+
+ if ((flags && flags[eventType]) || (!flags && getClosestElementWithVirtualBinding(event.target, eventType))) {
+ var ve = createVirtualEvent(event, eventType);
+ $(event.target).trigger(ve);
+ defaultPrevented = ve.isDefaultPrevented();
+ }
+
+ return defaultPrevented;
+}
+
+function mouseEventCallback(event)
+{
+ var touchID = $.data(event.target, touchTargetPropertyName);
+ if (!blockMouseTriggers && (!lastTouchID || lastTouchID !== touchID)){
+ triggerVirtualEvent("v" + event.type, event);
+ }
+}
+
+function handleTouchStart(event)
+{
+ var touches = getNativeEvent(event).touches;
+ if (touches && touches.length === 1){
+ var target = event.target,
+ flags = getVirtualBindingFlags(target);
+
+ if (flags.hasVirtualBinding){
+ lastTouchID = nextTouchID++;
+ $.data(target, touchTargetPropertyName, lastTouchID);
+
+ clearResetTimer();
+
+ disableMouseBindings();
+ didScroll = false;
+
+ var t = getNativeEvent(event).touches[0];
+ startX = t.pageX;
+ startY = t.pageY;
+
+ triggerVirtualEvent("vmouseover", event, flags);
+ triggerVirtualEvent("vmousedown", event, flags);
+ }
+ }
+}
+
+function handleScroll(event)
+{
+ if (blockTouchTriggers){
+ return;
+ }
+
+ if (!didScroll){
+ triggerVirtualEvent("vmousecancel", event, getVirtualBindingFlags(event.target));
+ }
+
+ didScroll = true;
+ startResetTimer();
+}
+
+function handleTouchMove(event)
+{
+ if (blockTouchTriggers){
+ return;
+ }
+
+ var t = getNativeEvent(event).touches[0];
+
+ var didCancel = didScroll,
+ moveThreshold = $.vmouse.moveDistanceThreshold;
+ didScroll = didScroll
+ || (Math.abs(t.pageX - startX) > moveThreshold || Math.abs(t.pageY - startY) > moveThreshold);
+
+ var flags = getVirtualBindingFlags(event.target);
+ if (didScroll && !didCancel){
+ triggerVirtualEvent("vmousecancel", event, flags);
+ }
+ triggerVirtualEvent("vmousemove", event, flags);
+ startResetTimer();
+}
+
+function handleTouchEnd(event)
+{
+ if (blockTouchTriggers){
+ return;
+ }
+
+ disableTouchBindings();
+
+ var flags = getVirtualBindingFlags(event.target);
+ triggerVirtualEvent("vmouseup", event, flags);
+ if (!didScroll){
+ if (triggerVirtualEvent("vclick", event, flags)){
+ // The target of the mouse events that follow the touchend
+ // event don't necessarily match the target used during the
+ // touch. This means we need to rely on coordinates for blocking
+ // any click that is generated.
+ var t = getNativeEvent(event).changedTouches[0];
+ clickBlockList.push({ touchID: lastTouchID, x: t.clientX, y: t.clientY });
+
+ // Prevent any mouse events that follow from triggering
+ // virtual event notifications.
+ blockMouseTriggers = true;
+ }
+ }
+ triggerVirtualEvent("vmouseout", event, flags);
+ didScroll = false;
+
+ startResetTimer();
+}
+
+function hasVirtualBindings(ele)
+{
+ var bindings = $.data(ele, dataPropertyName), k;
+ if (bindings){
+ for (k in bindings){
+ if (bindings[k]){
+ return true;
+ }
+ }
+ }
+ return false;
+}
+
+function dummyMouseHandler(){}
+
+function getSpecialEventObject(eventType)
+{
+ var realType = eventType.substr(1);
+ return {
+ setup: function(data, namespace) {
+ // If this is the first virtual mouse binding for this element,
+ // add a bindings object to its data.
+
+ if (!hasVirtualBindings(this)){
+ $.data(this, dataPropertyName, {});
+ }
+
+ // If setup is called, we know it is the first binding for this
+ // eventType, so initialize the count for the eventType to zero.
+
+ var bindings = $.data(this, dataPropertyName);
+ bindings[eventType] = true;
+
+ // If this is the first virtual mouse event for this type,
+ // register a global handler on the document.
+
+ activeDocHandlers[eventType] = (activeDocHandlers[eventType] || 0) + 1;
+ if (activeDocHandlers[eventType] === 1){
+ $document.bind(realType, mouseEventCallback);
+ }
+
+ // Some browsers, like Opera Mini, won't dispatch mouse/click events
+ // for elements unless they actually have handlers registered on them.
+ // To get around this, we register dummy handlers on the elements.
+
+ $(this).bind(realType, dummyMouseHandler);
+
+ // For now, if event capture is not supported, we rely on mouse handlers.
+ if (eventCaptureSupported){
+ // If this is the first virtual mouse binding for the document,
+ // register our touchstart handler on the document.
+
+ activeDocHandlers["touchstart"] = (activeDocHandlers["touchstart"] || 0) + 1;
+ if (activeDocHandlers["touchstart"] === 1) {
+ $document.bind("touchstart", handleTouchStart)
+
+ .bind("touchend", handleTouchEnd)
+
+ // On touch platforms, touching the screen and then dragging your finger
+ // causes the window content to scroll after some distance threshold is
+ // exceeded. On these platforms, a scroll prevents a click event from being
+ // dispatched, and on some platforms, even the touchend is suppressed. To
+ // mimic the suppression of the click event, we need to watch for a scroll
+ // event. Unfortunately, some platforms like iOS don't dispatch scroll
+ // events until *AFTER* the user lifts their finger (touchend). This means
+ // we need to watch both scroll and touchmove events to figure out whether
+ // or not a scroll happenens before the touchend event is fired.
+
+ .bind("touchmove", handleTouchMove)
+ .bind("scroll", handleScroll);
+ }
+ }
+ },
+
+ teardown: function(data, namespace) {
+ // If this is the last virtual binding for this eventType,
+ // remove its global handler from the document.
+
+ --activeDocHandlers[eventType];
+ if (!activeDocHandlers[eventType]){
+ $document.unbind(realType, mouseEventCallback);
+ }
+
+ if (eventCaptureSupported){
+ // If this is the last virtual mouse binding in existence,
+ // remove our document touchstart listener.
+
+ --activeDocHandlers["touchstart"];
+ if (!activeDocHandlers["touchstart"]) {
+ $document.unbind("touchstart", handleTouchStart)
+ .unbind("touchmove", handleTouchMove)
+ .unbind("touchend", handleTouchEnd)
+ .unbind("scroll", handleScroll);
+ }
+ }
+
+ var $this = $(this),
+ bindings = $.data(this, dataPropertyName);
+
+ // teardown may be called when an element was
+ // removed from the DOM. If this is the case,
+ // jQuery core may have already stripped the element
+ // of any data bindings so we need to check it before
+ // using it.
+ if (bindings){
+ bindings[eventType] = false;
+ }
+
+ // Unregister the dummy event handler.
+
+ $this.unbind(realType, dummyMouseHandler);
+
+ // If this is the last virtual mouse binding on the
+ // element, remove the binding data from the element.
+
+ if (!hasVirtualBindings(this)){
+ $this.removeData(dataPropertyName);
+ }
+ }
+ };
+}
+
+// Expose our custom events to the jQuery bind/unbind mechanism.
+
+for (var i = 0; i < virtualEventNames.length; i++){
+ $.event.special[virtualEventNames[i]] = getSpecialEventObject(virtualEventNames[i]);
+}
+
+// Add a capture click handler to block clicks.
+// Note that we require event capture support for this so if the device
+// doesn't support it, we punt for now and rely solely on mouse events.
+if (eventCaptureSupported){
+ document.addEventListener("click", function(e){
+ var cnt = clickBlockList.length;
+ var target = e.target;
+ if (cnt) {
+ var x = e.clientX,
+ y = e.clientY,
+ threshold = $.vmouse.clickDistanceThreshold;
+
+ // The idea here is to run through the clickBlockList to see if
+ // the current click event is in the proximity of one of our
+ // vclick events that had preventDefault() called on it. If we find
+ // one, then we block the click.
+ //
+ // Why do we have to rely on proximity?
+ //
+ // Because the target of the touch event that triggered the vclick
+ // can be different from the target of the click event synthesized
+ // by the browser. The target of a mouse/click event that is syntehsized
+ // from a touch event seems to be implementation specific. For example,
+ // some browsers will fire mouse/click events for a link that is near
+ // a touch event, even though the target of the touchstart/touchend event
+ // says the user touched outside the link. Also, it seems that with most
+ // browsers, the target of the mouse/click event is not calculated until the
+ // time it is dispatched, so if you replace an element that you touched
+ // with another element, the target of the mouse/click will be the new
+ // element underneath that point.
+ //
+ // Aside from proximity, we also check to see if the target and any
+ // of its ancestors were the ones that blocked a click. This is necessary
+ // because of the strange mouse/click target calculation done in the
+ // Android 2.1 browser, where if you click on an element, and there is a
+ // mouse/click handler on one of its ancestors, the target will be the
+ // innermost child of the touched element, even if that child is no where
+ // near the point of touch.
+
+ var ele = target;
+ while (ele) {
+ for (var i = 0; i < cnt; i++) {
+ var o = clickBlockList[i],
+ touchID = 0;
+ if ((ele === target && Math.abs(o.x - x) < threshold && Math.abs(o.y - y) < threshold) || $.data(ele, touchTargetPropertyName) === o.touchID){
+ // XXX: We may want to consider removing matches from the block list
+ // instead of waiting for the reset timer to fire.
+ e.preventDefault();
+ e.stopPropagation();
+ return;
+ }
+ }
+ ele = ele.parentNode;
+ }
+ }
+ }, true);
+}
+})(jQuery, window, document);
+/*
+* jQuery Mobile Framework : events
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT or GPL Version 2 licenses.
+* http://jquery.org/license
+*/
+(function($, undefined ) {
+
+// add new event shortcuts
+$.each( "touchstart touchmove touchend orientationchange throttledresize tap taphold swipe swipeleft swiperight scrollstart scrollstop".split( " " ), function( i, name ) {
+ $.fn[ name ] = function( fn ) {
+ return fn ? this.bind( name, fn ) : this.trigger( name );
+ };
+ $.attrFn[ name ] = true;
+});
+
+var supportTouch = $.support.touch,
+ scrollEvent = "touchmove scroll",
+ touchStartEvent = supportTouch ? "touchstart" : "mousedown",
+ touchStopEvent = supportTouch ? "touchend" : "mouseup",
+ touchMoveEvent = supportTouch ? "touchmove" : "mousemove";
+
+function triggerCustomEvent(obj, eventType, event)
+{
+ var originalType = event.type;
+ event.type = eventType;
+ $.event.handle.call( obj, event );
+ event.type = originalType;
+}
+
+// also handles scrollstop
+$.event.special.scrollstart = {
+ enabled: true,
+
+ setup: function() {
+ var thisObject = this,
+ $this = $( thisObject ),
+ scrolling,
+ timer;
+
+ function trigger( event, state ) {
+ scrolling = state;
+ triggerCustomEvent( thisObject, scrolling ? "scrollstart" : "scrollstop", event );
+ }
+
+ // iPhone triggers scroll after a small delay; use touchmove instead
+ $this.bind( scrollEvent, function( event ) {
+ if ( !$.event.special.scrollstart.enabled ) {
+ return;
+ }
+
+ if ( !scrolling ) {
+ trigger( event, true );
+ }
+
+ clearTimeout( timer );
+ timer = setTimeout(function() {
+ trigger( event, false );
+ }, 50 );
+ });
+ }
+};
+
+// also handles taphold
+$.event.special.tap = {
+ setup: function() {
+ var thisObject = this,
+ $this = $( thisObject );
+
+ $this
+ .bind("vmousedown", function( event ) {
+ if ( event.which && event.which !== 1 ) {
+ return false;
+ }
+
+ var touching = true,
+ origTarget = event.target,
+ origEvent = event.originalEvent,
+ timer;
+
+ function clearTapHandlers() {
+ touching = false;
+ clearTimeout(timer);
+ $this.unbind("vclick", clickHandler).unbind("vmousecancel", clearTapHandlers);
+ }
+
+ function clickHandler(event) {
+ clearTapHandlers();
+
+ /* ONLY trigger a 'tap' event if the start target is
+ * the same as the stop target.
+ */
+ if ( origTarget == event.target ) {
+ triggerCustomEvent( thisObject, "tap", event );
+ }
+ }
+
+ $this.bind("vmousecancel", clearTapHandlers).bind("vclick", clickHandler);
+
+ timer = setTimeout(function() {
+ if ( touching ) {
+ triggerCustomEvent( thisObject, "taphold", event );
+ }
+ }, 750 );
+ });
+ }
+};
+
+// also handles swipeleft, swiperight
+$.event.special.swipe = {
+ setup: function() {
+ var thisObject = this,
+ $this = $( thisObject );
+
+ $this
+ .bind( touchStartEvent, function( event ) {
+ var data = event.originalEvent.touches ?
+ event.originalEvent.touches[ 0 ] :
+ event,
+ start = {
+ time: (new Date).getTime(),
+ coords: [ data.pageX, data.pageY ],
+ origin: $( event.target )
+ },
+ stop;
+
+ function moveHandler( event ) {
+ if ( !start ) {
+ return;
+ }
+
+ var data = event.originalEvent.touches ?
+ event.originalEvent.touches[ 0 ] :
+ event;
+ stop = {
+ time: (new Date).getTime(),
+ coords: [ data.pageX, data.pageY ]
+ };
+
+ // prevent scrolling
+ if ( Math.abs( start.coords[0] - stop.coords[0] ) > 10 ) {
+ event.preventDefault();
+ }
+ }
+
+ $this
+ .bind( touchMoveEvent, moveHandler )
+ .one( touchStopEvent, function( event ) {
+ $this.unbind( touchMoveEvent, moveHandler );
+ if ( start && stop ) {
+ if ( stop.time - start.time < 1000 &&
+ Math.abs( start.coords[0] - stop.coords[0]) > 30 &&
+ Math.abs( start.coords[1] - stop.coords[1]) < 75 ) {
+ start.origin
+ .trigger( "swipe" )
+
+ .trigger( start.coords[0] > stop.coords[0] ? "swipeleft" : "swiperight" );
+ }
+ }
+ start = stop = undefined;
+ });
+ });
+ }
+};
+
+(function($){
+ // "Cowboy" Ben Alman
+
+ var win = $(window),
+ special_event,
+ get_orientation,
+ last_orientation;
+
+ $.event.special.orientationchange = special_event = {
+ setup: function(){
+ // If the event is supported natively, return false so that jQuery
+ // will bind to the event using DOM methods.
+ if ( $.support.orientation ) { return false; }
+
+ // Get the current orientation to avoid initial double-triggering.
+ last_orientation = get_orientation();
+
+ // Because the orientationchange event doesn't exist, simulate the
+ // event by testing window dimensions on resize.
+ win.bind( "throttledresize", handler );
+ },
+ teardown: function(){
+ // If the event is not supported natively, return false so that
+ // jQuery will unbind the event using DOM methods.
+ if ( $.support.orientation ) { return false; }
+
+ // Because the orientationchange event doesn't exist, unbind the
+ // resize event handler.
+ win.unbind( "throttledresize", handler );
+ },
+ add: function( handleObj ) {
+ // Save a reference to the bound event handler.
+ var old_handler = handleObj.handler;
+
+ handleObj.handler = function( event ) {
+ // Modify event object, adding the .orientation property.
+ event.orientation = get_orientation();
+
+ // Call the originally-bound event handler and return its result.
+ return old_handler.apply( this, arguments );
+ };
+ }
+ };
+
+ // If the event is not supported natively, this handler will be bound to
+ // the window resize event to simulate the orientationchange event.
+ function handler() {
+ // Get the current orientation.
+ var orientation = get_orientation();
+
+ if ( orientation !== last_orientation ) {
+ // The orientation has changed, so trigger the orientationchange event.
+ last_orientation = orientation;
+ win.trigger( "orientationchange" );
+ }
+ };
+
+ // Get the current page orientation. This method is exposed publicly, should it
+ // be needed, as jQuery.event.special.orientationchange.orientation()
+ $.event.special.orientationchange.orientation = get_orientation = function() {
+ var elem = document.documentElement;
+ return elem && elem.clientWidth / elem.clientHeight < 1.1 ? "portrait" : "landscape";
+ };
+
+})(jQuery);
+
+
+// throttled resize event
+(function(){
+ $.event.special.throttledresize = {
+ setup: function() {
+ $( this ).bind( "resize", handler );
+ },
+ teardown: function(){
+ $( this ).unbind( "resize", handler );
+ }
+ };
+
+ var throttle = 250,
+ handler = function(){
+ curr = ( new Date() ).getTime();
+ diff = curr - lastCall;
+ if( diff >= throttle ){
+ lastCall = curr;
+ $( this ).trigger( "throttledresize" );
+ }
+ else{
+ if( heldCall ){
+ clearTimeout( heldCall );
+ }
+ //promise a held call will still execute
+ heldCall = setTimeout( handler, throttle - diff );
+ }
+ },
+ lastCall = 0,
+ heldCall,
+ curr,
+ diff;
+})();
+
+
+$.each({
+ scrollstop: "scrollstart",
+ taphold: "tap",
+ swipeleft: "swipe",
+ swiperight: "swipe"
+}, function( event, sourceEvent ) {
+ $.event.special[ event ] = {
+ setup: function() {
+ $( this ).bind( sourceEvent, $.noop );
+ }
+ };
+});
+
+})( jQuery );
+/*!
+ * jQuery hashchange event - v1.3 - 7/21/2010
+ * http://benalman.com/projects/jquery-hashchange-plugin/
+ *
+ * Copyright (c) 2010 "Cowboy" Ben Alman
+ * Dual licensed under the MIT and GPL licenses.
+ * http://benalman.com/about/license/
+ */
+
+// Script: jQuery hashchange event
+//
+// *Version: 1.3, Last updated: 7/21/2010*
+//
+// Project Home - http://benalman.com/projects/jquery-hashchange-plugin/
+// GitHub - http://github.com/cowboy/jquery-hashchange/
+// Source - http://github.com/cowboy/jquery-hashchange/raw/master/jquery.ba-hashchange.js
+// (Minified) - http://github.com/cowboy/jquery-hashchange/raw/master/jquery.ba-hashchange.min.js (0.8kb gzipped)
+//
+// About: License
+//
+// Copyright (c) 2010 "Cowboy" Ben Alman,
+// Dual licensed under the MIT and GPL licenses.
+// http://benalman.com/about/license/
+//
+// About: Examples
+//
+// These working examples, complete with fully commented code, illustrate a few
+// ways in which this plugin can be used.
+//
+// hashchange event - http://benalman.com/code/projects/jquery-hashchange/examples/hashchange/
+// document.domain - http://benalman.com/code/projects/jquery-hashchange/examples/document_domain/
+//
+// About: Support and Testing
+//
+// Information about what version or versions of jQuery this plugin has been
+// tested with, what browsers it has been tested in, and where the unit tests
+// reside (so you can test it yourself).
+//
+// jQuery Versions - 1.2.6, 1.3.2, 1.4.1, 1.4.2
+// Browsers Tested - Internet Explorer 6-8, Firefox 2-4, Chrome 5-6, Safari 3.2-5,
+// Opera 9.6-10.60, iPhone 3.1, Android 1.6-2.2, BlackBerry 4.6-5.
+// Unit Tests - http://benalman.com/code/projects/jquery-hashchange/unit/
+//
+// About: Known issues
+//
+// While this jQuery hashchange event implementation is quite stable and
+// robust, there are a few unfortunate browser bugs surrounding expected
+// hashchange event-based behaviors, independent of any JavaScript
+// window.onhashchange abstraction. See the following examples for more
+// information:
+//
+// Chrome: Back Button - http://benalman.com/code/projects/jquery-hashchange/examples/bug-chrome-back-button/
+// Firefox: Remote XMLHttpRequest - http://benalman.com/code/projects/jquery-hashchange/examples/bug-firefox-remote-xhr/
+// WebKit: Back Button in an Iframe - http://benalman.com/code/projects/jquery-hashchange/examples/bug-webkit-hash-iframe/
+// Safari: Back Button from a different domain - http://benalman.com/code/projects/jquery-hashchange/examples/bug-safari-back-from-diff-domain/
+//
+// Also note that should a browser natively support the window.onhashchange
+// event, but not report that it does, the fallback polling loop will be used.
+//
+// About: Release History
+//
+// 1.3 - (7/21/2010) Reorganized IE6/7 Iframe code to make it more
+// "removable" for mobile-only development. Added IE6/7 document.title
+// support. Attempted to make Iframe as hidden as possible by using
+// techniques from http://www.paciellogroup.com/blog/?p=604. Added
+// support for the "shortcut" format $(window).hashchange( fn ) and
+// $(window).hashchange() like jQuery provides for built-in events.
+// Renamed jQuery.hashchangeDelay to <jQuery.fn.hashchange.delay> and
+// lowered its default value to 50. Added <jQuery.fn.hashchange.domain>
+// and <jQuery.fn.hashchange.src> properties plus document-domain.html
+// file to address access denied issues when setting document.domain in
+// IE6/7.
+// 1.2 - (2/11/2010) Fixed a bug where coming back to a page using this plugin
+// from a page on another domain would cause an error in Safari 4. Also,
+// IE6/7 Iframe is now inserted after the body (this actually works),
+// which prevents the page from scrolling when the event is first bound.
+// Event can also now be bound before DOM ready, but it won't be usable
+// before then in IE6/7.
+// 1.1 - (1/21/2010) Incorporated document.documentMode test to fix IE8 bug
+// where browser version is incorrectly reported as 8.0, despite
+// inclusion of the X-UA-Compatible IE=EmulateIE7 meta tag.
+// 1.0 - (1/9/2010) Initial Release. Broke out the jQuery BBQ event.special
+// window.onhashchange functionality into a separate plugin for users
+// who want just the basic event & back button support, without all the
+// extra awesomeness that BBQ provides. This plugin will be included as
+// part of jQuery BBQ, but also be available separately.
+
+(function($,window,undefined){
+ '$:nomunge'; // Used by YUI compressor.
+
+ // Reused string.
+ var str_hashchange = 'hashchange',
+
+ // Method / object references.
+ doc = document,
+ fake_onhashchange,
+ special = $.event.special,
+
+ // Does the browser support window.onhashchange? Note that IE8 running in
+ // IE7 compatibility mode reports true for 'onhashchange' in window, even
+ // though the event isn't supported, so also test document.documentMode.
+ doc_mode = doc.documentMode,
+ supports_onhashchange = 'on' + str_hashchange in window && ( doc_mode === undefined || doc_mode > 7 );
+
+ // Get location.hash (or what you'd expect location.hash to be) sans any
+ // leading #. Thanks for making this necessary, Firefox!
+ function get_fragment( url ) {
+ url = url || location.href;
+ return '#' + url.replace( /^[^#]*#?(.*)$/, '$1' );
+ };
+
+ // Method: jQuery.fn.hashchange
+ //
+ // Bind a handler to the window.onhashchange event or trigger all bound
+ // window.onhashchange event handlers. This behavior is consistent with
+ // jQuery's built-in event handlers.
+ //
+ // Usage:
+ //
+ // > jQuery(window).hashchange( [ handler ] );
+ //
+ // Arguments:
+ //
+ // handler - (Function) Optional handler to be bound to the hashchange
+ // event. This is a "shortcut" for the more verbose form:
+ // jQuery(window).bind( 'hashchange', handler ). If handler is omitted,
+ // all bound window.onhashchange event handlers will be triggered. This
+ // is a shortcut for the more verbose
+ // jQuery(window).trigger( 'hashchange' ). These forms are described in
+ // the <hashchange event> section.
+ //
+ // Returns:
+ //
+ // (jQuery) The initial jQuery collection of elements.
+
+ // Allow the "shortcut" format $(elem).hashchange( fn ) for binding and
+ // $(elem).hashchange() for triggering, like jQuery does for built-in events.
+ $.fn[ str_hashchange ] = function( fn ) {
+ return fn ? this.bind( str_hashchange, fn ) : this.trigger( str_hashchange );
+ };
+
+ // Property: jQuery.fn.hashchange.delay
+ //
+ // The numeric interval (in milliseconds) at which the <hashchange event>
+ // polling loop executes. Defaults to 50.
+
+ // Property: jQuery.fn.hashchange.domain
+ //
+ // If you're setting document.domain in your JavaScript, and you want hash
+ // history to work in IE6/7, not only must this property be set, but you must
+ // also set document.domain BEFORE jQuery is loaded into the page. This
+ // property is only applicable if you are supporting IE6/7 (or IE8 operating
+ // in "IE7 compatibility" mode).
+ //
+ // In addition, the <jQuery.fn.hashchange.src> property must be set to the
+ // path of the included "document-domain.html" file, which can be renamed or
+ // modified if necessary (note that the document.domain specified must be the
+ // same in both your main JavaScript as well as in this file).
+ //
+ // Usage:
+ //
+ // jQuery.fn.hashchange.domain = document.domain;
+
+ // Property: jQuery.fn.hashchange.src
+ //
+ // If, for some reason, you need to specify an Iframe src file (for example,
+ // when setting document.domain as in <jQuery.fn.hashchange.domain>), you can
+ // do so using this property. Note that when using this property, history
+ // won't be recorded in IE6/7 until the Iframe src file loads. This property
+ // is only applicable if you are supporting IE6/7 (or IE8 operating in "IE7
+ // compatibility" mode).
+ //
+ // Usage:
+ //
+ // jQuery.fn.hashchange.src = 'path/to/file.html';
+
+ $.fn[ str_hashchange ].delay = 50;
+ /*
+ $.fn[ str_hashchange ].domain = null;
+ $.fn[ str_hashchange ].src = null;
+ */
+
+ // Event: hashchange event
+ //
+ // Fired when location.hash changes. In browsers that support it, the native
+ // HTML5 window.onhashchange event is used, otherwise a polling loop is
+ // initialized, running every <jQuery.fn.hashchange.delay> milliseconds to
+ // see if the hash has changed. In IE6/7 (and IE8 operating in "IE7
+ // compatibility" mode), a hidden Iframe is created to allow the back button
+ // and hash-based history to work.
+ //
+ // Usage as described in <jQuery.fn.hashchange>:
+ //
+ // > // Bind an event handler.
+ // > jQuery(window).hashchange( function(e) {
+ // > var hash = location.hash;
+ // > ...
+ // > });
+ // >
+ // > // Manually trigger the event handler.
+ // > jQuery(window).hashchange();
+ //
+ // A more verbose usage that allows for event namespacing:
+ //
+ // > // Bind an event handler.
+ // > jQuery(window).bind( 'hashchange', function(e) {
+ // > var hash = location.hash;
+ // > ...
+ // > });
+ // >
+ // > // Manually trigger the event handler.
+ // > jQuery(window).trigger( 'hashchange' );
+ //
+ // Additional Notes:
+ //
+ // * The polling loop and Iframe are not created until at least one handler
+ // is actually bound to the 'hashchange' event.
+ // * If you need the bound handler(s) to execute immediately, in cases where
+ // a location.hash exists on page load, via bookmark or page refresh for
+ // example, use jQuery(window).hashchange() or the more verbose
+ // jQuery(window).trigger( 'hashchange' ).
+ // * The event can be bound before DOM ready, but since it won't be usable
+ // before then in IE6/7 (due to the necessary Iframe), recommended usage is
+ // to bind it inside a DOM ready handler.
+
+ // Override existing $.event.special.hashchange methods (allowing this plugin
+ // to be defined after jQuery BBQ in BBQ's source code).
+ special[ str_hashchange ] = $.extend( special[ str_hashchange ], {
+
+ // Called only when the first 'hashchange' event is bound to window.
+ setup: function() {
+ // If window.onhashchange is supported natively, there's nothing to do..
+ if ( supports_onhashchange ) { return false; }
+
+ // Otherwise, we need to create our own. And we don't want to call this
+ // until the user binds to the event, just in case they never do, since it
+ // will create a polling loop and possibly even a hidden Iframe.
+ $( fake_onhashchange.start );
+ },
+
+ // Called only when the last 'hashchange' event is unbound from window.
+ teardown: function() {
+ // If window.onhashchange is supported natively, there's nothing to do..
+ if ( supports_onhashchange ) { return false; }
+
+ // Otherwise, we need to stop ours (if possible).
+ $( fake_onhashchange.stop );
+ }
+
+ });
+
+ // fake_onhashchange does all the work of triggering the window.onhashchange
+ // event for browsers that don't natively support it, including creating a
+ // polling loop to watch for hash changes and in IE 6/7 creating a hidden
+ // Iframe to enable back and forward.
+ fake_onhashchange = (function(){
+ var self = {},
+ timeout_id,
+
+ // Remember the initial hash so it doesn't get triggered immediately.
+ last_hash = get_fragment(),
+
+ fn_retval = function(val){ return val; },
+ history_set = fn_retval,
+ history_get = fn_retval;
+
+ // Start the polling loop.
+ self.start = function() {
+ timeout_id || poll();
+ };
+
+ // Stop the polling loop.
+ self.stop = function() {
+ timeout_id && clearTimeout( timeout_id );
+ timeout_id = undefined;
+ };
+
+ // This polling loop checks every $.fn.hashchange.delay milliseconds to see
+ // if location.hash has changed, and triggers the 'hashchange' event on
+ // window when necessary.
+ function poll() {
+ var hash = get_fragment(),
+ history_hash = history_get( last_hash );
+
+ if ( hash !== last_hash ) {
+ history_set( last_hash = hash, history_hash );
+
+ $(window).trigger( str_hashchange );
+
+ } else if ( history_hash !== last_hash ) {
+ location.href = location.href.replace( /#.*/, '' ) + history_hash;
+ }
+
+ timeout_id = setTimeout( poll, $.fn[ str_hashchange ].delay );
+ };
+
+ // vvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvv
+ // vvvvvvvvvvvvvvvvvvv REMOVE IF NOT SUPPORTING IE6/7/8 vvvvvvvvvvvvvvvvvvv
+ // vvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvv
+ $.browser.msie && !supports_onhashchange && (function(){
+ // Not only do IE6/7 need the "magical" Iframe treatment, but so does IE8
+ // when running in "IE7 compatibility" mode.
+
+ var iframe,
+ iframe_src;
+
+ // When the event is bound and polling starts in IE 6/7, create a hidden
+ // Iframe for history handling.
+ self.start = function(){
+ if ( !iframe ) {
+ iframe_src = $.fn[ str_hashchange ].src;
+ iframe_src = iframe_src && iframe_src + get_fragment();
+
+ // Create hidden Iframe. Attempt to make Iframe as hidden as possible
+ // by using techniques from http://www.paciellogroup.com/blog/?p=604.
+ iframe = $('<iframe tabindex="-1" title="empty"/>').hide()
+
+ // When Iframe has completely loaded, initialize the history and
+ // start polling.
+ .one( 'load', function(){
+ iframe_src || history_set( get_fragment() );
+ poll();
+ })
+
+ // Load Iframe src if specified, otherwise nothing.
+ .attr( 'src', iframe_src || 'javascript:0' )
+
+ // Append Iframe after the end of the body to prevent unnecessary
+ // initial page scrolling (yes, this works).
+ .insertAfter( 'body' )[0].contentWindow;
+
+ // Whenever `document.title` changes, update the Iframe's title to
+ // prettify the back/next history menu entries. Since IE sometimes
+ // errors with "Unspecified error" the very first time this is set
+ // (yes, very useful) wrap this with a try/catch block.
+ doc.onpropertychange = function(){
+ try {
+ if ( event.propertyName === 'title' ) {
+ iframe.document.title = doc.title;
+ }
+ } catch(e) {}
+ };
+
+ }
+ };
+
+ // Override the "stop" method since an IE6/7 Iframe was created. Even
+ // if there are no longer any bound event handlers, the polling loop
+ // is still necessary for back/next to work at all!
+ self.stop = fn_retval;
+
+ // Get history by looking at the hidden Iframe's location.hash.
+ history_get = function() {
+ return get_fragment( iframe.location.href );
+ };
+
+ // Set a new history item by opening and then closing the Iframe
+ // document, *then* setting its location.hash. If document.domain has
+ // been set, update that as well.
+ history_set = function( hash, history_hash ) {
+ var iframe_doc = iframe.document,
+ domain = $.fn[ str_hashchange ].domain;
+
+ if ( hash !== history_hash ) {
+ // Update Iframe with any initial `document.title` that might be set.
+ iframe_doc.title = doc.title;
+
+ // Opening the Iframe's document after it has been closed is what
+ // actually adds a history entry.
+ iframe_doc.open();
+
+ // Set document.domain for the Iframe document as well, if necessary.
+ domain && iframe_doc.write( '<script>document.domain="' + domain + '"</script>' );
+
+ iframe_doc.close();
+
+ // Update the Iframe's hash, for great justice.
+ iframe.location.hash = hash;
+ }
+ };
+
+ })();
+ // ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^
+ // ^^^^^^^^^^^^^^^^^^^ REMOVE IF NOT SUPPORTING IE6/7/8 ^^^^^^^^^^^^^^^^^^^
+ // ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^
+
+ return self;
+ })();
+
+})(jQuery,this);
+/*
+* jQuery Mobile Framework : "page" plugin
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT or GPL Version 2 licenses.
+* http://jquery.org/license
+*/
+(function($, undefined ) {
+
+$.widget( "mobile.page", $.mobile.widget, {
+ options: {
+ backBtnText: "Back",
+ addBackBtn: false,
+ backBtnTheme: null,
+ degradeInputs: {
+ color: false,
+ date: false,
+ datetime: false,
+ "datetime-local": false,
+ email: false,
+ month: false,
+ number: false,
+ range: "number",
+ search: true,
+ tel: false,
+ time: false,
+ url: false,
+ week: false
+ },
+ keepNative: null
+ },
+
+ _create: function() {
+ var $elem = this.element,
+ o = this.options;
+
+ this.keepNative = ":jqmData(role='none'), :jqmData(role='nojs')" + (o.keepNative ? ", " + o.keepNative : "");
+
+ if ( this._trigger( "beforeCreate" ) === false ) {
+ return;
+ }
+
+ //some of the form elements currently rely on the presence of ui-page and ui-content
+ // classes so we'll handle page and content roles outside of the main role processing
+ // loop below.
+ $elem.find( ":jqmData(role='page'), :jqmData(role='content')" ).andSelf().each(function() {
+ $(this).addClass( "ui-" + $(this).jqmData( "role" ) );
+ });
+
+ $elem.find( ":jqmData(role='nojs')" ).addClass( "ui-nojs" );
+
+ // pre-find data els
+ var $dataEls = $elem.find( ":jqmData(role)" ).andSelf().each(function() {
+ var $this = $( this ),
+ role = $this.jqmData( "role" ),
+ theme = $this.jqmData( "theme" );
+
+ //apply theming and markup modifications to page,header,content,footer
+ if ( role === "header" || role === "footer" ) {
+ $this.addClass( "ui-bar-" + (theme || $this.parent( ":jqmData(role='page')" ).jqmData( "theme" ) || "a") );
+
+ // add ARIA role
+ $this.attr( "role", role === "header" ? "banner" : "contentinfo" );
+
+ //right,left buttons
+ var $headeranchors = $this.children( "a" ),
+ leftbtn = $headeranchors.hasClass( "ui-btn-left" ),
+ rightbtn = $headeranchors.hasClass( "ui-btn-right" );
+
+ if ( !leftbtn ) {
+ leftbtn = $headeranchors.eq( 0 ).not( ".ui-btn-right" ).addClass( "ui-btn-left" ).length;
+ }
+
+ if ( !rightbtn ) {
+ rightbtn = $headeranchors.eq( 1 ).addClass( "ui-btn-right" ).length;
+ }
+
+ // auto-add back btn on pages beyond first view
+ if ( o.addBackBtn && role === "header" &&
+ $( ".ui-page" ).length > 1 &&
+ $elem.jqmData( "url" ) !== $.mobile.path.stripHash( location.hash ) &&
+ !leftbtn && $this.jqmData( "backbtn" ) !== false ) {
+
+ var backBtn = $( "<a href='#' class='ui-btn-left' data-"+ $.mobile.ns +"rel='back' data-"+ $.mobile.ns +"icon='arrow-l'>"+ o.backBtnText +"</a>" ).prependTo( $this );
+
+ //if theme is provided, override default inheritance
+ if( o.backBtnTheme ){
+ backBtn.attr( "data-"+ $.mobile.ns +"theme", o.backBtnTheme );
+ }
+ }
+
+ //page title
+ $this.children( "h1, h2, h3, h4, h5, h6" )
+ .addClass( "ui-title" )
+ //regardless of h element number in src, it becomes h1 for the enhanced page
+ .attr({ "tabindex": "0", "role": "heading", "aria-level": "1" });
+
+ } else if ( role === "content" ) {
+ if ( theme ) {
+ $this.addClass( "ui-body-" + theme );
+ }
+
+ // add ARIA role
+ $this.attr( "role", "main" );
+
+ } else if ( role === "page" ) {
+ $this.addClass( "ui-body-" + (theme || "c") );
+ }
+
+ switch(role) {
+ case "header":
+ case "footer":
+ case "page":
+ case "content":
+ $this.addClass( "ui-" + role );
+ break;
+ case "collapsible":
+ case "fieldcontain":
+ case "navbar":
+ case "listview":
+ case "dialog":
+ $this[ role ]();
+ break;
+ }
+ });
+
+ //enhance form controls
+ this._enhanceControls();
+
+ //links in bars, or those with data-role become buttons
+ $elem.find( ":jqmData(role='button'), .ui-bar > a, .ui-header > a, .ui-footer > a" )
+ .not( ".ui-btn" )
+ .not(this.keepNative)
+ .buttonMarkup();
+
+ $elem
+ .find(":jqmData(role='controlgroup')")
+ .controlgroup();
+
+ //links within content areas
+ $elem.find( "a:not(.ui-btn):not(.ui-link-inherit)" )
+ .not(this.keepNative)
+ .addClass( "ui-link" );
+
+ //fix toolbars
+ $elem.fixHeaderFooter();
+ },
+
+ _typeAttributeRegex: /\s+type=["']?\w+['"]?/,
+
+ _enhanceControls: function() {
+ var o = this.options, self = this;
+
+ // degrade inputs to avoid poorly implemented native functionality
+ this.element.find( "input" ).not(this.keepNative).each(function() {
+ var type = this.getAttribute( "type" ),
+ optType = o.degradeInputs[ type ] || "text";
+
+ if ( o.degradeInputs[ type ] ) {
+ $( this ).replaceWith(
+ $( "<div>" ).html( $(this).clone() ).html()
+ .replace( self._typeAttributeRegex, " type=\""+ optType +"\" data-" + $.mobile.ns + "type=\""+type+"\" " ) );
+ }
+ });
+
+ // We re-find form elements since the degredation code above
+ // may have injected new elements. We cache the non-native control
+ // query to reduce the number of times we search through the entire page.
+
+ var allControls = this.element.find("input, textarea, select, button"),
+ nonNativeControls = allControls.not(this.keepNative);
+
+ // XXX: Temporary workaround for issue 785. Turn off autocorrect and
+ // autocomplete since the popup they use can't be dismissed by
+ // the user. Note that we test for the presence of the feature
+ // by looking for the autocorrect property on the input element.
+
+ var textInputs = allControls.filter( "input[type=text]" );
+ if (textInputs.length && typeof textInputs[0].autocorrect !== "undefined") {
+ textInputs.each(function(){
+ // Set the attribute instead of the property just in case there
+ // is code that attempts to make modifications via HTML.
+ this.setAttribute("autocorrect", "off");
+ this.setAttribute("autocomplete", "off");
+ });
+ }
+
+ // enchance form controls
+ nonNativeControls
+ .filter( "[type='radio'], [type='checkbox']" )
+ .checkboxradio();
+
+ nonNativeControls
+ .filter( "button, [type='button'], [type='submit'], [type='reset'], [type='image']" )
+ .button();
+
+ nonNativeControls
+ .filter( "input, textarea" )
+ .not( "[type='radio'], [type='checkbox'], [type='button'], [type='submit'], [type='reset'], [type='image'], [type='hidden']" )
+ .textinput();
+
+ nonNativeControls
+ .filter( "input, select" )
+ .filter( ":jqmData(role='slider'), :jqmData(type='range')" )
+ .slider();
+
+ nonNativeControls
+ .filter( "select:not(:jqmData(role='slider'))" )
+ .selectmenu();
+ }
+});
+
+})( jQuery );
+/*!
+ * jQuery Mobile v@VERSION
+ * http://jquerymobile.com/
+ *
+ * Copyright 2010, jQuery Project
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ */
+
+(function( $, window, undefined ) {
+
+ //jQuery.mobile configurable options
+ $.extend( $.mobile, {
+
+ //namespace used framework-wide for data-attrs. Default is no namespace
+ ns: "",
+
+ //define the url parameter used for referencing widget-generated sub-pages.
+ //Translates to to example.html&ui-page=subpageIdentifier
+ //hash segment before &ui-page= is used to make Ajax request
+ subPageUrlKey: "ui-page",
+
+ //anchor links with a data-rel, or pages with a data-role, that match these selectors will be untrackable in history
+ //(no change in URL, not bookmarkable)
+ nonHistorySelectors: "dialog",
+
+ //class assigned to page currently in view, and during transitions
+ activePageClass: "ui-page-active",
+
+ //class used for "active" button state, from CSS framework
+ activeBtnClass: "ui-btn-active",
+
+ //automatically handle clicks and form submissions through Ajax, when same-domain
+ ajaxEnabled: true,
+
+ //When enabled, clicks and taps that result in Ajax page changes will happen slightly sooner on touch devices.
+ //Also, it will prevent the address bar from appearing on platforms like iOS during page transitions.
+ //This option has no effect on non-touch devices, but enabling it may interfere with jQuery plugins that bind to click events
+ useFastClick: true,
+
+ //automatically load and show pages based on location.hash
+ hashListeningEnabled: true,
+
+ //set default page transition - 'none' for no transitions
+ defaultPageTransition: "slide",
+
+ //minimum scroll distance that will be remembered when returning to a page
+ minScrollBack: screen.height / 2,
+
+ //set default dialog transition - 'none' for no transitions
+ defaultDialogTransition: "pop",
+
+ //show loading message during Ajax requests
+ //if false, message will not appear, but loading classes will still be toggled on html el
+ loadingMessage: "loading",
+
+ //error response message - appears when an Ajax page request fails
+ pageLoadErrorMessage: "Error Loading Page",
+
+ //support conditions that must be met in order to proceed
+ //default enhanced qualifications are media query support OR IE 7+
+ gradeA: function(){
+ return $.support.mediaquery || $.mobile.browser.ie && $.mobile.browser.ie >= 7;
+ },
+
+ //TODO might be useful upstream in jquery itself ?
+ keyCode: {
+ ALT: 18,
+ BACKSPACE: 8,
+ CAPS_LOCK: 20,
+ COMMA: 188,
+ COMMAND: 91,
+ COMMAND_LEFT: 91, // COMMAND
+ COMMAND_RIGHT: 93,
+ CONTROL: 17,
+ DELETE: 46,
+ DOWN: 40,
+ END: 35,
+ ENTER: 13,
+ ESCAPE: 27,
+ HOME: 36,
+ INSERT: 45,
+ LEFT: 37,
+ MENU: 93, // COMMAND_RIGHT
+ NUMPAD_ADD: 107,
+ NUMPAD_DECIMAL: 110,
+ NUMPAD_DIVIDE: 111,
+ NUMPAD_ENTER: 108,
+ NUMPAD_MULTIPLY: 106,
+ NUMPAD_SUBTRACT: 109,
+ PAGE_DOWN: 34,
+ PAGE_UP: 33,
+ PERIOD: 190,
+ RIGHT: 39,
+ SHIFT: 16,
+ SPACE: 32,
+ TAB: 9,
+ UP: 38,
+ WINDOWS: 91 // COMMAND
+ },
+
+ //scroll page vertically: scroll to 0 to hide iOS address bar, or pass a Y value
+ silentScroll: function( ypos ) {
+ if( $.type( ypos ) !== "number" ){
+ ypos = $.mobile.defaultHomeScroll;
+ }
+
+ // prevent scrollstart and scrollstop events
+ $.event.special.scrollstart.enabled = false;
+
+ setTimeout(function() {
+ window.scrollTo( 0, ypos );
+ $(document).trigger( "silentscroll", { x: 0, y: ypos });
+ },20);
+
+ setTimeout(function() {
+ $.event.special.scrollstart.enabled = true;
+ }, 150 );
+ },
+
+ // compile the namespace normalization regex once
+ normalizeRegex: /-([a-z])/g,
+
+ // take a data attribute property, prepend the namespace
+ // and then camel case the attribute string
+ nsNormalize: function(prop){
+ if(!prop) return;
+
+ return $.camelCase( $.mobile.ns + prop );
+ }
+ });
+
+ //mobile version of data and removeData and hasData methods
+ //ensures all data is set and retrieved using jQuery Mobile's data namespace
+ $.fn.jqmData = function( prop, value ){
+ return this.data( prop ? $.mobile.nsNormalize(prop) : prop, value );
+ };
+
+ $.jqmData = function( elem, prop, value ){
+ return $.data( elem, $.mobile.nsNormalize(prop), value );
+ };
+
+ $.fn.jqmRemoveData = function( prop ){
+ return this.removeData( $.mobile.nsNormalize(prop) );
+ };
+
+ $.jqmRemoveData = function( elem, prop ){
+ return $.removeData( elem, $.mobile.nsNormalize(prop) );
+ };
+
+ $.jqmHasData = function( elem, prop ){
+ return $.hasData( elem, $.mobile.nsNormalize(prop) );
+ };
+
+ // Monkey-patching Sizzle to filter the :jqmData selector
+ var oldFind = $.find;
+
+ $.find = function( selector, context, ret, extra ) {
+ selector = selector.replace(/:jqmData\(([^)]*)\)/g, "[data-" + ($.mobile.ns || "") + "$1]");
+
+ return oldFind.call( this, selector, context, ret, extra );
+ };
+
+ $.extend( $.find, oldFind );
+
+ $.find.matches = function( expr, set ) {
+ return $.find( expr, null, null, set );
+ };
+
+ $.find.matchesSelector = function( node, expr ) {
+ return $.find( expr, null, null, [node] ).length > 0;
+ };
+})( jQuery, this );
+/*
+* jQuery Mobile Framework : core utilities for auto ajax navigation, base tag mgmt,
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT or GPL Version 2 licenses.
+* http://jquery.org/license
+*/
+( function( $, undefined ) {
+
+ //define vars for interal use
+ var $window = $( window ),
+ $html = $( 'html' ),
+ $head = $( 'head' ),
+
+ //url path helpers for use in relative url management
+ path = {
+
+ // This scary looking regular expression parses an absolute URL or its relative
+ // variants (protocol, site, document, query, and hash), into the various
+ // components (protocol, host, path, query, fragment, etc that make up the
+ // URL as well as some other commonly used sub-parts. When used with RegExp.exec()
+ // or String.match, it parses the URL into a results array that looks like this:
+ //
+ // [0]: http://jblas:password@mycompany.com:8080/mail/inbox?msg=1234&type=unread#msg-content
+ // [1]: http://jblas:password@mycompany.com:8080/mail/inbox?msg=1234&type=unread
+ // [2]: http://jblas:password@mycompany.com:8080/mail/inbox
+ // [3]: http://jblas:password@mycompany.com:8080
+ // [4]: http:
+ // [5]: jblas:password@mycompany.com:8080
+ // [6]: jblas:password
+ // [7]: jblas
+ // [8]: password
+ // [9]: mycompany.com:8080
+ // [10]: mycompany.com
+ // [11]: 8080
+ // [12]: /mail/inbox
+ // [13]: /mail/
+ // [14]: inbox
+ // [15]: ?msg=1234&type=unread
+ // [16]: #msg-content
+ //
+ urlParseRE: /^(((([^:\/#\?]+:)?(?:\/\/((?:(([^:@\/#\?]+)(?:\:([^:@\/#\?]+))?)@)?(([^:\/#\?]+)(?:\:([0-9]+))?))?)?)?((\/?(?:[^\/\?#]+\/+)*)([^\?#]*)))?(\?[^#]+)?)(#.*)?/,
+
+ //Parse a URL into a structure that allows easy access to
+ //all of the URL components by name.
+ parseUrl: function( url ) {
+ // If we're passed an object, we'll assume that it is
+ // a parsed url object and just return it back to the caller.
+ if ( typeof url === "object" ) {
+ return url;
+ }
+
+ var u = url || "",
+ matches = path.urlParseRE.exec( url ),
+ results;
+ if ( matches ) {
+ // Create an object that allows the caller to access the sub-matches
+ // by name. Note that IE returns an empty string instead of undefined,
+ // like all other browsers do, so we normalize everything so its consistent
+ // no matter what browser we're running on.
+ results = {
+ href: matches[0] || "",
+ hrefNoHash: matches[1] || "",
+ hrefNoSearch: matches[2] || "",
+ domain: matches[3] || "",
+ protocol: matches[4] || "",
+ authority: matches[5] || "",
+ username: matches[7] || "",
+ password: matches[8] || "",
+ host: matches[9] || "",
+ hostname: matches[10] || "",
+ port: matches[11] || "",
+ pathname: matches[12] || "",
+ directory: matches[13] || "",
+ filename: matches[14] || "",
+ search: matches[15] || "",
+ hash: matches[16] || ""
+ };
+ }
+ return results || {};
+ },
+
+ //Turn relPath into an asbolute path. absPath is
+ //an optional absolute path which describes what
+ //relPath is relative to.
+ makePathAbsolute: function( relPath, absPath ) {
+ if ( relPath && relPath.charAt( 0 ) === "/" ) {
+ return relPath;
+ }
+
+ relPath = relPath || "";
+ absPath = absPath ? absPath.replace( /^\/|\/?[^\/]*$/g, "" ) : "";
+
+ var absStack = absPath ? absPath.split( "/" ) : [],
+ relStack = relPath.split( "/" );
+ for ( var i = 0; i < relStack.length; i++ ) {
+ var d = relStack[ i ];
+ switch ( d ) {
+ case ".":
+ break;
+ case "..":
+ if ( absStack.length ) {
+ absStack.pop();
+ }
+ break;
+ default:
+ absStack.push( d );
+ break;
+ }
+ }
+ return "/" + absStack.join( "/" );
+ },
+
+ //Returns true if both urls have the same domain.
+ isSameDomain: function( absUrl1, absUrl2 ) {
+ return path.parseUrl( absUrl1 ).domain === path.parseUrl( absUrl2 ).domain;
+ },
+
+ //Returns true for any relative variant.
+ isRelativeUrl: function( url ) {
+ // All relative Url variants have one thing in common, no protocol.
+ return path.parseUrl( url ).protocol === "";
+ },
+
+ //Returns true for an absolute url.
+ isAbsoluteUrl: function( url ) {
+ return path.parseUrl( url ).protocol !== "";
+ },
+
+ //Turn the specified realtive URL into an absolute one. This function
+ //can handle all relative variants (protocol, site, document, query, fragment).
+ makeUrlAbsolute: function( relUrl, absUrl ) {
+ if ( !path.isRelativeUrl( relUrl ) ) {
+ return relUrl;
+ }
+
+ var relObj = path.parseUrl( relUrl ),
+ absObj = path.parseUrl( absUrl ),
+ protocol = relObj.protocol || absObj.protocol,
+ authority = relObj.authority || absObj.authority,
+ hasPath = relObj.pathname !== "",
+ pathname = path.makePathAbsolute( relObj.pathname || absObj.filename, absObj.pathname ),
+ search = relObj.search || ( !hasPath && absObj.search ) || "",
+ hash = relObj.hash;
+
+ return protocol + "//" + authority + pathname + search + hash;
+ },
+
+ //Add search (aka query) params to the specified url.
+ addSearchParams: function( url, params ) {
+ var u = path.parseUrl( url ),
+ p = ( typeof params === "object" ) ? $.param( params ) : params,
+ s = u.search || "?";
+ return u.hrefNoSearch + s + ( s.charAt( s.length - 1 ) !== "?" ? "&" : "" ) + p + ( u.hash || "" );
+ },
+
+ convertUrlToDataUrl: function( absUrl ) {
+ var u = path.parseUrl( absUrl );
+ if ( path.isEmbeddedPage( u ) ) {
+ return u.hash.replace( /^#/, "" );
+ } else if ( path.isSameDomain( u, documentBase ) ) {
+ return u.hrefNoHash.replace( documentBase.domain, "" );
+ }
+ return absUrl;
+ },
+
+ //get path from current hash, or from a file path
+ get: function( newPath ) {
+ if( newPath === undefined ) {
+ newPath = location.hash;
+ }
+ return path.stripHash( newPath ).replace( /[^\/]*\.[^\/*]+$/, '' );
+ },
+
+ //return the substring of a filepath before the sub-page key, for making a server request
+ getFilePath: function( path ) {
+ var splitkey = '&' + $.mobile.subPageUrlKey;
+ return path && path.split( splitkey )[0].split( dialogHashKey )[0];
+ },
+
+ //set location hash to path
+ set: function( path ) {
+ location.hash = path;
+ },
+
+ //test if a given url (string) is a path
+ //NOTE might be exceptionally naive
+ isPath: function( url ) {
+ return ( /\// ).test( url );
+ },
+
+ //return a url path with the window's location protocol/hostname/pathname removed
+ clean: function( url ) {
+ return url.replace( documentBase.domain, "" );
+ },
+
+ //just return the url without an initial #
+ stripHash: function( url ) {
+ return url.replace( /^#/, "" );
+ },
+
+ //remove the preceding hash, any query params, and dialog notations
+ cleanHash: function( hash ) {
+ return path.stripHash( hash.replace( /\?.*$/, "" ).replace( dialogHashKey, "" ) );
+ },
+
+ //check whether a url is referencing the same domain, or an external domain or different protocol
+ //could be mailto, etc
+ isExternal: function( url ) {
+ var u = path.parseUrl( url );
+ return u.protocol && u.domain !== documentUrl.domain ? true : false;
+ },
+
+ hasProtocol: function( url ) {
+ return ( /^(:?\w+:)/ ).test( url );
+ },
+
+ isEmbeddedPage: function( url ) {
+ var u = path.parseUrl( url );
+
+ //if the path is absolute, then we need to compare the url against
+ //both the documentUrl and the documentBase. The main reason for this
+ //is that links embedded within external documents will refer to the
+ //application document, whereas links embedded within the application
+ //document will be resolved against the document base.
+ if ( u.protocol !== "" ) {
+ return ( u.hash && ( u.hrefNoHash === documentUrl.hrefNoHash || ( documentBaseDiffers && u.hrefNoHash === documentBase.hrefNoHash ) ) );
+ }
+ return (/^#/).test( u.href );
+ }
+ },
+
+ //will be defined when a link is clicked and given an active class
+ $activeClickedLink = null,
+
+ //urlHistory is purely here to make guesses at whether the back or forward button was clicked
+ //and provide an appropriate transition
+ urlHistory = {
+ //array of pages that are visited during a single page load. each has a url and optional transition
+ stack: [],
+
+ //maintain an index number for the active page in the stack
+ activeIndex: 0,
+
+ //get active
+ getActive: function() {
+ return urlHistory.stack[ urlHistory.activeIndex ];
+ },
+
+ getPrev: function() {
+ return urlHistory.stack[ urlHistory.activeIndex - 1 ];
+ },
+
+ getNext: function() {
+ return urlHistory.stack[ urlHistory.activeIndex + 1 ];
+ },
+
+ // addNew is used whenever a new page is added
+ addNew: function( url, transition, title, storedTo ) {
+ //if there's forward history, wipe it
+ if( urlHistory.getNext() ) {
+ urlHistory.clearForward();
+ }
+
+ urlHistory.stack.push( {url : url, transition: transition, title: title, page: storedTo } );
+
+ urlHistory.activeIndex = urlHistory.stack.length - 1;
+ },
+
+ //wipe urls ahead of active index
+ clearForward: function() {
+ urlHistory.stack = urlHistory.stack.slice( 0, urlHistory.activeIndex + 1 );
+ },
+
+ directHashChange: function( opts ) {
+ var back , forward, newActiveIndex;
+
+ // check if url isp in history and if it's ahead or behind current page
+ $.each( urlHistory.stack, function( i, historyEntry ) {
+
+ //if the url is in the stack, it's a forward or a back
+ if( opts.currentUrl === historyEntry.url ) {
+ //define back and forward by whether url is older or newer than current page
+ back = i < urlHistory.activeIndex;
+ forward = !back;
+ newActiveIndex = i;
+ }
+ });
+
+ // save new page index, null check to prevent falsey 0 result
+ this.activeIndex = newActiveIndex !== undefined ? newActiveIndex : this.activeIndex;
+
+ if( back ) {
+ opts.isBack();
+ } else if( forward ) {
+ opts.isForward();
+ }
+ },
+
+ //disable hashchange event listener internally to ignore one change
+ //toggled internally when location.hash is updated to match the url of a successful page load
+ ignoreNextHashChange: false
+ },
+
+ //define first selector to receive focus when a page is shown
+ focusable = "[tabindex],a,button:visible,select:visible,input",
+
+ //queue to hold simultanious page transitions
+ pageTransitionQueue = [],
+
+ //indicates whether or not page is in process of transitioning
+ isPageTransitioning = false,
+
+ //nonsense hash change key for dialogs, so they create a history entry
+ dialogHashKey = "&ui-state=dialog",
+
+ //existing base tag?
+ $base = $head.children( "base" ),
+
+ //tuck away the original document URL minus any fragment.
+ documentUrl = path.parseUrl( location.href ),
+
+ //if the document has an embedded base tag, documentBase is set to its
+ //initial value. If a base tag does not exist, then we default to the documentUrl.
+ documentBase = $base.length ? path.parseUrl( path.makeUrlAbsolute( $base.attr( "href" ), documentUrl.href ) ) : documentUrl,
+
+ //cache the comparison once.
+ documentBaseDiffers = ( documentUrl.hrefNoHash !== documentBase.hrefNoHash );
+
+ //base element management, defined depending on dynamic base tag support
+ var base = $.support.dynamicBaseTag ? {
+
+ //define base element, for use in routing asset urls that are referenced in Ajax-requested markup
+ element: ( $base.length ? $base : $( "<base>", { href: documentBase.hrefNoHash } ).prependTo( $head ) ),
+
+ //set the generated BASE element's href attribute to a new page's base path
+ set: function( href ) {
+ base.element.attr( "href", path.makeUrlAbsolute( href, documentBase ) );
+ },
+
+ //set the generated BASE element's href attribute to a new page's base path
+ reset: function() {
+ base.element.attr( "href", documentBase.hrefNoHash );
+ }
+
+ } : undefined;
+
+/*
+ internal utility functions
+--------------------------------------*/
+
+
+ //direct focus to the page title, or otherwise first focusable element
+ function reFocus( page ) {
+ var lastClicked = page.jqmData( "lastClicked" );
+
+ if( lastClicked && lastClicked.length ) {
+ lastClicked.focus();
+ }
+ else {
+ var pageTitle = page.find( ".ui-title:eq(0)" );
+
+ if( pageTitle.length ) {
+ pageTitle.focus();
+ }
+ else{
+ page.find( focusable ).eq( 0 ).focus();
+ }
+ }
+ }
+
+ //remove active classes after page transition or error
+ function removeActiveLinkClass( forceRemoval ) {
+ if( !!$activeClickedLink && ( !$activeClickedLink.closest( '.ui-page-active' ).length || forceRemoval ) ) {
+ $activeClickedLink.removeClass( $.mobile.activeBtnClass );
+ }
+ $activeClickedLink = null;
+ }
+
+ function releasePageTransitionLock() {
+ isPageTransitioning = false;
+ if( pageTransitionQueue.length > 0 ) {
+ $.mobile.changePage.apply( null, pageTransitionQueue.pop() );
+ }
+ }
+
+ //function for transitioning between two existing pages
+ function transitionPages( toPage, fromPage, transition, reverse ) {
+
+ //get current scroll distance
+ var currScroll = $.support.scrollTop ? $window.scrollTop() : true,
+ toScroll = toPage.data( "lastScroll" ) || $.mobile.defaultHomeScroll,
+ screenHeight = getScreenHeight();
+
+ //if scrolled down, scroll to top
+ if( currScroll ){
+ window.scrollTo( 0, $.mobile.defaultHomeScroll );
+ }
+
+ //if the Y location we're scrolling to is less than 10px, let it go for sake of smoothness
+ if( toScroll < $.mobile.minScrollBack ){
+ toScroll = 0;
+ }
+
+ if( fromPage ) {
+ //set as data for returning to that spot
+ fromPage
+ .height( screenHeight + currScroll )
+ .jqmData( "lastScroll", currScroll )
+ .jqmData( "lastClicked", $activeClickedLink );
+
+ //trigger before show/hide events
+ fromPage.data( "page" )._trigger( "beforehide", null, { nextPage: toPage } );
+ }
+ toPage
+ .height( screenHeight + toScroll )
+ .data( "page" )._trigger( "beforeshow", null, { prevPage: fromPage || $( "" ) } );
+
+ //clear page loader
+ $.mobile.hidePageLoadingMsg();
+
+ //find the transition handler for the specified transition. If there
+ //isn't one in our transitionHandlers dictionary, use the default one.
+ //call the handler immediately to kick-off the transition.
+ var th = $.mobile.transitionHandlers[transition || "none"] || $.mobile.defaultTransitionHandler,
+ promise = th( transition, reverse, toPage, fromPage );
+
+ promise.done(function() {
+ //reset toPage height bac
+ toPage.height( "" );
+
+ //jump to top or prev scroll, sometimes on iOS the page has not rendered yet.
+ if( toScroll ){
+ $.mobile.silentScroll( toScroll );
+ $( document ).one( "silentscroll", function() { reFocus( toPage ); } );
+ }
+ else{
+ reFocus( toPage );
+ }
+
+ //trigger show/hide events
+ if( fromPage ) {
+ fromPage.height("").data( "page" )._trigger( "hide", null, { nextPage: toPage } );
+ }
+
+ //trigger pageshow, define prevPage as either fromPage or empty jQuery obj
+ toPage.data( "page" )._trigger( "show", null, { prevPage: fromPage || $( "" ) } );
+ });
+
+ return promise;
+ }
+
+ //simply set the active page's minimum height to screen height, depending on orientation
+ function getScreenHeight(){
+ var orientation = jQuery.event.special.orientationchange.orientation(),
+ port = orientation === "portrait",
+ winMin = port ? 480 : 320,
+ screenHeight = port ? screen.availHeight : screen.availWidth,
+ winHeight = Math.max( winMin, $( window ).height() ),
+ pageMin = Math.min( screenHeight, winHeight );
+
+ return pageMin;
+ }
+
+ //simply set the active page's minimum height to screen height, depending on orientation
+ function resetActivePageHeight(){
+ $( "." + $.mobile.activePageClass ).css( "min-height", getScreenHeight() );
+ }
+
+ //shared page enhancements
+ function enhancePage( $page, role ) {
+ // If a role was specified, make sure the data-role attribute
+ // on the page element is in sync.
+ if( role ) {
+ $page.attr( "data-" + $.mobile.ns + "role", role );
+ }
+
+ //run page plugin
+ $page.page();
+ }
+
+/* exposed $.mobile methods */
+
+ //animation complete callback
+ $.fn.animationComplete = function( callback ) {
+ if( $.support.cssTransitions ) {
+ return $( this ).one( 'webkitAnimationEnd', callback );
+ }
+ else{
+ // defer execution for consistency between webkit/non webkit
+ setTimeout( callback, 0 );
+ return $( this );
+ }
+ };
+
+ //update location.hash, with or without triggering hashchange event
+ //TODO - deprecate this one at 1.0
+ $.mobile.updateHash = path.set;
+
+ //expose path object on $.mobile
+ $.mobile.path = path;
+
+ //expose base object on $.mobile
+ $.mobile.base = base;
+
+ //url stack, useful when plugins need to be aware of previous pages viewed
+ //TODO: deprecate this one at 1.0
+ $.mobile.urlstack = urlHistory.stack;
+
+ //history stack
+ $.mobile.urlHistory = urlHistory;
+
+ //default non-animation transition handler
+ $.mobile.noneTransitionHandler = function( name, reverse, $toPage, $fromPage ) {
+ if ( $fromPage ) {
+ $fromPage.removeClass( $.mobile.activePageClass );
+ }
+ $toPage.addClass( $.mobile.activePageClass );
+
+ return $.Deferred().resolve( name, reverse, $toPage, $fromPage ).promise();
+ };
+
+ //default handler for unknown transitions
+ $.mobile.defaultTransitionHandler = $.mobile.noneTransitionHandler;
+
+ //transition handler dictionary for 3rd party transitions
+ $.mobile.transitionHandlers = {
+ none: $.mobile.defaultTransitionHandler
+ };
+
+ //enable cross-domain page support
+ $.mobile.allowCrossDomainPages = false;
+
+ //return the original document url
+ $.mobile.getDocumentUrl = function(asParsedObject) {
+ return asParsedObject ? $.extend( {}, documentUrl ) : documentUrl.href;
+ };
+
+ //return the original document base url
+ $.mobile.getDocumentBase = function(asParsedObject) {
+ return asParsedObject ? $.extend( {}, documentBase ) : documentBase.href;
+ };
+
+ // Load a page into the DOM.
+ $.mobile.loadPage = function( url, options ) {
+ // This function uses deferred notifications to let callers
+ // know when the page is done loading, or if an error has occurred.
+ var deferred = $.Deferred(),
+
+ // The default loadPage options with overrides specified by
+ // the caller.
+ settings = $.extend( {}, $.mobile.loadPage.defaults, options ),
+
+ // The DOM element for the page after it has been loaded.
+ page = null,
+
+ // If the reloadPage option is true, and the page is already
+ // in the DOM, dupCachedPage will be set to the page element
+ // so that it can be removed after the new version of the
+ // page is loaded off the network.
+ dupCachedPage = null,
+
+ // The absolute version of the URL passed into the function. This
+ // version of the URL may contain dialog/subpage params in it.
+ absUrl = path.makeUrlAbsolute( url, documentBase.hrefNoHash );
+
+
+ // If the caller provided data, and we're using "get" request,
+ // append the data to the URL.
+ if ( settings.data && settings.type === "get" ) {
+ absUrl = path.addSearchParams( absUrl, settings.data );
+ settings.data = undefined;
+ }
+
+ // The absolute version of the URL minus any dialog/subpage params.
+ // In otherwords the real URL of the page to be loaded.
+ var fileUrl = path.getFilePath( absUrl ),
+
+ // The version of the Url actually stored in the data-url attribute of
+ // the page. For embedded pages, it is just the id of the page. For pages
+ // within the same domain as the document base, it is the site relative
+ // path. For cross-domain pages (Phone Gap only) the entire absolute Url
+ // used to load the page.
+ dataUrl = path.convertUrlToDataUrl( absUrl );
+
+ // Make sure we have a pageContainer to work with.
+ settings.pageContainer = settings.pageContainer || $.mobile.pageContainer;
+
+ // Check to see if the page already exists in the DOM.
+ page = settings.pageContainer.children( ":jqmData(url='" + dataUrl + "')" );
+
+ // Reset base to the default document base.
+ if ( base ) {
+ base.reset();
+ }
+
+ // If the page we are interested in is already in the DOM,
+ // and the caller did not indicate that we should force a
+ // reload of the file, we are done. Otherwise, track the
+ // existing page as a duplicated.
+ if ( page.length ) {
+ if ( !settings.reloadPage ) {
+ enhancePage( page, settings.role );
+ deferred.resolve( absUrl, options, page );
+ return deferred.promise();
+ }
+ dupCachedPage = page;
+ }
+
+ if ( settings.showLoadMsg ) {
+ $.mobile.showPageLoadingMsg();
+ }
+
+ // Load the new page.
+ $.ajax({
+ url: fileUrl,
+ type: settings.type,
+ data: settings.data,
+ dataType: "html",
+ success: function( html ) {
+ //pre-parse html to check for a data-url,
+ //use it as the new fileUrl, base path, etc
+ var all = $( "<div></div>" ),
+
+ //page title regexp
+ newPageTitle = html.match( /<title[^>]*>([^<]*)/ ) && RegExp.$1,
+
+ // TODO handle dialogs again
+ pageElemRegex = new RegExp( ".*(<[^>]+\\bdata-" + $.mobile.ns + "role=[\"']?page[\"']?[^>]*>).*" ),
+ dataUrlRegex = new RegExp( "\\bdata-" + $.mobile.ns + "url=[\"']?([^\"'>]*)[\"']?" );
+
+
+ // data-url must be provided for the base tag so resource requests can be directed to the
+ // correct url. loading into a temprorary element makes these requests immediately
+ if( pageElemRegex.test( html )
+ && RegExp.$1
+ && dataUrlRegex.test( RegExp.$1 )
+ && RegExp.$1 ) {
+ url = fileUrl = path.getFilePath( RegExp.$1 );
+ }
+
+ if ( base ) {
+ base.set( fileUrl );
+ }
+
+ //workaround to allow scripts to execute when included in page divs
+ all.get( 0 ).innerHTML = html;
+ page = all.find( ":jqmData(role='page'), :jqmData(role='dialog')" ).first();
+
+ if ( newPageTitle && !page.jqmData( "title" ) ) {
+ page.jqmData( "title", newPageTitle );
+ }
+
+ //rewrite src and href attrs to use a base url
+ if( !$.support.dynamicBaseTag ) {
+ var newPath = path.get( fileUrl );
+ page.find( "[src], link[href], a[rel='external'], :jqmData(ajax='false'), a[target]" ).each(function() {
+ var thisAttr = $( this ).is( '[href]' ) ? 'href' :
+ $(this).is('[src]') ? 'src' : 'action',
+ thisUrl = $( this ).attr( thisAttr );
+
+ // XXX_jblas: We need to fix this so that it removes the document
+ // base URL, and then prepends with the new page URL.
+ //if full path exists and is same, chop it - helps IE out
+ thisUrl = thisUrl.replace( location.protocol + '//' + location.host + location.pathname, '' );
+
+ if( !/^(\w+:|#|\/)/.test( thisUrl ) ) {
+ $( this ).attr( thisAttr, newPath + thisUrl );
+ }
+ });
+ }
+
+ //append to page and enhance
+ page
+ .attr( "data-" + $.mobile.ns + "url", path.convertUrlToDataUrl( fileUrl ) )
+ .appendTo( settings.pageContainer );
+
+ enhancePage( page, settings.role );
+
+ // Enhancing the page may result in new dialogs/sub pages being inserted
+ // into the DOM. If the original absUrl refers to a sub-page, that is the
+ // real page we are interested in.
+ if ( absUrl.indexOf( "&" + $.mobile.subPageUrlKey ) > -1 ) {
+ page = settings.pageContainer.children( ":jqmData(url='" + dataUrl + "')" );
+ }
+
+ // Remove loading message.
+ if ( settings.showLoadMsg ) {
+ $.mobile.hidePageLoadingMsg();
+ }
+
+ deferred.resolve( absUrl, options, page, dupCachedPage );
+ },
+ error: function() {
+ //set base back to current path
+ if( base ) {
+ base.set( path.get() );
+ }
+
+ // Remove loading message.
+ if ( settings.showLoadMsg ) {
+ $.mobile.hidePageLoadingMsg();
+
+ //show error message
+ $( "<div class='ui-loader ui-overlay-shadow ui-body-e ui-corner-all'><h1>"+ $.mobile.pageLoadErrorMessage +"</h1></div>" )
+ .css({ "display": "block", "opacity": 0.96, "top": $window.scrollTop() + 100 })
+ .appendTo( settings.pageContainer )
+ .delay( 800 )
+ .fadeOut( 400, function() {
+ $( this ).remove();
+ });
+ }
+
+ deferred.reject( absUrl, options );
+ }
+ });
+
+ return deferred.promise();
+ };
+
+ $.mobile.loadPage.defaults = {
+ type: "get",
+ data: undefined,
+ reloadPage: false,
+ role: undefined, // By default we rely on the role defined by the @data-role attribute.
+ showLoadMsg: true,
+ pageContainer: undefined
+ };
+
+ // Show a specific page in the page container.
+ $.mobile.changePage = function( toPage, options ) {
+ // XXX: REMOVE_BEFORE_SHIPPING_1.0
+ // This is temporary code that makes changePage() compatible with previous alpha versions.
+ if ( typeof options !== "object" ) {
+ var opts = null;
+
+ // Map old-style call signature for form submit to the new options object format.
+ if ( typeof toPage === "object" && toPage.url && toPage.type ) {
+ opts = {
+ type: toPage.type,
+ data: toPage.data,
+ forcePageLoad: true
+ };
+ toPage = toPage.url;
+ }
+
+ // The arguments passed into the function need to be re-mapped
+ // to the new options object format.
+ var len = arguments.length;
+ if ( len > 1 ) {
+ var argNames = [ "transition", "reverse", "changeHash", "fromHashChange" ], i;
+ for ( i = 1; i < len; i++ ) {
+ var a = arguments[ i ];
+ if ( typeof a !== "undefined" ) {
+ opts = opts || {};
+ opts[ argNames[ i - 1 ] ] = a;
+ }
+ }
+ }
+
+ // If an options object was created, then we know changePage() was called
+ // with an old signature.
+ if ( opts ) {
+ return $.mobile.changePage( toPage, opts );
+ }
+ }
+ // XXX: REMOVE_BEFORE_SHIPPING_1.0
+
+ // If we are in the midst of a transition, queue the current request.
+ // We'll call changePage() once we're done with the current transition to
+ // service the request.
+ if( isPageTransitioning ) {
+ pageTransitionQueue.unshift( arguments );
+ return;
+ }
+
+ // Set the isPageTransitioning flag to prevent any requests from
+ // entering this method while we are in the midst of loading a page
+ // or transitioning.
+
+ isPageTransitioning = true;
+
+ var settings = $.extend( {}, $.mobile.changePage.defaults, options );
+
+ // Make sure we have a pageContainer to work with.
+ settings.pageContainer = settings.pageContainer || $.mobile.pageContainer;
+
+ // If the caller passed us a url, call loadPage()
+ // to make sure it is loaded into the DOM. We'll listen
+ // to the promise object it returns so we know when
+ // it is done loading or if an error ocurred.
+ if ( typeof toPage == "string" ) {
+ $.mobile.loadPage( toPage, settings )
+ .done(function( url, options, newPage, dupCachedPage ) {
+ isPageTransitioning = false;
+ options.duplicateCachedPage = dupCachedPage;
+ $.mobile.changePage( newPage, options );
+ })
+ .fail(function( url, options ) {
+ // XXX_jblas: Fire off changepagefailed notificaiton.
+ isPageTransitioning = false;
+
+ //clear out the active button state
+ removeActiveLinkClass( true );
+
+ //release transition lock so navigation is free again
+ releasePageTransitionLock();
+ settings.pageContainer.trigger("changepagefailed");
+ });
+ return;
+ }
+
+ // The caller passed us a real page DOM element. Update our
+ // internal state and then trigger a transition to the page.
+ var mpc = settings.pageContainer,
+ fromPage = $.mobile.activePage,
+ url = toPage.jqmData( "url" ),
+ fileUrl = path.getFilePath( url ),
+ active = urlHistory.getActive(),
+ activeIsInitialPage = urlHistory.activeIndex === 0,
+ historyDir = 0,
+ pageTitle = document.title,
+ isDialog = settings.role === "dialog" || toPage.jqmData( "role" ) === "dialog";
+
+ // Let listeners know we're about to change the current page.
+ mpc.trigger( "beforechangepage" );
+
+ // If we are trying to transition to the same page that we are currently on ignore the request.
+ // an illegal same page request is defined by the current page being the same as the url, as long as there's history
+ // and toPage is not an array or object (those are allowed to be "same")
+ //
+ // XXX_jblas: We need to remove this at some point when we allow for transitions
+ // to the same page.
+ if( fromPage && fromPage[0] === toPage[0] ) {
+ isPageTransitioning = false;
+ mpc.trigger( "changepage" );
+ return;
+ }
+
+ // We need to make sure the page we are given has already been enhanced.
+ enhancePage( toPage, settings.role );
+
+ // If the changePage request was sent from a hashChange event, check to see if the
+ // page is already within the urlHistory stack. If so, we'll assume the user hit
+ // the forward/back button and will try to match the transition accordingly.
+ if( settings.fromHashChange ) {
+ urlHistory.directHashChange({
+ currentUrl: url,
+ isBack: function() { historyDir = -1; },
+ isForward: function() { historyDir = 1; }
+ });
+ }
+
+ // Kill the keyboard.
+ // XXX_jblas: We need to stop crawling the entire document to kill focus. Instead,
+ // we should be tracking focus with a live() handler so we already have
+ // the element in hand at this point.
+ $( document.activeElement || "" ).add( "input:focus, textarea:focus, select:focus" ).blur();
+
+ // If we're displaying the page as a dialog, we don't want the url
+ // for the dialog content to be used in the hash. Instead, we want
+ // to append the dialogHashKey to the url of the current page.
+ if ( isDialog && active ) {
+ url = active.url + dialogHashKey;
+ }
+
+ // Set the location hash.
+ if( settings.changeHash !== false && url ) {
+ //disable hash listening temporarily
+ urlHistory.ignoreNextHashChange = true;
+ //update hash and history
+ path.set( url );
+ }
+
+ //if title element wasn't found, try the page div data attr too
+ var newPageTitle = toPage.jqmData( "title" ) || toPage.children(":jqmData(role='header')").find(".ui-title" ).text();
+ if( !!newPageTitle && pageTitle == document.title ) {
+ pageTitle = newPageTitle;
+ }
+
+ //add page to history stack if it's not back or forward
+ if( !historyDir ) {
+ urlHistory.addNew( url, settings.transition, pageTitle, toPage );
+ }
+
+ //set page title
+ document.title = urlHistory.getActive().title;
+
+ //set "toPage" as activePage
+ $.mobile.activePage = toPage;
+
+ // Make sure we have a transition defined.
+ settings.transition = settings.transition
+ || ( ( historyDir && !activeIsInitialPage ) ? active.transition : undefined )
+ || ( settings.role === "dialog" ? $.mobile.defaultDialogTransition : $.mobile.defaultPageTransition );
+
+ // If we're navigating back in the URL history, set reverse accordingly.
+ settings.reverse = settings.reverse || historyDir < 0;
+
+ transitionPages( toPage, fromPage, settings.transition, settings.reverse )
+ .done(function() {
+ removeActiveLinkClass();
+
+ //if there's a duplicateCachedPage, remove it from the DOM now that it's hidden
+ if ( settings.duplicateCachedPage ) {
+ settings.duplicateCachedPage.remove();
+ }
+
+ //remove initial build class (only present on first pageshow)
+ $html.removeClass( "ui-mobile-rendering" );
+
+ releasePageTransitionLock();
+
+ // Let listeners know we're all done changing the current page.
+ mpc.trigger( "changepage" );
+ });
+ };
+
+ $.mobile.changePage.defaults = {
+ transition: undefined,
+ reverse: false,
+ changeHash: true,
+ fromHashChange: false,
+ role: undefined, // By default we rely on the role defined by the @data-role attribute.
+ duplicateCachedPage: undefined,
+ pageContainer: undefined
+ };
+
+/* Event Bindings - hashchange, submit, and click */
+
+ //bind to form submit events, handle with Ajax
+ $( "form" ).live('submit', function( event ) {
+ var $this = $( this );
+ if( !$.mobile.ajaxEnabled ||
+ $this.is( ":jqmData(ajax='false')" ) ) {
+ return;
+ }
+
+ var type = $this.attr( "method" ),
+ url = path.makeUrlAbsolute( $this.attr( "action" ), getClosestBaseUrl($this) ),
+ target = $this.attr( "target" );
+
+ //external submits use regular HTTP
+ if( path.isExternal( url ) || target ) {
+ return;
+ }
+
+ $.mobile.changePage(
+ url,
+ {
+ type: type.length && type.toLowerCase() || "get",
+ data: $this.serialize(),
+ transition: $this.jqmData( "transition" ),
+ direction: $this.jqmData( "direction" ),
+ reloadPage: true
+ }
+ );
+ event.preventDefault();
+ });
+
+ function findClosestLink( ele )
+ {
+ while ( ele ) {
+ if ( ele.nodeName.toLowerCase() == "a" ) {
+ break;
+ }
+ ele = ele.parentNode;
+ }
+ return ele;
+ }
+
+ // The base URL for any given element depends on the page it resides in.
+ function getClosestBaseUrl( ele )
+ {
+ // Find the closest page and extract out its url.
+ var url = $( ele ).closest( ".ui-page" ).jqmData( "url" ),
+ base = documentBase.hrefNoHash;
+
+ if ( !url || !path.isPath( url ) ) {
+ url = base;
+ }
+
+ return path.makeUrlAbsolute( url, base);
+ }
+
+ //add active state on vclick
+ $( document ).bind( "vclick", function( event ) {
+ var link = findClosestLink( event.target );
+ if ( link ) {
+ if ( path.parseUrl( link.getAttribute( "href" ) || "#" ).hash !== "#" ) {
+ $( link ).closest( ".ui-btn" ).not( ".ui-disabled" ).addClass( $.mobile.activeBtnClass );
+ $( "." + $.mobile.activePageClass + " .ui-btn" ).not( link ).blur();
+ }
+ }
+ });
+
+ // click routing - direct to HTTP or Ajax, accordingly
+ // TODO: most of the time, vclick will be all we need for fastClick bulletproofing.
+ // However, it seems that in Android 2.1, a click event
+ // will occasionally arrive independently of the bound vclick
+ // binding to click as well seems to help in this edge case
+ // we'll dig into this further in the next release cycle
+ $( document ).bind( $.mobile.useFastClick ? "vclick click" : "click", function( event ) {
+ var link = findClosestLink( event.target );
+ if ( !link ) {
+ return;
+ }
+
+ var $link = $( link ),
+ //remove active link class if external (then it won't be there if you come back)
+ httpCleanup = function(){
+ window.setTimeout( function() { removeActiveLinkClass( true ); }, 200 );
+ };
+
+ //if there's a data-rel=back attr, go back in history
+ if( $link.is( ":jqmData(rel='back')" ) ) {
+ window.history.back();
+ return false;
+ }
+
+ //if ajax is disabled, exit early
+ if( !$.mobile.ajaxEnabled ){
+ httpCleanup();
+ //use default click handling
+ return;
+ }
+
+ var baseUrl = getClosestBaseUrl( $link ),
+
+ //get href, if defined, otherwise default to empty hash
+ href = path.makeUrlAbsolute( $link.attr( "href" ) || "#", baseUrl );
+
+ // XXX_jblas: Ideally links to application pages should be specified as
+ // an url to the application document with a hash that is either
+ // the site relative path or id to the page. But some of the
+ // internal code that dynamically generates sub-pages for nested
+ // lists and select dialogs, just write a hash in the link they
+ // create. This means the actual URL path is based on whatever
+ // the current value of the base tag is at the time this code
+ // is called. For now we are just assuming that any url with a
+ // hash in it is an application page reference.
+ if ( href.search( "#" ) != -1 ) {
+ href = href.replace( /[^#]*#/, "" );
+ if ( !href ) {
+ //link was an empty hash meant purely
+ //for interaction, so we ignore it.
+ event.preventDefault();
+ return;
+ } else if ( path.isPath( href ) ) {
+ //we have apath so make it the href we want to load.
+ href = path.makeUrlAbsolute( href, baseUrl );
+ } else {
+ //we have a simple id so use the documentUrl as its base.
+ href = path.makeUrlAbsolute( "#" + href, documentUrl.hrefNoHash );
+ }
+ }
+
+ // Should we handle this link, or let the browser deal with it?
+ var useDefaultUrlHandling = $link.is( "[rel='external']" ) || $link.is( ":jqmData(ajax='false')" ) || $link.is( "[target]" ),
+
+ // Some embedded browsers, like the web view in Phone Gap, allow cross-domain XHR
+ // requests if the document doing the request was loaded via the file:// protocol.
+ // This is usually to allow the application to "phone home" and fetch app specific
+ // data. We normally let the browser handle external/cross-domain urls, but if the
+ // allowCrossDomainPages option is true, we will allow cross-domain http/https
+ // requests to go through our page loading logic.
+ isCrossDomainPageLoad = ( $.mobile.allowCrossDomainPages && documentUrl.protocol === "file:" && href.search( /^https?:/ ) != -1 ),
+
+ //check for protocol or rel and its not an embedded page
+ //TODO overlap in logic from isExternal, rel=external check should be
+ // moved into more comprehensive isExternalLink
+ isExternal = useDefaultUrlHandling || ( path.isExternal( href ) && !isCrossDomainPageLoad );
+
+ $activeClickedLink = $link.closest( ".ui-btn" );
+
+ if( isExternal ) {
+ httpCleanup();
+ //use default click handling
+ return;
+ }
+
+ //use ajax
+ var transition = $link.jqmData( "transition" ),
+ direction = $link.jqmData( "direction" ),
+ reverse = ( direction && direction === "reverse" ) ||
+ // deprecated - remove by 1.0
+ $link.jqmData( "back" ),
+
+ //this may need to be more specific as we use data-rel more
+ role = $link.attr( "data-" + $.mobile.ns + "rel" ) || undefined;
+
+ $.mobile.changePage( href, { transition: transition, reverse: reverse, role: role } );
+ event.preventDefault();
+ });
+
+ //hashchange event handler
+ $window.bind( "hashchange", function( e, triggered ) {
+ //find first page via hash
+ var to = path.stripHash( location.hash ),
+ //transition is false if it's the first page, undefined otherwise (and may be overridden by default)
+ transition = $.mobile.urlHistory.stack.length === 0 ? "none" : undefined;
+
+ //if listening is disabled (either globally or temporarily), or it's a dialog hash
+ if( !$.mobile.hashListeningEnabled || urlHistory.ignoreNextHashChange ) {
+ urlHistory.ignoreNextHashChange = false;
+ return;
+ }
+
+ // special case for dialogs
+ if( urlHistory.stack.length > 1 &&
+ to.indexOf( dialogHashKey ) > -1 ) {
+
+ // If current active page is not a dialog skip the dialog and continue
+ // in the same direction
+ if(!$.mobile.activePage.is( ".ui-dialog" )) {
+ //determine if we're heading forward or backward and continue accordingly past
+ //the current dialog
+ urlHistory.directHashChange({
+ currentUrl: to,
+ isBack: function() { window.history.back(); },
+ isForward: function() { window.history.forward(); }
+ });
+
+ // prevent changepage
+ return;
+ } else {
+ var setTo = function() { to = $.mobile.urlHistory.getActive().page; };
+ // if the current active page is a dialog and we're navigating
+ // to a dialog use the dialog objected saved in the stack
+ urlHistory.directHashChange({ currentUrl: to, isBack: setTo, isForward: setTo });
+ }
+ }
+
+ //if to is defined, load it
+ if ( to ) {
+ to = ( typeof to === "string" && !path.isPath( to ) ) ? ( '#' + to ) : to;
+ $.mobile.changePage( to, { transition: transition, changeHash: false, fromHashChange: true } );
+ }
+ //there's no hash, go to the first page in the dom
+ else {
+ $.mobile.changePage( $.mobile.firstPage, { transition: transition, changeHash: false, fromHashChange: true } );
+ }
+ });
+
+ //set page min-heights to be device specific
+ $( document ).bind( "pageshow", resetActivePageHeight );
+ $( window ).bind( "throttledresize", resetActivePageHeight );
+
+})( jQuery );
+/*!
+ * jQuery Mobile v@VERSION
+ * http://jquerymobile.com/
+ *
+ * Copyright 2010, jQuery Project
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ */
+
+( function( $, window, undefined ) {
+
+function css3TransitionHandler( name, reverse, $to, $from )
+{
+ var deferred = new $.Deferred(),
+ reverseClass = reverse ? " reverse" : "",
+ viewportClass = "ui-mobile-viewport-transitioning viewport-" + name,
+ doneFunc = function() {
+ $to.add( $from ).removeClass( "out in reverse " + name );
+ if ( $from ) {
+ $from.removeClass( $.mobile.activePageClass );
+ }
+ $to.parent().removeClass( viewportClass );
+
+ deferred.resolve( name, reverse, $to, $from );
+ };
+
+ $to.animationComplete( doneFunc );
+
+ $to.parent().addClass( viewportClass );
+ if ( $from ) {
+ $from.addClass( name + " out" + reverseClass );
+ }
+ $to.addClass( $.mobile.activePageClass + " " + name + " in" + reverseClass );
+
+ return deferred.promise();
+}
+
+// Make our transition handler public.
+$.mobile.css3TransitionHandler = css3TransitionHandler;
+
+// If the default transition handler is the 'none' handler, replace it with our handler.
+if ( $.mobile.defaultTransitionHandler === $.mobile.noneTransitionHandler ) {
+ $.mobile.defaultTransitionHandler = css3TransitionHandler;
+}
+
+})( jQuery, this );
+/*
+* jQuery Mobile Framework : "fixHeaderFooter" plugin - on-demand positioning for headers,footers
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT or GPL Version 2 licenses.
+* http://jquery.org/license
+*/
+(function($, undefined ) {
+$.fn.fixHeaderFooter = function(options){
+ if( !$.support.scrollTop ){ return this; }
+
+ return this.each(function(){
+ var $this = $(this);
+
+ if( $this.jqmData('fullscreen') ){ $this.addClass('ui-page-fullscreen'); }
+ $this.find( ".ui-header:jqmData(position='fixed')" ).addClass('ui-header-fixed ui-fixed-inline fade'); //should be slidedown
+ $this.find( ".ui-footer:jqmData(position='fixed')" ).addClass('ui-footer-fixed ui-fixed-inline fade'); //should be slideup
+ });
+};
+
+//single controller for all showing,hiding,toggling
+$.fixedToolbars = (function(){
+ if( !$.support.scrollTop ){ return; }
+ var currentstate = 'inline',
+ autoHideMode = false,
+ showDelay = 100,
+ delayTimer,
+ ignoreTargets = 'a,input,textarea,select,button,label,.ui-header-fixed,.ui-footer-fixed',
+ toolbarSelector = '.ui-header-fixed:first, .ui-footer-fixed:not(.ui-footer-duplicate):last',
+ stickyFooter, //for storing quick references to duplicate footers
+ supportTouch = $.support.touch,
+ touchStartEvent = supportTouch ? "touchstart" : "mousedown",
+ touchStopEvent = supportTouch ? "touchend" : "mouseup",
+ stateBefore = null,
+ scrollTriggered = false,
+ touchToggleEnabled = true;
+
+ function showEventCallback(event)
+ {
+ // An event that affects the dimensions of the visual viewport has
+ // been triggered. If the header and/or footer for the current page are in overlay
+ // mode, we want to hide them, and then fire off a timer to show them at a later
+ // point. Events like a resize can be triggered continuously during a scroll, on
+ // some platforms, so the timer is used to delay the actual positioning until the
+ // flood of events have subsided.
+ //
+ // If we are in autoHideMode, we don't do anything because we know the scroll
+ // callbacks for the plugin will fire off a show when the scrolling has stopped.
+ if (!autoHideMode && currentstate == 'overlay') {
+ if (!delayTimer)
+ $.fixedToolbars.hide(true);
+ $.fixedToolbars.startShowTimer();
+ }
+ }
+
+ $(function() {
+ $(document)
+ .bind( "vmousedown",function(event){
+ if( touchToggleEnabled ) {
+ stateBefore = currentstate;
+ }
+ })
+ .bind( "vclick",function(event){
+ if( touchToggleEnabled ) {
+ if( $(event.target).closest(ignoreTargets).length ){ return; }
+ if( !scrollTriggered ){
+ $.fixedToolbars.toggle(stateBefore);
+ stateBefore = null;
+ }
+ }
+ })
+ .bind('silentscroll', showEventCallback);
+
+/*
+ The below checks first for a $(document).scrollTop() value, and if zero, binds scroll events to $(window) instead. If the scrollTop value is actually zero, both will return zero anyway.
+
+ Works with $(document), not $(window) : Opera Mobile (WinMO phone; kinda broken anyway)
+ Works with $(window), not $(document) : IE 7/8
+ Works with either $(window) or $(document) : Chrome, FF 3.6/4, Android 1.6/2.1, iOS
+ Needs work either way : BB5, Opera Mobile (iOS)
+
+*/
+
+ (( $(document).scrollTop() == 0 ) ? $(window) : $(document))
+ .bind('scrollstart',function(event){
+ scrollTriggered = true;
+ if(stateBefore == null){ stateBefore = currentstate; }
+
+ // We only enter autoHideMode if the headers/footers are in
+ // an overlay state or the show timer was started. If the
+ // show timer is set, clear it so the headers/footers don't
+ // show up until after we're done scrolling.
+ var isOverlayState = stateBefore == 'overlay';
+ autoHideMode = isOverlayState || !!delayTimer;
+ if (autoHideMode){
+ $.fixedToolbars.clearShowTimer();
+ if (isOverlayState) {
+ $.fixedToolbars.hide(true);
+ }
+ }
+ })
+ .bind('scrollstop',function(event){
+ if( $(event.target).closest(ignoreTargets).length ){ return; }
+ scrollTriggered = false;
+ if (autoHideMode) {
+ autoHideMode = false;
+ $.fixedToolbars.startShowTimer();
+ }
+ stateBefore = null;
+ });
+
+ $(window).bind('resize', showEventCallback);
+ });
+
+ //before page is shown, check for duplicate footer
+ $('.ui-page').live('pagebeforeshow', function(event, ui){
+ var page = $(event.target),
+ footer = page.find( ":jqmData(role='footer')" ),
+ id = footer.data('id'),
+ prevPage = ui.prevPage,
+ prevFooter = prevPage && prevPage.find( ":jqmData(role='footer')" ),
+ prevFooterMatches = prevFooter.length && prevFooter.jqmData( "id" ) === id;
+
+ if( id && prevFooterMatches ){
+ stickyFooter = footer;
+ setTop( stickyFooter.removeClass( "fade in out" ).appendTo( $.mobile.pageContainer ) );
+ }
+ });
+
+ //after page is shown, append footer to new page
+ $('.ui-page').live('pageshow', function(event, ui){
+ var $this = $(this);
+
+ if( stickyFooter && stickyFooter.length ){
+
+ setTimeout(function(){
+ setTop( stickyFooter.appendTo( $this ).addClass("fade") );
+ stickyFooter = null;
+ }, 500);
+ }
+
+ $.fixedToolbars.show(true, this);
+ });
+
+ //When a collapsiable is hidden or shown we need to trigger the fixed toolbar to reposition itself (#1635)
+ $( ".ui-collapsible-contain" ).live( "collapse expand", showEventCallback );
+
+ // element.getBoundingClientRect() is broken in iOS 3.2.1 on the iPad. The
+ // coordinates inside of the rect it returns don't have the page scroll position
+ // factored out of it like the other platforms do. To get around this,
+ // we'll just calculate the top offset the old fashioned way until core has
+ // a chance to figure out how to handle this situation.
+ //
+ // TODO: We'll need to get rid of getOffsetTop() once a fix gets folded into core.
+
+ function getOffsetTop(ele)
+ {
+ var top = 0;
+ if (ele)
+ {
+ var op = ele.offsetParent, body = document.body;
+ top = ele.offsetTop;
+ while (ele && ele != body)
+ {
+ top += ele.scrollTop || 0;
+ if (ele == op)
+ {
+ top += op.offsetTop;
+ op = ele.offsetParent;
+ }
+ ele = ele.parentNode;
+ }
+ }
+ return top;
+ }
+
+ function setTop(el){
+ var fromTop = $(window).scrollTop(),
+ thisTop = getOffsetTop(el[0]), // el.offset().top returns the wrong value on iPad iOS 3.2.1, call our workaround instead.
+ thisCSStop = el.css('top') == 'auto' ? 0 : parseFloat(el.css('top')),
+ screenHeight = window.innerHeight,
+ thisHeight = el.outerHeight(),
+ useRelative = el.parents('.ui-page:not(.ui-page-fullscreen)').length,
+ relval;
+ if( el.is('.ui-header-fixed') ){
+ relval = fromTop - thisTop + thisCSStop;
+ if( relval < thisTop){ relval = 0; }
+ return el.css('top', ( useRelative ) ? relval : fromTop);
+ }
+ else{
+ //relval = -1 * (thisTop - (fromTop + screenHeight) + thisCSStop + thisHeight);
+ //if( relval > thisTop ){ relval = 0; }
+ relval = fromTop + screenHeight - thisHeight - (thisTop - thisCSStop);
+ return el.css('top', ( useRelative ) ? relval : fromTop + screenHeight - thisHeight );
+ }
+ }
+
+ //exposed methods
+ return {
+ show: function(immediately, page){
+ $.fixedToolbars.clearShowTimer();
+ currentstate = 'overlay';
+ var $ap = page ? $(page) : ($.mobile.activePage ? $.mobile.activePage : $(".ui-page-active"));
+ return $ap.children( toolbarSelector ).each(function(){
+ var el = $(this),
+ fromTop = $(window).scrollTop(),
+ thisTop = getOffsetTop(el[0]), // el.offset().top returns the wrong value on iPad iOS 3.2.1, call our workaround instead.
+ screenHeight = window.innerHeight,
+ thisHeight = el.outerHeight(),
+ alreadyVisible = (el.is('.ui-header-fixed') && fromTop <= thisTop + thisHeight) || (el.is('.ui-footer-fixed') && thisTop <= fromTop + screenHeight);
+
+ //add state class
+ el.addClass('ui-fixed-overlay').removeClass('ui-fixed-inline');
+
+ if( !alreadyVisible && !immediately ){
+ el.animationComplete(function(){
+ el.removeClass('in');
+ }).addClass('in');
+ }
+ setTop(el);
+ });
+ },
+ hide: function(immediately){
+ currentstate = 'inline';
+ var $ap = $.mobile.activePage ? $.mobile.activePage : $(".ui-page-active");
+ return $ap.children( toolbarSelector ).each(function(){
+ var el = $(this);
+
+ var thisCSStop = el.css('top'); thisCSStop = thisCSStop == 'auto' ? 0 : parseFloat(thisCSStop);
+
+ //add state class
+ el.addClass('ui-fixed-inline').removeClass('ui-fixed-overlay');
+
+ if (thisCSStop < 0 || (el.is('.ui-header-fixed') && thisCSStop != 0))
+ {
+ if(immediately){
+ el.css('top',0);
+ }
+ else{
+ if( el.css('top') !== 'auto' && parseFloat(el.css('top')) !== 0 ){
+ var classes = 'out reverse';
+ el.animationComplete(function(){
+ el.removeClass(classes);
+ el.css('top',0);
+ }).addClass(classes);
+ }
+ }
+ }
+ });
+ },
+ startShowTimer: function(){
+ $.fixedToolbars.clearShowTimer();
+ var args = $.makeArray(arguments);
+ delayTimer = setTimeout(function(){
+ delayTimer = undefined;
+ $.fixedToolbars.show.apply(null, args);
+ }, showDelay);
+ },
+ clearShowTimer: function() {
+ if (delayTimer) {
+ clearTimeout(delayTimer);
+ }
+ delayTimer = undefined;
+ },
+ toggle: function(from){
+ if(from){ currentstate = from; }
+ return (currentstate == 'overlay') ? $.fixedToolbars.hide() : $.fixedToolbars.show();
+ },
+ setTouchToggleEnabled: function(enabled) {
+ touchToggleEnabled = enabled;
+ }
+ };
+})();
+
+})(jQuery);
+/*
+* jQuery Mobile Framework : "checkboxradio" plugin
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT or GPL Version 2 licenses.
+* http://jquery.org/license
+*/
+(function($, undefined ) {
+$.widget( "mobile.checkboxradio", $.mobile.widget, {
+ options: {
+ theme: null
+ },
+ _create: function(){
+ var self = this,
+ input = this.element,
+ //NOTE: Windows Phone could not find the label through a selector
+ //filter works though.
+ label = input.closest("form,fieldset,:jqmData(role='page')").find("label").filter('[for="' + input[0].id + '"]'),
+ inputtype = input.attr( "type" ),
+ checkedicon = "ui-icon-" + inputtype + "-on",
+ uncheckedicon = "ui-icon-" + inputtype + "-off";
+
+ if ( inputtype != "checkbox" && inputtype != "radio" ) { return; }
+
+ //expose for other methods
+ $.extend( this,{
+ label : label,
+ inputtype : inputtype,
+ checkedicon : checkedicon,
+ uncheckedicon : uncheckedicon
+ });
+
+ // If there's no selected theme...
+ if( !this.options.theme ) {
+ this.options.theme = this.element.jqmData( "theme" );
+ }
+
+ label
+ .buttonMarkup({
+ theme: this.options.theme,
+ icon: this.element.parents( ":jqmData(type='horizontal')" ).length ? undefined : uncheckedicon,
+ shadow: false
+ });
+
+ // wrap the input + label in a div
+ input
+ .add( label )
+ .wrapAll( "<div class='ui-" + inputtype +"'></div>" );
+
+ label.bind({
+ vmouseover: function() {
+ if( $(this).parent().is('.ui-disabled') ){ return false; }
+ },
+
+ vclick: function( event ){
+ if ( input.is( ":disabled" ) ){
+ event.preventDefault();
+ return;
+ }
+
+ self._cacheVals();
+
+ input.prop( "checked", inputtype === "radio" && true || !(input.prop("checked")) );
+
+ // input set for common radio buttons will contain all the radio
+ // buttons, but will not for checkboxes. clearing the checked status
+ // of other radios ensures the active button state is applied properly
+ self._getInputSet().not(input).prop('checked', false);
+
+ self._updateAll();
+ return false;
+ }
+
+ });
+
+ input
+ .bind({
+ vmousedown: function(){
+ this._cacheVals();
+ },
+
+ vclick: function(){
+ // adds checked attribute to checked input when keyboard is used
+ if ($(this).is(":checked")) {
+ $(this).prop( "checked", true);
+ self._getInputSet().not($(this)).prop('checked', false);
+ } else {
+ $(this).prop("checked", false);
+ }
+ self._updateAll();
+ },
+
+ focus: function() {
+ label.addClass( "ui-focus" );
+ },
+
+ blur: function() {
+ label.removeClass( "ui-focus" );
+ }
+ });
+
+ this.refresh();
+
+ },
+
+ _cacheVals: function(){
+ this._getInputSet().each(function(){
+ $(this).jqmData("cacheVal", $(this).is(":checked") );
+ });
+ },
+
+ //returns either a set of radios with the same name attribute, or a single checkbox
+ _getInputSet: function(){
+ return this.element.closest( "form,fieldset,:jqmData(role='page')" )
+ .find( "input[name='"+ this.element.attr( "name" ) +"'][type='"+ this.inputtype +"']" );
+ },
+
+ _updateAll: function(){
+ var self = this;
+
+ this._getInputSet().each(function(){
+ if( $(this).is(":checked") || self.inputtype === "checkbox" ){
+ $(this).trigger("change");
+ }
+ })
+ .checkboxradio( "refresh" );
+ },
+
+ refresh: function( ){
+ var input = this.element,
+ label = this.label,
+ icon = label.find( ".ui-icon" );
+
+ // input[0].checked expando doesn't always report the proper value
+ // for checked='checked'
+ if ( $(input[0]).prop('checked') ) {
+ label.addClass( $.mobile.activeBtnClass );
+ icon.addClass( this.checkedicon ).removeClass( this.uncheckedicon );
+
+ } else {
+ label.removeClass( $.mobile.activeBtnClass );
+ icon.removeClass( this.checkedicon ).addClass( this.uncheckedicon );
+ }
+
+ if( input.is( ":disabled" ) ){
+ this.disable();
+ }
+ else {
+ this.enable();
+ }
+ },
+
+ disable: function(){
+ this.element.prop("disabled",true).parent().addClass("ui-disabled");
+ },
+
+ enable: function(){
+ this.element.prop("disabled",false).parent().removeClass("ui-disabled");
+ }
+});
+})( jQuery );
+/*
+* jQuery Mobile Framework : "textinput" plugin for text inputs, textareas
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT or GPL Version 2 licenses.
+* http://jquery.org/license
+*/
+(function($, undefined ) {
+$.widget( "mobile.textinput", $.mobile.widget, {
+ options: {
+ theme: null
+ },
+ _create: function(){
+ var input = this.element,
+ o = this.options,
+ theme = o.theme,
+ themeclass;
+
+ if ( !theme ) {
+ var themedParent = this.element.closest("[class*='ui-bar-'],[class*='ui-body-']"),
+ themeLetter = themedParent.length && /ui-(bar|body)-([a-z])/.exec( themedParent.attr("class") ),
+ theme = themeLetter && themeLetter[2] || "c";
+ }
+
+ themeclass = " ui-body-" + theme;
+
+ $('label[for="'+input.attr('id')+'"]').addClass('ui-input-text');
+
+ input.addClass('ui-input-text ui-body-'+ o.theme);
+
+ var focusedEl = input;
+
+ //"search" input widget
+ if( input.is( "[type='search'],:jqmData(type='search')" ) ){
+ focusedEl = input.wrap('<div class="ui-input-search ui-shadow-inset ui-btn-corner-all ui-btn-shadow ui-icon-searchfield'+ themeclass +'"></div>').parent();
+ var clearbtn = $('<a href="#" class="ui-input-clear" title="clear text">clear text</a>')
+ .tap(function( e ){
+ input.val('').focus();
+ input.trigger('change');
+ clearbtn.addClass('ui-input-clear-hidden');
+ e.preventDefault();
+ })
+ .appendTo(focusedEl)
+ .buttonMarkup({icon: 'delete', iconpos: 'notext', corners:true, shadow:true});
+
+ function toggleClear(){
+ if(input.val() == ''){
+ clearbtn.addClass('ui-input-clear-hidden');
+ }
+ else{
+ clearbtn.removeClass('ui-input-clear-hidden');
+ }
+ }
+
+ toggleClear();
+ input.keyup(toggleClear);
+ input.focus(toggleClear);
+ }
+ else{
+ input.addClass('ui-corner-all ui-shadow-inset' + themeclass);
+ }
+
+ input
+ .focus(function(){
+ focusedEl.addClass('ui-focus');
+ })
+ .blur(function(){
+ focusedEl.removeClass('ui-focus');
+ });
+
+ //autogrow
+ if ( input.is('textarea') ) {
+ var extraLineHeight = 15,
+ keyupTimeoutBuffer = 100,
+ keyup = function() {
+ var scrollHeight = input[0].scrollHeight,
+ clientHeight = input[0].clientHeight;
+ if ( clientHeight < scrollHeight ) {
+ input.css({ height: (scrollHeight + extraLineHeight) });
+ }
+ },
+ keyupTimeout;
+ input.keyup(function() {
+ clearTimeout( keyupTimeout );
+ keyupTimeout = setTimeout( keyup, keyupTimeoutBuffer );
+ });
+ }
+ },
+
+ disable: function(){
+ ( this.element.attr("disabled",true).is( "[type='search'],:jqmData(type='search')" ) ? this.element.parent() : this.element ).addClass("ui-disabled");
+ },
+
+ enable: function(){
+ ( this.element.attr("disabled", false).is( "[type='search'],:jqmData(type='search')" ) ? this.element.parent() : this.element ).removeClass("ui-disabled");
+ }
+});
+})( jQuery );
+/*
+* jQuery Mobile Framework : "selectmenu" plugin
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT or GPL Version 2 licenses.
+* http://jquery.org/license
+*/
+(function($, undefined ) {
+$.widget( "mobile.selectmenu", $.mobile.widget, {
+ options: {
+ theme: null,
+ disabled: false,
+ icon: 'arrow-d',
+ iconpos: 'right',
+ inline: null,
+ corners: true,
+ shadow: true,
+ iconshadow: true,
+ menuPageTheme: 'b',
+ overlayTheme: 'a',
+ hidePlaceholderMenuItems: true,
+ closeText: 'Close',
+ nativeMenu: true
+ },
+ _create: function(){
+
+ var self = this,
+
+ o = this.options,
+
+ select = this.element
+ .wrap( "<div class='ui-select'>" ),
+
+ selectID = select.attr( "id" ),
+
+ label = $( 'label[for="'+ selectID +'"]' ).addClass( "ui-select" ),
+
+ //IE throws an exception at options.item() function when
+ //there is no selected item
+ //select first in this case
+ selectedIndex = select[0].selectedIndex == -1 ? 0 : select[0].selectedIndex,
+
+ button = ( self.options.nativeMenu ? $( "<div/>" ) : $( "<a>", {
+ "href": "#",
+ "role": "button",
+ "id": buttonId,
+ "aria-haspopup": "true",
+ "aria-owns": menuId
+ }) )
+ .text( $( select[0].options.item( selectedIndex ) ).text() )
+ .insertBefore( select )
+ .buttonMarkup({
+ theme: o.theme,
+ icon: o.icon,
+ iconpos: o.iconpos,
+ inline: o.inline,
+ corners: o.corners,
+ shadow: o.shadow,
+ iconshadow: o.iconshadow
+ }),
+
+ //multi select or not
+ isMultiple = self.isMultiple = select[0].multiple;
+
+ //Opera does not properly support opacity on select elements
+ //In Mini, it hides the element, but not its text
+ //On the desktop,it seems to do the opposite
+ //for these reasons, using the nativeMenu option results in a full native select in Opera
+ if( o.nativeMenu && window.opera && window.opera.version ){
+ select.addClass( "ui-select-nativeonly" );
+ }
+
+ //vars for non-native menus
+ if( !o.nativeMenu ){
+ var options = select.find("option"),
+
+ buttonId = selectID + "-button",
+
+ menuId = selectID + "-menu",
+
+ thisPage = select.closest( ".ui-page" ),
+
+ //button theme
+ theme = /ui-btn-up-([a-z])/.exec( button.attr("class") )[1],
+
+ menuPage = $( "<div data-" + $.mobile.ns + "role='dialog' data-" +$.mobile.ns + "theme='"+ o.menuPageTheme +"'>" +
+ "<div data-" + $.mobile.ns + "role='header'>" +
+ "<div class='ui-title'>" + label.text() + "</div>"+
+ "</div>"+
+ "<div data-" + $.mobile.ns + "role='content'></div>"+
+ "</div>" )
+ .appendTo( $.mobile.pageContainer )
+ .page(),
+
+ menuPageContent = menuPage.find( ".ui-content" ),
+
+ menuPageClose = menuPage.find( ".ui-header a" ),
+
+ screen = $( "<div>", {"class": "ui-selectmenu-screen ui-screen-hidden"})
+ .appendTo( thisPage ),
+
+ listbox = $( "<div>", { "class": "ui-selectmenu ui-selectmenu-hidden ui-overlay-shadow ui-corner-all pop ui-body-" + o.overlayTheme } )
+ .insertAfter(screen),
+
+ list = $( "<ul>", {
+ "class": "ui-selectmenu-list",
+ "id": menuId,
+ "role": "listbox",
+ "aria-labelledby": buttonId
+ })
+ .attr( "data-" + $.mobile.ns + "theme", theme )
+ .appendTo( listbox ),
+
+ header = $( "<div>", {
+ "class": "ui-header ui-bar-" + theme
+ })
+ .prependTo( listbox ),
+
+ headerTitle = $( "<h1>", {
+ "class": "ui-title"
+ })
+ .appendTo( header ),
+
+ headerClose = $( "<a>", {
+ "text": o.closeText,
+ "href": "#",
+ "class": "ui-btn-left"
+ })
+ .attr( "data-" + $.mobile.ns + "iconpos", "notext" )
+ .attr( "data-" + $.mobile.ns + "icon", "delete" )
+ .appendTo( header )
+ .buttonMarkup(),
+
+ menuType;
+ } //end non native vars
+
+ // add counter for multi selects
+ if( isMultiple ){
+ self.buttonCount = $('<span>')
+ .addClass( 'ui-li-count ui-btn-up-c ui-btn-corner-all' )
+ .hide()
+ .appendTo( button );
+ }
+
+ //disable if specified
+ if( o.disabled ){ this.disable(); }
+
+ //events on native select
+ select
+ .change(function(){
+ self.refresh();
+ });
+
+ //expose to other methods
+ $.extend(self, {
+ select: select,
+ optionElems: options,
+ selectID: selectID,
+ label: label,
+ buttonId:buttonId,
+ menuId:menuId,
+ thisPage:thisPage,
+ button:button,
+ menuPage:menuPage,
+ menuPageContent:menuPageContent,
+ screen:screen,
+ listbox:listbox,
+ list:list,
+ menuType:menuType,
+ header:header,
+ headerClose:headerClose,
+ headerTitle:headerTitle,
+ placeholder: ''
+ });
+
+ //support for using the native select menu with a custom button
+ if( o.nativeMenu ){
+
+ select
+ .appendTo(button)
+ .bind( "vmousedown", function( e ){
+ //add active class to button
+ button.addClass( $.mobile.activeBtnClass );
+ })
+ .bind( "focus vmouseover", function(){
+ button.trigger( "vmouseover" );
+ })
+ .bind( "vmousemove", function(){
+ //remove active class on scroll/touchmove
+ button.removeClass( $.mobile.activeBtnClass );
+ })
+ .bind( "change blur vmouseout", function(){
+ button
+ .trigger( "vmouseout" )
+ .removeClass( $.mobile.activeBtnClass );
+ });
+
+
+ } else {
+
+ //create list from select, update state
+ self.refresh();
+
+ select
+ .attr( "tabindex", "-1" )
+ .focus(function(){
+ $(this).blur();
+ button.focus();
+ });
+
+ //button events
+ button
+ .bind( "vclick keydown" , function( event ){
+ if( event.type == "vclick" ||
+ event.keyCode && ( event.keyCode === $.mobile.keyCode.ENTER || event.keyCode === $.mobile.keyCode.SPACE ) ){
+ self.open();
+ event.preventDefault();
+ }
+ });
+
+ //events for list items
+ list
+ .attr( "role", "listbox" )
+ .delegate( ".ui-li>a", "focusin", function() {
+ $( this ).attr( "tabindex", "0" );
+ })
+ .delegate( ".ui-li>a", "focusout", function() {
+ $( this ).attr( "tabindex", "-1" );
+ })
+ .delegate("li:not(.ui-disabled, .ui-li-divider)", "vclick", function(event){
+
+ // index of option tag to be selected
+ var oldIndex = select[0].selectedIndex,
+ newIndex = list.find( "li:not(.ui-li-divider)" ).index( this ),
+ option = self.optionElems.eq( newIndex )[0];
+
+ // toggle selected status on the tag for multi selects
+ option.selected = isMultiple ? !option.selected : true;
+
+ // toggle checkbox class for multiple selects
+ if( isMultiple ){
+ $(this)
+ .find('.ui-icon')
+ .toggleClass('ui-icon-checkbox-on', option.selected)
+ .toggleClass('ui-icon-checkbox-off', !option.selected);
+ }
+
+ // trigger change if value changed
+ if( isMultiple || oldIndex !== newIndex ){
+ select.trigger( "change" );
+ }
+
+ //hide custom select for single selects only
+ if( !isMultiple ){
+ self.close();
+ }
+
+ event.preventDefault();
+ })
+ //keyboard events for menu items
+ .keydown(function( e ) {
+ var target = $( e.target ),
+ li = target.closest( "li" );
+
+ // switch logic based on which key was pressed
+ switch ( e.keyCode ) {
+ // up or left arrow keys
+ case 38:
+ var prev = li.prev();
+
+ // if there's a previous option, focus it
+ if ( prev.length ) {
+ target
+ .blur()
+ .attr( "tabindex", "-1" );
+
+ prev.find( "a" ).first().focus();
+ }
+
+ return false;
+ break;
+
+ // down or right arrow keys
+ case 40:
+ var next = li.next();
+
+ // if there's a next option, focus it
+ if ( next.length ) {
+ target
+ .blur()
+ .attr( "tabindex", "-1" );
+
+ next.find( "a" ).first().focus();
+ }
+
+ return false;
+ break;
+
+ // if enter or space is pressed, trigger click
+ case 13:
+ case 32:
+ target.trigger( "vclick" );
+
+ return false;
+ break;
+ }
+ });
+
+ //events on "screen" overlay
+ screen.bind("vclick", function( event ){
+ self.close();
+ });
+
+ //close button on small overlays
+ self.headerClose.click(function(){
+ if( self.menuType == "overlay" ){
+ self.close();
+ return false;
+ }
+ })
+ }
+ },
+
+ _buildList: function(){
+ var self = this,
+ o = this.options,
+ placeholder = this.placeholder,
+ optgroups = [],
+ lis = [],
+ dataIcon = self.isMultiple ? "checkbox-off" : "false";
+
+ self.list.empty().filter('.ui-listview').listview('destroy');
+
+ //populate menu with options from select element
+ self.select.find( "option" ).each(function( i ){
+ var $this = $(this),
+ $parent = $this.parent(),
+ text = $this.text(),
+ anchor = "<a href='#'>"+ text +"</a>",
+ classes = [],
+ extraAttrs = [];
+
+ // are we inside an optgroup?
+ if( $parent.is("optgroup") ){
+ var optLabel = $parent.attr("label");
+
+ // has this optgroup already been built yet?
+ if( $.inArray(optLabel, optgroups) === -1 ){
+ lis.push( "<li data-" + $.mobile.ns + "role='list-divider'>"+ optLabel +"</li>" );
+ optgroups.push( optLabel );
+ }
+ }
+
+ //find placeholder text
+ if( !this.getAttribute('value') || text.length == 0 || $this.jqmData('placeholder') ){
+ if( o.hidePlaceholderMenuItems ){
+ classes.push( "ui-selectmenu-placeholder" );
+ }
+ placeholder = self.placeholder = text;
+ }
+
+ // support disabled option tags
+ if( this.disabled ){
+ classes.push( "ui-disabled" );
+ extraAttrs.push( "aria-disabled='true'" );
+ }
+
+ lis.push( "<li data-" + $.mobile.ns + "icon='"+ dataIcon +"' class='"+ classes.join(" ") + "' " + extraAttrs.join(" ") +">"+ anchor +"</li>" )
+ });
+
+ self.list.html( lis.join(" ") );
+
+ self.list.find( "li" )
+ .attr({ "role": "option", "tabindex": "-1" })
+ .first().attr( "tabindex", "0" );
+
+ // hide header close link for single selects
+ if( !this.isMultiple ){
+ this.headerClose.hide();
+ }
+
+ // hide header if it's not a multiselect and there's no placeholder
+ if( !this.isMultiple && !placeholder.length ){
+ this.header.hide();
+ } else {
+ this.headerTitle.text( this.placeholder );
+ }
+
+ //now populated, create listview
+ self.list.listview();
+ },
+
+ refresh: function( forceRebuild ){
+ var self = this,
+ select = this.element,
+ isMultiple = this.isMultiple,
+ options = this.optionElems = select.find("option"),
+ selected = options.filter(":selected"),
+
+ // return an array of all selected index's
+ indicies = selected.map(function(){
+ return options.index( this );
+ }).get();
+
+ if( !self.options.nativeMenu && ( forceRebuild || select[0].options.length != self.list.find('li').length )){
+ self._buildList();
+ }
+
+ self.button
+ .find( ".ui-btn-text" )
+ .text(function(){
+ if( !isMultiple ){
+ return selected.text();
+ }
+
+ return selected.length ?
+ selected.map(function(){ return $(this).text(); }).get().join(', ') :
+ self.placeholder;
+ });
+
+ // multiple count inside button
+ if( isMultiple ){
+ self.buttonCount[ selected.length > 1 ? 'show' : 'hide' ]().text( selected.length );
+ }
+
+ if( !self.options.nativeMenu ){
+ self.list
+ .find( 'li:not(.ui-li-divider)' )
+ .removeClass( $.mobile.activeBtnClass )
+ .attr( 'aria-selected', false )
+ .each(function( i ){
+ if( $.inArray(i, indicies) > -1 ){
+ var item = $(this).addClass( $.mobile.activeBtnClass );
+
+ // aria selected attr
+ item.find( 'a' ).attr( 'aria-selected', true );
+
+ // multiple selects: add the "on" checkbox state to the icon
+ if( isMultiple ){
+ item.find('.ui-icon').removeClass('ui-icon-checkbox-off').addClass('ui-icon-checkbox-on');
+ }
+ }
+ });
+ }
+ },
+
+ open: function(){
+ if( this.options.disabled || this.options.nativeMenu ){ return; }
+
+ var self = this,
+ menuHeight = self.list.parent().outerHeight(),
+ menuWidth = self.list.parent().outerWidth(),
+ scrollTop = $(window).scrollTop(),
+ btnOffset = self.button.offset().top,
+ screenHeight = window.innerHeight,
+ screenWidth = window.innerWidth;
+
+ //add active class to button
+ self.button.addClass( $.mobile.activeBtnClass );
+
+ //remove after delay
+ setTimeout(function(){
+ self.button.removeClass( $.mobile.activeBtnClass );
+ }, 300);
+
+ function focusMenuItem(){
+ self.list.find( ".ui-btn-active" ).focus();
+ }
+
+ if( menuHeight > screenHeight - 80 || !$.support.scrollTop ){
+
+ //for webos (set lastscroll using button offset)
+ if( scrollTop == 0 && btnOffset > screenHeight ){
+ self.thisPage.one('pagehide',function(){
+ $(this).jqmData('lastScroll', btnOffset);
+ });
+ }
+
+ self.menuPage.one('pageshow', function() {
+ // silentScroll() is called whenever a page is shown to restore
+ // any previous scroll position the page may have had. We need to
+ // wait for the "silentscroll" event before setting focus to avoid
+ // the browser's "feature" which offsets rendering to make sure
+ // whatever has focus is in view.
+ $(window).one("silentscroll", function(){ focusMenuItem(); });
+ });
+
+ self.menuType = "page";
+ self.menuPageContent.append( self.list );
+ $.mobile.changePage( self.menuPage, { transition: 'pop' } );
+ }
+ else {
+ self.menuType = "overlay";
+
+ self.screen
+ .height( $(document).height() )
+ .removeClass('ui-screen-hidden');
+
+ //try and center the overlay over the button
+ var roomtop = btnOffset - scrollTop,
+ roombot = scrollTop + screenHeight - btnOffset,
+ halfheight = menuHeight / 2,
+ maxwidth = parseFloat(self.list.parent().css('max-width')),
+ newtop, newleft;
+
+ if( roomtop > menuHeight / 2 && roombot > menuHeight / 2 ){
+ newtop = btnOffset + ( self.button.outerHeight() / 2 ) - halfheight;
+ }
+ else{
+ //30px tolerance off the edges
+ newtop = roomtop > roombot ? scrollTop + screenHeight - menuHeight - 30 : scrollTop + 30;
+ }
+
+ // if the menuwidth is smaller than the screen center is
+ if (menuWidth < maxwidth) {
+ newleft = (screenWidth - menuWidth) / 2;
+ } else { //otherwise insure a >= 30px offset from the left
+ newleft = self.button.offset().left + self.button.outerWidth() / 2 - menuWidth / 2;
+ // 30px tolerance off the edges
+ if (newleft < 30) {
+ newleft = 30;
+ } else if ((newleft + menuWidth) > screenWidth) {
+ newleft = screenWidth - menuWidth - 30;
+ }
+ }
+
+ self.listbox
+ .append( self.list )
+ .removeClass( "ui-selectmenu-hidden" )
+ .css({
+ top: newtop,
+ left: newleft
+ })
+ .addClass("in");
+
+ focusMenuItem();
+ }
+
+ // wait before the dialog can be closed
+ setTimeout(function(){
+ self.isOpen = true;
+ }, 400);
+ },
+
+ close: function(){
+ if( this.options.disabled || !this.isOpen || this.options.nativeMenu ){ return; }
+ var self = this;
+
+ function focusButton(){
+ setTimeout(function(){
+ self.button.focus();
+ }, 40);
+
+ self.listbox.removeAttr('style').append( self.list );
+ }
+
+ if(self.menuType == "page"){
+ // button refocus ensures proper height calculation
+ // by removing the inline style and ensuring page inclusion
+ self.menuPage.one("pagehide", focusButton);
+
+ // doesn't solve the possible issue with calling change page
+ // where the objects don't define data urls which prevents dialog key
+ // stripping - changePage has incoming refactor
+ window.history.back();
+ }
+ else{
+ self.screen.addClass( "ui-screen-hidden" );
+ self.listbox.addClass( "ui-selectmenu-hidden" ).removeAttr( "style" ).removeClass("in");
+ focusButton();
+ }
+
+ // allow the dialog to be closed again
+ this.isOpen = false;
+ },
+
+ disable: function(){
+ this.element.attr("disabled",true);
+ this.button.addClass('ui-disabled').attr("aria-disabled", true);
+ return this._setOption( "disabled", true );
+ },
+
+ enable: function(){
+ this.element.attr("disabled",false);
+ this.button.removeClass('ui-disabled').attr("aria-disabled", false);
+ return this._setOption( "disabled", false );
+ }
+});
+})( jQuery );
+
+/*
+* jQuery Mobile Framework : plugin for making button-like links
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT or GPL Version 2 licenses.
+* http://jquery.org/license
+*/
+( function( $, undefined ) {
+
+$.fn.buttonMarkup = function( options ) {
+ return this.each( function() {
+ var el = $( this ),
+ o = $.extend( {}, $.fn.buttonMarkup.defaults, el.jqmData(), options ),
+
+ // Classes Defined
+ buttonClass,
+ innerClass = "ui-btn-inner",
+ iconClass;
+
+ if ( attachEvents ) {
+ attachEvents();
+ }
+
+ // if not, try to find closest theme container
+ if ( !o.theme ) {
+ var themedParent = el.closest( "[class*='ui-bar-'],[class*='ui-body-']" );
+ o.theme = themedParent.length ?
+ /ui-(bar|body)-([a-z])/.exec( themedParent.attr( "class" ) )[2] :
+ "c";
+ }
+
+ buttonClass = "ui-btn ui-btn-up-" + o.theme;
+
+ if ( o.inline ) {
+ buttonClass += " ui-btn-inline";
+ }
+
+ if ( o.icon ) {
+ o.icon = "ui-icon-" + o.icon;
+ o.iconpos = o.iconpos || "left";
+
+ iconClass = "ui-icon " + o.icon;
+
+ if ( o.shadow ) {
+ iconClass += " ui-icon-shadow";
+ }
+ }
+
+ if ( o.iconpos ) {
+ buttonClass += " ui-btn-icon-" + o.iconpos;
+
+ if ( o.iconpos == "notext" && !el.attr( "title" ) ) {
+ el.attr( "title", el.text() );
+ }
+ }
+
+ if ( o.corners ) {
+ buttonClass += " ui-btn-corner-all";
+ innerClass += " ui-btn-corner-all";
+ }
+
+ if ( o.shadow ) {
+ buttonClass += " ui-shadow";
+ }
+
+ el
+ .attr( "data-" + $.mobile.ns + "theme", o.theme )
+ .addClass( buttonClass );
+
+ var wrap = ( "<D class='" + innerClass + "'><D class='ui-btn-text'></D>" +
+ ( o.icon ? "<span class='" + iconClass + "'></span>" : "" ) +
+ "</D>" ).replace( /D/g, o.wrapperEls );
+
+ el.wrapInner( wrap );
+ });
+};
+
+$.fn.buttonMarkup.defaults = {
+ corners: true,
+ shadow: true,
+ iconshadow: true,
+ wrapperEls: "span"
+};
+
+function closestEnabledButton( element )
+{
+ while ( element ) {
+ var $ele = $( element );
+ if ( $ele.hasClass( "ui-btn" ) && !$ele.hasClass( "ui-disabled" ) ) {
+ break;
+ }
+ element = element.parentNode;
+ }
+ return element;
+}
+
+var attachEvents = function() {
+ $( document ).bind( {
+ "vmousedown": function( event ) {
+ var btn = closestEnabledButton( event.target );
+ if ( btn ) {
+ var $btn = $( btn ),
+ theme = $btn.attr( "data-" + $.mobile.ns + "theme" );
+ $btn.removeClass( "ui-btn-up-" + theme ).addClass( "ui-btn-down-" + theme );
+ }
+ },
+ "vmousecancel vmouseup": function( event ) {
+ var btn = closestEnabledButton( event.target );
+ if ( btn ) {
+ var $btn = $( btn ),
+ theme = $btn.attr( "data-" + $.mobile.ns + "theme" );
+ $btn.removeClass( "ui-btn-down-" + theme ).addClass( "ui-btn-up-" + theme );
+ }
+ },
+ "vmouseover focus": function( event ) {
+ var btn = closestEnabledButton( event.target );
+ if ( btn ) {
+ var $btn = $( btn ),
+ theme = $btn.attr( "data-" + $.mobile.ns + "theme" );
+ $btn.removeClass( "ui-btn-up-" + theme ).addClass( "ui-btn-hover-" + theme );
+ }
+ },
+ "vmouseout blur": function( event ) {
+ var btn = closestEnabledButton( event.target );
+ if ( btn ) {
+ var $btn = $( btn ),
+ theme = $btn.attr( "data-" + $.mobile.ns + "theme" );
+ $btn.removeClass( "ui-btn-hover-" + theme ).addClass( "ui-btn-up-" + theme );
+ }
+ }
+ });
+
+ attachEvents = null;
+};
+
+})( jQuery );
+/*
+* jQuery Mobile Framework : "button" plugin - links that proxy to native input/buttons
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT or GPL Version 2 licenses.
+* http://jquery.org/license
+*/
+(function($, undefined ) {
+$.widget( "mobile.button", $.mobile.widget, {
+ options: {
+ theme: null,
+ icon: null,
+ iconpos: null,
+ inline: null,
+ corners: true,
+ shadow: true,
+ iconshadow: true
+ },
+ _create: function(){
+ var $el = this.element,
+ o = this.options;
+
+ //add ARIA role
+ this.button = $( "<div></div>" )
+ .text( $el.text() || $el.val() )
+ .buttonMarkup({
+ theme: o.theme,
+ icon: o.icon,
+ iconpos: o.iconpos,
+ inline: o.inline,
+ corners: o.corners,
+ shadow: o.shadow,
+ iconshadow: o.iconshadow
+ })
+ .insertBefore( $el )
+ .append( $el.addClass('ui-btn-hidden') );
+
+ //add hidden input during submit
+ var type = $el.attr('type');
+ if( type !== 'button' && type !== 'reset' ){
+ $el.bind("vclick", function(){
+ var $buttonPlaceholder = $("<input>",
+ {type: "hidden", name: $el.attr("name"), value: $el.attr("value")})
+ .insertBefore($el);
+
+ //bind to doc to remove after submit handling
+ $(document).submit(function(){
+ $buttonPlaceholder.remove();
+ });
+ });
+ }
+ this.refresh();
+
+ },
+
+ enable: function(){
+ this.element.attr("disabled", false);
+ this.button.removeClass("ui-disabled").attr("aria-disabled", false);
+ return this._setOption("disabled", false);
+ },
+
+ disable: function(){
+ this.element.attr("disabled", true);
+ this.button.addClass("ui-disabled").attr("aria-disabled", true);
+ return this._setOption("disabled", true);
+ },
+
+ refresh: function(){
+ if( this.element.attr('disabled') ){
+ this.disable();
+ }
+ else{
+ this.enable();
+ }
+ }
+});
+})( jQuery );/*
+* jQuery Mobile Framework : "slider" plugin
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT or GPL Version 2 licenses.
+* http://jquery.org/license
+*/
+(function($, undefined ) {
+$.widget( "mobile.slider", $.mobile.widget, {
+ options: {
+ theme: null,
+ trackTheme: null,
+ disabled: false
+ },
+ _create: function(){
+ var self = this,
+
+ control = this.element,
+
+ parentTheme = control.parents('[class*=ui-bar-],[class*=ui-body-]').eq(0),
+
+ parentTheme = parentTheme.length ? parentTheme.attr('class').match(/ui-(bar|body)-([a-z])/)[2] : 'c',
+
+ theme = this.options.theme ? this.options.theme : parentTheme,
+
+ trackTheme = this.options.trackTheme ? this.options.trackTheme : parentTheme,
+
+ cType = control[0].nodeName.toLowerCase(),
+ selectClass = (cType == 'select') ? 'ui-slider-switch' : '',
+ controlID = control.attr('id'),
+ labelID = controlID + '-label',
+ label = $('[for="'+ controlID +'"]').attr('id',labelID),
+ val = function(){
+ return (cType == 'input') ? parseFloat(control.val()) : control[0].selectedIndex;
+ },
+ min = (cType == 'input') ? parseFloat(control.attr('min')) : 0,
+ max = (cType == 'input') ? parseFloat(control.attr('max')) : control.find('option').length-1,
+ step = window.parseFloat(control.attr('step') || 1),
+ slider = $('<div class="ui-slider '+ selectClass +' ui-btn-down-'+ trackTheme+' ui-btn-corner-all" role="application"></div>'),
+ handle = $('<a href="#" class="ui-slider-handle"></a>')
+ .appendTo(slider)
+ .buttonMarkup({corners: true, theme: theme, shadow: true})
+ .attr({
+ 'role': 'slider',
+ 'aria-valuemin': min,
+ 'aria-valuemax': max,
+ 'aria-valuenow': val(),
+ 'aria-valuetext': val(),
+ 'title': val(),
+ 'aria-labelledby': labelID
+ });
+
+ $.extend(this, {
+ slider: slider,
+ handle: handle,
+ dragging: false,
+ beforeStart: null
+ });
+
+ if(cType == 'select'){
+ slider.wrapInner('<div class="ui-slider-inneroffset"></div>');
+ var options = control.find('option');
+
+ control.find('option').each(function(i){
+ var side = (i==0) ?'b':'a',
+ corners = (i==0) ? 'right' :'left',
+ theme = (i==0) ? ' ui-btn-down-' + trackTheme :' ui-btn-active';
+ $('<div class="ui-slider-labelbg ui-slider-labelbg-'+ side + theme +' ui-btn-corner-'+ corners+'"></div>').prependTo(slider);
+ $('<span class="ui-slider-label ui-slider-label-'+ side + theme +' ui-btn-corner-'+ corners+'" role="img">'+$(this).text()+'</span>').prependTo(handle);
+ });
+
+ }
+
+ label.addClass('ui-slider');
+
+ // monitor the input for updated values
+ control
+ .addClass((cType == 'input') ? 'ui-slider-input' : 'ui-slider-switch')
+ .change(function(){
+ self.refresh( val(), true );
+ })
+ .keyup(function(){ // necessary?
+ self.refresh( val(), true, true );
+ })
+ .blur(function(){
+ self.refresh( val(), true );
+ });
+
+ // prevent screen drag when slider activated
+ $(document).bind( "vmousemove", function(event){
+ if ( self.dragging ) {
+ self.refresh( event );
+ return false;
+ }
+ });
+
+ slider
+ .bind( "vmousedown", function(event){
+ self.dragging = true;
+ if ( cType === "select" ) {
+ self.beforeStart = control[0].selectedIndex;
+ }
+ self.refresh( event );
+ return false;
+ });
+
+ slider
+ .add(document)
+ .bind( "vmouseup", function(){
+ if ( self.dragging ) {
+ self.dragging = false;
+ if ( cType === "select" ) {
+ if ( self.beforeStart === control[0].selectedIndex ) {
+ //tap occurred, but value didn't change. flip it!
+ self.refresh( self.beforeStart === 0 ? 1 : 0 );
+ }
+ var curval = val();
+ var snapped = Math.round( curval / (max - min) * 100 );
+ handle
+ .addClass("ui-slider-handle-snapping")
+ .css("left", snapped + "%")
+ .animationComplete(function(){
+ handle.removeClass("ui-slider-handle-snapping");
+ });
+ }
+ return false;
+ }
+ });
+
+ slider.insertAfter(control);
+
+ // NOTE force focus on handle
+ this.handle
+ .bind( "vmousedown", function(){
+ $(this).focus();
+ })
+ .bind( "vclick", false );
+
+ this.handle
+ .bind( "keydown", function( event ) {
+ var index = val();
+
+ if ( self.options.disabled ) {
+ return;
+ }
+
+ // In all cases prevent the default and mark the handle as active
+ switch ( event.keyCode ) {
+ case $.mobile.keyCode.HOME:
+ case $.mobile.keyCode.END:
+ case $.mobile.keyCode.PAGE_UP:
+ case $.mobile.keyCode.PAGE_DOWN:
+ case $.mobile.keyCode.UP:
+ case $.mobile.keyCode.RIGHT:
+ case $.mobile.keyCode.DOWN:
+ case $.mobile.keyCode.LEFT:
+ event.preventDefault();
+
+ if ( !self._keySliding ) {
+ self._keySliding = true;
+ $( this ).addClass( "ui-state-active" );
+ }
+ break;
+ }
+
+ // move the slider according to the keypress
+ switch ( event.keyCode ) {
+ case $.mobile.keyCode.HOME:
+ self.refresh(min);
+ break;
+ case $.mobile.keyCode.END:
+ self.refresh(max);
+ break;
+ case $.mobile.keyCode.PAGE_UP:
+ case $.mobile.keyCode.UP:
+ case $.mobile.keyCode.RIGHT:
+ self.refresh(index + step);
+ break;
+ case $.mobile.keyCode.PAGE_DOWN:
+ case $.mobile.keyCode.DOWN:
+ case $.mobile.keyCode.LEFT:
+ self.refresh(index - step);
+ break;
+ }
+ }) // remove active mark
+ .keyup(function( event ) {
+ if ( self._keySliding ) {
+ self._keySliding = false;
+ $( this ).removeClass( "ui-state-active" );
+ }
+ });
+
+ this.refresh();
+ },
+
+ refresh: function(val, isfromControl, preventInputUpdate){
+ if ( this.options.disabled ) { return; }
+
+ var control = this.element, percent,
+ cType = control[0].nodeName.toLowerCase(),
+ min = (cType === "input") ? parseFloat(control.attr("min")) : 0,
+ max = (cType === "input") ? parseFloat(control.attr("max")) : control.find("option").length - 1;
+
+ if ( typeof val === "object" ) {
+ var data = val,
+ // a slight tolerance helped get to the ends of the slider
+ tol = 8;
+ if ( !this.dragging
+ || data.pageX < this.slider.offset().left - tol
+ || data.pageX > this.slider.offset().left + this.slider.width() + tol ) {
+ return;
+ }
+ percent = Math.round( ((data.pageX - this.slider.offset().left) / this.slider.width() ) * 100 );
+ } else {
+ if ( val == null ) {
+ val = (cType === "input") ? parseFloat(control.val()) : control[0].selectedIndex;
+ }
+ percent = (parseFloat(val) - min) / (max - min) * 100;
+ }
+
+ if ( isNaN(percent) ) { return; }
+ if ( percent < 0 ) { percent = 0; }
+ if ( percent > 100 ) { percent = 100; }
+
+ var newval = Math.round( (percent / 100) * (max - min) ) + min;
+ if ( newval < min ) { newval = min; }
+ if ( newval > max ) { newval = max; }
+
+ //flip the stack of the bg colors
+ if ( percent > 60 && cType === "select" ) {
+
+ }
+ this.handle.css("left", percent + "%");
+ this.handle.attr({
+ "aria-valuenow": (cType === "input") ? newval : control.find("option").eq(newval).attr("value"),
+ "aria-valuetext": (cType === "input") ? newval : control.find("option").eq(newval).text(),
+ title: newval
+ });
+
+ // add/remove classes for flip toggle switch
+ if ( cType === "select" ) {
+ if ( newval === 0 ) {
+ this.slider.addClass("ui-slider-switch-a")
+ .removeClass("ui-slider-switch-b");
+ } else {
+ this.slider.addClass("ui-slider-switch-b")
+ .removeClass("ui-slider-switch-a");
+ }
+ }
+
+ if(!preventInputUpdate){
+ // update control's value
+ if ( cType === "input" ) {
+ control.val(newval);
+ } else {
+ control[ 0 ].selectedIndex = newval;
+ }
+ if (!isfromControl) { control.trigger("change"); }
+ }
+ },
+
+ enable: function(){
+ this.element.attr("disabled", false);
+ this.slider.removeClass("ui-disabled").attr("aria-disabled", false);
+ return this._setOption("disabled", false);
+ },
+
+ disable: function(){
+ this.element.attr("disabled", true);
+ this.slider.addClass("ui-disabled").attr("aria-disabled", true);
+ return this._setOption("disabled", true);
+ }
+
+});
+})( jQuery );
+
+/*
+* jQuery Mobile Framework : "collapsible" plugin
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT or GPL Version 2 licenses.
+* http://jquery.org/license
+*/
+( function( $, undefined ) {
+$.widget( "mobile.collapsible", $.mobile.widget, {
+ options: {
+ expandCueText: " click to expand contents",
+ collapseCueText: " click to collapse contents",
+ collapsed: false,
+ heading: ">:header,>legend",
+ theme: null,
+ iconTheme: "d"
+ },
+ _create: function() {
+
+ var $el = this.element,
+ o = this.options,
+ collapsibleContain = $el.addClass( "ui-collapsible-contain" ),
+ collapsibleHeading = $el.find( o.heading ).eq( 0 ),
+ collapsibleContent = collapsibleContain.wrapInner( '<div class="ui-collapsible-content"></div>' ).find( ".ui-collapsible-content" ),
+ collapsibleParent = $el.closest( ":jqmData(role='collapsible-set')" ).addClass( "ui-collapsible-set" );
+
+ //replace collapsibleHeading if it's a legend
+ if ( collapsibleHeading.is( "legend" ) ) {
+ collapsibleHeading = $( '<div role="heading">'+ collapsibleHeading.html() +"</div>" ).insertBefore( collapsibleHeading );
+ collapsibleHeading.next().remove();
+ }
+
+ collapsibleHeading
+ //drop heading in before content
+ .insertBefore( collapsibleContent )
+ //modify markup & attributes
+ .addClass( "ui-collapsible-heading" )
+ .append( '<span class="ui-collapsible-heading-status"></span>' )
+ .wrapInner( '<a href="#" class="ui-collapsible-heading-toggle"></a>' )
+ .find( "a:eq(0)" )
+ .buttonMarkup( {
+ shadow: !collapsibleParent.length,
+ corners: false,
+ iconPos: "left",
+ icon: "plus",
+ theme: o.theme
+ } )
+ .find( ".ui-icon" )
+ .removeAttr( "class" )
+ .buttonMarkup( {
+ shadow: true,
+ corners: true,
+ iconPos: "notext",
+ icon: "plus",
+ theme: o.iconTheme
+ } );
+
+ if ( ! collapsibleParent.length ) {
+ collapsibleHeading
+ .find( "a:eq(0)" )
+ .addClass( "ui-corner-all" )
+ .find( ".ui-btn-inner" )
+ .addClass( "ui-corner-all" );
+ }
+ else {
+ if ( collapsibleContain.jqmData( "collapsible-last" ) ) {
+ collapsibleHeading
+ .find( "a:eq(0), .ui-btn-inner" )
+ .addClass( "ui-corner-bottom" );
+ }
+ }
+
+ //events
+ collapsibleContain
+ .bind( "collapse", function( event ) {
+ if ( ! event.isDefaultPrevented() && $( event.target ).closest( ".ui-collapsible-contain" ).is( collapsibleContain ) ) {
+ event.preventDefault();
+ collapsibleHeading
+ .addClass( "ui-collapsible-heading-collapsed" )
+ .find( ".ui-collapsible-heading-status" )
+ .text( o.expandCueText )
+ .end()
+ .find( ".ui-icon" )
+ .removeClass( "ui-icon-minus" )
+ .addClass( "ui-icon-plus" );
+ collapsibleContent.addClass( "ui-collapsible-content-collapsed" ).attr( "aria-hidden", true );
+
+ if ( collapsibleContain.jqmData( "collapsible-last" ) ) {
+ collapsibleHeading
+ .find( "a:eq(0), .ui-btn-inner" )
+ .addClass( "ui-corner-bottom" );
+ }
+ }
+
+ } )
+ .bind( "expand", function( event ) {
+ if ( ! event.isDefaultPrevented() ) {
+ event.preventDefault();
+ collapsibleHeading
+ .removeClass( "ui-collapsible-heading-collapsed" )
+ .find( ".ui-collapsible-heading-status" ).text( o.collapseCueText );
+
+ collapsibleHeading.find( ".ui-icon" ).removeClass( "ui-icon-plus" ).addClass( "ui-icon-minus" );
+ collapsibleContent.removeClass( "ui-collapsible-content-collapsed" ).attr( "aria-hidden", false );
+
+ if ( collapsibleContain.jqmData( "collapsible-last" ) ) {
+ collapsibleHeading
+ .find( "a:eq(0), .ui-btn-inner" )
+ .removeClass( "ui-corner-bottom" );
+ }
+ }
+ } )
+ .trigger( o.collapsed ? "collapse" : "expand" );
+
+
+ //close others in a set
+ if ( collapsibleParent.length && !collapsibleParent.jqmData( "collapsiblebound" ) ) {
+ collapsibleParent
+ .jqmData( "collapsiblebound", true )
+ .bind( "expand", function( event ){
+
+ $( event.target )
+ .closest( ".ui-collapsible-contain" )
+ .siblings( ".ui-collapsible-contain" )
+ .trigger( "collapse" );
+
+ } );
+
+
+ var set = collapsibleParent.find( ":jqmData(role='collapsible'):first" );
+
+ set.first()
+ .find( "a:eq(0)" )
+ .addClass( "ui-corner-top" )
+ .find( ".ui-btn-inner" )
+ .addClass( "ui-corner-top" );
+
+ set.last().jqmData( "collapsible-last", true );
+ }
+
+ collapsibleHeading
+ .bind( "vclick", function( e ) {
+ if ( collapsibleHeading.is( ".ui-collapsible-heading-collapsed" ) ) {
+ collapsibleContain.trigger( "expand" );
+ }
+ else {
+ collapsibleContain.trigger( "collapse" );
+ }
+ e.preventDefault();
+ } );
+ }
+} );
+} )( jQuery );
+/*
+* jQuery Mobile Framework: "controlgroup" plugin - corner-rounding for groups of buttons, checks, radios, etc
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT or GPL Version 2 licenses.
+* http://jquery.org/license
+*/
+(function($, undefined ) {
+$.fn.controlgroup = function(options){
+
+ return this.each(function(){
+ var o = $.extend({
+ direction: $( this ).jqmData( "type" ) || "vertical",
+ shadow: false
+ },options);
+ var groupheading = $(this).find('>legend'),
+ flCorners = o.direction == 'horizontal' ? ['ui-corner-left', 'ui-corner-right'] : ['ui-corner-top', 'ui-corner-bottom'],
+ type = $(this).find('input:eq(0)').attr('type');
+
+ //replace legend with more stylable replacement div
+ if( groupheading.length ){
+ $(this).wrapInner('<div class="ui-controlgroup-controls"></div>');
+ $('<div role="heading" class="ui-controlgroup-label">'+ groupheading.html() +'</div>').insertBefore( $(this).children(0) );
+ groupheading.remove();
+ }
+
+ $(this).addClass('ui-corner-all ui-controlgroup ui-controlgroup-'+o.direction);
+
+ function flipClasses(els){
+ els
+ .removeClass('ui-btn-corner-all ui-shadow')
+ .eq(0).addClass(flCorners[0])
+ .end()
+ .filter(':last').addClass(flCorners[1]).addClass('ui-controlgroup-last');
+ }
+ flipClasses($(this).find('.ui-btn'));
+ flipClasses($(this).find('.ui-btn-inner'));
+ if(o.shadow){
+ $(this).addClass('ui-shadow');
+ }
+ });
+};
+})(jQuery);/*
+* jQuery Mobile Framework : "fieldcontain" plugin - simple class additions to make form row separators
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT or GPL Version 2 licenses.
+* http://jquery.org/license
+*/
+(function($, undefined ) {
+$.fn.fieldcontain = function(options){
+ return this.addClass('ui-field-contain ui-body ui-br');
+};
+})(jQuery);/*
+* jQuery Mobile Framework : "listview" plugin
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT or GPL Version 2 licenses.
+* http://jquery.org/license
+*/
+(function($, undefined ) {
+//Keeps track of the number of lists per page UID
+//This allows support for multiple nested list in the same page
+//https://github.com/jquery/jquery-mobile/issues/1617
+var listCountPerPage = {};
+
+$.widget( "mobile.listview", $.mobile.widget, {
+ options: {
+ theme: "c",
+ countTheme: "c",
+ headerTheme: "b",
+ dividerTheme: "b",
+ splitIcon: "arrow-r",
+ splitTheme: "b",
+ inset: false
+ },
+
+ _create: function() {
+ var t = this;
+
+ // create listview markup
+ t.element.addClass(function( i, orig ) {
+ return orig + " ui-listview " + ( t.options.inset ? " ui-listview-inset ui-corner-all ui-shadow " : "" );
+ });
+
+ t.refresh();
+ },
+
+ _itemApply: function( $list, item ) {
+ // TODO class has to be defined in markup
+ item.find( ".ui-li-count" )
+ .addClass( "ui-btn-up-" + ($list.jqmData( "counttheme" ) || this.options.countTheme) + " ui-btn-corner-all" ).end()
+ .find( "h1, h2, h3, h4, h5, h6" ).addClass( "ui-li-heading" ).end()
+ .find( "p, dl" ).addClass( "ui-li-desc" ).end()
+ .find( ">img:eq(0), .ui-link-inherit>img:eq(0)" ).addClass( "ui-li-thumb" ).each(function() {
+ item.addClass( $(this).is( ".ui-li-icon" ) ? "ui-li-has-icon" : "ui-li-has-thumb" );
+ }).end()
+ .find( ".ui-li-aside" ).each(function() {
+ var $this = $(this);
+ $this.prependTo( $this.parent() ); //shift aside to front for css float
+ });
+ },
+
+ _removeCorners: function( li ) {
+ li
+ .add( li.find(".ui-btn-inner, .ui-li-link-alt, .ui-li-thumb") )
+ .removeClass( "ui-corner-top ui-corner-bottom ui-corner-br ui-corner-bl ui-corner-tr ui-corner-tl" );
+ },
+
+ refresh: function( create ) {
+ this._createSubPages();
+
+ var o = this.options,
+ $list = this.element,
+ self = this,
+ dividertheme = $list.jqmData( "dividertheme" ) || o.dividerTheme,
+ listsplittheme = $list.jqmData( "splittheme" ),
+ listspliticon = $list.jqmData( "spliticon" ),
+ li = $list.children( "li" ),
+ counter = $.support.cssPseudoElement || !$.nodeName( $list[0], "ol" ) ? 0 : 1;
+
+ if ( counter ) {
+ $list.find( ".ui-li-dec" ).remove();
+ }
+
+ for (var pos = 0, numli = li.length; pos < numli; pos++) {
+ var item = li.eq(pos),
+ itemClass = "ui-li";
+
+ // If we're creating the element, we update it regardless
+ if ( create || !item.hasClass( "ui-li" ) ) {
+ var itemTheme = item.jqmData("theme") || o.theme,
+ a = item.children( "a" );
+
+ if ( a.length ) {
+ var icon = item.jqmData("icon");
+
+ item
+ .buttonMarkup({
+ wrapperEls: "div",
+ shadow: false,
+ corners: false,
+ iconpos: "right",
+ icon: a.length > 1 || icon === false ? false : icon || "arrow-r",
+ theme: itemTheme
+ });
+
+ a.first().addClass( "ui-link-inherit" );
+
+ if ( a.length > 1 ) {
+ itemClass += " ui-li-has-alt";
+
+ var last = a.last(),
+ splittheme = listsplittheme || last.jqmData( "theme" ) || o.splitTheme;
+
+ last
+ .appendTo(item)
+ .attr( "title", last.text() )
+ .addClass( "ui-li-link-alt" )
+ .empty()
+ .buttonMarkup({
+ shadow: false,
+ corners: false,
+ theme: itemTheme,
+ icon: false,
+ iconpos: false
+ })
+ .find( ".ui-btn-inner" )
+ .append( $( "<span />" ).buttonMarkup({
+ shadow: true,
+ corners: true,
+ theme: splittheme,
+ iconpos: "notext",
+ icon: listspliticon || last.jqmData( "icon" ) || o.splitIcon
+ } ) );
+ }
+
+ } else if ( item.jqmData( "role" ) === "list-divider" ) {
+ itemClass += " ui-li-divider ui-btn ui-bar-" + dividertheme;
+ item.attr( "role", "heading" );
+
+ //reset counter when a divider heading is encountered
+ if ( counter ) {
+ counter = 1;
+ }
+
+ } else {
+ itemClass += " ui-li-static ui-body-" + itemTheme;
+ }
+ }
+
+
+ if( o.inset ){
+ if ( pos === 0 ) {
+ itemClass += " ui-corner-top";
+
+ item
+ .add( item.find( ".ui-btn-inner" ) )
+ .find( ".ui-li-link-alt" )
+ .addClass( "ui-corner-tr" )
+ .end()
+ .find( ".ui-li-thumb" )
+ .addClass( "ui-corner-tl" );
+ if(item.next().next().length){
+ self._removeCorners( item.next() );
+ }
+
+ }
+ if ( pos === li.length - 1 ) {
+ itemClass += " ui-corner-bottom";
+
+ item
+ .add( item.find( ".ui-btn-inner" ) )
+ .find( ".ui-li-link-alt" )
+ .addClass( "ui-corner-br" )
+ .end()
+ .find( ".ui-li-thumb" )
+ .addClass( "ui-corner-bl" );
+
+ if(item.prev().prev().length){
+ self._removeCorners( item.prev() );
+ }
+ }
+ }
+
+
+ if ( counter && itemClass.indexOf( "ui-li-divider" ) < 0 ) {
+
+ var countParent = item.is(".ui-li-static:first") ? item : item.find( ".ui-link-inherit" );
+
+ countParent
+ .addClass( "ui-li-jsnumbering" )
+ .prepend( "<span class='ui-li-dec'>" + (counter++) + ". </span>" );
+ }
+
+ item.add( item.children( ".ui-btn-inner" ) ).addClass( itemClass );
+
+ if ( !create ) {
+ self._itemApply( $list, item );
+ }
+ }
+ },
+
+ //create a string for ID/subpage url creation
+ _idStringEscape: function( str ){
+ return str.replace(/[^a-zA-Z0-9]/g, '-');
+ },
+
+ _createSubPages: function() {
+ var parentList = this.element,
+ parentPage = parentList.closest( ".ui-page" ),
+ parentUrl = parentPage.jqmData( "url" ),
+ parentId = parentUrl || parentPage[ 0 ][ $.expando ],
+ parentListId = parentList.attr( "id" ),
+ o = this.options,
+ dns = "data-" + $.mobile.ns,
+ self = this,
+ persistentFooterID = parentPage.find( ":jqmData(role='footer')" ).jqmData( "id" );
+
+ if ( typeof( listCountPerPage[ parentId ] ) === 'undefined' ) {
+ listCountPerPage[ parentId ] = -1;
+ }
+ parentListId = parentListId || ++listCountPerPage[ parentId ];
+
+ $( parentList.find( "li>ul, li>ol" ).toArray().reverse() ).each(function( i ) {
+ var list = $( this ),
+ listId = list.attr( "id" ) || parentListId + "-" + i,
+ parent = list.parent(),
+ nodeEls = $( list.prevAll().toArray().reverse() ),
+ nodeEls = nodeEls.length ? nodeEls : $( "<span>" + $.trim(parent.contents()[ 0 ].nodeValue) + "</span>" ),
+ title = nodeEls.first().text(),//url limits to first 30 chars of text
+ id = ( parentUrl || "" ) + "&" + $.mobile.subPageUrlKey + "=" + listId;
+ theme = list.jqmData( "theme" ) || o.theme,
+ countTheme = list.jqmData( "counttheme" ) || parentList.jqmData( "counttheme" ) || o.countTheme,
+ newPage = list.detach()
+ .wrap( "<div " + dns + "role='page' " + dns + "url='" + id + "' " + dns + "theme='" + theme + "' " + dns + "count-theme='" + countTheme + "'><div " + dns + "role='content'></div></div>" )
+ .parent()
+ .before( "<div " + dns + "role='header' " + dns + "theme='" + o.headerTheme + "'><div class='ui-title'>" + title + "</div></div>" )
+ .after( persistentFooterID ? $( "<div " + dns + "role='footer' " + dns + "id='"+ persistentFooterID +"'>") : "" )
+ .parent()
+ .appendTo( $.mobile.pageContainer );
+
+ newPage.page();
+ var anchor = parent.find('a:first');
+ if ( !anchor.length ) {
+ anchor = $("<a />").html( nodeEls || title ).prependTo( parent.empty() );
+ }
+ anchor.attr('href','#' + id);
+ }).listview();
+ }
+});
+
+})( jQuery );
+/*
+* jQuery Mobile Framework : "listview" filter extension
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT or GPL Version 2 licenses.
+* http://jquery.org/license
+*/
+(function($, undefined ) {
+
+$.mobile.listview.prototype.options.filter = false;
+$.mobile.listview.prototype.options.filterPlaceholder = "Filter items...";
+$.mobile.listview.prototype.options.filterTheme = "c";
+
+$( ":jqmData(role='listview')" ).live( "listviewcreate", function() {
+ var list = $( this ),
+ listview = list.data( "listview" );
+
+ if ( !listview.options.filter ) {
+ return;
+ }
+
+ var wrapper = $( "<form>", { "class": "ui-listview-filter ui-bar-" + listview.options.filterTheme, "role": "search" } ),
+
+ search = $( "<input>", {
+ placeholder: listview.options.filterPlaceholder
+ })
+ .attr( "data-" + $.mobile.ns + "type", "search" )
+ .jqmData( 'lastval', "" )
+ .bind( "keyup change", function() {
+
+ var val = this.value.toLowerCase(),
+ listItems=null,
+ lastval = $( this ).jqmData('lastval')+"";
+
+ //change val as lastval for next execution
+ $(this).jqmData( 'lastval' , val );
+
+ change = val.replace( new RegExp( "^" + lastval ) , "" );
+
+ if( val.length < lastval.length || change.length != ( val.length - lastval.length ) ){
+
+ //removed chars or pasted something totaly different, check all items
+ listItems = list.children();
+ } else {
+
+ //only chars added, not removed, only use visible subset
+ listItems = list.children( ':not(.ui-screen-hidden)' );
+ }
+
+ if ( val ) {
+
+ // This handles hiding regular rows without the text we search for
+ // and any list dividers without regular rows shown under it
+ var item,
+ childItems = false,
+ itemtext="";
+
+ for ( var i = listItems.length - 1; i >= 0; i-- ) {
+ item = $( listItems[i] );
+ itemtext = item.jqmData( 'filtertext' ) || item.text();
+
+ if ( item.is( "li:jqmData(role=list-divider)" ) ) {
+
+ item.toggleClass( 'ui-filter-hidequeue' , !childItems );
+
+ // New bucket!
+ childItems = false;
+
+ } else if ( itemtext.toLowerCase().indexOf( val ) === -1) {
+
+ //mark to be hidden
+ item.toggleClass( 'ui-filter-hidequeue' , true );
+ } else {
+
+ // There's a shown item in the bucket
+ childItems = true;
+ }
+ }
+
+ // show items, not marked to be hidden
+ listItems
+ .filter( ':not(.ui-filter-hidequeue)' )
+ .toggleClass('ui-screen-hidden',false);
+
+ // hide items, marked to be hidden
+ listItems
+ .filter( '.ui-filter-hidequeue' )
+ .toggleClass('ui-screen-hidden',true)
+ .toggleClass( 'ui-filter-hidequeue' , false );
+
+ }else{
+
+ //filtervalue is empty => show all
+ listItems.toggleClass('ui-screen-hidden',false);
+ }
+ })
+ .appendTo( wrapper )
+ .textinput();
+
+ if ($( this ).jqmData( "inset" ) ) {
+ wrapper.addClass( "ui-listview-filter-inset" );
+ }
+
+ wrapper.insertBefore( list );
+});
+
+})( jQuery );/*
+* jQuery Mobile Framework : "dialog" plugin.
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.
+* Note: Code is in draft form and is subject to change
+*/
+( function( $, undefined ) {
+$.widget( "mobile.dialog", $.mobile.widget, {
+ options: {
+ closeBtnText: "Close"
+ },
+ _create: function() {
+ var $el = this.element;
+
+ /* class the markup for dialog styling */
+ $el
+ //add ARIA role
+ .attr( "role", "dialog" )
+ .addClass( "ui-page ui-dialog ui-body-a" )
+ .find( ":jqmData(role=header)" )
+ .addClass( "ui-corner-top ui-overlay-shadow" )
+ .prepend( "<a href='#' data-" + $.mobile.ns + "icon='delete' data-" + $.mobile.ns + "rel='back' data-" + $.mobile.ns + "iconpos='notext'>"+ this.options.closeBtnText +"</a>" )
+ .end()
+ .find( '.ui-content:not([class*="ui-body-"])' )
+ .addClass( 'ui-body-c' )
+ .end()
+ .find( ".ui-content,:jqmData(role='footer')" )
+ .last()
+ .addClass( "ui-corner-bottom ui-overlay-shadow" );
+
+ /* bind events
+ - clicks and submits should use the closing transition that the dialog opened with
+ unless a data-transition is specified on the link/form
+ - if the click was on the close button, or the link has a data-rel="back" it'll go back in history naturally
+ */
+ $el
+ .bind( "vclick submit", function( e ) {
+ var $target = $( e.target ).closest( e.type === "vclick" ? "a" : "form" );
+
+ if( $target.length && ! $target.jqmData( "transition" ) ) {
+ var active = $.mobile.urlHistory.getActive() || {};
+ $target
+ .attr( "data-" + $.mobile.ns + "transition", ( active.transition || $.mobile.defaultDialogTransition ) )
+ .attr( "data-" + $.mobile.ns + "direction", "reverse" );
+ }
+ })
+ .bind( "pagehide", function() {
+ $( this ).find( "." + $.mobile.activeBtnClass ).removeClass( $.mobile.activeBtnClass );
+ });
+ },
+
+ //close method goes back in history
+ close: function() {
+ window.history.back();
+ }
+});
+})( jQuery );
+/*
+* jQuery Mobile Framework : "navbar" plugin
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT or GPL Version 2 licenses.
+* http://jquery.org/license
+*/
+(function($, undefined ) {
+$.widget( "mobile.navbar", $.mobile.widget, {
+ options: {
+ iconpos: 'top',
+ grid: null
+ },
+ _create: function(){
+ var $navbar = this.element,
+ $navbtns = $navbar.find("a"),
+ iconpos = $navbtns.filter( ":jqmData(icon)").length ? this.options.iconpos : undefined;
+
+ $navbar
+ .addClass('ui-navbar')
+ .attr("role","navigation")
+ .find("ul")
+ .grid({grid: this.options.grid });
+
+ if( !iconpos ){
+ $navbar.addClass("ui-navbar-noicons");
+ }
+
+ $navbtns
+ .buttonMarkup({
+ corners: false,
+ shadow: false,
+ iconpos: iconpos
+ });
+
+ $navbar.delegate("a", "vclick",function(event){
+ $navbtns.not( ".ui-state-persist" ).removeClass( $.mobile.activeBtnClass );
+ $( this ).addClass( $.mobile.activeBtnClass );
+ });
+ }
+});
+})( jQuery );
+/*
+* jQuery Mobile Framework : plugin for creating CSS grids
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT or GPL Version 2 licenses.
+* http://jquery.org/license
+*/
+(function($, undefined ) {
+$.fn.grid = function(options){
+ return this.each(function(){
+ var o = $.extend({
+ grid: null
+ },options);
+
+
+ var $kids = $(this).children(),
+ gridCols = {solo:1, a:2, b:3, c:4, d:5},
+ grid = o.grid,
+ iterator;
+
+ if( !grid ){
+ if( $kids.length <= 5 ){
+ for(var letter in gridCols){
+ if(gridCols[letter] == $kids.length){ grid = letter; }
+ }
+ }
+ else{
+ grid = 'a';
+ }
+ }
+ iterator = gridCols[grid];
+
+ $(this).addClass('ui-grid-' + grid);
+
+ $kids.filter(':nth-child(' + iterator + 'n+1)').addClass('ui-block-a');
+ if(iterator > 1){
+ $kids.filter(':nth-child(' + iterator + 'n+2)').addClass('ui-block-b');
+ }
+ if(iterator > 2){
+ $kids.filter(':nth-child(3n+3)').addClass('ui-block-c');
+ }
+ if(iterator > 3){
+ $kids.filter(':nth-child(4n+4)').addClass('ui-block-d');
+ }
+ if(iterator > 4){
+ $kids.filter(':nth-child(5n+5)').addClass('ui-block-e');
+ }
+
+ });
+};
+})(jQuery);/*!
+ * jQuery Mobile v@VERSION
+ * http://jquerymobile.com/
+ *
+ * Copyright 2010, jQuery Project
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ */
+
+(function( $, window, undefined ) {
+ var $html = $( "html" ),
+ $head = $( "head" ),
+ $window = $( window );
+
+ //trigger mobileinit event - useful hook for configuring $.mobile settings before they're used
+ $( window.document ).trigger( "mobileinit" );
+
+ //support conditions
+ //if device support condition(s) aren't met, leave things as they are -> a basic, usable experience,
+ //otherwise, proceed with the enhancements
+ if ( !$.mobile.gradeA() ) {
+ return;
+ }
+
+ // override ajaxEnabled on platforms that have known conflicts with hash history updates
+ // or generally work better browsing in regular http for full page refreshes (BB5, Opera Mini)
+ if( window.blackberry && !window.WebKitPoint || window.operamini && Object.prototype.toString.call( window.operamini ) === "[object OperaMini]" ){
+ $.mobile.ajaxEnabled = false;
+ }
+
+ //add mobile, initial load "rendering" classes to docEl
+ $html.addClass( "ui-mobile ui-mobile-rendering" );
+
+ //loading div which appears during Ajax requests
+ //will not appear if $.mobile.loadingMessage is false
+ var $loader = $.mobile.loadingMessage ? $( "<div class='ui-loader ui-body-a ui-corner-all'>" + "<span class='ui-icon ui-icon-loading spin'></span>" + "<h1>" + $.mobile.loadingMessage + "</h1>" + "</div>" ) : undefined;
+
+ $.extend($.mobile, {
+ // turn on/off page loading message.
+ showPageLoadingMsg: function() {
+ if( $.mobile.loadingMessage ){
+ var activeBtn = $( "." + $.mobile.activeBtnClass ).first();
+
+ $loader
+ .appendTo( $.mobile.pageContainer )
+ //position at y center (if scrollTop supported), above the activeBtn (if defined), or just 100px from top
+ .css( {
+ top: $.support.scrollTop && $(window).scrollTop() + $(window).height() / 2 ||
+ activeBtn.length && activeBtn.offset().top || 100
+ } );
+ }
+
+ $html.addClass( "ui-loading" );
+ },
+
+ hidePageLoadingMsg: function() {
+ $html.removeClass( "ui-loading" );
+ },
+
+ // XXX: deprecate for 1.0
+ pageLoading: function ( done ) {
+ if ( done ) {
+ $.mobile.hidePageLoadingMsg();
+ } else {
+ $.mobile.showPageLoadingMsg();
+ }
+ },
+
+ // find and enhance the pages in the dom and transition to the first page.
+ initializePage: function(){
+ //find present pages
+ var $pages = $( ":jqmData(role='page')" );
+
+ //add dialogs, set data-url attrs
+ $pages.add( ":jqmData(role='dialog')" ).each(function(){
+ var $this = $(this);
+
+ // unless the data url is already set set it to the id
+ if( !$this.jqmData('url') ){
+ $this.attr( "data-" + $.mobile.ns + "url", $this.attr( "id" ) );
+ }
+ });
+
+ //define first page in dom case one backs out to the directory root (not always the first page visited, but defined as fallback)
+ $.mobile.firstPage = $pages.first();
+
+ //define page container
+ $.mobile.pageContainer = $pages.first().parent().addClass( "ui-mobile-viewport" );
+
+ //cue page loading message
+ $.mobile.showPageLoadingMsg();
+
+ // if hashchange listening is disabled or there's no hash deeplink, change to the first page in the DOM
+ if( !$.mobile.hashListeningEnabled || !$.mobile.path.stripHash( location.hash ) ){
+ $.mobile.changePage( $.mobile.firstPage, { transition: "none", reverse: true, changeHash: false, fromHashChange: true } );
+ }
+ // otherwise, trigger a hashchange to load a deeplink
+ else {
+ $window.trigger( "hashchange", [ true ] );
+ }
+ }
+ });
+
+ //check which scrollTop value should be used by scrolling to 1 immediately at domready
+ //then check what the scroll top is. Android will report 0... others 1
+ //note that this initial scroll won't hide the address bar. It's just for the check.
+ $(function(){
+ window.scrollTo( 0, 1 );
+
+ //if defaultHomeScroll hasn't been set yet, see if scrollTop is 1
+ //it should be 1 in most browsers, but android treats 1 as 0 (for hiding addr bar)
+ //so if it's 1, use 0 from now on
+ $.mobile.defaultHomeScroll = ( !$.support.scrollTop || $(window).scrollTop() === 1 ) ? 0 : 1;
+
+ //dom-ready inits
+ $( $.mobile.initializePage );
+
+ //window load event
+ //hide iOS browser chrome on load
+ $window.load( $.mobile.silentScroll );
+ });
+})( jQuery, this );
+
--- /dev/null
+++ b/js/jquery.ui.autocomplete.min.js
@@ -1,1 +1,33 @@
+/*
+ * jQuery UI Autocomplete 1.8.12
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Autocomplete
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ * jquery.ui.position.js
+ */
+(function(d){var e=0;d.widget("ui.autocomplete",{options:{appendTo:"body",autoFocus:false,delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},pending:0,_create:function(){var a=this,b=this.element[0].ownerDocument,g;this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(c){if(!(a.options.disabled||a.element.attr("readonly"))){g=
+false;var f=d.ui.keyCode;switch(c.keyCode){case f.PAGE_UP:a._move("previousPage",c);break;case f.PAGE_DOWN:a._move("nextPage",c);break;case f.UP:a._move("previous",c);c.preventDefault();break;case f.DOWN:a._move("next",c);c.preventDefault();break;case f.ENTER:case f.NUMPAD_ENTER:if(a.menu.active){g=true;c.preventDefault()}case f.TAB:if(!a.menu.active)return;a.menu.select(c);break;case f.ESCAPE:a.element.val(a.term);a.close(c);break;default:clearTimeout(a.searching);a.searching=setTimeout(function(){if(a.term!=
+a.element.val()){a.selectedItem=null;a.search(null,c)}},a.options.delay);break}}}).bind("keypress.autocomplete",function(c){if(g){g=false;c.preventDefault()}}).bind("focus.autocomplete",function(){if(!a.options.disabled){a.selectedItem=null;a.previous=a.element.val()}}).bind("blur.autocomplete",function(c){if(!a.options.disabled){clearTimeout(a.searching);a.closing=setTimeout(function(){a.close(c);a._change(c)},150)}});this._initSource();this.response=function(){return a._response.apply(a,arguments)};
+this.menu=d("<ul></ul>").addClass("ui-autocomplete").appendTo(d(this.options.appendTo||"body",b)[0]).mousedown(function(c){var f=a.menu.element[0];d(c.target).closest(".ui-menu-item").length||setTimeout(function(){d(document).one("mousedown",function(h){h.target!==a.element[0]&&h.target!==f&&!d.ui.contains(f,h.target)&&a.close()})},1);setTimeout(function(){clearTimeout(a.closing)},13)}).menu({focus:function(c,f){f=f.item.data("item.autocomplete");false!==a._trigger("focus",c,{item:f})&&/^key/.test(c.originalEvent.type)&&
+a.element.val(f.value)},selected:function(c,f){var h=f.item.data("item.autocomplete"),i=a.previous;if(a.element[0]!==b.activeElement){a.element.focus();a.previous=i;setTimeout(function(){a.previous=i;a.selectedItem=h},1)}false!==a._trigger("select",c,{item:h})&&a.element.val(h.value);a.term=a.element.val();a.close(c);a.selectedItem=h},blur:function(){a.menu.element.is(":visible")&&a.element.val()!==a.term&&a.element.val(a.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu");
+d.fn.bgiframe&&this.menu.element.bgiframe()},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup");this.menu.element.remove();d.Widget.prototype.destroy.call(this)},_setOption:function(a,b){d.Widget.prototype._setOption.apply(this,arguments);a==="source"&&this._initSource();if(a==="appendTo")this.menu.element.appendTo(d(b||"body",this.element[0].ownerDocument)[0]);a==="disabled"&&
+b&&this.xhr&&this.xhr.abort()},_initSource:function(){var a=this,b,g;if(d.isArray(this.options.source)){b=this.options.source;this.source=function(c,f){f(d.ui.autocomplete.filter(b,c.term))}}else if(typeof this.options.source==="string"){g=this.options.source;this.source=function(c,f){a.xhr&&a.xhr.abort();a.xhr=d.ajax({url:g,data:c,dataType:"json",autocompleteRequest:++e,success:function(h){this.autocompleteRequest===e&&f(h)},error:function(){this.autocompleteRequest===e&&f([])}})}}else this.source=
+this.options.source},search:function(a,b){a=a!=null?a:this.element.val();this.term=this.element.val();if(a.length<this.options.minLength)return this.close(b);clearTimeout(this.closing);if(this._trigger("search",b)!==false)return this._search(a)},_search:function(a){this.pending++;this.element.addClass("ui-autocomplete-loading");this.source({term:a},this.response)},_response:function(a){if(!this.options.disabled&&a&&a.length){a=this._normalize(a);this._suggest(a);this._trigger("open")}else this.close();
+this.pending--;this.pending||this.element.removeClass("ui-autocomplete-loading")},close:function(a){clearTimeout(this.closing);if(this.menu.element.is(":visible")){this.menu.element.hide();this.menu.deactivate();this._trigger("close",a)}},_change:function(a){this.previous!==this.element.val()&&this._trigger("change",a,{item:this.selectedItem})},_normalize:function(a){if(a.length&&a[0].label&&a[0].value)return a;return d.map(a,function(b){if(typeof b==="string")return{label:b,value:b};return d.extend({label:b.label||
+b.value,value:b.value||b.label},b)})},_suggest:function(a){var b=this.menu.element.empty().zIndex(this.element.zIndex()+1);this._renderMenu(b,a);this.menu.deactivate();this.menu.refresh();b.show();this._resizeMenu();b.position(d.extend({of:this.element},this.options.position));this.options.autoFocus&&this.menu.next(new d.Event("mouseover"))},_resizeMenu:function(){var a=this.menu.element;a.outerWidth(Math.max(a.width("").outerWidth(),this.element.outerWidth()))},_renderMenu:function(a,b){var g=this;
+d.each(b,function(c,f){g._renderItem(a,f)})},_renderItem:function(a,b){return d("<li></li>").data("item.autocomplete",b).append(d("<a></a>").text(b.label)).appendTo(a)},_move:function(a,b){if(this.menu.element.is(":visible"))if(this.menu.first()&&/^previous/.test(a)||this.menu.last()&&/^next/.test(a)){this.element.val(this.term);this.menu.deactivate()}else this.menu[a](b);else this.search(null,b)},widget:function(){return this.menu.element}});d.extend(d.ui.autocomplete,{escapeRegex:function(a){return a.replace(/[-[\]{}()*+?.,\\^$|#\s]/g,
+"\\$&")},filter:function(a,b){var g=new RegExp(d.ui.autocomplete.escapeRegex(b),"i");return d.grep(a,function(c){return g.test(c.label||c.value||c)})}})})(jQuery);
+(function(d){d.widget("ui.menu",{_create:function(){var e=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(a){if(d(a.target).closest(".ui-menu-item a").length){a.preventDefault();e.select(a)}});this.refresh()},refresh:function(){var e=this;this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem").children("a").addClass("ui-corner-all").attr("tabindex",
+-1).mouseenter(function(a){e.activate(a,d(this).parent())}).mouseleave(function(){e.deactivate()})},activate:function(e,a){this.deactivate();if(this.hasScroll()){var b=a.offset().top-this.element.offset().top,g=this.element.attr("scrollTop"),c=this.element.height();if(b<0)this.element.attr("scrollTop",g+b);else b>=c&&this.element.attr("scrollTop",g+b-c+a.height())}this.active=a.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end();this._trigger("focus",e,{item:a})},
+deactivate:function(){if(this.active){this.active.children("a").removeClass("ui-state-hover").removeAttr("id");this._trigger("blur");this.active=null}},next:function(e){this.move("next",".ui-menu-item:first",e)},previous:function(e){this.move("prev",".ui-menu-item:last",e)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(e,a,b){if(this.active){e=this.active[e+"All"](".ui-menu-item").eq(0);
+e.length?this.activate(b,e):this.activate(b,this.element.children(a))}else this.activate(b,this.element.children(a))},nextPage:function(e){if(this.hasScroll())if(!this.active||this.last())this.activate(e,this.element.children(".ui-menu-item:first"));else{var a=this.active.offset().top,b=this.element.height(),g=this.element.children(".ui-menu-item").filter(function(){var c=d(this).offset().top-a-b+d(this).height();return c<10&&c>-10});g.length||(g=this.element.children(".ui-menu-item:last"));this.activate(e,
+g)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active||this.last()?":first":":last"))},previousPage:function(e){if(this.hasScroll())if(!this.active||this.first())this.activate(e,this.element.children(".ui-menu-item:last"));else{var a=this.active.offset().top,b=this.element.height();result=this.element.children(".ui-menu-item").filter(function(){var g=d(this).offset().top-a+b-d(this).height();return g<10&&g>-10});result.length||(result=this.element.children(".ui-menu-item:first"));
+this.activate(e,result)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active||this.first()?":last":":first"))},hasScroll:function(){return this.element.height()<this.element.attr("scrollHeight")},select:function(e){this._trigger("selected",e,{item:this.active})}})})(jQuery);
--- /dev/null
+++ b/js/jquery.ui.core.min.js
@@ -1,1 +1,18 @@
+/*!
+ * jQuery UI 1.8.12
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI
+ */
+(function(c,j){function k(a){return!c(a).parents().andSelf().filter(function(){return c.curCSS(this,"visibility")==="hidden"||c.expr.filters.hidden(this)}).length}c.ui=c.ui||{};if(!c.ui.version){c.extend(c.ui,{version:"1.8.12",keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,
+NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});c.fn.extend({_focus:c.fn.focus,focus:function(a,b){return typeof a==="number"?this.each(function(){var d=this;setTimeout(function(){c(d).focus();b&&b.call(d)},a)}):this._focus.apply(this,arguments)},scrollParent:function(){var a;a=c.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(c.curCSS(this,
+"position",1))&&/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!a.length?c(document):a},zIndex:function(a){if(a!==j)return this.css("zIndex",a);if(this.length){a=c(this[0]);for(var b;a.length&&a[0]!==document;){b=a.css("position");
+if(b==="absolute"||b==="relative"||b==="fixed"){b=parseInt(a.css("zIndex"),10);if(!isNaN(b)&&b!==0)return b}a=a.parent()}}return 0},disableSelection:function(){return this.bind((c.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection",function(a){a.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});c.each(["Width","Height"],function(a,b){function d(f,g,l,m){c.each(e,function(){g-=parseFloat(c.curCSS(f,"padding"+this,true))||0;if(l)g-=parseFloat(c.curCSS(f,
+"border"+this+"Width",true))||0;if(m)g-=parseFloat(c.curCSS(f,"margin"+this,true))||0});return g}var e=b==="Width"?["Left","Right"]:["Top","Bottom"],h=b.toLowerCase(),i={innerWidth:c.fn.innerWidth,innerHeight:c.fn.innerHeight,outerWidth:c.fn.outerWidth,outerHeight:c.fn.outerHeight};c.fn["inner"+b]=function(f){if(f===j)return i["inner"+b].call(this);return this.each(function(){c(this).css(h,d(this,f)+"px")})};c.fn["outer"+b]=function(f,g){if(typeof f!=="number")return i["outer"+b].call(this,f);return this.each(function(){c(this).css(h,
+d(this,f,true,g)+"px")})}});c.extend(c.expr[":"],{data:function(a,b,d){return!!c.data(a,d[3])},focusable:function(a){var b=a.nodeName.toLowerCase(),d=c.attr(a,"tabindex");if("area"===b){b=a.parentNode;d=b.name;if(!a.href||!d||b.nodeName.toLowerCase()!=="map")return false;a=c("img[usemap=#"+d+"]")[0];return!!a&&k(a)}return(/input|select|textarea|button|object/.test(b)?!a.disabled:"a"==b?a.href||!isNaN(d):!isNaN(d))&&k(a)},tabbable:function(a){var b=c.attr(a,"tabindex");return(isNaN(b)||b>=0)&&c(a).is(":focusable")}});
+c(function(){var a=document.body,b=a.appendChild(b=document.createElement("div"));c.extend(b.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});c.support.minHeight=b.offsetHeight===100;c.support.selectstart="onselectstart"in b;a.removeChild(b).style.display="none"});c.extend(c.ui,{plugin:{add:function(a,b,d){a=c.ui[a].prototype;for(var e in d){a.plugins[e]=a.plugins[e]||[];a.plugins[e].push([b,d[e]])}},call:function(a,b,d){if((b=a.plugins[b])&&a.element[0].parentNode)for(var e=0;e<b.length;e++)a.options[b[e][0]]&&
+b[e][1].apply(a.element,d)}},contains:function(a,b){return document.compareDocumentPosition?a.compareDocumentPosition(b)&16:a!==b&&a.contains(b)},hasScroll:function(a,b){if(c(a).css("overflow")==="hidden")return false;b=b&&b==="left"?"scrollLeft":"scrollTop";var d=false;if(a[b]>0)return true;a[b]=1;d=a[b]>0;a[b]=0;return d},isOverAxis:function(a,b,d){return a>b&&a<b+d},isOver:function(a,b,d,e,h,i){return c.ui.isOverAxis(a,d,h)&&c.ui.isOverAxis(b,e,i)}})}})(jQuery);
--- /dev/null
+++ b/js/jquery.ui.position.min.js
@@ -1,1 +1,17 @@
+/*
+ * jQuery UI Position 1.8.12
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Position
+ */
+(function(c){c.ui=c.ui||{};var n=/left|center|right/,o=/top|center|bottom/,t=c.fn.position,u=c.fn.offset;c.fn.position=function(b){if(!b||!b.of)return t.apply(this,arguments);b=c.extend({},b);var a=c(b.of),d=a[0],g=(b.collision||"flip").split(" "),e=b.offset?b.offset.split(" "):[0,0],h,k,j;if(d.nodeType===9){h=a.width();k=a.height();j={top:0,left:0}}else if(d.setTimeout){h=a.width();k=a.height();j={top:a.scrollTop(),left:a.scrollLeft()}}else if(d.preventDefault){b.at="left top";h=k=0;j={top:b.of.pageY,
+left:b.of.pageX}}else{h=a.outerWidth();k=a.outerHeight();j=a.offset()}c.each(["my","at"],function(){var f=(b[this]||"").split(" ");if(f.length===1)f=n.test(f[0])?f.concat(["center"]):o.test(f[0])?["center"].concat(f):["center","center"];f[0]=n.test(f[0])?f[0]:"center";f[1]=o.test(f[1])?f[1]:"center";b[this]=f});if(g.length===1)g[1]=g[0];e[0]=parseInt(e[0],10)||0;if(e.length===1)e[1]=e[0];e[1]=parseInt(e[1],10)||0;if(b.at[0]==="right")j.left+=h;else if(b.at[0]==="center")j.left+=h/2;if(b.at[1]==="bottom")j.top+=
+k;else if(b.at[1]==="center")j.top+=k/2;j.left+=e[0];j.top+=e[1];return this.each(function(){var f=c(this),l=f.outerWidth(),m=f.outerHeight(),p=parseInt(c.curCSS(this,"marginLeft",true))||0,q=parseInt(c.curCSS(this,"marginTop",true))||0,v=l+p+(parseInt(c.curCSS(this,"marginRight",true))||0),w=m+q+(parseInt(c.curCSS(this,"marginBottom",true))||0),i=c.extend({},j),r;if(b.my[0]==="right")i.left-=l;else if(b.my[0]==="center")i.left-=l/2;if(b.my[1]==="bottom")i.top-=m;else if(b.my[1]==="center")i.top-=
+m/2;i.left=Math.round(i.left);i.top=Math.round(i.top);r={left:i.left-p,top:i.top-q};c.each(["left","top"],function(s,x){c.ui.position[g[s]]&&c.ui.position[g[s]][x](i,{targetWidth:h,targetHeight:k,elemWidth:l,elemHeight:m,collisionPosition:r,collisionWidth:v,collisionHeight:w,offset:e,my:b.my,at:b.at})});c.fn.bgiframe&&f.bgiframe();f.offset(c.extend(i,{using:b.using}))})};c.ui.position={fit:{left:function(b,a){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();b.left=
+d>0?b.left-d:Math.max(b.left-a.collisionPosition.left,b.left)},top:function(b,a){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();b.top=d>0?b.top-d:Math.max(b.top-a.collisionPosition.top,b.top)}},flip:{left:function(b,a){if(a.at[0]!=="center"){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();var g=a.my[0]==="left"?-a.elemWidth:a.my[0]==="right"?a.elemWidth:0,e=a.at[0]==="left"?a.targetWidth:-a.targetWidth,h=-2*a.offset[0];b.left+=
+a.collisionPosition.left<0?g+e+h:d>0?g+e+h:0}},top:function(b,a){if(a.at[1]!=="center"){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();var g=a.my[1]==="top"?-a.elemHeight:a.my[1]==="bottom"?a.elemHeight:0,e=a.at[1]==="top"?a.targetHeight:-a.targetHeight,h=-2*a.offset[1];b.top+=a.collisionPosition.top<0?g+e+h:d>0?g+e+h:0}}}};if(!c.offset.setOffset){c.offset.setOffset=function(b,a){if(/static/.test(c.curCSS(b,"position")))b.style.position="relative";var d=c(b),
+g=d.offset(),e=parseInt(c.curCSS(b,"top",true),10)||0,h=parseInt(c.curCSS(b,"left",true),10)||0;g={top:a.top-g.top+e,left:a.left-g.left+h};"using"in a?a.using.call(b,g):d.css(g)};c.fn.offset=function(b){var a=this[0];if(!a||!a.ownerDocument)return null;if(b)return this.each(function(){c.offset.setOffset(this,b)});return u.call(this)}}})(jQuery);
--- /dev/null
+++ b/js/jquery.ui.widget.min.js
@@ -1,1 +1,16 @@
+/*!
+ * jQuery UI Widget 1.8.12
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Widget
+ */
+(function(b,j){if(b.cleanData){var k=b.cleanData;b.cleanData=function(a){for(var c=0,d;(d=a[c])!=null;c++)b(d).triggerHandler("remove");k(a)}}else{var l=b.fn.remove;b.fn.remove=function(a,c){return this.each(function(){if(!c)if(!a||b.filter(a,[this]).length)b("*",this).add([this]).each(function(){b(this).triggerHandler("remove")});return l.call(b(this),a,c)})}}b.widget=function(a,c,d){var e=a.split(".")[0],f;a=a.split(".")[1];f=e+"-"+a;if(!d){d=c;c=b.Widget}b.expr[":"][f]=function(h){return!!b.data(h,
+a)};b[e]=b[e]||{};b[e][a]=function(h,g){arguments.length&&this._createWidget(h,g)};c=new c;c.options=b.extend(true,{},c.options);b[e][a].prototype=b.extend(true,c,{namespace:e,widgetName:a,widgetEventPrefix:b[e][a].prototype.widgetEventPrefix||a,widgetBaseClass:f},d);b.widget.bridge(a,b[e][a])};b.widget.bridge=function(a,c){b.fn[a]=function(d){var e=typeof d==="string",f=Array.prototype.slice.call(arguments,1),h=this;d=!e&&f.length?b.extend.apply(null,[true,d].concat(f)):d;if(e&&d.charAt(0)==="_")return h;
+e?this.each(function(){var g=b.data(this,a),i=g&&b.isFunction(g[d])?g[d].apply(g,f):g;if(i!==g&&i!==j){h=i;return false}}):this.each(function(){var g=b.data(this,a);g?g.option(d||{})._init():b.data(this,a,new c(d,this))});return h}};b.Widget=function(a,c){arguments.length&&this._createWidget(a,c)};b.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",options:{disabled:false},_createWidget:function(a,c){b.data(c,this.widgetName,this);this.element=b(c);this.options=b.extend(true,{},this.options,
+this._getCreateOptions(),a);var d=this;this.element.bind("remove."+this.widgetName,function(){d.destroy()});this._create();this._trigger("create");this._init()},_getCreateOptions:function(){return b.metadata&&b.metadata.get(this.element[0])[this.widgetName]},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName);this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+"-disabled ui-state-disabled")},
+widget:function(){return this.element},option:function(a,c){var d=a;if(arguments.length===0)return b.extend({},this.options);if(typeof a==="string"){if(c===j)return this.options[a];d={};d[a]=c}this._setOptions(d);return this},_setOptions:function(a){var c=this;b.each(a,function(d,e){c._setOption(d,e)});return this},_setOption:function(a,c){this.options[a]=c;if(a==="disabled")this.widget()[c?"addClass":"removeClass"](this.widgetBaseClass+"-disabled ui-state-disabled").attr("aria-disabled",c);return this},
+enable:function(){return this._setOption("disabled",false)},disable:function(){return this._setOption("disabled",true)},_trigger:function(a,c,d){var e=this.options[a];c=b.Event(c);c.type=(a===this.widgetEventPrefix?a:this.widgetEventPrefix+a).toLowerCase();d=d||{};if(c.originalEvent){a=b.event.props.length;for(var f;a;){f=b.event.props[--a];c[f]=c.originalEvent[f]}}this.element.trigger(c,d);return!(b.isFunction(e)&&e.call(this.element[0],c,d)===false||c.isDefaultPrevented())}}})(jQuery);
--- /dev/null
+++ b/labs/OpenStreetMap.js
@@ -1,1 +1,165 @@
+/**
+ * Namespace: Util.OSM
+ */
+OpenLayers.Util.OSM = {};
+/**
+ * Constant: MISSING_TILE_URL
+ * {String} URL of image to display for missing tiles
+ */
+OpenLayers.Util.OSM.MISSING_TILE_URL = "/404.php";
+
+/**
+ * Property: originalOnImageLoadError
+ * {Function} Original onImageLoadError function.
+ */
+OpenLayers.Util.OSM.originalOnImageLoadError = OpenLayers.Util.onImageLoadError;
+
+/**
+ * Function: onImageLoadError
+ */
+OpenLayers.Util.onImageLoadError = function() {
+ if (this.src.match(/^http:\/\/[abc]\.[a-z]+\.openstreetmap\.org\//)) {
+ this.src = OpenLayers.Util.OSM.MISSING_TILE_URL;
+ } else if (this.src.match(/^http:\/\/[def]\.tah\.openstreetmap\.org\//)) {
+ // do nothing - this layer is transparent
+ } else {
+ OpenLayers.Util.OSM.originalOnImageLoadError;
+ }
+};
+
+/**
+ * Class: OpenLayers.Layer.OSM.Mapnik
+ *
+ * Inherits from:
+ * - <OpenLayers.Layer.OSM>
+ */
+OpenLayers.Layer.OSM.Mapnik = OpenLayers.Class(OpenLayers.Layer.OSM, {
+ /**
+ * Constructor: OpenLayers.Layer.OSM.Mapnik
+ *
+ * Parameters:
+ * name - {String}
+ * options - {Object} Hashtable of extra options to tag onto the layer
+ */
+ initialize: function(name, options) {
+ var url = [
+ "http://a.tiles.bigtincan.com/${z}/${x}/${y}.png",
+ "http://b.tiles.bigtincan.com/${z}/${x}/${y}.png",
+ "http://c.tiles.bigtincan.com/${z}/${x}/${y}.png"
+ ];
+ options = OpenLayers.Util.extend({ numZoomLevels: 19 }, options);
+ var newArguments = [name, url, options];
+ OpenLayers.Layer.OSM.prototype.initialize.apply(this, newArguments);
+ },
+
+ CLASS_NAME: "OpenLayers.Layer.OSM.Mapnik"
+});
+
+OpenLayers.Layer.OSM.NearMap = OpenLayers.Class(OpenLayers.Layer.OSM, {
+ /**
+ * Constructor: OpenLayers.Layer.OSM.Mapnik
+ *
+ * Parameters:
+ * name - {String}
+ * options - {Object} Hashtable of extra options to tag onto the layer
+ */
+ initialize: function(name, options) {
+ var url = [
+ "http://nearmap:findreality@web0.nearmap.com/maps/hl=en&nml=Vert&x=${x}&y=${y}&z=${z}",
+ "http://nearmap:findreality@web1.nearmap.com/maps/hl=en&nml=Vert&x=${x}&y=${y}&z=${z}",
+ "http://nearmap:findreality@web2.nearmap.com/maps/hl=en&nml=Vert&x=${x}&y=${y}&z=${z}",
+ "http://nearmap:findreality@web3.nearmap.com/maps/hl=en&nml=Vert&x=${x}&y=${y}&z=${z}"
+ ];
+ options = OpenLayers.Util.extend({ numZoomLevels: 22 }, options);
+ var newArguments = [name, url, options];
+ OpenLayers.Layer.OSM.prototype.initialize.apply(this, newArguments);
+ },
+
+ CLASS_NAME: "OpenLayers.Layer.OSM.NearMap"
+});
+
+/**
+ * Class: OpenLayers.Layer.OSM.Osmarender
+ *
+ * Inherits from:
+ * - <OpenLayers.Layer.OSM>
+ */
+OpenLayers.Layer.OSM.Osmarender = OpenLayers.Class(OpenLayers.Layer.OSM, {
+ /**
+ * Constructor: OpenLayers.Layer.OSM.Osmarender
+ *
+ * Parameters:
+ * name - {String}
+ * options - {Object} Hashtable of extra options to tag onto the layer
+ */
+ initialize: function(name, options) {
+ var url = [
+ "http://a.tah.openstreetmap.org/Tiles/tile/${z}/${x}/${y}.png",
+ "http://b.tah.openstreetmap.org/Tiles/tile/${z}/${x}/${y}.png",
+ "http://c.tah.openstreetmap.org/Tiles/tile/${z}/${x}/${y}.png"
+ ];
+ options = OpenLayers.Util.extend({ numZoomLevels: 18 }, options);
+ var newArguments = [name, url, options];
+ OpenLayers.Layer.OSM.prototype.initialize.apply(this, newArguments);
+ },
+
+ CLASS_NAME: "OpenLayers.Layer.OSM.Osmarender"
+});
+
+/**
+ * Class: OpenLayers.Layer.OSM.CycleMap
+ *
+ * Inherits from:
+ * - <OpenLayers.Layer.OSM>
+ */
+OpenLayers.Layer.OSM.CycleMap = OpenLayers.Class(OpenLayers.Layer.OSM, {
+ /**
+ * Constructor: OpenLayers.Layer.OSM.CycleMap
+ *
+ * Parameters:
+ * name - {String}
+ * options - {Object} Hashtable of extra options to tag onto the layer
+ */
+ initialize: function(name, options) {
+ var url = [
+ "http://a.andy.sandbox.cloudmade.com/tiles/cycle/${z}/${x}/${y}.png",
+ "http://b.andy.sandbox.cloudmade.com/tiles/cycle/${z}/${x}/${y}.png",
+ "http://c.andy.sandbox.cloudmade.com/tiles/cycle/${z}/${x}/${y}.png"
+ ];
+ options = OpenLayers.Util.extend({ numZoomLevels: 19 }, options);
+ var newArguments = [name, url, options];
+ OpenLayers.Layer.OSM.prototype.initialize.apply(this, newArguments);
+ },
+
+ CLASS_NAME: "OpenLayers.Layer.OSM.CycleMap"
+});
+
+/**
+ * Class: OpenLayers.Layer.OSM.Maplint
+ *
+ * Inherits from:
+ * - <OpenLayers.Layer.OSM>
+ */
+OpenLayers.Layer.OSM.Maplint = OpenLayers.Class(OpenLayers.Layer.OSM, {
+ /**
+ * Constructor: OpenLayers.Layer.OSM.Maplint
+ *
+ * Parameters:
+ * name - {String}
+ * options - {Object} Hashtable of extra options to tag onto the layer
+ */
+ initialize: function(name, options) {
+ var url = [
+ "http://d.tah.openstreetmap.org/Tiles/maplint/${z}/${x}/${y}.png",
+ "http://e.tah.openstreetmap.org/Tiles/maplint/${z}/${x}/${y}.png",
+ "http://f.tah.openstreetmap.org/Tiles/maplint/${z}/${x}/${y}.png"
+ ];
+ options = OpenLayers.Util.extend({ numZoomLevels: 18, isBaseLayer: false, visibility: false }, options);
+ var newArguments = [name, url, options];
+ OpenLayers.Layer.OSM.prototype.initialize.apply(this, newArguments);
+ },
+
+ CLASS_NAME: "OpenLayers.Layer.OSM.Maplint"
+});
+
--- /dev/null
+++ b/labs/busstopdensity.php
@@ -1,1 +1,78 @@
+<?php
+include ('../include/common.inc.php');
+//include_header("Bus Stop Density", "busstopdensity")
+?>
+<style type="text/css">
+
+ #map_container{
+ width:100%;
+ height:100%;
+ }
+ #status, #legend {
+ background-color: #eeeeee;
+ padding: 3px 5px 3px 5px;
+ opacity: .9;
+ }
+ </style>
+
+ <div id="map_container"></div>
+ <div id="status">
+ Status: <span id="log"> <img alt="progess bar" src="progress_bar.gif" width="150" height="16"/></span>
+ </div>
+ <script type="text/javascript" src="http://www.google.com/jsapi?autoload={%22modules%22:[{%22name%22:%22maps%22,version:3,other_params:%22sensor=false%22},{%22name%22:%22jquery%22,%22version%22:%221.4.2%22}]}"></script>
+ <script type="text/javascript">
+ //<![CDATA[
+ //Google Map API v3
+
+ var googleMap = null;
+ var previousPos = null;
+
+ $(function($){//Called when page is loaded
+ googleMap = new google.maps.Map(document.getElementById("map_container"), {
+ zoom: 17,
+ minZoom: 12,
+ center: new google.maps.LatLng(-35.25,149.125),
+ mapTypeId: google.maps.MapTypeId.SATELLITE});
+ //Set status bar
+ googleMap.controls[google.maps.ControlPosition.TOP_LEFT].push($("#status").get(0));
+ //Set legend
+ googleMap.controls[google.maps.ControlPosition.BOTTOM_LEFT].push($("#legend").get(0));
+
+ google.maps.event.addListener(googleMap, "zoom_changed", function(){
+ google.maps.event.trigger(googleMap, "mousemove", previousPos);
+ });//onzoomend
+
+ //Add a listener when mouse moves
+ google.maps.event.addListener(googleMap, "mousemove", function(event){
+ var latLng = event.latLng;
+ var xy = googleMap.getProjection().fromLatLngToPoint(latLng);
+ var ratio = Math.pow(2,googleMap.getZoom());
+ $("#log").html("Zoom:" + googleMap.getZoom() + " WGS84:(" + latLng.lat().toFixed(5) + ", " + latLng.lng().toFixed(5) + ") Px:(" + Math.floor(xy.x * ratio) + "," + Math.floor(xy.y *ratio) + ")");
+ previousPos = event;
+ });//onmouseover
+
+ //Add a listener when mouse leaves the map area
+ google.maps.event.addListener(googleMap, "mouseout", function(event){
+ $("#log").html("");
+ });//onmouseout
+
+ //Add tile overlay
+ var myOverlay = new google.maps.ImageMapType({
+ getTileUrl: function(coord, zoom) {
+ return 'busstopdensity.tile.php?x=' + coord.x + '&y=' + coord.y + '&zoom=' +zoom;
+ },
+ tileSize: new google.maps.Size(256, 256),
+ isPng: true,
+ opacity:1.0
+ });
+ googleMap.overlayMapTypes.insertAt(0, myOverlay);
+ $("#log").html("Map loaded!");
+ });//onload
+ //]]>
+ </script>
+<?php
+include_footer()
+?>
+
+
--- /dev/null
+++ b/labs/busstopdensity.tile.php
@@ -1,1 +1,124 @@
+<?php
+include ('../include/common.inc.php');
+$debugOkay = Array();
+/*
+*DISCLAIMER
+* http://blog.gmapify.fr/create-beautiful-tiled-heat-maps-with-php-and-gd
+*THIS SOFTWARE IS PROVIDED BY THE AUTHOR 'AS IS' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES *OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, *INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF *USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT *(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+*
+* @author: Olivier G. <olbibigo_AT_gmail_DOT_com>
+* @version: 1.0
+* @history:
+* 1.0 creation
+*/
+ set_time_limit(120);//2mn
+ ini_set('memory_limit', '256M');
+error_reporting(E_ALL ^ E_DEPRECATED);
+ require_once ('lib/GoogleMapUtility.php');
+ require_once ('lib/HeatMap.php');
+
+ //Root folder to store generated tiles
+ define('TILE_DIR', 'tiles/');
+ //Covered geographic areas
+ define('MIN_LAT', -35.48);
+ define('MAX_LAT', -35.15);
+ define('MIN_LNG', 148.98);
+ define('MAX_LNG', 149.25);
+ define('TILE_SIZE_FACTOR', 0.5);
+ define('SPOT_RADIUS', 30);
+ define('SPOT_DIMMING_LEVEL', 50);
+
+ //Input parameters
+ if(isset($_GET['x']))
+ $X = (int)$_GET['x'];
+ else
+ exit("x missing");
+ if(isset($_GET['y']))
+ $Y = (int)$_GET['y'];
+ else
+ exit("y missing");
+ if(isset($_GET['zoom']))
+ $zoom = (int)$_GET['zoom'];
+ else
+ exit("zoom missing");
+if ($zoom < 12) { //enforce minimum zoom
+ header('Content-type: image/png');
+ echo file_get_contents(TILE_DIR.'empty.png');
+}
+ $dir = TILE_DIR.$zoom;
+ $tilename = $dir.'/'.$X.'_'.$Y.'.png';
+ //HTTP headers (data type and caching rule)
+ header("Cache-Control: must-revalidate");
+ header("Expires: " . gmdate("D, d M Y H:i:s", time() + 86400) . " GMT");
+ if(!file_exists($tilename)){
+ $rect = GoogleMapUtility::getTileRect($X, $Y, $zoom);
+ //A tile can contain part of a spot with center in an adjacent tile (overlaps).
+ //Knowing the spot radius (in pixels) and zoom level, a smart way to process tiles would be to compute the box (in decimal degrees) containing only spots that can be drawn on current tile. We choose a simpler solution by increeasing geo bounds by 2*TILE_SIZE_FACTOR whatever the zoom level and spot radius.
+ $extend_X = $rect->width * TILE_SIZE_FACTOR;//in decimal degrees
+ $extend_Y = $rect->height * TILE_SIZE_FACTOR;//in decimal degrees
+ $swlat = $rect->y - $extend_Y;
+ $swlng = $rect->x - $extend_X;
+ $nelat = $swlat + $rect->height + 2 * $extend_Y;
+ $nelng = $swlng + $rect->width + 2 * $extend_X;
+
+ if( ($nelat <= MIN_LAT) || ($swlat >= MAX_LAT) || ($nelng <= MIN_LNG) || ($swlng >= MAX_LNG)){
+ //No geodata so return generic empty tile
+ echo file_get_contents(TILE_DIR.'empty.png');
+ exit();
+ }
+
+ //Get McDonald's spots
+ $spots = fGetPOI('Select * from stops where
+ (stop_lon > '.$swlng.' AND stop_lon < '.$nelng.')
+ AND (stop_lat < '.$nelat.' AND stop_lat > '.$swlat.')', $im, $X, $Y, $zoom, SPOT_RADIUS);
+
+
+ if(empty($spots)){
+ //No geodata so return generic empty tile
+ header('Content-type: image/png');
+ echo file_get_contents(TILE_DIR.'empty.png');
+ }else{
+ if(!file_exists($dir)){
+ mkdir($dir, 0705);
+ }
+ //All the magics is in HeatMap class :)
+ $im = HeatMap::createImage($spots, GoogleMapUtility::TILE_SIZE, GoogleMapUtility::TILE_SIZE, heatMap::$WITH_ALPHA, SPOT_RADIUS, SPOT_DIMMING_LEVEL, HeatMap::$GRADIENT_FIRE);
+ //Store tile for reuse and output it
+ header('content-type:image/png;');
+ imagepng($im, $tilename);
+ echo file_get_contents($tilename);
+ imagedestroy($im);
+ unset($im);
+ }
+ }else{
+ //Output stored tile
+ header('content-type:image/png;');
+ echo file_get_contents($tilename);
+ }
+ /////////////
+ //Functions//
+ /////////////
+ function fGetPOI($query, &$im, $X, $Y, $zoom, $offset){
+ global $conn;
+ $nbPOIInsideTile = 0;
+
+ $result = pg_query($conn, $query);
+ $spots = Array();
+ if (!$result) {
+ databaseError(pg_result_error($result));
+ return Array();
+ }
+ foreach( pg_fetch_all($result) as $row){
+ $point = GoogleMapUtility::getOffsetPixelCoords($row['stop_lat'], $row['stop_lon'], $zoom, $X, $Y);
+ //Count result only in the tile
+ if( ($point->x > -$offset) && ($point->x < (GoogleMapUtility::TILE_SIZE+$offset)) && ($point->y > -$offset) && ($point->y < (GoogleMapUtility::TILE_SIZE+$offset))){
+ $spots[] = new HeatMapPoint($point->x, $point->y);
+ }
+
+ }//while
+ return $spots;
+ }//fAddPOI
+?>
+
+
--- /dev/null
+++ b/labs/googlemaps.php
@@ -1,1 +1,29 @@
-
+<!DOCTYPE html>
+<html>
+<head>
+<meta name="viewport" content="initial-scale=1.0, user-scalable=no" />
+<style type="text/css">
+ html { height: 100% }
+ body { height: 100%; margin: 0px; padding: 0px }
+ #map_canvas { height: 100% }
+</style>
+<script type="text/javascript"
+ src="http://maps.google.com/maps/api/js?sensor=false">
+</script>
+<script type="text/javascript">
+ function initialize() {
+ var latlng = new google.maps.LatLng(-35.25, 149.125);
+ var myOptions = {
+ zoom: 10,
+ center: latlng,
+ mapTypeId: google.maps.MapTypeId.ROADMAP
+ };
+ var map = new google.maps.Map(document.getElementById("map_canvas"),
+ myOptions);
+ }
+</script>
+</head>
+<body onload="initialize()">
+ <div id="map_canvas" style="width:100%; height:100%"></div>
+</body>
+</html>
Binary files /dev/null and b/labs/gradient/classic.png differ
Binary files /dev/null and b/labs/gradient/fire.png differ
Binary files /dev/null and b/labs/gradient/pgaitch.png differ
--- /dev/null
+++ b/labs/index.php
@@ -1,1 +1,31 @@
+<?php
+include ('../include/common.inc.php');
+include_header("Busness R&D", "index")
+?>
+ <ul data-role="listview" data-theme="e" data-groupingtheme="e">
+ <li data-role="list-divider" > Experimental Features </li>
+ <li><a href="mywaybalance.php"><h3>MyWay Balance for mobile</h3>
+ <p>Mobile viewer for MyWay balance. Warning! No HTTPS security.</p></a></li>
+ <li><a href="busstopdensity.php"><h3>Bus Stop Density Map</h3>
+ <p>Analysis of bus stop coverage</p></a></li>
+ <li><a href="stopBrowser.php"><h3>Bus Stop Browser Map</h3>
+ <p>Bus stop location/route browser</p></a></li>
+ </ul>
+ <ul data-role="listview" data-theme="e" data-groupingtheme="e">
+ <li data-role="list-divider" > MyWay Timeliness Graphs </li>
+ <li><a href="myway_timeliness.php"><h3>Timeliness over Day</h3>
+ <p>Displays the deviation from the timetable over the day</p></a></li>
+ <li><a href="myway_timeliness_freqdist.php"><h3>Frequency Distribution of Time Deviation</h3>
+ <p>Displays spread of time deviations</p></a></li>
+ <!--<li><a href="myway_timeliness_route.php"><h3>Timeliness over Route</h3>
+ <p>Displays the deviation from timetable as a specific route progresses</p></a></li>
+ <li><a href="myway_timeliness_stop.php"><h3>Timeliness at Stop</h3>
+ <p>Displays the deviation from the timetable at a specific stop</p></a></li>
+ --></ul>
+ </div>
+<?php
+include_footer()
+?>
+
+
--- /dev/null
+++ b/labs/myway_api.json.php
@@ -1,1 +1,141 @@
+<?php
+function cleanString($subject)
+{
+ $subject = str_replace(" ", " ", $subject);
+ $subject = str_replace("&", "&", $subject);
+ $subject = preg_replace('/[^\r\n\t\x20-\x7E\xA0-\xFF]/', '', $subject);
+ $subject = str_replace(" ", " ", $subject);
+ return trim($subject);
+}
+$return = Array();
+/*if (file_exists("mywayresponse.txt")) {
+ @$fh = fopen("mywayresponse.txt", 'r');
+ if ($fh) {
+ $pageHTML = fread($fh, filesize("mywayresponse.txt"));
+ fclose($fh);
+ }
+}*/
+//set POST variables
+$url = 'https://www.action.act.gov.au/ARTS/use_Funcs.asp';
+//$url = 'http://localhost/myway.htm';
+$field_mapping = Array(
+ "card_number" => "SRNO",
+ "DOBmonth" => "month",
+ "DOBday" => "day",
+ "DOByear" => "year",
+ "secret_answer" => "pwrd",
+ "button" => "Submit"
+);
+foreach (Array(
+ "card_number",
+ "DOBday",
+ "DOBmonth",
+ "DOByear"
+) as $field_name) {
+ if (isset($_REQUEST[$field_name])) {
+ $fields[$field_name] = filter_var($_REQUEST[$field_name], FILTER_SANITIZE_NUMBER_INT);
+ }
+ else {
+ $return["error"][] = $field_name. " parameter invalid or unspecified";
+ }
+}
+if (isset($_REQUEST['secret_answer'])) {
+ $fields['secret_answer'] = filter_var($_REQUEST['secret_answer'], FILTER_SANITIZE_STRING, Array(
+ FILTER_FLAG_NO_ENCODE_QUOTES,
+ FILTER_FLAG_STRIP_HIGH,
+ FILTER_FLAG_STRIP_LOW
+ ));
+}
+else {
+ $return["error"][] = "secret_answer parameter invalid or unspecified";
+}
+$fields['button'] = 'Submit';
+$fields_string = "";
+//url-ify the data for the POST
+foreach ($fields as $key => $value) {
+ if (sizeof($value) === 0) $return['error'][] = $key . " parameter invalid or unspecified";
+ $fields_string.= $field_mapping[$key] . '=' . $value . '&';
+}
+$fields_string = rtrim($fields_string, '&');
+if (!isset($return['error'])) {
+ //open connection
+ $ch = curl_init();
+ //set the url, number of POST vars, POST data
+ curl_setopt($ch, CURLOPT_URL, $url);
+ curl_setopt($ch, CURLOPT_POST, count($fields));
+ curl_setopt($ch, CURLOPT_POSTFIELDS, $fields_string);
+ curl_setopt($ch, CURLOPT_RETURNTRANSFER, 1);
+ curl_setopt($ch, CURLOPT_REFERER, "https://www.action.act.gov.au/ARTS/getbalance.asp");
+ curl_setopt($ch, CURLOPT_HEADER, 0);
+ curl_setopt($ch, CURLOPT_TIMEOUT, 30);
+ //execute post
+ $pageHTML = curl_exec($ch);
+ if (curl_errno($ch)) $return["error"][] = "Network error " . curl_errno($ch) . " " . curl_error($ch) . " " . $url . $fields_string;
+ //close connection
+ curl_close($ch);
+}
+if (!isset($return['error'])) {
+ include_once ('../lib/simple_html_dom.php');
+ //print_r($pageHTML);
+ $page = str_get_html($pageHTML);
+ $pageAlerts = $page->find(".smartCardAlert");
+ if (sizeof($pageAlerts) > 0) {
+ $return['error'][] = $pageAlerts[0]->plaintext;
+ }
+ if (!isset($return['error'])) {
+ $tableNum = 0;
+ $tableName = Array(
+ 1 => "myway_carddetails",
+ 2 => "myway_transactions"
+ );
+ foreach ($page->find("table") as $table) {
+ $tableNum++;
+ $tableColumns = Array();
+ $tableColumnNum = 0;
+ foreach ($table->find("th") as $th) {
+ $tableColumns[$tableColumnNum] = cleanString($th->plaintext);
+ $tableColumnNum++;
+ }
+ //print_r($tableColumns);
+ $tableRowNum = 0;
+ foreach ($table->find("tr") as $tr) {
+ $tableColumnNum = 0;
+ foreach ($tr->find("td") as $td) {
+ if ($tableNum == 1) {
+ // first table has card/cardholder details
+ $return[$tableName[$tableNum]][$tableColumns[$tableColumnNum]] = cleanString($td->plaintext);
+ } else {
+ // second table has transactions
+
+ if ($tableColumns[$tableColumnNum] == "TX Reference No / Type") {
+ $return[$tableName[$tableNum]][$tableRowNum]["TX Reference No"] = substr(cleanString($td->plaintext), 0,6);
+ $return[$tableName[$tableNum]][$tableRowNum]["TX Type"] = substr(cleanString($td->plaintext), 7);
+ } else {
+ $return[$tableName[$tableNum]][$tableRowNum][$tableColumns[$tableColumnNum]] = cleanString($td->plaintext);
+ }
+ }
+ //print_r($return);
+ $tableColumnNum++;
+ }
+ $tableRowNum++;
+ }
+ }
+ }
+}
+if (sizeof($return) == 0) {
+$return['error'][] = "No data extracted from MyWay website - API may be out of date";
+}
+
+header('Content-Type: text/javascript; charset=utf8');
+// header('Access-Control-Allow-Origin: http://bus.lambdacomplex.org/');
+header('Access-Control-Max-Age: 3628800');
+header('Access-Control-Allow-Methods: GET, POST, PUT, DELETE');
+if (isset($_GET['callback'])) {
+ $json = '(' . json_encode($return) . ');'; //must wrap in parens and end with semicolon
+ print_r($_GET['callback'] . $json); //callback is prepended for json-p
+
+}
+else echo json_encode($return);
+?>
+
--- /dev/null
+++ b/labs/myway_timeliness.php
@@ -1,1 +1,118 @@
+<?php
+include ('../include/common.inc.php');
+include_header("MyWay Deltas", "mywayDelta");
+?>
+ <!--[if lte IE 8]><script language="javascript" type="text/javascript" src="../js/flot/excanvas.min.js"></script><![endif]-->
+
+ <script language="javascript" type="text/javascript" src="../js/flot/jquery.flot.js"></script>
+ <center><div id="placeholder" style="width:900px;height:550px"></div></center>
+<script type="text/javascript">
+$(function () {
+ var d = new Date();
+ d.setUTCMinutes(0);
+ d.setUTCHours(0);
+ var midnight = d.getTime();
+
+<?php
+$query = "select * from myway_timingdeltas where abs(timing_delta) < 2*(select stddev(timing_delta) from myway_timingdeltas) order by route_full_name;";
+$query = $conn->prepare($query);
+$query->execute();
+if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+}
+$i = 0;
+$labels = Array();
+$lastRoute = "";
+foreach ($query->fetchAll() as $delta) {
+ $routeName = $delta['route_full_name'];
+ if (strstr($routeName, " 3")) $routeName = "312-319";
+ else $routeName = preg_replace('/\D/', '', $routeName);
+ if ($routeName != $lastRoute) {
+ $i++;
+ echo " var d$i = [];";
+ $lastRoute = $routeName;
+ $labels[$i] = $routeName;
+ }
+ echo "d$i.push([ midnight+ (1000*" . midnight_seconds(strtotime($delta['time'])) . "), ".intval($delta['timing_delta'])."]); \n";
+};
+?>
+
+ var placeholder = $("#placeholder");
+
+ var plot = $.plot(placeholder, [
+<?php
+foreach ($labels as $key => $label) {
+ echo " {
+ data: d$key,
+ points: { show: true },
+ label: '$label'
+ },";
+}
+?>
+ ],
+ {
+ xaxis: {
+ mode: "time",
+ min: midnight + (1000*60*60*8),
+ max: midnight + (1000*60*60*23.5)
+ },
+ yaxis: {
+ tickFormatter: yformatter
+ },
+ grid: { hoverable: true, clickable: true, labelMargin: 32 },
+ });
+ var o;
+ o = plot.pointOffset({ x: midnight+ (9*60*60*1000), y: -1.2});
+ placeholder.append('<div style="position:absolute;left:' + (o.left + 4) + 'px;top:' + o.top + 'px;color:#666;font-size:smaller">9am</div>');
+ o = plot.pointOffset({ x: midnight+ (16*60*60*1000), y: -1.2});
+ placeholder.append('<div style="position:absolute;left:' + (o.left + 4) + 'px;top:' + o.top + 'px;color:#666;font-size:smaller">4pm</div>');
+
+ });
+function yformatter(v) {
+ if (Math.floor(v/60) < -9) return "";
+ return Math.abs(Math.floor(v/60)) + " min " + (v == 0 ? "" : (v >0 ? "early":"late"))
+}
+ function showTooltip(x, y, contents) {
+ $('<div id="tooltip">' + contents + '</div>').css( {
+ position: 'absolute',
+ display: 'none',
+ top: y + 5,
+ left: x + 5,
+ border: '1px solid #fdd',
+ padding: '2px',
+ 'background-color': '#fee',
+ opacity: 0.80
+ }).appendTo("body").fadeIn(200);
+ }
+
+ var previousPoint = null;
+ $("#placeholder").bind("plothover", function (event, pos, item) {
+ $("#x").text(pos.x.toFixed(2));
+ $("#y").text(pos.y.toFixed(2));
+
+ if (item) {
+ if (previousPoint != item.dataIndex) {
+ previousPoint = item.dataIndex;
+
+ $("#tooltip").remove();
+ var x = item.datapoint[0].toFixed(2),
+ y = item.datapoint[1].toFixed(2);
+
+ var d = new Date();
+d.setTime(x);
+var time = d.getUTCHours() +':'+ (d.getUTCMinutes().toString().length == 1 ? '0'+ d.getMinutes(): d.getUTCMinutes())
+
+
+ showTooltip(item.pageX, item.pageY,
+ item.series.label + " at "+ time +" = " + Math.abs(new Number(y/60).toFixed(2))+" minutes "+(y >0 ? "early":"late"));
+ }
+ }
+ else {
+ $("#tooltip").remove();
+ previousPoint = null;
+ }
+ });
+
+</script>
--- /dev/null
+++ b/labs/myway_timeliness_calculate.php
@@ -1,1 +1,134 @@
+<?php
+include ('../include/common.inc.php');
+include_header("MyWay Delta Calculate", "mywayDeltaCalc");
+function abssort($a, $b)
+{
+ if ($a['timeDiff'] == $b['timeDiff']) {
+ return 0;
+ }
+ return (abs($a['timeDiff']) < abs($b['timeDiff'])) ? -1 : 1;
+}
+//collect all observation not in delta
+$query = "select * from myway_observations INNER JOIN myway_stops
+ON myway_observations.myway_stop=myway_stops.myway_stop INNER JOIN myway_routes
+ON myway_observations.myway_route=myway_routes.myway_route
+ WHERE observation_id NOT IN
+(
+SELECT observation_id
+FROM myway_timingdeltas
+)";
+debug($query, "database");
+$query = $conn->prepare($query);
+$query->execute();
+if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+}
+$uncalcdObservations = $query->fetchAll();
+//Display count
+echo "<h3>" . sizeof($uncalcdObservations) . " observations not yet processed</h2>";
+//foreach observation not in delta
+foreach ($uncalcdObservations as $obsv) {
+ //var_dump($obsv);
+ echo "<h3>Observation {$obsv['observation_id']}:</h1>
+<small>{$obsv['myway_stop']} @ {$obsv['time']} on {$obsv['myway_route']}</small><br>";
+ if ($obsv["stop_code"] == "") {
+ echo "error, stop '{$obsv['myway_stop']}' unknown";
+ continue;
+ }
+ if ($obsv["route_full_name"] == "") {
+ echo "error, route '{$obsv['myway_route']}' unknown";
+ continue;
+ }
+ // :convert timestamp into time of day and date
+ $time = date("H:i:s", strtotime($obsv['time']));
+ $search_time = date("H:i:s", strtotime($obsv['time'])-(30*60)); // 30 minutes margin
+ $date = date("c", strtotime($obsv['time']));
+ $timing_period = service_period(strtotime($date));
+ $potentialStops = getStopsByStopCode($obsv["stop_code"], $obsv["stop_street"]);
+ //:get myway_stops records
+ //:search by starts with stopcode and starts with street if street is not null
+ //no result, skip and display error
+ if (sizeof($potentialStops) < 1) {
+ echo "error, potential stops for stopcode {$obsv["stop_code"]} street {$obsv["stop_street"]} unknown";
+ continue;
+ }
+ //print out stops
+ echo "Matched stops: ";
+ foreach ($potentialStops as $potentialStop) echo $potentialStop['stop_code'] . " ";
+ echo "<br>";
+ //:get myway_route record
+ //no result, skip and display error
+ //print out route
+ $potentialRoute = getRouteByFullName($obsv["route_full_name"]);
+ if ($potentialRoute["route_short_name"] == "") {
+ echo "error, route '{$obsv["route_full_name"]}' unknown";
+ continue;
+ }
+ echo "Matched route: {$potentialRoute['route_short_name']}{$potentialRoute['route_long_name']} {$timing_period}<br>";
+ $timeDeltas = Array();
+ foreach ($potentialStops as $potentialStop) {
+ $stopRoutes = getStopRoutes($potentialStop['stop_id'], $timing_period);
+ $foundRoute = Array();
+ foreach ($stopRoutes as $stopRoute) {
+ //Check if this route stops at each stop
+ if ($stopRoute['route_short_name'] . $stopRoute['route_long_name'] == $obsv["route_full_name"]) {
+ echo "Matching route {$stopRoute['route_id']} found at {$potentialStop['stop_code']}<br>";
+ $foundRoute = $stopRoute;
+ //if does get tripstoptimes for this route
+ $trips = getStopTrips($potentialStop['stop_id'], $timing_period, $search_time);
+ foreach ($trips as $trip) {
+ //echo $trip['route_id']." ".$stopRoute['route_id'].";";
+ if ($trip['route_id'] == $stopRoute['route_id']) {
+ $timedTrip = getTimeInterpolatedTripAtStop($trip['trip_id'], $trip['stop_sequence']);
+ $actual_time = strtotime($time);
+ $trip_time = strtotime($timedTrip['arrival_time']);
+ $timeDiff = $actual_time - $trip_time;
+ //work out time delta, put into array with index of delta
+ $timeDeltas[] = Array(
+ "timeDiff" => $timeDiff,
+ "stop_code" => $potentialStop['stop_code']
+ );
+ echo "Found trip {$trip['trip_id']} at stop {$potentialStop['stop_code']} (#{$potentialStop['stop_id']}, sequence #{$trip['stop_sequence']})<br>";
+ echo "Arriving at {$timedTrip['arrival_time']}, difference of " . round($timeDiff / 60, 2) . " minutes<br>";
+ }
+ }
+ break; // because have found route
+
+ }
+ }
+ if (sizeof($foundRoute) < 1) {
+ //print out that stops/does not stop
+ echo "No matching routes found at {$potentialStop['stop_code']}<br>";
+ var_dump($stopRoutes);
+ }
+ }
+ // lowest delta is recorded delta
+ usort($timeDeltas, "abssort");
+ $lowestDelta = $timeDeltas[0]["timeDiff"];
+ if (sizeof($timeDeltas) != 0) {
+ echo "Lowest difference of " . round($lowestDelta / 60, 2) . " minutes will be recorded for this observation<br>";
+ $observation_id = $obsv['observation_id'];
+ $route_full_name = $obsv['route_full_name'];
+ $myway_route = $obsv['myway_stop'];
+ $stop_code = $timeDeltas[0]["stop_code"];
+ $stmt = $conn->prepare("insert into myway_timingdeltas (observation_id, route_full_name, myway_route, stop_code, timing_delta, time, date, timing_period)
+ values (:observation_id, :route_full_name, :myway_route, :stop_code, :timing_delta, :time, :date, :timing_period)");
+ $stmt->bindParam(':observation_id', $observation_id);
+ $stmt->bindParam(':route_full_name', $route_full_name);
+ $stmt->bindParam(':myway_route', $myway_route);
+ $stmt->bindParam(':stop_code', $stop_code);
+ $stmt->bindParam(':timing_delta', $lowestDelta);
+ $stmt->bindParam(':time', $time);
+ $stmt->bindParam(':date', $date);
+ $stmt->bindParam(':timing_period', $timing_period);
+ // insert a record
+ $stmt->execute();
+ if ($stmt->rowCount() > 0) {
+ echo "Recorded.<br>";
+ }
+ var_dump($conn->errorInfo());
+ }
+ flush();
+}
--- /dev/null
+++ b/labs/myway_timeliness_freqdist.php
@@ -1,1 +1,78 @@
+<?php
+include ('../include/common.inc.php');
+include_header("MyWay Deltas", "mywayDelta");
+?>
+ <!--[if lte IE 8]><script language="javascript" type="text/javascript" src="../js/flot/excanvas.min.js"></script><![endif]-->
+
+ <script language="javascript" type="text/javascript" src="../js/flot/jquery.flot.js"></script>
+ <center><div id="placeholder" style="width:900px;height:550px"></div></center>
+<script type="text/javascript">
+$(function () {
+
+ var d1 = [];
+<?php
+$query = "select td, count(*) from (select (timing_delta - MOD(timing_delta,10)) as td from myway_timingdeltas where abs(timing_delta) < 2*(select stddev(timing_delta) from myway_timingdeltas)) as a group by td order by td";
+$query = $conn->prepare($query);
+$query->execute();
+if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+}
+
+foreach ($query->fetchAll() as $delta) {
+
+ echo "d1.push([ ".intval($delta['td']).", ".intval($delta['count'])."]); \n";
+};
+?>
+
+ var placeholder = $("#placeholder");
+
+ var plot = $.plot(placeholder, [
+ {
+ data: d1,
+ bars: { show: true }
+ },
+ ],
+ {
+
+ grid: { hoverable: true, clickable: true, labelMargin: 17 },
+ });
+ /* var o;
+ o = plot.pointOffset({ x: midnight+ (9*60*60*1000), y: -1.2});
+ placeholder.append('<div style="position:absolute;left:' + (o.left + 4) + 'px;top:' + o.top + 'px;color:#666;font-size:smaller">9am</div>');
+ o = plot.pointOffset({ x: midnight+ (16*60*60*1000), y: -1.2});
+ placeholder.append('<div style="position:absolute;left:' + (o.left + 4) + 'px;top:' + o.top + 'px;color:#666;font-size:smaller">4pm</div>');
+ */
+ });
+
+ /*
+ var previousPoint = null;
+ $("#placeholder").bind("plothover", function (event, pos, item) {
+ $("#x").text(pos.x.toFixed(2));
+ $("#y").text(pos.y.toFixed(2));
+
+ if (item) {
+ if (previousPoint != item.dataIndex) {
+ previousPoint = item.dataIndex;
+
+ $("#tooltip").remove();
+ var x = item.datapoint[0].toFixed(2),
+ y = item.datapoint[1].toFixed(2);
+
+ var d = new Date();
+d.setTime(x);
+var time = d.getUTCHours() +':'+ (d.getUTCMinutes().toString().length == 1 ? '0'+ d.getMinutes(): d.getUTCMinutes())
+
+
+ showTooltip(item.pageX, item.pageY,
+ item.series.label + " at "+ time +" = " + Math.abs(new Number(y/60).toFixed(2))+" minutes "+(y >0 ? "early":"late"));
+ }
+ }
+ else {
+ $("#tooltip").remove();
+ previousPoint = null;
+ }
+ });
+ */
+</script>
--- /dev/null
+++ b/labs/myway_timeliness_reconcile.php
@@ -1,1 +1,132 @@
+<?php
+include ('../include/common.inc.php');
+foreach ($_REQUEST as $key => $value) {
+ if (strstr($key, "route") && !strstr($value, "Select")) {
+ $myway_route = str_replace("route", "", $key);
+ $route_full_name = $value;
+ $query = "update myway_routes set route_full_name = :route_full_name where myway_route = :myway_route";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":myway_route", $myway_route,PDO::PARAM_STR, 5);
+ $query->bindParam(":route_full_name", $route_full_name,PDO::PARAM_STR, 42);
+ $query->execute();
+ die(print_r($conn->errorInfo() , true));
+ }
+ if (strstr($key, "myway_stop")) {
+ $myway_stop = $value;
+ $stop_code = $_REQUEST['stop_code'];
+ $stop_street = $_REQUEST['stop_street'];
+ $query = "update myway_stops set stop_code = :stop_code, stop_street = :stop_street where myway_stop = :myway_stop";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":myway_stop", $myway_stop, PDO::PARAM_STR, 25);
+ $query->bindParam(":stop_code", $stop_code, PDO::PARAM_STR, 32);
+ $query->bindParam(":stop_street", $stop_street);
+ $query->execute();
+ die(print_r($conn->errorInfo() , true));
+ }
+}
+include_header("MyWay Data Reconcile", "mywayTimeRec");
+// initialise
+$count = $conn->exec("insert into myway_stops
+ select distinct myway_stop from myway_observations
+ WHERE myway_stop NOT IN
+ (
+ SELECT myway_stop
+ FROM myway_stops
+ )");
+echo "$count new stops.<br>";
+if (!$count) {
+ print_r($conn->errorInfo());
+}
+$count = $conn->exec("insert into myway_routes select distinct myway_route from myway_observations
+ WHERE myway_route NOT IN
+ (
+ SELECT myway_route
+ FROM myway_routes
+ )");
+echo "$count new routes.<br>";
+if (!$count) {
+ print_r($conn->errorInfo());
+}
+echo "<h2>Stops</h2>";
+/*stops
+ search start of name, display map and table nuimbered, two text boxes */
+$query = "Select * from myway_stops where stop_code is NULL and stop_street is NUll;";
+debug($query, "database");
+$query = $conn->prepare($query);
+$query->execute();
+if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+}
+foreach ($query->fetchAll() as $myway_stop) {
+ echo "<h3>{$myway_stop[0]}</h3>";
+ $stopNameParts = explode(" ", $myway_stop[0]);
+ $markers = array();
+ $stopKey = 1;
+ $foundStops = getStops(false, "", $stopNameParts[0] . " " . $stopNameParts[1]);
+ if (sizeof($foundStops) > 0) {
+ echo "<table>";
+ foreach ($foundStops as $stopResult) {
+ $markers[] = array(
+ $stopResult['stop_lat'],
+ $stopResult['stop_lon']
+ );
+ echo "<tr><td>" . $stopKey++ . "</td><td>" . $stopResult['stop_name'] . "</td><td>" . $stopResult['stop_code'] . "</td></tr>";
+ }
+ echo '</table>';
+ echo "" . staticmap($markers, 0, "icong", false) . "<br>\n";
+ }
+ echo '<form id="inputform' .md5($myway_stop[0]).'">
+ <input type="hidden" name="myway_stop" value="' .$myway_stop[0].'">
+ <div data-role="fieldcontain">
+ <label for="stop_code">Stop Code</label>
+ <input type="text" name="stop_code" id="stop_code" value="' . $foundStops[0]['stop_code'] . '" />
+ </div>
+ <div data-role="fieldcontain">
+ <label for="stop_street">Stop Street </label>
+ <input type="text" name="stop_street" id="stop_street" value="' . $foundStops[0]['stop_name'] . '" />
+ </div> <input type="button" onclick="$.post(\'myway_timeliness_reconcile.php\', $(\'#inputform' .md5($myway_stop[0]) . '\').serialize())" value="Go!"></form>
+';
+ echo '<hr>';
+}
+echo '<h2>Routes</h2>';
+/*routes
+ remove alpha char, search present dropdown*/
+$query = "Select * from myway_routes where route_full_name is NUll;";
+debug($query, "database");
+$query = $conn->prepare($query);
+$query->execute();
+if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+}
+foreach ($query->fetchAll() as $myway_route) {
+ echo "<h3>{$myway_route[0]}</h3>";
+ $query = "Select * from myway_observations where myway_route = :route order by time";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":route", $myway_route[0]);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ foreach ($query->fetchAll() as $myway_obvs) {
+ echo $myway_obvs['myway_stop'] . $myway_obvs['time'] . "<br>";
+ }
+ $searchRouteNo = preg_replace("/[A-Z]/", "", $myway_route[0]);
+ echo $searchRouteNo;
+ echo '<form id="inputform' . $myway_route[0] . '">
+<select name="route' . $myway_route[0] . '" onchange=\'$.post("myway_timeliness_reconcile.php", $("#inputform' . $myway_route[0] . '").serialize())\'>
+<option>Select a from/to pair...</option>';
+ foreach (getRoutesByNumber($searchRouteNo) as $routeResult) {
+ echo "<option value=\"{$routeResult['route_short_name']}{$routeResult['route_long_name']}\"> {$routeResult['route_short_name']}{$routeResult['route_long_name']} </option>\n";
+ }
+ echo "</select></form>";
+ echo '<hr>';
+}
+include_footer();
+?>
--- /dev/null
+++ b/labs/mywaybalance.php
@@ -1,1 +1,120 @@
+<?php
+include ('../include/common.inc.php');
+include_header("MyWay Balance", "mywayBalance", false, false, true);
+echo '<div data-role="page">
+ <div data-role="header" data-position="inline">
+ <a href="' . $_SERVER["HTTP_REFERER"] . '" data-icon="arrow-l" data-rel="back" class="ui-btn-left">Back</a>
+ <h1>MyWay Balance</h1>
+ <a href="mywaybalance.php?logout=yes" data-icon="delete" class="ui-btn-right">Logout</a>
+ </div><!-- /header -->
+ <a name="maincontent" id="maincontent"></a>
+ <div data-role="content"> ';
+$return = Array();
+function logout()
+{
+ setcookie("card_number", "", time() - 60 * 60 * 24 * 100, "/");
+ setcookie("date", "", time() - 60 * 60 * 24 * 100, "/");
+ setcookie("secret_answer", "", time() - 60 * 60 * 24 * 100, "/");
+ setcookie("contribute_myway", "", time() - 60 * 60 * 24 * 100, "/");
+}
+function printBalance($mywayResult)
+{
+ if (isset($mywayResult['error'])) {
+ logout();
+ echo '<h3><font color="red">' . $mywayResult['error'][0] . "</font></h3>";
+ }
+ else {
+ echo "<h2>Balance: " . $mywayResult['myway_carddetails']['Card Balance'] . "</h2>";
+ echo '<ul data-role="listview" data-inset="true"><li data-role="list-divider"> Recent Transactions </li>';
+ $txCount = 0;
+ foreach ($mywayResult['myway_transactions'] as $transaction) {
+ echo "<li>";
+ if ($transaction["Deduction Type"] == "DEFAULT") echo '<img src="css/images/warning.png" alt="Failed to tap off: " class="ui-li-icon">';
+ echo "<b>" . $transaction["Date / Time"] . "</b>";
+ echo "<br><small>" . $transaction["Route"] . " at " . $transaction["Stop Name"] . "<br>";
+ echo $transaction["TX Reference No"] . " " . $transaction["TX Type"] . "</small>";
+ echo '<p class="ui-li-aside">' . $transaction["TX Amount"] . '</p>';
+ echo "</li>";
+ $txCount++;
+ if ($txCount > 10) break;
+ }
+ echo "</ul>";
+ }
+}
+function recordMyWayObservations($mywayResult)
+{
+ global $conn;
+ if (!isset($mywayResult['error'])) {
+ $stmt = $conn->prepare("insert into myway_observations (observation_id, myway_stop, time, myway_route)
+ values (:observation_id, :myway_stop, :time, :myway_route)");
+ $stmt->bindParam(':observation_id', $observation_hash);
+ $stmt->bindParam(':myway_stop', $myway_stop);
+ $stmt->bindParam(':time', $timestamp);
+ $stmt->bindParam(':myway_route', $myway_route);
+ // insert a record
+ $resultCount = 0;
+ foreach ($mywayResult['myway_transactions'] as $transaction) {
+ if ($transaction["Stop Name"] != "" && $transaction["Deduction Type"] != "DEFAULT") {
+ $observation_hash = md5($mywayResult['myway_carddetails']['MyWay Number'] . $transaction["TX Reference No"]);
+ $timestamp = date("c", strtotime($transaction["Date / Time"]));
+ $myway_stop = $transaction["Stop Name"];
+ $myway_route = $transaction["Route"];
+ if ($stmt->execute()) $resultCount++;
+ }
+ }
+ echo "<h3>Thanks for participating in the study! $resultCount transactions were recorded</h3>";
+ }
+}
+if (isset($_REQUEST['card_number']) && isset($_REQUEST['date']) && isset($_REQUEST['secret_answer'])) {
+ $cardNumber = $_REQUEST['card_number'];
+ $date = explode("/", $_REQUEST['date']);
+ $pwrd = $_REQUEST['secret_answer'];
+ if ($_REQUEST['remember'] == "on") {
+ setcookie("card_number", $cardNumber, time() + 60 * 60 * 24 * 100, "/");
+ setcookie("date", $_REQUEST['date'], time() + 60 * 60 * 24 * 100, "/");
+ setcookie("contribute_myway", $_REQUEST['contribute_myway'], time() + 60 * 60 * 24 * 100, "/");
+ setcookie("secret_answer", $pwrd, time() + 60 * 60 * 24 * 100, "/");
+ }
+ $mywayResult = json_decode(getPage(curPageURL() . "/myway_api.json.php?card_number=$cardNumber&DOBday={$date[0]}&DOBmonth={$date[1]}&DOByear={$date[2]}&secret_answer=$pwrd") , true);
+ if ($_REQUEST['contribute_myway'] == "on") recordMyWayObservations($mywayResult);
+ printBalance($mywayResult);
+}
+else if (isset($_REQUEST['logout'])) {
+ echo '<center><h3> Logged out of MyWay balance </h3><a href="/index.php">Back to main menu...</a><center>';
+}
+else if (isset($_COOKIE['card_number']) && isset($_COOKIE['date']) && isset($_COOKIE['secret_answer'])) {
+ $cardNumber = $_COOKIE['card_number'];
+ $date = explode("/", $_COOKIE['date']);
+ $pwrd = $_COOKIE['secret_answer'];
+ $mywayResult = json_decode(getPage(curPageURL() . "/myway_api.json.php?card_number=$cardNumber&DOBday={$date[0]}&DOBmonth={$date[1]}&DOByear={$date[2]}&secret_answer=$pwrd") , true);
+ if ($_COOKIE['contribute_myway'] == "on") recordMyWayObservations($mywayResult);
+ printBalance($mywayResult);
+}
+else {
+ $date = (isset($_REQUEST['date']) ? filter_var($_REQUEST['date'], FILTER_SANITIZE_STRING) : date("m/d/Y"));
+ echo '<form action="" method="post">
+ <div data-role="fieldcontain">
+ <label for="card_number">Card number</label>
+ <input type="text" name="card_number" id="card_number" value="' . $card_number . '" />
+ </div>
+ <div data-role="fieldcontain">
+ <label for="date"> Date of birth </label>
+ <input type="text" name="date" id="date" value="' . $date . '" />
+ </div>
+ <div data-role="fieldcontain">
+ <label for="secret_answer"> Secret question answer </label>
+ <input type="text" name="secret_answer" id="secret_answer" value="' . $secret_answer . '" />
+ </div>
+ <div data-role="fieldcontain">
+ <label for="remember"> Remember these details? </label>
+ <input type="checkbox" name="remember" id="remember" checked="yes" />
+ </div>
+ <div data-role="fieldcontain">
+ <label for="contribute_myway">Contribute MyWay records to timeliness study? </label>
+ <input type="checkbox" name="contribute_myway" id="contribute_myway" defaultChecked="no" />
+ </div>
+ <input type="submit" value="Go!"></form>';
+}
+include_footer();
+?>
--- /dev/null
+++ b/labs/openlayers/OpenLayers.js
@@ -1,1 +1,2553 @@
+/*
+ OpenLayers.js -- OpenLayers Map Viewer Library
+
+ Copyright 2005-2010 OpenLayers Contributors, released under the Clear BSD
+ license. Please see http://svn.openlayers.org/trunk/openlayers/license.txt
+ for the full text of the license.
+
+ Includes compressed code under the following licenses:
+
+ (For uncompressed versions of the code used please see the
+ OpenLayers SVN repository: <http://openlayers.org/>)
+
+*/
+
+/* Contains portions of Prototype.js:
+ *
+ * Prototype JavaScript framework, version 1.4.0
+ * (c) 2005 Sam Stephenson <sam@conio.net>
+ *
+ * Prototype is freely distributable under the terms of an MIT-style license.
+ * For details, see the Prototype web site: http://prototype.conio.net/
+ *
+ *--------------------------------------------------------------------------*/
+
+/**
+*
+* Contains portions of Rico <http://openrico.org/>
+*
+* Copyright 2005 Sabre Airline Solutions
+*
+* Licensed under the Apache License, Version 2.0 (the "License"); you
+* may not use this file except in compliance with the License. You
+* may obtain a copy of the License at
+*
+* http://www.apache.org/licenses/LICENSE-2.0
+*
+* Unless required by applicable law or agreed to in writing, software
+* distributed under the License is distributed on an "AS IS" BASIS,
+* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or
+* implied. See the License for the specific language governing
+* permissions and limitations under the License.
+*
+**/
+
+/**
+ * Contains XMLHttpRequest.js <http://code.google.com/p/xmlhttprequest/>
+ * Copyright 2007 Sergey Ilinsky (http://www.ilinsky.com)
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ * http://www.apache.org/licenses/LICENSE-2.0
+ */
+
+/**
+ * Contains portions of Gears <http://code.google.com/apis/gears/>
+ *
+ * Copyright 2007, Google Inc.
+ *
+ * Redistribution and use in source and binary forms, with or without
+ * modification, are permitted provided that the following conditions are met:
+ *
+ * 1. Redistributions of source code must retain the above copyright notice,
+ * this list of conditions and the following disclaimer.
+ * 2. Redistributions in binary form must reproduce the above copyright notice,
+ * this list of conditions and the following disclaimer in the documentation
+ * and/or other materials provided with the distribution.
+ * 3. Neither the name of Google Inc. nor the names of its contributors may be
+ * used to endorse or promote products derived from this software without
+ * specific prior written permission.
+ *
+ * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR IMPLIED
+ * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
+ * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO
+ * EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL,
+ * SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO,
+ * PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS;
+ * OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY,
+ * WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR
+ * OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF
+ * ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+ *
+ * Sets up google.gears.*, which is *the only* supported way to access Gears.
+ *
+ * Circumvent this file at your own risk!
+ *
+ * In the future, Gears may automatically define google.gears.* without this
+ * file. Gears may use these objects to transparently fix bugs and compatibility
+ * issues. Applications that use the code below will continue to work seamlessly
+ * when that happens.
+ */
+var OpenLayers={singleFile:true};(function(){var singleFile=(typeof OpenLayers=="object"&&OpenLayers.singleFile);var scriptLocation;window.OpenLayers={_scriptName:(!singleFile)?"lib/OpenLayers.js":"OpenLayers.js",_getScriptLocation:function(){if(scriptLocation!=undefined){return scriptLocation;}
+scriptLocation="";var isOL=new RegExp("(^|(.*?\\/))("+OpenLayers._scriptName+")(\\?|$)");var scripts=document.getElementsByTagName('script');for(var i=0,len=scripts.length;i<len;i++){var src=scripts[i].getAttribute('src');if(src){var match=src.match(isOL);if(match){scriptLocation=match[1];break;}}}
+return scriptLocation;}};if(!singleFile){var jsfiles=new Array("OpenLayers/Util.js","OpenLayers/BaseTypes.js","OpenLayers/BaseTypes/Class.js","OpenLayers/BaseTypes/Bounds.js","OpenLayers/BaseTypes/Element.js","OpenLayers/BaseTypes/LonLat.js","OpenLayers/BaseTypes/Pixel.js","OpenLayers/BaseTypes/Size.js","OpenLayers/Console.js","OpenLayers/Tween.js","Rico/Corner.js","Rico/Color.js","OpenLayers/Ajax.js","OpenLayers/Events.js","OpenLayers/Request.js","OpenLayers/Request/XMLHttpRequest.js","OpenLayers/Projection.js","OpenLayers/Map.js","OpenLayers/Layer.js","OpenLayers/Icon.js","OpenLayers/Marker.js","OpenLayers/Marker/Box.js","OpenLayers/Popup.js","OpenLayers/Tile.js","OpenLayers/Tile/Image.js","OpenLayers/Tile/Image/IFrame.js","OpenLayers/Tile/WFS.js","OpenLayers/Layer/Image.js","OpenLayers/Layer/SphericalMercator.js","OpenLayers/Layer/EventPane.js","OpenLayers/Layer/FixedZoomLevels.js","OpenLayers/Layer/Google.js","OpenLayers/Layer/Google/v3.js","OpenLayers/Layer/VirtualEarth.js","OpenLayers/Layer/Yahoo.js","OpenLayers/Layer/HTTPRequest.js","OpenLayers/Layer/Grid.js","OpenLayers/Layer/MapGuide.js","OpenLayers/Layer/MapServer.js","OpenLayers/Layer/MapServer/Untiled.js","OpenLayers/Layer/KaMap.js","OpenLayers/Layer/KaMapCache.js","OpenLayers/Layer/MultiMap.js","OpenLayers/Layer/Markers.js","OpenLayers/Layer/Text.js","OpenLayers/Layer/WorldWind.js","OpenLayers/Layer/ArcGIS93Rest.js","OpenLayers/Layer/WMS.js","OpenLayers/Layer/WMS/Untiled.js","OpenLayers/Layer/WMS/Post.js","OpenLayers/Layer/WMTS.js","OpenLayers/Layer/ArcIMS.js","OpenLayers/Layer/GeoRSS.js","OpenLayers/Layer/Boxes.js","OpenLayers/Layer/XYZ.js","OpenLayers/Layer/TMS.js","OpenLayers/Layer/TileCache.js","OpenLayers/Layer/Zoomify.js","OpenLayers/Popup/Anchored.js","OpenLayers/Popup/AnchoredBubble.js","OpenLayers/Popup/Framed.js","OpenLayers/Popup/FramedCloud.js","OpenLayers/Feature.js","OpenLayers/Feature/Vector.js","OpenLayers/Feature/WFS.js","OpenLayers/Handler.js","OpenLayers/Handler/Click.js","OpenLayers/Handler/Hover.js","OpenLayers/Handler/Point.js","OpenLayers/Handler/Path.js","OpenLayers/Handler/Polygon.js","OpenLayers/Handler/Feature.js","OpenLayers/Handler/Drag.js","OpenLayers/Handler/RegularPolygon.js","OpenLayers/Handler/Box.js","OpenLayers/Handler/MouseWheel.js","OpenLayers/Handler/Keyboard.js","OpenLayers/Control.js","OpenLayers/Control/Attribution.js","OpenLayers/Control/Button.js","OpenLayers/Control/ZoomBox.js","OpenLayers/Control/ZoomToMaxExtent.js","OpenLayers/Control/DragPan.js","OpenLayers/Control/Navigation.js","OpenLayers/Control/MouseDefaults.js","OpenLayers/Control/MousePosition.js","OpenLayers/Control/OverviewMap.js","OpenLayers/Control/KeyboardDefaults.js","OpenLayers/Control/PanZoom.js","OpenLayers/Control/PanZoomBar.js","OpenLayers/Control/ArgParser.js","OpenLayers/Control/Permalink.js","OpenLayers/Control/Scale.js","OpenLayers/Control/ScaleLine.js","OpenLayers/Control/Snapping.js","OpenLayers/Control/Split.js","OpenLayers/Control/LayerSwitcher.js","OpenLayers/Control/DrawFeature.js","OpenLayers/Control/DragFeature.js","OpenLayers/Control/ModifyFeature.js","OpenLayers/Control/Panel.js","OpenLayers/Control/SelectFeature.js","OpenLayers/Control/NavigationHistory.js","OpenLayers/Control/Measure.js","OpenLayers/Control/WMSGetFeatureInfo.js","OpenLayers/Control/WMTSGetFeatureInfo.js","OpenLayers/Control/Graticule.js","OpenLayers/Control/TransformFeature.js","OpenLayers/Control/SLDSelect.js","OpenLayers/Geometry.js","OpenLayers/Geometry/Rectangle.js","OpenLayers/Geometry/Collection.js","OpenLayers/Geometry/Point.js","OpenLayers/Geometry/MultiPoint.js","OpenLayers/Geometry/Curve.js","OpenLayers/Geometry/LineString.js","OpenLayers/Geometry/LinearRing.js","OpenLayers/Geometry/Polygon.js","OpenLayers/Geometry/MultiLineString.js","OpenLayers/Geometry/MultiPolygon.js","OpenLayers/Geometry/Surface.js","OpenLayers/Renderer.js","OpenLayers/Renderer/Elements.js","OpenLayers/Renderer/SVG.js","OpenLayers/Renderer/Canvas.js","OpenLayers/Renderer/VML.js","OpenLayers/Layer/Vector.js","OpenLayers/Layer/Vector/RootContainer.js","OpenLayers/Strategy.js","OpenLayers/Strategy/Filter.js","OpenLayers/Strategy/Fixed.js","OpenLayers/Strategy/Cluster.js","OpenLayers/Strategy/Paging.js","OpenLayers/Strategy/BBOX.js","OpenLayers/Strategy/Save.js","OpenLayers/Strategy/Refresh.js","OpenLayers/Filter.js","OpenLayers/Filter/FeatureId.js","OpenLayers/Filter/Logical.js","OpenLayers/Filter/Comparison.js","OpenLayers/Filter/Spatial.js","OpenLayers/Protocol.js","OpenLayers/Protocol/HTTP.js","OpenLayers/Protocol/SQL.js","OpenLayers/Protocol/SQL/Gears.js","OpenLayers/Protocol/WFS.js","OpenLayers/Protocol/WFS/v1.js","OpenLayers/Protocol/WFS/v1_0_0.js","OpenLayers/Protocol/WFS/v1_1_0.js","OpenLayers/Protocol/SOS.js","OpenLayers/Protocol/SOS/v1_0_0.js","OpenLayers/Layer/PointTrack.js","OpenLayers/Layer/GML.js","OpenLayers/Style.js","OpenLayers/Style2.js","OpenLayers/StyleMap.js","OpenLayers/Rule.js","OpenLayers/Format.js","OpenLayers/Format/XML.js","OpenLayers/Format/Context.js","OpenLayers/Format/ArcXML.js","OpenLayers/Format/ArcXML/Features.js","OpenLayers/Format/GML.js","OpenLayers/Format/GML/Base.js","OpenLayers/Format/GML/v2.js","OpenLayers/Format/GML/v3.js","OpenLayers/Format/Atom.js","OpenLayers/Format/KML.js","OpenLayers/Format/GeoRSS.js","OpenLayers/Format/WFS.js","OpenLayers/Format/WFSCapabilities.js","OpenLayers/Format/WFSCapabilities/v1.js","OpenLayers/Format/WFSCapabilities/v1_0_0.js","OpenLayers/Format/WFSCapabilities/v1_1_0.js","OpenLayers/Format/WFSDescribeFeatureType.js","OpenLayers/Format/WMSDescribeLayer.js","OpenLayers/Format/WMSDescribeLayer/v1_1.js","OpenLayers/Format/WKT.js","OpenLayers/Format/OSM.js","OpenLayers/Format/GPX.js","OpenLayers/Format/Filter.js","OpenLayers/Format/Filter/v1.js","OpenLayers/Format/Filter/v1_0_0.js","OpenLayers/Format/Filter/v1_1_0.js","OpenLayers/Format/SLD.js","OpenLayers/Format/SLD/v1.js","OpenLayers/Format/SLD/v1_0_0.js","OpenLayers/Format/OWSCommon/v1.js","OpenLayers/Format/OWSCommon/v1_0_0.js","OpenLayers/Format/OWSCommon/v1_1_0.js","OpenLayers/Format/CSWGetDomain.js","OpenLayers/Format/CSWGetDomain/v2_0_2.js","OpenLayers/Format/CSWGetRecords.js","OpenLayers/Format/CSWGetRecords/v2_0_2.js","OpenLayers/Format/WFST.js","OpenLayers/Format/WFST/v1.js","OpenLayers/Format/WFST/v1_0_0.js","OpenLayers/Format/WFST/v1_1_0.js","OpenLayers/Format/Text.js","OpenLayers/Format/JSON.js","OpenLayers/Format/GeoJSON.js","OpenLayers/Format/WMC.js","OpenLayers/Format/WMC/v1.js","OpenLayers/Format/WMC/v1_0_0.js","OpenLayers/Format/WMC/v1_1_0.js","OpenLayers/Format/WMSCapabilities.js","OpenLayers/Format/WMSCapabilities/v1.js","OpenLayers/Format/WMSCapabilities/v1_1.js","OpenLayers/Format/WMSCapabilities/v1_1_0.js","OpenLayers/Format/WMSCapabilities/v1_1_1.js","OpenLayers/Format/WMSCapabilities/v1_3.js","OpenLayers/Format/WMSCapabilities/v1_3_0.js","OpenLayers/Format/WMSGetFeatureInfo.js","OpenLayers/Format/SOSCapabilities.js","OpenLayers/Format/SOSCapabilities/v1_0_0.js","OpenLayers/Format/SOSGetObservation.js","OpenLayers/Format/SOSGetFeatureOfInterest.js","OpenLayers/Format/OWSContext.js","OpenLayers/Format/OWSContext/v0_3_1.js","OpenLayers/Format/WMTSCapabilities.js","OpenLayers/Format/WMTSCapabilities/v1_0_0.js","OpenLayers/Layer/WFS.js","OpenLayers/Control/GetFeature.js","OpenLayers/Control/MouseToolbar.js","OpenLayers/Control/NavToolbar.js","OpenLayers/Control/PanPanel.js","OpenLayers/Control/Pan.js","OpenLayers/Control/ZoomIn.js","OpenLayers/Control/ZoomOut.js","OpenLayers/Control/ZoomPanel.js","OpenLayers/Control/EditingToolbar.js","OpenLayers/Symbolizer.js","OpenLayers/Symbolizer/Point.js","OpenLayers/Symbolizer/Line.js","OpenLayers/Symbolizer/Polygon.js","OpenLayers/Symbolizer/Text.js","OpenLayers/Symbolizer/Raster.js","OpenLayers/Lang.js","OpenLayers/Lang/en.js");var agent=navigator.userAgent;var docWrite=(agent.match("MSIE")||agent.match("Safari"));if(docWrite){var allScriptTags=new Array(jsfiles.length);}
+var host=OpenLayers._getScriptLocation()+"lib/";for(var i=0,len=jsfiles.length;i<len;i++){if(docWrite){allScriptTags[i]="<script src='"+host+jsfiles[i]+"'></script>";}else{var s=document.createElement("script");s.src=host+jsfiles[i];var h=document.getElementsByTagName("head").length?document.getElementsByTagName("head")[0]:document.body;h.appendChild(s);}}
+if(docWrite){document.write(allScriptTags.join(""));}}})();OpenLayers.VERSION_NUMBER="OpenLayers 2.10 -- $Revision: 10721 $";OpenLayers.String={startsWith:function(str,sub){return(str.indexOf(sub)==0);},contains:function(str,sub){return(str.indexOf(sub)!=-1);},trim:function(str){return str.replace(/^\s\s*/,'').replace(/\s\s*$/,'');},camelize:function(str){var oStringList=str.split('-');var camelizedString=oStringList[0];for(var i=1,len=oStringList.length;i<len;i++){var s=oStringList[i];camelizedString+=s.charAt(0).toUpperCase()+s.substring(1);}
+return camelizedString;},format:function(template,context,args){if(!context){context=window;}
+var replacer=function(str,match){var replacement;var subs=match.split(/\.+/);for(var i=0;i<subs.length;i++){if(i==0){replacement=context;}
+replacement=replacement[subs[i]];}
+if(typeof replacement=="function"){replacement=args?replacement.apply(null,args):replacement();}
+if(typeof replacement=='undefined'){return'undefined';}else{return replacement;}};return template.replace(OpenLayers.String.tokenRegEx,replacer);},tokenRegEx:/\$\{([\w.]+?)\}/g,numberRegEx:/^([+-]?)(?=\d|\.\d)\d*(\.\d*)?([Ee]([+-]?\d+))?$/,isNumeric:function(value){return OpenLayers.String.numberRegEx.test(value);},numericIf:function(value){return OpenLayers.String.isNumeric(value)?parseFloat(value):value;}};if(!String.prototype.startsWith){String.prototype.startsWith=function(sStart){OpenLayers.Console.warn(OpenLayers.i18n("methodDeprecated",{'newMethod':'OpenLayers.String.startsWith'}));return OpenLayers.String.startsWith(this,sStart);};}
+if(!String.prototype.contains){String.prototype.contains=function(str){OpenLayers.Console.warn(OpenLayers.i18n("methodDeprecated",{'newMethod':'OpenLayers.String.contains'}));return OpenLayers.String.contains(this,str);};}
+if(!String.prototype.trim){String.prototype.trim=function(){OpenLayers.Console.warn(OpenLayers.i18n("methodDeprecated",{'newMethod':'OpenLayers.String.trim'}));return OpenLayers.String.trim(this);};}
+if(!String.prototype.camelize){String.prototype.camelize=function(){OpenLayers.Console.warn(OpenLayers.i18n("methodDeprecated",{'newMethod':'OpenLayers.String.camelize'}));return OpenLayers.String.camelize(this);};}
+OpenLayers.Number={decimalSeparator:".",thousandsSeparator:",",limitSigDigs:function(num,sig){var fig=0;if(sig>0){fig=parseFloat(num.toPrecision(sig));}
+return fig;},format:function(num,dec,tsep,dsep){dec=(typeof dec!="undefined")?dec:0;tsep=(typeof tsep!="undefined")?tsep:OpenLayers.Number.thousandsSeparator;dsep=(typeof dsep!="undefined")?dsep:OpenLayers.Number.decimalSeparator;if(dec!=null){num=parseFloat(num.toFixed(dec));}
+var parts=num.toString().split(".");if(parts.length==1&&dec==null){dec=0;}
+var integer=parts[0];if(tsep){var thousands=/(-?[0-9]+)([0-9]{3})/;while(thousands.test(integer)){integer=integer.replace(thousands,"$1"+tsep+"$2");}}
+var str;if(dec==0){str=integer;}else{var rem=parts.length>1?parts[1]:"0";if(dec!=null){rem=rem+new Array(dec-rem.length+1).join("0");}
+str=integer+dsep+rem;}
+return str;}};if(!Number.prototype.limitSigDigs){Number.prototype.limitSigDigs=function(sig){OpenLayers.Console.warn(OpenLayers.i18n("methodDeprecated",{'newMethod':'OpenLayers.Number.limitSigDigs'}));return OpenLayers.Number.limitSigDigs(this,sig);};}
+OpenLayers.Function={bind:function(func,object){var args=Array.prototype.slice.apply(arguments,[2]);return function(){var newArgs=args.concat(Array.prototype.slice.apply(arguments,[0]));return func.apply(object,newArgs);};},bindAsEventListener:function(func,object){return function(event){return func.call(object,event||window.event);};},False:function(){return false;},True:function(){return true;}};if(!Function.prototype.bind){Function.prototype.bind=function(){OpenLayers.Console.warn(OpenLayers.i18n("methodDeprecated",{'newMethod':'OpenLayers.Function.bind'}));Array.prototype.unshift.apply(arguments,[this]);return OpenLayers.Function.bind.apply(null,arguments);};}
+if(!Function.prototype.bindAsEventListener){Function.prototype.bindAsEventListener=function(object){OpenLayers.Console.warn(OpenLayers.i18n("methodDeprecated",{'newMethod':'OpenLayers.Function.bindAsEventListener'}));return OpenLayers.Function.bindAsEventListener(this,object);};}
+OpenLayers.Array={filter:function(array,callback,caller){var selected=[];if(Array.prototype.filter){selected=array.filter(callback,caller);}else{var len=array.length;if(typeof callback!="function"){throw new TypeError();}
+for(var i=0;i<len;i++){if(i in array){var val=array[i];if(callback.call(caller,val,i,array)){selected.push(val);}}}}
+return selected;}};OpenLayers.Date={toISOString:(function(){if("toISOString"in Date.prototype){return function(date){return date.toISOString();}}else{function pad(num,len){var str=num+"";while(str.length<len){str="0"+str;}
+return str;}
+return function(date){var str;if(isNaN(date.getTime())){str="Invalid Date";}else{str=date.getUTCFullYear()+"-"+
+pad(date.getUTCMonth()+1,2)+"-"+
+pad(date.getUTCDate(),2)+"T"+
+pad(date.getUTCHours(),2)+":"+
+pad(date.getUTCMinutes(),2)+":"+
+pad(date.getUTCSeconds(),2)+"."+
+pad(date.getUTCMilliseconds(),3)+"Z";}
+return str;}}})(),parse:function(str){var date;var elapsed=Date.parse(str);if(!isNaN(elapsed)){date=new Date(elapsed);}else{var match=str.match(/^(?:(\d{4})(?:-(\d{2})(?:-(\d{2}))?)?)?(?:T(\d{1,2}):(\d{2}):(\d{2}(?:\.\d+)?)(Z|(?:[+-]\d{1,2}(?::(\d{2}))?)))?$/);var date;if(match&&(match[1]||match[7])){var year=parseInt(match[1],10)||0;var month=(parseInt(match[2],10)-1)||0;var day=parseInt(match[3],10)||1;date=new Date(Date.UTC(year,month,day));var type=match[7];if(type){var hours=parseInt(match[4],10);var minutes=parseInt(match[5],10);var secFrac=parseFloat(match[6]);var seconds=secFrac|0;var milliseconds=Math.round(1000*(secFrac-seconds));date.setUTCHours(hours,minutes,seconds,milliseconds);if(type!=="Z"){var hoursOffset=parseInt(type,10);var minutesOffset=parseInt(match[8])||0;var offset=-1000*(60*(hoursOffset*60)+minutesOffset*60);date=new Date(date.getTime()+offset);}}}else{date=new Date("invalid");}}
+return date;}};OpenLayers.Class=function(){var Class=function(){if(arguments&&arguments[0]!=OpenLayers.Class.isPrototype){this.initialize.apply(this,arguments);}};var extended={};var parent,initialize,Type;for(var i=0,len=arguments.length;i<len;++i){Type=arguments[i];if(typeof Type=="function"){if(i==0&&len>1){initialize=Type.prototype.initialize;Type.prototype.initialize=function(){};extended=new Type();if(initialize===undefined){delete Type.prototype.initialize;}else{Type.prototype.initialize=initialize;}}
+parent=Type.prototype;}else{parent=Type;}
+OpenLayers.Util.extend(extended,parent);}
+Class.prototype=extended;return Class;};OpenLayers.Class.isPrototype=function(){};OpenLayers.Class.create=function(){return function(){if(arguments&&arguments[0]!=OpenLayers.Class.isPrototype){this.initialize.apply(this,arguments);}};};OpenLayers.Class.inherit=function(){var superClass=arguments[0];var proto=new superClass(OpenLayers.Class.isPrototype);for(var i=1,len=arguments.length;i<len;i++){if(typeof arguments[i]=="function"){var mixin=arguments[i];arguments[i]=new mixin(OpenLayers.Class.isPrototype);}
+OpenLayers.Util.extend(proto,arguments[i]);}
+return proto;};OpenLayers.Util={};OpenLayers.Util.getElement=function(){var elements=[];for(var i=0,len=arguments.length;i<len;i++){var element=arguments[i];if(typeof element=='string'){element=document.getElementById(element);}
+if(arguments.length==1){return element;}
+elements.push(element);}
+return elements;};OpenLayers.Util.isElement=function(o){return!!(o&&o.nodeType===1);};if(typeof window.$==="undefined"){window.$=OpenLayers.Util.getElement;}
+OpenLayers.Util.extend=function(destination,source){destination=destination||{};if(source){for(var property in source){var value=source[property];if(value!==undefined){destination[property]=value;}}
+var sourceIsEvt=typeof window.Event=="function"&&source instanceof window.Event;if(!sourceIsEvt&&source.hasOwnProperty&&source.hasOwnProperty('toString')){destination.toString=source.toString;}}
+return destination;};OpenLayers.Util.removeItem=function(array,item){for(var i=array.length-1;i>=0;i--){if(array[i]==item){array.splice(i,1);}}
+return array;};OpenLayers.Util.clearArray=function(array){OpenLayers.Console.warn(OpenLayers.i18n("methodDeprecated",{'newMethod':'array = []'}));array.length=0;};OpenLayers.Util.indexOf=function(array,obj){if(typeof array.indexOf=="function"){return array.indexOf(obj);}else{for(var i=0,len=array.length;i<len;i++){if(array[i]==obj){return i;}}
+return-1;}};OpenLayers.Util.modifyDOMElement=function(element,id,px,sz,position,border,overflow,opacity){if(id){element.id=id;}
+if(px){element.style.left=px.x+"px";element.style.top=px.y+"px";}
+if(sz){element.style.width=sz.w+"px";element.style.height=sz.h+"px";}
+if(position){element.style.position=position;}
+if(border){element.style.border=border;}
+if(overflow){element.style.overflow=overflow;}
+if(parseFloat(opacity)>=0.0&&parseFloat(opacity)<1.0){element.style.filter='alpha(opacity='+(opacity*100)+')';element.style.opacity=opacity;}else if(parseFloat(opacity)==1.0){element.style.filter='';element.style.opacity='';}};OpenLayers.Util.createDiv=function(id,px,sz,imgURL,position,border,overflow,opacity){var dom=document.createElement('div');if(imgURL){dom.style.backgroundImage='url('+imgURL+')';}
+if(!id){id=OpenLayers.Util.createUniqueID("OpenLayersDiv");}
+if(!position){position="absolute";}
+OpenLayers.Util.modifyDOMElement(dom,id,px,sz,position,border,overflow,opacity);return dom;};OpenLayers.Util.createImage=function(id,px,sz,imgURL,position,border,opacity,delayDisplay){var image=document.createElement("img");if(!id){id=OpenLayers.Util.createUniqueID("OpenLayersDiv");}
+if(!position){position="relative";}
+OpenLayers.Util.modifyDOMElement(image,id,px,sz,position,border,null,opacity);if(delayDisplay){image.style.display="none";OpenLayers.Event.observe(image,"load",OpenLayers.Function.bind(OpenLayers.Util.onImageLoad,image));OpenLayers.Event.observe(image,"error",OpenLayers.Function.bind(OpenLayers.Util.onImageLoadError,image));}
+image.style.alt=id;image.galleryImg="no";if(imgURL){image.src=imgURL;}
+return image;};OpenLayers.Util.setOpacity=function(element,opacity){OpenLayers.Util.modifyDOMElement(element,null,null,null,null,null,null,opacity);};OpenLayers.Util.onImageLoad=function(){if(!this.viewRequestID||(this.map&&this.viewRequestID==this.map.viewRequestID)){this.style.display="";}
+OpenLayers.Element.removeClass(this,"olImageLoadError");};OpenLayers.IMAGE_RELOAD_ATTEMPTS=0;OpenLayers.Util.onImageLoadError=function(){this._attempts=(this._attempts)?(this._attempts+1):1;if(this._attempts<=OpenLayers.IMAGE_RELOAD_ATTEMPTS){var urls=this.urls;if(urls&&urls instanceof Array&&urls.length>1){var src=this.src.toString();var current_url,k;for(k=0;current_url=urls[k];k++){if(src.indexOf(current_url)!=-1){break;}}
+var guess=Math.floor(urls.length*Math.random());var new_url=urls[guess];k=0;while(new_url==current_url&&k++<4){guess=Math.floor(urls.length*Math.random());new_url=urls[guess];}
+this.src=src.replace(current_url,new_url);}else{this.src=this.src;}}else{OpenLayers.Element.addClass(this,"olImageLoadError");}
+this.style.display="";};OpenLayers.Util.alphaHackNeeded=null;OpenLayers.Util.alphaHack=function(){if(OpenLayers.Util.alphaHackNeeded==null){var arVersion=navigator.appVersion.split("MSIE");var version=parseFloat(arVersion[1]);var filter=false;try{filter=!!(document.body.filters);}catch(e){}
+OpenLayers.Util.alphaHackNeeded=(filter&&(version>=5.5)&&(version<7));}
+return OpenLayers.Util.alphaHackNeeded;};OpenLayers.Util.modifyAlphaImageDiv=function(div,id,px,sz,imgURL,position,border,sizing,opacity){OpenLayers.Util.modifyDOMElement(div,id,px,sz,position,null,null,opacity);var img=div.childNodes[0];if(imgURL){img.src=imgURL;}
+OpenLayers.Util.modifyDOMElement(img,div.id+"_innerImage",null,sz,"relative",border);if(OpenLayers.Util.alphaHack()){if(div.style.display!="none"){div.style.display="inline-block";}
+if(sizing==null){sizing="scale";}
+div.style.filter="progid:DXImageTransform.Microsoft"+".AlphaImageLoader(src='"+img.src+"', "+"sizingMethod='"+sizing+"')";if(parseFloat(div.style.opacity)>=0.0&&parseFloat(div.style.opacity)<1.0){div.style.filter+=" alpha(opacity="+div.style.opacity*100+")";}
+img.style.filter="alpha(opacity=0)";}};OpenLayers.Util.createAlphaImageDiv=function(id,px,sz,imgURL,position,border,sizing,opacity,delayDisplay){var div=OpenLayers.Util.createDiv();var img=OpenLayers.Util.createImage(null,null,null,null,null,null,null,false);div.appendChild(img);if(delayDisplay){img.style.display="none";OpenLayers.Event.observe(img,"load",OpenLayers.Function.bind(OpenLayers.Util.onImageLoad,div));OpenLayers.Event.observe(img,"error",OpenLayers.Function.bind(OpenLayers.Util.onImageLoadError,div));}
+OpenLayers.Util.modifyAlphaImageDiv(div,id,px,sz,imgURL,position,border,sizing,opacity);return div;};OpenLayers.Util.upperCaseObject=function(object){var uObject={};for(var key in object){uObject[key.toUpperCase()]=object[key];}
+return uObject;};OpenLayers.Util.applyDefaults=function(to,from){to=to||{};var fromIsEvt=typeof window.Event=="function"&&from instanceof window.Event;for(var key in from){if(to[key]===undefined||(!fromIsEvt&&from.hasOwnProperty&&from.hasOwnProperty(key)&&!to.hasOwnProperty(key))){to[key]=from[key];}}
+if(!fromIsEvt&&from&&from.hasOwnProperty&&from.hasOwnProperty('toString')&&!to.hasOwnProperty('toString')){to.toString=from.toString;}
+return to;};OpenLayers.Util.getParameterString=function(params){var paramsArray=[];for(var key in params){var value=params[key];if((value!=null)&&(typeof value!='function')){var encodedValue;if(typeof value=='object'&&value.constructor==Array){var encodedItemArray=[];var item;for(var itemIndex=0,len=value.length;itemIndex<len;itemIndex++){item=value[itemIndex];encodedItemArray.push(encodeURIComponent((item===null||item===undefined)?"":item));}
+encodedValue=encodedItemArray.join(",");}
+else{encodedValue=encodeURIComponent(value);}
+paramsArray.push(encodeURIComponent(key)+"="+encodedValue);}}
+return paramsArray.join("&");};OpenLayers.Util.urlAppend=function(url,paramStr){var newUrl=url;if(paramStr){var parts=(url+" ").split(/[?&]/);newUrl+=(parts.pop()===" "?paramStr:parts.length?"&"+paramStr:"?"+paramStr);}
+return newUrl;};OpenLayers.ImgPath='';OpenLayers.Util.getImagesLocation=function(){return OpenLayers.ImgPath||(OpenLayers._getScriptLocation()+"img/");};OpenLayers.Util.Try=function(){var returnValue=null;for(var i=0,len=arguments.length;i<len;i++){var lambda=arguments[i];try{returnValue=lambda();break;}catch(e){}}
+return returnValue;};OpenLayers.Util.getNodes=function(p,tagName){var nodes=OpenLayers.Util.Try(function(){return OpenLayers.Util._getNodes(p.documentElement.childNodes,tagName);},function(){return OpenLayers.Util._getNodes(p.childNodes,tagName);});return nodes;};OpenLayers.Util._getNodes=function(nodes,tagName){var retArray=[];for(var i=0,len=nodes.length;i<len;i++){if(nodes[i].nodeName==tagName){retArray.push(nodes[i]);}}
+return retArray;};OpenLayers.Util.getTagText=function(parent,item,index){var result=OpenLayers.Util.getNodes(parent,item);if(result&&(result.length>0))
+{if(!index){index=0;}
+if(result[index].childNodes.length>1){return result.childNodes[1].nodeValue;}
+else if(result[index].childNodes.length==1){return result[index].firstChild.nodeValue;}}else{return"";}};OpenLayers.Util.getXmlNodeValue=function(node){var val=null;OpenLayers.Util.Try(function(){val=node.text;if(!val){val=node.textContent;}
+if(!val){val=node.firstChild.nodeValue;}},function(){val=node.textContent;});return val;};OpenLayers.Util.mouseLeft=function(evt,div){var target=(evt.relatedTarget)?evt.relatedTarget:evt.toElement;while(target!=div&&target!=null){target=target.parentNode;}
+return(target!=div);};OpenLayers.Util.DEFAULT_PRECISION=14;OpenLayers.Util.toFloat=function(number,precision){if(precision==null){precision=OpenLayers.Util.DEFAULT_PRECISION;}
+var number;if(precision==0){number=parseFloat(number);}else{number=parseFloat(parseFloat(number).toPrecision(precision));}
+return number;};OpenLayers.Util.rad=function(x){return x*Math.PI/180;};OpenLayers.Util.deg=function(x){return x*180/Math.PI;};OpenLayers.Util.VincentyConstants={a:6378137,b:6356752.3142,f:1/298.257223563};OpenLayers.Util.distVincenty=function(p1,p2){var ct=OpenLayers.Util.VincentyConstants;var a=ct.a,b=ct.b,f=ct.f;var L=OpenLayers.Util.rad(p2.lon-p1.lon);var U1=Math.atan((1-f)*Math.tan(OpenLayers.Util.rad(p1.lat)));var U2=Math.atan((1-f)*Math.tan(OpenLayers.Util.rad(p2.lat)));var sinU1=Math.sin(U1),cosU1=Math.cos(U1);var sinU2=Math.sin(U2),cosU2=Math.cos(U2);var lambda=L,lambdaP=2*Math.PI;var iterLimit=20;while(Math.abs(lambda-lambdaP)>1e-12&&--iterLimit>0){var sinLambda=Math.sin(lambda),cosLambda=Math.cos(lambda);var sinSigma=Math.sqrt((cosU2*sinLambda)*(cosU2*sinLambda)+
+(cosU1*sinU2-sinU1*cosU2*cosLambda)*(cosU1*sinU2-sinU1*cosU2*cosLambda));if(sinSigma==0){return 0;}
+var cosSigma=sinU1*sinU2+cosU1*cosU2*cosLambda;var sigma=Math.atan2(sinSigma,cosSigma);var alpha=Math.asin(cosU1*cosU2*sinLambda/sinSigma);var cosSqAlpha=Math.cos(alpha)*Math.cos(alpha);var cos2SigmaM=cosSigma-2*sinU1*sinU2/cosSqAlpha;var C=f/16*cosSqAlpha*(4+f*(4-3*cosSqAlpha));lambdaP=lambda;lambda=L+(1-C)*f*Math.sin(alpha)*(sigma+C*sinSigma*(cos2SigmaM+C*cosSigma*(-1+2*cos2SigmaM*cos2SigmaM)));}
+if(iterLimit==0){return NaN;}
+var uSq=cosSqAlpha*(a*a-b*b)/(b*b);var A=1+uSq/16384*(4096+uSq*(-768+uSq*(320-175*uSq)));var B=uSq/1024*(256+uSq*(-128+uSq*(74-47*uSq)));var deltaSigma=B*sinSigma*(cos2SigmaM+B/4*(cosSigma*(-1+2*cos2SigmaM*cos2SigmaM)-
+B/6*cos2SigmaM*(-3+4*sinSigma*sinSigma)*(-3+4*cos2SigmaM*cos2SigmaM)));var s=b*A*(sigma-deltaSigma);var d=s.toFixed(3)/1000;return d;};OpenLayers.Util.destinationVincenty=function(lonlat,brng,dist){var u=OpenLayers.Util;var ct=u.VincentyConstants;var a=ct.a,b=ct.b,f=ct.f;var lon1=lonlat.lon;var lat1=lonlat.lat;var s=dist;var alpha1=u.rad(brng);var sinAlpha1=Math.sin(alpha1);var cosAlpha1=Math.cos(alpha1);var tanU1=(1-f)*Math.tan(u.rad(lat1));var cosU1=1/Math.sqrt((1+tanU1*tanU1)),sinU1=tanU1*cosU1;var sigma1=Math.atan2(tanU1,cosAlpha1);var sinAlpha=cosU1*sinAlpha1;var cosSqAlpha=1-sinAlpha*sinAlpha;var uSq=cosSqAlpha*(a*a-b*b)/(b*b);var A=1+uSq/16384*(4096+uSq*(-768+uSq*(320-175*uSq)));var B=uSq/1024*(256+uSq*(-128+uSq*(74-47*uSq)));var sigma=s/(b*A),sigmaP=2*Math.PI;while(Math.abs(sigma-sigmaP)>1e-12){var cos2SigmaM=Math.cos(2*sigma1+sigma);var sinSigma=Math.sin(sigma);var cosSigma=Math.cos(sigma);var deltaSigma=B*sinSigma*(cos2SigmaM+B/4*(cosSigma*(-1+2*cos2SigmaM*cos2SigmaM)-
+B/6*cos2SigmaM*(-3+4*sinSigma*sinSigma)*(-3+4*cos2SigmaM*cos2SigmaM)));sigmaP=sigma;sigma=s/(b*A)+deltaSigma;}
+var tmp=sinU1*sinSigma-cosU1*cosSigma*cosAlpha1;var lat2=Math.atan2(sinU1*cosSigma+cosU1*sinSigma*cosAlpha1,(1-f)*Math.sqrt(sinAlpha*sinAlpha+tmp*tmp));var lambda=Math.atan2(sinSigma*sinAlpha1,cosU1*cosSigma-sinU1*sinSigma*cosAlpha1);var C=f/16*cosSqAlpha*(4+f*(4-3*cosSqAlpha));var L=lambda-(1-C)*f*sinAlpha*(sigma+C*sinSigma*(cos2SigmaM+C*cosSigma*(-1+2*cos2SigmaM*cos2SigmaM)));var revAz=Math.atan2(sinAlpha,-tmp);return new OpenLayers.LonLat(lon1+u.deg(L),u.deg(lat2));};OpenLayers.Util.getParameters=function(url){url=url||window.location.href;var paramsString="";if(OpenLayers.String.contains(url,'?')){var start=url.indexOf('?')+1;var end=OpenLayers.String.contains(url,"#")?url.indexOf('#'):url.length;paramsString=url.substring(start,end);}
+var parameters={};var pairs=paramsString.split(/[&;]/);for(var i=0,len=pairs.length;i<len;++i){var keyValue=pairs[i].split('=');if(keyValue[0]){var key=decodeURIComponent(keyValue[0]);var value=keyValue[1]||'';value=decodeURIComponent(value.replace(/\+/g," ")).split(",");if(value.length==1){value=value[0];}
+parameters[key]=value;}}
+return parameters;};OpenLayers.Util.getArgs=function(url){OpenLayers.Console.warn(OpenLayers.i18n("methodDeprecated",{'newMethod':'OpenLayers.Util.getParameters'}));return OpenLayers.Util.getParameters(url);};OpenLayers.Util.lastSeqID=0;OpenLayers.Util.createUniqueID=function(prefix){if(prefix==null){prefix="id_";}
+OpenLayers.Util.lastSeqID+=1;return prefix+OpenLayers.Util.lastSeqID;};OpenLayers.INCHES_PER_UNIT={'inches':1.0,'ft':12.0,'mi':63360.0,'m':39.3701,'km':39370.1,'dd':4374754,'yd':36};OpenLayers.INCHES_PER_UNIT["in"]=OpenLayers.INCHES_PER_UNIT.inches;OpenLayers.INCHES_PER_UNIT["degrees"]=OpenLayers.INCHES_PER_UNIT.dd;OpenLayers.INCHES_PER_UNIT["nmi"]=1852*OpenLayers.INCHES_PER_UNIT.m;OpenLayers.METERS_PER_INCH=0.02540005080010160020;OpenLayers.Util.extend(OpenLayers.INCHES_PER_UNIT,{"Inch":OpenLayers.INCHES_PER_UNIT.inches,"Meter":1.0/OpenLayers.METERS_PER_INCH,"Foot":0.30480060960121920243/OpenLayers.METERS_PER_INCH,"IFoot":0.30480000000000000000/OpenLayers.METERS_PER_INCH,"ClarkeFoot":0.3047972651151/OpenLayers.METERS_PER_INCH,"SearsFoot":0.30479947153867624624/OpenLayers.METERS_PER_INCH,"GoldCoastFoot":0.30479971018150881758/OpenLayers.METERS_PER_INCH,"IInch":0.02540000000000000000/OpenLayers.METERS_PER_INCH,"MicroInch":0.00002540000000000000/OpenLayers.METERS_PER_INCH,"Mil":0.00000002540000000000/OpenLayers.METERS_PER_INCH,"Centimeter":0.01000000000000000000/OpenLayers.METERS_PER_INCH,"Kilometer":1000.00000000000000000000/OpenLayers.METERS_PER_INCH,"Yard":0.91440182880365760731/OpenLayers.METERS_PER_INCH,"SearsYard":0.914398414616029/OpenLayers.METERS_PER_INCH,"IndianYard":0.91439853074444079983/OpenLayers.METERS_PER_INCH,"IndianYd37":0.91439523/OpenLayers.METERS_PER_INCH,"IndianYd62":0.9143988/OpenLayers.METERS_PER_INCH,"IndianYd75":0.9143985/OpenLayers.METERS_PER_INCH,"IndianFoot":0.30479951/OpenLayers.METERS_PER_INCH,"IndianFt37":0.30479841/OpenLayers.METERS_PER_INCH,"IndianFt62":0.3047996/OpenLayers.METERS_PER_INCH,"IndianFt75":0.3047995/OpenLayers.METERS_PER_INCH,"Mile":1609.34721869443738887477/OpenLayers.METERS_PER_INCH,"IYard":0.91440000000000000000/OpenLayers.METERS_PER_INCH,"IMile":1609.34400000000000000000/OpenLayers.METERS_PER_INCH,"NautM":1852.00000000000000000000/OpenLayers.METERS_PER_INCH,"Lat-66":110943.316488932731/OpenLayers.METERS_PER_INCH,"Lat-83":110946.25736872234125/OpenLayers.METERS_PER_INCH,"Decimeter":0.10000000000000000000/OpenLayers.METERS_PER_INCH,"Millimeter":0.00100000000000000000/OpenLayers.METERS_PER_INCH,"Dekameter":10.00000000000000000000/OpenLayers.METERS_PER_INCH,"Decameter":10.00000000000000000000/OpenLayers.METERS_PER_INCH,"Hectometer":100.00000000000000000000/OpenLayers.METERS_PER_INCH,"GermanMeter":1.0000135965/OpenLayers.METERS_PER_INCH,"CaGrid":0.999738/OpenLayers.METERS_PER_INCH,"ClarkeChain":20.1166194976/OpenLayers.METERS_PER_INCH,"GunterChain":20.11684023368047/OpenLayers.METERS_PER_INCH,"BenoitChain":20.116782494375872/OpenLayers.METERS_PER_INCH,"SearsChain":20.11676512155/OpenLayers.METERS_PER_INCH,"ClarkeLink":0.201166194976/OpenLayers.METERS_PER_INCH,"GunterLink":0.2011684023368047/OpenLayers.METERS_PER_INCH,"BenoitLink":0.20116782494375872/OpenLayers.METERS_PER_INCH,"SearsLink":0.2011676512155/OpenLayers.METERS_PER_INCH,"Rod":5.02921005842012/OpenLayers.METERS_PER_INCH,"IntnlChain":20.1168/OpenLayers.METERS_PER_INCH,"IntnlLink":0.201168/OpenLayers.METERS_PER_INCH,"Perch":5.02921005842012/OpenLayers.METERS_PER_INCH,"Pole":5.02921005842012/OpenLayers.METERS_PER_INCH,"Furlong":201.1684023368046/OpenLayers.METERS_PER_INCH,"Rood":3.778266898/OpenLayers.METERS_PER_INCH,"CapeFoot":0.3047972615/OpenLayers.METERS_PER_INCH,"Brealey":375.00000000000000000000/OpenLayers.METERS_PER_INCH,"ModAmFt":0.304812252984505969011938/OpenLayers.METERS_PER_INCH,"Fathom":1.8288/OpenLayers.METERS_PER_INCH,"NautM-UK":1853.184/OpenLayers.METERS_PER_INCH,"50kilometers":50000.0/OpenLayers.METERS_PER_INCH,"150kilometers":150000.0/OpenLayers.METERS_PER_INCH});OpenLayers.Util.extend(OpenLayers.INCHES_PER_UNIT,{"mm":OpenLayers.INCHES_PER_UNIT["Meter"]/1000.0,"cm":OpenLayers.INCHES_PER_UNIT["Meter"]/100.0,"dm":OpenLayers.INCHES_PER_UNIT["Meter"]*100.0,"km":OpenLayers.INCHES_PER_UNIT["Meter"]*1000.0,"kmi":OpenLayers.INCHES_PER_UNIT["nmi"],"fath":OpenLayers.INCHES_PER_UNIT["Fathom"],"ch":OpenLayers.INCHES_PER_UNIT["IntnlChain"],"link":OpenLayers.INCHES_PER_UNIT["IntnlLink"],"us-in":OpenLayers.INCHES_PER_UNIT["inches"],"us-ft":OpenLayers.INCHES_PER_UNIT["Foot"],"us-yd":OpenLayers.INCHES_PER_UNIT["Yard"],"us-ch":OpenLayers.INCHES_PER_UNIT["GunterChain"],"us-mi":OpenLayers.INCHES_PER_UNIT["Mile"],"ind-yd":OpenLayers.INCHES_PER_UNIT["IndianYd37"],"ind-ft":OpenLayers.INCHES_PER_UNIT["IndianFt37"],"ind-ch":20.11669506/OpenLayers.METERS_PER_INCH});OpenLayers.DOTS_PER_INCH=72;OpenLayers.Util.normalizeScale=function(scale){var normScale=(scale>1.0)?(1.0/scale):scale;return normScale;};OpenLayers.Util.getResolutionFromScale=function(scale,units){var resolution;if(scale){if(units==null){units="degrees";}
+var normScale=OpenLayers.Util.normalizeScale(scale);resolution=1/(normScale*OpenLayers.INCHES_PER_UNIT[units]*OpenLayers.DOTS_PER_INCH);}
+return resolution;};OpenLayers.Util.getScaleFromResolution=function(resolution,units){if(units==null){units="degrees";}
+var scale=resolution*OpenLayers.INCHES_PER_UNIT[units]*OpenLayers.DOTS_PER_INCH;return scale;};OpenLayers.Util.safeStopPropagation=function(evt){OpenLayers.Event.stop(evt,true);};OpenLayers.Util.pagePosition=function(forElement){var valueT=0,valueL=0;var element=forElement;var child=forElement;while(element){if(element==document.body){if(OpenLayers.Element.getStyle(child,'position')=='absolute'){break;}}
+valueT+=element.offsetTop||0;valueL+=element.offsetLeft||0;child=element;try{element=element.offsetParent;}catch(e){OpenLayers.Console.error(OpenLayers.i18n("pagePositionFailed",{'elemId':element.id}));break;}}
+element=forElement;while(element){valueT-=element.scrollTop||0;valueL-=element.scrollLeft||0;element=element.parentNode;}
+return[valueL,valueT];};OpenLayers.Util.isEquivalentUrl=function(url1,url2,options){options=options||{};OpenLayers.Util.applyDefaults(options,{ignoreCase:true,ignorePort80:true,ignoreHash:true});var urlObj1=OpenLayers.Util.createUrlObject(url1,options);var urlObj2=OpenLayers.Util.createUrlObject(url2,options);for(var key in urlObj1){if(key!=="args"){if(urlObj1[key]!=urlObj2[key]){return false;}}}
+for(var key in urlObj1.args){if(urlObj1.args[key]!=urlObj2.args[key]){return false;}
+delete urlObj2.args[key];}
+for(var key in urlObj2.args){return false;}
+return true;};OpenLayers.Util.createUrlObject=function(url,options){options=options||{};if(!(/^\w+:\/\//).test(url)){var loc=window.location;var port=loc.port?":"+loc.port:"";var fullUrl=loc.protocol+"//"+loc.host.split(":").shift()+port;if(url.indexOf("/")===0){url=fullUrl+url;}else{var parts=loc.pathname.split("/");parts.pop();url=fullUrl+parts.join("/")+"/"+url;}}
+if(options.ignoreCase){url=url.toLowerCase();}
+var a=document.createElement('a');a.href=url;var urlObject={};urlObject.host=a.host.split(":").shift();urlObject.protocol=a.protocol;if(options.ignorePort80){urlObject.port=(a.port=="80"||a.port=="0")?"":a.port;}else{urlObject.port=(a.port==""||a.port=="0")?"80":a.port;}
+urlObject.hash=(options.ignoreHash||a.hash==="#")?"":a.hash;var queryString=a.search;if(!queryString){var qMark=url.indexOf("?");queryString=(qMark!=-1)?url.substr(qMark):"";}
+urlObject.args=OpenLayers.Util.getParameters(queryString);urlObject.pathname=(a.pathname.charAt(0)=="/")?a.pathname:"/"+a.pathname;return urlObject;};OpenLayers.Util.removeTail=function(url){var head=null;var qMark=url.indexOf("?");var hashMark=url.indexOf("#");if(qMark==-1){head=(hashMark!=-1)?url.substr(0,hashMark):url;}else{head=(hashMark!=-1)?url.substr(0,Math.min(qMark,hashMark)):url.substr(0,qMark);}
+return head;};OpenLayers.Util.getBrowserName=function(){var browserName="";var ua=navigator.userAgent.toLowerCase();if(ua.indexOf("opera")!=-1){browserName="opera";}else if(ua.indexOf("msie")!=-1){browserName="msie";}else if(ua.indexOf("safari")!=-1){browserName="safari";}else if(ua.indexOf("mozilla")!=-1){if(ua.indexOf("firefox")!=-1){browserName="firefox";}else{browserName="mozilla";}}
+return browserName;};OpenLayers.Util.getRenderedDimensions=function(contentHTML,size,options){var w,h;var container=document.createElement("div");container.style.visibility="hidden";var containerElement=(options&&options.containerElement)?options.containerElement:document.body;if(size){if(size.w){w=size.w;container.style.width=w+"px";}else if(size.h){h=size.h;container.style.height=h+"px";}}
+if(options&&options.displayClass){container.className=options.displayClass;}
+var content=document.createElement("div");content.innerHTML=contentHTML;content.style.overflow="visible";if(content.childNodes){for(var i=0,l=content.childNodes.length;i<l;i++){if(!content.childNodes[i].style)continue;content.childNodes[i].style.overflow="visible";}}
+container.appendChild(content);containerElement.appendChild(container);var parentHasPositionAbsolute=false;var parent=container.parentNode;while(parent&&parent.tagName.toLowerCase()!="body"){var parentPosition=OpenLayers.Element.getStyle(parent,"position");if(parentPosition=="absolute"){parentHasPositionAbsolute=true;break;}else if(parentPosition&&parentPosition!="static"){break;}
+parent=parent.parentNode;}
+if(!parentHasPositionAbsolute){container.style.position="absolute";}
+if(!w){w=parseInt(content.scrollWidth);container.style.width=w+"px";}
+if(!h){h=parseInt(content.scrollHeight);}
+container.removeChild(content);containerElement.removeChild(container);return new OpenLayers.Size(w,h);};OpenLayers.Util.getScrollbarWidth=function(){var scrollbarWidth=OpenLayers.Util._scrollbarWidth;if(scrollbarWidth==null){var scr=null;var inn=null;var wNoScroll=0;var wScroll=0;scr=document.createElement('div');scr.style.position='absolute';scr.style.top='-1000px';scr.style.left='-1000px';scr.style.width='100px';scr.style.height='50px';scr.style.overflow='hidden';inn=document.createElement('div');inn.style.width='100%';inn.style.height='200px';scr.appendChild(inn);document.body.appendChild(scr);wNoScroll=inn.offsetWidth;scr.style.overflow='scroll';wScroll=inn.offsetWidth;document.body.removeChild(document.body.lastChild);OpenLayers.Util._scrollbarWidth=(wNoScroll-wScroll);scrollbarWidth=OpenLayers.Util._scrollbarWidth;}
+return scrollbarWidth;};OpenLayers.Util.getFormattedLonLat=function(coordinate,axis,dmsOption){if(!dmsOption){dmsOption='dms';}
+var abscoordinate=Math.abs(coordinate)
+var coordinatedegrees=Math.floor(abscoordinate);var coordinateminutes=(abscoordinate-coordinatedegrees)/(1/60);var tempcoordinateminutes=coordinateminutes;coordinateminutes=Math.floor(coordinateminutes);var coordinateseconds=(tempcoordinateminutes-coordinateminutes)/(1/60);coordinateseconds=Math.round(coordinateseconds*10);coordinateseconds/=10;if(coordinatedegrees<10){coordinatedegrees="0"+coordinatedegrees;}
+var str=coordinatedegrees+"\u00B0";if(dmsOption.indexOf('dm')>=0){if(coordinateminutes<10){coordinateminutes="0"+coordinateminutes;}
+str+=coordinateminutes+"'";if(dmsOption.indexOf('dms')>=0){if(coordinateseconds<10){coordinateseconds="0"+coordinateseconds;}
+str+=coordinateseconds+'"';}}
+if(axis=="lon"){str+=coordinate<0?OpenLayers.i18n("W"):OpenLayers.i18n("E");}else{str+=coordinate<0?OpenLayers.i18n("S"):OpenLayers.i18n("N");}
+return str;};OpenLayers.Rico=new Object();OpenLayers.Rico.Corner={round:function(e,options){e=OpenLayers.Util.getElement(e);this._setOptions(options);var color=this.options.color;if(this.options.color=="fromElement"){color=this._background(e);}
+var bgColor=this.options.bgColor;if(this.options.bgColor=="fromParent"){bgColor=this._background(e.offsetParent);}
+this._roundCornersImpl(e,color,bgColor);},changeColor:function(theDiv,newColor){theDiv.style.backgroundColor=newColor;var spanElements=theDiv.parentNode.getElementsByTagName("span");for(var currIdx=0;currIdx<spanElements.length;currIdx++){spanElements[currIdx].style.backgroundColor=newColor;}},changeOpacity:function(theDiv,newOpacity){var mozillaOpacity=newOpacity;var ieOpacity='alpha(opacity='+newOpacity*100+')';theDiv.style.opacity=mozillaOpacity;theDiv.style.filter=ieOpacity;var spanElements=theDiv.parentNode.getElementsByTagName("span");for(var currIdx=0;currIdx<spanElements.length;currIdx++){spanElements[currIdx].style.opacity=mozillaOpacity;spanElements[currIdx].style.filter=ieOpacity;}},reRound:function(theDiv,options){var topRico=theDiv.parentNode.childNodes[0];var bottomRico=theDiv.parentNode.childNodes[2];theDiv.parentNode.removeChild(topRico);theDiv.parentNode.removeChild(bottomRico);this.round(theDiv.parentNode,options);},_roundCornersImpl:function(e,color,bgColor){if(this.options.border){this._renderBorder(e,bgColor);}
+if(this._isTopRounded()){this._roundTopCorners(e,color,bgColor);}
+if(this._isBottomRounded()){this._roundBottomCorners(e,color,bgColor);}},_renderBorder:function(el,bgColor){var borderValue="1px solid "+this._borderColor(bgColor);var borderL="border-left: "+borderValue;var borderR="border-right: "+borderValue;var style="style='"+borderL+";"+borderR+"'";el.innerHTML="<div "+style+">"+el.innerHTML+"</div>";},_roundTopCorners:function(el,color,bgColor){var corner=this._createCorner(bgColor);for(var i=0;i<this.options.numSlices;i++){corner.appendChild(this._createCornerSlice(color,bgColor,i,"top"));}
+el.style.paddingTop=0;el.insertBefore(corner,el.firstChild);},_roundBottomCorners:function(el,color,bgColor){var corner=this._createCorner(bgColor);for(var i=(this.options.numSlices-1);i>=0;i--){corner.appendChild(this._createCornerSlice(color,bgColor,i,"bottom"));}
+el.style.paddingBottom=0;el.appendChild(corner);},_createCorner:function(bgColor){var corner=document.createElement("div");corner.style.backgroundColor=(this._isTransparent()?"transparent":bgColor);return corner;},_createCornerSlice:function(color,bgColor,n,position){var slice=document.createElement("span");var inStyle=slice.style;inStyle.backgroundColor=color;inStyle.display="block";inStyle.height="1px";inStyle.overflow="hidden";inStyle.fontSize="1px";var borderColor=this._borderColor(color,bgColor);if(this.options.border&&n==0){inStyle.borderTopStyle="solid";inStyle.borderTopWidth="1px";inStyle.borderLeftWidth="0px";inStyle.borderRightWidth="0px";inStyle.borderBottomWidth="0px";inStyle.height="0px";inStyle.borderColor=borderColor;}
+else if(borderColor){inStyle.borderColor=borderColor;inStyle.borderStyle="solid";inStyle.borderWidth="0px 1px";}
+if(!this.options.compact&&(n==(this.options.numSlices-1))){inStyle.height="2px";}
+this._setMargin(slice,n,position);this._setBorder(slice,n,position);return slice;},_setOptions:function(options){this.options={corners:"all",color:"fromElement",bgColor:"fromParent",blend:true,border:false,compact:false};OpenLayers.Util.extend(this.options,options||{});this.options.numSlices=this.options.compact?2:4;if(this._isTransparent()){this.options.blend=false;}},_whichSideTop:function(){if(this._hasString(this.options.corners,"all","top")){return"";}
+if(this.options.corners.indexOf("tl")>=0&&this.options.corners.indexOf("tr")>=0){return"";}
+if(this.options.corners.indexOf("tl")>=0){return"left";}else if(this.options.corners.indexOf("tr")>=0){return"right";}
+return"";},_whichSideBottom:function(){if(this._hasString(this.options.corners,"all","bottom")){return"";}
+if(this.options.corners.indexOf("bl")>=0&&this.options.corners.indexOf("br")>=0){return"";}
+if(this.options.corners.indexOf("bl")>=0){return"left";}else if(this.options.corners.indexOf("br")>=0){return"right";}
+return"";},_borderColor:function(color,bgColor){if(color=="transparent"){return bgColor;}else if(this.options.border){return this.options.border;}else if(this.options.blend){return this._blend(bgColor,color);}else{return"";}},_setMargin:function(el,n,corners){var marginSize=this._marginSize(n);var whichSide=corners=="top"?this._whichSideTop():this._whichSideBottom();if(whichSide=="left"){el.style.marginLeft=marginSize+"px";el.style.marginRight="0px";}
+else if(whichSide=="right"){el.style.marginRight=marginSize+"px";el.style.marginLeft="0px";}
+else{el.style.marginLeft=marginSize+"px";el.style.marginRight=marginSize+"px";}},_setBorder:function(el,n,corners){var borderSize=this._borderSize(n);var whichSide=corners=="top"?this._whichSideTop():this._whichSideBottom();if(whichSide=="left"){el.style.borderLeftWidth=borderSize+"px";el.style.borderRightWidth="0px";}
+else if(whichSide=="right"){el.style.borderRightWidth=borderSize+"px";el.style.borderLeftWidth="0px";}
+else{el.style.borderLeftWidth=borderSize+"px";el.style.borderRightWidth=borderSize+"px";}
+if(this.options.border!=false){el.style.borderLeftWidth=borderSize+"px";el.style.borderRightWidth=borderSize+"px";}},_marginSize:function(n){if(this._isTransparent()){return 0;}
+var marginSizes=[5,3,2,1];var blendedMarginSizes=[3,2,1,0];var compactMarginSizes=[2,1];var smBlendedMarginSizes=[1,0];if(this.options.compact&&this.options.blend){return smBlendedMarginSizes[n];}else if(this.options.compact){return compactMarginSizes[n];}else if(this.options.blend){return blendedMarginSizes[n];}else{return marginSizes[n];}},_borderSize:function(n){var transparentBorderSizes=[5,3,2,1];var blendedBorderSizes=[2,1,1,1];var compactBorderSizes=[1,0];var actualBorderSizes=[0,2,0,0];if(this.options.compact&&(this.options.blend||this._isTransparent())){return 1;}else if(this.options.compact){return compactBorderSizes[n];}else if(this.options.blend){return blendedBorderSizes[n];}else if(this.options.border){return actualBorderSizes[n];}else if(this._isTransparent()){return transparentBorderSizes[n];}
+return 0;},_hasString:function(str){for(var i=1;i<arguments.length;i++)if(str.indexOf(arguments[i])>=0){return true;}return false;},_blend:function(c1,c2){var cc1=OpenLayers.Rico.Color.createFromHex(c1);cc1.blend(OpenLayers.Rico.Color.createFromHex(c2));return cc1;},_background:function(el){try{return OpenLayers.Rico.Color.createColorFromBackground(el).asHex();}catch(err){return"#ffffff";}},_isTransparent:function(){return this.options.color=="transparent";},_isTopRounded:function(){return this._hasString(this.options.corners,"all","top","tl","tr");},_isBottomRounded:function(){return this._hasString(this.options.corners,"all","bottom","bl","br");},_hasSingleTextChild:function(el){return el.childNodes.length==1&&el.childNodes[0].nodeType==3;}};(function(){if(window.google&&google.gears){return;}
+var factory=null;if(typeof GearsFactory!='undefined'){factory=new GearsFactory();}else{try{factory=new ActiveXObject('Gears.Factory');if(factory.getBuildInfo().indexOf('ie_mobile')!=-1){factory.privateSetGlobalObject(this);}}catch(e){if((typeof navigator.mimeTypes!='undefined')&&navigator.mimeTypes["application/x-googlegears"]){factory=document.createElement("object");factory.style.display="none";factory.width=0;factory.height=0;factory.type="application/x-googlegears";document.documentElement.appendChild(factory);}}}
+if(!factory){return;}
+if(!window.google){google={};}
+if(!google.gears){google.gears={factory:factory};}})();OpenLayers.Element={visible:function(element){return OpenLayers.Util.getElement(element).style.display!='none';},toggle:function(){for(var i=0,len=arguments.length;i<len;i++){var element=OpenLayers.Util.getElement(arguments[i]);var display=OpenLayers.Element.visible(element)?'hide':'show';OpenLayers.Element[display](element);}},hide:function(){for(var i=0,len=arguments.length;i<len;i++){var element=OpenLayers.Util.getElement(arguments[i]);if(element){element.style.display='none';}}},show:function(){for(var i=0,len=arguments.length;i<len;i++){var element=OpenLayers.Util.getElement(arguments[i]);if(element){element.style.display='';}}},remove:function(element){element=OpenLayers.Util.getElement(element);element.parentNode.removeChild(element);},getHeight:function(element){element=OpenLayers.Util.getElement(element);return element.offsetHeight;},getDimensions:function(element){element=OpenLayers.Util.getElement(element);if(OpenLayers.Element.getStyle(element,'display')!='none'){return{width:element.offsetWidth,height:element.offsetHeight};}
+var els=element.style;var originalVisibility=els.visibility;var originalPosition=els.position;var originalDisplay=els.display;els.visibility='hidden';els.position='absolute';els.display='';var originalWidth=element.clientWidth;var originalHeight=element.clientHeight;els.display=originalDisplay;els.position=originalPosition;els.visibility=originalVisibility;return{width:originalWidth,height:originalHeight};},hasClass:function(element,name){var names=element.className;return(!!names&&new RegExp("(^|\\s)"+name+"(\\s|$)").test(names));},addClass:function(element,name){if(!OpenLayers.Element.hasClass(element,name)){element.className+=(element.className?" ":"")+name;}
+return element;},removeClass:function(element,name){var names=element.className;if(names){element.className=OpenLayers.String.trim(names.replace(new RegExp("(^|\\s+)"+name+"(\\s+|$)")," "));}
+return element;},toggleClass:function(element,name){if(OpenLayers.Element.hasClass(element,name)){OpenLayers.Element.removeClass(element,name);}else{OpenLayers.Element.addClass(element,name);}
+return element;},getStyle:function(element,style){element=OpenLayers.Util.getElement(element);var value=null;if(element&&element.style){value=element.style[OpenLayers.String.camelize(style)];if(!value){if(document.defaultView&&document.defaultView.getComputedStyle){var css=document.defaultView.getComputedStyle(element,null);value=css?css.getPropertyValue(style):null;}else if(element.currentStyle){value=element.currentStyle[OpenLayers.String.camelize(style)];}}
+var positions=['left','top','right','bottom'];if(window.opera&&(OpenLayers.Util.indexOf(positions,style)!=-1)&&(OpenLayers.Element.getStyle(element,'position')=='static')){value='auto';}}
+return value=='auto'?null:value;}};OpenLayers.Size=OpenLayers.Class({w:0.0,h:0.0,initialize:function(w,h){this.w=parseFloat(w);this.h=parseFloat(h);},toString:function(){return("w="+this.w+",h="+this.h);},clone:function(){return new OpenLayers.Size(this.w,this.h);},equals:function(sz){var equals=false;if(sz!=null){equals=((this.w==sz.w&&this.h==sz.h)||(isNaN(this.w)&&isNaN(this.h)&&isNaN(sz.w)&&isNaN(sz.h)));}
+return equals;},CLASS_NAME:"OpenLayers.Size"});OpenLayers.Console={log:function(){},debug:function(){},info:function(){},warn:function(){},error:function(){},userError:function(error){alert(error);},assert:function(){},dir:function(){},dirxml:function(){},trace:function(){},group:function(){},groupEnd:function(){},time:function(){},timeEnd:function(){},profile:function(){},profileEnd:function(){},count:function(){},CLASS_NAME:"OpenLayers.Console"};(function(){var scripts=document.getElementsByTagName("script");for(var i=0,len=scripts.length;i<len;++i){if(scripts[i].src.indexOf("firebug.js")!=-1){if(console){OpenLayers.Util.extend(OpenLayers.Console,console);break;}}}})();OpenLayers.Icon=OpenLayers.Class({url:null,size:null,offset:null,calculateOffset:null,imageDiv:null,px:null,initialize:function(url,size,offset,calculateOffset){this.url=url;this.size=(size)?size:new OpenLayers.Size(20,20);this.offset=offset?offset:new OpenLayers.Pixel(-(this.size.w/2),-(this.size.h/2));this.calculateOffset=calculateOffset;var id=OpenLayers.Util.createUniqueID("OL_Icon_");this.imageDiv=OpenLayers.Util.createAlphaImageDiv(id);},destroy:function(){this.erase();OpenLayers.Event.stopObservingElement(this.imageDiv.firstChild);this.imageDiv.innerHTML="";this.imageDiv=null;},clone:function(){return new OpenLayers.Icon(this.url,this.size,this.offset,this.calculateOffset);},setSize:function(size){if(size!=null){this.size=size;}
+this.draw();},setUrl:function(url){if(url!=null){this.url=url;}
+this.draw();},draw:function(px){OpenLayers.Util.modifyAlphaImageDiv(this.imageDiv,null,null,this.size,this.url,"absolute");this.moveTo(px);return this.imageDiv;},erase:function(){if(this.imageDiv!=null&&this.imageDiv.parentNode!=null){OpenLayers.Element.remove(this.imageDiv);}},setOpacity:function(opacity){OpenLayers.Util.modifyAlphaImageDiv(this.imageDiv,null,null,null,null,null,null,null,opacity);},moveTo:function(px){if(px!=null){this.px=px;}
+if(this.imageDiv!=null){if(this.px==null){this.display(false);}else{if(this.calculateOffset){this.offset=this.calculateOffset(this.size);}
+var offsetPx=this.px.offset(this.offset);OpenLayers.Util.modifyAlphaImageDiv(this.imageDiv,null,offsetPx);}}},display:function(display){this.imageDiv.style.display=(display)?"":"none";},isDrawn:function(){var isDrawn=(this.imageDiv&&this.imageDiv.parentNode&&(this.imageDiv.parentNode.nodeType!=11));return isDrawn;},CLASS_NAME:"OpenLayers.Icon"});OpenLayers.Popup=OpenLayers.Class({events:null,id:"",lonlat:null,div:null,contentSize:null,size:null,contentHTML:null,backgroundColor:"",opacity:"",border:"",contentDiv:null,groupDiv:null,closeDiv:null,autoSize:false,minSize:null,maxSize:null,displayClass:"olPopup",contentDisplayClass:"olPopupContent",padding:0,disableFirefoxOverflowHack:false,fixPadding:function(){if(typeof this.padding=="number"){this.padding=new OpenLayers.Bounds(this.padding,this.padding,this.padding,this.padding);}},panMapIfOutOfView:false,keepInMap:false,closeOnMove:false,map:null,initialize:function(id,lonlat,contentSize,contentHTML,closeBox,closeBoxCallback){if(id==null){id=OpenLayers.Util.createUniqueID(this.CLASS_NAME+"_");}
+this.id=id;this.lonlat=lonlat;this.contentSize=(contentSize!=null)?contentSize:new OpenLayers.Size(OpenLayers.Popup.WIDTH,OpenLayers.Popup.HEIGHT);if(contentHTML!=null){this.contentHTML=contentHTML;}
+this.backgroundColor=OpenLayers.Popup.COLOR;this.opacity=OpenLayers.Popup.OPACITY;this.border=OpenLayers.Popup.BORDER;this.div=OpenLayers.Util.createDiv(this.id,null,null,null,null,null,"hidden");this.div.className=this.displayClass;var groupDivId=this.id+"_GroupDiv";this.groupDiv=OpenLayers.Util.createDiv(groupDivId,null,null,null,"relative",null,"hidden");var id=this.div.id+"_contentDiv";this.contentDiv=OpenLayers.Util.createDiv(id,null,this.contentSize.clone(),null,"relative");this.contentDiv.className=this.contentDisplayClass;this.groupDiv.appendChild(this.contentDiv);this.div.appendChild(this.groupDiv);if(closeBox){this.addCloseBox(closeBoxCallback);}
+this.registerEvents();},destroy:function(){this.id=null;this.lonlat=null;this.size=null;this.contentHTML=null;this.backgroundColor=null;this.opacity=null;this.border=null;if(this.closeOnMove&&this.map){this.map.events.unregister("movestart",this,this.hide);}
+this.events.destroy();this.events=null;if(this.closeDiv){OpenLayers.Event.stopObservingElement(this.closeDiv);this.groupDiv.removeChild(this.closeDiv);}
+this.closeDiv=null;this.div.removeChild(this.groupDiv);this.groupDiv=null;if(this.map!=null){this.map.removePopup(this);}
+this.map=null;this.div=null;this.autoSize=null;this.minSize=null;this.maxSize=null;this.padding=null;this.panMapIfOutOfView=null;},draw:function(px){if(px==null){if((this.lonlat!=null)&&(this.map!=null)){px=this.map.getLayerPxFromLonLat(this.lonlat);}}
+if(this.closeOnMove){this.map.events.register("movestart",this,this.hide);}
+if(!this.disableFirefoxOverflowHack&&OpenLayers.Util.getBrowserName()=='firefox'){this.map.events.register("movestart",this,function(){var style=document.defaultView.getComputedStyle(this.contentDiv,null);var currentOverflow=style.getPropertyValue("overflow");if(currentOverflow!="hidden"){this.contentDiv._oldOverflow=currentOverflow;this.contentDiv.style.overflow="hidden";}});this.map.events.register("moveend",this,function(){var oldOverflow=this.contentDiv._oldOverflow;if(oldOverflow){this.contentDiv.style.overflow=oldOverflow;this.contentDiv._oldOverflow=null;}});}
+this.moveTo(px);if(!this.autoSize&&!this.size){this.setSize(this.contentSize);}
+this.setBackgroundColor();this.setOpacity();this.setBorder();this.setContentHTML();if(this.panMapIfOutOfView){this.panIntoView();}
+return this.div;},updatePosition:function(){if((this.lonlat)&&(this.map)){var px=this.map.getLayerPxFromLonLat(this.lonlat);if(px){this.moveTo(px);}}},moveTo:function(px){if((px!=null)&&(this.div!=null)){this.div.style.left=px.x+"px";this.div.style.top=px.y+"px";}},visible:function(){return OpenLayers.Element.visible(this.div);},toggle:function(){if(this.visible()){this.hide();}else{this.show();}},show:function(){OpenLayers.Element.show(this.div);if(this.panMapIfOutOfView){this.panIntoView();}},hide:function(){OpenLayers.Element.hide(this.div);},setSize:function(contentSize){this.size=contentSize.clone();var contentDivPadding=this.getContentDivPadding();var wPadding=contentDivPadding.left+contentDivPadding.right;var hPadding=contentDivPadding.top+contentDivPadding.bottom;this.fixPadding();wPadding+=this.padding.left+this.padding.right;hPadding+=this.padding.top+this.padding.bottom;if(this.closeDiv){var closeDivWidth=parseInt(this.closeDiv.style.width);wPadding+=closeDivWidth+contentDivPadding.right;}
+this.size.w+=wPadding;this.size.h+=hPadding;if(OpenLayers.Util.getBrowserName()=="msie"){this.contentSize.w+=contentDivPadding.left+contentDivPadding.right;this.contentSize.h+=contentDivPadding.bottom+contentDivPadding.top;}
+if(this.div!=null){this.div.style.width=this.size.w+"px";this.div.style.height=this.size.h+"px";}
+if(this.contentDiv!=null){this.contentDiv.style.width=contentSize.w+"px";this.contentDiv.style.height=contentSize.h+"px";}},updateSize:function(){var preparedHTML="<div class='"+this.contentDisplayClass+"'>"+
+this.contentDiv.innerHTML+"</div>";var containerElement=(this.map)?this.map.layerContainerDiv:document.body;var realSize=OpenLayers.Util.getRenderedDimensions(preparedHTML,null,{displayClass:this.displayClass,containerElement:containerElement});var safeSize=this.getSafeContentSize(realSize);var newSize=null;if(safeSize.equals(realSize)){newSize=realSize;}else{var fixedSize=new OpenLayers.Size();fixedSize.w=(safeSize.w<realSize.w)?safeSize.w:null;fixedSize.h=(safeSize.h<realSize.h)?safeSize.h:null;if(fixedSize.w&&fixedSize.h){newSize=safeSize;}else{var clippedSize=OpenLayers.Util.getRenderedDimensions(preparedHTML,fixedSize,{displayClass:this.contentDisplayClass,containerElement:containerElement});var currentOverflow=OpenLayers.Element.getStyle(this.contentDiv,"overflow");if((currentOverflow!="hidden")&&(clippedSize.equals(safeSize))){var scrollBar=OpenLayers.Util.getScrollbarWidth();if(fixedSize.w){clippedSize.h+=scrollBar;}else{clippedSize.w+=scrollBar;}}
+newSize=this.getSafeContentSize(clippedSize);}}
+this.setSize(newSize);},setBackgroundColor:function(color){if(color!=undefined){this.backgroundColor=color;}
+if(this.div!=null){this.div.style.backgroundColor=this.backgroundColor;}},setOpacity:function(opacity){if(opacity!=undefined){this.opacity=opacity;}
+if(this.div!=null){this.div.style.opacity=this.opacity;this.div.style.filter='alpha(opacity='+this.opacity*100+')';}},setBorder:function(border){if(border!=undefined){this.border=border;}
+if(this.div!=null){this.div.style.border=this.border;}},setContentHTML:function(contentHTML){if(contentHTML!=null){this.contentHTML=contentHTML;}
+if((this.contentDiv!=null)&&(this.contentHTML!=null)&&(this.contentHTML!=this.contentDiv.innerHTML)){this.contentDiv.innerHTML=this.contentHTML;if(this.autoSize){this.registerImageListeners();this.updateSize();}}},registerImageListeners:function(){var onImgLoad=function(){this.popup.updateSize();if(this.popup.visible()&&this.popup.panMapIfOutOfView){this.popup.panIntoView();}
+OpenLayers.Event.stopObserving(this.img,"load",this.img._onImageLoad);};var images=this.contentDiv.getElementsByTagName("img");for(var i=0,len=images.length;i<len;i++){var img=images[i];if(img.width==0||img.height==0){var context={'popup':this,'img':img};img._onImgLoad=OpenLayers.Function.bind(onImgLoad,context);OpenLayers.Event.observe(img,'load',img._onImgLoad);}}},getSafeContentSize:function(size){var safeContentSize=size.clone();var contentDivPadding=this.getContentDivPadding();var wPadding=contentDivPadding.left+contentDivPadding.right;var hPadding=contentDivPadding.top+contentDivPadding.bottom;this.fixPadding();wPadding+=this.padding.left+this.padding.right;hPadding+=this.padding.top+this.padding.bottom;if(this.closeDiv){var closeDivWidth=parseInt(this.closeDiv.style.width);wPadding+=closeDivWidth+contentDivPadding.right;}
+if(this.minSize){safeContentSize.w=Math.max(safeContentSize.w,(this.minSize.w-wPadding));safeContentSize.h=Math.max(safeContentSize.h,(this.minSize.h-hPadding));}
+if(this.maxSize){safeContentSize.w=Math.min(safeContentSize.w,(this.maxSize.w-wPadding));safeContentSize.h=Math.min(safeContentSize.h,(this.maxSize.h-hPadding));}
+if(this.map&&this.map.size){var extraX=0,extraY=0;if(this.keepInMap&&!this.panMapIfOutOfView){var px=this.map.getPixelFromLonLat(this.lonlat);switch(this.relativePosition){case"tr":extraX=px.x;extraY=this.map.size.h-px.y;break;case"tl":extraX=this.map.size.w-px.x;extraY=this.map.size.h-px.y;break;case"bl":extraX=this.map.size.w-px.x;extraY=px.y;break;case"br":extraX=px.x;extraY=px.y;break;default:extraX=px.x;extraY=this.map.size.h-px.y;break;}}
+var maxY=this.map.size.h-
+this.map.paddingForPopups.top-
+this.map.paddingForPopups.bottom-
+hPadding-extraY;var maxX=this.map.size.w-
+this.map.paddingForPopups.left-
+this.map.paddingForPopups.right-
+wPadding-extraX;safeContentSize.w=Math.min(safeContentSize.w,maxX);safeContentSize.h=Math.min(safeContentSize.h,maxY);}
+return safeContentSize;},getContentDivPadding:function(){var contentDivPadding=this._contentDivPadding;if(!contentDivPadding){if(this.div.parentNode==null){this.div.style.display="none";document.body.appendChild(this.div);}
+contentDivPadding=new OpenLayers.Bounds(OpenLayers.Element.getStyle(this.contentDiv,"padding-left"),OpenLayers.Element.getStyle(this.contentDiv,"padding-bottom"),OpenLayers.Element.getStyle(this.contentDiv,"padding-right"),OpenLayers.Element.getStyle(this.contentDiv,"padding-top"));this._contentDivPadding=contentDivPadding;if(this.div.parentNode==document.body){document.body.removeChild(this.div);this.div.style.display="";}}
+return contentDivPadding;},addCloseBox:function(callback){this.closeDiv=OpenLayers.Util.createDiv(this.id+"_close",null,new OpenLayers.Size(17,17));this.closeDiv.className="olPopupCloseBox";var contentDivPadding=this.getContentDivPadding();this.closeDiv.style.right=contentDivPadding.right+"px";this.closeDiv.style.top=contentDivPadding.top+"px";this.groupDiv.appendChild(this.closeDiv);var closePopup=callback||function(e){this.hide();OpenLayers.Event.stop(e);};OpenLayers.Event.observe(this.closeDiv,"click",OpenLayers.Function.bindAsEventListener(closePopup,this));},panIntoView:function(){var mapSize=this.map.getSize();var origTL=this.map.getViewPortPxFromLayerPx(new OpenLayers.Pixel(parseInt(this.div.style.left),parseInt(this.div.style.top)));var newTL=origTL.clone();if(origTL.x<this.map.paddingForPopups.left){newTL.x=this.map.paddingForPopups.left;}else
+if((origTL.x+this.size.w)>(mapSize.w-this.map.paddingForPopups.right)){newTL.x=mapSize.w-this.map.paddingForPopups.right-this.size.w;}
+if(origTL.y<this.map.paddingForPopups.top){newTL.y=this.map.paddingForPopups.top;}else
+if((origTL.y+this.size.h)>(mapSize.h-this.map.paddingForPopups.bottom)){newTL.y=mapSize.h-this.map.paddingForPopups.bottom-this.size.h;}
+var dx=origTL.x-newTL.x;var dy=origTL.y-newTL.y;this.map.pan(dx,dy);},registerEvents:function(){this.events=new OpenLayers.Events(this,this.div,null,true);this.events.on({"mousedown":this.onmousedown,"mousemove":this.onmousemove,"mouseup":this.onmouseup,"click":this.onclick,"mouseout":this.onmouseout,"dblclick":this.ondblclick,scope:this});},onmousedown:function(evt){this.mousedown=true;OpenLayers.Event.stop(evt,true);},onmousemove:function(evt){if(this.mousedown){OpenLayers.Event.stop(evt,true);}},onmouseup:function(evt){if(this.mousedown){this.mousedown=false;OpenLayers.Event.stop(evt,true);}},onclick:function(evt){OpenLayers.Event.stop(evt,true);},onmouseout:function(evt){this.mousedown=false;},ondblclick:function(evt){OpenLayers.Event.stop(evt,true);},CLASS_NAME:"OpenLayers.Popup"});OpenLayers.Popup.WIDTH=200;OpenLayers.Popup.HEIGHT=200;OpenLayers.Popup.COLOR="white";OpenLayers.Popup.OPACITY=1;OpenLayers.Popup.BORDER="0px";OpenLayers.Protocol=OpenLayers.Class({format:null,options:null,autoDestroy:true,defaultFilter:null,initialize:function(options){options=options||{};OpenLayers.Util.extend(this,options);this.options=options;},mergeWithDefaultFilter:function(filter){var merged;if(filter&&this.defaultFilter){merged=new OpenLayers.Filter.Logical({type:OpenLayers.Filter.Logical.AND,filters:[this.defaultFilter,filter]});}else{merged=filter||this.defaultFilter||undefined;}
+return merged;},destroy:function(){this.options=null;this.format=null;},read:function(options){options=options||{};options.filter=this.mergeWithDefaultFilter(options.filter);},create:function(){},update:function(){},"delete":function(){},commit:function(){},abort:function(response){},createCallback:function(method,response,options){return OpenLayers.Function.bind(function(){method.apply(this,[response,options]);},this);},CLASS_NAME:"OpenLayers.Protocol"});OpenLayers.Protocol.Response=OpenLayers.Class({code:null,requestType:null,last:true,features:null,reqFeatures:null,priv:null,initialize:function(options){OpenLayers.Util.extend(this,options);},success:function(){return this.code>0;},CLASS_NAME:"OpenLayers.Protocol.Response"});OpenLayers.Protocol.Response.SUCCESS=1;OpenLayers.Protocol.Response.FAILURE=0;OpenLayers.Renderer=OpenLayers.Class({container:null,root:null,extent:null,locked:false,size:null,resolution:null,map:null,initialize:function(containerID,options){this.container=OpenLayers.Util.getElement(containerID);},destroy:function(){this.container=null;this.extent=null;this.size=null;this.resolution=null;this.map=null;},supported:function(){return false;},setExtent:function(extent,resolutionChanged){this.extent=extent.clone();if(resolutionChanged){this.resolution=null;}},setSize:function(size){this.size=size.clone();this.resolution=null;},getResolution:function(){this.resolution=this.resolution||this.map.getResolution();return this.resolution;},drawFeature:function(feature,style){if(style==null){style=feature.style;}
+if(feature.geometry){var bounds=feature.geometry.getBounds();if(bounds){if(!bounds.intersectsBounds(this.extent)){style={display:"none"};}
+var rendered=this.drawGeometry(feature.geometry,style,feature.id);if(style.display!="none"&&style.label&&rendered!==false){var location=feature.geometry.getCentroid();if(style.labelXOffset||style.labelYOffset){xOffset=isNaN(style.labelXOffset)?0:style.labelXOffset;yOffset=isNaN(style.labelYOffset)?0:style.labelYOffset;var res=this.getResolution();location.move(xOffset*res,yOffset*res);}
+this.drawText(feature.id,style,location);}else{this.removeText(feature.id);}
+return rendered;}}},drawGeometry:function(geometry,style,featureId){},drawText:function(featureId,style,location){},removeText:function(featureId){},clear:function(){},getFeatureIdFromEvent:function(evt){},eraseFeatures:function(features){if(!(features instanceof Array)){features=[features];}
+for(var i=0,len=features.length;i<len;++i){var feature=features[i];this.eraseGeometry(feature.geometry,feature.id);this.removeText(feature.id);}},eraseGeometry:function(geometry,featureId){},moveRoot:function(renderer){},getRenderLayerId:function(){return this.container.id;},applyDefaultSymbolizer:function(symbolizer){var result=OpenLayers.Util.extend({},OpenLayers.Renderer.defaultSymbolizer);if(symbolizer.stroke===false){delete result.strokeWidth;delete result.strokeColor;}
+if(symbolizer.fill===false){delete result.fillColor;}
+OpenLayers.Util.extend(result,symbolizer);return result;},CLASS_NAME:"OpenLayers.Renderer"});OpenLayers.Renderer.defaultSymbolizer={fillColor:"#000000",strokeColor:"#000000",strokeWidth:2,fillOpacity:1,strokeOpacity:1,pointRadius:0};OpenLayers.Strategy=OpenLayers.Class({layer:null,options:null,active:null,autoActivate:true,autoDestroy:true,initialize:function(options){OpenLayers.Util.extend(this,options);this.options=options;this.active=false;},destroy:function(){this.deactivate();this.layer=null;this.options=null;},setLayer:function(layer){this.layer=layer;},activate:function(){if(!this.active){this.active=true;return true;}
+return false;},deactivate:function(){if(this.active){this.active=false;return true;}
+return false;},CLASS_NAME:"OpenLayers.Strategy"});OpenLayers.Symbolizer=OpenLayers.Class({zIndex:0,initialize:function(config){OpenLayers.Util.extend(this,config);},clone:function(){var Type=eval(this.CLASS_NAME);return new Type(OpenLayers.Util.extend({},this));},CLASS_NAME:"OpenLayers.Symbolizer"});OpenLayers.Rico.Color=OpenLayers.Class({initialize:function(red,green,blue){this.rgb={r:red,g:green,b:blue};},setRed:function(r){this.rgb.r=r;},setGreen:function(g){this.rgb.g=g;},setBlue:function(b){this.rgb.b=b;},setHue:function(h){var hsb=this.asHSB();hsb.h=h;this.rgb=OpenLayers.Rico.Color.HSBtoRGB(hsb.h,hsb.s,hsb.b);},setSaturation:function(s){var hsb=this.asHSB();hsb.s=s;this.rgb=OpenLayers.Rico.Color.HSBtoRGB(hsb.h,hsb.s,hsb.b);},setBrightness:function(b){var hsb=this.asHSB();hsb.b=b;this.rgb=OpenLayers.Rico.Color.HSBtoRGB(hsb.h,hsb.s,hsb.b);},darken:function(percent){var hsb=this.asHSB();this.rgb=OpenLayers.Rico.Color.HSBtoRGB(hsb.h,hsb.s,Math.max(hsb.b-percent,0));},brighten:function(percent){var hsb=this.asHSB();this.rgb=OpenLayers.Rico.Color.HSBtoRGB(hsb.h,hsb.s,Math.min(hsb.b+percent,1));},blend:function(other){this.rgb.r=Math.floor((this.rgb.r+other.rgb.r)/2);this.rgb.g=Math.floor((this.rgb.g+other.rgb.g)/2);this.rgb.b=Math.floor((this.rgb.b+other.rgb.b)/2);},isBright:function(){var hsb=this.asHSB();return this.asHSB().b>0.5;},isDark:function(){return!this.isBright();},asRGB:function(){return"rgb("+this.rgb.r+","+this.rgb.g+","+this.rgb.b+")";},asHex:function(){return"#"+this.rgb.r.toColorPart()+this.rgb.g.toColorPart()+this.rgb.b.toColorPart();},asHSB:function(){return OpenLayers.Rico.Color.RGBtoHSB(this.rgb.r,this.rgb.g,this.rgb.b);},toString:function(){return this.asHex();}});OpenLayers.Rico.Color.createFromHex=function(hexCode){if(hexCode.length==4){var shortHexCode=hexCode;var hexCode='#';for(var i=1;i<4;i++){hexCode+=(shortHexCode.charAt(i)+
+shortHexCode.charAt(i));}}
+if(hexCode.indexOf('#')==0){hexCode=hexCode.substring(1);}
+var red=hexCode.substring(0,2);var green=hexCode.substring(2,4);var blue=hexCode.substring(4,6);return new OpenLayers.Rico.Color(parseInt(red,16),parseInt(green,16),parseInt(blue,16));};OpenLayers.Rico.Color.createColorFromBackground=function(elem){var actualColor=RicoUtil.getElementsComputedStyle(OpenLayers.Util.getElement(elem),"backgroundColor","background-color");if(actualColor=="transparent"&&elem.parentNode){return OpenLayers.Rico.Color.createColorFromBackground(elem.parentNode);}
+if(actualColor==null){return new OpenLayers.Rico.Color(255,255,255);}
+if(actualColor.indexOf("rgb(")==0){var colors=actualColor.substring(4,actualColor.length-1);var colorArray=colors.split(",");return new OpenLayers.Rico.Color(parseInt(colorArray[0]),parseInt(colorArray[1]),parseInt(colorArray[2]));}
+else if(actualColor.indexOf("#")==0){return OpenLayers.Rico.Color.createFromHex(actualColor);}
+else{return new OpenLayers.Rico.Color(255,255,255);}};OpenLayers.Rico.Color.HSBtoRGB=function(hue,saturation,brightness){var red=0;var green=0;var blue=0;if(saturation==0){red=parseInt(brightness*255.0+0.5);green=red;blue=red;}
+else{var h=(hue-Math.floor(hue))*6.0;var f=h-Math.floor(h);var p=brightness*(1.0-saturation);var q=brightness*(1.0-saturation*f);var t=brightness*(1.0-(saturation*(1.0-f)));switch(parseInt(h)){case 0:red=(brightness*255.0+0.5);green=(t*255.0+0.5);blue=(p*255.0+0.5);break;case 1:red=(q*255.0+0.5);green=(brightness*255.0+0.5);blue=(p*255.0+0.5);break;case 2:red=(p*255.0+0.5);green=(brightness*255.0+0.5);blue=(t*255.0+0.5);break;case 3:red=(p*255.0+0.5);green=(q*255.0+0.5);blue=(brightness*255.0+0.5);break;case 4:red=(t*255.0+0.5);green=(p*255.0+0.5);blue=(brightness*255.0+0.5);break;case 5:red=(brightness*255.0+0.5);green=(p*255.0+0.5);blue=(q*255.0+0.5);break;}}
+return{r:parseInt(red),g:parseInt(green),b:parseInt(blue)};};OpenLayers.Rico.Color.RGBtoHSB=function(r,g,b){var hue;var saturation;var brightness;var cmax=(r>g)?r:g;if(b>cmax){cmax=b;}
+var cmin=(r<g)?r:g;if(b<cmin){cmin=b;}
+brightness=cmax/255.0;if(cmax!=0){saturation=(cmax-cmin)/cmax;}else{saturation=0;}
+if(saturation==0){hue=0;}else{var redc=(cmax-r)/(cmax-cmin);var greenc=(cmax-g)/(cmax-cmin);var bluec=(cmax-b)/(cmax-cmin);if(r==cmax){hue=bluec-greenc;}else if(g==cmax){hue=2.0+redc-bluec;}else{hue=4.0+greenc-redc;}
+hue=hue/6.0;if(hue<0){hue=hue+1.0;}}
+return{h:hue,s:saturation,b:brightness};};OpenLayers.Bounds=OpenLayers.Class({left:null,bottom:null,right:null,top:null,centerLonLat:null,initialize:function(left,bottom,right,top){if(left!=null){this.left=OpenLayers.Util.toFloat(left);}
+if(bottom!=null){this.bottom=OpenLayers.Util.toFloat(bottom);}
+if(right!=null){this.right=OpenLayers.Util.toFloat(right);}
+if(top!=null){this.top=OpenLayers.Util.toFloat(top);}},clone:function(){return new OpenLayers.Bounds(this.left,this.bottom,this.right,this.top);},equals:function(bounds){var equals=false;if(bounds!=null){equals=((this.left==bounds.left)&&(this.right==bounds.right)&&(this.top==bounds.top)&&(this.bottom==bounds.bottom));}
+return equals;},toString:function(){return("left-bottom=("+this.left+","+this.bottom+")"
++" right-top=("+this.right+","+this.top+")");},toArray:function(reverseAxisOrder){if(reverseAxisOrder===true){return[this.bottom,this.left,this.top,this.right];}else{return[this.left,this.bottom,this.right,this.top];}},toBBOX:function(decimal,reverseAxisOrder){if(decimal==null){decimal=6;}
+var mult=Math.pow(10,decimal);var xmin=Math.round(this.left*mult)/mult;var ymin=Math.round(this.bottom*mult)/mult;var xmax=Math.round(this.right*mult)/mult;var ymax=Math.round(this.top*mult)/mult;if(reverseAxisOrder===true){return ymin+","+xmin+","+ymax+","+xmax;}else{return xmin+","+ymin+","+xmax+","+ymax;}},toGeometry:function(){return new OpenLayers.Geometry.Polygon([new OpenLayers.Geometry.LinearRing([new OpenLayers.Geometry.Point(this.left,this.bottom),new OpenLayers.Geometry.Point(this.right,this.bottom),new OpenLayers.Geometry.Point(this.right,this.top),new OpenLayers.Geometry.Point(this.left,this.top)])]);},getWidth:function(){return(this.right-this.left);},getHeight:function(){return(this.top-this.bottom);},getSize:function(){return new OpenLayers.Size(this.getWidth(),this.getHeight());},getCenterPixel:function(){return new OpenLayers.Pixel((this.left+this.right)/2,(this.bottom+this.top)/2);},getCenterLonLat:function(){if(!this.centerLonLat){this.centerLonLat=new OpenLayers.LonLat((this.left+this.right)/2,(this.bottom+this.top)/2);}
+return this.centerLonLat;},scale:function(ratio,origin){if(origin==null){origin=this.getCenterLonLat();}
+var origx,origy;if(origin.CLASS_NAME=="OpenLayers.LonLat"){origx=origin.lon;origy=origin.lat;}else{origx=origin.x;origy=origin.y;}
+var left=(this.left-origx)*ratio+origx;var bottom=(this.bottom-origy)*ratio+origy;var right=(this.right-origx)*ratio+origx;var top=(this.top-origy)*ratio+origy;return new OpenLayers.Bounds(left,bottom,right,top);},add:function(x,y){if((x==null)||(y==null)){var msg=OpenLayers.i18n("boundsAddError");OpenLayers.Console.error(msg);return null;}
+return new OpenLayers.Bounds(this.left+x,this.bottom+y,this.right+x,this.top+y);},extend:function(object){var bounds=null;if(object){switch(object.CLASS_NAME){case"OpenLayers.LonLat":bounds=new OpenLayers.Bounds(object.lon,object.lat,object.lon,object.lat);break;case"OpenLayers.Geometry.Point":bounds=new OpenLayers.Bounds(object.x,object.y,object.x,object.y);break;case"OpenLayers.Bounds":bounds=object;break;}
+if(bounds){this.centerLonLat=null;if((this.left==null)||(bounds.left<this.left)){this.left=bounds.left;}
+if((this.bottom==null)||(bounds.bottom<this.bottom)){this.bottom=bounds.bottom;}
+if((this.right==null)||(bounds.right>this.right)){this.right=bounds.right;}
+if((this.top==null)||(bounds.top>this.top)){this.top=bounds.top;}}}},containsLonLat:function(ll,inclusive){return this.contains(ll.lon,ll.lat,inclusive);},containsPixel:function(px,inclusive){return this.contains(px.x,px.y,inclusive);},contains:function(x,y,inclusive){if(inclusive==null){inclusive=true;}
+if(x==null||y==null){return false;}
+x=OpenLayers.Util.toFloat(x);y=OpenLayers.Util.toFloat(y);var contains=false;if(inclusive){contains=((x>=this.left)&&(x<=this.right)&&(y>=this.bottom)&&(y<=this.top));}else{contains=((x>this.left)&&(x<this.right)&&(y>this.bottom)&&(y<this.top));}
+return contains;},intersectsBounds:function(bounds,inclusive){if(inclusive==null){inclusive=true;}
+var intersects=false;var mightTouch=(this.left==bounds.right||this.right==bounds.left||this.top==bounds.bottom||this.bottom==bounds.top);if(inclusive||!mightTouch){var inBottom=(((bounds.bottom>=this.bottom)&&(bounds.bottom<=this.top))||((this.bottom>=bounds.bottom)&&(this.bottom<=bounds.top)));var inTop=(((bounds.top>=this.bottom)&&(bounds.top<=this.top))||((this.top>bounds.bottom)&&(this.top<bounds.top)));var inLeft=(((bounds.left>=this.left)&&(bounds.left<=this.right))||((this.left>=bounds.left)&&(this.left<=bounds.right)));var inRight=(((bounds.right>=this.left)&&(bounds.right<=this.right))||((this.right>=bounds.left)&&(this.right<=bounds.right)));intersects=((inBottom||inTop)&&(inLeft||inRight));}
+return intersects;},containsBounds:function(bounds,partial,inclusive){if(partial==null){partial=false;}
+if(inclusive==null){inclusive=true;}
+var bottomLeft=this.contains(bounds.left,bounds.bottom,inclusive);var bottomRight=this.contains(bounds.right,bounds.bottom,inclusive);var topLeft=this.contains(bounds.left,bounds.top,inclusive);var topRight=this.contains(bounds.right,bounds.top,inclusive);return(partial)?(bottomLeft||bottomRight||topLeft||topRight):(bottomLeft&&bottomRight&&topLeft&&topRight);},determineQuadrant:function(lonlat){var quadrant="";var center=this.getCenterLonLat();quadrant+=(lonlat.lat<center.lat)?"b":"t";quadrant+=(lonlat.lon<center.lon)?"l":"r";return quadrant;},transform:function(source,dest){this.centerLonLat=null;var ll=OpenLayers.Projection.transform({'x':this.left,'y':this.bottom},source,dest);var lr=OpenLayers.Projection.transform({'x':this.right,'y':this.bottom},source,dest);var ul=OpenLayers.Projection.transform({'x':this.left,'y':this.top},source,dest);var ur=OpenLayers.Projection.transform({'x':this.right,'y':this.top},source,dest);this.left=Math.min(ll.x,ul.x);this.bottom=Math.min(ll.y,lr.y);this.right=Math.max(lr.x,ur.x);this.top=Math.max(ul.y,ur.y);return this;},wrapDateLine:function(maxExtent,options){options=options||{};var leftTolerance=options.leftTolerance||0;var rightTolerance=options.rightTolerance||0;var newBounds=this.clone();if(maxExtent){while(newBounds.left<maxExtent.left&&(newBounds.right-rightTolerance)<=maxExtent.left){newBounds=newBounds.add(maxExtent.getWidth(),0);}
+while((newBounds.left+leftTolerance)>=maxExtent.right&&newBounds.right>maxExtent.right){newBounds=newBounds.add(-maxExtent.getWidth(),0);}}
+return newBounds;},CLASS_NAME:"OpenLayers.Bounds"});OpenLayers.Bounds.fromString=function(str){var bounds=str.split(",");return OpenLayers.Bounds.fromArray(bounds);};OpenLayers.Bounds.fromArray=function(bbox){return new OpenLayers.Bounds(parseFloat(bbox[0]),parseFloat(bbox[1]),parseFloat(bbox[2]),parseFloat(bbox[3]));};OpenLayers.Bounds.fromSize=function(size){return new OpenLayers.Bounds(0,size.h,size.w,0);};OpenLayers.Bounds.oppositeQuadrant=function(quadrant){var opp="";opp+=(quadrant.charAt(0)=='t')?'b':'t';opp+=(quadrant.charAt(1)=='l')?'r':'l';return opp;};OpenLayers.LonLat=OpenLayers.Class({lon:0.0,lat:0.0,initialize:function(lon,lat){this.lon=OpenLayers.Util.toFloat(lon);this.lat=OpenLayers.Util.toFloat(lat);},toString:function(){return("lon="+this.lon+",lat="+this.lat);},toShortString:function(){return(this.lon+", "+this.lat);},clone:function(){return new OpenLayers.LonLat(this.lon,this.lat);},add:function(lon,lat){if((lon==null)||(lat==null)){var msg=OpenLayers.i18n("lonlatAddError");OpenLayers.Console.error(msg);return null;}
+return new OpenLayers.LonLat(this.lon+OpenLayers.Util.toFloat(lon),this.lat+OpenLayers.Util.toFloat(lat));},equals:function(ll){var equals=false;if(ll!=null){equals=((this.lon==ll.lon&&this.lat==ll.lat)||(isNaN(this.lon)&&isNaN(this.lat)&&isNaN(ll.lon)&&isNaN(ll.lat)));}
+return equals;},transform:function(source,dest){var point=OpenLayers.Projection.transform({'x':this.lon,'y':this.lat},source,dest);this.lon=point.x;this.lat=point.y;return this;},wrapDateLine:function(maxExtent){var newLonLat=this.clone();if(maxExtent){while(newLonLat.lon<maxExtent.left){newLonLat.lon+=maxExtent.getWidth();}
+while(newLonLat.lon>maxExtent.right){newLonLat.lon-=maxExtent.getWidth();}}
+return newLonLat;},CLASS_NAME:"OpenLayers.LonLat"});OpenLayers.LonLat.fromString=function(str){var pair=str.split(",");return new OpenLayers.LonLat(pair[0],pair[1]);};OpenLayers.Pixel=OpenLayers.Class({x:0.0,y:0.0,initialize:function(x,y){this.x=parseFloat(x);this.y=parseFloat(y);},toString:function(){return("x="+this.x+",y="+this.y);},clone:function(){return new OpenLayers.Pixel(this.x,this.y);},equals:function(px){var equals=false;if(px!=null){equals=((this.x==px.x&&this.y==px.y)||(isNaN(this.x)&&isNaN(this.y)&&isNaN(px.x)&&isNaN(px.y)));}
+return equals;},add:function(x,y){if((x==null)||(y==null)){var msg=OpenLayers.i18n("pixelAddError");OpenLayers.Console.error(msg);return null;}
+return new OpenLayers.Pixel(this.x+x,this.y+y);},offset:function(px){var newPx=this.clone();if(px){newPx=this.add(px.x,px.y);}
+return newPx;},CLASS_NAME:"OpenLayers.Pixel"});OpenLayers.Control=OpenLayers.Class({id:null,map:null,div:null,type:null,allowSelection:false,displayClass:"",title:"",autoActivate:false,active:null,handler:null,eventListeners:null,events:null,EVENT_TYPES:["activate","deactivate"],initialize:function(options){this.displayClass=this.CLASS_NAME.replace("OpenLayers.","ol").replace(/\./g,"");OpenLayers.Util.extend(this,options);this.events=new OpenLayers.Events(this,null,this.EVENT_TYPES);if(this.eventListeners instanceof Object){this.events.on(this.eventListeners);}
+if(this.id==null){this.id=OpenLayers.Util.createUniqueID(this.CLASS_NAME+"_");}},destroy:function(){if(this.events){if(this.eventListeners){this.events.un(this.eventListeners);}
+this.events.destroy();this.events=null;}
+this.eventListeners=null;if(this.handler){this.handler.destroy();this.handler=null;}
+if(this.handlers){for(var key in this.handlers){if(this.handlers.hasOwnProperty(key)&&typeof this.handlers[key].destroy=="function"){this.handlers[key].destroy();}}
+this.handlers=null;}
+if(this.map){this.map.removeControl(this);this.map=null;}},setMap:function(map){this.map=map;if(this.handler){this.handler.setMap(map);}},draw:function(px){if(this.div==null){this.div=OpenLayers.Util.createDiv(this.id);this.div.className=this.displayClass;if(!this.allowSelection){this.div.className+=" olControlNoSelect";this.div.setAttribute("unselectable","on",0);this.div.onselectstart=OpenLayers.Function.False;}
+if(this.title!=""){this.div.title=this.title;}}
+if(px!=null){this.position=px.clone();}
+this.moveTo(this.position);return this.div;},moveTo:function(px){if((px!=null)&&(this.div!=null)){this.div.style.left=px.x+"px";this.div.style.top=px.y+"px";}},activate:function(){if(this.active){return false;}
+if(this.handler){this.handler.activate();}
+this.active=true;if(this.map){OpenLayers.Element.addClass(this.map.viewPortDiv,this.displayClass.replace(/ /g,"")+"Active");}
+this.events.triggerEvent("activate");return true;},deactivate:function(){if(this.active){if(this.handler){this.handler.deactivate();}
+this.active=false;if(this.map){OpenLayers.Element.removeClass(this.map.viewPortDiv,this.displayClass.replace(/ /g,"")+"Active");}
+this.events.triggerEvent("deactivate");return true;}
+return false;},CLASS_NAME:"OpenLayers.Control"});OpenLayers.Control.TYPE_BUTTON=1;OpenLayers.Control.TYPE_TOGGLE=2;OpenLayers.Control.TYPE_TOOL=3;OpenLayers.Lang={code:null,defaultCode:"en",getCode:function(){if(!OpenLayers.Lang.code){OpenLayers.Lang.setCode();}
+return OpenLayers.Lang.code;},setCode:function(code){var lang;if(!code){code=(OpenLayers.Util.getBrowserName()=="msie")?navigator.userLanguage:navigator.language;}
+var parts=code.split('-');parts[0]=parts[0].toLowerCase();if(typeof OpenLayers.Lang[parts[0]]=="object"){lang=parts[0];}
+if(parts[1]){var testLang=parts[0]+'-'+parts[1].toUpperCase();if(typeof OpenLayers.Lang[testLang]=="object"){lang=testLang;}}
+if(!lang){OpenLayers.Console.warn('Failed to find OpenLayers.Lang.'+parts.join("-")+' dictionary, falling back to default language');lang=OpenLayers.Lang.defaultCode;}
+OpenLayers.Lang.code=lang;},translate:function(key,context){var dictionary=OpenLayers.Lang[OpenLayers.Lang.getCode()];var message=dictionary[key];if(!message){message=key;}
+if(context){message=OpenLayers.String.format(message,context);}
+return message;}};OpenLayers.i18n=OpenLayers.Lang.translate;OpenLayers.Popup.Anchored=OpenLayers.Class(OpenLayers.Popup,{relativePosition:null,keepInMap:true,anchor:null,initialize:function(id,lonlat,contentSize,contentHTML,anchor,closeBox,closeBoxCallback){var newArguments=[id,lonlat,contentSize,contentHTML,closeBox,closeBoxCallback];OpenLayers.Popup.prototype.initialize.apply(this,newArguments);this.anchor=(anchor!=null)?anchor:{size:new OpenLayers.Size(0,0),offset:new OpenLayers.Pixel(0,0)};},destroy:function(){this.anchor=null;this.relativePosition=null;OpenLayers.Popup.prototype.destroy.apply(this,arguments);},show:function(){this.updatePosition();OpenLayers.Popup.prototype.show.apply(this,arguments);},moveTo:function(px){var oldRelativePosition=this.relativePosition;this.relativePosition=this.calculateRelativePosition(px);var newPx=this.calculateNewPx(px);var newArguments=new Array(newPx);OpenLayers.Popup.prototype.moveTo.apply(this,newArguments);if(this.relativePosition!=oldRelativePosition){this.updateRelativePosition();}},setSize:function(contentSize){OpenLayers.Popup.prototype.setSize.apply(this,arguments);if((this.lonlat)&&(this.map)){var px=this.map.getLayerPxFromLonLat(this.lonlat);this.moveTo(px);}},calculateRelativePosition:function(px){var lonlat=this.map.getLonLatFromLayerPx(px);var extent=this.map.getExtent();var quadrant=extent.determineQuadrant(lonlat);return OpenLayers.Bounds.oppositeQuadrant(quadrant);},updateRelativePosition:function(){},calculateNewPx:function(px){var newPx=px.offset(this.anchor.offset);var size=this.size||this.contentSize;var top=(this.relativePosition.charAt(0)=='t');newPx.y+=(top)?-(size.h+this.anchor.size.h):this.anchor.size.h;var left=(this.relativePosition.charAt(1)=='l');newPx.x+=(left)?-(size.w+this.anchor.size.w):this.anchor.size.w;return newPx;},CLASS_NAME:"OpenLayers.Popup.Anchored"});OpenLayers.Protocol.SOS=function(options){options=OpenLayers.Util.applyDefaults(options,OpenLayers.Protocol.SOS.DEFAULTS);var cls=OpenLayers.Protocol.SOS["v"+options.version.replace(/\./g,"_")];if(!cls){throw"Unsupported SOS version: "+options.version;}
+return new cls(options);};OpenLayers.Protocol.SOS.DEFAULTS={"version":"1.0.0"};OpenLayers.Protocol.SQL=OpenLayers.Class(OpenLayers.Protocol,{databaseName:'ol',tableName:"ol_vector_features",postReadFiltering:true,initialize:function(options){OpenLayers.Protocol.prototype.initialize.apply(this,[options]);},destroy:function(){OpenLayers.Protocol.prototype.destroy.apply(this);},supported:function(){return false;},evaluateFilter:function(feature,filter){return filter&&this.postReadFiltering?filter.evaluate(feature):true;},CLASS_NAME:"OpenLayers.Protocol.SQL"});OpenLayers.Protocol.WFS=function(options){options=OpenLayers.Util.applyDefaults(options,OpenLayers.Protocol.WFS.DEFAULTS);var cls=OpenLayers.Protocol.WFS["v"+options.version.replace(/\./g,"_")];if(!cls){throw"Unsupported WFS version: "+options.version;}
+return new cls(options);};OpenLayers.Protocol.WFS.fromWMSLayer=function(layer,options){var typeName,featurePrefix;var param=layer.params["LAYERS"];var parts=(param instanceof Array?param[0]:param).split(":");if(parts.length>1){featurePrefix=parts[0];}
+typeName=parts.pop();var protocolOptions={url:layer.url,featureType:typeName,featurePrefix:featurePrefix,srsName:layer.projection&&layer.projection.getCode()||layer.map&&layer.map.getProjectionObject().getCode(),version:"1.1.0"};return new OpenLayers.Protocol.WFS(OpenLayers.Util.applyDefaults(options,protocolOptions));};OpenLayers.Protocol.WFS.DEFAULTS={"version":"1.0.0"};OpenLayers.Renderer.Canvas=OpenLayers.Class(OpenLayers.Renderer,{canvas:null,features:null,initialize:function(containerID){OpenLayers.Renderer.prototype.initialize.apply(this,arguments);this.root=document.createElement("canvas");this.container.appendChild(this.root);this.canvas=this.root.getContext("2d");this.features={};},eraseGeometry:function(geometry,featureId){this.eraseFeatures(this.features[featureId][0]);},supported:function(){var canvas=document.createElement("canvas");return!!canvas.getContext;},setExtent:function(extent){this.extent=extent.clone();this.resolution=null;this.redraw();},setSize:function(size){this.size=size.clone();this.root.style.width=size.w+"px";this.root.style.height=size.h+"px";this.root.width=size.w;this.root.height=size.h;this.resolution=null;},drawFeature:function(feature,style){style=style||feature.style;style=this.applyDefaultSymbolizer(style);this.features[feature.id]=[feature,style];this.redraw();},drawGeometry:function(geometry,style){var className=geometry.CLASS_NAME;if((className=="OpenLayers.Geometry.Collection")||(className=="OpenLayers.Geometry.MultiPoint")||(className=="OpenLayers.Geometry.MultiLineString")||(className=="OpenLayers.Geometry.MultiPolygon")){for(var i=0;i<geometry.components.length;i++){this.drawGeometry(geometry.components[i],style);}
+return;}
+switch(geometry.CLASS_NAME){case"OpenLayers.Geometry.Point":this.drawPoint(geometry,style);break;case"OpenLayers.Geometry.LineString":this.drawLineString(geometry,style);break;case"OpenLayers.Geometry.LinearRing":this.drawLinearRing(geometry,style);break;case"OpenLayers.Geometry.Polygon":this.drawPolygon(geometry,style);break;default:break;}},drawExternalGraphic:function(pt,style){var img=new Image();if(style.graphicTitle){img.title=style.graphicTitle;}
+var width=style.graphicWidth||style.graphicHeight;var height=style.graphicHeight||style.graphicWidth;width=width?width:style.pointRadius*2;height=height?height:style.pointRadius*2;var xOffset=(style.graphicXOffset!=undefined)?style.graphicXOffset:-(0.5*width);var yOffset=(style.graphicYOffset!=undefined)?style.graphicYOffset:-(0.5*height);var context={img:img,x:(pt[0]+xOffset),y:(pt[1]+yOffset),width:width,height:height,opacity:style.graphicOpacity||style.fillOpacity,canvas:this.canvas};img.onload=OpenLayers.Function.bind(function(){this.canvas.globalAlpha=this.opacity;this.canvas.drawImage(this.img,this.x,this.y,this.width,this.height);},context);img.src=style.externalGraphic;},setCanvasStyle:function(type,style){if(type=="fill"){this.canvas.globalAlpha=style['fillOpacity'];this.canvas.fillStyle=style['fillColor'];}else if(type=="stroke"){this.canvas.globalAlpha=style['strokeOpacity'];this.canvas.strokeStyle=style['strokeColor'];this.canvas.lineWidth=style['strokeWidth'];}else{this.canvas.globalAlpha=0;this.canvas.lineWidth=1;}},drawPoint:function(geometry,style){if(style.graphic!==false){var pt=this.getLocalXY(geometry);if(style.externalGraphic){this.drawExternalGraphic(pt,style);}else{if(style.fill!==false){this.setCanvasStyle("fill",style);this.canvas.beginPath();this.canvas.arc(pt[0],pt[1],style.pointRadius,0,Math.PI*2,true);this.canvas.fill();}
+if(style.stroke!==false){this.setCanvasStyle("stroke",style);this.canvas.beginPath();this.canvas.arc(pt[0],pt[1],style.pointRadius,0,Math.PI*2,true);this.canvas.stroke();this.setCanvasStyle("reset");}}}},drawLineString:function(geometry,style){if(style.stroke!==false){this.setCanvasStyle("stroke",style);this.canvas.beginPath();var start=this.getLocalXY(geometry.components[0]);this.canvas.moveTo(start[0],start[1]);for(var i=1;i<geometry.components.length;i++){var pt=this.getLocalXY(geometry.components[i]);this.canvas.lineTo(pt[0],pt[1]);}
+this.canvas.stroke();}
+this.setCanvasStyle("reset");},drawLinearRing:function(geometry,style){if(style.fill!==false){this.setCanvasStyle("fill",style);this.canvas.beginPath();var start=this.getLocalXY(geometry.components[0]);this.canvas.moveTo(start[0],start[1]);for(var i=1;i<geometry.components.length-1;i++){var pt=this.getLocalXY(geometry.components[i]);this.canvas.lineTo(pt[0],pt[1]);}
+this.canvas.fill();}
+if(style.stroke!==false){this.setCanvasStyle("stroke",style);this.canvas.beginPath();var start=this.getLocalXY(geometry.components[0]);this.canvas.moveTo(start[0],start[1]);for(var i=1;i<geometry.components.length;i++){var pt=this.getLocalXY(geometry.components[i]);this.canvas.lineTo(pt[0],pt[1]);}
+this.canvas.stroke();}
+this.setCanvasStyle("reset");},drawPolygon:function(geometry,style){this.drawLinearRing(geometry.components[0],style);for(var i=1;i<geometry.components.length;i++){this.drawLinearRing(geometry.components[i],{fillOpacity:0,strokeWidth:0,strokeOpacity:0,strokeColor:'#000000',fillColor:'#000000'});}},drawText:function(location,style){style=OpenLayers.Util.extend({fontColor:"#000000",labelAlign:"cm"},style);var pt=this.getLocalXY(location);this.setCanvasStyle("reset");this.canvas.fillStyle=style.fontColor;this.canvas.globalAlpha=style.fontOpacity||1.0;var fontStyle=style.fontWeight+" "+style.fontSize+" "+style.fontFamily;if(this.canvas.fillText){var labelAlign=OpenLayers.Renderer.Canvas.LABEL_ALIGN[style.labelAlign[0]]||"center";this.canvas.font=fontStyle;this.canvas.textAlign=labelAlign;this.canvas.fillText(style.label,pt[0],pt[1]);}else if(this.canvas.mozDrawText){this.canvas.mozTextStyle=fontStyle;var len=this.canvas.mozMeasureText(style.label);switch(style.labelAlign[0]){case"l":break;case"r":pt[0]-=len;break;case"c":default:pt[0]-=len/2;}
+this.canvas.translate(pt[0],pt[1]);this.canvas.mozDrawText(style.label);this.canvas.translate(-1*pt[0],-1*pt[1]);}
+this.setCanvasStyle("reset");},getLocalXY:function(point){var resolution=this.getResolution();var extent=this.extent;var x=(point.x/resolution+(-extent.left/resolution));var y=((extent.top/resolution)-point.y/resolution);return[x,y];},clear:function(){this.canvas.clearRect(0,0,this.root.width,this.root.height);this.features={};},getFeatureIdFromEvent:function(evt){var loc=this.map.getLonLatFromPixel(evt.xy);var resolution=this.getResolution();var bounds=new OpenLayers.Bounds(loc.lon-resolution*5,loc.lat-resolution*5,loc.lon+resolution*5,loc.lat+resolution*5);var geom=bounds.toGeometry();for(var feat in this.features){if(!this.features.hasOwnProperty(feat)){continue;}
+if(this.features[feat][0].geometry.intersects(geom)){return feat;}}
+return null;},eraseFeatures:function(features){if(!(features instanceof Array)){features=[features];}
+for(var i=0;i<features.length;++i){delete this.features[features[i].id];}
+this.redraw();},redraw:function(){if(!this.locked){this.canvas.clearRect(0,0,this.root.width,this.root.height);var labelMap=[];var feature,style;for(var id in this.features){if(!this.features.hasOwnProperty(id)){continue;}
+feature=this.features[id][0];style=this.features[id][1];if(!feature.geometry){continue;}
+this.drawGeometry(feature.geometry,style);if(style.label){labelMap.push([feature,style]);}}
+var item;for(var i=0,len=labelMap.length;i<len;++i){item=labelMap[i];this.drawText(item[0].geometry.getCentroid(),item[1]);}}},CLASS_NAME:"OpenLayers.Renderer.Canvas"});OpenLayers.Renderer.Canvas.LABEL_ALIGN={"l":"left","r":"right"};OpenLayers.ElementsIndexer=OpenLayers.Class({maxZIndex:null,order:null,indices:null,compare:null,initialize:function(yOrdering){this.compare=yOrdering?OpenLayers.ElementsIndexer.IndexingMethods.Z_ORDER_Y_ORDER:OpenLayers.ElementsIndexer.IndexingMethods.Z_ORDER_DRAWING_ORDER;this.order=[];this.indices={};this.maxZIndex=0;},insert:function(newNode){if(this.exists(newNode)){this.remove(newNode);}
+var nodeId=newNode.id;this.determineZIndex(newNode);var leftIndex=-1;var rightIndex=this.order.length;var middle;while(rightIndex-leftIndex>1){middle=parseInt((leftIndex+rightIndex)/2);var placement=this.compare(this,newNode,OpenLayers.Util.getElement(this.order[middle]));if(placement>0){leftIndex=middle;}else{rightIndex=middle;}}
+this.order.splice(rightIndex,0,nodeId);this.indices[nodeId]=this.getZIndex(newNode);return this.getNextElement(rightIndex);},remove:function(node){var nodeId=node.id;var arrayIndex=OpenLayers.Util.indexOf(this.order,nodeId);if(arrayIndex>=0){this.order.splice(arrayIndex,1);delete this.indices[nodeId];if(this.order.length>0){var lastId=this.order[this.order.length-1];this.maxZIndex=this.indices[lastId];}else{this.maxZIndex=0;}}},clear:function(){this.order=[];this.indices={};this.maxZIndex=0;},exists:function(node){return(this.indices[node.id]!=null);},getZIndex:function(node){return node._style.graphicZIndex;},determineZIndex:function(node){var zIndex=node._style.graphicZIndex;if(zIndex==null){zIndex=this.maxZIndex;node._style.graphicZIndex=zIndex;}else if(zIndex>this.maxZIndex){this.maxZIndex=zIndex;}},getNextElement:function(index){var nextIndex=index+1;if(nextIndex<this.order.length){var nextElement=OpenLayers.Util.getElement(this.order[nextIndex]);if(nextElement==undefined){nextElement=this.getNextElement(nextIndex);}
+return nextElement;}else{return null;}},CLASS_NAME:"OpenLayers.ElementsIndexer"});OpenLayers.ElementsIndexer.IndexingMethods={Z_ORDER:function(indexer,newNode,nextNode){var newZIndex=indexer.getZIndex(newNode);var returnVal=0;if(nextNode){var nextZIndex=indexer.getZIndex(nextNode);returnVal=newZIndex-nextZIndex;}
+return returnVal;},Z_ORDER_DRAWING_ORDER:function(indexer,newNode,nextNode){var returnVal=OpenLayers.ElementsIndexer.IndexingMethods.Z_ORDER(indexer,newNode,nextNode);if(nextNode&&returnVal==0){returnVal=1;}
+return returnVal;},Z_ORDER_Y_ORDER:function(indexer,newNode,nextNode){var returnVal=OpenLayers.ElementsIndexer.IndexingMethods.Z_ORDER(indexer,newNode,nextNode);if(nextNode&&returnVal===0){var result=nextNode._boundsBottom-newNode._boundsBottom;returnVal=(result===0)?1:result;}
+return returnVal;}};OpenLayers.Renderer.Elements=OpenLayers.Class(OpenLayers.Renderer,{rendererRoot:null,root:null,vectorRoot:null,textRoot:null,xmlns:null,indexer:null,BACKGROUND_ID_SUFFIX:"_background",LABEL_ID_SUFFIX:"_label",initialize:function(containerID,options){OpenLayers.Renderer.prototype.initialize.apply(this,arguments);this.rendererRoot=this.createRenderRoot();this.root=this.createRoot("_root");this.vectorRoot=this.createRoot("_vroot");this.textRoot=this.createRoot("_troot");this.root.appendChild(this.vectorRoot);this.root.appendChild(this.textRoot);this.rendererRoot.appendChild(this.root);this.container.appendChild(this.rendererRoot);if(options&&(options.zIndexing||options.yOrdering)){this.indexer=new OpenLayers.ElementsIndexer(options.yOrdering);}},destroy:function(){this.clear();this.rendererRoot=null;this.root=null;this.xmlns=null;OpenLayers.Renderer.prototype.destroy.apply(this,arguments);},clear:function(){var child;var root=this.vectorRoot;if(root){while(child=root.firstChild){root.removeChild(child);}}
+root=this.textRoot;if(root){while(child=root.firstChild){root.removeChild(child);}}
+if(this.indexer){this.indexer.clear();}},getNodeType:function(geometry,style){},drawGeometry:function(geometry,style,featureId){var className=geometry.CLASS_NAME;var rendered=true;if((className=="OpenLayers.Geometry.Collection")||(className=="OpenLayers.Geometry.MultiPoint")||(className=="OpenLayers.Geometry.MultiLineString")||(className=="OpenLayers.Geometry.MultiPolygon")){for(var i=0,len=geometry.components.length;i<len;i++){rendered=this.drawGeometry(geometry.components[i],style,featureId)&&rendered;}
+return rendered;};rendered=false;if(style.display!="none"){if(style.backgroundGraphic){this.redrawBackgroundNode(geometry.id,geometry,style,featureId);}
+rendered=this.redrawNode(geometry.id,geometry,style,featureId);}
+if(rendered==false){var node=document.getElementById(geometry.id);if(node){if(node._style.backgroundGraphic){node.parentNode.removeChild(document.getElementById(geometry.id+this.BACKGROUND_ID_SUFFIX));}
+node.parentNode.removeChild(node);}}
+return rendered;},redrawNode:function(id,geometry,style,featureId){style=this.applyDefaultSymbolizer(style);var node=this.nodeFactory(id,this.getNodeType(geometry,style));node._featureId=featureId;node._boundsBottom=geometry.getBounds().bottom;node._geometryClass=geometry.CLASS_NAME;node._style=style;var drawResult=this.drawGeometryNode(node,geometry,style);if(drawResult===false){return false;}
+node=drawResult.node;if(this.indexer){var insert=this.indexer.insert(node);if(insert){this.vectorRoot.insertBefore(node,insert);}else{this.vectorRoot.appendChild(node);}}else{if(node.parentNode!==this.vectorRoot){this.vectorRoot.appendChild(node);}}
+this.postDraw(node);return drawResult.complete;},redrawBackgroundNode:function(id,geometry,style,featureId){var backgroundStyle=OpenLayers.Util.extend({},style);backgroundStyle.externalGraphic=backgroundStyle.backgroundGraphic;backgroundStyle.graphicXOffset=backgroundStyle.backgroundXOffset;backgroundStyle.graphicYOffset=backgroundStyle.backgroundYOffset;backgroundStyle.graphicZIndex=backgroundStyle.backgroundGraphicZIndex;backgroundStyle.graphicWidth=backgroundStyle.backgroundWidth||backgroundStyle.graphicWidth;backgroundStyle.graphicHeight=backgroundStyle.backgroundHeight||backgroundStyle.graphicHeight;backgroundStyle.backgroundGraphic=null;backgroundStyle.backgroundXOffset=null;backgroundStyle.backgroundYOffset=null;backgroundStyle.backgroundGraphicZIndex=null;return this.redrawNode(id+this.BACKGROUND_ID_SUFFIX,geometry,backgroundStyle,null);},drawGeometryNode:function(node,geometry,style){style=style||node._style;var options={'isFilled':style.fill===undefined?true:style.fill,'isStroked':style.stroke===undefined?!!style.strokeWidth:style.stroke};var drawn;switch(geometry.CLASS_NAME){case"OpenLayers.Geometry.Point":if(style.graphic===false){options.isFilled=false;options.isStroked=false;}
+drawn=this.drawPoint(node,geometry);break;case"OpenLayers.Geometry.LineString":options.isFilled=false;drawn=this.drawLineString(node,geometry);break;case"OpenLayers.Geometry.LinearRing":drawn=this.drawLinearRing(node,geometry);break;case"OpenLayers.Geometry.Polygon":drawn=this.drawPolygon(node,geometry);break;case"OpenLayers.Geometry.Surface":drawn=this.drawSurface(node,geometry);break;case"OpenLayers.Geometry.Rectangle":drawn=this.drawRectangle(node,geometry);break;default:break;}
+node._options=options;if(drawn!=false){return{node:this.setStyle(node,style,options,geometry),complete:drawn};}else{return false;}},postDraw:function(node){},drawPoint:function(node,geometry){},drawLineString:function(node,geometry){},drawLinearRing:function(node,geometry){},drawPolygon:function(node,geometry){},drawRectangle:function(node,geometry){},drawCircle:function(node,geometry){},drawSurface:function(node,geometry){},removeText:function(featureId){var label=document.getElementById(featureId+this.LABEL_ID_SUFFIX);if(label){this.textRoot.removeChild(label);}},getFeatureIdFromEvent:function(evt){var target=evt.target;var useElement=target&&target.correspondingUseElement;var node=useElement?useElement:(target||evt.srcElement);var featureId=node._featureId;return featureId;},eraseGeometry:function(geometry,featureId){if((geometry.CLASS_NAME=="OpenLayers.Geometry.MultiPoint")||(geometry.CLASS_NAME=="OpenLayers.Geometry.MultiLineString")||(geometry.CLASS_NAME=="OpenLayers.Geometry.MultiPolygon")||(geometry.CLASS_NAME=="OpenLayers.Geometry.Collection")){for(var i=0,len=geometry.components.length;i<len;i++){this.eraseGeometry(geometry.components[i],featureId);}}else{var element=OpenLayers.Util.getElement(geometry.id);if(element&&element.parentNode){if(element.geometry){element.geometry.destroy();element.geometry=null;}
+element.parentNode.removeChild(element);if(this.indexer){this.indexer.remove(element);}
+if(element._style.backgroundGraphic){var backgroundId=geometry.id+this.BACKGROUND_ID_SUFFIX;var bElem=OpenLayers.Util.getElement(backgroundId);if(bElem&&bElem.parentNode){bElem.parentNode.removeChild(bElem);}}}}},nodeFactory:function(id,type){var node=OpenLayers.Util.getElement(id);if(node){if(!this.nodeTypeCompare(node,type)){node.parentNode.removeChild(node);node=this.nodeFactory(id,type);}}else{node=this.createNode(type,id);}
+return node;},nodeTypeCompare:function(node,type){},createNode:function(type,id){},moveRoot:function(renderer){var root=this.root;if(renderer.root.parentNode==this.rendererRoot){root=renderer.root;}
+root.parentNode.removeChild(root);renderer.rendererRoot.appendChild(root);},getRenderLayerId:function(){return this.root.parentNode.parentNode.id;},isComplexSymbol:function(graphicName){return(graphicName!="circle")&&!!graphicName;},CLASS_NAME:"OpenLayers.Renderer.Elements"});OpenLayers.Renderer.symbol={"star":[350,75,379,161,469,161,397,215,423,301,350,250,277,301,303,215,231,161,321,161,350,75],"cross":[4,0,6,0,6,4,10,4,10,6,6,6,6,10,4,10,4,6,0,6,0,4,4,4,4,0],"x":[0,0,25,0,50,35,75,0,100,0,65,50,100,100,75,100,50,65,25,100,0,100,35,50,0,0],"square":[0,0,0,1,1,1,1,0,0,0],"triangle":[0,10,10,10,5,0,0,10]};OpenLayers.Strategy.Cluster=OpenLayers.Class(OpenLayers.Strategy,{distance:20,threshold:null,features:null,clusters:null,clustering:false,resolution:null,initialize:function(options){OpenLayers.Strategy.prototype.initialize.apply(this,[options]);},activate:function(){var activated=OpenLayers.Strategy.prototype.activate.call(this);if(activated){this.layer.events.on({"beforefeaturesadded":this.cacheFeatures,"moveend":this.cluster,scope:this});}
+return activated;},deactivate:function(){var deactivated=OpenLayers.Strategy.prototype.deactivate.call(this);if(deactivated){this.clearCache();this.layer.events.un({"beforefeaturesadded":this.cacheFeatures,"moveend":this.cluster,scope:this});}
+return deactivated;},cacheFeatures:function(event){var propagate=true;if(!this.clustering){this.clearCache();this.features=event.features;this.cluster();propagate=false;}
+return propagate;},clearCache:function(){this.features=null;},cluster:function(event){if((!event||event.zoomChanged)&&this.features){var resolution=this.layer.map.getResolution();if(resolution!=this.resolution||!this.clustersExist()){this.resolution=resolution;var clusters=[];var feature,clustered,cluster;for(var i=0;i<this.features.length;++i){feature=this.features[i];if(feature.geometry){clustered=false;for(var j=clusters.length-1;j>=0;--j){cluster=clusters[j];if(this.shouldCluster(cluster,feature)){this.addToCluster(cluster,feature);clustered=true;break;}}
+if(!clustered){clusters.push(this.createCluster(this.features[i]));}}}
+this.layer.removeAllFeatures();if(clusters.length>0){if(this.threshold>1){var clone=clusters.slice();clusters=[];var candidate;for(var i=0,len=clone.length;i<len;++i){candidate=clone[i];if(candidate.attributes.count<this.threshold){Array.prototype.push.apply(clusters,candidate.cluster);}else{clusters.push(candidate);}}}
+this.clustering=true;this.layer.addFeatures(clusters);this.clustering=false;}
+this.clusters=clusters;}}},clustersExist:function(){var exist=false;if(this.clusters&&this.clusters.length>0&&this.clusters.length==this.layer.features.length){exist=true;for(var i=0;i<this.clusters.length;++i){if(this.clusters[i]!=this.layer.features[i]){exist=false;break;}}}
+return exist;},shouldCluster:function(cluster,feature){var cc=cluster.geometry.getBounds().getCenterLonLat();var fc=feature.geometry.getBounds().getCenterLonLat();var distance=(Math.sqrt(Math.pow((cc.lon-fc.lon),2)+Math.pow((cc.lat-fc.lat),2))/this.resolution);return(distance<=this.distance);},addToCluster:function(cluster,feature){cluster.cluster.push(feature);cluster.attributes.count+=1;},createCluster:function(feature){var center=feature.geometry.getBounds().getCenterLonLat();var cluster=new OpenLayers.Feature.Vector(new OpenLayers.Geometry.Point(center.lon,center.lat),{count:1});cluster.cluster=[feature];return cluster;},CLASS_NAME:"OpenLayers.Strategy.Cluster"});OpenLayers.Strategy.Fixed=OpenLayers.Class(OpenLayers.Strategy,{preload:false,initialize:function(options){OpenLayers.Strategy.prototype.initialize.apply(this,[options]);},destroy:function(){OpenLayers.Strategy.prototype.destroy.apply(this,arguments);},activate:function(){if(OpenLayers.Strategy.prototype.activate.apply(this,arguments)){this.layer.events.on({"refresh":this.load,scope:this});if(this.layer.visibility==true||this.preload){this.load();}else{this.layer.events.on({"visibilitychanged":this.load,scope:this});}
+return true;}
+return false;},deactivate:function(){var deactivated=OpenLayers.Strategy.prototype.deactivate.call(this);if(deactivated){this.layer.events.un({"refresh":this.load,"visibilitychanged":this.load,scope:this});}
+return deactivated;},load:function(options){this.layer.events.triggerEvent("loadstart");this.layer.protocol.read(OpenLayers.Util.applyDefaults({callback:this.merge,filter:this.layer.filter,scope:this},options));this.layer.events.un({"visibilitychanged":this.load,scope:this});},merge:function(resp){this.layer.destroyFeatures();var features=resp.features;if(features&&features.length>0){var remote=this.layer.projection;var local=this.layer.map.getProjectionObject();if(!local.equals(remote)){var geom;for(var i=0,len=features.length;i<len;++i){geom=features[i].geometry;if(geom){geom.transform(remote,local);}}}
+this.layer.addFeatures(features);}
+this.layer.events.triggerEvent("loadend");},CLASS_NAME:"OpenLayers.Strategy.Fixed"});OpenLayers.Strategy.Paging=OpenLayers.Class(OpenLayers.Strategy,{features:null,length:10,num:null,paging:false,initialize:function(options){OpenLayers.Strategy.prototype.initialize.apply(this,[options]);},activate:function(){var activated=OpenLayers.Strategy.prototype.activate.call(this);if(activated){this.layer.events.on({"beforefeaturesadded":this.cacheFeatures,scope:this});}
+return activated;},deactivate:function(){var deactivated=OpenLayers.Strategy.prototype.deactivate.call(this);if(deactivated){this.clearCache();this.layer.events.un({"beforefeaturesadded":this.cacheFeatures,scope:this});}
+return deactivated;},cacheFeatures:function(event){if(!this.paging){this.clearCache();this.features=event.features;this.pageNext(event);}},clearCache:function(){if(this.features){for(var i=0;i<this.features.length;++i){this.features[i].destroy();}}
+this.features=null;this.num=null;},pageCount:function(){var numFeatures=this.features?this.features.length:0;return Math.ceil(numFeatures/this.length);},pageNum:function(){return this.num;},pageLength:function(newLength){if(newLength&&newLength>0){this.length=newLength;}
+return this.length;},pageNext:function(event){var changed=false;if(this.features){if(this.num===null){this.num=-1;}
+var start=(this.num+1)*this.length;changed=this.page(start,event);}
+return changed;},pagePrevious:function(){var changed=false;if(this.features){if(this.num===null){this.num=this.pageCount();}
+var start=(this.num-1)*this.length;changed=this.page(start);}
+return changed;},page:function(start,event){var changed=false;if(this.features){if(start>=0&&start<this.features.length){var num=Math.floor(start/this.length);if(num!=this.num){this.paging=true;var features=this.features.slice(start,start+this.length);this.layer.removeFeatures(this.layer.features);this.num=num;if(event&&event.features){event.features=features;}else{this.layer.addFeatures(features);}
+this.paging=false;changed=true;}}}
+return changed;},CLASS_NAME:"OpenLayers.Strategy.Paging"});OpenLayers.Strategy.Refresh=OpenLayers.Class(OpenLayers.Strategy,{force:false,interval:0,timer:null,initialize:function(options){OpenLayers.Strategy.prototype.initialize.apply(this,[options]);},activate:function(){var activated=OpenLayers.Strategy.prototype.activate.call(this);if(activated){if(this.layer.visibility===true){this.start();}
+this.layer.events.on({"visibilitychanged":this.reset,scope:this});}
+return activated;},deactivate:function(){var deactivated=OpenLayers.Strategy.prototype.deactivate.call(this);if(deactivated){this.stop();}
+return deactivated;},reset:function(){if(this.layer.visibility===true){this.start();}else{this.stop();}},start:function(){if(this.interval&&typeof this.interval==="number"&&this.interval>0){this.timer=window.setInterval(OpenLayers.Function.bind(this.refresh,this),this.interval);}},refresh:function(){if(this.layer&&this.layer.refresh&&typeof this.layer.refresh=="function"){this.layer.refresh({force:this.force});}},stop:function(){if(this.timer!==null){window.clearInterval(this.timer);this.timer=null;}},CLASS_NAME:"OpenLayers.Strategy.Refresh"});OpenLayers.Strategy.Save=OpenLayers.Class(OpenLayers.Strategy,{EVENT_TYPES:["start","success","fail"],events:null,auto:false,timer:null,initialize:function(options){OpenLayers.Strategy.prototype.initialize.apply(this,[options]);this.events=new OpenLayers.Events(this,null,this.EVENT_TYPES);},activate:function(){var activated=OpenLayers.Strategy.prototype.activate.call(this);if(activated){if(this.auto){if(typeof this.auto==="number"){this.timer=window.setInterval(OpenLayers.Function.bind(this.save,this),this.auto*1000);}else{this.layer.events.on({"featureadded":this.triggerSave,"afterfeaturemodified":this.triggerSave,scope:this});}}}
+return activated;},deactivate:function(){var deactivated=OpenLayers.Strategy.prototype.deactivate.call(this);if(deactivated){if(this.auto){if(typeof this.auto==="number"){window.clearInterval(this.timer);}else{this.layer.events.un({"featureadded":this.triggerSave,"afterfeaturemodified":this.triggerSave,scope:this});}}}
+return deactivated;},triggerSave:function(event){var feature=event.feature;if(feature.state===OpenLayers.State.INSERT||feature.state===OpenLayers.State.UPDATE||feature.state===OpenLayers.State.DELETE){this.save([event.feature]);}},save:function(features){if(!features){features=this.layer.features;}
+this.events.triggerEvent("start",{features:features});var remote=this.layer.projection;var local=this.layer.map.getProjectionObject();if(!local.equals(remote)){var len=features.length;var clones=new Array(len);var orig,clone;for(var i=0;i<len;++i){orig=features[i];clone=orig.clone();clone.fid=orig.fid;clone.state=orig.state;if(orig.url){clone.url=orig.url;}
+clone._original=orig;clone.geometry.transform(local,remote);clones[i]=clone;}
+features=clones;}
+this.layer.protocol.commit(features,{callback:this.onCommit,scope:this});},onCommit:function(response){var evt={"response":response};if(response.success()){var features=response.reqFeatures;var state,feature;var destroys=[];var insertIds=response.insertIds||[];var j=0;for(var i=0,len=features.length;i<len;++i){feature=features[i];feature=feature._original||feature;state=feature.state;if(state){if(state==OpenLayers.State.DELETE){destroys.push(feature);}else if(state==OpenLayers.State.INSERT){feature.fid=insertIds[j];++j;}
+feature.state=null;}}
+if(destroys.length>0){this.layer.destroyFeatures(destroys);}
+this.events.triggerEvent("success",evt);}else{this.events.triggerEvent("fail",evt);}},CLASS_NAME:"OpenLayers.Strategy.Save"});OpenLayers.Symbolizer.Line=OpenLayers.Class(OpenLayers.Symbolizer,{strokeColor:null,strokeOpacity:null,strokeWidth:null,strokeLinecap:null,strokeDashstyle:null,initialize:function(config){OpenLayers.Symbolizer.prototype.initialize.apply(this,arguments);},CLASS_NAME:"OpenLayers.Symbolizer.Line"});OpenLayers.Symbolizer.Point=OpenLayers.Class(OpenLayers.Symbolizer,{strokeColor:null,strokeOpacity:null,strokeWidth:null,strokeLinecap:null,strokeDashstyle:null,fillColor:null,fillOpacity:null,pointRadius:null,externalGraphic:null,graphicWidth:null,graphicHeight:null,graphicOpacity:null,graphicXOffset:null,graphicYOffset:null,rotation:null,graphicName:null,initialize:function(config){OpenLayers.Symbolizer.prototype.initialize.apply(this,arguments);},CLASS_NAME:"OpenLayers.Symbolizer.Point"});OpenLayers.Symbolizer.Polygon=OpenLayers.Class(OpenLayers.Symbolizer,{strokeColor:null,strokeOpacity:null,strokeWidth:null,strokeLinecap:null,strokeDashstyle:null,fillColor:null,fillOpacity:null,initialize:function(config){OpenLayers.Symbolizer.prototype.initialize.apply(this,arguments);},CLASS_NAME:"OpenLayers.Symbolizer.Polygon"});OpenLayers.Symbolizer.Raster=OpenLayers.Class(OpenLayers.Symbolizer,{initialize:function(config){OpenLayers.Symbolizer.prototype.initialize.apply(this,arguments);},CLASS_NAME:"OpenLayers.Symbolizer.Raster"});OpenLayers.Symbolizer.Text=OpenLayers.Class(OpenLayers.Symbolizer,{label:null,fontFamily:null,fontSize:null,fontWeight:null,fontStyle:null,initialize:function(config){OpenLayers.Symbolizer.prototype.initialize.apply(this,arguments);},CLASS_NAME:"OpenLayers.Symbolizer.Text"});OpenLayers.Tween=OpenLayers.Class({INTERVAL:10,easing:null,begin:null,finish:null,duration:null,callbacks:null,time:null,interval:null,playing:false,initialize:function(easing){this.easing=(easing)?easing:OpenLayers.Easing.Expo.easeOut;},start:function(begin,finish,duration,options){this.playing=true;this.begin=begin;this.finish=finish;this.duration=duration;this.callbacks=options.callbacks;this.time=0;if(this.interval){window.clearInterval(this.interval);this.interval=null;}
+if(this.callbacks&&this.callbacks.start){this.callbacks.start.call(this,this.begin);}
+this.interval=window.setInterval(OpenLayers.Function.bind(this.play,this),this.INTERVAL);},stop:function(){if(!this.playing){return;}
+if(this.callbacks&&this.callbacks.done){this.callbacks.done.call(this,this.finish);}
+window.clearInterval(this.interval);this.interval=null;this.playing=false;},play:function(){var value={};for(var i in this.begin){var b=this.begin[i];var f=this.finish[i];if(b==null||f==null||isNaN(b)||isNaN(f)){OpenLayers.Console.error('invalid value for Tween');}
+var c=f-b;value[i]=this.easing.apply(this,[this.time,b,c,this.duration]);}
+this.time++;if(this.callbacks&&this.callbacks.eachStep){this.callbacks.eachStep.call(this,value);}
+if(this.time>this.duration){this.stop();}},CLASS_NAME:"OpenLayers.Tween"});OpenLayers.Easing={CLASS_NAME:"OpenLayers.Easing"};OpenLayers.Easing.Linear={easeIn:function(t,b,c,d){return c*t/d+b;},easeOut:function(t,b,c,d){return c*t/d+b;},easeInOut:function(t,b,c,d){return c*t/d+b;},CLASS_NAME:"OpenLayers.Easing.Linear"};OpenLayers.Easing.Expo={easeIn:function(t,b,c,d){return(t==0)?b:c*Math.pow(2,10*(t/d-1))+b;},easeOut:function(t,b,c,d){return(t==d)?b+c:c*(-Math.pow(2,-10*t/d)+1)+b;},easeInOut:function(t,b,c,d){if(t==0)return b;if(t==d)return b+c;if((t/=d/2)<1)return c/2*Math.pow(2,10*(t-1))+b;return c/2*(-Math.pow(2,-10*--t)+2)+b;},CLASS_NAME:"OpenLayers.Easing.Expo"};OpenLayers.Easing.Quad={easeIn:function(t,b,c,d){return c*(t/=d)*t+b;},easeOut:function(t,b,c,d){return-c*(t/=d)*(t-2)+b;},easeInOut:function(t,b,c,d){if((t/=d/2)<1)return c/2*t*t+b;return-c/2*((--t)*(t-2)-1)+b;},CLASS_NAME:"OpenLayers.Easing.Quad"};OpenLayers.Control.ArgParser=OpenLayers.Class(OpenLayers.Control,{center:null,zoom:null,layers:null,displayProjection:null,initialize:function(options){OpenLayers.Control.prototype.initialize.apply(this,arguments);},setMap:function(map){OpenLayers.Control.prototype.setMap.apply(this,arguments);for(var i=0,len=this.map.controls.length;i<len;i++){var control=this.map.controls[i];if((control!=this)&&(control.CLASS_NAME=="OpenLayers.Control.ArgParser")){if(control.displayProjection!=this.displayProjection){this.displayProjection=control.displayProjection;}
+break;}}
+if(i==this.map.controls.length){var args=OpenLayers.Util.getParameters();if(args.layers){this.layers=args.layers;this.map.events.register('addlayer',this,this.configureLayers);this.configureLayers();}
+if(args.lat&&args.lon){this.center=new OpenLayers.LonLat(parseFloat(args.lon),parseFloat(args.lat));if(args.zoom){this.zoom=parseInt(args.zoom);}
+this.map.events.register('changebaselayer',this,this.setCenter);this.setCenter();}}},setCenter:function(){if(this.map.baseLayer){this.map.events.unregister('changebaselayer',this,this.setCenter);if(this.displayProjection){this.center.transform(this.displayProjection,this.map.getProjectionObject());}
+this.map.setCenter(this.center,this.zoom);}},configureLayers:function(){if(this.layers.length==this.map.layers.length){this.map.events.unregister('addlayer',this,this.configureLayers);for(var i=0,len=this.layers.length;i<len;i++){var layer=this.map.layers[i];var c=this.layers.charAt(i);if(c=="B"){this.map.setBaseLayer(layer);}else if((c=="T")||(c=="F")){layer.setVisibility(c=="T");}}}},CLASS_NAME:"OpenLayers.Control.ArgParser"});OpenLayers.Control.Attribution=OpenLayers.Class(OpenLayers.Control,{separator:", ",initialize:function(options){OpenLayers.Control.prototype.initialize.apply(this,arguments);},destroy:function(){this.map.events.un({"removelayer":this.updateAttribution,"addlayer":this.updateAttribution,"changelayer":this.updateAttribution,"changebaselayer":this.updateAttribution,scope:this});OpenLayers.Control.prototype.destroy.apply(this,arguments);},draw:function(){OpenLayers.Control.prototype.draw.apply(this,arguments);this.map.events.on({'changebaselayer':this.updateAttribution,'changelayer':this.updateAttribution,'addlayer':this.updateAttribution,'removelayer':this.updateAttribution,scope:this});this.updateAttribution();return this.div;},updateAttribution:function(){var attributions=[];if(this.map&&this.map.layers){for(var i=0,len=this.map.layers.length;i<len;i++){var layer=this.map.layers[i];if(layer.attribution&&layer.getVisibility()){if(OpenLayers.Util.indexOf(attributions,layer.attribution)===-1){attributions.push(layer.attribution);}}}
+this.div.innerHTML=attributions.join(this.separator);}},CLASS_NAME:"OpenLayers.Control.Attribution"});OpenLayers.Control.Button=OpenLayers.Class(OpenLayers.Control,{type:OpenLayers.Control.TYPE_BUTTON,trigger:function(){},CLASS_NAME:"OpenLayers.Control.Button"});OpenLayers.Control.Graticule=OpenLayers.Class(OpenLayers.Control,{autoActivate:true,intervals:[45,30,20,10,5,2,1,0.5,0.2,0.1,0.05,0.01,0.005,0.002,0.001],displayInLayerSwitcher:true,visible:true,numPoints:50,targetSize:200,layerName:null,labelled:true,labelFormat:'dm',lineSymbolizer:{strokeColor:"#333",strokeWidth:1,strokeOpacity:0.5},labelSymbolizer:{},gratLayer:null,initialize:function(options){options=options||{};options.layerName=options.layerName||OpenLayers.i18n("graticule");OpenLayers.Control.prototype.initialize.apply(this,[options]);this.labelSymbolizer.stroke=false;this.labelSymbolizer.fill=false;this.labelSymbolizer.label="${label}";this.labelSymbolizer.labelAlign="${labelAlign}";this.labelSymbolizer.labelXOffset="${xOffset}";this.labelSymbolizer.labelYOffset="${yOffset}";},destroy:function(){this.deactivate();OpenLayers.Control.prototype.destroy.apply(this,arguments);if(this.gratLayer){this.gratLayer.destroy();this.gratLayer=null;}},draw:function(){OpenLayers.Control.prototype.draw.apply(this,arguments);if(!this.gratLayer){var gratStyle=new OpenLayers.Style({},{rules:[new OpenLayers.Rule({'symbolizer':{"Point":this.labelSymbolizer,"Line":this.lineSymbolizer}})]});this.gratLayer=new OpenLayers.Layer.Vector(this.layerName,{styleMap:new OpenLayers.StyleMap({'default':gratStyle}),visibility:this.visible,displayInLayerSwitcher:this.displayInLayerSwitcher});}
+return this.div;},activate:function(){if(OpenLayers.Control.prototype.activate.apply(this,arguments)){this.map.addLayer(this.gratLayer);this.map.events.register('moveend',this,this.update);this.update();return true;}else{return false;}},deactivate:function(){if(OpenLayers.Control.prototype.deactivate.apply(this,arguments)){this.map.events.unregister('moveend',this,this.update);this.map.removeLayer(this.gratLayer);return true;}else{return false;}},update:function(){var mapBounds=this.map.getExtent();if(!mapBounds){return;}
+this.gratLayer.destroyFeatures();var llProj=new OpenLayers.Projection("EPSG:4326");var mapProj=this.map.getProjectionObject();var mapRes=this.map.getResolution();if(mapProj.proj&&mapProj.proj.projName=="longlat"){this.numPoints=1;}
+var mapCenter=this.map.getCenter();var mapCenterLL=new OpenLayers.Pixel(mapCenter.lon,mapCenter.lat);OpenLayers.Projection.transform(mapCenterLL,mapProj,llProj);var testSq=this.targetSize*mapRes;testSq*=testSq;var llInterval;for(var i=0;i<this.intervals.length;++i){llInterval=this.intervals[i];var delta=llInterval/2;var p1=mapCenterLL.offset(new OpenLayers.Pixel(-delta,-delta));var p2=mapCenterLL.offset(new OpenLayers.Pixel(delta,delta));OpenLayers.Projection.transform(p1,llProj,mapProj);OpenLayers.Projection.transform(p2,llProj,mapProj);var distSq=(p1.x-p2.x)*(p1.x-p2.x)+(p1.y-p2.y)*(p1.y-p2.y);if(distSq<=testSq){break;}}
+mapCenterLL.x=Math.floor(mapCenterLL.x/llInterval)*llInterval;mapCenterLL.y=Math.floor(mapCenterLL.y/llInterval)*llInterval;var iter=0;var centerLonPoints=[mapCenterLL.clone()];var newPoint=mapCenterLL.clone();var mapXY;do{newPoint=newPoint.offset(new OpenLayers.Pixel(0,llInterval));mapXY=OpenLayers.Projection.transform(newPoint.clone(),llProj,mapProj);centerLonPoints.unshift(newPoint);}while(mapBounds.containsPixel(mapXY)&&++iter<1000);newPoint=mapCenterLL.clone();do{newPoint=newPoint.offset(new OpenLayers.Pixel(0,-llInterval));mapXY=OpenLayers.Projection.transform(newPoint.clone(),llProj,mapProj);centerLonPoints.push(newPoint);}while(mapBounds.containsPixel(mapXY)&&++iter<1000);iter=0;var centerLatPoints=[mapCenterLL.clone()];newPoint=mapCenterLL.clone();do{newPoint=newPoint.offset(new OpenLayers.Pixel(-llInterval,0));mapXY=OpenLayers.Projection.transform(newPoint.clone(),llProj,mapProj);centerLatPoints.unshift(newPoint);}while(mapBounds.containsPixel(mapXY)&&++iter<1000);newPoint=mapCenterLL.clone();do{newPoint=newPoint.offset(new OpenLayers.Pixel(llInterval,0));mapXY=OpenLayers.Projection.transform(newPoint.clone(),llProj,mapProj);centerLatPoints.push(newPoint);}while(mapBounds.containsPixel(mapXY)&&++iter<1000);var lines=[];for(var i=0;i<centerLatPoints.length;++i){var lon=centerLatPoints[i].x;var pointList=[];var labelPoint=null;var latEnd=Math.min(centerLonPoints[0].y,90);var latStart=Math.max(centerLonPoints[centerLonPoints.length-1].y,-90);var latDelta=(latEnd-latStart)/this.numPoints;var lat=latStart;for(var j=0;j<=this.numPoints;++j){var gridPoint=new OpenLayers.Geometry.Point(lon,lat);gridPoint.transform(llProj,mapProj);pointList.push(gridPoint);lat+=latDelta;if(gridPoint.y>=mapBounds.bottom&&!labelPoint){labelPoint=gridPoint;}}
+if(this.labelled){var labelPos=new OpenLayers.Geometry.Point(labelPoint.x,mapBounds.bottom);var labelAttrs={value:lon,label:this.labelled?OpenLayers.Util.getFormattedLonLat(lon,"lon",this.labelFormat):"",labelAlign:"cb",xOffset:0,yOffset:2};this.gratLayer.addFeatures(new OpenLayers.Feature.Vector(labelPos,labelAttrs));}
+var geom=new OpenLayers.Geometry.LineString(pointList);lines.push(new OpenLayers.Feature.Vector(geom));}
+for(var j=0;j<centerLonPoints.length;++j){lat=centerLonPoints[j].y;if(lat<-90||lat>90){continue;}
+var pointList=[];var lonStart=centerLatPoints[0].x;var lonEnd=centerLatPoints[centerLatPoints.length-1].x;var lonDelta=(lonEnd-lonStart)/this.numPoints;var lon=lonStart;var labelPoint=null;for(var i=0;i<=this.numPoints;++i){var gridPoint=new OpenLayers.Geometry.Point(lon,lat);gridPoint.transform(llProj,mapProj);pointList.push(gridPoint);lon+=lonDelta;if(gridPoint.x<mapBounds.right){labelPoint=gridPoint;}}
+if(this.labelled){var labelPos=new OpenLayers.Geometry.Point(mapBounds.right,labelPoint.y);var labelAttrs={value:lat,label:this.labelled?OpenLayers.Util.getFormattedLonLat(lat,"lat",this.labelFormat):"",labelAlign:"rb",xOffset:-2,yOffset:2};this.gratLayer.addFeatures(new OpenLayers.Feature.Vector(labelPos,labelAttrs));}
+var geom=new OpenLayers.Geometry.LineString(pointList);lines.push(new OpenLayers.Feature.Vector(geom));}
+this.gratLayer.addFeatures(lines);},CLASS_NAME:"OpenLayers.Control.Graticule"});OpenLayers.Control.LayerSwitcher=OpenLayers.Class(OpenLayers.Control,{roundedCorner:true,roundedCornerColor:"darkblue",layerStates:null,layersDiv:null,baseLayersDiv:null,baseLayers:null,dataLbl:null,dataLayersDiv:null,dataLayers:null,minimizeDiv:null,maximizeDiv:null,ascending:true,initialize:function(options){OpenLayers.Control.prototype.initialize.apply(this,arguments);this.layerStates=[];},destroy:function(){OpenLayers.Event.stopObservingElement(this.div);OpenLayers.Event.stopObservingElement(this.minimizeDiv);OpenLayers.Event.stopObservingElement(this.maximizeDiv);this.clearLayersArray("base");this.clearLayersArray("data");this.map.events.un({"addlayer":this.redraw,"changelayer":this.redraw,"removelayer":this.redraw,"changebaselayer":this.redraw,scope:this});OpenLayers.Control.prototype.destroy.apply(this,arguments);},setMap:function(map){OpenLayers.Control.prototype.setMap.apply(this,arguments);this.map.events.on({"addlayer":this.redraw,"changelayer":this.redraw,"removelayer":this.redraw,"changebaselayer":this.redraw,scope:this});},draw:function(){OpenLayers.Control.prototype.draw.apply(this);this.loadContents();if(!this.outsideViewport){this.minimizeControl();}
+this.redraw();return this.div;},clearLayersArray:function(layersType){var layers=this[layersType+"Layers"];if(layers){for(var i=0,len=layers.length;i<len;i++){var layer=layers[i];OpenLayers.Event.stopObservingElement(layer.inputElem);OpenLayers.Event.stopObservingElement(layer.labelSpan);}}
+this[layersType+"LayersDiv"].innerHTML="";this[layersType+"Layers"]=[];},checkRedraw:function(){var redraw=false;if(!this.layerStates.length||(this.map.layers.length!=this.layerStates.length)){redraw=true;}else{for(var i=0,len=this.layerStates.length;i<len;i++){var layerState=this.layerStates[i];var layer=this.map.layers[i];if((layerState.name!=layer.name)||(layerState.inRange!=layer.inRange)||(layerState.id!=layer.id)||(layerState.visibility!=layer.visibility)){redraw=true;break;}}}
+return redraw;},redraw:function(){if(!this.checkRedraw()){return this.div;}
+this.clearLayersArray("base");this.clearLayersArray("data");var containsOverlays=false;var containsBaseLayers=false;var len=this.map.layers.length;this.layerStates=new Array(len);for(var i=0;i<len;i++){var layer=this.map.layers[i];this.layerStates[i]={'name':layer.name,'visibility':layer.visibility,'inRange':layer.inRange,'id':layer.id};}
+var layers=this.map.layers.slice();if(!this.ascending){layers.reverse();}
+for(var i=0,len=layers.length;i<len;i++){var layer=layers[i];var baseLayer=layer.isBaseLayer;if(layer.displayInLayerSwitcher){if(baseLayer){containsBaseLayers=true;}else{containsOverlays=true;}
+var checked=(baseLayer)?(layer==this.map.baseLayer):layer.getVisibility();var inputElem=document.createElement("input");inputElem.id=this.id+"_input_"+layer.name;inputElem.name=(baseLayer)?this.id+"_baseLayers":layer.name;inputElem.type=(baseLayer)?"radio":"checkbox";inputElem.value=layer.name;inputElem.checked=checked;inputElem.defaultChecked=checked;if(!baseLayer&&!layer.inRange){inputElem.disabled=true;}
+var context={'inputElem':inputElem,'layer':layer,'layerSwitcher':this};OpenLayers.Event.observe(inputElem,"mouseup",OpenLayers.Function.bindAsEventListener(this.onInputClick,context));var labelSpan=document.createElement("span");OpenLayers.Element.addClass(labelSpan,"labelSpan")
+if(!baseLayer&&!layer.inRange){labelSpan.style.color="gray";}
+labelSpan.innerHTML=layer.name;labelSpan.style.verticalAlign=(baseLayer)?"bottom":"baseline";OpenLayers.Event.observe(labelSpan,"click",OpenLayers.Function.bindAsEventListener(this.onInputClick,context));var br=document.createElement("br");var groupArray=(baseLayer)?this.baseLayers:this.dataLayers;groupArray.push({'layer':layer,'inputElem':inputElem,'labelSpan':labelSpan});var groupDiv=(baseLayer)?this.baseLayersDiv:this.dataLayersDiv;groupDiv.appendChild(inputElem);groupDiv.appendChild(labelSpan);groupDiv.appendChild(br);}}
+this.dataLbl.style.display=(containsOverlays)?"":"none";this.baseLbl.style.display=(containsBaseLayers)?"":"none";return this.div;},onInputClick:function(e){if(!this.inputElem.disabled){if(this.inputElem.type=="radio"){this.inputElem.checked=true;this.layer.map.setBaseLayer(this.layer);}else{this.inputElem.checked=!this.inputElem.checked;this.layerSwitcher.updateMap();}}
+OpenLayers.Event.stop(e);},onLayerClick:function(e){this.updateMap();},updateMap:function(){for(var i=0,len=this.baseLayers.length;i<len;i++){var layerEntry=this.baseLayers[i];if(layerEntry.inputElem.checked){this.map.setBaseLayer(layerEntry.layer,false);}}
+for(var i=0,len=this.dataLayers.length;i<len;i++){var layerEntry=this.dataLayers[i];layerEntry.layer.setVisibility(layerEntry.inputElem.checked);}},maximizeControl:function(e){this.div.style.width="";this.div.style.height="";this.showControls(false);if(e!=null){OpenLayers.Event.stop(e);}},minimizeControl:function(e){this.div.style.width="0px";this.div.style.height="0px";this.showControls(true);if(e!=null){OpenLayers.Event.stop(e);}},showControls:function(minimize){this.maximizeDiv.style.display=minimize?"":"none";this.minimizeDiv.style.display=minimize?"none":"";this.layersDiv.style.display=minimize?"none":"";},loadContents:function(){OpenLayers.Event.observe(this.div,"mouseup",OpenLayers.Function.bindAsEventListener(this.mouseUp,this));OpenLayers.Event.observe(this.div,"click",this.ignoreEvent);OpenLayers.Event.observe(this.div,"mousedown",OpenLayers.Function.bindAsEventListener(this.mouseDown,this));OpenLayers.Event.observe(this.div,"dblclick",this.ignoreEvent);this.layersDiv=document.createElement("div");this.layersDiv.id=this.id+"_layersDiv";OpenLayers.Element.addClass(this.layersDiv,"layersDiv");this.baseLbl=document.createElement("div");this.baseLbl.innerHTML=OpenLayers.i18n("baseLayer");OpenLayers.Element.addClass(this.baseLbl,"baseLbl");this.baseLayersDiv=document.createElement("div");OpenLayers.Element.addClass(this.baseLayersDiv,"baseLayersDiv");this.dataLbl=document.createElement("div");this.dataLbl.innerHTML=OpenLayers.i18n("overlays");OpenLayers.Element.addClass(this.dataLbl,"dataLbl");this.dataLayersDiv=document.createElement("div");OpenLayers.Element.addClass(this.dataLayersDiv,"dataLayersDiv");if(this.ascending){this.layersDiv.appendChild(this.baseLbl);this.layersDiv.appendChild(this.baseLayersDiv);this.layersDiv.appendChild(this.dataLbl);this.layersDiv.appendChild(this.dataLayersDiv);}else{this.layersDiv.appendChild(this.dataLbl);this.layersDiv.appendChild(this.dataLayersDiv);this.layersDiv.appendChild(this.baseLbl);this.layersDiv.appendChild(this.baseLayersDiv);}
+this.div.appendChild(this.layersDiv);if(this.roundedCorner){OpenLayers.Rico.Corner.round(this.div,{corners:"tl bl",bgColor:"transparent",color:this.roundedCornerColor,blend:false});OpenLayers.Rico.Corner.changeOpacity(this.layersDiv,0.75);}
+var imgLocation=OpenLayers.Util.getImagesLocation();var sz=new OpenLayers.Size(18,18);var img=imgLocation+'layer-switcher-maximize.png';this.maximizeDiv=OpenLayers.Util.createAlphaImageDiv("OpenLayers_Control_MaximizeDiv",null,sz,img,"absolute");OpenLayers.Element.addClass(this.maximizeDiv,"maximizeDiv");this.maximizeDiv.style.display="none";OpenLayers.Event.observe(this.maximizeDiv,"click",OpenLayers.Function.bindAsEventListener(this.maximizeControl,this));this.div.appendChild(this.maximizeDiv);var img=imgLocation+'layer-switcher-minimize.png';var sz=new OpenLayers.Size(18,18);this.minimizeDiv=OpenLayers.Util.createAlphaImageDiv("OpenLayers_Control_MinimizeDiv",null,sz,img,"absolute");OpenLayers.Element.addClass(this.minimizeDiv,"minimizeDiv");this.minimizeDiv.style.display="none";OpenLayers.Event.observe(this.minimizeDiv,"click",OpenLayers.Function.bindAsEventListener(this.minimizeControl,this));this.div.appendChild(this.minimizeDiv);},ignoreEvent:function(evt){OpenLayers.Event.stop(evt);},mouseDown:function(evt){this.isMouseDown=true;this.ignoreEvent(evt);},mouseUp:function(evt){if(this.isMouseDown){this.isMouseDown=false;this.ignoreEvent(evt);}},CLASS_NAME:"OpenLayers.Control.LayerSwitcher"});OpenLayers.Control.MouseDefaults=OpenLayers.Class(OpenLayers.Control,{performedDrag:false,wheelObserver:null,initialize:function(){OpenLayers.Control.prototype.initialize.apply(this,arguments);},destroy:function(){if(this.handler){this.handler.destroy();}
+this.handler=null;this.map.events.un({"click":this.defaultClick,"dblclick":this.defaultDblClick,"mousedown":this.defaultMouseDown,"mouseup":this.defaultMouseUp,"mousemove":this.defaultMouseMove,"mouseout":this.defaultMouseOut,scope:this});OpenLayers.Event.stopObserving(window,"DOMMouseScroll",this.wheelObserver);OpenLayers.Event.stopObserving(window,"mousewheel",this.wheelObserver);OpenLayers.Event.stopObserving(document,"mousewheel",this.wheelObserver);this.wheelObserver=null;OpenLayers.Control.prototype.destroy.apply(this,arguments);},draw:function(){this.map.events.on({"click":this.defaultClick,"dblclick":this.defaultDblClick,"mousedown":this.defaultMouseDown,"mouseup":this.defaultMouseUp,"mousemove":this.defaultMouseMove,"mouseout":this.defaultMouseOut,scope:this});this.registerWheelEvents();},registerWheelEvents:function(){this.wheelObserver=OpenLayers.Function.bindAsEventListener(this.onWheelEvent,this);OpenLayers.Event.observe(window,"DOMMouseScroll",this.wheelObserver);OpenLayers.Event.observe(window,"mousewheel",this.wheelObserver);OpenLayers.Event.observe(document,"mousewheel",this.wheelObserver);},defaultClick:function(evt){if(!OpenLayers.Event.isLeftClick(evt)){return;}
+var notAfterDrag=!this.performedDrag;this.performedDrag=false;return notAfterDrag;},defaultDblClick:function(evt){var newCenter=this.map.getLonLatFromViewPortPx(evt.xy);this.map.setCenter(newCenter,this.map.zoom+1);OpenLayers.Event.stop(evt);return false;},defaultMouseDown:function(evt){if(!OpenLayers.Event.isLeftClick(evt)){return;}
+this.mouseDragStart=evt.xy.clone();this.performedDrag=false;if(evt.shiftKey){this.map.div.style.cursor="crosshair";this.zoomBox=OpenLayers.Util.createDiv('zoomBox',this.mouseDragStart,null,null,"absolute","2px solid red");this.zoomBox.style.backgroundColor="white";this.zoomBox.style.filter="alpha(opacity=50)";this.zoomBox.style.opacity="0.50";this.zoomBox.style.fontSize="1px";this.zoomBox.style.zIndex=this.map.Z_INDEX_BASE["Popup"]-1;this.map.viewPortDiv.appendChild(this.zoomBox);}
+document.onselectstart=OpenLayers.Function.False;OpenLayers.Event.stop(evt);},defaultMouseMove:function(evt){this.mousePosition=evt.xy.clone();if(this.mouseDragStart!=null){if(this.zoomBox){var deltaX=Math.abs(this.mouseDragStart.x-evt.xy.x);var deltaY=Math.abs(this.mouseDragStart.y-evt.xy.y);this.zoomBox.style.width=Math.max(1,deltaX)+"px";this.zoomBox.style.height=Math.max(1,deltaY)+"px";if(evt.xy.x<this.mouseDragStart.x){this.zoomBox.style.left=evt.xy.x+"px";}
+if(evt.xy.y<this.mouseDragStart.y){this.zoomBox.style.top=evt.xy.y+"px";}}else{var deltaX=this.mouseDragStart.x-evt.xy.x;var deltaY=this.mouseDragStart.y-evt.xy.y;var size=this.map.getSize();var newXY=new OpenLayers.Pixel(size.w/2+deltaX,size.h/2+deltaY);var newCenter=this.map.getLonLatFromViewPortPx(newXY);this.map.setCenter(newCenter,null,true);this.mouseDragStart=evt.xy.clone();this.map.div.style.cursor="move";}
+this.performedDrag=true;}},defaultMouseUp:function(evt){if(!OpenLayers.Event.isLeftClick(evt)){return;}
+if(this.zoomBox){this.zoomBoxEnd(evt);}else{if(this.performedDrag){this.map.setCenter(this.map.center);}}
+document.onselectstart=null;this.mouseDragStart=null;this.map.div.style.cursor="";},defaultMouseOut:function(evt){if(this.mouseDragStart!=null&&OpenLayers.Util.mouseLeft(evt,this.map.div)){if(this.zoomBox){this.removeZoomBox();}
+this.mouseDragStart=null;}},defaultWheelUp:function(evt){if(this.map.getZoom()<=this.map.getNumZoomLevels()){this.map.setCenter(this.map.getLonLatFromPixel(evt.xy),this.map.getZoom()+1);}},defaultWheelDown:function(evt){if(this.map.getZoom()>0){this.map.setCenter(this.map.getLonLatFromPixel(evt.xy),this.map.getZoom()-1);}},zoomBoxEnd:function(evt){if(this.mouseDragStart!=null){if(Math.abs(this.mouseDragStart.x-evt.xy.x)>5||Math.abs(this.mouseDragStart.y-evt.xy.y)>5){var start=this.map.getLonLatFromViewPortPx(this.mouseDragStart);var end=this.map.getLonLatFromViewPortPx(evt.xy);var top=Math.max(start.lat,end.lat);var bottom=Math.min(start.lat,end.lat);var left=Math.min(start.lon,end.lon);var right=Math.max(start.lon,end.lon);var bounds=new OpenLayers.Bounds(left,bottom,right,top);this.map.zoomToExtent(bounds);}else{var end=this.map.getLonLatFromViewPortPx(evt.xy);this.map.setCenter(new OpenLayers.LonLat((end.lon),(end.lat)),this.map.getZoom()+1);}
+this.removeZoomBox();}},removeZoomBox:function(){this.map.viewPortDiv.removeChild(this.zoomBox);this.zoomBox=null;},onWheelEvent:function(e){var inMap=false;var elem=OpenLayers.Event.element(e);while(elem!=null){if(this.map&&elem==this.map.div){inMap=true;break;}
+elem=elem.parentNode;}
+if(inMap){var delta=0;if(!e){e=window.event;}
+if(e.wheelDelta){delta=e.wheelDelta/120;if(window.opera&&window.opera.version()<9.2){delta=-delta;}}else if(e.detail){delta=-e.detail/3;}
+if(delta){e.xy=this.mousePosition;if(delta<0){this.defaultWheelDown(e);}else{this.defaultWheelUp(e);}}
+OpenLayers.Event.stop(e);}},CLASS_NAME:"OpenLayers.Control.MouseDefaults"});OpenLayers.Control.MousePosition=OpenLayers.Class(OpenLayers.Control,{autoActivate:true,element:null,prefix:'',separator:', ',suffix:'',numDigits:5,granularity:10,emptyString:null,lastXy:null,displayProjection:null,initialize:function(options){OpenLayers.Control.prototype.initialize.apply(this,arguments);},destroy:function(){this.deactivate();OpenLayers.Control.prototype.destroy.apply(this,arguments);},activate:function(){if(OpenLayers.Control.prototype.activate.apply(this,arguments)){this.map.events.register('mousemove',this,this.redraw);this.map.events.register('mouseout',this,this.reset);this.redraw();return true;}else{return false;}},deactivate:function(){if(OpenLayers.Control.prototype.deactivate.apply(this,arguments)){this.map.events.unregister('mousemove',this,this.redraw);this.map.events.unregister('mouseout',this,this.reset);this.element.innerHTML="";return true;}else{return false;}},draw:function(){OpenLayers.Control.prototype.draw.apply(this,arguments);if(!this.element){this.div.left="";this.div.top="";this.element=this.div;}
+return this.div;},redraw:function(evt){var lonLat;if(evt==null){this.reset();return;}else{if(this.lastXy==null||Math.abs(evt.xy.x-this.lastXy.x)>this.granularity||Math.abs(evt.xy.y-this.lastXy.y)>this.granularity)
+{this.lastXy=evt.xy;return;}
+lonLat=this.map.getLonLatFromPixel(evt.xy);if(!lonLat){return;}
+if(this.displayProjection){lonLat.transform(this.map.getProjectionObject(),this.displayProjection);}
+this.lastXy=evt.xy;}
+var newHtml=this.formatOutput(lonLat);if(newHtml!=this.element.innerHTML){this.element.innerHTML=newHtml;}},reset:function(evt){if(this.emptyString!=null){this.element.innerHTML=this.emptyString;}},formatOutput:function(lonLat){var digits=parseInt(this.numDigits);var newHtml=this.prefix+
+lonLat.lon.toFixed(digits)+
+this.separator+
+lonLat.lat.toFixed(digits)+
+this.suffix;return newHtml;},CLASS_NAME:"OpenLayers.Control.MousePosition"});OpenLayers.Control.Pan=OpenLayers.Class(OpenLayers.Control,{slideFactor:50,direction:null,type:OpenLayers.Control.TYPE_BUTTON,initialize:function(direction,options){this.direction=direction;this.CLASS_NAME+=this.direction;OpenLayers.Control.prototype.initialize.apply(this,[options]);},trigger:function(){switch(this.direction){case OpenLayers.Control.Pan.NORTH:this.map.pan(0,-this.slideFactor);break;case OpenLayers.Control.Pan.SOUTH:this.map.pan(0,this.slideFactor);break;case OpenLayers.Control.Pan.WEST:this.map.pan(-this.slideFactor,0);break;case OpenLayers.Control.Pan.EAST:this.map.pan(this.slideFactor,0);break;}},CLASS_NAME:"OpenLayers.Control.Pan"});OpenLayers.Control.Pan.NORTH="North";OpenLayers.Control.Pan.SOUTH="South";OpenLayers.Control.Pan.EAST="East";OpenLayers.Control.Pan.WEST="West";OpenLayers.Control.PanZoom=OpenLayers.Class(OpenLayers.Control,{slideFactor:50,slideRatio:null,buttons:null,position:null,initialize:function(options){this.position=new OpenLayers.Pixel(OpenLayers.Control.PanZoom.X,OpenLayers.Control.PanZoom.Y);OpenLayers.Control.prototype.initialize.apply(this,arguments);},destroy:function(){OpenLayers.Control.prototype.destroy.apply(this,arguments);this.removeButtons();this.buttons=null;this.position=null;},draw:function(px){OpenLayers.Control.prototype.draw.apply(this,arguments);px=this.position;this.buttons=[];var sz=new OpenLayers.Size(18,18);var centered=new OpenLayers.Pixel(px.x+sz.w/2,px.y);this._addButton("panup","north-mini.png",centered,sz);px.y=centered.y+sz.h;this._addButton("panleft","west-mini.png",px,sz);this._addButton("panright","east-mini.png",px.add(sz.w,0),sz);this._addButton("pandown","south-mini.png",centered.add(0,sz.h*2),sz);this._addButton("zoomin","zoom-plus-mini.png",centered.add(0,sz.h*3+5),sz);this._addButton("zoomworld","zoom-world-mini.png",centered.add(0,sz.h*4+5),sz);this._addButton("zoomout","zoom-minus-mini.png",centered.add(0,sz.h*5+5),sz);return this.div;},_addButton:function(id,img,xy,sz){var imgLocation=OpenLayers.Util.getImagesLocation()+img;var btn=OpenLayers.Util.createAlphaImageDiv(this.id+"_"+id,xy,sz,imgLocation,"absolute");this.div.appendChild(btn);OpenLayers.Event.observe(btn,"mousedown",OpenLayers.Function.bindAsEventListener(this.buttonDown,btn));OpenLayers.Event.observe(btn,"dblclick",OpenLayers.Function.bindAsEventListener(this.doubleClick,btn));OpenLayers.Event.observe(btn,"click",OpenLayers.Function.bindAsEventListener(this.doubleClick,btn));btn.action=id;btn.map=this.map;if(!this.slideRatio){var slideFactorPixels=this.slideFactor;var getSlideFactor=function(){return slideFactorPixels;};}else{var slideRatio=this.slideRatio;var getSlideFactor=function(dim){return this.map.getSize()[dim]*slideRatio;};}
+btn.getSlideFactor=getSlideFactor;this.buttons.push(btn);return btn;},_removeButton:function(btn){OpenLayers.Event.stopObservingElement(btn);btn.map=null;btn.getSlideFactor=null;this.div.removeChild(btn);OpenLayers.Util.removeItem(this.buttons,btn);},removeButtons:function(){for(var i=this.buttons.length-1;i>=0;--i){this._removeButton(this.buttons[i]);}},doubleClick:function(evt){OpenLayers.Event.stop(evt);return false;},buttonDown:function(evt){if(!OpenLayers.Event.isLeftClick(evt)){return;}
+switch(this.action){case"panup":this.map.pan(0,-this.getSlideFactor("h"));break;case"pandown":this.map.pan(0,this.getSlideFactor("h"));break;case"panleft":this.map.pan(-this.getSlideFactor("w"),0);break;case"panright":this.map.pan(this.getSlideFactor("w"),0);break;case"zoomin":this.map.zoomIn();break;case"zoomout":this.map.zoomOut();break;case"zoomworld":this.map.zoomToMaxExtent();break;}
+OpenLayers.Event.stop(evt);},CLASS_NAME:"OpenLayers.Control.PanZoom"});OpenLayers.Control.PanZoom.X=4;OpenLayers.Control.PanZoom.Y=4;OpenLayers.Control.Panel=OpenLayers.Class(OpenLayers.Control,{controls:null,autoActivate:true,defaultControl:null,saveState:false,activeState:null,initialize:function(options){OpenLayers.Control.prototype.initialize.apply(this,[options]);this.controls=[];this.activeState={};},destroy:function(){OpenLayers.Control.prototype.destroy.apply(this,arguments);for(var i=this.controls.length-1;i>=0;i--){if(this.controls[i].events){this.controls[i].events.un({"activate":this.redraw,"deactivate":this.redraw,scope:this});}
+OpenLayers.Event.stopObservingElement(this.controls[i].panel_div);this.controls[i].panel_div=null;}
+this.activeState=null;},activate:function(){if(OpenLayers.Control.prototype.activate.apply(this,arguments)){var control;for(var i=0,len=this.controls.length;i<len;i++){control=this.controls[i];if(control===this.defaultControl||(this.saveState&&this.activeState[control.id])){control.activate();}}
+if(this.saveState===true){this.defaultControl=null;}
+this.redraw();return true;}else{return false;}},deactivate:function(){if(OpenLayers.Control.prototype.deactivate.apply(this,arguments)){var control;for(var i=0,len=this.controls.length;i<len;i++){control=this.controls[i];this.activeState[control.id]=control.deactivate();}
+return true;}else{return false;}},draw:function(){OpenLayers.Control.prototype.draw.apply(this,arguments);this.addControlsToMap(this.controls);return this.div;},redraw:function(){if(this.div.children.length>0){for(var l=this.div.children.length,i=l-1;i>=0;i--){this.div.removeChild(this.div.children[i]);}}
+this.div.innerHTML="";if(this.active){for(var i=0,len=this.controls.length;i<len;i++){var element=this.controls[i].panel_div;if(this.controls[i].active){element.className=this.controls[i].displayClass+"ItemActive";}else{element.className=this.controls[i].displayClass+"ItemInactive";}
+this.div.appendChild(element);}}},activateControl:function(control){if(!this.active){return false;}
+if(control.type==OpenLayers.Control.TYPE_BUTTON){control.trigger();this.redraw();return;}
+if(control.type==OpenLayers.Control.TYPE_TOGGLE){if(control.active){control.deactivate();}else{control.activate();}
+this.redraw();return;}
+var c;for(var i=0,len=this.controls.length;i<len;i++){c=this.controls[i];if(c!=control&&(c.type===OpenLayers.Control.TYPE_TOOL||c.type==null)){c.deactivate();}}
+control.activate();},addControls:function(controls){if(!(controls instanceof Array)){controls=[controls];}
+this.controls=this.controls.concat(controls);for(var i=0,len=controls.length;i<len;i++){var element=document.createElement("div");controls[i].panel_div=element;if(controls[i].title!=""){controls[i].panel_div.title=controls[i].title;}
+OpenLayers.Event.observe(controls[i].panel_div,"click",OpenLayers.Function.bind(this.onClick,this,controls[i]));OpenLayers.Event.observe(controls[i].panel_div,"dblclick",OpenLayers.Function.bind(this.onDoubleClick,this,controls[i]));OpenLayers.Event.observe(controls[i].panel_div,"mousedown",OpenLayers.Function.bindAsEventListener(OpenLayers.Event.stop));}
+if(this.map){this.addControlsToMap(controls);this.redraw();}},addControlsToMap:function(controls){var control;for(var i=0,len=controls.length;i<len;i++){control=controls[i];if(control.autoActivate===true){control.autoActivate=false;this.map.addControl(control);control.autoActivate=true;}else{this.map.addControl(control);control.deactivate();}
+control.events.on({"activate":this.redraw,"deactivate":this.redraw,scope:this});}},onClick:function(ctrl,evt){OpenLayers.Event.stop(evt?evt:window.event);this.activateControl(ctrl);},onDoubleClick:function(ctrl,evt){OpenLayers.Event.stop(evt?evt:window.event);},getControlsBy:function(property,match){var test=(typeof match.test=="function");var found=OpenLayers.Array.filter(this.controls,function(item){return item[property]==match||(test&&match.test(item[property]));});return found;},getControlsByName:function(match){return this.getControlsBy("name",match);},getControlsByClass:function(match){return this.getControlsBy("CLASS_NAME",match);},CLASS_NAME:"OpenLayers.Control.Panel"});OpenLayers.Control.Scale=OpenLayers.Class(OpenLayers.Control,{element:null,geodesic:false,initialize:function(element,options){OpenLayers.Control.prototype.initialize.apply(this,[options]);this.element=OpenLayers.Util.getElement(element);},draw:function(){OpenLayers.Control.prototype.draw.apply(this,arguments);if(!this.element){this.element=document.createElement("div");this.div.appendChild(this.element);}
+this.map.events.register('moveend',this,this.updateScale);this.updateScale();return this.div;},updateScale:function(){var scale;if(this.geodesic===true){var units=this.map.getUnits();if(!units){return;}
+var inches=OpenLayers.INCHES_PER_UNIT;scale=(this.map.getGeodesicPixelSize().w||0.000001)*inches["km"]*OpenLayers.DOTS_PER_INCH;}else{scale=this.map.getScale();}
+if(!scale){return;}
+if(scale>=9500&&scale<=950000){scale=Math.round(scale/1000)+"K";}else if(scale>=950000){scale=Math.round(scale/1000000)+"M";}else{scale=Math.round(scale);}
+this.element.innerHTML=OpenLayers.i18n("scale",{'scaleDenom':scale});},CLASS_NAME:"OpenLayers.Control.Scale"});OpenLayers.Control.ScaleLine=OpenLayers.Class(OpenLayers.Control,{maxWidth:100,topOutUnits:"km",topInUnits:"m",bottomOutUnits:"mi",bottomInUnits:"ft",eTop:null,eBottom:null,geodesic:false,initialize:function(options){OpenLayers.Control.prototype.initialize.apply(this,[options]);},draw:function(){OpenLayers.Control.prototype.draw.apply(this,arguments);if(!this.eTop){this.eTop=document.createElement("div");this.eTop.className=this.displayClass+"Top";var theLen=this.topInUnits.length;this.div.appendChild(this.eTop);if((this.topOutUnits=="")||(this.topInUnits=="")){this.eTop.style.visibility="hidden";}else{this.eTop.style.visibility="visible";}
+this.eBottom=document.createElement("div");this.eBottom.className=this.displayClass+"Bottom";this.div.appendChild(this.eBottom);if((this.bottomOutUnits=="")||(this.bottomInUnits=="")){this.eBottom.style.visibility="hidden";}else{this.eBottom.style.visibility="visible";}}
+this.map.events.register('moveend',this,this.update);this.update();return this.div;},getBarLen:function(maxLen){var digits=parseInt(Math.log(maxLen)/Math.log(10));var pow10=Math.pow(10,digits);var firstChar=parseInt(maxLen/pow10);var barLen;if(firstChar>5){barLen=5;}else if(firstChar>2){barLen=2;}else{barLen=1;}
+return barLen*pow10;},update:function(){var res=this.map.getResolution();if(!res){return;}
+var curMapUnits=this.map.getUnits();var inches=OpenLayers.INCHES_PER_UNIT;var maxSizeData=this.maxWidth*res*inches[curMapUnits];var geodesicRatio=1;if(this.geodesic===true){var maxSizeGeodesic=(this.map.getGeodesicPixelSize().w||0.000001)*this.maxWidth;var maxSizeKilometers=maxSizeData/inches["km"];geodesicRatio=maxSizeGeodesic/maxSizeKilometers;maxSizeData*=geodesicRatio;}
+var topUnits;var bottomUnits;if(maxSizeData>100000){topUnits=this.topOutUnits;bottomUnits=this.bottomOutUnits;}else{topUnits=this.topInUnits;bottomUnits=this.bottomInUnits;}
+var topMax=maxSizeData/inches[topUnits];var bottomMax=maxSizeData/inches[bottomUnits];var topRounded=this.getBarLen(topMax);var bottomRounded=this.getBarLen(bottomMax);topMax=topRounded/inches[curMapUnits]*inches[topUnits];bottomMax=bottomRounded/inches[curMapUnits]*inches[bottomUnits];var topPx=topMax/res/geodesicRatio;var bottomPx=bottomMax/res/geodesicRatio;if(this.eBottom.style.visibility=="visible"){this.eBottom.style.width=Math.round(bottomPx)+"px";this.eBottom.innerHTML=bottomRounded+" "+bottomUnits;}
+if(this.eTop.style.visibility=="visible"){this.eTop.style.width=Math.round(topPx)+"px";this.eTop.innerHTML=topRounded+" "+topUnits;}},CLASS_NAME:"OpenLayers.Control.ScaleLine"});OpenLayers.Control.ZoomIn=OpenLayers.Class(OpenLayers.Control,{type:OpenLayers.Control.TYPE_BUTTON,trigger:function(){this.map.zoomIn();},CLASS_NAME:"OpenLayers.Control.ZoomIn"});OpenLayers.Control.ZoomOut=OpenLayers.Class(OpenLayers.Control,{type:OpenLayers.Control.TYPE_BUTTON,trigger:function(){this.map.zoomOut();},CLASS_NAME:"OpenLayers.Control.ZoomOut"});OpenLayers.Control.ZoomToMaxExtent=OpenLayers.Class(OpenLayers.Control,{type:OpenLayers.Control.TYPE_BUTTON,trigger:function(){if(this.map){this.map.zoomToMaxExtent();}},CLASS_NAME:"OpenLayers.Control.ZoomToMaxExtent"});OpenLayers.Event={observers:false,KEY_BACKSPACE:8,KEY_TAB:9,KEY_RETURN:13,KEY_ESC:27,KEY_LEFT:37,KEY_UP:38,KEY_RIGHT:39,KEY_DOWN:40,KEY_DELETE:46,element:function(event){return event.target||event.srcElement;},isLeftClick:function(event){return(((event.which)&&(event.which==1))||((event.button)&&(event.button==1)));},isRightClick:function(event){return(((event.which)&&(event.which==3))||((event.button)&&(event.button==2)));},stop:function(event,allowDefault){if(!allowDefault){if(event.preventDefault){event.preventDefault();}else{event.returnValue=false;}}
+if(event.stopPropagation){event.stopPropagation();}else{event.cancelBubble=true;}},findElement:function(event,tagName){var element=OpenLayers.Event.element(event);while(element.parentNode&&(!element.tagName||(element.tagName.toUpperCase()!=tagName.toUpperCase()))){element=element.parentNode;}
+return element;},observe:function(elementParam,name,observer,useCapture){var element=OpenLayers.Util.getElement(elementParam);useCapture=useCapture||false;if(name=='keypress'&&(navigator.appVersion.match(/Konqueror|Safari|KHTML/)||element.attachEvent)){name='keydown';}
+if(!this.observers){this.observers={};}
+if(!element._eventCacheID){var idPrefix="eventCacheID_";if(element.id){idPrefix=element.id+"_"+idPrefix;}
+element._eventCacheID=OpenLayers.Util.createUniqueID(idPrefix);}
+var cacheID=element._eventCacheID;if(!this.observers[cacheID]){this.observers[cacheID]=[];}
+this.observers[cacheID].push({'element':element,'name':name,'observer':observer,'useCapture':useCapture});if(element.addEventListener){element.addEventListener(name,observer,useCapture);}else if(element.attachEvent){element.attachEvent('on'+name,observer);}},stopObservingElement:function(elementParam){var element=OpenLayers.Util.getElement(elementParam);var cacheID=element._eventCacheID;this._removeElementObservers(OpenLayers.Event.observers[cacheID]);},_removeElementObservers:function(elementObservers){if(elementObservers){for(var i=elementObservers.length-1;i>=0;i--){var entry=elementObservers[i];var args=new Array(entry.element,entry.name,entry.observer,entry.useCapture);var removed=OpenLayers.Event.stopObserving.apply(this,args);}}},stopObserving:function(elementParam,name,observer,useCapture){useCapture=useCapture||false;var element=OpenLayers.Util.getElement(elementParam);var cacheID=element._eventCacheID;if(name=='keypress'){if(navigator.appVersion.match(/Konqueror|Safari|KHTML/)||element.detachEvent){name='keydown';}}
+var foundEntry=false;var elementObservers=OpenLayers.Event.observers[cacheID];if(elementObservers){var i=0;while(!foundEntry&&i<elementObservers.length){var cacheEntry=elementObservers[i];if((cacheEntry.name==name)&&(cacheEntry.observer==observer)&&(cacheEntry.useCapture==useCapture)){elementObservers.splice(i,1);if(elementObservers.length==0){delete OpenLayers.Event.observers[cacheID];}
+foundEntry=true;break;}
+i++;}}
+if(foundEntry){if(element.removeEventListener){element.removeEventListener(name,observer,useCapture);}else if(element&&element.detachEvent){element.detachEvent('on'+name,observer);}}
+return foundEntry;},unloadCache:function(){if(OpenLayers.Event&&OpenLayers.Event.observers){for(var cacheID in OpenLayers.Event.observers){var elementObservers=OpenLayers.Event.observers[cacheID];OpenLayers.Event._removeElementObservers.apply(this,[elementObservers]);}
+OpenLayers.Event.observers=false;}},CLASS_NAME:"OpenLayers.Event"};OpenLayers.Event.observe(window,'unload',OpenLayers.Event.unloadCache,false);if(window.Event){OpenLayers.Util.applyDefaults(window.Event,OpenLayers.Event);}else{var Event=OpenLayers.Event;}
+OpenLayers.Events=OpenLayers.Class({BROWSER_EVENTS:["mouseover","mouseout","mousedown","mouseup","mousemove","click","dblclick","rightclick","dblrightclick","resize","focus","blur"],listeners:null,object:null,element:null,eventTypes:null,eventHandler:null,fallThrough:null,includeXY:false,clearMouseListener:null,initialize:function(object,element,eventTypes,fallThrough,options){OpenLayers.Util.extend(this,options);this.object=object;this.fallThrough=fallThrough;this.listeners={};this.eventHandler=OpenLayers.Function.bindAsEventListener(this.handleBrowserEvent,this);this.clearMouseListener=OpenLayers.Function.bind(this.clearMouseCache,this);this.eventTypes=[];if(eventTypes!=null){for(var i=0,len=eventTypes.length;i<len;i++){this.addEventType(eventTypes[i]);}}
+if(element!=null){this.attachToElement(element);}},destroy:function(){if(this.element){OpenLayers.Event.stopObservingElement(this.element);if(this.element.hasScrollEvent){OpenLayers.Event.stopObserving(window,"scroll",this.clearMouseListener);}}
+this.element=null;this.listeners=null;this.object=null;this.eventTypes=null;this.fallThrough=null;this.eventHandler=null;},addEventType:function(eventName){if(!this.listeners[eventName]){this.eventTypes.push(eventName);this.listeners[eventName]=[];}},attachToElement:function(element){if(this.element){OpenLayers.Event.stopObservingElement(this.element);}
+this.element=element;for(var i=0,len=this.BROWSER_EVENTS.length;i<len;i++){var eventType=this.BROWSER_EVENTS[i];this.addEventType(eventType);OpenLayers.Event.observe(element,eventType,this.eventHandler);}
+OpenLayers.Event.observe(element,"dragstart",OpenLayers.Event.stop);},on:function(object){for(var type in object){if(type!="scope"){this.register(type,object.scope,object[type]);}}},register:function(type,obj,func){if((func!=null)&&(OpenLayers.Util.indexOf(this.eventTypes,type)!=-1)){if(obj==null){obj=this.object;}
+var listeners=this.listeners[type];listeners.push({obj:obj,func:func});}},registerPriority:function(type,obj,func){if(func!=null){if(obj==null){obj=this.object;}
+var listeners=this.listeners[type];if(listeners!=null){listeners.unshift({obj:obj,func:func});}}},un:function(object){for(var type in object){if(type!="scope"){this.unregister(type,object.scope,object[type]);}}},unregister:function(type,obj,func){if(obj==null){obj=this.object;}
+var listeners=this.listeners[type];if(listeners!=null){for(var i=0,len=listeners.length;i<len;i++){if(listeners[i].obj==obj&&listeners[i].func==func){listeners.splice(i,1);break;}}}},remove:function(type){if(this.listeners[type]!=null){this.listeners[type]=[];}},triggerEvent:function(type,evt){var listeners=this.listeners[type];if(!listeners||listeners.length==0){return;}
+if(evt==null){evt={};}
+evt.object=this.object;evt.element=this.element;if(!evt.type){evt.type=type;}
+var listeners=listeners.slice(),continueChain;for(var i=0,len=listeners.length;i<len;i++){var callback=listeners[i];continueChain=callback.func.apply(callback.obj,[evt]);if((continueChain!=undefined)&&(continueChain==false)){break;}}
+if(!this.fallThrough){OpenLayers.Event.stop(evt,true);}
+return continueChain;},handleBrowserEvent:function(evt){if(this.includeXY){evt.xy=this.getMousePosition(evt);}
+this.triggerEvent(evt.type,evt);},clearMouseCache:function(){this.element.scrolls=null;this.element.lefttop=null;this.element.offsets=null;},getMousePosition:function(evt){if(!this.includeXY){this.clearMouseCache();}else if(!this.element.hasScrollEvent){OpenLayers.Event.observe(window,"scroll",this.clearMouseListener);this.element.hasScrollEvent=true;}
+if(!this.element.scrolls){this.element.scrolls=[(document.documentElement.scrollLeft||document.body.scrollLeft),(document.documentElement.scrollTop||document.body.scrollTop)];}
+if(!this.element.lefttop){this.element.lefttop=[(document.documentElement.clientLeft||0),(document.documentElement.clientTop||0)];}
+if(!this.element.offsets){this.element.offsets=OpenLayers.Util.pagePosition(this.element);this.element.offsets[0]+=this.element.scrolls[0];this.element.offsets[1]+=this.element.scrolls[1];}
+return new OpenLayers.Pixel((evt.clientX+this.element.scrolls[0])-this.element.offsets[0]
+-this.element.lefttop[0],(evt.clientY+this.element.scrolls[1])-this.element.offsets[1]
+-this.element.lefttop[1]);},CLASS_NAME:"OpenLayers.Events"});OpenLayers.Format=OpenLayers.Class({options:null,externalProjection:null,internalProjection:null,data:null,keepData:false,initialize:function(options){OpenLayers.Util.extend(this,options);this.options=options;},destroy:function(){},read:function(data){OpenLayers.Console.userError(OpenLayers.i18n("readNotImplemented"));},write:function(object){OpenLayers.Console.userError(OpenLayers.i18n("writeNotImplemented"));},CLASS_NAME:"OpenLayers.Format"});OpenLayers.Lang["ar"]=OpenLayers.Util.applyDefaults({'permalink':"وصلة دائمة",'baseLayer':"الطبقة الاساسية",'readNotImplemented':"القراءة غير محققة.",'writeNotImplemented':"الكتابة غير محققة",'errorLoadingGML':"خطأ عند تحميل الملف جي ام ال ${url}",'scale':"النسبة = 1 : ${scaleDenom}",'W':"غ",'E':"شر",'N':"شم",'S':"ج"});OpenLayers.Lang["be-tarask"]=OpenLayers.Util.applyDefaults({'unhandledRequest':"Неапрацаваны вынік запыту ${statusText}",'permalink':"Сталая спасылка",'overlays':"Слаі",'baseLayer':"Базавы слой",'sameProjection':"Аглядная мапа працуе толькі калі яна мае тую ж праекцыю, што і асноўная мапа",'readNotImplemented':"Функцыянальнасьць чытаньня ня створаная.",'writeNotImplemented':"Функцыянальнасьць запісу ня створаная.",'noFID':"Немагчыма абнавіць магчымасьць, для якога не існуе FID.",'errorLoadingGML':"Памылка загрузкі файла GML ${url}",'browserNotSupported':"Ваш браўзэр не падтрымлівае вэктарную графіку. У цяперашні момант падтрымліваюцца: ${renderers}",'componentShouldBe':"addFeatures : кампанэнт павінен быць ${geomType}",'getFeatureError':"getFeatureFromEvent выкліканы для слоя бяз рэндэру. Звычайна гэта азначае, што Вы зьнішчылі слой, але пакінулі зьвязаны зь ім апрацоўшчык.",'minZoomLevelError':"Уласьцівасьць minZoomLevel прызначана толькі для выкарыстаньня са слаямі вытворнымі ад FixedZoomLevels. Тое, што гэты wfs-слой правяраецца на minZoomLevel — рэха прошлага. Але мы ня можам выдаліць гэтую магчымасьць, таму што ад яе залежаць некаторыя заснаваныя на OL дастасаваньні. Тым ня менш, праверка minZoomLevel будзе выдаленая ў вэрсіі 3.0. Калі ласка, выкарыстоўваеце замест яе ўстаноўкі мінімальнага/максымальнага памераў, як апісана тут: http://trac.openlayers.org/wiki/SettingZoomLevels",'commitSuccess':"WFS-транзакцыя: ПОСЬПЕХ ${response}",'commitFailed':"WFS-транзакцыя: ПАМЫЛКА ${response}",'googleWarning':"Не атрымалася загрузіць слой Google. \x3cbr\x3e\x3cbr\x3eКаб пазбавіцца гэтага паведамленьня, выберыце новы базавы слой у сьпісе ў верхнім правым куце.\x3cbr\x3e\x3cbr\x3e Хутчэй за ўсё, прычына ў тым, што скрыпт бібліятэкі Google Maps ня быў уключаныя альбо не ўтрымлівае слушны API-ключ для Вашага сайта.\x3cbr\x3e\x3cbr\x3eРаспрацоўшчыкам: Для таго, каб даведацца як зрабіць так, каб усё працавала, \x3ca href=\'http://trac.openlayers.org/wiki/Google\' target=\'_blank\'\x3eнацісьніце тут\x3c/a\x3e",'getLayerWarning':"Немагчыма загрузіць слой ${layerType}.\x3cbr\x3e\x3cbr\x3eКаб пазбавіцца гэтага паведамленьня, выберыце новы базавы слой у сьпісе ў верхнім правым куце.\x3cbr\x3e\x3cbr\x3eХутчэй за ўсё, прычына ў тым, што скрыпт бібліятэкі ${layerLib} ня быў слушна ўключаны.\x3cbr\x3e\x3cbr\x3eРаспрацоўшчыкам: Для таго, каб даведацца як зрабіць так, каб усё працавала, \x3ca href=\'http://trac.openlayers.org/wiki/${layerLib}\' target=\'_blank\'\x3eнацісьніце тут\x3c/a\x3e",'scale':"Маштаб = 1 : ${scaleDenom}",'W':"З",'E':"У",'N':"Пн",'S':"Пд",'layerAlreadyAdded':"Вы паспрабавалі дадаць слой ${layerName} на мапу, але ён ужо дададзены",'reprojectDeprecated':"Вы выкарыстоўваеце ўстаноўку \'reproject\' для слоя ${layerName}. Гэтая ўстаноўка зьяўляецца састарэлай: яна выкарыстоўвалася для падтрымкі паказу зьвестак на камэрцыйных базавых мапах, але гэта функцыя цяпер рэалізаваная ў убудаванай падтрымцы сфэрычнай праекцыі Мэркатара. Дадатковая інфармацыя ёсьць на http://trac.openlayers.org/wiki/SphericalMercator.",'methodDeprecated':"Гэты мэтад састарэлы і будзе выдалены ў вэрсіі 3.0. Калі ласка, замест яго выкарыстоўвайце ${newMethod}.",'boundsAddError':"Вам неабходна падаць абодва значэньні x і y для функцыі складаньня.",'lonlatAddError':"Вам неабходна падаць абодва значэньні lon і lat для функцыі складаньня.",'pixelAddError':"Вам неабходна падаць абодва значэньні x і y для функцыі складаньня.",'unsupportedGeometryType':"Тып геамэтрыі не падтрымліваецца: ${geomType}",'pagePositionFailed':"OpenLayers.Util.pagePosition failed: верагодна элемэнт з ідэнтыфікатарам ${elemId} займае няслушнае месца.",'filterEvaluateNotImplemented':"evaluate не рэалізаваны для гэтага тыпу фільтру."});OpenLayers.Lang["bg"]=OpenLayers.Util.applyDefaults({'permalink':"Постоянна препратка",'baseLayer':"Основен слой",'errorLoadingGML':"Грешка при зареждане на GML файл ${url}",'scale':"Мащаб = 1 : ${scaleDenom}",'layerAlreadyAdded':"Опитахте да добавите слой ${layerName} в картата, но той вече е добавен",'methodDeprecated':"Този метод е остарял и ще бъде премахват в 3.0. Вместо него използвайте ${newMethod}."});OpenLayers.Lang["br"]=OpenLayers.Util.applyDefaults({'unhandledRequest':"Distro evel reked anveret ${statusText}",'permalink':"Peurliamm",'overlays':"Gwiskadoù",'baseLayer':"Gwiskad diazez",'sameProjection':"Ne\'z ar gartenn lec\'hiañ en-dro nemet pa vez heñvel ar banndres anezhi ha hini ar gartenn bennañ",'readNotImplemented':"N\'eo ket emplementet al lenn.",'writeNotImplemented':"N\'eo ket emplementet ar skrivañ.",'noFID':"N\'haller ket hizivaat un elfenn ma n\'eus ket a niverenn-anaout (FID) eviti.",'errorLoadingGML':"Fazi e-ser kargañ ar restr GML ${url}",'browserNotSupported':"N\'eo ket skoret an daskor vektorel gant ho merdeer. Setu aze an daskorerioù skoret evit ar poent :\n${renderers}",'componentShouldBe':"addFeatures : bez\' e tlefe ar parzh besañ eus ar seurt ${geomType}",'getFeatureError':"Galvet eo bet getFeatureFromEvent called war ur gwiskad hep daskorer. Kement-se a dalvez ez eus bet freuzet ur gwiskad hag hoc\'h eus miret un embreger bennak stag outañ.",'minZoomLevelError':"Ne zleer implijout ar perzh minZoomLevel nemet evit gwiskadoù FixedZoomLevels-descendent. Ar fed ma wiria ar gwiskad WHS-se hag-eñ ez eus eus minZoomLevel zo un aspadenn gozh. Koulskoude n\'omp ket evit e ziverkañ kuit da derriñ arloadoù diazezet war OL a c\'hallfe bezañ stag outañ. Setu perak eo dispredet -- Lamet kuit e vo ar gwiriañ minZoomLevel a-is er stumm 3.0. Ober gant an arventennoù bihanañ/brasañ evel deskrivet amañ e plas : http://trac.openlayers.org/wiki/SettingZoomLevels",'commitSuccess':"Treuzgread WFS : MAT EO ${response}",'commitFailed':"Treuzgread WFS Transaction: C\'HWITET ${response}",'googleWarning':"N\'eus ket bet gallet kargañ ar gwiskad Google ent reizh.\x3cbr\x3e\x3cbr\x3eEvit en em zizober eus ar c\'hemenn-mañ, dibabit ur BaseLayer nevez en diuzer gwiskadoù er c\'horn dehoù el laez.\x3cbr\x3e\x3cbr\x3eSur a-walc\'h eo peogwir n\'eo ket bet ensoc\'het levraoueg Google Maps pe neuze ne glot ket an alc\'hwez API gant ho lec\'hienn.\x3cbr\x3e\x3cbr\x3eDiorroerien : Evit reizhañ an dra-se, \x3ca href=\'http://trac.openlayers.org/wiki/Google\' target=\'_blank\'\x3eclick here\x3c/a\x3e",'getLayerWarning':"N\'haller ket kargañ ar gwiskad ${layerType} ent reizh.\x3cbr\x3e\x3cbr\x3eEvit en em zizober eus ar c\'hemenn-mañ, dibabit ur BaseLayer nevez en diuzer gwiskadoù er c\'horn dehoù el laez.\x3cbr\x3e\x3cbr\x3eSur a-walc\'h eo peogwir n\'eo ket bet ensoc\'het mat al levraoueg ${layerLib}.\x3cbr\x3e\x3cbr\x3eDiorroerien : Evit gouzout penaos reizhañ an dra-se, \x3ca href=\'http://trac.openlayers.org/wiki/${layerLib}\' target=\'_blank\'\x3eclick here\x3c/a\x3e",'scale':"Skeul = 1 : ${scaleDenom}",'W':"K",'E':"R",'N':"N",'S':"S",'layerAlreadyAdded':"Klasket hoc\'h eus ouzhpennañ ar gwiskad : ${layerName} d\'ar gartenn, met ouzhpennet e oa bet c\'hoazh",'reprojectDeprecated':"Emaoc\'h oc\'h implijout an dibarzh \'reproject\' war ar gwiskad ${layerName}. Dispredet eo an dibarzh-mañ : bet eo hag e talveze da ziskwel roadennoù war-c\'horre kartennoù diazez kenwerzhel, un dra hag a c\'haller ober bremañ gant an arc\'hwel dre skor banndres boullek Mercator. Muioc\'h a ditouroù a c\'haller da gaout war http://trac.openlayers.org/wiki/SphericalMercator.",'methodDeprecated':"Dispredet eo an daore-se ha tennet e vo kuit eus ar stumm 3.0. Grit gant ${newMethod} e plas.",'boundsAddError':"Rekis eo tremen an div dalvoudenn x ha y d\'an arc\'hwel add.",'lonlatAddError':"Rekis eo tremen an div dalvoudenn hedred ha ledred d\'an arc\'hwel add.",'pixelAddError':"Rekis eo tremen an div dalvoudenn x ha y d\'an arc\'hwel add.",'unsupportedGeometryType':"Seurt mentoniezh anskoret : ${geomType}",'pagePositionFailed':"C\'hwitet eo OpenLayers.Util.pagePosition : marteze emañ lec\'hiet fall an elfenn id ${elemId}.",'filterEvaluateNotImplemented':"N\'eo ket bet emplementet ar priziañ evit seurt siloù c\'hoazh."});OpenLayers.Lang["el"]=OpenLayers.Util.applyDefaults({'scale':"Κλίμακα ~ 1 : ${scaleDenom}"});OpenLayers.Lang.en={'unhandledRequest':"Unhandled request return ${statusText}",'permalink':"Permalink",'overlays':"Overlays",'baseLayer':"Base Layer",'sameProjection':"The overview map only works when it is in the same projection as the main map",'readNotImplemented':"Read not implemented.",'writeNotImplemented':"Write not implemented.",'noFID':"Can't update a feature for which there is no FID.",'errorLoadingGML':"Error in loading GML file ${url}",'browserNotSupported':"Your browser does not support vector rendering. Currently supported renderers are:\n${renderers}",'componentShouldBe':"addFeatures : component should be an ${geomType}",'getFeatureError':"getFeatureFromEvent called on layer with no renderer. This usually means you "+"destroyed a layer, but not some handler which is associated with it.",'minZoomLevelError':"The minZoomLevel property is only intended for use "+"with the FixedZoomLevels-descendent layers. That this "+"wfs layer checks for minZoomLevel is a relic of the"+"past. We cannot, however, remove it without possibly "+"breaking OL based applications that may depend on it."+" Therefore we are deprecating it -- the minZoomLevel "+"check below will be removed at 3.0. Please instead "+"use min/max resolution setting as described here: "+"http://trac.openlayers.org/wiki/SettingZoomLevels",'commitSuccess':"WFS Transaction: SUCCESS ${response}",'commitFailed':"WFS Transaction: FAILED ${response}",'googleWarning':"The Google Layer was unable to load correctly.<br><br>"+"To get rid of this message, select a new BaseLayer "+"in the layer switcher in the upper-right corner.<br><br>"+"Most likely, this is because the Google Maps library "+"script was either not included, or does not contain the "+"correct API key for your site.<br><br>"+"Developers: For help getting this working correctly, "+"<a href='http://trac.openlayers.org/wiki/Google' "+"target='_blank'>click here</a>",'getLayerWarning':"The ${layerType} Layer was unable to load correctly.<br><br>"+"To get rid of this message, select a new BaseLayer "+"in the layer switcher in the upper-right corner.<br><br>"+"Most likely, this is because the ${layerLib} library "+"script was not correctly included.<br><br>"+"Developers: For help getting this working correctly, "+"<a href='http://trac.openlayers.org/wiki/${layerLib}' "+"target='_blank'>click here</a>",'scale':"Scale = 1 : ${scaleDenom}",'W':'W','E':'E','N':'N','S':'S','graticule':'Graticule','layerAlreadyAdded':"You tried to add the layer: ${layerName} to the map, but it has already been added",'reprojectDeprecated':"You are using the 'reproject' option "+"on the ${layerName} layer. This option is deprecated: "+"its use was designed to support displaying data over commercial "+"basemaps, but that functionality should now be achieved by using "+"Spherical Mercator support. More information is available from "+"http://trac.openlayers.org/wiki/SphericalMercator.",'methodDeprecated':"This method has been deprecated and will be removed in 3.0. "+"Please use ${newMethod} instead.",'boundsAddError':"You must pass both x and y values to the add function.",'lonlatAddError':"You must pass both lon and lat values to the add function.",'pixelAddError':"You must pass both x and y values to the add function.",'unsupportedGeometryType':"Unsupported geometry type: ${geomType}",'pagePositionFailed':"OpenLayers.Util.pagePosition failed: element with id ${elemId} may be misplaced.",'filterEvaluateNotImplemented':"evaluate is not implemented for this filter type.",'end':''};OpenLayers.Lang["fi"]=OpenLayers.Util.applyDefaults({'permalink':"Ikilinkki",'overlays':"Kerrokset",'baseLayer':"Peruskerros",'sameProjection':"Yleiskuvakarttaa voi käyttää vain, kun sillä on sama projektio kuin pääkartalla.",'W':"L",'E':"I",'N':"P",'S':"E"});OpenLayers.Lang["fur"]=OpenLayers.Util.applyDefaults({'permalink':"Leam Permanent",'overlays':"Livei parsore",'baseLayer':"Livel di base",'browserNotSupported':"Il to sgarfadôr nol supuarte la renderizazion vetoriâl. Al moment a son supuartâts:\n${renderers}",'scale':"Scjale = 1 : ${scaleDenom}",'W':"O",'E':"E",'N':"N",'S':"S"});OpenLayers.Lang["gl"]=OpenLayers.Util.applyDefaults({'unhandledRequest':"Solicitude non xerada; a resposta foi: ${statusText}",'permalink':"Ligazón permanente",'overlays':"Capas superpostas",'baseLayer':"Capa base",'sameProjection':"A vista xeral do mapa só funciona cando está na mesma proxección có mapa principal",'readNotImplemented':"Lectura non implementada.",'writeNotImplemented':"Escritura non implementada.",'noFID':"Non se pode actualizar a funcionalidade para a que non hai FID.",'errorLoadingGML':"Erro ao cargar o ficheiro GML ${url}",'browserNotSupported':"O seu navegador non soporta a renderización de vectores. Os renderizadores soportados actualmente son:\n${renderers}",'componentShouldBe':"addFeatures: o compoñente debera ser de tipo ${geomType}",'getFeatureError':"getFeatureFromEvent ten sido chamado a unha capa sen renderizador. Isto normalmente significa que destruíu unha capa, mais non o executador que está asociado con ela.",'minZoomLevelError':"A propiedade minZoomLevel é só para uso conxuntamente coas capas FixedZoomLevels-descendent. O feito de que esa capa wfs verifique o minZoomLevel é unha reliquia do pasado. Non podemos, con todo, eliminala sen a posibilidade de non romper as aplicacións baseadas en OL que poidan depender dela. Por iso a estamos deixando obsoleta (a comprobación minZoomLevel de embaixo será eliminada na versión 3.0). Por favor, no canto diso use o axuste de resolución mín/máx tal e como está descrito aquí: http://trac.openlayers.org/wiki/SettingZoomLevels",'commitSuccess':"Transacción WFS: ÉXITO ${response}",'commitFailed':"Transacción WFS: FALLIDA ${response}",'googleWarning':"A capa do Google non puido cargarse correctamente.\x3cbr\x3e\x3cbr\x3ePara evitar esta mensaxe, escolla unha nova capa base no seleccionador de capas na marxe superior dereita.\x3cbr\x3e\x3cbr\x3eProbablemente, isto acontece porque a escritura da libraría do Google Maps ou ben non foi incluída ou ben non contén a clave API correcta para o seu sitio.\x3cbr\x3e\x3cbr\x3eDesenvolvedores: para axudar a facer funcionar isto correctamente, \x3ca href=\'http://trac.openlayers.org/wiki/Google\' target=\'_blank\'\x3epremede aquí\x3c/a\x3e",'getLayerWarning':"A capa ${layerType} foi incapaz de cargarse correctamente.\x3cbr\x3e\x3cbr\x3ePara evitar esta mensaxe, escolla unha nova capa base no seleccionador de capas na marxe superior dereita.\x3cbr\x3e\x3cbr\x3eProbablemente, isto acontece porque a escritura da libraría ${layerLib} non foi ben incluída.\x3cbr\x3e\x3cbr\x3eDesenvolvedores: para axudar a facer funcionar isto correctamente, \x3ca href=\'http://trac.openlayers.org/wiki/${layerLib}\' target=\'_blank\'\x3epremede aquí\x3c/a\x3e",'scale':"Escala = 1 : ${scaleDenom}",'W':"O",'E':"L",'N':"N",'S':"S",'layerAlreadyAdded':"Intentou engadir a capa: ${layerName} ao mapa, pero xa fora engadida",'reprojectDeprecated':"Está usando a opción \"reproject\" na capa ${layerName}. Esta opción está obsoleta: o seu uso foi deseñado para a visualización de datos sobre mapas base comerciais, pero esta funcionalidade debera agora ser obtida utilizando a proxección Spherical Mercator. Hai dispoñible máis información en http://trac.openlayers.org/wiki/SphericalMercator.",'methodDeprecated':"Este método está obsoleto e será eliminado na versión 3.0. Por favor, no canto deste use ${newMethod}.",'boundsAddError':"Debe achegar os valores x e y á función add.",'lonlatAddError':"Debe achegar tanto o valor lon coma o lat á función add.",'pixelAddError':"Debe achegar os valores x e y á función add.",'unsupportedGeometryType':"Tipo xeométrico non soportado: ${geomType}",'pagePositionFailed':"OpenLayers.Util.pagePosition fallou: o elemento con id ${elemId} pode non estar na súa posición.",'filterEvaluateNotImplemented':"avaliar non está implementado para este tipo de filtro."});OpenLayers.Lang["gsw"]=OpenLayers.Util.applyDefaults({'unhandledRequest':"Nit behandleti Aafrogsruckmäldig ${statusText}",'permalink':"Permalink",'overlays':"Iberlagerige",'baseLayer':"Grundcharte",'sameProjection':"D Ibersichts-Charte funktioniert nume, wänn si di glych Projäktion brucht wie d Hauptcharte",'readNotImplemented':"Läse nit implementiert.",'writeNotImplemented':"Schrybe nit implementiert.",'noFID':"E Feature, wu s kei FID derfir git, cha nit aktualisiert wäre.",'errorLoadingGML':"Fähler bim Lade vu dr GML-Datei ${url}",'browserNotSupported':"Dyy Browser unterstitzt kei Vektordarstellig. Aktuäll unterstitzti Renderer:\n${renderers}",'componentShouldBe':"addFeatures : Komponänt sott dr Typ ${geomType} syy",'getFeatureError':"getFeatureFromEvent isch uf eme Layer ohni Renderer ufgruefe wore. Des heisst normalerwys, ass Du e Layer kaputt gmacht hesch, aber nit dr Handler, wu derzue ghert.",'minZoomLevelError':"D minZoomLevel-Eigeschaft isch nume dänk fir d Layer, wu vu dr FixedZoomLevels abstamme. Ass dää wfs-Layer minZoomLevel prieft, scih e Relikt us dr Vergangeheit. Mir chenne s aber nit ändere ohni OL_basierti Aawändige villicht kaputt gehn, wu dervu abhänge. Us däm Grund het die Funktion d Eigeschaft \'deprecated\' iberchuu. D minZoomLevel-Priefig unte wird in dr Version 3.0 usegnuu. Bitte verwänd statt däm e min/max-Uflesig wie s do bschriben isch: http://trac.openlayers.org/wiki/SettingZoomLevels",'commitSuccess':"WFS-Transaktion: ERFOLGRYCH ${response}",'commitFailed':"WFS-Transaktion: FÄHLGSCHLAA ${response}",'googleWarning':"Dr Google-Layer het nit korräkt chenne glade wäre.\x3cbr\x3e\x3cbr\x3eGo die Mäldig nimi z kriege, wehl e andere Hintergrundlayer us em LayerSwitcher im rächte obere Ecke.\x3cbr\x3e\x3cbr\x3eDää Fähler git s seli hyfig, wel s Skript vu dr Google-Maps-Bibliothek nit yybunde woren isch oder wel s kei giltige API-Schlissel fir Dyy URL din het.\x3cbr\x3e\x3cbr\x3eEntwickler: Fir Hilf zum korräkte Yybinde vum Google-Layer \x3ca href=\'http://trac.openlayers.org/wiki/Google\' target=\'_blank\'\x3edoo drucke\x3c/a\x3e",'getLayerWarning':"Dr ${layerType}-Layer het nit korräkt chenne glade wäre.\x3cbr\x3e\x3cbr\x3eGo die Mäldig nimi z kriege, wehl e andere Hintergrundlayer us em LayerSwitcher im rächte obere Ecke.\x3cbr\x3e\x3cbr\x3eDää Fähler git s seli hyfig, wel s Skript vu dr \'${layerLib}\'-Bibliothek nit yybunde woren isch oder wel s kei giltige API-Schlissel fir Dyy URL din het.\x3cbr\x3e\x3cbr\x3eEntwickler: Fir Hilf zum korräkte Yybinde vu Layer \x3ca href=\'http://trac.openlayers.org/wiki/${layerLib}\' target=\'_blank\'\x3edoo drucke\x3c/a\x3e",'scale':"Maßstab = 1 : ${scaleDenom}",'W':"W",'E':"O",'N':"N",'S':"S",'layerAlreadyAdded':"Du hesch versuecht dää Layer in d Charte yyzfiege: ${layerName}, aber är isch schoi yygfiegt",'reprojectDeprecated':"Du bruchsch d \'reproject\'-Option bim ${layerName}-Layer. Die Option isch nimi giltig: si isch aagleit wore go Date iber kommerziälli Grundcharte lege, aber des sott mer jetz mache mit dr Unterstitzig vu Spherical Mercator. Meh Informatione git s uf http://trac.openlayers.org/wiki/SphericalMercator.",'methodDeprecated':"Die Methode isch veraltet un wird us dr Version 3.0 usegnuu. Bitte verwäbnd statt däm ${newMethod}.",'boundsAddError':"Du muesch e x-Wärt un e y-Wärt yygee bi dr Zuefieg-Funktion",'lonlatAddError':"Du meusch e Lengi- un e Breiti-Grad yygee bi dr Zuefieg-Funktion.",'pixelAddError':"Du muesch x- un y-Wärt aagee bi dr Zuefieg-Funktion.",'unsupportedGeometryType':"Nit unterstitze Geometrii-Typ: ${geomType}",'pagePositionFailed':"OpenLayers.Util.pagePosition fählgschlaa: Elemänt mit ID ${elemId} isch villicht falsch gsetzt.",'filterEvaluateNotImplemented':"evaluiere isch nit implemäntiert in däm Filtertyp."});OpenLayers.Lang["hr"]=OpenLayers.Util.applyDefaults({'unhandledRequest':"Nepodržani zahtjev ${statusText}",'permalink':"Permalink",'overlays':"Overlays",'baseLayer':"Osnovna karta",'sameProjection':"Pregledna karta radi jedino kao je u istoj projekciji kao i glava karta",'readNotImplemented':"Čitanje nije implementirano.",'writeNotImplemented':"Pisanje nije implementirano.",'noFID':"Ne mogu ažurirati značajku za koju ne postoji FID.",'errorLoadingGML':"Greška u učitavanju GML datoteke ${url}",'browserNotSupported':"Vaš preglednik ne podržava vektorsko renderiranje. Trenutno podržani rendereri su: ${renderers}",'componentShouldBe':"addFeatures : komponenta bi trebala biti ${geomType}",'getFeatureError':"getFeatureFromEvent je pozvao Layer bez renderera. Ovo obično znači da ste uništiili Layer, a ne neki Handler koji je povezan s njim.",'commitSuccess':"WFS Transakcija: USPJEŠNA ${response}",'commitFailed':"WFS Transakcija: NEUSPJEŠNA ${response}",'scale':"Mjerilo = 1 : ${scaleDenom}",'layerAlreadyAdded':"Pokušali ste dodati layer: ${layerName} na kartu, ali je već dodan",'methodDeprecated':"Ova metoda nije odobrena i biti će maknuta u 3.0. Koristite ${newMethod}.",'boundsAddError':"Morate dati obje vrijednosti , x i y da bi dodali funkciju.",'lonlatAddError':"Morate dati obje vrijednosti , (lon i lat) da bi dodali funkciju.",'pixelAddError':"Morate dati obje vrijednosti , x i y da bi dodali funkciju.",'unsupportedGeometryType':"Nepodržani tip geometrije: ${geomType}",'pagePositionFailed':"OpenLayers.Util.pagePosition nije uspjelo: element sa id ${elemId} može biti krivo smješten."});OpenLayers.Lang["hsb"]=OpenLayers.Util.applyDefaults({'unhandledRequest':"Wotmołwa njewobdźěłaneho naprašowanja ${statusText}",'permalink':"Trajny wotkaz",'overlays':"Naworštowanja",'baseLayer':"Zakładna runina",'sameProjection':"Přehladowa karta jenož funguje, hdyž je w samsnej projekciji kaž hłowna karta",'readNotImplemented':"Čitanje njeimplementowane.",'writeNotImplemented':"Pisanje njeimplementowane.",'noFID':"Funkcija, za kotruž FID njeje, njeda so aktualizować.",'errorLoadingGML':"Zmylk při začitowanju dataje ${url}",'browserNotSupported':"Twój wobhladowak wektorowe rysowanje njepodpěruje. Tuchwilu podpěrowane rysowaki su:\n${renderers}",'componentShouldBe':"addFeatures: komponenta měła ${geomType} być",'getFeatureError':"getFeatureFromEvent bu na woršće bjez rysowak zawołany. To zwjetša woznamjenja, zo sy worštu zničił, ale nic wobdźěłak, kotryž je z njej zwjazany.",'minZoomLevelError':"Kajkosć minZoomLevel je jenož za wužiwanje z worštami myslena, kotrež wot FixedZoomLevels pochadźeja. Zo tuta woršta wfs za minZoomLevel přepruwuje, je relikt zańdźenosće. Njemóžemy wšak ju wotstronić, bjeztoho zo aplikacije, kotrež na OpenLayers bazěruja a snano tutu kajkosć wužiwaja, hižo njefunguja. Tohodla smy ju jako zestarjenu woznamjenili -- přepruwowanje za minZoomLevel budu so we wersiji 3.0 wotstronjeć. Prošu wužij město toho nastajenje min/max, kaž je tu wopisane: http://trac.openlayers.org/wiki/SettingZoomLevels",'commitSuccess':"WFS-Transakcija: WUSPĚŠNA ${response}",'commitFailed':"WFS-Transakcija: NJEPORADŹENA ${response}",'googleWarning':"Woršta Google njemóžeše so korektnje začitać.\x3cbr\x3e\x3cbr\x3eZo by tutu zdźělenku wotbył, wubjer nowy BaseLayer z wuběra worštow horjeka naprawo.\x3cbr\x3e\x3cbr\x3eNajskerje so to stawa, dokelž skript biblioteki Google Maps pak njebu zapřijaty pak njewobsahuje korektny kluč API za twoje sydło.\x3cbr\x3e\x3cbr\x3eWuwiwarjo: Za pomoc ke korektnemu fungowanju worštow\n\x3ca href=\'http://trac.openlayers.org/wiki/Google\' target=\'_blank\'\x3etu kliknyć\x3c/a\x3e",'getLayerWarning':"Woršta ${layerType} njemóžeše so korektnje začitać.\x3cbr\x3e\x3cbr\x3eZo by tutu zdźělenku wotbył, wubjer nowy BaseLayer z wuběra worštow horjeka naprawo.\x3cbr\x3e\x3cbr\x3eNajskerje so to stawa, dokelž skript biblioteki ${layerLib} njebu korektnje zapřijaty.\x3cbr\x3e\x3cbr\x3eWuwiwarjo: Za pomoc ke korektnemu fungowanju worštow\n\x3ca href=\'http://trac.openlayers.org/wiki/${layerLib}\' target=\'_blank\'\x3etu kliknyć\x3c/a\x3e",'scale':"Měritko = 1 : ${scaleDenom}",'W':"Z",'E':"W",'N':"S",'S':"J",'layerAlreadyAdded':"Sy spytał runinu ${layerName} karće dodać, ale je so hižo dodała",'reprojectDeprecated':"Wužiwaš opciju \"reproject\" wořšty ${layerName}. Tuta opcija je zestarjena: jeje wužiwanje bě myslene, zo by zwobraznjenje datow nad komercielnymi bazowymi kartami podpěrało, ale funkcionalnosć měła so nětko z pomocu Sperical Mercator docpěć. Dalše informacije steja na http://trac.openlayers.org/wiki/SphericalMercator k dispoziciji.",'methodDeprecated':"Tuta metoda je so njeschwaliła a budźe so w 3.0 wotstronjeć. Prošu wužij ${newMethod} město toho.",'boundsAddError':"Dyrbiš hódnotu x kaž tež y funkciji \"add\" přepodać.",'lonlatAddError':"Dyrbiš hódnotu lon kaž tež lat funkciji \"add\" přepodać.",'pixelAddError':"Dyrbiš hódnotu x kaž tež y funkciji \"add\" přepodać.",'unsupportedGeometryType':"Njepodpěrowany geometrijowy typ: ${geomType}",'pagePositionFailed':"OpenLayers.Util.pagePosition je so njeporadźił: element z id ${elemId} bu snano wopak zaměstnjeny.",'filterEvaluateNotImplemented':"wuhódnoćenje njeje za tutón filtrowy typ implementowany."});OpenLayers.Lang["hu"]=OpenLayers.Util.applyDefaults({'unhandledRequest':"Nem kezelt kérés visszatérése ${statusText}",'permalink':"Permalink",'overlays':"Rávetítések",'baseLayer':"Alapréteg",'sameProjection':"Az áttekintő térkép csak abban az esetben működik, ha ugyanazon a vetületen van, mint a fő térkép.",'readNotImplemented':"Olvasás nincs végrehajtva.",'writeNotImplemented':"Írás nincs végrehajtva.",'noFID':"Nem frissíthető olyan jellemző, amely nem rendelkezik FID-del.",'errorLoadingGML':"Hiba GML-fájl betöltésekor ${url}",'browserNotSupported':"A böngészője nem támogatja a vektoros renderelést. A jelenleg támogatott renderelők:\n${renderers}",'componentShouldBe':"addFeatures : az összetevőnek ilyen típusúnak kell lennie: ${geomType}",'getFeatureError':"getFeatureFromEvent réteget hívott meg renderelő nélkül. Ez rendszerint azt jelenti, hogy megsemmisített egy fóliát, de néhány ahhoz társított kezelőt nem.",'minZoomLevelError':"A minZoomLevel tulajdonságot csak a következővel való használatra szánták: FixedZoomLevels-leszármazott fóliák. Ez azt jelenti, hogy a minZoomLevel wfs fólia jelölőnégyzetei már a múlté. Mi azonban nem távolíthatjuk el annak a veszélye nélkül, hogy az esetlegesen ettől függő OL alapú alkalmazásokat tönkretennénk. Ezért ezt érvénytelenítjük -- a minZoomLevel az alul levő jelölőnégyzet a 3.0-s verzióból el lesz távolítva. Kérjük, helyette használja a min/max felbontás beállítást, amelyről az alábbi helyen talál leírást: http://trac.openlayers.org/wiki/SettingZoomLevels",'commitSuccess':"WFS tranzakció: SIKERES ${response}",'commitFailed':"WFS tranzakció: SIKERTELEN ${response}",'googleWarning':"A Google fólia betöltése sikertelen.\x3cbr\x3e\x3cbr\x3eAhhoz, hogy ez az üzenet eltűnjön, válasszon egy új BaseLayer fóliát a jobb felső sarokban található fóliakapcsoló segítségével.\x3cbr\x3e\x3cbr\x3eNagy valószínűséggel ez azért van, mert a Google Maps könyvtár parancsfájlja nem található, vagy nem tartalmazza az Ön oldalához tartozó megfelelő API-kulcsot.\x3cbr\x3e\x3cbr\x3eFejlesztőknek: A helyes működtetésre vonatkozó segítség az alábbi helyen érhető el, \x3ca href=\'http://trac.openlayers.org/wiki/Google\' target=\'_blank\'\x3ekattintson ide\x3c/a\x3e",'getLayerWarning':"A(z) ${layerType} fólia nem töltődött be helyesen.\x3cbr\x3e\x3cbr\x3eAhhoz, hogy ez az üzenet eltűnjön, válasszon egy új BaseLayer fóliát a jobb felső sarokban található fóliakapcsoló segítségével.\x3cbr\x3e\x3cbr\x3eNagy valószínűséggel ez azért van, mert a(z) ${layerLib} könyvtár parancsfájlja helytelen.\x3cbr\x3e\x3cbr\x3eFejlesztőknek: A helyes működtetésre vonatkozó segítség az alábbi helyen érhető el, \x3ca href=\'http://trac.openlayers.org/wiki/${layerLib}\' target=\'_blank\'\x3ekattintson ide\x3c/a\x3e",'scale':"Lépték = 1 : ${scaleDenom}",'W':"Ny",'E':"K",'N':"É",'S':"D",'layerAlreadyAdded':"Megpróbálta hozzáadni a(z) ${layerName} fóliát a térképhez, de az már hozzá van adva",'reprojectDeprecated':"Ön a \'reproject\' beállítást használja a(z) ${layerName} fólián. Ez a beállítás érvénytelen: használata az üzleti alaptérképek fölötti adatok megjelenítésének támogatására szolgált, de ezt a funkció ezentúl a Gömbi Mercator használatával érhető el. További információ az alábbi helyen érhető el: http://trac.openlayers.org/wiki/SphericalMercator",'methodDeprecated':"Ez a módszer érvénytelenítve lett és a 3.0-s verzióból el lesz távolítva. Használja a(z) ${newMethod} módszert helyette.",'boundsAddError':"Az x és y értékeknek egyaránt meg kell felelnie, hogy a funkciót hozzáadhassa.",'lonlatAddError':"A hossz. és szél. értékeknek egyaránt meg kell felelnie, hogy a funkciót hozzáadhassa.",'pixelAddError':"Az x és y értékeknek egyaránt meg kell felelnie, hogy a funkciót hozzáadhassa.",'unsupportedGeometryType':"Nem támogatott geometriatípus: ${geomType}",'pagePositionFailed':"OpenLayers.Util.pagePosition sikertelen: lehetséges, hogy a(z) ${elemId} azonosítójú elem téves helyre került.",'filterEvaluateNotImplemented':"ennél a szűrőtípusnál kiértékelés nem hajtódik végre."});OpenLayers.Lang["ia"]=OpenLayers.Util.applyDefaults({'unhandledRequest':"Le responsa a un requesta non esseva maneate: ${statusText}",'permalink':"Permaligamine",'overlays':"Superpositiones",'baseLayer':"Strato de base",'sameProjection':"Le mini-carta functiona solmente si illo es in le mesme projection que le carta principal",'readNotImplemented':"Lectura non implementate.",'writeNotImplemented':"Scriptura non implementate.",'noFID':"Non pote actualisar un elemento sin FID.",'errorLoadingGML':"Error al cargamento del file GML ${url}",'browserNotSupported':"Tu navigator non supporta le rendition de vectores. Le renditores actualmente supportate es:\n${renderers}",'componentShouldBe':"addFeatures: le componente debe esser del typo ${geomType}",'getFeatureError':"getFeatureFromEvent ha essite appellate in un strato sin renditor. Isto significa generalmente que tu ha destruite un strato, ma lassava un gestor associate con illo.",'minZoomLevelError':"Le proprietate minZoomLevel es solmente pro uso con le stratos descendente de FixedZoomLevels. Le facto que iste strato WFS verifica minZoomLevel es un reliquia del passato. Nonobstante, si nos lo remove immediatemente, nos pote rumper applicationes a base de OL que depende de illo. Ergo nos lo declara obsolete; le verification de minZoomLevel in basso essera removite in version 3.0. Per favor usa in su loco le configuration de resolutiones min/max como describite a: http://trac.openlayers.org/wiki/SettingZoomLevels",'commitSuccess':"Transaction WFS: SUCCESSO ${response}",'commitFailed':"Transaction WFS: FALLEVA ${response}",'googleWarning':"Le strato Google non poteva esser cargate correctemente.\x3cbr\x3e\x3cbr\x3ePro disfacer te de iste message, selige un nove BaseLayer in le selector de strato in alto a dextra.\x3cbr\x3e\x3cbr\x3eMulto probabilemente, isto es proque le script del libreria de Google Maps non esseva includite o non contine le clave API correcte pro tu sito.\x3cbr\x3e\x3cbr\x3eDisveloppatores: Pro adjuta de corriger isto, \x3ca href=\'http://trac.openlayers.org/wiki/Google\' target=\'_blank\'\x3eclicca hic\x3c/a",'getLayerWarning':"Le strato ${layerType} non poteva esser cargate correctemente.\x3cbr\x3e\x3cbr\x3ePro disfacer te de iste message, selige un nove BaseLayer in le selector de strato in alto a dextra.\x3cbr\x3e\x3cbr\x3eMulto probabilemente, isto es proque le script del libreria de ${layerLib} non esseva correctemente includite.\x3cbr\x3e\x3cbr\x3eDisveloppatores: Pro adjuta de corriger isto, \x3ca href=\'http://trac.openlayers.org/wiki/${layerLib}\' target=\'_blank\'\x3eclicca hic\x3c/a\x3e",'scale':"Scala = 1 : ${scaleDenom}",'W':"W",'E':"E",'N':"N",'S':"S",'layerAlreadyAdded':"Tu tentava adder le strato: ${layerName} al carta, ma illo es ja presente",'reprojectDeprecated':"Tu usa le option \'reproject\' in le strato ${layerName} layer. Iste option es obsolescente: illo esseva pro poter monstrar datos super cartas de base commercial, ma iste functionalitate pote ora esser attingite con le uso de Spherical Mercator. Ulterior information es disponibile a http://trac.openlayers.org/wiki/SphericalMercator.",'methodDeprecated':"Iste methodo ha essite declarate obsolescente e essera removite in version 3.0. Per favor usa ${newMethod} in su loco.",'boundsAddError':"Tu debe passar le duo valores x e y al function add.",'lonlatAddError':"Tu debe passar le duo valores lon e lat al function add.",'pixelAddError':"Tu debe passar le duo valores x e y al function add.",'unsupportedGeometryType':"Typo de geometria non supportate: ${geomType}",'pagePositionFailed':"OpenLayers.Util.pagePosition falleva: le elemento con id ${elemId} pote esser mal placiate.",'filterEvaluateNotImplemented':"\"evaluate\" non es implementate pro iste typo de filtro."});OpenLayers.Lang["id"]=OpenLayers.Util.applyDefaults({'unhandledRequest':"Permintaan yang tak tertangani menghasilkan ${statusText}",'permalink':"Pranala permanen",'overlays':"Hamparan",'baseLayer':"Lapisan Dasar",'sameProjection':"Peta tinjauan hanya bekerja bila dalam proyeksi yang sama dengan peta utama",'readNotImplemented':"Membaca tidak diterapkan.",'writeNotImplemented':"Menyimpan tidak diterapkan.",'noFID':"Tidak dapat memperbarui fitur yang tidak memiliki FID.",'errorLoadingGML':"Kesalahan dalam memuat berkas GML ${url}",'browserNotSupported':"Peramban Anda tidak mendukung penggambaran vektor. Penggambar yang didukung saat ini adalah:\n${renderers}",'componentShouldBe':"addFeatures : komponen harus berupa ${geomType}",'getFeatureError':"getFeatureFromEvent diterapkan pada lapisan tanpa penggambar. Ini biasanya berarti Anda menghapus sebuah lapisan, tetapi tidak menghapus penangan yang terkait dengannya.",'minZoomLevelError':"Properti minZoomLevel hanya ditujukan bekerja dengan lapisan FixedZoomLevels-descendent. Pengecekan minZoomLevel oleh lapisan wfs adalah peninggalan masa lalu. Kami tidak dapat menghapusnya tanpa kemungkinan merusak aplikasi berbasis OL yang mungkin bergantung padanya. Karenanya, kami menganggapnya tidak berlaku -- Cek minZoomLevel di bawah ini akan dihapus pada 3.0. Silakan gunakan penyetelan resolusi min/maks seperti dijabarkan di sini: http://trac.openlayers.org/wiki/SettingZoomLevels",'commitSuccess':"WFS Transaksi: BERHASIL ${respon}",'commitFailed':"WFS Transaksi: GAGAL ${respon}",'googleWarning':"Lapisan Google tidak dapat dimuat dengan benar.\x3cbr\x3e\x3cbr\x3eUntuk menghilangkan pesan ini, pilih suatu BaseLayer baru melalui penukar lapisan (layer switcher) di ujung kanan atas.\x3cbr\x3e\x3cbr\x3eKemungkinan besar ini karena pustaka skrip Google Maps tidak disertakan atau tidak mengandung kunci API yang tepat untuk situs Anda.\x3cbr\x3e\x3cbr\x3ePengembang: Untuk bantuan mengatasi masalah ini, \x3ca href=\'http://trac.openlayers.org/wiki/Google\' target=\'_blank\'\x3eklik di sini\x3c/a\x3e",'getLayerWarning':"Lapisan ${layerType} tidak dapat dimuat dengan benar.\x3cbr\x3e\x3cbr\x3eUntuk menghilangkan pesan ini, pilih suatu BaseLayer baru melalui penukar lapisan (layer switcher) di ujung kanan atas.\x3cbr\x3e\x3cbr\x3eKemungkinan besar ini karena pustaka skrip Google Maps tidak disertakan dengan benar.\x3cbr\x3e\x3cbr\x3ePengembang: Untuk bantuan mengatasi masalah ini, \x3ca href=\'http://trac.openlayers.org/wiki/${layerLib}\' target=\'_blank\'\x3eklik di sini\x3c/a\x3e",'scale':"Sekala = 1 : ${scaleDenom}",'W':"B",'E':"T",'N':"U",'S':"S",'layerAlreadyAdded':"Anda mencoba menambahkan lapisan: ${layerName} ke dalam peta, tapi lapisan itu telah ditambahkan",'reprojectDeprecated':"Anda menggunakan opsi \'reproject\' pada lapisan ${layerName}. Opsi ini telah ditinggalkan: penggunaannya dirancang untuk mendukung tampilan data melalui peta dasar komersial, tapi fungsionalitas tersebut saat ini harus dilakukan dengan menggunakan dukungan Spherical Mercator. Informasi lebih lanjut tersedia di http://trac.openlayers.org/wiki/SphericalMercator.",'methodDeprecated':"Metode ini telah usang dan akan dihapus di 3.0. Sebaliknya, harap gunakan ${newMethod}.",'boundsAddError':"Anda harus memberikan kedua nilai x dan y ke fungsi penambah.",'lonlatAddError':"Anda harus memberikan kedua nilai lon dan lat ke fungsi penambah.",'pixelAddError':"Anda harus memberikan kedua nilai x dan y ke fungsi penambah.",'unsupportedGeometryType':"Tipe geometri tak didukung: ${geomType}",'pagePositionFailed':"OpenLayers.Util.pagePosition gagal: elemen dengan id ${elemId} mungkin salah tempat.",'filterEvaluateNotImplemented':"evaluasi tidak tersedia untuk tipe filter ini."});OpenLayers.Lang["io"]=OpenLayers.Util.applyDefaults({'scale':"Skalo = 1 : ${scaleDenom}"});OpenLayers.Lang["is"]=OpenLayers.Util.applyDefaults({'permalink':"Varanlegur tengill",'overlays':"Þekjur",'baseLayer':"Grunnlag",'sameProjection':"Yfirlitskortið virkar aðeins ef það er í sömu vörpun og aðalkortið",'readNotImplemented':"Skrifun er óútfærð.",'writeNotImplemented':"Lestur er óútfærður.",'errorLoadingGML':"Villa kom upp við að hlaða inn GML skránni ${url}",'scale':"Skali = 1 : ${scaleDenom}",'layerAlreadyAdded':"Þú reyndir að bæta laginu ${layerName} á kortið en það er þegar búið að bæta því við",'methodDeprecated':"Þetta fall hefur verið úrelt og verður fjarlægt í 3.0. Notaðu ${newMethod} í staðin."});OpenLayers.Lang["ja"]=OpenLayers.Util.applyDefaults({'unhandledRequest':"未処理の要求は ${statusText} を返します",'permalink':"パーマリンク",'overlays':"オーバーレイ",'baseLayer':"基底レイヤー",'sameProjection':"概観地図はメインの地図と同じ投影法をとる場合のみ機能します",'readNotImplemented':"読み込みは実装されていません。",'writeNotImplemented':"書き込みは実装されていません。",'noFID':"FID のない地物は更新できません。",'errorLoadingGML':"GML ファイル ${url} の読み込みエラー",'browserNotSupported':"あなたのブラウザはベクターグラフィックスの描写に対応していません。現時点で対応しているソフトウェアは以下のものです。\n${renderers}",'componentShouldBe':"addFeatures: 要素は ${geomType} であるべきです",'getFeatureError':"getFeatureFromEvent がレンダラーのないレイヤーから呼ばれました。通常、これはあなたがレイヤーを、それに関連づけられたいくつかのハンドラを除いて、破壊してしまったことを意味します。",'minZoomLevelError':"minZoomLevel プロパティは FixedZoomLevels を継承するレイヤーでの使用のみを想定しています。この minZoomLevel に対する WFS レイヤーの検査は歴史的なものです。しかしながら、この検査を除去するとそれに依存する OpenLayers ベースのアプリケーションを破壊してしまう可能性があります。よって廃止が予定されており、この minZoomLevel 検査はバージョン3.0で除去されます。代わりに、http://trac.openlayers.org/wiki/SettingZoomLevels で解説されている、最小および最大解像度設定を使用してください。",'commitSuccess':"WFS トランザクション: 成功 ${response}",'commitFailed':"WFS トランザクション: 失敗 ${response}",'googleWarning':"Google レイヤーが正しく読み込みを行えませんでした。\x3cbr\x3e\x3cbr\x3eこのメッセージを消すには、右上の隅にあるレイヤー切り替え部分で新しい基底レイヤーを選んでください。\x3cbr\x3e\x3cbr\x3eおそらく、これは Google マップ用ライブラリのスクリプトが組み込まれていないか、あなたのサイトに対応する正しい API キーが設定されていないためです。\x3cbr\x3e\x3cbr\x3e開発者の方へ: 正しい動作をさせるために\x3ca href=\'http://trac.openlayers.org/wiki/Google\' target=\'_blank\'\x3eこちらのウィキ\x3c/a\x3eを参照してください。",'getLayerWarning':"${layerType} レイヤーが正しく読み込みを行えませんでした。\x3cbr\x3e\x3cbr\x3eこのメッセージを消すには、右上の隅にあるレイヤー切り替え部分で新しい基底レイヤーを選んでください。\x3cbr\x3e\x3cbr\x3eおそらく、これは ${layerLib} ライブラリのスクリプトが正しく組み込まれていないためです。\x3cbr\x3e\x3cbr\x3e開発者の方へ: 正しい動作をさせるために\x3ca href=\'http://trac.openlayers.org/wiki/${layerLib}\' target=\'_blank\'\x3eこちらのウィキ\x3c/a\x3eを参照してください。",'scale':"縮尺 = 1 : ${scaleDenom}",'W':"西",'E':"東",'N':"北",'S':"南",'layerAlreadyAdded':"あなたは「${layerName}」を地図に追加しようと試みましたが、そのレイヤーは既に追加されています",'reprojectDeprecated':"あなたは「${layerName}」レイヤーで reproject オプションを使っています。このオプションは商用の基底地図上に情報を表示する目的で設計されましたが、現在ではその機能は Spherical Mercator サポートを利用して実現されており、このオプションの使用は非推奨です。追加の情報は http://trac.openlayers.org/wiki/SphericalMercator で入手できます。",'methodDeprecated':"このメソッドは廃止が予定されており、バージョン3.0で除去されます。代わりに ${newMethod} を使用してください。",'boundsAddError':"x と y 両方の値を add 関数に渡さなければなりません。",'lonlatAddError':"lon と lat 両方の値を add 関数に渡さなければなりません。",'pixelAddError':"x と y の値両方を add 関数に渡さなければなりません。",'unsupportedGeometryType':"未対応の形状型: ${geomType}",'pagePositionFailed':"OpenLayers.Util.pagePosition が失敗しました: id ${elemId} をもつ要素が誤った位置にある可能性があります。",'filterEvaluateNotImplemented':"このフィルター型について evaluate は実装されていません。"});OpenLayers.Lang["km"]=OpenLayers.Util.applyDefaults({'permalink':"តំណភ្ជាប់អចិន្ត្រៃយ៍",'baseLayer':"ស្រទាប់បាត",'errorLoadingGML':"កំហុសកំឡុងពេលផ្ទុកឯកសារ GML ${url}",'scale':"មាត្រដ្ឋាន = ១ ៖ ${scaleDenom}"});OpenLayers.Lang["ksh"]=OpenLayers.Util.applyDefaults({'unhandledRequest':"Met dä Antwoot op en Aanfrooch ham_mer nix aanjefange: ${statusText}",'permalink':"Lengk op Duuer",'overlays':"Drövver jelaat",'baseLayer':"Jrund-Nivoh",'sameProjection':"De Övverseeschs_Kaat deiht et bloß, wann se de sälve Projäxjuhn bruche deiht, wi de Houp_Kaat",'readNotImplemented':"„\x3ccode lang=\"en\"\x3eread\x3c/code\x3e“ is em Projramm nit fürjesinn.",'writeNotImplemented':"„\x3ccode lang=\"en\"\x3ewrite\x3c/code\x3e“ is em Projramm nit fürjesinn.",'noFID':"En Saach, woh kein \x3ci lang=\"en\"\x3eFID\x3c/i\x3e för doh es, löht sesch nit ändere.",'errorLoadingGML':"Fähler beim \x3ci lang=\"en\"\x3eGML\x3c/i\x3e-Datei-Laade vun \x3ccode\x3e${url}\x3c/code\x3e",'browserNotSupported':"Dinge Brauser kann kein Väktore ußjävve. De Zoote Ußjaabe, di em Momang jon, sen:\n${renderers}",'componentShouldBe':"\x3ccode lang=\"en\"\x3eaddFeatures\x3c/code\x3e: dä Aandeil sullt vun dä Zoot „\x3ccode lang=\"en\"\x3e${geomType}\x3c/code\x3e“ sin.",'getFeatureError':"\x3ccode lang=\"en\"\x3egetFeatureFromEvent\x3c/code\x3e es vun enem Nivoh opjeroofe woode, woh et kei Projramm zom Ußjävve jit. Dat bedügg för jewöhnlesch, dat De e Nivoh kapott jemaat häs, ävver nit e Projramm för domet ömzejonn, wat domet verbonge es.",'minZoomLevelError':"De Eijeschaff „\x3ccode lang=\"en\"\x3eminZoomLevel\x3c/code\x3e“ es bloß doför jedaach, dat mer se met dä Nivvohß bruch, di vun \x3ccode lang=\"en\"\x3eFixedZoomLevels\x3c/code\x3e affhange don. Dat dat \x3ci lang=\"en\"\x3eWFS\x3c/i\x3e-Nivvoh övverhoup de Eijeschaff „\x3ccode lang=\"en\"\x3eminZoomLevel\x3c/code\x3e“ pröhfe deiht, es noch övveresch vun fröhjer. Mer künne dat ävver jez nit fott lohße, oohne dat mer Jevaa loufe, dat Aanwendunge vun OpenLayers nit mieh loufe, di sesch doh velleijsch noch drop am verlohße sin. Dröm sare mer, dat mer et nit mieh han welle, un de „\x3ccode lang=\"en\"\x3eminZoomLevel\x3c/code\x3e“-Eijeschaff weed hee vun de Version 3.0 af nit mieh jeprööf wäde. Nemm doför de Enstellung för de hühßte un de kleinßte Oplöhsung, esu wi et en http://trac.openlayers.org/wiki/SettingZoomLevels opjeschrevve es.",'commitSuccess':"Dä \x3ci lang=\"en\"\x3eWFS\x3c/i\x3e-Vörjang es joot jeloufe: ${response}",'commitFailed':"Dä \x3ci lang=\"en\"\x3eWFS\x3c/i\x3e-Vörjang es scheif jejange: ${response}",'googleWarning':"Dat Nivvoh \x3ccode lang=\"en\"\x3eGoogle\x3c/code\x3e kunnt nit reschtesch jelaade wääde.\x3cbr /\x3e\x3cbr /\x3eÖm hee di Nohreesch loß ze krijje, donn en ander Jrund-Nivvoh ußsöhke, rähß bovve en de Äk.\x3cbr /\x3e\x3cbr /\x3eWascheinlesch es dat wiel dat \x3ci lang=\"en\"\x3eGoogle-Maps\x3c/i\x3e-Skrepp entweeder nit reschtesch enjebonge wood, udder nit dä reschtejje \x3ci lang=\"en\"\x3eAPI\x3c/i\x3e-Schlößel för Ding Web-ßait scheke deiht.\x3cbr /\x3e\x3cbr /\x3eFör Projrammierer jidd_et Hölp do_drövver, \x3ca href=\"http://trac.openlayers.org/wiki/Google\" target=\"_blank\"\x3ewi mer dat aan et Loufe brengk\x3c/a\x3e.",'getLayerWarning':"Dat Nivvoh \x3ccode\x3e${layerType}\x3c/code\x3e kunnt nit reschtesch jelaade wääde.\x3cbr /\x3e\x3cbr /\x3eÖm hee di Nohreesch loß ze krijje, donn en ander Jrund-Nivvoh ußsöhkre, rähß bovve en de Äk.\x3cbr /\x3e\x3cbr /\x3eWascheinlesch es dat, wiel dat Skrepp \x3ccode\x3e${layerLib}\x3c/code\x3e nit reschtesch enjebonge wood.\x3cbr /\x3e\x3cbr /\x3eFör Projrammierer jidd_Et Hölp do_drövver, \x3ca href=\"http://trac.openlayers.org/wiki/${layerLib}\" target=\"_blank\"\x3ewi mer dat aan et Loufe brengk\x3c/a\x3e.",'scale':"Mohßshtaab = 1 : ${scaleDenom}",'W':"W",'E':"O",'N':"N",'S':"S",'layerAlreadyAdded':"Do häß versöhk, dat Nivvoh \x3ccode\x3e${layerName}\x3c/code\x3e en di Kaat eren ze bränge, et wohr ävver ald do dren.",'reprojectDeprecated':"Do bruchs de Ußwahl \x3ccode\x3ereproject\x3c/code\x3e op däm Nivvoh \x3ccode\x3e${layerName}\x3c/code\x3e. Di Ußwahl es nit mieh jähn jesinn. Se wohr doför jedaach, öm Date op jeschääfsmäßesch eruß jejovve Kaate bovve drop ze moole, wat ävver enzwesche besser met dä Öngershtözung för de ßfääresche Mäkaator Beldscher jeiht. Doh kanns De mieh drövver fenge op dä Sigg: http://trac.openlayers.org/wiki/SphericalMercator.",'methodDeprecated':"Hee di Metood es nim_mih aktoäll un et weed se en dä Version 3.0 nit mieh jävve. Nemm \x3ccode\x3e${newMethod}\x3c/code\x3e doföör.",'boundsAddError':"Do moß beeds vun de \x3ccode\x3ex\x3c/code\x3e un \x3ccode\x3ey\x3c/code\x3e Wääte aan de Fungkßjohn \x3ccode\x3eadd\x3c/code\x3e jävve.",'lonlatAddError':"Do moß beeds \x3ccode\x3elon\x3c/code\x3e un \x3ccode\x3elat\x3c/code\x3e aan de Fungkßjohn \x3ccode\x3eadd\x3c/code\x3e jävve.",'pixelAddError':"Do moß beeds \x3ccode\x3ex\x3c/code\x3e un \x3ccode\x3ey\x3c/code\x3e aan de Fungkßjohn \x3ccode\x3eadd\x3c/code\x3e jävve.",'unsupportedGeometryType':"De Zoot Jommetrii dom_mer nit ongershtöze: \x3ccode\x3e${geomType}\x3c/code\x3e",'pagePositionFailed':"\x3ccode lang=\"en\"\x3eOpenLayers.Util.pagePosition\x3c/code\x3e es donevve jejange: dat Denge met dä Kännong \x3ccode\x3e${elemId}\x3c/code\x3e künnt am verkeehte Plaz sin.",'filterEvaluateNotImplemented':"„\x3ccode lang=\"en\"\x3eevaluate\x3c/code\x3e“ es för di Zoot Fellter nit enjereschdt."});OpenLayers.Lang["nds"]=OpenLayers.Util.applyDefaults({'unhandledRequest':"Unbehannelt Trüchmellels för de Anfraag ${statusText}",'permalink':"Permalink",'overlays':"Overlays",'baseLayer':"Achtergrundkoort",'sameProjection':"De Översichtskoort geiht blot, wenn de sülve Projekschoon as bi de Hööftkoort bruukt warrt",'readNotImplemented':"Lesen is nich inricht.",'writeNotImplemented':"Schrieven is nich inricht.",'noFID':"En Feature, dat keen FID hett, kann nich aktuell maakt warrn.",'errorLoadingGML':"Fehler bi’t Laden vun de GML-Datei ${url}",'browserNotSupported':"Dien Browser ünnerstütt keen Vektorbiller. Ünnerstütt Renderers:\n${renderers}",'componentShouldBe':"addFeatures : Kumponent schull man den Typ ${geomType} hebben",'getFeatureError':"getFeatureFromEvent is von en Laag ahn Render opropen worrn. Dat bedüüdt normalerwies, dat en Laag wegmaakt worrn is, aver nich de Handler, de dor op verwiest.",'commitSuccess':"WFS-Transakschoon: hett klappt ${response}",'commitFailed':"WFS-Transakschoon: hett nich klappt ${response}",'scale':"Skaal = 1 : ${scaleDenom}",'layerAlreadyAdded':"Du versöchst de Laag „${layerName}“ to de Koort totofögen, man de is al toföögt",'methodDeprecated':"Disse Methood is oold un schall dat in 3.0 nich mehr geven. Bruuk dor man beter ${newMethod} för.",'boundsAddError':"De Weert x un y, de mööt all beid an de add-Funkschoon övergeven warrn.",'lonlatAddError':"De Weert lon un lat, de mööt all beid an de add-Funkschoon övergeven warrn.",'pixelAddError':"De Weert x un y, de mööt all beid an de add-Funkschoon övergeven warrn.",'unsupportedGeometryType':"Nich ünnerstütt Geometrie-Typ: ${geomType}",'pagePositionFailed':"OpenLayers.Util.pagePosition güng nich: Element mit de Id ${elemId} is villicht an’n verkehrten Platz."});OpenLayers.Lang["nn"]=OpenLayers.Util.applyDefaults({'scale':"Skala = 1 : ${scaleDenom}",'layerAlreadyAdded':"Du freista å leggja til laget «${layerName}» på kartet, men det har alt vorte lagt til.",'boundsAddError':"Du er nøydd til å gje både ein x- og ein y-verdi til «add»-funksjonen.",'lonlatAddError':"Du er nøydd til å gje både lon- og lat-verdiar til «add»-funksjonen.",'pixelAddError':"Du er nøydd til å gje både ein x- og ein y-verdi til «add»-funksjonen."});OpenLayers.Lang["oc"]=OpenLayers.Util.applyDefaults({'unhandledRequest':"Requèsta pas gerida, retorna ${statusText}",'permalink':"Permaligam",'overlays':"Calques",'baseLayer':"Calc de basa",'sameProjection':"La carta de situacion fonciona pas que quora sa projeccion es la meteissa que la de la carta principala",'readNotImplemented':"Lectura pas implementada.",'writeNotImplemented':"Escritura pas implementada.",'noFID':"Impossible de metre a jorn un objècte sens identificant (fid).",'errorLoadingGML':"Error al cargament del fichièr GML ${url}",'browserNotSupported':"Vòstre navegidor supòrta pas lo rendut vectorial. Los renderers actualament suportats son : \n${renderers}",'componentShouldBe':"addFeatures : lo compausant deuriá èsser de tipe ${geomType}",'getFeatureError':"getFeatureFromEvent es estat apelat sus un calc sens renderer. Aquò significa generalament qu\'avètz destruch aqueste jaç, mas qu\'avètz conservat un handler que li èra associat.",'minZoomLevelError':"La proprietat minZoomLevel deu èsser utilizada solament per de jaces FixedZoomLevels-descendent. Lo fach qu\'aqueste jaç WFS verifique la preséncia de minZoomLevel es una relica del passat. Çaquelà, la podèm suprimir sens copar d\'aplicacions que ne poirián dependre. Es per aquò que la depreciam -- la verificacion del minZoomLevel serà suprimida en version 3.0. A la plaça, mercés d\'utilizar los paramètres de resolucions min/max tal coma descrich sus : http://trac.openlayers.org/wiki/SettingZoomLevels",'commitSuccess':"Transaccion WFS : SUCCES ${response}",'commitFailed':"Transaccion WFS : FRACAS ${response}",'googleWarning':"Lo jaç Google es pas estat en mesura de se cargar corrèctament.\x3cbr\x3e\x3cbr\x3ePer suprimir aqueste messatge, causissètz una BaseLayer novèla dins lo selector de jaç en naut a drecha.\x3cbr\x3e\x3cbr\x3eAquò es possiblament causat par la non-inclusion de la librariá Google Maps, o alara perque que la clau de l\'API correspond pas a vòstre site.\x3cbr\x3e\x3cbr\x3eDesvolopaires : per saber cossí corregir aquò, \x3ca href=\'http://trac.openlayers.org/wiki/Google\' target=\'_blank\'\x3eclicatz aicí\x3c/a\x3e",'getLayerWarning':"Lo jaç ${layerType} es pas en mesura de se cargar corrèctament.\x3cbr\x3e\x3cbr\x3ePer suprimir aqueste messatge, causissètz una BaseLayer novèla dins lo selector de jaç en naut a drecha.\x3cbr\x3e\x3cbr\x3eAquò es possiblament causat per la non-inclusion de la librariá ${layerLib}.\x3cbr\x3e\x3cbr\x3eDesvolopaires : per saber cossí corregir aquí, \x3ca href=\'http://trac.openlayers.org/wiki/${layerLib}\' target=\'_blank\'\x3eclicatz aicí\x3c/a\x3e",'scale':"Escala ~ 1 : ${scaleDenom}",'W':"O",'E':"È",'N':"N",'S':"S",'layerAlreadyAdded':"Avètz ensajat d\'apondre a la carta lo calc : ${layerName}, mas ja es present",'reprojectDeprecated':"Utilizatz l\'opcion \'reproject\' sul jaç ${layerName}. Aquesta opcion es despreciada : Son usatge permetiá d\'afichar de donadas al dessús de jaces raster comercials. Aquesta foncionalitat ara es suportada en utilizant lo supòrt de la projeccion Mercator Esferica. Mai d\'informacion es disponibla sus http://trac.openlayers.org/wiki/SphericalMercator.",'methodDeprecated':"Aqueste metòde es despreciada, e serà suprimida a la version 3.0. Mercés d\'utilizar ${newMethod} a la plaça.",'boundsAddError':"Vos cal passar las doas valors x e y a la foncion add.",'lonlatAddError':"Vos cal passar las doas valors lon e lat a la foncion add.",'pixelAddError':"Vos cal passar las doas valors x e y a la foncion add.",'unsupportedGeometryType':"Tipe de geometria pas suportat : ${geomType}",'pagePositionFailed':"OpenLayers.Util.pagePosition a fracassat : l\'element d\'id ${elemId} poiriá èsser mal posicionat.",'filterEvaluateNotImplemented':"evaluar es pas encara estat implementat per aqueste tipe de filtre."});OpenLayers.Lang["pt"]=OpenLayers.Util.applyDefaults({'unhandledRequest':"Servidor devolveu erro não contemplado ${statusText}",'permalink':"Ligação permanente",'overlays':"Sobreposições",'baseLayer':"Camada Base",'sameProjection':"O mapa panorâmico só funciona quando está na mesma projeção que o mapa principal",'readNotImplemented':"Leitura não implementada.",'writeNotImplemented':"Escrita não implementada.",'noFID':"Não é possível atualizar um elemento para a qual não há FID.",'errorLoadingGML':"Erro ao carregar ficheiro GML ${url}",'browserNotSupported':"O seu navegador não suporta renderização vetorial. Actualmente os renderizadores suportados são:\n${renderers}",'componentShouldBe':"addFeatures: componente deve ser um(a) ${geomType}",'getFeatureError':"getFeatureFromEvent foi chamado numa camada sem renderizador. Isto normalmente significa que destruiu uma camada, mas não um manipulador \'\'(handler)\'\' que lhe está associado.",'minZoomLevelError':"A propriedade minZoomLevel só deve ser usada com as camadas descendentes da FixedZoomLevels. A verificação da propriedade por esta camada wfs é uma relíquia do passado. No entanto, não podemos removê-la sem correr o risco de afectar aplicações OL que dependam dela. Portanto, estamos a torná-la obsoleta -- a verificação minZoomLevel será removida na versão 3.0. Em vez dela, por favor, use as opções de resolução min/max descritas aqui: http://trac.openlayers.org/wiki/SettingZoomLevels",'commitSuccess':"Transacção WFS: SUCESSO ${response}",'commitFailed':"Transacção WFS: FALHOU ${response}",'googleWarning':"A Camada Google não foi correctamente carregada.\x3cbr\x3e\x3cbr\x3ePara deixar de receber esta mensagem, seleccione uma nova Camada-Base no \'\'switcher\'\' de camadas no canto superior direito.\x3cbr\x3e\x3cbr\x3eProvavelmente, isto acontece porque o \'\'script\'\' da biblioteca do Google Maps não foi incluído ou não contém a chave API correcta para o seu sítio.\x3cbr\x3e\x3cbr\x3eProgramadores: Para ajuda sobre como solucionar o problema \x3ca href=\'http://trac.openlayers.org/wiki/Google\' target=\'_blank\'\x3eclique aqui\x3c/a\x3e .",'getLayerWarning':"A camada ${layerType} não foi correctamente carregada.\x3cbr\x3e\x3cbr\x3ePara desactivar esta mensagem, seleccione uma nova Camada-Base no \'\'switcher\'\' de camadas no canto superior direito.\x3cbr\x3e\x3cbr\x3eProvavelmente, isto acontece porque o \'\'script\'\' da biblioteca ${layerLib} não foi incluído correctamente.\x3cbr\x3e\x3cbr\x3eProgramadores: Para ajuda sobre como solucionar o problema \x3ca href=\'http://trac.openlayers.org/wiki/${layerLib}\' target=\'_blank\'\x3eclique aqui\x3c/a\x3e .",'scale':"Escala = 1 : ${scaleDenom}",'W':"O",'E':"E",'N':"N",'S':"S",'layerAlreadyAdded':"Você tentou adicionar a camada: ${layerName} ao mapa, mas ela já tinha sido adicionada antes",'reprojectDeprecated':"Está usando a opção \'reproject\' na camada ${layerName}. Esta opção é obsoleta: foi concebida para permitir a apresentação de dados sobre mapas-base comerciais, mas esta funcionalidade é agora suportada pelo Mercator Esférico. Mais informação está disponível em http://trac.openlayers.org/wiki/SphericalMercator.",'methodDeprecated':"Este método foi declarado obsoleto e será removido na versão 3.0. Por favor, use ${newMethod} em vez disso.",'boundsAddError':"Você deve passar tanto o valor x como o y à função de adição.",'lonlatAddError':"Você deve passar tanto o valor lon como o lat à função de adição.",'pixelAddError':"Você deve passar tanto o valor x como o y à função de adição.",'unsupportedGeometryType':"Tipo de geometria não suportado: ${geomType}",'pagePositionFailed':"OpenLayers.Util.pagePosition falhou: o elemento com o id ${elemId} poderá estar mal-posicionado.",'filterEvaluateNotImplemented':"avaliar não está implementado para este tipo de filtro."});OpenLayers.Lang["ru"]=OpenLayers.Util.applyDefaults({'unhandledRequest':"Необработанный запрос вернул ${statusText}",'permalink':"Постоянная ссылка",'overlays':"Слои",'baseLayer':"Основной слой",'sameProjection':"Обзорная карта работает только тогда, когда имеет ту же проекцию, что и основная",'readNotImplemented':"Чтение не реализовано.",'writeNotImplemented':"Запись не реализована.",'noFID':"Невозможно обновить объект, для которого нет FID.",'errorLoadingGML':"Ошибка при загрузке файла GML ${url}",'browserNotSupported':"Ваш браузер не поддерживает векторную графику. На данный момент поддерживаются:\n${renderers}",'componentShouldBe':"addFeatures: компонент должен быть ${geomType}",'getFeatureError':"getFeatureFromEvent вызван для слоя без рендерера. Обычно это говорит о том, что вы уничтожили слой, но оставили связанный с ним обработчик.",'minZoomLevelError':"Свойство minZoomLevel предназначено только для использования со слоями, являющимися потомками FixedZoomLevels. То, что этот WFS-слой проверяется на minZoomLevel — реликт прошлого. Однако мы не можем удалить эту функцию, так как, возможно, от неё зависят некоторые основанные на OpenLayers приложения. Функция объявлена устаревшей — проверка minZoomLevel будет удалена в 3.0. Пожалуйста, используйте вместо неё настройку мин/макс разрешения, описанную здесь: http://trac.openlayers.org/wiki/SettingZoomLevels",'commitSuccess':"Транзакция WFS: УСПЕШНО ${response}",'commitFailed':"Транзакция WFS: ОШИБКА ${response}",'googleWarning':"Слой Google не удалось нормально загрузить.\x3cbr\x3e\x3cbr\x3eЧтобы избавиться от этого сообщения, выбите другой основной слой в переключателе в правом верхнем углу.\x3cbr\x3e\x3cbr\x3eСкорее всего, причина в том, что библиотека Google Maps не была включена или не содержит корректного API-ключа для вашего сайта.\x3cbr\x3e\x3cbr\x3eРазработчикам: чтобы узнать, как сделать, чтобы всё заработало, \x3ca href=\'http://trac.openlayers.org/wiki/Google\' target=\'_blank\'\x3eщёлкните тут\x3c/a\x3e",'getLayerWarning':"Слой ${layerType} не удалось нормально загрузить. \x3cbr\x3e\x3cbr\x3eЧтобы избавиться от этого сообщения, выбите другой основной слой в переключателе в правом верхнем углу.\x3cbr\x3e\x3cbr\x3eСкорее всего, причина в том, что библиотека ${layerLib} не была включена или была включена некорректно.\x3cbr\x3e\x3cbr\x3eРазработчикам: чтобы узнать, как сделать, чтобы всё заработало, \x3ca href=\'http://trac.openlayers.org/wiki/${layerLib}\' target=\'_blank\'\x3eщёлкните тут\x3c/a\x3e",'scale':"Масштаб = 1 : ${scaleDenom}",'W':"З",'E':"В",'N':"С",'S':"Ю",'layerAlreadyAdded':"Вы попытались добавить слой «${layerName}» на карту, но он уже был добавлен",'reprojectDeprecated':"Вы используете опцию \'reproject\' для слоя ${layerName}. Эта опция является устаревшей: ее использование предполагалось для поддержки показа данных поверх коммерческих базовых карт, но теперь этот функционал несёт встроенная поддержка сферической проекции Меркатора. Больше сведений доступно на http://trac.openlayers.org/wiki/SphericalMercator.",'methodDeprecated':"Этот метод считается устаревшим и будет удалён в версии 3.0. Пожалуйста, пользуйтесь ${newMethod}.",'boundsAddError':"Функции add надо передавать оба значения, x и y.",'lonlatAddError':"Функции add надо передавать оба значения, lon и lat.",'pixelAddError':"Функции add надо передавать оба значения, x и y.",'unsupportedGeometryType':"Неподдерживаемый тип геометрии: ${geomType}",'pagePositionFailed':"OpenLayers.Util.pagePosition failed: элемент с id ${elemId} может находиться не в нужном месте.",'filterEvaluateNotImplemented':"evaluate не реализовано для фильтра данного типа."});OpenLayers.Lang["sk"]=OpenLayers.Util.applyDefaults({'unhandledRequest':"Neobslúžené požiadavky vracajú ${statusText}",'permalink':"Trvalý odkaz",'overlays':"Prekrytia",'baseLayer':"Základná vrstva",'sameProjection':"Prehľadová mapka funguje iba vtedy, keď je v rovnakej projekcii ako hlavná mapa",'readNotImplemented':"Čítanie nie je implementované.",'writeNotImplemented':"Zápis nie je implementovaný.",'noFID':"Nie je možné aktualizovať vlastnosť, pre ktorú neexistuje FID.",'errorLoadingGML':"Chyba pri načítaní súboru GML ${url}",'browserNotSupported':"Váš prehliadač nepodporuje vykresľovanie vektorov. Momentálne podporované vykresľovače sú:\n${renderers}",'componentShouldBe':"addFeatures: komponent by mal byť ${geomType}",'getFeatureError':"getFeatureFromEvent bola zavolaná na vrstve bez vykresľovača. To zvyčajne znamená, že ste odstránili vrstvu, ale nie niektorú z obslúh, ktorá je s ňou asociovaná.",'minZoomLevelError':"Vlastnosť minZoomLevel je určený iba na použitie s vrstvami odvodenými od FixedZoomLevels. To, že táto wfs vrstva kontroluje minZoomLevel je pozostatok z minulosti. Nemôžeme ho však odstrániť, aby sme sa vyhli možnému porušeniu aplikácií založených na Open Layers, ktoré na tomto môže závisieť. Preto ho označujeme ako zavrhovaný - dolu uvedená kontrola minZoomLevel bude odstránená vo verzii 3.0. Použite prosím namiesto toho kontrolu min./max. rozlíšenia podľa tu uvedeného popisu: http://trac.openlayers.org/wiki/SettingZoomLevels",'commitSuccess':"Transakcia WFS: ÚSPEŠNÁ ${response}",'commitFailed':"Transakcia WFS: ZLYHALA ${response}",'googleWarning':"Vrstvu Google nebolo možné správne načítať.\x3cbr\x3e\x3cbr\x3eAby ste sa tejto správy zbavili vyberte novú BaseLayer v prepínači vrstiev v pravom hornom rohu.\x3cbr\x3e\x3cbr\x3eToto sa stalo pravdepodobne preto, že skript knižnice Google Maps buď nebol načítaný alebo neobsahuje správny kľúč API pre vašu lokalitu.\x3cbr\x3e\x3cbr\x3eVývojári: Tu môžete získať \x3ca href=\'http://trac.openlayers.org/wiki/Google\' target=\'_blank\'\x3epomoc so sfunkčnením\x3c/a\x3e",'getLayerWarning':"Vrstvu ${layerType} nebolo možné správne načítať.\x3cbr\x3e\x3cbr\x3eAby ste sa tejto správy zbavili vyberte novú BaseLayer v prepínači vrstiev v pravom hornom rohu.\x3cbr\x3e\x3cbr\x3eToto sa stalo pravdepodobne preto, že skript knižnice ${layerType} buď nebol načítaný alebo neobsahuje správny kľúč API pre vašu lokalitu.\x3cbr\x3e\x3cbr\x3eVývojári: Tu môžete získať \x3ca href=\'http://trac.openlayers.org/wiki/${layerType}\' target=\'_blank\'\x3epomoc so sfunkčnením\x3c/a\x3e",'scale':"Mierka = 1 : ${scaleDenom}",'layerAlreadyAdded':"Pokúsili ste sa do mapy pridať vrstvu ${layerName}, ale tá už bola pridaná",'reprojectDeprecated':"Používate voľby „reproject“ vrstvy ${layerType}. Táto voľba je zzavrhovaná: jej použitie bolo navrhnuté na podporu zobrazovania údajov nad komerčnými základovými mapami, ale túto funkcionalitu je teraz možné dosiahnuť pomocou Spherical Mercator. Ďalšie informácie získate na stránke http://trac.openlayers.org/wiki/SphericalMercator.",'methodDeprecated':"Táto metóda je zavrhovaná a bude odstránená vo verzii 3.0. Použite prosím namiesto nej metódu ${newMethod}.",'boundsAddError':"Sčítacej funkcii musíte dať hodnoty x aj y.",'lonlatAddError':"Sčítacej funkcii musíte dať hodnoty lon (zem. dĺžka) aj lat (zem. šírka).",'pixelAddError':"Sčítacej funkcii musíte dať hodnoty x aj y.",'unsupportedGeometryType':"Nepodporovaný typ geometrie: ${geomType}",'pagePositionFailed':"OpenLayers.Util.pagePosition zlyhalo: prvok s id ${elemId} môže byť zle umiestnený.",'filterEvaluateNotImplemented':"evaluate nie je implementovaný pre tento typ filtra"});OpenLayers.Lang["te"]=OpenLayers.Util.applyDefaults({'permalink':"స్థిరలింకు",'W':"ప",'E':"తూ",'N':"ఉ",'S':"ద"});OpenLayers.Lang["vi"]=OpenLayers.Util.applyDefaults({'unhandledRequest':"Không xử lý được phản hồi ${statusText} cho yêu cầu",'permalink':"Liên kết thường trực",'overlays':"Lấp bản đồ",'baseLayer':"Lớp nền",'sameProjection':"Bản đồ toàn cảnh chỉ hoạt động khi cùng phép chiếu với bản đồ chính",'readNotImplemented':"Chưa hỗ trợ chức năng đọc.",'writeNotImplemented':"Chưa hỗ trợ chức năng viết.",'noFID':"Không thể cập nhật tính năng thiếu FID.",'errorLoadingGML':"Lỗi tải tập tin GML tại ${url}",'browserNotSupported':"Trình duyệt của bạn không hỗ trợ chức năng vẽ bằng vectơ. Hiện hỗ trợ các bộ kết xuất:\n${renderers}",'componentShouldBe':"addFeatures: bộ phận cần phải là ${geomType}",'getFeatureError':"getFeatureFromEvent được gọi từ lớp không có bộ kết xuất. Thường thì có lẽ lớp bị xóa nhưng một phần xử lý của nó vẫn còn.",'minZoomLevelError':"Chỉ nên sử dụng thuộc tính minZoomLevel với các lớp FixedZoomLevels-descendent. Việc lớp wfs này tìm cho minZoomLevel là di tích còn lại từ xưa. Tuy nhiên, nếu chúng tôi dời nó thì sẽ vỡ các chương trình OpenLayers mà dựa trên nó. Bởi vậy chúng tôi phản đối sử dụng nó\x26nbsp;– bước tìm cho minZoomLevel sẽ được dời vào phiên bản 3.0. Xin sử dụng thiết lập độ phân tích tối thiểu / tối đa thay thế, theo hướng dẫn này: http://trac.openlayers.org/wiki/SettingZoomLevels",'commitSuccess':"Giao dịch WFS: THÀNH CÔNG ${response}",'commitFailed':"Giao dịch WFS: THẤT BẠI ${response}",'googleWarning':"Không thể tải lớp Google đúng đắn.\x3cbr\x3e\x3cbr\x3eĐể tránh thông báo này lần sau, hãy chọn BaseLayer mới dùng điều khiển chọn lớp ở góc trên phải.\x3cbr\x3e\x3cbr\x3eChắc script thư viện Google Maps hoặc không được bao gồm hoặc không chứa khóa API hợp với website của bạn.\x3cbr\x3e\x3cbr\x3e\x3ca href=\'http://trac.openlayers.org/wiki/Google\' target=\'_blank\'\x3eTrợ giúp về tính năng này\x3c/a\x3e cho người phát triển.",'getLayerWarning':"Không thể tải lớp ${layerType} đúng đắn.\x3cbr\x3e\x3cbr\x3eĐể tránh thông báo này lần sau, hãy chọn BaseLayer mới dùng điều khiển chọn lớp ở góc trên phải.\x3cbr\x3e\x3cbr\x3eChắc script thư viện ${layerLib} không được bao gồm đúng kiểu.\x3cbr\x3e\x3cbr\x3e\x3ca href=\'http://trac.openlayers.org/wiki/${layerLib}\' target=\'_blank\'\x3eTrợ giúp về tính năng này\x3c/a\x3e cho người phát triển.",'scale':"Tỷ lệ = 1 : ${scaleDenom}",'W':"T",'E':"Đ",'N':"B",'S':"N",'layerAlreadyAdded':"Bạn muốn thêm lớp ${layerName} vào bản đồ, nhưng lớp này đã được thêm",'reprojectDeprecated':"Bạn đang áp dụng chế độ “reproject” vào lớp ${layerName}. Chế độ này đã bị phản đối: nó có mục đích hỗ trợ lấp dữ liệu trên các nền bản đồ thương mại; nên thực hiện hiệu ứng đó dùng tính năng Mercator Hình cầu. Có sẵn thêm chi tiết tại http://trac.openlayers.org/wiki/SphericalMercator .",'methodDeprecated':"Phương thức này đã bị phản đối và sẽ bị dời vào phiên bản 3.0. Xin hãy sử dụng ${newMethod} thay thế.",'boundsAddError':"Cần phải cho cả giá trị x và y vào hàm add.",'lonlatAddError':"Cần phải cho cả giá trị lon và lat vào hàm add.",'pixelAddError':"Cần phải cho cả giá trị x và y vào hàm add.",'unsupportedGeometryType':"Không hỗ trợ kiểu địa lý: ${geomType}",'pagePositionFailed':"OpenLayers.Util.pagePosition bị thất bại: nguyên tố với ID ${elemId} có thể ở chỗ sai.",'filterEvaluateNotImplemented':"chưa hỗ trợ evaluate cho loại bộ lọc này."});OpenLayers.Popup.AnchoredBubble=OpenLayers.Class(OpenLayers.Popup.Anchored,{rounded:false,initialize:function(id,lonlat,contentSize,contentHTML,anchor,closeBox,closeBoxCallback){this.padding=new OpenLayers.Bounds(0,OpenLayers.Popup.AnchoredBubble.CORNER_SIZE,0,OpenLayers.Popup.AnchoredBubble.CORNER_SIZE);OpenLayers.Popup.Anchored.prototype.initialize.apply(this,arguments);},draw:function(px){OpenLayers.Popup.Anchored.prototype.draw.apply(this,arguments);this.setContentHTML();this.setBackgroundColor();this.setOpacity();return this.div;},updateRelativePosition:function(){this.setRicoCorners();},setSize:function(contentSize){OpenLayers.Popup.Anchored.prototype.setSize.apply(this,arguments);this.setRicoCorners();},setBackgroundColor:function(color){if(color!=undefined){this.backgroundColor=color;}
+if(this.div!=null){if(this.contentDiv!=null){this.div.style.background="transparent";OpenLayers.Rico.Corner.changeColor(this.groupDiv,this.backgroundColor);}}},setOpacity:function(opacity){OpenLayers.Popup.Anchored.prototype.setOpacity.call(this,opacity);if(this.div!=null){if(this.groupDiv!=null){OpenLayers.Rico.Corner.changeOpacity(this.groupDiv,this.opacity);}}},setBorder:function(border){this.border=0;},setRicoCorners:function(){var corners=this.getCornersToRound(this.relativePosition);var options={corners:corners,color:this.backgroundColor,bgColor:"transparent",blend:false};if(!this.rounded){OpenLayers.Rico.Corner.round(this.div,options);this.rounded=true;}else{OpenLayers.Rico.Corner.reRound(this.groupDiv,options);this.setBackgroundColor();this.setOpacity();}},getCornersToRound:function(){var corners=['tl','tr','bl','br'];var corner=OpenLayers.Bounds.oppositeQuadrant(this.relativePosition);OpenLayers.Util.removeItem(corners,corner);return corners.join(" ");},CLASS_NAME:"OpenLayers.Popup.AnchoredBubble"});OpenLayers.Popup.AnchoredBubble.CORNER_SIZE=5;OpenLayers.Popup.Framed=OpenLayers.Class(OpenLayers.Popup.Anchored,{imageSrc:null,imageSize:null,isAlphaImage:false,positionBlocks:null,blocks:null,fixedRelativePosition:false,initialize:function(id,lonlat,contentSize,contentHTML,anchor,closeBox,closeBoxCallback){OpenLayers.Popup.Anchored.prototype.initialize.apply(this,arguments);if(this.fixedRelativePosition){this.updateRelativePosition();this.calculateRelativePosition=function(px){return this.relativePosition;};}
+this.contentDiv.style.position="absolute";this.contentDiv.style.zIndex=1;if(closeBox){this.closeDiv.style.zIndex=1;}
+this.groupDiv.style.position="absolute";this.groupDiv.style.top="0px";this.groupDiv.style.left="0px";this.groupDiv.style.height="100%";this.groupDiv.style.width="100%";},destroy:function(){this.imageSrc=null;this.imageSize=null;this.isAlphaImage=null;this.fixedRelativePosition=false;this.positionBlocks=null;for(var i=0;i<this.blocks.length;i++){var block=this.blocks[i];if(block.image){block.div.removeChild(block.image);}
+block.image=null;if(block.div){this.groupDiv.removeChild(block.div);}
+block.div=null;}
+this.blocks=null;OpenLayers.Popup.Anchored.prototype.destroy.apply(this,arguments);},setBackgroundColor:function(color){},setBorder:function(){},setOpacity:function(opacity){},setSize:function(contentSize){OpenLayers.Popup.Anchored.prototype.setSize.apply(this,arguments);this.updateBlocks();},updateRelativePosition:function(){this.padding=this.positionBlocks[this.relativePosition].padding;if(this.closeDiv){var contentDivPadding=this.getContentDivPadding();this.closeDiv.style.right=contentDivPadding.right+
+this.padding.right+"px";this.closeDiv.style.top=contentDivPadding.top+
+this.padding.top+"px";}
+this.updateBlocks();},calculateNewPx:function(px){var newPx=OpenLayers.Popup.Anchored.prototype.calculateNewPx.apply(this,arguments);newPx=newPx.offset(this.positionBlocks[this.relativePosition].offset);return newPx;},createBlocks:function(){this.blocks=[];var firstPosition=null;for(var key in this.positionBlocks){firstPosition=key;break;}
+var position=this.positionBlocks[firstPosition];for(var i=0;i<position.blocks.length;i++){var block={};this.blocks.push(block);var divId=this.id+'_FrameDecorationDiv_'+i;block.div=OpenLayers.Util.createDiv(divId,null,null,null,"absolute",null,"hidden",null);var imgId=this.id+'_FrameDecorationImg_'+i;var imageCreator=(this.isAlphaImage)?OpenLayers.Util.createAlphaImageDiv:OpenLayers.Util.createImage;block.image=imageCreator(imgId,null,this.imageSize,this.imageSrc,"absolute",null,null,null);block.div.appendChild(block.image);this.groupDiv.appendChild(block.div);}},updateBlocks:function(){if(!this.blocks){this.createBlocks();}
+if(this.size&&this.relativePosition){var position=this.positionBlocks[this.relativePosition];for(var i=0;i<position.blocks.length;i++){var positionBlock=position.blocks[i];var block=this.blocks[i];var l=positionBlock.anchor.left;var b=positionBlock.anchor.bottom;var r=positionBlock.anchor.right;var t=positionBlock.anchor.top;var w=(isNaN(positionBlock.size.w))?this.size.w-(r+l):positionBlock.size.w;var h=(isNaN(positionBlock.size.h))?this.size.h-(b+t):positionBlock.size.h;block.div.style.width=(w<0?0:w)+'px';block.div.style.height=(h<0?0:h)+'px';block.div.style.left=(l!=null)?l+'px':'';block.div.style.bottom=(b!=null)?b+'px':'';block.div.style.right=(r!=null)?r+'px':'';block.div.style.top=(t!=null)?t+'px':'';block.image.style.left=positionBlock.position.x+'px';block.image.style.top=positionBlock.position.y+'px';}
+this.contentDiv.style.left=this.padding.left+"px";this.contentDiv.style.top=this.padding.top+"px";}},CLASS_NAME:"OpenLayers.Popup.Framed"});OpenLayers.Projection=OpenLayers.Class({proj:null,projCode:null,initialize:function(projCode,options){OpenLayers.Util.extend(this,options);this.projCode=projCode;if(window.Proj4js){this.proj=new Proj4js.Proj(projCode);}},getCode:function(){return this.proj?this.proj.srsCode:this.projCode;},getUnits:function(){return this.proj?this.proj.units:null;},toString:function(){return this.getCode();},equals:function(projection){if(projection&&projection.getCode){return this.getCode()==projection.getCode();}else{return false;}},destroy:function(){delete this.proj;delete this.projCode;},CLASS_NAME:"OpenLayers.Projection"});OpenLayers.Projection.transforms={};OpenLayers.Projection.addTransform=function(from,to,method){if(!OpenLayers.Projection.transforms[from]){OpenLayers.Projection.transforms[from]={};}
+OpenLayers.Projection.transforms[from][to]=method;};OpenLayers.Projection.transform=function(point,source,dest){if(source.proj&&dest.proj){point=Proj4js.transform(source.proj,dest.proj,point);}else if(source&&dest&&OpenLayers.Projection.transforms[source.getCode()]&&OpenLayers.Projection.transforms[source.getCode()][dest.getCode()]){OpenLayers.Projection.transforms[source.getCode()][dest.getCode()](point);}
+return point;};OpenLayers.Protocol.WFS.v1=OpenLayers.Class(OpenLayers.Protocol,{version:null,srsName:"EPSG:4326",featureType:null,featureNS:null,geometryName:"the_geom",schema:null,featurePrefix:"feature",formatOptions:null,readFormat:null,initialize:function(options){OpenLayers.Protocol.prototype.initialize.apply(this,[options]);if(!options.format){this.format=OpenLayers.Format.WFST(OpenLayers.Util.extend({version:this.version,featureType:this.featureType,featureNS:this.featureNS,featurePrefix:this.featurePrefix,geometryName:this.geometryName,srsName:this.srsName,schema:this.schema},this.formatOptions));}
+if(!this.featureNS&&this.featurePrefix){var readNode=this.format.readNode;this.format.readNode=function(node,obj){if(!this.featureNS&&node.prefix==this.featurePrefix){this.featureNS=node.namespaceURI;this.setNamespace("feature",this.featureNS);}
+return readNode.apply(this,arguments);};}},destroy:function(){if(this.options&&!this.options.format){this.format.destroy();}
+this.format=null;OpenLayers.Protocol.prototype.destroy.apply(this);},read:function(options){OpenLayers.Protocol.prototype.read.apply(this,arguments);options=OpenLayers.Util.extend({},options);OpenLayers.Util.applyDefaults(options,this.options||{});var response=new OpenLayers.Protocol.Response({requestType:"read"});var data=OpenLayers.Format.XML.prototype.write.apply(this.format,[this.format.writeNode("wfs:GetFeature",options)]);response.priv=OpenLayers.Request.POST({url:options.url,callback:this.createCallback(this.handleRead,response,options),params:options.params,headers:options.headers,data:data});return response;},handleRead:function(response,options){if(options.callback){var request=response.priv;if(request.status>=200&&request.status<300){response.features=this.parseFeatures(request);response.code=OpenLayers.Protocol.Response.SUCCESS;}else{response.code=OpenLayers.Protocol.Response.FAILURE;}
+options.callback.call(options.scope,response);}},parseFeatures:function(request){var doc=request.responseXML;if(!doc||!doc.documentElement){doc=request.responseText;}
+if(!doc||doc.length<=0){return null;}
+return(this.readFormat!==null)?this.readFormat.read(doc):this.format.read(doc);},commit:function(features,options){options=OpenLayers.Util.extend({},options);OpenLayers.Util.applyDefaults(options,this.options);var response=new OpenLayers.Protocol.Response({requestType:"commit",reqFeatures:features});response.priv=OpenLayers.Request.POST({url:options.url,data:this.format.write(features,options),callback:this.createCallback(this.handleCommit,response,options)});return response;},handleCommit:function(response,options){if(options.callback){var request=response.priv;var data=request.responseXML;if(!data||!data.documentElement){data=request.responseText;}
+var obj=this.format.read(data)||{};response.insertIds=obj.insertIds||[];response.code=(obj.success)?OpenLayers.Protocol.Response.SUCCESS:OpenLayers.Protocol.Response.FAILURE;options.callback.call(options.scope,response);}},filterDelete:function(filter,options){options=OpenLayers.Util.extend({},options);OpenLayers.Util.applyDefaults(options,this.options);var response=new OpenLayers.Protocol.Response({requestType:"commit"});var root=this.format.createElementNSPlus("wfs:Transaction",{attributes:{service:"WFS",version:this.version}});var deleteNode=this.format.createElementNSPlus("wfs:Delete",{attributes:{typeName:(options.featureNS?this.featurePrefix+":":"")+
+options.featureType}});if(options.featureNS){deleteNode.setAttribute("xmlns:"+this.featurePrefix,options.featureNS);}
+var filterNode=this.format.writeNode("ogc:Filter",filter);deleteNode.appendChild(filterNode);root.appendChild(deleteNode);var data=OpenLayers.Format.XML.prototype.write.apply(this.format,[root]);return OpenLayers.Request.POST({url:this.url,callback:options.callback||function(){},data:data});},abort:function(response){if(response){response.priv.abort();}},CLASS_NAME:"OpenLayers.Protocol.WFS.v1"});OpenLayers.Renderer.SVG=OpenLayers.Class(OpenLayers.Renderer.Elements,{xmlns:"http://www.w3.org/2000/svg",xlinkns:"http://www.w3.org/1999/xlink",MAX_PIXEL:15000,translationParameters:null,symbolMetrics:null,isGecko:null,supportUse:null,initialize:function(containerID){if(!this.supported()){return;}
+OpenLayers.Renderer.Elements.prototype.initialize.apply(this,arguments);this.translationParameters={x:0,y:0};this.supportUse=(navigator.userAgent.toLowerCase().indexOf("applewebkit/5")==-1);this.isGecko=(navigator.userAgent.toLowerCase().indexOf("gecko/")!=-1);this.symbolMetrics={};},destroy:function(){OpenLayers.Renderer.Elements.prototype.destroy.apply(this,arguments);},supported:function(){var svgFeature="http://www.w3.org/TR/SVG11/feature#";return(document.implementation&&(document.implementation.hasFeature("org.w3c.svg","1.0")||document.implementation.hasFeature(svgFeature+"SVG","1.1")||document.implementation.hasFeature(svgFeature+"BasicStructure","1.1")));},inValidRange:function(x,y,xyOnly){var left=x+(xyOnly?0:this.translationParameters.x);var top=y+(xyOnly?0:this.translationParameters.y);return(left>=-this.MAX_PIXEL&&left<=this.MAX_PIXEL&&top>=-this.MAX_PIXEL&&top<=this.MAX_PIXEL);},setExtent:function(extent,resolutionChanged){OpenLayers.Renderer.Elements.prototype.setExtent.apply(this,arguments);var resolution=this.getResolution();var left=-extent.left/resolution;var top=extent.top/resolution;if(resolutionChanged){this.left=left;this.top=top;var extentString="0 0 "+this.size.w+" "+this.size.h;this.rendererRoot.setAttributeNS(null,"viewBox",extentString);this.translate(0,0);return true;}else{var inRange=this.translate(left-this.left,top-this.top);if(!inRange){this.setExtent(extent,true);}
+return inRange;}},translate:function(x,y){if(!this.inValidRange(x,y,true)){return false;}else{var transformString="";if(x||y){transformString="translate("+x+","+y+")";}
+this.root.setAttributeNS(null,"transform",transformString);this.translationParameters={x:x,y:y};return true;}},setSize:function(size){OpenLayers.Renderer.prototype.setSize.apply(this,arguments);this.rendererRoot.setAttributeNS(null,"width",this.size.w);this.rendererRoot.setAttributeNS(null,"height",this.size.h);},getNodeType:function(geometry,style){var nodeType=null;switch(geometry.CLASS_NAME){case"OpenLayers.Geometry.Point":if(style.externalGraphic){nodeType="image";}else if(this.isComplexSymbol(style.graphicName)){nodeType=this.supportUse===false?"svg":"use";}else{nodeType="circle";}
+break;case"OpenLayers.Geometry.Rectangle":nodeType="rect";break;case"OpenLayers.Geometry.LineString":nodeType="polyline";break;case"OpenLayers.Geometry.LinearRing":nodeType="polygon";break;case"OpenLayers.Geometry.Polygon":case"OpenLayers.Geometry.Curve":case"OpenLayers.Geometry.Surface":nodeType="path";break;default:break;}
+return nodeType;},setStyle:function(node,style,options){style=style||node._style;options=options||node._options;var r=parseFloat(node.getAttributeNS(null,"r"));var widthFactor=1;var pos;if(node._geometryClass=="OpenLayers.Geometry.Point"&&r){node.style.visibility="";if(style.graphic===false){node.style.visibility="hidden";}else if(style.externalGraphic){pos=this.getPosition(node);if(style.graphicTitle){node.setAttributeNS(null,"title",style.graphicTitle);}
+if(style.graphicWidth&&style.graphicHeight){node.setAttributeNS(null,"preserveAspectRatio","none");}
+var width=style.graphicWidth||style.graphicHeight;var height=style.graphicHeight||style.graphicWidth;width=width?width:style.pointRadius*2;height=height?height:style.pointRadius*2;var xOffset=(style.graphicXOffset!=undefined)?style.graphicXOffset:-(0.5*width);var yOffset=(style.graphicYOffset!=undefined)?style.graphicYOffset:-(0.5*height);var opacity=style.graphicOpacity||style.fillOpacity;node.setAttributeNS(null,"x",(pos.x+xOffset).toFixed());node.setAttributeNS(null,"y",(pos.y+yOffset).toFixed());node.setAttributeNS(null,"width",width);node.setAttributeNS(null,"height",height);node.setAttributeNS(this.xlinkns,"href",style.externalGraphic);node.setAttributeNS(null,"style","opacity: "+opacity);}else if(this.isComplexSymbol(style.graphicName)){var offset=style.pointRadius*3;var size=offset*2;var id=this.importSymbol(style.graphicName);pos=this.getPosition(node);widthFactor=this.symbolMetrics[id][0]*3/size;var parent=node.parentNode;var nextSibling=node.nextSibling;if(parent){parent.removeChild(node);}
+if(this.supportUse===false){var src=document.getElementById(id);node.firstChild&&node.removeChild(node.firstChild);node.appendChild(src.firstChild.cloneNode(true));node.setAttributeNS(null,"viewBox",src.getAttributeNS(null,"viewBox"));}else{node.setAttributeNS(this.xlinkns,"href","#"+id);}
+node.setAttributeNS(null,"width",size);node.setAttributeNS(null,"height",size);node.setAttributeNS(null,"x",pos.x-offset);node.setAttributeNS(null,"y",pos.y-offset);if(nextSibling){parent.insertBefore(node,nextSibling);}else if(parent){parent.appendChild(node);}}else{node.setAttributeNS(null,"r",style.pointRadius);}
+var rotation=style.rotation;if((rotation!==undefined||node._rotation!==undefined)&&pos){node._rotation=rotation;rotation|=0;if(node.nodeName!=="svg"){node.setAttributeNS(null,"transform","rotate("+rotation+" "+pos.x+" "+
+pos.y+")");}else{var metrics=this.symbolMetrics[id];node.firstChild.setAttributeNS(null,"transform","rotate("+style.rotation+" "+metrics[1]+" "+metrics[2]+")");}}}
+if(options.isFilled){node.setAttributeNS(null,"fill",style.fillColor);node.setAttributeNS(null,"fill-opacity",style.fillOpacity);}else{node.setAttributeNS(null,"fill","none");}
+if(options.isStroked){node.setAttributeNS(null,"stroke",style.strokeColor);node.setAttributeNS(null,"stroke-opacity",style.strokeOpacity);node.setAttributeNS(null,"stroke-width",style.strokeWidth*widthFactor);node.setAttributeNS(null,"stroke-linecap",style.strokeLinecap||"round");node.setAttributeNS(null,"stroke-linejoin","round");style.strokeDashstyle&&node.setAttributeNS(null,"stroke-dasharray",this.dashStyle(style,widthFactor));}else{node.setAttributeNS(null,"stroke","none");}
+if(style.pointerEvents){node.setAttributeNS(null,"pointer-events",style.pointerEvents);}
+if(style.cursor!=null){node.setAttributeNS(null,"cursor",style.cursor);}
+return node;},dashStyle:function(style,widthFactor){var w=style.strokeWidth*widthFactor;var str=style.strokeDashstyle;switch(str){case'solid':return'none';case'dot':return[1,4*w].join();case'dash':return[4*w,4*w].join();case'dashdot':return[4*w,4*w,1,4*w].join();case'longdash':return[8*w,4*w].join();case'longdashdot':return[8*w,4*w,1,4*w].join();default:return OpenLayers.String.trim(str).replace(/\s+/g,",");}},createNode:function(type,id){var node=document.createElementNS(this.xmlns,type);if(id){node.setAttributeNS(null,"id",id);}
+return node;},nodeTypeCompare:function(node,type){return(type==node.nodeName);},createRenderRoot:function(){return this.nodeFactory(this.container.id+"_svgRoot","svg");},createRoot:function(suffix){return this.nodeFactory(this.container.id+suffix,"g");},createDefs:function(){var defs=this.nodeFactory(this.container.id+"_defs","defs");this.rendererRoot.appendChild(defs);return defs;},drawPoint:function(node,geometry){return this.drawCircle(node,geometry,1);},drawCircle:function(node,geometry,radius){var resolution=this.getResolution();var x=(geometry.x/resolution+this.left);var y=(this.top-geometry.y/resolution);if(this.inValidRange(x,y)){node.setAttributeNS(null,"cx",x);node.setAttributeNS(null,"cy",y);node.setAttributeNS(null,"r",radius);return node;}else{return false;}},drawLineString:function(node,geometry){var componentsResult=this.getComponentsString(geometry.components);if(componentsResult.path){node.setAttributeNS(null,"points",componentsResult.path);return(componentsResult.complete?node:null);}else{return false;}},drawLinearRing:function(node,geometry){var componentsResult=this.getComponentsString(geometry.components);if(componentsResult.path){node.setAttributeNS(null,"points",componentsResult.path);return(componentsResult.complete?node:null);}else{return false;}},drawPolygon:function(node,geometry){var d="";var draw=true;var complete=true;var linearRingResult,path;for(var j=0,len=geometry.components.length;j<len;j++){d+=" M";linearRingResult=this.getComponentsString(geometry.components[j].components," ");path=linearRingResult.path;if(path){d+=" "+path;complete=linearRingResult.complete&&complete;}else{draw=false;}}
+d+=" z";if(draw){node.setAttributeNS(null,"d",d);node.setAttributeNS(null,"fill-rule","evenodd");return complete?node:null;}else{return false;}},drawRectangle:function(node,geometry){var resolution=this.getResolution();var x=(geometry.x/resolution+this.left);var y=(this.top-geometry.y/resolution);if(this.inValidRange(x,y)){node.setAttributeNS(null,"x",x);node.setAttributeNS(null,"y",y);node.setAttributeNS(null,"width",geometry.width/resolution);node.setAttributeNS(null,"height",geometry.height/resolution);return node;}else{return false;}},drawSurface:function(node,geometry){var d=null;var draw=true;for(var i=0,len=geometry.components.length;i<len;i++){if((i%3)==0&&(i/3)==0){var component=this.getShortString(geometry.components[i]);if(!component){draw=false;}
+d="M "+component;}else if((i%3)==1){var component=this.getShortString(geometry.components[i]);if(!component){draw=false;}
+d+=" C "+component;}else{var component=this.getShortString(geometry.components[i]);if(!component){draw=false;}
+d+=" "+component;}}
+d+=" Z";if(draw){node.setAttributeNS(null,"d",d);return node;}else{return false;}},drawText:function(featureId,style,location){var resolution=this.getResolution();var x=(location.x/resolution+this.left);var y=(location.y/resolution-this.top);var label=this.nodeFactory(featureId+this.LABEL_ID_SUFFIX,"text");var tspan=this.nodeFactory(featureId+this.LABEL_ID_SUFFIX+"_tspan","tspan");label.setAttributeNS(null,"x",x);label.setAttributeNS(null,"y",-y);if(style.fontColor){label.setAttributeNS(null,"fill",style.fontColor);}
+if(style.fontOpacity){label.setAttributeNS(null,"opacity",style.fontOpacity);}
+if(style.fontFamily){label.setAttributeNS(null,"font-family",style.fontFamily);}
+if(style.fontSize){label.setAttributeNS(null,"font-size",style.fontSize);}
+if(style.fontWeight){label.setAttributeNS(null,"font-weight",style.fontWeight);}
+if(style.labelSelect===true){label.setAttributeNS(null,"pointer-events","visible");label._featureId=featureId;tspan._featureId=featureId;tspan._geometry=location;tspan._geometryClass=location.CLASS_NAME;}else{label.setAttributeNS(null,"pointer-events","none");}
+var align=style.labelAlign||"cm";label.setAttributeNS(null,"text-anchor",OpenLayers.Renderer.SVG.LABEL_ALIGN[align[0]]||"middle");if(this.isGecko){label.setAttributeNS(null,"dominant-baseline",OpenLayers.Renderer.SVG.LABEL_ALIGN[align[1]]||"central");}else{tspan.setAttributeNS(null,"baseline-shift",OpenLayers.Renderer.SVG.LABEL_VSHIFT[align[1]]||"-35%");}
+tspan.textContent=style.label;if(!label.parentNode){label.appendChild(tspan);this.textRoot.appendChild(label);}},getComponentsString:function(components,separator){var renderCmp=[];var complete=true;var len=components.length;var strings=[];var str,component;for(var i=0;i<len;i++){component=components[i];renderCmp.push(component);str=this.getShortString(component);if(str){strings.push(str);}else{if(i>0){if(this.getShortString(components[i-1])){strings.push(this.clipLine(components[i],components[i-1]));}}
+if(i<len-1){if(this.getShortString(components[i+1])){strings.push(this.clipLine(components[i],components[i+1]));}}
+complete=false;}}
+return{path:strings.join(separator||","),complete:complete};},clipLine:function(badComponent,goodComponent){if(goodComponent.equals(badComponent)){return"";}
+var resolution=this.getResolution();var maxX=this.MAX_PIXEL-this.translationParameters.x;var maxY=this.MAX_PIXEL-this.translationParameters.y;var x1=goodComponent.x/resolution+this.left;var y1=this.top-goodComponent.y/resolution;var x2=badComponent.x/resolution+this.left;var y2=this.top-badComponent.y/resolution;var k;if(x2<-maxX||x2>maxX){k=(y2-y1)/(x2-x1);x2=x2<0?-maxX:maxX;y2=y1+(x2-x1)*k;}
+if(y2<-maxY||y2>maxY){k=(x2-x1)/(y2-y1);y2=y2<0?-maxY:maxY;x2=x1+(y2-y1)*k;}
+return x2+","+y2;},getShortString:function(point){var resolution=this.getResolution();var x=(point.x/resolution+this.left);var y=(this.top-point.y/resolution);if(this.inValidRange(x,y)){return x+","+y;}else{return false;}},getPosition:function(node){return({x:parseFloat(node.getAttributeNS(null,"cx")),y:parseFloat(node.getAttributeNS(null,"cy"))});},importSymbol:function(graphicName){if(!this.defs){this.defs=this.createDefs();}
+var id=this.container.id+"-"+graphicName;if(document.getElementById(id)!=null){return id;}
+var symbol=OpenLayers.Renderer.symbol[graphicName];if(!symbol){throw new Error(graphicName+' is not a valid symbol name');}
+var symbolNode=this.nodeFactory(id,"symbol");var node=this.nodeFactory(null,"polygon");symbolNode.appendChild(node);var symbolExtent=new OpenLayers.Bounds(Number.MAX_VALUE,Number.MAX_VALUE,0,0);var points=[];var x,y;for(var i=0;i<symbol.length;i=i+2){x=symbol[i];y=symbol[i+1];symbolExtent.left=Math.min(symbolExtent.left,x);symbolExtent.bottom=Math.min(symbolExtent.bottom,y);symbolExtent.right=Math.max(symbolExtent.right,x);symbolExtent.top=Math.max(symbolExtent.top,y);points.push(x,",",y);}
+node.setAttributeNS(null,"points",points.join(" "));var width=symbolExtent.getWidth();var height=symbolExtent.getHeight();var viewBox=[symbolExtent.left-width,symbolExtent.bottom-height,width*3,height*3];symbolNode.setAttributeNS(null,"viewBox",viewBox.join(" "));this.symbolMetrics[id]=[Math.max(width,height),symbolExtent.getCenterLonLat().lon,symbolExtent.getCenterLonLat().lat];this.defs.appendChild(symbolNode);return symbolNode.id;},getFeatureIdFromEvent:function(evt){var featureId=OpenLayers.Renderer.Elements.prototype.getFeatureIdFromEvent.apply(this,arguments);if(this.supportUse===false&&!featureId){var target=evt.target;featureId=target.parentNode&&target!=this.rendererRoot&&target.parentNode._featureId;}
+return featureId;},CLASS_NAME:"OpenLayers.Renderer.SVG"});OpenLayers.Renderer.SVG.LABEL_ALIGN={"l":"start","r":"end","b":"bottom","t":"hanging"};OpenLayers.Renderer.SVG.LABEL_VSHIFT={"t":"-70%","b":"0"};OpenLayers.Renderer.VML=OpenLayers.Class(OpenLayers.Renderer.Elements,{xmlns:"urn:schemas-microsoft-com:vml",symbolCache:{},offset:null,initialize:function(containerID){if(!this.supported()){return;}
+if(!document.namespaces.olv){document.namespaces.add("olv",this.xmlns);var style=document.createStyleSheet();var shapes=['shape','rect','oval','fill','stroke','imagedata','group','textbox'];for(var i=0,len=shapes.length;i<len;i++){style.addRule('olv\\:'+shapes[i],"behavior: url(#default#VML); "+"position: absolute; display: inline-block;");}}
+OpenLayers.Renderer.Elements.prototype.initialize.apply(this,arguments);},destroy:function(){OpenLayers.Renderer.Elements.prototype.destroy.apply(this,arguments);},supported:function(){return!!(document.namespaces);},setExtent:function(extent,resolutionChanged){OpenLayers.Renderer.Elements.prototype.setExtent.apply(this,arguments);var resolution=this.getResolution();var left=(extent.left/resolution)|0;var top=(extent.top/resolution-this.size.h)|0;if(resolutionChanged||!this.offset){this.offset={x:left,y:top};left=0;top=0;}else{left=left-this.offset.x;top=top-this.offset.y;}
+var org=left+" "+top;this.root.coordorigin=org;var roots=[this.root,this.vectorRoot,this.textRoot];var root;for(var i=0,len=roots.length;i<len;++i){root=roots[i];var size=this.size.w+" "+this.size.h;root.coordsize=size;}
+this.root.style.flip="y";return true;},setSize:function(size){OpenLayers.Renderer.prototype.setSize.apply(this,arguments);var roots=[this.rendererRoot,this.root,this.vectorRoot,this.textRoot];var w=this.size.w+"px";var h=this.size.h+"px";var root;for(var i=0,len=roots.length;i<len;++i){root=roots[i];root.style.width=w;root.style.height=h;}},getNodeType:function(geometry,style){var nodeType=null;switch(geometry.CLASS_NAME){case"OpenLayers.Geometry.Point":if(style.externalGraphic){nodeType="olv:rect";}else if(this.isComplexSymbol(style.graphicName)){nodeType="olv:shape";}else{nodeType="olv:oval";}
+break;case"OpenLayers.Geometry.Rectangle":nodeType="olv:rect";break;case"OpenLayers.Geometry.LineString":case"OpenLayers.Geometry.LinearRing":case"OpenLayers.Geometry.Polygon":case"OpenLayers.Geometry.Curve":case"OpenLayers.Geometry.Surface":nodeType="olv:shape";break;default:break;}
+return nodeType;},setStyle:function(node,style,options,geometry){style=style||node._style;options=options||node._options;var fillColor=style.fillColor;if(node._geometryClass==="OpenLayers.Geometry.Point"){if(style.externalGraphic){if(style.graphicTitle){node.title=style.graphicTitle;}
+var width=style.graphicWidth||style.graphicHeight;var height=style.graphicHeight||style.graphicWidth;width=width?width:style.pointRadius*2;height=height?height:style.pointRadius*2;var resolution=this.getResolution();var xOffset=(style.graphicXOffset!=undefined)?style.graphicXOffset:-(0.5*width);var yOffset=(style.graphicYOffset!=undefined)?style.graphicYOffset:-(0.5*height);node.style.left=(((geometry.x/resolution-this.offset.x)+xOffset)|0)+"px";node.style.top=(((geometry.y/resolution-this.offset.y)-(yOffset+height))|0)+"px";node.style.width=width+"px";node.style.height=height+"px";node.style.flip="y";fillColor="none";options.isStroked=false;}else if(this.isComplexSymbol(style.graphicName)){var cache=this.importSymbol(style.graphicName);node.path=cache.path;node.coordorigin=cache.left+","+cache.bottom;var size=cache.size;node.coordsize=size+","+size;this.drawCircle(node,geometry,style.pointRadius);node.style.flip="y";}else{this.drawCircle(node,geometry,style.pointRadius);}}
+if(options.isFilled){node.fillcolor=fillColor;}else{node.filled="false";}
+var fills=node.getElementsByTagName("fill");var fill=(fills.length==0)?null:fills[0];if(!options.isFilled){if(fill){node.removeChild(fill);}}else{if(!fill){fill=this.createNode('olv:fill',node.id+"_fill");}
+fill.opacity=style.fillOpacity;if(node._geometryClass==="OpenLayers.Geometry.Point"&&style.externalGraphic){if(style.graphicOpacity){fill.opacity=style.graphicOpacity;}
+fill.src=style.externalGraphic;fill.type="frame";if(!(style.graphicWidth&&style.graphicHeight)){fill.aspect="atmost";}}
+if(fill.parentNode!=node){node.appendChild(fill);}}
+var rotation=style.rotation;if((rotation!==undefined||node._rotation!==undefined)){node._rotation=rotation;if(style.externalGraphic){this.graphicRotate(node,xOffset,yOffset,style);fill.opacity=0;}else if(node._geometryClass==="OpenLayers.Geometry.Point"){node.style.rotation=rotation||0;}}
+var strokes=node.getElementsByTagName("stroke");var stroke=(strokes.length==0)?null:strokes[0];if(!options.isStroked){node.stroked=false;if(stroke){stroke.on=false;}}else{if(!stroke){stroke=this.createNode('olv:stroke',node.id+"_stroke");node.appendChild(stroke);}
+stroke.on=true;stroke.color=style.strokeColor;stroke.weight=style.strokeWidth+"px";stroke.opacity=style.strokeOpacity;stroke.endcap=style.strokeLinecap=='butt'?'flat':(style.strokeLinecap||'round');if(style.strokeDashstyle){stroke.dashstyle=this.dashStyle(style);}}
+if(style.cursor!="inherit"&&style.cursor!=null){node.style.cursor=style.cursor;}
+return node;},graphicRotate:function(node,xOffset,yOffset,style){var style=style||node._style;var rotation=style.rotation||0;var aspectRatio,size;if(!(style.graphicWidth&&style.graphicHeight)){var img=new Image();img.onreadystatechange=OpenLayers.Function.bind(function(){if(img.readyState=="complete"||img.readyState=="interactive"){aspectRatio=img.width/img.height;size=Math.max(style.pointRadius*2,style.graphicWidth||0,style.graphicHeight||0);xOffset=xOffset*aspectRatio;style.graphicWidth=size*aspectRatio;style.graphicHeight=size;this.graphicRotate(node,xOffset,yOffset,style);}},this);img.src=style.externalGraphic;return;}else{size=Math.max(style.graphicWidth,style.graphicHeight);aspectRatio=style.graphicWidth/style.graphicHeight;}
+var width=Math.round(style.graphicWidth||size*aspectRatio);var height=Math.round(style.graphicHeight||size);node.style.width=width+"px";node.style.height=height+"px";var image=document.getElementById(node.id+"_image");if(!image){image=this.createNode("olv:imagedata",node.id+"_image");node.appendChild(image);}
+image.style.width=width+"px";image.style.height=height+"px";image.src=style.externalGraphic;image.style.filter="progid:DXImageTransform.Microsoft.AlphaImageLoader("+"src='', sizingMethod='scale')";var rot=rotation*Math.PI/180;var sintheta=Math.sin(rot);var costheta=Math.cos(rot);var filter="progid:DXImageTransform.Microsoft.Matrix(M11="+costheta+",M12="+(-sintheta)+",M21="+sintheta+",M22="+costheta+",SizingMethod='auto expand')\n";var opacity=style.graphicOpacity||style.fillOpacity;if(opacity&&opacity!=1){filter+="progid:DXImageTransform.Microsoft.BasicImage(opacity="+
+opacity+")\n";}
+node.style.filter=filter;var centerPoint=new OpenLayers.Geometry.Point(-xOffset,-yOffset);var imgBox=new OpenLayers.Bounds(0,0,width,height).toGeometry();imgBox.rotate(style.rotation,centerPoint);var imgBounds=imgBox.getBounds();node.style.left=Math.round(parseInt(node.style.left)+imgBounds.left)+"px";node.style.top=Math.round(parseInt(node.style.top)-imgBounds.bottom)+"px";},postDraw:function(node){node.style.visibility="visible";var fillColor=node._style.fillColor;var strokeColor=node._style.strokeColor;if(fillColor=="none"&&node.fillcolor!=fillColor){node.fillcolor=fillColor;}
+if(strokeColor=="none"&&node.strokecolor!=strokeColor){node.strokecolor=strokeColor;}},setNodeDimension:function(node,geometry){var bbox=geometry.getBounds();if(bbox){var resolution=this.getResolution();var scaledBox=new OpenLayers.Bounds((bbox.left/resolution-this.offset.x)|0,(bbox.bottom/resolution-this.offset.y)|0,(bbox.right/resolution-this.offset.x)|0,(bbox.top/resolution-this.offset.y)|0);node.style.left=scaledBox.left+"px";node.style.top=scaledBox.top+"px";node.style.width=scaledBox.getWidth()+"px";node.style.height=scaledBox.getHeight()+"px";node.coordorigin=scaledBox.left+" "+scaledBox.top;node.coordsize=scaledBox.getWidth()+" "+scaledBox.getHeight();}},dashStyle:function(style){var dash=style.strokeDashstyle;switch(dash){case'solid':case'dot':case'dash':case'dashdot':case'longdash':case'longdashdot':return dash;default:var parts=dash.split(/[ ,]/);if(parts.length==2){if(1*parts[0]>=2*parts[1]){return"longdash";}
+return(parts[0]==1||parts[1]==1)?"dot":"dash";}else if(parts.length==4){return(1*parts[0]>=2*parts[1])?"longdashdot":"dashdot";}
+return"solid";}},createNode:function(type,id){var node=document.createElement(type);if(id){node.id=id;}
+node.unselectable='on';node.onselectstart=OpenLayers.Function.False;return node;},nodeTypeCompare:function(node,type){var subType=type;var splitIndex=subType.indexOf(":");if(splitIndex!=-1){subType=subType.substr(splitIndex+1);}
+var nodeName=node.nodeName;splitIndex=nodeName.indexOf(":");if(splitIndex!=-1){nodeName=nodeName.substr(splitIndex+1);}
+return(subType==nodeName);},createRenderRoot:function(){return this.nodeFactory(this.container.id+"_vmlRoot","div");},createRoot:function(suffix){return this.nodeFactory(this.container.id+suffix,"olv:group");},drawPoint:function(node,geometry){return this.drawCircle(node,geometry,1);},drawCircle:function(node,geometry,radius){if(!isNaN(geometry.x)&&!isNaN(geometry.y)){var resolution=this.getResolution();node.style.left=(((geometry.x/resolution-this.offset.x)|0)-radius)+"px";node.style.top=(((geometry.y/resolution-this.offset.y)|0)-radius)+"px";var diameter=radius*2;node.style.width=diameter+"px";node.style.height=diameter+"px";return node;}
+return false;},drawLineString:function(node,geometry){return this.drawLine(node,geometry,false);},drawLinearRing:function(node,geometry){return this.drawLine(node,geometry,true);},drawLine:function(node,geometry,closeLine){this.setNodeDimension(node,geometry);var resolution=this.getResolution();var numComponents=geometry.components.length;var parts=new Array(numComponents);var comp,x,y;for(var i=0;i<numComponents;i++){comp=geometry.components[i];x=(comp.x/resolution-this.offset.x)|0;y=(comp.y/resolution-this.offset.y)|0;parts[i]=" "+x+","+y+" l ";}
+var end=(closeLine)?" x e":" e";node.path="m"+parts.join("")+end;return node;},drawPolygon:function(node,geometry){this.setNodeDimension(node,geometry);var resolution=this.getResolution();var path=[];var linearRing,i,j,len,ilen,comp,x,y;for(j=0,len=geometry.components.length;j<len;j++){linearRing=geometry.components[j];path.push("m");for(i=0,ilen=linearRing.components.length;i<ilen;i++){comp=linearRing.components[i];x=(comp.x/resolution-this.offset.x)|0;y=(comp.y/resolution-this.offset.y)|0;path.push(" "+x+","+y);if(i==0){path.push(" l");}}
+path.push(" x ");}
+path.push("e");node.path=path.join("");return node;},drawRectangle:function(node,geometry){var resolution=this.getResolution();node.style.left=((geometry.x/resolution-this.offset.x)|0)+"px";node.style.top=((geometry.y/resolution-this.offset.y)|0)+"px";node.style.width=((geometry.width/resolution)|0)+"px";node.style.height=((geometry.height/resolution)|0)+"px";return node;},drawText:function(featureId,style,location){var label=this.nodeFactory(featureId+this.LABEL_ID_SUFFIX,"olv:rect");var textbox=this.nodeFactory(featureId+this.LABEL_ID_SUFFIX+"_textbox","olv:textbox");var resolution=this.getResolution();label.style.left=((location.x/resolution-this.offset.x)|0)+"px";label.style.top=((location.y/resolution-this.offset.y)|0)+"px";label.style.flip="y";textbox.innerText=style.label;if(style.fontColor){textbox.style.color=style.fontColor;}
+if(style.fontOpacity){textbox.style.filter='alpha(opacity='+(style.fontOpacity*100)+')';}
+if(style.fontFamily){textbox.style.fontFamily=style.fontFamily;}
+if(style.fontSize){textbox.style.fontSize=style.fontSize;}
+if(style.fontWeight){textbox.style.fontWeight=style.fontWeight;}
+if(style.labelSelect===true){label._featureId=featureId;textbox._featureId=featureId;textbox._geometry=location;textbox._geometryClass=location.CLASS_NAME;}
+textbox.style.whiteSpace="nowrap";textbox.inset="1px,0px,0px,0px";if(!label.parentNode){label.appendChild(textbox);this.textRoot.appendChild(label);}
+var align=style.labelAlign||"cm";if(align.length==1){align+="m";}
+var xshift=textbox.clientWidth*(OpenLayers.Renderer.VML.LABEL_SHIFT[align.substr(0,1)]);var yshift=textbox.clientHeight*(OpenLayers.Renderer.VML.LABEL_SHIFT[align.substr(1,1)]);label.style.left=parseInt(label.style.left)-xshift-1+"px";label.style.top=parseInt(label.style.top)+yshift+"px";},drawSurface:function(node,geometry){this.setNodeDimension(node,geometry);var resolution=this.getResolution();var path=[];var comp,x,y;for(var i=0,len=geometry.components.length;i<len;i++){comp=geometry.components[i];x=(comp.x/resolution-this.offset.x)|0;y=(comp.y/resolution-this.offset.y)|0;if((i%3)==0&&(i/3)==0){path.push("m");}else if((i%3)==1){path.push(" c");}
+path.push(" "+x+","+y);}
+path.push(" x e");node.path=path.join("");return node;},moveRoot:function(renderer){var layer=this.map.getLayer(renderer.container.id);if(layer instanceof OpenLayers.Layer.Vector.RootContainer){layer=this.map.getLayer(this.container.id);}
+layer&&layer.renderer.clear();OpenLayers.Renderer.Elements.prototype.moveRoot.apply(this,arguments);layer&&layer.redraw();},importSymbol:function(graphicName){var id=this.container.id+"-"+graphicName;var cache=this.symbolCache[id];if(cache){return cache;}
+var symbol=OpenLayers.Renderer.symbol[graphicName];if(!symbol){throw new Error(graphicName+' is not a valid symbol name');}
+var symbolExtent=new OpenLayers.Bounds(Number.MAX_VALUE,Number.MAX_VALUE,0,0);var pathitems=["m"];for(var i=0;i<symbol.length;i=i+2){var x=symbol[i];var y=symbol[i+1];symbolExtent.left=Math.min(symbolExtent.left,x);symbolExtent.bottom=Math.min(symbolExtent.bottom,y);symbolExtent.right=Math.max(symbolExtent.right,x);symbolExtent.top=Math.max(symbolExtent.top,y);pathitems.push(x);pathitems.push(y);if(i==0){pathitems.push("l");}}
+pathitems.push("x e");var path=pathitems.join(" ");var diff=(symbolExtent.getWidth()-symbolExtent.getHeight())/2;if(diff>0){symbolExtent.bottom=symbolExtent.bottom-diff;symbolExtent.top=symbolExtent.top+diff;}else{symbolExtent.left=symbolExtent.left+diff;symbolExtent.right=symbolExtent.right-diff;}
+cache={path:path,size:symbolExtent.getWidth(),left:symbolExtent.left,bottom:symbolExtent.bottom};this.symbolCache[id]=cache;return cache;},CLASS_NAME:"OpenLayers.Renderer.VML"});OpenLayers.Renderer.VML.LABEL_SHIFT={"l":0,"c":.5,"r":1,"t":0,"m":.5,"b":1};OpenLayers.Tile=OpenLayers.Class({EVENT_TYPES:["loadstart","loadend","reload","unload"],events:null,id:null,layer:null,url:null,bounds:null,size:null,position:null,isLoading:false,initialize:function(layer,position,bounds,url,size){this.layer=layer;this.position=position.clone();this.bounds=bounds.clone();this.url=url;this.size=size.clone();this.id=OpenLayers.Util.createUniqueID("Tile_");this.events=new OpenLayers.Events(this,null,this.EVENT_TYPES);},unload:function(){if(this.isLoading){this.isLoading=false;this.events.triggerEvent("unload");}},destroy:function(){this.layer=null;this.bounds=null;this.size=null;this.position=null;this.events.destroy();this.events=null;},clone:function(obj){if(obj==null){obj=new OpenLayers.Tile(this.layer,this.position,this.bounds,this.url,this.size);}
+OpenLayers.Util.applyDefaults(obj,this);return obj;},draw:function(){var maxExtent=this.layer.maxExtent;var withinMaxExtent=(maxExtent&&this.bounds.intersectsBounds(maxExtent,false));this.shouldDraw=(withinMaxExtent||this.layer.displayOutsideMaxExtent);this.clear();return this.shouldDraw;},moveTo:function(bounds,position,redraw){if(redraw==null){redraw=true;}
+this.bounds=bounds.clone();this.position=position.clone();if(redraw){this.draw();}},clear:function(){},getBoundsFromBaseLayer:function(position){var msg=OpenLayers.i18n('reprojectDeprecated',{'layerName':this.layer.name});OpenLayers.Console.warn(msg);var topLeft=this.layer.map.getLonLatFromLayerPx(position);var bottomRightPx=position.clone();bottomRightPx.x+=this.size.w;bottomRightPx.y+=this.size.h;var bottomRight=this.layer.map.getLonLatFromLayerPx(bottomRightPx);if(topLeft.lon>bottomRight.lon){if(topLeft.lon<0){topLeft.lon=-180-(topLeft.lon+180);}else{bottomRight.lon=180+bottomRight.lon+180;}}
+var bounds=new OpenLayers.Bounds(topLeft.lon,bottomRight.lat,bottomRight.lon,topLeft.lat);return bounds;},showTile:function(){if(this.shouldDraw){this.show();}},show:function(){},hide:function(){},CLASS_NAME:"OpenLayers.Tile"});OpenLayers.Control.MouseToolbar=OpenLayers.Class(OpenLayers.Control.MouseDefaults,{mode:null,buttons:null,direction:"vertical",buttonClicked:null,initialize:function(position,direction){OpenLayers.Control.prototype.initialize.apply(this,arguments);this.position=new OpenLayers.Pixel(OpenLayers.Control.MouseToolbar.X,OpenLayers.Control.MouseToolbar.Y);if(position){this.position=position;}
+if(direction){this.direction=direction;}
+this.measureDivs=[];},destroy:function(){for(var btnId in this.buttons){var btn=this.buttons[btnId];btn.map=null;btn.events.destroy();}
+OpenLayers.Control.MouseDefaults.prototype.destroy.apply(this,arguments);},draw:function(){OpenLayers.Control.prototype.draw.apply(this,arguments);OpenLayers.Control.MouseDefaults.prototype.draw.apply(this,arguments);this.buttons={};var sz=new OpenLayers.Size(28,28);var centered=new OpenLayers.Pixel(OpenLayers.Control.MouseToolbar.X,0);this._addButton("zoombox","drag-rectangle-off.png","drag-rectangle-on.png",centered,sz,"Shift->Drag to zoom to area");centered=centered.add((this.direction=="vertical"?0:sz.w),(this.direction=="vertical"?sz.h:0));this._addButton("pan","panning-hand-off.png","panning-hand-on.png",centered,sz,"Drag the map to pan.");centered=centered.add((this.direction=="vertical"?0:sz.w),(this.direction=="vertical"?sz.h:0));this.switchModeTo("pan");return this.div;},_addButton:function(id,img,activeImg,xy,sz,title){var imgLocation=OpenLayers.Util.getImagesLocation()+img;var activeImgLocation=OpenLayers.Util.getImagesLocation()+activeImg;var btn=OpenLayers.Util.createAlphaImageDiv("OpenLayers_Control_MouseToolbar_"+id,xy,sz,imgLocation,"absolute");this.div.appendChild(btn);btn.imgLocation=imgLocation;btn.activeImgLocation=activeImgLocation;btn.events=new OpenLayers.Events(this,btn,null,true);btn.events.on({"mousedown":this.buttonDown,"mouseup":this.buttonUp,"dblclick":OpenLayers.Event.stop,scope:this});btn.action=id;btn.title=title;btn.alt=title;btn.map=this.map;this.buttons[id]=btn;return btn;},buttonDown:function(evt){if(!OpenLayers.Event.isLeftClick(evt)){return;}
+this.buttonClicked=evt.element.action;OpenLayers.Event.stop(evt);},buttonUp:function(evt){if(!OpenLayers.Event.isLeftClick(evt)){return;}
+if(this.buttonClicked!=null){if(this.buttonClicked==evt.element.action){this.switchModeTo(evt.element.action);}
+OpenLayers.Event.stop(evt);this.buttonClicked=null;}},defaultDblClick:function(evt){this.switchModeTo("pan");this.performedDrag=false;var newCenter=this.map.getLonLatFromViewPortPx(evt.xy);this.map.setCenter(newCenter,this.map.zoom+1);OpenLayers.Event.stop(evt);return false;},defaultMouseDown:function(evt){if(!OpenLayers.Event.isLeftClick(evt)){return;}
+this.mouseDragStart=evt.xy.clone();this.performedDrag=false;this.startViaKeyboard=false;if(evt.shiftKey&&this.mode!="zoombox"){this.switchModeTo("zoombox");this.startViaKeyboard=true;}else if(evt.altKey&&this.mode!="measure"){this.switchModeTo("measure");}else if(!this.mode){this.switchModeTo("pan");}
+switch(this.mode){case"zoombox":this.map.div.style.cursor="crosshair";this.zoomBox=OpenLayers.Util.createDiv('zoomBox',this.mouseDragStart,null,null,"absolute","2px solid red");this.zoomBox.style.backgroundColor="white";this.zoomBox.style.filter="alpha(opacity=50)";this.zoomBox.style.opacity="0.50";this.zoomBox.style.fontSize="1px";this.zoomBox.style.zIndex=this.map.Z_INDEX_BASE["Popup"]-1;this.map.viewPortDiv.appendChild(this.zoomBox);this.performedDrag=true;break;case"measure":var distance="";if(this.measureStart){var measureEnd=this.map.getLonLatFromViewPortPx(this.mouseDragStart);distance=OpenLayers.Util.distVincenty(this.measureStart,measureEnd);distance=Math.round(distance*100)/100;distance=distance+"km";this.measureStartBox=this.measureBox;}
+this.measureStart=this.map.getLonLatFromViewPortPx(this.mouseDragStart);;this.measureBox=OpenLayers.Util.createDiv(null,this.mouseDragStart.add(-2-parseInt(this.map.layerContainerDiv.style.left),-2-parseInt(this.map.layerContainerDiv.style.top)),null,null,"absolute");this.measureBox.style.width="4px";this.measureBox.style.height="4px";this.measureBox.style.fontSize="1px";this.measureBox.style.backgroundColor="red";this.measureBox.style.zIndex=this.map.Z_INDEX_BASE["Popup"]-1;this.map.layerContainerDiv.appendChild(this.measureBox);if(distance){this.measureBoxDistance=OpenLayers.Util.createDiv(null,this.mouseDragStart.add(-2-parseInt(this.map.layerContainerDiv.style.left),2-parseInt(this.map.layerContainerDiv.style.top)),null,null,"absolute");this.measureBoxDistance.innerHTML=distance;this.measureBoxDistance.style.zIndex=this.map.Z_INDEX_BASE["Popup"]-1;this.map.layerContainerDiv.appendChild(this.measureBoxDistance);this.measureDivs.push(this.measureBoxDistance);}
+this.measureBox.style.zIndex=this.map.Z_INDEX_BASE["Popup"]-1;this.map.layerContainerDiv.appendChild(this.measureBox);this.measureDivs.push(this.measureBox);break;default:this.map.div.style.cursor="move";break;}
+document.onselectstart=OpenLayers.Function.False;OpenLayers.Event.stop(evt);},switchModeTo:function(mode){if(mode!=this.mode){if(this.mode&&this.buttons[this.mode]){OpenLayers.Util.modifyAlphaImageDiv(this.buttons[this.mode],null,null,null,this.buttons[this.mode].imgLocation);}
+if(this.mode=="measure"&&mode!="measure"){for(var i=0,len=this.measureDivs.length;i<len;i++){if(this.measureDivs[i]){this.map.layerContainerDiv.removeChild(this.measureDivs[i]);}}
+this.measureDivs=[];this.measureStart=null;}
+this.mode=mode;if(this.buttons[mode]){OpenLayers.Util.modifyAlphaImageDiv(this.buttons[mode],null,null,null,this.buttons[mode].activeImgLocation);}
+switch(this.mode){case"zoombox":this.map.div.style.cursor="crosshair";break;default:this.map.div.style.cursor="";break;}}},leaveMode:function(){this.switchModeTo("pan");},defaultMouseMove:function(evt){if(this.mouseDragStart!=null){switch(this.mode){case"zoombox":var deltaX=Math.abs(this.mouseDragStart.x-evt.xy.x);var deltaY=Math.abs(this.mouseDragStart.y-evt.xy.y);this.zoomBox.style.width=Math.max(1,deltaX)+"px";this.zoomBox.style.height=Math.max(1,deltaY)+"px";if(evt.xy.x<this.mouseDragStart.x){this.zoomBox.style.left=evt.xy.x+"px";}
+if(evt.xy.y<this.mouseDragStart.y){this.zoomBox.style.top=evt.xy.y+"px";}
+break;default:var deltaX=this.mouseDragStart.x-evt.xy.x;var deltaY=this.mouseDragStart.y-evt.xy.y;var size=this.map.getSize();var newXY=new OpenLayers.Pixel(size.w/2+deltaX,size.h/2+deltaY);var newCenter=this.map.getLonLatFromViewPortPx(newXY);this.map.setCenter(newCenter,null,true);this.mouseDragStart=evt.xy.clone();}
+this.performedDrag=true;}},defaultMouseUp:function(evt){if(!OpenLayers.Event.isLeftClick(evt)){return;}
+switch(this.mode){case"zoombox":this.zoomBoxEnd(evt);if(this.startViaKeyboard){this.leaveMode();}
+break;case"pan":if(this.performedDrag){this.map.setCenter(this.map.center);}}
+document.onselectstart=null;this.mouseDragStart=null;this.map.div.style.cursor="default";},defaultMouseOut:function(evt){if(this.mouseDragStart!=null&&OpenLayers.Util.mouseLeft(evt,this.map.div)){if(this.zoomBox){this.removeZoomBox();if(this.startViaKeyboard){this.leaveMode();}}
+this.mouseDragStart=null;this.map.div.style.cursor="default";}},defaultClick:function(evt){if(this.performedDrag){this.performedDrag=false;return false;}},CLASS_NAME:"OpenLayers.Control.MouseToolbar"});OpenLayers.Control.MouseToolbar.X=6;OpenLayers.Control.MouseToolbar.Y=300;OpenLayers.Control.NavigationHistory=OpenLayers.Class(OpenLayers.Control,{type:OpenLayers.Control.TYPE_TOGGLE,previous:null,previousOptions:null,next:null,nextOptions:null,limit:50,autoActivate:true,clearOnDeactivate:false,registry:null,nextStack:null,previousStack:null,listeners:null,restoring:false,initialize:function(options){OpenLayers.Control.prototype.initialize.apply(this,[options]);this.registry=OpenLayers.Util.extend({"moveend":this.getState},this.registry);var previousOptions={trigger:OpenLayers.Function.bind(this.previousTrigger,this),displayClass:this.displayClass+" "+this.displayClass+"Previous"};OpenLayers.Util.extend(previousOptions,this.previousOptions);this.previous=new OpenLayers.Control.Button(previousOptions);var nextOptions={trigger:OpenLayers.Function.bind(this.nextTrigger,this),displayClass:this.displayClass+" "+this.displayClass+"Next"};OpenLayers.Util.extend(nextOptions,this.nextOptions);this.next=new OpenLayers.Control.Button(nextOptions);this.clear();},onPreviousChange:function(state,length){if(state&&!this.previous.active){this.previous.activate();}else if(!state&&this.previous.active){this.previous.deactivate();}},onNextChange:function(state,length){if(state&&!this.next.active){this.next.activate();}else if(!state&&this.next.active){this.next.deactivate();}},destroy:function(){OpenLayers.Control.prototype.destroy.apply(this);this.previous.destroy();this.next.destroy();this.deactivate();for(var prop in this){this[prop]=null;}},setMap:function(map){this.map=map;this.next.setMap(map);this.previous.setMap(map);},draw:function(){OpenLayers.Control.prototype.draw.apply(this,arguments);this.next.draw();this.previous.draw();},previousTrigger:function(){var current=this.previousStack.shift();var state=this.previousStack.shift();if(state!=undefined){this.nextStack.unshift(current);this.previousStack.unshift(state);this.restoring=true;this.restore(state);this.restoring=false;this.onNextChange(this.nextStack[0],this.nextStack.length);this.onPreviousChange(this.previousStack[1],this.previousStack.length-1);}else{this.previousStack.unshift(current);}
+return state;},nextTrigger:function(){var state=this.nextStack.shift();if(state!=undefined){this.previousStack.unshift(state);this.restoring=true;this.restore(state);this.restoring=false;this.onNextChange(this.nextStack[0],this.nextStack.length);this.onPreviousChange(this.previousStack[1],this.previousStack.length-1);}
+return state;},clear:function(){this.previousStack=[];this.previous.deactivate();this.nextStack=[];this.next.deactivate();},getState:function(){return{center:this.map.getCenter(),resolution:this.map.getResolution(),projection:this.map.getProjectionObject(),units:this.map.getProjectionObject().getUnits()||this.map.units||this.map.baseLayer.units};},restore:function(state){var center,zoom;if(this.map.getProjectionObject()==state.projection){zoom=this.map.getZoomForResolution(state.resolution);center=state.center;}else{center=state.center.clone();center.transform(state.projection,this.map.getProjectionObject());var sourceUnits=state.units;var targetUnits=this.map.getProjectionObject().getUnits()||this.map.units||this.map.baseLayer.units;var resolutionFactor=sourceUnits&&targetUnits?OpenLayers.INCHES_PER_UNIT[sourceUnits]/OpenLayers.INCHES_PER_UNIT[targetUnits]:1;zoom=this.map.getZoomForResolution(resolutionFactor*state.resolution);}
+this.map.setCenter(center,zoom);},setListeners:function(){this.listeners={};for(var type in this.registry){this.listeners[type]=OpenLayers.Function.bind(function(){if(!this.restoring){var state=this.registry[type].apply(this,arguments);this.previousStack.unshift(state);if(this.previousStack.length>1){this.onPreviousChange(this.previousStack[1],this.previousStack.length-1);}
+if(this.previousStack.length>(this.limit+1)){this.previousStack.pop();}
+if(this.nextStack.length>0){this.nextStack=[];this.onNextChange(null,0);}}
+return true;},this);}},activate:function(){var activated=false;if(this.map){if(OpenLayers.Control.prototype.activate.apply(this)){if(this.listeners==null){this.setListeners();}
+for(var type in this.listeners){this.map.events.register(type,this,this.listeners[type]);}
+activated=true;if(this.previousStack.length==0){this.initStack();}}}
+return activated;},initStack:function(){if(this.map.getCenter()){this.listeners.moveend();}},deactivate:function(){var deactivated=false;if(this.map){if(OpenLayers.Control.prototype.deactivate.apply(this)){for(var type in this.listeners){this.map.events.unregister(type,this,this.listeners[type]);}
+if(this.clearOnDeactivate){this.clear();}
+deactivated=true;}}
+return deactivated;},CLASS_NAME:"OpenLayers.Control.NavigationHistory"});OpenLayers.Control.PanPanel=OpenLayers.Class(OpenLayers.Control.Panel,{slideFactor:50,initialize:function(options){OpenLayers.Control.Panel.prototype.initialize.apply(this,[options]);this.addControls([new OpenLayers.Control.Pan(OpenLayers.Control.Pan.NORTH,{slideFactor:this.slideFactor}),new OpenLayers.Control.Pan(OpenLayers.Control.Pan.SOUTH,{slideFactor:this.slideFactor}),new OpenLayers.Control.Pan(OpenLayers.Control.Pan.EAST,{slideFactor:this.slideFactor}),new OpenLayers.Control.Pan(OpenLayers.Control.Pan.WEST,{slideFactor:this.slideFactor})]);},CLASS_NAME:"OpenLayers.Control.PanPanel"});OpenLayers.Control.PanZoomBar=OpenLayers.Class(OpenLayers.Control.PanZoom,{zoomStopWidth:18,zoomStopHeight:11,slider:null,sliderEvents:null,zoombarDiv:null,divEvents:null,zoomWorldIcon:false,forceFixedZoomLevel:false,mouseDragStart:null,zoomStart:null,initialize:function(){OpenLayers.Control.PanZoom.prototype.initialize.apply(this,arguments);},destroy:function(){this._removeZoomBar();this.map.events.un({"changebaselayer":this.redraw,scope:this});OpenLayers.Control.PanZoom.prototype.destroy.apply(this,arguments);delete this.mouseDragStart;delete this.zoomStart;},setMap:function(map){OpenLayers.Control.PanZoom.prototype.setMap.apply(this,arguments);this.map.events.register("changebaselayer",this,this.redraw);},redraw:function(){if(this.div!=null){this.removeButtons();this._removeZoomBar();}
+this.draw();},draw:function(px){OpenLayers.Control.prototype.draw.apply(this,arguments);px=this.position.clone();this.buttons=[];var sz=new OpenLayers.Size(18,18);var centered=new OpenLayers.Pixel(px.x+sz.w/2,px.y);var wposition=sz.w;if(this.zoomWorldIcon){centered=new OpenLayers.Pixel(px.x+sz.w,px.y);}
+this._addButton("panup","north-mini.png",centered,sz);px.y=centered.y+sz.h;this._addButton("panleft","west-mini.png",px,sz);if(this.zoomWorldIcon){this._addButton("zoomworld","zoom-world-mini.png",px.add(sz.w,0),sz);wposition*=2;}
+this._addButton("panright","east-mini.png",px.add(wposition,0),sz);this._addButton("pandown","south-mini.png",centered.add(0,sz.h*2),sz);this._addButton("zoomin","zoom-plus-mini.png",centered.add(0,sz.h*3+5),sz);centered=this._addZoomBar(centered.add(0,sz.h*4+5));this._addButton("zoomout","zoom-minus-mini.png",centered,sz);return this.div;},_addZoomBar:function(centered){var imgLocation=OpenLayers.Util.getImagesLocation();var id=this.id+"_"+this.map.id;var zoomsToEnd=this.map.getNumZoomLevels()-1-this.map.getZoom();var slider=OpenLayers.Util.createAlphaImageDiv(id,centered.add(-1,zoomsToEnd*this.zoomStopHeight),new OpenLayers.Size(20,9),imgLocation+"slider.png","absolute");this.slider=slider;this.sliderEvents=new OpenLayers.Events(this,slider,null,true,{includeXY:true});this.sliderEvents.on({"mousedown":this.zoomBarDown,"mousemove":this.zoomBarDrag,"mouseup":this.zoomBarUp,"dblclick":this.doubleClick,"click":this.doubleClick});var sz=new OpenLayers.Size();sz.h=this.zoomStopHeight*this.map.getNumZoomLevels();sz.w=this.zoomStopWidth;var div=null;if(OpenLayers.Util.alphaHack()){var id=this.id+"_"+this.map.id;div=OpenLayers.Util.createAlphaImageDiv(id,centered,new OpenLayers.Size(sz.w,this.zoomStopHeight),imgLocation+"zoombar.png","absolute",null,"crop");div.style.height=sz.h+"px";}else{div=OpenLayers.Util.createDiv('OpenLayers_Control_PanZoomBar_Zoombar'+this.map.id,centered,sz,imgLocation+"zoombar.png");}
+this.zoombarDiv=div;this.divEvents=new OpenLayers.Events(this,div,null,true,{includeXY:true});this.divEvents.on({"mousedown":this.divClick,"mousemove":this.passEventToSlider,"dblclick":this.doubleClick,"click":this.doubleClick});this.div.appendChild(div);this.startTop=parseInt(div.style.top);this.div.appendChild(slider);this.map.events.register("zoomend",this,this.moveZoomBar);centered=centered.add(0,this.zoomStopHeight*this.map.getNumZoomLevels());return centered;},_removeZoomBar:function(){this.sliderEvents.un({"mousedown":this.zoomBarDown,"mousemove":this.zoomBarDrag,"mouseup":this.zoomBarUp,"dblclick":this.doubleClick,"click":this.doubleClick});this.sliderEvents.destroy();this.divEvents.un({"mousedown":this.divClick,"mousemove":this.passEventToSlider,"dblclick":this.doubleClick,"click":this.doubleClick});this.divEvents.destroy();this.div.removeChild(this.zoombarDiv);this.zoombarDiv=null;this.div.removeChild(this.slider);this.slider=null;this.map.events.unregister("zoomend",this,this.moveZoomBar);},passEventToSlider:function(evt){this.sliderEvents.handleBrowserEvent(evt);},divClick:function(evt){if(!OpenLayers.Event.isLeftClick(evt)){return;}
+var y=evt.xy.y;var top=OpenLayers.Util.pagePosition(evt.object)[1];var levels=(y-top)/this.zoomStopHeight;if(this.forceFixedZoomLevel||!this.map.fractionalZoom){levels=Math.floor(levels);}
+var zoom=(this.map.getNumZoomLevels()-1)-levels;zoom=Math.min(Math.max(zoom,0),this.map.getNumZoomLevels()-1);this.map.zoomTo(zoom);OpenLayers.Event.stop(evt);},zoomBarDown:function(evt){if(!OpenLayers.Event.isLeftClick(evt)){return;}
+this.map.events.on({"mousemove":this.passEventToSlider,"mouseup":this.passEventToSlider,scope:this});this.mouseDragStart=evt.xy.clone();this.zoomStart=evt.xy.clone();this.div.style.cursor="move";this.zoombarDiv.offsets=null;OpenLayers.Event.stop(evt);},zoomBarDrag:function(evt){if(this.mouseDragStart!=null){var deltaY=this.mouseDragStart.y-evt.xy.y;var offsets=OpenLayers.Util.pagePosition(this.zoombarDiv);if((evt.clientY-offsets[1])>0&&(evt.clientY-offsets[1])<parseInt(this.zoombarDiv.style.height)-2){var newTop=parseInt(this.slider.style.top)-deltaY;this.slider.style.top=newTop+"px";this.mouseDragStart=evt.xy.clone();}
+OpenLayers.Event.stop(evt);}},zoomBarUp:function(evt){if(!OpenLayers.Event.isLeftClick(evt)){return;}
+if(this.mouseDragStart){this.div.style.cursor="";this.map.events.un({"mouseup":this.passEventToSlider,"mousemove":this.passEventToSlider,scope:this});var deltaY=this.zoomStart.y-evt.xy.y;var zoomLevel=this.map.zoom;if(!this.forceFixedZoomLevel&&this.map.fractionalZoom){zoomLevel+=deltaY/this.zoomStopHeight;zoomLevel=Math.min(Math.max(zoomLevel,0),this.map.getNumZoomLevels()-1);}else{zoomLevel+=Math.round(deltaY/this.zoomStopHeight);}
+this.map.zoomTo(zoomLevel);this.mouseDragStart=null;this.zoomStart=null;OpenLayers.Event.stop(evt);}},moveZoomBar:function(){var newTop=((this.map.getNumZoomLevels()-1)-this.map.getZoom())*this.zoomStopHeight+this.startTop+1;this.slider.style.top=newTop+"px";},CLASS_NAME:"OpenLayers.Control.PanZoomBar"});OpenLayers.Control.Permalink=OpenLayers.Class(OpenLayers.Control,{argParserClass:OpenLayers.Control.ArgParser,element:null,base:'',displayProjection:null,initialize:function(element,base,options){OpenLayers.Control.prototype.initialize.apply(this,[options]);this.element=OpenLayers.Util.getElement(element);this.base=base||document.location.href;},destroy:function(){if(this.element.parentNode==this.div){this.div.removeChild(this.element);}
+this.element=null;this.map.events.unregister('moveend',this,this.updateLink);OpenLayers.Control.prototype.destroy.apply(this,arguments);},setMap:function(map){OpenLayers.Control.prototype.setMap.apply(this,arguments);for(var i=0,len=this.map.controls.length;i<len;i++){var control=this.map.controls[i];if(control.CLASS_NAME==this.argParserClass.CLASS_NAME){if(control.displayProjection!=this.displayProjection){this.displayProjection=control.displayProjection;}
+break;}}
+if(i==this.map.controls.length){this.map.addControl(new this.argParserClass({'displayProjection':this.displayProjection}));}},draw:function(){OpenLayers.Control.prototype.draw.apply(this,arguments);if(!this.element){this.div.className=this.displayClass;this.element=document.createElement("a");this.element.innerHTML=OpenLayers.i18n("permalink");this.element.href="";this.div.appendChild(this.element);}
+this.map.events.on({'moveend':this.updateLink,'changelayer':this.updateLink,'changebaselayer':this.updateLink,scope:this});this.updateLink();return this.div;},updateLink:function(){var href=this.base;if(href.indexOf('?')!=-1){href=href.substring(0,href.indexOf('?'));}
+href+='?'+OpenLayers.Util.getParameterString(this.createParams());this.element.href=href;},createParams:function(center,zoom,layers){center=center||this.map.getCenter();var params=OpenLayers.Util.getParameters(this.base);if(center){params.zoom=zoom||this.map.getZoom();var lat=center.lat;var lon=center.lon;if(this.displayProjection){var mapPosition=OpenLayers.Projection.transform({x:lon,y:lat},this.map.getProjectionObject(),this.displayProjection);lon=mapPosition.x;lat=mapPosition.y;}
+params.lat=Math.round(lat*100000)/100000;params.lon=Math.round(lon*100000)/100000;layers=layers||this.map.layers;params.layers='';for(var i=0,len=layers.length;i<len;i++){var layer=layers[i];if(layer.isBaseLayer){params.layers+=(layer==this.map.baseLayer)?"B":"0";}else{params.layers+=(layer.getVisibility())?"T":"F";}}}
+return params;},CLASS_NAME:"OpenLayers.Control.Permalink"});OpenLayers.Control.ZoomPanel=OpenLayers.Class(OpenLayers.Control.Panel,{initialize:function(options){OpenLayers.Control.Panel.prototype.initialize.apply(this,[options]);this.addControls([new OpenLayers.Control.ZoomIn(),new OpenLayers.Control.ZoomToMaxExtent(),new OpenLayers.Control.ZoomOut()]);},CLASS_NAME:"OpenLayers.Control.ZoomPanel"});OpenLayers.Format.CSWGetDomain=function(options){options=OpenLayers.Util.applyDefaults(options,OpenLayers.Format.CSWGetDomain.DEFAULTS);var cls=OpenLayers.Format.CSWGetDomain["v"+options.version.replace(/\./g,"_")];if(!cls){throw"Unsupported CSWGetDomain version: "+options.version;}
+return new cls(options);};OpenLayers.Format.CSWGetDomain.DEFAULTS={"version":"2.0.2"};OpenLayers.Format.CSWGetRecords=function(options){options=OpenLayers.Util.applyDefaults(options,OpenLayers.Format.CSWGetRecords.DEFAULTS);var cls=OpenLayers.Format.CSWGetRecords["v"+options.version.replace(/\./g,"_")];if(!cls){throw"Unsupported CSWGetRecords version: "+options.version;}
+return new cls(options);};OpenLayers.Format.CSWGetRecords.DEFAULTS={"version":"2.0.2"};OpenLayers.Format.JSON=OpenLayers.Class(OpenLayers.Format,{indent:" ",space:" ",newline:"\n",level:0,pretty:false,initialize:function(options){OpenLayers.Format.prototype.initialize.apply(this,[options]);},read:function(json,filter){try{if(/^[\],:{}\s]*$/.test(json.replace(/\\["\\\/bfnrtu]/g,'@').replace(/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,']').replace(/(?:^|:|,)(?:\s*\[)+/g,''))){var object=eval('('+json+')');if(typeof filter==='function'){function walk(k,v){if(v&&typeof v==='object'){for(var i in v){if(v.hasOwnProperty(i)){v[i]=walk(i,v[i]);}}}
+return filter(k,v);}
+object=walk('',object);}
+if(this.keepData){this.data=object;}
+return object;}}catch(e){}
+return null;},write:function(value,pretty){this.pretty=!!pretty;var json=null;var type=typeof value;if(this.serialize[type]){try{json=this.serialize[type].apply(this,[value]);}catch(err){OpenLayers.Console.error("Trouble serializing: "+err);}}
+return json;},writeIndent:function(){var pieces=[];if(this.pretty){for(var i=0;i<this.level;++i){pieces.push(this.indent);}}
+return pieces.join('');},writeNewline:function(){return(this.pretty)?this.newline:'';},writeSpace:function(){return(this.pretty)?this.space:'';},serialize:{'object':function(object){if(object==null){return"null";}
+if(object.constructor==Date){return this.serialize.date.apply(this,[object]);}
+if(object.constructor==Array){return this.serialize.array.apply(this,[object]);}
+var pieces=['{'];this.level+=1;var key,keyJSON,valueJSON;var addComma=false;for(key in object){if(object.hasOwnProperty(key)){keyJSON=OpenLayers.Format.JSON.prototype.write.apply(this,[key,this.pretty]);valueJSON=OpenLayers.Format.JSON.prototype.write.apply(this,[object[key],this.pretty]);if(keyJSON!=null&&valueJSON!=null){if(addComma){pieces.push(',');}
+pieces.push(this.writeNewline(),this.writeIndent(),keyJSON,':',this.writeSpace(),valueJSON);addComma=true;}}}
+this.level-=1;pieces.push(this.writeNewline(),this.writeIndent(),'}');return pieces.join('');},'array':function(array){var json;var pieces=['['];this.level+=1;for(var i=0,len=array.length;i<len;++i){json=OpenLayers.Format.JSON.prototype.write.apply(this,[array[i],this.pretty]);if(json!=null){if(i>0){pieces.push(',');}
+pieces.push(this.writeNewline(),this.writeIndent(),json);}}
+this.level-=1;pieces.push(this.writeNewline(),this.writeIndent(),']');return pieces.join('');},'string':function(string){var m={'\b':'\\b','\t':'\\t','\n':'\\n','\f':'\\f','\r':'\\r','"':'\\"','\\':'\\\\'};if(/["\\\x00-\x1f]/.test(string)){return'"'+string.replace(/([\x00-\x1f\\"])/g,function(a,b){var c=m[b];if(c){return c;}
+c=b.charCodeAt();return'\\u00'+
+Math.floor(c/16).toString(16)+
+(c%16).toString(16);})+'"';}
+return'"'+string+'"';},'number':function(number){return isFinite(number)?String(number):"null";},'boolean':function(bool){return String(bool);},'date':function(date){function format(number){return(number<10)?'0'+number:number;}
+return'"'+date.getFullYear()+'-'+
+format(date.getMonth()+1)+'-'+
+format(date.getDate())+'T'+
+format(date.getHours())+':'+
+format(date.getMinutes())+':'+
+format(date.getSeconds())+'"';}},CLASS_NAME:"OpenLayers.Format.JSON"});OpenLayers.Format.WFST=function(options){options=OpenLayers.Util.applyDefaults(options,OpenLayers.Format.WFST.DEFAULTS);var cls=OpenLayers.Format.WFST["v"+options.version.replace(/\./g,"_")];if(!cls){throw"Unsupported WFST version: "+options.version;}
+return new cls(options);};OpenLayers.Format.WFST.DEFAULTS={"version":"1.0.0"};OpenLayers.Format.XML=OpenLayers.Class(OpenLayers.Format,{namespaces:null,namespaceAlias:null,defaultPrefix:null,readers:{},writers:{},xmldom:null,initialize:function(options){if(window.ActiveXObject){this.xmldom=new ActiveXObject("Microsoft.XMLDOM");}
+OpenLayers.Format.prototype.initialize.apply(this,[options]);this.namespaces=OpenLayers.Util.extend({},this.namespaces);this.namespaceAlias={};for(var alias in this.namespaces){this.namespaceAlias[this.namespaces[alias]]=alias;}},destroy:function(){this.xmldom=null;OpenLayers.Format.prototype.destroy.apply(this,arguments);},setNamespace:function(alias,uri){this.namespaces[alias]=uri;this.namespaceAlias[uri]=alias;},read:function(text){var index=text.indexOf('<');if(index>0){text=text.substring(index);}
+var node=OpenLayers.Util.Try(OpenLayers.Function.bind((function(){var xmldom;if(window.ActiveXObject&&!this.xmldom){xmldom=new ActiveXObject("Microsoft.XMLDOM");}else{xmldom=this.xmldom;}
+xmldom.loadXML(text);return xmldom;}