| shared_writable_dirs: | |
| - /labs/tiles | |
| - /lib/staticmaplite/cache | |
| php_extensions: [pgsql, pdo, pdo_pgsql, curl] | |
| <?php | <?php |
| include ('include/common.inc.php'); | include ('include/common.inc.php'); |
| include_header("About", "about") | include_header("About", "about") |
| ?> | ?> |
| <p> | <p> |
| Busness Time - An ACT bus timetable webapp<br /> | Busness Time - An ACT bus timetable webapp<br /> |
| Based on the maxious-canberra-transit-feed (<a | Based on the maxious-canberra-transit-feed (<a |
| href="http://s3-ap-southeast-1.amazonaws.com/busresources/cbrfeed.zip">download</a>, | href="http://s3-ap-southeast-1.amazonaws.com/busresources/cbrfeed.zip">download</a>, |
| last updated <?php | last updated <?php |
| echo date("F d Y.", @filemtime('cbrfeed.zip')); ?>)<br /> | echo date("F d Y.", @filemtime('cbrfeed.zip')); ?>)<br /> |
| Source code for the <a | Source code for the <a |
| href="https://github.com/maxious/ACTBus-data">transit | href="https://github.com/maxious/ACTBus-data">transit |
| feed</a> and <a href="https://github.com/maxious/ACTBus-ui">this | feed</a> and <a href="https://github.com/maxious/ACTBus-ui">this |
| site</a> available from github.<br /> | site</a> available from github.<br /> |
| Uses jQuery Mobile, PHP, PostgreSQL, OpenTripPlanner, OpenLayers, OpenStreetMap, Cloudmade Geocoder and Tile Service<br /> | Uses jQuery Mobile, PHP, PostgreSQL, OpenTripPlanner, OpenLayers, OpenStreetMap, Cloudmade Geocoder and Tile Service<br /> |
| <br /> | <br /> |
| Feedback encouraged; contact maxious@lambdacomplex.org<br /> | Feedback encouraged; contact maxious@lambdacomplex.org<br /> |
| <br /> | <br /> |
| Some icons by Joseph Wain / glyphish.com<br /> | Some icons by Joseph Wain / glyphish.com<br /> |
| Native clients also available for iPhone(<a href="http://itunes.apple.com/au/app/cbrtimetable/id444287349?mt=8">cbrTimetable by Sandor Kolotenko</a> | |
| , <a href="http://itunes.apple.com/au/app/act-buses/id376634797?mt=8">ACT Buses by David Sullivan</a>) | |
| and Android (<a href="https://market.android.com/details?id=com.action">MyBus 2.0 by Imagine Team</a>) | |
| <br /> | |
| <br /> | <br /> |
| <small>Disclaimer: The content of this website is of a general and informative nature. Please check with printed timetables or those available on http://action.act.gov.au before your trip. | <small>Disclaimer: The content of this website is of a general and informative nature. Please check with printed timetables or those available on http://action.act.gov.au before your trip. |
| Whilst every effort has been made to ensure the high quality and accuracy of the Site, the Author makes no warranty, | Whilst every effort has been made to ensure the high quality and accuracy of the Site, the Author makes no warranty, |
| express or implied concerning the topicality, correctness, completeness or quality of the information, which is provided | express or implied concerning the topicality, correctness, completeness or quality of the information, which is provided |
| "as is". The Author expressly disclaims all warranties, including but not limited to warranties of fitness for a particular purpose and warranties of merchantability. | "as is". The Author expressly disclaims all warranties, including but not limited to warranties of fitness for a particular purpose and warranties of merchantability. |
| All offers are not binding and without obligation. The Author expressly reserves the right, in his discretion, to suspend, | All offers are not binding and without obligation. The Author expressly reserves the right, in his discretion, to suspend, |
| change, modify, add or remove portions of the Site and to restrict or terminate the use and accessibility of the Site | change, modify, add or remove portions of the Site and to restrict or terminate the use and accessibility of the Site |
| without prior notice. </small> | without prior notice. </small> |
| <?php | <?php |
| include_footer(); | include_footer(); |
| ?> | ?> |
| #!/bin/bash | #!/bin/bash |
| #this script should be run from a fresh git checkout from github | #this script should be run from a fresh git checkout from github |
| #ami base must have yum install lighttpd-fastcgi, git, tomcat6 | #ami base must have yum install lighttpd-fastcgi, git, tomcat6 |
| #php-cli php-gd tomcat6-webapps tomcat6-admin-webapps svn maven2 | #php-cli php-gd tomcat6-webapps tomcat6-admin-webapps svn maven2 |
| #postgres postgres-server php-pg | #postgres postgres-server php-pg |
| #http://www.how2forge.org/installing-lighttpd-with-php5-and-mysql-support-on-fedora-12 | #http://www.how2forge.org/installing-lighttpd-with-php5-and-mysql-support-on-fedora-12 |
| cp /root/aws.php /tmp/ | sh busuiphp.sh |
| mkdir /var/www/lib/staticmaplite/cache | sh busuidb.sh |
| chcon -h system_u:object_r:httpd_sys_content_t /var/www | sh busuiotp.sh |
| chcon -R -h root:object_r:httpd_sys_content_t /var/www/* | |
| chcon -R -t httpd_sys_content_rw_t /var/www/lib/staticmaplite/cache | |
| chmod -R 777 /var/www/lib/staticmaplite/cache | |
| chcon -R -t httpd_sys_content_rw_t /var/www/labs/tiles | |
| chmod -R 777 /var/www/labs/tiles | |
| wget http://s3-ap-southeast-1.amazonaws.com/busresources/cbrfeed.zip \ | |
| -O /var/www/cbrfeed.zip | |
| createdb transitdata | |
| createlang -d transitdata plpgsql | |
| psql -d transitdata -f /var/www/lib/postgis.sql | |
| # curl https://github.com/maxious/ACTBus-ui/raw/master/transitdata.cbrfeed.sql.gz -o transitdata.cbrfeed.sql.gz | |
| #made with pg_dump transitdata | gzip -c > transitdata.cbrfeed.sql.gz | |
| gunzip /var/www/transitdata.cbrfeed.sql.gz | |
| psql -d transitdata -f /var/www/transitdata.cbrfeed.sql | |
| #createuser transitdata -SDRP | |
| #password transitdata | |
| #psql -d transitdata -c \"GRANT SELECT ON TABLE agency,calendar,calendar_dates,routes,stop_times,stops,trips TO transitdata;\" | |
| php /var/www/updatedb.php | |
| wget http://s3-ap-southeast-1.amazonaws.com/busresources/Graph.obj \ | |
| -O /tmp/Graph.obj | |
| rm -rfv /usr/share/tomcat6/webapps/opentripplanner* | |
| wget http://s3-ap-southeast-1.amazonaws.com/busresources/opentripplanner-webapp.war \ | |
| -O /usr/share/tomcat6/webapps/opentripplanner-webapp.war | |
| wget http://s3-ap-southeast-1.amazonaws.com/busresources/opentripplanner-api-webapp.war \ | |
| -O /usr/share/tomcat6/webapps/opentripplanner-api-webapp.war | |
| /etc/init.d/tomcat6 restart | |
| createdb transitdata | |
| createlang -d transitdata plpgsql | |
| psql -d transitdata -f /var/www/lib/postgis.sql | |
| # curl https://github.com/maxious/ACTBus-ui/raw/master/transitdata.cbrfeed.sql.gz -o transitdata.cbrfeed.sql.gz | |
| #made with pg_dump transitdata | gzip -c > transitdata.cbrfeed.sql.gz | |
| gunzip /var/www/transitdata.cbrfeed.sql.gz | |
| psql -d transitdata -f /var/www/transitdata.cbrfeed.sql | |
| #createuser transitdata -SDRP | |
| #password transitdata | |
| #psql -d transitdata -c "GRANT SELECT ON TABLE agency,calendar,calendar_dates,routes,stop_times,stops,trips TO transitdata;" | |
| #psql -d transitdata -c "GRANT SELECT,INSERT ON TABLE myway_observations,myway_routes,myway_stops,myway_timingdeltas TO transitdata;" | |
| #psql -d transitdata -c "GRANT SELECT,INSERT,UPDATE ON TABLE myway_routes,myway_stops TO transitdata;" | |
| ##psql -d transitdata -c "GRANT SELECT ON ALL TABLES IN SCHEMA public TO transitdata;" | |
| php /var/www/updatedb.php |
| wget http://s3-ap-southeast-1.amazonaws.com/busresources/Graph.obj \ | |
| -O /tmp/Graph.obj | |
| /etc/init.d/tomcat6 stop | |
| rm -rfv /usr/share/tomcat6/webapps/opentripplanner* | |
| wget http://s3-ap-southeast-1.amazonaws.com/busresources/opentripplanner-webapp.war \ | |
| -O /usr/share/tomcat6/webapps/opentripplanner-webapp.war | |
| wget http://s3-ap-southeast-1.amazonaws.com/busresources/opentripplanner-api-webapp.war \ | |
| -O /usr/share/tomcat6/webapps/opentripplanner-api-webapp.war | |
| /etc/init.d/tomcat6 restart | |
| wget http://s3-ap-southeast-1.amazonaws.com/busresources/testing/Graph.obj \ | |
| -O /tmp/Graph.obj | |
| /etc/init.d/tomcat6 stop | |
| rm -rfv /usr/share/tomcat6/webapps/opentripplanner* | |
| wget http://s3-ap-southeast-1.amazonaws.com/busresources/testing/opentripplanner-webapp.war \ | |
| -O /usr/share/tomcat6/webapps/opentripplanner-webapp.war | |
| wget http://s3-ap-southeast-1.amazonaws.com/busresources/testing/opentripplanner-api-webapp.war \ | |
| -O /usr/share/tomcat6/webapps/opentripplanner-api-webapp.war | |
| /etc/init.d/tomcat6 restart | |
| cp /root/aws.php /tmp/ | |
| mkdir /var/www/lib/staticmaplite/cache | |
| chcon -h system_u:object_r:httpd_sys_content_t /var/www | |
| chcon -R -h root:object_r:httpd_sys_content_t /var/www/* | |
| chcon -R -t httpd_sys_content_rw_t /var/www/lib/staticmaplite/cache | |
| chmod -R 777 /var/www/lib/staticmaplite/cache | |
| chcon -R -t httpd_sys_content_rw_t /var/www/labs/tiles | |
| chmod -R 777 /var/www/labs/tiles | |
| wget http://s3-ap-southeast-1.amazonaws.com/busresources/cbrfeed.zip \ | |
| -O /var/www/cbrfeed.zip |
| <?xml version="1.0" encoding="UTF-8"?> | |
| <beans xmlns="http://www.springframework.org/schema/beans" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" | |
| xsi:schemaLocation="http://www.springframework.org/schema/beans http://www.springframework.org/schema/beans/spring-beans-2.5.xsd"> | |
| <!-- Single graph --> | |
| <import resource="classpath:org/opentripplanner/api/application-context.xml" /> | |
| <bean id="graphBundle" class="org.opentripplanner.model.GraphBundle"> | |
| <property name="path" value="/tmp/" /> | |
| </bean> | |
| </beans> | |
| /*! | |
| * jQuery Mobile v1.0b1 | |
| * http://jquerymobile.com/ | |
| * | |
| * Copyright 2010, jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| /* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses. | |
| * Note: Code is in draft form and is subject to change | |
| */ | |
| /* A | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-bar-a { | |
| border: 1px solid #2A2A2A; | |
| background: #111111; | |
| color: #ffffff; | |
| font-weight: bold; | |
| text-shadow: 0 -1px 1px #000000; | |
| background-image: -moz-linear-gradient(top, | |
| #3c3c3c, | |
| #111111); | |
| background-image: -webkit-gradient(linear,left top,left bottom, | |
| color-stop(0, #3c3c3c), | |
| color-stop(1, #111111)); | |
| -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#3c3c3c', EndColorStr='#111111')"; | |
| } | |
| .ui-bar-a, | |
| .ui-bar-a input, | |
| .ui-bar-a select, | |
| .ui-bar-a textarea, | |
| .ui-bar-a button { | |
| font-family: Helvetica, Arial, sans-serif; | |
| } | |
| .ui-bar-a .ui-link-inherit { | |
| color: #fff; | |
| } | |
| .ui-bar-a .ui-link { | |
| color: #7cc4e7; | |
| font-weight: bold; | |
| } | |
| .ui-body-a { | |
| border: 1px solid #2A2A2A; | |
| background: #222222; | |
| color: #fff; | |
| text-shadow: 0 1px 0 #000; | |
| font-weight: normal; | |
| background-image: -moz-linear-gradient(top, | |
| #666666, | |
| #222222); | |
| background-image: -webkit-gradient(linear,left top,left bottom, | |
| color-stop(0, #666666), | |
| color-stop(1, #222222)); | |
| -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#666666', EndColorStr='#222222)')"; | |
| } | |
| .ui-body-a, | |
| .ui-body-a input, | |
| .ui-body-a select, | |
| .ui-body-a textarea, | |
| .ui-body-a button { | |
| font-family: Helvetica, Arial, sans-serif; | |
| } | |
| .ui-body-a .ui-link-inherit { | |
| color: #fff; | |
| } | |
| .ui-body-a .ui-link { | |
| color: #2489CE; | |
| font-weight: bold; | |
| } | |
| .ui-br { | |
| border-bottom: rgb(130,130,130); | |
| border-bottom: rgba(130,130,130,.3); | |
| border-bottom-width: 1px; | |
| border-bottom-style: solid; | |
| } | |
| .ui-btn-up-a { | |
| border: 1px solid #222; | |
| background: #333333; | |
| font-weight: bold; | |
| color: #fff; | |
| text-shadow: 0 -1px 1px #000; | |
| background-image: -moz-linear-gradient(top, | |
| #555555, | |
| #333333); | |
| background-image: -webkit-gradient(linear,left top,left bottom, | |
| color-stop(0, #555555), | |
| color-stop(1, #333333)); | |
| -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#555555', EndColorStr='#333333')"; | |
| } | |
| .ui-btn-up-a a.ui-link-inherit { | |
| color: #fff; | |
| } | |
| .ui-btn-hover-a { | |
| border: 1px solid #000; | |
| background: #444444; | |
| font-weight: bold; | |
| color: #fff; | |
| text-shadow: 0 -1px 1px #000; | |
| background-image: -moz-linear-gradient(top, | |
| #666666, | |
| #444444); | |
| background-image: -webkit-gradient(linear,left top,left bottom, | |
| color-stop(0, #666666), | |
| color-stop(1, #444444)); | |
| -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#666666', EndColorStr='#444444')"; | |
| } | |
| .ui-btn-hover-a a.ui-link-inherit { | |
| color: #fff; | |
| } | |
| .ui-btn-down-a { | |
| border: 1px solid #000; | |
| background: #3d3d3d; | |
| font-weight: bold; | |
| color: #fff; | |
| text-shadow: 0 -1px 1px #000; | |
| background-image: -moz-linear-gradient(top, | |
| #333333, | |
| #5a5a5a); | |
| background-image: -webkit-gradient(linear,left top,left bottom, | |
| color-stop(0, #333333), | |
| color-stop(1, #5a5a5a)); | |
| -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#333333', EndColorStr='#5a5a5a')"; | |
| } | |
| .ui-btn-down-a a.ui-link-inherit { | |
| color: #fff; | |
| } | |
| .ui-btn-up-a, | |
| .ui-btn-hover-a, | |
| .ui-btn-down-a { | |
| font-family: Helvetica, Arial, sans-serif; | |
| text-decoration: none; | |
| } | |
| /* B | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-bar-b { | |
| border: 1px solid #456f9a; | |
| background: #5e87b0; | |
| color: #fff; | |
| font-weight: bold; | |
| text-shadow: 0 -1px 1px #254f7a; | |
| background-image: -moz-linear-gradient(top, | |
| #81a8ce, | |
| #5e87b0); | |
| background-image: -webkit-gradient(linear,left top,left bottom, | |
| color-stop(0, #81a8ce), | |
| color-stop(1, #5e87b0)); | |
| -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#81a8ce', EndColorStr='#5e87b0')"; | |
| } | |
| .ui-bar-b, | |
| .ui-bar-b input, | |
| .ui-bar-b select, | |
| .ui-bar-b textarea, | |
| .ui-bar-b button { | |
| font-family: Helvetica, Arial, sans-serif; | |
| } | |
| .ui-bar-b .ui-link-inherit { | |
| color: #fff; | |
| } | |
| .ui-bar-b .ui-link { | |
| color: #7cc4e7; | |
| font-weight: bold; | |
| } | |
| .ui-body-b { | |
| border: 1px solid #C6C6C6; | |
| background: #cccccc; | |
| color: #333333; | |
| text-shadow: 0 1px 0 #fff; | |
| font-weight: normal; | |
| background-image: -moz-linear-gradient(top, | |
| #e6e6e6, | |
| #cccccc); | |
| background-image: -webkit-gradient(linear,left top,left bottom, | |
| color-stop(0, #e6e6e6), | |
| color-stop(1, #cccccc)); | |
| -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#e6e6e6', EndColorStr='#cccccc')"; | |
| } | |
| .ui-body-b, | |
| .ui-body-b input, | |
| .ui-body-b select, | |
| .ui-body-b textarea, | |
| .ui-body-b button { | |
| font-family: Helvetica, Arial, sans-serif; | |
| } | |
| .ui-body-b .ui-link-inherit { | |
| color: #333333; | |
| } | |
| .ui-body-b .ui-link { | |
| color: #2489CE; | |
| font-weight: bold; | |
| } | |
| .ui-btn-up-b { | |
| border: 1px solid #145072; | |
| background: #2567ab; | |
| font-weight: bold; | |
| color: #fff; | |
| text-shadow: 0 -1px 1px #145072; | |
| background-image: -moz-linear-gradient(top, | |
| #4e89c5, | |
| #2567ab); | |
| background-image: -webkit-gradient(linear,left top,left bottom, | |
| color-stop(0, #5f9cc5), | |
| color-stop(1, #396b9e)); | |
| -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#4e89c5', EndColorStr='#2567ab')"; | |
| } | |
| .ui-btn-up-b a.ui-link-inherit { | |
| color: #fff; | |
| } | |
| .ui-btn-hover-b { | |
| border: 1px solid #00516e; | |
| background: #4b88b6; | |
| font-weight: bold; | |
| color: #fff; | |
| text-shadow: 0 -1px 1px #014D68; | |
| background-image: -moz-linear-gradient(top, | |
| #72b0d4, | |
| #4b88b6); | |
| background-image: -webkit-gradient(linear,left top,left bottom, | |
| color-stop(0, #72b0d4), | |
| color-stop(1, #4b88b6)); | |
| -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#72b0d4', EndColorStr='#4b88b6')"; | |
| } | |
| .ui-btn-hover-b a.ui-link-inherit { | |
| color: #fff; | |
| } | |
| .ui-btn-down-b { | |
| border: 1px solid #225377; | |
| background: #4e89c5; | |
| font-weight: bold; | |
| color: #fff; | |
| text-shadow: 0 -1px 1px #225377; | |
| background-image: -moz-linear-gradient(top, | |
| #396b9e, | |
| #4e89c5); | |
| background-image: -webkit-gradient(linear,left top,left bottom, | |
| color-stop(0, #396b9e), | |
| color-stop(1, #4e89c5)); | |
| -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#396b9e', EndColorStr='#4e89c5')"; | |
| } | |
| .ui-btn-down-b a.ui-link-inherit { | |
| color: #fff; | |
| } | |
| .ui-btn-up-b, | |
| .ui-btn-hover-b, | |
| .ui-btn-down-b { | |
| font-family: Helvetica, Arial, sans-serif; | |
| text-decoration: none; | |
| } | |
| /* C | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-bar-c { | |
| border: 1px solid #B3B3B3; | |
| background: #e9eaeb; | |
| color: #3E3E3E; | |
| font-weight: bold; | |
| text-shadow: 0 1px 1px #fff; | |
| background-image: -moz-linear-gradient(top, | |
| #f0f0f0, | |
| #e9eaeb); | |
| background-image: -webkit-gradient(linear,left top,left bottom, | |
| color-stop(0, #f0f0f0), | |
| color-stop(1, #e9eaeb)); | |
| -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#f0f0f0', EndColorStr='#e9eaeb')"; | |
| } | |
| .ui-bar-c, | |
| .ui-bar-c input, | |
| .ui-bar-c select, | |
| .ui-bar-c textarea, | |
| .ui-bar-c button { | |
| font-family: Helvetica, Arial, sans-serif; | |
| } | |
| .ui-body-c { | |
| border: 1px solid #B3B3B3; | |
| color: #333333; | |
| text-shadow: 0 1px 0 #fff; | |
| background: #f0f0f0; | |
| background-image: -moz-linear-gradient(top, | |
| #eeeeee, | |
| #dddddd); | |
| background-image: -webkit-gradient(linear,left top,left bottom, | |
| color-stop(0, #eeeeee), | |
| color-stop(1, #dddddd)); | |
| -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#eeeeee', EndColorStr='#dddddd')"; | |
| } | |
| .ui-body-c, | |
| .ui-body-c input, | |
| .ui-body-c select, | |
| .ui-body-c textarea, | |
| .ui-body-c button { | |
| font-family: Helvetica, Arial, sans-serif; | |
| } | |
| .ui-body-c .ui-link-inherit { | |
| color: #333333; | |
| } | |
| .ui-body-c .ui-link { | |
| color: #2489CE; | |
| font-weight: bold; | |
| } | |
| .ui-btn-up-c { | |
| border: 1px solid #ccc; | |
| background: #eee; | |
| font-weight: bold; | |
| color: #444; | |
| text-shadow: 0 1px 1px #f6f6f6; | |
| background-image: -moz-linear-gradient(top, | |
| #fefefe, | |
| #eeeeee); | |
| background-image: -webkit-gradient(linear,left top,left bottom, | |
| color-stop(0, #fdfdfd), | |
| color-stop(1, #eeeeee)); | |
| -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#fdfdfd', EndColorStr='#eeeeee')"; | |
| } | |
| .ui-btn-up-c a.ui-link-inherit { | |
| color: #2F3E46; | |
| } | |
| .ui-btn-hover-c { | |
| border: 1px solid #bbb; | |
| background: #dadada; | |
| font-weight: bold; | |
| color: #101010; | |
| text-shadow: 0 1px 1px #fff; | |
| background-image: -moz-linear-gradient(top, | |
| #ededed, | |
| #dadada); | |
| background-image: -webkit-gradient(linear,left top,left bottom, | |
| color-stop(0, #ededed), | |
| color-stop(1, #dadada)); | |
| -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#ededed', EndColorStr='#dadada')"; | |
| } | |
| .ui-btn-hover-c a.ui-link-inherit { | |
| color: #2F3E46; | |
| } | |
| .ui-btn-down-c { | |
| border: 1px solid #808080; | |
| background: #fdfdfd; | |
| font-weight: bold; | |
| color: #111111; | |
| text-shadow: 0 1px 1px #ffffff; | |
| background-image: -moz-linear-gradient(top, | |
| #eeeeee, | |
| #fdfdfd); | |
| background-image: -webkit-gradient(linear,left top,left bottom, | |
| color-stop(0, #eeeeee), | |
| color-stop(1, #fdfdfd)); | |
| -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#eeeeee', EndColorStr='#fdfdfd')"; | |
| } | |
| .ui-btn-down-c a.ui-link-inherit { | |
| color: #2F3E46; | |
| } | |
| .ui-btn-up-c, | |
| .ui-btn-hover-c, | |
| .ui-btn-down-c { | |
| font-family: Helvetica, Arial, sans-serif; | |
| text-decoration: none; | |
| } | |
| /* D | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-bar-d { | |
| border: 1px solid #ccc; | |
| background: #bbb; | |
| color: #333; | |
| text-shadow: 0 1px 0 #eee; | |
| background-image: -moz-linear-gradient(top, | |
| #ddd, | |
| #bbb); | |
| background-image: -webkit-gradient(linear,left top,left bottom, | |
| color-stop(0, #ddd), | |
| color-stop(1, #bbb)); | |
| -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#dddddd', EndColorStr='#bbbbbb')"; | |
| } | |
| .ui-bar-d, | |
| .ui-bar-d input, | |
| .ui-bar-d select, | |
| .ui-bar-d textarea, | |
| .ui-bar-d button { | |
| font-family: Helvetica, Arial, sans-serif; | |
| } | |
| .ui-bar-d .ui-link-inherit { | |
| color: #333; | |
| } | |
| .ui-bar-d .ui-link { | |
| color: #2489CE; | |
| font-weight: bold; | |
| } | |
| .ui-body-d { | |
| border: 1px solid #ccc; | |
| color: #333333; | |
| text-shadow: 0 1px 0 #fff; | |
| background: #ffffff; | |
| } | |
| .ui-body-d, | |
| .ui-body-d input, | |
| .ui-body-d select, | |
| .ui-body-d textarea, | |
| .ui-body-d button { | |
| font-family: Helvetica, Arial, sans-serif; | |
| } | |
| .ui-body-d .ui-link-inherit { | |
| color: #333333; | |
| } | |
| .ui-body-d .ui-link { | |
| color: #2489CE; | |
| font-weight: bold; | |
| } | |
| .ui-btn-up-d { | |
| border: 1px solid #ccc; | |
| background: #fff; | |
| font-weight: bold; | |
| color: #444; | |
| text-shadow: 0 1px 1px #fff; | |
| } | |
| .ui-btn-up-d a.ui-link-inherit { | |
| color: #333; | |
| } | |
| .ui-btn-hover-d { | |
| border: 1px solid #aaa; | |
| background: #eeeeee; | |
| font-weight: bold; | |
| color: #222; | |
| cursor: pointer; | |
| text-shadow: 0 1px 1px #fff; | |
| background-image: -moz-linear-gradient(top, | |
| #fdfdfd, | |
| #eeeeee); | |
| background-image: -webkit-gradient(linear,left top,left bottom, | |
| color-stop(0, #fdfdfd), | |
| color-stop(1, #eeeeee)); | |
| -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#fdfdfd', EndColorStr='#eeeeee')"; | |
| } | |
| .ui-btn-hover-d a.ui-link-inherit { | |
| color: #222; | |
| } | |
| .ui-btn-down-d { | |
| border: 1px solid #aaaaaa; | |
| background: #ffffff; | |
| font-weight: bold; | |
| color: #111; | |
| text-shadow: 0 1px 1px #ffffff; | |
| background-image: -moz-linear-gradient(top, | |
| #eeeeee, | |
| #ffffff); | |
| background-image: -webkit-gradient(linear,left top,left bottom, | |
| color-stop(0, #eeeeee), | |
| color-stop(1, #ffffff)); | |
| -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#eeeeee', EndColorStr='#ffffff')"; | |
| } | |
| .ui-btn-down-d a.ui-link-inherit { | |
| color: #111; | |
| } | |
| .ui-btn-up-d, | |
| .ui-btn-hover-d, | |
| .ui-btn-down-d { | |
| font-family: Helvetica, Arial, sans-serif; | |
| text-decoration: none; | |
| } | |
| /* E | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-bar-e { | |
| border: 1px solid #F7C942; | |
| background: #fadb4e; | |
| color: #333; | |
| text-shadow: 0 1px 0 #fff; | |
| background-image: -moz-linear-gradient(top, | |
| #fceda7, | |
| #fadb4e); | |
| background-image: -webkit-gradient(linear,left top,left bottom, | |
| color-stop(0, #fceda7), | |
| color-stop(1, #fadb4e)); | |
| -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#fceda7', EndColorStr='#fadb4e')"; | |
| } | |
| .ui-bar-e, | |
| .ui-bar-e input, | |
| .ui-bar-e select, | |
| .ui-bar-e textarea, | |
| .ui-bar-d button { | |
| font-family: Helvetica, Arial, sans-serif; | |
| } | |
| .ui-bar-e .ui-link-inherit { | |
| color: #333; | |
| } | |
| .ui-bar-e .ui-link { | |
| color: #2489CE; | |
| font-weight: bold; | |
| } | |
| .ui-body-e { | |
| border: 1px solid #F7C942; | |
| color: #333333; | |
| text-shadow: 0 1px 0 #fff; | |
| background: #faeb9e; | |
| background-image: -moz-linear-gradient(top, | |
| #fff, | |
| #faeb9e); | |
| background-image: -webkit-gradient(linear,left top,left bottom, | |
| color-stop(0, #fff), | |
| color-stop(1, #faeb9e)); | |
| -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#ffffff', EndColorStr='#faeb9e')"; | |
| } | |
| .ui-body-e, | |
| .ui-body-e input, | |
| .ui-body-e select, | |
| .ui-body-e textarea, | |
| .ui-body-e button { | |
| font-family: Helvetica, Arial, sans-serif; | |
| } | |
| .ui-body-e .ui-link-inherit { | |
| color: #333333; | |
| } | |
| .ui-body-e .ui-link { | |
| color: #2489CE; | |
| font-weight: bold; | |
| } | |
| .ui-btn-up-e { | |
| border: 1px solid #F7C942; | |
| background: #fadb4e; | |
| font-weight: bold; | |
| color: #333; | |
| text-shadow: 0 1px 0 #fff; | |
| background-image: -moz-linear-gradient(top, | |
| #fceda7, | |
| #fadb4e); | |
| background-image: -webkit-gradient(linear,left top,left bottom, | |
| color-stop(0, #fceda7), | |
| color-stop(1, #fadb4e)); | |
| -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#fceda7', EndColorStr='#fadb4e')"; | |
| } | |
| .ui-btn-up-e a.ui-link-inherit { | |
| color: #333; | |
| } | |
| .ui-btn-hover-e { | |
| border: 1px solid #e79952; | |
| background: #fbe26f; | |
| font-weight: bold; | |
| color: #111; | |
| text-shadow: 0 1px 1px #fff; | |
| background-image: -moz-linear-gradient(top, | |
| #fcf0b5, | |
| #fbe26f); | |
| background-image: -webkit-gradient(linear,left top,left bottom, | |
| color-stop(0, #fcf0b5), | |
| color-stop(1, #fbe26f)); | |
| -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#fcf0b5', EndColorStr='#fbe26f')"; | |
| } | |
| .ui-btn-hover-e a.ui-link-inherit { | |
| color: #333; | |
| } | |
| .ui-btn-down-e { | |
| border: 1px solid #F7C942; | |
| background: #fceda7; | |
| font-weight: bold; | |
| color: #111; | |
| text-shadow: 0 1px 1px #ffffff; | |
| background-image: -moz-linear-gradient(top, | |
| #fadb4e, | |
| #fceda7); | |
| background-image: -webkit-gradient(linear,left top,left bottom, | |
| color-stop(0, #fadb4e), | |
| color-stop(1, #fceda7)); | |
| -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#fadb4e', EndColorStr='#fceda7')"; | |
| } | |
| .ui-btn-down-e a.ui-link-inherit { | |
| color: #333; | |
| } | |
| .ui-btn-up-e, | |
| .ui-btn-hover-e, | |
| .ui-btn-down-e { | |
| font-family: Helvetica, Arial, sans-serif; | |
| text-decoration: none; | |
| } | |
| /* links within "buttons" | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| a.ui-link-inherit { | |
| text-decoration: none !important; | |
| } | |
| /* Active class used as the "on" state across all themes | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-btn-active { | |
| border: 1px solid #155678; | |
| background: #4596ce; | |
| font-weight: bold; | |
| color: #fff; | |
| cursor: pointer; | |
| text-shadow: 0 -1px 1px #145072; | |
| text-decoration: none; | |
| background-image: -moz-linear-gradient(top, | |
| #85bae4, | |
| #5393c5); | |
| background-image: -webkit-gradient(linear,left top,left bottom, | |
| color-stop(0, #85bae4), | |
| color-stop(1, #5393c5)); | |
| -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#85bae4', EndColorStr='#5393c5')"; | |
| outline: none; | |
| } | |
| .ui-btn-active a.ui-link-inherit { | |
| color: #fff; | |
| } | |
| /* button inner top highlight | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-btn-inner { | |
| border-top: 1px solid #fff; | |
| border-color: rgba(255,255,255,.3); | |
| } | |
| /* corner rounding classes | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-corner-tl { | |
| -moz-border-radius-topleft: .6em; | |
| -webkit-border-top-left-radius: .6em; | |
| border-top-left-radius: .6em; | |
| } | |
| .ui-corner-tr { | |
| -moz-border-radius-topright: .6em; | |
| -webkit-border-top-right-radius: .6em; | |
| border-top-right-radius: .6em; | |
| } | |
| .ui-corner-bl { | |
| -moz-border-radius-bottomleft: .6em; | |
| -webkit-border-bottom-left-radius: .6em; | |
| border-bottom-left-radius: .6em; | |
| } | |
| .ui-corner-br { | |
| -moz-border-radius-bottomright: .6em; | |
| -webkit-border-bottom-right-radius: .6em; | |
| border-bottom-right-radius: .6em; | |
| } | |
| .ui-corner-top { | |
| -moz-border-radius-topleft: .6em; | |
| -webkit-border-top-left-radius: .6em; | |
| border-top-left-radius: .6em; | |
| -moz-border-radius-topright: .6em; | |
| -webkit-border-top-right-radius: .6em; | |
| border-top-right-radius: .6em; | |
| } | |
| .ui-corner-bottom { | |
| -moz-border-radius-bottomleft: .6em; | |
| -webkit-border-bottom-left-radius: .6em; | |
| border-bottom-left-radius: .6em; | |
| -moz-border-radius-bottomright: .6em; | |
| -webkit-border-bottom-right-radius: .6em; | |
| border-bottom-right-radius: .6em; | |
| } | |
| .ui-corner-right { | |
| -moz-border-radius-topright: .6em; | |
| -webkit-border-top-right-radius: .6em; | |
| border-top-right-radius: .6em; | |
| -moz-border-radius-bottomright: .6em; | |
| -webkit-border-bottom-right-radius: .6em; | |
| border-bottom-right-radius: .6em; | |
| } | |
| .ui-corner-left { | |
| -moz-border-radius-topleft: .6em; | |
| -webkit-border-top-left-radius: .6em; | |
| border-top-left-radius: .6em; | |
| -moz-border-radius-bottomleft: .6em; | |
| -webkit-border-bottom-left-radius: .6em; | |
| border-bottom-left-radius: .6em; | |
| } | |
| .ui-corner-all { | |
| -moz-border-radius: .6em; | |
| -webkit-border-radius: .6em; | |
| border-radius: .6em; | |
| } | |
| /* Interaction cues | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-disabled { | |
| opacity: .3; | |
| } | |
| .ui-disabled, | |
| .ui-disabled a { | |
| cursor: default; | |
| } | |
| /* Icons | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-icon { | |
| background: #666; | |
| background: rgba(0,0,0,.4); | |
| background-image: url(images/icons-18-white.png); | |
| background-repeat: no-repeat; | |
| -moz-border-radius: 9px; | |
| -webkit-border-radius: 9px; | |
| border-radius: 9px; | |
| } | |
| /* Alt icon color | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-icon-alt { | |
| background: #fff; | |
| background: rgba(255,255,255,.3); | |
| background-image: url(images/icons-18-black.png); | |
| background-repeat: no-repeat; | |
| } | |
| /* HD/"retina" sprite | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| @media only screen and (-webkit-min-device-pixel-ratio: 1.5), | |
| only screen and (min--moz-device-pixel-ratio: 1.5), | |
| only screen and (min-resolution: 240dpi) { | |
| .ui-icon-plus, .ui-icon-minus, .ui-icon-delete, .ui-icon-arrow-r, | |
| .ui-icon-arrow-l, .ui-icon-arrow-u, .ui-icon-arrow-d, .ui-icon-check, | |
| .ui-icon-gear, .ui-icon-refresh, .ui-icon-forward, .ui-icon-back, | |
| .ui-icon-grid, .ui-icon-star, .ui-icon-alert, .ui-icon-info, .ui-icon-home, .ui-icon-search, | |
| .ui-icon-checkbox-off, .ui-icon-checkbox-on, .ui-icon-radio-off, .ui-icon-radio-on { | |
| background-image: url(images/icons-36-white.png); | |
| -moz-background-size: 776px 18px; | |
| -o-background-size: 776px 18px; | |
| -webkit-background-size: 776px 18px; | |
| background-size: 776px 18px; | |
| } | |
| .ui-icon-alt { | |
| background-image: url(images/icons-36-black.png); | |
| } | |
| } | |
| /* plus minus */ | |
| .ui-icon-plus { | |
| background-position: -0 50%; | |
| } | |
| .ui-icon-minus { | |
| background-position: -36px 50%; | |
| } | |
| /* delete/close */ | |
| .ui-icon-delete { | |
| background-position: -72px 50%; | |
| } | |
| /* arrows */ | |
| .ui-icon-arrow-r { | |
| background-position: -108px 50%; | |
| } | |
| .ui-icon-arrow-l { | |
| background-position: -144px 50%; | |
| } | |
| .ui-icon-arrow-u { | |
| background-position: -180px 50%; | |
| } | |
| .ui-icon-arrow-d { | |
| background-position: -216px 50%; | |
| } | |
| /* misc */ | |
| .ui-icon-check { | |
| background-position: -252px 50%; | |
| } | |
| .ui-icon-gear { | |
| background-position: -288px 50%; | |
| } | |
| .ui-icon-refresh { | |
| background-position: -324px 50%; | |
| } | |
| .ui-icon-forward { | |
| background-position: -360px 50%; | |
| } | |
| .ui-icon-back { | |
| background-position: -396px 50%; | |
| } | |
| .ui-icon-grid { | |
| background-position: -432px 50%; | |
| } | |
| .ui-icon-star { | |
| background-position: -468px 50%; | |
| } | |
| .ui-icon-alert { | |
| background-position: -504px 50%; | |
| } | |
| .ui-icon-info { | |
| background-position: -540px 50%; | |
| } | |
| .ui-icon-home { | |
| background-position: -576px 50%; | |
| } | |
| .ui-icon-search { | |
| background-position: -612px 50%; | |
| } | |
| .ui-icon-checkbox-off { | |
| background-position: -684px 50%; | |
| } | |
| .ui-icon-checkbox-on { | |
| background-position: -648px 50%; | |
| } | |
| .ui-icon-radio-off { | |
| background-position: -756px 50%; | |
| } | |
| .ui-icon-radio-on { | |
| background-position: -720px 50%; | |
| } | |
| /* checks,radios */ | |
| .ui-icon-checkbox-off, | |
| .ui-icon-checkbox-on, | |
| .ui-icon-radio-off, | |
| .ui-icon-radio-on { | |
| background-color: transparent; | |
| -moz-border-radius: 0; | |
| -webkit-border-radius: 0; | |
| border-radius: 0; | |
| } | |
| .ui-icon-searchfield { | |
| background-image: url(images/icon-search-black.png); | |
| background-size: 16px 16px; | |
| } | |
| /* loading icon */ | |
| .ui-icon-loading { | |
| background-image: url(images/ajax-loader.png); | |
| width: 40px; | |
| height: 40px; | |
| -moz-border-radius: 20px; | |
| -webkit-border-radius: 20px; | |
| border-radius: 20px; | |
| background-size: 35px 35px; | |
| } | |
| /* Button corner classes | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-btn-corner-tl { | |
| -moz-border-radius-topleft: 1em; | |
| -webkit-border-top-left-radius: 1em; | |
| border-top-left-radius: 1em; | |
| } | |
| .ui-btn-corner-tr { | |
| -moz-border-radius-topright: 1em; | |
| -webkit-border-top-right-radius: 1em; | |
| border-top-right-radius: 1em; | |
| } | |
| .ui-btn-corner-bl { | |
| -moz-border-radius-bottomleft: 1em; | |
| -webkit-border-bottom-left-radius: 1em; | |
| border-bottom-left-radius: 1em; | |
| } | |
| .ui-btn-corner-br { | |
| -moz-border-radius-bottomright: 1em; | |
| -webkit-border-bottom-right-radius: 1em; | |
| border-bottom-right-radius: 1em; | |
| } | |
| .ui-btn-corner-top { | |
| -moz-border-radius-topleft: 1em; | |
| -webkit-border-top-left-radius: 1em; | |
| border-top-left-radius: 1em; | |
| -moz-border-radius-topright: 1em; | |
| -webkit-border-top-right-radius: 1em; | |
| border-top-right-radius: 1em; | |
| } | |
| .ui-btn-corner-bottom { | |
| -moz-border-radius-bottomleft: 1em; | |
| -webkit-border-bottom-left-radius: 1em; | |
| border-bottom-left-radius: 1em; | |
| -moz-border-radius-bottomright: 1em; | |
| -webkit-border-bottom-right-radius: 1em; | |
| border-bottom-right-radius: 1em; | |
| } | |
| .ui-btn-corner-right { | |
| -moz-border-radius-topright: 1em; | |
| -webkit-border-top-right-radius: 1em; | |
| border-top-right-radius: 1em; | |
| -moz-border-radius-bottomright: 1em; | |
| -webkit-border-bottom-right-radius: 1em; | |
| border-bottom-right-radius: 1em; | |
| } | |
| .ui-btn-corner-left { | |
| -moz-border-radius-topleft: 1em; | |
| -webkit-border-top-left-radius: 1em; | |
| border-top-left-radius: 1em; | |
| -moz-border-radius-bottomleft: 1em; | |
| -webkit-border-bottom-left-radius: 1em; | |
| border-bottom-left-radius: 1em; | |
| } | |
| .ui-btn-corner-all { | |
| -moz-border-radius: 1em; | |
| -webkit-border-radius: 1em; | |
| border-radius: 1em; | |
| } | |
| /* radius clip workaround for cleaning up corner trapping */ | |
| .ui-corner-tl, | |
| .ui-corner-tr, | |
| .ui-corner-bl, | |
| .ui-corner-br, | |
| .ui-corner-top, | |
| .ui-corner-bottom, | |
| .ui-corner-right, | |
| .ui-corner-left, | |
| .ui-corner-all, | |
| .ui-btn-corner-tl, | |
| .ui-btn-corner-tr, | |
| .ui-btn-corner-bl, | |
| .ui-btn-corner-br, | |
| .ui-btn-corner-top, | |
| .ui-btn-corner-bottom, | |
| .ui-btn-corner-right, | |
| .ui-btn-corner-left, | |
| .ui-btn-corner-all { | |
| -webkit-background-clip: padding-box; | |
| -moz-background-clip: padding-box; | |
| background-clip: padding-box; | |
| } | |
| /* Overlay / modal | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-overlay { | |
| background: #666; | |
| opacity: .5; | |
| filter: Alpha(Opacity=50); | |
| position: absolute; | |
| width: 100%; | |
| height: 100%; | |
| } | |
| .ui-overlay-shadow { | |
| -moz-box-shadow: 0px 0px 12px rgba(0,0,0,.6); | |
| -webkit-box-shadow: 0px 0px 12px rgba(0,0,0,.6); | |
| box-shadow: 0px 0px 12px rgba(0,0,0,.6); | |
| } | |
| .ui-shadow { | |
| -moz-box-shadow: 0px 1px 4px rgba(0,0,0,.3); | |
| -webkit-box-shadow: 0px 1px 4px rgba(0,0,0,.3); | |
| box-shadow: 0px 1px 4px rgba(0,0,0,.3); | |
| } | |
| .ui-bar-a .ui-shadow, | |
| .ui-bar-b .ui-shadow , | |
| .ui-bar-c .ui-shadow { | |
| -moz-box-shadow: 0px 1px 0 rgba(255,255,255,.3); | |
| -webkit-box-shadow: 0px 1px 0 rgba(255,255,255,.3); | |
| box-shadow: 0px 1px 0 rgba(255,255,255,.3); | |
| } | |
| .ui-shadow-inset { | |
| -moz-box-shadow: inset 0px 1px 4px rgba(0,0,0,.2); | |
| -webkit-box-shadow: inset 0px 1px 4px rgba(0,0,0,.2); | |
| box-shadow: inset 0px 1px 4px rgba(0,0,0,.2); | |
| } | |
| .ui-icon-shadow { | |
| -moz-box-shadow: 0px 1px 0 rgba(255,255,255,.4); | |
| -webkit-box-shadow: 0px 1px 0 rgba(255,255,255,.4); | |
| box-shadow: 0px 1px 0 rgba(255,255,255,.4); | |
| } | |
| /* Focus state - set here for specificity | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-focus { | |
| -moz-box-shadow: 0px 0px 12px #387bbe; | |
| -webkit-box-shadow: 0px 0px 12px #387bbe; | |
| box-shadow: 0px 0px 12px #387bbe; | |
| } | |
| /* unset box shadow in browsers that don't do it right | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-mobile-nosupport-boxshadow * { | |
| -moz-box-shadow: none !important; | |
| -webkit-box-shadow: none !important; | |
| box-shadow: none !important; | |
| } | |
| /* ...and bring back focus */ | |
| .ui-mobile-nosupport-boxshadow .ui-focus { | |
| outline-width: 2px; | |
| }/* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses. | |
| * Note: Code is in draft form and is subject to change | |
| */ | |
| /* some unsets - more probably needed */ | |
| .ui-mobile, .ui-mobile body { height: 100%; } | |
| .ui-mobile fieldset, .ui-page { padding: 0; margin: 0; } | |
| .ui-mobile a img, .ui-mobile fieldset { border: 0; } | |
| /* responsive page widths */ | |
| .ui-mobile-viewport { margin: 0; overflow-x: hidden; -webkit-text-size-adjust: none; -ms-text-size-adjust:none; -webkit-tap-highlight-color: rgba(0, 0, 0, 0); } | |
| /* "page" containers - full-screen views, one should always be in view post-pageload */ | |
| .ui-mobile [data-role=page], .ui-mobile [data-role=dialog], .ui-page { top: 0; left: 0; width: 100%; min-height: 100%; position: absolute; display: none; border: 0; } | |
| .ui-mobile .ui-page-active { display: block; overflow: visible; } | |
| /*orientations from js are available */ | |
| .portrait, | |
| .portrait .ui-page { min-height: 420px; } | |
| .landscape, | |
| .landscape .ui-page { min-height: 300px; } | |
| /* loading screen */ | |
| .ui-loading .ui-mobile-viewport { overflow: hidden !important; } | |
| .ui-loading .ui-loader { display: block; } | |
| .ui-loading .ui-page { overflow: hidden; } | |
| .ui-loader { display: none; position: absolute; opacity: .85; z-index: 100; left: 50%; width: 200px; margin-left: -130px; margin-top: -35px; padding: 10px 30px; } | |
| .ui-loader h1 { font-size: 15px; text-align: center; } | |
| .ui-loader .ui-icon { position: static; display: block; opacity: .9; margin: 0 auto; width: 35px; height: 35px; background-color: transparent; } | |
| /*fouc*/ | |
| .ui-mobile-rendering > * { visibility: hidden; } | |
| /*headers, content panels*/ | |
| .ui-bar, .ui-body { position: relative; padding: .4em 15px; overflow: hidden; display: block; clear:both; } | |
| .ui-bar { font-size: 16px; margin: 0; } | |
| .ui-bar h1, .ui-bar h2, .ui-bar h3, .ui-bar h4, .ui-bar h5, .ui-bar h6 { margin: 0; padding: 0; font-size: 16px; display: inline-block; } | |
| .ui-header, .ui-footer { display: block; } | |
| .ui-page .ui-header, .ui-page .ui-footer { position: relative; } | |
| .ui-header .ui-btn-left { position: absolute; left: 10px; top: .4em; } | |
| .ui-header .ui-btn-right { position: absolute; right: 10px; top: .4em; } | |
| .ui-header .ui-title, .ui-footer .ui-title { min-height: 1.1em; text-align: center; font-size: 16px; display: block; margin: .6em 90px .8em; padding: 0; text-overflow: ellipsis; overflow: hidden; white-space: nowrap; outline: 0 !important; } | |
| /*content area*/ | |
| .ui-content { border-width: 0; overflow: visible; overflow-x: hidden; padding: 15px; } | |
| .ui-page-fullscreen .ui-content { padding:0; } | |
| /* icons sizing */ | |
| .ui-icon { width: 18px; height: 18px; } | |
| /* fullscreen class on ui-content div */ | |
| .ui-fullscreen { } | |
| .ui-fullscreen img { max-width: 100%; } | |
| /* non-js content hiding */ | |
| .ui-nojs { position: absolute; left: -9999px; } | |
| /* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| .spin { | |
| -webkit-transform: rotate(360deg); | |
| -webkit-animation-name: spin; | |
| -webkit-animation-duration: 1s; | |
| -webkit-animation-iteration-count: infinite; | |
| } | |
| @-webkit-keyframes spin { | |
| from {-webkit-transform: rotate(0deg);} | |
| to {-webkit-transform: rotate(360deg);} | |
| } | |
| /* Transitions from jQtouch (with small modifications): http://www.jqtouch.com/ | |
| Built by David Kaneda and maintained by Jonathan Stark. | |
| */ | |
| .in, .out { | |
| -webkit-animation-timing-function: ease-in-out; | |
| -webkit-animation-duration: 350ms; | |
| } | |
| .slide.in { | |
| -webkit-transform: translateX(0); | |
| -webkit-animation-name: slideinfromright; | |
| } | |
| .slide.out { | |
| -webkit-transform: translateX(-100%); | |
| -webkit-animation-name: slideouttoleft; | |
| } | |
| .slide.in.reverse { | |
| -webkit-transform: translateX(0); | |
| -webkit-animation-name: slideinfromleft; | |
| } | |
| .slide.out.reverse { | |
| -webkit-transform: translateX(100%); | |
| -webkit-animation-name: slideouttoright; | |
| } | |
| .slideup.in { | |
| -webkit-transform: translateY(0); | |
| -webkit-animation-name: slideinfrombottom; | |
| z-index: 10; | |
| } | |
| .slideup.out { | |
| -webkit-animation-name: dontmove; | |
| z-index: 0; | |
| } | |
| .slideup.out.reverse { | |
| -webkit-transform: translateY(100%); | |
| z-index: 10; | |
| -webkit-animation-name: slideouttobottom; | |
| } | |
| .slideup.in.reverse { | |
| z-index: 0; | |
| -webkit-animation-name: dontmove; | |
| } | |
| .slidedown.in { | |
| -webkit-transform: translateY(0); | |
| -webkit-animation-name: slideinfromtop; | |
| z-index: 10; | |
| } | |
| .slidedown.out { | |
| -webkit-animation-name: dontmove; | |
| z-index: 0; | |
| } | |
| .slidedown.out.reverse { | |
| -webkit-transform: translateY(-100%); | |
| z-index: 10; | |
| -webkit-animation-name: slideouttotop; | |
| } | |
| .slidedown.in.reverse { | |
| z-index: 0; | |
| -webkit-animation-name: dontmove; | |
| } | |
| @-webkit-keyframes slideinfromright { | |
| from { -webkit-transform: translateX(100%); } | |
| to { -webkit-transform: translateX(0); } | |
| } | |
| @-webkit-keyframes slideinfromleft { | |
| from { -webkit-transform: translateX(-100%); } | |
| to { -webkit-transform: translateX(0); } | |
| } | |
| @-webkit-keyframes slideouttoleft { | |
| from { -webkit-transform: translateX(0); } | |
| to { -webkit-transform: translateX(-100%); } | |
| } | |
| @-webkit-keyframes slideouttoright { | |
| from { -webkit-transform: translateX(0); } | |
| to { -webkit-transform: translateX(100%); } | |
| } | |
| @-webkit-keyframes slideinfromtop { | |
| from { -webkit-transform: translateY(-100%); } | |
| to { -webkit-transform: translateY(0); } | |
| } | |
| @-webkit-keyframes slideinfrombottom { | |
| from { -webkit-transform: translateY(100%); } | |
| to { -webkit-transform: translateY(0); } | |
| } | |
| @-webkit-keyframes slideouttobottom { | |
| from { -webkit-transform: translateY(0); } | |
| to { -webkit-transform: translateY(100%); } | |
| } | |
| @-webkit-keyframes slideouttotop { | |
| from { -webkit-transform: translateY(0); } | |
| to { -webkit-transform: translateY(-100%); } | |
| } | |
| @-webkit-keyframes fadein { | |
| from { opacity: 0; } | |
| to { opacity: 1; } | |
| } | |
| @-webkit-keyframes fadeout { | |
| from { opacity: 1; } | |
| to { opacity: 0; } | |
| } | |
| .fade.in { | |
| opacity: 1; | |
| z-index: 10; | |
| -webkit-animation-name: fadein; | |
| } | |
| .fade.out { | |
| z-index: 0; | |
| -webkit-animation-name: fadeout; | |
| } | |
| /* The properties in this rule are only necessary for the 'flip' transition. | |
| * We need specify the perspective to create a projection matrix. This will add | |
| * some depth as the element flips. The depth number represents the distance of | |
| * the viewer from the z-plane. According to the CSS3 spec, 1000 is a moderate | |
| * value. | |
| */ | |
| .viewport-flip { | |
| -webkit-perspective: 1000; | |
| position: absolute; | |
| } | |
| .ui-mobile-viewport-transitioning, | |
| .ui-mobile-viewport-transitioning .ui-page { | |
| width: 100%; | |
| height: 100%; | |
| overflow: hidden; | |
| } | |
| .flip { | |
| -webkit-animation-duration: .65s; | |
| -webkit-backface-visibility:hidden; | |
| -webkit-transform:translateX(0); /* Needed to work around an iOS 3.1 bug that causes listview thumbs to disappear when -webkit-visibility:hidden is used. */ | |
| } | |
| .flip.in { | |
| -webkit-transform: rotateY(0) scale(1); | |
| -webkit-animation-name: flipinfromleft; | |
| } | |
| .flip.out { | |
| -webkit-transform: rotateY(-180deg) scale(.8); | |
| -webkit-animation-name: flipouttoleft; | |
| } | |
| /* Shake it all about */ | |
| .flip.in.reverse { | |
| -webkit-transform: rotateY(0) scale(1); | |
| -webkit-animation-name: flipinfromright; | |
| } | |
| .flip.out.reverse { | |
| -webkit-transform: rotateY(180deg) scale(.8); | |
| -webkit-animation-name: flipouttoright; | |
| } | |
| @-webkit-keyframes flipinfromright { | |
| from { -webkit-transform: rotateY(-180deg) scale(.8); } | |
| to { -webkit-transform: rotateY(0) scale(1); } | |
| } | |
| @-webkit-keyframes flipinfromleft { | |
| from { -webkit-transform: rotateY(180deg) scale(.8); } | |
| to { -webkit-transform: rotateY(0) scale(1); } | |
| } | |
| @-webkit-keyframes flipouttoleft { | |
| from { -webkit-transform: rotateY(0) scale(1); } | |
| to { -webkit-transform: rotateY(-180deg) scale(.8); } | |
| } | |
| @-webkit-keyframes flipouttoright { | |
| from { -webkit-transform: rotateY(0) scale(1); } | |
| to { -webkit-transform: rotateY(180deg) scale(.8); } | |
| } | |
| /* Hackish, but reliable. */ | |
| @-webkit-keyframes dontmove { | |
| from { opacity: 1; } | |
| to { opacity: 1; } | |
| } | |
| .pop { | |
| -webkit-transform-origin: 50% 50%; | |
| } | |
| .pop.in { | |
| -webkit-transform: scale(1); | |
| opacity: 1; | |
| -webkit-animation-name: popin; | |
| z-index: 10; | |
| } | |
| .pop.out.reverse { | |
| -webkit-transform: scale(.2); | |
| opacity: 0; | |
| -webkit-animation-name: popout; | |
| z-index: 10; | |
| } | |
| .pop.in.reverse { | |
| z-index: 0; | |
| -webkit-animation-name: dontmove; | |
| } | |
| @-webkit-keyframes popin { | |
| from { | |
| -webkit-transform: scale(.2); | |
| opacity: 0; | |
| } | |
| to { | |
| -webkit-transform: scale(1); | |
| opacity: 1; | |
| } | |
| } | |
| @-webkit-keyframes popout { | |
| from { | |
| -webkit-transform: scale(1); | |
| opacity: 1; | |
| } | |
| to { | |
| -webkit-transform: scale(.2); | |
| opacity: 0; | |
| } | |
| }/* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| /* content configurations. */ | |
| .ui-grid-a, .ui-grid-b, .ui-grid-c, .ui-grid-d { overflow: hidden; } | |
| .ui-block-a, .ui-block-b, .ui-block-c, .ui-block-d, .ui-block-e { margin: 0; padding: 0; border: 0; float: left; min-height:1px;} | |
| /* grid solo: 100 - single item fallback */ | |
| .ui-grid-solo .ui-block-a { width: 100%; float: none; } | |
| /* grid a: 50/50 */ | |
| .ui-grid-a .ui-block-a, .ui-grid-a .ui-block-b { width: 50%; } | |
| .ui-grid-a .ui-block-a { clear: left; } | |
| /* grid b: 33/33/33 */ | |
| .ui-grid-b .ui-block-a, .ui-grid-b .ui-block-b, .ui-grid-b .ui-block-c { width: 33.333%; } | |
| .ui-grid-b .ui-block-a { clear: left; } | |
| /* grid c: 25/25/25/25 */ | |
| .ui-grid-c .ui-block-a, .ui-grid-c .ui-block-b, .ui-grid-c .ui-block-c, .ui-grid-c .ui-block-d { width: 25%; } | |
| .ui-grid-c .ui-block-a { clear: left; } | |
| /* grid d: 20/20/20/20/20 */ | |
| .ui-grid-d .ui-block-a, .ui-grid-d .ui-block-b, .ui-grid-d .ui-block-c, .ui-grid-d .ui-block-d, .ui-grid-d .ui-block-e { width: 20%; } | |
| .ui-grid-d .ui-block-a { clear: left; } | |
| /* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| /* fixed page header & footer configuration */ | |
| .ui-header, .ui-footer, .ui-page-fullscreen .ui-header, .ui-page-fullscreen .ui-footer { position: absolute; overflow: hidden; width: 100%; border-left-width: 0; border-right-width: 0; } | |
| .ui-header-fixed, .ui-footer-fixed { | |
| z-index: 1000; | |
| -webkit-transform: translateZ(0); /* Force header/footer rendering to go through the same rendering pipeline as native page scrolling. */ | |
| } | |
| .ui-footer-duplicate, .ui-page-fullscreen .ui-fixed-inline { display: none; } | |
| .ui-page-fullscreen .ui-header, .ui-page-fullscreen .ui-footer { opacity: .9; } | |
| /* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| .ui-navbar { overflow: hidden; } | |
| .ui-navbar ul, .ui-navbar-expanded ul { list-style:none; padding: 0; margin: 0; position: relative; display: block; border: 0;} | |
| .ui-navbar-collapsed ul { float: left; width: 75%; margin-right: -2px; } | |
| .ui-navbar-collapsed .ui-navbar-toggle { float: left; width: 25%; } | |
| .ui-navbar li.ui-navbar-truncate { position: absolute; left: -9999px; top: -9999px; } | |
| .ui-navbar li .ui-btn, .ui-navbar .ui-navbar-toggle .ui-btn { display: block; font-size: 12px; text-align: center; margin: 0; border-right-width: 0; } | |
| .ui-navbar li .ui-btn { margin-right: -1px; } | |
| .ui-navbar li .ui-btn:last-child { margin-right: 0; } | |
| .ui-header .ui-navbar li .ui-btn, .ui-header .ui-navbar .ui-navbar-toggle .ui-btn, | |
| .ui-footer .ui-navbar li .ui-btn, .ui-footer .ui-navbar .ui-navbar-toggle .ui-btn { border-top-width: 0; border-bottom-width: 0; } | |
| .ui-navbar .ui-btn-inner { padding-left: 2px; padding-right: 2px; } | |
| .ui-navbar-noicons li .ui-btn .ui-btn-inner, .ui-navbar-noicons .ui-navbar-toggle .ui-btn-inner { padding-top: .8em; padding-bottom: .9em; } | |
| /*expanded page styles*/ | |
| .ui-navbar-expanded .ui-btn { margin: 0; font-size: 14px; } | |
| .ui-navbar-expanded .ui-btn-inner { padding-left: 5px; padding-right: 5px; } | |
| .ui-navbar-expanded .ui-btn-icon-top .ui-btn-inner { padding: 45px 5px 15px; text-align: center; } | |
| .ui-navbar-expanded .ui-btn-icon-top .ui-icon { top: 15px; } | |
| .ui-navbar-expanded .ui-btn-icon-bottom .ui-btn-inner { padding: 15px 5px 45px; text-align: center; } | |
| .ui-navbar-expanded .ui-btn-icon-bottom .ui-icon { bottom: 15px; } | |
| .ui-navbar-expanded li .ui-btn .ui-btn-inner { min-height: 2.5em; } | |
| .ui-navbar-expanded .ui-navbar-noicons .ui-btn .ui-btn-inner { padding-top: 1.8em; padding-bottom: 1.9em; } | |
| /* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| .ui-btn { display: block; text-align: center; cursor:pointer; position: relative; margin: .5em 5px; padding: 0; } | |
| .ui-btn:focus, .ui-btn:active { outline: none; } | |
| .ui-header .ui-btn, .ui-footer .ui-btn, .ui-bar .ui-btn { display: inline-block; font-size: 13px; margin: 0; } | |
| .ui-btn-inline { display: inline-block; } | |
| .ui-btn-inner { padding: .6em 25px; display: block; text-overflow: ellipsis; overflow: hidden; white-space: nowrap; position: relative; } | |
| .ui-header .ui-btn-inner, .ui-footer .ui-btn-inner, .ui-bar .ui-btn-inner { padding: .4em 8px .5em; } | |
| .ui-btn-icon-notext { display: inline-block; width: 20px; height: 20px; padding: 2px 1px 2px 3px; text-indent: -9999px; } | |
| .ui-btn-icon-notext .ui-btn-inner { padding: 0; } | |
| .ui-btn-icon-notext .ui-btn-text { position: absolute; left: -999px; } | |
| .ui-btn-icon-left .ui-btn-inner { padding-left: 33px; } | |
| .ui-header .ui-btn-icon-left .ui-btn-inner, | |
| .ui-footer .ui-btn-icon-left .ui-btn-inner, | |
| .ui-bar .ui-btn-icon-left .ui-btn-inner { padding-left: 27px; } | |
| .ui-btn-icon-right .ui-btn-inner { padding-right: 33px; } | |
| .ui-header .ui-btn-icon-right .ui-btn-inner, | |
| .ui-footer .ui-btn-icon-right .ui-btn-inner, | |
| .ui-bar .ui-btn-icon-right .ui-btn-inner { padding-right: 27px; } | |
| .ui-btn-icon-top .ui-btn-inner { padding-top: 33px; } | |
| .ui-header .ui-btn-icon-top .ui-btn-inner, | |
| .ui-footer .ui-btn-icon-top .ui-btn-inner, | |
| .ui-bar .ui-btn-icon-top .ui-btn-inner { padding-top: 27px; } | |
| .ui-btn-icon-bottom .ui-btn-inner { padding-bottom: 33px; } | |
| .ui-header .ui-btn-icon-bottom .ui-btn-inner, | |
| .ui-footer .ui-btn-icon-bottom .ui-btn-inner, | |
| .ui-bar .ui-btn-icon-bottom .ui-btn-inner { padding-bottom: 27px; } | |
| /*btn icon positioning*/ | |
| .ui-btn-icon-notext .ui-icon { display: block; } | |
| .ui-btn-icon-left .ui-icon, .ui-btn-icon-right .ui-icon { position: absolute; top: 50%; margin-top: -9px; } | |
| .ui-btn-icon-top .ui-icon, .ui-btn-icon-bottom .ui-icon { position: absolute; left: 50%; margin-left: -9px; } | |
| .ui-btn-icon-left .ui-icon { left: 10px; } | |
| .ui-btn-icon-right .ui-icon {right: 10px; } | |
| .ui-header .ui-btn-icon-left .ui-icon, | |
| .ui-footer .ui-btn-icon-left .ui-icon, | |
| .ui-bar .ui-btn-icon-left .ui-icon { left: 4px; } | |
| .ui-header .ui-btn-icon-right .ui-icon, | |
| .ui-footer .ui-btn-icon-right .ui-icon, | |
| .ui-bar .ui-btn-icon-right .ui-icon { right: 4px; } | |
| .ui-header .ui-btn-icon-top .ui-icon, | |
| .ui-footer .ui-btn-icon-top .ui-icon, | |
| .ui-bar .ui-btn-icon-top .ui-icon { top: 4px; } | |
| .ui-header .ui-btn-icon-bottom .ui-icon, | |
| .ui-footer .ui-btn-icon-bottom .ui-icon, | |
| .ui-bar .ui-btn-icon-bottom .ui-icon { bottom: 4px; } | |
| .ui-btn-icon-top .ui-icon { top: 5px; } | |
| .ui-btn-icon-bottom .ui-icon { bottom: 5px; } | |
| /*hiding native button,inputs */ | |
| .ui-btn-hidden { position: absolute; top: 0; left: 0; width: 100%; height: 100%; -webkit-appearance: button; opacity: 0; cursor: pointer; -ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=0)"; filter: alpha(opacity=0); background: transparent; } | |
| /* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| .ui-collapsible-contain { margin: .5em 0; } | |
| .ui-collapsible-heading { font-size: 16px; display: block; margin: 0 -8px; padding: 0; border-width: 0 0 1px 0; position: relative; } | |
| .ui-collapsible-heading a { text-align: left; margin: 0; } | |
| .ui-collapsible-heading a .ui-btn-inner { padding-left: 40px; } | |
| .ui-collapsible-heading a span.ui-btn { position: absolute; left: 6px; top: 50%; margin: -12px 0 0 0; width: 20px; height: 20px; padding: 1px 0px 1px 2px; text-indent: -9999px; } | |
| .ui-collapsible-heading a span.ui-btn .ui-btn-inner { padding: 10px 0; } | |
| .ui-collapsible-heading a span.ui-btn .ui-icon { left: 0; margin-top: -10px; } | |
| .ui-collapsible-heading-status { position:absolute; left:-9999px; } | |
| .ui-collapsible-content { display: block; padding: 10px 0 10px 8px; } | |
| .ui-collapsible-content-collapsed { display: none; } | |
| .ui-collapsible-set { margin: .5em 0; } | |
| .ui-collapsible-set .ui-collapsible-contain { margin: -1px 0 0; } | |
| /* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| .ui-controlgroup, fieldset.ui-controlgroup { padding: 0; margin: .5em 0 1em; } | |
| .ui-bar .ui-controlgroup { margin: 0 .3em; } | |
| .ui-controlgroup-label { font-size: 16px; line-height: 1.4; font-weight: normal; margin: 0 0 .3em; } | |
| .ui-controlgroup-controls { display: block; width: 95%;} | |
| .ui-controlgroup li { list-style: none; } | |
| .ui-controlgroup-vertical .ui-btn, | |
| .ui-controlgroup-vertical .ui-checkbox, .ui-controlgroup-vertical .ui-radio { margin: 0; border-bottom-width: 0; } | |
| .ui-controlgroup-vertical .ui-controlgroup-last { border-bottom-width: 1px; } | |
| .ui-controlgroup-horizontal { padding: 0; } | |
| .ui-controlgroup-horizontal .ui-btn, | |
| .ui-controlgroup-horizontal .ui-checkbox, .ui-controlgroup-horizontal .ui-radio { display: inline-block; margin: 0 -5px 0 0; } | |
| .ui-controlgroup-horizontal .ui-checkbox, .ui-controlgroup-horizontal .ui-radio { display: inline; } | |
| .ui-controlgroup-horizontal .ui-checkbox .ui-btn, .ui-controlgroup-horizontal .ui-radio .ui-btn, | |
| .ui-controlgroup-horizontal .ui-checkbox:last-child, .ui-controlgroup-horizontal .ui-radio:last-child { margin-right: 0; } | |
| .ui-controlgroup-horizontal .ui-controlgroup-last { margin-right: 0; } | |
| .ui-controlgroup .ui-checkbox label, .ui-controlgroup .ui-radio label { font-size: 16px; } | |
| /* conflicts with listview.. | |
| .ui-controlgroup .ui-btn-icon-notext { width: 30px; height: 30px; text-indent: -9999px; } | |
| .ui-controlgroup .ui-btn-icon-notext .ui-btn-inner { padding: 5px 6px 5px 5px; } | |
| */ | |
| @media all and (min-width: 450px){ | |
| .ui-controlgroup-label { vertical-align: top; display: inline-block; width: 20%; margin: 0 2% 0 0; } | |
| .ui-controlgroup-controls { width: 60%; display: inline-block; } | |
| } /* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| .ui-dialog { min-height: 480px; } | |
| .ui-dialog .ui-header, .ui-dialog .ui-content, .ui-dialog .ui-footer { margin: 15px; position: relative; } | |
| .ui-dialog .ui-header, .ui-dialog .ui-footer { z-index: 10; width: auto; } | |
| .ui-dialog .ui-content, .ui-dialog .ui-footer { margin-top: -15px; }/* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| .ui-checkbox, .ui-radio { position:relative; margin: .2em 0 .5em; z-index: 1; } | |
| .ui-checkbox .ui-btn, .ui-radio .ui-btn { margin: 0; text-align: left; z-index: 2; } | |
| .ui-checkbox .ui-btn-inner, .ui-radio .ui-btn-inner { white-space: normal; } | |
| .ui-checkbox .ui-btn-icon-left .ui-btn-inner,.ui-radio .ui-btn-icon-left .ui-btn-inner { padding-left: 45px; } | |
| .ui-checkbox .ui-btn-icon-right .ui-btn-inner, .ui-radio .ui-btn-icon-right .ui-btn-inner { padding-right: 45px; } | |
| .ui-checkbox .ui-icon, .ui-radio .ui-icon { top: 1.1em; } | |
| .ui-checkbox .ui-btn-icon-left .ui-icon, .ui-radio .ui-btn-icon-left .ui-icon {left: 15px; } | |
| .ui-checkbox .ui-btn-icon-right .ui-icon, .ui-radio .ui-btn-icon-right .ui-icon {right: 15px; } | |
| /* input, label positioning */ | |
| .ui-checkbox input,.ui-radio input { position:absolute; left:20px; top:50%; width: 10px; height: 10px; margin:-5px 0 0 0; outline: 0 !important; z-index: 1; }/* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| .ui-field-contain { background: none; padding: 1.5em 0; margin: 0; border-bottom-width: 1px; overflow: visible; } | |
| .ui-field-contain:first-child { border-top-width: 0; } | |
| @media all and (min-width: 450px){ | |
| .ui-field-contain { border-width: 0; padding: 0; margin: 1em 0; } | |
| } /* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| .ui-select { display: block; position: relative; } | |
| .ui-select select { position: absolute; left: -9999px; top: -9999px; } | |
| .ui-select .ui-btn { overflow: hidden; } | |
| .ui-select .ui-btn select { cursor: pointer; -webkit-appearance: button; left: 0; top:0; width: 100%; height: 100%; opacity: 0; -ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=0)"; filter: alpha(opacity=0); } | |
| @-moz-document url-prefix() {.ui-select .ui-btn select { opacity: 0.0001; }} | |
| .ui-select .ui-btn select.ui-select-nativeonly { opacity: 1; text-indent: 0; } | |
| .ui-select .ui-btn-icon-right .ui-btn-inner { padding-right: 45px; } | |
| .ui-select .ui-btn-icon-right .ui-icon { right: 15px; } | |
| /* labels */ | |
| label.ui-select { font-size: 16px; line-height: 1.4; font-weight: normal; margin: 0 0 .3em; display: block; } | |
| /*listbox*/ | |
| .ui-select .ui-btn-text, .ui-selectmenu .ui-btn-text { display: inline-block; min-height: 1em; } | |
| .ui-select .ui-btn-text { text-overflow: ellipsis; overflow: hidden; display: block;} | |
| .ui-selectmenu { position: absolute; padding: 0; z-index: 100 !important; width: 80%; max-width: 350px; padding: 6px; } | |
| .ui-selectmenu .ui-listview { margin: 0; } | |
| .ui-selectmenu .ui-btn.ui-li-divider { cursor: default; } | |
| .ui-selectmenu-hidden { top: -9999px; left: -9999px; } | |
| .ui-selectmenu-screen { position: absolute; top: 0; left: 0; width: 100%; height: 100%; z-index: 99; } | |
| .ui-screen-hidden, .ui-selectmenu-list .ui-li .ui-icon { display: none; } | |
| .ui-selectmenu-list .ui-li .ui-icon { display: block; } | |
| .ui-li.ui-selectmenu-placeholder { display: none; } | |
| .ui-selectmenu .ui-header .ui-title { margin: 0.6em 46px 0.8em; } | |
| @media all and (min-width: 450px){ | |
| label.ui-select { display: inline-block; width: 20%; margin: 0 2% 0 0; } | |
| .ui-select { width: 60%; display: inline-block; } | |
| } | |
| /* when no placeholder is defined in a multiple select, the header height doesn't even extend past the close button. this shim's content in there */ | |
| .ui-selectmenu .ui-header h1:after { content: '.'; visibility: hidden; }/* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| label.ui-input-text { font-size: 16px; line-height: 1.4; display: block; font-weight: normal; margin: 0 0 .3em; } | |
| input.ui-input-text, textarea.ui-input-text { background-image: none; padding: .4em; line-height: 1.4; font-size: 16px; display: block; width: 95%; } | |
| input.ui-input-text { -webkit-appearance: none; } | |
| textarea.ui-input-text { height: 50px; -webkit-transition: height 200ms linear; -moz-transition: height 200ms linear; -o-transition: height 200ms linear; transition: height 200ms linear; } | |
| .ui-input-search { padding: 0 30px; width: 77%; background-position: 8px 50%; background-repeat: no-repeat; position: relative; } | |
| .ui-input-search input.ui-input-text { border: none; width: 98%; padding: .4em 0; margin: 0; display: block; background: transparent none; outline: 0 !important; } | |
| .ui-input-search .ui-input-clear { position: absolute; right: 0; top: 50%; margin-top: -14px; } | |
| .ui-input-search .ui-input-clear-hidden { display: none; } | |
| /* orientation adjustments - incomplete!*/ | |
| @media all and (min-width: 450px){ | |
| label.ui-input-text { vertical-align: top; display: inline-block; width: 20%; margin: 0 2% 0 0 } | |
| input.ui-input-text, | |
| textarea.ui-input-text, | |
| .ui-input-search { width: 60%; display: inline-block; } | |
| .ui-input-search { width: 50%; } | |
| .ui-input-search input.ui-input-text { width: 98%; /*echos rule from above*/ } | |
| }/* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| .ui-listview { margin: 0; counter-reset: listnumbering; } | |
| .ui-content .ui-listview { margin: -15px; } | |
| .ui-content .ui-listview-inset { margin: 1em 0; } | |
| .ui-listview, .ui-li { list-style:none; padding:0; } | |
| .ui-li, .ui-li.ui-field-contain { display: block; margin:0; position: relative; overflow: visible; text-align: left; border-width: 0; border-top-width: 1px; } | |
| .ui-li .ui-btn-text a.ui-link-inherit { text-overflow: ellipsis; overflow: hidden; white-space: nowrap; } | |
| .ui-li-divider, .ui-li-static { padding: .5em 15px; font-size: 14px; font-weight: bold; } | |
| .ui-li-divider { counter-reset: listnumbering; } | |
| ol.ui-listview .ui-link-inherit:before, ol.ui-listview .ui-li-static:before, .ui-li-dec { font-size: .8em; display: inline-block; padding-right: .3em; font-weight: normal;counter-increment: listnumbering; content: counter(listnumbering) ". "; } | |
| ol.ui-listview .ui-li-jsnumbering:before { content: "" !important; } /* to avoid chance of duplication */ | |
| .ui-listview-inset .ui-li { border-right-width: 1px; border-left-width: 1px; } | |
| .ui-li:last-child, .ui-li.ui-field-contain:last-child { border-bottom-width: 1px; } | |
| .ui-li>.ui-btn-inner { display: block; position: relative; padding: 0; } | |
| .ui-li .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li { padding: .7em 75px .7em 15px; display: block; } | |
| .ui-li-has-thumb .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li-has-thumb { min-height: 60px; padding-left: 100px; } | |
| .ui-li-has-icon .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li-has-icon { min-height: 20px; padding-left: 40px; } | |
| .ui-li-heading { font-size: 16px; font-weight: bold; display: block; margin: .6em 0; text-overflow: ellipsis; overflow: hidden; white-space: nowrap; } | |
| .ui-li-desc { font-size: 12px; font-weight: normal; display: block; margin: -.5em 0 .6em; text-overflow: ellipsis; overflow: hidden; white-space: nowrap; } | |
| .ui-li-thumb, .ui-li-icon { position: absolute; left: 1px; top: 0; max-height: 80px; max-width: 80px; } | |
| .ui-li-icon { max-height: 40px; max-width: 40px; left: 10px; top: .9em; } | |
| .ui-li-thumb, .ui-li-icon, .ui-li-content { float: left; margin-right: 10px; } | |
| .ui-li-aside { float: right; width: 50%; text-align: right; margin: .3em 0; } | |
| @media all and (min-width: 480px){ | |
| .ui-li-aside { width: 45%; } | |
| } | |
| .ui-li-divider { cursor: default; } | |
| .ui-li-has-alt .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li-has-alt { padding-right: 95px; } | |
| .ui-li-count { position: absolute; font-size: 11px; font-weight: bold; padding: .2em .5em; top: 50%; margin-top: -.9em; right: 38px; } | |
| .ui-li-divider .ui-li-count, .ui-li-static .ui-li-count { right: 10px; } | |
| .ui-li-has-alt .ui-li-count { right: 55px; } | |
| .ui-li-link-alt { position: absolute; width: 40px; height: 100%; border-width: 0; border-left-width: 1px; top: 0; right: 0; margin: 0; padding: 0; } | |
| .ui-li-link-alt .ui-btn { overflow: hidden; position: absolute; right: 8px; top: 50%; margin: -11px 0 0 0; border-bottom-width: 1px; } | |
| .ui-li-link-alt .ui-btn-inner { padding: 0; position: static; } | |
| .ui-li-link-alt .ui-btn .ui-icon { right: 50%; margin-right: -9px; } | |
| .ui-listview-filter { border-width: 0; overflow: hidden; margin: -15px -15px 15px -15px } | |
| .ui-listview-filter .ui-input-search { margin: 5px; width: auto; display: block; } | |
| .ui-listview-filter-inset { margin: -15px -5px -15px -5px; background: transparent; } | |
| .ui-li.ui-screen-hidden{display:none;} | |
| /* Odd iPad positioning issue. */ | |
| @media only screen and (min-device-width: 768px) and (max-device-width: 1024px) { | |
| .ui-li .ui-btn-text { overflow: visible; } | |
| }/* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| label.ui-slider { display: block; } | |
| input.ui-slider-input { display: inline-block; width: 50px; } | |
| select.ui-slider-switch { display: none; } | |
| div.ui-slider { position: relative; display: inline-block; overflow: visible; height: 15px; padding: 0; margin: 0 2% 0 20px; top: 4px; width: 66%; } | |
| a.ui-slider-handle { position: absolute; z-index: 10; top: 50%; width: 28px; height: 28px; margin-top: -15px; margin-left: -15px; } | |
| a.ui-slider-handle .ui-btn-inner { padding-left: 0; padding-right: 0; } | |
| @media all and (min-width: 480px){ | |
| label.ui-slider { display: inline-block; width: 20%; margin: 0 2% 0 0; } | |
| div.ui-slider { width: 45%; } | |
| } | |
| div.ui-slider-switch { height: 32px; overflow: hidden; margin-left: 0; } | |
| div.ui-slider-inneroffset { margin-left: 50%; position: absolute; top: 1px; height: 100%; width: 50%; } | |
| div.ui-slider-handle-snapping { -webkit-transition: left 100ms linear; } | |
| div.ui-slider-labelbg { position: absolute; top:0; margin: 0; border-width: 0; } | |
| div.ui-slider-switch div.ui-slider-labelbg-a { width: 60%; height: 100%; left: 0; } | |
| div.ui-slider-switch div.ui-slider-labelbg-b { width: 60%; height: 100%; right: 0; } | |
| .ui-slider-switch-a div.ui-slider-labelbg-a, .ui-slider-switch-b div.ui-slider-labelbg-b { z-index: -1; } | |
| .ui-slider-switch-a div.ui-slider-labelbg-b, .ui-slider-switch-b div.ui-slider-labelbg-a { z-index: 0; } | |
| div.ui-slider-switch a.ui-slider-handle { z-index: 20; width: 101%; height: 32px; margin-top: -18px; margin-left: -101%; } | |
| span.ui-slider-label { width: 100%; position: absolute;height: 32px; font-size: 16px; text-align: center; line-height: 2; background: none; border-color: transparent; } | |
| span.ui-slider-label-a { left: -100%; margin-right: -1px } | |
| span.ui-slider-label-b { right: -100%; margin-left: -1px } | |
| /*! | |
| * jQuery Mobile v1.0b2 | |
| * http://jquerymobile.com/ | |
| * | |
| * Copyright 2010, jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| /* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| /* A | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-bar-a { | |
| border: 1px solid #2A2A2A; | |
| background: #111111; | |
| color: #ffffff; | |
| font-weight: bold; | |
| text-shadow: 0 -1px 1px #000000; | |
| background-image: -webkit-gradient(linear, left top, left bottom, from(#3c3c3c), to(#111)); /* Saf4+, Chrome */ | |
| background-image: -webkit-linear-gradient(top, #3c3c3c, #111); /* Chrome 10+, Saf5.1+ */ | |
| background-image: -moz-linear-gradient(top, #3c3c3c, #111); /* FF3.6 */ | |
| background-image: -ms-linear-gradient(top, #3c3c3c, #111); /* IE10 */ | |
| background-image: -o-linear-gradient(top, #3c3c3c, #111); /* Opera 11.10+ */ | |
| background-image: linear-gradient(top, #3c3c3c, #111); | |
| } | |
| .ui-bar-a, | |
| .ui-bar-a input, | |
| .ui-bar-a select, | |
| .ui-bar-a textarea, | |
| .ui-bar-a button { | |
| font-family: Helvetica, Arial, sans-serif; | |
| } | |
| .ui-bar-a .ui-link-inherit { | |
| color: #fff; | |
| } | |
| .ui-bar-a .ui-link { | |
| color: #7cc4e7; | |
| font-weight: bold; | |
| } | |
| .ui-body-a { | |
| border: 1px solid #2A2A2A; | |
| background: #222222; | |
| color: #fff; | |
| text-shadow: 0 1px 0 #000; | |
| font-weight: normal; | |
| background-image: -webkit-gradient(linear, left top, left bottom, from(#666), to(#222)); /* Saf4+, Chrome */ | |
| background-image: -webkit-linear-gradient(top, #666, #222); /* Chrome 10+, Saf5.1+ */ | |
| background-image: -moz-linear-gradient(top, #666, #222); /* FF3.6 */ | |
| background-image: -ms-linear-gradient(top, #666, #222); /* IE10 */ | |
| background-image: -o-linear-gradient(top, #666, #222); /* Opera 11.10+ */ | |
| background-image: linear-gradient(top, #666, #222); | |
| } | |
| .ui-body-a, | |
| .ui-body-a input, | |
| .ui-body-a select, | |
| .ui-body-a textarea, | |
| .ui-body-a button { | |
| font-family: Helvetica, Arial, sans-serif; | |
| } | |
| .ui-body-a .ui-link-inherit { | |
| color: #fff; | |
| } | |
| .ui-body-a .ui-link { | |
| color: #2489CE; | |
| font-weight: bold; | |
| } | |
| .ui-br { | |
| border-bottom: rgb(130,130,130); | |
| border-bottom: rgba(130,130,130,.3); | |
| border-bottom-width: 1px; | |
| border-bottom-style: solid; | |
| } | |
| .ui-btn-up-a { | |
| border: 1px solid #222; | |
| background: #333333; | |
| font-weight: bold; | |
| color: #fff; | |
| text-shadow: 0 -1px 1px #000; | |
| background-image: -webkit-gradient(linear, left top, left bottom, from(#555), to(#333)); /* Saf4+, Chrome */ | |
| background-image: -webkit-linear-gradient(top, #555, #333); /* Chrome 10+, Saf5.1+ */ | |
| background-image: -moz-linear-gradient(top, #555, #333); /* FF3.6 */ | |
| background-image: -ms-linear-gradient(top, #555, #333); /* IE10 */ | |
| background-image: -o-linear-gradient(top, #555, #333); /* Opera 11.10+ */ | |
| background-image: linear-gradient(top, #555, #333); | |
| } | |
| .ui-btn-up-a a.ui-link-inherit { | |
| color: #fff; | |
| } | |
| .ui-btn-hover-a { | |
| border: 1px solid #000; | |
| background: #444444; | |
| font-weight: bold; | |
| color: #fff; | |
| text-shadow: 0 -1px 1px #000; | |
| background-image: -webkit-gradient(linear, left top, left bottom, from(#666), to(#444)); /* Saf4+, Chrome */ | |
| background-image: -webkit-linear-gradient(top, #666, #444); /* Chrome 10+, Saf5.1+ */ | |
| background-image: -moz-linear-gradient(top, #666, #444); /* FF3.6 */ | |
| background-image: -ms-linear-gradient(top, #666, #444); /* IE10 */ | |
| background-image: -o-linear-gradient(top, #666, #444); /* Opera 11.10+ */ | |
| background-image: linear-gradient(top, #666, #444); | |
| } | |
| .ui-btn-hover-a a.ui-link-inherit { | |
| color: #fff; | |
| } | |
| .ui-btn-down-a { | |
| border: 1px solid #000; | |
| background: #3d3d3d; | |
| font-weight: bold; | |
| color: #fff; | |
| text-shadow: 0 -1px 1px #000; | |
| background-image: -webkit-gradient(linear, left top, left bottom, from(#333), to(#5a5a5a)); /* Saf4+, Chrome */ | |
| background-image: -webkit-linear-gradient(top, #333, #5a5a5a); /* Chrome 10+, Saf5.1+ */ | |
| background-image: -moz-linear-gradient(top, #333, #5a5a5a); /* FF3.6 */ | |
| background-image: -ms-linear-gradient(top, #333, #5a5a5a); /* IE10 */ | |
| background-image: -o-linear-gradient(top, #333, #5a5a5a); /* Opera 11.10+ */ | |
| background-image: linear-gradient(top, #333, #5a5a5a); | |
| } | |
| .ui-btn-down-a a.ui-link-inherit { | |
| color: #fff; | |
| } | |
| .ui-btn-up-a, | |
| .ui-btn-hover-a, | |
| .ui-btn-down-a { | |
| font-family: Helvetica, Arial, sans-serif; | |
| text-decoration: none; | |
| } | |
| /* B | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-bar-b { | |
| border: 1px solid #456f9a; | |
| background: #5e87b0; | |
| color: #fff; | |
| font-weight: bold; | |
| text-shadow: 0 -1px 1px #254f7a; | |
| background-image: -webkit-gradient(linear, left top, left bottom, from(#81a8ce), to(#5e87b0)); /* Saf4+, Chrome */ | |
| background-image: -webkit-linear-gradient(top, #81a8ce, #5e87b0); /* Chrome 10+, Saf5.1+ */ | |
| background-image: -moz-linear-gradient(top, #81a8ce, #5e87b0); /* FF3.6 */ | |
| background-image: -ms-linear-gradient(top, #81a8ce, #5e87b0); /* IE10 */ | |
| background-image: -o-linear-gradient(top, #81a8ce, #5e87b0); /* Opera 11.10+ */ | |
| background-image: linear-gradient(top, #81a8ce, #5e87b0); | |
| } | |
| .ui-bar-b, | |
| .ui-bar-b input, | |
| .ui-bar-b select, | |
| .ui-bar-b textarea, | |
| .ui-bar-b button { | |
| font-family: Helvetica, Arial, sans-serif; | |
| } | |
| .ui-bar-b .ui-link-inherit { | |
| color: #fff; | |
| } | |
| .ui-bar-b .ui-link { | |
| color: #7cc4e7; | |
| font-weight: bold; | |
| } | |
| .ui-body-b { | |
| border: 1px solid #C6C6C6; | |
| background: #cccccc; | |
| color: #333333; | |
| text-shadow: 0 1px 0 #fff; | |
| font-weight: normal; | |
| background-image: -webkit-gradient(linear, left top, left bottom, from(#e6e6e6), to(#ccc)); /* Saf4+, Chrome */ | |
| background-image: -webkit-linear-gradient(top, #e6e6e6, #ccc); /* Chrome 10+, Saf5.1+ */ | |
| background-image: -moz-linear-gradient(top, #e6e6e6, #ccc); /* FF3.6 */ | |
| background-image: -ms-linear-gradient(top, #e6e6e6, #ccc); /* IE10 */ | |
| background-image: -o-linear-gradient(top, #e6e6e6, #ccc); /* Opera 11.10+ */ | |
| background-image: linear-gradient(top, #e6e6e6, #ccc); | |
| } | |
| .ui-body-b, | |
| .ui-body-b input, | |
| .ui-body-b select, | |
| .ui-body-b textarea, | |
| .ui-body-b button { | |
| font-family: Helvetica, Arial, sans-serif; | |
| } | |
| .ui-body-b .ui-link-inherit { | |
| color: #333333; | |
| } | |
| .ui-body-b .ui-link { | |
| color: #2489CE; | |
| font-weight: bold; | |
| } | |
| .ui-btn-up-b { | |
| border: 1px solid #145072; | |
| background: #2567ab; | |
| font-weight: bold; | |
| color: #fff; | |
| text-shadow: 0 -1px 1px #145072; | |
| background-image: -webkit-gradient(linear, left top, left bottom, from(#5f9cc5), to(#396b9e)); /* Saf4+, Chrome */ | |
| background-image: -webkit-linear-gradient(top, #5f9cc5, #396b9e); /* Chrome 10+, Saf5.1+ */ | |
| background-image: -moz-linear-gradient(top, #5f9cc5, #396b9e); /* FF3.6 */ | |
| background-image: -ms-linear-gradient(top, #5f9cc5, #396b9e); /* IE10 */ | |
| background-image: -o-linear-gradient(top, #5f9cc5, #396b9e); /* Opera 11.10+ */ | |
| background-image: linear-gradient(top, #5f9cc5, #396b9e); | |
| } | |
| .ui-btn-up-b a.ui-link-inherit { | |
| color: #fff; | |
| } | |
| .ui-btn-hover-b { | |
| border: 1px solid #00516e; | |
| background: #4b88b6; | |
| font-weight: bold; | |
| color: #fff; | |
| text-shadow: 0 -1px 1px #014D68; | |
| background-image: -webkit-gradient(linear, left top, left bottom, from(#72b0d4), to(#4b88b6)); /* Saf4+, Chrome */ | |
| background-image: -webkit-linear-gradient(top, #72b0d4, #4b88b6); /* Chrome 10+, Saf5.1+ */ | |
| background-image: -moz-linear-gradient(top, #72b0d4, #4b88b6); /* FF3.6 */ | |
| background-image: -ms-linear-gradient(top, #72b0d4, #4b88b6); /* IE10 */ | |
| background-image: -o-linear-gradient(top, #72b0d4, #4b88b6); /* Opera 11.10+ */ | |
| background-image: linear-gradient(top, #72b0d4, #4b88b6); | |
| } | |
| .ui-btn-hover-b a.ui-link-inherit { | |
| color: #fff; | |
| } | |
| .ui-btn-down-b { | |
| border: 1px solid #225377; | |
| background: #4e89c5; | |
| font-weight: bold; | |
| color: #fff; | |
| text-shadow: 0 -1px 1px #225377; | |
| background-image: -webkit-gradient(linear, left top, left bottom, from(#396b9e), to(#4e89c5)); /* Saf4+, Chrome */ | |
| background-image: -webkit-linear-gradient(top, #396b9e, #4e89c5); /* Chrome 10+, Saf5.1+ */ | |
| background-image: -moz-linear-gradient(top, #396b9e, #4e89c5); /* FF3.6 */ | |
| background-image: -ms-linear-gradient(top, #396b9e, #4e89c5); /* IE10 */ | |
| background-image: -o-linear-gradient(top, #396b9e, #4e89c5); /* Opera 11.10+ */ | |
| background-image: linear-gradient(top, #396b9e, #4e89c5); | |
| } | |
| .ui-btn-down-b a.ui-link-inherit { | |
| color: #fff; | |
| } | |
| .ui-btn-up-b, | |
| .ui-btn-hover-b, | |
| .ui-btn-down-b { | |
| font-family: Helvetica, Arial, sans-serif; | |
| text-decoration: none; | |
| } | |
| /* C | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-bar-c { | |
| border: 1px solid #B3B3B3; | |
| background: #e9eaeb; | |
| color: #3E3E3E; | |
| font-weight: bold; | |
| text-shadow: 0 1px 1px #fff; | |
| background-image: -webkit-gradient(linear, left top, left bottom, from(#f0f0f0), to(#e9eaeb)); /* Saf4+, Chrome */ | |
| background-image: -webkit-linear-gradient(top, #f0f0f0, #e9eaeb); /* Chrome 10+, Saf5.1+ */ | |
| background-image: -moz-linear-gradient(top, #f0f0f0, #e9eaeb); /* FF3.6 */ | |
| background-image: -ms-linear-gradient(top, #f0f0f0, #e9eaeb); /* IE10 */ | |
| background-image: -o-linear-gradient(top, #f0f0f0, #e9eaeb); /* Opera 11.10+ */ | |
| background-image: linear-gradient(top, #f0f0f0, #e9eaeb); | |
| } | |
| .ui-bar-c, | |
| .ui-bar-c input, | |
| .ui-bar-c select, | |
| .ui-bar-c textarea, | |
| .ui-bar-c button { | |
| font-family: Helvetica, Arial, sans-serif; | |
| } | |
| .ui-body-c { | |
| border: 1px solid #B3B3B3; | |
| color: #333333; | |
| text-shadow: 0 1px 0 #fff; | |
| background: #f0f0f0; | |
| background-image: -webkit-gradient(linear, left top, left bottom, from(#eee), to(#ddd)); /* Saf4+, Chrome */ | |
| background-image: -webkit-linear-gradient(top, #eee, #ddd); /* Chrome 10+, Saf5.1+ */ | |
| background-image: -moz-linear-gradient(top, #eee, #ddd); /* FF3.6 */ | |
| background-image: -ms-linear-gradient(top, #eee, #ddd); /* IE10 */ | |
| background-image: -o-linear-gradient(top, #eee, #ddd); /* Opera 11.10+ */ | |
| background-image: linear-gradient(top, #eee, #ddd); | |
| } | |
| .ui-body-c, | |
| .ui-body-c input, | |
| .ui-body-c select, | |
| .ui-body-c textarea, | |
| .ui-body-c button { | |
| font-family: Helvetica, Arial, sans-serif; | |
| } | |
| .ui-body-c .ui-link-inherit { | |
| color: #333333; | |
| } | |
| .ui-body-c .ui-link { | |
| color: #2489CE; | |
| font-weight: bold; | |
| } | |
| .ui-btn-up-c { | |
| border: 1px solid #ccc; | |
| background: #eee; | |
| font-weight: bold; | |
| color: #444; | |
| text-shadow: 0 1px 1px #f6f6f6; | |
| background-image: -webkit-gradient(linear, left top, left bottom, from(#fdfdfd), to(#eee)); /* Saf4+, Chrome */ | |
| background-image: -webkit-linear-gradient(top, #fdfdfd, #eee); /* Chrome 10+, Saf5.1+ */ | |
| background-image: -moz-linear-gradient(top, #fdfdfd, #eee); /* FF3.6 */ | |
| background-image: -ms-linear-gradient(top, #fdfdfd, #eee); /* IE10 */ | |
| background-image: -o-linear-gradient(top, #fdfdfd, #eee); /* Opera 11.10+ */ | |
| background-image: linear-gradient(top, #fdfdfd, #eee); | |
| } | |
| .ui-btn-up-c a.ui-link-inherit { | |
| color: #2F3E46; | |
| } | |
| .ui-btn-hover-c { | |
| border: 1px solid #bbb; | |
| background: #dadada; | |
| font-weight: bold; | |
| color: #101010; | |
| text-shadow: 0 1px 1px #fff; | |
| background-image: -webkit-gradient(linear, left top, left bottom, from(#ededed), to(#dadada)); /* Saf4+, Chrome */ | |
| background-image: -webkit-linear-gradient(top, #ededed, #dadada); /* Chrome 10+, Saf5.1+ */ | |
| background-image: -moz-linear-gradient(top, #ededed, #dadada); /* FF3.6 */ | |
| background-image: -ms-linear-gradient(top, #ededed, #dadada); /* IE10 */ | |
| background-image: -o-linear-gradient(top, #ededed, #dadada); /* Opera 11.10+ */ | |
| background-image: linear-gradient(top, #ededed, #dadada); | |
| } | |
| .ui-btn-hover-c a.ui-link-inherit { | |
| color: #2F3E46; | |
| } | |
| .ui-btn-down-c { | |
| border: 1px solid #808080; | |
| background: #fdfdfd; | |
| font-weight: bold; | |
| color: #111111; | |
| text-shadow: 0 1px 1px #ffffff; | |
| background-image: -webkit-gradient(linear, left top, left bottom, from(#eee), to(#fdfdfd)); /* Saf4+, Chrome */ | |
| background-image: -webkit-linear-gradient(top, #eee, #fdfdfd); /* Chrome 10+, Saf5.1+ */ | |
| background-image: -moz-linear-gradient(top, #eee, #fdfdfd); /* FF3.6 */ | |
| background-image: -ms-linear-gradient(top, #eee, #fdfdfd); /* IE10 */ | |
| background-image: -o-linear-gradient(top, #eee, #fdfdfd); /* Opera 11.10+ */ | |
| background-image: linear-gradient(top, #eee, #fdfdfd); | |
| } | |
| .ui-btn-down-c a.ui-link-inherit { | |
| color: #2F3E46; | |
| } | |
| .ui-btn-up-c, | |
| .ui-btn-hover-c, | |
| .ui-btn-down-c { | |
| font-family: Helvetica, Arial, sans-serif; | |
| text-decoration: none; | |
| } | |
| /* D | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-bar-d { | |
| border: 1px solid #ccc; | |
| background: #bbb; | |
| color: #333; | |
| text-shadow: 0 1px 0 #eee; | |
| background-image: -webkit-gradient(linear, left top, left bottom, from(#ddd), to(#bbb)); /* Saf4+, Chrome */ | |
| background-image: -webkit-linear-gradient(top, #ddd, #bbb); /* Chrome 10+, Saf5.1+ */ | |
| background-image: -moz-linear-gradient(top, #ddd, #bbb); /* FF3.6 */ | |
| background-image: -ms-linear-gradient(top, #ddd, #bbb); /* IE10 */ | |
| background-image: -o-linear-gradient(top, #ddd, #bbb); /* Opera 11.10+ */ | |
| background-image: linear-gradient(top, #ddd, #bbb); | |
| } | |
| .ui-bar-d, | |
| .ui-bar-d input, | |
| .ui-bar-d select, | |
| .ui-bar-d textarea, | |
| .ui-bar-d button { | |
| font-family: Helvetica, Arial, sans-serif; | |
| } | |
| .ui-bar-d .ui-link-inherit { | |
| color: #333; | |
| } | |
| .ui-bar-d .ui-link { | |
| color: #2489CE; | |
| font-weight: bold; | |
| } | |
| .ui-body-d { | |
| border: 1px solid #ccc; | |
| color: #333333; | |
| text-shadow: 0 1px 0 #fff; | |
| background: #ffffff; | |
| } | |
| .ui-body-d, | |
| .ui-body-d input, | |
| .ui-body-d select, | |
| .ui-body-d textarea, | |
| .ui-body-d button { | |
| font-family: Helvetica, Arial, sans-serif; | |
| } | |
| .ui-body-d .ui-link-inherit { | |
| color: #333333; | |
| } | |
| .ui-body-d .ui-link { | |
| color: #2489CE; | |
| font-weight: bold; | |
| } | |
| .ui-btn-up-d { | |
| border: 1px solid #ccc; | |
| background: #fff; | |
| font-weight: bold; | |
| color: #444; | |
| text-shadow: 0 1px 1px #fff; | |
| } | |
| .ui-btn-up-d a.ui-link-inherit { | |
| color: #333; | |
| } | |
| .ui-btn-hover-d { | |
| border: 1px solid #aaa; | |
| background: #eeeeee; | |
| font-weight: bold; | |
| color: #222; | |
| cursor: pointer; | |
| text-shadow: 0 1px 1px #fff; | |
| background-image: -webkit-gradient(linear, left top, left bottom, from(#fdfdfd), to(#eee)); /* Saf4+, Chrome */ | |
| background-image: -webkit-linear-gradient(top, #fdfdfd, #eee); /* Chrome 10+, Saf5.1+ */ | |
| background-image: -moz-linear-gradient(top, #fdfdfd, #eee); /* FF3.6 */ | |
| background-image: -ms-linear-gradient(top, #fdfdfd, #eee); /* IE10 */ | |
| background-image: -o-linear-gradient(top, #fdfdfd, #eee); /* Opera 11.10+ */ | |
| background-image: linear-gradient(top, #fdfdfd, #eee); | |
| } | |
| .ui-btn-hover-d a.ui-link-inherit { | |
| color: #222; | |
| } | |
| .ui-btn-down-d { | |
| border: 1px solid #aaaaaa; | |
| background: #ffffff; | |
| font-weight: bold; | |
| color: #111; | |
| text-shadow: 0 1px 1px #ffffff; | |
| background-image: -webkit-gradient(linear, left top, left bottom, from(#eee), to(#fff)); /* Saf4+, Chrome */ | |
| background-image: -webkit-linear-gradient(top, #eee, #fff); /* Chrome 10+, Saf5.1+ */ | |
| background-image: -moz-linear-gradient(top, #eee, #fff); /* FF3.6 */ | |
| background-image: -ms-linear-gradient(top, #eee, #fff); /* IE10 */ | |
| background-image: -o-linear-gradient(top, #eee, #fff); /* Opera 11.10+ */ | |
| background-image: linear-gradient(top, #eee, #fff); | |
| } | |
| .ui-btn-down-d a.ui-link-inherit { | |
| color: #111; | |
| } | |
| .ui-btn-up-d, | |
| .ui-btn-hover-d, | |
| .ui-btn-down-d { | |
| font-family: Helvetica, Arial, sans-serif; | |
| text-decoration: none; | |
| } | |
| /* E | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-bar-e { | |
| border: 1px solid #F7C942; | |
| background: #fadb4e; | |
| color: #333; | |
| text-shadow: 0 1px 0 #fff; | |
| background-image: -webkit-gradient(linear, left top, left bottom, from(#fceda7), to(#fadb4e)); /* Saf4+, Chrome */ | |
| background-image: -webkit-linear-gradient(top, #fceda7, #fadb4e); /* Chrome 10+, Saf5.1+ */ | |
| background-image: -moz-linear-gradient(top, #fceda7, #fadb4e); /* FF3.6 */ | |
| background-image: -ms-linear-gradient(top, #fceda7, #fadb4e); /* IE10 */ | |
| background-image: -o-linear-gradient(top, #fceda7, #fadb4e); /* Opera 11.10+ */ | |
| background-image: linear-gradient(top, #fceda7, #fadb4e); | |
| } | |
| .ui-bar-e, | |
| .ui-bar-e input, | |
| .ui-bar-e select, | |
| .ui-bar-e textarea, | |
| .ui-bar-e button { | |
| font-family: Helvetica, Arial, sans-serif; | |
| } | |
| .ui-bar-e .ui-link-inherit { | |
| color: #333; | |
| } | |
| .ui-bar-e .ui-link { | |
| color: #2489CE; | |
| font-weight: bold; | |
| } | |
| .ui-body-e { | |
| border: 1px solid #F7C942; | |
| color: #333333; | |
| text-shadow: 0 1px 0 #fff; | |
| background: #faeb9e; | |
| background-image: -webkit-gradient(linear, left top, left bottom, from(#fff), to(#faeb9e)); /* Saf4+, Chrome */ | |
| background-image: -webkit-linear-gradient(top, #fff, #faeb9e); /* Chrome 10+, Saf5.1+ */ | |
| background-image: -moz-linear-gradient(top, #fff, #faeb9e); /* FF3.6 */ | |
| background-image: -ms-linear-gradient(top, #fff, #faeb9e); /* IE10 */ | |
| background-image: -o-linear-gradient(top, #fff, #faeb9e); /* Opera 11.10+ */ | |
| background-image: linear-gradient(top, #fff, #faeb9e); | |
| } | |
| .ui-body-e, | |
| .ui-body-e input, | |
| .ui-body-e select, | |
| .ui-body-e textarea, | |
| .ui-body-e button { | |
| font-family: Helvetica, Arial, sans-serif; | |
| } | |
| .ui-body-e .ui-link-inherit { | |
| color: #333333; | |
| } | |
| .ui-body-e .ui-link { | |
| color: #2489CE; | |
| font-weight: bold; | |
| } | |
| .ui-btn-up-e { | |
| border: 1px solid #F7C942; | |
| background: #fadb4e; | |
| font-weight: bold; | |
| color: #333; | |
| text-shadow: 0 1px 0 #fff; | |
| background-image: -webkit-gradient(linear, left top, left bottom, from(#fceda7), to(#fadb4e)); /* Saf4+, Chrome */ | |
| background-image: -webkit-linear-gradient(top, #fceda7, #fadb4e); /* Chrome 10+, Saf5.1+ */ | |
| background-image: -moz-linear-gradient(top, #fceda7, #fadb4e); /* FF3.6 */ | |
| background-image: -ms-linear-gradient(top, #fceda7, #fadb4e); /* IE10 */ | |
| background-image: -o-linear-gradient(top, #fceda7, #fadb4e); /* Opera 11.10+ */ | |
| background-image: linear-gradient(top, #fceda7, #fadb4e); | |
| } | |
| .ui-btn-up-e a.ui-link-inherit { | |
| color: #333; | |
| } | |
| .ui-btn-hover-e { | |
| border: 1px solid #e79952; | |
| background: #fbe26f; | |
| font-weight: bold; | |
| color: #111; | |
| text-shadow: 0 1px 1px #fff; | |
| background-image: -webkit-gradient(linear, left top, left bottom, from(#fcf0b5), to(#fbe26f)); /* Saf4+, Chrome */ | |
| background-image: -webkit-linear-gradient(top, #fcf0b5, #fbe26f); /* Chrome 10+, Saf5.1+ */ | |
| background-image: -moz-linear-gradient(top, #fcf0b5, #fbe26f); /* FF3.6 */ | |
| background-image: -ms-linear-gradient(top, #fcf0b5, #fbe26f); /* IE10 */ | |
| background-image: -o-linear-gradient(top, #fcf0b5, #fbe26f); /* Opera 11.10+ */ | |
| background-image: linear-gradient(top, #fcf0b5, #fbe26f); | |
| } | |
| .ui-btn-hover-e a.ui-link-inherit { | |
| color: #333; | |
| } | |
| .ui-btn-down-e { | |
| border: 1px solid #F7C942; | |
| background: #fceda7; | |
| font-weight: bold; | |
| color: #111; | |
| text-shadow: 0 1px 1px #ffffff; | |
| background-image: -webkit-gradient(linear, left top, left bottom, from(#fadb4e), to(#fceda7)); /* Saf4+, Chrome */ | |
| background-image: -webkit-linear-gradient(top, #fadb4e, #fceda7); /* Chrome 10+, Saf5.1+ */ | |
| background-image: -moz-linear-gradient(top, #fadb4e, #fceda7); /* FF3.6 */ | |
| background-image: -ms-linear-gradient(top, #fadb4e, #fceda7); /* IE10 */ | |
| background-image: -o-linear-gradient(top, #fadb4e, #fceda7); /* Opera 11.10+ */ | |
| background-image: linear-gradient(top, #fadb4e, #fceda7); | |
| } | |
| .ui-btn-down-e a.ui-link-inherit { | |
| color: #333; | |
| } | |
| .ui-btn-up-e, | |
| .ui-btn-hover-e, | |
| .ui-btn-down-e { | |
| font-family: Helvetica, Arial, sans-serif; | |
| text-decoration: none; | |
| } | |
| /* links within "buttons" | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| a.ui-link-inherit { | |
| text-decoration: none !important; | |
| } | |
| /* Active class used as the "on" state across all themes | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-btn-active { | |
| border: 1px solid #155678; | |
| background: #4596ce; | |
| font-weight: bold; | |
| color: #fff; | |
| cursor: pointer; | |
| text-shadow: 0 -1px 1px #145072; | |
| text-decoration: none; | |
| background-image: -webkit-gradient(linear, left top, left bottom, from(#85bae4), to(#5393c5)); /* Saf4+, Chrome */ | |
| background-image: -webkit-linear-gradient(top, #85bae4, #5393c5); /* Chrome 10+, Saf5.1+ */ | |
| background-image: -moz-linear-gradient(top, #85bae4, #5393c5); /* FF3.6 */ | |
| background-image: -ms-linear-gradient(top, #85bae4, #5393c5); /* IE10 */ | |
| background-image: -o-linear-gradient(top, #85bae4, #5393c5); /* Opera 11.10+ */ | |
| background-image: linear-gradient(top, #85bae4, #5393c5); | |
| outline: none; | |
| } | |
| .ui-btn-active a.ui-link-inherit { | |
| color: #fff; | |
| } | |
| /* button inner top highlight | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-btn-inner { | |
| border-top: 1px solid #fff; | |
| border-color: rgba(255,255,255,.3); | |
| } | |
| /* corner rounding classes | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-corner-tl { | |
| -moz-border-radius-topleft: .6em; | |
| -webkit-border-top-left-radius: .6em; | |
| border-top-left-radius: .6em; | |
| } | |
| .ui-corner-tr { | |
| -moz-border-radius-topright: .6em; | |
| -webkit-border-top-right-radius: .6em; | |
| border-top-right-radius: .6em; | |
| } | |
| .ui-corner-bl { | |
| -moz-border-radius-bottomleft: .6em; | |
| -webkit-border-bottom-left-radius: .6em; | |
| border-bottom-left-radius: .6em; | |
| } | |
| .ui-corner-br { | |
| -moz-border-radius-bottomright: .6em; | |
| -webkit-border-bottom-right-radius: .6em; | |
| border-bottom-right-radius: .6em; | |
| } | |
| .ui-corner-top { | |
| -moz-border-radius-topleft: .6em; | |
| -webkit-border-top-left-radius: .6em; | |
| border-top-left-radius: .6em; | |
| -moz-border-radius-topright: .6em; | |
| -webkit-border-top-right-radius: .6em; | |
| border-top-right-radius: .6em; | |
| } | |
| .ui-corner-bottom { | |
| -moz-border-radius-bottomleft: .6em; | |
| -webkit-border-bottom-left-radius: .6em; | |
| border-bottom-left-radius: .6em; | |
| -moz-border-radius-bottomright: .6em; | |
| -webkit-border-bottom-right-radius: .6em; | |
| border-bottom-right-radius: .6em; | |
| } | |
| .ui-corner-right { | |
| -moz-border-radius-topright: .6em; | |
| -webkit-border-top-right-radius: .6em; | |
| border-top-right-radius: .6em; | |
| -moz-border-radius-bottomright: .6em; | |
| -webkit-border-bottom-right-radius: .6em; | |
| border-bottom-right-radius: .6em; | |
| } | |
| .ui-corner-left { | |
| -moz-border-radius-topleft: .6em; | |
| -webkit-border-top-left-radius: .6em; | |
| border-top-left-radius: .6em; | |
| -moz-border-radius-bottomleft: .6em; | |
| -webkit-border-bottom-left-radius: .6em; | |
| border-bottom-left-radius: .6em; | |
| } | |
| .ui-corner-all { | |
| -moz-border-radius: .6em; | |
| -webkit-border-radius: .6em; | |
| border-radius: .6em; | |
| } | |
| /* Interaction cues | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-disabled { | |
| opacity: .3; | |
| } | |
| .ui-disabled, | |
| .ui-disabled a { | |
| cursor: default; | |
| } | |
| /* Icons | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-icon { | |
| background: #666; | |
| background: rgba(0,0,0,.4); | |
| background-image: url(images/icons-18-white.png); | |
| background-repeat: no-repeat; | |
| -moz-border-radius: 9px; | |
| -webkit-border-radius: 9px; | |
| border-radius: 9px; | |
| } | |
| /* Alt icon color | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-icon-alt { | |
| background: #fff; | |
| background: rgba(255,255,255,.3); | |
| background-image: url(images/icons-18-black.png); | |
| background-repeat: no-repeat; | |
| } | |
| /* HD/"retina" sprite | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| @media only screen and (-webkit-min-device-pixel-ratio: 1.5), | |
| only screen and (min--moz-device-pixel-ratio: 1.5), | |
| only screen and (min-resolution: 240dpi) { | |
| .ui-icon-plus, .ui-icon-minus, .ui-icon-delete, .ui-icon-arrow-r, | |
| .ui-icon-arrow-l, .ui-icon-arrow-u, .ui-icon-arrow-d, .ui-icon-check, | |
| .ui-icon-gear, .ui-icon-refresh, .ui-icon-forward, .ui-icon-back, | |
| .ui-icon-grid, .ui-icon-star, .ui-icon-alert, .ui-icon-info, .ui-icon-home, .ui-icon-search, | |
| .ui-icon-checkbox-off, .ui-icon-checkbox-on, .ui-icon-radio-off, .ui-icon-radio-on { | |
| background-image: url(images/icons-36-white.png); | |
| -moz-background-size: 776px 18px; | |
| -o-background-size: 776px 18px; | |
| -webkit-background-size: 776px 18px; | |
| background-size: 776px 18px; | |
| } | |
| .ui-icon-alt { | |
| background-image: url(images/icons-36-black.png); | |
| } | |
| } | |
| /* plus minus */ | |
| .ui-icon-plus { | |
| background-position: -0 50%; | |
| } | |
| .ui-icon-minus { | |
| background-position: -36px 50%; | |
| } | |
| /* delete/close */ | |
| .ui-icon-delete { | |
| background-position: -72px 50%; | |
| } | |
| /* arrows */ | |
| .ui-icon-arrow-r { | |
| background-position: -108px 50%; | |
| } | |
| .ui-icon-arrow-l { | |
| background-position: -144px 50%; | |
| } | |
| .ui-icon-arrow-u { | |
| background-position: -180px 50%; | |
| } | |
| .ui-icon-arrow-d { | |
| background-position: -216px 50%; | |
| } | |
| /* misc */ | |
| .ui-icon-check { | |
| background-position: -252px 50%; | |
| } | |
| .ui-icon-gear { | |
| background-position: -288px 50%; | |
| } | |
| .ui-icon-refresh { | |
| background-position: -324px 50%; | |
| } | |
| .ui-icon-forward { | |
| background-position: -360px 50%; | |
| } | |
| .ui-icon-back { | |
| background-position: -396px 50%; | |
| } | |
| .ui-icon-grid { | |
| background-position: -432px 50%; | |
| } | |
| .ui-icon-star { | |
| background-position: -468px 50%; | |
| } | |
| .ui-icon-alert { | |
| background-position: -504px 50%; | |
| } | |
| .ui-icon-info { | |
| background-position: -540px 50%; | |
| } | |
| .ui-icon-home { | |
| background-position: -576px 50%; | |
| } | |
| .ui-icon-search { | |
| background-position: -612px 50%; | |
| } | |
| .ui-icon-checkbox-off { | |
| background-position: -684px 50%; | |
| } | |
| .ui-icon-checkbox-on { | |
| background-position: -648px 50%; | |
| } | |
| .ui-icon-radio-off { | |
| background-position: -756px 50%; | |
| } | |
| .ui-icon-radio-on { | |
| background-position: -720px 50%; | |
| } | |
| /* checks,radios */ | |
| .ui-checkbox .ui-icon { | |
| -moz-border-radius: 3px; | |
| -webkit-border-radius: 3px; | |
| border-radius: 3px; | |
| } | |
| .ui-icon-checkbox-off, | |
| .ui-icon-radio-off { | |
| background-color: transparent; | |
| } | |
| .ui-checkbox-on .ui-icon, | |
| .ui-radio-on .ui-icon { | |
| background-color: #4596ce; /* NOTE: this hex should match the active state color. It's repeated here for cascade */ | |
| } | |
| .ui-icon-searchfield { | |
| background-image: url(images/icon-search-black.png); | |
| background-size: 16px 16px; | |
| } | |
| /* loading icon */ | |
| .ui-icon-loading { | |
| background-image: url(images/ajax-loader.png); | |
| width: 40px; | |
| height: 40px; | |
| -moz-border-radius: 20px; | |
| -webkit-border-radius: 20px; | |
| border-radius: 20px; | |
| background-size: 35px 35px; | |
| } | |
| /* Button corner classes | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-btn-corner-tl { | |
| -moz-border-radius-topleft: 1em; | |
| -webkit-border-top-left-radius: 1em; | |
| border-top-left-radius: 1em; | |
| } | |
| .ui-btn-corner-tr { | |
| -moz-border-radius-topright: 1em; | |
| -webkit-border-top-right-radius: 1em; | |
| border-top-right-radius: 1em; | |
| } | |
| .ui-btn-corner-bl { | |
| -moz-border-radius-bottomleft: 1em; | |
| -webkit-border-bottom-left-radius: 1em; | |
| border-bottom-left-radius: 1em; | |
| } | |
| .ui-btn-corner-br { | |
| -moz-border-radius-bottomright: 1em; | |
| -webkit-border-bottom-right-radius: 1em; | |
| border-bottom-right-radius: 1em; | |
| } | |
| .ui-btn-corner-top { | |
| -moz-border-radius-topleft: 1em; | |
| -webkit-border-top-left-radius: 1em; | |
| border-top-left-radius: 1em; | |
| -moz-border-radius-topright: 1em; | |
| -webkit-border-top-right-radius: 1em; | |
| border-top-right-radius: 1em; | |
| } | |
| .ui-btn-corner-bottom { | |
| -moz-border-radius-bottomleft: 1em; | |
| -webkit-border-bottom-left-radius: 1em; | |
| border-bottom-left-radius: 1em; | |
| -moz-border-radius-bottomright: 1em; | |
| -webkit-border-bottom-right-radius: 1em; | |
| border-bottom-right-radius: 1em; | |
| } | |
| .ui-btn-corner-right { | |
| -moz-border-radius-topright: 1em; | |
| -webkit-border-top-right-radius: 1em; | |
| border-top-right-radius: 1em; | |
| -moz-border-radius-bottomright: 1em; | |
| -webkit-border-bottom-right-radius: 1em; | |
| border-bottom-right-radius: 1em; | |
| } | |
| .ui-btn-corner-left { | |
| -moz-border-radius-topleft: 1em; | |
| -webkit-border-top-left-radius: 1em; | |
| border-top-left-radius: 1em; | |
| -moz-border-radius-bottomleft: 1em; | |
| -webkit-border-bottom-left-radius: 1em; | |
| border-bottom-left-radius: 1em; | |
| } | |
| .ui-btn-corner-all { | |
| -moz-border-radius: 1em; | |
| -webkit-border-radius: 1em; | |
| border-radius: 1em; | |
| } | |
| /* radius clip workaround for cleaning up corner trapping */ | |
| .ui-corner-tl, | |
| .ui-corner-tr, | |
| .ui-corner-bl, | |
| .ui-corner-br, | |
| .ui-corner-top, | |
| .ui-corner-bottom, | |
| .ui-corner-right, | |
| .ui-corner-left, | |
| .ui-corner-all, | |
| .ui-btn-corner-tl, | |
| .ui-btn-corner-tr, | |
| .ui-btn-corner-bl, | |
| .ui-btn-corner-br, | |
| .ui-btn-corner-top, | |
| .ui-btn-corner-bottom, | |
| .ui-btn-corner-right, | |
| .ui-btn-corner-left, | |
| .ui-btn-corner-all { | |
| -webkit-background-clip: padding-box; | |
| -moz-background-clip: padding; | |
| background-clip: padding-box; | |
| } | |
| /* Overlay / modal | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-overlay { | |
| background: #666; | |
| opacity: .5; | |
| filter: Alpha(Opacity=50); | |
| position: absolute; | |
| width: 100%; | |
| height: 100%; | |
| } | |
| .ui-overlay-shadow { | |
| -moz-box-shadow: 0px 0px 12px rgba(0,0,0,.6); | |
| -webkit-box-shadow: 0px 0px 12px rgba(0,0,0,.6); | |
| box-shadow: 0px 0px 12px rgba(0,0,0,.6); | |
| } | |
| .ui-shadow { | |
| -moz-box-shadow: 0px 1px 4px rgba(0,0,0,.3); | |
| -webkit-box-shadow: 0px 1px 4px rgba(0,0,0,.3); | |
| box-shadow: 0px 1px 4px rgba(0,0,0,.3); | |
| } | |
| .ui-bar-a .ui-shadow, | |
| .ui-bar-b .ui-shadow , | |
| .ui-bar-c .ui-shadow { | |
| -moz-box-shadow: 0px 1px 0 rgba(255,255,255,.3); | |
| -webkit-box-shadow: 0px 1px 0 rgba(255,255,255,.3); | |
| box-shadow: 0px 1px 0 rgba(255,255,255,.3); | |
| } | |
| .ui-shadow-inset { | |
| -moz-box-shadow: inset 0px 1px 4px rgba(0,0,0,.2); | |
| -webkit-box-shadow: inset 0px 1px 4px rgba(0,0,0,.2); | |
| box-shadow: inset 0px 1px 4px rgba(0,0,0,.2); | |
| } | |
| .ui-icon-shadow { | |
| -moz-box-shadow: 0px 1px 0 rgba(255,255,255,.4); | |
| -webkit-box-shadow: 0px 1px 0 rgba(255,255,255,.4); | |
| box-shadow: 0px 1px 0 rgba(255,255,255,.4); | |
| } | |
| /* Focus state - set here for specificity | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-focus { | |
| -moz-box-shadow: 0px 0px 12px #387bbe; | |
| -webkit-box-shadow: 0px 0px 12px #387bbe; | |
| box-shadow: 0px 0px 12px #387bbe; | |
| } | |
| /* unset box shadow in browsers that don't do it right | |
| -----------------------------------------------------------------------------------------------------------*/ | |
| .ui-mobile-nosupport-boxshadow * { | |
| -moz-box-shadow: none !important; | |
| -webkit-box-shadow: none !important; | |
| box-shadow: none !important; | |
| } | |
| /* ...and bring back focus */ | |
| .ui-mobile-nosupport-boxshadow .ui-focus { | |
| outline-width: 2px; | |
| }/* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| /* some unsets - more probably needed */ | |
| .ui-mobile, .ui-mobile body { height: 100%; } | |
| .ui-mobile fieldset, .ui-page { padding: 0; margin: 0; } | |
| .ui-mobile a img, .ui-mobile fieldset { border: 0; } | |
| /* responsive page widths */ | |
| .ui-mobile-viewport { margin: 0; overflow-x: hidden; -webkit-text-size-adjust: none; -ms-text-size-adjust:none; -webkit-tap-highlight-color: rgba(0, 0, 0, 0); } | |
| /* "page" containers - full-screen views, one should always be in view post-pageload */ | |
| .ui-mobile [data-role=page], .ui-mobile [data-role=dialog], .ui-page { top: 0; left: 0; width: 100%; min-height: 100%; position: absolute; display: none; border: 0; } | |
| .ui-mobile .ui-page-active { display: block; overflow: visible; } | |
| /*orientations from js are available */ | |
| .portrait, | |
| .portrait .ui-page { min-height: 420px; } | |
| .landscape, | |
| .landscape .ui-page { min-height: 300px; } | |
| /* loading screen */ | |
| .ui-loading .ui-mobile-viewport { overflow: hidden !important; } | |
| .ui-loading .ui-loader { display: block; } | |
| .ui-loading .ui-page { overflow: hidden; } | |
| .ui-loader { display: none; position: absolute; opacity: .85; z-index: 100; left: 50%; width: 200px; margin-left: -130px; margin-top: -35px; padding: 10px 30px; } | |
| .ui-loader h1 { font-size: 15px; text-align: center; } | |
| .ui-loader .ui-icon { position: static; display: block; opacity: .9; margin: 0 auto; width: 35px; height: 35px; background-color: transparent; } | |
| /*fouc*/ | |
| .ui-mobile-rendering > * { visibility: hidden; } | |
| /*headers, content panels*/ | |
| .ui-bar, .ui-body { position: relative; padding: .4em 15px; overflow: hidden; display: block; clear:both; } | |
| .ui-bar { font-size: 16px; margin: 0; } | |
| .ui-bar h1, .ui-bar h2, .ui-bar h3, .ui-bar h4, .ui-bar h5, .ui-bar h6 { margin: 0; padding: 0; font-size: 16px; display: inline-block; } | |
| .ui-header, .ui-footer { display: block; } | |
| .ui-page .ui-header, .ui-page .ui-footer { position: relative; } | |
| .ui-header .ui-btn-left { position: absolute; left: 10px; top: .4em; } | |
| .ui-header .ui-btn-right { position: absolute; right: 10px; top: .4em; } | |
| .ui-header .ui-title, .ui-footer .ui-title { min-height: 1.1em; text-align: center; font-size: 16px; display: block; margin: .6em 90px .8em; padding: 0; text-overflow: ellipsis; overflow: hidden; white-space: nowrap; outline: 0 !important; } | |
| /*content area*/ | |
| .ui-content { border-width: 0; overflow: visible; overflow-x: hidden; padding: 15px; } | |
| .ui-page-fullscreen .ui-content { padding:0; } | |
| /* icons sizing */ | |
| .ui-icon { width: 18px; height: 18px; } | |
| /* fullscreen class on ui-content div */ | |
| .ui-fullscreen { } | |
| .ui-fullscreen img { max-width: 100%; } | |
| /* non-js content hiding */ | |
| .ui-nojs { position: absolute; left: -9999px; } | |
| /* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| .spin { | |
| -webkit-transform: rotate(360deg); | |
| -webkit-animation-name: spin; | |
| -webkit-animation-duration: 1s; | |
| -webkit-animation-iteration-count: infinite; | |
| -webkit-animation-timing-function: linear; | |
| } | |
| @-webkit-keyframes spin { | |
| from {-webkit-transform: rotate(0deg);} | |
| to {-webkit-transform: rotate(360deg);} | |
| } | |
| /* Transitions from jQtouch (with small modifications): http://www.jqtouch.com/ | |
| Built by David Kaneda and maintained by Jonathan Stark. | |
| */ | |
| .in, .out { | |
| -webkit-animation-timing-function: ease-in-out; | |
| -webkit-animation-duration: 350ms; | |
| } | |
| .slide.in { | |
| -webkit-transform: translateX(0); | |
| -webkit-animation-name: slideinfromright; | |
| } | |
| .slide.out { | |
| -webkit-transform: translateX(-100%); | |
| -webkit-animation-name: slideouttoleft; | |
| } | |
| .slide.in.reverse { | |
| -webkit-transform: translateX(0); | |
| -webkit-animation-name: slideinfromleft; | |
| } | |
| .slide.out.reverse { | |
| -webkit-transform: translateX(100%); | |
| -webkit-animation-name: slideouttoright; | |
| } | |
| .slideup.in { | |
| -webkit-transform: translateY(0); | |
| -webkit-animation-name: slideinfrombottom; | |
| z-index: 10; | |
| } | |
| .slideup.out { | |
| -webkit-animation-name: dontmove; | |
| z-index: 0; | |
| } | |
| .slideup.out.reverse { | |
| -webkit-transform: translateY(100%); | |
| z-index: 10; | |
| -webkit-animation-name: slideouttobottom; | |
| } | |
| .slideup.in.reverse { | |
| z-index: 0; | |
| -webkit-animation-name: dontmove; | |
| } | |
| .slidedown.in { | |
| -webkit-transform: translateY(0); | |
| -webkit-animation-name: slideinfromtop; | |
| z-index: 10; | |
| } | |
| .slidedown.out { | |
| -webkit-animation-name: dontmove; | |
| z-index: 0; | |
| } | |
| .slidedown.out.reverse { | |
| -webkit-transform: translateY(-100%); | |
| z-index: 10; | |
| -webkit-animation-name: slideouttotop; | |
| } | |
| .slidedown.in.reverse { | |
| z-index: 0; | |
| -webkit-animation-name: dontmove; | |
| } | |
| @-webkit-keyframes slideinfromright { | |
| from { -webkit-transform: translateX(100%); } | |
| to { -webkit-transform: translateX(0); } | |
| } | |
| @-webkit-keyframes slideinfromleft { | |
| from { -webkit-transform: translateX(-100%); } | |
| to { -webkit-transform: translateX(0); } | |
| } | |
| @-webkit-keyframes slideouttoleft { | |
| from { -webkit-transform: translateX(0); } | |
| to { -webkit-transform: translateX(-100%); } | |
| } | |
| @-webkit-keyframes slideouttoright { | |
| from { -webkit-transform: translateX(0); } | |
| to { -webkit-transform: translateX(100%); } | |
| } | |
| @-webkit-keyframes slideinfromtop { | |
| from { -webkit-transform: translateY(-100%); } | |
| to { -webkit-transform: translateY(0); } | |
| } | |
| @-webkit-keyframes slideinfrombottom { | |
| from { -webkit-transform: translateY(100%); } | |
| to { -webkit-transform: translateY(0); } | |
| } | |
| @-webkit-keyframes slideouttobottom { | |
| from { -webkit-transform: translateY(0); } | |
| to { -webkit-transform: translateY(100%); } | |
| } | |
| @-webkit-keyframes slideouttotop { | |
| from { -webkit-transform: translateY(0); } | |
| to { -webkit-transform: translateY(-100%); } | |
| } | |
| @-webkit-keyframes fadein { | |
| from { opacity: 0; } | |
| to { opacity: 1; } | |
| } | |
| @-webkit-keyframes fadeout { | |
| from { opacity: 1; } | |
| to { opacity: 0; } | |
| } | |
| .fade.in { | |
| opacity: 1; | |
| z-index: 10; | |
| -webkit-animation-name: fadein; | |
| } | |
| .fade.out { | |
| z-index: 0; | |
| -webkit-animation-name: fadeout; | |
| } | |
| /* The properties in this rule are only necessary for the 'flip' transition. | |
| * We need specify the perspective to create a projection matrix. This will add | |
| * some depth as the element flips. The depth number represents the distance of | |
| * the viewer from the z-plane. According to the CSS3 spec, 1000 is a moderate | |
| * value. | |
| */ | |
| .viewport-flip { | |
| -webkit-perspective: 1000; | |
| position: absolute; | |
| } | |
| .ui-mobile-viewport-transitioning, | |
| .ui-mobile-viewport-transitioning .ui-page { | |
| width: 100%; | |
| height: 100%; | |
| overflow: hidden; | |
| } | |
| .flip { | |
| -webkit-animation-duration: .65s; | |
| -webkit-backface-visibility:hidden; | |
| -webkit-transform:translateX(0); /* Needed to work around an iOS 3.1 bug that causes listview thumbs to disappear when -webkit-visibility:hidden is used. */ | |
| } | |
| .flip.in { | |
| -webkit-transform: rotateY(0) scale(1); | |
| -webkit-animation-name: flipinfromleft; | |
| } | |
| .flip.out { | |
| -webkit-transform: rotateY(-180deg) scale(.8); | |
| -webkit-animation-name: flipouttoleft; | |
| } | |
| /* Shake it all about */ | |
| .flip.in.reverse { | |
| -webkit-transform: rotateY(0) scale(1); | |
| -webkit-animation-name: flipinfromright; | |
| } | |
| .flip.out.reverse { | |
| -webkit-transform: rotateY(180deg) scale(.8); | |
| -webkit-animation-name: flipouttoright; | |
| } | |
| @-webkit-keyframes flipinfromright { | |
| from { -webkit-transform: rotateY(-180deg) scale(.8); } | |
| to { -webkit-transform: rotateY(0) scale(1); } | |
| } | |
| @-webkit-keyframes flipinfromleft { | |
| from { -webkit-transform: rotateY(180deg) scale(.8); } | |
| to { -webkit-transform: rotateY(0) scale(1); } | |
| } | |
| @-webkit-keyframes flipouttoleft { | |
| from { -webkit-transform: rotateY(0) scale(1); } | |
| to { -webkit-transform: rotateY(-180deg) scale(.8); } | |
| } | |
| @-webkit-keyframes flipouttoright { | |
| from { -webkit-transform: rotateY(0) scale(1); } | |
| to { -webkit-transform: rotateY(180deg) scale(.8); } | |
| } | |
| /* Hackish, but reliable. */ | |
| @-webkit-keyframes dontmove { | |
| from { opacity: 1; } | |
| to { opacity: 1; } | |
| } | |
| .pop { | |
| -webkit-transform-origin: 50% 50%; | |
| } | |
| .pop.in { | |
| -webkit-transform: scale(1); | |
| opacity: 1; | |
| -webkit-animation-name: popin; | |
| z-index: 10; | |
| } | |
| .pop.out.reverse { | |
| -webkit-transform: scale(.2); | |
| opacity: 0; | |
| -webkit-animation-name: popout; | |
| z-index: 10; | |
| } | |
| .pop.in.reverse { | |
| z-index: 0; | |
| -webkit-animation-name: dontmove; | |
| } | |
| @-webkit-keyframes popin { | |
| from { | |
| -webkit-transform: scale(.2); | |
| opacity: 0; | |
| } | |
| to { | |
| -webkit-transform: scale(1); | |
| opacity: 1; | |
| } | |
| } | |
| @-webkit-keyframes popout { | |
| from { | |
| -webkit-transform: scale(1); | |
| opacity: 1; | |
| } | |
| to { | |
| -webkit-transform: scale(.2); | |
| opacity: 0; | |
| } | |
| }/* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| /* content configurations. */ | |
| .ui-grid-a, .ui-grid-b, .ui-grid-c, .ui-grid-d { overflow: hidden; } | |
| .ui-block-a, .ui-block-b, .ui-block-c, .ui-block-d, .ui-block-e { margin: 0; padding: 0; border: 0; float: left; min-height:1px;} | |
| /* grid solo: 100 - single item fallback */ | |
| .ui-grid-solo .ui-block-a { width: 100%; float: none; } | |
| /* grid a: 50/50 */ | |
| .ui-grid-a .ui-block-a, .ui-grid-a .ui-block-b { width: 50%; } | |
| .ui-grid-a .ui-block-a { clear: left; } | |
| /* grid b: 33/33/33 */ | |
| .ui-grid-b .ui-block-a, .ui-grid-b .ui-block-b, .ui-grid-b .ui-block-c { width: 33.333%; } | |
| .ui-grid-b .ui-block-a { clear: left; } | |
| /* grid c: 25/25/25/25 */ | |
| .ui-grid-c .ui-block-a, .ui-grid-c .ui-block-b, .ui-grid-c .ui-block-c, .ui-grid-c .ui-block-d { width: 25%; } | |
| .ui-grid-c .ui-block-a { clear: left; } | |
| /* grid d: 20/20/20/20/20 */ | |
| .ui-grid-d .ui-block-a, .ui-grid-d .ui-block-b, .ui-grid-d .ui-block-c, .ui-grid-d .ui-block-d, .ui-grid-d .ui-block-e { width: 20%; } | |
| .ui-grid-d .ui-block-a { clear: left; } | |
| /* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| /* fixed page header & footer configuration */ | |
| .ui-header, .ui-footer, .ui-page-fullscreen .ui-header, .ui-page-fullscreen .ui-footer { position: absolute; overflow: hidden; width: 100%; border-left-width: 0; border-right-width: 0; } | |
| .ui-header-fixed, .ui-footer-fixed { | |
| z-index: 1000; | |
| -webkit-transform: translateZ(0); /* Force header/footer rendering to go through the same rendering pipeline as native page scrolling. */ | |
| } | |
| .ui-footer-duplicate, .ui-page-fullscreen .ui-fixed-inline { display: none; } | |
| .ui-page-fullscreen .ui-header, .ui-page-fullscreen .ui-footer { opacity: .9; } | |
| /* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| .ui-navbar { overflow: hidden; } | |
| .ui-navbar ul, .ui-navbar-expanded ul { list-style:none; padding: 0; margin: 0; position: relative; display: block; border: 0;} | |
| .ui-navbar-collapsed ul { float: left; width: 75%; margin-right: -2px; } | |
| .ui-navbar-collapsed .ui-navbar-toggle { float: left; width: 25%; } | |
| .ui-navbar li.ui-navbar-truncate { position: absolute; left: -9999px; top: -9999px; } | |
| .ui-navbar li .ui-btn, .ui-navbar .ui-navbar-toggle .ui-btn { display: block; font-size: 12px; text-align: center; margin: 0; border-right-width: 0; } | |
| .ui-navbar li .ui-btn { margin-right: -1px; } | |
| .ui-navbar li .ui-btn:last-child { margin-right: 0; } | |
| .ui-header .ui-navbar li .ui-btn, .ui-header .ui-navbar .ui-navbar-toggle .ui-btn, | |
| .ui-footer .ui-navbar li .ui-btn, .ui-footer .ui-navbar .ui-navbar-toggle .ui-btn { border-top-width: 0; border-bottom-width: 0; } | |
| .ui-navbar .ui-btn-inner { padding-left: 2px; padding-right: 2px; } | |
| .ui-navbar-noicons li .ui-btn .ui-btn-inner, .ui-navbar-noicons .ui-navbar-toggle .ui-btn-inner { padding-top: .8em; padding-bottom: .9em; } | |
| /*expanded page styles*/ | |
| .ui-navbar-expanded .ui-btn { margin: 0; font-size: 14px; } | |
| .ui-navbar-expanded .ui-btn-inner { padding-left: 5px; padding-right: 5px; } | |
| .ui-navbar-expanded .ui-btn-icon-top .ui-btn-inner { padding: 45px 5px 15px; text-align: center; } | |
| .ui-navbar-expanded .ui-btn-icon-top .ui-icon { top: 15px; } | |
| .ui-navbar-expanded .ui-btn-icon-bottom .ui-btn-inner { padding: 15px 5px 45px; text-align: center; } | |
| .ui-navbar-expanded .ui-btn-icon-bottom .ui-icon { bottom: 15px; } | |
| .ui-navbar-expanded li .ui-btn .ui-btn-inner { min-height: 2.5em; } | |
| .ui-navbar-expanded .ui-navbar-noicons .ui-btn .ui-btn-inner { padding-top: 1.8em; padding-bottom: 1.9em; } | |
| /* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| .ui-btn { display: block; text-align: center; cursor:pointer; position: relative; margin: .5em 5px; padding: 0; } | |
| .ui-btn:focus, .ui-btn:active { outline: none; } | |
| .ui-header .ui-btn, .ui-footer .ui-btn, .ui-bar .ui-btn { display: inline-block; font-size: 13px; margin: 0; } | |
| .ui-btn-inline { display: inline-block; } | |
| .ui-btn-inner { padding: .6em 25px; display: block; text-overflow: ellipsis; overflow: hidden; white-space: nowrap; position: relative; zoom: 1; } | |
| .ui-header .ui-btn-inner, .ui-footer .ui-btn-inner, .ui-bar .ui-btn-inner { padding: .4em 8px .5em; } | |
| .ui-btn-icon-notext { display: inline-block; width: 20px; height: 20px; padding: 2px 1px 2px 3px; text-indent: -9999px; } | |
| .ui-btn-icon-notext .ui-btn-inner { padding: 0; } | |
| .ui-btn-icon-notext .ui-btn-text { position: absolute; left: -999px; } | |
| .ui-btn-icon-left .ui-btn-inner { padding-left: 33px; } | |
| .ui-header .ui-btn-icon-left .ui-btn-inner, | |
| .ui-footer .ui-btn-icon-left .ui-btn-inner, | |
| .ui-bar .ui-btn-icon-left .ui-btn-inner { padding-left: 27px; } | |
| .ui-btn-icon-right .ui-btn-inner { padding-right: 33px; } | |
| .ui-header .ui-btn-icon-right .ui-btn-inner, | |
| .ui-footer .ui-btn-icon-right .ui-btn-inner, | |
| .ui-bar .ui-btn-icon-right .ui-btn-inner { padding-right: 27px; } | |
| .ui-btn-icon-top .ui-btn-inner { padding-top: 33px; } | |
| .ui-header .ui-btn-icon-top .ui-btn-inner, | |
| .ui-footer .ui-btn-icon-top .ui-btn-inner, | |
| .ui-bar .ui-btn-icon-top .ui-btn-inner { padding-top: 27px; } | |
| .ui-btn-icon-bottom .ui-btn-inner { padding-bottom: 33px; } | |
| .ui-header .ui-btn-icon-bottom .ui-btn-inner, | |
| .ui-footer .ui-btn-icon-bottom .ui-btn-inner, | |
| .ui-bar .ui-btn-icon-bottom .ui-btn-inner { padding-bottom: 27px; } | |
| /*btn icon positioning*/ | |
| .ui-btn-icon-notext .ui-icon { display: block; } | |
| .ui-btn-icon-left .ui-icon, .ui-btn-icon-right .ui-icon { position: absolute; top: 50%; margin-top: -9px; } | |
| .ui-btn-icon-top .ui-icon, .ui-btn-icon-bottom .ui-icon { position: absolute; left: 50%; margin-left: -9px; } | |
| .ui-btn-icon-left .ui-icon { left: 10px; } | |
| .ui-btn-icon-right .ui-icon {right: 10px; } | |
| .ui-header .ui-btn-icon-left .ui-icon, | |
| .ui-footer .ui-btn-icon-left .ui-icon, | |
| .ui-bar .ui-btn-icon-left .ui-icon { left: 4px; } | |
| .ui-header .ui-btn-icon-right .ui-icon, | |
| .ui-footer .ui-btn-icon-right .ui-icon, | |
| .ui-bar .ui-btn-icon-right .ui-icon { right: 4px; } | |
| .ui-header .ui-btn-icon-top .ui-icon, | |
| .ui-footer .ui-btn-icon-top .ui-icon, | |
| .ui-bar .ui-btn-icon-top .ui-icon { top: 4px; } | |
| .ui-header .ui-btn-icon-bottom .ui-icon, | |
| .ui-footer .ui-btn-icon-bottom .ui-icon, | |
| .ui-bar .ui-btn-icon-bottom .ui-icon { bottom: 4px; } | |
| .ui-btn-icon-top .ui-icon { top: 5px; } | |
| .ui-btn-icon-bottom .ui-icon { bottom: 5px; } | |
| /*hiding native button,inputs */ | |
| .ui-btn-hidden { position: absolute; top: 0; left: 0; width: 100%; height: 100%; -webkit-appearance: button; opacity: 0; cursor: pointer; -ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=0)"; filter: alpha(opacity=0); background: transparent; } | |
| /* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| .ui-collapsible-contain { margin: .5em 0; } | |
| .ui-collapsible-heading { font-size: 16px; display: block; margin: 0 -8px; padding: 0; border-width: 0 0 1px 0; position: relative; } | |
| .ui-collapsible-heading a { text-align: left; margin: 0; } | |
| .ui-collapsible-heading a .ui-btn-inner { padding-left: 40px; } | |
| .ui-collapsible-heading a span.ui-btn { position: absolute; left: 6px; top: 50%; margin: -12px 0 0 0; width: 20px; height: 20px; padding: 1px 0px 1px 2px; text-indent: -9999px; } | |
| .ui-collapsible-heading a span.ui-btn .ui-btn-inner { padding: 10px 0; } | |
| .ui-collapsible-heading a span.ui-btn .ui-icon { left: 0; margin-top: -10px; } | |
| .ui-collapsible-heading-status { position:absolute; left:-9999px; } | |
| .ui-collapsible-content { display: block; padding: 10px 0 10px 8px; } | |
| .ui-collapsible-content-collapsed { display: none; } | |
| .ui-collapsible-set { margin: .5em 0; } | |
| .ui-collapsible-set .ui-collapsible-contain { margin: -1px 0 0; } | |
| /* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| .ui-controlgroup, fieldset.ui-controlgroup { padding: 0; margin: .5em 0 1em; } | |
| .ui-bar .ui-controlgroup { margin: 0 .3em; } | |
| .ui-controlgroup-label { font-size: 16px; line-height: 1.4; font-weight: normal; margin: 0 0 .3em; } | |
| .ui-controlgroup-controls { display: block; width: 95%;} | |
| .ui-controlgroup li { list-style: none; } | |
| .ui-controlgroup-vertical .ui-btn, | |
| .ui-controlgroup-vertical .ui-checkbox, .ui-controlgroup-vertical .ui-radio { margin: 0; border-bottom-width: 0; } | |
| .ui-controlgroup-vertical .ui-controlgroup-last { border-bottom-width: 1px; } | |
| .ui-controlgroup-horizontal { padding: 0; } | |
| .ui-controlgroup-horizontal .ui-btn, | |
| .ui-controlgroup-horizontal .ui-checkbox, .ui-controlgroup-horizontal .ui-radio { display: inline-block; margin: 0 -5px 0 0; } | |
| .ui-controlgroup-horizontal .ui-checkbox, .ui-controlgroup-horizontal .ui-radio { display: inline; } | |
| .ui-controlgroup-horizontal .ui-checkbox .ui-btn, .ui-controlgroup-horizontal .ui-radio .ui-btn, | |
| .ui-controlgroup-horizontal .ui-checkbox:last-child, .ui-controlgroup-horizontal .ui-radio:last-child { margin-right: 0; } | |
| .ui-controlgroup-horizontal .ui-controlgroup-last { margin-right: 0; } | |
| .ui-controlgroup .ui-checkbox label, .ui-controlgroup .ui-radio label { font-size: 16px; } | |
| /* conflicts with listview.. | |
| .ui-controlgroup .ui-btn-icon-notext { width: 30px; height: 30px; text-indent: -9999px; } | |
| .ui-controlgroup .ui-btn-icon-notext .ui-btn-inner { padding: 5px 6px 5px 5px; } | |
| */ | |
| @media all and (min-width: 450px){ | |
| .ui-controlgroup-label { vertical-align: top; display: inline-block; width: 20%; margin: 0 2% 0 0; } | |
| .ui-controlgroup-controls { width: 60%; display: inline-block; } | |
| } /* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| .ui-dialog { min-height: 480px; } | |
| .ui-dialog .ui-header, .ui-dialog .ui-content, .ui-dialog .ui-footer { margin: 15px; position: relative; } | |
| .ui-dialog .ui-header, .ui-dialog .ui-footer { z-index: 10; width: auto; } | |
| .ui-dialog .ui-content, .ui-dialog .ui-footer { margin-top: -15px; }/* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| .ui-checkbox, .ui-radio { position:relative; margin: .2em 0 .5em; z-index: 1; } | |
| .ui-checkbox .ui-btn, .ui-radio .ui-btn { margin: 0; text-align: left; z-index: 2; } | |
| .ui-checkbox .ui-btn-inner, .ui-radio .ui-btn-inner { white-space: normal; } | |
| .ui-checkbox .ui-btn-icon-left .ui-btn-inner,.ui-radio .ui-btn-icon-left .ui-btn-inner { padding-left: 45px; } | |
| .ui-checkbox .ui-btn-icon-right .ui-btn-inner, .ui-radio .ui-btn-icon-right .ui-btn-inner { padding-right: 45px; } | |
| .ui-checkbox .ui-icon, .ui-radio .ui-icon { top: 1.1em; } | |
| .ui-checkbox .ui-btn-icon-left .ui-icon, .ui-radio .ui-btn-icon-left .ui-icon {left: 15px; } | |
| .ui-checkbox .ui-btn-icon-right .ui-icon, .ui-radio .ui-btn-icon-right .ui-icon {right: 15px; } | |
| /* input, label positioning */ | |
| .ui-checkbox input,.ui-radio input { position:absolute; left:20px; top:50%; width: 10px; height: 10px; margin:-5px 0 0 0; outline: 0 !important; z-index: 1; }/* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| .ui-field-contain { padding: 1.5em 0; margin: 0; border-bottom-width: 1px; overflow: visible; } | |
| .ui-field-contain:first-child { border-top-width: 0; } | |
| @media all and (min-width: 450px){ | |
| .ui-field-contain { border-width: 0; padding: 0; margin: 1em 0; } | |
| } /* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| .ui-select { display: block; position: relative; } | |
| .ui-select select { position: absolute; left: -9999px; top: -9999px; } | |
| .ui-select .ui-btn { overflow: hidden; } | |
| .ui-select .ui-btn select { cursor: pointer; -webkit-appearance: button; left: 0; top:0; width: 100%; height: 100%; opacity: 0; -ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=0)"; filter: alpha(opacity=0); } | |
| @-moz-document url-prefix() {.ui-select .ui-btn select { opacity: 0.0001; }} | |
| .ui-select .ui-btn select.ui-select-nativeonly { opacity: 1; text-indent: 0; } | |
| .ui-select .ui-btn-icon-right .ui-btn-inner { padding-right: 45px; } | |
| .ui-select .ui-btn-icon-right .ui-icon { right: 15px; } | |
| /* labels */ | |
| label.ui-select { font-size: 16px; line-height: 1.4; font-weight: normal; margin: 0 0 .3em; display: block; } | |
| /*listbox*/ | |
| .ui-select .ui-btn-text, .ui-selectmenu .ui-btn-text { display: block; min-height: 1em; } | |
| .ui-select .ui-btn-text { text-overflow: ellipsis; overflow: hidden;} | |
| .ui-selectmenu { position: absolute; padding: 0; z-index: 100 !important; width: 80%; max-width: 350px; padding: 6px; } | |
| .ui-selectmenu .ui-listview { margin: 0; } | |
| .ui-selectmenu .ui-btn.ui-li-divider { cursor: default; } | |
| .ui-selectmenu-hidden { top: -9999px; left: -9999px; } | |
| .ui-selectmenu-screen { position: absolute; top: 0; left: 0; width: 100%; height: 100%; z-index: 99; } | |
| .ui-screen-hidden, .ui-selectmenu-list .ui-li .ui-icon { display: none; } | |
| .ui-selectmenu-list .ui-li .ui-icon { display: block; } | |
| .ui-li.ui-selectmenu-placeholder { display: none; } | |
| .ui-selectmenu .ui-header .ui-title { margin: 0.6em 46px 0.8em; } | |
| @media all and (min-width: 450px){ | |
| label.ui-select { display: inline-block; width: 20%; margin: 0 2% 0 0; } | |
| .ui-select { width: 60%; display: inline-block; } | |
| } | |
| /* when no placeholder is defined in a multiple select, the header height doesn't even extend past the close button. this shim's content in there */ | |
| .ui-selectmenu .ui-header h1:after { content: '.'; visibility: hidden; }/* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| label.ui-input-text { font-size: 16px; line-height: 1.4; display: block; font-weight: normal; margin: 0 0 .3em; } | |
| input.ui-input-text, textarea.ui-input-text { background-image: none; padding: .4em; line-height: 1.4; font-size: 16px; display: block; width: 95%; } | |
| input.ui-input-text { -webkit-appearance: none; } | |
| textarea.ui-input-text { height: 50px; -webkit-transition: height 200ms linear; -moz-transition: height 200ms linear; -o-transition: height 200ms linear; transition: height 200ms linear; } | |
| .ui-input-search { padding: 0 30px; width: 77%; background-position: 8px 50%; background-repeat: no-repeat; position: relative; } | |
| .ui-input-search input.ui-input-text { border: none; width: 98%; padding: .4em 0; margin: 0; display: block; background: transparent none; outline: 0 !important; } | |
| .ui-input-search .ui-input-clear { position: absolute; right: 0; top: 50%; margin-top: -14px; } | |
| .ui-input-search .ui-input-clear-hidden { display: none; } | |
| /* orientation adjustments - incomplete!*/ | |
| @media all and (min-width: 450px){ | |
| label.ui-input-text { vertical-align: top; display: inline-block; width: 20%; margin: 0 2% 0 0 } | |
| input.ui-input-text, | |
| textarea.ui-input-text, | |
| .ui-input-search { width: 60%; display: inline-block; } | |
| .ui-input-search { width: 50%; } | |
| .ui-input-search input.ui-input-text { width: 98%; /*echos rule from above*/ } | |
| }/* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| .ui-listview { margin: 0; counter-reset: listnumbering; } | |
| .ui-content .ui-listview { margin: -15px; } | |
| .ui-content .ui-listview-inset { margin: 1em 0; } | |
| .ui-listview, .ui-li { list-style:none; padding:0; } | |
| .ui-li, .ui-li.ui-field-contain { display: block; margin:0; position: relative; overflow: visible; text-align: left; border-width: 0; border-top-width: 1px; } | |
| .ui-li .ui-btn-text a.ui-link-inherit { text-overflow: ellipsis; overflow: hidden; white-space: nowrap; } | |
| .ui-li-divider, .ui-li-static { padding: .5em 15px; font-size: 14px; font-weight: bold; } | |
| .ui-li-divider { counter-reset: listnumbering; } | |
| ol.ui-listview .ui-link-inherit:before, ol.ui-listview .ui-li-static:before, .ui-li-dec { font-size: .8em; display: inline-block; padding-right: .3em; font-weight: normal;counter-increment: listnumbering; content: counter(listnumbering) ". "; } | |
| ol.ui-listview .ui-li-jsnumbering:before { content: "" !important; } /* to avoid chance of duplication */ | |
| .ui-listview-inset .ui-li { border-right-width: 1px; border-left-width: 1px; } | |
| .ui-li:last-child, .ui-li.ui-field-contain:last-child { border-bottom-width: 1px; } | |
| .ui-li>.ui-btn-inner { display: block; position: relative; padding: 0; } | |
| .ui-li .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li { padding: .7em 75px .7em 15px; display: block; } | |
| .ui-li-has-thumb .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li-has-thumb { min-height: 60px; padding-left: 100px; } | |
| .ui-li-has-icon .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li-has-icon { min-height: 20px; padding-left: 40px; } | |
| .ui-li-heading { font-size: 16px; font-weight: bold; display: block; margin: .6em 0; text-overflow: ellipsis; overflow: hidden; white-space: nowrap; } | |
| .ui-li-desc { font-size: 12px; font-weight: normal; display: block; margin: -.5em 0 .6em; text-overflow: ellipsis; overflow: hidden; white-space: nowrap; } | |
| .ui-li-thumb, .ui-li-icon { position: absolute; left: 1px; top: 0; max-height: 80px; max-width: 80px; } | |
| .ui-li-icon { max-height: 40px; max-width: 40px; left: 10px; top: .9em; } | |
| .ui-li-thumb, .ui-li-icon, .ui-li-content { float: left; margin-right: 10px; } | |
| .ui-li-aside { float: right; width: 50%; text-align: right; margin: .3em 0; } | |
| @media all and (min-width: 480px){ | |
| .ui-li-aside { width: 45%; } | |
| } | |
| .ui-li-divider { cursor: default; } | |
| .ui-li-has-alt .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li-has-alt { padding-right: 95px; } | |
| .ui-li-count { position: absolute; font-size: 11px; font-weight: bold; padding: .2em .5em; top: 50%; margin-top: -.9em; right: 38px; } | |
| .ui-li-divider .ui-li-count, .ui-li-static .ui-li-count { right: 10px; } | |
| .ui-li-has-alt .ui-li-count { right: 55px; } | |
| .ui-li-link-alt { position: absolute; width: 40px; height: 100%; border-width: 0; border-left-width: 1px; top: 0; right: 0; margin: 0; padding: 0; } | |
| .ui-li-link-alt .ui-btn { overflow: hidden; position: absolute; right: 8px; top: 50%; margin: -11px 0 0 0; border-bottom-width: 1px; } | |
| .ui-li-link-alt .ui-btn-inner { padding: 0; position: static; } | |
| .ui-li-link-alt .ui-btn .ui-icon { right: 50%; margin-right: -9px; } | |
| .ui-listview-filter { border-width: 0; overflow: hidden; margin: -15px -15px 15px -15px } | |
| .ui-listview-filter .ui-input-search { margin: 5px; width: auto; display: block; } | |
| .ui-listview-filter-inset { margin: -15px -5px -15px -5px; background: transparent; } | |
| .ui-li.ui-screen-hidden{display:none;} | |
| /* Odd iPad positioning issue. */ | |
| @media only screen and (min-device-width: 768px) and (max-device-width: 1024px) { | |
| .ui-li .ui-btn-text { overflow: visible; } | |
| }/* | |
| * jQuery Mobile Framework | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| label.ui-slider { display: block; } | |
| input.ui-slider-input { display: inline-block; width: 50px; } | |
| select.ui-slider-switch { display: none; } | |
| div.ui-slider { position: relative; display: inline-block; overflow: visible; height: 15px; padding: 0; margin: 0 2% 0 20px; top: 4px; width: 66%; } | |
| a.ui-slider-handle { position: absolute; z-index: 10; top: 50%; width: 28px; height: 28px; margin-top: -15px; margin-left: -15px; } | |
| a.ui-slider-handle .ui-btn-inner { padding-left: 0; padding-right: 0; } | |
| @media all and (min-width: 480px){ | |
| label.ui-slider { display: inline-block; width: 20%; margin: 0 2% 0 0; } | |
| div.ui-slider { width: 45%; } | |
| } | |
| div.ui-slider-switch { height: 32px; overflow: hidden; margin-left: 0; } | |
| div.ui-slider-inneroffset { margin-left: 50%; position: absolute; top: 1px; height: 100%; width: 50%; } | |
| div.ui-slider-handle-snapping { -webkit-transition: left 100ms linear; } | |
| div.ui-slider-labelbg { position: absolute; top:0; margin: 0; border-width: 0; } | |
| div.ui-slider-switch div.ui-slider-labelbg-a { width: 60%; height: 100%; left: 0; } | |
| div.ui-slider-switch div.ui-slider-labelbg-b { width: 60%; height: 100%; right: 0; } | |
| .ui-slider-switch-a div.ui-slider-labelbg-a, .ui-slider-switch-b div.ui-slider-labelbg-b { z-index: -1; } | |
| .ui-slider-switch-a div.ui-slider-labelbg-b, .ui-slider-switch-b div.ui-slider-labelbg-a { z-index: 0; } | |
| div.ui-slider-switch a.ui-slider-handle { z-index: 20; width: 101%; height: 32px; margin-top: -18px; margin-left: -101%; } | |
| span.ui-slider-label { width: 100%; position: absolute;height: 32px; font-size: 16px; text-align: center; line-height: 2; background: none; border-color: transparent; } | |
| span.ui-slider-label-a { left: -100%; margin-right: -1px } | |
| span.ui-slider-label-b { right: -100%; margin-left: -1px } | |
| <?php | |
| header('Content-type: text/css'); | |
| ob_start("compress"); | |
| function compress($buffer) { | |
| /* remove comments */ | |
| $buffer = preg_replace('!/\*[^*]*\*+([^/][^*]*\*+)*/!', '', $buffer); | |
| /* remove tabs, spaces, newlines, etc. */ | |
| $buffer = str_replace(array("\r\n", "\r", "\n", "\t", ' ', ' ', ' '), '', $buffer); | |
| return $buffer; | |
| } | |
| echo ' | |
| .ui-li-thumb, .ui-li-icon { position: relative; } | |
| .ui-navbar { | |
| width: 100%; | |
| } | |
| .ui-btn-inner { | |
| white-space: normal !important; | |
| } | |
| .ui-li-heading { | |
| white-space: normal !important; | |
| } | |
| .ui-listview-filter { | |
| margin: 0 !important; | |
| } | |
| .ui-icon-navigation { | |
| background-image: url(images/113-navigation.png); | |
| background-position: 1px 0; | |
| } | |
| .ui-icon-beaker { | |
| background-image: url(images/91-beaker-2.png); | |
| background-position: 1px 0; | |
| } | |
| #footer { | |
| text-size: 0.75em; | |
| text-align: center; | |
| } | |
| body { | |
| background-color: #F0F0F0; | |
| } | |
| #jqm-homeheader { | |
| text-align: center; | |
| } | |
| .viaPoints { | |
| display: none; | |
| text-size: 0.2em; | |
| } | |
| .min-width-480px .viaPoints { | |
| display: inline; | |
| } | |
| #extrainfo { | |
| visibility: hidden; | |
| display: none; | |
| } | |
| #servicewarning { | |
| padding: 1em; | |
| margin-bottom: 0.5em; | |
| text-size: 0.2em; | |
| background-color: #FF9; | |
| -moz-border-radius: 15px; | |
| border-radius: 15px; | |
| } | |
| #footer { | |
| clear:both; | |
| text-align:center; | |
| } | |
| // source http://webaim.org/techniques/skipnav/ | |
| #skip a, #skip a:hover, #skip a:visited | |
| { | |
| position:absolute; | |
| left:0px; | |
| top:-500px; | |
| width:1px; | |
| height:1px; | |
| overflow:hidden; | |
| } | |
| #skip a:active, #skip a:focus | |
| { | |
| position:static; | |
| width:auto; | |
| height:auto; | |
| }'; | |
| //if (false) | |
| echo ' | |
| // adaptive layout from jQuery Mobile docs site | |
| .type-interior .content-secondary { | |
| border-right: 0; | |
| border-left: 0; | |
| margin: 10px -15px 0; | |
| background: #fff; | |
| border-top: 1px solid #ccc; | |
| } | |
| .type-home .ui-content { | |
| margin-top: 5px; | |
| } | |
| .type-interior .ui-content { | |
| padding-bottom: 0; | |
| } | |
| .content-secondary .ui-collapsible-contain { | |
| padding: 10px 15px; | |
| } | |
| .content-secondary .ui-collapsible-heading { | |
| margin: 0 0 30px; | |
| } | |
| .content-secondary .ui-collapsible-heading-collapsed, | |
| .content-secondary .ui-collapsible-content { | |
| padding:0; | |
| margin: 0; | |
| } | |
| @media all and (min-width: 650px){ | |
| .content-secondary { | |
| text-align: left; | |
| float: left; | |
| width: 45%; | |
| background: none; | |
| border-top: 0; | |
| } | |
| .content-secondary, | |
| .type-interior .content-secondary { | |
| margin: 30px 0 20px 2%; | |
| padding: 20px 4% 0 0; | |
| background: none; | |
| } | |
| .type-index .content-secondary { | |
| padding: 0; | |
| } | |
| .type-index .content-secondary .ui-listview { | |
| margin: 0; | |
| } | |
| .content-primary { | |
| width: 45%; | |
| float: right; | |
| margin-top: 30px; | |
| margin-right: 1%; | |
| padding-right: 1%; | |
| } | |
| .content-primary ul:first-child { | |
| margin-top: 0; | |
| } | |
| .type-interior .content-primary { | |
| padding: 1.5em 6% 3em 0; | |
| margin: 0; | |
| } | |
| /* fix up the collapsibles - expanded on desktop */ | |
| .content-secondary .ui-collapsible-heading { | |
| display: none; | |
| } | |
| .content-secondary .ui-collapsible-contain { | |
| margin:0; | |
| } | |
| .content-secondary .ui-collapsible-content { | |
| display: block; | |
| margin: 0; | |
| padding: 0; | |
| } | |
| .type-interior .content-secondary .ui-li-divider { | |
| padding-top: 1em; | |
| padding-bottom: 1em; | |
| } | |
| .type-interior .content-secondary { | |
| margin: 0; | |
| padding: 0; | |
| } | |
| } | |
| @media all and (min-width: 750px){ | |
| .type-home .ui-content, | |
| .type-interior .ui-content { | |
| background-position: 39%; | |
| } | |
| .content-secondary { | |
| width: 34%; | |
| } | |
| .content-primary { | |
| width: 56%; | |
| padding-right: 1%; | |
| } | |
| .type-interior .ui-content { | |
| background-position: 34%; | |
| } | |
| } | |
| @media all and (min-width: 1200px){ | |
| .type-home .ui-content{ | |
| background-position: 38.5%; | |
| } | |
| .type-interior .ui-content { | |
| background-position: 30%; | |
| } | |
| .content-secondary { | |
| width: 30%; | |
| padding-right:6%; | |
| margin: 30px 0 20px 5%; | |
| } | |
| .type-interior .content-secondary { | |
| margin: 0; | |
| padding: 0; | |
| } | |
| .content-primary { | |
| width: 50%; | |
| margin-right: 5%; | |
| padding-right: 3%; | |
| } | |
| .type-interior .content-primary { | |
| width: 60%; | |
| } | |
| }'; | |
| ob_end_flush(); | |
| ?> | |
| #!/bin/bash | #!/bin/bash |
| #dotcloud postinstall | #dotcloud postinstall |
| curl http://s3-ap-southeast-1.amazonaws.com/busresources/cbrfeed.zip \ | curl http://s3-ap-southeast-1.amazonaws.com/busresources/cbrfeed.zip \ |
| -o /home/dotcloud/current/cbrfeed.zip | -o /home/dotcloud/current/cbrfeed.zip |
| wget http://s3-ap-southeast-1.amazonaws.com/busresources/Graph.obj \ | curl http://s3-ap-southeast-1.amazonaws.com/busresources/Graph.obj \ |
| -O /tmp/Graph.obj | -o /tmp/Graph.obj |
| #db setup | #db setup |
| #curl https://github.com/maxious/ACTBus-ui/raw/master/transitdata.cbrfeed.sql.gz -o transitdata.cbrfeed.sql.gz | #curl https://github.com/maxious/ACTBus-ui/raw/master/transitdata.cbrfeed.sql.gz -o transitdata.cbrfeed.sql.gz |
| #curl https://github.com/maxious/ACTBus-ui/raw/master/lib/postgis.sql -o postgis.sql | #curl https://github.com/maxious/ACTBus-ui/raw/master/lib/postgis.sql -o postgis.sql |
| #createlang -d transitdata plpgsql | #createlang -d transitdata plpgsql |
| #psql -d transitdata -f postgis.sql | #psql -d transitdata -f postgis.sql |
| #gunzip /var/www/transitdata.cbrfeed.sql.gz | #gunzip /var/www/transitdata.cbrfeed.sql.gz |
| #psql -d transitdata -f transitdata.cbrfeed.sql | #psql -d transitdata -f transitdata.cbrfeed.sql |
| #createuser transitdata -SDRP | #createuser transitdata -SDRP |
| #password transitdata | #password transitdata |
| #psql -c \"GRANT SELECT ON TABLE agency,calendar,calendar_dates,routes,stop_times,stops,trips TO transitdata;\" | #psql -c \"GRANT SELECT ON TABLE agency,calendar,calendar_dates,routes,stop_times,stops,trips TO transitdata;\" |
| <?php | <?php |
| // SELECT array_to_string(array(SELECT REPLACE(name_2006, ',', '\,') as name FROM suburbs order by name), ',') | // SELECT array_to_string(array(SELECT REPLACE(name_2006, ',', '\,') as name FROM suburbs order by name), ',') |
| $suburbs = explode(",", "Acton,Ainslie,Amaroo,Aranda,Banks,Barton,Belconnen,Bonner,Bonython,Braddon,Bruce,Calwell,Campbell,Chapman,Charnwood,Chifley,Chisholm,City,Conder,Cook,Curtin,Deakin,Dickson,Downer,Duffy,Dunlop,Evatt,Fadden,Farrer,Fisher,Florey,Flynn,Forrest,Franklin,Fraser,Fyshwick,Garran,Gilmore,Giralang,Gordon,Gowrie,Greenway,Griffith,Gungahlin,Hackett,Hall,Harrison,Hawker,Higgins,Holder,Holt,Hughes,Hume,Isaacs,Isabella Plains,Kaleen,Kambah,Kingston,Latham,Lawson,Lyneham,Lyons,Macarthur,Macgregor,Macquarie,Mawson,McKellar,Melba,Mitchell,Monash,Narrabundah,Ngunnawal,Nicholls,Oaks Estate,O'Connor,O'Malley,Oxley,Page,Palmerston,Parkes,Pearce,Phillip,Pialligo,Red Hill,Reid,Richardson,Rivett,Russell,Scullin,Spence,Stirling,Symonston,Tharwa,Theodore,Torrens,Turner,Wanniassa,Waramanga,Watson,Weetangera,Weston,Yarralumla"); | $suburbs = explode(",", "Acton,Ainslie,Amaroo,Aranda,Banks,Barton,Belconnen,Bonner,Bonython,Braddon,Bruce,Calwell,Campbell,Chapman,Charnwood,Chifley,Chisholm,City,Conder,Cook,Curtin,Deakin,Dickson,Downer,Duffy,Dunlop,Evatt,Fadden,Farrer,Fisher,Florey,Flynn,Forrest,Franklin,Fraser,Fyshwick,Garran,Gilmore,Giralang,Gordon,Gowrie,Greenway,Griffith,Gungahlin,Hackett,Hall,Harrison,Hawker,Higgins,Holder,Holt,Hughes,Hume,Isaacs,Isabella Plains,Kaleen,Kambah,Kingston,Latham,Lawson,Lyneham,Lyons,Macarthur,Macgregor,Macquarie,Mawson,McKellar,Melba,Mitchell,Monash,Narrabundah,Ngunnawal,Nicholls,Oaks Estate,O'Connor,O'Malley,Oxley,Page,Palmerston,Parkes,Pearce,Phillip,Pialligo,Red Hill,Reid,Richardson,Rivett,Russell,Scullin,Spence,Stirling,Symonston,Tharwa,Theodore,Torrens,Turner,Wanniassa,Waramanga,Watson,Weetangera,Weston,Yarralumla"); |
| function staticmap($mapPoints, $zoom = 0, $markerImage = "iconb", $collapsible = true) | function staticmap($mapPoints, $zoom = 0, $markerImage = "iconb", $collapsible = true, $twotone = false) |
| { | { |
| global $labsPath; | |
| $width = 300; | $width = 300; |
| $height = 300; | $height = 300; |
| $metersperpixel[9] = 305.492 * $width; | $metersperpixel[9] = 305.492 * $width; |
| $metersperpixel[10] = 152.746 * $width; | $metersperpixel[10] = 152.746 * $width; |
| $metersperpixel[11] = 76.373 * $width; | $metersperpixel[11] = 76.373 * $width; |
| $metersperpixel[12] = 38.187 * $width; | $metersperpixel[12] = 38.187 * $width; |
| $metersperpixel[13] = 19.093 * $width; | $metersperpixel[13] = 19.093 * $width; |
| $metersperpixel[14] = 9.547 * $width; | $metersperpixel[14] = 9.547 * $width; |
| $metersperpixel[15] = 4.773 * $width; | $metersperpixel[15] = 4.773 * $width; |
| $metersperpixel[16] = 2.387 * $width; | //$metersperpixel[16] = 2.387 * $width; |
| // $metersperpixel[17]=1.193*$width; | // $metersperpixel[17]=1.193*$width; |
| $center = ""; | $center = ""; |
| $markers = ""; | $markers = ""; |
| $minlat = 999; | $mapwidthinmeters = 50; |
| $minlon = 999; | |
| $maxlat = 0; | |
| $maxlon = 0; | |
| if (sizeof($mapPoints) < 1) return "map error"; | if (sizeof($mapPoints) < 1) return "map error"; |
| if (sizeof($mapPoints) === 1) { | if (sizeof($mapPoints) === 1) { |
| if ($zoom == 0) $zoom = 14; | if ($zoom == 0) $zoom = 14; |
| $markers.= "{$mapPoints[0][0]},{$mapPoints[0][1]},$markerimage"; | $markers.= "{$mapPoints[0][0]},{$mapPoints[0][1]},$markerimage"; |
| $center = "{$mapPoints[0][0]},{$mapPoints[0][1]}"; | $center = "{$mapPoints[0][0]},{$mapPoints[0][1]}"; |
| } | } |
| else { | else { |
| foreach ($mapPoints as $index => $mapPoint) { | foreach ($mapPoints as $index => $mapPoint) { |
| $markers.= $mapPoint[0] . "," . $mapPoint[1] . "," . $markerImage . ($index + 1); | if ($twotone && $index == 0) { |
| $markers.= $mapPoint[0] . "," . $mapPoint[1] . "," . "iconr" . ($index + 1); | |
| $center = "{$mapPoints[0][0]},{$mapPoints[0][1]}"; | |
| } | |
| else { | |
| $markers.= $mapPoint[0] . "," . $mapPoint[1] . "," . $markerImage . ($index + 1); | |
| } | |
| if ($index + 1 != sizeof($mapPoints)) $markers.= "|"; | if ($index + 1 != sizeof($mapPoints)) $markers.= "|"; |
| if ($mapPoint[0] < $minlat) $minlat = $mapPoint[0]; | $dist = distance($mapPoints[0][0], $mapPoint[0][1], $mapPoint[0], $mapPoint[1]); |
| if ($mapPoint[0] > $maxlat) $maxlat = $mapPoint[0]; | $mapwidthinmeters = ($dist > $mapwidthinmeters ? $dist : $mapwidthinmeters); |
| if ($mapPoint[1] < $minlon) $minlon = $mapPoint[1]; | |
| if ($mapPoint[1] > $maxlon) $maxlon = $mapPoint[1]; | |
| $totalLat+= $mapPoint[0]; | $totalLat+= $mapPoint[0]; |
| $totalLon+= $mapPoint[1]; | $totalLon+= $mapPoint[1]; |
| } | } |
| if ($zoom == 0) { | if ($zoom == 0) { |
| $mapwidthinmeters = distance($minlat, $minlon, $minlat, $maxlon); | $mapwidthinmeters = distance($minlat, $minlon, $minlat, $maxlon); |
| foreach (array_reverse($metersperpixel, true) as $zoomLevel => $maxdistance) { | foreach (array_reverse($metersperpixel, true) as $zoomLevel => $maxdistance) { |
| if ($zoom == 0 && $mapwidthinmeters < ($maxdistance + 50)) $zoom = $zoomLevel; | if ($zoom == 0 && $mapwidthinmeters * 1.5 < ($maxdistance)) $zoom = $zoomLevel; |
| } | } |
| } | } |
| $center = $totalLat / sizeof($mapPoints) . "," . $totalLon / sizeof($mapPoints); | $center = $totalLat / sizeof($mapPoints) . "," . $totalLon / sizeof($mapPoints); |
| } | } |
| $output = ""; | $output = ""; |
| if ($collapsible) $output.= '<div class="map" data-role="collapsible" data-collapsed="true"><h3>Open Map...</h3>'; | if ($collapsible) $output.= '<div class="map" data-role="collapsible" data-collapsed="true"><h3>Open Map...</h3>'; |
| $output.= '<img class="map" src="' . curPageURL() . '/lib/staticmaplite/staticmap.php?center=' . $center . '&zoom=' . $zoom . '&size=' . $width . 'x' . $height . '&markers=' . | $output.= '<img class="map" src="' . curPageURL() . '/' . $labsPath . '/lib/staticmaplite/staticmap.php?center=' . $center . '&zoom=' . $zoom . '&size=' . $width . 'x' . $height . '&markers=' . $markers . '" width=' . $width . ' height=' . $height . '>'; |
| $markers . '" width=' . $width . ' height=' . $height . '>'; | |
| if ($collapsible) $output.= '</div>'; | if ($collapsible) $output.= '</div>'; |
| return $output; | return $output; |
| } | } |
| function distance($lat1, $lng1, $lat2, $lng2, $roundLargeValues = false) | function distance($lat1, $lng1, $lat2, $lng2, $roundLargeValues = false) |
| { | { |
| $pi80 = M_PI / 180; | $pi80 = M_PI / 180; |
| $lat1*= $pi80; | $lat1*= $pi80; |
| $lng1*= $pi80; | $lng1*= $pi80; |
| $lat2*= $pi80; | $lat2*= $pi80; |
| $lng2*= $pi80; | $lng2*= $pi80; |
| $r = 6372.797; // mean radius of Earth in km | $r = 6372.797; // mean radius of Earth in km |
| $dlat = $lat2 - $lat1; | $dlat = $lat2 - $lat1; |
| $dlng = $lng2 - $lng1; | $dlng = $lng2 - $lng1; |
| $a = sin($dlat / 2) * sin($dlat / 2) + cos($lat1) * cos($lat2) * sin($dlng / 2) * sin($dlng / 2); | $a = sin($dlat / 2) * sin($dlat / 2) + cos($lat1) * cos($lat2) * sin($dlng / 2) * sin($dlng / 2); |
| $c = 2 * atan2(sqrt($a) , sqrt(1 - $a)); | $c = 2 * atan2(sqrt($a) , sqrt(1 - $a)); |
| $km = $r * $c; | $km = $r * $c; |
| if ($roundLargeValues) { | if ($roundLargeValues) { |
| if ($km < 1) return floor($km * 1000); | if ($km < 1) return floor($km * 1000); |
| else return round($km,2)."k"; | else return round($km, 2) . "k"; |
| } else return floor($km * 1000); | } |
| else return floor($km * 1000); | |
| } | } |
| function decodePolylineToArray($encoded) | function decodePolylineToArray($encoded) |
| { | { |
| // source: http://latlongeeks.com/forum/viewtopic.php?f=4&t=5 | // source: http://latlongeeks.com/forum/viewtopic.php?f=4&t=5 |
| $length = strlen($encoded); | $length = strlen($encoded); |
| $index = 0; | $index = 0; |
| $points = array(); | $points = array(); |
| $lat = 0; | $lat = 0; |
| $lng = 0; | $lng = 0; |
| while ($index < $length) { | while ($index < $length) { |
| // Temporary variable to hold each ASCII byte. | // Temporary variable to hold each ASCII byte. |
| $b = 0; | $b = 0; |
| // The encoded polyline consists of a latitude value followed by a | // The encoded polyline consists of a latitude value followed by a |
| // longitude value. They should always come in pairs. Read the | // longitude value. They should always come in pairs. Read the |
| // latitude value first. | // latitude value first. |
| $shift = 0; | $shift = 0; |
| $result = 0; | $result = 0; |
| do { | do { |
| // The `ord(substr($encoded, $index++))` statement returns the ASCII | // The `ord(substr($encoded, $index++))` statement returns the ASCII |
| // code for the character at $index. Subtract 63 to get the original | // code for the character at $index. Subtract 63 to get the original |
| // value. (63 was added to ensure proper ASCII characters are displayed | // value. (63 was added to ensure proper ASCII characters are displayed |
| // in the encoded polyline string, which is `human` readable) | // in the encoded polyline string, which is `human` readable) |
| $b = ord(substr($encoded, $index++)) - 63; | $b = ord(substr($encoded, $index++)) - 63; |
| // AND the bits of the byte with 0x1f to get the original 5-bit `chunk. | // AND the bits of the byte with 0x1f to get the original 5-bit `chunk. |
| // Then left shift the bits by the required amount, which increases | // Then left shift the bits by the required amount, which increases |
| // by 5 bits each time. | // by 5 bits each time. |
| // OR the value into $results, which sums up the individual 5-bit chunks | // OR the value into $results, which sums up the individual 5-bit chunks |
| // into the original value. Since the 5-bit chunks were reversed in | // into the original value. Since the 5-bit chunks were reversed in |
| // order during encoding, reading them in this way ensures proper | // order during encoding, reading them in this way ensures proper |
| // summation. | // summation. |
| $result|= ($b & 0x1f) << $shift; | $result|= ($b & 0x1f) << $shift; |
| $shift+= 5; | $shift+= 5; |
| } | } |
| // Continue while the read byte is >= 0x20 since the last `chunk` | // Continue while the read byte is >= 0x20 since the last `chunk` |
| // was not OR'd with 0x20 during the conversion process. (Signals the end) | // was not OR'd with 0x20 during the conversion process. (Signals the end) |
| while ($b >= 0x20); | while ($b >= 0x20); |
| // Check if negative, and convert. (All negative values have the last bit | // Check if negative, and convert. (All negative values have the last bit |
| // set) | // set) |
| $dlat = (($result & 1) ? ~($result >> 1) : ($result >> 1)); | $dlat = (($result & 1) ? ~($result >> 1) : ($result >> 1)); |
| // Compute actual latitude since value is offset from previous value. | // Compute actual latitude since value is offset from previous value. |
| $lat+= $dlat; | $lat+= $dlat; |
| // The next values will correspond to the longitude for this point. | // The next values will correspond to the longitude for this point. |
| $shift = 0; | $shift = 0; |
| $result = 0; | $result = 0; |
| do { | do { |
| $b = ord(substr($encoded, $index++)) - 63; | $b = ord(substr($encoded, $index++)) - 63; |
| $result|= ($b & 0x1f) << $shift; | $result|= ($b & 0x1f) << $shift; |
| $shift+= 5; | $shift+= 5; |
| } while ($b >= 0x20); | } while ($b >= 0x20); |
| $dlng = (($result & 1) ? ~($result >> 1) : ($result >> 1)); | $dlng = (($result & 1) ? ~($result >> 1) : ($result >> 1)); |
| $lng+= $dlng; | $lng+= $dlng; |
| // The actual latitude and longitude values were multiplied by | // The actual latitude and longitude values were multiplied by |
| // 1e5 before encoding so that they could be converted to a 32-bit | // 1e5 before encoding so that they could be converted to a 32-bit |
| // integer representation. (With a decimal accuracy of 5 places) | // integer representation. (With a decimal accuracy of 5 places) |
| // Convert back to original values. | // Convert back to original values. |
| $points[] = array( | $points[] = array( |
| $lat * 1e-5, | $lat * 1e-5, |
| $lng * 1e-5 | $lng * 1e-5 |
| ); | ); |
| } | } |
| return $points; | return $points; |
| } | } |
| function geocode($query, $giveOptions) | function geocode($query, $giveOptions) |
| { | { |
| global $cloudmadeAPIkey; | global $cloudmadeAPIkey; |
| $url = "http://geocoding.cloudmade.com/$cloudmadeAPIkey/geocoding/v2/find.js?query=" . urlencode($query) . "&bbox=-35.5,149.00,-35.15,149.1930&return_location=true&bbox_only=true"; | $url = "http://geocoding.cloudmade.com/$cloudmadeAPIkey/geocoding/v2/find.js?query=" . urlencode($query) . "&bbox=-35.5,149.00,-35.15,149.1930&return_location=true&bbox_only=true"; |
| $contents = json_decode(getPage($url)); | $contents = json_decode(getPage($url)); |
| if ($giveOptions) return $contents->features; | if ($giveOptions) return $contents->features; |
| elseif (isset($contents->features[0]->centroid)) return $contents->features[0]->centroid->coordinates[0] . "," . $contents->features[0]->centroid->coordinates[1]; | elseif (isset($contents->features[0]->centroid)) return $contents->features[0]->centroid->coordinates[0] . "," . $contents->features[0]->centroid->coordinates[1]; |
| else return ""; | else return ""; |
| } | } |
| function reverseGeocode($lat, $lng) | function reverseGeocode($lat, $lng) |
| { | { |
| global $cloudmadeAPIkey; | global $cloudmadeAPIkey; |
| $url = "http://geocoding.cloudmade.com/$cloudmadeAPIkey/geocoding/v2/find.js?around=" . $lat . "," . $lng . "&distance=closest&object_type=road"; | $url = "http://geocoding.cloudmade.com/$cloudmadeAPIkey/geocoding/v2/find.js?around=" . $lat . "," . $lng . "&distance=closest&object_type=road"; |
| $contents = json_decode(getPage($url)); | $contents = json_decode(getPage($url)); |
| return $contents->features[0]->properties->name; | return $contents->features[0]->properties->name; |
| } | } |
| ?> | ?> |
| <?php | <?php |
| if (isset($_REQUEST['firstLetter'])) { | if (isset($_REQUEST['firstLetter'])) { |
| $firstLetter = filter_var($_REQUEST['firstLetter'], FILTER_SANITIZE_STRING); | $firstLetter = filter_var($_REQUEST['firstLetter'], FILTER_SANITIZE_STRING); |
| } | } |
| if (isset($_REQUEST['bysuburbs'])) { | if (isset($_REQUEST['bysuburbs'])) { |
| $bysuburbs = true; | $bysuburbs = true; |
| } | } |
| if (isset($_REQUEST['bynumber'])) { | if (isset($_REQUEST['bynumber'])) { |
| $bynumber = true; | $bynumber = true; |
| } | } |
| if (isset($_REQUEST['allstops'])) { | if (isset($_REQUEST['allstops'])) { |
| $allstops = true; | $allstops = true; |
| } | } |
| if (isset($_REQUEST['nearby'])) { | if (isset($_REQUEST['nearby'])) { |
| $nearby = true; | $nearby = true; |
| } | } |
| if (isset($_REQUEST['suburb'])) { | if (isset($_REQUEST['suburb'])) { |
| $suburb = filter_var($_REQUEST['suburb'], FILTER_SANITIZE_STRING); | $suburb = $_REQUEST['suburb']; |
| } | } |
| $pageKey = filter_var($_REQUEST['pageKey'], FILTER_SANITIZE_NUMBER_INT); | $pageKey = filter_var($_REQUEST['pageKey'], FILTER_SANITIZE_NUMBER_INT); |
| $lat = filter_var($_REQUEST['lat'], FILTER_SANITIZE_NUMBER_FLOAT, FILTER_FLAG_ALLOW_FRACTION); | $lat = filter_var($_REQUEST['lat'], FILTER_SANITIZE_NUMBER_FLOAT, FILTER_FLAG_ALLOW_FRACTION); |
| $lon = filter_var($_REQUEST['lon'], FILTER_SANITIZE_NUMBER_FLOAT, FILTER_FLAG_ALLOW_FRACTION); | $lon = filter_var($_REQUEST['lon'], FILTER_SANITIZE_NUMBER_FLOAT, FILTER_FLAG_ALLOW_FRACTION); |
| $max_distance = filter_var($_REQUEST['radius'], FILTER_SANITIZE_NUMBER_INT); | $max_distance = filter_var($_REQUEST['radius'], FILTER_SANITIZE_NUMBER_INT); |
| if (isset($_REQUEST['numberSeries'])) { | if (isset($_REQUEST['numberSeries'])) { |
| $numberSeries = filter_var($_REQUEST['numberSeries'], FILTER_SANITIZE_NUMBER_INT); | $numberSeries = filter_var($_REQUEST['numberSeries'], FILTER_SANITIZE_NUMBER_INT); |
| } | } |
| if (isset($_REQUEST['routeDestination'])) { | if (isset($_REQUEST['routeDestination'])) { |
| $routeDestination = urldecode(filter_var($_REQUEST['routeDestination'], FILTER_SANITIZE_ENCODED)); | $routeDestination = urldecode(filter_var($_REQUEST['routeDestination'], FILTER_SANITIZE_ENCODED)); |
| } | } |
| if (isset($_REQUEST['stopcode'])) { | if (isset($_REQUEST['stopcode'])) { |
| $stopcode = filter_var($_REQUEST['stopcode'], FILTER_SANITIZE_STRING); | $stopcode = filter_var($_REQUEST['stopcode'], FILTER_SANITIZE_STRING); |
| } | } |
| if (isset($_REQUEST['stopids'])) { | if (isset($_REQUEST['stopids'])) { |
| $stopids = explode(",", filter_var($_REQUEST['stopids'], FILTER_SANITIZE_STRING)); | $stopids = explode(",", filter_var($_REQUEST['stopids'], FILTER_SANITIZE_STRING)); |
| } | } |
| if (isset($_REQUEST['tripid'])) { | if (isset($_REQUEST['tripid'])) { |
| $tripid = filter_var($_REQUEST['tripid'], FILTER_SANITIZE_NUMBER_INT); | $tripid = filter_var($_REQUEST['tripid'], FILTER_SANITIZE_NUMBER_INT); |
| } | } |
| if (isset($_REQUEST['stopid'])) { | if (isset($_REQUEST['stopid'])) { |
| $stopid = filter_var($_REQUEST['stopid'], FILTER_SANITIZE_NUMBER_INT); | $stopid = filter_var($_REQUEST['stopid'], FILTER_SANITIZE_NUMBER_INT); |
| } | } |
| if (isset($_REQUEST['routeid'])) { | if (isset($_REQUEST['routeid'])) { |
| $routeid = filter_var($_REQUEST['routeid'], FILTER_SANITIZE_NUMBER_INT); | $routeid = filter_var($_REQUEST['routeid'], FILTER_SANITIZE_NUMBER_INT); |
| } | } |
| if (isset($_REQUEST['geolocate'])) { | if (isset($_REQUEST['geolocate'])) { |
| $geolocate = filter_var($_REQUEST['geolocate'], FILTER_SANITIZE_URL); | $geolocate = filter_var($_REQUEST['geolocate'], FILTER_SANITIZE_URL); |
| } | } |
| ?> | ?> |
| <?php | <?php |
| // Copyright 2009 Google Inc. All Rights Reserved. | // Copyright 2009 Google Inc. All Rights Reserved. |
| $GA_ACCOUNT = "MO-22173039-1"; | $GA_ACCOUNT = "MO-22173039-1"; |
| $GA_PIXEL = "/lib/ga.php"; | $GA_PIXEL = "/lib/ga.php"; |
| function googleAnalyticsGetImageUrl() | function googleAnalyticsGetImageUrl() |
| { | { |
| global $GA_ACCOUNT, $GA_PIXEL; | global $GA_ACCOUNT, $GA_PIXEL; |
| //if (stristr($_SERVER['HTTP_USER_AGENT'], 'Googlebot') return ""; | //if (stristr($_SERVER['HTTP_USER_AGENT'], 'Googlebot') return ""; |
| $url = ""; | $url = ""; |
| $url.= $GA_PIXEL . "?"; | $url.= $GA_PIXEL . "?"; |
| $url.= "utmac=" . $GA_ACCOUNT; | $url.= "utmac=" . $GA_ACCOUNT; |
| $url.= "&utmn=" . rand(0, 0x7fffffff); | $url.= "&utmn=" . rand(0, 0x7fffffff); |
| $referer = $_SERVER["HTTP_REFERER"]; | $referer = $_SERVER["HTTP_REFERER"]; |
| $query = $_SERVER["QUERY_STRING"]; | $query = $_SERVER["QUERY_STRING"]; |
| $path = $_SERVER["REQUEST_URI"]; | $path = $_SERVER["REQUEST_URI"]; |
| if (empty($referer)) { | if (empty($referer)) { |
| $referer = "-"; | $referer = "-"; |
| } | } |
| $url.= "&utmr=" . urlencode($referer); | $url.= "&utmr=" . urlencode($referer); |
| if (!empty($path)) { | if (!empty($path)) { |
| $url.= "&utmp=" . urlencode($path); | $url.= "&utmp=" . urlencode($path); |
| } | } |
| $url.= "&guid=ON"; | $url.= "&guid=ON"; |
| return str_replace("&", "&", $url); | return str_replace("&", "&", $url); |
| } | } |
| $labsPath = ""; | |
| if (strstr($_SERVER['PHP_SELF'],"labs")) $labsPath = "../"; | |
| function include_header($pageTitle, $pageType, $opendiv = true, $geolocate = false, $datepicker = false) | function include_header($pageTitle, $pageType, $opendiv = true, $geolocate = false, $datepicker = false) |
| { | { |
| global $labsPath; | global $labsPath,$serviceAlertsEnabled; |
| echo ' | echo ' |
| <!DOCTYPE html> | <!DOCTYPE html> |
| <html lang="en"> | <html lang="en"> |
| <head> | <head> |
| <meta charset="UTF-8"> | <meta charset="UTF-8"> |
| <title>' . $pageTitle . '</title> | <meta name="viewport" content="width=device-width, initial-scale=1"> |
| <meta name="google-site-verification" | <title>' . $pageTitle . '</title> |
| content="-53T5Qn4TB_de1NyfR_ZZkEVdUNcNFSaYKSFkWKx-sY" /> | <meta name="google-site-verification" content="-53T5Qn4TB_de1NyfR_ZZkEVdUNcNFSaYKSFkWKx-sY" /> |
| <link rel="stylesheet" href="'.$labsPath.'css/jquery-ui-1.8.12.custom.css" />'; | <link rel="dns-prefetch" href="//code.jquery.com"> |
| <link rel="dns-prefetch" href="//ajax.googleapis.com"> | |
| <link rel="stylesheet" href="' . $labsPath . 'css/jquery-ui-1.8.12.custom.css" />'; | |
| if (isDebugServer()) { | if (isDebugServer()) { |
| echo '<link rel="stylesheet" href="'.$labsPath.'css/jquery.mobile-1.0b1.css" /> | $jqmcss = $labsPath . 'css/jquery.mobile-1.0b2.css'; |
| $jqjs = $labsPath . 'js/jquery-1.6.2.min.js'; | |
| <script type="text/javascript" src="'.$labsPath.'js/jquery-1.6.1.min.js"></script> | $jqmjs = $labsPath . 'js/jquery.mobile-1.0b2.js'; |
| <script>$(document).bind("mobileinit", function(){ | } |
| else { | |
| $jqmcss = "//code.jquery.com/mobile/1.0b2/jquery.mobile-1.0b2.min.css"; | |
| $jqjs = "//ajax.googleapis.com/ajax/libs/jquery/1.6.2/jquery.min.js"; | |
| $jqmjs = "//code.jquery.com/mobile/1.0b2/jquery.mobile-1.0b2.min.js"; | |
| } | |
| echo '<link rel="stylesheet" href="' . $jqmcss . '" /> | |
| <script src="'.$jqjs.'"></script> | |
| <script>$(document).bind("mobileinit", function(){ | |
| $.mobile.ajaxEnabled = false; | $.mobile.ajaxEnabled = false; |
| }); | }); |
| </script> | </script> |
| <script type="text/javascript" src="'.$labsPath.'js/jquery.mobile-1.0b1.js"></script>'; | <script src="'.$jqmjs.'"></script> |
| } | |
| else { | <script src="' . $labsPath . 'js/jquery.ui.core.min.js"></script> |
| echo '<link rel="stylesheet" href="http://code.jquery.com/mobile/1.0b1/jquery.mobile-1.0b1.min.css" /> | <script src="' . $labsPath . 'js/jquery.ui.position.min.js"></script> |
| <script type="text/javascript" src="http://ajax.googleapis.com/ajax/libs/jquery/1.6.1/jquery.min.js"></script> | <script src="' . $labsPath . 'js/jquery.ui.widget.min.js"></script> |
| <script>$(document).bind("mobileinit", function(){ | <script src="' . $labsPath . 'js/jquery.ui.autocomplete.min.js"></script> |
| $.mobile.ajaxEnabled = false; | |
| }); | |
| </script> | |
| <script type="text/javascript" src="http://code.jquery.com/mobile/1.0b1/jquery.mobile-1.0b1.min.js"></script>'; | |
| } | |
| echo ' | |
| <script src="'.$labsPath.'js/jquery.ui.autocomplete.min.js"></script> | |
| <script src="'.$labsPath.'js/jquery.ui.core.min.js"></script> | |
| <script src="'.$labsPath.'js/jquery.ui.position.min.js"></script> | |
| <script src="'.$labsPath.'js/jquery.ui.widget.min.js"></script> | |
| <script> | <script> |
| $(function() { | $(function() { |
| $( "#geolocate" ).autocomplete({ | $( "#geolocate" ).autocomplete({ |
| source: "lib/autocomplete.php", | source: "lib/autocomplete.php", |
| minLength: 2 | minLength: 2 |
| }); | }); |
| $( "#from" ).autocomplete({ | $( "#from" ).autocomplete({ |
| source: "lib/autocomplete.php", | source: "lib/autocomplete.php", |
| minLength: 2 | minLength: 2 |
| }); | }); |
| $( "#to" ).autocomplete({ | $( "#to" ).autocomplete({ |
| source: "lib/autocomplete.php", | source: "lib/autocomplete.php", |
| minLength: 2 | minLength: 2 |
| }); | }); |
| }); | }); |
| </script> | </script>'; |
| '; | echo '<style type="text/css">'; |
| echo '<style type="text/css"> | if (strstr($_SERVER['HTTP_USER_AGENT'], 'Android')) echo '.ui-shadow,.ui-btn-up-a,.ui-btn-hover-a,.ui-btn-down-a,.ui-body-b,.ui-btn-up-b,.ui-btn-hover-b, |
| .ui-li-thumb, .ui-li-icon { position: relative; }'; | |
| if (strstr($_SERVER['HTTP_USER_AGENT'], 'Android')) echo '.ui-shadow,.ui-btn-up-a,.ui-btn-hover-a,.ui-btn-down-a,.ui-body-b,.ui-btn-up-b,.ui-btn-hover-b, | |
| .ui-btn-down-b,.ui-bar-c,.ui-body-c,.ui-btn-up-c,.ui-btn-hover-c,.ui-btn-down-c,.ui-bar-c,.ui-body-d, | .ui-btn-down-b,.ui-bar-c,.ui-body-c,.ui-btn-up-c,.ui-btn-hover-c,.ui-btn-down-c,.ui-bar-c,.ui-body-d, |
| .ui-btn-up-d,.ui-btn-hover-d,.ui-btn-down-d,.ui-bar-d,.ui-body-e,.ui-btn-up-e,.ui-btn-hover-e, | .ui-btn-up-d,.ui-btn-hover-d,.ui-btn-down-d,.ui-bar-d,.ui-body-e,.ui-btn-up-e,.ui-btn-hover-e, |
| .ui-btn-down-e,.ui-bar-e,.ui-overlay-shadow,.ui-shadow,.ui-btn-active,.ui-body-a,.ui-bar-a { | .ui-btn-down-e,.ui-bar-e,.ui-overlay-shadow,.ui-shadow,.ui-btn-active,.ui-body-a,.ui-bar-a { |
| text-shadow: none; | text-shadow: none; |
| box-shadow: none; | box-shadow: none; |
| -webkit-box-shadow: none; | -webkit-box-shadow: none; |
| }'; | }'; |
| echo ' | echo '</style>'; |
| .ui-navbar { | echo '<link rel="stylesheet" href="' . $labsPath . 'css/local.css.php" />'; |
| width: 100%; | |
| } | |
| .ui-btn-inner { | |
| white-space: normal !important; | |
| } | |
| .ui-li-heading { | |
| white-space: normal !important; | |
| } | |
| .ui-listview-filter { | |
| margin: 0 !important; | |
| } | |
| .ui-icon-navigation { | |
| background-image: url('.$labsPath.'css/images/113-navigation.png); | |
| background-position: 1px 0; | |
| } | |
| .ui-icon-beaker { | |
| background-image: url('.$labsPath.'css/images/91-beaker-2.png); | |
| background-position: 1px 0; | |
| } | |
| #footer { | |
| text-size: 0.75em; | |
| text-align: center; | |
| } | |
| body { | |
| background-color: #F0F0F0; | |
| } | |
| #jqm-homeheader { | |
| text-align: center; | |
| } | |
| .viaPoints { | |
| display: none; | |
| text-size: 0.2em; | |
| } | |
| .min-width-480px .viaPoints { | |
| display: inline; | |
| } | |
| #extrainfo { | |
| visibility: hidden; | |
| display: none; | |
| } | |
| #servicewarning { | |
| padding: 1em; | |
| margin-bottom: 0.5em; | |
| text-size: 0.2em; | |
| background-color: #FF9; | |
| -moz-border-radius: 15px; | |
| border-radius: 15px; | |
| } | |
| /*#leftcolumn { | |
| float: none; | |
| } | |
| .min-width-768px #leftcolumn { | |
| float: left; | |
| width: 30%; | |
| } | |
| #rightcolumn { | |
| float: none; | |
| } | |
| .min-width-768px #rightcolumn { | |
| float: right; | |
| width: 68%; | |
| }*/ | |
| #footer { | |
| clear:both; | |
| text-align:center; | |
| } | |
| // source http://webaim.org/techniques/skipnav/ | |
| #skip a, #skip a:hover, #skip a:visited | |
| { | |
| position:absolute; | |
| left:0px; | |
| top:-500px; | |
| width:1px; | |
| height:1px; | |
| overflow:hidden; | |
| } | |
| #skip a:active, #skip a:focus | |
| { | |
| position:static; | |
| width:auto; | |
| height:auto; | |
| } | |
| </style>'; | |
| if (strstr($_SERVER['HTTP_USER_AGENT'], 'iPhone') || strstr($_SERVER['HTTP_USER_AGENT'], 'iPod') || strstr($_SERVER['HTTP_USER_AGENT'], 'iPad')) { | if (strstr($_SERVER['HTTP_USER_AGENT'], 'iPhone') || strstr($_SERVER['HTTP_USER_AGENT'], 'iPod') || strstr($_SERVER['HTTP_USER_AGENT'], 'iPad')) { |
| echo '<meta name="apple-mobile-web-app-capable" content="yes" /> | echo '<meta name="apple-mobile-web-app-capable" content="yes" /> |
| <meta name="apple-mobile-web-app-status-bar-style" content="black" /> | <meta name="apple-mobile-web-app-status-bar-style" content="black" /> |
| <link rel="apple-touch-startup-image" href="startup.png" /> | <link rel="apple-touch-startup-image" href="startup.png" /> |
| <link rel="apple-touch-icon" href="apple-touch-icon.png" />'; | <link rel="apple-touch-icon" href="apple-touch-icon.png" />'; |
| } | } |
| if ($geolocate) { | if ($geolocate) { |
| echo "<script> | echo "<script> |
| function success(position) { | function success(position) { |
| $('#error').val('Location now detected. Please wait for data to load.'); | $('#error').val('Location now detected. Please wait for data to load.'); |
| $('#geolocate').val(position.coords.latitude+','+position.coords.longitude); | $('#geolocate').val(position.coords.latitude+','+position.coords.longitude); |
| $.ajax({ url: \"include/common.inc.php?geolocate=yes&lat=\"+position.coords.latitude+\"&lon=\"+position.coords.longitude }); | $.ajax({ url: \"include/common.inc.php?geolocate=yes&lat=\"+position.coords.latitude+\"&lon=\"+position.coords.longitude }); |
| location.reload(true); | location.reload(true); |
| } | } |
| function error(msg) { | function error(msg) { |
| $('#error').val('Error: '+msg); | $('#error').val('Error: '+msg); |
| } | } |
| function geolocate() { | function geolocate() { |
| if (navigator.geolocation) { | if (navigator.geolocation) { |
| var options = { | var options = { |
| enableHighAccuracy: true, | enableHighAccuracy: true, |
| timeout: 60000, | timeout: 60000, |
| maximumAge: 10000 | maximumAge: 10000 |
| } | } |
| navigator.geolocation.getCurrentPosition(success, error, options); | navigator.geolocation.getCurrentPosition(success, error, options); |
| } | } |
| } | } |
| $(document).ready(function() { | $(document).ready(function() { |
| $('#here').click(function(event) { $('#geolocate').val(geolocate()); return false;}); | $('#here').click(function(event) { $('#geolocate').val(geolocate()); return false;}); |
| $('#here').show(); | $('#here').show(); |
| /*if ($.mobile.media('screen and (min-width: 768px)')) { | |
| $('map a:first').click(); | |
| $('#settings a:first').click(); | |
| }*/ | |
| }); | }); |
| "; | "; |
| if (!isset($_SESSION['lat']) || $_SESSION['lat'] == "") echo "geolocate();"; | if (!isset($_SESSION['lat']) || $_SESSION['lat'] == "") echo "geolocate();"; |
| echo "</script> "; | echo "</script> "; |
| } | } |
| if (isAnalyticsOn()) echo ' | if (isAnalyticsOn()) echo ' |
| <script type="text/javascript">' . " | <script type="text/javascript">' . " |
| var _gaq = _gaq || []; | var _gaq = _gaq || []; |
| _gaq.push(['_setAccount', 'UA-22173039-1']); | _gaq.push(['_setAccount', 'UA-22173039-1']); |
| _gaq.push(['_trackPageview']); | _gaq.push(['_trackPageview']); |
| _gaq.push(['_trackPageLoadTime']); | _gaq.push(['_trackPageLoadTime']); |
| </script>"; | </script>"; |
| echo '</head> | echo '</head> |
| <body> | <body> |
| <div id="skip"> | <div id="skip"> |
| <a href="#maincontent">Skip to content</a> | <a href="#maincontent">Skip to content</a> |
| </div> | </div> |
| '; | '; |
| if ($opendiv) { | if ($opendiv) { |
| echo '<div data-role="page"> | echo '<div data-role="page"> |
| <div data-role="header" data-position="inline"> | <div data-role="header" data-position="inline"> |
| <a href="' . (isset($_SERVER["HTTP_REFERER"]) ? $_SERVER["HTTP_REFERER"] : "javascript:history.go(-1)") . '" data-icon="arrow-l" data-rel="back" class="ui-btn-left">Back</a> | <a href="' . (isset($_SERVER["HTTP_REFERER"]) ? $_SERVER["HTTP_REFERER"] : "javascript:history.go(-1)") . '" data-icon="arrow-l" data-rel="back" class="ui-btn-left">Back</a> |
| <h1>' . $pageTitle . '</h1> | <h1>' . $pageTitle . '</h1> |
| <a href="'.$labsPath.'/index.php" data-icon="home" class="ui-btn-right">Home</a> | <a href="' . $labsPath . '/index.php" data-icon="home" class="ui-btn-right">Home</a> |
| </div><!-- /header --> | </div><!-- /header --> |
| <a name="maincontent" id="maincontent"></a> | <a name="maincontent" id="maincontent"></a> |
| <div data-role="content"> '; | <div data-role="content"> '; |
| $overrides = getServiceOverride(); | $overrides = getServiceOverride(); |
| if ($overrides['service_id']) { | if ($overrides['service_id']) { |
| if ($overrides['service_id'] == "noservice") { | if ($overrides['service_id'] == "noservice") { |
| echo '<div id="servicewarning">Buses are <strong>not running today</strong> due to industrial action/public holiday. See <a | echo '<div id="servicewarning">Buses are <strong>not running today</strong> due to industrial action/public holiday. See <a |
| href="http://www.action.act.gov.au">http://www.action.act.gov.au</a> for details.</div>'; | href="http://www.action.act.gov.au">http://www.action.act.gov.au</a> for details.</div>'; |
| } | } |
| else { | else { |
| echo '<div id="servicewarning">Buses are running on an altered timetable today due to industrial action/public holiday. See <a href="http://www.action.act.gov.au">http://www.action.act.gov.au</a> for details.</div>'; | echo '<div id="servicewarning">Buses are running on an altered timetable today due to industrial action/public holiday. See <a href="http://www.action.act.gov.au">http://www.action.act.gov.au</a> for details.</div>'; |
| } | |
| } | } |
| } | } |
| if ($serviceAlertsEnabled) { | |
| $serviceAlerts = getServiceAlerts("network","network"); | |
| foreach ($serviceAlerts['entities'] as $entity) { | |
| echo "<div id='servicewarning'>".date("F j, g:i a",strtotime($entity['alert']['active_period']['start']))." to ". date("F j, g:i a", strtotime($entity['alert']['active_period']['end']))."<br>Warning: {$entity['alert']['description']['translation']} | |
| <br><a href='{$entity['alert']['url']['translation']}'>Source</a> </div>"; | |
| } | |
| } | |
| } | |
| } | } |
| function include_footer() | function include_footer() |
| { | { |
| global $labsPath; | |
| global $labsPath; | echo '<div id="footer"><a href="' . $labsPath . 'about.php">About/Contact Us</a> <a href="' . $labsPath . 'feedback.php">Feedback/Bug Report</a> <a href="' . $labsPath . 'privacy.php">Privacy Policy</a>'; |
| echo '<div id="footer"><a href="'.$labsPath.'about.php">About/Contact Us</a> <a href="'.$labsPath.'feedback.php">Feedback/Bug Report</a> <a href="'.$labsPath.'privacy.php">Privacy Policy</a>'; | |
| echo '</div>'; | echo '</div>'; |
| if (isAnalyticsOn()) { | if (isAnalyticsOn()) { |
| echo "<script> (function() { | echo "<script> (function() { |
| var ga = document.createElement('script'); ga.type = | var ga = document.createElement('script'); ga.type = |
| 'text/javascript'; ga.async = true; | 'text/javascript'; ga.async = true; |
| ga.src = ('https:' == document.location.protocol ? | ga.src = ('https:' == document.location.protocol ? |
| 'https://ssl' : 'http://www') + '.google-analytics.com/ga.js'; | 'https://ssl' : 'http://www') + '.google-analytics.com/ga.js'; |
| var s = document.getElementsByTagName('script')[0]; | var s = document.getElementsByTagName('script')[0]; |
| s.parentNode.insertBefore(ga, s); | s.parentNode.insertBefore(ga, s); |
| })();</script>"; | })();</script>"; |
| $googleAnalyticsImageUrl = googleAnalyticsGetImageUrl(); | $googleAnalyticsImageUrl = googleAnalyticsGetImageUrl(); |
| echo '<noscript><img src="' . $googleAnalyticsImageUrl . '" /></noscript>'; | echo '<noscript><img src="' . $googleAnalyticsImageUrl . '" /></noscript>'; |
| } | |
| } | echo "\n</div></div></body></html>"; |
| echo "\n</div></div></body></html>"; | } |
| } | function placeSettings() |
| function timePlaceSettings($geolocate = false) | |
| { | { |
| global $service_periods; | global $service_periods; |
| $geoerror = false; | $geoerror = false; |
| if ($geolocate == true) { | |
| $geoerror = !isset($_SESSION['lat']) || !isset($_SESSION['lat']) || $_SESSION['lat'] == "" || $_SESSION['lon'] == ""; | $geoerror = !isset($_SESSION['lat']) || !isset($_SESSION['lat']) || $_SESSION['lat'] == "" || $_SESSION['lon'] == ""; |
| } | |
| echo '<div id="error">'; | echo '<div id="error">'; |
| if ($geoerror) { | if ($geoerror) { |
| echo 'Sorry, but your location could not currently be detected. | echo 'Sorry, but your location could not currently be detected. |
| Please allow location permission, wait for your location to be detected, | Please allow location permission, wait for your location to be detected, |
| or enter an address/co-ordinates in the box below.'; | or enter an address/co-ordinates in the box below.'; |
| } | } |
| echo '</div>'; | echo '</div>'; |
| echo '<div id="settings" data-role="collapsible" data-collapsed="' . !$geoerror . '"> | echo '<div id="settings" data-role="collapsible" data-collapsed="' . !$geoerror . '"> |
| <h3>Change Time/Place (' . (isset($_SESSION['time']) ? $_SESSION['time'] : "Current Time,") . ' ' . ucwords(service_period()) . ')...</h3> | <h3>Change Location...</h3> |
| <form action="' . basename($_SERVER['PHP_SELF']) . "?" . $_SERVER['QUERY_STRING'] . '" method="post"> | <form action="' . basename($_SERVER['PHP_SELF']) . "?" . $_SERVER['QUERY_STRING'] . '" method="post"> |
| <div class="ui-body"> | <div class="ui-body"> |
| <div data-role="fieldcontain"> | <div data-role="fieldcontain"> |
| <label for="geolocate"> Current Location: </label> | <label for="geolocate"> Current Location: </label> |
| <input type="text" id="geolocate" name="geolocate" value="' . (isset($_SESSION['lat']) && isset($_SESSION['lon']) ? $_SESSION['lat'] . "," . $_SESSION['lon'] : "Enter co-ordinates or address here") . '"/> <a href="#" style="display:none" name="here" id="here">Here?</a> | <input type="text" id="geolocate" name="geolocate" value="' . (isset($_SESSION['lat']) && isset($_SESSION['lon']) ? $_SESSION['lat'] . "," . $_SESSION['lon'] : "Enter co-ordinates or address here") . '"/> <a href="#" style="display:none" name="here" id="here">Here?</a> |
| </div> | </div> |
| <div data-role="fieldcontain"> | |
| <label for="time"> Time: </label> | |
| <input type="time" name="time" id="time" value="' . (isset($_SESSION['time']) ? $_SESSION['time'] : date("H:i")) . '"/> | |
| <a href="#" name="currentTime" id="currentTime" onClick="var d = new Date();' . "$('#time').val(d.getHours() +':'+ (d.getMinutes().toString().length == 1 ? '0'+ d.getMinutes(): d.getMinutes()));" . '">Current Time?</a> | |
| </div> | |
| <div data-role="fieldcontain"> | |
| <label for="service_period"> Service Period: </label> | |
| <select name="service_period" id="service_period">'; | |
| foreach ($service_periods as $service_period) { | |
| echo "<option value=\"$service_period\"" . (service_period() === $service_period ? " SELECTED" : "") . '>' . ucwords($service_period) . '</option>'; | |
| } | |
| echo '</select> | |
| <a href="#" style="display:none" name="currentPeriod" id="currentPeriod">Current Period?</a> | |
| </div> | |
| <input type="submit" value="Update"/> | <input type="submit" value="Update"/> |
| </div></form> | </div></form> |
| </div>'; | </div>'; |
| } | } |
| function trackEvent($category, $action, $label = "", $value = - 1) | function trackEvent($category, $action, $label = "", $value = - 1) |
| { | { |
| if (isAnalyticsOn()) { | if (isAnalyticsOn()) { |
| echo "\n<script> _gaq.push(['_trackEvent', '$category', '$action'" . ($label != "" ? ", '$label'" : "") . ($value != - 1 ? ", $value" : "") . "]);</script>"; | echo "\n<script> _gaq.push(['_trackEvent', '$category', '$action'" . ($label != "" ? ", '$label'" : "") . ($value != - 1 ? ", $value" : "") . "]);</script>"; |
| } | } |
| } | } |
| ?> | ?> |
| <?php | <?php |
| $service_periods = Array( | $service_periods = Array( |
| 'sunday', | 'sunday', |
| 'saturday', | 'saturday', |
| 'weekday' | 'weekday' |
| ); | ); |
| function service_period() | function service_period($date = "") |
| { | { |
| if (isset($_SESSION['service_period'])) return $_SESSION['service_period']; | if (isset($_SESSION['service_period'])) return $_SESSION['service_period']; |
| $override = getServiceOverride(); | $override = getServiceOverride($date); |
| if ($override['service_id']){ | if ($override['service_id']){ |
| return $override['service_id']; | return $override['service_id']; |
| } | } |
| switch (date('w')) { | switch (date('w',($date != "" ? $date : time()))) { |
| case 0: | case 0: |
| return 'sunday'; | return 'sunday'; |
| case 6: | case 6: |
| return 'saturday'; | return 'saturday'; |
| default: | default: |
| return 'weekday'; | return 'weekday'; |
| } | } |
| } | } |
| function midnight_seconds() | function midnight_seconds($time = "") |
| { | { |
| // from http://www.perturb.org/display/Perlfunc__Seconds_Since_Midnight.html | // from http://www.perturb.org/display/Perlfunc__Seconds_Since_Midnight.html |
| if ($time != "") { | |
| return (date("G", $time) * 3600) + (date("i", $time) * 60) + date("s", $time); | |
| } | |
| if (isset($_SESSION['time'])) { | if (isset($_SESSION['time'])) { |
| $time = strtotime($_SESSION['time']); | $time = strtotime($_SESSION['time']); |
| return (date("G", $time) * 3600) + (date("i", $time) * 60) + date("s", $time); | return (date("G", $time) * 3600) + (date("i", $time) * 60) + date("s", $time); |
| } | } |
| return (date("G") * 3600) + (date("i") * 60) + date("s"); | return (date("G") * 3600) + (date("i") * 60) + date("s"); |
| } | } |
| function midnight_seconds_to_time($seconds) | function midnight_seconds_to_time($seconds) |
| { | { |
| if ($seconds > 0) { | if ($seconds > 0) { |
| $midnight = mktime(0, 0, 0, date("n") , date("j") , date("Y")); | $midnight = mktime(0, 0, 0, date("n") , date("j") , date("Y")); |
| return date("h:ia", $midnight + $seconds); | return date("h:ia", $midnight + $seconds); |
| } | } |
| else { | else { |
| return ""; | return ""; |
| } | } |
| } | } |
| function getServiceAlerts($filter_class, $filter_id) { | |
| /* | |
| also need last modified epoch of client gtfs | |
| - add,remove,patch,inform (null) | |
| - stop | |
| - trip | |
| - network | |
| - classes (WHERE=) | |
| - route (short_name or route_id) | |
| - street | |
| - stop | |
| - trip | |
| Currently support: | |
| network inform | |
| trip patch: stop remove | |
| street inform: route inform, trip inform, stop inform | |
| route patch: trip remove | |
| */ | |
| $return = Array(); | |
| $return['header']['gtrtfs_version'] = "1"; | |
| $return['header']['timestamp'] = time(); | |
| $return['entities'] = Array(); | |
| foreach(getCurrentAlerts() as $alert) { | |
| $informedEntities = getInformedAlerts($alert['id'],$_REQUEST['filter_class'],$_REQUEST['filter_id']); | |
| if (sizeof($informedEntities) >0) { | |
| $entity = Array(); | |
| $entity['id'] = $alert['id']; | |
| $entity['alert']['active_period']['start'] = $alert['start']; | |
| $entity['alert']['active_period']['end'] = $alert['end']; | |
| $entity['alert']['url']['translation'] = $alert['url']; | |
| $entity['alert']['description']['translation'] = $alert['description']; | |
| foreach ($informedEntities as $informedEntity) { | |
| $informed = Array(); | |
| $informed[$informedEntity['informed_class']."_id"] = $informedEntity['informed_id']; | |
| if ($informedEntity['informed_action'] != "") $informed["x-action"] = $informedEntity['informed_action']; | |
| $informed[$informedEntity['class']."_type"] = $informedEntity['type']; | |
| $entity['informed'][] = $informed; | |
| } | |
| $return['entities'][] = $entity; | |
| } | |
| } | |
| return $return; | |
| } | |
| function getServiceAlertsByClass() { | |
| $return = Array(); | |
| $alerts = getServiceAlerts("",""); | |
| foreach ($alerts['entities'] as $entity) { | |
| foreach ($entity['informed'] as $informed) { | |
| foreach($informed as $key => $value){ | |
| if (strpos("_id",$key) > 0) { | |
| $parts = explode($key); | |
| $class = $parts[0]; | |
| $id = $value; | |
| } | |
| } | |
| $return[$class][$id][]['entity'] = $entity; | |
| $return[$class][$id][]['action'] = $informed["x-action"]; | |
| } | |
| } | |
| } | |
| ?> | ?> |
| <?php | <?php |
| date_default_timezone_set('Australia/ACT'); | date_default_timezone_set('Australia/ACT'); |
| $debugOkay = Array( | $debugOkay = Array( |
| "session", | "session", |
| "json", | "json", |
| "phperror", | "phperror", |
| "awsotp", | "awsotp", |
| //"squallotp", | //"squallotp", |
| "vanilleotp", | //"vanilleotp", |
| "database", | "database", |
| "other" | "other" |
| ); | ); |
| $serviceAlertsEnabled = true; | |
| $cloudmadeAPIkey = "daa03470bb8740298d4b10e3f03d63e6"; | $cloudmadeAPIkey = "daa03470bb8740298d4b10e3f03d63e6"; |
| $googleMapsAPIkey = "ABQIAAAA95XYXN0cki3Yj_Sb71CFvBTPaLd08ONybQDjcH_VdYtHHLgZvRTw2INzI_m17_IoOUqH3RNNmlTk1Q"; | $googleMapsAPIkey = "ABQIAAAA95XYXN0cki3Yj_Sb71CFvBTPaLd08ONybQDjcH_VdYtHHLgZvRTw2INzI_m17_IoOUqH3RNNmlTk1Q"; |
| $otpAPIurl = 'http://localhost:8080/opentripplanner-api-webapp/'; | $otpAPIurl = 'http://localhost:8080/opentripplanner-api-webapp/'; |
| if (isDebug("awsotp") || php_uname('n') == "maxious.xen.prgmr.com") { | if (isDebug("awsotp") || php_uname('n') == "maxious.xen.prgmr.com") { |
| $otpAPIurl = 'http://bus-main.lambdacomplex.org:8080/opentripplanner-api-webapp/'; | $otpAPIurl = 'http://bus-main.lambdacomplex.org:8080/opentripplanner-api-webapp/'; |
| } | } |
| if (isDebug("dotcloudotp") || php_uname('n') == "actbus-www") { | if (isDebug("dotcloudotp") || php_uname('n') == "actbus-www") { |
| $otpAPIurl = 'http://otp.actbus.dotcloud.com/opentripplanner-api-webapp/'; | $otpAPIurl = 'http://otp.actbus.dotcloud.com/opentripplanner-api-webapp/'; |
| } | } |
| if (isDebug("squallotp")) { | if (isDebug("squallotp")) { |
| $otpAPIurl = 'http://10.0.1.108:5080/opentripplanner-api-webapp/'; | $otpAPIurl = 'http://10.0.1.108:5080/opentripplanner-api-webapp/'; |
| } | } |
| if (isDebug("vanilleotp")) { | if (isDebug("vanilleotp")) { |
| $otpAPIurl = 'http://10.0.1.135:8080/opentripplanner-api-webapp/'; | $otpAPIurl = 'http://10.0.1.135:8080/opentripplanner-api-webapp/'; |
| } | } |
| if (isDebug("phperror")) error_reporting(E_ALL ^ E_NOTICE); | if (isDebug("phperror")) error_reporting(E_ALL ^ E_NOTICE); |
| $labsPath = ""; | |
| if (strstr($_SERVER['PHP_SELF'],"labs")) $labsPath = "../"; | |
| function isDebugServer() | |
| { | |
| return php_sapi_name() == "cli" || isset($_SERVER['SERVER_NAME']) && ( $_SERVER['SERVER_NAME'] == "10.0.1.154" || $_SERVER['SERVER_NAME'] == "10.1.0.4" || $_SERVER['SERVER_NAME'] == | |
| "localhost" || $_SERVER['SERVER_NAME'] == "127.0.0.1") ; | |
| } | |
| include_once ("common-geo.inc.php"); | include_once ("common-geo.inc.php"); |
| include_once ("common-net.inc.php"); | include_once ("common-net.inc.php"); |
| include_once ("common-transit.inc.php"); | include_once ("common-transit.inc.php"); |
| include_once ("common-db.inc.php"); | include_once ("common-db.inc.php"); |
| include_once ("common-request.inc.php"); | include_once ("common-request.inc.php"); |
| include_once ("common-session.inc.php"); | include_once ("common-session.inc.php"); |
| include_once ("common-template.inc.php"); | include_once ("common-template.inc.php"); |
| function isDebugServer() | |
| { | |
| return $_SERVER['SERVER_NAME'] == "10.0.1.154" || $_SERVER['SERVER_NAME'] == "localhost" || $_SERVER['SERVER_NAME'] == "127.0.0.1" || !$_SERVER['SERVER_NAME']; | |
| } | |
| function isAnalyticsOn() | function isAnalyticsOn() |
| { | { |
| return !isDebugServer(); | return !isDebugServer(); |
| } | } |
| function isDebug($debugReason = "other") | function isDebug($debugReason = "other") |
| { | { |
| global $debugOkay; | global $debugOkay; |
| return in_array($debugReason, $debugOkay, false) && isDebugServer(); | return in_array($debugReason, $debugOkay, false) && isDebugServer(); |
| } | } |
| function debug($msg, $debugReason = "other") | function debug($msg, $debugReason = "other") |
| { | { |
| if (isDebug($debugReason)) echo "\n<!-- " . date(DATE_RFC822) . "\n $msg -->\n"; | if (isDebug($debugReason)) echo "\n<!-- " . date(DATE_RFC822) . "\n $msg -->\n"; |
| } | } |
| function isJQueryMobileDevice() | function isJQueryMobileDevice() |
| { | { |
| // http://forum.jquery.com/topic/what-is-the-best-way-to-detect-all-useragents-which-can-handle-jquery-mobile#14737000002087897 | // http://forum.jquery.com/topic/what-is-the-best-way-to-detect-all-useragents-which-can-handle-jquery-mobile#14737000002087897 |
| $user_agent = $_SERVER['HTTP_USER_AGENT']; | $user_agent = $_SERVER['HTTP_USER_AGENT']; |
| return preg_match('/iphone/i', $user_agent) || preg_match('/android/i', $user_agent) || preg_match('/webos/i', $user_agent) || preg_match('/ios/i', $user_agent) || preg_match('/bada/i', $user_agent) || preg_match('/maemo/i', $user_agent) || preg_match('/meego/i', $user_agent) || preg_match('/fennec/i', $user_agent) || (preg_match('/symbian/i', $user_agent) && preg_match('/s60/i', $user_agent) && $browser['majorver'] >= 5) || (preg_match('/symbian/i', $user_agent) && preg_match('/platform/i', $user_agent) && $browser['majorver'] >= 3) || (preg_match('/blackberry/i', $user_agent) && $browser['majorver'] >= 5) || (preg_match('/opera mobile/i', $user_agent) && $browser['majorver'] >= 10) || (preg_match('/opera mini/i', $user_agent) && $browser['majorver'] >= 5); | return preg_match('/iphone/i', $user_agent) || preg_match('/android/i', $user_agent) || preg_match('/webos/i', $user_agent) || preg_match('/ios/i', $user_agent) || preg_match('/bada/i', $user_agent) || preg_match('/maemo/i', $user_agent) || preg_match('/meego/i', $user_agent) || preg_match('/fennec/i', $user_agent) || (preg_match('/symbian/i', $user_agent) && preg_match('/s60/i', $user_agent) && $browser['majorver'] >= 5) || (preg_match('/symbian/i', $user_agent) && preg_match('/platform/i', $user_agent) && $browser['majorver'] >= 3) || (preg_match('/blackberry/i', $user_agent) && $browser['majorver'] >= 5) || (preg_match('/opera mobile/i', $user_agent) && $browser['majorver'] >= 10) || (preg_match('/opera mini/i', $user_agent) && $browser['majorver'] >= 5); |
| } | } |
| function isFastDevice() | function isFastDevice() |
| { | { |
| $ua = $_SERVER['HTTP_USER_AGENT']; | $ua = $_SERVER['HTTP_USER_AGENT']; |
| $fastDevices = Array( | $fastDevices = Array( |
| "Mozilla/5.0 (X11;", | "Mozilla/5.0 (X11;", |
| "Mozilla/5.0 (Windows;", | "Mozilla/5.0 (Windows;", |
| "Mozilla/5.0 (iP", | "Mozilla/5.0 (iP", |
| "Mozilla/5.0 (Linux; U; Android", | "Mozilla/5.0 (Linux; U; Android", |
| "Mozilla/4.0 (compatible; MSIE" | "Mozilla/4.0 (compatible; MSIE" |
| ); | ); |
| $slowDevices = Array( | $slowDevices = Array( |
| "J2ME", | "J2ME", |
| "MIDP", | "MIDP", |
| "Opera/", | "Opera/", |
| "Mozilla/2.0 (compatible;", | "Mozilla/2.0 (compatible;", |
| "Mozilla/3.0 (compatible;" | "Mozilla/3.0 (compatible;" |
| ); | ); |
| return true; | return true; |
| } | } |
| function array_flatten($a, $f = array()) | function array_flatten($a, $f = array()) |
| { | { |
| if (!$a || !is_array($a)) return ''; | if (!$a || !is_array($a)) return ''; |
| foreach ($a as $k => $v) { | foreach ($a as $k => $v) { |
| if (is_array($v)) $f = array_flatten($v, $f); | if (is_array($v)) $f = array_flatten($v, $f); |
| else $f[$k] = $v; | else $f[$k] = $v; |
| } | } |
| return $f; | return $f; |
| } | } |
| function remove_spaces($string) | function remove_spaces($string) |
| { | { |
| return str_replace(' ', '', $string); | return str_replace(' ', '', $string); |
| } | } |
| function object2array($object) | function object2array($object) |
| { | { |
| if (is_object($object)) { | if (is_object($object)) { |
| foreach ($object as $key => $value) { | foreach ($object as $key => $value) { |
| $array[$key] = $value; | $array[$key] = $value; |
| } | } |
| } | } |
| else { | else { |
| $array = $object; | $array = $object; |
| } | } |
| return $array; | return $array; |
| } | } |
| function startsWith($haystack, $needle, $case = true) | function startsWith($haystack, $needle, $case = true) |
| { | { |
| if ($case) { | if ($case) { |
| return (strcmp(substr($haystack, 0, strlen($needle)) , $needle) === 0); | return (strcmp(substr($haystack, 0, strlen($needle)) , $needle) === 0); |
| } | } |
| return (strcasecmp(substr($haystack, 0, strlen($needle)) , $needle) === 0); | return (strcasecmp(substr($haystack, 0, strlen($needle)) , $needle) === 0); |
| } | } |
| function endsWith($haystack, $needle, $case = true) | function endsWith($haystack, $needle, $case = true) |
| { | { |
| if ($case) { | if ($case) { |
| return (strcmp(substr($haystack, strlen($haystack) - strlen($needle)) , $needle) === 0); | return (strcmp(substr($haystack, strlen($haystack) - strlen($needle)) , $needle) === 0); |
| } | } |
| return (strcasecmp(substr($haystack, strlen($haystack) - strlen($needle)) , $needle) === 0); | return (strcasecmp(substr($haystack, strlen($haystack) - strlen($needle)) , $needle) === 0); |
| } | } |
| function bracketsMeanNewLine($input) | function bracketsMeanNewLine($input) |
| { | { |
| return str_replace(")", "</small>", str_replace("(", "<br><small>", $input)); | return str_replace(")", "</small>", str_replace("(", "<br><small>", $input)); |
| } | } |
| function sksort(&$array, $subkey = "id", $sort_ascending = false) | function sksort(&$array, $subkey = "id", $sort_ascending = false) |
| { | { |
| if (count($array)) $temp_array[key($array) ] = array_shift($array); | if (count($array)) $temp_array[key($array) ] = array_shift($array); |
| foreach ($array as $key => $val) { | foreach ($array as $key => $val) { |
| $offset = 0; | $offset = 0; |
| $found = false; | $found = false; |
| foreach ($temp_array as $tmp_key => $tmp_val) { | foreach ($temp_array as $tmp_key => $tmp_val) { |
| if (!$found and strtolower($val[$subkey]) > strtolower($tmp_val[$subkey])) { | if (!$found and strtolower($val[$subkey]) > strtolower($tmp_val[$subkey])) { |
| $temp_array = array_merge((array)array_slice($temp_array, 0, $offset) , array( | $temp_array = array_merge((array)array_slice($temp_array, 0, $offset) , array( |
| $key => $val | $key => $val |
| ) , array_slice($temp_array, $offset)); | ) , array_slice($temp_array, $offset)); |
| $found = true; | $found = true; |
| } | } |
| $offset++; | $offset++; |
| } | } |
| if (!$found) $temp_array = array_merge($temp_array, array( | if (!$found) $temp_array = array_merge($temp_array, array( |
| $key => $val | $key => $val |
| )); | )); |
| } | } |
| if ($sort_ascending) $array = array_reverse($temp_array); | if ($sort_ascending) $array = array_reverse($temp_array); |
| else $array = $temp_array; | else $array = $temp_array; |
| } | } |
| function sktimesort(&$array, $subkey = "id", $sort_ascending = false) | function sktimesort(&$array, $subkey = "id", $sort_ascending = false) |
| { | { |
| if (count($array)) $temp_array[key($array) ] = array_shift($array); | if (count($array)) $temp_array[key($array) ] = array_shift($array); |
| foreach ($array as $key => $val) { | foreach ($array as $key => $val) { |
| $offset = 0; | $offset = 0; |
| $found = false; | $found = false; |
| foreach ($temp_array as $tmp_key => $tmp_val) { | foreach ($temp_array as $tmp_key => $tmp_val) { |
| if (!$found and strtotime($val[$subkey]) > strtotime($tmp_val[$subkey])) { | if (!$found and strtotime($val[$subkey]) > strtotime($tmp_val[$subkey])) { |
| $temp_array = array_merge((array)array_slice($temp_array, 0, $offset) , array( | $temp_array = array_merge((array)array_slice($temp_array, 0, $offset) , array( |
| $key => $val | $key => $val |
| ) , array_slice($temp_array, $offset)); | ) , array_slice($temp_array, $offset)); |
| $found = true; | $found = true; |
| } | } |
| $offset++; | $offset++; |
| } | } |
| if (!$found) $temp_array = array_merge($temp_array, array( | if (!$found) $temp_array = array_merge($temp_array, array( |
| $key => $val | $key => $val |
| )); | )); |
| } | } |
| if ($sort_ascending && isset($temp_array)) $array = array_reverse($temp_array); | if ($sort_ascending && isset($temp_array)) $array = array_reverse($temp_array); |
| else $array = $temp_array; | else $array = $temp_array; |
| } | } |
| function r_implode( $glue, $pieces ) | function r_implode( $glue, $pieces ) |
| { | { |
| foreach( $pieces as $r_pieces ) | foreach( $pieces as $r_pieces ) |
| { | { |
| if( is_array( $r_pieces ) ) | if( is_array( $r_pieces ) ) |
| { | { |
| $retVal[] = r_implode( $glue, $r_pieces ); | $retVal[] = r_implode( $glue, $r_pieces ); |
| } | } |
| else | else |
| { | { |
| $retVal[] = $r_pieces; | $retVal[] = $r_pieces; |
| } | } |
| } | } |
| return implode( $glue, $retVal ); | return implode( $glue, $retVal ); |
| } | } |
| ?> | ?> |
| <?php | <?php |
| function getRoute($routeID) | function getRoute($routeID) |
| { | |
| global $conn; | { |
| $query = "Select * from routes where route_id = :routeID LIMIT 1"; | global $conn; |
| debug($query, "database"); | $query = "Select * from routes where route_id = :routeID LIMIT 1"; |
| $query = $conn->prepare($query); | debug($query, "database"); |
| $query->bindParam(":routeID", $routeID); | $query = $conn -> prepare($query); |
| $query->execute(); | $query -> bindParam(":routeID", $routeID); |
| if (!$query) { | $query -> execute(); |
| databaseError($conn->errorInfo()); | if (!$query) { |
| return Array(); | databaseError($conn -> errorInfo()); |
| } | return Array(); |
| return $query->fetch(PDO::FETCH_ASSOC); | } |
| } | return $query -> fetch(PDO :: FETCH_ASSOC); |
| } | |
| function getRouteByFullName($routeFullName) | |
| { | |
| global $conn; | |
| $query = "Select * from routes where route_short_name||route_long_name = :routeFullName LIMIT 1"; | |
| debug($query, "database"); | |
| $query = $conn -> prepare($query); | |
| $query -> bindParam(":routeFullName", $routeFullName); | |
| $query -> execute(); | |
| if (!$query) { | |
| databaseError($conn -> errorInfo()); | |
| return Array(); | |
| } | |
| return $query -> fetch(PDO :: FETCH_ASSOC); | |
| } | |
| function getRoutes() | function getRoutes() |
| { | |
| global $conn; | { |
| $query = "Select * from routes order by route_short_name;"; | global $conn; |
| debug($query, "database"); | $query = "Select * from routes order by route_short_name;"; |
| $query = $conn->prepare($query); | debug($query, "database"); |
| $query->execute(); | $query = $conn -> prepare($query); |
| if (!$query) { | $query -> execute(); |
| databaseError($conn->errorInfo()); | if (!$query) { |
| return Array(); | databaseError($conn -> errorInfo()); |
| } | return Array(); |
| return $query->fetchAll(); | } |
| } | return $query -> fetchAll(); |
| } | |
| function getRoutesByNumber($routeNumber = "") | function getRoutesByNumber($routeNumber = "") |
| { | |
| global $conn; | { |
| if ($routeNumber != "") { | global $conn; |
| $query = "Select distinct routes.route_id,routes.route_short_name,routes.route_long_name,service_id from routes join trips on trips.route_id = | if ($routeNumber != "") { |
| routes.route_id join stop_times on stop_times.trip_id = trips.trip_id where route_short_name = :routeNumber order by route_short_name;"; | $query = "Select distinct routes.route_id,routes.route_short_name,routes.route_long_name,service_id from routes join trips on trips.route_id = |
| } | routes.route_id join stop_times on stop_times.trip_id = trips.trip_id |
| else { | where route_short_name = :routeNumber OR route_short_name LIKE :routeNumber2 order by route_short_name;"; |
| $query = "SELECT DISTINCT route_short_name from routes order by route_short_name"; | } |
| } | else { |
| debug($query, "database"); | $query = "SELECT DISTINCT route_short_name from routes order by route_short_name"; |
| $query = $conn->prepare($query); | } |
| if ($routeNumber != "") { | debug($query, "database"); |
| $query->bindParam(":routeNumber", $routeNumber); | $query = $conn -> prepare($query); |
| } | if ($routeNumber != "") { |
| $query->execute(); | $query -> bindParam(":routeNumber", $routeNumber); |
| if (!$query) { | $routeNumber2 = "% " . $routeNumber; |
| databaseError($conn->errorInfo()); | $query -> bindParam(":routeNumber2", $routeNumber2); |
| return Array(); | } |
| } | $query -> execute(); |
| return $query->fetchAll(); | if (!$query) { |
| } | databaseError($conn -> errorInfo()); |
| return Array(); | |
| } | |
| return $query -> fetchAll(); | |
| } | |
| function getRoutesByNumberSeries($routeNumberSeries = "") | function getRoutesByNumberSeries($routeNumberSeries = "") |
| { | |
| global $conn; | { |
| if (strlen($routeNumberSeries) == 1) { | global $conn; |
| return getRoutesByNumber($routeNumberSeries); | if (strlen($routeNumberSeries) == 1) { |
| } | return getRoutesByNumber($routeNumberSeries); |
| $seriesMin = substr($routeNumberSeries, 0, -1) . "0"; | } |
| $seriesMax = substr($routeNumberSeries, 0, -1) . "9"; | $seriesMin = substr($routeNumberSeries, 0, -1) . "0"; |
| $query = "Select distinct routes.route_id,routes.route_short_name,routes.route_long_name,service_id from routes join trips on trips.route_id = | $seriesMax = substr($routeNumberSeries, 0, -1) . "9"; |
| $query = "Select distinct routes.route_id,routes.route_short_name,routes.route_long_name,service_id from routes join trips on trips.route_id = | |
| routes.route_id join stop_times on stop_times.trip_id = trips.trip_id where to_number(route_short_name, 'FM999') between :seriesMin and :seriesMax OR route_short_name LIKE :routeNumberSeries order by route_short_name;"; | routes.route_id join stop_times on stop_times.trip_id = trips.trip_id where to_number(route_short_name, 'FM999') between :seriesMin and :seriesMax OR route_short_name LIKE :routeNumberSeries order by route_short_name;"; |
| debug($query, "database"); | debug($query, "database"); |
| $query = $conn->prepare($query); | $query = $conn -> prepare($query); |
| $query->bindParam(":seriesMin", $seriesMin); | $query -> bindParam(":seriesMin", $seriesMin); |
| $query->bindParam(":seriesMax", $seriesMax); | $query -> bindParam(":seriesMax", $seriesMax); |
| $routeNumberSeries = "% ".substr($routeNumberSeries, 0, -1)."%"; | $routeNumberSeries = "% " . substr($routeNumberSeries, 0, -1) . "%"; |
| $query->bindParam(":routeNumberSeries", $routeNumberSeries); | $query -> bindParam(":routeNumberSeries", $routeNumberSeries); |
| $query->execute(); | $query -> execute(); |
| if (!$query) { | if (!$query) { |
| databaseError($conn->errorInfo()); | databaseError($conn -> errorInfo()); |
| return Array(); | return Array(); |
| } | } |
| return $query->fetchAll(); | return $query -> fetchAll(); |
| } | } |
| function getRouteNextTrip($routeID) | function getRouteNextTrip($routeID) |
| { | |
| global $conn; | { |
| $query = "select * from routes join trips on trips.route_id = routes.route_id | global $conn; |
| $query = "select * from routes join trips on trips.route_id = routes.route_id | |
| join stop_times on stop_times.trip_id = trips.trip_id where | join stop_times on stop_times.trip_id = trips.trip_id where |
| arrival_time > :currentTime and routes.route_id = :routeID order by | arrival_time > :currentTime and routes.route_id = :routeID order by |
| arrival_time limit 1"; | arrival_time limit 1"; |
| debug($query, "database"); | debug($query, "database"); |
| $query = $conn->prepare($query); | $query = $conn -> prepare($query); |
| $query->bindParam(":currentTime", current_time()); | $query -> bindParam(":currentTime", current_time()); |
| $query->bindParam(":routeID", $routeID); | $query -> bindParam(":routeID", $routeID); |
| $query->execute(); | $query -> execute(); |
| if (!$query) { | if (!$query) { |
| databaseError($conn->errorInfo()); | databaseError($conn -> errorInfo()); |
| return Array(); | return Array(); |
| } | } |
| $r = $query->fetch(PDO::FETCH_ASSOC); | $r = $query -> fetch(PDO :: FETCH_ASSOC); |
| // past last trip of the day special case | // past last trip of the day special case |
| if (sizeof($r) < 16) { | if (sizeof($r) < 16) { |
| $query = "select * from routes join trips on trips.route_id = routes.route_id | $query = "select * from routes join trips on trips.route_id = routes.route_id |
| join stop_times on stop_times.trip_id = trips.trip_id where routes.route_id = :routeID order by | join stop_times on stop_times.trip_id = trips.trip_id where routes.route_id = :routeID order by |
| arrival_time DESC limit 1"; | arrival_time DESC limit 1"; |
| debug($query, "database"); | debug($query, "database"); |
| $query = $conn->prepare($query); | $query = $conn -> prepare($query); |
| $query->bindParam(":routeID", $routeID); | $query -> bindParam(":routeID", $routeID); |
| $query->execute(); | $query -> execute(); |
| if (!$query) { | if (!$query) { |
| databaseError($conn->errorInfo()); | databaseError($conn -> errorInfo()); |
| return Array(); | return Array(); |
| } | } |
| $r = $query->fetch(PDO::FETCH_ASSOC); | $r = $query -> fetch(PDO :: FETCH_ASSOC); |
| } | } |
| return $r; | return $r; |
| } | } |
| function getTimeInterpolatedRouteAtStop($routeID, $stop_id) | function getTimeInterpolatedRouteAtStop($routeID, $stop_id) |
| { | |
| $nextTrip = getRouteNextTrip($routeID); | { |
| if ($nextTrip['trip_id']) { | $nextTrip = getRouteNextTrip($routeID); |
| foreach (getTimeInterpolatedTrip($nextTrip['trip_id']) as $tripStop) { | if ($nextTrip['trip_id']) { |
| if ($tripStop['stop_id'] == $stop_id) return $tripStop; | foreach (getTimeInterpolatedTrip($nextTrip['trip_id']) as $tripStop) { |
| } | if ($tripStop['stop_id'] == $stop_id) return $tripStop; |
| } | } |
| return Array(); | } |
| } | return Array(); |
| } | |
| function getRouteTrips($routeID) | function getRouteTrips($routeID) |
| { | |
| global $conn; | { |
| $query = "select routes.route_id,trips.trip_id,service_id,arrival_time, stop_id, stop_sequence from routes join trips on trips.route_id = routes.route_id | global $conn; |
| $query = "select routes.route_id,trips.trip_id,service_id,arrival_time, stop_id, stop_sequence from routes join trips on trips.route_id = routes.route_id | |
| join stop_times on stop_times.trip_id = trips.trip_id where routes.route_id = :routeID and stop_sequence = '1' order by | join stop_times on stop_times.trip_id = trips.trip_id where routes.route_id = :routeID and stop_sequence = '1' order by |
| arrival_time "; | arrival_time "; |
| debug($query, "database"); | debug($query, "database"); |
| $query = $conn->prepare($query); | $query = $conn -> prepare($query); |
| $query->bindParam(":routeID", $routeID); | $query -> bindParam(":routeID", $routeID); |
| $query->execute(); | $query -> execute(); |
| if (!$query) { | if (!$query) { |
| databaseError($conn->errorInfo()); | databaseError($conn -> errorInfo()); |
| return Array(); | return Array(); |
| } | } |
| return $query->fetchAll(); | return $query -> fetchAll(); |
| } | } |
| function getRoutesByDestination($destination = "", $service_period = "") | function getRoutesByDestination($destination = "", $service_period = "") |
| { | |
| global $conn; | { |
| if ($service_period == "") $service_period = service_period(); | global $conn; |
| if ($destination != "") { | if ($service_period == "") $service_period = service_period(); |
| $query = "SELECT DISTINCT trips.route_id,route_short_name,route_long_name, service_id | if ($destination != "") { |
| $query = "SELECT DISTINCT trips.route_id,route_short_name,route_long_name, service_id | |
| FROM stop_times join trips on trips.trip_id = | FROM stop_times join trips on trips.trip_id = |
| stop_times.trip_id join routes on trips.route_id = routes.route_id | stop_times.trip_id join routes on trips.route_id = routes.route_id |
| WHERE route_long_name = :destination AND service_id=:service_period order by route_short_name"; | WHERE route_long_name = :destination AND service_id=:service_period order by route_short_name"; |
| } | } |
| else { | else { |
| $query = "SELECT DISTINCT route_long_name | $query = "SELECT DISTINCT route_long_name |
| FROM stop_times join trips on trips.trip_id = | FROM stop_times join trips on trips.trip_id = |
| stop_times.trip_id join routes on trips.route_id = routes.route_id | stop_times.trip_id join routes on trips.route_id = routes.route_id |
| WHERE service_id= :service_period order by route_long_name"; | WHERE service_id= :service_period order by route_long_name"; |
| } | } |
| debug($query, "database"); | debug($query, "database"); |
| $query = $conn->prepare($query); | $query = $conn -> prepare($query); |
| $query->bindParam(":service_period", $service_period); | $query -> bindParam(":service_period", $service_period); |
| if ($destination != "") $query->bindParam(":destination", $destination); | if ($destination != "") $query -> bindParam(":destination", $destination); |
| $query->execute(); | $query -> execute(); |
| if (!$query) { | if (!$query) { |
| databaseError($conn->errorInfo()); | databaseError($conn -> errorInfo()); |
| return Array(); | return Array(); |
| } | } |
| return $query->fetchAll(); | return $query -> fetchAll(); |
| } | } |
| function getRoutesBySuburb($suburb, $service_period = "") | function getRoutesBySuburb($suburb, $service_period = "") |
| { | |
| if ($service_period == "") $service_period = service_period(); | { |
| global $conn; | if ($service_period == "") $service_period = service_period(); |
| $query = "SELECT DISTINCT service_id,trips.route_id,route_short_name,route_long_name | global $conn; |
| $query = "SELECT DISTINCT service_id,trips.route_id,route_short_name,route_long_name | |
| FROM stop_times join trips on trips.trip_id = stop_times.trip_id | FROM stop_times join trips on trips.trip_id = stop_times.trip_id |
| join routes on trips.route_id = routes.route_id | join routes on trips.route_id = routes.route_id |
| join stops on stops.stop_id = stop_times.stop_id | join stops on stops.stop_id = stop_times.stop_id |
| WHERE zone_id LIKE ':suburb AND service_id=:service_period ORDER BY route_short_name"; | WHERE zone_id LIKE ':suburb AND service_id=:service_period ORDER BY route_short_name"; |
| debug($query, "database"); | debug($query, "database"); |
| $query = $conn->prepare($query); | $query = $conn -> prepare($query); |
| $query->bindParam(":service_period", $service_period); | $query -> bindParam(":service_period", $service_period); |
| $suburb = "%" . $suburb . ";%"; | $suburb = "%" . $suburb . ";%"; |
| $query->bindParam(":suburb", $suburb); | $query -> bindParam(":suburb", $suburb); |
| $query->execute(); | $query -> execute(); |
| if (!$query) { | if (!$query) { |
| databaseError($conn->errorInfo()); | databaseError($conn -> errorInfo()); |
| return Array(); | return Array(); |
| } | } |
| return $query->fetchAll(); | return $query -> fetchAll(); |
| } | } |
| function getRoutesNearby($lat, $lng, $limit = "", $distance = 500) | function getRoutesNearby($lat, $lng, $limit = "", $distance = 500) |
| { | |
| if ($service_period == "") $service_period = service_period(); | { |
| if ($limit != "") $limitSQL = " LIMIT :limit "; | if ($service_period == "") $service_period = service_period(); |
| global $conn; | if ($limit != "") $limitSQL = " LIMIT :limit "; |
| $query = "SELECT service_id,trips.route_id,route_short_name,route_long_name,min(stops.stop_id) as stop_id, | global $conn; |
| $query = "SELECT service_id,trips.route_id,route_short_name,route_long_name,min(stops.stop_id) as stop_id, | |
| min(ST_Distance(position, ST_GeographyFromText('SRID=4326;POINT($lng $lat)'), FALSE)) as distance | min(ST_Distance(position, ST_GeographyFromText('SRID=4326;POINT($lng $lat)'), FALSE)) as distance |
| FROM stop_times | FROM stop_times |
| join trips on trips.trip_id = stop_times.trip_id | join trips on trips.trip_id = stop_times.trip_id |
| join routes on trips.route_id = routes.route_id | join routes on trips.route_id = routes.route_id |
| join stops on stops.stop_id = stop_times.stop_id | join stops on stops.stop_id = stop_times.stop_id |
| WHERE service_id=:service_period | WHERE service_id=:service_period |
| AND ST_DWithin(position, ST_GeographyFromText('SRID=4326;POINT($lng $lat)'), :distance, FALSE) | AND ST_DWithin(position, ST_GeographyFromText('SRID=4326;POINT($lng $lat)'), :distance, FALSE) |
| group by service_id,trips.route_id,route_short_name,route_long_name | group by service_id,trips.route_id,route_short_name,route_long_name |
| order by distance $limitSQL"; | order by distance $limitSQL"; |
| debug($query, "database"); | debug($query, "database"); |
| $query = $conn->prepare($query); | $query = $conn -> prepare($query); |
| $query->bindParam(":service_period", $service_period); | $query -> bindParam(":service_period", $service_period); |
| $query->bindParam(":distance", $distance); | $query -> bindParam(":distance", $distance); |
| if ($limit != "") $query->bindParam(":limit", $limit); | if ($limit != "") $query -> bindParam(":limit", $limit); |
| $query->execute(); | $query -> execute(); |
| if (!$query) { | if (!$query) { |
| databaseError($conn->errorInfo()); | databaseError($conn -> errorInfo()); |
| return Array(); | return Array(); |
| } | } |
| return $query->fetchAll(); | return $query -> fetchAll(); |
| } | } |
| ?> | ?> |
| <?php | <?php |
| function getServiceOverride() { | function getServiceOverride($date = "") |
| global $conn; | { |
| $query = "Select * from calendar_dates where date = :date and exception_type = '1' LIMIT 1"; | global $conn; |
| debug($query,"database"); | $query = "Select * from calendar_dates where date = :date and exception_type = '1' LIMIT 1"; |
| $query = $conn->prepare($query); // Create a prepared statement | // debug($query,"database"); |
| $query->bindParam(":date", date("Ymd")); | $query = $conn -> prepare($query); // Create a prepared statement |
| $query->execute(); | $query -> bindParam(":date", date("Ymd", ($date != "" ? $date : time()))); |
| if (!$query) { | $query -> execute(); |
| databaseError($conn->errorInfo()); | if (!$query) { |
| return Array(); | databaseError($conn -> errorInfo()); |
| } | return Array(); |
| return $query->fetch(PDO::FETCH_ASSOC); | } |
| } | return $query -> fetch(PDO :: FETCH_ASSOC); |
| } | |
| function getServiceAlert($alertID) | |
| { | |
| global $conn; | |
| $query = 'SELECT * from servicealerts_alerts where id = :servicealert_id'; | |
| debug($query, "database"); | |
| $query = $conn -> prepare($query); | |
| $query -> bindParam(":servicealert_id", $alertID); | |
| $query -> execute(); | |
| if (!$query) { | |
| databaseError($conn -> errorInfo()); | |
| return Array(); | |
| } | |
| return $query -> fetch(PDO :: FETCH_ASSOC); | |
| } | |
| function updateServiceAlert($alertID, $start, $end, $description, $url) | |
| { | |
| global $conn; | |
| $query = 'update servicealerts_alerts set start=:start, "end"=:end, description=:description, url=:url where id = :servicealert_id'; | |
| debug($query, "database"); | |
| $query = $conn -> prepare($query); | |
| $query -> bindParam(":servicealert_id", $alertID); | |
| $query -> bindParam(":start", $start); | |
| $query -> bindParam(":end", $end); | |
| $query -> bindParam(":description", $description); | |
| $query -> bindParam(":url", $url); | |
| $query -> execute(); | |
| print_r($conn -> errorInfo()); | |
| if (!$query) { | |
| databaseError($conn -> errorInfo()); | |
| return Array(); | |
| } | |
| return $query -> fetch(PDO :: FETCH_ASSOC); | |
| } | |
| function addServiceAlert($start, $end, $description, $url) | |
| { | |
| global $conn; | |
| $query = 'INSERT INTO servicealerts_alerts (start, "end", description, url) VALUES (:start, :end, :description, :url) '; | |
| debug($query, "database"); | |
| $query = $conn -> prepare($query); | |
| $query -> bindParam(":start", $start); | |
| $query -> bindParam(":end", $end); | |
| $query -> bindParam(":description", $description); | |
| $query -> bindParam(":url", $url); | |
| $query -> execute(); | |
| print_r($conn -> errorInfo()); | |
| if (!$query) { | |
| databaseError($conn -> errorInfo()); | |
| return Array(); | |
| } | |
| return $query -> fetch(PDO :: FETCH_ASSOC); | |
| } | |
| function getCurrentAlerts() | |
| { | |
| global $conn; | |
| $query = 'SELECT * from servicealerts_alerts where NOW() > start and NOW() < "end"'; | |
| // debug($query, "database"); | |
| $query = $conn -> prepare($query); | |
| $query -> execute(); | |
| if (!$query) { | |
| databaseError($conn -> errorInfo()); | |
| return Array(); | |
| } | |
| return $query -> fetchAll(); | |
| } | |
| function getFutureAlerts() | |
| { | |
| global $conn; | |
| $query = 'SELECT * from servicealerts_alerts where NOW() > start or NOW() < "end"'; | |
| // debug($query, "database"); | |
| $query = $conn -> prepare($query); | |
| $query -> execute(); | |
| if (!$query) { | |
| databaseError($conn -> errorInfo()); | |
| return Array(); | |
| } | |
| return $query -> fetchAll(); | |
| } | |
| function getInformedAlerts($id, $filter_class, $filter_id) | |
| { | |
| global $conn; | |
| $query = "SELECT * from servicealerts_informed where servicealert_id = :servicealert_id"; | |
| if ($filter_class != "") { | |
| $query .= " AND informed_class = :informed_class "; | |
| } | |
| if ($filter_id != "") { | |
| $query .= " AND informed_id = :informed_id "; | |
| } | |
| // debug($query, "database"); | |
| $query = $conn -> prepare($query); | |
| if ($filter_class != "") { | |
| $query -> bindParam(":informed_class", $filter_class); | |
| } | |
| if ($filter_id != "") { | |
| $query -> bindParam(":informed_id", $filter_id); | |
| } | |
| $query -> bindParam(":servicealert_id", $id); | |
| $query -> execute(); | |
| if (!$query) { | |
| databaseError($conn -> errorInfo()); | |
| return Array(); | |
| } | |
| return $query -> fetchAll(); | |
| } | |
| function deleteInformedAlert($serviceAlertID, $class, $id) | |
| { | |
| global $conn; | |
| $query = 'DELETE from servicealerts_informed where servicealert_id = :servicealert_id and informed_class = :informed_class AND informed_id = :informed_id'; | |
| debug($query, "database"); | |
| $query = $conn -> prepare($query); | |
| $query -> bindParam(":servicealert_id", $serviceAlertID); | |
| $query -> bindParam(":informed_class", $class); | |
| $query -> bindParam(":informed_id", $id); | |
| $query -> execute(); | |
| print_r($conn -> errorInfo()); | |
| if (!$query) { | |
| databaseError($conn -> errorInfo()); | |
| return Array(); | |
| } | |
| return null; | |
| } | |
| function addInformedAlert($serviceAlertID, $class, $id, $action) | |
| { | |
| global $conn; | |
| $query = 'INSERT INTO servicealerts_informed (servicealert_id , informed_class , informed_id) VALUES(:servicealert_id ,:informed_class, :informed_id)'; | |
| debug($query, "database"); | |
| $query = $conn -> prepare($query); | |
| $query -> bindParam(":servicealert_id", $serviceAlertID); | |
| $query -> bindParam(":informed_class", $class); | |
| $query -> bindParam(":informed_id", $id); | |
| $query -> execute(); | |
| print_r($conn -> errorInfo()); | |
| if (!$query) { | |
| databaseError($conn -> errorInfo()); | |
| return Array(); | |
| } | |
| return null; | |
| } | |
| ?> | ?> |
| <?php | <?php |
| function getStop($stopID) | function getStop($stopID) |
| { | |
| global $conn; | { |
| $query = "Select * from stops where stop_id = :stopID LIMIT 1"; | global $conn; |
| debug($query, "database"); | $query = "Select * from stops where stop_id = :stopID LIMIT 1"; |
| $query = $conn->prepare($query); | debug($query, "database"); |
| $query->bindParam(":stopID", $stopID); | $query = $conn -> prepare($query); |
| $query->execute(); | $query -> bindParam(":stopID", $stopID); |
| if (!$query) { | $query -> execute(); |
| databaseError($conn->errorInfo()); | if (!$query) { |
| return Array(); | databaseError($conn -> errorInfo()); |
| } | return Array(); |
| return $query->fetch(PDO::FETCH_ASSOC); | } |
| } | return $query -> fetch(PDO :: FETCH_ASSOC); |
| function getStops($timingPointsOnly = false, $firstLetter = "") | } |
| { | function getStops($timingPointsOnly = false, $firstLetter = "", $startsWith = "") |
| global $conn; | |
| $conditions = Array(); | { |
| if ($timingPointsOnly) $conditions[] = "substr(stop_code,1,2) != 'Wj'"; | global $conn; |
| if ($firstLetter != "") $conditions[] = "substr(stop_name,1,1) = :firstLetter"; | $conditions = Array(); |
| $query = "Select * from stops"; | if ($timingPointsOnly) $conditions[] = "substr(stop_code,1,2) != 'Wj'"; |
| if (sizeof($conditions) > 0) { | if ($firstLetter != "") $conditions[] = "substr(stop_name,1,1) = :firstLetter"; |
| if (sizeof($conditions) > 1) { | if ($startsWith != "") $conditions[] = "stop_name like :startsWith"; |
| $query.= " Where " . implode(" AND ", $conditions) . " "; | $query = "Select * from stops"; |
| } | if (sizeof($conditions) > 0) { |
| else { | if (sizeof($conditions) > 1) { |
| $query.= " Where " . $conditions[0] . " "; | $query .= " Where " . implode(" AND ", $conditions) . " "; |
| } | } |
| } | else { |
| $query.= " order by stop_name;"; | $query .= " Where " . $conditions[0] . " "; |
| $query = $conn->prepare($query); | } |
| if ($firstLetter != "") $query->bindParam(":firstLetter", $firstLetter); | } |
| $query->execute(); | $query .= " order by stop_name;"; |
| if (!$query) { | $query = $conn -> prepare($query); |
| databaseError($conn->errorInfo()); | if ($firstLetter != "") $query -> bindParam(":firstLetter", $firstLetter); |
| return Array(); | |
| } | if ($startsWith != "") { |
| return $query->fetchAll(); | $startsWith = $startsWith . "%"; |
| } | $query -> bindParam(":startsWith", $startsWith); |
| } | |
| $query -> execute(); | |
| if (!$query) { | |
| databaseError($conn -> errorInfo()); | |
| return Array(); | |
| } | |
| return $query -> fetchAll(); | |
| } | |
| function getNearbyStops($lat, $lng, $limit = "", $distance = 1000) | function getNearbyStops($lat, $lng, $limit = "", $distance = 1000) |
| { | |
| if ($lat == null || $lng == null) return Array(); | { |
| if ($limit != "") $limitSQL = " LIMIT :limit "; | if ($lat == null || $lng == null) return Array(); |
| global $conn; | if ($limit != "") $limitSQL = " LIMIT :limit "; |
| $query = "Select *, ST_Distance(position, ST_GeographyFromText('SRID=4326;POINT($lng $lat)'), FALSE) as distance | global $conn; |
| $query = "Select *, ST_Distance(position, ST_GeographyFromText('SRID=4326;POINT($lng $lat)'), FALSE) as distance | |
| from stops WHERE ST_DWithin(position, ST_GeographyFromText('SRID=4326;POINT($lng $lat)'), :distance, FALSE) | from stops WHERE ST_DWithin(position, ST_GeographyFromText('SRID=4326;POINT($lng $lat)'), :distance, FALSE) |
| order by distance $limitSQL;"; | order by distance $limitSQL;"; |
| debug($query, "database"); | debug($query, "database"); |
| $query = $conn->prepare($query); | $query = $conn -> prepare($query); |
| $query->bindParam(":distance", $distance); | $query -> bindParam(":distance", $distance); |
| $query->bindParam(":limit", $limit); | $query -> bindParam(":limit", $limit); |
| $query->execute(); | $query -> execute(); |
| if (!$query) { | if (!$query) { |
| databaseError($conn->errorInfo()); | databaseError($conn -> errorInfo()); |
| return Array(); | return Array(); |
| } | } |
| return $query->fetchAll(); | return $query -> fetchAll(); |
| } | } |
| function getStopsByName($name) | |
| { | |
| global $conn; | |
| $query = "Select * from stops where stop_name LIKE :name;"; | |
| debug($query, "database"); | |
| $query = $conn -> prepare($query); | |
| $name = "%" . $name . ";%"; | |
| $query -> bindParam(":name", $name); | |
| $query -> execute(); | |
| if (!$query) { | |
| databaseError($conn -> errorInfo()); | |
| return Array(); | |
| } | |
| return $query -> fetchAll(); | |
| } | |
| function getStopsBySuburb($suburb) | function getStopsBySuburb($suburb) |
| { | |
| global $conn; | { |
| $query = "Select * from stops where zone_id LIKE :suburb order by stop_name;"; | global $conn; |
| debug($query, "database"); | $query = "Select * from stops where zone_id LIKE :suburb order by stop_name;"; |
| $query = $conn->prepare($query); | debug($query, "database"); |
| $suburb = "%" . $suburb . ";%"; | $query = $conn -> prepare($query); |
| $query->bindParam(":suburb", $suburb); | $suburb = "%" . $suburb . ";%"; |
| $query->execute(); | $query -> bindParam(":suburb", $suburb); |
| if (!$query) { | $query -> execute(); |
| databaseError($conn->errorInfo()); | if (!$query) { |
| return Array(); | databaseError($conn -> errorInfo()); |
| } | return Array(); |
| return $query->fetchAll(); | } |
| } | return $query -> fetchAll(); |
| } | |
| function getStopsByStopCode($stop_code, $startsWith = "") | |
| { | |
| global $conn; | |
| $query = "Select * from stops where (stop_code = :stop_code OR stop_code LIKE :stop_code2)"; | |
| if ($startsWith != "") $query .= " AND stop_name like :startsWith"; | |
| debug($query, "database"); | |
| $query = $conn -> prepare($query); | |
| $query -> bindParam(":stop_code", $stop_code); | |
| $stop_code2 = $stop_code . "%"; | |
| $query -> bindParam(":stop_code2", $stop_code2); | |
| if ($startsWith != "") { | |
| $startsWith = $startsWith . "%"; | |
| $query -> bindParam(":startsWith", $startsWith); | |
| } | |
| $query -> execute(); | |
| if (!$query) { | |
| databaseError($conn -> errorInfo()); | |
| return Array(); | |
| } | |
| return $query -> fetchAll(); | |
| } | |
| function getStopRoutes($stopID, $service_period) | function getStopRoutes($stopID, $service_period) |
| { | |
| if ($service_period == "") $service_period = service_period(); | { |
| global $conn; | if ($service_period == "") $service_period = service_period(); |
| $query = "SELECT service_id,trips.route_id,route_short_name,route_long_name | global $conn; |
| $query = "SELECT distinct service_id,trips.route_id,route_short_name,route_long_name | |
| FROM stop_times join trips on trips.trip_id = | FROM stop_times join trips on trips.trip_id = |
| stop_times.trip_id join routes on trips.route_id = routes.route_id WHERE stop_id = :stopID AND service_id=:service_period"; | stop_times.trip_id join routes on trips.route_id = routes.route_id WHERE stop_id = :stopID AND service_id=:service_period"; |
| debug($query, "database"); | debug($query, "database"); |
| $query = $conn->prepare($query); | $query = $conn -> prepare($query); |
| $query->bindParam(":service_period", $service_period); | $query -> bindParam(":service_period", $service_period); |
| $query->bindParam(":stopID", $stopID); | $query -> bindParam(":stopID", $stopID); |
| $query->execute(); | $query -> execute(); |
| if (!$query) { | if (!$query) { |
| databaseError($conn->errorInfo()); | databaseError($conn -> errorInfo()); |
| return Array(); | return Array(); |
| } | } |
| return $query->fetchAll(); | return $query -> fetchAll(); |
| } | } |
| function getStopTrips($stopID, $service_period = "", $afterTime = "") | function getStopTrips($stopID, $service_period = "", $afterTime = "", $limit = "") |
| { | |
| if ($service_period == "") $service_period = service_period(); | { |
| global $conn; | if ($service_period == "") $service_period = service_period(); |
| if ($afterTime != "") { | if ($limit != "") $limitSQL = " LIMIT :limit "; |
| $query = " SELECT stop_times.trip_id,stop_times.arrival_time,stop_times.stop_id,stop_sequence,service_id,trips.route_id,route_short_name,route_long_name, end_times.arrival_time as end_time | global $conn; |
| if ($afterTime != "") { | |
| $query = " SELECT stop_times.trip_id,stop_times.arrival_time,stop_times.stop_id,stop_sequence,service_id,trips.route_id,route_short_name,route_long_name, end_times.arrival_time as end_time | |
| FROM stop_times | FROM stop_times |
| join trips on trips.trip_id = | join trips on trips.trip_id = |
| stop_times.trip_id | stop_times.trip_id |
| join routes on trips.route_id = routes.route_id , (SELECT trip_id,max(arrival_time) as arrival_time from stop_times | join routes on trips.route_id = routes.route_id , (SELECT trip_id,max(arrival_time) as arrival_time from stop_times |
| WHERE stop_times.arrival_time IS NOT NULL group by trip_id) as end_times | WHERE stop_times.arrival_time IS NOT NULL group by trip_id) as end_times |
| WHERE stop_times.stop_id = :stopID | WHERE stop_times.stop_id = :stopID |
| AND stop_times.trip_id = end_times.trip_id | AND stop_times.trip_id = end_times.trip_id |
| AND service_id=:service_period | AND service_id=:service_period |
| AND end_times.arrival_time > :afterTime | AND end_times.arrival_time > :afterTime |
| ORDER BY end_time"; | ORDER BY end_time $limitSQL"; |
| } | } |
| else { | else { |
| $query = "SELECT stop_times.trip_id,arrival_time,stop_times.stop_id,stop_sequence,service_id,trips.route_id,route_short_name,route_long_name | $query = "SELECT stop_times.trip_id,arrival_time,stop_times.stop_id,stop_sequence,service_id,trips.route_id,route_short_name,route_long_name |
| FROM stop_times | FROM stop_times |
| join trips on trips.trip_id = | join trips on trips.trip_id = |
| stop_times.trip_id | stop_times.trip_id |
| join routes on trips.route_id = routes.route_id | join routes on trips.route_id = routes.route_id |
| WHERE stop_times.stop_id = :stopID | WHERE stop_times.stop_id = :stopID |
| AND service_id=:service_period | AND service_id=:service_period |
| ORDER BY arrival_time"; | ORDER BY arrival_time $limitSQL"; |
| } | } |
| debug($query, "database"); | debug($query, "database"); |
| $query = $conn->prepare($query); | $query = $conn -> prepare($query); |
| $query->bindParam(":service_period", $service_period); | $query -> bindParam(":service_period", $service_period); |
| $query->bindParam(":stopID", $stopID); | $query -> bindParam(":stopID", $stopID); |
| if ($afterTime != "") $query->bindParam(":afterTime", $afterTime); | if ($limit != "") $query -> bindParam(":limit", $limit); |
| $query->execute(); | if ($afterTime != "") $query -> bindParam(":afterTime", $afterTime); |
| if (!$query) { | $query -> execute(); |
| databaseError($conn->errorInfo()); | if (!$query) { |
| return Array(); | databaseError($conn -> errorInfo()); |
| } | return Array(); |
| return $query->fetchAll(); | } |
| } | return $query -> fetchAll(); |
| } | |
| function getStopTripsWithTimes($stopID, $time = "", $service_period = "", $time_range = "", $limit = "") | function getStopTripsWithTimes($stopID, $time = "", $service_period = "", $time_range = "", $limit = "") |
| { | |
| if ($service_period == "") $service_period = service_period(); | { |
| if ($time_range == "") $time_range = (24 * 60 * 60); | if ($service_period == "") $service_period = service_period(); |
| if ($time == "") $time = current_time(); | if ($time_range == "") $time_range = (24 * 60 * 60); |
| if ($limit == "") $limit = 10; | if ($time == "") $time = current_time(); |
| $trips = getStopTrips($stopID, $service_period, $time); | if ($limit == "") $limit = 10; |
| $timedTrips = Array(); | $trips = getStopTrips($stopID, $service_period, $time); |
| if ($trips && sizeof($trips) > 0) { | $timedTrips = Array(); |
| foreach ($trips as $trip) { | if ($trips && sizeof($trips) > 0) { |
| if ($trip['arrival_time'] != "") { | foreach ($trips as $trip) { |
| if (strtotime($trip['arrival_time']) > strtotime($time) and strtotime($trip['arrival_time']) < (strtotime($time) + $time_range)) { | if ($trip['arrival_time'] != "") { |
| $timedTrips[] = $trip; | if (strtotime($trip['arrival_time']) > strtotime($time) and strtotime($trip['arrival_time']) < (strtotime($time) + $time_range)) { |
| } | $timedTrips[] = $trip; |
| } | } |
| else { | } |
| $timedTrip = getTimeInterpolatedTripAtStop($trip['trip_id'], $trip['stop_sequence']); | else { |
| if ($timedTrip['arrival_time'] > $time and strtotime($timedTrip['arrival_time']) < (strtotime($time) + $time_range)) { | $timedTrip = getTimeInterpolatedTripAtStop($trip['trip_id'], $trip['stop_sequence']); |
| $timedTrips[] = $timedTrip; | if ($timedTrip['arrival_time'] > $time and strtotime($timedTrip['arrival_time']) < (strtotime($time) + $time_range)) { |
| } | $timedTrips[] = $timedTrip; |
| } | } |
| if (sizeof($timedTrips) > $limit) break; | } |
| } | if (sizeof($timedTrips) > $limit) break; |
| sktimesort($timedTrips, "arrival_time", true); | } |
| } | sktimesort($timedTrips, "arrival_time", true); |
| return $timedTrips; | } |
| } | return $timedTrips; |
| } | |
| ?> | ?> |
| <?php | <?php |
| function getTrip($tripID) | function getTrip($tripID) |
| { | |
| global $conn; | { |
| $query = "Select * from trips | global $conn; |
| $query = "Select * from trips | |
| join routes on trips.route_id = routes.route_id | join routes on trips.route_id = routes.route_id |
| where trip_id = :tripID | where trip_id = :tripID |
| LIMIT 1"; | LIMIT 1"; |
| debug($query, "database"); | debug($query, "database"); |
| $query = $conn->prepare($query); | $query = $conn -> prepare($query); |
| $query->bindParam(":tripID", $tripID); | $query -> bindParam(":tripID", $tripID); |
| $query->execute(); | $query -> execute(); |
| if (!$query) { | if (!$query) { |
| databaseError($conn->errorInfo()); | databaseError($conn -> errorInfo()); |
| return Array(); | return Array(); |
| } | } |
| return $query->fetch(PDO::FETCH_ASSOC); | return $query -> fetch(PDO :: FETCH_ASSOC); |
| } | } |
| function getTripShape($tripID) | function getTripShape($tripID) |
| { | |
| global $conn; | { |
| $query = "SELECT ST_AsKML(ST_MakeLine(geometry(a.position))) as the_route | global $conn; |
| $query = "SELECT ST_AsKML(ST_MakeLine(geometry(a.position))) as the_route | |
| FROM (SELECT position, | FROM (SELECT position, |
| stop_sequence, trips.trip_id | stop_sequence, trips.trip_id |
| FROM stop_times | FROM stop_times |
| join trips on trips.trip_id = stop_times.trip_id | join trips on trips.trip_id = stop_times.trip_id |
| join stops on stops.stop_id = stop_times.stop_id | join stops on stops.stop_id = stop_times.stop_id |
| WHERE trips.trip_id = :tripID ORDER BY stop_sequence) as a group by a.trip_id"; | WHERE trips.trip_id = :tripID ORDER BY stop_sequence) as a group by a.trip_id"; |
| debug($query, "database"); | debug($query, "database"); |
| $query = $conn->prepare($query); | $query = $conn -> prepare($query); |
| $query->bindParam(":tripID", $tripID); | $query -> bindParam(":tripID", $tripID); |
| $query->execute(); | $query -> execute(); |
| if (!$query) { | if (!$query) { |
| databaseError($conn->errorInfo()); | databaseError($conn -> errorInfo()); |
| return Array(); | return Array(); |
| } | } |
| return $query->fetchColumn(0); | return $query -> fetchColumn(0); |
| } | } |
| function getTimeInterpolatedTrip($tripID, $range = "") | function getTimeInterpolatedTrip($tripID, $range = "") |
| { | |
| global $conn; | { |
| $query = "SELECT stop_times.trip_id,arrival_time,stop_times.stop_id,stop_lat,stop_lon,stop_name,stop_code, | global $conn; |
| $query = "SELECT stop_times.trip_id,arrival_time,stop_times.stop_id,stop_lat,stop_lon,stop_name,stop_code, | |
| stop_sequence,service_id,trips.route_id,route_short_name,route_long_name | stop_sequence,service_id,trips.route_id,route_short_name,route_long_name |
| FROM stop_times | FROM stop_times |
| join trips on trips.trip_id = stop_times.trip_id | join trips on trips.trip_id = stop_times.trip_id |
| join routes on trips.route_id = routes.route_id | join routes on trips.route_id = routes.route_id |
| join stops on stops.stop_id = stop_times.stop_id | join stops on stops.stop_id = stop_times.stop_id |
| WHERE trips.trip_id = :tripID $range ORDER BY stop_sequence"; | WHERE trips.trip_id = :tripID $range ORDER BY stop_sequence"; |
| debug($query, "database"); | debug($query, "database"); |
| $query = $conn->prepare($query); | $query = $conn -> prepare($query); |
| $query->bindParam(":tripID", $tripID); | $query -> bindParam(":tripID", $tripID); |
| $query->execute(); | $query -> execute(); |
| if (!$query) { | if (!$query) { |
| databaseError($conn->errorInfo()); | databaseError($conn -> errorInfo()); |
| return Array(); | return Array(); |
| } | } |
| $stopTimes = $query->fetchAll(); | $stopTimes = $query -> fetchAll(); |
| $cur_timepoint = Array(); | $cur_timepoint = Array(); |
| $next_timepoint = Array(); | $next_timepoint = Array(); |
| $distance_between_timepoints = 0.0; | $distance_between_timepoints = 0.0; |
| $distance_traveled_between_timepoints = 0.0; | $distance_traveled_between_timepoints = 0.0; |
| $rv = Array(); | $rv = Array(); |
| foreach ($stopTimes as $i => $stopTime) { | foreach ($stopTimes as $i => $stopTime) { |
| if ($stopTime['arrival_time'] != "") { | if ($stopTime['arrival_time'] != "") { |
| // is timepoint | // is timepoint |
| $cur_timepoint = $stopTime; | $cur_timepoint = $stopTime; |
| $distance_between_timepoints = 0.0; | $distance_between_timepoints = 0.0; |
| $distance_traveled_between_timepoints = 0.0; | $distance_traveled_between_timepoints = 0.0; |
| if ($i + 1 < sizeof($stopTimes)) { | if ($i + 1 < sizeof($stopTimes)) { |
| $k = $i + 1; | $k = $i + 1; |
| $distance_between_timepoints+= distance($stopTimes[$k - 1]["stop_lat"], $stopTimes[$k - 1]["stop_lon"], $stopTimes[$k]["stop_lat"], $stopTimes[$k]["stop_lon"]); | $distance_between_timepoints += distance($stopTimes[$k - 1]["stop_lat"], $stopTimes[$k - 1]["stop_lon"], $stopTimes[$k]["stop_lat"], $stopTimes[$k]["stop_lon"]); |
| while ($stopTimes[$k]["arrival_time"] == "" && $k + 1 < sizeof($stopTimes)) { | while ($stopTimes[$k]["arrival_time"] == "" && $k + 1 < sizeof($stopTimes)) { |
| $k+= 1; | $k += 1; |
| //echo "k".$k; | // echo "k".$k; |
| $distance_between_timepoints+= distance($stopTimes[$k - 1]["stop_lat"], $stopTimes[$k - 1]["stop_lon"], $stopTimes[$k]["stop_lat"], $stopTimes[$k]["stop_lon"]); | $distance_between_timepoints += distance($stopTimes[$k - 1]["stop_lat"], $stopTimes[$k - 1]["stop_lon"], $stopTimes[$k]["stop_lat"], $stopTimes[$k]["stop_lon"]); |
| } | } |
| $next_timepoint = $stopTimes[$k]; | $next_timepoint = $stopTimes[$k]; |
| $rv[] = $stopTime; | |
| } | } |
| } | $rv[] = $stopTime; |
| else { | } |
| // is untimed point | else { |
| //echo "i".$i; | // is untimed point |
| $distance_traveled_between_timepoints+= distance($stopTimes[$i - 1]["stop_lat"], $stopTimes[$i - 1]["stop_lon"], $stopTimes[$i]["stop_lat"], $stopTimes[$i]["stop_lon"]); | // echo "i".$i; |
| //echo "$distance_traveled_between_timepoints / $distance_between_timepoints<br>"; | $distance_traveled_between_timepoints += distance($stopTimes[$i - 1]["stop_lat"], $stopTimes[$i - 1]["stop_lon"], $stopTimes[$i]["stop_lat"], $stopTimes[$i]["stop_lon"]); |
| $distance_percent = $distance_traveled_between_timepoints / $distance_between_timepoints; | // echo "$distance_traveled_between_timepoints / $distance_between_timepoints<br>"; |
| if ($next_timepoint["arrival_time"] != "") { | $distance_percent = $distance_traveled_between_timepoints / $distance_between_timepoints; |
| $total_time = strtotime($next_timepoint["arrival_time"]) - strtotime($cur_timepoint["arrival_time"]); | if ($next_timepoint["arrival_time"] != "") { |
| //echo strtotime($next_timepoint["arrival_time"])." - ".strtotime($cur_timepoint["arrival_time"])."<br>"; | $total_time = strtotime($next_timepoint["arrival_time"]) - strtotime($cur_timepoint["arrival_time"]); |
| $time_estimate = ($distance_percent * $total_time) + strtotime($cur_timepoint["arrival_time"]); | // echo strtotime($next_timepoint["arrival_time"])." - ".strtotime($cur_timepoint["arrival_time"])."<br>"; |
| $stopTime["arrival_time"] = date("H:i:s", $time_estimate); | $time_estimate = ($distance_percent * $total_time) + strtotime($cur_timepoint["arrival_time"]); |
| } | $stopTime["arrival_time"] = date("H:i:s", $time_estimate); |
| else { | } |
| $stopTime["arrival_time"] = $cur_timepoint["arrival_time"]; | else { |
| } | $stopTime["arrival_time"] = $cur_timepoint["arrival_time"]; |
| $rv[] = $stopTime; | } |
| //var_dump($rv); | $rv[] = $stopTime; |
| } | |
| } | } |
| return $rv; | } |
| } | // var_dump($rv); |
| return $rv; | |
| } | |
| function getTripPreviousTimePoint($tripID, $stop_sequence) | function getTripPreviousTimePoint($tripID, $stop_sequence) |
| { | |
| global $conn; | { |
| $query = " SELECT trip_id,stop_id, | global $conn; |
| $query = " SELECT trip_id,stop_id, | |
| stop_sequence | stop_sequence |
| FROM stop_times | FROM stop_times |
| WHERE trip_id = :tripID and stop_sequence < :stop_sequence | WHERE trip_id = :tripID and stop_sequence < :stop_sequence |
| and stop_times.arrival_time IS NOT NULL ORDER BY stop_sequence DESC LIMIT 1"; | and stop_times.arrival_time IS NOT NULL ORDER BY stop_sequence DESC LIMIT 1"; |
| debug($query, "database"); | debug($query, "database"); |
| $query = $conn->prepare($query); | $query = $conn -> prepare($query); |
| $query->bindParam(":tripID", $tripID); | $query -> bindParam(":tripID", $tripID); |
| $query->bindParam(":stop_sequence", $stop_sequence); | $query -> bindParam(":stop_sequence", $stop_sequence); |
| $query->execute(); | $query -> execute(); |
| if (!$query) { | if (!$query) { |
| databaseError($conn->errorInfo()); | databaseError($conn -> errorInfo()); |
| return Array(); | return Array(); |
| } | } |
| return $query->fetch(PDO::FETCH_ASSOC); | return $query -> fetch(PDO :: FETCH_ASSOC); |
| } | } |
| function getTripNextTimePoint($tripID, $stop_sequence) | function getTripNextTimePoint($tripID, $stop_sequence) |
| { | |
| global $conn; | { |
| $query = " SELECT trip_id,stop_id, | global $conn; |
| $query = " SELECT trip_id,stop_id, | |
| stop_sequence | stop_sequence |
| FROM stop_times | FROM stop_times |
| WHERE trip_id = :tripID and stop_sequence > :stop_sequence | WHERE trip_id = :tripID and stop_sequence > :stop_sequence |
| and stop_times.arrival_time IS NOT NULL ORDER BY stop_sequence LIMIT 1"; | and stop_times.arrival_time IS NOT NULL ORDER BY stop_sequence LIMIT 1"; |
| debug($query, "database"); | debug($query, "database"); |
| $query = $conn->prepare($query); | $query = $conn -> prepare($query); |
| $query->bindParam(":tripID", $tripID); | $query -> bindParam(":tripID", $tripID); |
| $query->bindParam(":stop_sequence", $stop_sequence); | $query -> bindParam(":stop_sequence", $stop_sequence); |
| $query->execute(); | $query -> execute(); |
| if (!$query) { | if (!$query) { |
| databaseError($conn->errorInfo()); | databaseError($conn -> errorInfo()); |
| return Array(); | return Array(); |
| } | } |
| return $query->fetch(PDO::FETCH_ASSOC); | return $query -> fetch(PDO :: FETCH_ASSOC); |
| } | } |
| function getTimeInterpolatedTripAtStop($tripID, $stop_sequence) | function getTimeInterpolatedTripAtStop($tripID, $stop_sequence) |
| { | |
| global $conn; | { |
| // limit interpolation to between nearest actual points. | global $conn; |
| $prevTimePoint = getTripPreviousTimePoint($tripID, $stop_sequence); | // limit interpolation to between nearest actual points. |
| $nextTimePoint = getTripNextTimePoint($tripID, $stop_sequence); | $prevTimePoint = getTripPreviousTimePoint($tripID, $stop_sequence); |
| $range = "AND stop_sequence >= '{$prevTimePoint['stop_sequence']}' AND stop_sequence <= '{$nextTimePoint['stop_sequence']}'"; | $nextTimePoint = getTripNextTimePoint($tripID, $stop_sequence); |
| foreach (getTimeInterpolatedTrip($tripID, $range) as $tripStop) { | // echo " prev {$lowestDelta['stop_sequence']} next {$nextTimePoint['stop_sequence']} "; |
| if ($tripStop['stop_sequence'] == $stop_sequence) return $tripStop; | $range = ""; |
| } | if ($prevTimePoint != "") $range .= " AND stop_sequence >= '{$prevTimePoint['stop_sequence']}'"; |
| return Array(); | if ($nextTimePoint != "") $range .= " AND stop_sequence <= '{$nextTimePoint['stop_sequence']}'"; |
| } | foreach (getTimeInterpolatedTrip($tripID, $range) as $tripStop) { |
| if ($tripStop['stop_sequence'] == $stop_sequence) return $tripStop; | |
| } | |
| return Array(); | |
| } | |
| function getTripStartTime($tripID) | function getTripStartTime($tripID) |
| { | |
| global $conn; | { |
| $query = "Select * from stop_times | global $conn; |
| $query = "Select * from stop_times | |
| where trip_id = :tripID | where trip_id = :tripID |
| AND arrival_time IS NOT NULL | AND arrival_time IS NOT NULL |
| AND stop_sequence = '1'"; | AND stop_sequence = '1'"; |
| debug($query, "database"); | debug($query, "database"); |
| $query = $conn->prepare($query); | $query = $conn -> prepare($query); |
| $query->bindParam(":tripID", $tripID); | $query -> bindParam(":tripID", $tripID); |
| $query->execute(); | $query -> execute(); |
| if (!$query) { | if (!$query) { |
| databaseError($conn->errorInfo()); | databaseError($conn -> errorInfo()); |
| return Array(); | return Array(); |
| } | } |
| $r = $query->fetch(PDO::FETCH_ASSOC); | $r = $query -> fetch(PDO :: FETCH_ASSOC); |
| return $r['arrival_time']; | return $r['arrival_time']; |
| } | } |
| function getTripEndTime($tripID) | |
| { | |
| global $conn; | |
| $query = "SELECT trip_id,max(arrival_time) as arrival_time from stop_times | |
| WHERE stop_times.arrival_time IS NOT NULL and trip_id = :tripID group by trip_id"; | |
| debug($query, "database"); | |
| $query = $conn -> prepare($query); | |
| $query -> bindParam(":tripID", $tripID); | |
| $query -> execute(); | |
| if (!$query) { | |
| databaseError($conn -> errorInfo()); | |
| return Array(); | |
| } | |
| $r = $query -> fetch(PDO :: FETCH_ASSOC); | |
| return $r['arrival_time']; | |
| } | |
| function getActiveTrips($time) | function getActiveTrips($time) |
| { | |
| global $conn; | { |
| if ($time == "") $time = current_time(); | global $conn; |
| $query = "Select distinct stop_times.trip_id, start_times.arrival_time as start_time, end_times.arrival_time as end_time from stop_times, (SELECT trip_id,arrival_time from stop_times WHERE stop_times.arrival_time IS NOT NULL | if ($time == "") $time = current_time(); |
| $query = "Select distinct stop_times.trip_id, start_times.arrival_time as start_time, end_times.arrival_time as end_time from stop_times, (SELECT trip_id,arrival_time from stop_times WHERE stop_times.arrival_time IS NOT NULL | |
| AND stop_sequence = '1') as start_times, (SELECT trip_id,max(arrival_time) as arrival_time from stop_times WHERE stop_times.arrival_time IS NOT NULL group by trip_id) as end_times | AND stop_sequence = '1') as start_times, (SELECT trip_id,max(arrival_time) as arrival_time from stop_times WHERE stop_times.arrival_time IS NOT NULL group by trip_id) as end_times |
| WHERE start_times.trip_id = end_times.trip_id AND stop_times.trip_id = end_times.trip_id AND :time > start_times.arrival_time AND :time < end_times.arrival_time"; | WHERE start_times.trip_id = end_times.trip_id AND stop_times.trip_id = end_times.trip_id AND :time > start_times.arrival_time AND :time < end_times.arrival_time"; |
| debug($query, "database"); | debug($query, "database"); |
| $query = $conn->prepare($query); | $query = $conn -> prepare($query); |
| $query->bindParam(":time", $time); | $query -> bindParam(":time", $time); |
| $query->execute(); | $query -> execute(); |
| if (!$query) { | if (!$query) { |
| databaseError($conn->errorInfo()); | databaseError($conn -> errorInfo()); |
| return Array(); | return Array(); |
| } | } |
| return $query->fetchAll(); | return $query -> fetchAll(); |
| } | } |
| function viaPoints($tripID, $stop_sequence = "") | function viaPoints($tripID, $stop_sequence = "") |
| { | |
| global $conn; | { |
| $query = "SELECT stops.stop_id, stop_name, arrival_time | global $conn; |
| $query = "SELECT stops.stop_id, stop_name, arrival_time | |
| FROM stop_times join stops on stops.stop_id = stop_times.stop_id | FROM stop_times join stops on stops.stop_id = stop_times.stop_id |
| WHERE stop_times.trip_id = :tripID | WHERE stop_times.trip_id = :tripID |
| " . ($stop_sequence != "" ? " AND stop_sequence > :stop_sequence " : "") . "AND substr(stop_code,1,2) != 'Wj' ORDER BY stop_sequence"; | " . ($stop_sequence != "" ? " AND stop_sequence > :stop_sequence " : "") . "AND substr(stop_code,1,2) != 'Wj' ORDER BY stop_sequence"; |
| debug($query, "database"); | debug($query, "database"); |
| $query = $conn->prepare($query); | $query = $conn -> prepare($query); |
| if ($stop_sequence != "") $query->bindParam(":stop_sequence", $stop_sequence); | if ($stop_sequence != "") $query -> bindParam(":stop_sequence", $stop_sequence); |
| $query->bindParam(":tripID", $tripID); | $query -> bindParam(":tripID", $tripID); |
| $query->execute(); | $query -> execute(); |
| if (!$query) { | if (!$query) { |
| databaseError($conn->errorInfo()); | databaseError($conn -> errorInfo()); |
| return Array(); | return Array(); |
| } | } |
| return $query->fetchAll(); | return $query -> fetchAll(); |
| } | } |
| function viaPointNames($tripid, $stop_sequence = "") | function viaPointNames($tripid, $stop_sequence = "") |
| { | |
| $viaPointNames = Array(); | { |
| foreach (viaPoints($tripid, $stop_sequence) as $point) { | $viaPointNames = Array(); |
| $viaPointNames[] = $point['stop_name']; | foreach (viaPoints($tripid, $stop_sequence) as $point) { |
| } | $viaPointNames[] = $point['stop_name']; |
| if (sizeof($viaPointNames) > 0) { | } |
| return r_implode(", ", $viaPointNames); | if (sizeof($viaPointNames) > 0) { |
| } | return r_implode(", ", $viaPointNames); |
| else { | } |
| return ""; | else { |
| } | return ""; |
| } | } |
| } | |
| ?> | ?> |
| <?php | <?php |
| include ('include/common.inc.php'); | include ('include/common.inc.php'); |
| include_header("bus.lambdacomplex.org", "index", false) | include_header("bus.lambdacomplex.org", "index", false) |
| ?> | ?> |
| <div data-role="page"> | <div data-role="page"> |
| <div data-role="content"> | <div data-role="content"> |
| <div id="jqm-homeheader"> | <div id="jqm-homeheader"> |
| <h1>busness time</h1><br><small>Canberra Bus Timetables and Trip Planner</small> | <h1>busness time</h1><br><small>Canberra Bus Timetables and Trip Planner</small> |
| </div> | </div> |
| <a name="maincontent" id="maincontent"></a> | <a name="maincontent" id="maincontent"></a> |
| <a href="tripPlanner.php" data-role="button" data-icon="navigation">Launch Trip Planner...</a> | <a href="tripPlanner.php" data-role="button" data-icon="navigation">Launch Trip Planner...</a> |
| <ul data-role="listview" data-inset="true" data-theme="c" data-dividertheme="b"> | <ul data-role="listview" data-inset="true" data-theme="c" data-dividertheme="b"> |
| <li data-role="list-divider">Timetables - Stops</li> | <li data-role="list-divider">Timetables - Stops</li> |
| <li><a href="stopList.php">Major (Timing Point) Stops</a></li> | <li><a href="stopList.php">Major (Timing Point) Stops</a></li> |
| <li><a href="stopList.php?allstops=yes">All Stops</a></li> | <li><a href="stopList.php?allstops=yes">All Stops</a></li> |
| <li><a href="stopList.php?bysuburbs=yes">Stops By Suburb</a></li> | <li><a href="stopList.php?bysuburbs=yes">Stops By Suburb</a></li> |
| <li><a class="nearby" href="stopList.php?nearby=yes">Nearby Stops</a></li> | <li><a class="nearby" href="stopList.php?nearby=yes">Nearby Stops</a></li> |
| </ul> | </ul> |
| <ul data-role="listview" data-inset="true" data-theme="c" data-dividertheme="b"> | <ul data-role="listview" data-inset="true" data-theme="c" data-dividertheme="b"> |
| <li data-role="list-divider">Timetables - Routes</li> | <li data-role="list-divider">Timetables - Routes</li> |
| <li><a href="routeList.php">Routes By Final Destination</a></li> | <li><a href="routeList.php">Routes By Final Destination</a></li> |
| <li><a href="routeList.php?bynumber=yes">Routes By Number</a></li> | <li><a href="routeList.php?bynumber=yes">Routes By Number</a></li> |
| <li><a href="routeList.php?bysuburbs=yes">Routes By Suburb</a></li> | <li><a href="routeList.php?bysuburbs=yes">Routes By Suburb</a></li> |
| <li><a class="nearby" href="routeList.php?nearby=yes">Nearby Routes</a></li> | <li><a class="nearby" href="routeList.php?nearby=yes">Nearby Routes</a></li> |
| </ul> | </ul> |
| <?php | <?php |
| echo timePlaceSettings(); | |
| echo ' <a href="labs/index.php" data-role="button" data-icon="beaker">Busness R&D</a>'; | echo ' <a href="labs/index.php" data-role="button" data-icon="beaker">Busness R&D</a>'; |
| include_footer(true) | include_footer(true) |
| ?> | ?> |
| /*! LAB.js (LABjs :: Loading And Blocking JavaScript) | |
| v2.0.1 (c) Kyle Simpson | |
| MIT License | |
| */ | |
| (function(o){var K=o.$LAB,y="UseLocalXHR",z="AlwaysPreserveOrder",u="AllowDuplicates",A="CacheBust",B="BasePath",C=/^[^?#]*\//.exec(location.href)[0],D=/^\w+\:\/\/\/?[^\/]+/.exec(C)[0],i=document.head||document.getElementsByTagName("head"),L=(o.opera&&Object.prototype.toString.call(o.opera)=="[object Opera]")||("MozAppearance"in document.documentElement.style),q=document.createElement("script"),E=typeof q.preload=="boolean",r=E||(q.readyState&&q.readyState=="uninitialized"),F=!r&&q.async===true,M=!r&&!F&&!L;function G(a){return Object.prototype.toString.call(a)=="[object Function]"}function H(a){return Object.prototype.toString.call(a)=="[object Array]"}function N(a,c){var b=/^\w+\:\/\//;if(/^\/\/\/?/.test(a)){a=location.protocol+a}else if(!b.test(a)&&a.charAt(0)!="/"){a=(c||"")+a}return b.test(a)?a:((a.charAt(0)=="/"?D:C)+a)}function s(a,c){for(var b in a){if(a.hasOwnProperty(b)){c[b]=a[b]}}return c}function O(a){var c=false;for(var b=0;b<a.scripts.length;b++){if(a.scripts[b].ready&&a.scripts[b].exec_trigger){c=true;a.scripts[b].exec_trigger();a.scripts[b].exec_trigger=null}}return c}function t(a,c,b,d){a.onload=a.onreadystatechange=function(){if((a.readyState&&a.readyState!="complete"&&a.readyState!="loaded")||c[b])return;a.onload=a.onreadystatechange=null;d()}}function I(a){a.ready=a.finished=true;for(var c=0;c<a.finished_listeners.length;c++){setTimeout(a.finished_listeners[c],0)}a.ready_listeners=[];a.finished_listeners=[]}function P(d,f,e,g,h){setTimeout(function(){var a,c=f.real_src,b;if("item"in i){if(!i[0]){setTimeout(arguments.callee,25);return}i=i[0]}a=document.createElement("script");if(f.type)a.type=f.type;if(f.charset)a.charset=f.charset;if(h){if(r){e.elem=a;if(E){a.preload=true;a.onpreload=g}else{a.onreadystatechange=function(){if(a.readyState=="loaded")g();a.onreadystatechange=null}}a.src=c}else if(h&&c.indexOf(D)==0&&d[y]){b=new XMLHttpRequest();b.onreadystatechange=function(){if(b.readyState==4){b.onreadystatechange=function(){};e.text=b.responseText+"\n//@ sourceURL="+c;g()}};b.open("GET",c);b.send()}else{a.type="text/cache-script";t(a,e,"ready",function(){i.removeChild(a);g()});a.src=c;i.insertBefore(a,i.firstChild)}}else if(F){a.async=false;t(a,e,"finished",g);a.src=c;i.insertBefore(a,i.firstChild)}else{t(a,e,"finished",g);a.src=c;i.insertBefore(a,i.firstChild)}},0)}function J(){var l={},Q=r||M,n=[],p={},m;l[y]=true;l[z]=false;l[u]=false;l[A]=false;l[B]="";function R(a,c,b){var d;function f(){if(d!=null){I(b);d=null}}if(p[c.src].finished)return;if(!a[u])p[c.src].finished=true;d=b.elem||document.createElement("script");if(c.type)d.type=c.type;if(c.charset)d.charset=c.charset;t(d,b,"finished",f);if(b.elem){b.elem=null}else if(b.text){d.onload=d.onreadystatechange=null;d.text=b.text}else{d.src=c.real_src}i.insertBefore(d,i.firstChild);if(b.text){f()}}function S(c,b,d,f){var e,g,h=function(){b.ready_cb(b,function(){R(c,b,e)})},j=function(){b.finished_cb(b,d)};b.src=N(b.src,c[B]);b.real_src=b.src+(c[A]?((/\?.*$/.test(b.src)?"&_":"?_")+~~(Math.random()*1E9)+"="):"");if(!p[b.src])p[b.src]={items:[],finished:false};g=p[b.src].items;if(c[u]||g.length==0){e=g[g.length]={ready:false,finished:false,ready_listeners:[h],finished_listeners:[j]};P(c,b,e,((f)?function(){e.ready=true;for(var a=0;a<e.ready_listeners.length;a++){setTimeout(e.ready_listeners[a],0)}e.ready_listeners=[]}:function(){I(e)}),f)}else{e=g[0];if(e.finished){setTimeout(j,0)}else{e.finished_listeners.push(j)}}}function v(){var e,g=s(l,{}),h=[],j=0,w=false,k;function T(a,c){a.ready=true;a.exec_trigger=c;x()}function U(a,c){a.ready=a.finished=true;a.exec_trigger=null;for(var b=0;b<c.scripts.length;b++){if(!c.scripts[b].finished)return}c.finished=true;x()}function x(){while(j<h.length){if(G(h[j])){try{h[j]()}catch(err){}}else if(!h[j].finished){if(O(h[j]))continue;break}j++}if(j==h.length){w=false;k=false}}function V(){if(!k||!k.scripts){h.push(k={scripts:[],finished:true})}}e={script:function(){for(var f=0;f<arguments.length;f++){(function(a,c){var b;if(!H(a)){c=[a]}for(var d=0;d<c.length;d++){V();a=c[d];if(G(a))a=a();if(!a)continue;if(H(a)){b=[].slice.call(a);b.push(d,1);c.splice.call(c,b);d--;continue}if(typeof a=="string")a={src:a};a=s(a,{ready:false,ready_cb:T,finished:false,finished_cb:U});k.finished=false;k.scripts.push(a);S(g,a,k,(Q&&w));w=true;if(g[z])e.wait()}})(arguments[f],arguments[f])}return e},wait:function(){if(arguments.length>0){for(var a=0;a<arguments.length;a++){h.push(arguments[a])}k=h[h.length-1]}else k=false;x();return e}};return{script:e.script,wait:e.wait,setOptions:function(a){s(a,g);return e}}}m={setGlobalDefaults:function(a){s(a,l);return m},setOptions:function(){return v().setOptions.apply(null,arguments)},script:function(){return v().script.apply(null,arguments)},wait:function(){return v().wait.apply(null,arguments)},queueScript:function(){n[n.length]={type:"script",args:[].slice.call(arguments)};return m},queueWait:function(){n[n.length]={type:"wait",args:[].slice.call(arguments)};return m},runQueue:function(){var a=m,c=n.length,b=c,d;for(;--b>=0;){d=n.shift();a=a[d.type].apply(null,d.args)}return a},noConflict:function(){o.$LAB=K;return m},sandbox:function(){return J()}};return m}o.$LAB=J();(function(a,c,b){if(document.readyState==null&&document[a]){document.readyState="loading";document[a](c,b=function(){document.removeEventListener(c,b,false);document.readyState="complete"},false)}})("addEventListener","DOMContentLoaded")})(this); |
| // Copyright 2006 Google Inc. | |
| // | |
| // Licensed under the Apache License, Version 2.0 (the "License"); | |
| // you may not use this file except in compliance with the License. | |
| // You may obtain a copy of the License at | |
| // | |
| // http://www.apache.org/licenses/LICENSE-2.0 | |
| // | |
| // Unless required by applicable law or agreed to in writing, software | |
| // distributed under the License is distributed on an "AS IS" BASIS, | |
| // WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. | |
| // See the License for the specific language governing permissions and | |
| // limitations under the License. | |
| // Known Issues: | |
| // | |
| // * Patterns only support repeat. | |
| // * Radial gradient are not implemented. The VML version of these look very | |
| // different from the canvas one. | |
| // * Clipping paths are not implemented. | |
| // * Coordsize. The width and height attribute have higher priority than the | |
| // width and height style values which isn't correct. | |
| // * Painting mode isn't implemented. | |
| // * Canvas width/height should is using content-box by default. IE in | |
| // Quirks mode will draw the canvas using border-box. Either change your | |
| // doctype to HTML5 | |
| // (http://www.whatwg.org/specs/web-apps/current-work/#the-doctype) | |
| // or use Box Sizing Behavior from WebFX | |
| // (http://webfx.eae.net/dhtml/boxsizing/boxsizing.html) | |
| // * Non uniform scaling does not correctly scale strokes. | |
| // * Filling very large shapes (above 5000 points) is buggy. | |
| // * Optimize. There is always room for speed improvements. | |
| // Only add this code if we do not already have a canvas implementation | |
| if (!document.createElement('canvas').getContext) { | |
| (function() { | |
| // alias some functions to make (compiled) code shorter | |
| var m = Math; | |
| var mr = m.round; | |
| var ms = m.sin; | |
| var mc = m.cos; | |
| var abs = m.abs; | |
| var sqrt = m.sqrt; | |
| // this is used for sub pixel precision | |
| var Z = 10; | |
| var Z2 = Z / 2; | |
| /** | |
| * This funtion is assigned to the <canvas> elements as element.getContext(). | |
| * @this {HTMLElement} | |
| * @return {CanvasRenderingContext2D_} | |
| */ | |
| function getContext() { | |
| return this.context_ || | |
| (this.context_ = new CanvasRenderingContext2D_(this)); | |
| } | |
| var slice = Array.prototype.slice; | |
| /** | |
| * Binds a function to an object. The returned function will always use the | |
| * passed in {@code obj} as {@code this}. | |
| * | |
| * Example: | |
| * | |
| * g = bind(f, obj, a, b) | |
| * g(c, d) // will do f.call(obj, a, b, c, d) | |
| * | |
| * @param {Function} f The function to bind the object to | |
| * @param {Object} obj The object that should act as this when the function | |
| * is called | |
| * @param {*} var_args Rest arguments that will be used as the initial | |
| * arguments when the function is called | |
| * @return {Function} A new function that has bound this | |
| */ | |
| function bind(f, obj, var_args) { | |
| var a = slice.call(arguments, 2); | |
| return function() { | |
| return f.apply(obj, a.concat(slice.call(arguments))); | |
| }; | |
| } | |
| function encodeHtmlAttribute(s) { | |
| return String(s).replace(/&/g, '&').replace(/"/g, '"'); | |
| } | |
| function addNamespacesAndStylesheet(doc) { | |
| // create xmlns | |
| if (!doc.namespaces['g_vml_']) { | |
| doc.namespaces.add('g_vml_', 'urn:schemas-microsoft-com:vml', | |
| '#default#VML'); | |
| } | |
| if (!doc.namespaces['g_o_']) { | |
| doc.namespaces.add('g_o_', 'urn:schemas-microsoft-com:office:office', | |
| '#default#VML'); | |
| } | |
| // Setup default CSS. Only add one style sheet per document | |
| if (!doc.styleSheets['ex_canvas_']) { | |
| var ss = doc.createStyleSheet(); | |
| ss.owningElement.id = 'ex_canvas_'; | |
| ss.cssText = 'canvas{display:inline-block;overflow:hidden;' + | |
| // default size is 300x150 in Gecko and Opera | |
| 'text-align:left;width:300px;height:150px}'; | |
| } | |
| } | |
| // Add namespaces and stylesheet at startup. | |
| addNamespacesAndStylesheet(document); | |
| var G_vmlCanvasManager_ = { | |
| init: function(opt_doc) { | |
| if (/MSIE/.test(navigator.userAgent) && !window.opera) { | |
| var doc = opt_doc || document; | |
| // Create a dummy element so that IE will allow canvas elements to be | |
| // recognized. | |
| doc.createElement('canvas'); | |
| doc.attachEvent('onreadystatechange', bind(this.init_, this, doc)); | |
| } | |
| }, | |
| init_: function(doc) { | |
| // find all canvas elements | |
| var els = doc.getElementsByTagName('canvas'); | |
| for (var i = 0; i < els.length; i++) { | |
| this.initElement(els[i]); | |
| } | |
| }, | |
| /** | |
| * Public initializes a canvas element so that it can be used as canvas | |
| * element from now on. This is called automatically before the page is | |
| * loaded but if you are creating elements using createElement you need to | |
| * make sure this is called on the element. | |
| * @param {HTMLElement} el The canvas element to initialize. | |
| * @return {HTMLElement} the element that was created. | |
| */ | |
| initElement: function(el) { | |
| if (!el.getContext) { | |
| el.getContext = getContext; | |
| // Add namespaces and stylesheet to document of the element. | |
| addNamespacesAndStylesheet(el.ownerDocument); | |
| // Remove fallback content. There is no way to hide text nodes so we | |
| // just remove all childNodes. We could hide all elements and remove | |
| // text nodes but who really cares about the fallback content. | |
| el.innerHTML = ''; | |
| // do not use inline function because that will leak memory | |
| el.attachEvent('onpropertychange', onPropertyChange); | |
| el.attachEvent('onresize', onResize); | |
| var attrs = el.attributes; | |
| if (attrs.width && attrs.width.specified) { | |
| // TODO: use runtimeStyle and coordsize | |
| // el.getContext().setWidth_(attrs.width.nodeValue); | |
| el.style.width = attrs.width.nodeValue + 'px'; | |
| } else { | |
| el.width = el.clientWidth; | |
| } | |
| if (attrs.height && attrs.height.specified) { | |
| // TODO: use runtimeStyle and coordsize | |
| // el.getContext().setHeight_(attrs.height.nodeValue); | |
| el.style.height = attrs.height.nodeValue + 'px'; | |
| } else { | |
| el.height = el.clientHeight; | |
| } | |
| //el.getContext().setCoordsize_() | |
| } | |
| return el; | |
| } | |
| }; | |
| function onPropertyChange(e) { | |
| var el = e.srcElement; | |
| switch (e.propertyName) { | |
| case 'width': | |
| el.getContext().clearRect(); | |
| el.style.width = el.attributes.width.nodeValue + 'px'; | |
| // In IE8 this does not trigger onresize. | |
| el.firstChild.style.width = el.clientWidth + 'px'; | |
| break; | |
| case 'height': | |
| el.getContext().clearRect(); | |
| el.style.height = el.attributes.height.nodeValue + 'px'; | |
| el.firstChild.style.height = el.clientHeight + 'px'; | |
| break; | |
| } | |
| } | |
| function onResize(e) { | |
| var el = e.srcElement; | |
| if (el.firstChild) { | |
| el.firstChild.style.width = el.clientWidth + 'px'; | |
| el.firstChild.style.height = el.clientHeight + 'px'; | |
| } | |
| } | |
| G_vmlCanvasManager_.init(); | |
| // precompute "00" to "FF" | |
| var decToHex = []; | |
| for (var i = 0; i < 16; i++) { | |
| for (var j = 0; j < 16; j++) { | |
| decToHex[i * 16 + j] = i.toString(16) + j.toString(16); | |
| } | |
| } | |
| function createMatrixIdentity() { | |
| return [ | |
| [1, 0, 0], | |
| [0, 1, 0], | |
| [0, 0, 1] | |
| ]; | |
| } | |
| function matrixMultiply(m1, m2) { | |
| var result = createMatrixIdentity(); | |
| for (var x = 0; x < 3; x++) { | |
| for (var y = 0; y < 3; y++) { | |
| var sum = 0; | |
| for (var z = 0; z < 3; z++) { | |
| sum += m1[x][z] * m2[z][y]; | |
| } | |
| result[x][y] = sum; | |
| } | |
| } | |
| return result; | |
| } | |
| function copyState(o1, o2) { | |
| o2.fillStyle = o1.fillStyle; | |
| o2.lineCap = o1.lineCap; | |
| o2.lineJoin = o1.lineJoin; | |
| o2.lineWidth = o1.lineWidth; | |
| o2.miterLimit = o1.miterLimit; | |
| o2.shadowBlur = o1.shadowBlur; | |
| o2.shadowColor = o1.shadowColor; | |
| o2.shadowOffsetX = o1.shadowOffsetX; | |
| o2.shadowOffsetY = o1.shadowOffsetY; | |
| o2.strokeStyle = o1.strokeStyle; | |
| o2.globalAlpha = o1.globalAlpha; | |
| o2.font = o1.font; | |
| o2.textAlign = o1.textAlign; | |
| o2.textBaseline = o1.textBaseline; | |
| o2.arcScaleX_ = o1.arcScaleX_; | |
| o2.arcScaleY_ = o1.arcScaleY_; | |
| o2.lineScale_ = o1.lineScale_; | |
| } | |
| var colorData = { | |
| aliceblue: '#F0F8FF', | |
| antiquewhite: '#FAEBD7', | |
| aquamarine: '#7FFFD4', | |
| azure: '#F0FFFF', | |
| beige: '#F5F5DC', | |
| bisque: '#FFE4C4', | |
| black: '#000000', | |
| blanchedalmond: '#FFEBCD', | |
| blueviolet: '#8A2BE2', | |
| brown: '#A52A2A', | |
| burlywood: '#DEB887', | |
| cadetblue: '#5F9EA0', | |
| chartreuse: '#7FFF00', | |
| chocolate: '#D2691E', | |
| coral: '#FF7F50', | |
| cornflowerblue: '#6495ED', | |
| cornsilk: '#FFF8DC', | |
| crimson: '#DC143C', | |
| cyan: '#00FFFF', | |
| darkblue: '#00008B', | |
| darkcyan: '#008B8B', | |
| darkgoldenrod: '#B8860B', | |
| darkgray: '#A9A9A9', | |
| darkgreen: '#006400', | |
| darkgrey: '#A9A9A9', | |
| darkkhaki: '#BDB76B', | |
| darkmagenta: '#8B008B', | |
| darkolivegreen: '#556B2F', | |
| darkorange: '#FF8C00', | |
| darkorchid: '#9932CC', | |
| darkred: '#8B0000', | |
| darksalmon: '#E9967A', | |
| darkseagreen: '#8FBC8F', | |
| darkslateblue: '#483D8B', | |
| darkslategray: '#2F4F4F', | |
| darkslategrey: '#2F4F4F', | |
| darkturquoise: '#00CED1', | |
| darkviolet: '#9400D3', | |
| deeppink: '#FF1493', | |
| deepskyblue: '#00BFFF', | |
| dimgray: '#696969', | |
| dimgrey: '#696969', | |
| dodgerblue: '#1E90FF', | |
| firebrick: '#B22222', | |
| floralwhite: '#FFFAF0', | |
| forestgreen: '#228B22', | |
| gainsboro: '#DCDCDC', | |
| ghostwhite: '#F8F8FF', | |
| gold: '#FFD700', | |
| goldenrod: '#DAA520', | |
| grey: '#808080', | |
| greenyellow: '#ADFF2F', | |
| honeydew: '#F0FFF0', | |
| hotpink: '#FF69B4', | |
| indianred: '#CD5C5C', | |
| indigo: '#4B0082', | |
| ivory: '#FFFFF0', | |
| khaki: '#F0E68C', | |
| lavender: '#E6E6FA', | |
| lavenderblush: '#FFF0F5', | |
| lawngreen: '#7CFC00', | |
| lemonchiffon: '#FFFACD', | |
| lightblue: '#ADD8E6', | |
| lightcoral: '#F08080', | |
| lightcyan: '#E0FFFF', | |
| lightgoldenrodyellow: '#FAFAD2', | |
| lightgreen: '#90EE90', | |
| lightgrey: '#D3D3D3', | |
| lightpink: '#FFB6C1', | |
| lightsalmon: '#FFA07A', | |
| lightseagreen: '#20B2AA', | |
| lightskyblue: '#87CEFA', | |
| lightslategray: '#778899', | |
| lightslategrey: '#778899', | |
| lightsteelblue: '#B0C4DE', | |
| lightyellow: '#FFFFE0', | |
| limegreen: '#32CD32', | |
| linen: '#FAF0E6', | |
| magenta: '#FF00FF', | |
| mediumaquamarine: '#66CDAA', | |
| mediumblue: '#0000CD', | |
| mediumorchid: '#BA55D3', | |
| mediumpurple: '#9370DB', | |
| mediumseagreen: '#3CB371', | |
| mediumslateblue: '#7B68EE', | |
| mediumspringgreen: '#00FA9A', | |
| mediumturquoise: '#48D1CC', | |
| mediumvioletred: '#C71585', | |
| midnightblue: '#191970', | |
| mintcream: '#F5FFFA', | |
| mistyrose: '#FFE4E1', | |
| moccasin: '#FFE4B5', | |
| navajowhite: '#FFDEAD', | |
| oldlace: '#FDF5E6', | |
| olivedrab: '#6B8E23', | |
| orange: '#FFA500', | |
| orangered: '#FF4500', | |
| orchid: '#DA70D6', | |
| palegoldenrod: '#EEE8AA', | |
| palegreen: '#98FB98', | |
| paleturquoise: '#AFEEEE', | |
| palevioletred: '#DB7093', | |
| papayawhip: '#FFEFD5', | |
| peachpuff: '#FFDAB9', | |
| peru: '#CD853F', | |
| pink: '#FFC0CB', | |
| plum: '#DDA0DD', | |
| powderblue: '#B0E0E6', | |
| rosybrown: '#BC8F8F', | |
| royalblue: '#4169E1', | |
| saddlebrown: '#8B4513', | |
| salmon: '#FA8072', | |
| sandybrown: '#F4A460', | |
| seagreen: '#2E8B57', | |
| seashell: '#FFF5EE', | |
| sienna: '#A0522D', | |
| skyblue: '#87CEEB', | |
| slateblue: '#6A5ACD', | |
| slategray: '#708090', | |
| slategrey: '#708090', | |
| snow: '#FFFAFA', | |
| springgreen: '#00FF7F', | |
| steelblue: '#4682B4', | |
| tan: '#D2B48C', | |
| thistle: '#D8BFD8', | |
| tomato: '#FF6347', | |
| turquoise: '#40E0D0', | |
| violet: '#EE82EE', | |
| wheat: '#F5DEB3', | |
| whitesmoke: '#F5F5F5', | |
| yellowgreen: '#9ACD32' | |
| }; | |
| function getRgbHslContent(styleString) { | |
| var start = styleString.indexOf('(', 3); | |
| var end = styleString.indexOf(')', start + 1); | |
| var parts = styleString.substring(start + 1, end).split(','); | |
| // add alpha if needed | |
| if (parts.length == 4 && styleString.substr(3, 1) == 'a') { | |
| alpha = Number(parts[3]); | |
| } else { | |
| parts[3] = 1; | |
| } | |
| return parts; | |
| } | |
| function percent(s) { | |
| return parseFloat(s) / 100; | |
| } | |
| function clamp(v, min, max) { | |
| return Math.min(max, Math.max(min, v)); | |
| } | |
| function hslToRgb(parts){ | |
| var r, g, b; | |
| h = parseFloat(parts[0]) / 360 % 360; | |
| if (h < 0) | |
| h++; | |
| s = clamp(percent(parts[1]), 0, 1); | |
| l = clamp(percent(parts[2]), 0, 1); | |
| if (s == 0) { | |
| r = g = b = l; // achromatic | |
| } else { | |
| var q = l < 0.5 ? l * (1 + s) : l + s - l * s; | |
| var p = 2 * l - q; | |
| r = hueToRgb(p, q, h + 1 / 3); | |
| g = hueToRgb(p, q, h); | |
| b = hueToRgb(p, q, h - 1 / 3); | |
| } | |
| return '#' + decToHex[Math.floor(r * 255)] + | |
| decToHex[Math.floor(g * 255)] + | |
| decToHex[Math.floor(b * 255)]; | |
| } | |
| function hueToRgb(m1, m2, h) { | |
| if (h < 0) | |
| h++; | |
| if (h > 1) | |
| h--; | |
| if (6 * h < 1) | |
| return m1 + (m2 - m1) * 6 * h; | |
| else if (2 * h < 1) | |
| return m2; | |
| else if (3 * h < 2) | |
| return m1 + (m2 - m1) * (2 / 3 - h) * 6; | |
| else | |
| return m1; | |
| } | |
| function processStyle(styleString) { | |
| var str, alpha = 1; | |
| styleString = String(styleString); | |
| if (styleString.charAt(0) == '#') { | |
| str = styleString; | |
| } else if (/^rgb/.test(styleString)) { | |
| var parts = getRgbHslContent(styleString); | |
| var str = '#', n; | |
| for (var i = 0; i < 3; i++) { | |
| if (parts[i].indexOf('%') != -1) { | |
| n = Math.floor(percent(parts[i]) * 255); | |
| } else { | |
| n = Number(parts[i]); | |
| } | |
| str += decToHex[clamp(n, 0, 255)]; | |
| } | |
| alpha = parts[3]; | |
| } else if (/^hsl/.test(styleString)) { | |
| var parts = getRgbHslContent(styleString); | |
| str = hslToRgb(parts); | |
| alpha = parts[3]; | |
| } else { | |
| str = colorData[styleString] || styleString; | |
| } | |
| return {color: str, alpha: alpha}; | |
| } | |
| var DEFAULT_STYLE = { | |
| style: 'normal', | |
| variant: 'normal', | |
| weight: 'normal', | |
| size: 10, | |
| family: 'sans-serif' | |
| }; | |
| // Internal text style cache | |
| var fontStyleCache = {}; | |
| function processFontStyle(styleString) { | |
| if (fontStyleCache[styleString]) { | |
| return fontStyleCache[styleString]; | |
| } | |
| var el = document.createElement('div'); | |
| var style = el.style; | |
| try { | |
| style.font = styleString; | |
| } catch (ex) { | |
| // Ignore failures to set to invalid font. | |
| } | |
| return fontStyleCache[styleString] = { | |
| style: style.fontStyle || DEFAULT_STYLE.style, | |
| variant: style.fontVariant || DEFAULT_STYLE.variant, | |
| weight: style.fontWeight || DEFAULT_STYLE.weight, | |
| size: style.fontSize || DEFAULT_STYLE.size, | |
| family: style.fontFamily || DEFAULT_STYLE.family | |
| }; | |
| } | |
| function getComputedStyle(style, element) { | |
| var computedStyle = {}; | |
| for (var p in style) { | |
| computedStyle[p] = style[p]; | |
| } | |
| // Compute the size | |
| var canvasFontSize = parseFloat(element.currentStyle.fontSize), | |
| fontSize = parseFloat(style.size); | |
| if (typeof style.size == 'number') { | |
| computedStyle.size = style.size; | |
| } else if (style.size.indexOf('px') != -1) { | |
| computedStyle.size = fontSize; | |
| } else if (style.size.indexOf('em') != -1) { | |
| computedStyle.size = canvasFontSize * fontSize; | |
| } else if(style.size.indexOf('%') != -1) { | |
| computedStyle.size = (canvasFontSize / 100) * fontSize; | |
| } else if (style.size.indexOf('pt') != -1) { | |
| computedStyle.size = fontSize / .75; | |
| } else { | |
| computedStyle.size = canvasFontSize; | |
| } | |
| // Different scaling between normal text and VML text. This was found using | |
| // trial and error to get the same size as non VML text. | |
| computedStyle.size *= 0.981; | |
| return computedStyle; | |
| } | |
| function buildStyle(style) { | |
| return style.style + ' ' + style.variant + ' ' + style.weight + ' ' + | |
| style.size + 'px ' + style.family; | |
| } | |
| function processLineCap(lineCap) { | |
| switch (lineCap) { | |
| case 'butt': | |
| return 'flat'; | |
| case 'round': | |
| return 'round'; | |
| case 'square': | |
| default: | |
| return 'square'; | |
| } | |
| } | |
| /** | |
| * This class implements CanvasRenderingContext2D interface as described by | |
| * the WHATWG. | |
| * @param {HTMLElement} surfaceElement The element that the 2D context should | |
| * be associated with | |
| */ | |
| function CanvasRenderingContext2D_(surfaceElement) { | |
| this.m_ = createMatrixIdentity(); | |
| this.mStack_ = []; | |
| this.aStack_ = []; | |
| this.currentPath_ = []; | |
| // Canvas context properties | |
| this.strokeStyle = '#000'; | |
| this.fillStyle = '#000'; | |
| this.lineWidth = 1; | |
| this.lineJoin = 'miter'; | |
| this.lineCap = 'butt'; | |
| this.miterLimit = Z * 1; | |
| this.globalAlpha = 1; | |
| this.font = '10px sans-serif'; | |
| this.textAlign = 'left'; | |
| this.textBaseline = 'alphabetic'; | |
| this.canvas = surfaceElement; | |
| var el = surfaceElement.ownerDocument.createElement('div'); | |
| el.style.width = surfaceElement.clientWidth + 'px'; | |
| el.style.height = surfaceElement.clientHeight + 'px'; | |
| el.style.overflow = 'hidden'; | |
| el.style.position = 'absolute'; | |
| surfaceElement.appendChild(el); | |
| this.element_ = el; | |
| this.arcScaleX_ = 1; | |
| this.arcScaleY_ = 1; | |
| this.lineScale_ = 1; | |
| } | |
| var contextPrototype = CanvasRenderingContext2D_.prototype; | |
| contextPrototype.clearRect = function() { | |
| if (this.textMeasureEl_) { | |
| this.textMeasureEl_.removeNode(true); | |
| this.textMeasureEl_ = null; | |
| } | |
| this.element_.innerHTML = ''; | |
| }; | |
| contextPrototype.beginPath = function() { | |
| // TODO: Branch current matrix so that save/restore has no effect | |
| // as per safari docs. | |
| this.currentPath_ = []; | |
| }; | |
| contextPrototype.moveTo = function(aX, aY) { | |
| var p = this.getCoords_(aX, aY); | |
| this.currentPath_.push({type: 'moveTo', x: p.x, y: p.y}); | |
| this.currentX_ = p.x; | |
| this.currentY_ = p.y; | |
| }; | |
| contextPrototype.lineTo = function(aX, aY) { | |
| var p = this.getCoords_(aX, aY); | |
| this.currentPath_.push({type: 'lineTo', x: p.x, y: p.y}); | |
| this.currentX_ = p.x; | |
| this.currentY_ = p.y; | |
| }; | |
| contextPrototype.bezierCurveTo = function(aCP1x, aCP1y, | |
| aCP2x, aCP2y, | |
| aX, aY) { | |
| var p = this.getCoords_(aX, aY); | |
| var cp1 = this.getCoords_(aCP1x, aCP1y); | |
| var cp2 = this.getCoords_(aCP2x, aCP2y); | |
| bezierCurveTo(this, cp1, cp2, p); | |
| }; | |
| // Helper function that takes the already fixed cordinates. | |
| function bezierCurveTo(self, cp1, cp2, p) { | |
| self.currentPath_.push({ | |
| type: 'bezierCurveTo', | |
| cp1x: cp1.x, | |
| cp1y: cp1.y, | |
| cp2x: cp2.x, | |
| cp2y: cp2.y, | |
| x: p.x, | |
| y: p.y | |
| }); | |
| self.currentX_ = p.x; | |
| self.currentY_ = p.y; | |
| } | |
| contextPrototype.quadraticCurveTo = function(aCPx, aCPy, aX, aY) { | |
| // the following is lifted almost directly from | |
| // http://developer.mozilla.org/en/docs/Canvas_tutorial:Drawing_shapes | |
| var cp = this.getCoords_(aCPx, aCPy); | |
| var p = this.getCoords_(aX, aY); | |
| var cp1 = { | |
| x: this.currentX_ + 2.0 / 3.0 * (cp.x - this.currentX_), | |
| y: this.currentY_ + 2.0 / 3.0 * (cp.y - this.currentY_) | |
| }; | |
| var cp2 = { | |
| x: cp1.x + (p.x - this.currentX_) / 3.0, | |
| y: cp1.y + (p.y - this.currentY_) / 3.0 | |
| }; | |
| bezierCurveTo(this, cp1, cp2, p); | |
| }; | |
| contextPrototype.arc = function(aX, aY, aRadius, | |
| aStartAngle, aEndAngle, aClockwise) { | |
| aRadius *= Z; | |
| var arcType = aClockwise ? 'at' : 'wa'; | |
| var xStart = aX + mc(aStartAngle) * aRadius - Z2; | |
| var yStart = aY + ms(aStartAngle) * aRadius - Z2; | |
| var xEnd = aX + mc(aEndAngle) * aRadius - Z2; | |
| var yEnd = aY + ms(aEndAngle) * aRadius - Z2; | |
| // IE won't render arches drawn counter clockwise if xStart == xEnd. | |
| if (xStart == xEnd && !aClockwise) { | |
| xStart += 0.125; // Offset xStart by 1/80 of a pixel. Use something | |
| // that can be represented in binary | |
| } | |
| var p = this.getCoords_(aX, aY); | |
| var pStart = this.getCoords_(xStart, yStart); | |
| var pEnd = this.getCoords_(xEnd, yEnd); | |
| this.currentPath_.push({type: arcType, | |
| x: p.x, | |
| y: p.y, | |
| radius: aRadius, | |
| xStart: pStart.x, | |
| yStart: pStart.y, | |
| xEnd: pEnd.x, | |
| yEnd: pEnd.y}); | |
| }; | |
| contextPrototype.rect = function(aX, aY, aWidth, aHeight) { | |
| this.moveTo(aX, aY); | |
| this.lineTo(aX + aWidth, aY); | |
| this.lineTo(aX + aWidth, aY + aHeight); | |
| this.lineTo(aX, aY + aHeight); | |
| this.closePath(); | |
| }; | |
| contextPrototype.strokeRect = function(aX, aY, aWidth, aHeight) { | |
| var oldPath = this.currentPath_; | |
| this.beginPath(); | |
| this.moveTo(aX, aY); | |
| this.lineTo(aX + aWidth, aY); | |
| this.lineTo(aX + aWidth, aY + aHeight); | |
| this.lineTo(aX, aY + aHeight); | |
| this.closePath(); | |
| this.stroke(); | |
| this.currentPath_ = oldPath; | |
| }; | |
| contextPrototype.fillRect = function(aX, aY, aWidth, aHeight) { | |
| var oldPath = this.currentPath_; | |
| this.beginPath(); | |
| this.moveTo(aX, aY); | |
| this.lineTo(aX + aWidth, aY); | |
| this.lineTo(aX + aWidth, aY + aHeight); | |
| this.lineTo(aX, aY + aHeight); | |
| this.closePath(); | |
| this.fill(); | |
| this.currentPath_ = oldPath; | |
| }; | |
| contextPrototype.createLinearGradient = function(aX0, aY0, aX1, aY1) { | |
| var gradient = new CanvasGradient_('gradient'); | |
| gradient.x0_ = aX0; | |
| gradient.y0_ = aY0; | |
| gradient.x1_ = aX1; | |
| gradient.y1_ = aY1; | |
| return gradient; | |
| }; | |
| contextPrototype.createRadialGradient = function(aX0, aY0, aR0, | |
| aX1, aY1, aR1) { | |
| var gradient = new CanvasGradient_('gradientradial'); | |
| gradient.x0_ = aX0; | |
| gradient.y0_ = aY0; | |
| gradient.r0_ = aR0; | |
| gradient.x1_ = aX1; | |
| gradient.y1_ = aY1; | |
| gradient.r1_ = aR1; | |
| return gradient; | |
| }; | |
| contextPrototype.drawImage = function(image, var_args) { | |
| var dx, dy, dw, dh, sx, sy, sw, sh; | |
| // to find the original width we overide the width and height | |
| var oldRuntimeWidth = image.runtimeStyle.width; | |
| var oldRuntimeHeight = image.runtimeStyle.height; | |
| image.runtimeStyle.width = 'auto'; | |
| image.runtimeStyle.height = 'auto'; | |
| // get the original size | |
| var w = image.width; | |
| var h = image.height; | |
| // and remove overides | |
| image.runtimeStyle.width = oldRuntimeWidth; | |
| image.runtimeStyle.height = oldRuntimeHeight; | |
| if (arguments.length == 3) { | |
| dx = arguments[1]; | |
| dy = arguments[2]; | |
| sx = sy = 0; | |
| sw = dw = w; | |
| sh = dh = h; | |
| } else if (arguments.length == 5) { | |
| dx = arguments[1]; | |
| dy = arguments[2]; | |
| dw = arguments[3]; | |
| dh = arguments[4]; | |
| sx = sy = 0; | |
| sw = w; | |
| sh = h; | |
| } else if (arguments.length == 9) { | |
| sx = arguments[1]; | |
| sy = arguments[2]; | |
| sw = arguments[3]; | |
| sh = arguments[4]; | |
| dx = arguments[5]; | |
| dy = arguments[6]; | |
| dw = arguments[7]; | |
| dh = arguments[8]; | |
| } else { | |
| throw Error('Invalid number of arguments'); | |
| } | |
| var d = this.getCoords_(dx, dy); | |
| var w2 = sw / 2; | |
| var h2 = sh / 2; | |
| var vmlStr = []; | |
| var W = 10; | |
| var H = 10; | |
| // For some reason that I've now forgotten, using divs didn't work | |
| vmlStr.push(' <g_vml_:group', | |
| ' coordsize="', Z * W, ',', Z * H, '"', | |
| ' coordorigin="0,0"' , | |
| ' style="width:', W, 'px;height:', H, 'px;position:absolute;'); | |
| // If filters are necessary (rotation exists), create them | |
| // filters are bog-slow, so only create them if abbsolutely necessary | |
| // The following check doesn't account for skews (which don't exist | |
| // in the canvas spec (yet) anyway. | |
| if (this.m_[0][0] != 1 || this.m_[0][1] || | |
| this.m_[1][1] != 1 || this.m_[1][0]) { | |
| var filter = []; | |
| // Note the 12/21 reversal | |
| filter.push('M11=', this.m_[0][0], ',', | |
| 'M12=', this.m_[1][0], ',', | |
| 'M21=', this.m_[0][1], ',', | |
| 'M22=', this.m_[1][1], ',', | |
| 'Dx=', mr(d.x / Z), ',', | |
| 'Dy=', mr(d.y / Z), ''); | |
| // Bounding box calculation (need to minimize displayed area so that | |
| // filters don't waste time on unused pixels. | |
| var max = d; | |
| var c2 = this.getCoords_(dx + dw, dy); | |
| var c3 = this.getCoords_(dx, dy + dh); | |
| var c4 = this.getCoords_(dx + dw, dy + dh); | |
| max.x = m.max(max.x, c2.x, c3.x, c4.x); | |
| max.y = m.max(max.y, c2.y, c3.y, c4.y); | |
| vmlStr.push('padding:0 ', mr(max.x / Z), 'px ', mr(max.y / Z), | |
| 'px 0;filter:progid:DXImageTransform.Microsoft.Matrix(', | |
| filter.join(''), ", sizingmethod='clip');"); | |
| } else { | |
| vmlStr.push('top:', mr(d.y / Z), 'px;left:', mr(d.x / Z), 'px;'); | |
| } | |
| vmlStr.push(' ">' , | |
| '<g_vml_:image src="', image.src, '"', | |
| ' style="width:', Z * dw, 'px;', | |
| ' height:', Z * dh, 'px"', | |
| ' cropleft="', sx / w, '"', | |
| ' croptop="', sy / h, '"', | |
| ' cropright="', (w - sx - sw) / w, '"', | |
| ' cropbottom="', (h - sy - sh) / h, '"', | |
| ' />', | |
| '</g_vml_:group>'); | |
| this.element_.insertAdjacentHTML('BeforeEnd', vmlStr.join('')); | |
| }; | |
| contextPrototype.stroke = function(aFill) { | |
| var W = 10; | |
| var H = 10; | |
| // Divide the shape into chunks if it's too long because IE has a limit | |
| // somewhere for how long a VML shape can be. This simple division does | |
| // not work with fills, only strokes, unfortunately. | |
| var chunkSize = 5000; | |
| var min = {x: null, y: null}; | |
| var max = {x: null, y: null}; | |
| for (var j = 0; j < this.currentPath_.length; j += chunkSize) { | |
| var lineStr = []; | |
| var lineOpen = false; | |
| lineStr.push('<g_vml_:shape', | |
| ' filled="', !!aFill, '"', | |
| ' style="position:absolute;width:', W, 'px;height:', H, 'px;"', | |
| ' coordorigin="0,0"', | |
| ' coordsize="', Z * W, ',', Z * H, '"', | |
| ' stroked="', !aFill, '"', | |
| ' path="'); | |
| var newSeq = false; | |
| for (var i = j; i < Math.min(j + chunkSize, this.currentPath_.length); i++) { | |
| if (i % chunkSize == 0 && i > 0) { // move into position for next chunk | |
| lineStr.push(' m ', mr(this.currentPath_[i-1].x), ',', mr(this.currentPath_[i-1].y)); | |
| } | |
| var p = this.currentPath_[i]; | |
| var c; | |
| switch (p.type) { | |
| case 'moveTo': | |
| c = p; | |
| lineStr.push(' m ', mr(p.x), ',', mr(p.y)); | |
| break; | |
| case 'lineTo': | |
| lineStr.push(' l ', mr(p.x), ',', mr(p.y)); | |
| break; | |
| case 'close': | |
| lineStr.push(' x '); | |
| p = null; | |
| break; | |
| case 'bezierCurveTo': | |
| lineStr.push(' c ', | |
| mr(p.cp1x), ',', mr(p.cp1y), ',', | |
| mr(p.cp2x), ',', mr(p.cp2y), ',', | |
| mr(p.x), ',', mr(p.y)); | |
| break; | |
| case 'at': | |
| case 'wa': | |
| lineStr.push(' ', p.type, ' ', | |
| mr(p.x - this.arcScaleX_ * p.radius), ',', | |
| mr(p.y - this.arcScaleY_ * p.radius), ' ', | |
| mr(p.x + this.arcScaleX_ * p.radius), ',', | |
| mr(p.y + this.arcScaleY_ * p.radius), ' ', | |
| mr(p.xStart), ',', mr(p.yStart), ' ', | |
| mr(p.xEnd), ',', mr(p.yEnd)); | |
| break; | |
| } | |
| // TODO: Following is broken for curves due to | |
| // move to proper paths. | |
| // Figure out dimensions so we can do gradient fills | |
| // properly | |
| if (p) { | |
| if (min.x == null || p.x < min.x) { | |
| min.x = p.x; | |
| } | |
| if (max.x == null || p.x > max.x) { | |
| max.x = p.x; | |
| } | |
| if (min.y == null || p.y < min.y) { | |
| min.y = p.y; | |
| } | |
| if (max.y == null || p.y > max.y) { | |
| max.y = p.y; | |
| } | |
| } | |
| } | |
| lineStr.push(' ">'); | |
| if (!aFill) { | |
| appendStroke(this, lineStr); | |
| } else { | |
| appendFill(this, lineStr, min, max); | |
| } | |
| lineStr.push('</g_vml_:shape>'); | |
| this.element_.insertAdjacentHTML('beforeEnd', lineStr.join('')); | |
| } | |
| }; | |
| function appendStroke(ctx, lineStr) { | |
| var a = processStyle(ctx.strokeStyle); | |
| var color = a.color; | |
| var opacity = a.alpha * ctx.globalAlpha; | |
| var lineWidth = ctx.lineScale_ * ctx.lineWidth; | |
| // VML cannot correctly render a line if the width is less than 1px. | |
| // In that case, we dilute the color to make the line look thinner. | |
| if (lineWidth < 1) { | |
| opacity *= lineWidth; | |
| } | |
| lineStr.push( | |
| '<g_vml_:stroke', | |
| ' opacity="', opacity, '"', | |
| ' joinstyle="', ctx.lineJoin, '"', | |
| ' miterlimit="', ctx.miterLimit, '"', | |
| ' endcap="', processLineCap(ctx.lineCap), '"', | |
| ' weight="', lineWidth, 'px"', | |
| ' color="', color, '" />' | |
| ); | |
| } | |
| function appendFill(ctx, lineStr, min, max) { | |
| var fillStyle = ctx.fillStyle; | |
| var arcScaleX = ctx.arcScaleX_; | |
| var arcScaleY = ctx.arcScaleY_; | |
| var width = max.x - min.x; | |
| var height = max.y - min.y; | |
| if (fillStyle instanceof CanvasGradient_) { | |
| // TODO: Gradients transformed with the transformation matrix. | |
| var angle = 0; | |
| var focus = {x: 0, y: 0}; | |
| // additional offset | |
| var shift = 0; | |
| // scale factor for offset | |
| var expansion = 1; | |
| if (fillStyle.type_ == 'gradient') { | |
| var x0 = fillStyle.x0_ / arcScaleX; | |
| var y0 = fillStyle.y0_ / arcScaleY; | |
| var x1 = fillStyle.x1_ / arcScaleX; | |
| var y1 = fillStyle.y1_ / arcScaleY; | |
| var p0 = ctx.getCoords_(x0, y0); | |
| var p1 = ctx.getCoords_(x1, y1); | |
| var dx = p1.x - p0.x; | |
| var dy = p1.y - p0.y; | |
| angle = Math.atan2(dx, dy) * 180 / Math.PI; | |
| // The angle should be a non-negative number. | |
| if (angle < 0) { | |
| angle += 360; | |
| } | |
| // Very small angles produce an unexpected result because they are | |
| // converted to a scientific notation string. | |
| if (angle < 1e-6) { | |
| angle = 0; | |
| } | |
| } else { | |
| var p0 = ctx.getCoords_(fillStyle.x0_, fillStyle.y0_); | |
| focus = { | |
| x: (p0.x - min.x) / width, | |
| y: (p0.y - min.y) / height | |
| }; | |
| width /= arcScaleX * Z; | |
| height /= arcScaleY * Z; | |
| var dimension = m.max(width, height); | |
| shift = 2 * fillStyle.r0_ / dimension; | |
| expansion = 2 * fillStyle.r1_ / dimension - shift; | |
| } | |
| // We need to sort the color stops in ascending order by offset, | |
| // otherwise IE won't interpret it correctly. | |
| var stops = fillStyle.colors_; | |
| stops.sort(function(cs1, cs2) { | |
| return cs1.offset - cs2.offset; | |
| }); | |
| var length = stops.length; | |
| var color1 = stops[0].color; | |
| var color2 = stops[length - 1].color; | |
| var opacity1 = stops[0].alpha * ctx.globalAlpha; | |
| var opacity2 = stops[length - 1].alpha * ctx.globalAlpha; | |
| var colors = []; | |
| for (var i = 0; i < length; i++) { | |
| var stop = stops[i]; | |
| colors.push(stop.offset * expansion + shift + ' ' + stop.color); | |
| } | |
| // When colors attribute is used, the meanings of opacity and o:opacity2 | |
| // are reversed. | |
| lineStr.push('<g_vml_:fill type="', fillStyle.type_, '"', | |
| ' method="none" focus="100%"', | |
| ' color="', color1, '"', | |
| ' color2="', color2, '"', | |
| ' colors="', colors.join(','), '"', | |
| ' opacity="', opacity2, '"', | |
| ' g_o_:opacity2="', opacity1, '"', | |
| ' angle="', angle, '"', | |
| ' focusposition="', focus.x, ',', focus.y, '" />'); | |
| } else if (fillStyle instanceof CanvasPattern_) { | |
| if (width && height) { | |
| var deltaLeft = -min.x; | |
| var deltaTop = -min.y; | |
| lineStr.push('<g_vml_:fill', | |
| ' position="', | |
| deltaLeft / width * arcScaleX * arcScaleX, ',', | |
| deltaTop / height * arcScaleY * arcScaleY, '"', | |
| ' type="tile"', | |
| // TODO: Figure out the correct size to fit the scale. | |
| //' size="', w, 'px ', h, 'px"', | |
| ' src="', fillStyle.src_, '" />'); | |
| } | |
| } else { | |
| var a = processStyle(ctx.fillStyle); | |
| var color = a.color; | |
| var opacity = a.alpha * ctx.globalAlpha; | |
| lineStr.push('<g_vml_:fill color="', color, '" opacity="', opacity, | |
| '" />'); | |
| } | |
| } | |
| contextPrototype.fill = function() { | |
| this.stroke(true); | |
| }; | |
| contextPrototype.closePath = function() { | |
| this.currentPath_.push({type: 'close'}); | |
| }; | |
| /** | |
| * @private | |
| */ | |
| contextPrototype.getCoords_ = function(aX, aY) { | |
| var m = this.m_; | |
| return { | |
| x: Z * (aX * m[0][0] + aY * m[1][0] + m[2][0]) - Z2, | |
| y: Z * (aX * m[0][1] + aY * m[1][1] + m[2][1]) - Z2 | |
| }; | |
| }; | |
| contextPrototype.save = function() { | |
| var o = {}; | |
| copyState(this, o); | |
| this.aStack_.push(o); | |
| this.mStack_.push(this.m_); | |
| this.m_ = matrixMultiply(createMatrixIdentity(), this.m_); | |
| }; | |
| contextPrototype.restore = function() { | |
| if (this.aStack_.length) { | |
| copyState(this.aStack_.pop(), this); | |
| this.m_ = this.mStack_.pop(); | |
| } | |
| }; | |
| function matrixIsFinite(m) { | |
| return isFinite(m[0][0]) && isFinite(m[0][1]) && | |
| isFinite(m[1][0]) && isFinite(m[1][1]) && | |
| isFinite(m[2][0]) && isFinite(m[2][1]); | |
| } | |
| function setM(ctx, m, updateLineScale) { | |
| if (!matrixIsFinite(m)) { | |
| return; | |
| } | |
| ctx.m_ = m; | |
| if (updateLineScale) { | |
| // Get the line scale. | |
| // Determinant of this.m_ means how much the area is enlarged by the | |
| // transformation. So its square root can be used as a scale factor | |
| // for width. | |
| var det = m[0][0] * m[1][1] - m[0][1] * m[1][0]; | |
| ctx.lineScale_ = sqrt(abs(det)); | |
| } | |
| } | |
| contextPrototype.translate = function(aX, aY) { | |
| var m1 = [ | |
| [1, 0, 0], | |
| [0, 1, 0], | |
| [aX, aY, 1] | |
| ]; | |
| setM(this, matrixMultiply(m1, this.m_), false); | |
| }; | |
| contextPrototype.rotate = function(aRot) { | |
| var c = mc(aRot); | |
| var s = ms(aRot); | |
| var m1 = [ | |
| [c, s, 0], | |
| [-s, c, 0], | |
| [0, 0, 1] | |
| ]; | |
| setM(this, matrixMultiply(m1, this.m_), false); | |
| }; | |
| contextPrototype.scale = function(aX, aY) { | |
| this.arcScaleX_ *= aX; | |
| this.arcScaleY_ *= aY; | |
| var m1 = [ | |
| [aX, 0, 0], | |
| [0, aY, 0], | |
| [0, 0, 1] | |
| ]; | |
| setM(this, matrixMultiply(m1, this.m_), true); | |
| }; | |
| contextPrototype.transform = function(m11, m12, m21, m22, dx, dy) { | |
| var m1 = [ | |
| [m11, m12, 0], | |
| [m21, m22, 0], | |
| [dx, dy, 1] | |
| ]; | |
| setM(this, matrixMultiply(m1, this.m_), true); | |
| }; | |
| contextPrototype.setTransform = function(m11, m12, m21, m22, dx, dy) { | |
| var m = [ | |
| [m11, m12, 0], | |
| [m21, m22, 0], | |
| [dx, dy, 1] | |
| ]; | |
| setM(this, m, true); | |
| }; | |
| /** | |
| * The text drawing function. | |
| * The maxWidth argument isn't taken in account, since no browser supports | |
| * it yet. | |
| */ | |
| contextPrototype.drawText_ = function(text, x, y, maxWidth, stroke) { | |
| var m = this.m_, | |
| delta = 1000, | |
| left = 0, | |
| right = delta, | |
| offset = {x: 0, y: 0}, | |
| lineStr = []; | |
| var fontStyle = getComputedStyle(processFontStyle(this.font), | |
| this.element_); | |
| var fontStyleString = buildStyle(fontStyle); | |
| var elementStyle = this.element_.currentStyle; | |
| var textAlign = this.textAlign.toLowerCase(); | |
| switch (textAlign) { | |
| case 'left': | |
| case 'center': | |
| case 'right': | |
| break; | |
| case 'end': | |
| textAlign = elementStyle.direction == 'ltr' ? 'right' : 'left'; | |
| break; | |
| case 'start': | |
| textAlign = elementStyle.direction == 'rtl' ? 'right' : 'left'; | |
| break; | |
| default: | |
| textAlign = 'left'; | |
| } | |
| // 1.75 is an arbitrary number, as there is no info about the text baseline | |
| switch (this.textBaseline) { | |
| case 'hanging': | |
| case 'top': | |
| offset.y = fontStyle.size / 1.75; | |
| break; | |
| case 'middle': | |
| break; | |
| default: | |
| case null: | |
| case 'alphabetic': | |
| case 'ideographic': | |
| case 'bottom': | |
| offset.y = -fontStyle.size / 2.25; | |
| break; | |
| } | |
| switch(textAlign) { | |
| case 'right': | |
| left = delta; | |
| right = 0.05; | |
| break; | |
| case 'center': | |
| left = right = delta / 2; | |
| break; | |
| } | |
| var d = this.getCoords_(x + offset.x, y + offset.y); | |
| lineStr.push('<g_vml_:line from="', -left ,' 0" to="', right ,' 0.05" ', | |
| ' coordsize="100 100" coordorigin="0 0"', | |
| ' filled="', !stroke, '" stroked="', !!stroke, | |
| '" style="position:absolute;width:1px;height:1px;">'); | |
| if (stroke) { | |
| appendStroke(this, lineStr); | |
| } else { | |
| // TODO: Fix the min and max params. | |
| appendFill(this, lineStr, {x: -left, y: 0}, | |
| {x: right, y: fontStyle.size}); | |
| } | |
| var skewM = m[0][0].toFixed(3) + ',' + m[1][0].toFixed(3) + ',' + | |
| m[0][1].toFixed(3) + ',' + m[1][1].toFixed(3) + ',0,0'; | |
| var skewOffset = mr(d.x / Z) + ',' + mr(d.y / Z); | |
| lineStr.push('<g_vml_:skew on="t" matrix="', skewM ,'" ', | |
| ' offset="', skewOffset, '" origin="', left ,' 0" />', | |
| '<g_vml_:path textpathok="true" />', | |
| '<g_vml_:textpath on="true" string="', | |
| encodeHtmlAttribute(text), | |
| '" style="v-text-align:', textAlign, | |
| ';font:', encodeHtmlAttribute(fontStyleString), | |
| '" /></g_vml_:line>'); | |
| this.element_.insertAdjacentHTML('beforeEnd', lineStr.join('')); | |
| }; | |
| contextPrototype.fillText = function(text, x, y, maxWidth) { | |
| this.drawText_(text, x, y, maxWidth, false); | |
| }; | |
| contextPrototype.strokeText = function(text, x, y, maxWidth) { | |
| this.drawText_(text, x, y, maxWidth, true); | |
| }; | |
| contextPrototype.measureText = function(text) { | |
| if (!this.textMeasureEl_) { | |
| var s = '<span style="position:absolute;' + | |
| 'top:-20000px;left:0;padding:0;margin:0;border:none;' + | |
| 'white-space:pre;"></span>'; | |
| this.element_.insertAdjacentHTML('beforeEnd', s); | |
| this.textMeasureEl_ = this.element_.lastChild; | |
| } | |
| var doc = this.element_.ownerDocument; | |
| this.textMeasureEl_.innerHTML = ''; | |
| this.textMeasureEl_.style.font = this.font; | |
| // Don't use innerHTML or innerText because they allow markup/whitespace. | |
| this.textMeasureEl_.appendChild(doc.createTextNode(text)); | |
| return {width: this.textMeasureEl_.offsetWidth}; | |
| }; | |
| /******** STUBS ********/ | |
| contextPrototype.clip = function() { | |
| // TODO: Implement | |
| }; | |
| contextPrototype.arcTo = function() { | |
| // TODO: Implement | |
| }; | |
| contextPrototype.createPattern = function(image, repetition) { | |
| return new CanvasPattern_(image, repetition); | |
| }; | |
| // Gradient / Pattern Stubs | |
| function CanvasGradient_(aType) { | |
| this.type_ = aType; | |
| this.x0_ = 0; | |
| this.y0_ = 0; | |
| this.r0_ = 0; | |
| this.x1_ = 0; | |
| this.y1_ = 0; | |
| this.r1_ = 0; | |
| this.colors_ = []; | |
| } | |
| CanvasGradient_.prototype.addColorStop = function(aOffset, aColor) { | |
| aColor = processStyle(aColor); | |
| this.colors_.push({offset: aOffset, | |
| color: aColor.color, | |
| alpha: aColor.alpha}); | |
| }; | |
| function CanvasPattern_(image, repetition) { | |
| assertImageIsValid(image); | |
| switch (repetition) { | |
| case 'repeat': | |
| case null: | |
| case '': | |
| this.repetition_ = 'repeat'; | |
| break | |
| case 'repeat-x': | |
| case 'repeat-y': | |
| case 'no-repeat': | |
| this.repetition_ = repetition; | |
| break; | |
| default: | |
| throwException('SYNTAX_ERR'); | |
| } | |
| this.src_ = image.src; | |
| this.width_ = image.width; | |
| this.height_ = image.height; | |
| } | |
| function throwException(s) { | |
| throw new DOMException_(s); | |
| } | |
| function assertImageIsValid(img) { | |
| if (!img || img.nodeType != 1 || img.tagName != 'IMG') { | |
| throwException('TYPE_MISMATCH_ERR'); | |
| } | |
| if (img.readyState != 'complete') { | |
| throwException('INVALID_STATE_ERR'); | |
| } | |
| } | |
| function DOMException_(s) { | |
| this.code = this[s]; | |
| this.message = s +': DOM Exception ' + this.code; | |
| } | |
| var p = DOMException_.prototype = new Error; | |
| p.INDEX_SIZE_ERR = 1; | |
| p.DOMSTRING_SIZE_ERR = 2; | |
| p.HIERARCHY_REQUEST_ERR = 3; | |
| p.WRONG_DOCUMENT_ERR = 4; | |
| p.INVALID_CHARACTER_ERR = 5; | |
| p.NO_DATA_ALLOWED_ERR = 6; | |
| p.NO_MODIFICATION_ALLOWED_ERR = 7; | |
| p.NOT_FOUND_ERR = 8; | |
| p.NOT_SUPPORTED_ERR = 9; | |
| p.INUSE_ATTRIBUTE_ERR = 10; | |
| p.INVALID_STATE_ERR = 11; | |
| p.SYNTAX_ERR = 12; | |
| p.INVALID_MODIFICATION_ERR = 13; | |
| p.NAMESPACE_ERR = 14; | |
| p.INVALID_ACCESS_ERR = 15; | |
| p.VALIDATION_ERR = 16; | |
| p.TYPE_MISMATCH_ERR = 17; | |
| // set up externs | |
| G_vmlCanvasManager = G_vmlCanvasManager_; | |
| CanvasRenderingContext2D = CanvasRenderingContext2D_; | |
| CanvasGradient = CanvasGradient_; | |
| CanvasPattern = CanvasPattern_; | |
| DOMException = DOMException_; | |
| })(); | |
| } // if | |
| if(!document.createElement("canvas").getContext){(function(){var z=Math;var K=z.round;var J=z.sin;var U=z.cos;var b=z.abs;var k=z.sqrt;var D=10;var F=D/2;function T(){return this.context_||(this.context_=new W(this))}var O=Array.prototype.slice;function G(i,j,m){var Z=O.call(arguments,2);return function(){return i.apply(j,Z.concat(O.call(arguments)))}}function AD(Z){return String(Z).replace(/&/g,"&").replace(/"/g,""")}function r(i){if(!i.namespaces.g_vml_){i.namespaces.add("g_vml_","urn:schemas-microsoft-com:vml","#default#VML")}if(!i.namespaces.g_o_){i.namespaces.add("g_o_","urn:schemas-microsoft-com:office:office","#default#VML")}if(!i.styleSheets.ex_canvas_){var Z=i.createStyleSheet();Z.owningElement.id="ex_canvas_";Z.cssText="canvas{display:inline-block;overflow:hidden;text-align:left;width:300px;height:150px}"}}r(document);var E={init:function(Z){if(/MSIE/.test(navigator.userAgent)&&!window.opera){var i=Z||document;i.createElement("canvas");i.attachEvent("onreadystatechange",G(this.init_,this,i))}},init_:function(m){var j=m.getElementsByTagName("canvas");for(var Z=0;Z<j.length;Z++){this.initElement(j[Z])}},initElement:function(i){if(!i.getContext){i.getContext=T;r(i.ownerDocument);i.innerHTML="";i.attachEvent("onpropertychange",S);i.attachEvent("onresize",w);var Z=i.attributes;if(Z.width&&Z.width.specified){i.style.width=Z.width.nodeValue+"px"}else{i.width=i.clientWidth}if(Z.height&&Z.height.specified){i.style.height=Z.height.nodeValue+"px"}else{i.height=i.clientHeight}}return i}};function S(i){var Z=i.srcElement;switch(i.propertyName){case"width":Z.getContext().clearRect();Z.style.width=Z.attributes.width.nodeValue+"px";Z.firstChild.style.width=Z.clientWidth+"px";break;case"height":Z.getContext().clearRect();Z.style.height=Z.attributes.height.nodeValue+"px";Z.firstChild.style.height=Z.clientHeight+"px";break}}function w(i){var Z=i.srcElement;if(Z.firstChild){Z.firstChild.style.width=Z.clientWidth+"px";Z.firstChild.style.height=Z.clientHeight+"px"}}E.init();var I=[];for(var AC=0;AC<16;AC++){for(var AB=0;AB<16;AB++){I[AC*16+AB]=AC.toString(16)+AB.toString(16)}}function V(){return[[1,0,0],[0,1,0],[0,0,1]]}function d(m,j){var i=V();for(var Z=0;Z<3;Z++){for(var AF=0;AF<3;AF++){var p=0;for(var AE=0;AE<3;AE++){p+=m[Z][AE]*j[AE][AF]}i[Z][AF]=p}}return i}function Q(i,Z){Z.fillStyle=i.fillStyle;Z.lineCap=i.lineCap;Z.lineJoin=i.lineJoin;Z.lineWidth=i.lineWidth;Z.miterLimit=i.miterLimit;Z.shadowBlur=i.shadowBlur;Z.shadowColor=i.shadowColor;Z.shadowOffsetX=i.shadowOffsetX;Z.shadowOffsetY=i.shadowOffsetY;Z.strokeStyle=i.strokeStyle;Z.globalAlpha=i.globalAlpha;Z.font=i.font;Z.textAlign=i.textAlign;Z.textBaseline=i.textBaseline;Z.arcScaleX_=i.arcScaleX_;Z.arcScaleY_=i.arcScaleY_;Z.lineScale_=i.lineScale_}var B={aliceblue:"#F0F8FF",antiquewhite:"#FAEBD7",aquamarine:"#7FFFD4",azure:"#F0FFFF",beige:"#F5F5DC",bisque:"#FFE4C4",black:"#000000",blanchedalmond:"#FFEBCD",blueviolet:"#8A2BE2",brown:"#A52A2A",burlywood:"#DEB887",cadetblue:"#5F9EA0",chartreuse:"#7FFF00",chocolate:"#D2691E",coral:"#FF7F50",cornflowerblue:"#6495ED",cornsilk:"#FFF8DC",crimson:"#DC143C",cyan:"#00FFFF",darkblue:"#00008B",darkcyan:"#008B8B",darkgoldenrod:"#B8860B",darkgray:"#A9A9A9",darkgreen:"#006400",darkgrey:"#A9A9A9",darkkhaki:"#BDB76B",darkmagenta:"#8B008B",darkolivegreen:"#556B2F",darkorange:"#FF8C00",darkorchid:"#9932CC",darkred:"#8B0000",darksalmon:"#E9967A",darkseagreen:"#8FBC8F",darkslateblue:"#483D8B",darkslategray:"#2F4F4F",darkslategrey:"#2F4F4F",darkturquoise:"#00CED1",darkviolet:"#9400D3",deeppink:"#FF1493",deepskyblue:"#00BFFF",dimgray:"#696969",dimgrey:"#696969",dodgerblue:"#1E90FF",firebrick:"#B22222",floralwhite:"#FFFAF0",forestgreen:"#228B22",gainsboro:"#DCDCDC",ghostwhite:"#F8F8FF",gold:"#FFD700",goldenrod:"#DAA520",grey:"#808080",greenyellow:"#ADFF2F",honeydew:"#F0FFF0",hotpink:"#FF69B4",indianred:"#CD5C5C",indigo:"#4B0082",ivory:"#FFFFF0",khaki:"#F0E68C",lavender:"#E6E6FA",lavenderblush:"#FFF0F5",lawngreen:"#7CFC00",lemonchiffon:"#FFFACD",lightblue:"#ADD8E6",lightcoral:"#F08080",lightcyan:"#E0FFFF",lightgoldenrodyellow:"#FAFAD2",lightgreen:"#90EE90",lightgrey:"#D3D3D3",lightpink:"#FFB6C1",lightsalmon:"#FFA07A",lightseagreen:"#20B2AA",lightskyblue:"#87CEFA",lightslategray:"#778899",lightslategrey:"#778899",lightsteelblue:"#B0C4DE",lightyellow:"#FFFFE0",limegreen:"#32CD32",linen:"#FAF0E6",magenta:"#FF00FF",mediumaquamarine:"#66CDAA",mediumblue:"#0000CD",mediumorchid:"#BA55D3",mediumpurple:"#9370DB",mediumseagreen:"#3CB371",mediumslateblue:"#7B68EE",mediumspringgreen:"#00FA9A",mediumturquoise:"#48D1CC",mediumvioletred:"#C71585",midnightblue:"#191970",mintcream:"#F5FFFA",mistyrose:"#FFE4E1",moccasin:"#FFE4B5",navajowhite:"#FFDEAD",oldlace:"#FDF5E6",olivedrab:"#6B8E23",orange:"#FFA500",orangered:"#FF4500",orchid:"#DA70D6",palegoldenrod:"#EEE8AA",palegreen:"#98FB98",paleturquoise:"#AFEEEE",palevioletred:"#DB7093",papayawhip:"#FFEFD5",peachpuff:"#FFDAB9",peru:"#CD853F",pink:"#FFC0CB",plum:"#DDA0DD",powderblue:"#B0E0E6",rosybrown:"#BC8F8F",royalblue:"#4169E1",saddlebrown:"#8B4513",salmon:"#FA8072",sandybrown:"#F4A460",seagreen:"#2E8B57",seashell:"#FFF5EE",sienna:"#A0522D",skyblue:"#87CEEB",slateblue:"#6A5ACD",slategray:"#708090",slategrey:"#708090",snow:"#FFFAFA",springgreen:"#00FF7F",steelblue:"#4682B4",tan:"#D2B48C",thistle:"#D8BFD8",tomato:"#FF6347",turquoise:"#40E0D0",violet:"#EE82EE",wheat:"#F5DEB3",whitesmoke:"#F5F5F5",yellowgreen:"#9ACD32"};function g(i){var m=i.indexOf("(",3);var Z=i.indexOf(")",m+1);var j=i.substring(m+1,Z).split(",");if(j.length==4&&i.substr(3,1)=="a"){alpha=Number(j[3])}else{j[3]=1}return j}function C(Z){return parseFloat(Z)/100}function N(i,j,Z){return Math.min(Z,Math.max(j,i))}function c(AF){var j,i,Z;h=parseFloat(AF[0])/360%360;if(h<0){h++}s=N(C(AF[1]),0,1);l=N(C(AF[2]),0,1);if(s==0){j=i=Z=l}else{var m=l<0.5?l*(1+s):l+s-l*s;var AE=2*l-m;j=A(AE,m,h+1/3);i=A(AE,m,h);Z=A(AE,m,h-1/3)}return"#"+I[Math.floor(j*255)]+I[Math.floor(i*255)]+I[Math.floor(Z*255)]}function A(i,Z,j){if(j<0){j++}if(j>1){j--}if(6*j<1){return i+(Z-i)*6*j}else{if(2*j<1){return Z}else{if(3*j<2){return i+(Z-i)*(2/3-j)*6}else{return i}}}}function Y(Z){var AE,p=1;Z=String(Z);if(Z.charAt(0)=="#"){AE=Z}else{if(/^rgb/.test(Z)){var m=g(Z);var AE="#",AF;for(var j=0;j<3;j++){if(m[j].indexOf("%")!=-1){AF=Math.floor(C(m[j])*255)}else{AF=Number(m[j])}AE+=I[N(AF,0,255)]}p=m[3]}else{if(/^hsl/.test(Z)){var m=g(Z);AE=c(m);p=m[3]}else{AE=B[Z]||Z}}}return{color:AE,alpha:p}}var L={style:"normal",variant:"normal",weight:"normal",size:10,family:"sans-serif"};var f={};function X(Z){if(f[Z]){return f[Z]}var m=document.createElement("div");var j=m.style;try{j.font=Z}catch(i){}return f[Z]={style:j.fontStyle||L.style,variant:j.fontVariant||L.variant,weight:j.fontWeight||L.weight,size:j.fontSize||L.size,family:j.fontFamily||L.family}}function P(j,i){var Z={};for(var AF in j){Z[AF]=j[AF]}var AE=parseFloat(i.currentStyle.fontSize),m=parseFloat(j.size);if(typeof j.size=="number"){Z.size=j.size}else{if(j.size.indexOf("px")!=-1){Z.size=m}else{if(j.size.indexOf("em")!=-1){Z.size=AE*m}else{if(j.size.indexOf("%")!=-1){Z.size=(AE/100)*m}else{if(j.size.indexOf("pt")!=-1){Z.size=m/0.75}else{Z.size=AE}}}}}Z.size*=0.981;return Z}function AA(Z){return Z.style+" "+Z.variant+" "+Z.weight+" "+Z.size+"px "+Z.family}function t(Z){switch(Z){case"butt":return"flat";case"round":return"round";case"square":default:return"square"}}function W(i){this.m_=V();this.mStack_=[];this.aStack_=[];this.currentPath_=[];this.strokeStyle="#000";this.fillStyle="#000";this.lineWidth=1;this.lineJoin="miter";this.lineCap="butt";this.miterLimit=D*1;this.globalAlpha=1;this.font="10px sans-serif";this.textAlign="left";this.textBaseline="alphabetic";this.canvas=i;var Z=i.ownerDocument.createElement("div");Z.style.width=i.clientWidth+"px";Z.style.height=i.clientHeight+"px";Z.style.overflow="hidden";Z.style.position="absolute";i.appendChild(Z);this.element_=Z;this.arcScaleX_=1;this.arcScaleY_=1;this.lineScale_=1}var M=W.prototype;M.clearRect=function(){if(this.textMeasureEl_){this.textMeasureEl_.removeNode(true);this.textMeasureEl_=null}this.element_.innerHTML=""};M.beginPath=function(){this.currentPath_=[]};M.moveTo=function(i,Z){var j=this.getCoords_(i,Z);this.currentPath_.push({type:"moveTo",x:j.x,y:j.y});this.currentX_=j.x;this.currentY_=j.y};M.lineTo=function(i,Z){var j=this.getCoords_(i,Z);this.currentPath_.push({type:"lineTo",x:j.x,y:j.y});this.currentX_=j.x;this.currentY_=j.y};M.bezierCurveTo=function(j,i,AI,AH,AG,AE){var Z=this.getCoords_(AG,AE);var AF=this.getCoords_(j,i);var m=this.getCoords_(AI,AH);e(this,AF,m,Z)};function e(Z,m,j,i){Z.currentPath_.push({type:"bezierCurveTo",cp1x:m.x,cp1y:m.y,cp2x:j.x,cp2y:j.y,x:i.x,y:i.y});Z.currentX_=i.x;Z.currentY_=i.y}M.quadraticCurveTo=function(AG,j,i,Z){var AF=this.getCoords_(AG,j);var AE=this.getCoords_(i,Z);var AH={x:this.currentX_+2/3*(AF.x-this.currentX_),y:this.currentY_+2/3*(AF.y-this.currentY_)};var m={x:AH.x+(AE.x-this.currentX_)/3,y:AH.y+(AE.y-this.currentY_)/3};e(this,AH,m,AE)};M.arc=function(AJ,AH,AI,AE,i,j){AI*=D;var AN=j?"at":"wa";var AK=AJ+U(AE)*AI-F;var AM=AH+J(AE)*AI-F;var Z=AJ+U(i)*AI-F;var AL=AH+J(i)*AI-F;if(AK==Z&&!j){AK+=0.125}var m=this.getCoords_(AJ,AH);var AG=this.getCoords_(AK,AM);var AF=this.getCoords_(Z,AL);this.currentPath_.push({type:AN,x:m.x,y:m.y,radius:AI,xStart:AG.x,yStart:AG.y,xEnd:AF.x,yEnd:AF.y})};M.rect=function(j,i,Z,m){this.moveTo(j,i);this.lineTo(j+Z,i);this.lineTo(j+Z,i+m);this.lineTo(j,i+m);this.closePath()};M.strokeRect=function(j,i,Z,m){var p=this.currentPath_;this.beginPath();this.moveTo(j,i);this.lineTo(j+Z,i);this.lineTo(j+Z,i+m);this.lineTo(j,i+m);this.closePath();this.stroke();this.currentPath_=p};M.fillRect=function(j,i,Z,m){var p=this.currentPath_;this.beginPath();this.moveTo(j,i);this.lineTo(j+Z,i);this.lineTo(j+Z,i+m);this.lineTo(j,i+m);this.closePath();this.fill();this.currentPath_=p};M.createLinearGradient=function(i,m,Z,j){var p=new v("gradient");p.x0_=i;p.y0_=m;p.x1_=Z;p.y1_=j;return p};M.createRadialGradient=function(m,AE,j,i,p,Z){var AF=new v("gradientradial");AF.x0_=m;AF.y0_=AE;AF.r0_=j;AF.x1_=i;AF.y1_=p;AF.r1_=Z;return AF};M.drawImage=function(AO,j){var AH,AF,AJ,AV,AM,AK,AQ,AX;var AI=AO.runtimeStyle.width;var AN=AO.runtimeStyle.height;AO.runtimeStyle.width="auto";AO.runtimeStyle.height="auto";var AG=AO.width;var AT=AO.height;AO.runtimeStyle.width=AI;AO.runtimeStyle.height=AN;if(arguments.length==3){AH=arguments[1];AF=arguments[2];AM=AK=0;AQ=AJ=AG;AX=AV=AT}else{if(arguments.length==5){AH=arguments[1];AF=arguments[2];AJ=arguments[3];AV=arguments[4];AM=AK=0;AQ=AG;AX=AT}else{if(arguments.length==9){AM=arguments[1];AK=arguments[2];AQ=arguments[3];AX=arguments[4];AH=arguments[5];AF=arguments[6];AJ=arguments[7];AV=arguments[8]}else{throw Error("Invalid number of arguments")}}}var AW=this.getCoords_(AH,AF);var m=AQ/2;var i=AX/2;var AU=[];var Z=10;var AE=10;AU.push(" <g_vml_:group",' coordsize="',D*Z,",",D*AE,'"',' coordorigin="0,0"',' style="width:',Z,"px;height:",AE,"px;position:absolute;");if(this.m_[0][0]!=1||this.m_[0][1]||this.m_[1][1]!=1||this.m_[1][0]){var p=[];p.push("M11=",this.m_[0][0],",","M12=",this.m_[1][0],",","M21=",this.m_[0][1],",","M22=",this.m_[1][1],",","Dx=",K(AW.x/D),",","Dy=",K(AW.y/D),"");var AS=AW;var AR=this.getCoords_(AH+AJ,AF);var AP=this.getCoords_(AH,AF+AV);var AL=this.getCoords_(AH+AJ,AF+AV);AS.x=z.max(AS.x,AR.x,AP.x,AL.x);AS.y=z.max(AS.y,AR.y,AP.y,AL.y);AU.push("padding:0 ",K(AS.x/D),"px ",K(AS.y/D),"px 0;filter:progid:DXImageTransform.Microsoft.Matrix(",p.join(""),", sizingmethod='clip');")}else{AU.push("top:",K(AW.y/D),"px;left:",K(AW.x/D),"px;")}AU.push(' ">','<g_vml_:image src="',AO.src,'"',' style="width:',D*AJ,"px;"," height:",D*AV,'px"',' cropleft="',AM/AG,'"',' croptop="',AK/AT,'"',' cropright="',(AG-AM-AQ)/AG,'"',' cropbottom="',(AT-AK-AX)/AT,'"'," />","</g_vml_:group>");this.element_.insertAdjacentHTML("BeforeEnd",AU.join(""))};M.stroke=function(AM){var m=10;var AN=10;var AE=5000;var AG={x:null,y:null};var AL={x:null,y:null};for(var AH=0;AH<this.currentPath_.length;AH+=AE){var AK=[];var AF=false;AK.push("<g_vml_:shape",' filled="',!!AM,'"',' style="position:absolute;width:',m,"px;height:",AN,'px;"',' coordorigin="0,0"',' coordsize="',D*m,",",D*AN,'"',' stroked="',!AM,'"',' path="');var AO=false;for(var AI=AH;AI<Math.min(AH+AE,this.currentPath_.length);AI++){if(AI%AE==0&&AI>0){AK.push(" m ",K(this.currentPath_[AI-1].x),",",K(this.currentPath_[AI-1].y))}var Z=this.currentPath_[AI];var AJ;switch(Z.type){case"moveTo":AJ=Z;AK.push(" m ",K(Z.x),",",K(Z.y));break;case"lineTo":AK.push(" l ",K(Z.x),",",K(Z.y));break;case"close":AK.push(" x ");Z=null;break;case"bezierCurveTo":AK.push(" c ",K(Z.cp1x),",",K(Z.cp1y),",",K(Z.cp2x),",",K(Z.cp2y),",",K(Z.x),",",K(Z.y));break;case"at":case"wa":AK.push(" ",Z.type," ",K(Z.x-this.arcScaleX_*Z.radius),",",K(Z.y-this.arcScaleY_*Z.radius)," ",K(Z.x+this.arcScaleX_*Z.radius),",",K(Z.y+this.arcScaleY_*Z.radius)," ",K(Z.xStart),",",K(Z.yStart)," ",K(Z.xEnd),",",K(Z.yEnd));break}if(Z){if(AG.x==null||Z.x<AG.x){AG.x=Z.x}if(AL.x==null||Z.x>AL.x){AL.x=Z.x}if(AG.y==null||Z.y<AG.y){AG.y=Z.y}if(AL.y==null||Z.y>AL.y){AL.y=Z.y}}}AK.push(' ">');if(!AM){R(this,AK)}else{a(this,AK,AG,AL)}AK.push("</g_vml_:shape>");this.element_.insertAdjacentHTML("beforeEnd",AK.join(""))}};function R(j,AE){var i=Y(j.strokeStyle);var m=i.color;var p=i.alpha*j.globalAlpha;var Z=j.lineScale_*j.lineWidth;if(Z<1){p*=Z}AE.push("<g_vml_:stroke",' opacity="',p,'"',' joinstyle="',j.lineJoin,'"',' miterlimit="',j.miterLimit,'"',' endcap="',t(j.lineCap),'"',' weight="',Z,'px"',' color="',m,'" />')}function a(AO,AG,Ah,AP){var AH=AO.fillStyle;var AY=AO.arcScaleX_;var AX=AO.arcScaleY_;var Z=AP.x-Ah.x;var m=AP.y-Ah.y;if(AH instanceof v){var AL=0;var Ac={x:0,y:0};var AU=0;var AK=1;if(AH.type_=="gradient"){var AJ=AH.x0_/AY;var j=AH.y0_/AX;var AI=AH.x1_/AY;var Aj=AH.y1_/AX;var Ag=AO.getCoords_(AJ,j);var Af=AO.getCoords_(AI,Aj);var AE=Af.x-Ag.x;var p=Af.y-Ag.y;AL=Math.atan2(AE,p)*180/Math.PI;if(AL<0){AL+=360}if(AL<0.000001){AL=0}}else{var Ag=AO.getCoords_(AH.x0_,AH.y0_);Ac={x:(Ag.x-Ah.x)/Z,y:(Ag.y-Ah.y)/m};Z/=AY*D;m/=AX*D;var Aa=z.max(Z,m);AU=2*AH.r0_/Aa;AK=2*AH.r1_/Aa-AU}var AS=AH.colors_;AS.sort(function(Ak,i){return Ak.offset-i.offset});var AN=AS.length;var AR=AS[0].color;var AQ=AS[AN-1].color;var AW=AS[0].alpha*AO.globalAlpha;var AV=AS[AN-1].alpha*AO.globalAlpha;var Ab=[];for(var Ae=0;Ae<AN;Ae++){var AM=AS[Ae];Ab.push(AM.offset*AK+AU+" "+AM.color)}AG.push('<g_vml_:fill type="',AH.type_,'"',' method="none" focus="100%"',' color="',AR,'"',' color2="',AQ,'"',' colors="',Ab.join(","),'"',' opacity="',AV,'"',' g_o_:opacity2="',AW,'"',' angle="',AL,'"',' focusposition="',Ac.x,",",Ac.y,'" />')}else{if(AH instanceof u){if(Z&&m){var AF=-Ah.x;var AZ=-Ah.y;AG.push("<g_vml_:fill",' position="',AF/Z*AY*AY,",",AZ/m*AX*AX,'"',' type="tile"',' src="',AH.src_,'" />')}}else{var Ai=Y(AO.fillStyle);var AT=Ai.color;var Ad=Ai.alpha*AO.globalAlpha;AG.push('<g_vml_:fill color="',AT,'" opacity="',Ad,'" />')}}}M.fill=function(){this.stroke(true)};M.closePath=function(){this.currentPath_.push({type:"close"})};M.getCoords_=function(j,i){var Z=this.m_;return{x:D*(j*Z[0][0]+i*Z[1][0]+Z[2][0])-F,y:D*(j*Z[0][1]+i*Z[1][1]+Z[2][1])-F}};M.save=function(){var Z={};Q(this,Z);this.aStack_.push(Z);this.mStack_.push(this.m_);this.m_=d(V(),this.m_)};M.restore=function(){if(this.aStack_.length){Q(this.aStack_.pop(),this);this.m_=this.mStack_.pop()}};function H(Z){return isFinite(Z[0][0])&&isFinite(Z[0][1])&&isFinite(Z[1][0])&&isFinite(Z[1][1])&&isFinite(Z[2][0])&&isFinite(Z[2][1])}function y(i,Z,j){if(!H(Z)){return }i.m_=Z;if(j){var p=Z[0][0]*Z[1][1]-Z[0][1]*Z[1][0];i.lineScale_=k(b(p))}}M.translate=function(j,i){var Z=[[1,0,0],[0,1,0],[j,i,1]];y(this,d(Z,this.m_),false)};M.rotate=function(i){var m=U(i);var j=J(i);var Z=[[m,j,0],[-j,m,0],[0,0,1]];y(this,d(Z,this.m_),false)};M.scale=function(j,i){this.arcScaleX_*=j;this.arcScaleY_*=i;var Z=[[j,0,0],[0,i,0],[0,0,1]];y(this,d(Z,this.m_),true)};M.transform=function(p,m,AF,AE,i,Z){var j=[[p,m,0],[AF,AE,0],[i,Z,1]];y(this,d(j,this.m_),true)};M.setTransform=function(AE,p,AG,AF,j,i){var Z=[[AE,p,0],[AG,AF,0],[j,i,1]];y(this,Z,true)};M.drawText_=function(AK,AI,AH,AN,AG){var AM=this.m_,AQ=1000,i=0,AP=AQ,AF={x:0,y:0},AE=[];var Z=P(X(this.font),this.element_);var j=AA(Z);var AR=this.element_.currentStyle;var p=this.textAlign.toLowerCase();switch(p){case"left":case"center":case"right":break;case"end":p=AR.direction=="ltr"?"right":"left";break;case"start":p=AR.direction=="rtl"?"right":"left";break;default:p="left"}switch(this.textBaseline){case"hanging":case"top":AF.y=Z.size/1.75;break;case"middle":break;default:case null:case"alphabetic":case"ideographic":case"bottom":AF.y=-Z.size/2.25;break}switch(p){case"right":i=AQ;AP=0.05;break;case"center":i=AP=AQ/2;break}var AO=this.getCoords_(AI+AF.x,AH+AF.y);AE.push('<g_vml_:line from="',-i,' 0" to="',AP,' 0.05" ',' coordsize="100 100" coordorigin="0 0"',' filled="',!AG,'" stroked="',!!AG,'" style="position:absolute;width:1px;height:1px;">');if(AG){R(this,AE)}else{a(this,AE,{x:-i,y:0},{x:AP,y:Z.size})}var AL=AM[0][0].toFixed(3)+","+AM[1][0].toFixed(3)+","+AM[0][1].toFixed(3)+","+AM[1][1].toFixed(3)+",0,0";var AJ=K(AO.x/D)+","+K(AO.y/D);AE.push('<g_vml_:skew on="t" matrix="',AL,'" ',' offset="',AJ,'" origin="',i,' 0" />','<g_vml_:path textpathok="true" />','<g_vml_:textpath on="true" string="',AD(AK),'" style="v-text-align:',p,";font:",AD(j),'" /></g_vml_:line>');this.element_.insertAdjacentHTML("beforeEnd",AE.join(""))};M.fillText=function(j,Z,m,i){this.drawText_(j,Z,m,i,false)};M.strokeText=function(j,Z,m,i){this.drawText_(j,Z,m,i,true)};M.measureText=function(j){if(!this.textMeasureEl_){var Z='<span style="position:absolute;top:-20000px;left:0;padding:0;margin:0;border:none;white-space:pre;"></span>';this.element_.insertAdjacentHTML("beforeEnd",Z);this.textMeasureEl_=this.element_.lastChild}var i=this.element_.ownerDocument;this.textMeasureEl_.innerHTML="";this.textMeasureEl_.style.font=this.font;this.textMeasureEl_.appendChild(i.createTextNode(j));return{width:this.textMeasureEl_.offsetWidth}};M.clip=function(){};M.arcTo=function(){};M.createPattern=function(i,Z){return new u(i,Z)};function v(Z){this.type_=Z;this.x0_=0;this.y0_=0;this.r0_=0;this.x1_=0;this.y1_=0;this.r1_=0;this.colors_=[]}v.prototype.addColorStop=function(i,Z){Z=Y(Z);this.colors_.push({offset:i,color:Z.color,alpha:Z.alpha})};function u(i,Z){q(i);switch(Z){case"repeat":case null:case"":this.repetition_="repeat";break;case"repeat-x":case"repeat-y":case"no-repeat":this.repetition_=Z;break;default:n("SYNTAX_ERR")}this.src_=i.src;this.width_=i.width;this.height_=i.height}function n(Z){throw new o(Z)}function q(Z){if(!Z||Z.nodeType!=1||Z.tagName!="IMG"){n("TYPE_MISMATCH_ERR")}if(Z.readyState!="complete"){n("INVALID_STATE_ERR")}}function o(Z){this.code=this[Z];this.message=Z+": DOM Exception "+this.code}var x=o.prototype=new Error;x.INDEX_SIZE_ERR=1;x.DOMSTRING_SIZE_ERR=2;x.HIERARCHY_REQUEST_ERR=3;x.WRONG_DOCUMENT_ERR=4;x.INVALID_CHARACTER_ERR=5;x.NO_DATA_ALLOWED_ERR=6;x.NO_MODIFICATION_ALLOWED_ERR=7;x.NOT_FOUND_ERR=8;x.NOT_SUPPORTED_ERR=9;x.INUSE_ATTRIBUTE_ERR=10;x.INVALID_STATE_ERR=11;x.SYNTAX_ERR=12;x.INVALID_MODIFICATION_ERR=13;x.NAMESPACE_ERR=14;x.INVALID_ACCESS_ERR=15;x.VALIDATION_ERR=16;x.TYPE_MISMATCH_ERR=17;G_vmlCanvasManager=E;CanvasRenderingContext2D=W;CanvasGradient=v;CanvasPattern=u;DOMException=o})()}; |
| /* Plugin for jQuery for working with colors. | |
| * | |
| * Version 1.1. | |
| * | |
| * Inspiration from jQuery color animation plugin by John Resig. | |
| * | |
| * Released under the MIT license by Ole Laursen, October 2009. | |
| * | |
| * Examples: | |
| * | |
| * $.color.parse("#fff").scale('rgb', 0.25).add('a', -0.5).toString() | |
| * var c = $.color.extract($("#mydiv"), 'background-color'); | |
| * console.log(c.r, c.g, c.b, c.a); | |
| * $.color.make(100, 50, 25, 0.4).toString() // returns "rgba(100,50,25,0.4)" | |
| * | |
| * Note that .scale() and .add() return the same modified object | |
| * instead of making a new one. | |
| * | |
| * V. 1.1: Fix error handling so e.g. parsing an empty string does | |
| * produce a color rather than just crashing. | |
| */ | |
| (function($) { | |
| $.color = {}; | |
| // construct color object with some convenient chainable helpers | |
| $.color.make = function (r, g, b, a) { | |
| var o = {}; | |
| o.r = r || 0; | |
| o.g = g || 0; | |
| o.b = b || 0; | |
| o.a = a != null ? a : 1; | |
| o.add = function (c, d) { | |
| for (var i = 0; i < c.length; ++i) | |
| o[c.charAt(i)] += d; | |
| return o.normalize(); | |
| }; | |
| o.scale = function (c, f) { | |
| for (var i = 0; i < c.length; ++i) | |
| o[c.charAt(i)] *= f; | |
| return o.normalize(); | |
| }; | |
| o.toString = function () { | |
| if (o.a >= 1.0) { | |
| return "rgb("+[o.r, o.g, o.b].join(",")+")"; | |
| } else { | |
| return "rgba("+[o.r, o.g, o.b, o.a].join(",")+")"; | |
| } | |
| }; | |
| o.normalize = function () { | |
| function clamp(min, value, max) { | |
| return value < min ? min: (value > max ? max: value); | |
| } | |
| o.r = clamp(0, parseInt(o.r), 255); | |
| o.g = clamp(0, parseInt(o.g), 255); | |
| o.b = clamp(0, parseInt(o.b), 255); | |
| o.a = clamp(0, o.a, 1); | |
| return o; | |
| }; | |
| o.clone = function () { | |
| return $.color.make(o.r, o.b, o.g, o.a); | |
| }; | |
| return o.normalize(); | |
| } | |
| // extract CSS color property from element, going up in the DOM | |
| // if it's "transparent" | |
| $.color.extract = function (elem, css) { | |
| var c; | |
| do { | |
| c = elem.css(css).toLowerCase(); | |
| // keep going until we find an element that has color, or | |
| // we hit the body | |
| if (c != '' && c != 'transparent') | |
| break; | |
| elem = elem.parent(); | |
| } while (!$.nodeName(elem.get(0), "body")); | |
| // catch Safari's way of signalling transparent | |
| if (c == "rgba(0, 0, 0, 0)") | |
| c = "transparent"; | |
| return $.color.parse(c); | |
| } | |
| // parse CSS color string (like "rgb(10, 32, 43)" or "#fff"), | |
| // returns color object, if parsing failed, you get black (0, 0, | |
| // 0) out | |
| $.color.parse = function (str) { | |
| var res, m = $.color.make; | |
| // Look for rgb(num,num,num) | |
| if (res = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(str)) | |
| return m(parseInt(res[1], 10), parseInt(res[2], 10), parseInt(res[3], 10)); | |
| // Look for rgba(num,num,num,num) | |
| if (res = /rgba\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(str)) | |
| return m(parseInt(res[1], 10), parseInt(res[2], 10), parseInt(res[3], 10), parseFloat(res[4])); | |
| // Look for rgb(num%,num%,num%) | |
| if (res = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(str)) | |
| return m(parseFloat(res[1])*2.55, parseFloat(res[2])*2.55, parseFloat(res[3])*2.55); | |
| // Look for rgba(num%,num%,num%,num) | |
| if (res = /rgba\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(str)) | |
| return m(parseFloat(res[1])*2.55, parseFloat(res[2])*2.55, parseFloat(res[3])*2.55, parseFloat(res[4])); | |
| // Look for #a0b1c2 | |
| if (res = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(str)) | |
| return m(parseInt(res[1], 16), parseInt(res[2], 16), parseInt(res[3], 16)); | |
| // Look for #fff | |
| if (res = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(str)) | |
| return m(parseInt(res[1]+res[1], 16), parseInt(res[2]+res[2], 16), parseInt(res[3]+res[3], 16)); | |
| // Otherwise, we're most likely dealing with a named color | |
| var name = $.trim(str).toLowerCase(); | |
| if (name == "transparent") | |
| return m(255, 255, 255, 0); | |
| else { | |
| // default to black | |
| res = lookupColors[name] || [0, 0, 0]; | |
| return m(res[0], res[1], res[2]); | |
| } | |
| } | |
| var lookupColors = { | |
| aqua:[0,255,255], | |
| azure:[240,255,255], | |
| beige:[245,245,220], | |
| black:[0,0,0], | |
| blue:[0,0,255], | |
| brown:[165,42,42], | |
| cyan:[0,255,255], | |
| darkblue:[0,0,139], | |
| darkcyan:[0,139,139], | |
| darkgrey:[169,169,169], | |
| darkgreen:[0,100,0], | |
| darkkhaki:[189,183,107], | |
| darkmagenta:[139,0,139], | |
| darkolivegreen:[85,107,47], | |
| darkorange:[255,140,0], | |
| darkorchid:[153,50,204], | |
| darkred:[139,0,0], | |
| darksalmon:[233,150,122], | |
| darkviolet:[148,0,211], | |
| fuchsia:[255,0,255], | |
| gold:[255,215,0], | |
| green:[0,128,0], | |
| indigo:[75,0,130], | |
| khaki:[240,230,140], | |
| lightblue:[173,216,230], | |
| lightcyan:[224,255,255], | |
| lightgreen:[144,238,144], | |
| lightgrey:[211,211,211], | |
| lightpink:[255,182,193], | |
| lightyellow:[255,255,224], | |
| lime:[0,255,0], | |
| magenta:[255,0,255], | |
| maroon:[128,0,0], | |
| navy:[0,0,128], | |
| olive:[128,128,0], | |
| orange:[255,165,0], | |
| pink:[255,192,203], | |
| purple:[128,0,128], | |
| violet:[128,0,128], | |
| red:[255,0,0], | |
| silver:[192,192,192], | |
| white:[255,255,255], | |
| yellow:[255,255,0] | |
| }; | |
| })(jQuery); | |
| (function(b){b.color={};b.color.make=function(f,e,c,d){var h={};h.r=f||0;h.g=e||0;h.b=c||0;h.a=d!=null?d:1;h.add=function(k,j){for(var g=0;g<k.length;++g){h[k.charAt(g)]+=j}return h.normalize()};h.scale=function(k,j){for(var g=0;g<k.length;++g){h[k.charAt(g)]*=j}return h.normalize()};h.toString=function(){if(h.a>=1){return"rgb("+[h.r,h.g,h.b].join(",")+")"}else{return"rgba("+[h.r,h.g,h.b,h.a].join(",")+")"}};h.normalize=function(){function g(j,k,i){return k<j?j:(k>i?i:k)}h.r=g(0,parseInt(h.r),255);h.g=g(0,parseInt(h.g),255);h.b=g(0,parseInt(h.b),255);h.a=g(0,h.a,1);return h};h.clone=function(){return b.color.make(h.r,h.b,h.g,h.a)};return h.normalize()};b.color.extract=function(e,d){var f;do{f=e.css(d).toLowerCase();if(f!=""&&f!="transparent"){break}e=e.parent()}while(!b.nodeName(e.get(0),"body"));if(f=="rgba(0, 0, 0, 0)"){f="transparent"}return b.color.parse(f)};b.color.parse=function(f){var e,c=b.color.make;if(e=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(f)){return c(parseInt(e[1],10),parseInt(e[2],10),parseInt(e[3],10))}if(e=/rgba\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(f)){return c(parseInt(e[1],10),parseInt(e[2],10),parseInt(e[3],10),parseFloat(e[4]))}if(e=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(f)){return c(parseFloat(e[1])*2.55,parseFloat(e[2])*2.55,parseFloat(e[3])*2.55)}if(e=/rgba\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(f)){return c(parseFloat(e[1])*2.55,parseFloat(e[2])*2.55,parseFloat(e[3])*2.55,parseFloat(e[4]))}if(e=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(f)){return c(parseInt(e[1],16),parseInt(e[2],16),parseInt(e[3],16))}if(e=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(f)){return c(parseInt(e[1]+e[1],16),parseInt(e[2]+e[2],16),parseInt(e[3]+e[3],16))}var d=b.trim(f).toLowerCase();if(d=="transparent"){return c(255,255,255,0)}else{e=a[d]||[0,0,0];return c(e[0],e[1],e[2])}};var a={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0]}})(jQuery); |
| /* | |
| Flot plugin for showing crosshairs, thin lines, when the mouse hovers | |
| over the plot. | |
| crosshair: { | |
| mode: null or "x" or "y" or "xy" | |
| color: color | |
| lineWidth: number | |
| } | |
| Set the mode to one of "x", "y" or "xy". The "x" mode enables a | |
| vertical crosshair that lets you trace the values on the x axis, "y" | |
| enables a horizontal crosshair and "xy" enables them both. "color" is | |
| the color of the crosshair (default is "rgba(170, 0, 0, 0.80)"), | |
| "lineWidth" is the width of the drawn lines (default is 1). | |
| The plugin also adds four public methods: | |
| - setCrosshair(pos) | |
| Set the position of the crosshair. Note that this is cleared if | |
| the user moves the mouse. "pos" is in coordinates of the plot and | |
| should be on the form { x: xpos, y: ypos } (you can use x2/x3/... | |
| if you're using multiple axes), which is coincidentally the same | |
| format as what you get from a "plothover" event. If "pos" is null, | |
| the crosshair is cleared. | |
| - clearCrosshair() | |
| Clear the crosshair. | |
| - lockCrosshair(pos) | |
| Cause the crosshair to lock to the current location, no longer | |
| updating if the user moves the mouse. Optionally supply a position | |
| (passed on to setCrosshair()) to move it to. | |
| Example usage: | |
| var myFlot = $.plot( $("#graph"), ..., { crosshair: { mode: "x" } } }; | |
| $("#graph").bind("plothover", function (evt, position, item) { | |
| if (item) { | |
| // Lock the crosshair to the data point being hovered | |
| myFlot.lockCrosshair({ x: item.datapoint[0], y: item.datapoint[1] }); | |
| } | |
| else { | |
| // Return normal crosshair operation | |
| myFlot.unlockCrosshair(); | |
| } | |
| }); | |
| - unlockCrosshair() | |
| Free the crosshair to move again after locking it. | |
| */ | |
| (function ($) { | |
| var options = { | |
| crosshair: { | |
| mode: null, // one of null, "x", "y" or "xy", | |
| color: "rgba(170, 0, 0, 0.80)", | |
| lineWidth: 1 | |
| } | |
| }; | |
| function init(plot) { | |
| // position of crosshair in pixels | |
| var crosshair = { x: -1, y: -1, locked: false }; | |
| plot.setCrosshair = function setCrosshair(pos) { | |
| if (!pos) | |
| crosshair.x = -1; | |
| else { | |
| var o = plot.p2c(pos); | |
| crosshair.x = Math.max(0, Math.min(o.left, plot.width())); | |
| crosshair.y = Math.max(0, Math.min(o.top, plot.height())); | |
| } | |
| plot.triggerRedrawOverlay(); | |
| }; | |
| plot.clearCrosshair = plot.setCrosshair; // passes null for pos | |
| plot.lockCrosshair = function lockCrosshair(pos) { | |
| if (pos) | |
| plot.setCrosshair(pos); | |
| crosshair.locked = true; | |
| } | |
| plot.unlockCrosshair = function unlockCrosshair() { | |
| crosshair.locked = false; | |
| } | |
| function onMouseOut(e) { | |
| if (crosshair.locked) | |
| return; | |
| if (crosshair.x != -1) { | |
| crosshair.x = -1; | |
| plot.triggerRedrawOverlay(); | |
| } | |
| } | |
| function onMouseMove(e) { | |
| if (crosshair.locked) | |
| return; | |
| if (plot.getSelection && plot.getSelection()) { | |
| crosshair.x = -1; // hide the crosshair while selecting | |
| return; | |
| } | |
| var offset = plot.offset(); | |
| crosshair.x = Math.max(0, Math.min(e.pageX - offset.left, plot.width())); | |
| crosshair.y = Math.max(0, Math.min(e.pageY - offset.top, plot.height())); | |
| plot.triggerRedrawOverlay(); | |
| } | |
| plot.hooks.bindEvents.push(function (plot, eventHolder) { | |
| if (!plot.getOptions().crosshair.mode) | |
| return; | |
| eventHolder.mouseout(onMouseOut); | |
| eventHolder.mousemove(onMouseMove); | |
| }); | |
| plot.hooks.drawOverlay.push(function (plot, ctx) { | |
| var c = plot.getOptions().crosshair; | |
| if (!c.mode) | |
| return; | |
| var plotOffset = plot.getPlotOffset(); | |
| ctx.save(); | |
| ctx.translate(plotOffset.left, plotOffset.top); | |
| if (crosshair.x != -1) { | |
| ctx.strokeStyle = c.color; | |
| ctx.lineWidth = c.lineWidth; | |
| ctx.lineJoin = "round"; | |
| ctx.beginPath(); | |
| if (c.mode.indexOf("x") != -1) { | |
| ctx.moveTo(crosshair.x, 0); | |
| ctx.lineTo(crosshair.x, plot.height()); | |
| } | |
| if (c.mode.indexOf("y") != -1) { | |
| ctx.moveTo(0, crosshair.y); | |
| ctx.lineTo(plot.width(), crosshair.y); | |
| } | |
| ctx.stroke(); | |
| } | |
| ctx.restore(); | |
| }); | |
| plot.hooks.shutdown.push(function (plot, eventHolder) { | |
| eventHolder.unbind("mouseout", onMouseOut); | |
| eventHolder.unbind("mousemove", onMouseMove); | |
| }); | |
| } | |
| $.plot.plugins.push({ | |
| init: init, | |
| options: options, | |
| name: 'crosshair', | |
| version: '1.0' | |
| }); | |
| })(jQuery); | |
| (function(b){var a={crosshair:{mode:null,color:"rgba(170, 0, 0, 0.80)",lineWidth:1}};function c(h){var j={x:-1,y:-1,locked:false};h.setCrosshair=function e(l){if(!l){j.x=-1}else{var k=h.p2c(l);j.x=Math.max(0,Math.min(k.left,h.width()));j.y=Math.max(0,Math.min(k.top,h.height()))}h.triggerRedrawOverlay()};h.clearCrosshair=h.setCrosshair;h.lockCrosshair=function f(k){if(k){h.setCrosshair(k)}j.locked=true};h.unlockCrosshair=function g(){j.locked=false};function d(k){if(j.locked){return}if(j.x!=-1){j.x=-1;h.triggerRedrawOverlay()}}function i(k){if(j.locked){return}if(h.getSelection&&h.getSelection()){j.x=-1;return}var l=h.offset();j.x=Math.max(0,Math.min(k.pageX-l.left,h.width()));j.y=Math.max(0,Math.min(k.pageY-l.top,h.height()));h.triggerRedrawOverlay()}h.hooks.bindEvents.push(function(l,k){if(!l.getOptions().crosshair.mode){return}k.mouseout(d);k.mousemove(i)});h.hooks.drawOverlay.push(function(m,k){var n=m.getOptions().crosshair;if(!n.mode){return}var l=m.getPlotOffset();k.save();k.translate(l.left,l.top);if(j.x!=-1){k.strokeStyle=n.color;k.lineWidth=n.lineWidth;k.lineJoin="round";k.beginPath();if(n.mode.indexOf("x")!=-1){k.moveTo(j.x,0);k.lineTo(j.x,m.height())}if(n.mode.indexOf("y")!=-1){k.moveTo(0,j.y);k.lineTo(m.width(),j.y)}k.stroke()}k.restore()});h.hooks.shutdown.push(function(l,k){k.unbind("mouseout",d);k.unbind("mousemove",i)})}b.plot.plugins.push({init:c,options:a,name:"crosshair",version:"1.0"})})(jQuery); |
| /* | |
| Flot plugin for computing bottoms for filled line and bar charts. | |
| The case: you've got two series that you want to fill the area | |
| between. In Flot terms, you need to use one as the fill bottom of the | |
| other. You can specify the bottom of each data point as the third | |
| coordinate manually, or you can use this plugin to compute it for you. | |
| In order to name the other series, you need to give it an id, like this | |
| var dataset = [ | |
| { data: [ ... ], id: "foo" } , // use default bottom | |
| { data: [ ... ], fillBetween: "foo" }, // use first dataset as bottom | |
| ]; | |
| $.plot($("#placeholder"), dataset, { line: { show: true, fill: true }}); | |
| As a convenience, if the id given is a number that doesn't appear as | |
| an id in the series, it is interpreted as the index in the array | |
| instead (so fillBetween: 0 can also mean the first series). | |
| Internally, the plugin modifies the datapoints in each series. For | |
| line series, extra data points might be inserted through | |
| interpolation. Note that at points where the bottom line is not | |
| defined (due to a null point or start/end of line), the current line | |
| will show a gap too. The algorithm comes from the jquery.flot.stack.js | |
| plugin, possibly some code could be shared. | |
| */ | |
| (function ($) { | |
| var options = { | |
| series: { fillBetween: null } // or number | |
| }; | |
| function init(plot) { | |
| function findBottomSeries(s, allseries) { | |
| var i; | |
| for (i = 0; i < allseries.length; ++i) { | |
| if (allseries[i].id == s.fillBetween) | |
| return allseries[i]; | |
| } | |
| if (typeof s.fillBetween == "number") { | |
| i = s.fillBetween; | |
| if (i < 0 || i >= allseries.length) | |
| return null; | |
| return allseries[i]; | |
| } | |
| return null; | |
| } | |
| function computeFillBottoms(plot, s, datapoints) { | |
| if (s.fillBetween == null) | |
| return; | |
| var other = findBottomSeries(s, plot.getData()); | |
| if (!other) | |
| return; | |
| var ps = datapoints.pointsize, | |
| points = datapoints.points, | |
| otherps = other.datapoints.pointsize, | |
| otherpoints = other.datapoints.points, | |
| newpoints = [], | |
| px, py, intery, qx, qy, bottom, | |
| withlines = s.lines.show, | |
| withbottom = ps > 2 && datapoints.format[2].y, | |
| withsteps = withlines && s.lines.steps, | |
| fromgap = true, | |
| i = 0, j = 0, l; | |
| while (true) { | |
| if (i >= points.length) | |
| break; | |
| l = newpoints.length; | |
| if (points[i] == null) { | |
| // copy gaps | |
| for (m = 0; m < ps; ++m) | |
| newpoints.push(points[i + m]); | |
| i += ps; | |
| } | |
| else if (j >= otherpoints.length) { | |
| // for lines, we can't use the rest of the points | |
| if (!withlines) { | |
| for (m = 0; m < ps; ++m) | |
| newpoints.push(points[i + m]); | |
| } | |
| i += ps; | |
| } | |
| else if (otherpoints[j] == null) { | |
| // oops, got a gap | |
| for (m = 0; m < ps; ++m) | |
| newpoints.push(null); | |
| fromgap = true; | |
| j += otherps; | |
| } | |
| else { | |
| // cases where we actually got two points | |
| px = points[i]; | |
| py = points[i + 1]; | |
| qx = otherpoints[j]; | |
| qy = otherpoints[j + 1]; | |
| bottom = 0; | |
| if (px == qx) { | |
| for (m = 0; m < ps; ++m) | |
| newpoints.push(points[i + m]); | |
| //newpoints[l + 1] += qy; | |
| bottom = qy; | |
| i += ps; | |
| j += otherps; | |
| } | |
| else if (px > qx) { | |
| // we got past point below, might need to | |
| // insert interpolated extra point | |
| if (withlines && i > 0 && points[i - ps] != null) { | |
| intery = py + (points[i - ps + 1] - py) * (qx - px) / (points[i - ps] - px); | |
| newpoints.push(qx); | |
| newpoints.push(intery) | |
| for (m = 2; m < ps; ++m) | |
| newpoints.push(points[i + m]); | |
| bottom = qy; | |
| } | |
| j += otherps; | |
| } | |
| else { // px < qx | |
| if (fromgap && withlines) { | |
| // if we come from a gap, we just skip this point | |
| i += ps; | |
| continue; | |
| } | |
| for (m = 0; m < ps; ++m) | |
| newpoints.push(points[i + m]); | |
| // we might be able to interpolate a point below, | |
| // this can give us a better y | |
| if (withlines && j > 0 && otherpoints[j - otherps] != null) | |
| bottom = qy + (otherpoints[j - otherps + 1] - qy) * (px - qx) / (otherpoints[j - otherps] - qx); | |
| //newpoints[l + 1] += bottom; | |
| i += ps; | |
| } | |
| fromgap = false; | |
| if (l != newpoints.length && withbottom) | |
| newpoints[l + 2] = bottom; | |
| } | |
| // maintain the line steps invariant | |
| if (withsteps && l != newpoints.length && l > 0 | |
| && newpoints[l] != null | |
| && newpoints[l] != newpoints[l - ps] | |
| && newpoints[l + 1] != newpoints[l - ps + 1]) { | |
| for (m = 0; m < ps; ++m) | |
| newpoints[l + ps + m] = newpoints[l + m]; | |
| newpoints[l + 1] = newpoints[l - ps + 1]; | |
| } | |
| } | |
| datapoints.points = newpoints; | |
| } | |
| plot.hooks.processDatapoints.push(computeFillBottoms); | |
| } | |
| $.plot.plugins.push({ | |
| init: init, | |
| options: options, | |
| name: 'fillbetween', | |
| version: '1.0' | |
| }); | |
| })(jQuery); | |
| (function(b){var a={series:{fillBetween:null}};function c(f){function d(j,h){var g;for(g=0;g<h.length;++g){if(h[g].id==j.fillBetween){return h[g]}}if(typeof j.fillBetween=="number"){g=j.fillBetween;if(g<0||g>=h.length){return null}return h[g]}return null}function e(B,u,g){if(u.fillBetween==null){return}var p=d(u,B.getData());if(!p){return}var y=g.pointsize,E=g.points,h=p.datapoints.pointsize,x=p.datapoints.points,r=[],w,v,k,G,F,q,t=u.lines.show,o=y>2&&g.format[2].y,n=t&&u.lines.steps,D=true,C=0,A=0,z;while(true){if(C>=E.length){break}z=r.length;if(E[C]==null){for(m=0;m<y;++m){r.push(E[C+m])}C+=y}else{if(A>=x.length){if(!t){for(m=0;m<y;++m){r.push(E[C+m])}}C+=y}else{if(x[A]==null){for(m=0;m<y;++m){r.push(null)}D=true;A+=h}else{w=E[C];v=E[C+1];G=x[A];F=x[A+1];q=0;if(w==G){for(m=0;m<y;++m){r.push(E[C+m])}q=F;C+=y;A+=h}else{if(w>G){if(t&&C>0&&E[C-y]!=null){k=v+(E[C-y+1]-v)*(G-w)/(E[C-y]-w);r.push(G);r.push(k);for(m=2;m<y;++m){r.push(E[C+m])}q=F}A+=h}else{if(D&&t){C+=y;continue}for(m=0;m<y;++m){r.push(E[C+m])}if(t&&A>0&&x[A-h]!=null){q=F+(x[A-h+1]-F)*(w-G)/(x[A-h]-G)}C+=y}}D=false;if(z!=r.length&&o){r[z+2]=q}}}}if(n&&z!=r.length&&z>0&&r[z]!=null&&r[z]!=r[z-y]&&r[z+1]!=r[z-y+1]){for(m=0;m<y;++m){r[z+y+m]=r[z+m]}r[z+1]=r[z-y+1]}}g.points=r}f.hooks.processDatapoints.push(e)}b.plot.plugins.push({init:c,options:a,name:"fillbetween",version:"1.0"})})(jQuery); |
| /* | |
| Flot plugin for plotting images, e.g. useful for putting ticks on a | |
| prerendered complex visualization. | |
| The data syntax is [[image, x1, y1, x2, y2], ...] where (x1, y1) and | |
| (x2, y2) are where you intend the two opposite corners of the image to | |
| end up in the plot. Image must be a fully loaded Javascript image (you | |
| can make one with new Image()). If the image is not complete, it's | |
| skipped when plotting. | |
| There are two helpers included for retrieving images. The easiest work | |
| the way that you put in URLs instead of images in the data (like | |
| ["myimage.png", 0, 0, 10, 10]), then call $.plot.image.loadData(data, | |
| options, callback) where data and options are the same as you pass in | |
| to $.plot. This loads the images, replaces the URLs in the data with | |
| the corresponding images and calls "callback" when all images are | |
| loaded (or failed loading). In the callback, you can then call $.plot | |
| with the data set. See the included example. | |
| A more low-level helper, $.plot.image.load(urls, callback) is also | |
| included. Given a list of URLs, it calls callback with an object | |
| mapping from URL to Image object when all images are loaded or have | |
| failed loading. | |
| Options for the plugin are | |
| series: { | |
| images: { | |
| show: boolean | |
| anchor: "corner" or "center" | |
| alpha: [0,1] | |
| } | |
| } | |
| which can be specified for a specific series | |
| $.plot($("#placeholder"), [{ data: [ ... ], images: { ... } ]) | |
| Note that because the data format is different from usual data points, | |
| you can't use images with anything else in a specific data series. | |
| Setting "anchor" to "center" causes the pixels in the image to be | |
| anchored at the corner pixel centers inside of at the pixel corners, | |
| effectively letting half a pixel stick out to each side in the plot. | |
| A possible future direction could be support for tiling for large | |
| images (like Google Maps). | |
| */ | |
| (function ($) { | |
| var options = { | |
| series: { | |
| images: { | |
| show: false, | |
| alpha: 1, | |
| anchor: "corner" // or "center" | |
| } | |
| } | |
| }; | |
| $.plot.image = {}; | |
| $.plot.image.loadDataImages = function (series, options, callback) { | |
| var urls = [], points = []; | |
| var defaultShow = options.series.images.show; | |
| $.each(series, function (i, s) { | |
| if (!(defaultShow || s.images.show)) | |
| return; | |
| if (s.data) | |
| s = s.data; | |
| $.each(s, function (i, p) { | |
| if (typeof p[0] == "string") { | |
| urls.push(p[0]); | |
| points.push(p); | |
| } | |
| }); | |
| }); | |
| $.plot.image.load(urls, function (loadedImages) { | |
| $.each(points, function (i, p) { | |
| var url = p[0]; | |
| if (loadedImages[url]) | |
| p[0] = loadedImages[url]; | |
| }); | |
| callback(); | |
| }); | |
| } | |
| $.plot.image.load = function (urls, callback) { | |
| var missing = urls.length, loaded = {}; | |
| if (missing == 0) | |
| callback({}); | |
| $.each(urls, function (i, url) { | |
| var handler = function () { | |
| --missing; | |
| loaded[url] = this; | |
| if (missing == 0) | |
| callback(loaded); | |
| }; | |
| $('<img />').load(handler).error(handler).attr('src', url); | |
| }); | |
| } | |
| function drawSeries(plot, ctx, series) { | |
| var plotOffset = plot.getPlotOffset(); | |
| if (!series.images || !series.images.show) | |
| return; | |
| var points = series.datapoints.points, | |
| ps = series.datapoints.pointsize; | |
| for (var i = 0; i < points.length; i += ps) { | |
| var img = points[i], | |
| x1 = points[i + 1], y1 = points[i + 2], | |
| x2 = points[i + 3], y2 = points[i + 4], | |
| xaxis = series.xaxis, yaxis = series.yaxis, | |
| tmp; | |
| // actually we should check img.complete, but it | |
| // appears to be a somewhat unreliable indicator in | |
| // IE6 (false even after load event) | |
| if (!img || img.width <= 0 || img.height <= 0) | |
| continue; | |
| if (x1 > x2) { | |
| tmp = x2; | |
| x2 = x1; | |
| x1 = tmp; | |
| } | |
| if (y1 > y2) { | |
| tmp = y2; | |
| y2 = y1; | |
| y1 = tmp; | |
| } | |
| // if the anchor is at the center of the pixel, expand the | |
| // image by 1/2 pixel in each direction | |
| if (series.images.anchor == "center") { | |
| tmp = 0.5 * (x2-x1) / (img.width - 1); | |
| x1 -= tmp; | |
| x2 += tmp; | |
| tmp = 0.5 * (y2-y1) / (img.height - 1); | |
| y1 -= tmp; | |
| y2 += tmp; | |
| } | |
| // clip | |
| if (x1 == x2 || y1 == y2 || | |
| x1 >= xaxis.max || x2 <= xaxis.min || | |
| y1 >= yaxis.max || y2 <= yaxis.min) | |
| continue; | |
| var sx1 = 0, sy1 = 0, sx2 = img.width, sy2 = img.height; | |
| if (x1 < xaxis.min) { | |
| sx1 += (sx2 - sx1) * (xaxis.min - x1) / (x2 - x1); | |
| x1 = xaxis.min; | |
| } | |
| if (x2 > xaxis.max) { | |
| sx2 += (sx2 - sx1) * (xaxis.max - x2) / (x2 - x1); | |
| x2 = xaxis.max; | |
| } | |
| if (y1 < yaxis.min) { | |
| sy2 += (sy1 - sy2) * (yaxis.min - y1) / (y2 - y1); | |
| y1 = yaxis.min; | |
| } | |
| if (y2 > yaxis.max) { | |
| sy1 += (sy1 - sy2) * (yaxis.max - y2) / (y2 - y1); | |
| y2 = yaxis.max; | |
| } | |
| x1 = xaxis.p2c(x1); | |
| x2 = xaxis.p2c(x2); | |
| y1 = yaxis.p2c(y1); | |
| y2 = yaxis.p2c(y2); | |
| // the transformation may have swapped us | |
| if (x1 > x2) { | |
| tmp = x2; | |
| x2 = x1; | |
| x1 = tmp; | |
| } | |
| if (y1 > y2) { | |
| tmp = y2; | |
| y2 = y1; | |
| y1 = tmp; | |
| } | |
| tmp = ctx.globalAlpha; | |
| ctx.globalAlpha *= series.images.alpha; | |
| ctx.drawImage(img, | |
| sx1, sy1, sx2 - sx1, sy2 - sy1, | |
| x1 + plotOffset.left, y1 + plotOffset.top, | |
| x2 - x1, y2 - y1); | |
| ctx.globalAlpha = tmp; | |
| } | |
| } | |
| function processRawData(plot, series, data, datapoints) { | |
| if (!series.images.show) | |
| return; | |
| // format is Image, x1, y1, x2, y2 (opposite corners) | |
| datapoints.format = [ | |
| { required: true }, | |
| { x: true, number: true, required: true }, | |
| { y: true, number: true, required: true }, | |
| { x: true, number: true, required: true }, | |
| { y: true, number: true, required: true } | |
| ]; | |
| } | |
| function init(plot) { | |
| plot.hooks.processRawData.push(processRawData); | |
| plot.hooks.drawSeries.push(drawSeries); | |
| } | |
| $.plot.plugins.push({ | |
| init: init, | |
| options: options, | |
| name: 'image', | |
| version: '1.1' | |
| }); | |
| })(jQuery); | |
| (function(c){var a={series:{images:{show:false,alpha:1,anchor:"corner"}}};c.plot.image={};c.plot.image.loadDataImages=function(g,f,k){var j=[],h=[];var i=f.series.images.show;c.each(g,function(l,m){if(!(i||m.images.show)){return}if(m.data){m=m.data}c.each(m,function(n,o){if(typeof o[0]=="string"){j.push(o[0]);h.push(o)}})});c.plot.image.load(j,function(l){c.each(h,function(n,o){var m=o[0];if(l[m]){o[0]=l[m]}});k()})};c.plot.image.load=function(h,i){var g=h.length,f={};if(g==0){i({})}c.each(h,function(k,j){var l=function(){--g;f[j]=this;if(g==0){i(f)}};c("<img />").load(l).error(l).attr("src",j)})};function d(q,o,l){var m=q.getPlotOffset();if(!l.images||!l.images.show){return}var r=l.datapoints.points,n=l.datapoints.pointsize;for(var t=0;t<r.length;t+=n){var y=r[t],w=r[t+1],g=r[t+2],v=r[t+3],f=r[t+4],h=l.xaxis,u=l.yaxis,x;if(!y||y.width<=0||y.height<=0){continue}if(w>v){x=v;v=w;w=x}if(g>f){x=f;f=g;g=x}if(l.images.anchor=="center"){x=0.5*(v-w)/(y.width-1);w-=x;v+=x;x=0.5*(f-g)/(y.height-1);g-=x;f+=x}if(w==v||g==f||w>=h.max||v<=h.min||g>=u.max||f<=u.min){continue}var k=0,s=0,j=y.width,p=y.height;if(w<h.min){k+=(j-k)*(h.min-w)/(v-w);w=h.min}if(v>h.max){j+=(j-k)*(h.max-v)/(v-w);v=h.max}if(g<u.min){p+=(s-p)*(u.min-g)/(f-g);g=u.min}if(f>u.max){s+=(s-p)*(u.max-f)/(f-g);f=u.max}w=h.p2c(w);v=h.p2c(v);g=u.p2c(g);f=u.p2c(f);if(w>v){x=v;v=w;w=x}if(g>f){x=f;f=g;g=x}x=o.globalAlpha;o.globalAlpha*=l.images.alpha;o.drawImage(y,k,s,j-k,p-s,w+m.left,g+m.top,v-w,f-g);o.globalAlpha=x}}function b(i,f,g,h){if(!f.images.show){return}h.format=[{required:true},{x:true,number:true,required:true},{y:true,number:true,required:true},{x:true,number:true,required:true},{y:true,number:true,required:true}]}function e(f){f.hooks.processRawData.push(b);f.hooks.drawSeries.push(d)}c.plot.plugins.push({init:e,options:a,name:"image",version:"1.1"})})(jQuery); |
| /*! Javascript plotting library for jQuery, v. 0.7. | |
| * | |
| * Released under the MIT license by IOLA, December 2007. | |
| * | |
| */ | |
| // first an inline dependency, jquery.colorhelpers.js, we inline it here | |
| // for convenience | |
| /* Plugin for jQuery for working with colors. | |
| * | |
| * Version 1.1. | |
| * | |
| * Inspiration from jQuery color animation plugin by John Resig. | |
| * | |
| * Released under the MIT license by Ole Laursen, October 2009. | |
| * | |
| * Examples: | |
| * | |
| * $.color.parse("#fff").scale('rgb', 0.25).add('a', -0.5).toString() | |
| * var c = $.color.extract($("#mydiv"), 'background-color'); | |
| * console.log(c.r, c.g, c.b, c.a); | |
| * $.color.make(100, 50, 25, 0.4).toString() // returns "rgba(100,50,25,0.4)" | |
| * | |
| * Note that .scale() and .add() return the same modified object | |
| * instead of making a new one. | |
| * | |
| * V. 1.1: Fix error handling so e.g. parsing an empty string does | |
| * produce a color rather than just crashing. | |
| */ | |
| (function(B){B.color={};B.color.make=function(F,E,C,D){var G={};G.r=F||0;G.g=E||0;G.b=C||0;G.a=D!=null?D:1;G.add=function(J,I){for(var H=0;H<J.length;++H){G[J.charAt(H)]+=I}return G.normalize()};G.scale=function(J,I){for(var H=0;H<J.length;++H){G[J.charAt(H)]*=I}return G.normalize()};G.toString=function(){if(G.a>=1){return"rgb("+[G.r,G.g,G.b].join(",")+")"}else{return"rgba("+[G.r,G.g,G.b,G.a].join(",")+")"}};G.normalize=function(){function H(J,K,I){return K<J?J:(K>I?I:K)}G.r=H(0,parseInt(G.r),255);G.g=H(0,parseInt(G.g),255);G.b=H(0,parseInt(G.b),255);G.a=H(0,G.a,1);return G};G.clone=function(){return B.color.make(G.r,G.b,G.g,G.a)};return G.normalize()};B.color.extract=function(D,C){var E;do{E=D.css(C).toLowerCase();if(E!=""&&E!="transparent"){break}D=D.parent()}while(!B.nodeName(D.get(0),"body"));if(E=="rgba(0, 0, 0, 0)"){E="transparent"}return B.color.parse(E)};B.color.parse=function(F){var E,C=B.color.make;if(E=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(F)){return C(parseInt(E[1],10),parseInt(E[2],10),parseInt(E[3],10))}if(E=/rgba\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(F)){return C(parseInt(E[1],10),parseInt(E[2],10),parseInt(E[3],10),parseFloat(E[4]))}if(E=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(F)){return C(parseFloat(E[1])*2.55,parseFloat(E[2])*2.55,parseFloat(E[3])*2.55)}if(E=/rgba\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(F)){return C(parseFloat(E[1])*2.55,parseFloat(E[2])*2.55,parseFloat(E[3])*2.55,parseFloat(E[4]))}if(E=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(F)){return C(parseInt(E[1],16),parseInt(E[2],16),parseInt(E[3],16))}if(E=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(F)){return C(parseInt(E[1]+E[1],16),parseInt(E[2]+E[2],16),parseInt(E[3]+E[3],16))}var D=B.trim(F).toLowerCase();if(D=="transparent"){return C(255,255,255,0)}else{E=A[D]||[0,0,0];return C(E[0],E[1],E[2])}};var A={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0]}})(jQuery); | |
| // the actual Flot code | |
| (function($) { | |
| function Plot(placeholder, data_, options_, plugins) { | |
| // data is on the form: | |
| // [ series1, series2 ... ] | |
| // where series is either just the data as [ [x1, y1], [x2, y2], ... ] | |
| // or { data: [ [x1, y1], [x2, y2], ... ], label: "some label", ... } | |
| var series = [], | |
| options = { | |
| // the color theme used for graphs | |
| colors: ["#edc240", "#afd8f8", "#cb4b4b", "#4da74d", "#9440ed"], | |
| legend: { | |
| show: true, | |
| noColumns: 1, // number of colums in legend table | |
| labelFormatter: null, // fn: string -> string | |
| labelBoxBorderColor: "#ccc", // border color for the little label boxes | |
| container: null, // container (as jQuery object) to put legend in, null means default on top of graph | |
| position: "ne", // position of default legend container within plot | |
| margin: 5, // distance from grid edge to default legend container within plot | |
| backgroundColor: null, // null means auto-detect | |
| backgroundOpacity: 0.85 // set to 0 to avoid background | |
| }, | |
| xaxis: { | |
| show: null, // null = auto-detect, true = always, false = never | |
| position: "bottom", // or "top" | |
| mode: null, // null or "time" | |
| color: null, // base color, labels, ticks | |
| tickColor: null, // possibly different color of ticks, e.g. "rgba(0,0,0,0.15)" | |
| transform: null, // null or f: number -> number to transform axis | |
| inverseTransform: null, // if transform is set, this should be the inverse function | |
| min: null, // min. value to show, null means set automatically | |
| max: null, // max. value to show, null means set automatically | |
| autoscaleMargin: null, // margin in % to add if auto-setting min/max | |
| ticks: null, // either [1, 3] or [[1, "a"], 3] or (fn: axis info -> ticks) or app. number of ticks for auto-ticks | |
| tickFormatter: null, // fn: number -> string | |
| labelWidth: null, // size of tick labels in pixels | |
| labelHeight: null, | |
| reserveSpace: null, // whether to reserve space even if axis isn't shown | |
| tickLength: null, // size in pixels of ticks, or "full" for whole line | |
| alignTicksWithAxis: null, // axis number or null for no sync | |
| // mode specific options | |
| tickDecimals: null, // no. of decimals, null means auto | |
| tickSize: null, // number or [number, "unit"] | |
| minTickSize: null, // number or [number, "unit"] | |
| monthNames: null, // list of names of months | |
| timeformat: null, // format string to use | |
| twelveHourClock: false // 12 or 24 time in time mode | |
| }, | |
| yaxis: { | |
| autoscaleMargin: 0.02, | |
| position: "left" // or "right" | |
| }, | |
| xaxes: [], | |
| yaxes: [], | |
| series: { | |
| points: { | |
| show: false, | |
| radius: 3, | |
| lineWidth: 2, // in pixels | |
| fill: true, | |
| fillColor: "#ffffff", | |
| symbol: "circle" // or callback | |
| }, | |
| lines: { | |
| // we don't put in show: false so we can see | |
| // whether lines were actively disabled | |
| lineWidth: 2, // in pixels | |
| fill: false, | |
| fillColor: null, | |
| steps: false | |
| }, | |
| bars: { | |
| show: false, | |
| lineWidth: 2, // in pixels | |
| barWidth: 1, // in units of the x axis | |
| fill: true, | |
| fillColor: null, | |
| align: "left", // or "center" | |
| horizontal: false | |
| }, | |
| shadowSize: 3 | |
| }, | |
| grid: { | |
| show: true, | |
| aboveData: false, | |
| color: "#545454", // primary color used for outline and labels | |
| backgroundColor: null, // null for transparent, else color | |
| borderColor: null, // set if different from the grid color | |
| tickColor: null, // color for the ticks, e.g. "rgba(0,0,0,0.15)" | |
| labelMargin: 5, // in pixels | |
| axisMargin: 8, // in pixels | |
| borderWidth: 2, // in pixels | |
| minBorderMargin: null, // in pixels, null means taken from points radius | |
| markings: null, // array of ranges or fn: axes -> array of ranges | |
| markingsColor: "#f4f4f4", | |
| markingsLineWidth: 2, | |
| // interactive stuff | |
| clickable: false, | |
| hoverable: false, | |
| autoHighlight: true, // highlight in case mouse is near | |
| mouseActiveRadius: 10 // how far the mouse can be away to activate an item | |
| }, | |
| hooks: {} | |
| }, | |
| canvas = null, // the canvas for the plot itself | |
| overlay = null, // canvas for interactive stuff on top of plot | |
| eventHolder = null, // jQuery object that events should be bound to | |
| ctx = null, octx = null, | |
| xaxes = [], yaxes = [], | |
| plotOffset = { left: 0, right: 0, top: 0, bottom: 0}, | |
| canvasWidth = 0, canvasHeight = 0, | |
| plotWidth = 0, plotHeight = 0, | |
| hooks = { | |
| processOptions: [], | |
| processRawData: [], | |
| processDatapoints: [], | |
| drawSeries: [], | |
| draw: [], | |
| bindEvents: [], | |
| drawOverlay: [], | |
| shutdown: [] | |
| }, | |
| plot = this; | |
| // public functions | |
| plot.setData = setData; | |
| plot.setupGrid = setupGrid; | |
| plot.draw = draw; | |
| plot.getPlaceholder = function() { return placeholder; }; | |
| plot.getCanvas = function() { return canvas; }; | |
| plot.getPlotOffset = function() { return plotOffset; }; | |
| plot.width = function () { return plotWidth; }; | |
| plot.height = function () { return plotHeight; }; | |
| plot.offset = function () { | |
| var o = eventHolder.offset(); | |
| o.left += plotOffset.left; | |
| o.top += plotOffset.top; | |
| return o; | |
| }; | |
| plot.getData = function () { return series; }; | |
| plot.getAxes = function () { | |
| var res = {}, i; | |
| $.each(xaxes.concat(yaxes), function (_, axis) { | |
| if (axis) | |
| res[axis.direction + (axis.n != 1 ? axis.n : "") + "axis"] = axis; | |
| }); | |
| return res; | |
| }; | |
| plot.getXAxes = function () { return xaxes; }; | |
| plot.getYAxes = function () { return yaxes; }; | |
| plot.c2p = canvasToAxisCoords; | |
| plot.p2c = axisToCanvasCoords; | |
| plot.getOptions = function () { return options; }; | |
| plot.highlight = highlight; | |
| plot.unhighlight = unhighlight; | |
| plot.triggerRedrawOverlay = triggerRedrawOverlay; | |
| plot.pointOffset = function(point) { | |
| return { | |
| left: parseInt(xaxes[axisNumber(point, "x") - 1].p2c(+point.x) + plotOffset.left), | |
| top: parseInt(yaxes[axisNumber(point, "y") - 1].p2c(+point.y) + plotOffset.top) | |
| }; | |
| }; | |
| plot.shutdown = shutdown; | |
| plot.resize = function () { | |
| getCanvasDimensions(); | |
| resizeCanvas(canvas); | |
| resizeCanvas(overlay); | |
| }; | |
| // public attributes | |
| plot.hooks = hooks; | |
| // initialize | |
| initPlugins(plot); | |
| parseOptions(options_); | |
| setupCanvases(); | |
| setData(data_); | |
| setupGrid(); | |
| draw(); | |
| bindEvents(); | |
| function executeHooks(hook, args) { | |
| args = [plot].concat(args); | |
| for (var i = 0; i < hook.length; ++i) | |
| hook[i].apply(this, args); | |
| } | |
| function initPlugins() { | |
| for (var i = 0; i < plugins.length; ++i) { | |
| var p = plugins[i]; | |
| p.init(plot); | |
| if (p.options) | |
| $.extend(true, options, p.options); | |
| } | |
| } | |
| function parseOptions(opts) { | |
| var i; | |
| $.extend(true, options, opts); | |
| if (options.xaxis.color == null) | |
| options.xaxis.color = options.grid.color; | |
| if (options.yaxis.color == null) | |
| options.yaxis.color = options.grid.color; | |
| if (options.xaxis.tickColor == null) // backwards-compatibility | |
| options.xaxis.tickColor = options.grid.tickColor; | |
| if (options.yaxis.tickColor == null) // backwards-compatibility | |
| options.yaxis.tickColor = options.grid.tickColor; | |
| if (options.grid.borderColor == null) | |
| options.grid.borderColor = options.grid.color; | |
| if (options.grid.tickColor == null) | |
| options.grid.tickColor = $.color.parse(options.grid.color).scale('a', 0.22).toString(); | |
| // fill in defaults in axes, copy at least always the | |
| // first as the rest of the code assumes it'll be there | |
| for (i = 0; i < Math.max(1, options.xaxes.length); ++i) | |
| options.xaxes[i] = $.extend(true, {}, options.xaxis, options.xaxes[i]); | |
| for (i = 0; i < Math.max(1, options.yaxes.length); ++i) | |
| options.yaxes[i] = $.extend(true, {}, options.yaxis, options.yaxes[i]); | |
| // backwards compatibility, to be removed in future | |
| if (options.xaxis.noTicks && options.xaxis.ticks == null) | |
| options.xaxis.ticks = options.xaxis.noTicks; | |
| if (options.yaxis.noTicks && options.yaxis.ticks == null) | |
| options.yaxis.ticks = options.yaxis.noTicks; | |
| if (options.x2axis) { | |
| options.xaxes[1] = $.extend(true, {}, options.xaxis, options.x2axis); | |
| options.xaxes[1].position = "top"; | |
| } | |
| if (options.y2axis) { | |
| options.yaxes[1] = $.extend(true, {}, options.yaxis, options.y2axis); | |
| options.yaxes[1].position = "right"; | |
| } | |
| if (options.grid.coloredAreas) | |
| options.grid.markings = options.grid.coloredAreas; | |
| if (options.grid.coloredAreasColor) | |
| options.grid.markingsColor = options.grid.coloredAreasColor; | |
| if (options.lines) | |
| $.extend(true, options.series.lines, options.lines); | |
| if (options.points) | |
| $.extend(true, options.series.points, options.points); | |
| if (options.bars) | |
| $.extend(true, options.series.bars, options.bars); | |
| if (options.shadowSize != null) | |
| options.series.shadowSize = options.shadowSize; | |
| // save options on axes for future reference | |
| for (i = 0; i < options.xaxes.length; ++i) | |
| getOrCreateAxis(xaxes, i + 1).options = options.xaxes[i]; | |
| for (i = 0; i < options.yaxes.length; ++i) | |
| getOrCreateAxis(yaxes, i + 1).options = options.yaxes[i]; | |
| // add hooks from options | |
| for (var n in hooks) | |
| if (options.hooks[n] && options.hooks[n].length) | |
| hooks[n] = hooks[n].concat(options.hooks[n]); | |
| executeHooks(hooks.processOptions, [options]); | |
| } | |
| function setData(d) { | |
| series = parseData(d); | |
| fillInSeriesOptions(); | |
| processData(); | |
| } | |
| function parseData(d) { | |
| var res = []; | |
| for (var i = 0; i < d.length; ++i) { | |
| var s = $.extend(true, {}, options.series); | |
| if (d[i].data != null) { | |
| s.data = d[i].data; // move the data instead of deep-copy | |
| delete d[i].data; | |
| $.extend(true, s, d[i]); | |
| d[i].data = s.data; | |
| } | |
| else | |
| s.data = d[i]; | |
| res.push(s); | |
| } | |
| return res; | |
| } | |
| function axisNumber(obj, coord) { | |
| var a = obj[coord + "axis"]; | |
| if (typeof a == "object") // if we got a real axis, extract number | |
| a = a.n; | |
| if (typeof a != "number") | |
| a = 1; // default to first axis | |
| return a; | |
| } | |
| function allAxes() { | |
| // return flat array without annoying null entries | |
| return $.grep(xaxes.concat(yaxes), function (a) { return a; }); | |
| } | |
| function canvasToAxisCoords(pos) { | |
| // return an object with x/y corresponding to all used axes | |
| var res = {}, i, axis; | |
| for (i = 0; i < xaxes.length; ++i) { | |
| axis = xaxes[i]; | |
| if (axis && axis.used) | |
| res["x" + axis.n] = axis.c2p(pos.left); | |
| } | |
| for (i = 0; i < yaxes.length; ++i) { | |
| axis = yaxes[i]; | |
| if (axis && axis.used) | |
| res["y" + axis.n] = axis.c2p(pos.top); | |
| } | |
| if (res.x1 !== undefined) | |
| res.x = res.x1; | |
| if (res.y1 !== undefined) | |
| res.y = res.y1; | |
| return res; | |
| } | |
| function axisToCanvasCoords(pos) { | |
| // get canvas coords from the first pair of x/y found in pos | |
| var res = {}, i, axis, key; | |
| for (i = 0; i < xaxes.length; ++i) { | |
| axis = xaxes[i]; | |
| if (axis && axis.used) { | |
| key = "x" + axis.n; | |
| if (pos[key] == null && axis.n == 1) | |
| key = "x"; | |
| if (pos[key] != null) { | |
| res.left = axis.p2c(pos[key]); | |
| break; | |
| } | |
| } | |
| } | |
| for (i = 0; i < yaxes.length; ++i) { | |
| axis = yaxes[i]; | |
| if (axis && axis.used) { | |
| key = "y" + axis.n; | |
| if (pos[key] == null && axis.n == 1) | |
| key = "y"; | |
| if (pos[key] != null) { | |
| res.top = axis.p2c(pos[key]); | |
| break; | |
| } | |
| } | |
| } | |
| return res; | |
| } | |
| function getOrCreateAxis(axes, number) { | |
| if (!axes[number - 1]) | |
| axes[number - 1] = { | |
| n: number, // save the number for future reference | |
| direction: axes == xaxes ? "x" : "y", | |
| options: $.extend(true, {}, axes == xaxes ? options.xaxis : options.yaxis) | |
| }; | |
| return axes[number - 1]; | |
| } | |
| function fillInSeriesOptions() { | |
| var i; | |
| // collect what we already got of colors | |
| var neededColors = series.length, | |
| usedColors = [], | |
| assignedColors = []; | |
| for (i = 0; i < series.length; ++i) { | |
| var sc = series[i].color; | |
| if (sc != null) { | |
| --neededColors; | |
| if (typeof sc == "number") | |
| assignedColors.push(sc); | |
| else | |
| usedColors.push($.color.parse(series[i].color)); | |
| } | |
| } | |
| // we might need to generate more colors if higher indices | |
| // are assigned | |
| for (i = 0; i < assignedColors.length; ++i) { | |
| neededColors = Math.max(neededColors, assignedColors[i] + 1); | |
| } | |
| // produce colors as needed | |
| var colors = [], variation = 0; | |
| i = 0; | |
| while (colors.length < neededColors) { | |
| var c; | |
| if (options.colors.length == i) // check degenerate case | |
| c = $.color.make(100, 100, 100); | |
| else | |
| c = $.color.parse(options.colors[i]); | |
| // vary color if needed | |
| var sign = variation % 2 == 1 ? -1 : 1; | |
| c.scale('rgb', 1 + sign * Math.ceil(variation / 2) * 0.2) | |
| // FIXME: if we're getting to close to something else, | |
| // we should probably skip this one | |
| colors.push(c); | |
| ++i; | |
| if (i >= options.colors.length) { | |
| i = 0; | |
| ++variation; | |
| } | |
| } | |
| // fill in the options | |
| var colori = 0, s; | |
| for (i = 0; i < series.length; ++i) { | |
| s = series[i]; | |
| // assign colors | |
| if (s.color == null) { | |
| s.color = colors[colori].toString(); | |
| ++colori; | |
| } | |
| else if (typeof s.color == "number") | |
| s.color = colors[s.color].toString(); | |
| // turn on lines automatically in case nothing is set | |
| if (s.lines.show == null) { | |
| var v, show = true; | |
| for (v in s) | |
| if (s[v] && s[v].show) { | |
| show = false; | |
| break; | |
| } | |
| if (show) | |
| s.lines.show = true; | |
| } | |
| // setup axes | |
| s.xaxis = getOrCreateAxis(xaxes, axisNumber(s, "x")); | |
| s.yaxis = getOrCreateAxis(yaxes, axisNumber(s, "y")); | |
| } | |
| } | |
| function processData() { | |
| var topSentry = Number.POSITIVE_INFINITY, | |
| bottomSentry = Number.NEGATIVE_INFINITY, | |
| fakeInfinity = Number.MAX_VALUE, | |
| i, j, k, m, length, | |
| s, points, ps, x, y, axis, val, f, p; | |
| function updateAxis(axis, min, max) { | |
| if (min < axis.datamin && min != -fakeInfinity) | |
| axis.datamin = min; | |
| if (max > axis.datamax && max != fakeInfinity) | |
| axis.datamax = max; | |
| } | |
| $.each(allAxes(), function (_, axis) { | |
| // init axis | |
| axis.datamin = topSentry; | |
| axis.datamax = bottomSentry; | |
| axis.used = false; | |
| }); | |
| for (i = 0; i < series.length; ++i) { | |
| s = series[i]; | |
| s.datapoints = { points: [] }; | |
| executeHooks(hooks.processRawData, [ s, s.data, s.datapoints ]); | |
| } | |
| // first pass: clean and copy data | |
| for (i = 0; i < series.length; ++i) { | |
| s = series[i]; | |
| var data = s.data, format = s.datapoints.format; | |
| if (!format) { | |
| format = []; | |
| // find out how to copy | |
| format.push({ x: true, number: true, required: true }); | |
| format.push({ y: true, number: true, required: true }); | |
| if (s.bars.show || (s.lines.show && s.lines.fill)) { | |
| format.push({ y: true, number: true, required: false, defaultValue: 0 }); | |
| if (s.bars.horizontal) { | |
| delete format[format.length - 1].y; | |
| format[format.length - 1].x = true; | |
| } | |
| } | |
| s.datapoints.format = format; | |
| } | |
| if (s.datapoints.pointsize != null) | |
| continue; // already filled in | |
| s.datapoints.pointsize = format.length; | |
| ps = s.datapoints.pointsize; | |
| points = s.datapoints.points; | |
| insertSteps = s.lines.show && s.lines.steps; | |
| s.xaxis.used = s.yaxis.used = true; | |
| for (j = k = 0; j < data.length; ++j, k += ps) { | |
| p = data[j]; | |
| var nullify = p == null; | |
| if (!nullify) { | |
| for (m = 0; m < ps; ++m) { | |
| val = p[m]; | |
| f = format[m]; | |
| if (f) { | |
| if (f.number && val != null) { | |
| val = +val; // convert to number | |
| if (isNaN(val)) | |
| val = null; | |
| else if (val == Infinity) | |
| val = fakeInfinity; | |
| else if (val == -Infinity) | |
| val = -fakeInfinity; | |
| } | |
| if (val == null) { | |
| if (f.required) | |
| nullify = true; | |
| if (f.defaultValue != null) | |
| val = f.defaultValue; | |
| } | |
| } | |
| points[k + m] = val; | |
| } | |
| } | |
| if (nullify) { | |
| for (m = 0; m < ps; ++m) { | |
| val = points[k + m]; | |
| if (val != null) { | |
| f = format[m]; | |
| // extract min/max info | |
| if (f.x) | |
| updateAxis(s.xaxis, val, val); | |
| if (f.y) | |
| updateAxis(s.yaxis, val, val); | |
| } | |
| points[k + m] = null; | |
| } | |
| } | |
| else { | |
| // a little bit of line specific stuff that | |
| // perhaps shouldn't be here, but lacking | |
| // better means... | |
| if (insertSteps && k > 0 | |
| && points[k - ps] != null | |
| && points[k - ps] != points[k] | |
| && points[k - ps + 1] != points[k + 1]) { | |
| // copy the point to make room for a middle point | |
| for (m = 0; m < ps; ++m) | |
| points[k + ps + m] = points[k + m]; | |
| // middle point has same y | |
| points[k + 1] = points[k - ps + 1]; | |
| // we've added a point, better reflect that | |
| k += ps; | |
| } | |
| } | |
| } | |
| } | |
| // give the hooks a chance to run | |
| for (i = 0; i < series.length; ++i) { | |
| s = series[i]; | |
| executeHooks(hooks.processDatapoints, [ s, s.datapoints]); | |
| } | |
| // second pass: find datamax/datamin for auto-scaling | |
| for (i = 0; i < series.length; ++i) { | |
| s = series[i]; | |
| points = s.datapoints.points, | |
| ps = s.datapoints.pointsize; | |
| var xmin = topSentry, ymin = topSentry, | |
| xmax = bottomSentry, ymax = bottomSentry; | |
| for (j = 0; j < points.length; j += ps) { | |
| if (points[j] == null) | |
| continue; | |
| for (m = 0; m < ps; ++m) { | |
| val = points[j + m]; | |
| f = format[m]; | |
| if (!f || val == fakeInfinity || val == -fakeInfinity) | |
| continue; | |
| if (f.x) { | |
| if (val < xmin) | |
| xmin = val; | |
| if (val > xmax) | |
| xmax = val; | |
| } | |
| if (f.y) { | |
| if (val < ymin) | |
| ymin = val; | |
| if (val > ymax) | |
| ymax = val; | |
| } | |
| } | |
| } | |
| if (s.bars.show) { | |
| // make sure we got room for the bar on the dancing floor | |
| var delta = s.bars.align == "left" ? 0 : -s.bars.barWidth/2; | |
| if (s.bars.horizontal) { | |
| ymin += delta; | |
| ymax += delta + s.bars.barWidth; | |
| } | |
| else { | |
| xmin += delta; | |
| xmax += delta + s.bars.barWidth; | |
| } | |
| } | |
| updateAxis(s.xaxis, xmin, xmax); | |
| updateAxis(s.yaxis, ymin, ymax); | |
| } | |
| $.each(allAxes(), function (_, axis) { | |
| if (axis.datamin == topSentry) | |
| axis.datamin = null; | |
| if (axis.datamax == bottomSentry) | |
| axis.datamax = null; | |
| }); | |
| } | |
| function makeCanvas(skipPositioning, cls) { | |
| var c = document.createElement('canvas'); | |
| c.className = cls; | |
| c.width = canvasWidth; | |
| c.height = canvasHeight; | |
| if (!skipPositioning) | |
| $(c).css({ position: 'absolute', left: 0, top: 0 }); | |
| $(c).appendTo(placeholder); | |
| if (!c.getContext) // excanvas hack | |
| c = window.G_vmlCanvasManager.initElement(c); | |
| // used for resetting in case we get replotted | |
| c.getContext("2d").save(); | |
| return c; | |
| } | |
| function getCanvasDimensions() { | |
| canvasWidth = placeholder.width(); | |
| canvasHeight = placeholder.height(); | |
| if (canvasWidth <= 0 || canvasHeight <= 0) | |
| throw "Invalid dimensions for plot, width = " + canvasWidth + ", height = " + canvasHeight; | |
| } | |
| function resizeCanvas(c) { | |
| // resizing should reset the state (excanvas seems to be | |
| // buggy though) | |
| if (c.width != canvasWidth) | |
| c.width = canvasWidth; | |
| if (c.height != canvasHeight) | |
| c.height = canvasHeight; | |
| // so try to get back to the initial state (even if it's | |
| // gone now, this should be safe according to the spec) | |
| var cctx = c.getContext("2d"); | |
| cctx.restore(); | |
| // and save again | |
| cctx.save(); | |
| } | |
| function setupCanvases() { | |
| var reused, | |
| existingCanvas = placeholder.children("canvas.base"), | |
| existingOverlay = placeholder.children("canvas.overlay"); | |
| if (existingCanvas.length == 0 || existingOverlay == 0) { | |
| // init everything | |
| placeholder.html(""); // make sure placeholder is clear | |
| placeholder.css({ padding: 0 }); // padding messes up the positioning | |
| if (placeholder.css("position") == 'static') | |
| placeholder.css("position", "relative"); // for positioning labels and overlay | |
| getCanvasDimensions(); | |
| canvas = makeCanvas(true, "base"); | |
| overlay = makeCanvas(false, "overlay"); // overlay canvas for interactive features | |
| reused = false; | |
| } | |
| else { | |
| // reuse existing elements | |
| canvas = existingCanvas.get(0); | |
| overlay = existingOverlay.get(0); | |
| reused = true; | |
| } | |
| ctx = canvas.getContext("2d"); | |
| octx = overlay.getContext("2d"); | |
| // we include the canvas in the event holder too, because IE 7 | |
| // sometimes has trouble with the stacking order | |
| eventHolder = $([overlay, canvas]); | |
| if (reused) { | |
| // run shutdown in the old plot object | |
| placeholder.data("plot").shutdown(); | |
| // reset reused canvases | |
| plot.resize(); | |
| // make sure overlay pixels are cleared (canvas is cleared when we redraw) | |
| octx.clearRect(0, 0, canvasWidth, canvasHeight); | |
| // then whack any remaining obvious garbage left | |
| eventHolder.unbind(); | |
| placeholder.children().not([canvas, overlay]).remove(); | |
| } | |
| // save in case we get replotted | |
| placeholder.data("plot", plot); | |
| } | |
| function bindEvents() { | |
| // bind events | |
| if (options.grid.hoverable) { | |
| eventHolder.mousemove(onMouseMove); | |
| eventHolder.mouseleave(onMouseLeave); | |
| } | |
| if (options.grid.clickable) | |
| eventHolder.click(onClick); | |
| executeHooks(hooks.bindEvents, [eventHolder]); | |
| } | |
| function shutdown() { | |
| if (redrawTimeout) | |
| clearTimeout(redrawTimeout); | |
| eventHolder.unbind("mousemove", onMouseMove); | |
| eventHolder.unbind("mouseleave", onMouseLeave); | |
| eventHolder.unbind("click", onClick); | |
| executeHooks(hooks.shutdown, [eventHolder]); | |
| } | |
| function setTransformationHelpers(axis) { | |
| // set helper functions on the axis, assumes plot area | |
| // has been computed already | |
| function identity(x) { return x; } | |
| var s, m, t = axis.options.transform || identity, | |
| it = axis.options.inverseTransform; | |
| // precompute how much the axis is scaling a point | |
| // in canvas space | |
| if (axis.direction == "x") { | |
| s = axis.scale = plotWidth / Math.abs(t(axis.max) - t(axis.min)); | |
| m = Math.min(t(axis.max), t(axis.min)); | |
| } | |
| else { | |
| s = axis.scale = plotHeight / Math.abs(t(axis.max) - t(axis.min)); | |
| s = -s; | |
| m = Math.max(t(axis.max), t(axis.min)); | |
| } | |
| // data point to canvas coordinate | |
| if (t == identity) // slight optimization | |
| axis.p2c = function (p) { return (p - m) * s; }; | |
| else | |
| axis.p2c = function (p) { return (t(p) - m) * s; }; | |
| // canvas coordinate to data point | |
| if (!it) | |
| axis.c2p = function (c) { return m + c / s; }; | |
| else | |
| axis.c2p = function (c) { return it(m + c / s); }; | |
| } | |
| function measureTickLabels(axis) { | |
| var opts = axis.options, i, ticks = axis.ticks || [], labels = [], | |
| l, w = opts.labelWidth, h = opts.labelHeight, dummyDiv; | |
| function makeDummyDiv(labels, width) { | |
| return $('<div style="position:absolute;top:-10000px;' + width + 'font-size:smaller">' + | |
| '<div class="' + axis.direction + 'Axis ' + axis.direction + axis.n + 'Axis">' | |
| + labels.join("") + '</div></div>') | |
| .appendTo(placeholder); | |
| } | |
| if (axis.direction == "x") { | |
| // to avoid measuring the widths of the labels (it's slow), we | |
| // construct fixed-size boxes and put the labels inside | |
| // them, we don't need the exact figures and the | |
| // fixed-size box content is easy to center | |
| if (w == null) | |
| w = Math.floor(canvasWidth / (ticks.length > 0 ? ticks.length : 1)); | |
| // measure x label heights | |
| if (h == null) { | |
| labels = []; | |
| for (i = 0; i < ticks.length; ++i) { | |
| l = ticks[i].label; | |
| if (l) | |
| labels.push('<div class="tickLabel" style="float:left;width:' + w + 'px">' + l + '</div>'); | |
| } | |
| if (labels.length > 0) { | |
| // stick them all in the same div and measure | |
| // collective height | |
| labels.push('<div style="clear:left"></div>'); | |
| dummyDiv = makeDummyDiv(labels, "width:10000px;"); | |
| h = dummyDiv.height(); | |
| dummyDiv.remove(); | |
| } | |
| } | |
| } | |
| else if (w == null || h == null) { | |
| // calculate y label dimensions | |
| for (i = 0; i < ticks.length; ++i) { | |
| l = ticks[i].label; | |
| if (l) | |
| labels.push('<div class="tickLabel">' + l + '</div>'); | |
| } | |
| if (labels.length > 0) { | |
| dummyDiv = makeDummyDiv(labels, ""); | |
| if (w == null) | |
| w = dummyDiv.children().width(); | |
| if (h == null) | |
| h = dummyDiv.find("div.tickLabel").height(); | |
| dummyDiv.remove(); | |
| } | |
| } | |
| if (w == null) | |
| w = 0; | |
| if (h == null) | |
| h = 0; | |
| axis.labelWidth = w; | |
| axis.labelHeight = h; | |
| } | |
| function allocateAxisBoxFirstPhase(axis) { | |
| // find the bounding box of the axis by looking at label | |
| // widths/heights and ticks, make room by diminishing the | |
| // plotOffset | |
| var lw = axis.labelWidth, | |
| lh = axis.labelHeight, | |
| pos = axis.options.position, | |
| tickLength = axis.options.tickLength, | |
| axismargin = options.grid.axisMargin, | |
| padding = options.grid.labelMargin, | |
| all = axis.direction == "x" ? xaxes : yaxes, | |
| index; | |
| // determine axis margin | |
| var samePosition = $.grep(all, function (a) { | |
| return a && a.options.position == pos && a.reserveSpace; | |
| }); | |
| if ($.inArray(axis, samePosition) == samePosition.length - 1) | |
| axismargin = 0; // outermost | |
| // determine tick length - if we're innermost, we can use "full" | |
| if (tickLength == null) | |
| tickLength = "full"; | |
| var sameDirection = $.grep(all, function (a) { | |
| return a && a.reserveSpace; | |
| }); | |
| var innermost = $.inArray(axis, sameDirection) == 0; | |
| if (!innermost && tickLength == "full") | |
| tickLength = 5; | |
| if (!isNaN(+tickLength)) | |
| padding += +tickLength; | |
| // compute box | |
| if (axis.direction == "x") { | |
| lh += padding; | |
| if (pos == "bottom") { | |
| plotOffset.bottom += lh + axismargin; | |
| axis.box = { top: canvasHeight - plotOffset.bottom, height: lh }; | |
| } | |
| else { | |
| axis.box = { top: plotOffset.top + axismargin, height: lh }; | |
| plotOffset.top += lh + axismargin; | |
| } | |
| } | |
| else { | |
| lw += padding; | |
| if (pos == "left") { | |
| axis.box = { left: plotOffset.left + axismargin, width: lw }; | |
| plotOffset.left += lw + axismargin; | |
| } | |
| else { | |
| plotOffset.right += lw + axismargin; | |
| axis.box = { left: canvasWidth - plotOffset.right, width: lw }; | |
| } | |
| } | |
| // save for future reference | |
| axis.position = pos; | |
| axis.tickLength = tickLength; | |
| axis.box.padding = padding; | |
| axis.innermost = innermost; | |
| } | |
| function allocateAxisBoxSecondPhase(axis) { | |
| // set remaining bounding box coordinates | |
| if (axis.direction == "x") { | |
| axis.box.left = plotOffset.left; | |
| axis.box.width = plotWidth; | |
| } | |
| else { | |
| axis.box.top = plotOffset.top; | |
| axis.box.height = plotHeight; | |
| } | |
| } | |
| function setupGrid() { | |
| var i, axes = allAxes(); | |
| // first calculate the plot and axis box dimensions | |
| $.each(axes, function (_, axis) { | |
| axis.show = axis.options.show; | |
| if (axis.show == null) | |
| axis.show = axis.used; // by default an axis is visible if it's got data | |
| axis.reserveSpace = axis.show || axis.options.reserveSpace; | |
| setRange(axis); | |
| }); | |
| allocatedAxes = $.grep(axes, function (axis) { return axis.reserveSpace; }); | |
| plotOffset.left = plotOffset.right = plotOffset.top = plotOffset.bottom = 0; | |
| if (options.grid.show) { | |
| $.each(allocatedAxes, function (_, axis) { | |
| // make the ticks | |
| setupTickGeneration(axis); | |
| setTicks(axis); | |
| snapRangeToTicks(axis, axis.ticks); | |
| // find labelWidth/Height for axis | |
| measureTickLabels(axis); | |
| }); | |
| // with all dimensions in house, we can compute the | |
| // axis boxes, start from the outside (reverse order) | |
| for (i = allocatedAxes.length - 1; i >= 0; --i) | |
| allocateAxisBoxFirstPhase(allocatedAxes[i]); | |
| // make sure we've got enough space for things that | |
| // might stick out | |
| var minMargin = options.grid.minBorderMargin; | |
| if (minMargin == null) { | |
| minMargin = 0; | |
| for (i = 0; i < series.length; ++i) | |
| minMargin = Math.max(minMargin, series[i].points.radius + series[i].points.lineWidth/2); | |
| } | |
| for (var a in plotOffset) { | |
| plotOffset[a] += options.grid.borderWidth; | |
| plotOffset[a] = Math.max(minMargin, plotOffset[a]); | |
| } | |
| } | |
| plotWidth = canvasWidth - plotOffset.left - plotOffset.right; | |
| plotHeight = canvasHeight - plotOffset.bottom - plotOffset.top; | |
| // now we got the proper plotWidth/Height, we can compute the scaling | |
| $.each(axes, function (_, axis) { | |
| setTransformationHelpers(axis); | |
| }); | |
| if (options.grid.show) { | |
| $.each(allocatedAxes, function (_, axis) { | |
| allocateAxisBoxSecondPhase(axis); | |
| }); | |
| insertAxisLabels(); | |
| } | |
| insertLegend(); | |
| } | |
| function setRange(axis) { | |
| var opts = axis.options, | |
| min = +(opts.min != null ? opts.min : axis.datamin), | |
| max = +(opts.max != null ? opts.max : axis.datamax), | |
| delta = max - min; | |
| if (delta == 0.0) { | |
| // degenerate case | |
| var widen = max == 0 ? 1 : 0.01; | |
| if (opts.min == null) | |
| min -= widen; | |
| // always widen max if we couldn't widen min to ensure we | |
| // don't fall into min == max which doesn't work | |
| if (opts.max == null || opts.min != null) | |
| max += widen; | |
| } | |
| else { | |
| // consider autoscaling | |
| var margin = opts.autoscaleMargin; | |
| if (margin != null) { | |
| if (opts.min == null) { | |
| min -= delta * margin; | |
| // make sure we don't go below zero if all values | |
| // are positive | |
| if (min < 0 && axis.datamin != null && axis.datamin >= 0) | |
| min = 0; | |
| } | |
| if (opts.max == null) { | |
| max += delta * margin; | |
| if (max > 0 && axis.datamax != null && axis.datamax <= 0) | |
| max = 0; | |
| } | |
| } | |
| } | |
| axis.min = min; | |
| axis.max = max; | |
| } | |
| function setupTickGeneration(axis) { | |
| var opts = axis.options; | |
| // estimate number of ticks | |
| var noTicks; | |
| if (typeof opts.ticks == "number" && opts.ticks > 0) | |
| noTicks = opts.ticks; | |
| else | |
| // heuristic based on the model a*sqrt(x) fitted to | |
| // some data points that seemed reasonable | |
| noTicks = 0.3 * Math.sqrt(axis.direction == "x" ? canvasWidth : canvasHeight); | |
| var delta = (axis.max - axis.min) / noTicks, | |
| size, generator, unit, formatter, i, magn, norm; | |
| if (opts.mode == "time") { | |
| // pretty handling of time | |
| // map of app. size of time units in milliseconds | |
| var timeUnitSize = { | |
| "second": 1000, | |
| "minute": 60 * 1000, | |
| "hour": 60 * 60 * 1000, | |
| "day": 24 * 60 * 60 * 1000, | |
| "month": 30 * 24 * 60 * 60 * 1000, | |
| "year": 365.2425 * 24 * 60 * 60 * 1000 | |
| }; | |
| // the allowed tick sizes, after 1 year we use | |
| // an integer algorithm | |
| var spec = [ | |
| [1, "second"], [2, "second"], [5, "second"], [10, "second"], | |
| [30, "second"], | |
| [1, "minute"], [2, "minute"], [5, "minute"], [10, "minute"], | |
| [30, "minute"], | |
| [1, "hour"], [2, "hour"], [4, "hour"], | |
| [8, "hour"], [12, "hour"], | |
| [1, "day"], [2, "day"], [3, "day"], | |
| [0.25, "month"], [0.5, "month"], [1, "month"], | |
| [2, "month"], [3, "month"], [6, "month"], | |
| [1, "year"] | |
| ]; | |
| var minSize = 0; | |
| if (opts.minTickSize != null) { | |
| if (typeof opts.tickSize == "number") | |
| minSize = opts.tickSize; | |
| else | |
| minSize = opts.minTickSize[0] * timeUnitSize[opts.minTickSize[1]]; | |
| } | |
| for (var i = 0; i < spec.length - 1; ++i) | |
| if (delta < (spec[i][0] * timeUnitSize[spec[i][1]] | |
| + spec[i + 1][0] * timeUnitSize[spec[i + 1][1]]) / 2 | |
| && spec[i][0] * timeUnitSize[spec[i][1]] >= minSize) | |
| break; | |
| size = spec[i][0]; | |
| unit = spec[i][1]; | |
| // special-case the possibility of several years | |
| if (unit == "year") { | |
| magn = Math.pow(10, Math.floor(Math.log(delta / timeUnitSize.year) / Math.LN10)); | |
| norm = (delta / timeUnitSize.year) / magn; | |
| if (norm < 1.5) | |
| size = 1; | |
| else if (norm < 3) | |
| size = 2; | |
| else if (norm < 7.5) | |
| size = 5; | |
| else | |
| size = 10; | |
| size *= magn; | |
| } | |
| axis.tickSize = opts.tickSize || [size, unit]; | |
| generator = function(axis) { | |
| var ticks = [], | |
| tickSize = axis.tickSize[0], unit = axis.tickSize[1], | |
| d = new Date(axis.min); | |
| var step = tickSize * timeUnitSize[unit]; | |
| if (unit == "second") | |
| d.setUTCSeconds(floorInBase(d.getUTCSeconds(), tickSize)); | |
| if (unit == "minute") | |
| d.setUTCMinutes(floorInBase(d.getUTCMinutes(), tickSize)); | |
| if (unit == "hour") | |
| d.setUTCHours(floorInBase(d.getUTCHours(), tickSize)); | |
| if (unit == "month") | |
| d.setUTCMonth(floorInBase(d.getUTCMonth(), tickSize)); | |
| if (unit == "year") | |
| d.setUTCFullYear(floorInBase(d.getUTCFullYear(), tickSize)); | |
| // reset smaller components | |
| d.setUTCMilliseconds(0); | |
| if (step >= timeUnitSize.minute) | |
| d.setUTCSeconds(0); | |
| if (step >= timeUnitSize.hour) | |
| d.setUTCMinutes(0); | |
| if (step >= timeUnitSize.day) | |
| d.setUTCHours(0); | |
| if (step >= timeUnitSize.day * 4) | |
| d.setUTCDate(1); | |
| if (step >= timeUnitSize.year) | |
| d.setUTCMonth(0); | |
| var carry = 0, v = Number.NaN, prev; | |
| do { | |
| prev = v; | |
| v = d.getTime(); | |
| ticks.push(v); | |
| if (unit == "month") { | |
| if (tickSize < 1) { | |
| // a bit complicated - we'll divide the month | |
| // up but we need to take care of fractions | |
| // so we don't end up in the middle of a day | |
| d.setUTCDate(1); | |
| var start = d.getTime(); | |
| d.setUTCMonth(d.getUTCMonth() + 1); | |
| var end = d.getTime(); | |
| d.setTime(v + carry * timeUnitSize.hour + (end - start) * tickSize); | |
| carry = d.getUTCHours(); | |
| d.setUTCHours(0); | |
| } | |
| else | |
| d.setUTCMonth(d.getUTCMonth() + tickSize); | |
| } | |
| else if (unit == "year") { | |
| d.setUTCFullYear(d.getUTCFullYear() + tickSize); | |
| } | |
| else | |
| d.setTime(v + step); | |
| } while (v < axis.max && v != prev); | |
| return ticks; | |
| }; | |
| formatter = function (v, axis) { | |
| var d = new Date(v); | |
| // first check global format | |
| if (opts.timeformat != null) | |
| return $.plot.formatDate(d, opts.timeformat, opts.monthNames); | |
| var t = axis.tickSize[0] * timeUnitSize[axis.tickSize[1]]; | |
| var span = axis.max - axis.min; | |
| var suffix = (opts.twelveHourClock) ? " %p" : ""; | |
| if (t < timeUnitSize.minute) | |
| fmt = "%h:%M:%S" + suffix; | |
| else if (t < timeUnitSize.day) { | |
| if (span < 2 * timeUnitSize.day) | |
| fmt = "%h:%M" + suffix; | |
| else | |
| fmt = "%b %d %h:%M" + suffix; | |
| } | |
| else if (t < timeUnitSize.month) | |
| fmt = "%b %d"; | |
| else if (t < timeUnitSize.year) { | |
| if (span < timeUnitSize.year) | |
| fmt = "%b"; | |
| else | |
| fmt = "%b %y"; | |
| } | |
| else | |
| fmt = "%y"; | |
| return $.plot.formatDate(d, fmt, opts.monthNames); | |
| }; | |
| } | |
| else { | |
| // pretty rounding of base-10 numbers | |
| var maxDec = opts.tickDecimals; | |
| var dec = -Math.floor(Math.log(delta) / Math.LN10); | |
| if (maxDec != null && dec > maxDec) | |
| dec = maxDec; | |
| magn = Math.pow(10, -dec); | |
| norm = delta / magn; // norm is between 1.0 and 10.0 | |
| if (norm < 1.5) | |
| size = 1; | |
| else if (norm < 3) { | |
| size = 2; | |
| // special case for 2.5, requires an extra decimal | |
| if (norm > 2.25 && (maxDec == null || dec + 1 <= maxDec)) { | |
| size = 2.5; | |
| ++dec; | |
| } | |
| } | |
| else if (norm < 7.5) | |
| size = 5; | |
| else | |
| size = 10; | |
| size *= magn; | |
| if (opts.minTickSize != null && size < opts.minTickSize) | |
| size = opts.minTickSize; | |
| axis.tickDecimals = Math.max(0, maxDec != null ? maxDec : dec); | |
| axis.tickSize = opts.tickSize || size; | |
| generator = function (axis) { | |
| var ticks = []; | |
| // spew out all possible ticks | |
| var start = floorInBase(axis.min, axis.tickSize), | |
| i = 0, v = Number.NaN, prev; | |
| do { | |
| prev = v; | |
| v = start + i * axis.tickSize; | |
| ticks.push(v); | |
| ++i; | |
| } while (v < axis.max && v != prev); | |
| return ticks; | |
| }; | |
| formatter = function (v, axis) { | |
| return v.toFixed(axis.tickDecimals); | |
| }; | |
| } | |
| if (opts.alignTicksWithAxis != null) { | |
| var otherAxis = (axis.direction == "x" ? xaxes : yaxes)[opts.alignTicksWithAxis - 1]; | |
| if (otherAxis && otherAxis.used && otherAxis != axis) { | |
| // consider snapping min/max to outermost nice ticks | |
| var niceTicks = generator(axis); | |
| if (niceTicks.length > 0) { | |
| if (opts.min == null) | |
| axis.min = Math.min(axis.min, niceTicks[0]); | |
| if (opts.max == null && niceTicks.length > 1) | |
| axis.max = Math.max(axis.max, niceTicks[niceTicks.length - 1]); | |
| } | |
| generator = function (axis) { | |
| // copy ticks, scaled to this axis | |
| var ticks = [], v, i; | |
| for (i = 0; i < otherAxis.ticks.length; ++i) { | |
| v = (otherAxis.ticks[i].v - otherAxis.min) / (otherAxis.max - otherAxis.min); | |
| v = axis.min + v * (axis.max - axis.min); | |
| ticks.push(v); | |
| } | |
| return ticks; | |
| }; | |
| // we might need an extra decimal since forced | |
| // ticks don't necessarily fit naturally | |
| if (axis.mode != "time" && opts.tickDecimals == null) { | |
| var extraDec = Math.max(0, -Math.floor(Math.log(delta) / Math.LN10) + 1), | |
| ts = generator(axis); | |
| // only proceed if the tick interval rounded | |
| // with an extra decimal doesn't give us a | |
| // zero at end | |
| if (!(ts.length > 1 && /\..*0$/.test((ts[1] - ts[0]).toFixed(extraDec)))) | |
| axis.tickDecimals = extraDec; | |
| } | |
| } | |
| } | |
| axis.tickGenerator = generator; | |
| if ($.isFunction(opts.tickFormatter)) | |
| axis.tickFormatter = function (v, axis) { return "" + opts.tickFormatter(v, axis); }; | |
| else | |
| axis.tickFormatter = formatter; | |
| } | |
| function setTicks(axis) { | |
| var oticks = axis.options.ticks, ticks = []; | |
| if (oticks == null || (typeof oticks == "number" && oticks > 0)) | |
| ticks = axis.tickGenerator(axis); | |
| else if (oticks) { | |
| if ($.isFunction(oticks)) | |
| // generate the ticks | |
| ticks = oticks({ min: axis.min, max: axis.max }); | |
| else | |
| ticks = oticks; | |
| } | |
| // clean up/labelify the supplied ticks, copy them over | |
| var i, v; | |
| axis.ticks = []; | |
| for (i = 0; i < ticks.length; ++i) { | |
| var label = null; | |
| var t = ticks[i]; | |
| if (typeof t == "object") { | |
| v = +t[0]; | |
| if (t.length > 1) | |
| label = t[1]; | |
| } | |
| else | |
| v = +t; | |
| if (label == null) | |
| label = axis.tickFormatter(v, axis); | |
| if (!isNaN(v)) | |
| axis.ticks.push({ v: v, label: label }); | |
| } | |
| } | |
| function snapRangeToTicks(axis, ticks) { | |
| if (axis.options.autoscaleMargin && ticks.length > 0) { | |
| // snap to ticks | |
| if (axis.options.min == null) | |
| axis.min = Math.min(axis.min, ticks[0].v); | |
| if (axis.options.max == null && ticks.length > 1) | |
| axis.max = Math.max(axis.max, ticks[ticks.length - 1].v); | |
| } | |
| } | |
| function draw() { | |
| ctx.clearRect(0, 0, canvasWidth, canvasHeight); | |
| var grid = options.grid; | |
| // draw background, if any | |
| if (grid.show && grid.backgroundColor) | |
| drawBackground(); | |
| if (grid.show && !grid.aboveData) | |
| drawGrid(); | |
| for (var i = 0; i < series.length; ++i) { | |
| executeHooks(hooks.drawSeries, [ctx, series[i]]); | |
| drawSeries(series[i]); | |
| } | |
| executeHooks(hooks.draw, [ctx]); | |
| if (grid.show && grid.aboveData) | |
| drawGrid(); | |
| } | |
| function extractRange(ranges, coord) { | |
| var axis, from, to, key, axes = allAxes(); | |
| for (i = 0; i < axes.length; ++i) { | |
| axis = axes[i]; | |
| if (axis.direction == coord) { | |
| key = coord + axis.n + "axis"; | |
| if (!ranges[key] && axis.n == 1) | |
| key = coord + "axis"; // support x1axis as xaxis | |
| if (ranges[key]) { | |
| from = ranges[key].from; | |
| to = ranges[key].to; | |
| break; | |
| } | |
| } | |
| } | |
| // backwards-compat stuff - to be removed in future | |
| if (!ranges[key]) { | |
| axis = coord == "x" ? xaxes[0] : yaxes[0]; | |
| from = ranges[coord + "1"]; | |
| to = ranges[coord + "2"]; | |
| } | |
| // auto-reverse as an added bonus | |
| if (from != null && to != null && from > to) { | |
| var tmp = from; | |
| from = to; | |
| to = tmp; | |
| } | |
| return { from: from, to: to, axis: axis }; | |
| } | |
| function drawBackground() { | |
| ctx.save(); | |
| ctx.translate(plotOffset.left, plotOffset.top); | |
| ctx.fillStyle = getColorOrGradient(options.grid.backgroundColor, plotHeight, 0, "rgba(255, 255, 255, 0)"); | |
| ctx.fillRect(0, 0, plotWidth, plotHeight); | |
| ctx.restore(); | |
| } | |
| function drawGrid() { | |
| var i; | |
| ctx.save(); | |
| ctx.translate(plotOffset.left, plotOffset.top); | |
| // draw markings | |
| var markings = options.grid.markings; | |
| if (markings) { | |
| if ($.isFunction(markings)) { | |
| var axes = plot.getAxes(); | |
| // xmin etc. is backwards compatibility, to be | |
| // removed in the future | |
| axes.xmin = axes.xaxis.min; | |
| axes.xmax = axes.xaxis.max; | |
| axes.ymin = axes.yaxis.min; | |
| axes.ymax = axes.yaxis.max; | |
| markings = markings(axes); | |
| } | |
| for (i = 0; i < markings.length; ++i) { | |
| var m = markings[i], | |
| xrange = extractRange(m, "x"), | |
| yrange = extractRange(m, "y"); | |
| // fill in missing | |
| if (xrange.from == null) | |
| xrange.from = xrange.axis.min; | |
| if (xrange.to == null) | |
| xrange.to = xrange.axis.max; | |
| if (yrange.from == null) | |
| yrange.from = yrange.axis.min; | |
| if (yrange.to == null) | |
| yrange.to = yrange.axis.max; | |
| // clip | |
| if (xrange.to < xrange.axis.min || xrange.from > xrange.axis.max || | |
| yrange.to < yrange.axis.min || yrange.from > yrange.axis.max) | |
| continue; | |
| xrange.from = Math.max(xrange.from, xrange.axis.min); | |
| xrange.to = Math.min(xrange.to, xrange.axis.max); | |
| yrange.from = Math.max(yrange.from, yrange.axis.min); | |
| yrange.to = Math.min(yrange.to, yrange.axis.max); | |
| if (xrange.from == xrange.to && yrange.from == yrange.to) | |
| continue; | |
| // then draw | |
| xrange.from = xrange.axis.p2c(xrange.from); | |
| xrange.to = xrange.axis.p2c(xrange.to); | |
| yrange.from = yrange.axis.p2c(yrange.from); | |
| yrange.to = yrange.axis.p2c(yrange.to); | |
| if (xrange.from == xrange.to || yrange.from == yrange.to) { | |
| // draw line | |
| ctx.beginPath(); | |
| ctx.strokeStyle = m.color || options.grid.markingsColor; | |
| ctx.lineWidth = m.lineWidth || options.grid.markingsLineWidth; | |
| ctx.moveTo(xrange.from, yrange.from); | |
| ctx.lineTo(xrange.to, yrange.to); | |
| ctx.stroke(); | |
| } | |
| else { | |
| // fill area | |
| ctx.fillStyle = m.color || options.grid.markingsColor; | |
| ctx.fillRect(xrange.from, yrange.to, | |
| xrange.to - xrange.from, | |
| yrange.from - yrange.to); | |
| } | |
| } | |
| } | |
| // draw the ticks | |
| var axes = allAxes(), bw = options.grid.borderWidth; | |
| for (var j = 0; j < axes.length; ++j) { | |
| var axis = axes[j], box = axis.box, | |
| t = axis.tickLength, x, y, xoff, yoff; | |
| if (!axis.show || axis.ticks.length == 0) | |
| continue | |
| ctx.strokeStyle = axis.options.tickColor || $.color.parse(axis.options.color).scale('a', 0.22).toString(); | |
| ctx.lineWidth = 1; | |
| // find the edges | |
| if (axis.direction == "x") { | |
| x = 0; | |
| if (t == "full") | |
| y = (axis.position == "top" ? 0 : plotHeight); | |
| else | |
| y = box.top - plotOffset.top + (axis.position == "top" ? box.height : 0); | |
| } | |
| else { | |
| y = 0; | |
| if (t == "full") | |
| x = (axis.position == "left" ? 0 : plotWidth); | |
| else | |
| x = box.left - plotOffset.left + (axis.position == "left" ? box.width : 0); | |
| } | |
| // draw tick bar | |
| if (!axis.innermost) { | |
| ctx.beginPath(); | |
| xoff = yoff = 0; | |
| if (axis.direction == "x") | |
| xoff = plotWidth; | |
| else | |
| yoff = plotHeight; | |
| if (ctx.lineWidth == 1) { | |
| x = Math.floor(x) + 0.5; | |
| y = Math.floor(y) + 0.5; | |
| } | |
| ctx.moveTo(x, y); | |
| ctx.lineTo(x + xoff, y + yoff); | |
| ctx.stroke(); | |
| } | |
| // draw ticks | |
| ctx.beginPath(); | |
| for (i = 0; i < axis.ticks.length; ++i) { | |
| var v = axis.ticks[i].v; | |
| xoff = yoff = 0; | |
| if (v < axis.min || v > axis.max | |
| // skip those lying on the axes if we got a border | |
| || (t == "full" && bw > 0 | |
| && (v == axis.min || v == axis.max))) | |
| continue; | |
| if (axis.direction == "x") { | |
| x = axis.p2c(v); | |
| yoff = t == "full" ? -plotHeight : t; | |
| if (axis.position == "top") | |
| yoff = -yoff; | |
| } | |
| else { | |
| y = axis.p2c(v); | |
| xoff = t == "full" ? -plotWidth : t; | |
| if (axis.position == "left") | |
| xoff = -xoff; | |
| } | |
| if (ctx.lineWidth == 1) { | |
| if (axis.direction == "x") | |
| x = Math.floor(x) + 0.5; | |
| else | |
| y = Math.floor(y) + 0.5; | |
| } | |
| ctx.moveTo(x, y); | |
| ctx.lineTo(x + xoff, y + yoff); | |
| } | |
| ctx.stroke(); | |
| } | |
| // draw border | |
| if (bw) { | |
| ctx.lineWidth = bw; | |
| ctx.strokeStyle = options.grid.borderColor; | |
| ctx.strokeRect(-bw/2, -bw/2, plotWidth + bw, plotHeight + bw); | |
| } | |
| ctx.restore(); | |
| } | |
| function insertAxisLabels() { | |
| placeholder.find(".tickLabels").remove(); | |
| var html = ['<div class="tickLabels" style="font-size:smaller">']; | |
| var axes = allAxes(); | |
| for (var j = 0; j < axes.length; ++j) { | |
| var axis = axes[j], box = axis.box; | |
| if (!axis.show) | |
| continue; | |
| //debug: html.push('<div style="position:absolute;opacity:0.10;background-color:red;left:' + box.left + 'px;top:' + box.top + 'px;width:' + box.width + 'px;height:' + box.height + 'px"></div>') | |
| html.push('<div class="' + axis.direction + 'Axis ' + axis.direction + axis.n + 'Axis" style="color:' + axis.options.color + '">'); | |
| for (var i = 0; i < axis.ticks.length; ++i) { | |
| var tick = axis.ticks[i]; | |
| if (!tick.label || tick.v < axis.min || tick.v > axis.max) | |
| continue; | |
| var pos = {}, align; | |
| if (axis.direction == "x") { | |
| align = "center"; | |
| pos.left = Math.round(plotOffset.left + axis.p2c(tick.v) - axis.labelWidth/2); | |
| if (axis.position == "bottom") | |
| pos.top = box.top + box.padding; | |
| else | |
| pos.bottom = canvasHeight - (box.top + box.height - box.padding); | |
| } | |
| else { | |
| pos.top = Math.round(plotOffset.top + axis.p2c(tick.v) - axis.labelHeight/2); | |
| if (axis.position == "left") { | |
| pos.right = canvasWidth - (box.left + box.width - box.padding) | |
| align = "right"; | |
| } | |
| else { | |
| pos.left = box.left + box.padding; | |
| align = "left"; | |
| } | |
| } | |
| pos.width = axis.labelWidth; | |
| var style = ["position:absolute", "text-align:" + align ]; | |
| for (var a in pos) | |
| style.push(a + ":" + pos[a] + "px") | |
| html.push('<div class="tickLabel" style="' + style.join(';') + '">' + tick.label + '</div>'); | |
| } | |
| html.push('</div>'); | |
| } | |
| html.push('</div>'); | |
| placeholder.append(html.join("")); | |
| } | |
| function drawSeries(series) { | |
| if (series.lines.show) | |
| drawSeriesLines(series); | |
| if (series.bars.show) | |
| drawSeriesBars(series); | |
| if (series.points.show) | |
| drawSeriesPoints(series); | |
| } | |
| function drawSeriesLines(series) { | |
| function plotLine(datapoints, xoffset, yoffset, axisx, axisy) { | |
| var points = datapoints.points, | |
| ps = datapoints.pointsize, | |
| prevx = null, prevy = null; | |
| ctx.beginPath(); | |
| for (var i = ps; i < points.length; i += ps) { | |
| var x1 = points[i - ps], y1 = points[i - ps + 1], | |
| x2 = points[i], y2 = points[i + 1]; | |
| if (x1 == null || x2 == null) | |
| continue; | |
| // clip with ymin | |
| if (y1 <= y2 && y1 < axisy.min) { | |
| if (y2 < axisy.min) | |
| continue; // line segment is outside | |
| // compute new intersection point | |
| x1 = (axisy.min - y1) / (y2 - y1) * (x2 - x1) + x1; | |
| y1 = axisy.min; | |
| } | |
| else if (y2 <= y1 && y2 < axisy.min) { | |
| if (y1 < axisy.min) | |
| continue; | |
| x2 = (axisy.min - y1) / (y2 - y1) * (x2 - x1) + x1; | |
| y2 = axisy.min; | |
| } | |
| // clip with ymax | |
| if (y1 >= y2 && y1 > axisy.max) { | |
| if (y2 > axisy.max) | |
| continue; | |
| x1 = (axisy.max - y1) / (y2 - y1) * (x2 - x1) + x1; | |
| y1 = axisy.max; | |
| } | |
| else if (y2 >= y1 && y2 > axisy.max) { | |
| if (y1 > axisy.max) | |
| continue; | |
| x2 = (axisy.max - y1) / (y2 - y1) * (x2 - x1) + x1; | |
| y2 = axisy.max; | |
| } | |
| // clip with xmin | |
| if (x1 <= x2 && x1 < axisx.min) { | |
| if (x2 < axisx.min) | |
| continue; | |
| y1 = (axisx.min - x1) / (x2 - x1) * (y2 - y1) + y1; | |
| x1 = axisx.min; | |
| } | |
| else if (x2 <= x1 && x2 < axisx.min) { | |
| if (x1 < axisx.min) | |
| continue; | |
| y2 = (axisx.min - x1) / (x2 - x1) * (y2 - y1) + y1; | |
| x2 = axisx.min; | |
| } | |
| // clip with xmax | |
| if (x1 >= x2 && x1 > axisx.max) { | |
| if (x2 > axisx.max) | |
| continue; | |
| y1 = (axisx.max - x1) / (x2 - x1) * (y2 - y1) + y1; | |
| x1 = axisx.max; | |
| } | |
| else if (x2 >= x1 && x2 > axisx.max) { | |
| if (x1 > axisx.max) | |
| continue; | |
| y2 = (axisx.max - x1) / (x2 - x1) * (y2 - y1) + y1; | |
| x2 = axisx.max; | |
| } | |
| if (x1 != prevx || y1 != prevy) | |
| ctx.moveTo(axisx.p2c(x1) + xoffset, axisy.p2c(y1) + yoffset); | |
| prevx = x2; | |
| prevy = y2; | |
| ctx.lineTo(axisx.p2c(x2) + xoffset, axisy.p2c(y2) + yoffset); | |
| } | |
| ctx.stroke(); | |
| } | |
| function plotLineArea(datapoints, axisx, axisy) { | |
| var points = datapoints.points, | |
| ps = datapoints.pointsize, | |
| bottom = Math.min(Math.max(0, axisy.min), axisy.max), | |
| i = 0, top, areaOpen = false, | |
| ypos = 1, segmentStart = 0, segmentEnd = 0; | |
| // we process each segment in two turns, first forward | |
| // direction to sketch out top, then once we hit the | |
| // end we go backwards to sketch the bottom | |
| while (true) { | |
| if (ps > 0 && i > points.length + ps) | |
| break; | |
| i += ps; // ps is negative if going backwards | |
| var x1 = points[i - ps], | |
| y1 = points[i - ps + ypos], | |
| x2 = points[i], y2 = points[i + ypos]; | |
| if (areaOpen) { | |
| if (ps > 0 && x1 != null && x2 == null) { | |
| // at turning point | |
| segmentEnd = i; | |
| ps = -ps; | |
| ypos = 2; | |
| continue; | |
| } | |
| if (ps < 0 && i == segmentStart + ps) { | |
| // done with the reverse sweep | |
| ctx.fill(); | |
| areaOpen = false; | |
| ps = -ps; | |
| ypos = 1; | |
| i = segmentStart = segmentEnd + ps; | |
| continue; | |
| } | |
| } | |
| if (x1 == null || x2 == null) | |
| continue; | |
| // clip x values | |
| // clip with xmin | |
| if (x1 <= x2 && x1 < axisx.min) { | |
| if (x2 < axisx.min) | |
| continue; | |
| y1 = (axisx.min - x1) / (x2 - x1) * (y2 - y1) + y1; | |
| x1 = axisx.min; | |
| } | |
| else if (x2 <= x1 && x2 < axisx.min) { | |
| if (x1 < axisx.min) | |
| continue; | |
| y2 = (axisx.min - x1) / (x2 - x1) * (y2 - y1) + y1; | |
| x2 = axisx.min; | |
| } | |
| // clip with xmax | |
| if (x1 >= x2 && x1 > axisx.max) { | |
| if (x2 > axisx.max) | |
| continue; | |
| y1 = (axisx.max - x1) / (x2 - x1) * (y2 - y1) + y1; | |
| x1 = axisx.max; | |
| } | |
| else if (x2 >= x1 && x2 > axisx.max) { | |
| if (x1 > axisx.max) | |
| continue; | |
| y2 = (axisx.max - x1) / (x2 - x1) * (y2 - y1) + y1; | |
| x2 = axisx.max; | |
| } | |
| if (!areaOpen) { | |
| // open area | |
| ctx.beginPath(); | |
| ctx.moveTo(axisx.p2c(x1), axisy.p2c(bottom)); | |
| areaOpen = true; | |
| } | |
| // now first check the case where both is outside | |
| if (y1 >= axisy.max && y2 >= axisy.max) { | |
| ctx.lineTo(axisx.p2c(x1), axisy.p2c(axisy.max)); | |
| ctx.lineTo(axisx.p2c(x2), axisy.p2c(axisy.max)); | |
| continue; | |
| } | |
| else if (y1 <= axisy.min && y2 <= axisy.min) { | |
| ctx.lineTo(axisx.p2c(x1), axisy.p2c(axisy.min)); | |
| ctx.lineTo(axisx.p2c(x2), axisy.p2c(axisy.min)); | |
| continue; | |
| } | |
| // else it's a bit more complicated, there might | |
| // be a flat maxed out rectangle first, then a | |
| // triangular cutout or reverse; to find these | |
| // keep track of the current x values | |
| var x1old = x1, x2old = x2; | |
| // clip the y values, without shortcutting, we | |
| // go through all cases in turn | |
| // clip with ymin | |
| if (y1 <= y2 && y1 < axisy.min && y2 >= axisy.min) { | |
| x1 = (axisy.min - y1) / (y2 - y1) * (x2 - x1) + x1; | |
| y1 = axisy.min; | |
| } | |
| else if (y2 <= y1 && y2 < axisy.min && y1 >= axisy.min) { | |
| x2 = (axisy.min - y1) / (y2 - y1) * (x2 - x1) + x1; | |
| y2 = axisy.min; | |
| } | |
| // clip with ymax | |
| if (y1 >= y2 && y1 > axisy.max && y2 <= axisy.max) { | |
| x1 = (axisy.max - y1) / (y2 - y1) * (x2 - x1) + x1; | |
| y1 = axisy.max; | |
| } | |
| else if (y2 >= y1 && y2 > axisy.max && y1 <= axisy.max) { | |
| x2 = (axisy.max - y1) / (y2 - y1) * (x2 - x1) + x1; | |
| y2 = axisy.max; | |
| } | |
| // if the x value was changed we got a rectangle | |
| // to fill | |
| if (x1 != x1old) { | |
| ctx.lineTo(axisx.p2c(x1old), axisy.p2c(y1)); | |
| // it goes to (x1, y1), but we fill that below | |
| } | |
| // fill triangular section, this sometimes result | |
| // in redundant points if (x1, y1) hasn't changed | |
| // from previous line to, but we just ignore that | |
| ctx.lineTo(axisx.p2c(x1), axisy.p2c(y1)); | |
| ctx.lineTo(axisx.p2c(x2), axisy.p2c(y2)); | |
| // fill the other rectangle if it's there | |
| if (x2 != x2old) { | |
| ctx.lineTo(axisx.p2c(x2), axisy.p2c(y2)); | |
| ctx.lineTo(axisx.p2c(x2old), axisy.p2c(y2)); | |
| } | |
| } | |
| } | |
| ctx.save(); | |
| ctx.translate(plotOffset.left, plotOffset.top); | |
| ctx.lineJoin = "round"; | |
| var lw = series.lines.lineWidth, | |
| sw = series.shadowSize; | |
| // FIXME: consider another form of shadow when filling is turned on | |
| if (lw > 0 && sw > 0) { | |
| // draw shadow as a thick and thin line with transparency | |
| ctx.lineWidth = sw; | |
| ctx.strokeStyle = "rgba(0,0,0,0.1)"; | |
| // position shadow at angle from the mid of line | |
| var angle = Math.PI/18; | |
| plotLine(series.datapoints, Math.sin(angle) * (lw/2 + sw/2), Math.cos(angle) * (lw/2 + sw/2), series.xaxis, series.yaxis); | |
| ctx.lineWidth = sw/2; | |
| plotLine(series.datapoints, Math.sin(angle) * (lw/2 + sw/4), Math.cos(angle) * (lw/2 + sw/4), series.xaxis, series.yaxis); | |
| } | |
| ctx.lineWidth = lw; | |
| ctx.strokeStyle = series.color; | |
| var fillStyle = getFillStyle(series.lines, series.color, 0, plotHeight); | |
| if (fillStyle) { | |
| ctx.fillStyle = fillStyle; | |
| plotLineArea(series.datapoints, series.xaxis, series.yaxis); | |
| } | |
| if (lw > 0) | |
| plotLine(series.datapoints, 0, 0, series.xaxis, series.yaxis); | |
| ctx.restore(); | |
| } | |
| function drawSeriesPoints(series) { | |
| function plotPoints(datapoints, radius, fillStyle, offset, shadow, axisx, axisy, symbol) { | |
| var points = datapoints.points, ps = datapoints.pointsize; | |
| for (var i = 0; i < points.length; i += ps) { | |
| var x = points[i], y = points[i + 1]; | |
| if (x == null || x < axisx.min || x > axisx.max || y < axisy.min || y > axisy.max) | |
| continue; | |
| ctx.beginPath(); | |
| x = axisx.p2c(x); | |
| y = axisy.p2c(y) + offset; | |
| if (symbol == "circle") | |
| ctx.arc(x, y, radius, 0, shadow ? Math.PI : Math.PI * 2, false); | |
| else | |
| symbol(ctx, x, y, radius, shadow); | |
| ctx.closePath(); | |
| if (fillStyle) { | |
| ctx.fillStyle = fillStyle; | |
| ctx.fill(); | |
| } | |
| ctx.stroke(); | |
| } | |
| } | |
| ctx.save(); | |
| ctx.translate(plotOffset.left, plotOffset.top); | |
| var lw = series.points.lineWidth, | |
| sw = series.shadowSize, | |
| radius = series.points.radius, | |
| symbol = series.points.symbol; | |
| if (lw > 0 && sw > 0) { | |
| // draw shadow in two steps | |
| var w = sw / 2; | |
| ctx.lineWidth = w; | |
| ctx.strokeStyle = "rgba(0,0,0,0.1)"; | |
| plotPoints(series.datapoints, radius, null, w + w/2, true, | |
| series.xaxis, series.yaxis, symbol); | |
| ctx.strokeStyle = "rgba(0,0,0,0.2)"; | |
| plotPoints(series.datapoints, radius, null, w/2, true, | |
| series.xaxis, series.yaxis, symbol); | |
| } | |
| ctx.lineWidth = lw; | |
| ctx.strokeStyle = series.color; | |
| plotPoints(series.datapoints, radius, | |
| getFillStyle(series.points, series.color), 0, false, | |
| series.xaxis, series.yaxis, symbol); | |
| ctx.restore(); | |
| } | |
| function drawBar(x, y, b, barLeft, barRight, offset, fillStyleCallback, axisx, axisy, c, horizontal, lineWidth) { | |
| var left, right, bottom, top, | |
| drawLeft, drawRight, drawTop, drawBottom, | |
| tmp; | |
| // in horizontal mode, we start the bar from the left | |
| // instead of from the bottom so it appears to be | |
| // horizontal rather than vertical | |
| if (horizontal) { | |
| drawBottom = drawRight = drawTop = true; | |
| drawLeft = false; | |
| left = b; | |
| right = x; | |
| top = y + barLeft; | |
| bottom = y + barRight; | |
| // account for negative bars | |
| if (right < left) { | |
| tmp = right; | |
| right = left; | |
| left = tmp; | |
| drawLeft = true; | |
| drawRight = false; | |
| } | |
| } | |
| else { | |
| drawLeft = drawRight = drawTop = true; | |
| drawBottom = false; | |
| left = x + barLeft; | |
| right = x + barRight; | |
| bottom = b; | |
| top = y; | |
| // account for negative bars | |
| if (top < bottom) { | |
| tmp = top; | |
| top = bottom; | |
| bottom = tmp; | |
| drawBottom = true; | |
| drawTop = false; | |
| } | |
| } | |
| // clip | |
| if (right < axisx.min || left > axisx.max || | |
| top < axisy.min || bottom > axisy.max) | |
| return; | |
| if (left < axisx.min) { | |
| left = axisx.min; | |
| drawLeft = false; | |
| } | |
| if (right > axisx.max) { | |
| right = axisx.max; | |
| drawRight = false; | |
| } | |
| if (bottom < axisy.min) { | |
| bottom = axisy.min; | |
| drawBottom = false; | |
| } | |
| if (top > axisy.max) { | |
| top = axisy.max; | |
| drawTop = false; | |
| } | |
| left = axisx.p2c(left); | |
| bottom = axisy.p2c(bottom); | |
| right = axisx.p2c(right); | |
| top = axisy.p2c(top); | |
| // fill the bar | |
| if (fillStyleCallback) { | |
| c.beginPath(); | |
| c.moveTo(left, bottom); | |
| c.lineTo(left, top); | |
| c.lineTo(right, top); | |
| c.lineTo(right, bottom); | |
| c.fillStyle = fillStyleCallback(bottom, top); | |
| c.fill(); | |
| } | |
| // draw outline | |
| if (lineWidth > 0 && (drawLeft || drawRight || drawTop || drawBottom)) { | |
| c.beginPath(); | |
| // FIXME: inline moveTo is buggy with excanvas | |
| c.moveTo(left, bottom + offset); | |
| if (drawLeft) | |
| c.lineTo(left, top + offset); | |
| else | |
| c.moveTo(left, top + offset); | |
| if (drawTop) | |
| c.lineTo(right, top + offset); | |
| else | |
| c.moveTo(right, top + offset); | |
| if (drawRight) | |
| c.lineTo(right, bottom + offset); | |
| else | |
| c.moveTo(right, bottom + offset); | |
| if (drawBottom) | |
| c.lineTo(left, bottom + offset); | |
| else | |
| c.moveTo(left, bottom + offset); | |
| c.stroke(); | |
| } | |
| } | |
| function drawSeriesBars(series) { | |
| function plotBars(datapoints, barLeft, barRight, offset, fillStyleCallback, axisx, axisy) { | |
| var points = datapoints.points, ps = datapoints.pointsize; | |
| for (var i = 0; i < points.length; i += ps) { | |
| if (points[i] == null) | |
| continue; | |
| drawBar(points[i], points[i + 1], points[i + 2], barLeft, barRight, offset, fillStyleCallback, axisx, axisy, ctx, series.bars.horizontal, series.bars.lineWidth); | |
| } | |
| } | |
| ctx.save(); | |
| ctx.translate(plotOffset.left, plotOffset.top); | |
| // FIXME: figure out a way to add shadows (for instance along the right edge) | |
| ctx.lineWidth = series.bars.lineWidth; | |
| ctx.strokeStyle = series.color; | |
| var barLeft = series.bars.align == "left" ? 0 : -series.bars.barWidth/2; | |
| var fillStyleCallback = series.bars.fill ? function (bottom, top) { return getFillStyle(series.bars, series.color, bottom, top); } : null; | |
| plotBars(series.datapoints, barLeft, barLeft + series.bars.barWidth, 0, fillStyleCallback, series.xaxis, series.yaxis); | |
| ctx.restore(); | |
| } | |
| function getFillStyle(filloptions, seriesColor, bottom, top) { | |
| var fill = filloptions.fill; | |
| if (!fill) | |
| return null; | |
| if (filloptions.fillColor) | |
| return getColorOrGradient(filloptions.fillColor, bottom, top, seriesColor); | |
| var c = $.color.parse(seriesColor); | |
| c.a = typeof fill == "number" ? fill : 0.4; | |
| c.normalize(); | |
| return c.toString(); | |
| } | |
| function insertLegend() { | |
| placeholder.find(".legend").remove(); | |
| if (!options.legend.show) | |
| return; | |
| var fragments = [], rowStarted = false, | |
| lf = options.legend.labelFormatter, s, label; | |
| for (var i = 0; i < series.length; ++i) { | |
| s = series[i]; | |
| label = s.label; | |
| if (!label) | |
| continue; | |
| if (i % options.legend.noColumns == 0) { | |
| if (rowStarted) | |
| fragments.push('</tr>'); | |
| fragments.push('<tr>'); | |
| rowStarted = true; | |
| } | |
| if (lf) | |
| label = lf(label, s); | |
| fragments.push( | |
| '<td class="legendColorBox"><div style="border:1px solid ' + options.legend.labelBoxBorderColor + ';padding:1px"><div style="width:4px;height:0;border:5px solid ' + s.color + ';overflow:hidden"></div></div></td>' + | |
| '<td class="legendLabel">' + label + '</td>'); | |
| } | |
| if (rowStarted) | |
| fragments.push('</tr>'); | |
| if (fragments.length == 0) | |
| return; | |
| var table = '<table style="font-size:smaller;color:' + options.grid.color + '">' + fragments.join("") + '</table>'; | |
| if (options.legend.container != null) | |
| $(options.legend.container).html(table); | |
| else { | |
| var pos = "", | |
| p = options.legend.position, | |
| m = options.legend.margin; | |
| if (m[0] == null) | |
| m = [m, m]; | |
| if (p.charAt(0) == "n") | |
| pos += 'top:' + (m[1] + plotOffset.top) + 'px;'; | |
| else if (p.charAt(0) == "s") | |
| pos += 'bottom:' + (m[1] + plotOffset.bottom) + 'px;'; | |
| if (p.charAt(1) == "e") | |
| pos += 'right:' + (m[0] + plotOffset.right) + 'px;'; | |
| else if (p.charAt(1) == "w") | |
| pos += 'left:' + (m[0] + plotOffset.left) + 'px;'; | |
| var legend = $('<div class="legend">' + table.replace('style="', 'style="position:absolute;' + pos +';') + '</div>').appendTo(placeholder); | |
| if (options.legend.backgroundOpacity != 0.0) { | |
| // put in the transparent background | |
| // separately to avoid blended labels and | |
| // label boxes | |
| var c = options.legend.backgroundColor; | |
| if (c == null) { | |
| c = options.grid.backgroundColor; | |
| if (c && typeof c == "string") | |
| c = $.color.parse(c); | |
| else | |
| c = $.color.extract(legend, 'background-color'); | |
| c.a = 1; | |
| c = c.toString(); | |
| } | |
| var div = legend.children(); | |
| $('<div style="position:absolute;width:' + div.width() + 'px;height:' + div.height() + 'px;' + pos +'background-color:' + c + ';"> </div>').prependTo(legend).css('opacity', options.legend.backgroundOpacity); | |
| } | |
| } | |
| } | |
| // interactive features | |
| var highlights = [], | |
| redrawTimeout = null; | |
| // returns the data item the mouse is over, or null if none is found | |
| function findNearbyItem(mouseX, mouseY, seriesFilter) { | |
| var maxDistance = options.grid.mouseActiveRadius, | |
| smallestDistance = maxDistance * maxDistance + 1, | |
| item = null, foundPoint = false, i, j; | |
| for (i = series.length - 1; i >= 0; --i) { | |
| if (!seriesFilter(series[i])) | |
| continue; | |
| var s = series[i], | |
| axisx = s.xaxis, | |
| axisy = s.yaxis, | |
| points = s.datapoints.points, | |
| ps = s.datapoints.pointsize, | |
| mx = axisx.c2p(mouseX), // precompute some stuff to make the loop faster | |
| my = axisy.c2p(mouseY), | |
| maxx = maxDistance / axisx.scale, | |
| maxy = maxDistance / axisy.scale; | |
| // with inverse transforms, we can't use the maxx/maxy | |
| // optimization, sadly | |
| if (axisx.options.inverseTransform) | |
| maxx = Number.MAX_VALUE; | |
| if (axisy.options.inverseTransform) | |
| maxy = Number.MAX_VALUE; | |
| if (s.lines.show || s.points.show) { | |
| for (j = 0; j < points.length; j += ps) { | |
| var x = points[j], y = points[j + 1]; | |
| if (x == null) | |
| continue; | |
| // For points and lines, the cursor must be within a | |
| // certain distance to the data point | |
| if (x - mx > maxx || x - mx < -maxx || | |
| y - my > maxy || y - my < -maxy) | |
| continue; | |
| // We have to calculate distances in pixels, not in | |
| // data units, because the scales of the axes may be different | |
| var dx = Math.abs(axisx.p2c(x) - mouseX), | |
| dy = Math.abs(axisy.p2c(y) - mouseY), | |
| dist = dx * dx + dy * dy; // we save the sqrt | |
| // use <= to ensure last point takes precedence | |
| // (last generally means on top of) | |
| if (dist < smallestDistance) { | |
| smallestDistance = dist; | |
| item = [i, j / ps]; | |
| } | |
| } | |
| } | |
| if (s.bars.show && !item) { // no other point can be nearby | |
| var barLeft = s.bars.align == "left" ? 0 : -s.bars.barWidth/2, | |
| barRight = barLeft + s.bars.barWidth; | |
| for (j = 0; j < points.length; j += ps) { | |
| var x = points[j], y = points[j + 1], b = points[j + 2]; | |
| if (x == null) | |
| continue; | |
| // for a bar graph, the cursor must be inside the bar | |
| if (series[i].bars.horizontal ? | |
| (mx <= Math.max(b, x) && mx >= Math.min(b, x) && | |
| my >= y + barLeft && my <= y + barRight) : | |
| (mx >= x + barLeft && mx <= x + barRight && | |
| my >= Math.min(b, y) && my <= Math.max(b, y))) | |
| item = [i, j / ps]; | |
| } | |
| } | |
| } | |
| if (item) { | |
| i = item[0]; | |
| j = item[1]; | |
| ps = series[i].datapoints.pointsize; | |
| return { datapoint: series[i].datapoints.points.slice(j * ps, (j + 1) * ps), | |
| dataIndex: j, | |
| series: series[i], | |
| seriesIndex: i }; | |
| } | |
| return null; | |
| } | |
| function onMouseMove(e) { | |
| if (options.grid.hoverable) | |
| triggerClickHoverEvent("plothover", e, | |
| function (s) { return s["hoverable"] != false; }); | |
| } | |
| function onMouseLeave(e) { | |
| if (options.grid.hoverable) | |
| triggerClickHoverEvent("plothover", e, | |
| function (s) { return false; }); | |
| } | |
| function onClick(e) { | |
| triggerClickHoverEvent("plotclick", e, | |
| function (s) { return s["clickable"] != false; }); | |
| } | |
| // trigger click or hover event (they send the same parameters | |
| // so we share their code) | |
| function triggerClickHoverEvent(eventname, event, seriesFilter) { | |
| var offset = eventHolder.offset(), | |
| canvasX = event.pageX - offset.left - plotOffset.left, | |
| canvasY = event.pageY - offset.top - plotOffset.top, | |
| pos = canvasToAxisCoords({ left: canvasX, top: canvasY }); | |
| pos.pageX = event.pageX; | |
| pos.pageY = event.pageY; | |
| var item = findNearbyItem(canvasX, canvasY, seriesFilter); | |
| if (item) { | |
| // fill in mouse pos for any listeners out there | |
| item.pageX = parseInt(item.series.xaxis.p2c(item.datapoint[0]) + offset.left + plotOffset.left); | |
| item.pageY = parseInt(item.series.yaxis.p2c(item.datapoint[1]) + offset.top + plotOffset.top); | |
| } | |
| if (options.grid.autoHighlight) { | |
| // clear auto-highlights | |
| for (var i = 0; i < highlights.length; ++i) { | |
| var h = highlights[i]; | |
| if (h.auto == eventname && | |
| !(item && h.series == item.series && | |
| h.point[0] == item.datapoint[0] && | |
| h.point[1] == item.datapoint[1])) | |
| unhighlight(h.series, h.point); | |
| } | |
| if (item) | |
| highlight(item.series, item.datapoint, eventname); | |
| } | |
| placeholder.trigger(eventname, [ pos, item ]); | |
| } | |
| function triggerRedrawOverlay() { | |
| if (!redrawTimeout) | |
| redrawTimeout = setTimeout(drawOverlay, 30); | |
| } | |
| function drawOverlay() { | |
| redrawTimeout = null; | |
| // draw highlights | |
| octx.save(); | |
| octx.clearRect(0, 0, canvasWidth, canvasHeight); | |
| octx.translate(plotOffset.left, plotOffset.top); | |
| var i, hi; | |
| for (i = 0; i < highlights.length; ++i) { | |
| hi = highlights[i]; | |
| if (hi.series.bars.show) | |
| drawBarHighlight(hi.series, hi.point); | |
| else | |
| drawPointHighlight(hi.series, hi.point); | |
| } | |
| octx.restore(); | |
| executeHooks(hooks.drawOverlay, [octx]); | |
| } | |
| function highlight(s, point, auto) { | |
| if (typeof s == "number") | |
| s = series[s]; | |
| if (typeof point == "number") { | |
| var ps = s.datapoints.pointsize; | |
| point = s.datapoints.points.slice(ps * point, ps * (point + 1)); | |
| } | |
| var i = indexOfHighlight(s, point); | |
| if (i == -1) { | |
| highlights.push({ series: s, point: point, auto: auto }); | |
| triggerRedrawOverlay(); | |
| } | |
| else if (!auto) | |
| highlights[i].auto = false; | |
| } | |
| function unhighlight(s, point) { | |
| if (s == null && point == null) { | |
| highlights = []; | |
| triggerRedrawOverlay(); | |
| } | |
| if (typeof s == "number") | |
| s = series[s]; | |
| if (typeof point == "number") | |
| point = s.data[point]; | |
| var i = indexOfHighlight(s, point); | |
| if (i != -1) { | |
| highlights.splice(i, 1); | |
| triggerRedrawOverlay(); | |
| } | |
| } | |
| function indexOfHighlight(s, p) { | |
| for (var i = 0; i < highlights.length; ++i) { | |
| var h = highlights[i]; | |
| if (h.series == s && h.point[0] == p[0] | |
| && h.point[1] == p[1]) | |
| return i; | |
| } | |
| return -1; | |
| } | |
| function drawPointHighlight(series, point) { | |
| var x = point[0], y = point[1], | |
| axisx = series.xaxis, axisy = series.yaxis; | |
| if (x < axisx.min || x > axisx.max || y < axisy.min || y > axisy.max) | |
| return; | |
| var pointRadius = series.points.radius + series.points.lineWidth / 2; | |
| octx.lineWidth = pointRadius; | |
| octx.strokeStyle = $.color.parse(series.color).scale('a', 0.5).toString(); | |
| var radius = 1.5 * pointRadius, | |
| x = axisx.p2c(x), | |
| y = axisy.p2c(y); | |
| octx.beginPath(); | |
| if (series.points.symbol == "circle") | |
| octx.arc(x, y, radius, 0, 2 * Math.PI, false); | |
| else | |
| series.points.symbol(octx, x, y, radius, false); | |
| octx.closePath(); | |
| octx.stroke(); | |
| } | |
| function drawBarHighlight(series, point) { | |
| octx.lineWidth = series.bars.lineWidth; | |
| octx.strokeStyle = $.color.parse(series.color).scale('a', 0.5).toString(); | |
| var fillStyle = $.color.parse(series.color).scale('a', 0.5).toString(); | |
| var barLeft = series.bars.align == "left" ? 0 : -series.bars.barWidth/2; | |
| drawBar(point[0], point[1], point[2] || 0, barLeft, barLeft + series.bars.barWidth, | |
| 0, function () { return fillStyle; }, series.xaxis, series.yaxis, octx, series.bars.horizontal, series.bars.lineWidth); | |
| } | |
| function getColorOrGradient(spec, bottom, top, defaultColor) { | |
| if (typeof spec == "string") | |
| return spec; | |
| else { | |
| // assume this is a gradient spec; IE currently only | |
| // supports a simple vertical gradient properly, so that's | |
| // what we support too | |
| var gradient = ctx.createLinearGradient(0, top, 0, bottom); | |
| for (var i = 0, l = spec.colors.length; i < l; ++i) { | |
| var c = spec.colors[i]; | |
| if (typeof c != "string") { | |
| var co = $.color.parse(defaultColor); | |
| if (c.brightness != null) | |
| co = co.scale('rgb', c.brightness) | |
| if (c.opacity != null) | |
| co.a *= c.opacity; | |
| c = co.toString(); | |
| } | |
| gradient.addColorStop(i / (l - 1), c); | |
| } | |
| return gradient; | |
| } | |
| } | |
| } | |
| $.plot = function(placeholder, data, options) { | |
| //var t0 = new Date(); | |
| var plot = new Plot($(placeholder), data, options, $.plot.plugins); | |
| //(window.console ? console.log : alert)("time used (msecs): " + ((new Date()).getTime() - t0.getTime())); | |
| return plot; | |
| }; | |
| $.plot.version = "0.7"; | |
| $.plot.plugins = []; | |
| // returns a string with the date d formatted according to fmt | |
| $.plot.formatDate = function(d, fmt, monthNames) { | |
| var leftPad = function(n) { | |
| n = "" + n; | |
| return n.length == 1 ? "0" + n : n; | |
| }; | |
| var r = []; | |
| var escape = false, padNext = false; | |
| var hours = d.getUTCHours(); | |
| var isAM = hours < 12; | |
| if (monthNames == null) | |
| monthNames = ["Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug", "Sep", "Oct", "Nov", "Dec"]; | |
| if (fmt.search(/%p|%P/) != -1) { | |
| if (hours > 12) { | |
| hours = hours - 12; | |
| } else if (hours == 0) { | |
| hours = 12; | |
| } | |
| } | |
| for (var i = 0; i < fmt.length; ++i) { | |
| var c = fmt.charAt(i); | |
| if (escape) { | |
| switch (c) { | |
| case 'h': c = "" + hours; break; | |
| case 'H': c = leftPad(hours); break; | |
| case 'M': c = leftPad(d.getUTCMinutes()); break; | |
| case 'S': c = leftPad(d.getUTCSeconds()); break; | |
| case 'd': c = "" + d.getUTCDate(); break; | |
| case 'm': c = "" + (d.getUTCMonth() + 1); break; | |
| case 'y': c = "" + d.getUTCFullYear(); break; | |
| case 'b': c = "" + monthNames[d.getUTCMonth()]; break; | |
| case 'p': c = (isAM) ? ("" + "am") : ("" + "pm"); break; | |
| case 'P': c = (isAM) ? ("" + "AM") : ("" + "PM"); break; | |
| case '0': c = ""; padNext = true; break; | |
| } | |
| if (c && padNext) { | |
| c = leftPad(c); | |
| padNext = false; | |
| } | |
| r.push(c); | |
| if (!padNext) | |
| escape = false; | |
| } | |
| else { | |
| if (c == "%") | |
| escape = true; | |
| else | |
| r.push(c); | |
| } | |
| } | |
| return r.join(""); | |
| }; | |
| // round to nearby lower multiple of base | |
| function floorInBase(n, base) { | |
| return base * Math.floor(n / base); | |
| } | |
| })(jQuery); | |
| /* Javascript plotting library for jQuery, v. 0.7. | |
| * | |
| * Released under the MIT license by IOLA, December 2007. | |
| * | |
| */ | |
| (function(b){b.color={};b.color.make=function(d,e,g,f){var c={};c.r=d||0;c.g=e||0;c.b=g||0;c.a=f!=null?f:1;c.add=function(h,j){for(var k=0;k<h.length;++k){c[h.charAt(k)]+=j}return c.normalize()};c.scale=function(h,j){for(var k=0;k<h.length;++k){c[h.charAt(k)]*=j}return c.normalize()};c.toString=function(){if(c.a>=1){return"rgb("+[c.r,c.g,c.b].join(",")+")"}else{return"rgba("+[c.r,c.g,c.b,c.a].join(",")+")"}};c.normalize=function(){function h(k,j,l){return j<k?k:(j>l?l:j)}c.r=h(0,parseInt(c.r),255);c.g=h(0,parseInt(c.g),255);c.b=h(0,parseInt(c.b),255);c.a=h(0,c.a,1);return c};c.clone=function(){return b.color.make(c.r,c.b,c.g,c.a)};return c.normalize()};b.color.extract=function(d,e){var c;do{c=d.css(e).toLowerCase();if(c!=""&&c!="transparent"){break}d=d.parent()}while(!b.nodeName(d.get(0),"body"));if(c=="rgba(0, 0, 0, 0)"){c="transparent"}return b.color.parse(c)};b.color.parse=function(c){var d,f=b.color.make;if(d=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(c)){return f(parseInt(d[1],10),parseInt(d[2],10),parseInt(d[3],10))}if(d=/rgba\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(c)){return f(parseInt(d[1],10),parseInt(d[2],10),parseInt(d[3],10),parseFloat(d[4]))}if(d=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(c)){return f(parseFloat(d[1])*2.55,parseFloat(d[2])*2.55,parseFloat(d[3])*2.55)}if(d=/rgba\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(c)){return f(parseFloat(d[1])*2.55,parseFloat(d[2])*2.55,parseFloat(d[3])*2.55,parseFloat(d[4]))}if(d=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(c)){return f(parseInt(d[1],16),parseInt(d[2],16),parseInt(d[3],16))}if(d=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(c)){return f(parseInt(d[1]+d[1],16),parseInt(d[2]+d[2],16),parseInt(d[3]+d[3],16))}var e=b.trim(c).toLowerCase();if(e=="transparent"){return f(255,255,255,0)}else{d=a[e]||[0,0,0];return f(d[0],d[1],d[2])}};var a={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0]}})(jQuery);(function(c){function b(av,ai,J,af){var Q=[],O={colors:["#edc240","#afd8f8","#cb4b4b","#4da74d","#9440ed"],legend:{show:true,noColumns:1,labelFormatter:null,labelBoxBorderColor:"#ccc",container:null,position:"ne",margin:5,backgroundColor:null,backgroundOpacity:0.85},xaxis:{show:null,position:"bottom",mode:null,color:null,tickColor:null,transform:null,inverseTransform:null,min:null,max:null,autoscaleMargin:null,ticks:null,tickFormatter:null,labelWidth:null,labelHeight:null,reserveSpace:null,tickLength:null,alignTicksWithAxis:null,tickDecimals:null,tickSize:null,minTickSize:null,monthNames:null,timeformat:null,twelveHourClock:false},yaxis:{autoscaleMargin:0.02,position:"left"},xaxes:[],yaxes:[],series:{points:{show:false,radius:3,lineWidth:2,fill:true,fillColor:"#ffffff",symbol:"circle"},lines:{lineWidth:2,fill:false,fillColor:null,steps:false},bars:{show:false,lineWidth:2,barWidth:1,fill:true,fillColor:null,align:"left",horizontal:false},shadowSize:3},grid:{show:true,aboveData:false,color:"#545454",backgroundColor:null,borderColor:null,tickColor:null,labelMargin:5,axisMargin:8,borderWidth:2,minBorderMargin:null,markings:null,markingsColor:"#f4f4f4",markingsLineWidth:2,clickable:false,hoverable:false,autoHighlight:true,mouseActiveRadius:10},hooks:{}},az=null,ad=null,y=null,H=null,A=null,p=[],aw=[],q={left:0,right:0,top:0,bottom:0},G=0,I=0,h=0,w=0,ak={processOptions:[],processRawData:[],processDatapoints:[],drawSeries:[],draw:[],bindEvents:[],drawOverlay:[],shutdown:[]},aq=this;aq.setData=aj;aq.setupGrid=t;aq.draw=W;aq.getPlaceholder=function(){return av};aq.getCanvas=function(){return az};aq.getPlotOffset=function(){return q};aq.width=function(){return h};aq.height=function(){return w};aq.offset=function(){var aB=y.offset();aB.left+=q.left;aB.top+=q.top;return aB};aq.getData=function(){return Q};aq.getAxes=function(){var aC={},aB;c.each(p.concat(aw),function(aD,aE){if(aE){aC[aE.direction+(aE.n!=1?aE.n:"")+"axis"]=aE}});return aC};aq.getXAxes=function(){return p};aq.getYAxes=function(){return aw};aq.c2p=C;aq.p2c=ar;aq.getOptions=function(){return O};aq.highlight=x;aq.unhighlight=T;aq.triggerRedrawOverlay=f;aq.pointOffset=function(aB){return{left:parseInt(p[aA(aB,"x")-1].p2c(+aB.x)+q.left),top:parseInt(aw[aA(aB,"y")-1].p2c(+aB.y)+q.top)}};aq.shutdown=ag;aq.resize=function(){B();g(az);g(ad)};aq.hooks=ak;F(aq);Z(J);X();aj(ai);t();W();ah();function an(aD,aB){aB=[aq].concat(aB);for(var aC=0;aC<aD.length;++aC){aD[aC].apply(this,aB)}}function F(){for(var aB=0;aB<af.length;++aB){var aC=af[aB];aC.init(aq);if(aC.options){c.extend(true,O,aC.options)}}}function Z(aC){var aB;c.extend(true,O,aC);if(O.xaxis.color==null){O.xaxis.color=O.grid.color}if(O.yaxis.color==null){O.yaxis.color=O.grid.color}if(O.xaxis.tickColor==null){O.xaxis.tickColor=O.grid.tickColor}if(O.yaxis.tickColor==null){O.yaxis.tickColor=O.grid.tickColor}if(O.grid.borderColor==null){O.grid.borderColor=O.grid.color}if(O.grid.tickColor==null){O.grid.tickColor=c.color.parse(O.grid.color).scale("a",0.22).toString()}for(aB=0;aB<Math.max(1,O.xaxes.length);++aB){O.xaxes[aB]=c.extend(true,{},O.xaxis,O.xaxes[aB])}for(aB=0;aB<Math.max(1,O.yaxes.length);++aB){O.yaxes[aB]=c.extend(true,{},O.yaxis,O.yaxes[aB])}if(O.xaxis.noTicks&&O.xaxis.ticks==null){O.xaxis.ticks=O.xaxis.noTicks}if(O.yaxis.noTicks&&O.yaxis.ticks==null){O.yaxis.ticks=O.yaxis.noTicks}if(O.x2axis){O.xaxes[1]=c.extend(true,{},O.xaxis,O.x2axis);O.xaxes[1].position="top"}if(O.y2axis){O.yaxes[1]=c.extend(true,{},O.yaxis,O.y2axis);O.yaxes[1].position="right"}if(O.grid.coloredAreas){O.grid.markings=O.grid.coloredAreas}if(O.grid.coloredAreasColor){O.grid.markingsColor=O.grid.coloredAreasColor}if(O.lines){c.extend(true,O.series.lines,O.lines)}if(O.points){c.extend(true,O.series.points,O.points)}if(O.bars){c.extend(true,O.series.bars,O.bars)}if(O.shadowSize!=null){O.series.shadowSize=O.shadowSize}for(aB=0;aB<O.xaxes.length;++aB){V(p,aB+1).options=O.xaxes[aB]}for(aB=0;aB<O.yaxes.length;++aB){V(aw,aB+1).options=O.yaxes[aB]}for(var aD in ak){if(O.hooks[aD]&&O.hooks[aD].length){ak[aD]=ak[aD].concat(O.hooks[aD])}}an(ak.processOptions,[O])}function aj(aB){Q=Y(aB);ax();z()}function Y(aE){var aC=[];for(var aB=0;aB<aE.length;++aB){var aD=c.extend(true,{},O.series);if(aE[aB].data!=null){aD.data=aE[aB].data;delete aE[aB].data;c.extend(true,aD,aE[aB]);aE[aB].data=aD.data}else{aD.data=aE[aB]}aC.push(aD)}return aC}function aA(aC,aD){var aB=aC[aD+"axis"];if(typeof aB=="object"){aB=aB.n}if(typeof aB!="number"){aB=1}return aB}function m(){return c.grep(p.concat(aw),function(aB){return aB})}function C(aE){var aC={},aB,aD;for(aB=0;aB<p.length;++aB){aD=p[aB];if(aD&&aD.used){aC["x"+aD.n]=aD.c2p(aE.left)}}for(aB=0;aB<aw.length;++aB){aD=aw[aB];if(aD&&aD.used){aC["y"+aD.n]=aD.c2p(aE.top)}}if(aC.x1!==undefined){aC.x=aC.x1}if(aC.y1!==undefined){aC.y=aC.y1}return aC}function ar(aF){var aD={},aC,aE,aB;for(aC=0;aC<p.length;++aC){aE=p[aC];if(aE&&aE.used){aB="x"+aE.n;if(aF[aB]==null&&aE.n==1){aB="x"}if(aF[aB]!=null){aD.left=aE.p2c(aF[aB]);break}}}for(aC=0;aC<aw.length;++aC){aE=aw[aC];if(aE&&aE.used){aB="y"+aE.n;if(aF[aB]==null&&aE.n==1){aB="y"}if(aF[aB]!=null){aD.top=aE.p2c(aF[aB]);break}}}return aD}function V(aC,aB){if(!aC[aB-1]){aC[aB-1]={n:aB,direction:aC==p?"x":"y",options:c.extend(true,{},aC==p?O.xaxis:O.yaxis)}}return aC[aB-1]}function ax(){var aG;var aM=Q.length,aB=[],aE=[];for(aG=0;aG<Q.length;++aG){var aJ=Q[aG].color;if(aJ!=null){--aM;if(typeof aJ=="number"){aE.push(aJ)}else{aB.push(c.color.parse(Q[aG].color))}}}for(aG=0;aG<aE.length;++aG){aM=Math.max(aM,aE[aG]+1)}var aC=[],aF=0;aG=0;while(aC.length<aM){var aI;if(O.colors.length==aG){aI=c.color.make(100,100,100)}else{aI=c.color.parse(O.colors[aG])}var aD=aF%2==1?-1:1;aI.scale("rgb",1+aD*Math.ceil(aF/2)*0.2);aC.push(aI);++aG;if(aG>=O.colors.length){aG=0;++aF}}var aH=0,aN;for(aG=0;aG<Q.length;++aG){aN=Q[aG];if(aN.color==null){aN.color=aC[aH].toString();++aH}else{if(typeof aN.color=="number"){aN.color=aC[aN.color].toString()}}if(aN.lines.show==null){var aL,aK=true;for(aL in aN){if(aN[aL]&&aN[aL].show){aK=false;break}}if(aK){aN.lines.show=true}}aN.xaxis=V(p,aA(aN,"x"));aN.yaxis=V(aw,aA(aN,"y"))}}function z(){var aO=Number.POSITIVE_INFINITY,aI=Number.NEGATIVE_INFINITY,aB=Number.MAX_VALUE,aU,aS,aR,aN,aD,aJ,aT,aP,aH,aG,aC,a0,aX,aL;function aF(a3,a2,a1){if(a2<a3.datamin&&a2!=-aB){a3.datamin=a2}if(a1>a3.datamax&&a1!=aB){a3.datamax=a1}}c.each(m(),function(a1,a2){a2.datamin=aO;a2.datamax=aI;a2.used=false});for(aU=0;aU<Q.length;++aU){aJ=Q[aU];aJ.datapoints={points:[]};an(ak.processRawData,[aJ,aJ.data,aJ.datapoints])}for(aU=0;aU<Q.length;++aU){aJ=Q[aU];var aZ=aJ.data,aW=aJ.datapoints.format;if(!aW){aW=[];aW.push({x:true,number:true,required:true});aW.push({y:true,number:true,required:true});if(aJ.bars.show||(aJ.lines.show&&aJ.lines.fill)){aW.push({y:true,number:true,required:false,defaultValue:0});if(aJ.bars.horizontal){delete aW[aW.length-1].y;aW[aW.length-1].x=true}}aJ.datapoints.format=aW}if(aJ.datapoints.pointsize!=null){continue}aJ.datapoints.pointsize=aW.length;aP=aJ.datapoints.pointsize;aT=aJ.datapoints.points;insertSteps=aJ.lines.show&&aJ.lines.steps;aJ.xaxis.used=aJ.yaxis.used=true;for(aS=aR=0;aS<aZ.length;++aS,aR+=aP){aL=aZ[aS];var aE=aL==null;if(!aE){for(aN=0;aN<aP;++aN){a0=aL[aN];aX=aW[aN];if(aX){if(aX.number&&a0!=null){a0=+a0;if(isNaN(a0)){a0=null}else{if(a0==Infinity){a0=aB}else{if(a0==-Infinity){a0=-aB}}}}if(a0==null){if(aX.required){aE=true}if(aX.defaultValue!=null){a0=aX.defaultValue}}}aT[aR+aN]=a0}}if(aE){for(aN=0;aN<aP;++aN){a0=aT[aR+aN];if(a0!=null){aX=aW[aN];if(aX.x){aF(aJ.xaxis,a0,a0)}if(aX.y){aF(aJ.yaxis,a0,a0)}}aT[aR+aN]=null}}else{if(insertSteps&&aR>0&&aT[aR-aP]!=null&&aT[aR-aP]!=aT[aR]&&aT[aR-aP+1]!=aT[aR+1]){for(aN=0;aN<aP;++aN){aT[aR+aP+aN]=aT[aR+aN]}aT[aR+1]=aT[aR-aP+1];aR+=aP}}}}for(aU=0;aU<Q.length;++aU){aJ=Q[aU];an(ak.processDatapoints,[aJ,aJ.datapoints])}for(aU=0;aU<Q.length;++aU){aJ=Q[aU];aT=aJ.datapoints.points,aP=aJ.datapoints.pointsize;var aK=aO,aQ=aO,aM=aI,aV=aI;for(aS=0;aS<aT.length;aS+=aP){if(aT[aS]==null){continue}for(aN=0;aN<aP;++aN){a0=aT[aS+aN];aX=aW[aN];if(!aX||a0==aB||a0==-aB){continue}if(aX.x){if(a0<aK){aK=a0}if(a0>aM){aM=a0}}if(aX.y){if(a0<aQ){aQ=a0}if(a0>aV){aV=a0}}}}if(aJ.bars.show){var aY=aJ.bars.align=="left"?0:-aJ.bars.barWidth/2;if(aJ.bars.horizontal){aQ+=aY;aV+=aY+aJ.bars.barWidth}else{aK+=aY;aM+=aY+aJ.bars.barWidth}}aF(aJ.xaxis,aK,aM);aF(aJ.yaxis,aQ,aV)}c.each(m(),function(a1,a2){if(a2.datamin==aO){a2.datamin=null}if(a2.datamax==aI){a2.datamax=null}})}function j(aB,aC){var aD=document.createElement("canvas");aD.className=aC;aD.width=G;aD.height=I;if(!aB){c(aD).css({position:"absolute",left:0,top:0})}c(aD).appendTo(av);if(!aD.getContext){aD=window.G_vmlCanvasManager.initElement(aD)}aD.getContext("2d").save();return aD}function B(){G=av.width();I=av.height();if(G<=0||I<=0){throw"Invalid dimensions for plot, width = "+G+", height = "+I}}function g(aC){if(aC.width!=G){aC.width=G}if(aC.height!=I){aC.height=I}var aB=aC.getContext("2d");aB.restore();aB.save()}function X(){var aC,aB=av.children("canvas.base"),aD=av.children("canvas.overlay");if(aB.length==0||aD==0){av.html("");av.css({padding:0});if(av.css("position")=="static"){av.css("position","relative")}B();az=j(true,"base");ad=j(false,"overlay");aC=false}else{az=aB.get(0);ad=aD.get(0);aC=true}H=az.getContext("2d");A=ad.getContext("2d");y=c([ad,az]);if(aC){av.data("plot").shutdown();aq.resize();A.clearRect(0,0,G,I);y.unbind();av.children().not([az,ad]).remove()}av.data("plot",aq)}function ah(){if(O.grid.hoverable){y.mousemove(aa);y.mouseleave(l)}if(O.grid.clickable){y.click(R)}an(ak.bindEvents,[y])}function ag(){if(M){clearTimeout(M)}y.unbind("mousemove",aa);y.unbind("mouseleave",l);y.unbind("click",R);an(ak.shutdown,[y])}function r(aG){function aC(aH){return aH}var aF,aB,aD=aG.options.transform||aC,aE=aG.options.inverseTransform;if(aG.direction=="x"){aF=aG.scale=h/Math.abs(aD(aG.max)-aD(aG.min));aB=Math.min(aD(aG.max),aD(aG.min))}else{aF=aG.scale=w/Math.abs(aD(aG.max)-aD(aG.min));aF=-aF;aB=Math.max(aD(aG.max),aD(aG.min))}if(aD==aC){aG.p2c=function(aH){return(aH-aB)*aF}}else{aG.p2c=function(aH){return(aD(aH)-aB)*aF}}if(!aE){aG.c2p=function(aH){return aB+aH/aF}}else{aG.c2p=function(aH){return aE(aB+aH/aF)}}}function L(aD){var aB=aD.options,aF,aJ=aD.ticks||[],aI=[],aE,aK=aB.labelWidth,aG=aB.labelHeight,aC;function aH(aM,aL){return c('<div style="position:absolute;top:-10000px;'+aL+'font-size:smaller"><div class="'+aD.direction+"Axis "+aD.direction+aD.n+'Axis">'+aM.join("")+"</div></div>").appendTo(av)}if(aD.direction=="x"){if(aK==null){aK=Math.floor(G/(aJ.length>0?aJ.length:1))}if(aG==null){aI=[];for(aF=0;aF<aJ.length;++aF){aE=aJ[aF].label;if(aE){aI.push('<div class="tickLabel" style="float:left;width:'+aK+'px">'+aE+"</div>")}}if(aI.length>0){aI.push('<div style="clear:left"></div>');aC=aH(aI,"width:10000px;");aG=aC.height();aC.remove()}}}else{if(aK==null||aG==null){for(aF=0;aF<aJ.length;++aF){aE=aJ[aF].label;if(aE){aI.push('<div class="tickLabel">'+aE+"</div>")}}if(aI.length>0){aC=aH(aI,"");if(aK==null){aK=aC.children().width()}if(aG==null){aG=aC.find("div.tickLabel").height()}aC.remove()}}}if(aK==null){aK=0}if(aG==null){aG=0}aD.labelWidth=aK;aD.labelHeight=aG}function au(aD){var aC=aD.labelWidth,aL=aD.labelHeight,aH=aD.options.position,aF=aD.options.tickLength,aG=O.grid.axisMargin,aJ=O.grid.labelMargin,aK=aD.direction=="x"?p:aw,aE;var aB=c.grep(aK,function(aN){return aN&&aN.options.position==aH&&aN.reserveSpace});if(c.inArray(aD,aB)==aB.length-1){aG=0}if(aF==null){aF="full"}var aI=c.grep(aK,function(aN){return aN&&aN.reserveSpace});var aM=c.inArray(aD,aI)==0;if(!aM&&aF=="full"){aF=5}if(!isNaN(+aF)){aJ+=+aF}if(aD.direction=="x"){aL+=aJ;if(aH=="bottom"){q.bottom+=aL+aG;aD.box={top:I-q.bottom,height:aL}}else{aD.box={top:q.top+aG,height:aL};q.top+=aL+aG}}else{aC+=aJ;if(aH=="left"){aD.box={left:q.left+aG,width:aC};q.left+=aC+aG}else{q.right+=aC+aG;aD.box={left:G-q.right,width:aC}}}aD.position=aH;aD.tickLength=aF;aD.box.padding=aJ;aD.innermost=aM}function U(aB){if(aB.direction=="x"){aB.box.left=q.left;aB.box.width=h}else{aB.box.top=q.top;aB.box.height=w}}function t(){var aC,aE=m();c.each(aE,function(aF,aG){aG.show=aG.options.show;if(aG.show==null){aG.show=aG.used}aG.reserveSpace=aG.show||aG.options.reserveSpace;n(aG)});allocatedAxes=c.grep(aE,function(aF){return aF.reserveSpace});q.left=q.right=q.top=q.bottom=0;if(O.grid.show){c.each(allocatedAxes,function(aF,aG){S(aG);P(aG);ap(aG,aG.ticks);L(aG)});for(aC=allocatedAxes.length-1;aC>=0;--aC){au(allocatedAxes[aC])}var aD=O.grid.minBorderMargin;if(aD==null){aD=0;for(aC=0;aC<Q.length;++aC){aD=Math.max(aD,Q[aC].points.radius+Q[aC].points.lineWidth/2)}}for(var aB in q){q[aB]+=O.grid.borderWidth;q[aB]=Math.max(aD,q[aB])}}h=G-q.left-q.right;w=I-q.bottom-q.top;c.each(aE,function(aF,aG){r(aG)});if(O.grid.show){c.each(allocatedAxes,function(aF,aG){U(aG)});k()}o()}function n(aE){var aF=aE.options,aD=+(aF.min!=null?aF.min:aE.datamin),aB=+(aF.max!=null?aF.max:aE.datamax),aH=aB-aD;if(aH==0){var aC=aB==0?1:0.01;if(aF.min==null){aD-=aC}if(aF.max==null||aF.min!=null){aB+=aC}}else{var aG=aF.autoscaleMargin;if(aG!=null){if(aF.min==null){aD-=aH*aG;if(aD<0&&aE.datamin!=null&&aE.datamin>=0){aD=0}}if(aF.max==null){aB+=aH*aG;if(aB>0&&aE.datamax!=null&&aE.datamax<=0){aB=0}}}}aE.min=aD;aE.max=aB}function S(aG){var aM=aG.options;var aH;if(typeof aM.ticks=="number"&&aM.ticks>0){aH=aM.ticks}else{aH=0.3*Math.sqrt(aG.direction=="x"?G:I)}var aT=(aG.max-aG.min)/aH,aO,aB,aN,aR,aS,aQ,aI;if(aM.mode=="time"){var aJ={second:1000,minute:60*1000,hour:60*60*1000,day:24*60*60*1000,month:30*24*60*60*1000,year:365.2425*24*60*60*1000};var aK=[[1,"second"],[2,"second"],[5,"second"],[10,"second"],[30,"second"],[1,"minute"],[2,"minute"],[5,"minute"],[10,"minute"],[30,"minute"],[1,"hour"],[2,"hour"],[4,"hour"],[8,"hour"],[12,"hour"],[1,"day"],[2,"day"],[3,"day"],[0.25,"month"],[0.5,"month"],[1,"month"],[2,"month"],[3,"month"],[6,"month"],[1,"year"]];var aC=0;if(aM.minTickSize!=null){if(typeof aM.tickSize=="number"){aC=aM.tickSize}else{aC=aM.minTickSize[0]*aJ[aM.minTickSize[1]]}}for(var aS=0;aS<aK.length-1;++aS){if(aT<(aK[aS][0]*aJ[aK[aS][1]]+aK[aS+1][0]*aJ[aK[aS+1][1]])/2&&aK[aS][0]*aJ[aK[aS][1]]>=aC){break}}aO=aK[aS][0];aN=aK[aS][1];if(aN=="year"){aQ=Math.pow(10,Math.floor(Math.log(aT/aJ.year)/Math.LN10));aI=(aT/aJ.year)/aQ;if(aI<1.5){aO=1}else{if(aI<3){aO=2}else{if(aI<7.5){aO=5}else{aO=10}}}aO*=aQ}aG.tickSize=aM.tickSize||[aO,aN];aB=function(aX){var a2=[],a0=aX.tickSize[0],a3=aX.tickSize[1],a1=new Date(aX.min);var aW=a0*aJ[a3];if(a3=="second"){a1.setUTCSeconds(a(a1.getUTCSeconds(),a0))}if(a3=="minute"){a1.setUTCMinutes(a(a1.getUTCMinutes(),a0))}if(a3=="hour"){a1.setUTCHours(a(a1.getUTCHours(),a0))}if(a3=="month"){a1.setUTCMonth(a(a1.getUTCMonth(),a0))}if(a3=="year"){a1.setUTCFullYear(a(a1.getUTCFullYear(),a0))}a1.setUTCMilliseconds(0);if(aW>=aJ.minute){a1.setUTCSeconds(0)}if(aW>=aJ.hour){a1.setUTCMinutes(0)}if(aW>=aJ.day){a1.setUTCHours(0)}if(aW>=aJ.day*4){a1.setUTCDate(1)}if(aW>=aJ.year){a1.setUTCMonth(0)}var a5=0,a4=Number.NaN,aY;do{aY=a4;a4=a1.getTime();a2.push(a4);if(a3=="month"){if(a0<1){a1.setUTCDate(1);var aV=a1.getTime();a1.setUTCMonth(a1.getUTCMonth()+1);var aZ=a1.getTime();a1.setTime(a4+a5*aJ.hour+(aZ-aV)*a0);a5=a1.getUTCHours();a1.setUTCHours(0)}else{a1.setUTCMonth(a1.getUTCMonth()+a0)}}else{if(a3=="year"){a1.setUTCFullYear(a1.getUTCFullYear()+a0)}else{a1.setTime(a4+aW)}}}while(a4<aX.max&&a4!=aY);return a2};aR=function(aV,aY){var a0=new Date(aV);if(aM.timeformat!=null){return c.plot.formatDate(a0,aM.timeformat,aM.monthNames)}var aW=aY.tickSize[0]*aJ[aY.tickSize[1]];var aX=aY.max-aY.min;var aZ=(aM.twelveHourClock)?" %p":"";if(aW<aJ.minute){fmt="%h:%M:%S"+aZ}else{if(aW<aJ.day){if(aX<2*aJ.day){fmt="%h:%M"+aZ}else{fmt="%b %d %h:%M"+aZ}}else{if(aW<aJ.month){fmt="%b %d"}else{if(aW<aJ.year){if(aX<aJ.year){fmt="%b"}else{fmt="%b %y"}}else{fmt="%y"}}}}return c.plot.formatDate(a0,fmt,aM.monthNames)}}else{var aU=aM.tickDecimals;var aP=-Math.floor(Math.log(aT)/Math.LN10);if(aU!=null&&aP>aU){aP=aU}aQ=Math.pow(10,-aP);aI=aT/aQ;if(aI<1.5){aO=1}else{if(aI<3){aO=2;if(aI>2.25&&(aU==null||aP+1<=aU)){aO=2.5;++aP}}else{if(aI<7.5){aO=5}else{aO=10}}}aO*=aQ;if(aM.minTickSize!=null&&aO<aM.minTickSize){aO=aM.minTickSize}aG.tickDecimals=Math.max(0,aU!=null?aU:aP);aG.tickSize=aM.tickSize||aO;aB=function(aX){var aZ=[];var a0=a(aX.min,aX.tickSize),aW=0,aV=Number.NaN,aY;do{aY=aV;aV=a0+aW*aX.tickSize;aZ.push(aV);++aW}while(aV<aX.max&&aV!=aY);return aZ};aR=function(aV,aW){return aV.toFixed(aW.tickDecimals)}}if(aM.alignTicksWithAxis!=null){var aF=(aG.direction=="x"?p:aw)[aM.alignTicksWithAxis-1];if(aF&&aF.used&&aF!=aG){var aL=aB(aG);if(aL.length>0){if(aM.min==null){aG.min=Math.min(aG.min,aL[0])}if(aM.max==null&&aL.length>1){aG.max=Math.max(aG.max,aL[aL.length-1])}}aB=function(aX){var aY=[],aV,aW;for(aW=0;aW<aF.ticks.length;++aW){aV=(aF.ticks[aW].v-aF.min)/(aF.max-aF.min);aV=aX.min+aV*(aX.max-aX.min);aY.push(aV)}return aY};if(aG.mode!="time"&&aM.tickDecimals==null){var aE=Math.max(0,-Math.floor(Math.log(aT)/Math.LN10)+1),aD=aB(aG);if(!(aD.length>1&&/\..*0$/.test((aD[1]-aD[0]).toFixed(aE)))){aG.tickDecimals=aE}}}}aG.tickGenerator=aB;if(c.isFunction(aM.tickFormatter)){aG.tickFormatter=function(aV,aW){return""+aM.tickFormatter(aV,aW)}}else{aG.tickFormatter=aR}}function P(aF){var aH=aF.options.ticks,aG=[];if(aH==null||(typeof aH=="number"&&aH>0)){aG=aF.tickGenerator(aF)}else{if(aH){if(c.isFunction(aH)){aG=aH({min:aF.min,max:aF.max})}else{aG=aH}}}var aE,aB;aF.ticks=[];for(aE=0;aE<aG.length;++aE){var aC=null;var aD=aG[aE];if(typeof aD=="object"){aB=+aD[0];if(aD.length>1){aC=aD[1]}}else{aB=+aD}if(aC==null){aC=aF.tickFormatter(aB,aF)}if(!isNaN(aB)){aF.ticks.push({v:aB,label:aC})}}}function ap(aB,aC){if(aB.options.autoscaleMargin&&aC.length>0){if(aB.options.min==null){aB.min=Math.min(aB.min,aC[0].v)}if(aB.options.max==null&&aC.length>1){aB.max=Math.max(aB.max,aC[aC.length-1].v)}}}function W(){H.clearRect(0,0,G,I);var aC=O.grid;if(aC.show&&aC.backgroundColor){N()}if(aC.show&&!aC.aboveData){ac()}for(var aB=0;aB<Q.length;++aB){an(ak.drawSeries,[H,Q[aB]]);d(Q[aB])}an(ak.draw,[H]);if(aC.show&&aC.aboveData){ac()}}function D(aB,aI){var aE,aH,aG,aD,aF=m();for(i=0;i<aF.length;++i){aE=aF[i];if(aE.direction==aI){aD=aI+aE.n+"axis";if(!aB[aD]&&aE.n==1){aD=aI+"axis"}if(aB[aD]){aH=aB[aD].from;aG=aB[aD].to;break}}}if(!aB[aD]){aE=aI=="x"?p[0]:aw[0];aH=aB[aI+"1"];aG=aB[aI+"2"]}if(aH!=null&&aG!=null&&aH>aG){var aC=aH;aH=aG;aG=aC}return{from:aH,to:aG,axis:aE}}function N(){H.save();H.translate(q.left,q.top);H.fillStyle=am(O.grid.backgroundColor,w,0,"rgba(255, 255, 255, 0)");H.fillRect(0,0,h,w);H.restore()}function ac(){var aF;H.save();H.translate(q.left,q.top);var aH=O.grid.markings;if(aH){if(c.isFunction(aH)){var aK=aq.getAxes();aK.xmin=aK.xaxis.min;aK.xmax=aK.xaxis.max;aK.ymin=aK.yaxis.min;aK.ymax=aK.yaxis.max;aH=aH(aK)}for(aF=0;aF<aH.length;++aF){var aD=aH[aF],aC=D(aD,"x"),aI=D(aD,"y");if(aC.from==null){aC.from=aC.axis.min}if(aC.to==null){aC.to=aC.axis.max}if(aI.from==null){aI.from=aI.axis.min}if(aI.to==null){aI.to=aI.axis.max}if(aC.to<aC.axis.min||aC.from>aC.axis.max||aI.to<aI.axis.min||aI.from>aI.axis.max){continue}aC.from=Math.max(aC.from,aC.axis.min);aC.to=Math.min(aC.to,aC.axis.max);aI.from=Math.max(aI.from,aI.axis.min);aI.to=Math.min(aI.to,aI.axis.max);if(aC.from==aC.to&&aI.from==aI.to){continue}aC.from=aC.axis.p2c(aC.from);aC.to=aC.axis.p2c(aC.to);aI.from=aI.axis.p2c(aI.from);aI.to=aI.axis.p2c(aI.to);if(aC.from==aC.to||aI.from==aI.to){H.beginPath();H.strokeStyle=aD.color||O.grid.markingsColor;H.lineWidth=aD.lineWidth||O.grid.markingsLineWidth;H.moveTo(aC.from,aI.from);H.lineTo(aC.to,aI.to);H.stroke()}else{H.fillStyle=aD.color||O.grid.markingsColor;H.fillRect(aC.from,aI.to,aC.to-aC.from,aI.from-aI.to)}}}var aK=m(),aM=O.grid.borderWidth;for(var aE=0;aE<aK.length;++aE){var aB=aK[aE],aG=aB.box,aQ=aB.tickLength,aN,aL,aP,aJ;if(!aB.show||aB.ticks.length==0){continue}H.strokeStyle=aB.options.tickColor||c.color.parse(aB.options.color).scale("a",0.22).toString();H.lineWidth=1;if(aB.direction=="x"){aN=0;if(aQ=="full"){aL=(aB.position=="top"?0:w)}else{aL=aG.top-q.top+(aB.position=="top"?aG.height:0)}}else{aL=0;if(aQ=="full"){aN=(aB.position=="left"?0:h)}else{aN=aG.left-q.left+(aB.position=="left"?aG.width:0)}}if(!aB.innermost){H.beginPath();aP=aJ=0;if(aB.direction=="x"){aP=h}else{aJ=w}if(H.lineWidth==1){aN=Math.floor(aN)+0.5;aL=Math.floor(aL)+0.5}H.moveTo(aN,aL);H.lineTo(aN+aP,aL+aJ);H.stroke()}H.beginPath();for(aF=0;aF<aB.ticks.length;++aF){var aO=aB.ticks[aF].v;aP=aJ=0;if(aO<aB.min||aO>aB.max||(aQ=="full"&&aM>0&&(aO==aB.min||aO==aB.max))){continue}if(aB.direction=="x"){aN=aB.p2c(aO);aJ=aQ=="full"?-w:aQ;if(aB.position=="top"){aJ=-aJ}}else{aL=aB.p2c(aO);aP=aQ=="full"?-h:aQ;if(aB.position=="left"){aP=-aP}}if(H.lineWidth==1){if(aB.direction=="x"){aN=Math.floor(aN)+0.5}else{aL=Math.floor(aL)+0.5}}H.moveTo(aN,aL);H.lineTo(aN+aP,aL+aJ)}H.stroke()}if(aM){H.lineWidth=aM;H.strokeStyle=O.grid.borderColor;H.strokeRect(-aM/2,-aM/2,h+aM,w+aM)}H.restore()}function k(){av.find(".tickLabels").remove();var aG=['<div class="tickLabels" style="font-size:smaller">'];var aJ=m();for(var aD=0;aD<aJ.length;++aD){var aC=aJ[aD],aF=aC.box;if(!aC.show){continue}aG.push('<div class="'+aC.direction+"Axis "+aC.direction+aC.n+'Axis" style="color:'+aC.options.color+'">');for(var aE=0;aE<aC.ticks.length;++aE){var aH=aC.ticks[aE];if(!aH.label||aH.v<aC.min||aH.v>aC.max){continue}var aK={},aI;if(aC.direction=="x"){aI="center";aK.left=Math.round(q.left+aC.p2c(aH.v)-aC.labelWidth/2);if(aC.position=="bottom"){aK.top=aF.top+aF.padding}else{aK.bottom=I-(aF.top+aF.height-aF.padding)}}else{aK.top=Math.round(q.top+aC.p2c(aH.v)-aC.labelHeight/2);if(aC.position=="left"){aK.right=G-(aF.left+aF.width-aF.padding);aI="right"}else{aK.left=aF.left+aF.padding;aI="left"}}aK.width=aC.labelWidth;var aB=["position:absolute","text-align:"+aI];for(var aL in aK){aB.push(aL+":"+aK[aL]+"px")}aG.push('<div class="tickLabel" style="'+aB.join(";")+'">'+aH.label+"</div>")}aG.push("</div>")}aG.push("</div>");av.append(aG.join(""))}function d(aB){if(aB.lines.show){at(aB)}if(aB.bars.show){e(aB)}if(aB.points.show){ao(aB)}}function at(aE){function aD(aP,aQ,aI,aU,aT){var aV=aP.points,aJ=aP.pointsize,aN=null,aM=null;H.beginPath();for(var aO=aJ;aO<aV.length;aO+=aJ){var aL=aV[aO-aJ],aS=aV[aO-aJ+1],aK=aV[aO],aR=aV[aO+1];if(aL==null||aK==null){continue}if(aS<=aR&&aS<aT.min){if(aR<aT.min){continue}aL=(aT.min-aS)/(aR-aS)*(aK-aL)+aL;aS=aT.min}else{if(aR<=aS&&aR<aT.min){if(aS<aT.min){continue}aK=(aT.min-aS)/(aR-aS)*(aK-aL)+aL;aR=aT.min}}if(aS>=aR&&aS>aT.max){if(aR>aT.max){continue}aL=(aT.max-aS)/(aR-aS)*(aK-aL)+aL;aS=aT.max}else{if(aR>=aS&&aR>aT.max){if(aS>aT.max){continue}aK=(aT.max-aS)/(aR-aS)*(aK-aL)+aL;aR=aT.max}}if(aL<=aK&&aL<aU.min){if(aK<aU.min){continue}aS=(aU.min-aL)/(aK-aL)*(aR-aS)+aS;aL=aU.min}else{if(aK<=aL&&aK<aU.min){if(aL<aU.min){continue}aR=(aU.min-aL)/(aK-aL)*(aR-aS)+aS;aK=aU.min}}if(aL>=aK&&aL>aU.max){if(aK>aU.max){continue}aS=(aU.max-aL)/(aK-aL)*(aR-aS)+aS;aL=aU.max}else{if(aK>=aL&&aK>aU.max){if(aL>aU.max){continue}aR=(aU.max-aL)/(aK-aL)*(aR-aS)+aS;aK=aU.max}}if(aL!=aN||aS!=aM){H.moveTo(aU.p2c(aL)+aQ,aT.p2c(aS)+aI)}aN=aK;aM=aR;H.lineTo(aU.p2c(aK)+aQ,aT.p2c(aR)+aI)}H.stroke()}function aF(aI,aQ,aP){var aW=aI.points,aV=aI.pointsize,aN=Math.min(Math.max(0,aP.min),aP.max),aX=0,aU,aT=false,aM=1,aL=0,aR=0;while(true){if(aV>0&&aX>aW.length+aV){break}aX+=aV;var aZ=aW[aX-aV],aK=aW[aX-aV+aM],aY=aW[aX],aJ=aW[aX+aM];if(aT){if(aV>0&&aZ!=null&&aY==null){aR=aX;aV=-aV;aM=2;continue}if(aV<0&&aX==aL+aV){H.fill();aT=false;aV=-aV;aM=1;aX=aL=aR+aV;continue}}if(aZ==null||aY==null){continue}if(aZ<=aY&&aZ<aQ.min){if(aY<aQ.min){continue}aK=(aQ.min-aZ)/(aY-aZ)*(aJ-aK)+aK;aZ=aQ.min}else{if(aY<=aZ&&aY<aQ.min){if(aZ<aQ.min){continue}aJ=(aQ.min-aZ)/(aY-aZ)*(aJ-aK)+aK;aY=aQ.min}}if(aZ>=aY&&aZ>aQ.max){if(aY>aQ.max){continue}aK=(aQ.max-aZ)/(aY-aZ)*(aJ-aK)+aK;aZ=aQ.max}else{if(aY>=aZ&&aY>aQ.max){if(aZ>aQ.max){continue}aJ=(aQ.max-aZ)/(aY-aZ)*(aJ-aK)+aK;aY=aQ.max}}if(!aT){H.beginPath();H.moveTo(aQ.p2c(aZ),aP.p2c(aN));aT=true}if(aK>=aP.max&&aJ>=aP.max){H.lineTo(aQ.p2c(aZ),aP.p2c(aP.max));H.lineTo(aQ.p2c(aY),aP.p2c(aP.max));continue}else{if(aK<=aP.min&&aJ<=aP.min){H.lineTo(aQ.p2c(aZ),aP.p2c(aP.min));H.lineTo(aQ.p2c(aY),aP.p2c(aP.min));continue}}var aO=aZ,aS=aY;if(aK<=aJ&&aK<aP.min&&aJ>=aP.min){aZ=(aP.min-aK)/(aJ-aK)*(aY-aZ)+aZ;aK=aP.min}else{if(aJ<=aK&&aJ<aP.min&&aK>=aP.min){aY=(aP.min-aK)/(aJ-aK)*(aY-aZ)+aZ;aJ=aP.min}}if(aK>=aJ&&aK>aP.max&&aJ<=aP.max){aZ=(aP.max-aK)/(aJ-aK)*(aY-aZ)+aZ;aK=aP.max}else{if(aJ>=aK&&aJ>aP.max&&aK<=aP.max){aY=(aP.max-aK)/(aJ-aK)*(aY-aZ)+aZ;aJ=aP.max}}if(aZ!=aO){H.lineTo(aQ.p2c(aO),aP.p2c(aK))}H.lineTo(aQ.p2c(aZ),aP.p2c(aK));H.lineTo(aQ.p2c(aY),aP.p2c(aJ));if(aY!=aS){H.lineTo(aQ.p2c(aY),aP.p2c(aJ));H.lineTo(aQ.p2c(aS),aP.p2c(aJ))}}}H.save();H.translate(q.left,q.top);H.lineJoin="round";var aG=aE.lines.lineWidth,aB=aE.shadowSize;if(aG>0&&aB>0){H.lineWidth=aB;H.strokeStyle="rgba(0,0,0,0.1)";var aH=Math.PI/18;aD(aE.datapoints,Math.sin(aH)*(aG/2+aB/2),Math.cos(aH)*(aG/2+aB/2),aE.xaxis,aE.yaxis);H.lineWidth=aB/2;aD(aE.datapoints,Math.sin(aH)*(aG/2+aB/4),Math.cos(aH)*(aG/2+aB/4),aE.xaxis,aE.yaxis)}H.lineWidth=aG;H.strokeStyle=aE.color;var aC=ae(aE.lines,aE.color,0,w);if(aC){H.fillStyle=aC;aF(aE.datapoints,aE.xaxis,aE.yaxis)}if(aG>0){aD(aE.datapoints,0,0,aE.xaxis,aE.yaxis)}H.restore()}function ao(aE){function aH(aN,aM,aU,aK,aS,aT,aQ,aJ){var aR=aN.points,aI=aN.pointsize;for(var aL=0;aL<aR.length;aL+=aI){var aP=aR[aL],aO=aR[aL+1];if(aP==null||aP<aT.min||aP>aT.max||aO<aQ.min||aO>aQ.max){continue}H.beginPath();aP=aT.p2c(aP);aO=aQ.p2c(aO)+aK;if(aJ=="circle"){H.arc(aP,aO,aM,0,aS?Math.PI:Math.PI*2,false)}else{aJ(H,aP,aO,aM,aS)}H.closePath();if(aU){H.fillStyle=aU;H.fill()}H.stroke()}}H.save();H.translate(q.left,q.top);var aG=aE.points.lineWidth,aC=aE.shadowSize,aB=aE.points.radius,aF=aE.points.symbol;if(aG>0&&aC>0){var aD=aC/2;H.lineWidth=aD;H.strokeStyle="rgba(0,0,0,0.1)";aH(aE.datapoints,aB,null,aD+aD/2,true,aE.xaxis,aE.yaxis,aF);H.strokeStyle="rgba(0,0,0,0.2)";aH(aE.datapoints,aB,null,aD/2,true,aE.xaxis,aE.yaxis,aF)}H.lineWidth=aG;H.strokeStyle=aE.color;aH(aE.datapoints,aB,ae(aE.points,aE.color),0,false,aE.xaxis,aE.yaxis,aF);H.restore()}function E(aN,aM,aV,aI,aQ,aF,aD,aL,aK,aU,aR,aC){var aE,aT,aJ,aP,aG,aB,aO,aH,aS;if(aR){aH=aB=aO=true;aG=false;aE=aV;aT=aN;aP=aM+aI;aJ=aM+aQ;if(aT<aE){aS=aT;aT=aE;aE=aS;aG=true;aB=false}}else{aG=aB=aO=true;aH=false;aE=aN+aI;aT=aN+aQ;aJ=aV;aP=aM;if(aP<aJ){aS=aP;aP=aJ;aJ=aS;aH=true;aO=false}}if(aT<aL.min||aE>aL.max||aP<aK.min||aJ>aK.max){return}if(aE<aL.min){aE=aL.min;aG=false}if(aT>aL.max){aT=aL.max;aB=false}if(aJ<aK.min){aJ=aK.min;aH=false}if(aP>aK.max){aP=aK.max;aO=false}aE=aL.p2c(aE);aJ=aK.p2c(aJ);aT=aL.p2c(aT);aP=aK.p2c(aP);if(aD){aU.beginPath();aU.moveTo(aE,aJ);aU.lineTo(aE,aP);aU.lineTo(aT,aP);aU.lineTo(aT,aJ);aU.fillStyle=aD(aJ,aP);aU.fill()}if(aC>0&&(aG||aB||aO||aH)){aU.beginPath();aU.moveTo(aE,aJ+aF);if(aG){aU.lineTo(aE,aP+aF)}else{aU.moveTo(aE,aP+aF)}if(aO){aU.lineTo(aT,aP+aF)}else{aU.moveTo(aT,aP+aF)}if(aB){aU.lineTo(aT,aJ+aF)}else{aU.moveTo(aT,aJ+aF)}if(aH){aU.lineTo(aE,aJ+aF)}else{aU.moveTo(aE,aJ+aF)}aU.stroke()}}function e(aD){function aC(aJ,aI,aL,aG,aK,aN,aM){var aO=aJ.points,aF=aJ.pointsize;for(var aH=0;aH<aO.length;aH+=aF){if(aO[aH]==null){continue}E(aO[aH],aO[aH+1],aO[aH+2],aI,aL,aG,aK,aN,aM,H,aD.bars.horizontal,aD.bars.lineWidth)}}H.save();H.translate(q.left,q.top);H.lineWidth=aD.bars.lineWidth;H.strokeStyle=aD.color;var aB=aD.bars.align=="left"?0:-aD.bars.barWidth/2;var aE=aD.bars.fill?function(aF,aG){return ae(aD.bars,aD.color,aF,aG)}:null;aC(aD.datapoints,aB,aB+aD.bars.barWidth,0,aE,aD.xaxis,aD.yaxis);H.restore()}function ae(aD,aB,aC,aF){var aE=aD.fill;if(!aE){return null}if(aD.fillColor){return am(aD.fillColor,aC,aF,aB)}var aG=c.color.parse(aB);aG.a=typeof aE=="number"?aE:0.4;aG.normalize();return aG.toString()}function o(){av.find(".legend").remove();if(!O.legend.show){return}var aH=[],aF=false,aN=O.legend.labelFormatter,aM,aJ;for(var aE=0;aE<Q.length;++aE){aM=Q[aE];aJ=aM.label;if(!aJ){continue}if(aE%O.legend.noColumns==0){if(aF){aH.push("</tr>")}aH.push("<tr>");aF=true}if(aN){aJ=aN(aJ,aM)}aH.push('<td class="legendColorBox"><div style="border:1px solid '+O.legend.labelBoxBorderColor+';padding:1px"><div style="width:4px;height:0;border:5px solid '+aM.color+';overflow:hidden"></div></div></td><td class="legendLabel">'+aJ+"</td>")}if(aF){aH.push("</tr>")}if(aH.length==0){return}var aL='<table style="font-size:smaller;color:'+O.grid.color+'">'+aH.join("")+"</table>";if(O.legend.container!=null){c(O.legend.container).html(aL)}else{var aI="",aC=O.legend.position,aD=O.legend.margin;if(aD[0]==null){aD=[aD,aD]}if(aC.charAt(0)=="n"){aI+="top:"+(aD[1]+q.top)+"px;"}else{if(aC.charAt(0)=="s"){aI+="bottom:"+(aD[1]+q.bottom)+"px;"}}if(aC.charAt(1)=="e"){aI+="right:"+(aD[0]+q.right)+"px;"}else{if(aC.charAt(1)=="w"){aI+="left:"+(aD[0]+q.left)+"px;"}}var aK=c('<div class="legend">'+aL.replace('style="','style="position:absolute;'+aI+";")+"</div>").appendTo(av);if(O.legend.backgroundOpacity!=0){var aG=O.legend.backgroundColor;if(aG==null){aG=O.grid.backgroundColor;if(aG&&typeof aG=="string"){aG=c.color.parse(aG)}else{aG=c.color.extract(aK,"background-color")}aG.a=1;aG=aG.toString()}var aB=aK.children();c('<div style="position:absolute;width:'+aB.width()+"px;height:"+aB.height()+"px;"+aI+"background-color:"+aG+';"> </div>').prependTo(aK).css("opacity",O.legend.backgroundOpacity)}}}var ab=[],M=null;function K(aI,aG,aD){var aO=O.grid.mouseActiveRadius,a0=aO*aO+1,aY=null,aR=false,aW,aU;for(aW=Q.length-1;aW>=0;--aW){if(!aD(Q[aW])){continue}var aP=Q[aW],aH=aP.xaxis,aF=aP.yaxis,aV=aP.datapoints.points,aT=aP.datapoints.pointsize,aQ=aH.c2p(aI),aN=aF.c2p(aG),aC=aO/aH.scale,aB=aO/aF.scale;if(aH.options.inverseTransform){aC=Number.MAX_VALUE}if(aF.options.inverseTransform){aB=Number.MAX_VALUE}if(aP.lines.show||aP.points.show){for(aU=0;aU<aV.length;aU+=aT){var aK=aV[aU],aJ=aV[aU+1];if(aK==null){continue}if(aK-aQ>aC||aK-aQ<-aC||aJ-aN>aB||aJ-aN<-aB){continue}var aM=Math.abs(aH.p2c(aK)-aI),aL=Math.abs(aF.p2c(aJ)-aG),aS=aM*aM+aL*aL;if(aS<a0){a0=aS;aY=[aW,aU/aT]}}}if(aP.bars.show&&!aY){var aE=aP.bars.align=="left"?0:-aP.bars.barWidth/2,aX=aE+aP.bars.barWidth;for(aU=0;aU<aV.length;aU+=aT){var aK=aV[aU],aJ=aV[aU+1],aZ=aV[aU+2];if(aK==null){continue}if(Q[aW].bars.horizontal?(aQ<=Math.max(aZ,aK)&&aQ>=Math.min(aZ,aK)&&aN>=aJ+aE&&aN<=aJ+aX):(aQ>=aK+aE&&aQ<=aK+aX&&aN>=Math.min(aZ,aJ)&&aN<=Math.max(aZ,aJ))){aY=[aW,aU/aT]}}}}if(aY){aW=aY[0];aU=aY[1];aT=Q[aW].datapoints.pointsize;return{datapoint:Q[aW].datapoints.points.slice(aU*aT,(aU+1)*aT),dataIndex:aU,series:Q[aW],seriesIndex:aW}}return null}function aa(aB){if(O.grid.hoverable){u("plothover",aB,function(aC){return aC.hoverable!=false})}}function l(aB){if(O.grid.hoverable){u("plothover",aB,function(aC){return false})}}function R(aB){u("plotclick",aB,function(aC){return aC.clickable!=false})}function u(aC,aB,aD){var aE=y.offset(),aH=aB.pageX-aE.left-q.left,aF=aB.pageY-aE.top-q.top,aJ=C({left:aH,top:aF});aJ.pageX=aB.pageX;aJ.pageY=aB.pageY;var aK=K(aH,aF,aD);if(aK){aK.pageX=parseInt(aK.series.xaxis.p2c(aK.datapoint[0])+aE.left+q.left);aK.pageY=parseInt(aK.series.yaxis.p2c(aK.datapoint[1])+aE.top+q.top)}if(O.grid.autoHighlight){for(var aG=0;aG<ab.length;++aG){var aI=ab[aG];if(aI.auto==aC&&!(aK&&aI.series==aK.series&&aI.point[0]==aK.datapoint[0]&&aI.point[1]==aK.datapoint[1])){T(aI.series,aI.point)}}if(aK){x(aK.series,aK.datapoint,aC)}}av.trigger(aC,[aJ,aK])}function f(){if(!M){M=setTimeout(s,30)}}function s(){M=null;A.save();A.clearRect(0,0,G,I);A.translate(q.left,q.top);var aC,aB;for(aC=0;aC<ab.length;++aC){aB=ab[aC];if(aB.series.bars.show){v(aB.series,aB.point)}else{ay(aB.series,aB.point)}}A.restore();an(ak.drawOverlay,[A])}function x(aD,aB,aF){if(typeof aD=="number"){aD=Q[aD]}if(typeof aB=="number"){var aE=aD.datapoints.pointsize;aB=aD.datapoints.points.slice(aE*aB,aE*(aB+1))}var aC=al(aD,aB);if(aC==-1){ab.push({series:aD,point:aB,auto:aF});f()}else{if(!aF){ab[aC].auto=false}}}function T(aD,aB){if(aD==null&&aB==null){ab=[];f()}if(typeof aD=="number"){aD=Q[aD]}if(typeof aB=="number"){aB=aD.data[aB]}var aC=al(aD,aB);if(aC!=-1){ab.splice(aC,1);f()}}function al(aD,aE){for(var aB=0;aB<ab.length;++aB){var aC=ab[aB];if(aC.series==aD&&aC.point[0]==aE[0]&&aC.point[1]==aE[1]){return aB}}return -1}function ay(aE,aD){var aC=aD[0],aI=aD[1],aH=aE.xaxis,aG=aE.yaxis;if(aC<aH.min||aC>aH.max||aI<aG.min||aI>aG.max){return}var aF=aE.points.radius+aE.points.lineWidth/2;A.lineWidth=aF;A.strokeStyle=c.color.parse(aE.color).scale("a",0.5).toString();var aB=1.5*aF,aC=aH.p2c(aC),aI=aG.p2c(aI);A.beginPath();if(aE.points.symbol=="circle"){A.arc(aC,aI,aB,0,2*Math.PI,false)}else{aE.points.symbol(A,aC,aI,aB,false)}A.closePath();A.stroke()}function v(aE,aB){A.lineWidth=aE.bars.lineWidth;A.strokeStyle=c.color.parse(aE.color).scale("a",0.5).toString();var aD=c.color.parse(aE.color).scale("a",0.5).toString();var aC=aE.bars.align=="left"?0:-aE.bars.barWidth/2;E(aB[0],aB[1],aB[2]||0,aC,aC+aE.bars.barWidth,0,function(){return aD},aE.xaxis,aE.yaxis,A,aE.bars.horizontal,aE.bars.lineWidth)}function am(aJ,aB,aH,aC){if(typeof aJ=="string"){return aJ}else{var aI=H.createLinearGradient(0,aH,0,aB);for(var aE=0,aD=aJ.colors.length;aE<aD;++aE){var aF=aJ.colors[aE];if(typeof aF!="string"){var aG=c.color.parse(aC);if(aF.brightness!=null){aG=aG.scale("rgb",aF.brightness)}if(aF.opacity!=null){aG.a*=aF.opacity}aF=aG.toString()}aI.addColorStop(aE/(aD-1),aF)}return aI}}}c.plot=function(g,e,d){var f=new b(c(g),e,d,c.plot.plugins);return f};c.plot.version="0.7";c.plot.plugins=[];c.plot.formatDate=function(l,f,h){var o=function(d){d=""+d;return d.length==1?"0"+d:d};var e=[];var p=false,j=false;var n=l.getUTCHours();var k=n<12;if(h==null){h=["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"]}if(f.search(/%p|%P/)!=-1){if(n>12){n=n-12}else{if(n==0){n=12}}}for(var g=0;g<f.length;++g){var m=f.charAt(g);if(p){switch(m){case"h":m=""+n;break;case"H":m=o(n);break;case"M":m=o(l.getUTCMinutes());break;case"S":m=o(l.getUTCSeconds());break;case"d":m=""+l.getUTCDate();break;case"m":m=""+(l.getUTCMonth()+1);break;case"y":m=""+l.getUTCFullYear();break;case"b":m=""+h[l.getUTCMonth()];break;case"p":m=(k)?("am"):("pm");break;case"P":m=(k)?("AM"):("PM");break;case"0":m="";j=true;break}if(m&&j){m=o(m);j=false}e.push(m);if(!j){p=false}}else{if(m=="%"){p=true}else{e.push(m)}}}return e.join("")};function a(e,d){return d*Math.floor(e/d)}})(jQuery); |
| /* | |
| Flot plugin for adding panning and zooming capabilities to a plot. | |
| The default behaviour is double click and scrollwheel up/down to zoom | |
| in, drag to pan. The plugin defines plot.zoom({ center }), | |
| plot.zoomOut() and plot.pan(offset) so you easily can add custom | |
| controls. It also fires a "plotpan" and "plotzoom" event when | |
| something happens, useful for synchronizing plots. | |
| Options: | |
| zoom: { | |
| interactive: false | |
| trigger: "dblclick" // or "click" for single click | |
| amount: 1.5 // 2 = 200% (zoom in), 0.5 = 50% (zoom out) | |
| } | |
| pan: { | |
| interactive: false | |
| cursor: "move" // CSS mouse cursor value used when dragging, e.g. "pointer" | |
| frameRate: 20 | |
| } | |
| xaxis, yaxis, x2axis, y2axis: { | |
| zoomRange: null // or [number, number] (min range, max range) or false | |
| panRange: null // or [number, number] (min, max) or false | |
| } | |
| "interactive" enables the built-in drag/click behaviour. If you enable | |
| interactive for pan, then you'll have a basic plot that supports | |
| moving around; the same for zoom. | |
| "amount" specifies the default amount to zoom in (so 1.5 = 150%) | |
| relative to the current viewport. | |
| "cursor" is a standard CSS mouse cursor string used for visual | |
| feedback to the user when dragging. | |
| "frameRate" specifies the maximum number of times per second the plot | |
| will update itself while the user is panning around on it (set to null | |
| to disable intermediate pans, the plot will then not update until the | |
| mouse button is released). | |
| "zoomRange" is the interval in which zooming can happen, e.g. with | |
| zoomRange: [1, 100] the zoom will never scale the axis so that the | |
| difference between min and max is smaller than 1 or larger than 100. | |
| You can set either end to null to ignore, e.g. [1, null]. If you set | |
| zoomRange to false, zooming on that axis will be disabled. | |
| "panRange" confines the panning to stay within a range, e.g. with | |
| panRange: [-10, 20] panning stops at -10 in one end and at 20 in the | |
| other. Either can be null, e.g. [-10, null]. If you set | |
| panRange to false, panning on that axis will be disabled. | |
| Example API usage: | |
| plot = $.plot(...); | |
| // zoom default amount in on the pixel (10, 20) | |
| plot.zoom({ center: { left: 10, top: 20 } }); | |
| // zoom out again | |
| plot.zoomOut({ center: { left: 10, top: 20 } }); | |
| // zoom 200% in on the pixel (10, 20) | |
| plot.zoom({ amount: 2, center: { left: 10, top: 20 } }); | |
| // pan 100 pixels to the left and 20 down | |
| plot.pan({ left: -100, top: 20 }) | |
| Here, "center" specifies where the center of the zooming should | |
| happen. Note that this is defined in pixel space, not the space of the | |
| data points (you can use the p2c helpers on the axes in Flot to help | |
| you convert between these). | |
| "amount" is the amount to zoom the viewport relative to the current | |
| range, so 1 is 100% (i.e. no change), 1.5 is 150% (zoom in), 0.7 is | |
| 70% (zoom out). You can set the default in the options. | |
| */ | |
| // First two dependencies, jquery.event.drag.js and | |
| // jquery.mousewheel.js, we put them inline here to save people the | |
| // effort of downloading them. | |
| /* | |
| jquery.event.drag.js ~ v1.5 ~ Copyright (c) 2008, Three Dub Media (http://threedubmedia.com) | |
| Licensed under the MIT License ~ http://threedubmedia.googlecode.com/files/MIT-LICENSE.txt | |
| */ | |
| (function(E){E.fn.drag=function(L,K,J){if(K){this.bind("dragstart",L)}if(J){this.bind("dragend",J)}return !L?this.trigger("drag"):this.bind("drag",K?K:L)};var A=E.event,B=A.special,F=B.drag={not:":input",distance:0,which:1,dragging:false,setup:function(J){J=E.extend({distance:F.distance,which:F.which,not:F.not},J||{});J.distance=I(J.distance);A.add(this,"mousedown",H,J);if(this.attachEvent){this.attachEvent("ondragstart",D)}},teardown:function(){A.remove(this,"mousedown",H);if(this===F.dragging){F.dragging=F.proxy=false}G(this,true);if(this.detachEvent){this.detachEvent("ondragstart",D)}}};B.dragstart=B.dragend={setup:function(){},teardown:function(){}};function H(L){var K=this,J,M=L.data||{};if(M.elem){K=L.dragTarget=M.elem;L.dragProxy=F.proxy||K;L.cursorOffsetX=M.pageX-M.left;L.cursorOffsetY=M.pageY-M.top;L.offsetX=L.pageX-L.cursorOffsetX;L.offsetY=L.pageY-L.cursorOffsetY}else{if(F.dragging||(M.which>0&&L.which!=M.which)||E(L.target).is(M.not)){return }}switch(L.type){case"mousedown":E.extend(M,E(K).offset(),{elem:K,target:L.target,pageX:L.pageX,pageY:L.pageY});A.add(document,"mousemove mouseup",H,M);G(K,false);F.dragging=null;return false;case !F.dragging&&"mousemove":if(I(L.pageX-M.pageX)+I(L.pageY-M.pageY)<M.distance){break}L.target=M.target;J=C(L,"dragstart",K);if(J!==false){F.dragging=K;F.proxy=L.dragProxy=E(J||K)[0]}case"mousemove":if(F.dragging){J=C(L,"drag",K);if(B.drop){B.drop.allowed=(J!==false);B.drop.handler(L)}if(J!==false){break}L.type="mouseup"}case"mouseup":A.remove(document,"mousemove mouseup",H);if(F.dragging){if(B.drop){B.drop.handler(L)}C(L,"dragend",K)}G(K,true);F.dragging=F.proxy=M.elem=false;break}return true}function C(M,K,L){M.type=K;var J=E.event.handle.call(L,M);return J===false?false:J||M.result}function I(J){return Math.pow(J,2)}function D(){return(F.dragging===false)}function G(K,J){if(!K){return }K.unselectable=J?"off":"on";K.onselectstart=function(){return J};if(K.style){K.style.MozUserSelect=J?"":"none"}}})(jQuery); | |
| /* jquery.mousewheel.min.js | |
| * Copyright (c) 2009 Brandon Aaron (http://brandonaaron.net) | |
| * Dual licensed under the MIT (http://www.opensource.org/licenses/mit-license.php) | |
| * and GPL (http://www.opensource.org/licenses/gpl-license.php) licenses. | |
| * Thanks to: http://adomas.org/javascript-mouse-wheel/ for some pointers. | |
| * Thanks to: Mathias Bank(http://www.mathias-bank.de) for a scope bug fix. | |
| * | |
| * Version: 3.0.2 | |
| * | |
| * Requires: 1.2.2+ | |
| */ | |
| (function(c){var a=["DOMMouseScroll","mousewheel"];c.event.special.mousewheel={setup:function(){if(this.addEventListener){for(var d=a.length;d;){this.addEventListener(a[--d],b,false)}}else{this.onmousewheel=b}},teardown:function(){if(this.removeEventListener){for(var d=a.length;d;){this.removeEventListener(a[--d],b,false)}}else{this.onmousewheel=null}}};c.fn.extend({mousewheel:function(d){return d?this.bind("mousewheel",d):this.trigger("mousewheel")},unmousewheel:function(d){return this.unbind("mousewheel",d)}});function b(f){var d=[].slice.call(arguments,1),g=0,e=true;f=c.event.fix(f||window.event);f.type="mousewheel";if(f.wheelDelta){g=f.wheelDelta/120}if(f.detail){g=-f.detail/3}d.unshift(f,g);return c.event.handle.apply(this,d)}})(jQuery); | |
| (function ($) { | |
| var options = { | |
| xaxis: { | |
| zoomRange: null, // or [number, number] (min range, max range) | |
| panRange: null // or [number, number] (min, max) | |
| }, | |
| zoom: { | |
| interactive: false, | |
| trigger: "dblclick", // or "click" for single click | |
| amount: 1.5 // how much to zoom relative to current position, 2 = 200% (zoom in), 0.5 = 50% (zoom out) | |
| }, | |
| pan: { | |
| interactive: false, | |
| cursor: "move", | |
| frameRate: 20 | |
| } | |
| }; | |
| function init(plot) { | |
| function onZoomClick(e, zoomOut) { | |
| var c = plot.offset(); | |
| c.left = e.pageX - c.left; | |
| c.top = e.pageY - c.top; | |
| if (zoomOut) | |
| plot.zoomOut({ center: c }); | |
| else | |
| plot.zoom({ center: c }); | |
| } | |
| function onMouseWheel(e, delta) { | |
| onZoomClick(e, delta < 0); | |
| return false; | |
| } | |
| var prevCursor = 'default', prevPageX = 0, prevPageY = 0, | |
| panTimeout = null; | |
| function onDragStart(e) { | |
| if (e.which != 1) // only accept left-click | |
| return false; | |
| var c = plot.getPlaceholder().css('cursor'); | |
| if (c) | |
| prevCursor = c; | |
| plot.getPlaceholder().css('cursor', plot.getOptions().pan.cursor); | |
| prevPageX = e.pageX; | |
| prevPageY = e.pageY; | |
| } | |
| function onDrag(e) { | |
| var frameRate = plot.getOptions().pan.frameRate; | |
| if (panTimeout || !frameRate) | |
| return; | |
| panTimeout = setTimeout(function () { | |
| plot.pan({ left: prevPageX - e.pageX, | |
| top: prevPageY - e.pageY }); | |
| prevPageX = e.pageX; | |
| prevPageY = e.pageY; | |
| panTimeout = null; | |
| }, 1 / frameRate * 1000); | |
| } | |
| function onDragEnd(e) { | |
| if (panTimeout) { | |
| clearTimeout(panTimeout); | |
| panTimeout = null; | |
| } | |
| plot.getPlaceholder().css('cursor', prevCursor); | |
| plot.pan({ left: prevPageX - e.pageX, | |
| top: prevPageY - e.pageY }); | |
| } | |
| function bindEvents(plot, eventHolder) { | |
| var o = plot.getOptions(); | |
| if (o.zoom.interactive) { | |
| eventHolder[o.zoom.trigger](onZoomClick); | |
| eventHolder.mousewheel(onMouseWheel); | |
| } | |
| if (o.pan.interactive) { | |
| eventHolder.bind("dragstart", { distance: 10 }, onDragStart); | |
| eventHolder.bind("drag", onDrag); | |
| eventHolder.bind("dragend", onDragEnd); | |
| } | |
| } | |
| plot.zoomOut = function (args) { | |
| if (!args) | |
| args = {}; | |
| if (!args.amount) | |
| args.amount = plot.getOptions().zoom.amount | |
| args.amount = 1 / args.amount; | |
| plot.zoom(args); | |
| } | |
| plot.zoom = function (args) { | |
| if (!args) | |
| args = {}; | |
| var c = args.center, | |
| amount = args.amount || plot.getOptions().zoom.amount, | |
| w = plot.width(), h = plot.height(); | |
| if (!c) | |
| c = { left: w / 2, top: h / 2 }; | |
| var xf = c.left / w, | |
| yf = c.top / h, | |
| minmax = { | |
| x: { | |
| min: c.left - xf * w / amount, | |
| max: c.left + (1 - xf) * w / amount | |
| }, | |
| y: { | |
| min: c.top - yf * h / amount, | |
| max: c.top + (1 - yf) * h / amount | |
| } | |
| }; | |
| $.each(plot.getAxes(), function(_, axis) { | |
| var opts = axis.options, | |
| min = minmax[axis.direction].min, | |
| max = minmax[axis.direction].max, | |
| zr = opts.zoomRange; | |
| if (zr === false) // no zooming on this axis | |
| return; | |
| min = axis.c2p(min); | |
| max = axis.c2p(max); | |
| if (min > max) { | |
| // make sure min < max | |
| var tmp = min; | |
| min = max; | |
| max = tmp; | |
| } | |
| var range = max - min; | |
| if (zr && | |
| ((zr[0] != null && range < zr[0]) || | |
| (zr[1] != null && range > zr[1]))) | |
| return; | |
| opts.min = min; | |
| opts.max = max; | |
| }); | |
| plot.setupGrid(); | |
| plot.draw(); | |
| if (!args.preventEvent) | |
| plot.getPlaceholder().trigger("plotzoom", [ plot ]); | |
| } | |
| plot.pan = function (args) { | |
| var delta = { | |
| x: +args.left, | |
| y: +args.top | |
| }; | |
| if (isNaN(delta.x)) | |
| delta.x = 0; | |
| if (isNaN(delta.y)) | |
| delta.y = 0; | |
| $.each(plot.getAxes(), function (_, axis) { | |
| var opts = axis.options, | |
| min, max, d = delta[axis.direction]; | |
| min = axis.c2p(axis.p2c(axis.min) + d), | |
| max = axis.c2p(axis.p2c(axis.max) + d); | |
| var pr = opts.panRange; | |
| if (pr === false) // no panning on this axis | |
| return; | |
| if (pr) { | |
| // check whether we hit the wall | |
| if (pr[0] != null && pr[0] > min) { | |
| d = pr[0] - min; | |
| min += d; | |
| max += d; | |
| } | |
| if (pr[1] != null && pr[1] < max) { | |
| d = pr[1] - max; | |
| min += d; | |
| max += d; | |
| } | |
| } | |
| opts.min = min; | |
| opts.max = max; | |
| }); | |
| plot.setupGrid(); | |
| plot.draw(); | |
| if (!args.preventEvent) | |
| plot.getPlaceholder().trigger("plotpan", [ plot ]); | |
| } | |
| function shutdown(plot, eventHolder) { | |
| eventHolder.unbind(plot.getOptions().zoom.trigger, onZoomClick); | |
| eventHolder.unbind("mousewheel", onMouseWheel); | |
| eventHolder.unbind("dragstart", onDragStart); | |
| eventHolder.unbind("drag", onDrag); | |
| eventHolder.unbind("dragend", onDragEnd); | |
| if (panTimeout) | |
| clearTimeout(panTimeout); | |
| } | |
| plot.hooks.bindEvents.push(bindEvents); | |
| plot.hooks.shutdown.push(shutdown); | |
| } | |
| $.plot.plugins.push({ | |
| init: init, | |
| options: options, | |
| name: 'navigate', | |
| version: '1.3' | |
| }); | |
| })(jQuery); | |
| (function(i){i.fn.drag=function(j,k,l){if(k){this.bind("dragstart",j)}if(l){this.bind("dragend",l)}return !j?this.trigger("drag"):this.bind("drag",k?k:j)};var d=i.event,c=d.special,h=c.drag={not:":input",distance:0,which:1,dragging:false,setup:function(j){j=i.extend({distance:h.distance,which:h.which,not:h.not},j||{});j.distance=e(j.distance);d.add(this,"mousedown",f,j);if(this.attachEvent){this.attachEvent("ondragstart",a)}},teardown:function(){d.remove(this,"mousedown",f);if(this===h.dragging){h.dragging=h.proxy=false}g(this,true);if(this.detachEvent){this.detachEvent("ondragstart",a)}}};c.dragstart=c.dragend={setup:function(){},teardown:function(){}};function f(j){var k=this,l,m=j.data||{};if(m.elem){k=j.dragTarget=m.elem;j.dragProxy=h.proxy||k;j.cursorOffsetX=m.pageX-m.left;j.cursorOffsetY=m.pageY-m.top;j.offsetX=j.pageX-j.cursorOffsetX;j.offsetY=j.pageY-j.cursorOffsetY}else{if(h.dragging||(m.which>0&&j.which!=m.which)||i(j.target).is(m.not)){return}}switch(j.type){case"mousedown":i.extend(m,i(k).offset(),{elem:k,target:j.target,pageX:j.pageX,pageY:j.pageY});d.add(document,"mousemove mouseup",f,m);g(k,false);h.dragging=null;return false;case !h.dragging&&"mousemove":if(e(j.pageX-m.pageX)+e(j.pageY-m.pageY)<m.distance){break}j.target=m.target;l=b(j,"dragstart",k);if(l!==false){h.dragging=k;h.proxy=j.dragProxy=i(l||k)[0]}case"mousemove":if(h.dragging){l=b(j,"drag",k);if(c.drop){c.drop.allowed=(l!==false);c.drop.handler(j)}if(l!==false){break}j.type="mouseup"}case"mouseup":d.remove(document,"mousemove mouseup",f);if(h.dragging){if(c.drop){c.drop.handler(j)}b(j,"dragend",k)}g(k,true);h.dragging=h.proxy=m.elem=false;break}return true}function b(m,k,j){m.type=k;var l=i.event.handle.call(j,m);return l===false?false:l||m.result}function e(j){return Math.pow(j,2)}function a(){return(h.dragging===false)}function g(j,k){if(!j){return}j.unselectable=k?"off":"on";j.onselectstart=function(){return k};if(j.style){j.style.MozUserSelect=k?"":"none"}}})(jQuery);(function(f){var e=["DOMMouseScroll","mousewheel"];f.event.special.mousewheel={setup:function(){if(this.addEventListener){for(var a=e.length;a;){this.addEventListener(e[--a],d,false)}}else{this.onmousewheel=d}},teardown:function(){if(this.removeEventListener){for(var a=e.length;a;){this.removeEventListener(e[--a],d,false)}}else{this.onmousewheel=null}}};f.fn.extend({mousewheel:function(a){return a?this.bind("mousewheel",a):this.trigger("mousewheel")},unmousewheel:function(a){return this.unbind("mousewheel",a)}});function d(b){var h=[].slice.call(arguments,1),a=0,c=true;b=f.event.fix(b||window.event);b.type="mousewheel";if(b.wheelDelta){a=b.wheelDelta/120}if(b.detail){a=-b.detail/3}h.unshift(b,a);return f.event.handle.apply(this,h)}})(jQuery);(function(b){var a={xaxis:{zoomRange:null,panRange:null},zoom:{interactive:false,trigger:"dblclick",amount:1.5},pan:{interactive:false,cursor:"move",frameRate:20}};function c(o){function m(q,p){var r=o.offset();r.left=q.pageX-r.left;r.top=q.pageY-r.top;if(p){o.zoomOut({center:r})}else{o.zoom({center:r})}}function d(p,q){m(p,q<0);return false}var i="default",g=0,e=0,n=null;function f(p){if(p.which!=1){return false}var q=o.getPlaceholder().css("cursor");if(q){i=q}o.getPlaceholder().css("cursor",o.getOptions().pan.cursor);g=p.pageX;e=p.pageY}function j(q){var p=o.getOptions().pan.frameRate;if(n||!p){return}n=setTimeout(function(){o.pan({left:g-q.pageX,top:e-q.pageY});g=q.pageX;e=q.pageY;n=null},1/p*1000)}function h(p){if(n){clearTimeout(n);n=null}o.getPlaceholder().css("cursor",i);o.pan({left:g-p.pageX,top:e-p.pageY})}function l(q,p){var r=q.getOptions();if(r.zoom.interactive){p[r.zoom.trigger](m);p.mousewheel(d)}if(r.pan.interactive){p.bind("dragstart",{distance:10},f);p.bind("drag",j);p.bind("dragend",h)}}o.zoomOut=function(p){if(!p){p={}}if(!p.amount){p.amount=o.getOptions().zoom.amount}p.amount=1/p.amount;o.zoom(p)};o.zoom=function(q){if(!q){q={}}var x=q.center,r=q.amount||o.getOptions().zoom.amount,p=o.width(),t=o.height();if(!x){x={left:p/2,top:t/2}}var s=x.left/p,v=x.top/t,u={x:{min:x.left-s*p/r,max:x.left+(1-s)*p/r},y:{min:x.top-v*t/r,max:x.top+(1-v)*t/r}};b.each(o.getAxes(),function(z,C){var D=C.options,B=u[C.direction].min,w=u[C.direction].max,E=D.zoomRange;if(E===false){return}B=C.c2p(B);w=C.c2p(w);if(B>w){var A=B;B=w;w=A}var y=w-B;if(E&&((E[0]!=null&&y<E[0])||(E[1]!=null&&y>E[1]))){return}D.min=B;D.max=w});o.setupGrid();o.draw();if(!q.preventEvent){o.getPlaceholder().trigger("plotzoom",[o])}};o.pan=function(p){var q={x:+p.left,y:+p.top};if(isNaN(q.x)){q.x=0}if(isNaN(q.y)){q.y=0}b.each(o.getAxes(),function(s,u){var v=u.options,t,r,w=q[u.direction];t=u.c2p(u.p2c(u.min)+w),r=u.c2p(u.p2c(u.max)+w);var x=v.panRange;if(x===false){return}if(x){if(x[0]!=null&&x[0]>t){w=x[0]-t;t+=w;r+=w}if(x[1]!=null&&x[1]<r){w=x[1]-r;t+=w;r+=w}}v.min=t;v.max=r});o.setupGrid();o.draw();if(!p.preventEvent){o.getPlaceholder().trigger("plotpan",[o])}};function k(q,p){p.unbind(q.getOptions().zoom.trigger,m);p.unbind("mousewheel",d);p.unbind("dragstart",f);p.unbind("drag",j);p.unbind("dragend",h);if(n){clearTimeout(n)}}o.hooks.bindEvents.push(l);o.hooks.shutdown.push(k)}b.plot.plugins.push({init:c,options:a,name:"navigate",version:"1.3"})})(jQuery); |
| /* | |
| Flot plugin for rendering pie charts. The plugin assumes the data is | |
| coming is as a single data value for each series, and each of those | |
| values is a positive value or zero (negative numbers don't make | |
| any sense and will cause strange effects). The data values do | |
| NOT need to be passed in as percentage values because it | |
| internally calculates the total and percentages. | |
| * Created by Brian Medendorp, June 2009 | |
| * Updated November 2009 with contributions from: btburnett3, Anthony Aragues and Xavi Ivars | |
| * Changes: | |
| 2009-10-22: lineJoin set to round | |
| 2009-10-23: IE full circle fix, donut | |
| 2009-11-11: Added basic hover from btburnett3 - does not work in IE, and center is off in Chrome and Opera | |
| 2009-11-17: Added IE hover capability submitted by Anthony Aragues | |
| 2009-11-18: Added bug fix submitted by Xavi Ivars (issues with arrays when other JS libraries are included as well) | |
| Available options are: | |
| series: { | |
| pie: { | |
| show: true/false | |
| radius: 0-1 for percentage of fullsize, or a specified pixel length, or 'auto' | |
| innerRadius: 0-1 for percentage of fullsize or a specified pixel length, for creating a donut effect | |
| startAngle: 0-2 factor of PI used for starting angle (in radians) i.e 3/2 starts at the top, 0 and 2 have the same result | |
| tilt: 0-1 for percentage to tilt the pie, where 1 is no tilt, and 0 is completely flat (nothing will show) | |
| offset: { | |
| top: integer value to move the pie up or down | |
| left: integer value to move the pie left or right, or 'auto' | |
| }, | |
| stroke: { | |
| color: any hexidecimal color value (other formats may or may not work, so best to stick with something like '#FFF') | |
| width: integer pixel width of the stroke | |
| }, | |
| label: { | |
| show: true/false, or 'auto' | |
| formatter: a user-defined function that modifies the text/style of the label text | |
| radius: 0-1 for percentage of fullsize, or a specified pixel length | |
| background: { | |
| color: any hexidecimal color value (other formats may or may not work, so best to stick with something like '#000') | |
| opacity: 0-1 | |
| }, | |
| threshold: 0-1 for the percentage value at which to hide labels (if they're too small) | |
| }, | |
| combine: { | |
| threshold: 0-1 for the percentage value at which to combine slices (if they're too small) | |
| color: any hexidecimal color value (other formats may or may not work, so best to stick with something like '#CCC'), if null, the plugin will automatically use the color of the first slice to be combined | |
| label: any text value of what the combined slice should be labeled | |
| } | |
| highlight: { | |
| opacity: 0-1 | |
| } | |
| } | |
| } | |
| More detail and specific examples can be found in the included HTML file. | |
| */ | |
| (function ($) | |
| { | |
| function init(plot) // this is the "body" of the plugin | |
| { | |
| var canvas = null; | |
| var target = null; | |
| var maxRadius = null; | |
| var centerLeft = null; | |
| var centerTop = null; | |
| var total = 0; | |
| var redraw = true; | |
| var redrawAttempts = 10; | |
| var shrink = 0.95; | |
| var legendWidth = 0; | |
| var processed = false; | |
| var raw = false; | |
| // interactive variables | |
| var highlights = []; | |
| // add hook to determine if pie plugin in enabled, and then perform necessary operations | |
| plot.hooks.processOptions.push(checkPieEnabled); | |
| plot.hooks.bindEvents.push(bindEvents); | |
| // check to see if the pie plugin is enabled | |
| function checkPieEnabled(plot, options) | |
| { | |
| if (options.series.pie.show) | |
| { | |
| //disable grid | |
| options.grid.show = false; | |
| // set labels.show | |
| if (options.series.pie.label.show=='auto') | |
| if (options.legend.show) | |
| options.series.pie.label.show = false; | |
| else | |
| options.series.pie.label.show = true; | |
| // set radius | |
| if (options.series.pie.radius=='auto') | |
| if (options.series.pie.label.show) | |
| options.series.pie.radius = 3/4; | |
| else | |
| options.series.pie.radius = 1; | |
| // ensure sane tilt | |
| if (options.series.pie.tilt>1) | |
| options.series.pie.tilt=1; | |
| if (options.series.pie.tilt<0) | |
| options.series.pie.tilt=0; | |
| // add processData hook to do transformations on the data | |
| plot.hooks.processDatapoints.push(processDatapoints); | |
| plot.hooks.drawOverlay.push(drawOverlay); | |
| // add draw hook | |
| plot.hooks.draw.push(draw); | |
| } | |
| } | |
| // bind hoverable events | |
| function bindEvents(plot, eventHolder) | |
| { | |
| var options = plot.getOptions(); | |
| if (options.series.pie.show && options.grid.hoverable) | |
| eventHolder.unbind('mousemove').mousemove(onMouseMove); | |
| if (options.series.pie.show && options.grid.clickable) | |
| eventHolder.unbind('click').click(onClick); | |
| } | |
| // debugging function that prints out an object | |
| function alertObject(obj) | |
| { | |
| var msg = ''; | |
| function traverse(obj, depth) | |
| { | |
| if (!depth) | |
| depth = 0; | |
| for (var i = 0; i < obj.length; ++i) | |
| { | |
| for (var j=0; j<depth; j++) | |
| msg += '\t'; | |
| if( typeof obj[i] == "object") | |
| { // its an object | |
| msg += ''+i+':\n'; | |
| traverse(obj[i], depth+1); | |
| } | |
| else | |
| { // its a value | |
| msg += ''+i+': '+obj[i]+'\n'; | |
| } | |
| } | |
| } | |
| traverse(obj); | |
| alert(msg); | |
| } | |
| function calcTotal(data) | |
| { | |
| for (var i = 0; i < data.length; ++i) | |
| { | |
| var item = parseFloat(data[i].data[0][1]); | |
| if (item) | |
| total += item; | |
| } | |
| } | |
| function processDatapoints(plot, series, data, datapoints) | |
| { | |
| if (!processed) | |
| { | |
| processed = true; | |
| canvas = plot.getCanvas(); | |
| target = $(canvas).parent(); | |
| options = plot.getOptions(); | |
| plot.setData(combine(plot.getData())); | |
| } | |
| } | |
| function setupPie() | |
| { | |
| legendWidth = target.children().filter('.legend').children().width(); | |
| // calculate maximum radius and center point | |
| maxRadius = Math.min(canvas.width,(canvas.height/options.series.pie.tilt))/2; | |
| centerTop = (canvas.height/2)+options.series.pie.offset.top; | |
| centerLeft = (canvas.width/2); | |
| if (options.series.pie.offset.left=='auto') | |
| if (options.legend.position.match('w')) | |
| centerLeft += legendWidth/2; | |
| else | |
| centerLeft -= legendWidth/2; | |
| else | |
| centerLeft += options.series.pie.offset.left; | |
| if (centerLeft<maxRadius) | |
| centerLeft = maxRadius; | |
| else if (centerLeft>canvas.width-maxRadius) | |
| centerLeft = canvas.width-maxRadius; | |
| } | |
| function fixData(data) | |
| { | |
| for (var i = 0; i < data.length; ++i) | |
| { | |
| if (typeof(data[i].data)=='number') | |
| data[i].data = [[1,data[i].data]]; | |
| else if (typeof(data[i].data)=='undefined' || typeof(data[i].data[0])=='undefined') | |
| { | |
| if (typeof(data[i].data)!='undefined' && typeof(data[i].data.label)!='undefined') | |
| data[i].label = data[i].data.label; // fix weirdness coming from flot | |
| data[i].data = [[1,0]]; | |
| } | |
| } | |
| return data; | |
| } | |
| function combine(data) | |
| { | |
| data = fixData(data); | |
| calcTotal(data); | |
| var combined = 0; | |
| var numCombined = 0; | |
| var color = options.series.pie.combine.color; | |
| var newdata = []; | |
| for (var i = 0; i < data.length; ++i) | |
| { | |
| // make sure its a number | |
| data[i].data[0][1] = parseFloat(data[i].data[0][1]); | |
| if (!data[i].data[0][1]) | |
| data[i].data[0][1] = 0; | |
| if (data[i].data[0][1]/total<=options.series.pie.combine.threshold) | |
| { | |
| combined += data[i].data[0][1]; | |
| numCombined++; | |
| if (!color) | |
| color = data[i].color; | |
| } | |
| else | |
| { | |
| newdata.push({ | |
| data: [[1,data[i].data[0][1]]], | |
| color: data[i].color, | |
| label: data[i].label, | |
| angle: (data[i].data[0][1]*(Math.PI*2))/total, | |
| percent: (data[i].data[0][1]/total*100) | |
| }); | |
| } | |
| } | |
| if (numCombined>0) | |
| newdata.push({ | |
| data: [[1,combined]], | |
| color: color, | |
| label: options.series.pie.combine.label, | |
| angle: (combined*(Math.PI*2))/total, | |
| percent: (combined/total*100) | |
| }); | |
| return newdata; | |
| } | |
| function draw(plot, newCtx) | |
| { | |
| if (!target) return; // if no series were passed | |
| ctx = newCtx; | |
| setupPie(); | |
| var slices = plot.getData(); | |
| var attempts = 0; | |
| while (redraw && attempts<redrawAttempts) | |
| { | |
| redraw = false; | |
| if (attempts>0) | |
| maxRadius *= shrink; | |
| attempts += 1; | |
| clear(); | |
| if (options.series.pie.tilt<=0.8) | |
| drawShadow(); | |
| drawPie(); | |
| } | |
| if (attempts >= redrawAttempts) { | |
| clear(); | |
| target.prepend('<div class="error">Could not draw pie with labels contained inside canvas</div>'); | |
| } | |
| if ( plot.setSeries && plot.insertLegend ) | |
| { | |
| plot.setSeries(slices); | |
| plot.insertLegend(); | |
| } | |
| // we're actually done at this point, just defining internal functions at this point | |
| function clear() | |
| { | |
| ctx.clearRect(0,0,canvas.width,canvas.height); | |
| target.children().filter('.pieLabel, .pieLabelBackground').remove(); | |
| } | |
| function drawShadow() | |
| { | |
| var shadowLeft = 5; | |
| var shadowTop = 15; | |
| var edge = 10; | |
| var alpha = 0.02; | |
| // set radius | |
| if (options.series.pie.radius>1) | |
| var radius = options.series.pie.radius; | |
| else | |
| var radius = maxRadius * options.series.pie.radius; | |
| if (radius>=(canvas.width/2)-shadowLeft || radius*options.series.pie.tilt>=(canvas.height/2)-shadowTop || radius<=edge) | |
| return; // shadow would be outside canvas, so don't draw it | |
| ctx.save(); | |
| ctx.translate(shadowLeft,shadowTop); | |
| ctx.globalAlpha = alpha; | |
| ctx.fillStyle = '#000'; | |
| // center and rotate to starting position | |
| ctx.translate(centerLeft,centerTop); | |
| ctx.scale(1, options.series.pie.tilt); | |
| //radius -= edge; | |
| for (var i=1; i<=edge; i++) | |
| { | |
| ctx.beginPath(); | |
| ctx.arc(0,0,radius,0,Math.PI*2,false); | |
| ctx.fill(); | |
| radius -= i; | |
| } | |
| ctx.restore(); | |
| } | |
| function drawPie() | |
| { | |
| startAngle = Math.PI*options.series.pie.startAngle; | |
| // set radius | |
| if (options.series.pie.radius>1) | |
| var radius = options.series.pie.radius; | |
| else | |
| var radius = maxRadius * options.series.pie.radius; | |
| // center and rotate to starting position | |
| ctx.save(); | |
| ctx.translate(centerLeft,centerTop); | |
| ctx.scale(1, options.series.pie.tilt); | |
| //ctx.rotate(startAngle); // start at top; -- This doesn't work properly in Opera | |
| // draw slices | |
| ctx.save(); | |
| var currentAngle = startAngle; | |
| for (var i = 0; i < slices.length; ++i) | |
| { | |
| slices[i].startAngle = currentAngle; | |
| drawSlice(slices[i].angle, slices[i].color, true); | |
| } | |
| ctx.restore(); | |
| // draw slice outlines | |
| ctx.save(); | |
| ctx.lineWidth = options.series.pie.stroke.width; | |
| currentAngle = startAngle; | |
| for (var i = 0; i < slices.length; ++i) | |
| drawSlice(slices[i].angle, options.series.pie.stroke.color, false); | |
| ctx.restore(); | |
| // draw donut hole | |
| drawDonutHole(ctx); | |
| // draw labels | |
| if (options.series.pie.label.show) | |
| drawLabels(); | |
| // restore to original state | |
| ctx.restore(); | |
| function drawSlice(angle, color, fill) | |
| { | |
| if (angle<=0) | |
| return; | |
| if (fill) | |
| ctx.fillStyle = color; | |
| else | |
| { | |
| ctx.strokeStyle = color; | |
| ctx.lineJoin = 'round'; | |
| } | |
| ctx.beginPath(); | |
| if (Math.abs(angle - Math.PI*2) > 0.000000001) | |
| ctx.moveTo(0,0); // Center of the pie | |
| else if ($.browser.msie) | |
| angle -= 0.0001; | |
| //ctx.arc(0,0,radius,0,angle,false); // This doesn't work properly in Opera | |
| ctx.arc(0,0,radius,currentAngle,currentAngle+angle,false); | |
| ctx.closePath(); | |
| //ctx.rotate(angle); // This doesn't work properly in Opera | |
| currentAngle += angle; | |
| if (fill) | |
| ctx.fill(); | |
| else | |
| ctx.stroke(); | |
| } | |
| function drawLabels() | |
| { | |
| var currentAngle = startAngle; | |
| // set radius | |
| if (options.series.pie.label.radius>1) | |
| var radius = options.series.pie.label.radius; | |
| else | |
| var radius = maxRadius * options.series.pie.label.radius; | |
| for (var i = 0; i < slices.length; ++i) | |
| { | |
| if (slices[i].percent >= options.series.pie.label.threshold*100) | |
| drawLabel(slices[i], currentAngle, i); | |
| currentAngle += slices[i].angle; | |
| } | |
| function drawLabel(slice, startAngle, index) | |
| { | |
| if (slice.data[0][1]==0) | |
| return; | |
| // format label text | |
| var lf = options.legend.labelFormatter, text, plf = options.series.pie.label.formatter; | |
| if (lf) | |
| text = lf(slice.label, slice); | |
| else | |
| text = slice.label; | |
| if (plf) | |
| text = plf(text, slice); | |
| var halfAngle = ((startAngle+slice.angle) + startAngle)/2; | |
| var x = centerLeft + Math.round(Math.cos(halfAngle) * radius); | |
| var y = centerTop + Math.round(Math.sin(halfAngle) * radius) * options.series.pie.tilt; | |
| var html = '<span class="pieLabel" id="pieLabel'+index+'" style="position:absolute;top:' + y + 'px;left:' + x + 'px;">' + text + "</span>"; | |
| target.append(html); | |
| var label = target.children('#pieLabel'+index); | |
| var labelTop = (y - label.height()/2); | |
| var labelLeft = (x - label.width()/2); | |
| label.css('top', labelTop); | |
| label.css('left', labelLeft); | |
| // check to make sure that the label is not outside the canvas | |
| if (0-labelTop>0 || 0-labelLeft>0 || canvas.height-(labelTop+label.height())<0 || canvas.width-(labelLeft+label.width())<0) | |
| redraw = true; | |
| if (options.series.pie.label.background.opacity != 0) { | |
| // put in the transparent background separately to avoid blended labels and label boxes | |
| var c = options.series.pie.label.background.color; | |
| if (c == null) { | |
| c = slice.color; | |
| } | |
| var pos = 'top:'+labelTop+'px;left:'+labelLeft+'px;'; | |
| $('<div class="pieLabelBackground" style="position:absolute;width:' + label.width() + 'px;height:' + label.height() + 'px;' + pos +'background-color:' + c + ';"> </div>').insertBefore(label).css('opacity', options.series.pie.label.background.opacity); | |
| } | |
| } // end individual label function | |
| } // end drawLabels function | |
| } // end drawPie function | |
| } // end draw function | |
| // Placed here because it needs to be accessed from multiple locations | |
| function drawDonutHole(layer) | |
| { | |
| // draw donut hole | |
| if(options.series.pie.innerRadius > 0) | |
| { | |
| // subtract the center | |
| layer.save(); | |
| innerRadius = options.series.pie.innerRadius > 1 ? options.series.pie.innerRadius : maxRadius * options.series.pie.innerRadius; | |
| layer.globalCompositeOperation = 'destination-out'; // this does not work with excanvas, but it will fall back to using the stroke color | |
| layer.beginPath(); | |
| layer.fillStyle = options.series.pie.stroke.color; | |
| layer.arc(0,0,innerRadius,0,Math.PI*2,false); | |
| layer.fill(); | |
| layer.closePath(); | |
| layer.restore(); | |
| // add inner stroke | |
| layer.save(); | |
| layer.beginPath(); | |
| layer.strokeStyle = options.series.pie.stroke.color; | |
| layer.arc(0,0,innerRadius,0,Math.PI*2,false); | |
| layer.stroke(); | |
| layer.closePath(); | |
| layer.restore(); | |
| // TODO: add extra shadow inside hole (with a mask) if the pie is tilted. | |
| } | |
| } | |
| //-- Additional Interactive related functions -- | |
| function isPointInPoly(poly, pt) | |
| { | |
| for(var c = false, i = -1, l = poly.length, j = l - 1; ++i < l; j = i) | |
| ((poly[i][1] <= pt[1] && pt[1] < poly[j][1]) || (poly[j][1] <= pt[1] && pt[1]< poly[i][1])) | |
| && (pt[0] < (poly[j][0] - poly[i][0]) * (pt[1] - poly[i][1]) / (poly[j][1] - poly[i][1]) + poly[i][0]) | |
| && (c = !c); | |
| return c; | |
| } | |
| function findNearbySlice(mouseX, mouseY) | |
| { | |
| var slices = plot.getData(), | |
| options = plot.getOptions(), | |
| radius = options.series.pie.radius > 1 ? options.series.pie.radius : maxRadius * options.series.pie.radius; | |
| for (var i = 0; i < slices.length; ++i) | |
| { | |
| var s = slices[i]; | |
| if(s.pie.show) | |
| { | |
| ctx.save(); | |
| ctx.beginPath(); | |
| ctx.moveTo(0,0); // Center of the pie | |
| //ctx.scale(1, options.series.pie.tilt); // this actually seems to break everything when here. | |
| ctx.arc(0,0,radius,s.startAngle,s.startAngle+s.angle,false); | |
| ctx.closePath(); | |
| x = mouseX-centerLeft; | |
| y = mouseY-centerTop; | |
| if(ctx.isPointInPath) | |
| { | |
| if (ctx.isPointInPath(mouseX-centerLeft, mouseY-centerTop)) | |
| { | |
| //alert('found slice!'); | |
| ctx.restore(); | |
| return {datapoint: [s.percent, s.data], dataIndex: 0, series: s, seriesIndex: i}; | |
| } | |
| } | |
| else | |
| { | |
| // excanvas for IE doesn;t support isPointInPath, this is a workaround. | |
| p1X = (radius * Math.cos(s.startAngle)); | |
| p1Y = (radius * Math.sin(s.startAngle)); | |
| p2X = (radius * Math.cos(s.startAngle+(s.angle/4))); | |
| p2Y = (radius * Math.sin(s.startAngle+(s.angle/4))); | |
| p3X = (radius * Math.cos(s.startAngle+(s.angle/2))); | |
| p3Y = (radius * Math.sin(s.startAngle+(s.angle/2))); | |
| p4X = (radius * Math.cos(s.startAngle+(s.angle/1.5))); | |
| p4Y = (radius * Math.sin(s.startAngle+(s.angle/1.5))); | |
| p5X = (radius * Math.cos(s.startAngle+s.angle)); | |
| p5Y = (radius * Math.sin(s.startAngle+s.angle)); | |
| arrPoly = [[0,0],[p1X,p1Y],[p2X,p2Y],[p3X,p3Y],[p4X,p4Y],[p5X,p5Y]]; | |
| arrPoint = [x,y]; | |
| // TODO: perhaps do some mathmatical trickery here with the Y-coordinate to compensate for pie tilt? | |
| if(isPointInPoly(arrPoly, arrPoint)) | |
| { | |
| ctx.restore(); | |
| return {datapoint: [s.percent, s.data], dataIndex: 0, series: s, seriesIndex: i}; | |
| } | |
| } | |
| ctx.restore(); | |
| } | |
| } | |
| return null; | |
| } | |
| function onMouseMove(e) | |
| { | |
| triggerClickHoverEvent('plothover', e); | |
| } | |
| function onClick(e) | |
| { | |
| triggerClickHoverEvent('plotclick', e); | |
| } | |
| // trigger click or hover event (they send the same parameters so we share their code) | |
| function triggerClickHoverEvent(eventname, e) | |
| { | |
| var offset = plot.offset(), | |
| canvasX = parseInt(e.pageX - offset.left), | |
| canvasY = parseInt(e.pageY - offset.top), | |
| item = findNearbySlice(canvasX, canvasY); | |
| if (options.grid.autoHighlight) | |
| { | |
| // clear auto-highlights | |
| for (var i = 0; i < highlights.length; ++i) | |
| { | |
| var h = highlights[i]; | |
| if (h.auto == eventname && !(item && h.series == item.series)) | |
| unhighlight(h.series); | |
| } | |
| } | |
| // highlight the slice | |
| if (item) | |
| highlight(item.series, eventname); | |
| // trigger any hover bind events | |
| var pos = { pageX: e.pageX, pageY: e.pageY }; | |
| target.trigger(eventname, [ pos, item ]); | |
| } | |
| function highlight(s, auto) | |
| { | |
| if (typeof s == "number") | |
| s = series[s]; | |
| var i = indexOfHighlight(s); | |
| if (i == -1) | |
| { | |
| highlights.push({ series: s, auto: auto }); | |
| plot.triggerRedrawOverlay(); | |
| } | |
| else if (!auto) | |
| highlights[i].auto = false; | |
| } | |
| function unhighlight(s) | |
| { | |
| if (s == null) | |
| { | |
| highlights = []; | |
| plot.triggerRedrawOverlay(); | |
| } | |
| if (typeof s == "number") | |
| s = series[s]; | |
| var i = indexOfHighlight(s); | |
| if (i != -1) | |
| { | |
| highlights.splice(i, 1); | |
| plot.triggerRedrawOverlay(); | |
| } | |
| } | |
| function indexOfHighlight(s) | |
| { | |
| for (var i = 0; i < highlights.length; ++i) | |
| { | |
| var h = highlights[i]; | |
| if (h.series == s) | |
| return i; | |
| } | |
| return -1; | |
| } | |
| function drawOverlay(plot, octx) | |
| { | |
| //alert(options.series.pie.radius); | |
| var options = plot.getOptions(); | |
| //alert(options.series.pie.radius); | |
| var radius = options.series.pie.radius > 1 ? options.series.pie.radius : maxRadius * options.series.pie.radius; | |
| octx.save(); | |
| octx.translate(centerLeft, centerTop); | |
| octx.scale(1, options.series.pie.tilt); | |
| for (i = 0; i < highlights.length; ++i) | |
| drawHighlight(highlights[i].series); | |
| drawDonutHole(octx); | |
| octx.restore(); | |
| function drawHighlight(series) | |
| { | |
| if (series.angle < 0) return; | |
| //octx.fillStyle = parseColor(options.series.pie.highlight.color).scale(null, null, null, options.series.pie.highlight.opacity).toString(); | |
| octx.fillStyle = "rgba(255, 255, 255, "+options.series.pie.highlight.opacity+")"; // this is temporary until we have access to parseColor | |
| octx.beginPath(); | |
| if (Math.abs(series.angle - Math.PI*2) > 0.000000001) | |
| octx.moveTo(0,0); // Center of the pie | |
| octx.arc(0,0,radius,series.startAngle,series.startAngle+series.angle,false); | |
| octx.closePath(); | |
| octx.fill(); | |
| } | |
| } | |
| } // end init (plugin body) | |
| // define pie specific options and their default values | |
| var options = { | |
| series: { | |
| pie: { | |
| show: false, | |
| radius: 'auto', // actual radius of the visible pie (based on full calculated radius if <=1, or hard pixel value) | |
| innerRadius:0, /* for donut */ | |
| startAngle: 3/2, | |
| tilt: 1, | |
| offset: { | |
| top: 0, | |
| left: 'auto' | |
| }, | |
| stroke: { | |
| color: '#FFF', | |
| width: 1 | |
| }, | |
| label: { | |
| show: 'auto', | |
| formatter: function(label, slice){ | |
| return '<div style="font-size:x-small;text-align:center;padding:2px;color:'+slice.color+';">'+label+'<br/>'+Math.round(slice.percent)+'%</div>'; | |
| }, // formatter function | |
| radius: 1, // radius at which to place the labels (based on full calculated radius if <=1, or hard pixel value) | |
| background: { | |
| color: null, | |
| opacity: 0 | |
| }, | |
| threshold: 0 // percentage at which to hide the label (i.e. the slice is too narrow) | |
| }, | |
| combine: { | |
| threshold: -1, // percentage at which to combine little slices into one larger slice | |
| color: null, // color to give the new slice (auto-generated if null) | |
| label: 'Other' // label to give the new slice | |
| }, | |
| highlight: { | |
| //color: '#FFF', // will add this functionality once parseColor is available | |
| opacity: 0.5 | |
| } | |
| } | |
| } | |
| }; | |
| $.plot.plugins.push({ | |
| init: init, | |
| options: options, | |
| name: "pie", | |
| version: "1.0" | |
| }); | |
| })(jQuery); | |
| (function(b){function c(D){var h=null;var L=null;var n=null;var B=null;var p=null;var M=0;var F=true;var o=10;var w=0.95;var A=0;var d=false;var z=false;var j=[];D.hooks.processOptions.push(g);D.hooks.bindEvents.push(e);function g(O,N){if(N.series.pie.show){N.grid.show=false;if(N.series.pie.label.show=="auto"){if(N.legend.show){N.series.pie.label.show=false}else{N.series.pie.label.show=true}}if(N.series.pie.radius=="auto"){if(N.series.pie.label.show){N.series.pie.radius=3/4}else{N.series.pie.radius=1}}if(N.series.pie.tilt>1){N.series.pie.tilt=1}if(N.series.pie.tilt<0){N.series.pie.tilt=0}O.hooks.processDatapoints.push(E);O.hooks.drawOverlay.push(H);O.hooks.draw.push(r)}}function e(P,N){var O=P.getOptions();if(O.series.pie.show&&O.grid.hoverable){N.unbind("mousemove").mousemove(t)}if(O.series.pie.show&&O.grid.clickable){N.unbind("click").click(l)}}function G(O){var P="";function N(S,T){if(!T){T=0}for(var R=0;R<S.length;++R){for(var Q=0;Q<T;Q++){P+="\t"}if(typeof S[R]=="object"){P+=""+R+":\n";N(S[R],T+1)}else{P+=""+R+": "+S[R]+"\n"}}}N(O);alert(P)}function q(P){for(var N=0;N<P.length;++N){var O=parseFloat(P[N].data[0][1]);if(O){M+=O}}}function E(Q,N,O,P){if(!d){d=true;h=Q.getCanvas();L=b(h).parent();a=Q.getOptions();Q.setData(K(Q.getData()))}}function I(){A=L.children().filter(".legend").children().width();n=Math.min(h.width,(h.height/a.series.pie.tilt))/2;p=(h.height/2)+a.series.pie.offset.top;B=(h.width/2);if(a.series.pie.offset.left=="auto"){if(a.legend.position.match("w")){B+=A/2}else{B-=A/2}}else{B+=a.series.pie.offset.left}if(B<n){B=n}else{if(B>h.width-n){B=h.width-n}}}function v(O){for(var N=0;N<O.length;++N){if(typeof(O[N].data)=="number"){O[N].data=[[1,O[N].data]]}else{if(typeof(O[N].data)=="undefined"||typeof(O[N].data[0])=="undefined"){if(typeof(O[N].data)!="undefined"&&typeof(O[N].data.label)!="undefined"){O[N].label=O[N].data.label}O[N].data=[[1,0]]}}}return O}function K(Q){Q=v(Q);q(Q);var P=0;var S=0;var N=a.series.pie.combine.color;var R=[];for(var O=0;O<Q.length;++O){Q[O].data[0][1]=parseFloat(Q[O].data[0][1]);if(!Q[O].data[0][1]){Q[O].data[0][1]=0}if(Q[O].data[0][1]/M<=a.series.pie.combine.threshold){P+=Q[O].data[0][1];S++;if(!N){N=Q[O].color}}else{R.push({data:[[1,Q[O].data[0][1]]],color:Q[O].color,label:Q[O].label,angle:(Q[O].data[0][1]*(Math.PI*2))/M,percent:(Q[O].data[0][1]/M*100)})}}if(S>0){R.push({data:[[1,P]],color:N,label:a.series.pie.combine.label,angle:(P*(Math.PI*2))/M,percent:(P/M*100)})}return R}function r(S,Q){if(!L){return}ctx=Q;I();var T=S.getData();var P=0;while(F&&P<o){F=false;if(P>0){n*=w}P+=1;N();if(a.series.pie.tilt<=0.8){O()}R()}if(P>=o){N();L.prepend('<div class="error">Could not draw pie with labels contained inside canvas</div>')}if(S.setSeries&&S.insertLegend){S.setSeries(T);S.insertLegend()}function N(){ctx.clearRect(0,0,h.width,h.height);L.children().filter(".pieLabel, .pieLabelBackground").remove()}function O(){var Z=5;var Y=15;var W=10;var X=0.02;if(a.series.pie.radius>1){var U=a.series.pie.radius}else{var U=n*a.series.pie.radius}if(U>=(h.width/2)-Z||U*a.series.pie.tilt>=(h.height/2)-Y||U<=W){return}ctx.save();ctx.translate(Z,Y);ctx.globalAlpha=X;ctx.fillStyle="#000";ctx.translate(B,p);ctx.scale(1,a.series.pie.tilt);for(var V=1;V<=W;V++){ctx.beginPath();ctx.arc(0,0,U,0,Math.PI*2,false);ctx.fill();U-=V}ctx.restore()}function R(){startAngle=Math.PI*a.series.pie.startAngle;if(a.series.pie.radius>1){var U=a.series.pie.radius}else{var U=n*a.series.pie.radius}ctx.save();ctx.translate(B,p);ctx.scale(1,a.series.pie.tilt);ctx.save();var Y=startAngle;for(var W=0;W<T.length;++W){T[W].startAngle=Y;X(T[W].angle,T[W].color,true)}ctx.restore();ctx.save();ctx.lineWidth=a.series.pie.stroke.width;Y=startAngle;for(var W=0;W<T.length;++W){X(T[W].angle,a.series.pie.stroke.color,false)}ctx.restore();J(ctx);if(a.series.pie.label.show){V()}ctx.restore();function X(ab,Z,aa){if(ab<=0){return}if(aa){ctx.fillStyle=Z}else{ctx.strokeStyle=Z;ctx.lineJoin="round"}ctx.beginPath();if(Math.abs(ab-Math.PI*2)>1e-9){ctx.moveTo(0,0)}else{if(b.browser.msie){ab-=0.0001}}ctx.arc(0,0,U,Y,Y+ab,false);ctx.closePath();Y+=ab;if(aa){ctx.fill()}else{ctx.stroke()}}function V(){var ac=startAngle;if(a.series.pie.label.radius>1){var Z=a.series.pie.label.radius}else{var Z=n*a.series.pie.label.radius}for(var ab=0;ab<T.length;++ab){if(T[ab].percent>=a.series.pie.label.threshold*100){aa(T[ab],ac,ab)}ac+=T[ab].angle}function aa(ap,ai,ag){if(ap.data[0][1]==0){return}var ar=a.legend.labelFormatter,aq,ae=a.series.pie.label.formatter;if(ar){aq=ar(ap.label,ap)}else{aq=ap.label}if(ae){aq=ae(aq,ap)}var aj=((ai+ap.angle)+ai)/2;var ao=B+Math.round(Math.cos(aj)*Z);var am=p+Math.round(Math.sin(aj)*Z)*a.series.pie.tilt;var af='<span class="pieLabel" id="pieLabel'+ag+'" style="position:absolute;top:'+am+"px;left:"+ao+'px;">'+aq+"</span>";L.append(af);var an=L.children("#pieLabel"+ag);var ad=(am-an.height()/2);var ah=(ao-an.width()/2);an.css("top",ad);an.css("left",ah);if(0-ad>0||0-ah>0||h.height-(ad+an.height())<0||h.width-(ah+an.width())<0){F=true}if(a.series.pie.label.background.opacity!=0){var ak=a.series.pie.label.background.color;if(ak==null){ak=ap.color}var al="top:"+ad+"px;left:"+ah+"px;";b('<div class="pieLabelBackground" style="position:absolute;width:'+an.width()+"px;height:"+an.height()+"px;"+al+"background-color:"+ak+';"> </div>').insertBefore(an).css("opacity",a.series.pie.label.background.opacity)}}}}}function J(N){if(a.series.pie.innerRadius>0){N.save();innerRadius=a.series.pie.innerRadius>1?a.series.pie.innerRadius:n*a.series.pie.innerRadius;N.globalCompositeOperation="destination-out";N.beginPath();N.fillStyle=a.series.pie.stroke.color;N.arc(0,0,innerRadius,0,Math.PI*2,false);N.fill();N.closePath();N.restore();N.save();N.beginPath();N.strokeStyle=a.series.pie.stroke.color;N.arc(0,0,innerRadius,0,Math.PI*2,false);N.stroke();N.closePath();N.restore()}}function s(Q,R){for(var S=false,P=-1,N=Q.length,O=N-1;++P<N;O=P){((Q[P][1]<=R[1]&&R[1]<Q[O][1])||(Q[O][1]<=R[1]&&R[1]<Q[P][1]))&&(R[0]<(Q[O][0]-Q[P][0])*(R[1]-Q[P][1])/(Q[O][1]-Q[P][1])+Q[P][0])&&(S=!S)}return S}function u(R,P){var T=D.getData(),O=D.getOptions(),N=O.series.pie.radius>1?O.series.pie.radius:n*O.series.pie.radius;for(var Q=0;Q<T.length;++Q){var S=T[Q];if(S.pie.show){ctx.save();ctx.beginPath();ctx.moveTo(0,0);ctx.arc(0,0,N,S.startAngle,S.startAngle+S.angle,false);ctx.closePath();x=R-B;y=P-p;if(ctx.isPointInPath){if(ctx.isPointInPath(R-B,P-p)){ctx.restore();return{datapoint:[S.percent,S.data],dataIndex:0,series:S,seriesIndex:Q}}}else{p1X=(N*Math.cos(S.startAngle));p1Y=(N*Math.sin(S.startAngle));p2X=(N*Math.cos(S.startAngle+(S.angle/4)));p2Y=(N*Math.sin(S.startAngle+(S.angle/4)));p3X=(N*Math.cos(S.startAngle+(S.angle/2)));p3Y=(N*Math.sin(S.startAngle+(S.angle/2)));p4X=(N*Math.cos(S.startAngle+(S.angle/1.5)));p4Y=(N*Math.sin(S.startAngle+(S.angle/1.5)));p5X=(N*Math.cos(S.startAngle+S.angle));p5Y=(N*Math.sin(S.startAngle+S.angle));arrPoly=[[0,0],[p1X,p1Y],[p2X,p2Y],[p3X,p3Y],[p4X,p4Y],[p5X,p5Y]];arrPoint=[x,y];if(s(arrPoly,arrPoint)){ctx.restore();return{datapoint:[S.percent,S.data],dataIndex:0,series:S,seriesIndex:Q}}}ctx.restore()}}return null}function t(N){m("plothover",N)}function l(N){m("plotclick",N)}function m(N,T){var O=D.offset(),R=parseInt(T.pageX-O.left),P=parseInt(T.pageY-O.top),V=u(R,P);if(a.grid.autoHighlight){for(var Q=0;Q<j.length;++Q){var S=j[Q];if(S.auto==N&&!(V&&S.series==V.series)){f(S.series)}}}if(V){k(V.series,N)}var U={pageX:T.pageX,pageY:T.pageY};L.trigger(N,[U,V])}function k(O,P){if(typeof O=="number"){O=series[O]}var N=C(O);if(N==-1){j.push({series:O,auto:P});D.triggerRedrawOverlay()}else{if(!P){j[N].auto=false}}}function f(O){if(O==null){j=[];D.triggerRedrawOverlay()}if(typeof O=="number"){O=series[O]}var N=C(O);if(N!=-1){j.splice(N,1);D.triggerRedrawOverlay()}}function C(P){for(var N=0;N<j.length;++N){var O=j[N];if(O.series==P){return N}}return -1}function H(Q,R){var P=Q.getOptions();var N=P.series.pie.radius>1?P.series.pie.radius:n*P.series.pie.radius;R.save();R.translate(B,p);R.scale(1,P.series.pie.tilt);for(i=0;i<j.length;++i){O(j[i].series)}J(R);R.restore();function O(S){if(S.angle<0){return}R.fillStyle="rgba(255, 255, 255, "+P.series.pie.highlight.opacity+")";R.beginPath();if(Math.abs(S.angle-Math.PI*2)>1e-9){R.moveTo(0,0)}R.arc(0,0,N,S.startAngle,S.startAngle+S.angle,false);R.closePath();R.fill()}}}var a={series:{pie:{show:false,radius:"auto",innerRadius:0,startAngle:3/2,tilt:1,offset:{top:0,left:"auto"},stroke:{color:"#FFF",width:1},label:{show:"auto",formatter:function(d,e){return'<div style="font-size:x-small;text-align:center;padding:2px;color:'+e.color+';">'+d+"<br/>"+Math.round(e.percent)+"%</div>"},radius:1,background:{color:null,opacity:0},threshold:0},combine:{threshold:-1,color:null,label:"Other"},highlight:{opacity:0.5}}}};b.plot.plugins.push({init:c,options:a,name:"pie",version:"1.0"})})(jQuery); |
| /* | |
| Flot plugin for automatically redrawing plots when the placeholder | |
| size changes, e.g. on window resizes. | |
| It works by listening for changes on the placeholder div (through the | |
| jQuery resize event plugin) - if the size changes, it will redraw the | |
| plot. | |
| There are no options. If you need to disable the plugin for some | |
| plots, you can just fix the size of their placeholders. | |
| */ | |
| /* Inline dependency: | |
| * jQuery resize event - v1.1 - 3/14/2010 | |
| * http://benalman.com/projects/jquery-resize-plugin/ | |
| * | |
| * Copyright (c) 2010 "Cowboy" Ben Alman | |
| * Dual licensed under the MIT and GPL licenses. | |
| * http://benalman.com/about/license/ | |
| */ | |
| (function($,h,c){var a=$([]),e=$.resize=$.extend($.resize,{}),i,k="setTimeout",j="resize",d=j+"-special-event",b="delay",f="throttleWindow";e[b]=250;e[f]=true;$.event.special[j]={setup:function(){if(!e[f]&&this[k]){return false}var l=$(this);a=a.add(l);$.data(this,d,{w:l.width(),h:l.height()});if(a.length===1){g()}},teardown:function(){if(!e[f]&&this[k]){return false}var l=$(this);a=a.not(l);l.removeData(d);if(!a.length){clearTimeout(i)}},add:function(l){if(!e[f]&&this[k]){return false}var n;function m(s,o,p){var q=$(this),r=$.data(this,d);r.w=o!==c?o:q.width();r.h=p!==c?p:q.height();n.apply(this,arguments)}if($.isFunction(l)){n=l;return m}else{n=l.handler;l.handler=m}}};function g(){i=h[k](function(){a.each(function(){var n=$(this),m=n.width(),l=n.height(),o=$.data(this,d);if(m!==o.w||l!==o.h){n.trigger(j,[o.w=m,o.h=l])}});g()},e[b])}})(jQuery,this); | |
| (function ($) { | |
| var options = { }; // no options | |
| function init(plot) { | |
| function onResize() { | |
| var placeholder = plot.getPlaceholder(); | |
| // somebody might have hidden us and we can't plot | |
| // when we don't have the dimensions | |
| if (placeholder.width() == 0 || placeholder.height() == 0) | |
| return; | |
| plot.resize(); | |
| plot.setupGrid(); | |
| plot.draw(); | |
| } | |
| function bindEvents(plot, eventHolder) { | |
| plot.getPlaceholder().resize(onResize); | |
| } | |
| function shutdown(plot, eventHolder) { | |
| plot.getPlaceholder().unbind("resize", onResize); | |
| } | |
| plot.hooks.bindEvents.push(bindEvents); | |
| plot.hooks.shutdown.push(shutdown); | |
| } | |
| $.plot.plugins.push({ | |
| init: init, | |
| options: options, | |
| name: 'resize', | |
| version: '1.0' | |
| }); | |
| })(jQuery); | |
| (function(n,p,u){var w=n([]),s=n.resize=n.extend(n.resize,{}),o,l="setTimeout",m="resize",t=m+"-special-event",v="delay",r="throttleWindow";s[v]=250;s[r]=true;n.event.special[m]={setup:function(){if(!s[r]&&this[l]){return false}var a=n(this);w=w.add(a);n.data(this,t,{w:a.width(),h:a.height()});if(w.length===1){q()}},teardown:function(){if(!s[r]&&this[l]){return false}var a=n(this);w=w.not(a);a.removeData(t);if(!w.length){clearTimeout(o)}},add:function(b){if(!s[r]&&this[l]){return false}var c;function a(d,h,g){var f=n(this),e=n.data(this,t);e.w=h!==u?h:f.width();e.h=g!==u?g:f.height();c.apply(this,arguments)}if(n.isFunction(b)){c=b;return a}else{c=b.handler;b.handler=a}}};function q(){o=p[l](function(){w.each(function(){var d=n(this),a=d.width(),b=d.height(),c=n.data(this,t);if(a!==c.w||b!==c.h){d.trigger(m,[c.w=a,c.h=b])}});q()},s[v])}})(jQuery,this);(function(b){var a={};function c(f){function e(){var h=f.getPlaceholder();if(h.width()==0||h.height()==0){return}f.resize();f.setupGrid();f.draw()}function g(i,h){i.getPlaceholder().resize(e)}function d(i,h){i.getPlaceholder().unbind("resize",e)}f.hooks.bindEvents.push(g);f.hooks.shutdown.push(d)}b.plot.plugins.push({init:c,options:a,name:"resize",version:"1.0"})})(jQuery); |
| /* | |
| Flot plugin for selecting regions. | |
| The plugin defines the following options: | |
| selection: { | |
| mode: null or "x" or "y" or "xy", | |
| color: color | |
| } | |
| Selection support is enabled by setting the mode to one of "x", "y" or | |
| "xy". In "x" mode, the user will only be able to specify the x range, | |
| similarly for "y" mode. For "xy", the selection becomes a rectangle | |
| where both ranges can be specified. "color" is color of the selection | |
| (if you need to change the color later on, you can get to it with | |
| plot.getOptions().selection.color). | |
| When selection support is enabled, a "plotselected" event will be | |
| emitted on the DOM element you passed into the plot function. The | |
| event handler gets a parameter with the ranges selected on the axes, | |
| like this: | |
| placeholder.bind("plotselected", function(event, ranges) { | |
| alert("You selected " + ranges.xaxis.from + " to " + ranges.xaxis.to) | |
| // similar for yaxis - with multiple axes, the extra ones are in | |
| // x2axis, x3axis, ... | |
| }); | |
| The "plotselected" event is only fired when the user has finished | |
| making the selection. A "plotselecting" event is fired during the | |
| process with the same parameters as the "plotselected" event, in case | |
| you want to know what's happening while it's happening, | |
| A "plotunselected" event with no arguments is emitted when the user | |
| clicks the mouse to remove the selection. | |
| The plugin allso adds the following methods to the plot object: | |
| - setSelection(ranges, preventEvent) | |
| Set the selection rectangle. The passed in ranges is on the same | |
| form as returned in the "plotselected" event. If the selection mode | |
| is "x", you should put in either an xaxis range, if the mode is "y" | |
| you need to put in an yaxis range and both xaxis and yaxis if the | |
| selection mode is "xy", like this: | |
| setSelection({ xaxis: { from: 0, to: 10 }, yaxis: { from: 40, to: 60 } }); | |
| setSelection will trigger the "plotselected" event when called. If | |
| you don't want that to happen, e.g. if you're inside a | |
| "plotselected" handler, pass true as the second parameter. If you | |
| are using multiple axes, you can specify the ranges on any of those, | |
| e.g. as x2axis/x3axis/... instead of xaxis, the plugin picks the | |
| first one it sees. | |
| - clearSelection(preventEvent) | |
| Clear the selection rectangle. Pass in true to avoid getting a | |
| "plotunselected" event. | |
| - getSelection() | |
| Returns the current selection in the same format as the | |
| "plotselected" event. If there's currently no selection, the | |
| function returns null. | |
| */ | |
| (function ($) { | |
| function init(plot) { | |
| var selection = { | |
| first: { x: -1, y: -1}, second: { x: -1, y: -1}, | |
| show: false, | |
| active: false | |
| }; | |
| // FIXME: The drag handling implemented here should be | |
| // abstracted out, there's some similar code from a library in | |
| // the navigation plugin, this should be massaged a bit to fit | |
| // the Flot cases here better and reused. Doing this would | |
| // make this plugin much slimmer. | |
| var savedhandlers = {}; | |
| var mouseUpHandler = null; | |
| function onMouseMove(e) { | |
| if (selection.active) { | |
| updateSelection(e); | |
| plot.getPlaceholder().trigger("plotselecting", [ getSelection() ]); | |
| } | |
| } | |
| function onMouseDown(e) { | |
| if (e.which != 1) // only accept left-click | |
| return; | |
| // cancel out any text selections | |
| document.body.focus(); | |
| // prevent text selection and drag in old-school browsers | |
| if (document.onselectstart !== undefined && savedhandlers.onselectstart == null) { | |
| savedhandlers.onselectstart = document.onselectstart; | |
| document.onselectstart = function () { return false; }; | |
| } | |
| if (document.ondrag !== undefined && savedhandlers.ondrag == null) { | |
| savedhandlers.ondrag = document.ondrag; | |
| document.ondrag = function () { return false; }; | |
| } | |
| setSelectionPos(selection.first, e); | |
| selection.active = true; | |
| // this is a bit silly, but we have to use a closure to be | |
| // able to whack the same handler again | |
| mouseUpHandler = function (e) { onMouseUp(e); }; | |
| $(document).one("mouseup", mouseUpHandler); | |
| } | |
| function onMouseUp(e) { | |
| mouseUpHandler = null; | |
| // revert drag stuff for old-school browsers | |
| if (document.onselectstart !== undefined) | |
| document.onselectstart = savedhandlers.onselectstart; | |
| if (document.ondrag !== undefined) | |
| document.ondrag = savedhandlers.ondrag; | |
| // no more dragging | |
| selection.active = false; | |
| updateSelection(e); | |
| if (selectionIsSane()) | |
| triggerSelectedEvent(); | |
| else { | |
| // this counts as a clear | |
| plot.getPlaceholder().trigger("plotunselected", [ ]); | |
| plot.getPlaceholder().trigger("plotselecting", [ null ]); | |
| } | |
| return false; | |
| } | |
| function getSelection() { | |
| if (!selectionIsSane()) | |
| return null; | |
| var r = {}, c1 = selection.first, c2 = selection.second; | |
| $.each(plot.getAxes(), function (name, axis) { | |
| if (axis.used) { | |
| var p1 = axis.c2p(c1[axis.direction]), p2 = axis.c2p(c2[axis.direction]); | |
| r[name] = { from: Math.min(p1, p2), to: Math.max(p1, p2) }; | |
| } | |
| }); | |
| return r; | |
| } | |
| function triggerSelectedEvent() { | |
| var r = getSelection(); | |
| plot.getPlaceholder().trigger("plotselected", [ r ]); | |
| // backwards-compat stuff, to be removed in future | |
| if (r.xaxis && r.yaxis) | |
| plot.getPlaceholder().trigger("selected", [ { x1: r.xaxis.from, y1: r.yaxis.from, x2: r.xaxis.to, y2: r.yaxis.to } ]); | |
| } | |
| function clamp(min, value, max) { | |
| return value < min ? min: (value > max ? max: value); | |
| } | |
| function setSelectionPos(pos, e) { | |
| var o = plot.getOptions(); | |
| var offset = plot.getPlaceholder().offset(); | |
| var plotOffset = plot.getPlotOffset(); | |
| pos.x = clamp(0, e.pageX - offset.left - plotOffset.left, plot.width()); | |
| pos.y = clamp(0, e.pageY - offset.top - plotOffset.top, plot.height()); | |
| if (o.selection.mode == "y") | |
| pos.x = pos == selection.first ? 0 : plot.width(); | |
| if (o.selection.mode == "x") | |
| pos.y = pos == selection.first ? 0 : plot.height(); | |
| } | |
| function updateSelection(pos) { | |
| if (pos.pageX == null) | |
| return; | |
| setSelectionPos(selection.second, pos); | |
| if (selectionIsSane()) { | |
| selection.show = true; | |
| plot.triggerRedrawOverlay(); | |
| } | |
| else | |
| clearSelection(true); | |
| } | |
| function clearSelection(preventEvent) { | |
| if (selection.show) { | |
| selection.show = false; | |
| plot.triggerRedrawOverlay(); | |
| if (!preventEvent) | |
| plot.getPlaceholder().trigger("plotunselected", [ ]); | |
| } | |
| } | |
| // function taken from markings support in Flot | |
| function extractRange(ranges, coord) { | |
| var axis, from, to, key, axes = plot.getAxes(); | |
| for (var k in axes) { | |
| axis = axes[k]; | |
| if (axis.direction == coord) { | |
| key = coord + axis.n + "axis"; | |
| if (!ranges[key] && axis.n == 1) | |
| key = coord + "axis"; // support x1axis as xaxis | |
| if (ranges[key]) { | |
| from = ranges[key].from; | |
| to = ranges[key].to; | |
| break; | |
| } | |
| } | |
| } | |
| // backwards-compat stuff - to be removed in future | |
| if (!ranges[key]) { | |
| axis = coord == "x" ? plot.getXAxes()[0] : plot.getYAxes()[0]; | |
| from = ranges[coord + "1"]; | |
| to = ranges[coord + "2"]; | |
| } | |
| // auto-reverse as an added bonus | |
| if (from != null && to != null && from > to) { | |
| var tmp = from; | |
| from = to; | |
| to = tmp; | |
| } | |
| return { from: from, to: to, axis: axis }; | |
| } | |
| function setSelection(ranges, preventEvent) { | |
| var axis, range, o = plot.getOptions(); | |
| if (o.selection.mode == "y") { | |
| selection.first.x = 0; | |
| selection.second.x = plot.width(); | |
| } | |
| else { | |
| range = extractRange(ranges, "x"); | |
| selection.first.x = range.axis.p2c(range.from); | |
| selection.second.x = range.axis.p2c(range.to); | |
| } | |
| if (o.selection.mode == "x") { | |
| selection.first.y = 0; | |
| selection.second.y = plot.height(); | |
| } | |
| else { | |
| range = extractRange(ranges, "y"); | |
| selection.first.y = range.axis.p2c(range.from); | |
| selection.second.y = range.axis.p2c(range.to); | |
| } | |
| selection.show = true; | |
| plot.triggerRedrawOverlay(); | |
| if (!preventEvent && selectionIsSane()) | |
| triggerSelectedEvent(); | |
| } | |
| function selectionIsSane() { | |
| var minSize = 5; | |
| return Math.abs(selection.second.x - selection.first.x) >= minSize && | |
| Math.abs(selection.second.y - selection.first.y) >= minSize; | |
| } | |
| plot.clearSelection = clearSelection; | |
| plot.setSelection = setSelection; | |
| plot.getSelection = getSelection; | |
| plot.hooks.bindEvents.push(function(plot, eventHolder) { | |
| var o = plot.getOptions(); | |
| if (o.selection.mode != null) { | |
| eventHolder.mousemove(onMouseMove); | |
| eventHolder.mousedown(onMouseDown); | |
| } | |
| }); | |
| plot.hooks.drawOverlay.push(function (plot, ctx) { | |
| // draw selection | |
| if (selection.show && selectionIsSane()) { | |
| var plotOffset = plot.getPlotOffset(); | |
| var o = plot.getOptions(); | |
| ctx.save(); | |
| ctx.translate(plotOffset.left, plotOffset.top); | |
| var c = $.color.parse(o.selection.color); | |
| ctx.strokeStyle = c.scale('a', 0.8).toString(); | |
| ctx.lineWidth = 1; | |
| ctx.lineJoin = "round"; | |
| ctx.fillStyle = c.scale('a', 0.4).toString(); | |
| var x = Math.min(selection.first.x, selection.second.x), | |
| y = Math.min(selection.first.y, selection.second.y), | |
| w = Math.abs(selection.second.x - selection.first.x), | |
| h = Math.abs(selection.second.y - selection.first.y); | |
| ctx.fillRect(x, y, w, h); | |
| ctx.strokeRect(x, y, w, h); | |
| ctx.restore(); | |
| } | |
| }); | |
| plot.hooks.shutdown.push(function (plot, eventHolder) { | |
| eventHolder.unbind("mousemove", onMouseMove); | |
| eventHolder.unbind("mousedown", onMouseDown); | |
| if (mouseUpHandler) | |
| $(document).unbind("mouseup", mouseUpHandler); | |
| }); | |
| } | |
| $.plot.plugins.push({ | |
| init: init, | |
| options: { | |
| selection: { | |
| mode: null, // one of null, "x", "y" or "xy" | |
| color: "#e8cfac" | |
| } | |
| }, | |
| name: 'selection', | |
| version: '1.1' | |
| }); | |
| })(jQuery); | |
| (function(a){function b(k){var p={first:{x:-1,y:-1},second:{x:-1,y:-1},show:false,active:false};var m={};var r=null;function e(s){if(p.active){l(s);k.getPlaceholder().trigger("plotselecting",[g()])}}function n(s){if(s.which!=1){return}document.body.focus();if(document.onselectstart!==undefined&&m.onselectstart==null){m.onselectstart=document.onselectstart;document.onselectstart=function(){return false}}if(document.ondrag!==undefined&&m.ondrag==null){m.ondrag=document.ondrag;document.ondrag=function(){return false}}d(p.first,s);p.active=true;r=function(t){j(t)};a(document).one("mouseup",r)}function j(s){r=null;if(document.onselectstart!==undefined){document.onselectstart=m.onselectstart}if(document.ondrag!==undefined){document.ondrag=m.ondrag}p.active=false;l(s);if(f()){i()}else{k.getPlaceholder().trigger("plotunselected",[]);k.getPlaceholder().trigger("plotselecting",[null])}return false}function g(){if(!f()){return null}var u={},t=p.first,s=p.second;a.each(k.getAxes(),function(v,w){if(w.used){var y=w.c2p(t[w.direction]),x=w.c2p(s[w.direction]);u[v]={from:Math.min(y,x),to:Math.max(y,x)}}});return u}function i(){var s=g();k.getPlaceholder().trigger("plotselected",[s]);if(s.xaxis&&s.yaxis){k.getPlaceholder().trigger("selected",[{x1:s.xaxis.from,y1:s.yaxis.from,x2:s.xaxis.to,y2:s.yaxis.to}])}}function h(t,u,s){return u<t?t:(u>s?s:u)}function d(w,t){var v=k.getOptions();var u=k.getPlaceholder().offset();var s=k.getPlotOffset();w.x=h(0,t.pageX-u.left-s.left,k.width());w.y=h(0,t.pageY-u.top-s.top,k.height());if(v.selection.mode=="y"){w.x=w==p.first?0:k.width()}if(v.selection.mode=="x"){w.y=w==p.first?0:k.height()}}function l(s){if(s.pageX==null){return}d(p.second,s);if(f()){p.show=true;k.triggerRedrawOverlay()}else{q(true)}}function q(s){if(p.show){p.show=false;k.triggerRedrawOverlay();if(!s){k.getPlaceholder().trigger("plotunselected",[])}}}function c(s,w){var t,y,z,A,x=k.getAxes();for(var u in x){t=x[u];if(t.direction==w){A=w+t.n+"axis";if(!s[A]&&t.n==1){A=w+"axis"}if(s[A]){y=s[A].from;z=s[A].to;break}}}if(!s[A]){t=w=="x"?k.getXAxes()[0]:k.getYAxes()[0];y=s[w+"1"];z=s[w+"2"]}if(y!=null&&z!=null&&y>z){var v=y;y=z;z=v}return{from:y,to:z,axis:t}}function o(t,s){var v,u,w=k.getOptions();if(w.selection.mode=="y"){p.first.x=0;p.second.x=k.width()}else{u=c(t,"x");p.first.x=u.axis.p2c(u.from);p.second.x=u.axis.p2c(u.to)}if(w.selection.mode=="x"){p.first.y=0;p.second.y=k.height()}else{u=c(t,"y");p.first.y=u.axis.p2c(u.from);p.second.y=u.axis.p2c(u.to)}p.show=true;k.triggerRedrawOverlay();if(!s&&f()){i()}}function f(){var s=5;return Math.abs(p.second.x-p.first.x)>=s&&Math.abs(p.second.y-p.first.y)>=s}k.clearSelection=q;k.setSelection=o;k.getSelection=g;k.hooks.bindEvents.push(function(t,s){var u=t.getOptions();if(u.selection.mode!=null){s.mousemove(e);s.mousedown(n)}});k.hooks.drawOverlay.push(function(v,D){if(p.show&&f()){var t=v.getPlotOffset();var s=v.getOptions();D.save();D.translate(t.left,t.top);var z=a.color.parse(s.selection.color);D.strokeStyle=z.scale("a",0.8).toString();D.lineWidth=1;D.lineJoin="round";D.fillStyle=z.scale("a",0.4).toString();var B=Math.min(p.first.x,p.second.x),A=Math.min(p.first.y,p.second.y),C=Math.abs(p.second.x-p.first.x),u=Math.abs(p.second.y-p.first.y);D.fillRect(B,A,C,u);D.strokeRect(B,A,C,u);D.restore()}});k.hooks.shutdown.push(function(t,s){s.unbind("mousemove",e);s.unbind("mousedown",n);if(r){a(document).unbind("mouseup",r)}})}a.plot.plugins.push({init:b,options:{selection:{mode:null,color:"#e8cfac"}},name:"selection",version:"1.1"})})(jQuery); |
| /* | |
| Flot plugin for stacking data sets, i.e. putting them on top of each | |
| other, for accumulative graphs. | |
| The plugin assumes the data is sorted on x (or y if stacking | |
| horizontally). For line charts, it is assumed that if a line has an | |
| undefined gap (from a null point), then the line above it should have | |
| the same gap - insert zeros instead of "null" if you want another | |
| behaviour. This also holds for the start and end of the chart. Note | |
| that stacking a mix of positive and negative values in most instances | |
| doesn't make sense (so it looks weird). | |
| Two or more series are stacked when their "stack" attribute is set to | |
| the same key (which can be any number or string or just "true"). To | |
| specify the default stack, you can set | |
| series: { | |
| stack: null or true or key (number/string) | |
| } | |
| or specify it for a specific series | |
| $.plot($("#placeholder"), [{ data: [ ... ], stack: true }]) | |
| The stacking order is determined by the order of the data series in | |
| the array (later series end up on top of the previous). | |
| Internally, the plugin modifies the datapoints in each series, adding | |
| an offset to the y value. For line series, extra data points are | |
| inserted through interpolation. If there's a second y value, it's also | |
| adjusted (e.g for bar charts or filled areas). | |
| */ | |
| (function ($) { | |
| var options = { | |
| series: { stack: null } // or number/string | |
| }; | |
| function init(plot) { | |
| function findMatchingSeries(s, allseries) { | |
| var res = null | |
| for (var i = 0; i < allseries.length; ++i) { | |
| if (s == allseries[i]) | |
| break; | |
| if (allseries[i].stack == s.stack) | |
| res = allseries[i]; | |
| } | |
| return res; | |
| } | |
| function stackData(plot, s, datapoints) { | |
| if (s.stack == null) | |
| return; | |
| var other = findMatchingSeries(s, plot.getData()); | |
| if (!other) | |
| return; | |
| var ps = datapoints.pointsize, | |
| points = datapoints.points, | |
| otherps = other.datapoints.pointsize, | |
| otherpoints = other.datapoints.points, | |
| newpoints = [], | |
| px, py, intery, qx, qy, bottom, | |
| withlines = s.lines.show, | |
| horizontal = s.bars.horizontal, | |
| withbottom = ps > 2 && (horizontal ? datapoints.format[2].x : datapoints.format[2].y), | |
| withsteps = withlines && s.lines.steps, | |
| fromgap = true, | |
| keyOffset = horizontal ? 1 : 0, | |
| accumulateOffset = horizontal ? 0 : 1, | |
| i = 0, j = 0, l; | |
| while (true) { | |
| if (i >= points.length) | |
| break; | |
| l = newpoints.length; | |
| if (points[i] == null) { | |
| // copy gaps | |
| for (m = 0; m < ps; ++m) | |
| newpoints.push(points[i + m]); | |
| i += ps; | |
| } | |
| else if (j >= otherpoints.length) { | |
| // for lines, we can't use the rest of the points | |
| if (!withlines) { | |
| for (m = 0; m < ps; ++m) | |
| newpoints.push(points[i + m]); | |
| } | |
| i += ps; | |
| } | |
| else if (otherpoints[j] == null) { | |
| // oops, got a gap | |
| for (m = 0; m < ps; ++m) | |
| newpoints.push(null); | |
| fromgap = true; | |
| j += otherps; | |
| } | |
| else { | |
| // cases where we actually got two points | |
| px = points[i + keyOffset]; | |
| py = points[i + accumulateOffset]; | |
| qx = otherpoints[j + keyOffset]; | |
| qy = otherpoints[j + accumulateOffset]; | |
| bottom = 0; | |
| if (px == qx) { | |
| for (m = 0; m < ps; ++m) | |
| newpoints.push(points[i + m]); | |
| newpoints[l + accumulateOffset] += qy; | |
| bottom = qy; | |
| i += ps; | |
| j += otherps; | |
| } | |
| else if (px > qx) { | |
| // we got past point below, might need to | |
| // insert interpolated extra point | |
| if (withlines && i > 0 && points[i - ps] != null) { | |
| intery = py + (points[i - ps + accumulateOffset] - py) * (qx - px) / (points[i - ps + keyOffset] - px); | |
| newpoints.push(qx); | |
| newpoints.push(intery + qy); | |
| for (m = 2; m < ps; ++m) | |
| newpoints.push(points[i + m]); | |
| bottom = qy; | |
| } | |
| j += otherps; | |
| } | |
| else { // px < qx | |
| if (fromgap && withlines) { | |
| // if we come from a gap, we just skip this point | |
| i += ps; | |
| continue; | |
| } | |
| for (m = 0; m < ps; ++m) | |
| newpoints.push(points[i + m]); | |
| // we might be able to interpolate a point below, | |
| // this can give us a better y | |
| if (withlines && j > 0 && otherpoints[j - otherps] != null) | |
| bottom = qy + (otherpoints[j - otherps + accumulateOffset] - qy) * (px - qx) / (otherpoints[j - otherps + keyOffset] - qx); | |
| newpoints[l + accumulateOffset] += bottom; | |
| i += ps; | |
| } | |
| fromgap = false; | |
| if (l != newpoints.length && withbottom) | |
| newpoints[l + 2] += bottom; | |
| } | |
| // maintain the line steps invariant | |
| if (withsteps && l != newpoints.length && l > 0 | |
| && newpoints[l] != null | |
| && newpoints[l] != newpoints[l - ps] | |
| && newpoints[l + 1] != newpoints[l - ps + 1]) { | |
| for (m = 0; m < ps; ++m) | |
| newpoints[l + ps + m] = newpoints[l + m]; | |
| newpoints[l + 1] = newpoints[l - ps + 1]; | |
| } | |
| } | |
| datapoints.points = newpoints; | |
| } | |
| plot.hooks.processDatapoints.push(stackData); | |
| } | |
| $.plot.plugins.push({ | |
| init: init, | |
| options: options, | |
| name: 'stack', | |
| version: '1.2' | |
| }); | |
| })(jQuery); | |
| (function(b){var a={series:{stack:null}};function c(f){function d(k,j){var h=null;for(var g=0;g<j.length;++g){if(k==j[g]){break}if(j[g].stack==k.stack){h=j[g]}}return h}function e(C,v,g){if(v.stack==null){return}var p=d(v,C.getData());if(!p){return}var z=g.pointsize,F=g.points,h=p.datapoints.pointsize,y=p.datapoints.points,t=[],x,w,k,J,I,r,u=v.lines.show,G=v.bars.horizontal,o=z>2&&(G?g.format[2].x:g.format[2].y),n=u&&v.lines.steps,E=true,q=G?1:0,H=G?0:1,D=0,B=0,A;while(true){if(D>=F.length){break}A=t.length;if(F[D]==null){for(m=0;m<z;++m){t.push(F[D+m])}D+=z}else{if(B>=y.length){if(!u){for(m=0;m<z;++m){t.push(F[D+m])}}D+=z}else{if(y[B]==null){for(m=0;m<z;++m){t.push(null)}E=true;B+=h}else{x=F[D+q];w=F[D+H];J=y[B+q];I=y[B+H];r=0;if(x==J){for(m=0;m<z;++m){t.push(F[D+m])}t[A+H]+=I;r=I;D+=z;B+=h}else{if(x>J){if(u&&D>0&&F[D-z]!=null){k=w+(F[D-z+H]-w)*(J-x)/(F[D-z+q]-x);t.push(J);t.push(k+I);for(m=2;m<z;++m){t.push(F[D+m])}r=I}B+=h}else{if(E&&u){D+=z;continue}for(m=0;m<z;++m){t.push(F[D+m])}if(u&&B>0&&y[B-h]!=null){r=I+(y[B-h+H]-I)*(x-J)/(y[B-h+q]-J)}t[A+H]+=r;D+=z}}E=false;if(A!=t.length&&o){t[A+2]+=r}}}}if(n&&A!=t.length&&A>0&&t[A]!=null&&t[A]!=t[A-z]&&t[A+1]!=t[A-z+1]){for(m=0;m<z;++m){t[A+z+m]=t[A+m]}t[A+1]=t[A-z+1]}}g.points=t}f.hooks.processDatapoints.push(e)}b.plot.plugins.push({init:c,options:a,name:"stack",version:"1.2"})})(jQuery); |
| /* | |
| Flot plugin that adds some extra symbols for plotting points. | |
| The symbols are accessed as strings through the standard symbol | |
| choice: | |
| series: { | |
| points: { | |
| symbol: "square" // or "diamond", "triangle", "cross" | |
| } | |
| } | |
| */ | |
| (function ($) { | |
| function processRawData(plot, series, datapoints) { | |
| // we normalize the area of each symbol so it is approximately the | |
| // same as a circle of the given radius | |
| var handlers = { | |
| square: function (ctx, x, y, radius, shadow) { | |
| // pi * r^2 = (2s)^2 => s = r * sqrt(pi)/2 | |
| var size = radius * Math.sqrt(Math.PI) / 2; | |
| ctx.rect(x - size, y - size, size + size, size + size); | |
| }, | |
| diamond: function (ctx, x, y, radius, shadow) { | |
| // pi * r^2 = 2s^2 => s = r * sqrt(pi/2) | |
| var size = radius * Math.sqrt(Math.PI / 2); | |
| ctx.moveTo(x - size, y); | |
| ctx.lineTo(x, y - size); | |
| ctx.lineTo(x + size, y); | |
| ctx.lineTo(x, y + size); | |
| ctx.lineTo(x - size, y); | |
| }, | |
| triangle: function (ctx, x, y, radius, shadow) { | |
| // pi * r^2 = 1/2 * s^2 * sin (pi / 3) => s = r * sqrt(2 * pi / sin(pi / 3)) | |
| var size = radius * Math.sqrt(2 * Math.PI / Math.sin(Math.PI / 3)); | |
| var height = size * Math.sin(Math.PI / 3); | |
| ctx.moveTo(x - size/2, y + height/2); | |
| ctx.lineTo(x + size/2, y + height/2); | |
| if (!shadow) { | |
| ctx.lineTo(x, y - height/2); | |
| ctx.lineTo(x - size/2, y + height/2); | |
| } | |
| }, | |
| cross: function (ctx, x, y, radius, shadow) { | |
| // pi * r^2 = (2s)^2 => s = r * sqrt(pi)/2 | |
| var size = radius * Math.sqrt(Math.PI) / 2; | |
| ctx.moveTo(x - size, y - size); | |
| ctx.lineTo(x + size, y + size); | |
| ctx.moveTo(x - size, y + size); | |
| ctx.lineTo(x + size, y - size); | |
| } | |
| } | |
| var s = series.points.symbol; | |
| if (handlers[s]) | |
| series.points.symbol = handlers[s]; | |
| } | |
| function init(plot) { | |
| plot.hooks.processDatapoints.push(processRawData); | |
| } | |
| $.plot.plugins.push({ | |
| init: init, | |
| name: 'symbols', | |
| version: '1.0' | |
| }); | |
| })(jQuery); | |
| (function(b){function a(h,e,g){var d={square:function(k,j,n,i,m){var l=i*Math.sqrt(Math.PI)/2;k.rect(j-l,n-l,l+l,l+l)},diamond:function(k,j,n,i,m){var l=i*Math.sqrt(Math.PI/2);k.moveTo(j-l,n);k.lineTo(j,n-l);k.lineTo(j+l,n);k.lineTo(j,n+l);k.lineTo(j-l,n)},triangle:function(l,k,o,j,n){var m=j*Math.sqrt(2*Math.PI/Math.sin(Math.PI/3));var i=m*Math.sin(Math.PI/3);l.moveTo(k-m/2,o+i/2);l.lineTo(k+m/2,o+i/2);if(!n){l.lineTo(k,o-i/2);l.lineTo(k-m/2,o+i/2)}},cross:function(k,j,n,i,m){var l=i*Math.sqrt(Math.PI)/2;k.moveTo(j-l,n-l);k.lineTo(j+l,n+l);k.moveTo(j-l,n+l);k.lineTo(j+l,n-l)}};var f=e.points.symbol;if(d[f]){e.points.symbol=d[f]}}function c(d){d.hooks.processDatapoints.push(a)}b.plot.plugins.push({init:c,name:"symbols",version:"1.0"})})(jQuery); |
| /* | |
| Flot plugin for thresholding data. Controlled through the option | |
| "threshold" in either the global series options | |
| series: { | |
| threshold: { | |
| below: number | |
| color: colorspec | |
| } | |
| } | |
| or in a specific series | |
| $.plot($("#placeholder"), [{ data: [ ... ], threshold: { ... }}]) | |
| The data points below "below" are drawn with the specified color. This | |
| makes it easy to mark points below 0, e.g. for budget data. | |
| Internally, the plugin works by splitting the data into two series, | |
| above and below the threshold. The extra series below the threshold | |
| will have its label cleared and the special "originSeries" attribute | |
| set to the original series. You may need to check for this in hover | |
| events. | |
| */ | |
| (function ($) { | |
| var options = { | |
| series: { threshold: null } // or { below: number, color: color spec} | |
| }; | |
| function init(plot) { | |
| function thresholdData(plot, s, datapoints) { | |
| if (!s.threshold) | |
| return; | |
| var ps = datapoints.pointsize, i, x, y, p, prevp, | |
| thresholded = $.extend({}, s); // note: shallow copy | |
| thresholded.datapoints = { points: [], pointsize: ps }; | |
| thresholded.label = null; | |
| thresholded.color = s.threshold.color; | |
| thresholded.threshold = null; | |
| thresholded.originSeries = s; | |
| thresholded.data = []; | |
| var below = s.threshold.below, | |
| origpoints = datapoints.points, | |
| addCrossingPoints = s.lines.show; | |
| threspoints = []; | |
| newpoints = []; | |
| for (i = 0; i < origpoints.length; i += ps) { | |
| x = origpoints[i] | |
| y = origpoints[i + 1]; | |
| prevp = p; | |
| if (y < below) | |
| p = threspoints; | |
| else | |
| p = newpoints; | |
| if (addCrossingPoints && prevp != p && x != null | |
| && i > 0 && origpoints[i - ps] != null) { | |
| var interx = (x - origpoints[i - ps]) / (y - origpoints[i - ps + 1]) * (below - y) + x; | |
| prevp.push(interx); | |
| prevp.push(below); | |
| for (m = 2; m < ps; ++m) | |
| prevp.push(origpoints[i + m]); | |
| p.push(null); // start new segment | |
| p.push(null); | |
| for (m = 2; m < ps; ++m) | |
| p.push(origpoints[i + m]); | |
| p.push(interx); | |
| p.push(below); | |
| for (m = 2; m < ps; ++m) | |
| p.push(origpoints[i + m]); | |
| } | |
| p.push(x); | |
| p.push(y); | |
| } | |
| datapoints.points = newpoints; | |
| thresholded.datapoints.points = threspoints; | |
| if (thresholded.datapoints.points.length > 0) | |
| plot.getData().push(thresholded); | |
| // FIXME: there are probably some edge cases left in bars | |
| } | |
| plot.hooks.processDatapoints.push(thresholdData); | |
| } | |
| $.plot.plugins.push({ | |
| init: init, | |
| options: options, | |
| name: 'threshold', | |
| version: '1.0' | |
| }); | |
| })(jQuery); | |
| (function(B){var A={series:{threshold:null}};function C(D){function E(L,S,M){if(!S.threshold){return }var F=M.pointsize,I,O,N,G,K,H=B.extend({},S);H.datapoints={points:[],pointsize:F};H.label=null;H.color=S.threshold.color;H.threshold=null;H.originSeries=S;H.data=[];var P=S.threshold.below,Q=M.points,R=S.lines.show;threspoints=[];newpoints=[];for(I=0;I<Q.length;I+=F){O=Q[I];N=Q[I+1];K=G;if(N<P){G=threspoints}else{G=newpoints}if(R&&K!=G&&O!=null&&I>0&&Q[I-F]!=null){var J=(O-Q[I-F])/(N-Q[I-F+1])*(P-N)+O;K.push(J);K.push(P);for(m=2;m<F;++m){K.push(Q[I+m])}G.push(null);G.push(null);for(m=2;m<F;++m){G.push(Q[I+m])}G.push(J);G.push(P);for(m=2;m<F;++m){G.push(Q[I+m])}}G.push(O);G.push(N)}M.points=newpoints;H.datapoints.points=threspoints;if(H.datapoints.points.length>0){L.getData().push(H)}}D.hooks.processDatapoints.push(E)}B.plot.plugins.push({init:C,options:A,name:"threshold",version:"1.0"})})(jQuery); |
| //Flotr 0.2.0-alpha Copyright (c) 2009 Bas Wenneker, <http://solutoire.com>, MIT License. | |
| var Flotr={version:"0.2.0-alpha",author:"Bas Wenneker",website:"http://www.solutoire.com",_registeredTypes:{lines:"drawSeriesLines",points:"drawSeriesPoints",bars:"drawSeriesBars",candles:"drawSeriesCandles",pie:"drawSeriesPie"},register:function(A,B){Flotr._registeredTypes[A]=B+""},draw:function(B,D,A,C){C=C||Flotr.Graph;return new C(B,D,A)},getSeries:function(A){return A.collect(function(C){var B,C=(C.data)?Object.clone(C):{data:C};for(B=C.data.length-1;B>-1;--B){C.data[B][1]=(C.data[B][1]===null?null:parseFloat(C.data[B][1]))}return C})},merge:function(D,B){var A=B||{};for(var C in D){A[C]=(D[C]!=null&&typeof (D[C])=="object"&&!(D[C].constructor==Array||D[C].constructor==RegExp)&&!Object.isElement(D[C]))?Flotr.merge(D[C],B[C]):A[C]=D[C]}return A},getTickSize:function(E,D,A,B){var H=(A-D)/E;var G=Flotr.getMagnitude(H);var C=H/G;var F=10;if(C<1.5){F=1}else{if(C<2.25){F=2}else{if(C<3){F=((B==0)?2:2.5)}else{if(C<7.5){F=5}}}}return F*G},defaultTickFormatter:function(A){return A+""},defaultTrackFormatter:function(A){return"("+A.x+", "+A.y+")"},defaultPieLabelFormatter:function(A){return(A.fraction*100).toFixed(2)+"%"},getMagnitude:function(A){return Math.pow(10,Math.floor(Math.log(A)/Math.LN10))},toPixel:function(A){return Math.floor(A)+0.5},toRad:function(A){return -A*(Math.PI/180)},parseColor:function(D){if(D instanceof Flotr.Color){return D}var A,C=Flotr.Color;if((A=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(D))){return new C(parseInt(A[1]),parseInt(A[2]),parseInt(A[3]))}if((A=/rgba\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(D))){return new C(parseInt(A[1]),parseInt(A[2]),parseInt(A[3]),parseFloat(A[4]))}if((A=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(D))){return new C(parseFloat(A[1])*2.55,parseFloat(A[2])*2.55,parseFloat(A[3])*2.55)}if((A=/rgba\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(D))){return new C(parseFloat(A[1])*2.55,parseFloat(A[2])*2.55,parseFloat(A[3])*2.55,parseFloat(A[4]))}if((A=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(D))){return new C(parseInt(A[1],16),parseInt(A[2],16),parseInt(A[3],16))}if((A=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(D))){return new C(parseInt(A[1]+A[1],16),parseInt(A[2]+A[2],16),parseInt(A[3]+A[3],16))}var B=D.strip().toLowerCase();if(B=="transparent"){return new C(255,255,255,0)}return((A=C.lookupColors[B]))?new C(A[0],A[1],A[2]):false},extractColor:function(B){var A;do{A=B.getStyle("background-color").toLowerCase();if(!(A==""||A=="transparent")){break}B=B.up(0)}while(!B.nodeName.match(/^body$/i));return(A=="rgba(0, 0, 0, 0)")?"transparent":A}};Flotr.Graph=Class.create({initialize:function(B,C,A){this.el=$(B);if(!this.el){throw"The target container doesn't exist"}this.data=C;this.series=Flotr.getSeries(C);this.setOptions(A);this.lastMousePos={pageX:null,pageY:null};this.selection={first:{x:-1,y:-1},second:{x:-1,y:-1}};this.prevSelection=null;this.selectionInterval=null;this.ignoreClick=false;this.prevHit=null;this.constructCanvas();this.initEvents();this.findDataRanges();this.calculateTicks(this.axes.x);this.calculateTicks(this.axes.x2);this.calculateTicks(this.axes.y);this.calculateTicks(this.axes.y2);this.calculateSpacing();this.draw();this.insertLegend();if(this.options.spreadsheet.show){this.constructTabs()}},setOptions:function(B){var P={colors:["#00A8F0","#C0D800","#CB4B4B","#4DA74D","#9440ED"],title:null,subtitle:null,legend:{show:true,noColumns:1,labelFormatter:Prototype.K,labelBoxBorderColor:"#CCCCCC",labelBoxWidth:14,labelBoxHeight:10,labelBoxMargin:5,container:null,position:"nw",margin:5,backgroundColor:null,backgroundOpacity:0.85},xaxis:{ticks:null,showLabels:true,labelsAngle:0,title:null,titleAngle:0,noTicks:5,tickFormatter:Flotr.defaultTickFormatter,tickDecimals:null,min:null,max:null,autoscaleMargin:0,color:null},x2axis:{},yaxis:{ticks:null,showLabels:true,labelsAngle:0,title:null,titleAngle:90,noTicks:5,tickFormatter:Flotr.defaultTickFormatter,tickDecimals:null,min:null,max:null,autoscaleMargin:0,color:null},y2axis:{titleAngle:270},points:{show:false,radius:3,lineWidth:2,fill:true,fillColor:"#FFFFFF",fillOpacity:0.4},lines:{show:false,lineWidth:2,fill:false,fillColor:null,fillOpacity:0.4},bars:{show:false,lineWidth:2,barWidth:1,fill:true,fillColor:null,fillOpacity:0.4,horizontal:false,stacked:false},candles:{show:false,lineWidth:1,wickLineWidth:1,candleWidth:0.6,fill:true,upFillColor:"#00A8F0",downFillColor:"#CB4B4B",fillOpacity:0.5,barcharts:false},pie:{show:false,lineWidth:1,fill:true,fillColor:null,fillOpacity:0.6,explode:6,sizeRatio:0.6,startAngle:Math.PI/4,labelFormatter:Flotr.defaultPieLabelFormatter,pie3D:false,pie3DviewAngle:(Math.PI/2*0.8),pie3DspliceThickness:20},grid:{color:"#545454",backgroundColor:null,tickColor:"#DDDDDD",labelMargin:3,verticalLines:true,horizontalLines:true,outlineWidth:2},selection:{mode:null,color:"#B6D9FF",fps:20},mouse:{track:false,position:"se",relative:false,trackFormatter:Flotr.defaultTrackFormatter,margin:5,lineColor:"#FF3F19",trackDecimals:1,sensibility:2,radius:3},shadowSize:4,defaultType:"lines",HtmlText:true,fontSize:7.5,spreadsheet:{show:false,tabGraphLabel:"Graph",tabDataLabel:"Data",toolbarDownload:"Download CSV",toolbarSelectAll:"Select all"}};P.x2axis=Object.extend(Object.clone(P.xaxis),P.x2axis);P.y2axis=Object.extend(Object.clone(P.yaxis),P.y2axis);this.options=Flotr.merge((B||{}),P);this.axes={x:{options:this.options.xaxis,n:1},x2:{options:this.options.x2axis,n:2},y:{options:this.options.yaxis,n:1},y2:{options:this.options.y2axis,n:2}};var H=[],C=[],K=this.series.length,N=this.series.length,D=this.options.colors,A=[],G=0,M,J,I,O,E;for(J=N-1;J>-1;--J){M=this.series[J].color;if(M!=null){--N;if(Object.isNumber(M)){H.push(M)}else{A.push(Flotr.parseColor(M))}}}for(J=H.length-1;J>-1;--J){N=Math.max(N,H[J]+1)}for(J=0;C.length<N;){M=(D.length==J)?new Flotr.Color(100,100,100):Flotr.parseColor(D[J]);var F=G%2==1?-1:1;var L=1+F*Math.ceil(G/2)*0.2;M.scale(L,L,L);C.push(M);if(++J>=D.length){J=0;++G}}for(J=0,I=0;J<K;++J){O=this.series[J];if(O.color==null){O.color=C[I++].toString()}else{if(Object.isNumber(O.color)){O.color=C[O.color].toString()}}if(!O.xaxis){O.xaxis=this.axes.x}if(O.xaxis==1){O.xaxis=this.axes.x}else{if(O.xaxis==2){O.xaxis=this.axes.x2}}if(!O.yaxis){O.yaxis=this.axes.y}if(O.yaxis==1){O.yaxis=this.axes.y}else{if(O.yaxis==2){O.yaxis=this.axes.y2}}O.lines=Object.extend(Object.clone(this.options.lines),O.lines);O.points=Object.extend(Object.clone(this.options.points),O.points);O.bars=Object.extend(Object.clone(this.options.bars),O.bars);O.candles=Object.extend(Object.clone(this.options.candles),O.candles);O.pie=Object.extend(Object.clone(this.options.pie),O.pie);O.mouse=Object.extend(Object.clone(this.options.mouse),O.mouse);if(O.shadowSize==null){O.shadowSize=this.options.shadowSize}}},constructCanvas:function(){var C=this.el,B,D,A;this.canvas=C.select(".flotr-canvas")[0];this.overlay=C.select(".flotr-overlay")[0];C.childElements().invoke("remove");C.setStyle({position:"relative",cursor:"default"});this.canvasWidth=C.getWidth();this.canvasHeight=C.getHeight();B={width:this.canvasWidth,height:this.canvasHeight};if(this.canvasWidth<=0||this.canvasHeight<=0){throw"Invalid dimensions for plot, width = "+this.canvasWidth+", height = "+this.canvasHeight}if(!this.canvas){D=this.canvas=new Element("canvas",B);D.className="flotr-canvas";D=D.writeAttribute("style","position:absolute;left:0px;top:0px;")}else{D=this.canvas.writeAttribute(B)}C.insert(D);if(Prototype.Browser.IE){D=window.G_vmlCanvasManager.initElement(D)}this.ctx=D.getContext("2d");if(!this.overlay){A=this.overlay=new Element("canvas",B);A.className="flotr-overlay";A=A.writeAttribute("style","position:absolute;left:0px;top:0px;")}else{A=this.overlay.writeAttribute(B)}C.insert(A);if(Prototype.Browser.IE){A=window.G_vmlCanvasManager.initElement(A)}this.octx=A.getContext("2d");if(window.CanvasText){CanvasText.enable(this.ctx);CanvasText.enable(this.octx);this.textEnabled=true}},getTextDimensions:function(F,C,B,D){if(!F){return{width:0,height:0}}if(!this.options.HtmlText&&this.textEnabled){var E=this.ctx.getTextBounds(F,C);return{width:E.width+2,height:E.height+6}}else{var A=this.el.insert('<div style="position:absolute;top:-10000px;'+B+'" class="'+D+' flotr-dummy-div">'+F+"</div>").select(".flotr-dummy-div")[0];dim=A.getDimensions();A.remove();return dim}},loadDataGrid:function(){if(this.seriesData){return this.seriesData}var A=this.series;var B=[];for(i=0;i<A.length;++i){A[i].data.each(function(D){var C=D[0],F=D[1];if(r=B.find(function(G){return G[0]==C})){r[i+1]=F}else{var E=[];E[0]=C;E[i+1]=F;B.push(E)}})}B=B.sortBy(function(C){return C[0]});return this.seriesData=B},showTab:function(B,C){var A="canvas, .flotr-labels, .flotr-legend, .flotr-legend-bg, .flotr-title, .flotr-subtitle";switch(B){case"graph":this.datagrid.up().hide();this.el.select(A).invoke("show");this.tabs.data.removeClassName("selected");this.tabs.graph.addClassName("selected");break;case"data":this.constructDataGrid();this.datagrid.up().show();this.el.select(A).invoke("hide");this.tabs.data.addClassName("selected");this.tabs.graph.removeClassName("selected");break}},constructTabs:function(){var A=new Element("div",{className:"flotr-tabs-group",style:"position:absolute;left:0px;top:"+this.canvasHeight+"px;width:"+this.canvasWidth+"px;"});this.el.insert({bottom:A});this.tabs={graph:new Element("div",{className:"flotr-tab selected",style:"float:left;"}).update(this.options.spreadsheet.tabGraphLabel),data:new Element("div",{className:"flotr-tab",style:"float:left;"}).update(this.options.spreadsheet.tabDataLabel)};A.insert(this.tabs.graph).insert(this.tabs.data);this.el.setStyle({height:this.canvasHeight+this.tabs.data.getHeight()+2+"px"});this.tabs.graph.observe("click",(function(){this.showTab("graph")}).bind(this));this.tabs.data.observe("click",(function(){this.showTab("data")}).bind(this))},constructDataGrid:function(){if(this.datagrid){return this.datagrid}var D,B,L=this.series,J=this.loadDataGrid();var K=this.datagrid=new Element("table",{className:"flotr-datagrid",style:"height:100px;"});var C=["<colgroup><col />"];var F=['<tr class="first-row">'];F.push("<th> </th>");for(D=0;D<L.length;++D){F.push('<th scope="col">'+(L[D].label||String.fromCharCode(65+D))+"</th>");C.push("<col />")}F.push("</tr>");for(B=0;B<J.length;++B){F.push("<tr>");for(D=0;D<L.length+1;++D){var M="td";var G=(J[B][D]!=null?Math.round(J[B][D]*100000)/100000:"");if(D==0){M="th";var I;if(this.options.xaxis.ticks){var E=this.options.xaxis.ticks.find(function(N){return N[0]==J[B][D]});if(E){I=E[1]}}else{I=this.options.xaxis.tickFormatter(G)}if(I){G=I}}F.push("<"+M+(M=="th"?' scope="row"':"")+">"+G+"</"+M+">")}F.push("</tr>")}C.push("</colgroup>");K.update(C.join("")+F.join(""));if(!Prototype.Browser.IE){K.select("td").each(function(N){N.observe("mouseover",function(O){N=O.element();var P=N.previousSiblings();K.select("th[scope=col]")[P.length-1].addClassName("hover");K.select("colgroup col")[P.length].addClassName("hover")});N.observe("mouseout",function(){K.select("colgroup col.hover, th.hover").each(function(O){O.removeClassName("hover")})})})}var H=new Element("div",{className:"flotr-datagrid-toolbar"}).insert(new Element("button",{type:"button",className:"flotr-datagrid-toolbar-button"}).update(this.options.spreadsheet.toolbarDownload).observe("click",this.downloadCSV.bind(this))).insert(new Element("button",{type:"button",className:"flotr-datagrid-toolbar-button"}).update(this.options.spreadsheet.toolbarSelectAll).observe("click",this.selectAllData.bind(this)));var A=new Element("div",{className:"flotr-datagrid-container",style:"left:0px;top:0px;width:"+this.canvasWidth+"px;height:"+this.canvasHeight+"px;overflow:auto;"});A.insert(H);K.wrap(A.hide());this.el.insert(A);return K},selectAllData:function(){if(this.tabs){var B,A,E,D,C=this.constructDataGrid();this.showTab("data");(function(){if((E=C.ownerDocument)&&(D=E.defaultView)&&D.getSelection&&E.createRange&&(B=window.getSelection())&&B.removeAllRanges){A=E.createRange();A.selectNode(C);B.removeAllRanges();B.addRange(A)}else{if(document.body&&document.body.createTextRange&&(A=document.body.createTextRange())){A.moveToElementText(C);A.select()}}}).defer();return true}else{return false}},downloadCSV:function(){var D,A='"x"',C=this.series,E=this.loadDataGrid();for(D=0;D<C.length;++D){A+='%09"'+(C[D].label||String.fromCharCode(65+D))+'"'}A+="%0D%0A";for(D=0;D<E.length;++D){if(this.options.xaxis.ticks){var B=this.options.xaxis.ticks.find(function(F){return F[0]==E[D][0]});if(B){E[D][0]=B[1]}}else{E[D][0]=this.options.xaxis.tickFormatter(E[D][0])}A+=E[D].join("%09")+"%0D%0A"}if(Prototype.Browser.IE){A=A.gsub("%09","\t").gsub("%0A","\n").gsub("%0D","\r");window.open().document.write(A)}else{window.open("data:text/csv,"+A)}},initEvents:function(){this.overlay.stopObserving();this.overlay.observe("mousedown",this.mouseDownHandler.bind(this));this.overlay.observe("mousemove",this.mouseMoveHandler.bind(this));this.overlay.observe("click",this.clickHandler.bind(this))},findDataRanges:function(){var J=this.series,G=this.axes;G.x.datamin=0;G.x.datamax=0;G.x2.datamin=0;G.x2.datamax=0;G.y.datamin=0;G.y.datamax=0;G.y2.datamin=0;G.y2.datamax=0;if(J.length>0){var C,A,D,H,F,B,I,E;for(C=0;C<J.length;++C){B=J[C].data,I=J[C].xaxis,E=J[C].yaxis;if(B.length>0&&!J[C].hide){if(!I.used){I.datamin=I.datamax=B[0][0]}if(!E.used){E.datamin=E.datamax=B[0][1]}I.used=true;E.used=true;for(D=B.length-1;D>-1;--D){H=B[D][0];if(H<I.datamin){I.datamin=H}else{if(H>I.datamax){I.datamax=H}}for(A=1;A<B[D].length;A++){F=B[D][A];if(F<E.datamin){E.datamin=F}else{if(F>E.datamax){E.datamax=F}}}}}}}this.findXAxesValues();this.calculateRange(G.x);this.extendXRangeIfNeededByBar(G.x);if(G.x2.used){this.calculateRange(G.x2);this.extendXRangeIfNeededByBar(G.x2)}this.calculateRange(G.y);this.extendYRangeIfNeededByBar(G.y);if(G.y2.used){this.calculateRange(G.y2);this.extendYRangeIfNeededByBar(G.y2)}},calculateRange:function(D){var F=D.options,C=F.min!=null?F.min:D.datamin,A=F.max!=null?F.max:D.datamax,E;if(A-C==0){var B=(A==0)?1:0.01;C-=B;A+=B}D.tickSize=Flotr.getTickSize(F.noTicks,C,A,F.tickDecimals);if(F.min==null){E=F.autoscaleMargin;if(E!=0){C-=D.tickSize*E;if(C<0&&D.datamin>=0){C=0}C=D.tickSize*Math.floor(C/D.tickSize)}}if(F.max==null){E=F.autoscaleMargin;if(E!=0){A+=D.tickSize*E;if(A>0&&D.datamax<=0){A=0}A=D.tickSize*Math.ceil(A/D.tickSize)}}D.min=C;D.max=A},extendXRangeIfNeededByBar:function(A){if(A.options.max==null){var D=A.max,B,I,F,E,H=[],C=null;for(B=0;B<this.series.length;++B){I=this.series[B];F=I.bars;E=I.candles;if(I.axis==A&&(F.show||E.show)){if(!F.horizontal&&(F.barWidth+A.datamax>D)||(E.candleWidth+A.datamax>D)){D=A.max+I.bars.barWidth}if(F.stacked&&F.horizontal){for(j=0;j<I.data.length;j++){if(I.bars.show&&I.bars.stacked){var G=I.data[j][0];H[G]=(H[G]||0)+I.data[j][1];C=I}}for(j=0;j<H.length;j++){D=Math.max(H[j],D)}}}}A.lastSerie=C;A.max=D}},extendYRangeIfNeededByBar:function(A){if(A.options.max==null){var D=A.max,B,I,F,E,H=[],C=null;for(B=0;B<this.series.length;++B){I=this.series[B];F=I.bars;E=I.candles;if(I.yaxis==A&&F.show&&!I.hide){if(F.horizontal&&(F.barWidth+A.datamax>D)||(E.candleWidth+A.datamax>D)){D=A.max+F.barWidth}if(F.stacked&&!F.horizontal){for(j=0;j<I.data.length;j++){if(I.bars.show&&I.bars.stacked){var G=I.data[j][0];H[G]=(H[G]||0)+I.data[j][1];C=I}}for(j=0;j<H.length;j++){D=Math.max(H[j],D)}}}}A.lastSerie=C;A.max=D}},findXAxesValues:function(){for(i=this.series.length-1;i>-1;--i){s=this.series[i];s.xaxis.values=s.xaxis.values||[];for(j=s.data.length-1;j>-1;--j){s.xaxis.values[s.data[j][0]]={}}}},calculateTicks:function(D){var B=D.options,E,H;D.ticks=[];if(B.ticks){var G=B.ticks,I,F;if(Object.isFunction(G)){G=G({min:D.min,max:D.max})}for(E=0;E<G.length;++E){I=G[E];if(typeof (I)=="object"){H=I[0];F=(I.length>1)?I[1]:B.tickFormatter(H)}else{H=I;F=B.tickFormatter(H)}D.ticks[E]={v:H,label:F}}}else{var A=D.tickSize*Math.ceil(D.min/D.tickSize),C;for(E=0;A+E*D.tickSize<=D.max;++E){H=A+E*D.tickSize;C=B.tickDecimals;if(C==null){C=1-Math.floor(Math.log(D.tickSize)/Math.LN10)}if(C<0){C=0}H=H.toFixed(C);D.ticks.push({v:H,label:B.tickFormatter(H)})}}},calculateSpacing:function(){var L=this.axes,N=this.options,H=this.series,D=N.grid.labelMargin,M=L.x,A=L.x2,J=L.y,K=L.y2,F=2,G,E,C,I;[M,A,J,K].each(function(P){var O="";if(P.options.showLabels){for(G=0;G<P.ticks.length;++G){C=P.ticks[G].label.length;if(C>O.length){O=P.ticks[G].label}}}P.maxLabel=this.getTextDimensions(O,{size:N.fontSize,angle:Flotr.toRad(P.options.labelsAngle)},"font-size:smaller;","flotr-grid-label");P.titleSize=this.getTextDimensions(P.options.title,{size:N.fontSize*1.2,angle:Flotr.toRad(P.options.titleAngle)},"font-weight:bold;","flotr-axis-title")},this);I=this.getTextDimensions(N.title,{size:N.fontSize*1.5},"font-size:1em;font-weight:bold;","flotr-title");this.titleHeight=I.height;I=this.getTextDimensions(N.subtitle,{size:N.fontSize},"font-size:smaller;","flotr-subtitle");this.subtitleHeight=I.height;if(N.show){F=Math.max(F,N.points.radius+N.points.lineWidth/2)}for(E=0;E<N.length;++E){if(H[E].points.show){F=Math.max(F,H[E].points.radius+H[E].points.lineWidth/2)}}var B=this.plotOffset={left:0,right:0,top:0,bottom:0};B.left=B.right=B.top=B.bottom=F;B.bottom+=(M.options.showLabels?(M.maxLabel.height+D):0)+(M.options.title?(M.titleSize.height+D):0);B.top+=(A.options.showLabels?(A.maxLabel.height+D):0)+(A.options.title?(A.titleSize.height+D):0)+this.subtitleHeight+this.titleHeight;B.left+=(J.options.showLabels?(J.maxLabel.width+D):0)+(J.options.title?(J.titleSize.width+D):0);B.right+=(K.options.showLabels?(K.maxLabel.width+D):0)+(K.options.title?(K.titleSize.width+D):0);B.top=Math.floor(B.top);this.plotWidth=this.canvasWidth-B.left-B.right;this.plotHeight=this.canvasHeight-B.bottom-B.top;M.scale=this.plotWidth/(M.max-M.min);A.scale=this.plotWidth/(A.max-A.min);J.scale=this.plotHeight/(J.max-J.min);K.scale=this.plotHeight/(K.max-K.min)},draw:function(){this.drawGrid();this.drawLabels();this.drawTitles();if(this.series.length){this.el.fire("flotr:beforedraw",[this.series,this]);for(var A=0;A<this.series.length;A++){if(!this.series[A].hide){this.drawSeries(this.series[A])}}}this.el.fire("flotr:afterdraw",[this.series,this])},tHoz:function(A,B){B=B||this.axes.x;return(A-B.min)*B.scale},tVert:function(B,A){A=A||this.axes.y;return this.plotHeight-(B-A.min)*A.scale},drawGrid:function(){var B,E=this.options,A=this.ctx;if(E.grid.verticalLines||E.grid.horizontalLines){this.el.fire("flotr:beforegrid",[this.axes.x,this.axes.y,E,this])}A.save();A.translate(this.plotOffset.left,this.plotOffset.top);if(E.grid.backgroundColor!=null){A.fillStyle=E.grid.backgroundColor;A.fillRect(0,0,this.plotWidth,this.plotHeight)}A.lineWidth=1;A.strokeStyle=E.grid.tickColor;A.beginPath();if(E.grid.verticalLines){for(var D=0;D<this.axes.x.ticks.length;++D){B=this.axes.x.ticks[D].v;if((B==this.axes.x.min||B==this.axes.x.max)&&E.grid.outlineWidth!=0){continue}A.moveTo(Math.floor(this.tHoz(B))+A.lineWidth/2,0);A.lineTo(Math.floor(this.tHoz(B))+A.lineWidth/2,this.plotHeight)}}if(E.grid.horizontalLines){for(var C=0;C<this.axes.y.ticks.length;++C){B=this.axes.y.ticks[C].v;if((B==this.axes.y.min||B==this.axes.y.max)&&E.grid.outlineWidth!=0){continue}A.moveTo(0,Math.floor(this.tVert(B))+A.lineWidth/2);A.lineTo(this.plotWidth,Math.floor(this.tVert(B))+A.lineWidth/2)}}A.stroke();if(E.grid.outlineWidth!=0){A.lineWidth=E.grid.outlineWidth;A.strokeStyle=E.grid.color;A.lineJoin="round";A.strokeRect(0,0,this.plotWidth,this.plotHeight)}A.restore();if(E.grid.verticalLines||E.grid.horizontalLines){this.el.fire("flotr:aftergrid",[this.axes.x,this.axes.y,E,this])}},drawLabels:function(){var C=0,D,B,E,F,G,J=this.options,I=this.ctx,H=this.axes;for(E=0;E<H.x.ticks.length;++E){if(H.x.ticks[E].label){++C}}B=this.plotWidth/C;if(!J.HtmlText&&this.textEnabled){var A={size:J.fontSize,adjustAlign:true};D=H.x;A.color=D.options.color||J.grid.color;for(E=0;E<D.ticks.length&&D.options.showLabels&&D.used;++E){G=D.ticks[E];if(!G.label||G.label.length==0){continue}A.angle=Flotr.toRad(D.options.labelsAngle);A.halign="c";A.valign="t";I.drawText(G.label,this.plotOffset.left+this.tHoz(G.v,D),this.plotOffset.top+this.plotHeight+J.grid.labelMargin,A)}D=H.x2;A.color=D.options.color||J.grid.color;for(E=0;E<D.ticks.length&&D.options.showLabels&&D.used;++E){G=D.ticks[E];if(!G.label||G.label.length==0){continue}A.angle=Flotr.toRad(D.options.labelsAngle);A.halign="c";A.valign="b";I.drawText(G.label,this.plotOffset.left+this.tHoz(G.v,D),this.plotOffset.top+J.grid.labelMargin,A)}D=H.y;A.color=D.options.color||J.grid.color;for(E=0;E<D.ticks.length&&D.options.showLabels&&D.used;++E){G=D.ticks[E];if(!G.label||G.label.length==0){continue}A.angle=Flotr.toRad(D.options.labelsAngle);A.halign="r";A.valign="m";I.drawText(G.label,this.plotOffset.left-J.grid.labelMargin,this.plotOffset.top+this.tVert(G.v,D),A)}D=H.y2;A.color=D.options.color||J.grid.color;for(E=0;E<D.ticks.length&&D.options.showLabels&&D.used;++E){G=D.ticks[E];if(!G.label||G.label.length==0){continue}A.angle=Flotr.toRad(D.options.labelsAngle);A.halign="l";A.valign="m";I.drawText(G.label,this.plotOffset.left+this.plotWidth+J.grid.labelMargin,this.plotOffset.top+this.tVert(G.v,D),A);I.save();I.strokeStyle=A.color;I.beginPath();I.moveTo(this.plotOffset.left+this.plotWidth-8,this.plotOffset.top+this.tVert(G.v,D));I.lineTo(this.plotOffset.left+this.plotWidth,this.plotOffset.top+this.tVert(G.v,D));I.stroke();I.restore()}}else{if(H.x.options.showLabels||H.x2.options.showLabels||H.y.options.showLabels||H.y2.options.showLabels){F=['<div style="font-size:smaller;color:'+J.grid.color+';" class="flotr-labels">'];D=H.x;if(D.options.showLabels){for(E=0;E<D.ticks.length;++E){G=D.ticks[E];if(!G.label||G.label.length==0){continue}F.push('<div style="position:absolute;top:'+(this.plotOffset.top+this.plotHeight+J.grid.labelMargin)+"px;left:"+(this.plotOffset.left+this.tHoz(G.v,D)-B/2)+"px;width:"+B+"px;text-align:center;"+(D.options.color?("color:"+D.options.color+";"):"")+'" class="flotr-grid-label">'+G.label+"</div>")}}D=H.x2;if(D.options.showLabels&&D.used){for(E=0;E<D.ticks.length;++E){G=D.ticks[E];if(!G.label||G.label.length==0){continue}F.push('<div style="position:absolute;top:'+(this.plotOffset.top-J.grid.labelMargin-D.maxLabel.height)+"px;left:"+(this.plotOffset.left+this.tHoz(G.v,D)-B/2)+"px;width:"+B+"px;text-align:center;"+(D.options.color?("color:"+D.options.color+";"):"")+'" class="flotr-grid-label">'+G.label+"</div>")}}D=H.y;if(D.options.showLabels){for(E=0;E<D.ticks.length;++E){G=D.ticks[E];if(!G.label||G.label.length==0){continue}F.push('<div style="position:absolute;top:'+(this.plotOffset.top+this.tVert(G.v,D)-D.maxLabel.height/2)+"px;left:0;width:"+(this.plotOffset.left-J.grid.labelMargin)+"px;text-align:right;"+(D.options.color?("color:"+D.options.color+";"):"")+'" class="flotr-grid-label">'+G.label+"</div>")}}D=H.y2;if(D.options.showLabels&&D.used){I.save();I.strokeStyle=D.options.color||J.grid.color;I.beginPath();for(E=0;E<D.ticks.length;++E){G=D.ticks[E];if(!G.label||G.label.length==0){continue}F.push('<div style="position:absolute;top:'+(this.plotOffset.top+this.tVert(G.v,D)-D.maxLabel.height/2)+"px;right:0;width:"+(this.plotOffset.right-J.grid.labelMargin)+"px;text-align:left;"+(D.options.color?("color:"+D.options.color+";"):"")+'" class="flotr-grid-label">'+G.label+"</div>");I.moveTo(this.plotOffset.left+this.plotWidth-8,this.plotOffset.top+this.tVert(G.v,D));I.lineTo(this.plotOffset.left+this.plotWidth,this.plotOffset.top+this.tVert(G.v,D))}I.stroke();I.restore()}F.push("</div>");this.el.insert(F.join(""))}}},drawTitles:function(){var D,C=this.options,F=C.grid.labelMargin,B=this.ctx,A=this.axes;if(!C.HtmlText&&this.textEnabled){var E={size:C.fontSize,color:C.grid.color,halign:"c"};if(C.subtitle){B.drawText(C.subtitle,this.plotOffset.left+this.plotWidth/2,this.titleHeight+this.subtitleHeight-2,E)}E.weight=1.5;E.size*=1.5;if(C.title){B.drawText(C.title,this.plotOffset.left+this.plotWidth/2,this.titleHeight-2,E)}E.weight=1.8;E.size*=0.8;E.adjustAlign=true;if(A.x.options.title&&A.x.used){E.halign="c";E.valign="t";E.angle=Flotr.toRad(A.x.options.titleAngle);B.drawText(A.x.options.title,this.plotOffset.left+this.plotWidth/2,this.plotOffset.top+A.x.maxLabel.height+this.plotHeight+2*F,E)}if(A.x2.options.title&&A.x2.used){E.halign="c";E.valign="b";E.angle=Flotr.toRad(A.x2.options.titleAngle);B.drawText(A.x2.options.title,this.plotOffset.left+this.plotWidth/2,this.plotOffset.top-A.x2.maxLabel.height-2*F,E)}if(A.y.options.title&&A.y.used){E.halign="r";E.valign="m";E.angle=Flotr.toRad(A.y.options.titleAngle);B.drawText(A.y.options.title,this.plotOffset.left-A.y.maxLabel.width-2*F,this.plotOffset.top+this.plotHeight/2,E)}if(A.y2.options.title&&A.y2.used){E.halign="l";E.valign="m";E.angle=Flotr.toRad(A.y2.options.titleAngle);B.drawText(A.y2.options.title,this.plotOffset.left+this.plotWidth+A.y2.maxLabel.width+2*F,this.plotOffset.top+this.plotHeight/2,E)}}else{D=['<div style="color:'+C.grid.color+';" class="flotr-titles">'];if(C.title){D.push('<div style="position:absolute;top:0;left:'+this.plotOffset.left+"px;font-size:1em;font-weight:bold;text-align:center;width:"+this.plotWidth+'px;" class="flotr-title">'+C.title+"</div>")}if(C.subtitle){D.push('<div style="position:absolute;top:'+this.titleHeight+"px;left:"+this.plotOffset.left+"px;font-size:smaller;text-align:center;width:"+this.plotWidth+'px;" class="flotr-subtitle">'+C.subtitle+"</div>")}D.push("</div>");D.push('<div class="flotr-axis-title" style="font-weight:bold;">');if(A.x.options.title&&A.x.used){D.push('<div style="position:absolute;top:'+(this.plotOffset.top+this.plotHeight+C.grid.labelMargin+A.x.titleSize.height)+"px;left:"+this.plotOffset.left+"px;width:"+this.plotWidth+'px;text-align:center;" class="flotr-axis-title">'+A.x.options.title+"</div>")}if(A.x2.options.title&&A.x2.used){D.push('<div style="position:absolute;top:0;left:'+this.plotOffset.left+"px;width:"+this.plotWidth+'px;text-align:center;" class="flotr-axis-title">'+A.x2.options.title+"</div>")}if(A.y.options.title&&A.y.used){D.push('<div style="position:absolute;top:'+(this.plotOffset.top+this.plotHeight/2-A.y.titleSize.height/2)+'px;left:0;text-align:right;" class="flotr-axis-title">'+A.y.options.title+"</div>")}if(A.y2.options.title&&A.y2.used){D.push('<div style="position:absolute;top:'+(this.plotOffset.top+this.plotHeight/2-A.y.titleSize.height/2)+'px;right:0;text-align:right;" class="flotr-axis-title">'+A.y2.options.title+"</div>")}D.push("</div>");this.el.insert(D.join(""))}},drawSeries:function(A){A=A||this.series;var C=false;for(var B in Flotr._registeredTypes){if(A[B]&&A[B].show){this[Flotr._registeredTypes[B]](A);C=true}}if(!C){this[Flotr._registeredTypes[this.options.defaultType]](A)}},plotLine:function(I,F){var O=this.ctx,A=I.xaxis,K=I.yaxis,J=this.tHoz.bind(this),M=this.tVert.bind(this),H=I.data;if(H.length<2){return }var E=J(H[0][0],A),D=M(H[0][1],K)+F;O.beginPath();O.moveTo(E,D);for(var G=0;G<H.length-1;++G){var C=H[G][0],N=H[G][1],B=H[G+1][0],L=H[G+1][1];if(N===null||L===null){continue}if(N<=L&&N<K.min){if(L<K.min){continue}C=(K.min-N)/(L-N)*(B-C)+C;N=K.min}else{if(L<=N&&L<K.min){if(N<K.min){continue}B=(K.min-N)/(L-N)*(B-C)+C;L=K.min}}if(N>=L&&N>K.max){if(L>K.max){continue}C=(K.max-N)/(L-N)*(B-C)+C;N=K.max}else{if(L>=N&&L>K.max){if(N>K.max){continue}B=(K.max-N)/(L-N)*(B-C)+C;L=K.max}}if(C<=B&&C<A.min){if(B<A.min){continue}N=(A.min-C)/(B-C)*(L-N)+N;C=A.min}else{if(B<=C&&B<A.min){if(C<A.min){continue}L=(A.min-C)/(B-C)*(L-N)+N;B=A.min}}if(C>=B&&C>A.max){if(B>A.max){continue}N=(A.max-C)/(B-C)*(L-N)+N;C=A.max}else{if(B>=C&&B>A.max){if(C>A.max){continue}L=(A.max-C)/(B-C)*(L-N)+N;B=A.max}}if(E!=J(C,A)||D!=M(N,K)+F){O.moveTo(J(C,A),M(N,K)+F)}E=J(B,A);D=M(L,K)+F;O.lineTo(E,D)}O.stroke()},plotLineArea:function(J,D){var S=J.data;if(S.length<2){return }var L,G=0,N=this.ctx,Q=J.xaxis,B=J.yaxis,E=this.tHoz.bind(this),M=this.tVert.bind(this),H=Math.min(Math.max(0,B.min),B.max),F=true;N.beginPath();for(var O=0;O<S.length-1;++O){var R=S[O][0],C=S[O][1],P=S[O+1][0],A=S[O+1][1];if(R<=P&&R<Q.min){if(P<Q.min){continue}C=(Q.min-R)/(P-R)*(A-C)+C;R=Q.min}else{if(P<=R&&P<Q.min){if(R<Q.min){continue}A=(Q.min-R)/(P-R)*(A-C)+C;P=Q.min}}if(R>=P&&R>Q.max){if(P>Q.max){continue}C=(Q.max-R)/(P-R)*(A-C)+C;R=Q.max}else{if(P>=R&&P>Q.max){if(R>Q.max){continue}A=(Q.max-R)/(P-R)*(A-C)+C;P=Q.max}}if(F){N.moveTo(E(R,Q),M(H,B)+D);F=false}if(C>=B.max&&A>=B.max){N.lineTo(E(R,Q),M(B.max,B)+D);N.lineTo(E(P,Q),M(B.max,B)+D);continue}else{if(C<=B.min&&A<=B.min){N.lineTo(E(R,Q),M(B.min,B)+D);N.lineTo(E(P,Q),M(B.min,B)+D);continue}}var I=R,K=P;if(C<=A&&C<B.min&&A>=B.min){R=(B.min-C)/(A-C)*(P-R)+R;C=B.min}else{if(A<=C&&A<B.min&&C>=B.min){P=(B.min-C)/(A-C)*(P-R)+R;A=B.min}}if(C>=A&&C>B.max&&A<=B.max){R=(B.max-C)/(A-C)*(P-R)+R;C=B.max}else{if(A>=C&&A>B.max&&C<=B.max){P=(B.max-C)/(A-C)*(P-R)+R;A=B.max}}if(R!=I){L=(C<=B.min)?L=B.min:B.max;N.lineTo(E(I,Q),M(L,B)+D);N.lineTo(E(R,Q),M(L,B)+D)}N.lineTo(E(R,Q),M(C,B)+D);N.lineTo(E(P,Q),M(A,B)+D);if(P!=K){L=(A<=B.min)?B.min:B.max;N.lineTo(E(K,Q),M(L,B)+D);N.lineTo(E(P,Q),M(L,B)+D)}G=Math.max(P,K)}N.lineTo(E(G,Q),M(H,B)+D);N.closePath();N.fill()},drawSeriesLines:function(C){C=C||this.series;var B=this.ctx;B.save();B.translate(this.plotOffset.left,this.plotOffset.top);B.lineJoin="round";var D=C.lines.lineWidth;var A=C.shadowSize;if(A>0){B.lineWidth=A/2;var E=D/2+B.lineWidth/2;B.strokeStyle="rgba(0,0,0,0.1)";this.plotLine(C,E+A/2);B.strokeStyle="rgba(0,0,0,0.2)";this.plotLine(C,E);if(C.lines.fill){B.fillStyle="rgba(0,0,0,0.05)";this.plotLineArea(C,E+A/2)}}B.lineWidth=D;B.strokeStyle=C.color;if(C.lines.fill){B.fillStyle=C.lines.fillColor!=null?C.lines.fillColor:Flotr.parseColor(C.color).scale(null,null,null,C.lines.fillOpacity).toString();this.plotLineArea(C,0)}this.plotLine(C,0);B.restore()},drawSeriesPoints:function(C){var B=this.ctx;B.save();B.translate(this.plotOffset.left,this.plotOffset.top);var D=C.lines.lineWidth;var A=C.shadowSize;if(A>0){B.lineWidth=A/2;B.strokeStyle="rgba(0,0,0,0.1)";this.plotPointShadows(C,A/2+B.lineWidth/2,C.points.radius);B.strokeStyle="rgba(0,0,0,0.2)";this.plotPointShadows(C,B.lineWidth/2,C.points.radius)}B.lineWidth=C.points.lineWidth;B.strokeStyle=C.color;B.fillStyle=C.points.fillColor!=null?C.points.fillColor:C.color;this.plotPoints(C,C.points.radius,C.points.fill);B.restore()},plotPoints:function(C,E,I){var A=C.xaxis,F=C.yaxis,J=this.ctx,D,B=C.data;for(D=B.length-1;D>-1;--D){var H=B[D][0],G=B[D][1];if(H<A.min||H>A.max||G<F.min||G>F.max){continue}J.beginPath();J.arc(this.tHoz(H,A),this.tVert(G,F),E,0,2*Math.PI,true);if(I){J.fill()}J.stroke()}},plotPointShadows:function(D,B,F){var A=D.xaxis,G=D.yaxis,J=this.ctx,E,C=D.data;for(E=C.length-1;E>-1;--E){var I=C[E][0],H=C[E][1];if(I<A.min||I>A.max||H<G.min||H>G.max){continue}J.beginPath();J.arc(this.tHoz(I,A),this.tVert(H,G)+B,F,0,Math.PI,false);J.stroke()}},drawSeriesBars:function(B){var A=this.ctx,D=B.bars.barWidth,C=Math.min(B.bars.lineWidth,D);A.save();A.translate(this.plotOffset.left,this.plotOffset.top);A.lineJoin="miter";A.lineWidth=C;A.strokeStyle=B.color;this.plotBarsShadows(B,D,0,B.bars.fill);if(B.bars.fill){A.fillStyle=B.bars.fillColor!=null?B.bars.fillColor:Flotr.parseColor(B.color).scale(null,null,null,B.bars.fillOpacity).toString()}this.plotBars(B,D,0,B.bars.fill);A.restore()},plotBars:function(K,N,D,Q){var U=K.data;if(U.length<1){return }var S=K.xaxis,B=K.yaxis,P=this.ctx,F=this.tHoz.bind(this),O=this.tVert.bind(this);for(var R=0;R<U.length;R++){var J=U[R][0],I=U[R][1];var E=true,L=true,A=true;var H=0;if(K.bars.stacked){S.values.each(function(W,V){if(V==J){H=W.stack||0;W.stack=H+I}})}if(K.bars.horizontal){var C=H,T=J+H,G=I,M=I+N}else{var C=J,T=J+N,G=H,M=I+H}if(T<S.min||C>S.max||M<B.min||G>B.max){continue}if(C<S.min){C=S.min;E=false}if(T>S.max){T=S.max;if(S.lastSerie!=K&&K.bars.horizontal){L=false}}if(G<B.min){G=B.min}if(M>B.max){M=B.max;if(B.lastSerie!=K&&!K.bars.horizontal){L=false}}if(Q){P.beginPath();P.moveTo(F(C,S),O(G,B)+D);P.lineTo(F(C,S),O(M,B)+D);P.lineTo(F(T,S),O(M,B)+D);P.lineTo(F(T,S),O(G,B)+D);P.fill()}if(K.bars.lineWidth!=0&&(E||A||L)){P.beginPath();P.moveTo(F(C,S),O(G,B)+D);P[E?"lineTo":"moveTo"](F(C,S),O(M,B)+D);P[L?"lineTo":"moveTo"](F(T,S),O(M,B)+D);P[A?"lineTo":"moveTo"](F(T,S),O(G,B)+D);P.stroke()}}},plotBarsShadows:function(I,K,C){var T=I.data;if(T.length<1){return }var R=I.xaxis,A=I.yaxis,P=this.ctx,D=this.tHoz.bind(this),M=this.tVert.bind(this),N=this.options.shadowSize;for(var Q=0;Q<T.length;Q++){var H=T[Q][0],G=T[Q][1];var E=0;if(I.bars.stacked){R.values.each(function(V,U){if(U==H){E=V.stackShadow||0;V.stackShadow=E+G}})}if(I.bars.horizontal){var B=E,S=H+E,F=G,J=G+K}else{var B=H,S=H+K,F=E,J=G+E}if(S<R.min||B>R.max||J<A.min||F>A.max){continue}if(B<R.min){B=R.min}if(S>R.max){S=R.max}if(F<A.min){F=A.min}if(J>A.max){J=A.max}var O=D(S,R)-D(B,R)-((D(S,R)+N<=this.plotWidth)?0:N);var L=Math.max(0,M(F,A)-M(J,A)-((M(F,A)+N<=this.plotHeight)?0:N));P.fillStyle="rgba(0,0,0,0.05)";P.fillRect(Math.min(D(B,R)+N,this.plotWidth),Math.min(M(J,A)+N,this.plotWidth),O,L)}},drawSeriesCandles:function(B){var A=this.ctx,C=B.candles.candleWidth;A.save();A.translate(this.plotOffset.left,this.plotOffset.top);A.lineJoin="miter";A.lineWidth=B.candles.lineWidth;this.plotCandlesShadows(B,C/2);this.plotCandles(B,C/2);A.restore()},plotCandles:function(K,D){var W=K.data;if(W.length<1){return }var T=K.xaxis,B=K.yaxis,P=this.ctx,E=this.tHoz.bind(this),O=this.tVert.bind(this);for(var S=0;S<W.length;S++){var U=W[S],J=U[0],L=U[1],I=U[2],X=U[3],N=U[4];var C=J,V=J+K.candles.candleWidth,G=Math.max(B.min,X),M=Math.min(B.max,I),A=Math.max(B.min,Math.min(L,N)),R=Math.min(B.max,Math.max(L,N));if(V<T.min||C>T.max||M<B.min||G>B.max){continue}var Q=K.candles[L>N?"downFillColor":"upFillColor"];if(K.candles.fill&&!K.candles.barcharts){P.fillStyle=Flotr.parseColor(Q).scale(null,null,null,K.candles.fillOpacity).toString();P.fillRect(E(C,T),O(R,B)+D,E(V,T)-E(C,T),O(A,B)-O(R,B))}if(K.candles.lineWidth||K.candles.wickLineWidth){var J,H,F=(K.candles.wickLineWidth%2)/2;J=Math.floor(E((C+V)/2),T)+F;P.save();P.strokeStyle=Q;P.lineWidth=K.candles.wickLineWidth;P.lineCap="butt";if(K.candles.barcharts){P.beginPath();P.moveTo(J,Math.floor(O(M,B)+D));P.lineTo(J,Math.floor(O(G,B)+D));H=Math.floor(O(L,B)+D)+0.5;P.moveTo(Math.floor(E(C,T))+F,H);P.lineTo(J,H);H=Math.floor(O(N,B)+D)+0.5;P.moveTo(Math.floor(E(V,T))+F,H);P.lineTo(J,H)}else{P.strokeRect(E(C,T),O(R,B)+D,E(V,T)-E(C,T),O(A,B)-O(R,B));P.beginPath();P.moveTo(J,Math.floor(O(R,B)+D));P.lineTo(J,Math.floor(O(M,B)+D));P.moveTo(J,Math.floor(O(A,B)+D));P.lineTo(J,Math.floor(O(G,B)+D))}P.stroke();P.restore()}}},plotCandlesShadows:function(H,C){var T=H.data;if(T.length<1||H.candles.barcharts){return }var Q=H.xaxis,A=H.yaxis,D=this.tHoz.bind(this),M=this.tVert.bind(this),N=this.options.shadowSize;for(var P=0;P<T.length;P++){var R=T[P],G=R[0],I=R[1],F=R[2],U=R[3],K=R[4];var B=G,S=G+H.candles.candleWidth,E=Math.max(A.min,Math.min(I,K)),J=Math.min(A.max,Math.max(I,K));if(S<Q.min||B>Q.max||J<A.min||E>A.max){continue}var O=D(S,Q)-D(B,Q)-((D(S,Q)+N<=this.plotWidth)?0:N);var L=Math.max(0,M(E,A)-M(J,A)-((M(E,A)+N<=this.plotHeight)?0:N));this.ctx.fillStyle="rgba(0,0,0,0.05)";this.ctx.fillRect(Math.min(D(B,Q)+N,this.plotWidth),Math.min(M(J,A)+N,this.plotWidth),O,L)}},drawSeriesPie:function(G){if(!this.options.pie.drawn){var K=this.ctx,C=this.options,E=G.pie.lineWidth,I=G.shadowSize,R=G.data,D=(Math.min(this.canvasWidth,this.canvasHeight)*G.pie.sizeRatio)/2,H=[];var L=1;var P=Math.sin(G.pie.viewAngle)*G.pie.spliceThickness/L;var M={size:C.fontSize*1.2,color:C.grid.color,weight:1.5};var Q={x:(this.canvasWidth+this.plotOffset.left)/2,y:(this.canvasHeight-this.plotOffset.bottom)/2};var O=this.series.collect(function(T,S){if(T.pie.show){return{name:(T.label||T.data[0][1]),value:[S,T.data[0][1]],explode:T.pie.explode}}});var B=O.pluck("value").pluck(1).inject(0,function(S,T){return S+T});var F=0,N=G.pie.startAngle,J=0;var A=O.collect(function(S){N+=F;J=parseFloat(S.value[1]);F=J/B;return{name:S.name,fraction:F,x:S.value[0],y:J,explode:S.explode,startAngle:2*N*Math.PI,endAngle:2*(N+F)*Math.PI}});K.save();if(I>0){A.each(function(V){var S=(V.startAngle+V.endAngle)/2;var T=Q.x+Math.cos(S)*V.explode+I;var U=Q.y+Math.sin(S)*V.explode+I;this.plotSlice(T,U,D,V.startAngle,V.endAngle,false,L);K.fillStyle="rgba(0,0,0,0.1)";K.fill()},this)}if(C.HtmlText){H=['<div style="color:'+this.options.grid.color+'" class="flotr-labels">']}A.each(function(c,X){var W=(c.startAngle+c.endAngle)/2;var V=C.colors[X];var Y=Q.x+Math.cos(W)*c.explode;var U=Q.y+Math.sin(W)*c.explode;this.plotSlice(Y,U,D,c.startAngle,c.endAngle,false,L);if(G.pie.fill){K.fillStyle=Flotr.parseColor(V).scale(null,null,null,G.pie.fillOpacity).toString();K.fill()}K.lineWidth=E;K.strokeStyle=V;K.stroke();var b=C.pie.labelFormatter(c);var S=(Math.cos(W)<0);var a=Y+Math.cos(W)*(G.pie.explode+D);var Z=U+Math.sin(W)*(G.pie.explode+D);if(c.fraction&&b){if(C.HtmlText){var T="position:absolute;top:"+(Z-5)+"px;";if(S){T+="right:"+(this.canvasWidth-a)+"px;text-align:right;"}else{T+="left:"+a+"px;text-align:left;"}H.push('<div style="'+T+'" class="flotr-grid-label">'+b+"</div>")}else{M.halign=S?"r":"l";K.drawText(b,a,Z+M.size/2,M)}}},this);if(C.HtmlText){H.push("</div>");this.el.insert(H.join(""))}K.restore();C.pie.drawn=true}},plotSlice:function(B,H,A,E,D,F,G){var C=this.ctx;G=G||1;C.save();C.scale(1,G);C.beginPath();C.moveTo(B,H);C.arc(B,H,A,E,D,F);C.lineTo(B,H);C.closePath();C.restore()},plotPie:function(){},insertLegend:function(){if(!this.options.legend.show){return }var H=this.series,I=this.plotOffset,B=this.options,b=[],A=false,O=this.ctx,R;var Q=H.findAll(function(c){return(c.label&&!c.hide)}).size();if(Q){if(!B.HtmlText&&this.textEnabled){var T={size:B.fontSize*1.1,color:B.grid.color};var M=B.legend.position,N=B.legend.margin,L=B.legend.labelBoxWidth,Z=B.legend.labelBoxHeight,S=B.legend.labelBoxMargin,W=I.left+N,U=I.top+N;var a=0;for(R=H.length-1;R>-1;--R){if(!H[R].label||H[R].hide){continue}var E=B.legend.labelFormatter(H[R].label);a=Math.max(a,O.measureText(E,T))}var K=Math.round(L+S*3+a),C=Math.round(Q*(S+Z)+S);if(M.charAt(0)=="s"){U=I.top+this.plotHeight-(N+C)}if(M.charAt(1)=="e"){W=I.left+this.plotWidth-(N+K)}var P=Flotr.parseColor(B.legend.backgroundColor||"rgb(240,240,240)").scale(null,null,null,B.legend.backgroundOpacity||0.1).toString();O.fillStyle=P;O.fillRect(W,U,K,C);O.strokeStyle=B.legend.labelBoxBorderColor;O.strokeRect(Flotr.toPixel(W),Flotr.toPixel(U),K,C);var G=W+S;var F=U+S;for(R=0;R<H.length;R++){if(!H[R].label||H[R].hide){continue}var E=B.legend.labelFormatter(H[R].label);O.fillStyle=H[R].color;O.fillRect(G,F,L-1,Z-1);O.strokeStyle=B.legend.labelBoxBorderColor;O.lineWidth=1;O.strokeRect(Math.ceil(G)-1.5,Math.ceil(F)-1.5,L+2,Z+2);O.drawText(E,G+L+S,F+(Z+T.size-O.fontDescent(T))/2,T);F+=Z+S}}else{for(R=0;R<H.length;++R){if(!H[R].label||H[R].hide){continue}if(R%B.legend.noColumns==0){b.push(A?"</tr><tr>":"<tr>");A=true}var E=B.legend.labelFormatter(H[R].label);b.push('<td class="flotr-legend-color-box"><div style="border:1px solid '+B.legend.labelBoxBorderColor+';padding:1px"><div style="width:'+B.legend.labelBoxWidth+"px;height:"+B.legend.labelBoxHeight+"px;background-color:"+H[R].color+'"></div></div></td><td class="flotr-legend-label">'+E+"</td>")}if(A){b.push("</tr>")}if(b.length>0){var V='<table style="font-size:smaller;color:'+B.grid.color+'">'+b.join("")+"</table>";if(B.legend.container!=null){$(B.legend.container).update(V)}else{var D="";var M=B.legend.position,N=B.legend.margin;if(M.charAt(0)=="n"){D+="top:"+(N+I.top)+"px;"}else{if(M.charAt(0)=="s"){D+="bottom:"+(N+I.bottom)+"px;"}}if(M.charAt(1)=="e"){D+="right:"+(N+I.right)+"px;"}else{if(M.charAt(1)=="w"){D+="left:"+(N+I.left)+"px;"}}var J=this.el.insert('<div class="flotr-legend" style="position:absolute;z-index:2;'+D+'">'+V+"</div>").select("div.flotr-legend").first();if(B.legend.backgroundOpacity!=0){var Y=B.legend.backgroundColor;if(Y==null){var X=(B.grid.backgroundColor!=null)?B.grid.backgroundColor:Flotr.extractColor(J);Y=Flotr.parseColor(X).adjust(null,null,null,1).toString()}this.el.insert('<div class="flotr-legend-bg" style="position:absolute;width:'+J.getWidth()+"px;height:"+J.getHeight()+"px;"+D+"background-color:"+Y+';"> </div>').select("div.flotr-legend-bg").first().setStyle({opacity:B.legend.backgroundOpacity})}}}}}},getEventPosition:function(C){var G=this.overlay.cumulativeOffset(),F=(C.pageX-G.left-this.plotOffset.left),E=(C.pageY-G.top-this.plotOffset.top),D=0,B=0;if(C.pageX==null&&C.clientX!=null){var H=document.documentElement,A=document.body;D=C.clientX+(H&&H.scrollLeft||A.scrollLeft||0);B=C.clientY+(H&&H.scrollTop||A.scrollTop||0)}else{D=C.pageX;B=C.pageY}return{x:this.axes.x.min+F/this.axes.x.scale,x2:this.axes.x2.min+F/this.axes.x2.scale,y:this.axes.y.max-E/this.axes.y.scale,y2:this.axes.y2.max-E/this.axes.y2.scale,relX:F,relY:E,absX:D,absY:B}},clickHandler:function(A){if(this.ignoreClick){this.ignoreClick=false;return }this.el.fire("flotr:click",[this.getEventPosition(A),this])},mouseMoveHandler:function(A){var B=this.getEventPosition(A);this.lastMousePos.pageX=B.absX;this.lastMousePos.pageY=B.absY;if(this.selectionInterval==null&&(this.options.mouse.track||this.series.any(function(C){return C.mouse&&C.mouse.track}))){this.hit(B)}this.el.fire("flotr:mousemove",[A,B,this])},mouseDownHandler:function(C){if(C.isRightClick()){C.stop();var B=this.overlay;B.hide();function A(){B.show();$(document).stopObserving("mousemove",A)}$(document).observe("mousemove",A);return }if(!this.options.selection.mode||!C.isLeftClick()){return }this.setSelectionPos(this.selection.first,C);if(this.selectionInterval!=null){clearInterval(this.selectionInterval)}this.lastMousePos.pageX=null;this.selectionInterval=setInterval(this.updateSelection.bind(this),1000/this.options.selection.fps);this.mouseUpHandler=this.mouseUpHandler.bind(this);$(document).observe("mouseup",this.mouseUpHandler)},fireSelectEvent:function(){var A=this.axes,F=this.selection,C=(F.first.x<=F.second.x)?F.first.x:F.second.x,B=(F.first.x<=F.second.x)?F.second.x:F.first.x,E=(F.first.y>=F.second.y)?F.first.y:F.second.y,D=(F.first.y>=F.second.y)?F.second.y:F.first.y;C=A.x.min+C/A.x.scale;B=A.x.min+B/A.x.scale;E=A.y.max-E/A.y.scale;D=A.y.max-D/A.y.scale;this.el.fire("flotr:select",[{x1:C,y1:E,x2:B,y2:D},this])},mouseUpHandler:function(A){$(document).stopObserving("mouseup",this.mouseUpHandler);A.stop();if(this.selectionInterval!=null){clearInterval(this.selectionInterval);this.selectionInterval=null}this.setSelectionPos(this.selection.second,A);this.clearSelection();if(this.selectionIsSane()){this.drawSelection();this.fireSelectEvent();this.ignoreClick=true}},setSelectionPos:function(D,B){var A=this.options,C=$(this.overlay).cumulativeOffset();if(A.selection.mode.indexOf("x")==-1){D.x=(D==this.selection.first)?0:this.plotWidth}else{D.x=B.pageX-C.left-this.plotOffset.left;D.x=Math.min(Math.max(0,D.x),this.plotWidth)}if(A.selection.mode.indexOf("y")==-1){D.y=(D==this.selection.first)?0:this.plotHeight}else{D.y=B.pageY-C.top-this.plotOffset.top;D.y=Math.min(Math.max(0,D.y),this.plotHeight)}},updateSelection:function(){if(this.lastMousePos.pageX==null){return }this.setSelectionPos(this.selection.second,this.lastMousePos);this.clearSelection();if(this.selectionIsSane()){this.drawSelection()}},clearSelection:function(){if(this.prevSelection==null){return }var G=this.prevSelection,E=this.octx,C=this.plotOffset,A=Math.min(G.first.x,G.second.x),F=Math.min(G.first.y,G.second.y),B=Math.abs(G.second.x-G.first.x),D=Math.abs(G.second.y-G.first.y);E.clearRect(A+C.left-E.lineWidth,F+C.top-E.lineWidth,B+E.lineWidth*2,D+E.lineWidth*2);this.prevSelection=null},setSelection:function(G){var B=this.options,H=this.axes.x,A=this.axes.y,F=yaxis.scale,D=xaxis.scale,E=B.selection.mode.indexOf("x")!=-1,C=B.selection.mode.indexOf("y")!=-1;this.clearSelection();this.selection.first.y=E?0:(A.max-G.y1)*F;this.selection.second.y=E?this.plotHeight:(A.max-G.y2)*F;this.selection.first.x=C?0:(G.x1-H.min)*D;this.selection.second.x=C?this.plotWidth:(G.x2-H.min)*D;this.drawSelection();this.fireSelectEvent()},drawSelection:function(){var C=this.prevSelection,F=this.selection,H=this.octx,I=this.options,A=this.plotOffset;if(C!=null&&F.first.x==C.first.x&&F.first.y==C.first.y&&F.second.x==C.second.x&&F.second.y==C.second.y){return }H.strokeStyle=Flotr.parseColor(I.selection.color).scale(null,null,null,0.8).toString();H.lineWidth=1;H.lineJoin="round";H.fillStyle=Flotr.parseColor(I.selection.color).scale(null,null,null,0.4).toString();this.prevSelection={first:{x:F.first.x,y:F.first.y},second:{x:F.second.x,y:F.second.y}};var E=Math.min(F.first.x,F.second.x),D=Math.min(F.first.y,F.second.y),G=Math.abs(F.second.x-F.first.x),B=Math.abs(F.second.y-F.first.y);H.fillRect(E+A.left,D+A.top,G,B);H.strokeRect(E+A.left,D+A.top,G,B)},selectionIsSane:function(){var A=this.selection;return Math.abs(A.second.x-A.first.x)>=5&&Math.abs(A.second.y-A.first.y)>=5},clearHit:function(){if(this.prevHit){var B=this.options,A=this.plotOffset,C=this.prevHit;this.octx.clearRect(this.tHoz(C.x)+A.left-B.points.radius*2,this.tVert(C.y)+A.top-B.points.radius*2,B.points.radius*3+B.points.lineWidth*3,B.points.radius*3+B.points.lineWidth*3);this.prevHit=null}},hit:function(I){var G=this.series,C=this.options,R=this.prevHit,H=this.plotOffset,D=this.octx,S,A,M,Q,L={dist:Number.MAX_VALUE,x:null,y:null,relX:I.relX,relY:I.relY,absX:I.absX,absY:I.absY,mouse:null};for(Q=0;Q<G.length;Q++){s=G[Q];if(!s.mouse.track){continue}S=s.data;A=(s.xaxis.scale*s.mouse.sensibility);M=(s.yaxis.scale*s.mouse.sensibility);for(var P=0,B,E;P<S.length;P++){if(S[P][1]===null){continue}B=Math.pow(s.xaxis.scale*(S[P][0]-I.x),2);E=Math.pow(s.yaxis.scale*(S[P][1]-I.y),2);if(B<A&&E<M&&Math.sqrt(B+E)<L.dist){L.dist=Math.sqrt(B+E);L.x=S[P][0];L.y=S[P][1];L.mouse=s.mouse}}}if(L.mouse&&L.mouse.track&&!R||(R&&(L.x!=R.x||L.y!=R.y))){var K=this.mouseTrack||this.el.select(".flotr-mouse-value")[0],F="",J=C.mouse.position,N=C.mouse.margin,O="opacity:0.7;background-color:#000;color:#fff;display:none;position:absolute;padding:2px 8px;-moz-border-radius:4px;border-radius:4px;white-space:nowrap;";if(!C.mouse.relative){if(J.charAt(0)=="n"){F+="top:"+(N+H.top)+"px;"}else{if(J.charAt(0)=="s"){F+="bottom:"+(N+H.bottom)+"px;"}}if(J.charAt(1)=="e"){F+="right:"+(N+H.right)+"px;"}else{if(J.charAt(1)=="w"){F+="left:"+(N+H.left)+"px;"}}}else{if(J.charAt(0)=="n"){F+="bottom:"+(N-H.top-this.tVert(L.y)+this.canvasHeight)+"px;"}else{if(J.charAt(0)=="s"){F+="top:"+(N+H.top+this.tVert(L.y))+"px;"}}if(J.charAt(1)=="e"){F+="left:"+(N+H.left+this.tHoz(L.x))+"px;"}else{if(J.charAt(1)=="w"){F+="right:"+(N-H.left-this.tHoz(L.x)+this.canvasWidth)+"px;"}}}O+=F;if(!K){this.el.insert('<div class="flotr-mouse-value" style="'+O+'"></div>');K=this.mouseTrack=this.el.select(".flotr-mouse-value").first()}else{this.mouseTrack=K.setStyle(O)}if(L.x!==null&&L.y!==null){K.show();this.clearHit();if(L.mouse.lineColor!=null){D.save();D.translate(H.left,H.top);D.lineWidth=C.points.lineWidth;D.strokeStyle=L.mouse.lineColor;D.fillStyle="#ffffff";D.beginPath();D.arc(this.tHoz(L.x),this.tVert(L.y),C.mouse.radius,0,2*Math.PI,true);D.fill();D.stroke();D.restore()}this.prevHit=L;var T=L.mouse.trackDecimals;if(T==null||T<0){T=0}K.innerHTML=L.mouse.trackFormatter({x:L.x.toFixed(T),y:L.y.toFixed(T)});K.fire("flotr:hit",[L,this])}else{if(R){K.hide();this.clearHit()}}}},saveImage:function(D,C,A,B){var E=null;switch(D){case"jpeg":case"jpg":E=Canvas2Image.saveAsJPEG(this.canvas,B,C,A);break;default:case"png":E=Canvas2Image.saveAsPNG(this.canvas,B,C,A);break;case"bmp":E=Canvas2Image.saveAsBMP(this.canvas,B,C,A);break}if(Object.isElement(E)&&B){this.restoreCanvas();this.canvas.hide();this.overlay.hide();this.el.insert(E.setStyle({position:"absolute"}))}},restoreCanvas:function(){this.canvas.show();this.overlay.show();this.el.select("img").invoke("remove")}});Flotr.Color=Class.create({initialize:function(E,D,B,C){this.rgba=["r","g","b","a"];var A=4;while(-1<--A){this[this.rgba[A]]=arguments[A]||((A==3)?1:0)}this.normalize()},adjust:function(D,C,E,B){var A=4;while(-1<--A){if(arguments[A]!=null){this[this.rgba[A]]+=arguments[A]}}return this.normalize()},clone:function(){return new Flotr.Color(this.r,this.b,this.g,this.a)},limit:function(B,A,C){return Math.max(Math.min(B,C),A)},normalize:function(){var A=this.limit;this.r=A(parseInt(this.r),0,255);this.g=A(parseInt(this.g),0,255);this.b=A(parseInt(this.b),0,255);this.a=A(this.a,0,1);return this},scale:function(D,C,E,B){var A=4;while(-1<--A){if(arguments[A]!=null){this[this.rgba[A]]*=arguments[A]}}return this.normalize()},distance:function(B){if(!B){return }B=new Flotr.parseColor(B);var C=0;var A=3;while(-1<--A){C+=Math.abs(this[this.rgba[A]]-B[this.rgba[A]])}return C},toString:function(){return(this.a>=1)?"rgb("+[this.r,this.g,this.b].join(",")+")":"rgba("+[this.r,this.g,this.b,this.a].join(",")+")"}});Flotr.Color.lookupColors={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0]};Flotr.Date={format:function(F,E){if(!F){return }var A=function(H){H=H.toString();return H.length==1?"0"+H:H};var D=[];var C=false;for(var B=0;B<E.length;++B){var G=E.charAt(B);if(C){switch(G){case"h":G=F.getUTCHours().toString();break;case"H":G=A(F.getUTCHours());break;case"M":G=A(F.getUTCMinutes());break;case"S":G=A(F.getUTCSeconds());break;case"d":G=F.getUTCDate().toString();break;case"m":G=(F.getUTCMonth()+1).toString();break;case"y":G=F.getUTCFullYear().toString();break;case"b":G=Flotr.Date.monthNames[F.getUTCMonth()];break}D.push(G);C=false}else{if(G=="%"){C=true}else{D.push(G)}}}return D.join("")},timeUnits:{second:1000,minute:60*1000,hour:60*60*1000,day:24*60*60*1000,month:30*24*60*60*1000,year:365.2425*24*60*60*1000},spec:[[1,"second"],[2,"second"],[5,"second"],[10,"second"],[30,"second"],[1,"minute"],[2,"minute"],[5,"minute"],[10,"minute"],[30,"minute"],[1,"hour"],[2,"hour"],[4,"hour"],[8,"hour"],[12,"hour"],[1,"day"],[2,"day"],[3,"day"],[0.25,"month"],[0.5,"month"],[1,"month"],[2,"month"],[3,"month"],[6,"month"],[1,"year"]],monthNames:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"]}; |
| //Flotr 0.2.0-alpha Copyright (c) 2009 Bas Wenneker, <http://solutoire.com>, MIT License. | |
| // | |
| //Radar chart added by Ryan Simmons | |
| // | |
| /* $Id: flotr.js 82 2009-01-12 19:19:31Z fabien.menager $ */ | |
| var Flotr = { | |
| version: '0.2.0-alpha', | |
| author: 'Bas Wenneker', | |
| website: 'http://www.solutoire.com', | |
| /** | |
| * An object of the default registered graph types. Use Flotr.register(type, functionName) | |
| * to add your own type. | |
| */ | |
| _registeredTypes:{ | |
| 'lines': 'drawSeriesLines', | |
| 'points': 'drawSeriesPoints', | |
| 'bars': 'drawSeriesBars', | |
| 'candles': 'drawSeriesCandles', | |
| 'pie': 'drawSeriesPie', | |
| 'radar':'drawSeriesRadar' | |
| }, | |
| /** | |
| * Can be used to register your own chart type. Default types are 'lines', 'points' and 'bars'. | |
| * This is still experimental. | |
| * @todo Test and confirm. | |
| * @param {String} type - type of chart, like 'pies', 'bars' etc. | |
| * @param {String} functionName - Name of the draw function, like 'drawSeriesPies', 'drawSeriesBars' etc. | |
| */ | |
| register: function(type, functionName){ | |
| Flotr._registeredTypes[type] = functionName+''; | |
| }, | |
| /** | |
| * Draws the graph. This function is here for backwards compatibility with Flotr version 0.1.0alpha. | |
| * You could also draw graphs by directly calling Flotr.Graph(element, data, options). | |
| * @param {Element} el - element to insert the graph into | |
| * @param {Object} data - an array or object of dataseries | |
| * @param {Object} options - an object containing options | |
| * @param {Class} _GraphKlass_ - (optional) Class to pass the arguments to, defaults to Flotr.Graph | |
| * @return {Class} returns a new graph object and of course draws the graph. | |
| */ | |
| draw: function(el, data, options, _GraphKlass_){ | |
| _GraphKlass_ = _GraphKlass_ || Flotr.Graph; | |
| return new _GraphKlass_(el, data, options); | |
| }, | |
| /** | |
| * Collects dataseries from input and parses the series into the right format. It returns an Array | |
| * of Objects each having at least the 'data' key set. | |
| * @param {Array/Object} data - Object or array of dataseries | |
| * @return {Array} Array of Objects parsed into the right format ({(...,) data: [[x1,y1], [x2,y2], ...] (, ...)}) | |
| */ | |
| getSeries: function(data){ | |
| return data.collect(function(serie){ | |
| var i, serie = (serie.data) ? Object.clone(serie) : {'data': serie}; | |
| for (i = serie.data.length-1; i > -1; --i) { | |
| serie.data[i][1] = (serie.data[i][1] === null ? null : parseFloat(serie.data[i][1])); | |
| } | |
| return serie; | |
| }); | |
| }, | |
| /** | |
| * Recursively merges two objects. | |
| * @param {Object} src - source object (likely the object with the least properties) | |
| * @param {Object} dest - destination object (optional, object with the most properties) | |
| * @return {Object} recursively merged Object | |
| */ | |
| merge: function(src, dest){ | |
| var result = dest || {}; | |
| for(var i in src){ | |
| result[i] = (src[i] != null && typeof(src[i]) == 'object' && !(src[i].constructor == Array || src[i].constructor == RegExp) && !Object.isElement(src[i])) ? Flotr.merge(src[i], dest[i]) : result[i] = src[i]; | |
| } | |
| return result; | |
| }, | |
| /** | |
| * Function calculates the ticksize and returns it. | |
| * @param {Integer} noTicks - number of ticks | |
| * @param {Integer} min - lower bound integer value for the current axis | |
| * @param {Integer} max - upper bound integer value for the current axis | |
| * @param {Integer} decimals - number of decimals for the ticks | |
| * @return {Integer} returns the ticksize in pixels | |
| */ | |
| getTickSize: function(noTicks, min, max, decimals){ | |
| var delta = (max - min) / noTicks; | |
| var magn = Flotr.getMagnitude(delta); | |
| // Norm is between 1.0 and 10.0. | |
| var norm = delta / magn; | |
| var tickSize = 10; | |
| if(norm < 1.5) tickSize = 1; | |
| else if(norm < 2.25) tickSize = 2; | |
| else if(norm < 3) tickSize = ((decimals == 0) ? 2 : 2.5); | |
| else if(norm < 7.5) tickSize = 5; | |
| return tickSize * magn; | |
| }, | |
| /** | |
| * Default tick formatter. | |
| * @param {String/Integer} val - tick value integer | |
| * @return {String} formatted tick string | |
| */ | |
| defaultTickFormatter: function(val){ | |
| return val+''; | |
| }, | |
| /** | |
| * Formats the mouse tracker values. | |
| * @param {Object} obj - Track value Object {x:..,y:..} | |
| * @return {String} Formatted track string | |
| */ | |
| defaultTrackFormatter: function(obj){ | |
| return '('+obj.x+', '+obj.y+')'; | |
| }, | |
| defaultPieLabelFormatter: function(slice) { | |
| return (slice.fraction*100).toFixed(2)+'%'; | |
| }, | |
| /** | |
| * Returns the magnitude of the input value. | |
| * @param {Integer/Float} x - integer or float value | |
| * @return {Integer/Float} returns the magnitude of the input value | |
| */ | |
| getMagnitude: function(x){ | |
| return Math.pow(10, Math.floor(Math.log(x) / Math.LN10)); | |
| }, | |
| toPixel: function(val){ | |
| return Math.floor(val)+0.5;//((val-Math.round(val) < 0.4) ? (Math.floor(val)-0.5) : val); | |
| }, | |
| toRad: function(angle){ | |
| return -angle * (Math.PI/180); | |
| }, | |
| /** | |
| * Parses a color string and returns a corresponding Color. | |
| * @param {String} str - string thats representing a color | |
| * @return {Color} returns a Color object or false | |
| */ | |
| parseColor: function(str){ | |
| if (str instanceof Flotr.Color) return str; | |
| var result, Color = Flotr.Color; | |
| // rgb(num,num,num) | |
| if((result = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(str))) | |
| return new Color(parseInt(result[1]), parseInt(result[2]), parseInt(result[3])); | |
| // rgba(num,num,num,num) | |
| if((result = /rgba\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(str))) | |
| return new Color(parseInt(result[1]), parseInt(result[2]), parseInt(result[3]), parseFloat(result[4])); | |
| // rgb(num%,num%,num%) | |
| if((result = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(str))) | |
| return new Color(parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55); | |
| // rgba(num%,num%,num%,num) | |
| if((result = /rgba\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(str))) | |
| return new Color(parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55, parseFloat(result[4])); | |
| // #a0b1c2 | |
| if((result = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(str))) | |
| return new Color(parseInt(result[1],16), parseInt(result[2],16), parseInt(result[3],16)); | |
| // #fff | |
| if((result = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(str))) | |
| return new Color(parseInt(result[1]+result[1],16), parseInt(result[2]+result[2],16), parseInt(result[3]+result[3],16)); | |
| // Otherwise, we're most likely dealing with a named color. | |
| var name = str.strip().toLowerCase(); | |
| if(name == 'transparent'){ | |
| return new Color(255, 255, 255, 0); | |
| } | |
| return ((result = Color.lookupColors[name])) ? new Color(result[0], result[1], result[2]) : false; | |
| }, | |
| /** | |
| * Extracts the background-color of the passed element. | |
| * @param {Element} element | |
| * @return {String} color string | |
| */ | |
| extractColor: function(element){ | |
| var color; | |
| // Loop until we find an element with a background color and stop when we hit the body element. | |
| do { | |
| color = element.getStyle('background-color').toLowerCase(); | |
| if(!(color == '' || color == 'transparent')) break; | |
| element = element.up(0); | |
| } while(!element.nodeName.match(/^body$/i)); | |
| // Catch Safari's way of signaling transparent. | |
| return (color == 'rgba(0, 0, 0, 0)') ? 'transparent' : color; | |
| } | |
| }; | |
| /** | |
| * Flotr Graph class that plots a graph on creation. | |
| */ | |
| Flotr.Graph = Class.create({ | |
| /** | |
| * Flotr Graph constructor. | |
| * @param {Element} el - element to insert the graph into | |
| * @param {Object} data - an array or object of dataseries | |
| * @param {Object} options - an object containing options | |
| */ | |
| initialize: function(el, data, options){ | |
| this.el = $(el); | |
| if (!this.el) throw 'The target container doesn\'t exist'; | |
| this.data = data; | |
| this.series = Flotr.getSeries(data); | |
| this.setOptions(options); | |
| // Initialize some variables | |
| this.lastMousePos = { pageX: null, pageY: null }; | |
| this.selection = { first: { x: -1, y: -1}, second: { x: -1, y: -1} }; | |
| this.prevSelection = null; | |
| this.selectionInterval = null; | |
| this.ignoreClick = false; | |
| this.prevHit = null; | |
| // Create and prepare canvas. | |
| this.constructCanvas(); | |
| // Add event handlers for mouse tracking, clicking and selection | |
| this.initEvents(); | |
| this.findDataRanges(); | |
| this.calculateTicks(this.axes.x); | |
| this.calculateTicks(this.axes.x2); | |
| this.calculateTicks(this.axes.y); | |
| this.calculateTicks(this.axes.y2); | |
| this.calculateSpacing(); | |
| this.draw(); | |
| this.insertLegend(); | |
| // Graph and Data tabs | |
| if (this.options.spreadsheet.show) | |
| this.constructTabs(); | |
| }, | |
| /** | |
| * Sets options and initializes some variables and color specific values, used by the constructor. | |
| * @param {Object} opts - options object | |
| */ | |
| setOptions: function(opts){ | |
| var options = { | |
| colors: ['#00A8F0', '#C0D800', '#CB4B4B', '#4DA74D', '#9440ED'], //=> The default colorscheme. When there are > 5 series, additional colors are generated. | |
| title: null, | |
| subtitle: null, | |
| legend: { | |
| show: true, // => setting to true will show the legend, hide otherwise | |
| noColumns: 1, // => number of colums in legend table // @todo: doesn't work for HtmlText = false | |
| labelFormatter: Prototype.K, // => fn: string -> string | |
| labelBoxBorderColor: '#CCCCCC', // => border color for the little label boxes | |
| labelBoxWidth: 14, | |
| labelBoxHeight: 10, | |
| labelBoxMargin: 5, | |
| container: null, // => container (as jQuery object) to put legend in, null means default on top of graph | |
| position: 'nw', // => position of default legend container within plot | |
| margin: 5, // => distance from grid edge to default legend container within plot | |
| backgroundColor: null, // => null means auto-detect | |
| backgroundOpacity: 0.85// => set to 0 to avoid background, set to 1 for a solid background | |
| }, | |
| xaxis: { | |
| ticks: null, // => format: either [1, 3] or [[1, 'a'], 3] | |
| showLabels: true, // => setting to true will show the axis ticks labels, hide otherwise | |
| labelsAngle: 0, // => Labels' angle, in degrees | |
| title: null, // => axis title | |
| titleAngle: 0, // => axis title's angle, in degrees | |
| noTicks: 5, // => number of ticks for automagically generated ticks | |
| tickFormatter: Flotr.defaultTickFormatter, // => fn: number -> string | |
| tickDecimals: null, // => no. of decimals, null means auto | |
| min: null, // => min. value to show, null means set automatically | |
| max: null, // => max. value to show, null means set automatically | |
| autoscaleMargin: 0, // => margin in % to add if auto-setting min/max | |
| color: null | |
| }, | |
| x2axis: {}, | |
| yaxis: { | |
| ticks: null, // => format: either [1, 3] or [[1, 'a'], 3] | |
| showLabels: true, // => setting to true will show the axis ticks labels, hide otherwise | |
| labelsAngle: 0, // => Labels' angle, in degrees | |
| title: null, // => axis title | |
| titleAngle: 90, // => axis title's angle, in degrees | |
| noTicks: 5, // => number of ticks for automagically generated ticks | |
| tickFormatter: Flotr.defaultTickFormatter, // => fn: number -> string | |
| tickDecimals: null, // => no. of decimals, null means auto | |
| min: null, // => min. value to show, null means set automatically | |
| max: null, // => max. value to show, null means set automatically | |
| autoscaleMargin: 0, // => margin in % to add if auto-setting min/max | |
| color: null | |
| }, | |
| y2axis: { | |
| titleAngle: 270 | |
| }, | |
| points: { | |
| show: false, // => setting to true will show points, false will hide | |
| radius: 3, // => point radius (pixels) | |
| lineWidth: 2, // => line width in pixels | |
| fill: true, // => true to fill the points with a color, false for (transparent) no fill | |
| fillColor: '#FFFFFF', // => fill color | |
| fillOpacity: 0.4 | |
| }, | |
| lines: { | |
| show: false, // => setting to true will show lines, false will hide | |
| lineWidth: 2, // => line width in pixels | |
| fill: false, // => true to fill the area from the line to the x axis, false for (transparent) no fill | |
| fillColor: null, // => fill color | |
| fillOpacity: 0.4 // => opacity of the fill color, set to 1 for a solid fill, 0 hides the fill | |
| }, | |
| radar: { | |
| show: false, // => setting to true will show radar chart, false will hide | |
| lineWidth: 2, // => line width in pixels | |
| fill: false, // => true to fill the area from the line to the x axis, false for (transparent) no fill | |
| fillColor: null, // => fill color | |
| fillOpacity: 0.4 // => opacity of the fill color, set to 1 for a solid fill, 0 hides the fill | |
| }, | |
| bars: { | |
| show: false, // => setting to true will show bars, false will hide | |
| lineWidth: 2, // => in pixels | |
| barWidth: 1, // => in units of the x axis | |
| fill: true, // => true to fill the area from the line to the x axis, false for (transparent) no fill | |
| fillColor: null, // => fill color | |
| fillOpacity: 0.4, // => opacity of the fill color, set to 1 for a solid fill, 0 hides the fill | |
| horizontal: false, | |
| stacked: false | |
| }, | |
| candles: { | |
| show: false, // => setting to true will show candle sticks, false will hide | |
| lineWidth: 1, // => in pixels | |
| wickLineWidth: 1, // => in pixels | |
| candleWidth: 0.6, // => in units of the x axis | |
| fill: true, // => true to fill the area from the line to the x axis, false for (transparent) no fill | |
| upFillColor: '#00A8F0',// => up sticks fill color | |
| downFillColor: '#CB4B4B',// => down sticks fill color | |
| fillOpacity: 0.5, // => opacity of the fill color, set to 1 for a solid fill, 0 hides the fill | |
| barcharts: false // => draw as barcharts (not standard bars but financial barcharts) | |
| }, | |
| pie: { | |
| show: false, // => setting to true will show bars, false will hide | |
| lineWidth: 1, // => in pixels | |
| fill: true, // => true to fill the area from the line to the x axis, false for (transparent) no fill | |
| fillColor: null, // => fill color | |
| fillOpacity: 0.6, // => opacity of the fill color, set to 1 for a solid fill, 0 hides the fill | |
| explode: 6, | |
| sizeRatio: 0.6, | |
| startAngle: Math.PI/4, | |
| labelFormatter: Flotr.defaultPieLabelFormatter, | |
| pie3D: false, | |
| pie3DviewAngle: (Math.PI/2 * 0.8), | |
| pie3DspliceThickness: 20 | |
| }, | |
| grid: { | |
| color: '#545454', // => primary color used for outline and labels | |
| backgroundColor: null, // => null for transparent, else color | |
| tickColor: '#DDDDDD', // => color used for the ticks | |
| labelMargin: 3, // => margin in pixels | |
| verticalLines: true, // => whether to show gridlines in vertical direction | |
| horizontalLines: true, // => whether to show gridlines in horizontal direction | |
| outlineWidth: 2 // => width of the grid outline/border in pixels | |
| }, | |
| selection: { | |
| mode: null, // => one of null, 'x', 'y' or 'xy' | |
| color: '#B6D9FF', // => selection box color | |
| fps: 20 // => frames-per-second | |
| }, | |
| mouse: { | |
| track: false, // => true to track the mouse, no tracking otherwise | |
| position: 'se', // => position of the value box (default south-east) | |
| relative: false, // => next to the mouse cursor | |
| trackFormatter: Flotr.defaultTrackFormatter, // => formats the values in the value box | |
| margin: 5, // => margin in pixels of the valuebox | |
| lineColor: '#FF3F19', // => line color of points that are drawn when mouse comes near a value of a series | |
| trackDecimals: 1, // => decimals for the track values | |
| sensibility: 2, // => the lower this number, the more precise you have to aim to show a value | |
| radius: 3 // => radius of the track point | |
| }, | |
| radarChartMode: false, // => true to render radar grid / and setup scaling for radar chart | |
| shadowSize: 4, // => size of the 'fake' shadow | |
| defaultType: 'lines', // => default series type | |
| HtmlText: true, // => wether to draw the text using HTML or on the canvas | |
| fontSize: 7.5, // => canvas' text font size | |
| spreadsheet: { | |
| show: false, // => show the data grid using two tabs | |
| tabGraphLabel: 'Graph', | |
| tabDataLabel: 'Data', | |
| toolbarDownload: 'Download CSV', // @todo: add language support | |
| toolbarSelectAll: 'Select all' | |
| } | |
| } | |
| options.x2axis = Object.extend(Object.clone(options.xaxis), options.x2axis); | |
| options.y2axis = Object.extend(Object.clone(options.yaxis), options.y2axis); | |
| this.options = Flotr.merge((opts || {}), options); | |
| this.axes = { | |
| x: {options: this.options.xaxis, n: 1}, | |
| x2: {options: this.options.x2axis, n: 2}, | |
| y: {options: this.options.yaxis, n: 1}, | |
| y2: {options: this.options.y2axis, n: 2} | |
| }; | |
| // Initialize some variables used throughout this function. | |
| var assignedColors = [], | |
| colors = [], | |
| ln = this.series.length, | |
| neededColors = this.series.length, | |
| oc = this.options.colors, | |
| usedColors = [], | |
| variation = 0, | |
| c, i, j, s, tooClose; | |
| // Collect user-defined colors from series. | |
| for(i = neededColors - 1; i > -1; --i){ | |
| c = this.series[i].color; | |
| if(c != null){ | |
| --neededColors; | |
| if(Object.isNumber(c)) assignedColors.push(c); | |
| else usedColors.push(Flotr.parseColor(c)); | |
| } | |
| } | |
| // Calculate the number of colors that need to be generated. | |
| for(i = assignedColors.length - 1; i > -1; --i) | |
| neededColors = Math.max(neededColors, assignedColors[i] + 1); | |
| // Generate needed number of colors. | |
| for(i = 0; colors.length < neededColors;){ | |
| c = (oc.length == i) ? new Flotr.Color(100, 100, 100) : Flotr.parseColor(oc[i]); | |
| // Make sure each serie gets a different color. | |
| var sign = variation % 2 == 1 ? -1 : 1; | |
| var factor = 1 + sign * Math.ceil(variation / 2) * 0.2; | |
| c.scale(factor, factor, factor); | |
| /** | |
| * @todo if we're getting too close to something else, we should probably skip this one | |
| */ | |
| colors.push(c); | |
| if(++i >= oc.length){ | |
| i = 0; | |
| ++variation; | |
| } | |
| } | |
| // Fill the options with the generated colors. | |
| for(i = 0, j = 0; i < ln; ++i){ | |
| s = this.series[i]; | |
| // Assign the color. | |
| if(s.color == null){ | |
| s.color = colors[j++].toString(); | |
| }else if(Object.isNumber(s.color)){ | |
| s.color = colors[s.color].toString(); | |
| } | |
| if (!s.xaxis) s.xaxis = this.axes.x; | |
| if (s.xaxis == 1) s.xaxis = this.axes.x; | |
| else if (s.xaxis == 2) s.xaxis = this.axes.x2; | |
| if (!s.yaxis) s.yaxis = this.axes.y; | |
| if (s.yaxis == 1) s.yaxis = this.axes.y; | |
| else if (s.yaxis == 2) s.yaxis = this.axes.y2; | |
| // Apply missing options to the series. | |
| s.lines = Object.extend(Object.clone(this.options.lines), s.lines); | |
| s.points = Object.extend(Object.clone(this.options.points), s.points); | |
| s.bars = Object.extend(Object.clone(this.options.bars), s.bars); | |
| s.candles = Object.extend(Object.clone(this.options.candles), s.candles); | |
| s.pie = Object.extend(Object.clone(this.options.pie), s.pie); | |
| s.radar = Object.extend(Object.clone(this.options.radar), s.radar); | |
| s.mouse = Object.extend(Object.clone(this.options.mouse), s.mouse); | |
| if(s.shadowSize == null) s.shadowSize = this.options.shadowSize; | |
| } | |
| }, | |
| /** | |
| * Initializes the canvas and it's overlay canvas element. When the browser is IE, this makes use | |
| * of excanvas. The overlay canvas is inserted for displaying interactions. After the canvas elements | |
| * are created, the elements are inserted into the container element. | |
| */ | |
| constructCanvas: function(){ | |
| var el = this.el, | |
| size, c, oc; | |
| this.canvas = el.select('.flotr-canvas')[0]; | |
| this.overlay = el.select('.flotr-overlay')[0]; | |
| el.childElements().invoke('remove'); | |
| // For positioning labels and overlay. | |
| el.setStyle({position:'relative', cursor:'default'}); | |
| this.canvasWidth = el.getWidth(); | |
| this.canvasHeight = el.getHeight(); | |
| size = {'width': this.canvasWidth, 'height': this.canvasHeight}; | |
| if(this.canvasWidth <= 0 || this.canvasHeight <= 0){ | |
| throw 'Invalid dimensions for plot, width = ' + this.canvasWidth + ', height = ' + this.canvasHeight; | |
| } | |
| // Insert main canvas. | |
| if (!this.canvas) { | |
| c = this.canvas = new Element('canvas', size); | |
| c.className = 'flotr-canvas'; | |
| c = c.writeAttribute('style', 'position:absolute;left:0px;top:0px;'); | |
| } else { | |
| c = this.canvas.writeAttribute(size); | |
| } | |
| el.insert(c); | |
| if(Prototype.Browser.IE){ | |
| c = window.G_vmlCanvasManager.initElement(c); | |
| } | |
| this.ctx = c.getContext('2d'); | |
| // Insert overlay canvas for interactive features. | |
| if (!this.overlay) { | |
| oc = this.overlay = new Element('canvas', size); | |
| oc.className = 'flotr-overlay'; | |
| oc = oc.writeAttribute('style', 'position:absolute;left:0px;top:0px;'); | |
| } else { | |
| oc = this.overlay.writeAttribute(size); | |
| } | |
| el.insert(oc); | |
| if(Prototype.Browser.IE){ | |
| oc = window.G_vmlCanvasManager.initElement(oc); | |
| } | |
| this.octx = oc.getContext('2d'); | |
| // Enable text functions | |
| if (window.CanvasText) { | |
| CanvasText.enable(this.ctx); | |
| CanvasText.enable(this.octx); | |
| this.textEnabled = true; | |
| } | |
| }, | |
| getTextDimensions: function(text, canvasStyle, HtmlStyle, className) { | |
| if (!text) return {width:0, height:0}; | |
| if (!this.options.HtmlText && this.textEnabled) { | |
| var bounds = this.ctx.getTextBounds(text, canvasStyle); | |
| return { | |
| width: bounds.width+2, | |
| height: bounds.height+6 | |
| }; | |
| } | |
| else { | |
| var dummyDiv = this.el.insert('<div style="position:absolute;top:-10000px;'+HtmlStyle+'" class="'+className+' flotr-dummy-div">' + text + '</div>').select(".flotr-dummy-div")[0]; | |
| dim = dummyDiv.getDimensions(); | |
| dummyDiv.remove(); | |
| return dim; | |
| } | |
| }, | |
| loadDataGrid: function(){ | |
| if (this.seriesData) return this.seriesData; | |
| var s = this.series; | |
| var dg = []; | |
| /* The data grid is a 2 dimensions array. There is a row for each X value. | |
| * Each row contains the x value and the corresponding y value for each serie ('undefined' if there isn't one) | |
| **/ | |
| for(i = 0; i < s.length; ++i){ | |
| s[i].data.each(function(v) { | |
| var x = v[0], | |
| y = v[1]; | |
| if (r = dg.find(function(row) {return row[0] == x})) { | |
| r[i+1] = y; | |
| } | |
| else { | |
| var newRow = []; | |
| newRow[0] = x; | |
| newRow[i+1] = y | |
| dg.push(newRow); | |
| } | |
| }); | |
| } | |
| // The data grid is sorted by x value | |
| dg = dg.sortBy(function(v) { | |
| return v[0]; | |
| }); | |
| return this.seriesData = dg; | |
| }, | |
| // @todo: make a tab manager (Flotr.Tabs) | |
| showTab: function(tabName, onComplete){ | |
| var elementsClassNames = 'canvas, .flotr-labels, .flotr-legend, .flotr-legend-bg, .flotr-title, .flotr-subtitle'; | |
| switch(tabName) { | |
| case 'graph': | |
| this.datagrid.up().hide(); | |
| this.el.select(elementsClassNames).invoke('show'); | |
| this.tabs.data.removeClassName('selected'); | |
| this.tabs.graph.addClassName('selected'); | |
| break; | |
| case 'data': | |
| this.constructDataGrid(); | |
| this.datagrid.up().show(); | |
| this.el.select(elementsClassNames).invoke('hide'); | |
| this.tabs.data.addClassName('selected'); | |
| this.tabs.graph.removeClassName('selected'); | |
| break; | |
| } | |
| }, | |
| constructTabs: function(){ | |
| var tabsContainer = new Element('div', {className:'flotr-tabs-group', style:'position:absolute;left:0px;top:'+this.canvasHeight+'px;width:'+this.canvasWidth+'px;'}); | |
| this.el.insert({bottom: tabsContainer}); | |
| this.tabs = { | |
| graph: new Element('div', {className:'flotr-tab selected', style:'float:left;'}).update(this.options.spreadsheet.tabGraphLabel), | |
| data: new Element('div', {className:'flotr-tab', style:'float:left;'}).update(this.options.spreadsheet.tabDataLabel) | |
| } | |
| tabsContainer.insert(this.tabs.graph).insert(this.tabs.data); | |
| this.el.setStyle({height: this.canvasHeight+this.tabs.data.getHeight()+2+'px'}); | |
| this.tabs.graph.observe('click', (function() {this.showTab('graph')}).bind(this)); | |
| this.tabs.data.observe('click', (function() {this.showTab('data')}).bind(this)); | |
| }, | |
| // @todo: make a spreadsheet manager (Flotr.Spreadsheet) | |
| constructDataGrid: function(){ | |
| // If the data grid has already been built, nothing to do here | |
| if (this.datagrid) return this.datagrid; | |
| var i, j, | |
| s = this.series, | |
| datagrid = this.loadDataGrid(); | |
| var t = this.datagrid = new Element('table', {className:'flotr-datagrid', style:'height:100px;'}); | |
| var colgroup = ['<colgroup><col />']; | |
| // First row : series' labels | |
| var html = ['<tr class="first-row">']; | |
| html.push('<th> </th>'); | |
| for (i = 0; i < s.length; ++i) { | |
| html.push('<th scope="col">'+(s[i].label || String.fromCharCode(65+i))+'</th>'); | |
| colgroup.push('<col />'); | |
| } | |
| html.push('</tr>'); | |
| // Data rows | |
| for (j = 0; j < datagrid.length; ++j) { | |
| html.push('<tr>'); | |
| for (i = 0; i < s.length+1; ++i) { | |
| var tag = 'td'; | |
| var content = (datagrid[j][i] != null ? Math.round(datagrid[j][i]*100000)/100000 : ''); | |
| if (i == 0) { | |
| tag = 'th'; | |
| var label; | |
| if(this.options.xaxis.ticks) { | |
| var tick = this.options.xaxis.ticks.find(function (x) { return x[0] == datagrid[j][i] }); | |
| if (tick) label = tick[1]; | |
| } | |
| else { | |
| label = this.options.xaxis.tickFormatter(content); | |
| } | |
| if (label) content = label; | |
| } | |
| html.push('<'+tag+(tag=='th'?' scope="row"':'')+'>'+content+'</'+tag+'>'); | |
| } | |
| html.push('</tr>'); | |
| } | |
| colgroup.push('</colgroup>'); | |
| t.update(colgroup.join('')+html.join('')); | |
| if (!Prototype.Browser.IE) { | |
| t.select('td').each(function(td) { | |
| td.observe('mouseover', function(e){ | |
| td = e.element(); | |
| var siblings = td.previousSiblings(); | |
| t.select('th[scope=col]')[siblings.length-1].addClassName('hover'); | |
| t.select('colgroup col')[siblings.length].addClassName('hover'); | |
| }); | |
| td.observe('mouseout', function(){ | |
| t.select('colgroup col.hover, th.hover').each(function(e){e.removeClassName('hover')}); | |
| }); | |
| }); | |
| } | |
| var toolbar = new Element('div', {className: 'flotr-datagrid-toolbar'}). | |
| insert(new Element('button', {type:'button', className:'flotr-datagrid-toolbar-button'}).update(this.options.spreadsheet.toolbarDownload).observe('click', this.downloadCSV.bind(this))). | |
| insert(new Element('button', {type:'button', className:'flotr-datagrid-toolbar-button'}).update(this.options.spreadsheet.toolbarSelectAll).observe('click', this.selectAllData.bind(this))); | |
| var container = new Element('div', {className:'flotr-datagrid-container', style:'left:0px;top:0px;width:'+this.canvasWidth+'px;height:'+this.canvasHeight+'px;overflow:auto;'}); | |
| container.insert(toolbar); | |
| t.wrap(container.hide()); | |
| this.el.insert(container); | |
| return t; | |
| }, | |
| selectAllData: function(){ | |
| if (this.tabs) { | |
| var selection, range, doc, win, node = this.constructDataGrid(); | |
| this.showTab('data'); | |
| // deferred to be able to select the table | |
| (function () { | |
| if ((doc = node.ownerDocument) && (win = doc.defaultView) && | |
| win.getSelection && doc.createRange && | |
| (selection = window.getSelection()) && | |
| selection.removeAllRanges) { | |
| range = doc.createRange(); | |
| range.selectNode(node); | |
| selection.removeAllRanges(); | |
| selection.addRange(range); | |
| } | |
| else if (document.body && document.body.createTextRange && | |
| (range = document.body.createTextRange())) { | |
| range.moveToElementText(node); | |
| range.select(); | |
| } | |
| }).defer(); | |
| return true; | |
| } | |
| else return false; | |
| }, | |
| downloadCSV: function(){ | |
| var i, csv = '"x"', | |
| series = this.series, | |
| dg = this.loadDataGrid(); | |
| for (i = 0; i < series.length; ++i) { | |
| csv += '%09"'+(series[i].label || String.fromCharCode(65+i))+'"'; // \t | |
| } | |
| csv += "%0D%0A"; // \r\n | |
| for (i = 0; i < dg.length; ++i) { | |
| if (this.options.xaxis.ticks) { | |
| var tick = this.options.xaxis.ticks.find(function (x) { return x[0] == dg[i][0] }); | |
| if (tick) dg[i][0] = tick[1]; | |
| } else { | |
| dg[i][0] = this.options.xaxis.tickFormatter(dg[i][0]); | |
| } | |
| csv += dg[i].join('%09')+"%0D%0A"; // \t and \r\n | |
| } | |
| if (Prototype.Browser.IE) { | |
| csv = csv.gsub('%09', '\t').gsub('%0A', '\n').gsub('%0D', '\r'); | |
| window.open().document.write(csv); | |
| } | |
| else { | |
| window.open('data:text/csv,'+csv); | |
| } | |
| }, | |
| /** | |
| * Initializes event some handlers. | |
| */ | |
| initEvents: function () { | |
| //@todo: maybe stopObserving with only flotr functions | |
| this.overlay.stopObserving(); | |
| this.overlay.observe('mousedown', this.mouseDownHandler.bind(this)); | |
| this.overlay.observe('mousemove', this.mouseMoveHandler.bind(this)); | |
| this.overlay.observe('click', this.clickHandler.bind(this)); | |
| }, | |
| /** | |
| * Function determines the min and max values for the xaxis and yaxis. | |
| */ | |
| findDataRanges: function(){ | |
| var s = this.series, | |
| a = this.axes; | |
| a.x.datamin = 0; a.x.datamax = 0; | |
| a.x2.datamin = 0; a.x2.datamax = 0; | |
| a.y.datamin = 0; a.y.datamax = 0; | |
| a.y2.datamin = 0; a.y2.datamax = 0; | |
| if(s.length > 0){ | |
| var i, j, h, x, y, data, xaxis, yaxis; | |
| // Get datamin, datamax start values | |
| for(i = 0; i < s.length; ++i) { | |
| data = s[i].data, | |
| xaxis = s[i].xaxis, | |
| yaxis = s[i].yaxis; | |
| if (data.length > 0 && !s[i].hide) { | |
| if (!xaxis.used) xaxis.datamin = xaxis.datamax = data[0][0]; | |
| if (!yaxis.used) yaxis.datamin = yaxis.datamax = data[0][1]; | |
| xaxis.used = true; | |
| yaxis.used = true; | |
| for(h = data.length - 1; h > -1; --h){ | |
| x = data[h][0]; | |
| if(x < xaxis.datamin) xaxis.datamin = x; | |
| else if(x > xaxis.datamax) xaxis.datamax = x; | |
| for(j = 1; j < data[h].length; j++){ | |
| y = data[h][j]; | |
| if(y < yaxis.datamin) yaxis.datamin = y; | |
| else if(y > yaxis.datamax) yaxis.datamax = y; | |
| } | |
| } | |
| } | |
| if (this.options.radarChartMode) { | |
| xaxis.datamin = yaxis.datamin = - yaxis.datamax; | |
| xaxis.datamax = yaxis.datamax; | |
| if (!this.options.radarChartSides) this.options.radarChartSides = data.length; | |
| } | |
| } | |
| } | |
| this.findXAxesValues(); | |
| this.calculateRange(a.x); | |
| this.extendXRangeIfNeededByBar(a.x); | |
| if (a.x2.used) { | |
| this.calculateRange(a.x2); | |
| this.extendXRangeIfNeededByBar(a.x2); | |
| } | |
| this.calculateRange(a.y); | |
| this.extendYRangeIfNeededByBar(a.y); | |
| if (a.y2.used) { | |
| this.calculateRange(a.y2); | |
| this.extendYRangeIfNeededByBar(a.y2); | |
| } | |
| }, | |
| /** | |
| * Calculates the range of an axis to apply autoscaling. | |
| */ | |
| calculateRange: function(axis){ | |
| var o = axis.options, | |
| min = o.min != null ? o.min : axis.datamin, | |
| max = o.max != null ? o.max : axis.datamax, | |
| margin; | |
| if(max - min == 0.0){ | |
| var widen = (max == 0.0) ? 1.0 : 0.01; | |
| min -= widen; | |
| max += widen; | |
| } | |
| axis.tickSize = Flotr.getTickSize(o.noTicks, ((this.options.radarChartMode) ? 0 : min), max, o.tickDecimals); | |
| // Autoscaling. | |
| if(o.min == null){ | |
| // Add a margin. | |
| margin = o.autoscaleMargin; | |
| if(margin != 0){ | |
| min -= axis.tickSize * margin; | |
| // Make sure we don't go below zero if all values are positive. | |
| if(min < 0 && axis.datamin >= 0) min = 0; | |
| min = axis.tickSize * Math.floor(min / axis.tickSize); | |
| } | |
| } | |
| if(o.max == null){ | |
| margin = o.autoscaleMargin; | |
| if(margin != 0){ | |
| max += axis.tickSize * margin; | |
| if(max > 0 && axis.datamax <= 0) max = 0; | |
| max = axis.tickSize * Math.ceil(max / axis.tickSize); | |
| } | |
| } | |
| axis.min = min; | |
| axis.max = max; | |
| }, | |
| /** | |
| * Bar series autoscaling in x direction. | |
| */ | |
| extendXRangeIfNeededByBar: function(axis){ | |
| if(axis.options.max == null){ | |
| var newmax = axis.max, | |
| i, s, b, c, | |
| stackedSums = [], | |
| lastSerie = null; | |
| for(i = 0; i < this.series.length; ++i){ | |
| s = this.series[i]; | |
| b = s.bars; | |
| c = s.candles; | |
| if(s.axis == axis && (b.show || c.show)) { | |
| if (!b.horizontal && (b.barWidth + axis.datamax > newmax) || (c.candleWidth + axis.datamax > newmax)){ | |
| newmax = axis.max + s.bars.barWidth; | |
| } | |
| if(b.stacked && b.horizontal){ | |
| for (j = 0; j < s.data.length; j++) { | |
| if (s.bars.show && s.bars.stacked) { | |
| var x = s.data[j][0]; | |
| stackedSums[x] = (stackedSums[x] || 0) + s.data[j][1]; | |
| lastSerie = s; | |
| } | |
| } | |
| for (j = 0; j < stackedSums.length; j++) { | |
| newmax = Math.max(stackedSums[j], newmax); | |
| } | |
| } | |
| } | |
| } | |
| axis.lastSerie = lastSerie; | |
| axis.max = newmax; | |
| } | |
| }, | |
| /** | |
| * Bar series autoscaling in y direction. | |
| */ | |
| extendYRangeIfNeededByBar: function(axis){ | |
| if(axis.options.max == null){ | |
| var newmax = axis.max, | |
| i, s, b, c, | |
| stackedSums = [], | |
| lastSerie = null; | |
| for(i = 0; i < this.series.length; ++i){ | |
| s = this.series[i]; | |
| b = s.bars; | |
| c = s.candles; | |
| if (s.yaxis == axis && b.show && !s.hide) { | |
| if (b.horizontal && (b.barWidth + axis.datamax > newmax) || (c.candleWidth + axis.datamax > newmax)){ | |
| newmax = axis.max + b.barWidth; | |
| } | |
| if(b.stacked && !b.horizontal){ | |
| for (j = 0; j < s.data.length; j++) { | |
| if (s.bars.show && s.bars.stacked) { | |
| var x = s.data[j][0]; | |
| stackedSums[x] = (stackedSums[x] || 0) + s.data[j][1]; | |
| lastSerie = s; | |
| } | |
| } | |
| for (j = 0; j < stackedSums.length; j++) { | |
| newmax = Math.max(stackedSums[j], newmax); | |
| } | |
| } | |
| } | |
| } | |
| axis.lastSerie = lastSerie; | |
| axis.max = newmax; | |
| } | |
| }, | |
| /** | |
| * Find every values of the x axes | |
| */ | |
| findXAxesValues: function(){ | |
| for(i = this.series.length-1; i > -1 ; --i){ | |
| s = this.series[i]; | |
| s.xaxis.values = s.xaxis.values || []; | |
| for (j = s.data.length-1; j > -1 ; --j){ | |
| s.xaxis.values[s.data[j][0]] = {}; | |
| } | |
| } | |
| }, | |
| /** | |
| * Calculate axis ticks. | |
| * @param {Object} axis - axis object | |
| * @param {Object} o - axis options | |
| */ | |
| calculateTicks: function(axis){ | |
| var o = axis.options, i, v; | |
| axis.ticks = []; | |
| if(o.ticks){ | |
| var ticks = o.ticks, t, label; | |
| if(Object.isFunction(ticks)){ | |
| ticks = ticks({min: axis.min, max: axis.max}); | |
| } | |
| // Clean up the user-supplied ticks, copy them over. | |
| for(i = 0; i < ticks.length; ++i){ | |
| t = ticks[i]; | |
| if(typeof(t) == 'object'){ | |
| v = t[0]; | |
| label = (t.length > 1) ? t[1] : o.tickFormatter(v); | |
| }else{ | |
| v = t; | |
| label = o.tickFormatter(v); | |
| } | |
| axis.ticks[i] = { v: v, label: label }; | |
| } | |
| } | |
| else { | |
| // Round to nearest multiple of tick size. | |
| var start = axis.tickSize * Math.ceil(axis.min / axis.tickSize), | |
| decimals; | |
| // Then store all possible ticks. | |
| for(i = 0; start + i * axis.tickSize <= axis.max; ++i){ | |
| v = start + i * axis.tickSize; | |
| // Round (this is always needed to fix numerical instability). | |
| decimals = o.tickDecimals; | |
| if(decimals == null) decimals = 1 - Math.floor(Math.log(axis.tickSize) / Math.LN10); | |
| if(decimals < 0) decimals = 0; | |
| v = v.toFixed(decimals); | |
| axis.ticks.push({ v: v, label: o.tickFormatter(v) }); | |
| } | |
| } | |
| }, | |
| /** | |
| * Calculates axis label sizes. | |
| */ | |
| calculateSpacing: function(){ | |
| var a = this.axes, | |
| options = this.options, | |
| series = this.series, | |
| margin = options.grid.labelMargin, | |
| x = a.x, | |
| x2 = a.x2, | |
| y = a.y, | |
| y2 = a.y2, | |
| maxOutset = 2, | |
| i, j, l, dim; | |
| // Labels width and height | |
| [x, x2, y, y2].each(function(axis) { | |
| var maxLabel = ''; | |
| if (axis.options.showLabels) { | |
| for(i = 0; i < axis.ticks.length; ++i){ | |
| l = axis.ticks[i].label.length; | |
| if(l > maxLabel.length){ | |
| maxLabel = axis.ticks[i].label; | |
| } | |
| } | |
| } | |
| axis.maxLabel = this.getTextDimensions(maxLabel, {size:options.fontSize, angle: Flotr.toRad(axis.options.labelsAngle)}, 'font-size:smaller;', 'flotr-grid-label'); | |
| axis.titleSize = this.getTextDimensions(axis.options.title, {size: options.fontSize*1.2, angle: Flotr.toRad(axis.options.titleAngle)}, 'font-weight:bold;', 'flotr-axis-title'); | |
| }, this); | |
| // Title height | |
| dim = this.getTextDimensions(options.title, {size: options.fontSize*1.5}, 'font-size:1em;font-weight:bold;', 'flotr-title'); | |
| this.titleHeight = dim.height; | |
| // Subtitle height | |
| dim = this.getTextDimensions(options.subtitle, {size: options.fontSize}, 'font-size:smaller;', 'flotr-subtitle'); | |
| this.subtitleHeight = dim.height; | |
| // Grid outline line width. | |
| if(options.show){ | |
| maxOutset = Math.max(maxOutset, options.points.radius + options.points.lineWidth/2); | |
| } | |
| for(j = 0; j < options.length; ++j){ | |
| if (series[j].points.show){ | |
| maxOutset = Math.max(maxOutset, series[j].points.radius + series[j].points.lineWidth/2); | |
| } | |
| } | |
| var p = this.plotOffset = {left: 0, right: 0, top: 0, bottom: 0}; | |
| p.left = p.right = p.top = p.bottom = maxOutset; | |
| p.bottom += (x.options.showLabels ? (x.maxLabel.height + margin) : 0) + | |
| (x.options.title ? (x.titleSize.height + margin) : 0); | |
| p.top += (x2.options.showLabels ? (x2.maxLabel.height + margin) : 0) + | |
| (x2.options.title ? (x2.titleSize.height + margin) : 0) + this.subtitleHeight + this.titleHeight + | |
| this.options.radarChartMode ? (y.options.showLabels ? (y.maxLabel.height + margin) : 0) : 0; | |
| p.left += (y.options.showLabels ? (y.maxLabel.width + margin) : 0) + | |
| (y.options.title ? (y.titleSize.width + margin) : 0); | |
| p.right += (y2.options.showLabels ? (y2.maxLabel.width + margin) : 0) + | |
| (y2.options.title ? (y2.titleSize.width + margin) : 0) + | |
| this.options.radarChartMode ? (x.options.showLabels ? (x.maxLabel.width + margin) : 0) : 0; | |
| p.top = Math.floor(p.top); // In order the outline not to be blured | |
| this.plotWidth = this.canvasWidth - p.left - p.right; | |
| this.plotHeight = this.canvasHeight - p.bottom - p.top; | |
| x.scale = this.plotWidth / (x.max - x.min); | |
| x2.scale = this.plotWidth / (x2.max - x2.min); | |
| y.scale = this.plotHeight / (y.max - y.min); | |
| y2.scale = this.plotHeight / (y2.max - y2.min); | |
| }, | |
| /** | |
| * Draws grid, labels and series. | |
| */ | |
| draw: function() { | |
| this.drawGrid(); | |
| this.drawLabels(); | |
| this.drawTitles(); | |
| if(this.series.length){ | |
| this.el.fire('flotr:beforedraw', [this.series, this]); | |
| for(var i = 0; i < this.series.length; i++){ | |
| if (!this.series[i].hide) | |
| this.drawSeries(this.series[i]); | |
| } | |
| } | |
| this.el.fire('flotr:afterdraw', [this.series, this]); | |
| }, | |
| /** | |
| * Translates absolute horizontal x coordinates to relative coordinates. | |
| * @param {Integer} x - absolute integer x coordinate | |
| * @return {Integer} translated relative x coordinate | |
| */ | |
| tHoz: function(x, axis){ | |
| axis = axis || this.axes.x; | |
| return (x - axis.min) * axis.scale; | |
| }, | |
| /** | |
| * Translates absolute vertical x coordinates to relative coordinates. | |
| * @param {Integer} y - absolute integer y coordinate | |
| * @return {Integer} translated relative y coordinate | |
| */ | |
| tVert: function(y, axis){ | |
| axis = axis || this.axes.y; | |
| return this.plotHeight - (y - axis.min) * axis.scale; | |
| }, | |
| /** | |
| * Draws a grid for the graph. | |
| */ | |
| drawGrid: function(){ | |
| if (this.options.radarChartMode) { // If we are in radar chart mode call drawRadarGrid instead and exit | |
| this.drawRadarGrid(); | |
| return; | |
| } | |
| var v, o = this.options, | |
| ctx = this.ctx; | |
| if(o.grid.verticalLines || o.grid.horizontalLines){ | |
| this.el.fire('flotr:beforegrid', [this.axes.x, this.axes.y, o, this]); | |
| } | |
| ctx.save(); | |
| ctx.translate(this.plotOffset.left, this.plotOffset.top); | |
| // Draw grid background, if present in options. | |
| if(o.grid.backgroundColor != null){ | |
| ctx.fillStyle = o.grid.backgroundColor; | |
| ctx.fillRect(0, 0, this.plotWidth, this.plotHeight); | |
| } | |
| // Draw grid lines in vertical direction. | |
| ctx.lineWidth = 1; | |
| ctx.strokeStyle = o.grid.tickColor; | |
| ctx.beginPath(); | |
| if(o.grid.verticalLines){ | |
| for(var i = 0; i < this.axes.x.ticks.length; ++i){ | |
| v = this.axes.x.ticks[i].v; | |
| // Don't show lines on upper and lower bounds. | |
| if ((v == this.axes.x.min || v == this.axes.x.max) && o.grid.outlineWidth != 0) | |
| continue; | |
| ctx.moveTo(Math.floor(this.tHoz(v)) + ctx.lineWidth/2, 0); | |
| ctx.lineTo(Math.floor(this.tHoz(v)) + ctx.lineWidth/2, this.plotHeight); | |
| } | |
| } | |
| // Draw grid lines in horizontal direction. | |
| if(o.grid.horizontalLines){ | |
| for(var j = 0; j < this.axes.y.ticks.length; ++j){ | |
| v = this.axes.y.ticks[j].v; | |
| // Don't show lines on upper and lower bounds. | |
| if ((v == this.axes.y.min || v == this.axes.y.max) && o.grid.outlineWidth != 0) | |
| continue; | |
| ctx.moveTo(0, Math.floor(this.tVert(v)) + ctx.lineWidth/2); | |
| ctx.lineTo(this.plotWidth, Math.floor(this.tVert(v)) + ctx.lineWidth/2); | |
| } | |
| } | |
| ctx.stroke(); | |
| // Draw axis/grid border. | |
| if(o.grid.outlineWidth != 0) { | |
| ctx.lineWidth = o.grid.outlineWidth; | |
| ctx.strokeStyle = o.grid.color; | |
| ctx.lineJoin = 'round'; | |
| ctx.strokeRect(0, 0, this.plotWidth, this.plotHeight); | |
| } | |
| ctx.restore(); | |
| if(o.grid.verticalLines || o.grid.horizontalLines){ | |
| this.el.fire('flotr:aftergrid', [this.axes.x, this.axes.y, o, this]); | |
| } | |
| }, | |
| /** | |
| * Draws a grid for the graph. | |
| */ | |
| drawRadarGrid: function(){ | |
| var v, o = this.options, | |
| ctx = this.ctx; | |
| var sides = this.options.radarChartSides, | |
| degreesInRadiansForAngle = Math.PI * 2 / sides, | |
| nintyDegrees = Math.PI / 2; | |
| if(o.grid.verticalLines || o.grid.horizontalLines){ | |
| this.el.fire('flotr:beforegrid', [this.axes.x, this.axes.y, o, this]); | |
| } | |
| ctx.save(); | |
| ctx.translate(this.plotOffset.left, this.plotOffset.top); | |
| ctx.lineJoin = 'round'; | |
| // Draw grid background, if present in options. | |
| if(o.grid.backgroundColor != null){ | |
| ctx.fillStyle = o.grid.backgroundColor; | |
| ctx.fillRect(0, 0, this.plotWidth, this.plotHeight); | |
| } | |
| // Draw grid lines | |
| var regPoly = {}; | |
| regPoly.xaxis = {}; | |
| regPoly.yaxis = {}; | |
| regPoly.xaxis.min = regPoly.yaxis.min = this.axes.x.min; | |
| regPoly.xaxis.max = regPoly.yaxis.max = this.axes.x.max; | |
| regPoly.xaxis.scale = this.plotWidth / (this.axes.x.max - this.axes.x.min); | |
| regPoly.yaxis.scale = this.plotHeight / (this.axes.x.max - this.axes.x.min); | |
| ctx.lineWidth = 1; | |
| ctx.strokeStyle = o.grid.tickColor; | |
| if(o.grid.horizontalLines){ | |
| for(var j = 0; j < this.axes.y.ticks.length; ++j){ | |
| v = this.axes.y.ticks[j].v; | |
| if (v < 0) continue; | |
| // Don't show lines on upper and lower bounds. | |
| if ((v == this.axes.y.min || v == this.axes.y.max) && o.grid.outlineWidth != 0) | |
| continue; | |
| regPoly.data = new Array(); | |
| for (i = 0; i < sides; i++) { | |
| angle = nintyDegrees + (degreesInRadiansForAngle * i); | |
| regPoly.data[i] = [v * Math.cos(angle), v * Math.sin(angle)] | |
| } | |
| regPoly.data[sides] = regPoly.data[0]; | |
| this.plotLine(regPoly,0); | |
| } | |
| } | |
| // Draw axis/grid border. | |
| if(o.grid.outlineWidth != 0) { | |
| ctx.lineWidth = o.grid.outlineWidth; | |
| ctx.strokeStyle = o.grid.color; | |
| regPoly.data = new Array(); | |
| var radius = this.axes.x.max; | |
| for (i = 0; i < sides; i++) { | |
| angle = nintyDegrees + (degreesInRadiansForAngle * i); | |
| regPoly.data[i] = [radius * Math.cos(angle), radius * Math.sin(angle)] | |
| } | |
| regPoly.data[sides] = regPoly.data[0]; | |
| this.plotLine(regPoly,0); | |
| } | |
| ctx.lineWidth = 1; | |
| ctx.strokeStyle = o.grid.tickColor; | |
| ctx.beginPath(); | |
| if(o.grid.verticalLines){ | |
| for(var i = 0; i < sides; ++i){ | |
| ctx.moveTo(Math.floor(this.tHoz(0)) + ctx.lineWidth/2, | |
| Math.floor(this.tVert(0)) + ctx.lineWidth/2); | |
| ctx.lineTo(Math.floor(this.tHoz(regPoly.data[i][0])) + ctx.lineWidth/2, | |
| Math.floor(this.tVert(regPoly.data[i][1])) + ctx.lineWidth/2); | |
| } | |
| } | |
| ctx.stroke(); | |
| ctx.restore(); | |
| if(o.grid.verticalLines || o.grid.horizontalLines){ | |
| this.el.fire('flotr:aftergrid', [this.axes.x, this.axes.y, o, this]); | |
| } | |
| }, | |
| /** | |
| * Draws labels aroung radar chart | |
| */ | |
| drawRadarLabels:function(){ | |
| var ctx = this.ctx, | |
| options = this.options, | |
| axis = this.axes.x, | |
| tick, minY = 0, maxY = 0, | |
| xOffset, yOffset; | |
| var style = { | |
| size: options.fontSize, | |
| adjustAlign: true | |
| }; | |
| style.color = axis.options.color || options.grid.color; | |
| style.angle = Flotr.toRad(axis.options.labelsAngle); | |
| var radius = axis.max * 1, | |
| closeTo = axis.max * 0.1, | |
| sides = this.options.radarChartSides, | |
| degreesInRadiansForAngle = Math.PI * 2 / sides, | |
| nintyDegrees = Math.PI / 2, | |
| posdata = new Array(); | |
| for (i = 0; i < sides; i++) { | |
| angle = nintyDegrees + (degreesInRadiansForAngle * i); | |
| posdata[i] = [radius * Math.cos(angle), radius * Math.sin(angle)]; | |
| if (minY > posdata[i][1]) minY = posdata[i][1]; | |
| if (maxY < posdata[i][1]) maxY = posdata[i][1]; | |
| } | |
| for (i = 0; i < sides; i++) { | |
| tick = axis.ticks[i]; | |
| if(!tick.label || tick.label.length == 0) continue; | |
| yOffset = 0; | |
| if (posdata[i][0] > 0) { | |
| style.halign = 'l'; | |
| xOffset = options.grid.labelMargin; | |
| } else { | |
| style.halign = 'r'; | |
| xOffset = - options.grid.labelMargin; | |
| } | |
| style.valign = 'm'; | |
| if ((posdata[i][1] + closeTo) >= minY && (posdata[i][1] - closeTo) <= minY) { | |
| style.valign = 't' ; | |
| style.halign = 'c'; | |
| yOffset = options.grid.labelMargin; | |
| }; | |
| if (posdata[i][1] == maxY) { | |
| style.valign = 'b' ; | |
| style.halign = 'c'; | |
| yOffset = - options.grid.labelMargin; | |
| } | |
| ctx.drawText( | |
| tick.label, | |
| this.plotOffset.left + this.tHoz(posdata[i][0]) + xOffset, | |
| this.plotOffset.top + this.tVert(posdata[i][1]) + yOffset, | |
| style | |
| ); | |
| } | |
| }, | |
| /** | |
| * Draws labels for x and y axis. | |
| */ | |
| drawLabels: function(){ | |
| // Construct fixed width label boxes, which can be styled easily. | |
| var noLabels = 0, axis, | |
| xBoxWidth, i, html, tick, | |
| options = this.options, | |
| ctx = this.ctx, | |
| a = this.axes; | |
| for(i = 0; i < a.x.ticks.length; ++i){ | |
| if (a.x.ticks[i].label) { | |
| ++noLabels; | |
| } | |
| } | |
| xBoxWidth = this.plotWidth / noLabels; | |
| if (!options.HtmlText && this.textEnabled) { | |
| var style = { | |
| size: options.fontSize, | |
| adjustAlign: true | |
| }; | |
| // Add x labels. | |
| if (options.radarChartMode) { | |
| this.drawRadarLabels();} else { | |
| axis = a.x; | |
| style.color = axis.options.color || options.grid.color; | |
| for(i = 0; i < axis.ticks.length && axis.options.showLabels && axis.used; ++i){ | |
| tick = axis.ticks[i]; | |
| if(!tick.label || tick.label.length == 0) continue; | |
| style.angle = Flotr.toRad(axis.options.labelsAngle); | |
| style.halign = 'c'; | |
| style.valign = 't'; | |
| ctx.drawText( | |
| tick.label, | |
| this.plotOffset.left + this.tHoz(tick.v, axis), | |
| this.plotOffset.top + this.plotHeight + options.grid.labelMargin, | |
| style | |
| ); | |
| }} | |
| // Add x2 labels. | |
| axis = a.x2; | |
| style.color = axis.options.color || options.grid.color; | |
| for(i = 0; i < axis.ticks.length && axis.options.showLabels && axis.used; ++i){ | |
| tick = axis.ticks[i]; | |
| if(!tick.label || tick.label.length == 0) continue; | |
| style.angle = Flotr.toRad(axis.options.labelsAngle); | |
| style.halign = 'c'; | |
| style.valign = 'b'; | |
| ctx.drawText( | |
| tick.label, | |
| this.plotOffset.left + this.tHoz(tick.v, axis), | |
| this.plotOffset.top + options.grid.labelMargin, | |
| style | |
| ); | |
| } | |
| // Add y labels. | |
| axis = a.y; | |
| style.color = axis.options.color || options.grid.color; | |
| for(i = 0; i < axis.ticks.length && axis.options.showLabels && axis.used; ++i){ | |
| tick = axis.ticks[i]; | |
| if (!tick.label || tick.label.length == 0 || (tick.v < 0 && this.options.radarChartMode)) continue; | |
| style.angle = Flotr.toRad(axis.options.labelsAngle); | |
| style.halign = 'r'; | |
| style.valign = 'm'; | |
| ctx.drawText( | |
| tick.label, | |
| this.plotOffset.left + (this.options.radarChartMode ? this.tHoz(0) : 0) - options.grid.labelMargin, | |
| this.plotOffset.top + this.tVert(tick.v, axis), | |
| style | |
| ); | |
| } | |
| // Add y2 labels. | |
| axis = a.y2; | |
| style.color = axis.options.color || options.grid.color; | |
| for(i = 0; i < axis.ticks.length && axis.options.showLabels && axis.used; ++i){ | |
| tick = axis.ticks[i]; | |
| if (!tick.label || tick.label.length == 0) continue; | |
| style.angle = Flotr.toRad(axis.options.labelsAngle); | |
| style.halign = 'l'; | |
| style.valign = 'm'; | |
| ctx.drawText( | |
| tick.label, | |
| this.plotOffset.left + this.plotWidth + options.grid.labelMargin, | |
| this.plotOffset.top + this.tVert(tick.v, axis), | |
| style | |
| ); | |
| ctx.save(); | |
| ctx.strokeStyle = style.color; | |
| ctx.beginPath(); | |
| ctx.moveTo(this.plotOffset.left + this.plotWidth - 8, this.plotOffset.top + this.tVert(tick.v, axis)); | |
| ctx.lineTo(this.plotOffset.left + this.plotWidth, this.plotOffset.top + this.tVert(tick.v, axis)); | |
| ctx.stroke(); | |
| ctx.restore(); | |
| } | |
| } | |
| else if (a.x.options.showLabels || | |
| a.x2.options.showLabels || | |
| a.y.options.showLabels || | |
| a.y2.options.showLabels) { | |
| html = ['<div style="font-size:smaller;color:' + options.grid.color + ';" class="flotr-labels">']; | |
| // Add x labels. | |
| axis = a.x; | |
| if (axis.options.showLabels){ | |
| for(i = 0; i < axis.ticks.length; ++i){ | |
| tick = axis.ticks[i]; | |
| if(!tick.label || tick.label.length == 0) continue; | |
| html.push('<div style="position:absolute;top:' + (this.plotOffset.top + this.plotHeight + options.grid.labelMargin) + 'px;left:' + (this.plotOffset.left + this.tHoz(tick.v, axis) - xBoxWidth/2) + 'px;width:' + xBoxWidth + 'px;text-align:center;'+(axis.options.color?('color:'+axis.options.color+';'):'')+'" class="flotr-grid-label">' + tick.label + '</div>'); | |
| } | |
| } | |
| // Add x2 labels. | |
| axis = a.x2; | |
| if (axis.options.showLabels && axis.used){ | |
| for(i = 0; i < axis.ticks.length; ++i){ | |
| tick = axis.ticks[i]; | |
| if(!tick.label || tick.label.length == 0) continue; | |
| html.push('<div style="position:absolute;top:' + (this.plotOffset.top - options.grid.labelMargin - axis.maxLabel.height) + 'px;left:' + (this.plotOffset.left + this.tHoz(tick.v, axis) - xBoxWidth/2) + 'px;width:' + xBoxWidth + 'px;text-align:center;'+(axis.options.color?('color:'+axis.options.color+';'):'')+'" class="flotr-grid-label">' + tick.label + '</div>'); | |
| } | |
| } | |
| // Add y labels. | |
| axis = a.y; | |
| if (axis.options.showLabels){ | |
| for(i = 0; i < axis.ticks.length; ++i){ | |
| tick = axis.ticks[i]; | |
| if (!tick.label || tick.label.length == 0) continue; | |
| html.push('<div style="position:absolute;top:' + (this.plotOffset.top + this.tVert(tick.v, axis) - axis.maxLabel.height/2) + 'px;left:0;width:' + (this.plotOffset.left - options.grid.labelMargin) + 'px;text-align:right;'+(axis.options.color?('color:'+axis.options.color+';'):'')+'" class="flotr-grid-label">' + tick.label + '</div>'); | |
| } | |
| } | |
| // Add y2 labels. | |
| axis = a.y2; | |
| if (axis.options.showLabels && axis.used){ | |
| ctx.save(); | |
| ctx.strokeStyle = axis.options.color || options.grid.color; | |
| ctx.beginPath(); | |
| for(i = 0; i < axis.ticks.length; ++i){ | |
| tick = axis.ticks[i]; | |
| if (!tick.label || tick.label.length == 0) continue; | |
| html.push('<div style="position:absolute;top:' + (this.plotOffset.top + this.tVert(tick.v, axis) - axis.maxLabel.height/2) + 'px;right:0;width:' + (this.plotOffset.right - options.grid.labelMargin) + 'px;text-align:left;'+(axis.options.color?('color:'+axis.options.color+';'):'')+'" class="flotr-grid-label">' + tick.label + '</div>'); | |
| ctx.moveTo(this.plotOffset.left + this.plotWidth - 8, this.plotOffset.top + this.tVert(tick.v, axis)); | |
| ctx.lineTo(this.plotOffset.left + this.plotWidth, this.plotOffset.top + this.tVert(tick.v, axis)); | |
| } | |
| ctx.stroke(); | |
| ctx.restore(); | |
| } | |
| html.push('</div>'); | |
| this.el.insert(html.join('')); | |
| } | |
| }, | |
| /** | |
| * Draws the title and the subtitle | |
| */ | |
| drawTitles: function(){ | |
| var html, | |
| options = this.options, | |
| margin = options.grid.labelMargin, | |
| ctx = this.ctx, | |
| a = this.axes; | |
| if (!options.HtmlText && this.textEnabled) { | |
| var style = { | |
| size: options.fontSize, | |
| color: options.grid.color, | |
| halign: 'c' | |
| }; | |
| // Add subtitle | |
| if (options.subtitle){ | |
| ctx.drawText( | |
| options.subtitle, | |
| this.plotOffset.left + this.plotWidth/2, | |
| this.titleHeight + this.subtitleHeight - 2, | |
| style | |
| ); | |
| } | |
| style.weight = 1.5; | |
| style.size *= 1.5; | |
| // Add title | |
| if (options.title){ | |
| ctx.drawText( | |
| options.title, | |
| this.plotOffset.left + this.plotWidth/2, | |
| this.titleHeight - 2, | |
| style | |
| ); | |
| } | |
| style.weight = 1.8; | |
| style.size *= 0.8; | |
| style.adjustAlign = true; | |
| // Add x axis title | |
| if (a.x.options.title && a.x.used){ | |
| style.halign = 'c'; | |
| style.valign = 't'; | |
| style.angle = Flotr.toRad(a.x.options.titleAngle); | |
| ctx.drawText( | |
| a.x.options.title, | |
| this.plotOffset.left + this.plotWidth/2, | |
| this.plotOffset.top + a.x.maxLabel.height + this.plotHeight + 2 * margin, | |
| style | |
| ); | |
| } | |
| // Add x2 axis title | |
| if (a.x2.options.title && a.x2.used){ | |
| style.halign = 'c'; | |
| style.valign = 'b'; | |
| style.angle = Flotr.toRad(a.x2.options.titleAngle); | |
| ctx.drawText( | |
| a.x2.options.title, | |
| this.plotOffset.left + this.plotWidth/2, | |
| this.plotOffset.top - a.x2.maxLabel.height - 2 * margin, | |
| style | |
| ); | |
| } | |
| // Add y axis title | |
| if (a.y.options.title && a.y.used){ | |
| style.halign = 'r'; | |
| style.valign = 'm'; | |
| style.angle = Flotr.toRad(a.y.options.titleAngle); | |
| ctx.drawText( | |
| a.y.options.title, | |
| this.plotOffset.left - a.y.maxLabel.width - 2 * margin, | |
| this.plotOffset.top + this.plotHeight / 2, | |
| style | |
| ); | |
| } | |
| // Add y2 axis title | |
| if (a.y2.options.title && a.y2.used){ | |
| style.halign = 'l'; | |
| style.valign = 'm'; | |
| style.angle = Flotr.toRad(a.y2.options.titleAngle); | |
| ctx.drawText( | |
| a.y2.options.title, | |
| this.plotOffset.left + this.plotWidth + a.y2.maxLabel.width + 2 * margin, | |
| this.plotOffset.top + this.plotHeight / 2, | |
| style | |
| ); | |
| } | |
| } | |
| else { | |
| html = ['<div style="color:'+options.grid.color+';" class="flotr-titles">']; | |
| // Add title | |
| if (options.title){ | |
| html.push('<div style="position:absolute;top:0;left:'+this.plotOffset.left+'px;font-size:1em;font-weight:bold;text-align:center;width:'+this.plotWidth+'px;" class="flotr-title">'+options.title+'</div>'); | |
| } | |
| // Add subtitle | |
| if (options.subtitle){ | |
| html.push('<div style="position:absolute;top:'+this.titleHeight+'px;left:'+this.plotOffset.left+'px;font-size:smaller;text-align:center;width:'+this.plotWidth+'px;" class="flotr-subtitle">'+options.subtitle+'</div>'); | |
| } | |
| html.push('</div>'); | |
| html.push('<div class="flotr-axis-title" style="font-weight:bold;">'); | |
| // Add x axis title | |
| if (a.x.options.title && a.x.used){ | |
| html.push('<div style="position:absolute;top:' + (this.plotOffset.top + this.plotHeight + options.grid.labelMargin + a.x.titleSize.height) + 'px;left:' + this.plotOffset.left + 'px;width:' + this.plotWidth + 'px;text-align:center;" class="flotr-axis-title">' + a.x.options.title + '</div>'); | |
| } | |
| // Add x2 axis title | |
| if (a.x2.options.title && a.x2.used){ | |
| html.push('<div style="position:absolute;top:0;left:' + this.plotOffset.left + 'px;width:' + this.plotWidth + 'px;text-align:center;" class="flotr-axis-title">' + a.x2.options.title + '</div>'); | |
| } | |
| // Add y axis title | |
| if (a.y.options.title && a.y.used){ | |
| html.push('<div style="position:absolute;top:' + (this.plotOffset.top + this.plotHeight/2 - a.y.titleSize.height/2) + 'px;left:0;text-align:right;" class="flotr-axis-title">' + a.y.options.title + '</div>'); | |
| } | |
| // Add y2 axis title | |
| if (a.y2.options.title && a.y2.used){ | |
| html.push('<div style="position:absolute;top:' + (this.plotOffset.top + this.plotHeight/2 - a.y.titleSize.height/2) + 'px;right:0;text-align:right;" class="flotr-axis-title">' + a.y2.options.title + '</div>'); | |
| } | |
| html.push('</div>'); | |
| this.el.insert(html.join('')); | |
| } | |
| }, | |
| /** | |
| * Actually draws the graph. | |
| * @param {Object} series - series to draw | |
| */ | |
| drawSeries: function(series){ | |
| series = series || this.series; | |
| var drawn = false; | |
| for(var type in Flotr._registeredTypes){ | |
| if(series[type] && series[type].show){ | |
| this[Flotr._registeredTypes[type]](series); | |
| drawn = true; | |
| } | |
| } | |
| if(!drawn){ | |
| this[Flotr._registeredTypes[this.options.defaultType]](series); | |
| } | |
| }, | |
| plotLine: function(series, offset){ | |
| var ctx = this.ctx, | |
| xa = series.xaxis, | |
| ya = series.yaxis, | |
| tHoz = this.tHoz.bind(this), | |
| tVert = this.tVert.bind(this), | |
| data = series.data; | |
| if(data.length < 2) return; | |
| var prevx = tHoz(data[0][0], xa), | |
| prevy = tVert(data[0][1], ya) + offset; | |
| ctx.beginPath(); | |
| ctx.moveTo(prevx, prevy); | |
| for(var i = 0; i < data.length - 1; ++i){ | |
| var x1 = data[i][0], y1 = data[i][1], | |
| x2 = data[i+1][0], y2 = data[i+1][1]; | |
| // To allow empty values | |
| if (y1 === null || y2 === null) continue; | |
| /** | |
| * Clip with ymin. | |
| */ | |
| if(y1 <= y2 && y1 < ya.min){ | |
| /** | |
| * Line segment is outside the drawing area. | |
| */ | |
| if(y2 < ya.min) continue; | |
| /** | |
| * Compute new intersection point. | |
| */ | |
| x1 = (ya.min - y1) / (y2 - y1) * (x2 - x1) + x1; | |
| y1 = ya.min; | |
| }else if(y2 <= y1 && y2 < ya.min){ | |
| if(y1 < ya.min) continue; | |
| x2 = (ya.min - y1) / (y2 - y1) * (x2 - x1) + x1; | |
| y2 = ya.min; | |
| } | |
| /** | |
| * Clip with ymax. | |
| */ | |
| if(y1 >= y2 && y1 > ya.max) { | |
| if(y2 > ya.max) continue; | |
| x1 = (ya.max - y1) / (y2 - y1) * (x2 - x1) + x1; | |
| y1 = ya.max; | |
| } | |
| else if(y2 >= y1 && y2 > ya.max){ | |
| if(y1 > ya.max) continue; | |
| x2 = (ya.max - y1) / (y2 - y1) * (x2 - x1) + x1; | |
| y2 = ya.max; | |
| } | |
| /** | |
| * Clip with xmin. | |
| */ | |
| if(x1 <= x2 && x1 < xa.min){ | |
| if(x2 < xa.min) continue; | |
| y1 = (xa.min - x1) / (x2 - x1) * (y2 - y1) + y1; | |
| x1 = xa.min; | |
| }else if(x2 <= x1 && x2 < xa.min){ | |
| if(x1 < xa.min) continue; | |
| y2 = (xa.min - x1) / (x2 - x1) * (y2 - y1) + y1; | |
| x2 = xa.min; | |
| } | |
| /** | |
| * Clip with xmax. | |
| */ | |
| if(x1 >= x2 && x1 > xa.max){ | |
| if (x2 > xa.max) continue; | |
| y1 = (xa.max - x1) / (x2 - x1) * (y2 - y1) + y1; | |
| x1 = xa.max; | |
| }else if(x2 >= x1 && x2 > xa.max){ | |
| if(x1 > xa.max) continue; | |
| y2 = (xa.max - x1) / (x2 - x1) * (y2 - y1) + y1; | |
| x2 = xa.max; | |
| } | |
| if(prevx != tHoz(x1, xa) || prevy != tVert(y1, ya) + offset) | |
| ctx.moveTo(tHoz(x1, xa), tVert(y1, ya) + offset); | |
| prevx = tHoz(x2, xa); | |
| prevy = tVert(y2, ya) + offset; | |
| ctx.lineTo(prevx, prevy); | |
| } | |
| ctx.stroke(); | |
| }, | |
| /** | |
| * Function used to fill | |
| * @param {Object} data | |
| */ | |
| plotLineArea: function(series, offset){ | |
| var data = series.data; | |
| if(data.length < 2) return; | |
| var top, lastX = 0, | |
| ctx = this.ctx, | |
| xa = series.xaxis, | |
| ya = series.yaxis, | |
| tHoz = this.tHoz.bind(this), | |
| tVert = this.tVert.bind(this), | |
| bottom = Math.min(Math.max(0, ya.min), ya.max), | |
| first = true; | |
| ctx.beginPath(); | |
| for(var i = 0; i < data.length - 1; ++i){ | |
| var x1 = data[i][0], y1 = data[i][1], | |
| x2 = data[i+1][0], y2 = data[i+1][1]; | |
| if(x1 <= x2 && x1 < xa.min){ | |
| if(x2 < xa.min) continue; | |
| y1 = (xa.min - x1) / (x2 - x1) * (y2 - y1) + y1; | |
| x1 = xa.min; | |
| }else if(x2 <= x1 && x2 < xa.min){ | |
| if(x1 < xa.min) continue; | |
| y2 = (xa.min - x1) / (x2 - x1) * (y2 - y1) + y1; | |
| x2 = xa.min; | |
| } | |
| if(x1 >= x2 && x1 > xa.max){ | |
| if(x2 > xa.max) continue; | |
| y1 = (xa.max - x1) / (x2 - x1) * (y2 - y1) + y1; | |
| x1 = xa.max; | |
| }else if(x2 >= x1 && x2 > xa.max){ | |
| if (x1 > xa.max) continue; | |
| y2 = (xa.max - x1) / (x2 - x1) * (y2 - y1) + y1; | |
| x2 = xa.max; | |
| } | |
| if(first){ | |
| ctx.moveTo(tHoz(x1, xa), tVert(bottom, ya) + offset); | |
| first = false; | |
| } | |
| /** | |
| * Now check the case where both is outside. | |
| */ | |
| if(y1 >= ya.max && y2 >= ya.max){ | |
| ctx.lineTo(tHoz(x1, xa), tVert(ya.max, ya) + offset); | |
| ctx.lineTo(tHoz(x2, xa), tVert(ya.max, ya) + offset); | |
| continue; | |
| }else if(y1 <= ya.min && y2 <= ya.min){ | |
| ctx.lineTo(tHoz(x1, xa), tVert(ya.min, ya) + offset); | |
| ctx.lineTo(tHoz(x2, xa), tVert(ya.min, ya) + offset); | |
| continue; | |
| } | |
| /** | |
| * Else it's a bit more complicated, there might | |
| * be two rectangles and two triangles we need to fill | |
| * in; to find these keep track of the current x values. | |
| */ | |
| var x1old = x1, x2old = x2; | |
| /** | |
| * And clip the y values, without shortcutting. | |
| * Clip with ymin. | |
| */ | |
| if(y1 <= y2 && y1 < ya.min && y2 >= ya.min){ | |
| x1 = (ya.min - y1) / (y2 - y1) * (x2 - x1) + x1; | |
| y1 = ya.min; | |
| }else if(y2 <= y1 && y2 < ya.min && y1 >= ya.min){ | |
| x2 = (ya.min - y1) / (y2 - y1) * (x2 - x1) + x1; | |
| y2 = ya.min; | |
| } | |
| /** | |
| * Clip with ymax. | |
| */ | |
| if(y1 >= y2 && y1 > ya.max && y2 <= ya.max){ | |
| x1 = (ya.max - y1) / (y2 - y1) * (x2 - x1) + x1; | |
| y1 = ya.max; | |
| }else if(y2 >= y1 && y2 > ya.max && y1 <= ya.max){ | |
| x2 = (ya.max - y1) / (y2 - y1) * (x2 - x1) + x1; | |
| y2 = ya.max; | |
| } | |
| /** | |
| * If the x value was changed we got a rectangle to fill. | |
| */ | |
| if(x1 != x1old){ | |
| top = (y1 <= ya.min) ? top = ya.min : ya.max; | |
| ctx.lineTo(tHoz(x1old, xa), tVert(top, ya) + offset); | |
| ctx.lineTo(tHoz(x1, xa), tVert(top, ya) + offset); | |
| } | |
| /** | |
| * Fill the triangles. | |
| */ | |
| ctx.lineTo(tHoz(x1, xa), tVert(y1, ya) + offset); | |
| ctx.lineTo(tHoz(x2, xa), tVert(y2, ya) + offset); | |
| /** | |
| * Fill the other rectangle if it's there. | |
| */ | |
| if(x2 != x2old){ | |
| top = (y2 <= ya.min) ? ya.min : ya.max; | |
| ctx.lineTo(tHoz(x2old, xa), tVert(top, ya) + offset); | |
| ctx.lineTo(tHoz(x2, xa), tVert(top, ya) + offset); | |
| } | |
| lastX = Math.max(x2, x2old); | |
| } | |
| ctx.lineTo(tHoz(lastX, xa), tVert(bottom, ya) + offset); | |
| ctx.closePath(); | |
| ctx.fill(); | |
| }, | |
| /** | |
| * Function: (private) drawSeriesLines | |
| * | |
| * Function draws lines series in the canvas element. | |
| * | |
| * Parameters: | |
| * series - Series with options.lines.show = true. | |
| * | |
| * Returns: | |
| * void | |
| */ | |
| drawSeriesLines: function(series){ | |
| series = series || this.series; | |
| var ctx = this.ctx; | |
| ctx.save(); | |
| ctx.translate(this.plotOffset.left, this.plotOffset.top); | |
| ctx.lineJoin = 'round'; | |
| var lw = series.lines.lineWidth; | |
| var sw = series.shadowSize; | |
| if(sw > 0){ | |
| ctx.lineWidth = sw / 2; | |
| var offset = lw/2 + ctx.lineWidth/2; | |
| ctx.strokeStyle = "rgba(0,0,0,0.1)"; | |
| this.plotLine(series, offset + sw/2); | |
| ctx.strokeStyle = "rgba(0,0,0,0.2)"; | |
| this.plotLine(series, offset); | |
| if(series.lines.fill) { | |
| ctx.fillStyle = "rgba(0,0,0,0.05)"; | |
| this.plotLineArea(series, offset + sw/2); | |
| } | |
| } | |
| ctx.lineWidth = lw; | |
| ctx.strokeStyle = series.color; | |
| if(series.lines.fill){ | |
| ctx.fillStyle = series.lines.fillColor != null ? series.lines.fillColor : Flotr.parseColor(series.color).scale(null, null, null, series.lines.fillOpacity).toString(); | |
| this.plotLineArea(series, 0); | |
| } | |
| this.plotLine(series, 0); | |
| ctx.restore(); | |
| }, | |
| /** | |
| * Function: drawSeriesPoints | |
| * | |
| * Function draws point series in the canvas element. | |
| * | |
| * Parameters: | |
| * series - Series with options.points.show = true. | |
| * | |
| * Returns: | |
| * void | |
| */ | |
| drawSeriesPoints: function(series) { | |
| var ctx = this.ctx; | |
| ctx.save(); | |
| ctx.translate(this.plotOffset.left, this.plotOffset.top); | |
| var lw = series.lines.lineWidth; | |
| var sw = series.shadowSize; | |
| if(sw > 0){ | |
| ctx.lineWidth = sw / 2; | |
| ctx.strokeStyle = 'rgba(0,0,0,0.1)'; | |
| this.plotPointShadows(series, sw/2 + ctx.lineWidth/2, series.points.radius); | |
| ctx.strokeStyle = 'rgba(0,0,0,0.2)'; | |
| this.plotPointShadows(series, ctx.lineWidth/2, series.points.radius); | |
| } | |
| ctx.lineWidth = series.points.lineWidth; | |
| ctx.strokeStyle = series.color; | |
| ctx.fillStyle = series.points.fillColor != null ? series.points.fillColor : series.color; | |
| this.plotPoints(series, series.points.radius, series.points.fill); | |
| ctx.restore(); | |
| }, | |
| plotPoints: function (series, radius, fill) { | |
| var xa = series.xaxis, | |
| ya = series.yaxis, | |
| ctx = this.ctx, i, | |
| data = series.data; | |
| for(i = data.length - 1; i > -1; --i){ | |
| var x = data[i][0], y = data[i][1]; | |
| if(x < xa.min || x > xa.max || y < ya.min || y > ya.max) | |
| continue; | |
| ctx.beginPath(); | |
| ctx.arc(this.tHoz(x, xa), this.tVert(y, ya), radius, 0, 2 * Math.PI, true); | |
| if(fill) ctx.fill(); | |
| ctx.stroke(); | |
| } | |
| }, | |
| plotPointShadows: function(series, offset, radius){ | |
| var xa = series.xaxis, | |
| ya = series.yaxis, | |
| ctx = this.ctx, i, | |
| data = series.data; | |
| for(i = data.length - 1; i > -1; --i){ | |
| var x = data[i][0], y = data[i][1]; | |
| if (x < xa.min || x > xa.max || y < ya.min || y > ya.max) | |
| continue; | |
| ctx.beginPath(); | |
| ctx.arc(this.tHoz(x, xa), this.tVert(y, ya) + offset, radius, 0, Math.PI, false); | |
| ctx.stroke(); | |
| } | |
| }, | |
| /** | |
| * Function: drawSeriesBars | |
| * | |
| * Function draws bar series in the canvas element. | |
| * | |
| * Parameters: | |
| * series - Series with options.bars.show = true. | |
| * | |
| * Returns: | |
| * void | |
| */ | |
| drawSeriesBars: function(series) { | |
| var ctx = this.ctx, | |
| bw = series.bars.barWidth, | |
| lw = Math.min(series.bars.lineWidth, bw); | |
| ctx.save(); | |
| ctx.translate(this.plotOffset.left, this.plotOffset.top); | |
| ctx.lineJoin = 'miter'; | |
| /** | |
| * @todo linewidth not interpreted the right way. | |
| */ | |
| ctx.lineWidth = lw; | |
| ctx.strokeStyle = series.color; | |
| this.plotBarsShadows(series, bw, 0, series.bars.fill); | |
| if(series.bars.fill){ | |
| ctx.fillStyle = series.bars.fillColor != null ? series.bars.fillColor : Flotr.parseColor(series.color).scale(null, null, null, series.bars.fillOpacity).toString(); | |
| } | |
| this.plotBars(series, bw, 0, series.bars.fill); | |
| ctx.restore(); | |
| }, | |
| plotBars: function(series, barWidth, offset, fill){ | |
| var data = series.data; | |
| if(data.length < 1) return; | |
| var xa = series.xaxis, | |
| ya = series.yaxis, | |
| ctx = this.ctx, | |
| tHoz = this.tHoz.bind(this), | |
| tVert = this.tVert.bind(this); | |
| for(var i = 0; i < data.length; i++){ | |
| var x = data[i][0], | |
| y = data[i][1]; | |
| var drawLeft = true, drawTop = true, drawRight = true; | |
| // Stacked bars | |
| var stackOffset = 0; | |
| if(series.bars.stacked) { | |
| xa.values.each(function(o, v) { | |
| if (v == x) { | |
| stackOffset = o.stack || 0; | |
| o.stack = stackOffset + y; | |
| } | |
| }); | |
| } | |
| // @todo: fix horizontal bars support | |
| // Horizontal bars | |
| if(series.bars.horizontal) | |
| var left = stackOffset, right = x + stackOffset, bottom = y, top = y + barWidth; | |
| else | |
| var left = x, right = x + barWidth, bottom = stackOffset, top = y + stackOffset; | |
| if(right < xa.min || left > xa.max || top < ya.min || bottom > ya.max) | |
| continue; | |
| if(left < xa.min){ | |
| left = xa.min; | |
| drawLeft = false; | |
| } | |
| if(right > xa.max){ | |
| right = xa.max; | |
| if (xa.lastSerie != series && series.bars.horizontal) | |
| drawTop = false; | |
| } | |
| if(bottom < ya.min) | |
| bottom = ya.min; | |
| if(top > ya.max){ | |
| top = ya.max; | |
| if (ya.lastSerie != series && !series.bars.horizontal) | |
| drawTop = false; | |
| } | |
| /** | |
| * Fill the bar. | |
| */ | |
| if(fill){ | |
| ctx.beginPath(); | |
| ctx.moveTo(tHoz(left, xa), tVert(bottom, ya) + offset); | |
| ctx.lineTo(tHoz(left, xa), tVert(top, ya) + offset); | |
| ctx.lineTo(tHoz(right, xa), tVert(top, ya) + offset); | |
| ctx.lineTo(tHoz(right, xa), tVert(bottom, ya) + offset); | |
| ctx.fill(); | |
| } | |
| /** | |
| * Draw bar outline/border. | |
| */ | |
| if(series.bars.lineWidth != 0 && (drawLeft || drawRight || drawTop)){ | |
| ctx.beginPath(); | |
| ctx.moveTo(tHoz(left, xa), tVert(bottom, ya) + offset); | |
| ctx[drawLeft ?'lineTo':'moveTo'](tHoz(left, xa), tVert(top, ya) + offset); | |
| ctx[drawTop ?'lineTo':'moveTo'](tHoz(right, xa), tVert(top, ya) + offset); | |
| ctx[drawRight?'lineTo':'moveTo'](tHoz(right, xa), tVert(bottom, ya) + offset); | |
| ctx.stroke(); | |
| } | |
| } | |
| }, | |
| plotBarsShadows: function(series, barWidth, offset){ | |
| var data = series.data; | |
| if(data.length < 1) return; | |
| var xa = series.xaxis, | |
| ya = series.yaxis, | |
| ctx = this.ctx, | |
| tHoz = this.tHoz.bind(this), | |
| tVert = this.tVert.bind(this), | |
| sw = this.options.shadowSize; | |
| for(var i = 0; i < data.length; i++){ | |
| var x = data[i][0], | |
| y = data[i][1]; | |
| // Stacked bars | |
| var stackOffset = 0; | |
| if(series.bars.stacked) { | |
| xa.values.each(function(o, v) { | |
| if (v == x) { | |
| stackOffset = o.stackShadow || 0; | |
| o.stackShadow = stackOffset + y; | |
| } | |
| }); | |
| } | |
| // Horizontal bars | |
| if(series.bars.horizontal) | |
| var left = stackOffset, right = x + stackOffset, bottom = y, top = y + barWidth; | |
| else | |
| var left = x, right = x + barWidth, bottom = stackOffset, top = y + stackOffset; | |
| if(right < xa.min || left > xa.max || top < ya.min || bottom > ya.max) | |
| continue; | |
| if(left < xa.min) left = xa.min; | |
| if(right > xa.max) right = xa.max; | |
| if(bottom < ya.min) bottom = ya.min; | |
| if(top > ya.max) top = ya.max; | |
| var width = tHoz(right, xa)-tHoz(left, xa)-((tHoz(right, xa)+sw <= this.plotWidth) ? 0 : sw); | |
| var height = Math.max(0, tVert(bottom, ya)-tVert(top, ya)-((tVert(bottom, ya)+sw <= this.plotHeight) ? 0 : sw)); | |
| ctx.fillStyle = 'rgba(0,0,0,0.05)'; | |
| ctx.fillRect(Math.min(tHoz(left, xa)+sw, this.plotWidth), Math.min(tVert(top, ya)+sw, this.plotWidth), width, height); | |
| } | |
| }, | |
| /** | |
| * Function: drawSeriesCandles | |
| * | |
| * Function draws candles series in the canvas element. | |
| * | |
| * Parameters: | |
| * series - Series with options.candles.show = true. | |
| * | |
| * Returns: | |
| * void | |
| */ | |
| drawSeriesCandles: function(series) { | |
| var ctx = this.ctx, | |
| bw = series.candles.candleWidth; | |
| ctx.save(); | |
| ctx.translate(this.plotOffset.left, this.plotOffset.top); | |
| ctx.lineJoin = 'miter'; | |
| /** | |
| * @todo linewidth not interpreted the right way. | |
| */ | |
| ctx.lineWidth = series.candles.lineWidth; | |
| this.plotCandlesShadows(series, bw/2); | |
| this.plotCandles(series, bw/2); | |
| ctx.restore(); | |
| }, | |
| plotCandles: function(series, offset){ | |
| var data = series.data; | |
| if(data.length < 1) return; | |
| var xa = series.xaxis, | |
| ya = series.yaxis, | |
| ctx = this.ctx, | |
| tHoz = this.tHoz.bind(this), | |
| tVert = this.tVert.bind(this); | |
| for(var i = 0; i < data.length; i++){ | |
| var d = data[i], | |
| x = d[0], | |
| open = d[1], | |
| high = d[2], | |
| low = d[3], | |
| close = d[4]; | |
| var left = x, | |
| right = x + series.candles.candleWidth, | |
| bottom = Math.max(ya.min, low), | |
| top = Math.min(ya.max, high), | |
| bottom2 = Math.max(ya.min, Math.min(open, close)), | |
| top2 = Math.min(ya.max, Math.max(open, close)); | |
| if(right < xa.min || left > xa.max || top < ya.min || bottom > ya.max) | |
| continue; | |
| var color = series.candles[open>close?'downFillColor':'upFillColor']; | |
| /** | |
| * Fill the candle. | |
| */ | |
| if(series.candles.fill && !series.candles.barcharts){ | |
| ctx.fillStyle = Flotr.parseColor(color).scale(null, null, null, series.candles.fillOpacity).toString(); | |
| ctx.fillRect(tHoz(left, xa), tVert(top2, ya) + offset, tHoz(right, xa) - tHoz(left, xa), tVert(bottom2, ya) - tVert(top2, ya)); | |
| } | |
| /** | |
| * Draw candle outline/border, high, low. | |
| */ | |
| if(series.candles.lineWidth || series.candles.wickLineWidth){ | |
| var x, y, pixelOffset = (series.candles.wickLineWidth % 2) / 2; | |
| x = Math.floor(tHoz((left + right) / 2), xa) + pixelOffset; | |
| ctx.save(); | |
| ctx.strokeStyle = color; | |
| ctx.lineWidth = series.candles.wickLineWidth; | |
| ctx.lineCap = 'butt'; | |
| if (series.candles.barcharts) { | |
| ctx.beginPath(); | |
| ctx.moveTo(x, Math.floor(tVert(top, ya) + offset)); | |
| ctx.lineTo(x, Math.floor(tVert(bottom, ya) + offset)); | |
| y = Math.floor(tVert(open, ya) + offset)+0.5; | |
| ctx.moveTo(Math.floor(tHoz(left, xa))+pixelOffset, y); | |
| ctx.lineTo(x, y); | |
| y = Math.floor(tVert(close, ya) + offset)+0.5; | |
| ctx.moveTo(Math.floor(tHoz(right, xa))+pixelOffset, y); | |
| ctx.lineTo(x, y); | |
| } | |
| else { | |
| ctx.strokeRect(tHoz(left, xa), tVert(top2, ya) + offset, tHoz(right, xa) - tHoz(left, xa), tVert(bottom2, ya) - tVert(top2, ya)); | |
| ctx.beginPath(); | |
| ctx.moveTo(x, Math.floor(tVert(top2, ya) + offset)); | |
| ctx.lineTo(x, Math.floor(tVert(top, ya) + offset)); | |
| ctx.moveTo(x, Math.floor(tVert(bottom2, ya) + offset)); | |
| ctx.lineTo(x, Math.floor(tVert(bottom, ya) + offset)); | |
| } | |
| ctx.stroke(); | |
| ctx.restore(); | |
| } | |
| } | |
| }, | |
| plotCandlesShadows: function(series, offset){ | |
| var data = series.data; | |
| if(data.length < 1 || series.candles.barcharts) return; | |
| var xa = series.xaxis, | |
| ya = series.yaxis, | |
| tHoz = this.tHoz.bind(this), | |
| tVert = this.tVert.bind(this), | |
| sw = this.options.shadowSize; | |
| for(var i = 0; i < data.length; i++){ | |
| var d = data[i], | |
| x = d[0], | |
| open = d[1], | |
| high = d[2], | |
| low = d[3], | |
| close = d[4]; | |
| var left = x, | |
| right = x + series.candles.candleWidth, | |
| bottom = Math.max(ya.min, Math.min(open, close)), | |
| top = Math.min(ya.max, Math.max(open, close)); | |
| if(right < xa.min || left > xa.max || top < ya.min || bottom > ya.max) | |
| continue; | |
| var width = tHoz(right, xa)-tHoz(left, xa)-((tHoz(right, xa)+sw <= this.plotWidth) ? 0 : sw); | |
| var height = Math.max(0, tVert(bottom, ya)-tVert(top, ya)-((tVert(bottom, ya)+sw <= this.plotHeight) ? 0 : sw)); | |
| this.ctx.fillStyle = 'rgba(0,0,0,0.05)'; | |
| this.ctx.fillRect(Math.min(tHoz(left, xa)+sw, this.plotWidth), Math.min(tVert(top, ya)+sw, this.plotWidth), width, height); | |
| } | |
| }, | |
| /** | |
| * Function: drawSeriesRadar | |
| * | |
| * Function draws a radar chart on the canvas element. | |
| * | |
| * Parameters: | |
| * series - Series with options.radar.show = true. | |
| * | |
| * Returns: | |
| * void | |
| */ | |
| drawSeriesRadar: function(series) { | |
| var ctx = this.ctx, | |
| options = this.options, sides= series.data.length; | |
| var degreesInRadiansForAngle = Math.PI * 2 / sides, | |
| nintyDegrees = Math.PI / 2; | |
| var poly = {}; | |
| /* | |
| Draw radar grid | |
| poly.xaxis = series.xaxis; | |
| poly.yaxis = series.yaxis; | |
| ctx.save(); | |
| ctx.translate(this.plotOffset.left, this.plotOffset.top); | |
| ctx.lineJoin = 'round'; | |
| for (radius = 20; radius <= 100; radius += 20) { | |
| poly.data = new Array(); | |
| for (i = 0; i < sides; i++) { | |
| angle = nintyDegrees + (degreesInRadiansForAngle * i); | |
| poly.data[i] = [radius * Math.cos(angle), radius * Math.sin(angle)] | |
| } | |
| poly.data[sides] = poly.data[0]; | |
| this.plotLine(poly,0);} | |
| var outside = poly.data; | |
| for (i = 0; i < sides; i++) { | |
| poly.data = new Array(); | |
| poly.data[0] = [0,0]; | |
| poly.data[1] = outside[i]; | |
| this.plotLine(poly,0); | |
| } | |
| */ | |
| /* | |
| Convert Series data into X, Y co-ordinates | |
| */ | |
| if (!series.dataInRadarFormat) { | |
| poly.data = new Array(); | |
| for (i = 0; i < sides; i++) { | |
| angle = nintyDegrees + (degreesInRadiansForAngle * i); | |
| poly.data[i] = [series.data[i][1] * Math.cos(angle), series.data[i][1] * Math.sin(angle), series.data[i][0], series.data[i][1]] | |
| } | |
| poly.data[sides] = poly.data[0]; | |
| series.data = poly.data; | |
| series.lines = series.radar; | |
| series.lines.show = false; | |
| series.dataInRadarFormat = true; | |
| } | |
| this.drawSeriesLines(series); | |
| }, | |
| /** | |
| * Function: drawSeriesPie | |
| * | |
| * Function draws a pie in the canvas element. | |
| * | |
| * Parameters: | |
| * series - Series with options.pie.show = true. | |
| * | |
| * Returns: | |
| * void | |
| */ | |
| drawSeriesPie: function(series) { | |
| if (!this.options.pie.drawn) { | |
| var ctx = this.ctx, | |
| options = this.options, | |
| lw = series.pie.lineWidth, | |
| sw = series.shadowSize, | |
| data = series.data, | |
| radius = (Math.min(this.canvasWidth, this.canvasHeight) * series.pie.sizeRatio) / 2, | |
| html = []; | |
| var vScale = 1;//Math.cos(series.pie.viewAngle); | |
| var plotTickness = Math.sin(series.pie.viewAngle)*series.pie.spliceThickness / vScale; | |
| var style = { | |
| size: options.fontSize*1.2, | |
| color: options.grid.color, | |
| weight: 1.5 | |
| }; | |
| var center = { | |
| x: (this.canvasWidth+this.plotOffset.left)/2, | |
| y: (this.canvasHeight-this.plotOffset.bottom)/2 | |
| }; | |
| // Pie portions | |
| var portions = this.series.collect(function(hash, index){ | |
| if (hash.pie.show) | |
| return { | |
| name: (hash.label || hash.data[0][1]), | |
| value: [index, hash.data[0][1]], | |
| explode: hash.pie.explode | |
| }; | |
| }); | |
| // Sum of the portions' angles | |
| var sum = portions.pluck('value').pluck(1).inject(0, function(acc, n) { return acc + n; }); | |
| var fraction = 0.0, | |
| angle = series.pie.startAngle, | |
| value = 0.0; | |
| var slices = portions.collect(function(slice){ | |
| angle += fraction; | |
| value = parseFloat(slice.value[1]); // @warning : won't support null values !! | |
| fraction = value/sum; | |
| return { | |
| name: slice.name, | |
| fraction: fraction, | |
| x: slice.value[0], | |
| y: value, | |
| explode: slice.explode, | |
| startAngle: 2 * angle * Math.PI, | |
| endAngle: 2 * (angle + fraction) * Math.PI | |
| }; | |
| }); | |
| ctx.save(); | |
| if(sw > 0){ | |
| slices.each(function (slice) { | |
| var bisection = (slice.startAngle + slice.endAngle) / 2; | |
| var xOffset = center.x + Math.cos(bisection) * slice.explode + sw; | |
| var yOffset = center.y + Math.sin(bisection) * slice.explode + sw; | |
| this.plotSlice(xOffset, yOffset, radius, slice.startAngle, slice.endAngle, false, vScale); | |
| ctx.fillStyle = 'rgba(0,0,0,0.1)'; | |
| ctx.fill(); | |
| }, this); | |
| } | |
| if (options.HtmlText) { | |
| html = ['<div style="color:' + this.options.grid.color + '" class="flotr-labels">']; | |
| } | |
| slices.each(function (slice, index) { | |
| var bisection = (slice.startAngle + slice.endAngle) / 2; | |
| var color = options.colors[index]; | |
| var xOffset = center.x + Math.cos(bisection) * slice.explode; | |
| var yOffset = center.y + Math.sin(bisection) * slice.explode; | |
| this.plotSlice(xOffset, yOffset, radius, slice.startAngle, slice.endAngle, false, vScale); | |
| if(series.pie.fill){ | |
| ctx.fillStyle = Flotr.parseColor(color).scale(null, null, null, series.pie.fillOpacity).toString(); | |
| ctx.fill(); | |
| } | |
| ctx.lineWidth = lw; | |
| ctx.strokeStyle = color; | |
| ctx.stroke(); | |
| /*ctx.save(); | |
| ctx.scale(1, vScale); | |
| ctx.moveTo(xOffset, yOffset); | |
| ctx.beginPath(); | |
| ctx.lineTo(xOffset, yOffset+plotTickness); | |
| ctx.lineTo(xOffset+Math.cos(slice.startAngle)*radius, yOffset+Math.sin(slice.startAngle)*radius+plotTickness); | |
| ctx.lineTo(xOffset+Math.cos(slice.startAngle)*radius, yOffset+Math.sin(slice.startAngle)*radius); | |
| ctx.lineTo(xOffset, yOffset); | |
| ctx.closePath(); | |
| ctx.fill();ctx.stroke(); | |
| ctx.moveTo(xOffset, yOffset); | |
| ctx.beginPath(); | |
| ctx.lineTo(xOffset, yOffset+plotTickness); | |
| ctx.lineTo(xOffset+Math.cos(slice.endAngle)*radius, yOffset+Math.sin(slice.endAngle)*radius+plotTickness); | |
| ctx.lineTo(xOffset+Math.cos(slice.endAngle)*radius, yOffset+Math.sin(slice.endAngle)*radius); | |
| ctx.lineTo(xOffset, yOffset); | |
| ctx.closePath(); | |
| ctx.fill();ctx.stroke(); | |
| ctx.moveTo(xOffset+Math.cos(slice.startAngle)*radius, yOffset+Math.sin(slice.startAngle)*radius); | |
| ctx.beginPath(); | |
| ctx.lineTo(xOffset+Math.cos(slice.startAngle)*radius, yOffset+Math.sin(slice.startAngle)*radius+plotTickness); | |
| ctx.arc(xOffset, yOffset+plotTickness, radius, slice.startAngle, slice.endAngle, false); | |
| ctx.lineTo(xOffset+Math.cos(slice.endAngle)*radius, yOffset+Math.sin(slice.endAngle)*radius); | |
| ctx.arc(xOffset, yOffset, radius, slice.endAngle, slice.startAngle, true); | |
| ctx.closePath(); | |
| ctx.fill();ctx.stroke(); | |
| ctx.scale(1, 1/vScale); | |
| this.plotSlice(xOffset, yOffset+plotTickness, radius, slice.startAngle, slice.endAngle, false, vScale); | |
| ctx.stroke(); | |
| if(series.pie.fill){ | |
| ctx.fillStyle = Flotr.parseColor(color).scale(null, null, null, series.pie.fillOpacity).toString(); | |
| ctx.fill(); | |
| } | |
| ctx.restore();*/ | |
| var label = options.pie.labelFormatter(slice); | |
| var textAlignRight = (Math.cos(bisection) < 0); | |
| var distX = xOffset + Math.cos(bisection) * (series.pie.explode + radius); | |
| var distY = yOffset + Math.sin(bisection) * (series.pie.explode + radius); | |
| if (slice.fraction && label) { | |
| if (options.HtmlText) { | |
| var divStyle = 'position:absolute;top:' + (distY - 5) + 'px;'; //@todo: change | |
| if (textAlignRight) { | |
| divStyle += 'right:'+(this.canvasWidth - distX)+'px;text-align:right;'; | |
| } | |
| else { | |
| divStyle += 'left:'+distX+'px;text-align:left;'; | |
| } | |
| html.push('<div style="' + divStyle + '" class="flotr-grid-label">' + label + '</div>'); | |
| } | |
| else { | |
| style.halign = textAlignRight ? 'r' : 'l'; | |
| ctx.drawText( | |
| label, | |
| distX, | |
| distY + style.size / 2, | |
| style | |
| ); | |
| } | |
| } | |
| }, this); | |
| if (options.HtmlText) { | |
| html.push('</div>'); | |
| this.el.insert(html.join('')); | |
| } | |
| ctx.restore(); | |
| options.pie.drawn = true; | |
| } | |
| }, | |
| plotSlice: function(x, y, radius, startAngle, endAngle, fill, vScale) { | |
| var ctx = this.ctx; | |
| vScale = vScale || 1; | |
| ctx.save(); | |
| ctx.scale(1, vScale); | |
| ctx.beginPath(); | |
| ctx.moveTo(x, y); | |
| ctx.arc (x, y, radius, startAngle, endAngle, fill); | |
| ctx.lineTo(x, y); | |
| ctx.closePath(); | |
| ctx.restore(); | |
| }, | |
| plotPie: function() {}, | |
| /** | |
| * Function: insertLegend | |
| * | |
| * Function adds a legend div to the canvas container or draws it on the canvas. | |
| * | |
| * Parameters: | |
| * none | |
| * | |
| * Returns: | |
| * void | |
| */ | |
| insertLegend: function(){ | |
| if(!this.options.legend.show) | |
| return; | |
| var series = this.series, | |
| plotOffset = this.plotOffset, | |
| options = this.options, | |
| fragments = [], | |
| rowStarted = false, | |
| ctx = this.ctx, | |
| i; | |
| var noLegendItems = series.findAll(function(s) {return (s.label && !s.hide)}).size(); | |
| if (noLegendItems) { | |
| if (!options.HtmlText && this.textEnabled) { | |
| var style = { | |
| size: options.fontSize*1.1, | |
| color: options.grid.color | |
| }; | |
| // @todo: take css into account | |
| //var dummyDiv = this.el.insert('<div class="flotr-legend" style="position:absolute;top:-10000px;"></div>'); | |
| var p = options.legend.position, | |
| m = options.legend.margin, | |
| lbw = options.legend.labelBoxWidth, | |
| lbh = options.legend.labelBoxHeight, | |
| lbm = options.legend.labelBoxMargin, | |
| offsetX = plotOffset.left + m, | |
| offsetY = plotOffset.top + m; | |
| // We calculate the labels' max width | |
| var labelMaxWidth = 0; | |
| for(i = series.length - 1; i > -1; --i){ | |
| if(!series[i].label || series[i].hide) continue; | |
| var label = options.legend.labelFormatter(series[i].label); | |
| labelMaxWidth = Math.max(labelMaxWidth, ctx.measureText(label, style)); | |
| } | |
| var legendWidth = Math.round(lbw + lbm*3 + labelMaxWidth), | |
| legendHeight = Math.round(noLegendItems*(lbm+lbh) + lbm); | |
| if(p.charAt(0) == 's') offsetY = plotOffset.top + this.plotHeight - (m + legendHeight); | |
| if(p.charAt(1) == 'e') offsetX = plotOffset.left + this.plotWidth - (m + legendWidth); | |
| // Legend box | |
| var color = Flotr.parseColor(options.legend.backgroundColor || 'rgb(240,240,240)').scale(null, null, null, options.legend.backgroundOpacity || 0.1).toString(); | |
| ctx.fillStyle = color; | |
| ctx.fillRect(offsetX, offsetY, legendWidth, legendHeight); | |
| ctx.strokeStyle = options.legend.labelBoxBorderColor; | |
| ctx.strokeRect(Flotr.toPixel(offsetX), Flotr.toPixel(offsetY), legendWidth, legendHeight); | |
| // Legend labels | |
| var x = offsetX + lbm; | |
| var y = offsetY + lbm; | |
| for(i = 0; i < series.length; i++){ | |
| if(!series[i].label || series[i].hide) continue; | |
| var label = options.legend.labelFormatter(series[i].label); | |
| ctx.fillStyle = series[i].color; | |
| ctx.fillRect(x, y, lbw-1, lbh-1); | |
| ctx.strokeStyle = options.legend.labelBoxBorderColor; | |
| ctx.lineWidth = 1; | |
| ctx.strokeRect(Math.ceil(x)-1.5, Math.ceil(y)-1.5, lbw+2, lbh+2); | |
| // Legend text | |
| ctx.drawText( | |
| label, | |
| x + lbw + lbm, | |
| y + (lbh + style.size - ctx.fontDescent(style))/2, | |
| style | |
| ); | |
| y += lbh + lbm; | |
| } | |
| } | |
| else { | |
| for(i = 0; i < series.length; ++i){ | |
| if(!series[i].label || series[i].hide) continue; | |
| if(i % options.legend.noColumns == 0){ | |
| fragments.push(rowStarted ? '</tr><tr>' : '<tr>'); | |
| rowStarted = true; | |
| } | |
| var label = options.legend.labelFormatter(series[i].label); | |
| fragments.push('<td class="flotr-legend-color-box"><div style="border:1px solid ' + options.legend.labelBoxBorderColor + ';padding:1px"><div style="width:' + options.legend.labelBoxWidth + 'px;height:' + options.legend.labelBoxHeight + 'px;background-color:' + series[i].color + '"></div></div></td>' + | |
| '<td class="flotr-legend-label">' + label + '</td>'); | |
| } | |
| if(rowStarted) fragments.push('</tr>'); | |
| if(fragments.length > 0){ | |
| var table = '<table style="font-size:smaller;color:' + options.grid.color + '">' + fragments.join("") + '</table>'; | |
| if(options.legend.container != null){ | |
| $(options.legend.container).update(table); | |
| }else{ | |
| var pos = ''; | |
| var p = options.legend.position, m = options.legend.margin; | |
| if(p.charAt(0) == 'n') pos += 'top:' + (m + plotOffset.top) + 'px;'; | |
| else if(p.charAt(0) == 's') pos += 'bottom:' + (m + plotOffset.bottom) + 'px;'; | |
| if(p.charAt(1) == 'e') pos += 'right:' + (m + plotOffset.right) + 'px;'; | |
| else if(p.charAt(1) == 'w') pos += 'left:' + (m + plotOffset.left) + 'px;'; | |
| var div = this.el.insert('<div class="flotr-legend" style="position:absolute;z-index:2;' + pos +'">' + table + '</div>').select('div.flotr-legend').first(); | |
| if(options.legend.backgroundOpacity != 0.0){ | |
| /** | |
| * Put in the transparent background separately to avoid blended labels and | |
| * label boxes. | |
| */ | |
| var c = options.legend.backgroundColor; | |
| if(c == null){ | |
| var tmp = (options.grid.backgroundColor != null) ? options.grid.backgroundColor : Flotr.extractColor(div); | |
| c = Flotr.parseColor(tmp).adjust(null, null, null, 1).toString(); | |
| } | |
| this.el.insert('<div class="flotr-legend-bg" style="position:absolute;width:' + div.getWidth() + 'px;height:' + div.getHeight() + 'px;' + pos +'background-color:' + c + ';"> </div>').select('div.flotr-legend-bg').first().setStyle({ | |
| 'opacity': options.legend.backgroundOpacity | |
| }); | |
| } | |
| } | |
| } | |
| } | |
| } | |
| }, | |
| /** | |
| * Function: getEventPosition | |
| * | |
| * Calculates the coordinates from a mouse event object. | |
| * | |
| * Parameters: | |
| * event - Mouse Event object. | |
| * | |
| * Returns: | |
| * Object with x and y coordinates of the mouse. | |
| */ | |
| getEventPosition: function (event){ | |
| var offset = this.overlay.cumulativeOffset(), | |
| rx = (event.pageX - offset.left - this.plotOffset.left), | |
| ry = (event.pageY - offset.top - this.plotOffset.top), | |
| ax = 0, ay = 0 | |
| if(event.pageX == null && event.clientX != null){ | |
| var de = document.documentElement, b = document.body; | |
| ax = event.clientX + (de && de.scrollLeft || b.scrollLeft || 0); | |
| ay = event.clientY + (de && de.scrollTop || b.scrollTop || 0); | |
| }else{ | |
| ax = event.pageX; | |
| ay = event.pageY; | |
| } | |
| return { | |
| x: this.axes.x.min + rx / this.axes.x.scale, | |
| x2: this.axes.x2.min + rx / this.axes.x2.scale, | |
| y: this.axes.y.max - ry / this.axes.y.scale, | |
| y2: this.axes.y2.max - ry / this.axes.y2.scale, | |
| relX: rx, | |
| relY: ry, | |
| absX: ax, | |
| absY: ay | |
| }; | |
| }, | |
| /** | |
| * Function: clickHandler | |
| * | |
| * Handler observes the 'click' event and fires the 'flotr:click' event. | |
| * | |
| * Parameters: | |
| * event - 'click' Event object. | |
| * | |
| * Returns: | |
| * void | |
| */ | |
| clickHandler: function(event){ | |
| if(this.ignoreClick){ | |
| this.ignoreClick = false; | |
| return; | |
| } | |
| this.el.fire('flotr:click', [this.getEventPosition(event), this]); | |
| }, | |
| /** | |
| * Function: mouseMoveHandler | |
| * | |
| * Handler observes mouse movement over the graph area. Fires the | |
| * 'flotr:mousemove' event. | |
| * | |
| * Parameters: | |
| * event - 'mousemove' Event object. | |
| * | |
| * Returns: | |
| * void | |
| */ | |
| mouseMoveHandler: function(event){ | |
| var pos = this.getEventPosition(event); | |
| this.lastMousePos.pageX = pos.absX; | |
| this.lastMousePos.pageY = pos.absY; | |
| if(this.selectionInterval == null && (this.options.mouse.track || this.series.any(function(s){return s.mouse && s.mouse.track;}))){ | |
| this.hit(pos); | |
| } | |
| this.el.fire('flotr:mousemove', [event, pos, this]); | |
| }, | |
| /** | |
| * Function: mouseDownHandler | |
| * | |
| * Handler observes the 'mousedown' event. | |
| * | |
| * Parameters: | |
| * event - 'mousedown' Event object. | |
| * | |
| * Returns: | |
| * void | |
| */ | |
| mouseDownHandler: function (event){ | |
| if(event.isRightClick()) { | |
| event.stop(); | |
| var overlay = this.overlay; | |
| overlay.hide(); | |
| function cancelContextMenu () { | |
| overlay.show(); | |
| $(document).stopObserving('mousemove', cancelContextMenu); | |
| } | |
| $(document).observe('mousemove', cancelContextMenu); | |
| return; | |
| } | |
| if(!this.options.selection.mode || !event.isLeftClick()) return; | |
| this.setSelectionPos(this.selection.first, event); | |
| if(this.selectionInterval != null){ | |
| clearInterval(this.selectionInterval); | |
| } | |
| this.lastMousePos.pageX = null; | |
| this.selectionInterval = setInterval(this.updateSelection.bind(this), 1000/this.options.selection.fps); | |
| this.mouseUpHandler = this.mouseUpHandler.bind(this); | |
| $(document).observe('mouseup', this.mouseUpHandler); | |
| }, | |
| /** | |
| * Function: (private) fireSelectEvent | |
| * | |
| * Fires the 'flotr:select' event when the user made a selection. | |
| * | |
| * Parameters: | |
| * none | |
| * | |
| * Returns: | |
| * void | |
| */ | |
| fireSelectEvent: function(){ | |
| var a = this.axes, selection = this.selection, | |
| x1 = (selection.first.x <= selection.second.x) ? selection.first.x : selection.second.x, | |
| x2 = (selection.first.x <= selection.second.x) ? selection.second.x : selection.first.x, | |
| y1 = (selection.first.y >= selection.second.y) ? selection.first.y : selection.second.y, | |
| y2 = (selection.first.y >= selection.second.y) ? selection.second.y : selection.first.y; | |
| x1 = a.x.min + x1 / a.x.scale; | |
| x2 = a.x.min + x2 / a.x.scale; | |
| y1 = a.y.max - y1 / a.y.scale; | |
| y2 = a.y.max - y2 / a.y.scale; | |
| this.el.fire('flotr:select', [{x1:x1, y1:y1, x2:x2, y2:y2}, this]); | |
| }, | |
| /** | |
| * Function: (private) mouseUpHandler | |
| * | |
| * Handler observes the mouseup event for the document. | |
| * | |
| * Parameters: | |
| * event - 'mouseup' Event object. | |
| * | |
| * Returns: | |
| * void | |
| */ | |
| mouseUpHandler: function(event){ | |
| $(document).stopObserving('mouseup', this.mouseUpHandler); | |
| event.stop(); | |
| if(this.selectionInterval != null){ | |
| clearInterval(this.selectionInterval); | |
| this.selectionInterval = null; | |
| } | |
| this.setSelectionPos(this.selection.second, event); | |
| this.clearSelection(); | |
| if(this.selectionIsSane()){ | |
| this.drawSelection(); | |
| this.fireSelectEvent(); | |
| this.ignoreClick = true; | |
| } | |
| }, | |
| /** | |
| * Function: setSelectionPos | |
| * | |
| * Calculates the position of the selection. | |
| * | |
| * Parameters: | |
| * pos - Position object. | |
| * event - Event object. | |
| * | |
| * Returns: | |
| * void | |
| */ | |
| setSelectionPos: function(pos, event) { | |
| var options = this.options, | |
| offset = $(this.overlay).cumulativeOffset(); | |
| if(options.selection.mode.indexOf('x') == -1){ | |
| pos.x = (pos == this.selection.first) ? 0 : this.plotWidth; | |
| }else{ | |
| pos.x = event.pageX - offset.left - this.plotOffset.left; | |
| pos.x = Math.min(Math.max(0, pos.x), this.plotWidth); | |
| } | |
| if (options.selection.mode.indexOf('y') == -1){ | |
| pos.y = (pos == this.selection.first) ? 0 : this.plotHeight; | |
| }else{ | |
| pos.y = event.pageY - offset.top - this.plotOffset.top; | |
| pos.y = Math.min(Math.max(0, pos.y), this.plotHeight); | |
| } | |
| }, | |
| /** | |
| * Function: updateSelection | |
| * | |
| * Updates (draws) the selection box. | |
| * | |
| * Parameters: | |
| * none | |
| * | |
| * Returns: | |
| * void | |
| */ | |
| updateSelection: function(){ | |
| if(this.lastMousePos.pageX == null) return; | |
| this.setSelectionPos(this.selection.second, this.lastMousePos); | |
| this.clearSelection(); | |
| if(this.selectionIsSane()) this.drawSelection(); | |
| }, | |
| /** | |
| * Function: clearSelection | |
| * | |
| * Removes the selection box from the overlay canvas. | |
| * | |
| * Parameters: | |
| * none | |
| * | |
| * Returns: | |
| * void | |
| */ | |
| clearSelection: function() { | |
| if(this.prevSelection == null) return; | |
| var prevSelection = this.prevSelection, | |
| octx = this.octx, | |
| plotOffset = this.plotOffset, | |
| x = Math.min(prevSelection.first.x, prevSelection.second.x), | |
| y = Math.min(prevSelection.first.y, prevSelection.second.y), | |
| w = Math.abs(prevSelection.second.x - prevSelection.first.x), | |
| h = Math.abs(prevSelection.second.y - prevSelection.first.y); | |
| octx.clearRect(x + plotOffset.left - octx.lineWidth, | |
| y + plotOffset.top - octx.lineWidth, | |
| w + octx.lineWidth*2, | |
| h + octx.lineWidth*2); | |
| this.prevSelection = null; | |
| }, | |
| /** | |
| * Function: setSelection | |
| * | |
| * Allows the user the manually select an area. | |
| * | |
| * Parameters: | |
| * area - Object with coordinates to select. | |
| * | |
| * Returns: | |
| * void | |
| */ | |
| setSelection: function(area){ | |
| var options = this.options, | |
| xa = this.axes.x, | |
| ya = this.axes.y, | |
| vertScale = yaxis.scale, | |
| hozScale = xaxis.scale, | |
| selX = options.selection.mode.indexOf('x') != -1, | |
| selY = options.selection.mode.indexOf('y') != -1; | |
| this.clearSelection(); | |
| this.selection.first.y = selX ? 0 : (ya.max - area.y1) * vertScale; | |
| this.selection.second.y = selX ? this.plotHeight : (ya.max - area.y2) * vertScale; | |
| this.selection.first.x = selY ? 0 : (area.x1 - xa.min) * hozScale; | |
| this.selection.second.x = selY ? this.plotWidth : (area.x2 - xa.min) * hozScale; | |
| this.drawSelection(); | |
| this.fireSelectEvent(); | |
| }, | |
| /** | |
| * Function: (private) drawSelection | |
| * | |
| * Draws the selection box. | |
| * | |
| * Parameters: | |
| * none | |
| * | |
| * Returns: | |
| * void | |
| */ | |
| drawSelection: function() { | |
| var prevSelection = this.prevSelection, | |
| selection = this.selection, | |
| octx = this.octx, | |
| options = this.options, | |
| plotOffset = this.plotOffset; | |
| if(prevSelection != null && | |
| selection.first.x == prevSelection.first.x && | |
| selection.first.y == prevSelection.first.y && | |
| selection.second.x == prevSelection.second.x && | |
| selection.second.y == prevSelection.second.y) | |
| return; | |
| octx.strokeStyle = Flotr.parseColor(options.selection.color).scale(null, null, null, 0.8).toString(); | |
| octx.lineWidth = 1; | |
| octx.lineJoin = 'round'; | |
| octx.fillStyle = Flotr.parseColor(options.selection.color).scale(null, null, null, 0.4).toString(); | |
| this.prevSelection = { | |
| first: { x: selection.first.x, y: selection.first.y }, | |
| second: { x: selection.second.x, y: selection.second.y } | |
| }; | |
| var x = Math.min(selection.first.x, selection.second.x), | |
| y = Math.min(selection.first.y, selection.second.y), | |
| w = Math.abs(selection.second.x - selection.first.x), | |
| h = Math.abs(selection.second.y - selection.first.y); | |
| octx.fillRect(x + plotOffset.left, y + plotOffset.top, w, h); | |
| octx.strokeRect(x + plotOffset.left, y + plotOffset.top, w, h); | |
| }, | |
| /** | |
| * Function: (private) selectionIsSane | |
| * | |
| * Determines whether or not the selection is sane and should be drawn. | |
| * | |
| * Parameters: | |
| * none | |
| * | |
| * Returns: | |
| * boolean - True when sane, false otherwise. | |
| */ | |
| selectionIsSane: function(){ | |
| var selection = this.selection; | |
| return Math.abs(selection.second.x - selection.first.x) >= 5 && | |
| Math.abs(selection.second.y - selection.first.y) >= 5; | |
| }, | |
| /** | |
| * Function: clearHit | |
| * | |
| * Removes the mouse tracking point from the overlay. | |
| * | |
| * Parameters: | |
| * none | |
| * | |
| * Returns: | |
| * void | |
| */ | |
| clearHit: function(){ | |
| if(this.prevHit){ | |
| var options = this.options, | |
| plotOffset = this.plotOffset, | |
| prevHit = this.prevHit; | |
| this.octx.clearRect( | |
| this.tHoz(prevHit.x) + plotOffset.left - options.points.radius*2, | |
| this.tVert(prevHit.y) + plotOffset.top - options.points.radius*2, | |
| options.points.radius*3 + options.points.lineWidth*3, | |
| options.points.radius*3 + options.points.lineWidth*3 | |
| ); | |
| this.prevHit = null; | |
| } | |
| }, | |
| /** | |
| * Function: hit | |
| * | |
| * Retrieves the nearest data point from the mouse cursor. If it's within | |
| * a certain range, draw a point on the overlay canvas and display the x and y | |
| * value of the data. | |
| * | |
| * Parameters: | |
| * mouse - Object that holds the relative x and y coordinates of the cursor. | |
| * | |
| * Returns: | |
| * void | |
| */ | |
| hit: function(mouse){ | |
| var series = this.series, | |
| options = this.options, | |
| prevHit = this.prevHit, | |
| plotOffset = this.plotOffset, | |
| octx = this.octx, | |
| data, xsens, ysens, | |
| /** | |
| * Nearest data element. | |
| */ | |
| i, n = { | |
| dist:Number.MAX_VALUE, | |
| x:null, | |
| y:null, | |
| relX:mouse.relX, | |
| relY:mouse.relY, | |
| absX:mouse.absX, | |
| absY:mouse.absY, | |
| mouse:null, | |
| radarData:null | |
| }; | |
| for(i = 0; i < series.length; i++){ | |
| s = series[i]; | |
| if(!s.mouse.track) continue; | |
| data = s.data; | |
| xsens = (s.xaxis.scale*s.mouse.sensibility); | |
| ysens = (s.yaxis.scale*s.mouse.sensibility); | |
| for(var j = 0, xpow, ypow; j < data.length; j++){ | |
| if (data[j][1] === null) continue; | |
| xpow = Math.pow(s.xaxis.scale*(data[j][0] - mouse.x), 2); | |
| ypow = Math.pow(s.yaxis.scale*(data[j][1] - mouse.y), 2); | |
| if(xpow < xsens && ypow < ysens && Math.sqrt(xpow+ypow) < n.dist){ | |
| n.dist = Math.sqrt(xpow+ypow); | |
| n.x = data[j][0]; | |
| n.y = data[j][1]; | |
| n.radarLabel = data[j][2]; | |
| n.radarData = data[j][3]; | |
| n.mouse = s.mouse; | |
| } | |
| } | |
| } | |
| if(n.mouse && n.mouse.track && !prevHit || (prevHit && (n.x != prevHit.x || n.y != prevHit.y))){ | |
| var mt = this.mouseTrack || this.el.select(".flotr-mouse-value")[0], | |
| pos = '', | |
| p = options.mouse.position, | |
| m = options.mouse.margin, | |
| elStyle = 'opacity:0.7;background-color:#000;color:#fff;display:none;position:absolute;padding:2px 8px;-moz-border-radius:4px;border-radius:4px;white-space:nowrap;'; | |
| if (!options.mouse.relative) { // absolute to the canvas | |
| if(p.charAt(0) == 'n') pos += 'top:' + (m + plotOffset.top) + 'px;'; | |
| else if(p.charAt(0) == 's') pos += 'bottom:' + (m + plotOffset.bottom) + 'px;'; | |
| if(p.charAt(1) == 'e') pos += 'right:' + (m + plotOffset.right) + 'px;'; | |
| else if(p.charAt(1) == 'w') pos += 'left:' + (m + plotOffset.left) + 'px;'; | |
| } | |
| else { // relative to the mouse | |
| if(p.charAt(0) == 'n') pos += 'bottom:' + (m - plotOffset.top - this.tVert(n.y) + this.canvasHeight) + 'px;'; | |
| else if(p.charAt(0) == 's') pos += 'top:' + (m + plotOffset.top + this.tVert(n.y)) + 'px;'; | |
| if(p.charAt(1) == 'e') pos += 'left:' + (m + plotOffset.left + this.tHoz(n.x)) + 'px;'; | |
| else if(p.charAt(1) == 'w') pos += 'right:' + (m - plotOffset.left - this.tHoz(n.x) + this.canvasWidth) + 'px;'; | |
| } | |
| elStyle += pos; | |
| if(!mt){ | |
| this.el.insert('<div class="flotr-mouse-value" style="'+elStyle+'"></div>'); | |
| mt = this.mouseTrack = this.el.select('.flotr-mouse-value').first(); | |
| } | |
| else { | |
| this.mouseTrack = mt.setStyle(elStyle); | |
| } | |
| if(n.x !== null && n.y !== null){ | |
| mt.show(); | |
| this.clearHit(); | |
| if(n.mouse.lineColor != null){ | |
| octx.save(); | |
| octx.translate(plotOffset.left, plotOffset.top); | |
| octx.lineWidth = options.points.lineWidth; | |
| octx.strokeStyle = n.mouse.lineColor; | |
| octx.fillStyle = '#ffffff'; | |
| octx.beginPath(); | |
| octx.arc(this.tHoz(n.x), this.tVert(n.y), options.mouse.radius, 0, 2 * Math.PI, true); | |
| octx.fill(); | |
| octx.stroke(); | |
| octx.restore(); | |
| } | |
| this.prevHit = n; | |
| var decimals = n.mouse.trackDecimals; | |
| if(decimals == null || decimals < 0) decimals = 0; | |
| mt.innerHTML = n.mouse.trackFormatter({x: n.x.toFixed(decimals), y: n.y.toFixed(decimals), | |
| radarLabel: n.radarLabel, radarData: n.radarData.toFixed(decimals)}); | |
| mt.fire('flotr:hit', [n, this]); | |
| } | |
| else if(prevHit){ | |
| mt.hide(); | |
| this.clearHit(); | |
| } | |
| } | |
| }, | |
| saveImage: function (type, width, height, replaceCanvas) { | |
| var image = null; | |
| switch (type) { | |
| case 'jpeg': | |
| case 'jpg': image = Canvas2Image.saveAsJPEG(this.canvas, replaceCanvas, width, height); break; | |
| default: | |
| case 'png': image = Canvas2Image.saveAsPNG(this.canvas, replaceCanvas, width, height); break; | |
| case 'bmp': image = Canvas2Image.saveAsBMP(this.canvas, replaceCanvas, width, height); break; | |
| } | |
| if (Object.isElement(image) && replaceCanvas) { | |
| this.restoreCanvas(); | |
| this.canvas.hide(); | |
| this.overlay.hide(); | |
| this.el.insert(image.setStyle({position: 'absolute'})); | |
| } | |
| }, | |
| restoreCanvas: function() { | |
| this.canvas.show(); | |
| this.overlay.show(); | |
| this.el.select('img').invoke('remove'); | |
| } | |
| }); | |
| Flotr.Color = Class.create({ | |
| initialize: function(r, g, b, a){ | |
| this.rgba = ['r','g','b','a']; | |
| var x = 4; | |
| while(-1<--x){ | |
| this[this.rgba[x]] = arguments[x] || ((x==3) ? 1.0 : 0); | |
| } | |
| this.normalize(); | |
| }, | |
| adjust: function(rd, gd, bd, ad) { | |
| var x = 4; | |
| while(-1<--x){ | |
| if(arguments[x] != null) | |
| this[this.rgba[x]] += arguments[x]; | |
| } | |
| return this.normalize(); | |
| }, | |
| clone: function(){ | |
| return new Flotr.Color(this.r, this.b, this.g, this.a); | |
| }, | |
| limit: function(val,minVal,maxVal){ | |
| return Math.max(Math.min(val, maxVal), minVal); | |
| }, | |
| normalize: function(){ | |
| var limit = this.limit; | |
| this.r = limit(parseInt(this.r), 0, 255); | |
| this.g = limit(parseInt(this.g), 0, 255); | |
| this.b = limit(parseInt(this.b), 0, 255); | |
| this.a = limit(this.a, 0, 1); | |
| return this; | |
| }, | |
| scale: function(rf, gf, bf, af){ | |
| var x = 4; | |
| while(-1<--x){ | |
| if(arguments[x] != null) | |
| this[this.rgba[x]] *= arguments[x]; | |
| } | |
| return this.normalize(); | |
| }, | |
| distance: function(color){ | |
| if (!color) return; | |
| color = new Flotr.parseColor(color); | |
| var dist = 0; | |
| var x = 3; | |
| while(-1<--x){ | |
| dist += Math.abs(this[this.rgba[x]] - color[this.rgba[x]]); | |
| } | |
| return dist; | |
| }, | |
| toString: function(){ | |
| return (this.a >= 1.0) ? 'rgb('+[this.r,this.g,this.b].join(',')+')' : 'rgba('+[this.r,this.g,this.b,this.a].join(',')+')'; | |
| } | |
| }); | |
| Flotr.Color.lookupColors = { | |
| aqua:[0,255,255], | |
| azure:[240,255,255], | |
| beige:[245,245,220], | |
| black:[0,0,0], | |
| blue:[0,0,255], | |
| brown:[165,42,42], | |
| cyan:[0,255,255], | |
| darkblue:[0,0,139], | |
| darkcyan:[0,139,139], | |
| darkgrey:[169,169,169], | |
| darkgreen:[0,100,0], | |
| darkkhaki:[189,183,107], | |
| darkmagenta:[139,0,139], | |
| darkolivegreen:[85,107,47], | |
| darkorange:[255,140,0], | |
| darkorchid:[153,50,204], | |
| darkred:[139,0,0], | |
| darksalmon:[233,150,122], | |
| darkviolet:[148,0,211], | |
| fuchsia:[255,0,255], | |
| gold:[255,215,0], | |
| green:[0,128,0], | |
| indigo:[75,0,130], | |
| khaki:[240,230,140], | |
| lightblue:[173,216,230], | |
| lightcyan:[224,255,255], | |
| lightgreen:[144,238,144], | |
| lightgrey:[211,211,211], | |
| lightpink:[255,182,193], | |
| lightyellow:[255,255,224], | |
| lime:[0,255,0], | |
| magenta:[255,0,255], | |
| maroon:[128,0,0], | |
| navy:[0,0,128], | |
| olive:[128,128,0], | |
| orange:[255,165,0], | |
| pink:[255,192,203], | |
| purple:[128,0,128], | |
| violet:[128,0,128], | |
| red:[255,0,0], | |
| silver:[192,192,192], | |
| white:[255,255,255], | |
| yellow:[255,255,0] | |
| }; | |
| // not used yet | |
| Flotr.Date = { | |
| format: function(d, format) { | |
| if (!d) return; | |
| var leftPad = function(n) { | |
| n = n.toString(); | |
| return n.length == 1 ? "0" + n : n; | |
| }; | |
| var r = []; | |
| var escape = false; | |
| for (var i = 0; i < format.length; ++i) { | |
| var c = format.charAt(i); | |
| if (escape) { | |
| switch (c) { | |
| case 'h': c = d.getUTCHours().toString(); break; | |
| case 'H': c = leftPad(d.getUTCHours()); break; | |
| case 'M': c = leftPad(d.getUTCMinutes()); break; | |
| case 'S': c = leftPad(d.getUTCSeconds()); break; | |
| case 'd': c = d.getUTCDate().toString(); break; | |
| case 'm': c = (d.getUTCMonth() + 1).toString(); break; | |
| case 'y': c = d.getUTCFullYear().toString(); break; | |
| case 'b': c = Flotr.Date.monthNames[d.getUTCMonth()]; break; | |
| } | |
| r.push(c); | |
| escape = false; | |
| } | |
| else { | |
| if (c == "%") | |
| escape = true; | |
| else | |
| r.push(c); | |
| } | |
| } | |
| return r.join(""); | |
| }, | |
| timeUnits: { | |
| "second": 1000, | |
| "minute": 60 * 1000, | |
| "hour": 60 * 60 * 1000, | |
| "day": 24 * 60 * 60 * 1000, | |
| "month": 30 * 24 * 60 * 60 * 1000, | |
| "year": 365.2425 * 24 * 60 * 60 * 1000 | |
| }, | |
| // the allowed tick sizes, after 1 year we use an integer algorithm | |
| spec: [ | |
| [1, "second"], [2, "second"], [5, "second"], [10, "second"], [30, "second"], | |
| [1, "minute"], [2, "minute"], [5, "minute"], [10, "minute"], [30, "minute"], | |
| [1, "hour"], [2, "hour"], [4, "hour"], [8, "hour"], [12, "hour"], | |
| [1, "day"], [2, "day"], [3, "day"], | |
| [0.25, "month"], [0.5, "month"], [1, "month"], [2, "month"], [3, "month"], [6, "month"], | |
| [1, "year"] | |
| ], | |
| monthNames: ["Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug", "Sep", "Oct", "Nov", "Dec"] | |
| }; | |
| /* Copyright (C) 1999 Masanao Izumo <iz@onicos.co.jp> | |
| * Version: 1.0 | |
| * LastModified: Dec 25 1999 | |
| * This library is free. You can redistribute it and/or modify it. | |
| */ | |
| /* | |
| * Interfaces: | |
| * b64 = base64encode(data); | |
| * data = base64decode(b64); | |
| */ | |
| (function() { | |
| var base64EncodeChars = "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/"; | |
| var base64DecodeChars = [ | |
| -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, | |
| -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, | |
| -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, 62, -1, -1, -1, 63, | |
| 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, -1, -1, -1, -1, -1, -1, | |
| -1, 0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, | |
| 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, -1, -1, -1, -1, -1, | |
| -1, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, | |
| 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, -1, -1, -1, -1, -1]; | |
| function base64encode(str) { | |
| var out, i, len; | |
| var c1, c2, c3; | |
| len = str.length; | |
| i = 0; | |
| out = ""; | |
| while(i < len) { | |
| c1 = str.charCodeAt(i++) & 0xff; | |
| if(i == len) | |
| { | |
| out += base64EncodeChars.charAt(c1 >> 2); | |
| out += base64EncodeChars.charAt((c1 & 0x3) << 4); | |
| out += "=="; | |
| break; | |
| } | |
| c2 = str.charCodeAt(i++); | |
| if(i == len) | |
| { | |
| out += base64EncodeChars.charAt(c1 >> 2); | |
| out += base64EncodeChars.charAt(((c1 & 0x3)<< 4) | ((c2 & 0xF0) >> 4)); | |
| out += base64EncodeChars.charAt((c2 & 0xF) << 2); | |
| out += "="; | |
| break; | |
| } | |
| c3 = str.charCodeAt(i++); | |
| out += base64EncodeChars.charAt(c1 >> 2); | |
| out += base64EncodeChars.charAt(((c1 & 0x3)<< 4) | ((c2 & 0xF0) >> 4)); | |
| out += base64EncodeChars.charAt(((c2 & 0xF) << 2) | ((c3 & 0xC0) >>6)); | |
| out += base64EncodeChars.charAt(c3 & 0x3F); | |
| } | |
| return out; | |
| } | |
| function base64decode(str) { | |
| var c1, c2, c3, c4; | |
| var i, len, out; | |
| len = str.length; | |
| i = 0; | |
| out = ""; | |
| while(i < len) { | |
| /* c1 */ | |
| do { | |
| c1 = base64DecodeChars[str.charCodeAt(i++) & 0xff]; | |
| } while(i < len && c1 == -1); | |
| if(c1 == -1) | |
| break; | |
| /* c2 */ | |
| do { | |
| c2 = base64DecodeChars[str.charCodeAt(i++) & 0xff]; | |
| } while(i < len && c2 == -1); | |
| if(c2 == -1) | |
| break; | |
| out += String.fromCharCode((c1 << 2) | ((c2 & 0x30) >> 4)); | |
| /* c3 */ | |
| do { | |
| c3 = str.charCodeAt(i++) & 0xff; | |
| if(c3 == 61) | |
| return out; | |
| c3 = base64DecodeChars[c3]; | |
| } while(i < len && c3 == -1); | |
| if(c3 == -1) | |
| break; | |
| out += String.fromCharCode(((c2 & 0XF) << 4) | ((c3 & 0x3C) >> 2)); | |
| /* c4 */ | |
| do { | |
| c4 = str.charCodeAt(i++) & 0xff; | |
| if(c4 == 61) | |
| return out; | |
| c4 = base64DecodeChars[c4]; | |
| } while(i < len && c4 == -1); | |
| if(c4 == -1) | |
| break; | |
| out += String.fromCharCode(((c3 & 0x03) << 6) | c4); | |
| } | |
| return out; | |
| } | |
| if (!window.btoa) window.btoa = base64encode; | |
| if (!window.atob) window.atob = base64decode; | |
| })(); |
| /* | |
| * Canvas2Image v0.1 | |
| * Copyright (c) 2008 Jacob Seidelin, cupboy@gmail.com | |
| * MIT License [http://www.opensource.org/licenses/mit-license.php] | |
| */ | |
| var Canvas2Image = (function() { | |
| // check if we have canvas support | |
| var oCanvas = document.createElement("canvas"); | |
| // no canvas, bail out. | |
| if (!oCanvas.getContext) { | |
| return { | |
| saveAsBMP : function(){}, | |
| saveAsPNG : function(){}, | |
| saveAsJPEG : function(){} | |
| } | |
| } | |
| var bHasImageData = !!(oCanvas.getContext("2d").getImageData); | |
| var bHasDataURL = !!(oCanvas.toDataURL); | |
| var bHasBase64 = !!(window.btoa); | |
| var strDownloadMime = "image/octet-stream"; | |
| // ok, we're good | |
| var readCanvasData = function(oCanvas) { | |
| var iWidth = parseInt(oCanvas.width); | |
| var iHeight = parseInt(oCanvas.height); | |
| return oCanvas.getContext("2d").getImageData(0,0,iWidth,iHeight); | |
| } | |
| // base64 encodes either a string or an array of charcodes | |
| var encodeData = function(data) { | |
| var strData = ""; | |
| if (typeof data == "string") { | |
| strData = data; | |
| } else { | |
| var aData = data; | |
| for (var i = 0; i < aData.length; i++) { | |
| strData += String.fromCharCode(aData[i]); | |
| } | |
| } | |
| return btoa(strData); | |
| } | |
| // creates a base64 encoded string containing BMP data | |
| // takes an imagedata object as argument | |
| var createBMP = function(oData) { | |
| var aHeader = []; | |
| var iWidth = oData.width; | |
| var iHeight = oData.height; | |
| aHeader.push(0x42); // magic 1 | |
| aHeader.push(0x4D); | |
| var iFileSize = iWidth*iHeight*3 + 54; // total header size = 54 bytes | |
| aHeader.push(iFileSize % 256); iFileSize = Math.floor(iFileSize / 256); | |
| aHeader.push(iFileSize % 256); iFileSize = Math.floor(iFileSize / 256); | |
| aHeader.push(iFileSize % 256); iFileSize = Math.floor(iFileSize / 256); | |
| aHeader.push(iFileSize % 256); | |
| aHeader.push(0); // reserved | |
| aHeader.push(0); | |
| aHeader.push(0); // reserved | |
| aHeader.push(0); | |
| aHeader.push(54); // data offset | |
| aHeader.push(0); | |
| aHeader.push(0); | |
| aHeader.push(0); | |
| var aInfoHeader = []; | |
| aInfoHeader.push(40); // info header size | |
| aInfoHeader.push(0); | |
| aInfoHeader.push(0); | |
| aInfoHeader.push(0); | |
| var iImageWidth = iWidth; | |
| aInfoHeader.push(iImageWidth % 256); iImageWidth = Math.floor(iImageWidth / 256); | |
| aInfoHeader.push(iImageWidth % 256); iImageWidth = Math.floor(iImageWidth / 256); | |
| aInfoHeader.push(iImageWidth % 256); iImageWidth = Math.floor(iImageWidth / 256); | |
| aInfoHeader.push(iImageWidth % 256); | |
| var iImageHeight = iHeight; | |
| aInfoHeader.push(iImageHeight % 256); iImageHeight = Math.floor(iImageHeight / 256); | |
| aInfoHeader.push(iImageHeight % 256); iImageHeight = Math.floor(iImageHeight / 256); | |
| aInfoHeader.push(iImageHeight % 256); iImageHeight = Math.floor(iImageHeight / 256); | |
| aInfoHeader.push(iImageHeight % 256); | |
| aInfoHeader.push(1); // num of planes | |
| aInfoHeader.push(0); | |
| aInfoHeader.push(24); // num of bits per pixel | |
| aInfoHeader.push(0); | |
| aInfoHeader.push(0); // compression = none | |
| aInfoHeader.push(0); | |
| aInfoHeader.push(0); | |
| aInfoHeader.push(0); | |
| var iDataSize = iWidth*iHeight*3; | |
| aInfoHeader.push(iDataSize % 256); iDataSize = Math.floor(iDataSize / 256); | |
| aInfoHeader.push(iDataSize % 256); iDataSize = Math.floor(iDataSize / 256); | |
| aInfoHeader.push(iDataSize % 256); iDataSize = Math.floor(iDataSize / 256); | |
| aInfoHeader.push(iDataSize % 256); | |
| for (var i = 0; i < 16; i++) { | |
| aInfoHeader.push(0); // these bytes not used | |
| } | |
| var iPadding = (4 - ((iWidth * 3) % 4)) % 4; | |
| var aImgData = oData.data; | |
| var strPixelData = ""; | |
| var y = iHeight; | |
| do { | |
| var iOffsetY = iWidth*(y-1)*4; | |
| var strPixelRow = ""; | |
| for (var x=0;x<iWidth;x++) { | |
| var iOffsetX = 4*x; | |
| strPixelRow += String.fromCharCode(aImgData[iOffsetY+iOffsetX+2]); | |
| strPixelRow += String.fromCharCode(aImgData[iOffsetY+iOffsetX+1]); | |
| strPixelRow += String.fromCharCode(aImgData[iOffsetY+iOffsetX]); | |
| } | |
| for (var c=0;c<iPadding;c++) { | |
| strPixelRow += String.fromCharCode(0); | |
| } | |
| strPixelData += strPixelRow; | |
| } while (--y); | |
| return encodeData(aHeader.concat(aInfoHeader)) + encodeData(strPixelData); | |
| } | |
| // sends the generated file to the client | |
| var saveFile = function(strData) { | |
| if (!window.open(strData)) { | |
| document.location.href = strData; | |
| } | |
| } | |
| var makeDataURI = function(strData, strMime) { | |
| return "data:" + strMime + ";base64," + strData; | |
| } | |
| // generates a <img> object containing the imagedata | |
| var makeImageObject = function(strSource) { | |
| var oImgElement = document.createElement("img"); | |
| oImgElement.src = strSource; | |
| return oImgElement; | |
| } | |
| var scaleCanvas = function(oCanvas, iWidth, iHeight) { | |
| if (iWidth && iHeight) { | |
| var oSaveCanvas = document.createElement("canvas"); | |
| oSaveCanvas.width = iWidth; | |
| oSaveCanvas.height = iHeight; | |
| oSaveCanvas.style.width = iWidth+"px"; | |
| oSaveCanvas.style.height = iHeight+"px"; | |
| var oSaveCtx = oSaveCanvas.getContext("2d"); | |
| oSaveCtx.drawImage(oCanvas, 0, 0, oCanvas.width, oCanvas.height, 0, 0, iWidth, iWidth); | |
| return oSaveCanvas; | |
| } | |
| return oCanvas; | |
| } | |
| return { | |
| saveAsPNG : function(oCanvas, bReturnImg, iWidth, iHeight) { | |
| if (!bHasDataURL) { | |
| return false; | |
| } | |
| var oScaledCanvas = scaleCanvas(oCanvas, iWidth, iHeight); | |
| var strData = oScaledCanvas.toDataURL("image/png"); | |
| if (bReturnImg) { | |
| return makeImageObject(strData); | |
| } else { | |
| saveFile(strData.replace("image/png", strDownloadMime)); | |
| } | |
| return true; | |
| }, | |
| saveAsJPEG : function(oCanvas, bReturnImg, iWidth, iHeight) { | |
| if (!bHasDataURL) { | |
| return false; | |
| } | |
| var oScaledCanvas = scaleCanvas(oCanvas, iWidth, iHeight); | |
| var strMime = "image/jpeg"; | |
| var strData = oScaledCanvas.toDataURL(strMime); | |
| // check if browser actually supports jpeg by looking for the mime type in the data uri. | |
| // if not, return false | |
| if (strData.indexOf(strMime) != 5) { | |
| return false; | |
| } | |
| if (bReturnImg) { | |
| return makeImageObject(strData); | |
| } else { | |
| saveFile(strData.replace(strMime, strDownloadMime)); | |
| } | |
| return true; | |
| }, | |
| saveAsBMP : function(oCanvas, bReturnImg, iWidth, iHeight) { | |
| if (!(bHasImageData && bHasBase64)) { | |
| return false; | |
| } | |
| var oScaledCanvas = scaleCanvas(oCanvas, iWidth, iHeight); | |
| var oData = readCanvasData(oScaledCanvas); | |
| var strImgData = createBMP(oData); | |
| if (bReturnImg) { | |
| return makeImageObject(makeDataURI(strImgData, "image/bmp")); | |
| } else { | |
| saveFile(makeDataURI(strImgData, strDownloadMime)); | |
| } | |
| return true; | |
| } | |
| }; | |
| })(); |
| /** | |
| * This code is released to the public domain by Jim Studt, 2007. | |
| * He may keep some sort of up to date copy at http://www.federated.com/~jim/canvastext/ | |
| * A partial support for accentuated letters as been added too. | |
| */ | |
| var CanvasText = { | |
| /** The letters definition. It is a list of letters, | |
| * with their width, and the coordinates of points compositing them. | |
| * The syntax for the points is : [x, y], null value means "pen up" | |
| */ | |
| letters: { | |
| '\n':{ width: -1, points: [] }, | |
| ' ': { width: 10, points: [] }, | |
| '!': { width: 10, points: [[5,21],[5,7],null,[5,2],[4,1],[5,0],[6,1],[5,2]] }, | |
| '"': { width: 16, points: [[4,21],[4,14],null,[12,21],[12,14]] }, | |
| '#': { width: 21, points: [[11,25],[4,-7],null,[17,25],[10,-7],null,[4,12],[18,12],null,[3,6],[17,6]] }, | |
| '$': { width: 20, points: [[8,25],[8,-4],null,[12,25],[12,-4],null,[17,18],[15,20],[12,21],[8,21],[5,20],[3,18],[3,16],[4,14],[5,13],[7,12],[13,10],[15,9],[16,8],[17,6],[17,3],[15,1],[12,0],[8,0],[5,1],[3,3]] }, | |
| '%': { width: 24, points: [[21,21],[3,0],null,[8,21],[10,19],[10,17],[9,15],[7,14],[5,14],[3,16],[3,18],[4,20],[6,21],[8,21],null,[17,7],[15,6],[14,4],[14,2],[16,0],[18,0],[20,1],[21,3],[21,5],[19,7],[17,7]] }, | |
| '&': { width: 26, points: [[23,12],[23,13],[22,14],[21,14],[20,13],[19,11],[17,6],[15,3],[13,1],[11,0],[7,0],[5,1],[4,2],[3,4],[3,6],[4,8],[5,9],[12,13],[13,14],[14,16],[14,18],[13,20],[11,21],[9,20],[8,18],[8,16],[9,13],[11,10],[16,3],[18,1],[20,0],[22,0],[23,1],[23,2]] }, | |
| '\'':{ width: 10, points: [[5,19],[4,20],[5,21],[6,20],[6,18],[5,16],[4,15]] }, | |
| '(': { width: 14, points: [[11,25],[9,23],[7,20],[5,16],[4,11],[4,7],[5,2],[7,-2],[9,-5],[11,-7]] }, | |
| ')': { width: 14, points: [[3,25],[5,23],[7,20],[9,16],[10,11],[10,7],[9,2],[7,-2],[5,-5],[3,-7]] }, | |
| '*': { width: 16, points: [[8,21],[8,9],null,[3,18],[13,12],null,[13,18],[3,12]] }, | |
| '+': { width: 26, points: [[13,18],[13,0],null,[4,9],[22,9]] }, | |
| ',': { width: 10, points: [[6,1],[5,0],[4,1],[5,2],[6,1],[6,-1],[5,-3],[4,-4]] }, | |
| '-': { width: 26, points: [[4,9],[22,9]] }, | |
| '.': { width: 10, points: [[5,2],[4,1],[5,0],[6,1],[5,2]] }, | |
| '/': { width: 22, points: [[20,25],[2,-7]] }, | |
| '0': { width: 20, points: [[9,21],[6,20],[4,17],[3,12],[3,9],[4,4],[6,1],[9,0],[11,0],[14,1],[16,4],[17,9],[17,12],[16,17],[14,20],[11,21],[9,21]] }, | |
| '1': { width: 20, points: [[6,17],[8,18],[11,21],[11,0]] }, | |
| '2': { width: 20, points: [[4,16],[4,17],[5,19],[6,20],[8,21],[12,21],[14,20],[15,19],[16,17],[16,15],[15,13],[13,10],[3,0],[17,0]] }, | |
| '3': { width: 20, points: [[5,21],[16,21],[10,13],[13,13],[15,12],[16,11],[17,8],[17,6],[16,3],[14,1],[11,0],[8,0],[5,1],[4,2],[3,4]] }, | |
| '4': { width: 20, points: [[13,21],[3,7],[18,7],null,[13,21],[13,0]] }, | |
| '5': { width: 20, points: [[15,21],[5,21],[4,12],[5,13],[8,14],[11,14],[14,13],[16,11],[17,8],[17,6],[16,3],[14,1],[11,0],[8,0],[5,1],[4,2],[3,4]] }, | |
| '6': { width: 20, points: [[16,18],[15,20],[12,21],[10,21],[7,20],[5,17],[4,12],[4,7],[5,3],[7,1],[10,0],[11,0],[14,1],[16,3],[17,6],[17,7],[16,10],[14,12],[11,13],[10,13],[7,12],[5,10],[4,7]] }, | |
| '7': { width: 20, points: [[17,21],[7,0],null,[3,21],[17,21]] }, | |
| '8': { width: 20, points: [[8,21],[5,20],[4,18],[4,16],[5,14],[7,13],[11,12],[14,11],[16,9],[17,7],[17,4],[16,2],[15,1],[12,0],[8,0],[5,1],[4,2],[3,4],[3,7],[4,9],[6,11],[9,12],[13,13],[15,14],[16,16],[16,18],[15,20],[12,21],[8,21]] }, | |
| '9': { width: 20, points: [[16,14],[15,11],[13,9],[10,8],[9,8],[6,9],[4,11],[3,14],[3,15],[4,18],[6,20],[9,21],[10,21],[13,20],[15,18],[16,14],[16,9],[15,4],[13,1],[10,0],[8,0],[5,1],[4,3]] }, | |
| ':': { width: 10, points: [[5,14],[4,13],[5,12],[6,13],[5,14],null,[5,2],[4,1],[5,0],[6,1],[5,2]] }, | |
| ';': { width: 10, points: [[5,14],[4,13],[5,12],[6,13],[5,14],null,[6,1],[5,0],[4,1],[5,2],[6,1],[6,-1],[5,-3],[4,-4]] }, | |
| '<': { width: 24, points: [[20,18],[4,9],[20,0]] }, | |
| '=': { width: 26, points: [[4,12],[22,12],null,[4,6],[22,6]] }, | |
| '>': { width: 24, points: [[4,18],[20,9],[4,0]] }, | |
| '?': { width: 18, points: [[3,16],[3,17],[4,19],[5,20],[7,21],[11,21],[13,20],[14,19],[15,17],[15,15],[14,13],[13,12],[9,10],[9,7],null,[9,2],[8,1],[9,0],[10,1],[9,2]] }, | |
| '@': { width: 27, points: [[18,13],[17,15],[15,16],[12,16],[10,15],[9,14],[8,11],[8,8],[9,6],[11,5],[14,5],[16,6],[17,8],null,[12,16],[10,14],[9,11],[9,8],[10,6],[11,5],null,[18,16],[17,8],[17,6],[19,5],[21,5],[23,7],[24,10],[24,12],[23,15],[22,17],[20,19],[18,20],[15,21],[12,21],[9,20],[7,19],[5,17],[4,15],[3,12],[3,9],[4,6],[5,4],[7,2],[9,1],[12,0],[15,0],[18,1],[20,2],[21,3],null,[19,16],[18,8],[18,6],[19,5]] }, | |
| 'A': { width: 18, points: [[9,21],[1,0],null,[9,21],[17,0],null,[4,7],[14,7]] }, | |
| 'B': { width: 21, points: [[4,21],[4,0],null,[4,21],[13,21],[16,20],[17,19],[18,17],[18,15],[17,13],[16,12],[13,11],null,[4,11],[13,11],[16,10],[17,9],[18,7],[18,4],[17,2],[16,1],[13,0],[4,0]] }, | |
| 'C': { width: 21, points: [[18,16],[17,18],[15,20],[13,21],[9,21],[7,20],[5,18],[4,16],[3,13],[3,8],[4,5],[5,3],[7,1],[9,0],[13,0],[15,1],[17,3],[18,5]] }, | |
| 'D': { width: 21, points: [[4,21],[4,0],null,[4,21],[11,21],[14,20],[16,18],[17,16],[18,13],[18,8],[17,5],[16,3],[14,1],[11,0],[4,0]] }, | |
| 'E': { width: 19, points: [[4,21],[4,0],null,[4,21],[17,21],null,[4,11],[12,11],null,[4,0],[17,0]] }, | |
| 'F': { width: 18, points: [[4,21],[4,0],null,[4,21],[17,21],null,[4,11],[12,11]] }, | |
| 'G': { width: 21, points: [[18,16],[17,18],[15,20],[13,21],[9,21],[7,20],[5,18],[4,16],[3,13],[3,8],[4,5],[5,3],[7,1],[9,0],[13,0],[15,1],[17,3],[18,5],[18,8],null,[13,8],[18,8]] }, | |
| 'H': { width: 22, points: [[4,21],[4,0],null,[18,21],[18,0],null,[4,11],[18,11]] }, | |
| 'I': { width: 8, points: [[4,21],[4,0]] }, | |
| 'J': { width: 16, points: [[12,21],[12,5],[11,2],[10,1],[8,0],[6,0],[4,1],[3,2],[2,5],[2,7]] }, | |
| 'K': { width: 21, points: [[4,21],[4,0],null,[18,21],[4,7],null,[9,12],[18,0]] }, | |
| 'L': { width: 17, points: [[4,21],[4,0],null,[4,0],[16,0]] }, | |
| 'M': { width: 24, points: [[4,21],[4,0],null,[4,21],[12,0],null,[20,21],[12,0],null,[20,21],[20,0]] }, | |
| 'N': { width: 22, points: [[4,21],[4,0],null,[4,21],[18,0],null,[18,21],[18,0]] }, | |
| 'O': { width: 22, points: [[9,21],[7,20],[5,18],[4,16],[3,13],[3,8],[4,5],[5,3],[7,1],[9,0],[13,0],[15,1],[17,3],[18,5],[19,8],[19,13],[18,16],[17,18],[15,20],[13,21],[9,21]] }, | |
| 'P': { width: 21, points: [[4,21],[4,0],null,[4,21],[13,21],[16,20],[17,19],[18,17],[18,14],[17,12],[16,11],[13,10],[4,10]] }, | |
| 'Q': { width: 22, points: [[9,21],[7,20],[5,18],[4,16],[3,13],[3,8],[4,5],[5,3],[7,1],[9,0],[13,0],[15,1],[17,3],[18,5],[19,8],[19,13],[18,16],[17,18],[15,20],[13,21],[9,21],null,[12,4],[18,-2]] }, | |
| 'R': { width: 21, points: [[4,21],[4,0],null,[4,21],[13,21],[16,20],[17,19],[18,17],[18,15],[17,13],[16,12],[13,11],[4,11],null,[11,11],[18,0]] }, | |
| 'S': { width: 20, points: [[17,18],[15,20],[12,21],[8,21],[5,20],[3,18],[3,16],[4,14],[5,13],[7,12],[13,10],[15,9],[16,8],[17,6],[17,3],[15,1],[12,0],[8,0],[5,1],[3,3]] }, | |
| 'T': { width: 16, points: [[8,21],[8,0],null,[1,21],[15,21]] }, | |
| 'U': { width: 22, points: [[4,21],[4,6],[5,3],[7,1],[10,0],[12,0],[15,1],[17,3],[18,6],[18,21]] }, | |
| 'V': { width: 18, points: [[1,21],[9,0],null,[17,21],[9,0]] }, | |
| 'W': { width: 24, points: [[2,21],[7,0],null,[12,21],[7,0],null,[12,21],[17,0],null,[22,21],[17,0]] }, | |
| 'X': { width: 20, points: [[3,21],[17,0],null,[17,21],[3,0]] }, | |
| 'Y': { width: 18, points: [[1,21],[9,11],[9,0],null,[17,21],[9,11]] }, | |
| 'Z': { width: 20, points: [[17,21],[3,0],null,[3,21],[17,21],null,[3,0],[17,0]] }, | |
| '[': { width: 14, points: [[4,25],[4,-7],null,[5,25],[5,-7],null,[4,25],[11,25],null,[4,-7],[11,-7]] }, | |
| '\\':{ width: 14, points: [[0,21],[14,-3]] }, | |
| ']': { width: 14, points: [[9,25],[9,-7],null,[10,25],[10,-7],null,[3,25],[10,25],null,[3,-7],[10,-7]] }, | |
| '^': { width: 14, points: [[3,10],[8,18],[13,10]] }, | |
| '_': { width: 16, points: [[0,-2],[16,-2]] }, | |
| '`': { width: 10, points: [[6,21],[5,20],[4,18],[4,16],[5,15],[6,16],[5,17]] }, | |
| 'a': { width: 19, points: [[15,14],[15,0],null,[15,11],[13,13],[11,14],[8,14],[6,13],[4,11],[3,8],[3,6],[4,3],[6,1],[8,0],[11,0],[13,1],[15,3]] }, | |
| 'b': { width: 19, points: [[4,21],[4,0],null,[4,11],[6,13],[8,14],[11,14],[13,13],[15,11],[16,8],[16,6],[15,3],[13,1],[11,0],[8,0],[6,1],[4,3]] }, | |
| 'c': { width: 18, points: [[15,11],[13,13],[11,14],[8,14],[6,13],[4,11],[3,8],[3,6],[4,3],[6,1],[8,0],[11,0],[13,1],[15,3]] }, | |
| 'd': { width: 19, points: [[15,21],[15,0],null,[15,11],[13,13],[11,14],[8,14],[6,13],[4,11],[3,8],[3,6],[4,3],[6,1],[8,0],[11,0],[13,1],[15,3]] }, | |
| 'e': { width: 18, points: [[3,8],[15,8],[15,10],[14,12],[13,13],[11,14],[8,14],[6,13],[4,11],[3,8],[3,6],[4,3],[6,1],[8,0],[11,0],[13,1],[15,3]] }, | |
| 'f': { width: 12, points: [[10,21],[8,21],[6,20],[5,17],[5,0],null,[2,14],[9,14]] }, | |
| 'g': { width: 19, points: [[15,14],[15,-2],[14,-5],[13,-6],[11,-7],[8,-7],[6,-6],null,[15,11],[13,13],[11,14],[8,14],[6,13],[4,11],[3,8],[3,6],[4,3],[6,1],[8,0],[11,0],[13,1],[15,3]] }, | |
| 'h': { width: 19, points: [[4,21],[4,0],null,[4,10],[7,13],[9,14],[12,14],[14,13],[15,10],[15,0]] }, | |
| 'i': { width: 8, points: [[3,21],[4,20],[5,21],[4,22],[3,21],null,[4,14],[4,0]] }, | |
| 'j': { width: 10, points: [[5,21],[6,20],[7,21],[6,22],[5,21],null,[6,14],[6,-3],[5,-6],[3,-7],[1,-7]] }, | |
| 'k': { width: 17, points: [[4,21],[4,0],null,[14,14],[4,4],null,[8,8],[15,0]] }, | |
| 'l': { width: 8, points: [[4,21],[4,0]] }, | |
| 'm': { width: 30, points: [[4,14],[4,0],null,[4,10],[7,13],[9,14],[12,14],[14,13],[15,10],[15,0],null,[15,10],[18,13],[20,14],[23,14],[25,13],[26,10],[26,0]] }, | |
| 'n': { width: 19, points: [[4,14],[4,0],null,[4,10],[7,13],[9,14],[12,14],[14,13],[15,10],[15,0]] }, | |
| 'o': { width: 19, points: [[8,14],[6,13],[4,11],[3,8],[3,6],[4,3],[6,1],[8,0],[11,0],[13,1],[15,3],[16,6],[16,8],[15,11],[13,13],[11,14],[8,14]] }, | |
| 'p': { width: 19, points: [[4,14],[4,-7],null,[4,11],[6,13],[8,14],[11,14],[13,13],[15,11],[16,8],[16,6],[15,3],[13,1],[11,0],[8,0],[6,1],[4,3]] }, | |
| 'q': { width: 19, points: [[15,14],[15,-7],null,[15,11],[13,13],[11,14],[8,14],[6,13],[4,11],[3,8],[3,6],[4,3],[6,1],[8,0],[11,0],[13,1],[15,3]] }, | |
| 'r': { width: 13, points: [[4,14],[4,0],null,[4,8],[5,11],[7,13],[9,14],[12,14]] }, | |
| 's': { width: 17, points: [[14,11],[13,13],[10,14],[7,14],[4,13],[3,11],[4,9],[6,8],[11,7],[13,6],[14,4],[14,3],[13,1],[10,0],[7,0],[4,1],[3,3]] }, | |
| 't': { width: 12, points: [[5,21],[5,4],[6,1],[8,0],[10,0],null,[2,14],[9,14]] }, | |
| 'u': { width: 19, points: [[4,14],[4,4],[5,1],[7,0],[10,0],[12,1],[15,4],null,[15,14],[15,0]] }, | |
| 'v': { width: 16, points: [[2,14],[8,0],null,[14,14],[8,0]] }, | |
| 'w': { width: 22, points: [[3,14],[7,0],null,[11,14],[7,0],null,[11,14],[15,0],null,[19,14],[15,0]] }, | |
| 'x': { width: 17, points: [[3,14],[14,0],null,[14,14],[3,0]] }, | |
| 'y': { width: 16, points: [[2,14],[8,0],null,[14,14],[8,0],[6,-4],[4,-6],[2,-7],[1,-7]] }, | |
| 'z': { width: 17, points: [[14,14],[3,0],null,[3,14],[14,14],null,[3,0],[14,0]] }, | |
| '{': { width: 14, points: [[9,25],[7,24],[6,23],[5,21],[5,19],[6,17],[7,16],[8,14],[8,12],[6,10],null,[7,24],[6,22],[6,20],[7,18],[8,17],[9,15],[9,13],[8,11],[4,9],[8,7],[9,5],[9,3],[8,1],[7,0],[6,-2],[6,-4],[7,-6],null,[6,8],[8,6],[8,4],[7,2],[6,1],[5,-1],[5,-3],[6,-5],[7,-6],[9,-7]] }, | |
| '|': { width: 8, points: [[4,25],[4,-7]] }, | |
| '}': { width: 14, points: [[5,25],[7,24],[8,23],[9,21],[9,19],[8,17],[7,16],[6,14],[6,12],[8,10],null,[7,24],[8,22],[8,20],[7,18],[6,17],[5,15],[5,13],[6,11],[10,9],[6,7],[5,5],[5,3],[6,1],[7,0],[8,-2],[8,-4],[7,-6],null,[8,8],[6,6],[6,4],[7,2],[8,1],[9,-1],[9,-3],[8,-5],[7,-6],[5,-7]] }, | |
| '~': { width: 24, points: [[3,6],[3,8],[4,11],[6,12],[8,12],[10,11],[14,8],[16,7],[18,7],[20,8],[21,10],null,[3,8],[4,10],[6,11],[8,11],[10,10],[14,7],[16,6],[18,6],[20,7],[21,10],[21,12]] }, | |
| }, | |
| specialchars: { | |
| 'pi': { width: 19, points: [[6,14],[6,0],null,[14,14],[14,0],null,[2,13],[6,16],[13,13],[17,16]] } | |
| }, | |
| /** Diacritics, used to draw accentuated letters */ | |
| diacritics: { | |
| '`': { entity: 'grave', points: [[7,22],[12,19]] }, | |
| '^': { entity: 'circ', points: [[5.5,19],[9.5,23],[12.5,19]] }, | |
| '~': { entity: 'tilde', points: [[4,18],[7,22],[10,18],[13,22]] } | |
| }, | |
| /** The default font styling */ | |
| style: { | |
| size: 8, // font height in pixels | |
| font: null, // not yet implemented | |
| color: '#000000', // | |
| weight: 1, // float, 1 for 'normal' | |
| halign: 'l', // l: left, r: right, c: center | |
| valign: 'b', // t: top, m: middle, b: bottom | |
| adjustAlign: false, // modifies the alignments if the angle is different from 0 to make the spin point always at the good position | |
| angle: 0, // in radians, anticlockwise | |
| tracking: 1, // space between the letters, float, 1 for 'normal' | |
| boundingBoxColor: '#ff0000', //null // color of the bounding box (null to hide), can be used for debug and font drawing | |
| originPointColor: '#000000' //null // color of the bounding box (null to hide), can be used for debug and font drawing | |
| }, | |
| debug: false, | |
| _bufferLexemes: {}, | |
| /** Get the letter data corresponding to a char | |
| * @param {String} ch - The char | |
| */ | |
| letter: function(ch) { | |
| return CanvasText.letters[ch]; | |
| }, | |
| parseLexemes: function(str) { | |
| if (CanvasText._bufferLexemes[str]) | |
| return CanvasText._bufferLexemes[str]; | |
| var i, c, matches = str.match(/&[A-Za-z]{2,5};|\s|./g); | |
| var result = [], chars = []; | |
| for (i = 0; i < matches.length; i++) { | |
| c = matches[i]; | |
| if (c.length == 1) | |
| chars.push(c); | |
| else { | |
| var entity = c.substring(1, c.length-1); | |
| if (CanvasText.specialchars[entity]) | |
| chars.push(entity); | |
| else | |
| chars = chars.concat(c.toArray()); | |
| } | |
| } | |
| for (i = 0; i < chars.length; i++) { | |
| c = chars[i]; | |
| if (c = CanvasText.letters[c] || CanvasText.specialchars[c]) | |
| result.push(c); | |
| } | |
| return CanvasText._bufferLexemes[str] = result.compact(); | |
| }, | |
| /** Get the font ascent for a given style | |
| * @param {Object} style - The reference style | |
| */ | |
| ascent: function(style) { | |
| style = style || {}; | |
| return (style.size || CanvasText.style.size); | |
| }, | |
| /** Get the font descent for a given style | |
| * @param {Object} style - The reference style | |
| * */ | |
| descent: function(style) { | |
| style = style || {}; | |
| return 7.0*(style.size || CanvasText.style.size)/25.0; | |
| }, | |
| /** Measure the text horizontal size | |
| * @param {String} str - The text | |
| * @param {Object} style - Text style | |
| * */ | |
| measure: function(str, style) { | |
| if (!str) return; | |
| style = style || {}; | |
| var i, width, lexemes = CanvasText.parseLexemes(str), | |
| total = 0; | |
| for (i = lexemes.length-1; i > -1; --i) { | |
| c = lexemes[i]; | |
| width = (c.diacritic) ? CanvasText.letter(c.letter).width : c.width; | |
| total += width * (style.tracking || CanvasText.style.tracking) * (style.size || CanvasText.style.size) / 25.0; | |
| } | |
| return total; | |
| }, | |
| getDimensions: function(str, style) { | |
| var width = CanvasText.measure(str, style), | |
| height = style.size || CanvasText.style.size, | |
| angle = style.angle || CanvasText.style.angle; | |
| if (style.angle == 0) return {width: width, height: height}; | |
| return { | |
| width: Math.abs(Math.cos(angle) * width) + Math.abs(Math.sin(angle) * height), | |
| height: Math.abs(Math.sin(angle) * width) + Math.abs(Math.cos(angle) * height) | |
| } | |
| }, | |
| getBestAlign: function(angle, style) { | |
| angle += CanvasText.getAngleFromAlign(style.halign, style.valign); | |
| var a = {h:'c', v:'m'}; | |
| if (Math.round(Math.cos(angle)*1000)/1000 != 0) | |
| a.h = (Math.cos(angle) > 0 ? 'r' : 'l'); | |
| if (Math.round(Math.sin(angle)*1000)/1000 != 0) | |
| a.v = (Math.sin(angle) > 0 ? 't' : 'b'); | |
| return a; | |
| }, | |
| getAngleFromAlign: function(halign, valign) { | |
| var pi = Math.PI, table = { | |
| 'rm': 0, | |
| 'rt': pi/4, | |
| 'ct': pi/2, | |
| 'lt': 3*(pi/4), | |
| 'lm': pi, | |
| 'lb': -3*(pi/4), | |
| 'cb': -pi/2, | |
| 'rb': -pi/4, | |
| 'cm': 0 | |
| } | |
| return table[halign+valign]; | |
| }, | |
| /** Draws serie of points at given coordinates | |
| * @param {Canvas context} ctx - The canvas context | |
| * @param {Array} points - The points to draw | |
| * @param {Number} x - The X coordinate | |
| * @param {Number} y - The Y coordinate | |
| * @param {Number} mag - The scale | |
| */ | |
| drawPoints: function (ctx, points, x, y, mag, offset) { | |
| var i, a, penUp = true, needStroke = 0; | |
| offset = offset || {x:0, y:0}; | |
| ctx.beginPath(); | |
| for (i = 0; i < points.length; i++) { | |
| a = points[i]; | |
| if (!a) { | |
| penUp = true; | |
| continue; | |
| } | |
| if (penUp) { | |
| ctx.moveTo(x + a[0]*mag + offset.x, y - a[1]*mag + offset.y); | |
| penUp = false; | |
| } | |
| else { | |
| ctx.lineTo(x + a[0]*mag + offset.x, y - a[1]*mag + offset.y); | |
| } | |
| } | |
| ctx.stroke(); | |
| }, | |
| /** Draws a text at given coordinates and with a given style | |
| * @param {Canvas context} ctx - The canvas context | |
| * @param {String} str - The text to draw | |
| * @param {Number} xOrig - The X coordinate | |
| * @param {Number} yOrig - The Y coordinate | |
| * @param {Object} style - The font style | |
| */ | |
| draw: function(ctx, str, xOrig, yOrig, style) { | |
| if (!str) return; | |
| style = style || CanvasText.style; | |
| style.halign = style.halign || CanvasText.style.halign; | |
| style.valign = style.valign || CanvasText.style.valign; | |
| style.angle = style.angle || CanvasText.style.angle; | |
| style.size = style.size || CanvasText.style.size; | |
| style.adjustAlign = style.adjustAlign || CanvasText.style.adjustAlign; | |
| var i, c, total = 0, | |
| mag = style.size / 25.0, | |
| x = 0, y = 0, | |
| lexemes = CanvasText.parseLexemes(str); | |
| var offset = {x:0, y:0}, | |
| measure = CanvasText.measure(str, style), | |
| align; | |
| if (style.adjustAlign) { | |
| align = CanvasText.getBestAlign(style.angle, style); | |
| style.halign = align.h; | |
| style.valign = align.v; | |
| } | |
| switch (style.halign) { | |
| case 'l': break; | |
| case 'c': offset.x = -measure / 2; break; | |
| case 'r': offset.x = -measure; break; | |
| } | |
| switch (style.valign) { | |
| case 'b': break; | |
| case 'm': offset.y = style.size / 2; break; | |
| case 't': offset.y = style.size; break; | |
| } | |
| ctx.save(); | |
| ctx.translate(xOrig, yOrig); | |
| ctx.rotate(style.angle); | |
| ctx.lineCap = "round"; | |
| ctx.lineWidth = 2.0 * mag * (style.weight || CanvasText.style.weight); | |
| ctx.strokeStyle = style.color || CanvasText.style.color; | |
| for (i = 0; i < lexemes.length; i++) { | |
| c = lexemes[i]; | |
| if (c.width == -1) { | |
| x = 0; | |
| y = style.size * 1.4; | |
| continue; | |
| } | |
| var points = c.points, | |
| width = c.width; | |
| if (c.diacritic) { | |
| var dia = CanvasText.diacritics[c.diacritic]; | |
| var char = CanvasText.letter(c.letter); | |
| CanvasText.drawPoints(ctx, dia.points, x, y - (c.letter.toUpperCase() == c.letter ? 3 : 0), mag, offset); | |
| points = char.points; | |
| width = char.width; | |
| } | |
| CanvasText.drawPoints(ctx, points, x, y, mag, offset); | |
| if (CanvasText.debug) { | |
| ctx.save(); | |
| ctx.lineJoin = "miter"; | |
| ctx.lineWidth = 0.5; | |
| ctx.strokeStyle = (style.boundingBoxColor || CanvasText.style.boundingBoxColor); | |
| ctx.strokeRect(x+offset.x, y+offset.y, width*mag, -style.size); | |
| ctx.fillStyle = (style.originPointColor || CanvasText.style.originPointColor); | |
| ctx.beginPath(); | |
| ctx.arc(0, 0, 1.5, 0, Math.PI*2, true); | |
| ctx.fill(); | |
| ctx.restore(); | |
| } | |
| x += width*mag*(style.tracking || CanvasText.style.tracking); | |
| } | |
| ctx.restore(); | |
| return total; | |
| }, | |
| /** Enables the text function for a Canvas context | |
| * @param {Canvas context} ctx - The canvas context | |
| */ | |
| enable: function(ctx) { | |
| ctx.drawText = function(text, x, y, style) { return CanvasText.draw(ctx, text, x, y, style); }; | |
| ctx.measureText = function(text, style) { return CanvasText.measure(text, style); }; | |
| ctx.getTextBounds = function(text, style) { return CanvasText.getDimensions(text, style); }; | |
| ctx.fontAscent = function(style) { return CanvasText.ascent(style); }; | |
| ctx.fontDescent = function(style) { return CanvasText.descent(style); }; | |
| } | |
| }; |
| // Copyright 2006 Google Inc. | |
| // | |
| // Licensed under the Apache License, Version 2.0 (the "License"); | |
| // you may not use this file except in compliance with the License. | |
| // You may obtain a copy of the License at | |
| // | |
| // http://www.apache.org/licenses/LICENSE-2.0 | |
| // | |
| // Unless required by applicable law or agreed to in writing, software | |
| // distributed under the License is distributed on an "AS IS" BASIS, | |
| // WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. | |
| // See the License for the specific language governing permissions and | |
| // limitations under the License. | |
| // Known Issues: | |
| // | |
| // * Patterns are not implemented. | |
| // * Radial gradient are not implemented. The VML version of these look very | |
| // different from the canvas one. | |
| // * Clipping paths are not implemented. | |
| // * Coordsize. The width and height attribute have higher priority than the | |
| // width and height style values which isn't correct. | |
| // * Painting mode isn't implemented. | |
| // * Canvas width/height should is using content-box by default. IE in | |
| // Quirks mode will draw the canvas using border-box. Either change your | |
| // doctype to HTML5 | |
| // (http://www.whatwg.org/specs/web-apps/current-work/#the-doctype) | |
| // or use Box Sizing Behavior from WebFX | |
| // (http://webfx.eae.net/dhtml/boxsizing/boxsizing.html) | |
| // * Non uniform scaling does not correctly scale strokes. | |
| // * Optimize. There is always room for speed improvements. | |
| // Only add this code if we do not already have a canvas implementation | |
| if (!document.createElement('canvas').getContext) { | |
| (function() { | |
| // alias some functions to make (compiled) code shorter | |
| var m = Math; | |
| var mr = m.round; | |
| var ms = m.sin; | |
| var mc = m.cos; | |
| var abs = m.abs; | |
| var sqrt = m.sqrt; | |
| // this is used for sub pixel precision | |
| var Z = 10; | |
| var Z2 = Z / 2; | |
| /** | |
| * This funtion is assigned to the <canvas> elements as element.getContext(). | |
| * @this {HTMLElement} | |
| * @return {CanvasRenderingContext2D_} | |
| */ | |
| function getContext() { | |
| return this.context_ || | |
| (this.context_ = new CanvasRenderingContext2D_(this)); | |
| } | |
| var slice = Array.prototype.slice; | |
| /** | |
| * Binds a function to an object. The returned function will always use the | |
| * passed in {@code obj} as {@code this}. | |
| * | |
| * Example: | |
| * | |
| * g = bind(f, obj, a, b) | |
| * g(c, d) // will do f.call(obj, a, b, c, d) | |
| * | |
| * @param {Function} f The function to bind the object to | |
| * @param {Object} obj The object that should act as this when the function | |
| * is called | |
| * @param {*} var_args Rest arguments that will be used as the initial | |
| * arguments when the function is called | |
| * @return {Function} A new function that has bound this | |
| */ | |
| function bind(f, obj, var_args) { | |
| var a = slice.call(arguments, 2); | |
| return function() { | |
| return f.apply(obj, a.concat(slice.call(arguments))); | |
| }; | |
| } | |
| var G_vmlCanvasManager_ = { | |
| init: function(opt_doc) { | |
| if (/MSIE/.test(navigator.userAgent) && !window.opera) { | |
| var doc = opt_doc || document; | |
| // Create a dummy element so that IE will allow canvas elements to be | |
| // recognized. | |
| doc.createElement('canvas'); | |
| doc.attachEvent('onreadystatechange', bind(this.init_, this, doc)); | |
| } | |
| }, | |
| init_: function(doc) { | |
| // create xmlns | |
| if (!doc.namespaces['g_vml_']) { | |
| doc.namespaces.add('g_vml_', 'urn:schemas-microsoft-com:vml', | |
| '#default#VML'); | |
| } | |
| if (!doc.namespaces['g_o_']) { | |
| doc.namespaces.add('g_o_', 'urn:schemas-microsoft-com:office:office', | |
| '#default#VML'); | |
| } | |
| // Setup default CSS. Only add one style sheet per document | |
| if (!doc.styleSheets['ex_canvas_']) { | |
| var ss = doc.createStyleSheet(); | |
| ss.owningElement.id = 'ex_canvas_'; | |
| ss.cssText = 'canvas{display:inline-block;overflow:hidden;' + | |
| // default size is 300x150 in Gecko and Opera | |
| 'text-align:left;width:300px;height:150px}' + | |
| 'g_vml_\\:*{behavior:url(#default#VML)}' + | |
| 'g_o_\\:*{behavior:url(#default#VML)}'; | |
| } | |
| // find all canvas elements | |
| var els = doc.getElementsByTagName('canvas'); | |
| for (var i = 0; i < els.length; i++) { | |
| this.initElement(els[i]); | |
| } | |
| }, | |
| /** | |
| * Public initializes a canvas element so that it can be used as canvas | |
| * element from now on. This is called automatically before the page is | |
| * loaded but if you are creating elements using createElement you need to | |
| * make sure this is called on the element. | |
| * @param {HTMLElement} el The canvas element to initialize. | |
| * @return {HTMLElement} the element that was created. | |
| */ | |
| initElement: function(el) { | |
| if (!el.getContext) { | |
| el.getContext = getContext; | |
| // Remove fallback content. There is no way to hide text nodes so we | |
| // just remove all childNodes. We could hide all elements and remove | |
| // text nodes but who really cares about the fallback content. | |
| el.innerHTML = ''; | |
| // do not use inline function because that will leak memory | |
| el.attachEvent('onpropertychange', onPropertyChange); | |
| el.attachEvent('onresize', onResize); | |
| var attrs = el.attributes; | |
| if (attrs.width && attrs.width.specified) { | |
| // TODO: use runtimeStyle and coordsize | |
| // el.getContext().setWidth_(attrs.width.nodeValue); | |
| el.style.width = attrs.width.nodeValue + 'px'; | |
| } else { | |
| el.width = el.clientWidth; | |
| } | |
| if (attrs.height && attrs.height.specified) { | |
| // TODO: use runtimeStyle and coordsize | |
| // el.getContext().setHeight_(attrs.height.nodeValue); | |
| el.style.height = attrs.height.nodeValue + 'px'; | |
| } else { | |
| el.height = el.clientHeight; | |
| } | |
| //el.getContext().setCoordsize_() | |
| } | |
| return el; | |
| } | |
| }; | |
| function onPropertyChange(e) { | |
| var el = e.srcElement; | |
| switch (e.propertyName) { | |
| case 'width': | |
| el.style.width = el.attributes.width.nodeValue + 'px'; | |
| el.getContext().clearRect(); | |
| break; | |
| case 'height': | |
| el.style.height = el.attributes.height.nodeValue + 'px'; | |
| el.getContext().clearRect(); | |
| break; | |
| } | |
| } | |
| function onResize(e) { | |
| var el = e.srcElement; | |
| if (el.firstChild) { | |
| el.firstChild.style.width = el.clientWidth + 'px'; | |
| el.firstChild.style.height = el.clientHeight + 'px'; | |
| } | |
| } | |
| G_vmlCanvasManager_.init(); | |
| // precompute "00" to "FF" | |
| var dec2hex = []; | |
| for (var i = 0; i < 16; i++) { | |
| for (var j = 0; j < 16; j++) { | |
| dec2hex[i * 16 + j] = i.toString(16) + j.toString(16); | |
| } | |
| } | |
| function createMatrixIdentity() { | |
| return [ | |
| [1, 0, 0], | |
| [0, 1, 0], | |
| [0, 0, 1] | |
| ]; | |
| } | |
| function matrixMultiply(m1, m2) { | |
| var result = createMatrixIdentity(); | |
| for (var x = 0; x < 3; x++) { | |
| for (var y = 0; y < 3; y++) { | |
| var sum = 0; | |
| for (var z = 0; z < 3; z++) { | |
| sum += m1[x][z] * m2[z][y]; | |
| } | |
| result[x][y] = sum; | |
| } | |
| } | |
| return result; | |
| } | |
| function copyState(o1, o2) { | |
| o2.fillStyle = o1.fillStyle; | |
| o2.lineCap = o1.lineCap; | |
| o2.lineJoin = o1.lineJoin; | |
| o2.lineWidth = o1.lineWidth; | |
| o2.miterLimit = o1.miterLimit; | |
| o2.shadowBlur = o1.shadowBlur; | |
| o2.shadowColor = o1.shadowColor; | |
| o2.shadowOffsetX = o1.shadowOffsetX; | |
| o2.shadowOffsetY = o1.shadowOffsetY; | |
| o2.strokeStyle = o1.strokeStyle; | |
| o2.globalAlpha = o1.globalAlpha; | |
| o2.arcScaleX_ = o1.arcScaleX_; | |
| o2.arcScaleY_ = o1.arcScaleY_; | |
| o2.lineScale_ = o1.lineScale_; | |
| } | |
| function processStyle(styleString) { | |
| var str, alpha = 1; | |
| styleString = String(styleString); | |
| if (styleString.substring(0, 3) == 'rgb') { | |
| var start = styleString.indexOf('(', 3); | |
| var end = styleString.indexOf(')', start + 1); | |
| var guts = styleString.substring(start + 1, end).split(','); | |
| str = '#'; | |
| for (var i = 0; i < 3; i++) { | |
| str += dec2hex[Number(guts[i])]; | |
| } | |
| if (guts.length == 4 && styleString.substr(3, 1) == 'a') { | |
| alpha = guts[3]; | |
| } | |
| } else { | |
| str = styleString; | |
| } | |
| return {color: str, alpha: alpha}; | |
| } | |
| function processLineCap(lineCap) { | |
| switch (lineCap) { | |
| case 'butt': | |
| return 'flat'; | |
| case 'round': | |
| return 'round'; | |
| case 'square': | |
| default: | |
| return 'square'; | |
| } | |
| } | |
| /** | |
| * This class implements CanvasRenderingContext2D interface as described by | |
| * the WHATWG. | |
| * @param {HTMLElement} surfaceElement The element that the 2D context should | |
| * be associated with | |
| */ | |
| function CanvasRenderingContext2D_(surfaceElement) { | |
| this.m_ = createMatrixIdentity(); | |
| this.mStack_ = []; | |
| this.aStack_ = []; | |
| this.currentPath_ = []; | |
| // Canvas context properties | |
| this.strokeStyle = '#000'; | |
| this.fillStyle = '#000'; | |
| this.lineWidth = 1; | |
| this.lineJoin = 'miter'; | |
| this.lineCap = 'butt'; | |
| this.miterLimit = Z * 1; | |
| this.globalAlpha = 1; | |
| this.canvas = surfaceElement; | |
| var el = surfaceElement.ownerDocument.createElement('div'); | |
| el.style.width = surfaceElement.clientWidth + 'px'; | |
| el.style.height = surfaceElement.clientHeight + 'px'; | |
| el.style.overflow = 'hidden'; | |
| el.style.position = 'absolute'; | |
| surfaceElement.appendChild(el); | |
| this.element_ = el; | |
| this.arcScaleX_ = 1; | |
| this.arcScaleY_ = 1; | |
| this.lineScale_ = 1; | |
| } | |
| var contextPrototype = CanvasRenderingContext2D_.prototype; | |
| contextPrototype.clearRect = function() { | |
| this.element_.innerHTML = ''; | |
| }; | |
| contextPrototype.beginPath = function() { | |
| // TODO: Branch current matrix so that save/restore has no effect | |
| // as per safari docs. | |
| this.currentPath_ = []; | |
| }; | |
| contextPrototype.moveTo = function(aX, aY) { | |
| var p = this.getCoords_(aX, aY); | |
| this.currentPath_.push({type: 'moveTo', x: p.x, y: p.y}); | |
| this.currentX_ = p.x; | |
| this.currentY_ = p.y; | |
| }; | |
| contextPrototype.lineTo = function(aX, aY) { | |
| var p = this.getCoords_(aX, aY); | |
| this.currentPath_.push({type: 'lineTo', x: p.x, y: p.y}); | |
| this.currentX_ = p.x; | |
| this.currentY_ = p.y; | |
| }; | |
| contextPrototype.bezierCurveTo = function(aCP1x, aCP1y, | |
| aCP2x, aCP2y, | |
| aX, aY) { | |
| var p = this.getCoords_(aX, aY); | |
| var cp1 = this.getCoords_(aCP1x, aCP1y); | |
| var cp2 = this.getCoords_(aCP2x, aCP2y); | |
| bezierCurveTo(this, cp1, cp2, p); | |
| }; | |
| // Helper function that takes the already fixed cordinates. | |
| function bezierCurveTo(self, cp1, cp2, p) { | |
| self.currentPath_.push({ | |
| type: 'bezierCurveTo', | |
| cp1x: cp1.x, | |
| cp1y: cp1.y, | |
| cp2x: cp2.x, | |
| cp2y: cp2.y, | |
| x: p.x, | |
| y: p.y | |
| }); | |
| self.currentX_ = p.x; | |
| self.currentY_ = p.y; | |
| } | |
| contextPrototype.quadraticCurveTo = function(aCPx, aCPy, aX, aY) { | |
| // the following is lifted almost directly from | |
| // http://developer.mozilla.org/en/docs/Canvas_tutorial:Drawing_shapes | |
| var cp = this.getCoords_(aCPx, aCPy); | |
| var p = this.getCoords_(aX, aY); | |
| var cp1 = { | |
| x: this.currentX_ + 2.0 / 3.0 * (cp.x - this.currentX_), | |
| y: this.currentY_ + 2.0 / 3.0 * (cp.y - this.currentY_) | |
| }; | |
| var cp2 = { | |
| x: cp1.x + (p.x - this.currentX_) / 3.0, | |
| y: cp1.y + (p.y - this.currentY_) / 3.0 | |
| }; | |
| bezierCurveTo(this, cp1, cp2, p); | |
| }; | |
| contextPrototype.arc = function(aX, aY, aRadius, | |
| aStartAngle, aEndAngle, aClockwise) { | |
| aRadius *= Z; | |
| var arcType = aClockwise ? 'at' : 'wa'; | |
| var xStart = aX + mc(aStartAngle) * aRadius - Z2; | |
| var yStart = aY + ms(aStartAngle) * aRadius - Z2; | |
| var xEnd = aX + mc(aEndAngle) * aRadius - Z2; | |
| var yEnd = aY + ms(aEndAngle) * aRadius - Z2; | |
| // IE won't render arches drawn counter clockwise if xStart == xEnd. | |
| if (xStart == xEnd && !aClockwise) { | |
| xStart += 0.125; // Offset xStart by 1/80 of a pixel. Use something | |
| // that can be represented in binary | |
| } | |
| var p = this.getCoords_(aX, aY); | |
| var pStart = this.getCoords_(xStart, yStart); | |
| var pEnd = this.getCoords_(xEnd, yEnd); | |
| this.currentPath_.push({type: arcType, | |
| x: p.x, | |
| y: p.y, | |
| radius: aRadius, | |
| xStart: pStart.x, | |
| yStart: pStart.y, | |
| xEnd: pEnd.x, | |
| yEnd: pEnd.y}); | |
| }; | |
| contextPrototype.rect = function(aX, aY, aWidth, aHeight) { | |
| this.moveTo(aX, aY); | |
| this.lineTo(aX + aWidth, aY); | |
| this.lineTo(aX + aWidth, aY + aHeight); | |
| this.lineTo(aX, aY + aHeight); | |
| this.closePath(); | |
| }; | |
| contextPrototype.strokeRect = function(aX, aY, aWidth, aHeight) { | |
| var oldPath = this.currentPath_; | |
| this.beginPath(); | |
| this.moveTo(aX, aY); | |
| this.lineTo(aX + aWidth, aY); | |
| this.lineTo(aX + aWidth, aY + aHeight); | |
| this.lineTo(aX, aY + aHeight); | |
| this.closePath(); | |
| this.stroke(); | |
| this.currentPath_ = oldPath; | |
| }; | |
| contextPrototype.fillRect = function(aX, aY, aWidth, aHeight) { | |
| var oldPath = this.currentPath_; | |
| this.beginPath(); | |
| this.moveTo(aX, aY); | |
| this.lineTo(aX + aWidth, aY); | |
| this.lineTo(aX + aWidth, aY + aHeight); | |
| this.lineTo(aX, aY + aHeight); | |
| this.closePath(); | |
| this.fill(); | |
| this.currentPath_ = oldPath; | |
| }; | |
| contextPrototype.createLinearGradient = function(aX0, aY0, aX1, aY1) { | |
| var gradient = new CanvasGradient_('gradient'); | |
| gradient.x0_ = aX0; | |
| gradient.y0_ = aY0; | |
| gradient.x1_ = aX1; | |
| gradient.y1_ = aY1; | |
| return gradient; | |
| }; | |
| contextPrototype.createRadialGradient = function(aX0, aY0, aR0, | |
| aX1, aY1, aR1) { | |
| var gradient = new CanvasGradient_('gradientradial'); | |
| gradient.x0_ = aX0; | |
| gradient.y0_ = aY0; | |
| gradient.r0_ = aR0; | |
| gradient.x1_ = aX1; | |
| gradient.y1_ = aY1; | |
| gradient.r1_ = aR1; | |
| return gradient; | |
| }; | |
| contextPrototype.drawImage = function(image, var_args) { | |
| var dx, dy, dw, dh, sx, sy, sw, sh; | |
| // to find the original width we overide the width and height | |
| var oldRuntimeWidth = image.runtimeStyle.width; | |
| var oldRuntimeHeight = image.runtimeStyle.height; | |
| image.runtimeStyle.width = 'auto'; | |
| image.runtimeStyle.height = 'auto'; | |
| // get the original size | |
| var w = image.width; | |
| var h = image.height; | |
| // and remove overides | |
| image.runtimeStyle.width = oldRuntimeWidth; | |
| image.runtimeStyle.height = oldRuntimeHeight; | |
| if (arguments.length == 3) { | |
| dx = arguments[1]; | |
| dy = arguments[2]; | |
| sx = sy = 0; | |
| sw = dw = w; | |
| sh = dh = h; | |
| } else if (arguments.length == 5) { | |
| dx = arguments[1]; | |
| dy = arguments[2]; | |
| dw = arguments[3]; | |
| dh = arguments[4]; | |
| sx = sy = 0; | |
| sw = w; | |
| sh = h; | |
| } else if (arguments.length == 9) { | |
| sx = arguments[1]; | |
| sy = arguments[2]; | |
| sw = arguments[3]; | |
| sh = arguments[4]; | |
| dx = arguments[5]; | |
| dy = arguments[6]; | |
| dw = arguments[7]; | |
| dh = arguments[8]; | |
| } else { | |
| throw Error('Invalid number of arguments'); | |
| } | |
| var d = this.getCoords_(dx, dy); | |
| var w2 = sw / 2; | |
| var h2 = sh / 2; | |
| var vmlStr = []; | |
| var W = 10; | |
| var H = 10; | |
| // For some reason that I've now forgotten, using divs didn't work | |
| vmlStr.push(' <g_vml_:group', | |
| ' coordsize="', Z * W, ',', Z * H, '"', | |
| ' coordorigin="0,0"' , | |
| ' style="width:', W, 'px;height:', H, 'px;position:absolute;'); | |
| // If filters are necessary (rotation exists), create them | |
| // filters are bog-slow, so only create them if abbsolutely necessary | |
| // The following check doesn't account for skews (which don't exist | |
| // in the canvas spec (yet) anyway. | |
| if (this.m_[0][0] != 1 || this.m_[0][1]) { | |
| var filter = []; | |
| // Note the 12/21 reversal | |
| filter.push('M11=', this.m_[0][0], ',', | |
| 'M12=', this.m_[1][0], ',', | |
| 'M21=', this.m_[0][1], ',', | |
| 'M22=', this.m_[1][1], ',', | |
| 'Dx=', mr(d.x / Z), ',', | |
| 'Dy=', mr(d.y / Z), ''); | |
| // Bounding box calculation (need to minimize displayed area so that | |
| // filters don't waste time on unused pixels. | |
| var max = d; | |
| var c2 = this.getCoords_(dx + dw, dy); | |
| var c3 = this.getCoords_(dx, dy + dh); | |
| var c4 = this.getCoords_(dx + dw, dy + dh); | |
| max.x = m.max(max.x, c2.x, c3.x, c4.x); | |
| max.y = m.max(max.y, c2.y, c3.y, c4.y); | |
| vmlStr.push('padding:0 ', mr(max.x / Z), 'px ', mr(max.y / Z), | |
| 'px 0;filter:progid:DXImageTransform.Microsoft.Matrix(', | |
| filter.join(''), ", sizingmethod='clip');") | |
| } else { | |
| vmlStr.push('top:', mr(d.y / Z), 'px;left:', mr(d.x / Z), 'px;'); | |
| } | |
| vmlStr.push(' ">' , | |
| '<g_vml_:image src="', image.src, '"', | |
| ' style="width:', Z * dw, 'px;', | |
| ' height:', Z * dh, 'px;"', | |
| ' cropleft="', sx / w, '"', | |
| ' croptop="', sy / h, '"', | |
| ' cropright="', (w - sx - sw) / w, '"', | |
| ' cropbottom="', (h - sy - sh) / h, '"', | |
| ' />', | |
| '</g_vml_:group>'); | |
| this.element_.insertAdjacentHTML('BeforeEnd', | |
| vmlStr.join('')); | |
| }; | |
| contextPrototype.stroke = function(aFill) { | |
| var lineStr = []; | |
| var lineOpen = false; | |
| var a = processStyle(aFill ? this.fillStyle : this.strokeStyle); | |
| var color = a.color; | |
| var opacity = a.alpha * this.globalAlpha; | |
| var W = 10; | |
| var H = 10; | |
| lineStr.push('<g_vml_:shape', | |
| ' filled="', !!aFill, '"', | |
| ' style="position:absolute;width:', W, 'px;height:', H, 'px;"', | |
| ' coordorigin="0 0" coordsize="', Z * W, ' ', Z * H, '"', | |
| ' stroked="', !aFill, '"', | |
| ' path="'); | |
| var newSeq = false; | |
| var min = {x: null, y: null}; | |
| var max = {x: null, y: null}; | |
| for (var i = 0; i < this.currentPath_.length; i++) { | |
| var p = this.currentPath_[i]; | |
| var c; | |
| switch (p.type) { | |
| case 'moveTo': | |
| c = p; | |
| lineStr.push(' m ', mr(p.x), ',', mr(p.y)); | |
| break; | |
| case 'lineTo': | |
| lineStr.push(' l ', mr(p.x), ',', mr(p.y)); | |
| break; | |
| case 'close': | |
| lineStr.push(' x '); | |
| p = null; | |
| break; | |
| case 'bezierCurveTo': | |
| lineStr.push(' c ', | |
| mr(p.cp1x), ',', mr(p.cp1y), ',', | |
| mr(p.cp2x), ',', mr(p.cp2y), ',', | |
| mr(p.x), ',', mr(p.y)); | |
| break; | |
| case 'at': | |
| case 'wa': | |
| lineStr.push(' ', p.type, ' ', | |
| mr(p.x - this.arcScaleX_ * p.radius), ',', | |
| mr(p.y - this.arcScaleY_ * p.radius), ' ', | |
| mr(p.x + this.arcScaleX_ * p.radius), ',', | |
| mr(p.y + this.arcScaleY_ * p.radius), ' ', | |
| mr(p.xStart), ',', mr(p.yStart), ' ', | |
| mr(p.xEnd), ',', mr(p.yEnd)); | |
| break; | |
| } | |
| // TODO: Following is broken for curves due to | |
| // move to proper paths. | |
| // Figure out dimensions so we can do gradient fills | |
| // properly | |
| if (p) { | |
| if (min.x == null || p.x < min.x) { | |
| min.x = p.x; | |
| } | |
| if (max.x == null || p.x > max.x) { | |
| max.x = p.x; | |
| } | |
| if (min.y == null || p.y < min.y) { | |
| min.y = p.y; | |
| } | |
| if (max.y == null || p.y > max.y) { | |
| max.y = p.y; | |
| } | |
| } | |
| } | |
| lineStr.push(' ">'); | |
| if (!aFill) { | |
| var lineWidth = this.lineScale_ * this.lineWidth; | |
| // VML cannot correctly render a line if the width is less than 1px. | |
| // In that case, we dilute the color to make the line look thinner. | |
| if (lineWidth < 1) { | |
| opacity *= lineWidth; | |
| } | |
| lineStr.push( | |
| '<g_vml_:stroke', | |
| ' opacity="', opacity, '"', | |
| ' joinstyle="', this.lineJoin, '"', | |
| ' miterlimit="', this.miterLimit, '"', | |
| ' endcap="', processLineCap(this.lineCap), '"', | |
| ' weight="', lineWidth, 'px"', | |
| ' color="', color, '" />' | |
| ); | |
| } else if (typeof this.fillStyle == 'object') { | |
| var fillStyle = this.fillStyle; | |
| var angle = 0; | |
| var focus = {x: 0, y: 0}; | |
| // additional offset | |
| var shift = 0; | |
| // scale factor for offset | |
| var expansion = 1; | |
| if (fillStyle.type_ == 'gradient') { | |
| var x0 = fillStyle.x0_ / this.arcScaleX_; | |
| var y0 = fillStyle.y0_ / this.arcScaleY_; | |
| var x1 = fillStyle.x1_ / this.arcScaleX_; | |
| var y1 = fillStyle.y1_ / this.arcScaleY_; | |
| var p0 = this.getCoords_(x0, y0); | |
| var p1 = this.getCoords_(x1, y1); | |
| var dx = p1.x - p0.x; | |
| var dy = p1.y - p0.y; | |
| angle = Math.atan2(dx, dy) * 180 / Math.PI; | |
| // The angle should be a non-negative number. | |
| if (angle < 0) { | |
| angle += 360; | |
| } | |
| // Very small angles produce an unexpected result because they are | |
| // converted to a scientific notation string. | |
| if (angle < 1e-6) { | |
| angle = 0; | |
| } | |
| } else { | |
| var p0 = this.getCoords_(fillStyle.x0_, fillStyle.y0_); | |
| var width = max.x - min.x; | |
| var height = max.y - min.y; | |
| focus = { | |
| x: (p0.x - min.x) / width, | |
| y: (p0.y - min.y) / height | |
| }; | |
| width /= this.arcScaleX_ * Z; | |
| height /= this.arcScaleY_ * Z; | |
| var dimension = m.max(width, height); | |
| shift = 2 * fillStyle.r0_ / dimension; | |
| expansion = 2 * fillStyle.r1_ / dimension - shift; | |
| } | |
| // We need to sort the color stops in ascending order by offset, | |
| // otherwise IE won't interpret it correctly. | |
| var stops = fillStyle.colors_; | |
| stops.sort(function(cs1, cs2) { | |
| return cs1.offset - cs2.offset; | |
| }); | |
| var length = stops.length; | |
| var color1 = stops[0].color; | |
| var color2 = stops[length - 1].color; | |
| var opacity1 = stops[0].alpha * this.globalAlpha; | |
| var opacity2 = stops[length - 1].alpha * this.globalAlpha; | |
| var colors = []; | |
| for (var i = 0; i < length; i++) { | |
| var stop = stops[i]; | |
| colors.push(stop.offset * expansion + shift + ' ' + stop.color); | |
| } | |
| // When colors attribute is used, the meanings of opacity and o:opacity2 | |
| // are reversed. | |
| lineStr.push('<g_vml_:fill type="', fillStyle.type_, '"', | |
| ' method="none" focus="100%"', | |
| ' color="', color1, '"', | |
| ' color2="', color2, '"', | |
| ' colors="', colors.join(','), '"', | |
| ' opacity="', opacity2, '"', | |
| ' g_o_:opacity2="', opacity1, '"', | |
| ' angle="', angle, '"', | |
| ' focusposition="', focus.x, ',', focus.y, '" />'); | |
| } else { | |
| lineStr.push('<g_vml_:fill color="', color, '" opacity="', opacity, | |
| '" />'); | |
| } | |
| lineStr.push('</g_vml_:shape>'); | |
| this.element_.insertAdjacentHTML('beforeEnd', lineStr.join('')); | |
| }; | |
| contextPrototype.fill = function() { | |
| this.stroke(true); | |
| } | |
| contextPrototype.closePath = function() { | |
| this.currentPath_.push({type: 'close'}); | |
| }; | |
| /** | |
| * @private | |
| */ | |
| contextPrototype.getCoords_ = function(aX, aY) { | |
| var m = this.m_; | |
| return { | |
| x: Z * (aX * m[0][0] + aY * m[1][0] + m[2][0]) - Z2, | |
| y: Z * (aX * m[0][1] + aY * m[1][1] + m[2][1]) - Z2 | |
| } | |
| }; | |
| contextPrototype.save = function() { | |
| var o = {}; | |
| copyState(this, o); | |
| this.aStack_.push(o); | |
| this.mStack_.push(this.m_); | |
| this.m_ = matrixMultiply(createMatrixIdentity(), this.m_); | |
| }; | |
| contextPrototype.restore = function() { | |
| copyState(this.aStack_.pop(), this); | |
| this.m_ = this.mStack_.pop(); | |
| }; | |
| contextPrototype.translate = function(aX, aY) { | |
| var m1 = [ | |
| [1, 0, 0], | |
| [0, 1, 0], | |
| [aX, aY, 1] | |
| ]; | |
| this.m_ = matrixMultiply(m1, this.m_); | |
| }; | |
| contextPrototype.rotate = function(aRot) { | |
| var c = mc(aRot); | |
| var s = ms(aRot); | |
| var m1 = [ | |
| [c, s, 0], | |
| [-s, c, 0], | |
| [0, 0, 1] | |
| ]; | |
| this.m_ = matrixMultiply(m1, this.m_); | |
| }; | |
| contextPrototype.scale = function(aX, aY) { | |
| this.arcScaleX_ *= aX; | |
| this.arcScaleY_ *= aY; | |
| var m1 = [ | |
| [aX, 0, 0], | |
| [0, aY, 0], | |
| [0, 0, 1] | |
| ]; | |
| var m = this.m_ = matrixMultiply(m1, this.m_); | |
| // Get the line scale. | |
| // Determinant of this.m_ means how much the area is enlarged by the | |
| // transformation. So its square root can be used as a scale factor | |
| // for width. | |
| var det = m[0][0] * m[1][1] - m[0][1] * m[1][0]; | |
| this.lineScale_ = sqrt(abs(det)); | |
| }; | |
| /******** STUBS ********/ | |
| contextPrototype.clip = function() { | |
| // TODO: Implement | |
| }; | |
| contextPrototype.arcTo = function() { | |
| // TODO: Implement | |
| }; | |
| contextPrototype.createPattern = function() { | |
| return new CanvasPattern_; | |
| }; | |
| // Gradient / Pattern Stubs | |
| function CanvasGradient_(aType) { | |
| this.type_ = aType; | |
| this.x0_ = 0; | |
| this.y0_ = 0; | |
| this.r0_ = 0; | |
| this.x1_ = 0; | |
| this.y1_ = 0; | |
| this.r1_ = 0; | |
| this.colors_ = []; | |
| } | |
| CanvasGradient_.prototype.addColorStop = function(aOffset, aColor) { | |
| aColor = processStyle(aColor); | |
| this.colors_.push({offset: aOffset, | |
| color: aColor.color, | |
| alpha: aColor.alpha}); | |
| }; | |
| function CanvasPattern_() {} | |
| // set up externs | |
| G_vmlCanvasManager = G_vmlCanvasManager_; | |
| CanvasRenderingContext2D = CanvasRenderingContext2D_; | |
| CanvasGradient = CanvasGradient_; | |
| CanvasPattern = CanvasPattern_; | |
| })(); | |
| } // if | |
| /* Prototype JavaScript framework, version 1.6.0.2 | |
| * (c) 2005-2008 Sam Stephenson | |
| * | |
| * Prototype is freely distributable under the terms of an MIT-style license. | |
| * For details, see the Prototype web site: http://www.prototypejs.org/ | |
| * | |
| *--------------------------------------------------------------------------*/ | |
| var Prototype = { | |
| Version: '1.6.0.2', | |
| Browser: { | |
| IE: !!(window.attachEvent && !window.opera), | |
| Opera: !!window.opera, | |
| WebKit: navigator.userAgent.indexOf('AppleWebKit/') > -1, | |
| Gecko: navigator.userAgent.indexOf('Gecko') > -1 && navigator.userAgent.indexOf('KHTML') == -1, | |
| MobileSafari: !!navigator.userAgent.match(/Apple.*Mobile.*Safari/) | |
| }, | |
| BrowserFeatures: { | |
| XPath: !!document.evaluate, | |
| ElementExtensions: !!window.HTMLElement, | |
| SpecificElementExtensions: | |
| document.createElement('div').__proto__ && | |
| document.createElement('div').__proto__ !== | |
| document.createElement('form').__proto__ | |
| }, | |
| ScriptFragment: '<script[^>]*>([\\S\\s]*?)<\/script>', | |
| JSONFilter: /^\/\*-secure-([\s\S]*)\*\/\s*$/, | |
| emptyFunction: function() { }, | |
| K: function(x) { return x } | |
| }; | |
| if (Prototype.Browser.MobileSafari) | |
| Prototype.BrowserFeatures.SpecificElementExtensions = false; | |
| /* Based on Alex Arnell's inheritance implementation. */ | |
| var Class = { | |
| create: function() { | |
| var parent = null, properties = $A(arguments); | |
| if (Object.isFunction(properties[0])) | |
| parent = properties.shift(); | |
| function klass() { | |
| this.initialize.apply(this, arguments); | |
| } | |
| Object.extend(klass, Class.Methods); | |
| klass.superclass = parent; | |
| klass.subclasses = []; | |
| if (parent) { | |
| var subclass = function() { }; | |
| subclass.prototype = parent.prototype; | |
| klass.prototype = new subclass; | |
| parent.subclasses.push(klass); | |
| } | |
| for (var i = 0; i < properties.length; i++) | |
| klass.addMethods(properties[i]); | |
| if (!klass.prototype.initialize) | |
| klass.prototype.initialize = Prototype.emptyFunction; | |
| klass.prototype.constructor = klass; | |
| return klass; | |
| } | |
| }; | |
| Class.Methods = { | |
| addMethods: function(source) { | |
| var ancestor = this.superclass && this.superclass.prototype; | |
| var properties = Object.keys(source); | |
| if (!Object.keys({ toString: true }).length) | |
| properties.push("toString", "valueOf"); | |
| for (var i = 0, length = properties.length; i < length; i++) { | |
| var property = properties[i], value = source[property]; | |
| if (ancestor && Object.isFunction(value) && | |
| value.argumentNames().first() == "$super") { | |
| var method = value, value = Object.extend((function(m) { | |
| return function() { return ancestor[m].apply(this, arguments) }; | |
| })(property).wrap(method), { | |
| valueOf: function() { return method }, | |
| toString: function() { return method.toString() } | |
| }); | |
| } | |
| this.prototype[property] = value; | |
| } | |
| return this; | |
| } | |
| }; | |
| var Abstract = { }; | |
| Object.extend = function(destination, source) { | |
| for (var property in source) | |
| destination[property] = source[property]; | |
| return destination; | |
| }; | |
| Object.extend(Object, { | |
| inspect: function(object) { | |
| try { | |
| if (Object.isUndefined(object)) return 'undefined'; | |
| if (object === null) return 'null'; | |
| return object.inspect ? object.inspect() : String(object); | |
| } catch (e) { | |
| if (e instanceof RangeError) return '...'; | |
| throw e; | |
| } | |
| }, | |
| toJSON: function(object) { | |
| var type = typeof object; | |
| switch (type) { | |
| case 'undefined': | |
| case 'function': | |
| case 'unknown': return; | |
| case 'boolean': return object.toString(); | |
| } | |
| if (object === null) return 'null'; | |
| if (object.toJSON) return object.toJSON(); | |
| if (Object.isElement(object)) return; | |
| var results = []; | |
| for (var property in object) { | |
| var value = Object.toJSON(object[property]); | |
| if (!Object.isUndefined(value)) | |
| results.push(property.toJSON() + ': ' + value); | |
| } | |
| return '{' + results.join(', ') + '}'; | |
| }, | |
| toQueryString: function(object) { | |
| return $H(object).toQueryString(); | |
| }, | |
| toHTML: function(object) { | |
| return object && object.toHTML ? object.toHTML() : String.interpret(object); | |
| }, | |
| keys: function(object) { | |
| var keys = []; | |
| for (var property in object) | |
| keys.push(property); | |
| return keys; | |
| }, | |
| values: function(object) { | |
| var values = []; | |
| for (var property in object) | |
| values.push(object[property]); | |
| return values; | |
| }, | |
| clone: function(object) { | |
| return Object.extend({ }, object); | |
| }, | |
| isElement: function(object) { | |
| return object && object.nodeType == 1; | |
| }, | |
| isArray: function(object) { | |
| return object != null && typeof object == "object" && | |
| 'splice' in object && 'join' in object; | |
| }, | |
| isHash: function(object) { | |
| return object instanceof Hash; | |
| }, | |
| isFunction: function(object) { | |
| return typeof object == "function"; | |
| }, | |
| isString: function(object) { | |
| return typeof object == "string"; | |
| }, | |
| isNumber: function(object) { | |
| return typeof object == "number"; | |
| }, | |
| isUndefined: function(object) { | |
| return typeof object == "undefined"; | |
| } | |
| }); | |
| Object.extend(Function.prototype, { | |
| argumentNames: function() { | |
| var names = this.toString().match(/^[\s\(]*function[^(]*\((.*?)\)/)[1].split(",").invoke("strip"); | |
| return names.length == 1 && !names[0] ? [] : names; | |
| }, | |
| bind: function() { | |
| if (arguments.length < 2 && Object.isUndefined(arguments[0])) return this; | |
| var __method = this, args = $A(arguments), object = args.shift(); | |
| return function() { | |
| return __method.apply(object, args.concat($A(arguments))); | |
| } | |
| }, | |
| bindAsEventListener: function() { | |
| var __method = this, args = $A(arguments), object = args.shift(); | |
| return function(event) { | |
| return __method.apply(object, [event || window.event].concat(args)); | |
| } | |
| }, | |
| curry: function() { | |
| if (!arguments.length) return this; | |
| var __method = this, args = $A(arguments); | |
| return function() { | |
| return __method.apply(this, args.concat($A(arguments))); | |
| } | |
| }, | |
| delay: function() { | |
| var __method = this, args = $A(arguments), timeout = args.shift() * 1000; | |
| return window.setTimeout(function() { | |
| return __method.apply(__method, args); | |
| }, timeout); | |
| }, | |
| wrap: function(wrapper) { | |
| var __method = this; | |
| return function() { | |
| return wrapper.apply(this, [__method.bind(this)].concat($A(arguments))); | |
| } | |
| }, | |
| methodize: function() { | |
| if (this._methodized) return this._methodized; | |
| var __method = this; | |
| return this._methodized = function() { | |
| return __method.apply(null, [this].concat($A(arguments))); | |
| }; | |
| } | |
| }); | |
| Function.prototype.defer = Function.prototype.delay.curry(0.01); | |
| Date.prototype.toJSON = function() { | |
| return '"' + this.getUTCFullYear() + '-' + | |
| (this.getUTCMonth() + 1).toPaddedString(2) + '-' + | |
| this.getUTCDate().toPaddedString(2) + 'T' + | |
| this.getUTCHours().toPaddedString(2) + ':' + | |
| this.getUTCMinutes().toPaddedString(2) + ':' + | |
| this.getUTCSeconds().toPaddedString(2) + 'Z"'; | |
| }; | |
| var Try = { | |
| these: function() { | |
| var returnValue; | |
| for (var i = 0, length = arguments.length; i < length; i++) { | |
| var lambda = arguments[i]; | |
| try { | |
| returnValue = lambda(); | |
| break; | |
| } catch (e) { } | |
| } | |
| return returnValue; | |
| } | |
| }; | |
| RegExp.prototype.match = RegExp.prototype.test; | |
| RegExp.escape = function(str) { | |
| return String(str).replace(/([.*+?^=!:${}()|[\]\/\\])/g, '\\$1'); | |
| }; | |
| /*--------------------------------------------------------------------------*/ | |
| var PeriodicalExecuter = Class.create({ | |
| initialize: function(callback, frequency) { | |
| this.callback = callback; | |
| this.frequency = frequency; | |
| this.currentlyExecuting = false; | |
| this.registerCallback(); | |
| }, | |
| registerCallback: function() { | |
| this.timer = setInterval(this.onTimerEvent.bind(this), this.frequency * 1000); | |
| }, | |
| execute: function() { | |
| this.callback(this); | |
| }, | |
| stop: function() { | |
| if (!this.timer) return; | |
| clearInterval(this.timer); | |
| this.timer = null; | |
| }, | |
| onTimerEvent: function() { | |
| if (!this.currentlyExecuting) { | |
| try { | |
| this.currentlyExecuting = true; | |
| this.execute(); | |
| } finally { | |
| this.currentlyExecuting = false; | |
| } | |
| } | |
| } | |
| }); | |
| Object.extend(String, { | |
| interpret: function(value) { | |
| return value == null ? '' : String(value); | |
| }, | |
| specialChar: { | |
| '\b': '\\b', | |
| '\t': '\\t', | |
| '\n': '\\n', | |
| '\f': '\\f', | |
| '\r': '\\r', | |
| '\\': '\\\\' | |
| } | |
| }); | |
| Object.extend(String.prototype, { | |
| gsub: function(pattern, replacement) { | |
| var result = '', source = this, match; | |
| replacement = arguments.callee.prepareReplacement(replacement); | |
| while (source.length > 0) { | |
| if (match = source.match(pattern)) { | |
| result += source.slice(0, match.index); | |
| result += String.interpret(replacement(match)); | |
| source = source.slice(match.index + match[0].length); | |
| } else { | |
| result += source, source = ''; | |
| } | |
| } | |
| return result; | |
| }, | |
| sub: function(pattern, replacement, count) { | |
| replacement = this.gsub.prepareReplacement(replacement); | |
| count = Object.isUndefined(count) ? 1 : count; | |
| return this.gsub(pattern, function(match) { | |
| if (--count < 0) return match[0]; | |
| return replacement(match); | |
| }); | |
| }, | |
| scan: function(pattern, iterator) { | |
| this.gsub(pattern, iterator); | |
| return String(this); | |
| }, | |
| truncate: function(length, truncation) { | |
| length = length || 30; | |
| truncation = Object.isUndefined(truncation) ? '...' : truncation; | |
| return this.length > length ? | |
| this.slice(0, length - truncation.length) + truncation : String(this); | |
| }, | |
| strip: function() { | |
| return this.replace(/^\s+/, '').replace(/\s+$/, ''); | |
| }, | |
| stripTags: function() { | |
| return this.replace(/<\/?[^>]+>/gi, ''); | |
| }, | |
| stripScripts: function() { | |
| return this.replace(new RegExp(Prototype.ScriptFragment, 'img'), ''); | |
| }, | |
| extractScripts: function() { | |
| var matchAll = new RegExp(Prototype.ScriptFragment, 'img'); | |
| var matchOne = new RegExp(Prototype.ScriptFragment, 'im'); | |
| return (this.match(matchAll) || []).map(function(scriptTag) { | |
| return (scriptTag.match(matchOne) || ['', ''])[1]; | |
| }); | |
| }, | |
| evalScripts: function() { | |
| return this.extractScripts().map(function(script) { return eval(script) }); | |
| }, | |
| escapeHTML: function() { | |
| var self = arguments.callee; | |
| self.text.data = this; | |
| return self.div.innerHTML; | |
| }, | |
| unescapeHTML: function() { | |
| var div = new Element('div'); | |
| div.innerHTML = this.stripTags(); | |
| return div.childNodes[0] ? (div.childNodes.length > 1 ? | |
| $A(div.childNodes).inject('', function(memo, node) { return memo+node.nodeValue }) : | |
| div.childNodes[0].nodeValue) : ''; | |
| }, | |
| toQueryParams: function(separator) { | |
| var match = this.strip().match(/([^?#]*)(#.*)?$/); | |
| if (!match) return { }; | |
| return match[1].split(separator || '&').inject({ }, function(hash, pair) { | |
| if ((pair = pair.split('='))[0]) { | |
| var key = decodeURIComponent(pair.shift()); | |
| var value = pair.length > 1 ? pair.join('=') : pair[0]; | |
| if (value != undefined) value = decodeURIComponent(value); | |
| if (key in hash) { | |
| if (!Object.isArray(hash[key])) hash[key] = [hash[key]]; | |
| hash[key].push(value); | |
| } | |
| else hash[key] = value; | |
| } | |
| return hash; | |
| }); | |
| }, | |
| toArray: function() { | |
| return this.split(''); | |
| }, | |
| succ: function() { | |
| return this.slice(0, this.length - 1) + | |
| String.fromCharCode(this.charCodeAt(this.length - 1) + 1); | |
| }, | |
| times: function(count) { | |
| return count < 1 ? '' : new Array(count + 1).join(this); | |
| }, | |
| camelize: function() { | |
| var parts = this.split('-'), len = parts.length; | |
| if (len == 1) return parts[0]; | |
| var camelized = this.charAt(0) == '-' | |
| ? parts[0].charAt(0).toUpperCase() + parts[0].substring(1) | |
| : parts[0]; | |
| for (var i = 1; i < len; i++) | |
| camelized += parts[i].charAt(0).toUpperCase() + parts[i].substring(1); | |
| return camelized; | |
| }, | |
| capitalize: function() { | |
| return this.charAt(0).toUpperCase() + this.substring(1).toLowerCase(); | |
| }, | |
| underscore: function() { | |
| return this.gsub(/::/, '/').gsub(/([A-Z]+)([A-Z][a-z])/,'#{1}_#{2}').gsub(/([a-z\d])([A-Z])/,'#{1}_#{2}').gsub(/-/,'_').toLowerCase(); | |
| }, | |
| dasherize: function() { | |
| return this.gsub(/_/,'-'); | |
| }, | |
| inspect: function(useDoubleQuotes) { | |
| var escapedString = this.gsub(/[\x00-\x1f\\]/, function(match) { | |
| var character = String.specialChar[match[0]]; | |
| return character ? character : '\\u00' + match[0].charCodeAt().toPaddedString(2, 16); | |
| }); | |
| if (useDoubleQuotes) return '"' + escapedString.replace(/"/g, '\\"') + '"'; | |
| return "'" + escapedString.replace(/'/g, '\\\'') + "'"; | |
| }, | |
| toJSON: function() { | |
| return this.inspect(true); | |
| }, | |
| unfilterJSON: function(filter) { | |
| return this.sub(filter || Prototype.JSONFilter, '#{1}'); | |
| }, | |
| isJSON: function() { | |
| var str = this; | |
| if (str.blank()) return false; | |
| str = this.replace(/\\./g, '@').replace(/"[^"\\\n\r]*"/g, ''); | |
| return (/^[,:{}\[\]0-9.\-+Eaeflnr-u \n\r\t]*$/).test(str); | |
| }, | |
| evalJSON: function(sanitize) { | |
| var json = this.unfilterJSON(); | |
| try { | |
| if (!sanitize || json.isJSON()) return eval('(' + json + ')'); | |
| } catch (e) { } | |
| throw new SyntaxError('Badly formed JSON string: ' + this.inspect()); | |
| }, | |
| include: function(pattern) { | |
| return this.indexOf(pattern) > -1; | |
| }, | |
| startsWith: function(pattern) { | |
| return this.indexOf(pattern) === 0; | |
| }, | |
| endsWith: function(pattern) { | |
| var d = this.length - pattern.length; | |
| return d >= 0 && this.lastIndexOf(pattern) === d; | |
| }, | |
| empty: function() { | |
| return this == ''; | |
| }, | |
| blank: function() { | |
| return /^\s*$/.test(this); | |
| }, | |
| interpolate: function(object, pattern) { | |
| return new Template(this, pattern).evaluate(object); | |
| } | |
| }); | |
| if (Prototype.Browser.WebKit || Prototype.Browser.IE) Object.extend(String.prototype, { | |
| escapeHTML: function() { | |
| return this.replace(/&/g,'&').replace(/</g,'<').replace(/>/g,'>'); | |
| }, | |
| unescapeHTML: function() { | |
| return this.replace(/&/g,'&').replace(/</g,'<').replace(/>/g,'>'); | |
| } | |
| }); | |
| String.prototype.gsub.prepareReplacement = function(replacement) { | |
| if (Object.isFunction(replacement)) return replacement; | |
| var template = new Template(replacement); | |
| return function(match) { return template.evaluate(match) }; | |
| }; | |
| String.prototype.parseQuery = String.prototype.toQueryParams; | |
| Object.extend(String.prototype.escapeHTML, { | |
| div: document.createElement('div'), | |
| text: document.createTextNode('') | |
| }); | |
| with (String.prototype.escapeHTML) div.appendChild(text); | |
| var Template = Class.create({ | |
| initialize: function(template, pattern) { | |
| this.template = template.toString(); | |
| this.pattern = pattern || Template.Pattern; | |
| }, | |
| evaluate: function(object) { | |
| if (Object.isFunction(object.toTemplateReplacements)) | |
| object = object.toTemplateReplacements(); | |
| return this.template.gsub(this.pattern, function(match) { | |
| if (object == null) return ''; | |
| var before = match[1] || ''; | |
| if (before == '\\') return match[2]; | |
| var ctx = object, expr = match[3]; | |
| var pattern = /^([^.[]+|\[((?:.*?[^\\])?)\])(\.|\[|$)/; | |
| match = pattern.exec(expr); | |
| if (match == null) return before; | |
| while (match != null) { | |
| var comp = match[1].startsWith('[') ? match[2].gsub('\\\\]', ']') : match[1]; | |
| ctx = ctx[comp]; | |
| if (null == ctx || '' == match[3]) break; | |
| expr = expr.substring('[' == match[3] ? match[1].length : match[0].length); | |
| match = pattern.exec(expr); | |
| } | |
| return before + String.interpret(ctx); | |
| }); | |
| } | |
| }); | |
| Template.Pattern = /(^|.|\r|\n)(#\{(.*?)\})/; | |
| var $break = { }; | |
| var Enumerable = { | |
| each: function(iterator, context) { | |
| var index = 0; | |
| iterator = iterator.bind(context); | |
| try { | |
| this._each(function(value) { | |
| iterator(value, index++); | |
| }); | |
| } catch (e) { | |
| if (e != $break) throw e; | |
| } | |
| return this; | |
| }, | |
| eachSlice: function(number, iterator, context) { | |
| iterator = iterator ? iterator.bind(context) : Prototype.K; | |
| var index = -number, slices = [], array = this.toArray(); | |
| while ((index += number) < array.length) | |
| slices.push(array.slice(index, index+number)); | |
| return slices.collect(iterator, context); | |
| }, | |
| all: function(iterator, context) { | |
| iterator = iterator ? iterator.bind(context) : Prototype.K; | |
| var result = true; | |
| this.each(function(value, index) { | |
| result = result && !!iterator(value, index); | |
| if (!result) throw $break; | |
| }); | |
| return result; | |
| }, | |
| any: function(iterator, context) { | |
| iterator = iterator ? iterator.bind(context) : Prototype.K; | |
| var result = false; | |
| this.each(function(value, index) { | |
| if (result = !!iterator(value, index)) | |
| throw $break; | |
| }); | |
| return result; | |
| }, | |
| collect: function(iterator, context) { | |
| iterator = iterator ? iterator.bind(context) : Prototype.K; | |
| var results = []; | |
| this.each(function(value, index) { | |
| results.push(iterator(value, index)); | |
| }); | |
| return results; | |
| }, | |
| detect: function(iterator, context) { | |
| iterator = iterator.bind(context); | |
| var result; | |
| this.each(function(value, index) { | |
| if (iterator(value, index)) { | |
| result = value; | |
| throw $break; | |
| } | |
| }); | |
| return result; | |
| }, | |
| findAll: function(iterator, context) { | |
| iterator = iterator.bind(context); | |
| var results = []; | |
| this.each(function(value, index) { | |
| if (iterator(value, index)) | |
| results.push(value); | |
| }); | |
| return results; | |
| }, | |
| grep: function(filter, iterator, context) { | |
| iterator = iterator ? iterator.bind(context) : Prototype.K; | |
| var results = []; | |
| if (Object.isString(filter)) | |
| filter = new RegExp(filter); | |
| this.each(function(value, index) { | |
| if (filter.match(value)) | |
| results.push(iterator(value, index)); | |
| }); | |
| return results; | |
| }, | |
| include: function(object) { | |
| if (Object.isFunction(this.indexOf)) | |
| if (this.indexOf(object) != -1) return true; | |
| var found = false; | |
| this.each(function(value) { | |
| if (value == object) { | |
| found = true; | |
| throw $break; | |
| } | |
| }); | |
| return found; | |
| }, | |
| inGroupsOf: function(number, fillWith) { | |
| fillWith = Object.isUndefined(fillWith) ? null : fillWith; | |
| return this.eachSlice(number, function(slice) { | |
| while(slice.length < number) slice.push(fillWith); | |
| return slice; | |
| }); | |
| }, | |
| inject: function(memo, iterator, context) { | |
| iterator = iterator.bind(context); | |
| this.each(function(value, index) { | |
| memo = iterator(memo, value, index); | |
| }); | |
| return memo; | |
| }, | |
| invoke: function(method) { | |
| var args = $A(arguments).slice(1); | |
| return this.map(function(value) { | |
| return value[method].apply(value, args); | |
| }); | |
| }, | |
| max: function(iterator, context) { | |
| iterator = iterator ? iterator.bind(context) : Prototype.K; | |
| var result; | |
| this.each(function(value, index) { | |
| value = iterator(value, index); | |
| if (result == null || value >= result) | |
| result = value; | |
| }); | |
| return result; | |
| }, | |
| min: function(iterator, context) { | |
| iterator = iterator ? iterator.bind(context) : Prototype.K; | |
| var result; | |
| this.each(function(value, index) { | |
| value = iterator(value, index); | |
| if (result == null || value < result) | |
| result = value; | |
| }); | |
| return result; | |
| }, | |
| partition: function(iterator, context) { | |
| iterator = iterator ? iterator.bind(context) : Prototype.K; | |
| var trues = [], falses = []; | |
| this.each(function(value, index) { | |
| (iterator(value, index) ? | |
| trues : falses).push(value); | |
| }); | |
| return [trues, falses]; | |
| }, | |
| pluck: function(property) { | |
| var results = []; | |
| this.each(function(value) { | |
| results.push(value[property]); | |
| }); | |
| return results; | |
| }, | |
| reject: function(iterator, context) { | |
| iterator = iterator.bind(context); | |
| var results = []; | |
| this.each(function(value, index) { | |
| if (!iterator(value, index)) | |
| results.push(value); | |
| }); | |
| return results; | |
| }, | |
| sortBy: function(iterator, context) { | |
| iterator = iterator.bind(context); | |
| return this.map(function(value, index) { | |
| return {value: value, criteria: iterator(value, index)}; | |
| }).sort(function(left, right) { | |
| var a = left.criteria, b = right.criteria; | |
| return a < b ? -1 : a > b ? 1 : 0; | |
| }).pluck('value'); | |
| }, | |
| toArray: function() { | |
| return this.map(); | |
| }, | |
| zip: function() { | |
| var iterator = Prototype.K, args = $A(arguments); | |
| if (Object.isFunction(args.last())) | |
| iterator = args.pop(); | |
| var collections = [this].concat(args).map($A); | |
| return this.map(function(value, index) { | |
| return iterator(collections.pluck(index)); | |
| }); | |
| }, | |
| size: function() { | |
| return this.toArray().length; | |
| }, | |
| inspect: function() { | |
| return '#<Enumerable:' + this.toArray().inspect() + '>'; | |
| } | |
| }; | |
| Object.extend(Enumerable, { | |
| map: Enumerable.collect, | |
| find: Enumerable.detect, | |
| select: Enumerable.findAll, | |
| filter: Enumerable.findAll, | |
| member: Enumerable.include, | |
| entries: Enumerable.toArray, | |
| every: Enumerable.all, | |
| some: Enumerable.any | |
| }); | |
| function $A(iterable) { | |
| if (!iterable) return []; | |
| if (iterable.toArray) return iterable.toArray(); | |
| var length = iterable.length || 0, results = new Array(length); | |
| while (length--) results[length] = iterable[length]; | |
| return results; | |
| } | |
| if (Prototype.Browser.WebKit) { | |
| $A = function(iterable) { | |
| if (!iterable) return []; | |
| if (!(Object.isFunction(iterable) && iterable == '[object NodeList]') && | |
| iterable.toArray) return iterable.toArray(); | |
| var length = iterable.length || 0, results = new Array(length); | |
| while (length--) results[length] = iterable[length]; | |
| return results; | |
| }; | |
| } | |
| Array.from = $A; | |
| Object.extend(Array.prototype, Enumerable); | |
| if (!Array.prototype._reverse) Array.prototype._reverse = Array.prototype.reverse; | |
| Object.extend(Array.prototype, { | |
| _each: function(iterator) { | |
| for (var i = 0, length = this.length; i < length; i++) | |
| iterator(this[i]); | |
| }, | |
| clear: function() { | |
| this.length = 0; | |
| return this; | |
| }, | |
| first: function() { | |
| return this[0]; | |
| }, | |
| last: function() { | |
| return this[this.length - 1]; | |
| }, | |
| compact: function() { | |
| return this.select(function(value) { | |
| return value != null; | |
| }); | |
| }, | |
| flatten: function() { | |
| return this.inject([], function(array, value) { | |
| return array.concat(Object.isArray(value) ? | |
| value.flatten() : [value]); | |
| }); | |
| }, | |
| without: function() { | |
| var values = $A(arguments); | |
| return this.select(function(value) { | |
| return !values.include(value); | |
| }); | |
| }, | |
| reverse: function(inline) { | |
| return (inline !== false ? this : this.toArray())._reverse(); | |
| }, | |
| reduce: function() { | |
| return this.length > 1 ? this : this[0]; | |
| }, | |
| uniq: function(sorted) { | |
| return this.inject([], function(array, value, index) { | |
| if (0 == index || (sorted ? array.last() != value : !array.include(value))) | |
| array.push(value); | |
| return array; | |
| }); | |
| }, | |
| intersect: function(array) { | |
| return this.uniq().findAll(function(item) { | |
| return array.detect(function(value) { return item === value }); | |
| }); | |
| }, | |
| clone: function() { | |
| return [].concat(this); | |
| }, | |
| size: function() { | |
| return this.length; | |
| }, | |
| inspect: function() { | |
| return '[' + this.map(Object.inspect).join(', ') + ']'; | |
| }, | |
| toJSON: function() { | |
| var results = []; | |
| this.each(function(object) { | |
| var value = Object.toJSON(object); | |
| if (!Object.isUndefined(value)) results.push(value); | |
| }); | |
| return '[' + results.join(', ') + ']'; | |
| } | |
| }); | |
| // use native browser JS 1.6 implementation if available | |
| if (Object.isFunction(Array.prototype.forEach)) | |
| Array.prototype._each = Array.prototype.forEach; | |
| if (!Array.prototype.indexOf) Array.prototype.indexOf = function(item, i) { | |
| i || (i = 0); | |
| var length = this.length; | |
| if (i < 0) i = length + i; | |
| for (; i < length; i++) | |
| if (this[i] === item) return i; | |
| return -1; | |
| }; | |
| if (!Array.prototype.lastIndexOf) Array.prototype.lastIndexOf = function(item, i) { | |
| i = isNaN(i) ? this.length : (i < 0 ? this.length + i : i) + 1; | |
| var n = this.slice(0, i).reverse().indexOf(item); | |
| return (n < 0) ? n : i - n - 1; | |
| }; | |
| Array.prototype.toArray = Array.prototype.clone; | |
| function $w(string) { | |
| if (!Object.isString(string)) return []; | |
| string = string.strip(); | |
| return string ? string.split(/\s+/) : []; | |
| } | |
| if (Prototype.Browser.Opera){ | |
| Array.prototype.concat = function() { | |
| var array = []; | |
| for (var i = 0, length = this.length; i < length; i++) array.push(this[i]); | |
| for (var i = 0, length = arguments.length; i < length; i++) { | |
| if (Object.isArray(arguments[i])) { | |
| for (var j = 0, arrayLength = arguments[i].length; j < arrayLength; j++) | |
| array.push(arguments[i][j]); | |
| } else { | |
| array.push(arguments[i]); | |
| } | |
| } | |
| return array; | |
| }; | |
| } | |
| Object.extend(Number.prototype, { | |
| toColorPart: function() { | |
| return this.toPaddedString(2, 16); | |
| }, | |
| succ: function() { | |
| return this + 1; | |
| }, | |
| times: function(iterator) { | |
| $R(0, this, true).each(iterator); | |
| return this; | |
| }, | |
| toPaddedString: function(length, radix) { | |
| var string = this.toString(radix || 10); | |
| return '0'.times(length - string.length) + string; | |
| }, | |
| toJSON: function() { | |
| return isFinite(this) ? this.toString() : 'null'; | |
| } | |
| }); | |
| $w('abs round ceil floor').each(function(method){ | |
| Number.prototype[method] = Math[method].methodize(); | |
| }); | |
| function $H(object) { | |
| return new Hash(object); | |
| }; | |
| var Hash = Class.create(Enumerable, (function() { | |
| function toQueryPair(key, value) { | |
| if (Object.isUndefined(value)) return key; | |
| return key + '=' + encodeURIComponent(String.interpret(value)); | |
| } | |
| return { | |
| initialize: function(object) { | |
| this._object = Object.isHash(object) ? object.toObject() : Object.clone(object); | |
| }, | |
| _each: function(iterator) { | |
| for (var key in this._object) { | |
| var value = this._object[key], pair = [key, value]; | |
| pair.key = key; | |
| pair.value = value; | |
| iterator(pair); | |
| } | |
| }, | |
| set: function(key, value) { | |
| return this._object[key] = value; | |
| }, | |
| get: function(key) { | |
| return this._object[key]; | |
| }, | |
| unset: function(key) { | |
| var value = this._object[key]; | |
| delete this._object[key]; | |
| return value; | |
| }, | |
| toObject: function() { | |
| return Object.clone(this._object); | |
| }, | |
| keys: function() { | |
| return this.pluck('key'); | |
| }, | |
| values: function() { | |
| return this.pluck('value'); | |
| }, | |
| index: function(value) { | |
| var match = this.detect(function(pair) { | |
| return pair.value === value; | |
| }); | |
| return match && match.key; | |
| }, | |
| merge: function(object) { | |
| return this.clone().update(object); | |
| }, | |
| update: function(object) { | |
| return new Hash(object).inject(this, function(result, pair) { | |
| result.set(pair.key, pair.value); | |
| return result; | |
| }); | |
| }, | |
| toQueryString: function() { | |
| return this.map(function(pair) { | |
| var key = encodeURIComponent(pair.key), values = pair.value; | |
| if (values && typeof values == 'object') { | |
| if (Object.isArray(values)) | |
| return values.map(toQueryPair.curry(key)).join('&'); | |
| } | |
| return toQueryPair(key, values); | |
| }).join('&'); | |
| }, | |
| inspect: function() { | |
| return '#<Hash:{' + this.map(function(pair) { | |
| return pair.map(Object.inspect).join(': '); | |
| }).join(', ') + '}>'; | |
| }, | |
| toJSON: function() { | |
| return Object.toJSON(this.toObject()); | |
| }, | |
| clone: function() { | |
| return new Hash(this); | |
| } | |
| } | |
| })()); | |
| Hash.prototype.toTemplateReplacements = Hash.prototype.toObject; | |
| Hash.from = $H; | |
| var ObjectRange = Class.create(Enumerable, { | |
| initialize: function(start, end, exclusive) { | |
| this.start = start; | |
| this.end = end; | |
| this.exclusive = exclusive; | |
| }, | |
| _each: function(iterator) { | |
| var value = this.start; | |
| while (this.include(value)) { | |
| iterator(value); | |
| value = value.succ(); | |
| } | |
| }, | |
| include: function(value) { | |
| if (value < this.start) | |
| return false; | |
| if (this.exclusive) | |
| return value < this.end; | |
| return value <= this.end; | |
| } | |
| }); | |
| var $R = function(start, end, exclusive) { | |
| return new ObjectRange(start, end, exclusive); | |
| }; | |
| var Ajax = { | |
| getTransport: function() { | |
| return Try.these( | |
| function() {return new XMLHttpRequest()}, | |
| function() {return new ActiveXObject('Msxml2.XMLHTTP')}, | |
| function() {return new ActiveXObject('Microsoft.XMLHTTP')} | |
| ) || false; | |
| }, | |
| activeRequestCount: 0 | |
| }; | |
| Ajax.Responders = { | |
| responders: [], | |
| _each: function(iterator) { | |
| this.responders._each(iterator); | |
| }, | |
| register: function(responder) { | |
| if (!this.include(responder)) | |
| this.responders.push(responder); | |
| }, | |
| unregister: function(responder) { | |
| this.responders = this.responders.without(responder); | |
| }, | |
| dispatch: function(callback, request, transport, json) { | |
| this.each(function(responder) { | |
| if (Object.isFunction(responder[callback])) { | |
| try { | |
| responder[callback].apply(responder, [request, transport, json]); | |
| } catch (e) { } | |
| } | |
| }); | |
| } | |
| }; | |
| Object.extend(Ajax.Responders, Enumerable); | |
| Ajax.Responders.register({ | |
| onCreate: function() { Ajax.activeRequestCount++ }, | |
| onComplete: function() { Ajax.activeRequestCount-- } | |
| }); | |
| Ajax.Base = Class.create({ | |
| initialize: function(options) { | |
| this.options = { | |
| method: 'post', | |
| asynchronous: true, | |
| contentType: 'application/x-www-form-urlencoded', | |
| encoding: 'UTF-8', | |
| parameters: '', | |
| evalJSON: true, | |
| evalJS: true | |
| }; | |
| Object.extend(this.options, options || { }); | |
| this.options.method = this.options.method.toLowerCase(); | |
| if (Object.isString(this.options.parameters)) | |
| this.options.parameters = this.options.parameters.toQueryParams(); | |
| else if (Object.isHash(this.options.parameters)) | |
| this.options.parameters = this.options.parameters.toObject(); | |
| } | |
| }); | |
| Ajax.Request = Class.create(Ajax.Base, { | |
| _complete: false, | |
| initialize: function($super, url, options) { | |
| $super(options); | |
| this.transport = Ajax.getTransport(); | |
| this.request(url); | |
| }, | |
| request: function(url) { | |
| this.url = url; | |
| this.method = this.options.method; | |
| var params = Object.clone(this.options.parameters); | |
| if (!['get', 'post'].include(this.method)) { | |
| // simulate other verbs over post | |
| params['_method'] = this.method; | |
| this.method = 'post'; | |
| } | |
| this.parameters = params; | |
| if (params = Object.toQueryString(params)) { | |
| // when GET, append parameters to URL | |
| if (this.method == 'get') | |
| this.url += (this.url.include('?') ? '&' : '?') + params; | |
| else if (/Konqueror|Safari|KHTML/.test(navigator.userAgent)) | |
| params += '&_='; | |
| } | |
| try { | |
| var response = new Ajax.Response(this); | |
| if (this.options.onCreate) this.options.onCreate(response); | |
| Ajax.Responders.dispatch('onCreate', this, response); | |
| this.transport.open(this.method.toUpperCase(), this.url, | |
| this.options.asynchronous); | |
| if (this.options.asynchronous) this.respondToReadyState.bind(this).defer(1); | |
| this.transport.onreadystatechange = this.onStateChange.bind(this); | |
| this.setRequestHeaders(); | |
| this.body = this.method == 'post' ? (this.options.postBody || params) : null; | |
| this.transport.send(this.body); | |
| /* Force Firefox to handle ready state 4 for synchronous requests */ | |
| if (!this.options.asynchronous && this.transport.overrideMimeType) | |
| this.onStateChange(); | |
| } | |
| catch (e) { | |
| this.dispatchException(e); | |
| } | |
| }, | |
| onStateChange: function() { | |
| var readyState = this.transport.readyState; | |
| if (readyState > 1 && !((readyState == 4) && this._complete)) | |
| this.respondToReadyState(this.transport.readyState); | |
| }, | |
| setRequestHeaders: function() { | |
| var headers = { | |
| 'X-Requested-With': 'XMLHttpRequest', | |
| 'X-Prototype-Version': Prototype.Version, | |
| 'Accept': 'text/javascript, text/html, application/xml, text/xml, */*' | |
| }; | |
| if (this.method == 'post') { | |
| headers['Content-type'] = this.options.contentType + | |
| (this.options.encoding ? '; charset=' + this.options.encoding : ''); | |
| /* Force "Connection: close" for older Mozilla browsers to work | |
| * around a bug where XMLHttpRequest sends an incorrect | |
| * Content-length header. See Mozilla Bugzilla #246651. | |
| */ | |
| if (this.transport.overrideMimeType && | |
| (navigator.userAgent.match(/Gecko\/(\d{4})/) || [0,2005])[1] < 2005) | |
| headers['Connection'] = 'close'; | |
| } | |
| // user-defined headers | |
| if (typeof this.options.requestHeaders == 'object') { | |
| var extras = this.options.requestHeaders; | |
| if (Object.isFunction(extras.push)) | |
| for (var i = 0, length = extras.length; i < length; i += 2) | |
| headers[extras[i]] = extras[i+1]; | |
| else | |
| $H(extras).each(function(pair) { headers[pair.key] = pair.value }); | |
| } | |
| for (var name in headers) | |
| this.transport.setRequestHeader(name, headers[name]); | |
| }, | |
| success: function() { | |
| var status = this.getStatus(); | |
| return !status || (status >= 200 && status < 300); | |
| }, | |
| getStatus: function() { | |
| try { | |
| return this.transport.status || 0; | |
| } catch (e) { return 0 } | |
| }, | |
| respondToReadyState: function(readyState) { | |
| var state = Ajax.Request.Events[readyState], response = new Ajax.Response(this); | |
| if (state == 'Complete') { | |
| try { | |
| this._complete = true; | |
| (this.options['on' + response.status] | |
| || this.options['on' + (this.success() ? 'Success' : 'Failure')] | |
| || Prototype.emptyFunction)(response, response.headerJSON); | |
| } catch (e) { | |
| this.dispatchException(e); | |
| } | |
| var contentType = response.getHeader('Content-type'); | |
| if (this.options.evalJS == 'force' | |
| || (this.options.evalJS && this.isSameOrigin() && contentType | |
| && contentType.match(/^\s*(text|application)\/(x-)?(java|ecma)script(;.*)?\s*$/i))) | |
| this.evalResponse(); | |
| } | |
| try { | |
| (this.options['on' + state] || Prototype.emptyFunction)(response, response.headerJSON); | |
| Ajax.Responders.dispatch('on' + state, this, response, response.headerJSON); | |
| } catch (e) { | |
| this.dispatchException(e); | |
| } | |
| if (state == 'Complete') { | |
| // avoid memory leak in MSIE: clean up | |
| this.transport.onreadystatechange = Prototype.emptyFunction; | |
| } | |
| }, | |
| isSameOrigin: function() { | |
| var m = this.url.match(/^\s*https?:\/\/[^\/]*/); | |
| return !m || (m[0] == '#{protocol}//#{domain}#{port}'.interpolate({ | |
| protocol: location.protocol, | |
| domain: document.domain, | |
| port: location.port ? ':' + location.port : '' | |
| })); | |
| }, | |
| getHeader: function(name) { | |
| try { | |
| return this.transport.getResponseHeader(name) || null; | |
| } catch (e) { return null } | |
| }, | |
| evalResponse: function() { | |
| try { | |
| return eval((this.transport.responseText || '').unfilterJSON()); | |
| } catch (e) { | |
| this.dispatchException(e); | |
| } | |
| }, | |
| dispatchException: function(exception) { | |
| (this.options.onException || Prototype.emptyFunction)(this, exception); | |
| Ajax.Responders.dispatch('onException', this, exception); | |
| } | |
| }); | |
| Ajax.Request.Events = | |
| ['Uninitialized', 'Loading', 'Loaded', 'Interactive', 'Complete']; | |
| Ajax.Response = Class.create({ | |
| initialize: function(request){ | |
| this.request = request; | |
| var transport = this.transport = request.transport, | |
| readyState = this.readyState = transport.readyState; | |
| if((readyState > 2 && !Prototype.Browser.IE) || readyState == 4) { | |
| this.status = this.getStatus(); | |
| this.statusText = this.getStatusText(); | |
| this.responseText = String.interpret(transport.responseText); | |
| this.headerJSON = this._getHeaderJSON(); | |
| } | |
| if(readyState == 4) { | |
| var xml = transport.responseXML; | |
| this.responseXML = Object.isUndefined(xml) ? null : xml; | |
| this.responseJSON = this._getResponseJSON(); | |
| } | |
| }, | |
| status: 0, | |
| statusText: '', | |
| getStatus: Ajax.Request.prototype.getStatus, | |
| getStatusText: function() { | |
| try { | |
| return this.transport.statusText || ''; | |
| } catch (e) { return '' } | |
| }, | |
| getHeader: Ajax.Request.prototype.getHeader, | |
| getAllHeaders: function() { | |
| try { | |
| return this.getAllResponseHeaders(); | |
| } catch (e) { return null } | |
| }, | |
| getResponseHeader: function(name) { | |
| return this.transport.getResponseHeader(name); | |
| }, | |
| getAllResponseHeaders: function() { | |
| return this.transport.getAllResponseHeaders(); | |
| }, | |
| _getHeaderJSON: function() { | |
| var json = this.getHeader('X-JSON'); | |
| if (!json) return null; | |
| json = decodeURIComponent(escape(json)); | |
| try { | |
| return json.evalJSON(this.request.options.sanitizeJSON || | |
| !this.request.isSameOrigin()); | |
| } catch (e) { | |
| this.request.dispatchException(e); | |
| } | |
| }, | |
| _getResponseJSON: function() { | |
| var options = this.request.options; | |
| if (!options.evalJSON || (options.evalJSON != 'force' && | |
| !(this.getHeader('Content-type') || '').include('application/json')) || | |
| this.responseText.blank()) | |
| return null; | |
| try { | |
| return this.responseText.evalJSON(options.sanitizeJSON || | |
| !this.request.isSameOrigin()); | |
| } catch (e) { | |
| this.request.dispatchException(e); | |
| } | |
| } | |
| }); | |
| Ajax.Updater = Class.create(Ajax.Request, { | |
| initialize: function($super, container, url, options) { | |
| this.container = { | |
| success: (container.success || container), | |
| failure: (container.failure || (container.success ? null : container)) | |
| }; | |
| options = Object.clone(options); | |
| var onComplete = options.onComplete; | |
| options.onComplete = (function(response, json) { | |
| this.updateContent(response.responseText); | |
| if (Object.isFunction(onComplete)) onComplete(response, json); | |
| }).bind(this); | |
| $super(url, options); | |
| }, | |
| updateContent: function(responseText) { | |
| var receiver = this.container[this.success() ? 'success' : 'failure'], | |
| options = this.options; | |
| if (!options.evalScripts) responseText = responseText.stripScripts(); | |
| if (receiver = $(receiver)) { | |
| if (options.insertion) { | |
| if (Object.isString(options.insertion)) { | |
| var insertion = { }; insertion[options.insertion] = responseText; | |
| receiver.insert(insertion); | |
| } | |
| else options.insertion(receiver, responseText); | |
| } | |
| else receiver.update(responseText); | |
| } | |
| } | |
| }); | |
| Ajax.PeriodicalUpdater = Class.create(Ajax.Base, { | |
| initialize: function($super, container, url, options) { | |
| $super(options); | |
| this.onComplete = this.options.onComplete; | |
| this.frequency = (this.options.frequency || 2); | |
| this.decay = (this.options.decay || 1); | |
| this.updater = { }; | |
| this.container = container; | |
| this.url = url; | |
| this.start(); | |
| }, | |
| start: function() { | |
| this.options.onComplete = this.updateComplete.bind(this); | |
| this.onTimerEvent(); | |
| }, | |
| stop: function() { | |
| this.updater.options.onComplete = undefined; | |
| clearTimeout(this.timer); | |
| (this.onComplete || Prototype.emptyFunction).apply(this, arguments); | |
| }, | |
| updateComplete: function(response) { | |
| if (this.options.decay) { | |
| this.decay = (response.responseText == this.lastText ? | |
| this.decay * this.options.decay : 1); | |
| this.lastText = response.responseText; | |
| } | |
| this.timer = this.onTimerEvent.bind(this).delay(this.decay * this.frequency); | |
| }, | |
| onTimerEvent: function() { | |
| this.updater = new Ajax.Updater(this.container, this.url, this.options); | |
| } | |
| }); | |
| function $(element) { | |
| if (arguments.length > 1) { | |
| for (var i = 0, elements = [], length = arguments.length; i < length; i++) | |
| elements.push($(arguments[i])); | |
| return elements; | |
| } | |
| if (Object.isString(element)) | |
| element = document.getElementById(element); | |
| return Element.extend(element); | |
| } | |
| if (Prototype.BrowserFeatures.XPath) { | |
| document._getElementsByXPath = function(expression, parentElement) { | |
| var results = []; | |
| var query = document.evaluate(expression, $(parentElement) || document, | |
| null, XPathResult.ORDERED_NODE_SNAPSHOT_TYPE, null); | |
| for (var i = 0, length = query.snapshotLength; i < length; i++) | |
| results.push(Element.extend(query.snapshotItem(i))); | |
| return results; | |
| }; | |
| } | |
| /*--------------------------------------------------------------------------*/ | |
| if (!window.Node) var Node = { }; | |
| if (!Node.ELEMENT_NODE) { | |
| // DOM level 2 ECMAScript Language Binding | |
| Object.extend(Node, { | |
| ELEMENT_NODE: 1, | |
| ATTRIBUTE_NODE: 2, | |
| TEXT_NODE: 3, | |
| CDATA_SECTION_NODE: 4, | |
| ENTITY_REFERENCE_NODE: 5, | |
| ENTITY_NODE: 6, | |
| PROCESSING_INSTRUCTION_NODE: 7, | |
| COMMENT_NODE: 8, | |
| DOCUMENT_NODE: 9, | |
| DOCUMENT_TYPE_NODE: 10, | |
| DOCUMENT_FRAGMENT_NODE: 11, | |
| NOTATION_NODE: 12 | |
| }); | |
| } | |
| (function() { | |
| var element = this.Element; | |
| this.Element = function(tagName, attributes) { | |
| attributes = attributes || { }; | |
| tagName = tagName.toLowerCase(); | |
| var cache = Element.cache; | |
| if (Prototype.Browser.IE && attributes.name) { | |
| tagName = '<' + tagName + ' name="' + attributes.name + '">'; | |
| delete attributes.name; | |
| return Element.writeAttribute(document.createElement(tagName), attributes); | |
| } | |
| if (!cache[tagName]) cache[tagName] = Element.extend(document.createElement(tagName)); | |
| return Element.writeAttribute(cache[tagName].cloneNode(false), attributes); | |
| }; | |
| Object.extend(this.Element, element || { }); | |
| }).call(window); | |
| Element.cache = { }; | |
| Element.Methods = { | |
| visible: function(element) { | |
| return $(element).style.display != 'none'; | |
| }, | |
| toggle: function(element) { | |
| element = $(element); | |
| Element[Element.visible(element) ? 'hide' : 'show'](element); | |
| return element; | |
| }, | |
| hide: function(element) { | |
| $(element).style.display = 'none'; | |
| return element; | |
| }, | |
| show: function(element) { | |
| $(element).style.display = ''; | |
| return element; | |
| }, | |
| remove: function(element) { | |
| element = $(element); | |
| element.parentNode.removeChild(element); | |
| return element; | |
| }, | |
| update: function(element, content) { | |
| element = $(element); | |
| if (content && content.toElement) content = content.toElement(); | |
| if (Object.isElement(content)) return element.update().insert(content); | |
| content = Object.toHTML(content); | |
| element.innerHTML = content.stripScripts(); | |
| content.evalScripts.bind(content).defer(); | |
| return element; | |
| }, | |
| replace: function(element, content) { | |
| element = $(element); | |
| if (content && content.toElement) content = content.toElement(); | |
| else if (!Object.isElement(content)) { | |
| content = Object.toHTML(content); | |
| var range = element.ownerDocument.createRange(); | |
| range.selectNode(element); | |
| content.evalScripts.bind(content).defer(); | |
| content = range.createContextualFragment(content.stripScripts()); | |
| } | |
| element.parentNode.replaceChild(content, element); | |
| return element; | |
| }, | |
| insert: function(element, insertions) { | |
| element = $(element); | |
| if (Object.isString(insertions) || Object.isNumber(insertions) || | |
| Object.isElement(insertions) || (insertions && (insertions.toElement || insertions.toHTML))) | |
| insertions = {bottom:insertions}; | |
| var content, insert, tagName, childNodes; | |
| for (var position in insertions) { | |
| content = insertions[position]; | |
| position = position.toLowerCase(); | |
| insert = Element._insertionTranslations[position]; | |
| if (content && content.toElement) content = content.toElement(); | |
| if (Object.isElement(content)) { | |
| insert(element, content); | |
| continue; | |
| } | |
| content = Object.toHTML(content); | |
| tagName = ((position == 'before' || position == 'after') | |
| ? element.parentNode : element).tagName.toUpperCase(); | |
| childNodes = Element._getContentFromAnonymousElement(tagName, content.stripScripts()); | |
| if (position == 'top' || position == 'after') childNodes.reverse(); | |
| childNodes.each(insert.curry(element)); | |
| content.evalScripts.bind(content).defer(); | |
| } | |
| return element; | |
| }, | |
| wrap: function(element, wrapper, attributes) { | |
| element = $(element); | |
| if (Object.isElement(wrapper)) | |
| $(wrapper).writeAttribute(attributes || { }); | |
| else if (Object.isString(wrapper)) wrapper = new Element(wrapper, attributes); | |
| else wrapper = new Element('div', wrapper); | |
| if (element.parentNode) | |
| element.parentNode.replaceChild(wrapper, element); | |
| wrapper.appendChild(element); | |
| return wrapper; | |
| }, | |
| inspect: function(element) { | |
| element = $(element); | |
| var result = '<' + element.tagName.toLowerCase(); | |
| $H({'id': 'id', 'className': 'class'}).each(function(pair) { | |
| var property = pair.first(), attribute = pair.last(); | |
| var value = (element[property] || '').toString(); | |
| if (value) result += ' ' + attribute + '=' + value.inspect(true); | |
| }); | |
| return result + '>'; | |
| }, | |
| recursivelyCollect: function(element, property) { | |
| element = $(element); | |
| var elements = []; | |
| while (element = element[property]) | |
| if (element.nodeType == 1) | |
| elements.push(Element.extend(element)); | |
| return elements; | |
| }, | |
| ancestors: function(element) { | |
| return $(element).recursivelyCollect('parentNode'); | |
| }, | |
| descendants: function(element) { | |
| return $(element).select("*"); | |
| }, | |
| firstDescendant: function(element) { | |
| element = $(element).firstChild; | |
| while (element && element.nodeType != 1) element = element.nextSibling; | |
| return $(element); | |
| }, | |
| immediateDescendants: function(element) { | |
| if (!(element = $(element).firstChild)) return []; | |
| while (element && element.nodeType != 1) element = element.nextSibling; | |
| if (element) return [element].concat($(element).nextSiblings()); | |
| return []; | |
| }, | |
| previousSiblings: function(element) { | |
| return $(element).recursivelyCollect('previousSibling'); | |
| }, | |
| nextSiblings: function(element) { | |
| return $(element).recursivelyCollect('nextSibling'); | |
| }, | |
| siblings: function(element) { | |
| element = $(element); | |
| return element.previousSiblings().reverse().concat(element.nextSiblings()); | |
| }, | |
| match: function(element, selector) { | |
| if (Object.isString(selector)) | |
| selector = new Selector(selector); | |
| return selector.match($(element)); | |
| }, | |
| up: function(element, expression, index) { | |
| element = $(element); | |
| if (arguments.length == 1) return $(element.parentNode); | |
| var ancestors = element.ancestors(); | |
| return Object.isNumber(expression) ? ancestors[expression] : | |
| Selector.findElement(ancestors, expression, index); | |
| }, | |
| down: function(element, expression, index) { | |
| element = $(element); | |
| if (arguments.length == 1) return element.firstDescendant(); | |
| return Object.isNumber(expression) ? element.descendants()[expression] : | |
| element.select(expression)[index || 0]; | |
| }, | |
| previous: function(element, expression, index) { | |
| element = $(element); | |
| if (arguments.length == 1) return $(Selector.handlers.previousElementSibling(element)); | |
| var previousSiblings = element.previousSiblings(); | |
| return Object.isNumber(expression) ? previousSiblings[expression] : | |
| Selector.findElement(previousSiblings, expression, index); | |
| }, | |
| next: function(element, expression, index) { | |
| element = $(element); | |
| if (arguments.length == 1) return $(Selector.handlers.nextElementSibling(element)); | |
| var nextSiblings = element.nextSiblings(); | |
| return Object.isNumber(expression) ? nextSiblings[expression] : | |
| Selector.findElement(nextSiblings, expression, index); | |
| }, | |
| select: function() { | |
| var args = $A(arguments), element = $(args.shift()); | |
| return Selector.findChildElements(element, args); | |
| }, | |
| adjacent: function() { | |
| var args = $A(arguments), element = $(args.shift()); | |
| return Selector.findChildElements(element.parentNode, args).without(element); | |
| }, | |
| identify: function(element) { | |
| element = $(element); | |
| var id = element.readAttribute('id'), self = arguments.callee; | |
| if (id) return id; | |
| do { id = 'anonymous_element_' + self.counter++ } while ($(id)); | |
| element.writeAttribute('id', id); | |
| return id; | |
| }, | |
| readAttribute: function(element, name) { | |
| element = $(element); | |
| if (Prototype.Browser.IE) { | |
| var t = Element._attributeTranslations.read; | |
| if (t.values[name]) return t.values[name](element, name); | |
| if (t.names[name]) name = t.names[name]; | |
| if (name.include(':')) { | |
| return (!element.attributes || !element.attributes[name]) ? null : | |
| element.attributes[name].value; | |
| } | |
| } | |
| return element.getAttribute(name); | |
| }, | |
| writeAttribute: function(element, name, value) { | |
| element = $(element); | |
| var attributes = { }, t = Element._attributeTranslations.write; | |
| if (typeof name == 'object') attributes = name; | |
| else attributes[name] = Object.isUndefined(value) ? true : value; | |
| for (var attr in attributes) { | |
| name = t.names[attr] || attr; | |
| value = attributes[attr]; | |
| if (t.values[attr]) name = t.values[attr](element, value); | |
| if (value === false || value === null) | |
| element.removeAttribute(name); | |
| else if (value === true) | |
| element.setAttribute(name, name); | |
| else element.setAttribute(name, value); | |
| } | |
| return element; | |
| }, | |
| getHeight: function(element) { | |
| return $(element).getDimensions().height; | |
| }, | |
| getWidth: function(element) { | |
| return $(element).getDimensions().width; | |
| }, | |
| classNames: function(element) { | |
| return new Element.ClassNames(element); | |
| }, | |
| hasClassName: function(element, className) { | |
| if (!(element = $(element))) return; | |
| var elementClassName = element.className; | |
| return (elementClassName.length > 0 && (elementClassName == className || | |
| new RegExp("(^|\\s)" + className + "(\\s|$)").test(elementClassName))); | |
| }, | |
| addClassName: function(element, className) { | |
| if (!(element = $(element))) return; | |
| if (!element.hasClassName(className)) | |
| element.className += (element.className ? ' ' : '') + className; | |
| return element; | |
| }, | |
| removeClassName: function(element, className) { | |
| if (!(element = $(element))) return; | |
| element.className = element.className.replace( | |
| new RegExp("(^|\\s+)" + className + "(\\s+|$)"), ' ').strip(); | |
| return element; | |
| }, | |
| toggleClassName: function(element, className) { | |
| if (!(element = $(element))) return; | |
| return element[element.hasClassName(className) ? | |
| 'removeClassName' : 'addClassName'](className); | |
| }, | |
| // removes whitespace-only text node children | |
| cleanWhitespace: function(element) { | |
| element = $(element); | |
| var node = element.firstChild; | |
| while (node) { | |
| var nextNode = node.nextSibling; | |
| if (node.nodeType == 3 && !/\S/.test(node.nodeValue)) | |
| element.removeChild(node); | |
| node = nextNode; | |
| } | |
| return element; | |
| }, | |
| empty: function(element) { | |
| return $(element).innerHTML.blank(); | |
| }, | |
| descendantOf: function(element, ancestor) { | |
| element = $(element), ancestor = $(ancestor); | |
| var originalAncestor = ancestor; | |
| if (element.compareDocumentPosition) | |
| return (element.compareDocumentPosition(ancestor) & 8) === 8; | |
| if (element.sourceIndex && !Prototype.Browser.Opera) { | |
| var e = element.sourceIndex, a = ancestor.sourceIndex, | |
| nextAncestor = ancestor.nextSibling; | |
| if (!nextAncestor) { | |
| do { ancestor = ancestor.parentNode; } | |
| while (!(nextAncestor = ancestor.nextSibling) && ancestor.parentNode); | |
| } | |
| if (nextAncestor && nextAncestor.sourceIndex) | |
| return (e > a && e < nextAncestor.sourceIndex); | |
| } | |
| while (element = element.parentNode) | |
| if (element == originalAncestor) return true; | |
| return false; | |
| }, | |
| scrollTo: function(element) { | |
| element = $(element); | |
| var pos = element.cumulativeOffset(); | |
| window.scrollTo(pos[0], pos[1]); | |
| return element; | |
| }, | |
| getStyle: function(element, style) { | |
| element = $(element); | |
| style = style == 'float' ? 'cssFloat' : style.camelize(); | |
| var value = element.style[style]; | |
| if (!value) { | |
| var css = document.defaultView.getComputedStyle(element, null); | |
| value = css ? css[style] : null; | |
| } | |
| if (style == 'opacity') return value ? parseFloat(value) : 1.0; | |
| return value == 'auto' ? null : value; | |
| }, | |
| getOpacity: function(element) { | |
| return $(element).getStyle('opacity'); | |
| }, | |
| setStyle: function(element, styles) { | |
| element = $(element); | |
| var elementStyle = element.style, match; | |
| if (Object.isString(styles)) { | |
| element.style.cssText += ';' + styles; | |
| return styles.include('opacity') ? | |
| element.setOpacity(styles.match(/opacity:\s*(\d?\.?\d*)/)[1]) : element; | |
| } | |
| for (var property in styles) | |
| if (property == 'opacity') element.setOpacity(styles[property]); | |
| else | |
| elementStyle[(property == 'float' || property == 'cssFloat') ? | |
| (Object.isUndefined(elementStyle.styleFloat) ? 'cssFloat' : 'styleFloat') : | |
| property] = styles[property]; | |
| return element; | |
| }, | |
| setOpacity: function(element, value) { | |
| element = $(element); | |
| element.style.opacity = (value == 1 || value === '') ? '' : | |
| (value < 0.00001) ? 0 : value; | |
| return element; | |
| }, | |
| getDimensions: function(element) { | |
| element = $(element); | |
| var display = $(element).getStyle('display'); | |
| if (display != 'none' && display != null) // Safari bug | |
| return {width: element.offsetWidth, height: element.offsetHeight}; | |
| // All *Width and *Height properties give 0 on elements with display none, | |
| // so enable the element temporarily | |
| var els = element.style; | |
| var originalVisibility = els.visibility; | |
| var originalPosition = els.position; | |
| var originalDisplay = els.display; | |
| els.visibility = 'hidden'; | |
| els.position = 'absolute'; | |
| els.display = 'block'; | |
| var originalWidth = element.clientWidth; | |
| var originalHeight = element.clientHeight; | |
| els.display = originalDisplay; | |
| els.position = originalPosition; | |
| els.visibility = originalVisibility; | |
| return {width: originalWidth, height: originalHeight}; | |
| }, | |
| makePositioned: function(element) { | |
| element = $(element); | |
| var pos = Element.getStyle(element, 'position'); | |
| if (pos == 'static' || !pos) { | |
| element._madePositioned = true; | |
| element.style.position = 'relative'; | |
| // Opera returns the offset relative to the positioning context, when an | |
| // element is position relative but top and left have not been defined | |
| if (window.opera) { | |
| element.style.top = 0; | |
| element.style.left = 0; | |
| } | |
| } | |
| return element; | |
| }, | |
| undoPositioned: function(element) { | |
| element = $(element); | |
| if (element._madePositioned) { | |
| element._madePositioned = undefined; | |
| element.style.position = | |
| element.style.top = | |
| element.style.left = | |
| element.style.bottom = | |
| element.style.right = ''; | |
| } | |
| return element; | |
| }, | |
| makeClipping: function(element) { | |
| element = $(element); | |
| if (element._overflow) return element; | |
| element._overflow = Element.getStyle(element, 'overflow') || 'auto'; | |
| if (element._overflow !== 'hidden') | |
| element.style.overflow = 'hidden'; | |
| return element; | |
| }, | |
| undoClipping: function(element) { | |
| element = $(element); | |
| if (!element._overflow) return element; | |
| element.style.overflow = element._overflow == 'auto' ? '' : element._overflow; | |
| element._overflow = null; | |
| return element; | |
| }, | |
| cumulativeOffset: function(element) { | |
| var valueT = 0, valueL = 0; | |
| do { | |
| valueT += element.offsetTop || 0; | |
| valueL += element.offsetLeft || 0; | |
| element = element.offsetParent; | |
| } while (element); | |
| return Element._returnOffset(valueL, valueT); | |
| }, | |
| positionedOffset: function(element) { | |
| var valueT = 0, valueL = 0; | |
| do { | |
| valueT += element.offsetTop || 0; | |
| valueL += element.offsetLeft || 0; | |
| element = element.offsetParent; | |
| if (element) { | |
| if (element.tagName == 'BODY') break; | |
| var p = Element.getStyle(element, 'position'); | |
| if (p !== 'static') break; | |
| } | |
| } while (element); | |
| return Element._returnOffset(valueL, valueT); | |
| }, | |
| absolutize: function(element) { | |
| element = $(element); | |
| if (element.getStyle('position') == 'absolute') return; | |
| // Position.prepare(); // To be done manually by Scripty when it needs it. | |
| var offsets = element.positionedOffset(); | |
| var top = offsets[1]; | |
| var left = offsets[0]; | |
| var width = element.clientWidth; | |
| var height = element.clientHeight; | |
| element._originalLeft = left - parseFloat(element.style.left || 0); | |
| element._originalTop = top - parseFloat(element.style.top || 0); | |
| element._originalWidth = element.style.width; | |
| element._originalHeight = element.style.height; | |
| element.style.position = 'absolute'; | |
| element.style.top = top + 'px'; | |
| element.style.left = left + 'px'; | |
| element.style.width = width + 'px'; | |
| element.style.height = height + 'px'; | |
| return element; | |
| }, | |
| relativize: function(element) { | |
| element = $(element); | |
| if (element.getStyle('position') == 'relative') return; | |
| // Position.prepare(); // To be done manually by Scripty when it needs it. | |
| element.style.position = 'relative'; | |
| var top = parseFloat(element.style.top || 0) - (element._originalTop || 0); | |
| var left = parseFloat(element.style.left || 0) - (element._originalLeft || 0); | |
| element.style.top = top + 'px'; | |
| element.style.left = left + 'px'; | |
| element.style.height = element._originalHeight; | |
| element.style.width = element._originalWidth; | |
| return element; | |
| }, | |
| cumulativeScrollOffset: function(element) { | |
| var valueT = 0, valueL = 0; | |
| do { | |
| valueT += element.scrollTop || 0; | |
| valueL += element.scrollLeft || 0; | |
| element = element.parentNode; | |
| } while (element); | |
| return Element._returnOffset(valueL, valueT); | |
| }, | |
| getOffsetParent: function(element) { | |
| if (element.offsetParent) return $(element.offsetParent); | |
| if (element == document.body) return $(element); | |
| while ((element = element.parentNode) && element != document.body) | |
| if (Element.getStyle(element, 'position') != 'static') | |
| return $(element); | |
| return $(document.body); | |
| }, | |
| viewportOffset: function(forElement) { | |
| var valueT = 0, valueL = 0; | |
| var element = forElement; | |
| do { | |
| valueT += element.offsetTop || 0; | |
| valueL += element.offsetLeft || 0; | |
| // Safari fix | |
| if (element.offsetParent == document.body && | |
| Element.getStyle(element, 'position') == 'absolute') break; | |
| } while (element = element.offsetParent); | |
| element = forElement; | |
| do { | |
| if (!Prototype.Browser.Opera || element.tagName == 'BODY') { | |
| valueT -= element.scrollTop || 0; | |
| valueL -= element.scrollLeft || 0; | |
| } | |
| } while (element = element.parentNode); | |
| return Element._returnOffset(valueL, valueT); | |
| }, | |
| clonePosition: function(element, source) { | |
| var options = Object.extend({ | |
| setLeft: true, | |
| setTop: true, | |
| setWidth: true, | |
| setHeight: true, | |
| offsetTop: 0, | |
| offsetLeft: 0 | |
| }, arguments[2] || { }); | |
| // find page position of source | |
| source = $(source); | |
| var p = source.viewportOffset(); | |
| // find coordinate system to use | |
| element = $(element); | |
| var delta = [0, 0]; | |
| var parent = null; | |
| // delta [0,0] will do fine with position: fixed elements, | |
| // position:absolute needs offsetParent deltas | |
| if (Element.getStyle(element, 'position') == 'absolute') { | |
| parent = element.getOffsetParent(); | |
| delta = parent.viewportOffset(); | |
| } | |
| // correct by body offsets (fixes Safari) | |
| if (parent == document.body) { | |
| delta[0] -= document.body.offsetLeft; | |
| delta[1] -= document.body.offsetTop; | |
| } | |
| // set position | |
| if (options.setLeft) element.style.left = (p[0] - delta[0] + options.offsetLeft) + 'px'; | |
| if (options.setTop) element.style.top = (p[1] - delta[1] + options.offsetTop) + 'px'; | |
| if (options.setWidth) element.style.width = source.offsetWidth + 'px'; | |
| if (options.setHeight) element.style.height = source.offsetHeight + 'px'; | |
| return element; | |
| } | |
| }; | |
| Element.Methods.identify.counter = 1; | |
| Object.extend(Element.Methods, { | |
| getElementsBySelector: Element.Methods.select, | |
| childElements: Element.Methods.immediateDescendants | |
| }); | |
| Element._attributeTranslations = { | |
| write: { | |
| names: { | |
| className: 'class', | |
| htmlFor: 'for' | |
| }, | |
| values: { } | |
| } | |
| }; | |
| if (Prototype.Browser.Opera) { | |
| Element.Methods.getStyle = Element.Methods.getStyle.wrap( | |
| function(proceed, element, style) { | |
| switch (style) { | |
| case 'left': case 'top': case 'right': case 'bottom': | |
| if (proceed(element, 'position') === 'static') return null; | |
| case 'height': case 'width': | |
| // returns '0px' for hidden elements; we want it to return null | |
| if (!Element.visible(element)) return null; | |
| // returns the border-box dimensions rather than the content-box | |
| // dimensions, so we subtract padding and borders from the value | |
| var dim = parseInt(proceed(element, style), 10); | |
| if (dim !== element['offset' + style.capitalize()]) | |
| return dim + 'px'; | |
| var properties; | |
| if (style === 'height') { | |
| properties = ['border-top-width', 'padding-top', | |
| 'padding-bottom', 'border-bottom-width']; | |
| } | |
| else { | |
| properties = ['border-left-width', 'padding-left', | |
| 'padding-right', 'border-right-width']; | |
| } | |
| return properties.inject(dim, function(memo, property) { | |
| var val = proceed(element, property); | |
| return val === null ? memo : memo - parseInt(val, 10); | |
| }) + 'px'; | |
| default: return proceed(element, style); | |
| } | |
| } | |
| ); | |
| Element.Methods.readAttribute = Element.Methods.readAttribute.wrap( | |
| function(proceed, element, attribute) { | |
| if (attribute === 'title') return element.title; | |
| return proceed(element, attribute); | |
| } | |
| ); | |
| } | |
| else if (Prototype.Browser.IE) { | |
| // IE doesn't report offsets correctly for static elements, so we change them | |
| // to "relative" to get the values, then change them back. | |
| Element.Methods.getOffsetParent = Element.Methods.getOffsetParent.wrap( | |
| function(proceed, element) { | |
| element = $(element); | |
| var position = element.getStyle('position'); | |
| if (position !== 'static') return proceed(element); | |
| element.setStyle({ position: 'relative' }); | |
| var value = proceed(element); | |
| element.setStyle({ position: position }); | |
| return value; | |
| } | |
| ); | |
| $w('positionedOffset viewportOffset').each(function(method) { | |
| Element.Methods[method] = Element.Methods[method].wrap( | |
| function(proceed, element) { | |
| element = $(element); | |
| var position = element.getStyle('position'); | |
| if (position !== 'static') return proceed(element); | |
| // Trigger hasLayout on the offset parent so that IE6 reports | |
| // accurate offsetTop and offsetLeft values for position: fixed. | |
| var offsetParent = element.getOffsetParent(); | |
| if (offsetParent && offsetParent.getStyle('position') === 'fixed') | |
| offsetParent.setStyle({ zoom: 1 }); | |
| element.setStyle({ position: 'relative' }); | |
| var value = proceed(element); | |
| element.setStyle({ position: position }); | |
| return value; | |
| } | |
| ); | |
| }); | |
| Element.Methods.getStyle = function(element, style) { | |
| element = $(element); | |
| style = (style == 'float' || style == 'cssFloat') ? 'styleFloat' : style.camelize(); | |
| var value = element.style[style]; | |
| if (!value && element.currentStyle) value = element.currentStyle[style]; | |
| if (style == 'opacity') { | |
| if (value = (element.getStyle('filter') || '').match(/alpha\(opacity=(.*)\)/)) | |
| if (value[1]) return parseFloat(value[1]) / 100; | |
| return 1.0; | |
| } | |
| if (value == 'auto') { | |
| if ((style == 'width' || style == 'height') && (element.getStyle('display') != 'none')) | |
| return element['offset' + style.capitalize()] + 'px'; | |
| return null; | |
| } | |
| return value; | |
| }; | |
| Element.Methods.setOpacity = function(element, value) { | |
| function stripAlpha(filter){ | |
| return filter.replace(/alpha\([^\)]*\)/gi,''); | |
| } | |
| element = $(element); | |
| var currentStyle = element.currentStyle; | |
| if ((currentStyle && !currentStyle.hasLayout) || | |
| (!currentStyle && element.style.zoom == 'normal')) | |
| element.style.zoom = 1; | |
| var filter = element.getStyle('filter'), style = element.style; | |
| if (value == 1 || value === '') { | |
| (filter = stripAlpha(filter)) ? | |
| style.filter = filter : style.removeAttribute('filter'); | |
| return element; | |
| } else if (value < 0.00001) value = 0; | |
| style.filter = stripAlpha(filter) + | |
| 'alpha(opacity=' + (value * 100) + ')'; | |
| return element; | |
| }; | |
| Element._attributeTranslations = { | |
| read: { | |
| names: { | |
| 'class': 'className', | |
| 'for': 'htmlFor' | |
| }, | |
| values: { | |
| _getAttr: function(element, attribute) { | |
| return element.getAttribute(attribute, 2); | |
| }, | |
| _getAttrNode: function(element, attribute) { | |
| var node = element.getAttributeNode(attribute); | |
| return node ? node.value : ""; | |
| }, | |
| _getEv: function(element, attribute) { | |
| attribute = element.getAttribute(attribute); | |
| return attribute ? attribute.toString().slice(23, -2) : null; | |
| }, | |
| _flag: function(element, attribute) { | |
| return $(element).hasAttribute(attribute) ? attribute : null; | |
| }, | |
| style: function(element) { | |
| return element.style.cssText.toLowerCase(); | |
| }, | |
| title: function(element) { | |
| return element.title; | |
| } | |
| } | |
| } | |
| }; | |
| Element._attributeTranslations.write = { | |
| names: Object.extend({ | |
| cellpadding: 'cellPadding', | |
| cellspacing: 'cellSpacing' | |
| }, Element._attributeTranslations.read.names), | |
| values: { | |
| checked: function(element, value) { | |
| element.checked = !!value; | |
| }, | |
| style: function(element, value) { | |
| element.style.cssText = value ? value : ''; | |
| } | |
| } | |
| }; | |
| Element._attributeTranslations.has = {}; | |
| $w('colSpan rowSpan vAlign dateTime accessKey tabIndex ' + | |
| 'encType maxLength readOnly longDesc').each(function(attr) { | |
| Element._attributeTranslations.write.names[attr.toLowerCase()] = attr; | |
| Element._attributeTranslations.has[attr.toLowerCase()] = attr; | |
| }); | |
| (function(v) { | |
| Object.extend(v, { | |
| href: v._getAttr, | |
| src: v._getAttr, | |
| type: v._getAttr, | |
| action: v._getAttrNode, | |
| disabled: v._flag, | |
| checked: v._flag, | |
| readonly: v._flag, | |
| multiple: v._flag, | |
| onload: v._getEv, | |
| onunload: v._getEv, | |
| onclick: v._getEv, | |
| ondblclick: v._getEv, | |
| onmousedown: v._getEv, | |
| onmouseup: v._getEv, | |
| onmouseover: v._getEv, | |
| onmousemove: v._getEv, | |
| onmouseout: v._getEv, | |
| onfocus: v._getEv, | |
| onblur: v._getEv, | |
| onkeypress: v._getEv, | |
| onkeydown: v._getEv, | |
| onkeyup: v._getEv, | |
| onsubmit: v._getEv, | |
| onreset: v._getEv, | |
| onselect: v._getEv, | |
| onchange: v._getEv | |
| }); | |
| })(Element._attributeTranslations.read.values); | |
| } | |
| else if (Prototype.Browser.Gecko && /rv:1\.8\.0/.test(navigator.userAgent)) { | |
| Element.Methods.setOpacity = function(element, value) { | |
| element = $(element); | |
| element.style.opacity = (value == 1) ? 0.999999 : | |
| (value === '') ? '' : (value < 0.00001) ? 0 : value; | |
| return element; | |
| }; | |
| } | |
| else if (Prototype.Browser.WebKit) { | |
| Element.Methods.setOpacity = function(element, value) { | |
| element = $(element); | |
| element.style.opacity = (value == 1 || value === '') ? '' : | |
| (value < 0.00001) ? 0 : value; | |
| if (value == 1) | |
| if(element.tagName == 'IMG' && element.width) { | |
| element.width++; element.width--; | |
| } else try { | |
| var n = document.createTextNode(' '); | |
| element.appendChild(n); | |
| element.removeChild(n); | |
| } catch (e) { } | |
| return element; | |
| }; | |
| // Safari returns margins on body which is incorrect if the child is absolutely | |
| // positioned. For performance reasons, redefine Element#cumulativeOffset for | |
| // KHTML/WebKit only. | |
| Element.Methods.cumulativeOffset = function(element) { | |
| var valueT = 0, valueL = 0; | |
| do { | |
| valueT += element.offsetTop || 0; | |
| valueL += element.offsetLeft || 0; | |
| if (element.offsetParent == document.body) | |
| if (Element.getStyle(element, 'position') == 'absolute') break; | |
| element = element.offsetParent; | |
| } while (element); | |
| return Element._returnOffset(valueL, valueT); | |
| }; | |
| } | |
| if (Prototype.Browser.IE || Prototype.Browser.Opera) { | |
| // IE and Opera are missing .innerHTML support for TABLE-related and SELECT elements | |
| Element.Methods.update = function(element, content) { | |
| element = $(element); | |
| if (content && content.toElement) content = content.toElement(); | |
| if (Object.isElement(content)) return element.update().insert(content); | |
| content = Object.toHTML(content); | |
| var tagName = element.tagName.toUpperCase(); | |
| if (tagName in Element._insertionTranslations.tags) { | |
| $A(element.childNodes).each(function(node) { element.removeChild(node) }); | |
| Element._getContentFromAnonymousElement(tagName, content.stripScripts()) | |
| .each(function(node) { element.appendChild(node) }); | |
| } | |
| else element.innerHTML = content.stripScripts(); | |
| content.evalScripts.bind(content).defer(); | |
| return element; | |
| }; | |
| } | |
| if ('outerHTML' in document.createElement('div')) { | |
| Element.Methods.replace = function(element, content) { | |
| element = $(element); | |
| if (content && content.toElement) content = content.toElement(); | |
| if (Object.isElement(content)) { | |
| element.parentNode.replaceChild(content, element); | |
| return element; | |
| } | |
| content = Object.toHTML(content); | |
| var parent = element.parentNode, tagName = parent.tagName.toUpperCase(); | |
| if (Element._insertionTranslations.tags[tagName]) { | |
| var nextSibling = element.next(); | |
| var fragments = Element._getContentFromAnonymousElement(tagName, content.stripScripts()); | |
| parent.removeChild(element); | |
| if (nextSibling) | |
| fragments.each(function(node) { parent.insertBefore(node, nextSibling) }); | |
| else | |
| fragments.each(function(node) { parent.appendChild(node) }); | |
| } | |
| else element.outerHTML = content.stripScripts(); | |
| content.evalScripts.bind(content).defer(); | |
| return element; | |
| }; | |
| } | |
| Element._returnOffset = function(l, t) { | |
| var result = [l, t]; | |
| result.left = l; | |
| result.top = t; | |
| return result; | |
| }; | |
| Element._getContentFromAnonymousElement = function(tagName, html) { | |
| var div = new Element('div'), t = Element._insertionTranslations.tags[tagName]; | |
| if (t) { | |
| div.innerHTML = t[0] + html + t[1]; | |
| t[2].times(function() { div = div.firstChild }); | |
| } else div.innerHTML = html; | |
| return $A(div.childNodes); | |
| }; | |
| Element._insertionTranslations = { | |
| before: function(element, node) { | |
| element.parentNode.insertBefore(node, element); | |
| }, | |
| top: function(element, node) { | |
| element.insertBefore(node, element.firstChild); | |
| }, | |
| bottom: function(element, node) { | |
| element.appendChild(node); | |
| }, | |
| after: function(element, node) { | |
| element.parentNode.insertBefore(node, element.nextSibling); | |
| }, | |
| tags: { | |
| TABLE: ['<table>', '</table>', 1], | |
| TBODY: ['<table><tbody>', '</tbody></table>', 2], | |
| TR: ['<table><tbody><tr>', '</tr></tbody></table>', 3], | |
| TD: ['<table><tbody><tr><td>', '</td></tr></tbody></table>', 4], | |
| SELECT: ['<select>', '</select>', 1] | |
| } | |
| }; | |
| (function() { | |
| Object.extend(this.tags, { | |
| THEAD: this.tags.TBODY, | |
| TFOOT: this.tags.TBODY, | |
| TH: this.tags.TD | |
| }); | |
| }).call(Element._insertionTranslations); | |
| Element.Methods.Simulated = { | |
| hasAttribute: function(element, attribute) { | |
| attribute = Element._attributeTranslations.has[attribute] || attribute; | |
| var node = $(element).getAttributeNode(attribute); | |
| return node && node.specified; | |
| } | |
| }; | |
| Element.Methods.ByTag = { }; | |
| Object.extend(Element, Element.Methods); | |
| if (!Prototype.BrowserFeatures.ElementExtensions && | |
| document.createElement('div').__proto__) { | |
| window.HTMLElement = { }; | |
| window.HTMLElement.prototype = document.createElement('div').__proto__; | |
| Prototype.BrowserFeatures.ElementExtensions = true; | |
| } | |
| Element.extend = (function() { | |
| if (Prototype.BrowserFeatures.SpecificElementExtensions) | |
| return Prototype.K; | |
| var Methods = { }, ByTag = Element.Methods.ByTag; | |
| var extend = Object.extend(function(element) { | |
| if (!element || element._extendedByPrototype || | |
| element.nodeType != 1 || element == window) return element; | |
| var methods = Object.clone(Methods), | |
| tagName = element.tagName, property, value; | |
| // extend methods for specific tags | |
| if (ByTag[tagName]) Object.extend(methods, ByTag[tagName]); | |
| for (property in methods) { | |
| value = methods[property]; | |
| if (Object.isFunction(value) && !(property in element)) | |
| element[property] = value.methodize(); | |
| } | |
| element._extendedByPrototype = Prototype.emptyFunction; | |
| return element; | |
| }, { | |
| refresh: function() { | |
| // extend methods for all tags (Safari doesn't need this) | |
| if (!Prototype.BrowserFeatures.ElementExtensions) { | |
| Object.extend(Methods, Element.Methods); | |
| Object.extend(Methods, Element.Methods.Simulated); | |
| } | |
| } | |
| }); | |
| extend.refresh(); | |
| return extend; | |
| })(); | |
| Element.hasAttribute = function(element, attribute) { | |
| if (element.hasAttribute) return element.hasAttribute(attribute); | |
| return Element.Methods.Simulated.hasAttribute(element, attribute); | |
| }; | |
| Element.addMethods = function(methods) { | |
| var F = Prototype.BrowserFeatures, T = Element.Methods.ByTag; | |
| if (!methods) { | |
| Object.extend(Form, Form.Methods); | |
| Object.extend(Form.Element, Form.Element.Methods); | |
| Object.extend(Element.Methods.ByTag, { | |
| "FORM": Object.clone(Form.Methods), | |
| "INPUT": Object.clone(Form.Element.Methods), | |
| "SELECT": Object.clone(Form.Element.Methods), | |
| "TEXTAREA": Object.clone(Form.Element.Methods) | |
| }); | |
| } | |
| if (arguments.length == 2) { | |
| var tagName = methods; | |
| methods = arguments[1]; | |
| } | |
| if (!tagName) Object.extend(Element.Methods, methods || { }); | |
| else { | |
| if (Object.isArray(tagName)) tagName.each(extend); | |
| else extend(tagName); | |
| } | |
| function extend(tagName) { | |
| tagName = tagName.toUpperCase(); | |
| if (!Element.Methods.ByTag[tagName]) | |
| Element.Methods.ByTag[tagName] = { }; | |
| Object.extend(Element.Methods.ByTag[tagName], methods); | |
| } | |
| function copy(methods, destination, onlyIfAbsent) { | |
| onlyIfAbsent = onlyIfAbsent || false; | |
| for (var property in methods) { | |
| var value = methods[property]; | |
| if (!Object.isFunction(value)) continue; | |
| if (!onlyIfAbsent || !(property in destination)) | |
| destination[property] = value.methodize(); | |
| } | |
| } | |
| function findDOMClass(tagName) { | |
| var klass; | |
| var trans = { | |
| "OPTGROUP": "OptGroup", "TEXTAREA": "TextArea", "P": "Paragraph", | |
| "FIELDSET": "FieldSet", "UL": "UList", "OL": "OList", "DL": "DList", | |
| "DIR": "Directory", "H1": "Heading", "H2": "Heading", "H3": "Heading", | |
| "H4": "Heading", "H5": "Heading", "H6": "Heading", "Q": "Quote", | |
| "INS": "Mod", "DEL": "Mod", "A": "Anchor", "IMG": "Image", "CAPTION": | |
| "TableCaption", "COL": "TableCol", "COLGROUP": "TableCol", "THEAD": | |
| "TableSection", "TFOOT": "TableSection", "TBODY": "TableSection", "TR": | |
| "TableRow", "TH": "TableCell", "TD": "TableCell", "FRAMESET": | |
| "FrameSet", "IFRAME": "IFrame" | |
| }; | |
| if (trans[tagName]) klass = 'HTML' + trans[tagName] + 'Element'; | |
| if (window[klass]) return window[klass]; | |
| klass = 'HTML' + tagName + 'Element'; | |
| if (window[klass]) return window[klass]; | |
| klass = 'HTML' + tagName.capitalize() + 'Element'; | |
| if (window[klass]) return window[klass]; | |
| window[klass] = { }; | |
| window[klass].prototype = document.createElement(tagName).__proto__; | |
| return window[klass]; | |
| } | |
| if (F.ElementExtensions) { | |
| copy(Element.Methods, HTMLElement.prototype); | |
| copy(Element.Methods.Simulated, HTMLElement.prototype, true); | |
| } | |
| if (F.SpecificElementExtensions) { | |
| for (var tag in Element.Methods.ByTag) { | |
| var klass = findDOMClass(tag); | |
| if (Object.isUndefined(klass)) continue; | |
| copy(T[tag], klass.prototype); | |
| } | |
| } | |
| Object.extend(Element, Element.Methods); | |
| delete Element.ByTag; | |
| if (Element.extend.refresh) Element.extend.refresh(); | |
| Element.cache = { }; | |
| }; | |
| document.viewport = { | |
| getDimensions: function() { | |
| var dimensions = { }; | |
| var B = Prototype.Browser; | |
| $w('width height').each(function(d) { | |
| var D = d.capitalize(); | |
| dimensions[d] = (B.WebKit && !document.evaluate) ? self['inner' + D] : | |
| (B.Opera) ? document.body['client' + D] : document.documentElement['client' + D]; | |
| }); | |
| return dimensions; | |
| }, | |
| getWidth: function() { | |
| return this.getDimensions().width; | |
| }, | |
| getHeight: function() { | |
| return this.getDimensions().height; | |
| }, | |
| getScrollOffsets: function() { | |
| return Element._returnOffset( | |
| window.pageXOffset || document.documentElement.scrollLeft || document.body.scrollLeft, | |
| window.pageYOffset || document.documentElement.scrollTop || document.body.scrollTop); | |
| } | |
| }; | |
| /* Portions of the Selector class are derived from Jack Slocum’s DomQuery, | |
| * part of YUI-Ext version 0.40, distributed under the terms of an MIT-style | |
| * license. Please see http://www.yui-ext.com/ for more information. */ | |
| var Selector = Class.create({ | |
| initialize: function(expression) { | |
| this.expression = expression.strip(); | |
| this.compileMatcher(); | |
| }, | |
| shouldUseXPath: function() { | |
| if (!Prototype.BrowserFeatures.XPath) return false; | |
| var e = this.expression; | |
| // Safari 3 chokes on :*-of-type and :empty | |
| if (Prototype.Browser.WebKit && | |
| (e.include("-of-type") || e.include(":empty"))) | |
| return false; | |
| // XPath can't do namespaced attributes, nor can it read | |
| // the "checked" property from DOM nodes | |
| if ((/(\[[\w-]*?:|:checked)/).test(this.expression)) | |
| return false; | |
| return true; | |
| }, | |
| compileMatcher: function() { | |
| if (this.shouldUseXPath()) | |
| return this.compileXPathMatcher(); | |
| var e = this.expression, ps = Selector.patterns, h = Selector.handlers, | |
| c = Selector.criteria, le, p, m; | |
| if (Selector._cache[e]) { | |
| this.matcher = Selector._cache[e]; | |
| return; | |
| } | |
| this.matcher = ["this.matcher = function(root) {", | |
| "var r = root, h = Selector.handlers, c = false, n;"]; | |
| while (e && le != e && (/\S/).test(e)) { | |
| le = e; | |
| for (var i in ps) { | |
| p = ps[i]; | |
| if (m = e.match(p)) { | |
| this.matcher.push(Object.isFunction(c[i]) ? c[i](m) : | |
| new Template(c[i]).evaluate(m)); | |
| e = e.replace(m[0], ''); | |
| break; | |
| } | |
| } | |
| } | |
| this.matcher.push("return h.unique(n);\n}"); | |
| eval(this.matcher.join('\n')); | |
| Selector._cache[this.expression] = this.matcher; | |
| }, | |
| compileXPathMatcher: function() { | |
| var e = this.expression, ps = Selector.patterns, | |
| x = Selector.xpath, le, m; | |
| if (Selector._cache[e]) { | |
| this.xpath = Selector._cache[e]; return; | |
| } | |
| this.matcher = ['.//*']; | |
| while (e && le != e && (/\S/).test(e)) { | |
| le = e; | |
| for (var i in ps) { | |
| if (m = e.match(ps[i])) { | |
| this.matcher.push(Object.isFunction(x[i]) ? x[i](m) : | |
| new Template(x[i]).evaluate(m)); | |
| e = e.replace(m[0], ''); | |
| break; | |
| } | |
| } | |
| } | |
| this.xpath = this.matcher.join(''); | |
| Selector._cache[this.expression] = this.xpath; | |
| }, | |
| findElements: function(root) { | |
| root = root || document; | |
| if (this.xpath) return document._getElementsByXPath(this.xpath, root); | |
| return this.matcher(root); | |
| }, | |
| match: function(element) { | |
| this.tokens = []; | |
| var e = this.expression, ps = Selector.patterns, as = Selector.assertions; | |
| var le, p, m; | |
| while (e && le !== e && (/\S/).test(e)) { | |
| le = e; | |
| for (var i in ps) { | |
| p = ps[i]; | |
| if (m = e.match(p)) { | |
| // use the Selector.assertions methods unless the selector | |
| // is too complex. | |
| if (as[i]) { | |
| this.tokens.push([i, Object.clone(m)]); | |
| e = e.replace(m[0], ''); | |
| } else { | |
| // reluctantly do a document-wide search | |
| // and look for a match in the array | |
| return this.findElements(document).include(element); | |
| } | |
| } | |
| } | |
| } | |
| var match = true, name, matches; | |
| for (var i = 0, token; token = this.tokens[i]; i++) { | |
| name = token[0], matches = token[1]; | |
| if (!Selector.assertions[name](element, matches)) { | |
| match = false; break; | |
| } | |
| } | |
| return match; | |
| }, | |
| toString: function() { | |
| return this.expression; | |
| }, | |
| inspect: function() { | |
| return "#<Selector:" + this.expression.inspect() + ">"; | |
| } | |
| }); | |
| Object.extend(Selector, { | |
| _cache: { }, | |
| xpath: { | |
| descendant: "//*", | |
| child: "/*", | |
| adjacent: "/following-sibling::*[1]", | |
| laterSibling: '/following-sibling::*', | |
| tagName: function(m) { | |
| if (m[1] == '*') return ''; | |
| return "[local-name()='" + m[1].toLowerCase() + | |
| "' or local-name()='" + m[1].toUpperCase() + "']"; | |
| }, | |
| className: "[contains(concat(' ', @class, ' '), ' #{1} ')]", | |
| id: "[@id='#{1}']", | |
| attrPresence: function(m) { | |
| m[1] = m[1].toLowerCase(); | |
| return new Template("[@#{1}]").evaluate(m); | |
| }, | |
| attr: function(m) { | |
| m[1] = m[1].toLowerCase(); | |
| m[3] = m[5] || m[6]; | |
| return new Template(Selector.xpath.operators[m[2]]).evaluate(m); | |
| }, | |
| pseudo: function(m) { | |
| var h = Selector.xpath.pseudos[m[1]]; | |
| if (!h) return ''; | |
| if (Object.isFunction(h)) return h(m); | |
| return new Template(Selector.xpath.pseudos[m[1]]).evaluate(m); | |
| }, | |
| operators: { | |
| '=': "[@#{1}='#{3}']", | |
| '!=': "[@#{1}!='#{3}']", | |
| '^=': "[starts-with(@#{1}, '#{3}')]", | |
| '$=': "[substring(@#{1}, (string-length(@#{1}) - string-length('#{3}') + 1))='#{3}']", | |
| '*=': "[contains(@#{1}, '#{3}')]", | |
| '~=': "[contains(concat(' ', @#{1}, ' '), ' #{3} ')]", | |
| '|=': "[contains(concat('-', @#{1}, '-'), '-#{3}-')]" | |
| }, | |
| pseudos: { | |
| 'first-child': '[not(preceding-sibling::*)]', | |
| 'last-child': '[not(following-sibling::*)]', | |
| 'only-child': '[not(preceding-sibling::* or following-sibling::*)]', | |
| 'empty': "[count(*) = 0 and (count(text()) = 0 or translate(text(), ' \t\r\n', '') = '')]", | |
| 'checked': "[@checked]", | |
| 'disabled': "[@disabled]", | |
| 'enabled': "[not(@disabled)]", | |
| 'not': function(m) { | |
| var e = m[6], p = Selector.patterns, | |
| x = Selector.xpath, le, v; | |
| var exclusion = []; | |
| while (e && le != e && (/\S/).test(e)) { | |
| le = e; | |
| for (var i in p) { | |
| if (m = e.match(p[i])) { | |
| v = Object.isFunction(x[i]) ? x[i](m) : new Template(x[i]).evaluate(m); | |
| exclusion.push("(" + v.substring(1, v.length - 1) + ")"); | |
| e = e.replace(m[0], ''); | |
| break; | |
| } | |
| } | |
| } | |
| return "[not(" + exclusion.join(" and ") + ")]"; | |
| }, | |
| 'nth-child': function(m) { | |
| return Selector.xpath.pseudos.nth("(count(./preceding-sibling::*) + 1) ", m); | |
| }, | |
| 'nth-last-child': function(m) { | |
| return Selector.xpath.pseudos.nth("(count(./following-sibling::*) + 1) ", m); | |
| }, | |
| 'nth-of-type': function(m) { | |
| return Selector.xpath.pseudos.nth("position() ", m); | |
| }, | |
| 'nth-last-of-type': function(m) { | |
| return Selector.xpath.pseudos.nth("(last() + 1 - position()) ", m); | |
| }, | |
| 'first-of-type': function(m) { | |
| m[6] = "1"; return Selector.xpath.pseudos['nth-of-type'](m); | |
| }, | |
| 'last-of-type': function(m) { | |
| m[6] = "1"; return Selector.xpath.pseudos['nth-last-of-type'](m); | |
| }, | |
| 'only-of-type': function(m) { | |
| var p = Selector.xpath.pseudos; return p['first-of-type'](m) + p['last-of-type'](m); | |
| }, | |
| nth: function(fragment, m) { | |
| var mm, formula = m[6], predicate; | |
| if (formula == 'even') formula = '2n+0'; | |
| if (formula == 'odd') formula = '2n+1'; | |
| if (mm = formula.match(/^(\d+)$/)) // digit only | |
| return '[' + fragment + "= " + mm[1] + ']'; | |
| if (mm = formula.match(/^(-?\d*)?n(([+-])(\d+))?/)) { // an+b | |
| if (mm[1] == "-") mm[1] = -1; | |
| var a = mm[1] ? Number(mm[1]) : 1; | |
| var b = mm[2] ? Number(mm[2]) : 0; | |
| predicate = "[((#{fragment} - #{b}) mod #{a} = 0) and " + | |
| "((#{fragment} - #{b}) div #{a} >= 0)]"; | |
| return new Template(predicate).evaluate({ | |
| fragment: fragment, a: a, b: b }); | |
| } | |
| } | |
| } | |
| }, | |
| criteria: { | |
| tagName: 'n = h.tagName(n, r, "#{1}", c); c = false;', | |
| className: 'n = h.className(n, r, "#{1}", c); c = false;', | |
| id: 'n = h.id(n, r, "#{1}", c); c = false;', | |
| attrPresence: 'n = h.attrPresence(n, r, "#{1}", c); c = false;', | |
| attr: function(m) { | |
| m[3] = (m[5] || m[6]); | |
| return new Template('n = h.attr(n, r, "#{1}", "#{3}", "#{2}", c); c = false;').evaluate(m); | |
| }, | |
| pseudo: function(m) { | |
| if (m[6]) m[6] = m[6].replace(/"/g, '\\"'); | |
| return new Template('n = h.pseudo(n, "#{1}", "#{6}", r, c); c = false;').evaluate(m); | |
| }, | |
| descendant: 'c = "descendant";', | |
| child: 'c = "child";', | |
| adjacent: 'c = "adjacent";', | |
| laterSibling: 'c = "laterSibling";' | |
| }, | |
| patterns: { | |
| // combinators must be listed first | |
| // (and descendant needs to be last combinator) | |
| laterSibling: /^\s*~\s*/, | |
| child: /^\s*>\s*/, | |
| adjacent: /^\s*\+\s*/, | |
| descendant: /^\s/, | |
| // selectors follow | |
| tagName: /^\s*(\*|[\w\-]+)(\b|$)?/, | |
| id: /^#([\w\-\*]+)(\b|$)/, | |
| className: /^\.([\w\-\*]+)(\b|$)/, | |
| pseudo: | |
| /^:((first|last|nth|nth-last|only)(-child|-of-type)|empty|checked|(en|dis)abled|not)(\((.*?)\))?(\b|$|(?=\s|[:+~>]))/, | |
| attrPresence: /^\[([\w]+)\]/, | |
| attr: /\[((?:[\w-]*:)?[\w-]+)\s*(?:([!^$*~|]?=)\s*((['"])([^\4]*?)\4|([^'"][^\]]*?)))?\]/ | |
| }, | |
| // for Selector.match and Element#match | |
| assertions: { | |
| tagName: function(element, matches) { | |
| return matches[1].toUpperCase() == element.tagName.toUpperCase(); | |
| }, | |
| className: function(element, matches) { | |
| return Element.hasClassName(element, matches[1]); | |
| }, | |
| id: function(element, matches) { | |
| return element.id === matches[1]; | |
| }, | |
| attrPresence: function(element, matches) { | |
| return Element.hasAttribute(element, matches[1]); | |
| }, | |
| attr: function(element, matches) { | |
| var nodeValue = Element.readAttribute(element, matches[1]); | |
| return nodeValue && Selector.operators[matches[2]](nodeValue, matches[5] || matches[6]); | |
| } | |
| }, | |
| handlers: { | |
| // UTILITY FUNCTIONS | |
| // joins two collections | |
| concat: function(a, b) { | |
| for (var i = 0, node; node = b[i]; i++) | |
| a.push(node); | |
| return a; | |
| }, | |
| // marks an array of nodes for counting | |
| mark: function(nodes) { | |
| var _true = Prototype.emptyFunction; | |
| for (var i = 0, node; node = nodes[i]; i++) | |
| node._countedByPrototype = _true; | |
| return nodes; | |
| }, | |
| unmark: function(nodes) { | |
| for (var i = 0, node; node = nodes[i]; i++) | |
| node._countedByPrototype = undefined; | |
| return nodes; | |
| }, | |
| // mark each child node with its position (for nth calls) | |
| // "ofType" flag indicates whether we're indexing for nth-of-type | |
| // rather than nth-child | |
| index: function(parentNode, reverse, ofType) { | |
| parentNode._countedByPrototype = Prototype.emptyFunction; | |
| if (reverse) { | |
| for (var nodes = parentNode.childNodes, i = nodes.length - 1, j = 1; i >= 0; i--) { | |
| var node = nodes[i]; | |
| if (node.nodeType == 1 && (!ofType || node._countedByPrototype)) node.nodeIndex = j++; | |
| } | |
| } else { | |
| for (var i = 0, j = 1, nodes = parentNode.childNodes; node = nodes[i]; i++) | |
| if (node.nodeType == 1 && (!ofType || node._countedByPrototype)) node.nodeIndex = j++; | |
| } | |
| }, | |
| // filters out duplicates and extends all nodes | |
| unique: function(nodes) { | |
| if (nodes.length == 0) return nodes; | |
| var results = [], n; | |
| for (var i = 0, l = nodes.length; i < l; i++) | |
| if (!(n = nodes[i])._countedByPrototype) { | |
| n._countedByPrototype = Prototype.emptyFunction; | |
| results.push(Element.extend(n)); | |
| } | |
| return Selector.handlers.unmark(results); | |
| }, | |
| // COMBINATOR FUNCTIONS | |
| descendant: function(nodes) { | |
| var h = Selector.handlers; | |
| for (var i = 0, results = [], node; node = nodes[i]; i++) | |
| h.concat(results, node.getElementsByTagName('*')); | |
| return results; | |
| }, | |
| child: function(nodes) { | |
| var h = Selector.handlers; | |
| for (var i = 0, results = [], node; node = nodes[i]; i++) { | |
| for (var j = 0, child; child = node.childNodes[j]; j++) | |
| if (child.nodeType == 1 && child.tagName != '!') results.push(child); | |
| } | |
| return results; | |
| }, | |
| adjacent: function(nodes) { | |
| for (var i = 0, results = [], node; node = nodes[i]; i++) { | |
| var next = this.nextElementSibling(node); | |
| if (next) results.push(next); | |
| } | |
| return results; | |
| }, | |
| laterSibling: function(nodes) { | |
| var h = Selector.handlers; | |
| for (var i = 0, results = [], node; node = nodes[i]; i++) | |
| h.concat(results, Element.nextSiblings(node)); | |
| return results; | |
| }, | |
| nextElementSibling: function(node) { | |
| while (node = node.nextSibling) | |
| if (node.nodeType == 1) return node; | |
| return null; | |
| }, | |
| previousElementSibling: function(node) { | |
| while (node = node.previousSibling) | |
| if (node.nodeType == 1) return node; | |
| return null; | |
| }, | |
| // TOKEN FUNCTIONS | |
| tagName: function(nodes, root, tagName, combinator) { | |
| var uTagName = tagName.toUpperCase(); | |
| var results = [], h = Selector.handlers; | |
| if (nodes) { | |
| if (combinator) { | |
| // fastlane for ordinary descendant combinators | |
| if (combinator == "descendant") { | |
| for (var i = 0, node; node = nodes[i]; i++) | |
| h.concat(results, node.getElementsByTagName(tagName)); | |
| return results; | |
| } else nodes = this[combinator](nodes); | |
| if (tagName == "*") return nodes; | |
| } | |
| for (var i = 0, node; node = nodes[i]; i++) | |
| if (node.tagName.toUpperCase() === uTagName) results.push(node); | |
| return results; | |
| } else return root.getElementsByTagName(tagName); | |
| }, | |
| id: function(nodes, root, id, combinator) { | |
| var targetNode = $(id), h = Selector.handlers; | |
| if (!targetNode) return []; | |
| if (!nodes && root == document) return [targetNode]; | |
| if (nodes) { | |
| if (combinator) { | |
| if (combinator == 'child') { | |
| for (var i = 0, node; node = nodes[i]; i++) | |
| if (targetNode.parentNode == node) return [targetNode]; | |
| } else if (combinator == 'descendant') { | |
| for (var i = 0, node; node = nodes[i]; i++) | |
| if (Element.descendantOf(targetNode, node)) return [targetNode]; | |
| } else if (combinator == 'adjacent') { | |
| for (var i = 0, node; node = nodes[i]; i++) | |
| if (Selector.handlers.previousElementSibling(targetNode) == node) | |
| return [targetNode]; | |
| } else nodes = h[combinator](nodes); | |
| } | |
| for (var i = 0, node; node = nodes[i]; i++) | |
| if (node == targetNode) return [targetNode]; | |
| return []; | |
| } | |
| return (targetNode && Element.descendantOf(targetNode, root)) ? [targetNode] : []; | |
| }, | |
| className: function(nodes, root, className, combinator) { | |
| if (nodes && combinator) nodes = this[combinator](nodes); | |
| return Selector.handlers.byClassName(nodes, root, className); | |
| }, | |
| byClassName: function(nodes, root, className) { | |
| if (!nodes) nodes = Selector.handlers.descendant([root]); | |
| var needle = ' ' + className + ' '; | |
| for (var i = 0, results = [], node, nodeClassName; node = nodes[i]; i++) { | |
| nodeClassName = node.className; | |
| if (nodeClassName.length == 0) continue; | |
| if (nodeClassName == className || (' ' + nodeClassName + ' ').include(needle)) | |
| results.push(node); | |
| } | |
| return results; | |
| }, | |
| attrPresence: function(nodes, root, attr, combinator) { | |
| if (!nodes) nodes = root.getElementsByTagName("*"); | |
| if (nodes && combinator) nodes = this[combinator](nodes); | |
| var results = []; | |
| for (var i = 0, node; node = nodes[i]; i++) | |
| if (Element.hasAttribute(node, attr)) results.push(node); | |
| return results; | |
| }, | |
| attr: function(nodes, root, attr, value, operator, combinator) { | |
| if (!nodes) nodes = root.getElementsByTagName("*"); | |
| if (nodes && combinator) nodes = this[combinator](nodes); | |
| var handler = Selector.operators[operator], results = []; | |
| for (var i = 0, node; node = nodes[i]; i++) { | |
| var nodeValue = Element.readAttribute(node, attr); | |
| if (nodeValue === null) continue; | |
| if (handler(nodeValue, value)) results.push(node); | |
| } | |
| return results; | |
| }, | |
| pseudo: function(nodes, name, value, root, combinator) { | |
| if (nodes && combinator) nodes = this[combinator](nodes); | |
| if (!nodes) nodes = root.getElementsByTagName("*"); | |
| return Selector.pseudos[name](nodes, value, root); | |
| } | |
| }, | |
| pseudos: { | |
| 'first-child': function(nodes, value, root) { | |
| for (var i = 0, results = [], node; node = nodes[i]; i++) { | |
| if (Selector.handlers.previousElementSibling(node)) continue; | |
| results.push(node); | |
| } | |
| return results; | |
| }, | |
| 'last-child': function(nodes, value, root) { | |
| for (var i = 0, results = [], node; node = nodes[i]; i++) { | |
| if (Selector.handlers.nextElementSibling(node)) continue; | |
| results.push(node); | |
| } | |
| return results; | |
| }, | |
| 'only-child': function(nodes, value, root) { | |
| var h = Selector.handlers; | |
| for (var i = 0, results = [], node; node = nodes[i]; i++) | |
| if (!h.previousElementSibling(node) && !h.nextElementSibling(node)) | |
| results.push(node); | |
| return results; | |
| }, | |
| 'nth-child': function(nodes, formula, root) { | |
| return Selector.pseudos.nth(nodes, formula, root); | |
| }, | |
| 'nth-last-child': function(nodes, formula, root) { | |
| return Selector.pseudos.nth(nodes, formula, root, true); | |
| }, | |
| 'nth-of-type': function(nodes, formula, root) { | |
| return Selector.pseudos.nth(nodes, formula, root, false, true); | |
| }, | |
| 'nth-last-of-type': function(nodes, formula, root) { | |
| return Selector.pseudos.nth(nodes, formula, root, true, true); | |
| }, | |
| 'first-of-type': function(nodes, formula, root) { | |
| return Selector.pseudos.nth(nodes, "1", root, false, true); | |
| }, | |
| 'last-of-type': function(nodes, formula, root) { | |
| return Selector.pseudos.nth(nodes, "1", root, true, true); | |
| }, | |
| 'only-of-type': function(nodes, formula, root) { | |
| var p = Selector.pseudos; | |
| return p['last-of-type'](p['first-of-type'](nodes, formula, root), formula, root); | |
| }, | |
| // handles the an+b logic | |
| getIndices: function(a, b, total) { | |
| if (a == 0) return b > 0 ? [b] : []; | |
| return $R(1, total).inject([], function(memo, i) { | |
| if (0 == (i - b) % a && (i - b) / a >= 0) memo.push(i); | |
| return memo; | |
| }); | |
| }, | |
| // handles nth(-last)-child, nth(-last)-of-type, and (first|last)-of-type | |
| nth: function(nodes, formula, root, reverse, ofType) { | |
| if (nodes.length == 0) return []; | |
| if (formula == 'even') formula = '2n+0'; | |
| if (formula == 'odd') formula = '2n+1'; | |
| var h = Selector.handlers, results = [], indexed = [], m; | |
| h.mark(nodes); | |
| for (var i = 0, node; node = nodes[i]; i++) { | |
| if (!node.parentNode._countedByPrototype) { | |
| h.index(node.parentNode, reverse, ofType); | |
| indexed.push(node.parentNode); | |
| } | |
| } | |
| if (formula.match(/^\d+$/)) { // just a number | |
| formula = Number(formula); | |
| for (var i = 0, node; node = nodes[i]; i++) | |
| if (node.nodeIndex == formula) results.push(node); | |
| } else if (m = formula.match(/^(-?\d*)?n(([+-])(\d+))?/)) { // an+b | |
| if (m[1] == "-") m[1] = -1; | |
| var a = m[1] ? Number(m[1]) : 1; | |
| var b = m[2] ? Number(m[2]) : 0; | |
| var indices = Selector.pseudos.getIndices(a, b, nodes.length); | |
| for (var i = 0, node, l = indices.length; node = nodes[i]; i++) { | |
| for (var j = 0; j < l; j++) | |
| if (node.nodeIndex == indices[j]) results.push(node); | |
| } | |
| } | |
| h.unmark(nodes); | |
| h.unmark(indexed); | |
| return results; | |
| }, | |
| 'empty': function(nodes, value, root) { | |
| for (var i = 0, results = [], node; node = nodes[i]; i++) { | |
| // IE treats comments as element nodes | |
| if (node.tagName == '!' || (node.firstChild && !node.innerHTML.match(/^\s*$/))) continue; | |
| results.push(node); | |
| } | |
| return results; | |
| }, | |
| 'not': function(nodes, selector, root) { | |
| var h = Selector.handlers, selectorType, m; | |
| var exclusions = new Selector(selector).findElements(root); | |
| h.mark(exclusions); | |
| for (var i = 0, results = [], node; node = nodes[i]; i++) | |
| if (!node._countedByPrototype) results.push(node); | |
| h.unmark(exclusions); | |
| return results; | |
| }, | |
| 'enabled': function(nodes, value, root) { | |
| for (var i = 0, results = [], node; node = nodes[i]; i++) | |
| if (!node.disabled) results.push(node); | |
| return results; | |
| }, | |
| 'disabled': function(nodes, value, root) { | |
| for (var i = 0, results = [], node; node = nodes[i]; i++) | |
| if (node.disabled) results.push(node); | |
| return results; | |
| }, | |
| 'checked': function(nodes, value, root) { | |
| for (var i = 0, results = [], node; node = nodes[i]; i++) | |
| if (node.checked) results.push(node); | |
| return results; | |
| } | |
| }, | |
| operators: { | |
| '=': function(nv, v) { return nv == v; }, | |
| '!=': function(nv, v) { return nv != v; }, | |
| '^=': function(nv, v) { return nv.startsWith(v); }, | |
| '$=': function(nv, v) { return nv.endsWith(v); }, | |
| '*=': function(nv, v) { return nv.include(v); }, | |
| '~=': function(nv, v) { return (' ' + nv + ' ').include(' ' + v + ' '); }, | |
| '|=': function(nv, v) { return ('-' + nv.toUpperCase() + '-').include('-' + v.toUpperCase() + '-'); } | |
| }, | |
| split: function(expression) { | |
| var expressions = []; | |
| expression.scan(/(([\w#:.~>+()\s-]+|\*|\[.*?\])+)\s*(,|$)/, function(m) { | |
| expressions.push(m[1].strip()); | |
| }); | |
| return expressions; | |
| }, | |
| matchElements: function(elements, expression) { | |
| var matches = $$(expression), h = Selector.handlers; | |
| h.mark(matches); | |
| for (var i = 0, results = [], element; element = elements[i]; i++) | |
| if (element._countedByPrototype) results.push(element); | |
| h.unmark(matches); | |
| return results; | |
| }, | |
| findElement: function(elements, expression, index) { | |
| if (Object.isNumber(expression)) { | |
| index = expression; expression = false; | |
| } | |
| return Selector.matchElements(elements, expression || '*')[index || 0]; | |
| }, | |
| findChildElements: function(element, expressions) { | |
| expressions = Selector.split(expressions.join(',')); | |
| var results = [], h = Selector.handlers; | |
| for (var i = 0, l = expressions.length, selector; i < l; i++) { | |
| selector = new Selector(expressions[i].strip()); | |
| h.concat(results, selector.findElements(element)); | |
| } | |
| return (l > 1) ? h.unique(results) : results; | |
| } | |
| }); | |
| if (Prototype.Browser.IE) { | |
| Object.extend(Selector.handlers, { | |
| // IE returns comment nodes on getElementsByTagName("*"). | |
| // Filter them out. | |
| concat: function(a, b) { | |
| for (var i = 0, node; node = b[i]; i++) | |
| if (node.tagName !== "!") a.push(node); | |
| return a; | |
| }, | |
| // IE improperly serializes _countedByPrototype in (inner|outer)HTML. | |
| unmark: function(nodes) { | |
| for (var i = 0, node; node = nodes[i]; i++) | |
| node.removeAttribute('_countedByPrototype'); | |
| return nodes; | |
| } | |
| }); | |
| } | |
| function $$() { | |
| return Selector.findChildElements(document, $A(arguments)); | |
| } | |
| var Form = { | |
| reset: function(form) { | |
| $(form).reset(); | |
| return form; | |
| }, | |
| serializeElements: function(elements, options) { | |
| if (typeof options != 'object') options = { hash: !!options }; | |
| else if (Object.isUndefined(options.hash)) options.hash = true; | |
| var key, value, submitted = false, submit = options.submit; | |
| var data = elements.inject({ }, function(result, element) { | |
| if (!element.disabled && element.name) { | |
| key = element.name; value = $(element).getValue(); | |
| if (value != null && (element.type != 'submit' || (!submitted && | |
| submit !== false && (!submit || key == submit) && (submitted = true)))) { | |
| if (key in result) { | |
| // a key is already present; construct an array of values | |
| if (!Object.isArray(result[key])) result[key] = [result[key]]; | |
| result[key].push(value); | |
| } | |
| else result[key] = value; | |
| } | |
| } | |
| return result; | |
| }); | |
| return options.hash ? data : Object.toQueryString(data); | |
| } | |
| }; | |
| Form.Methods = { | |
| serialize: function(form, options) { | |
| return Form.serializeElements(Form.getElements(form), options); | |
| }, | |
| getElements: function(form) { | |
| return $A($(form).getElementsByTagName('*')).inject([], | |
| function(elements, child) { | |
| if (Form.Element.Serializers[child.tagName.toLowerCase()]) | |
| elements.push(Element.extend(child)); | |
| return elements; | |
| } | |
| ); | |
| }, | |
| getInputs: function(form, typeName, name) { | |
| form = $(form); | |
| var inputs = form.getElementsByTagName('input'); | |
| if (!typeName && !name) return $A(inputs).map(Element.extend); | |
| for (var i = 0, matchingInputs = [], length = inputs.length; i < length; i++) { | |
| var input = inputs[i]; | |
| if ((typeName && input.type != typeName) || (name && input.name != name)) | |
| continue; | |
| matchingInputs.push(Element.extend(input)); | |
| } | |
| return matchingInputs; | |
| }, | |
| disable: function(form) { | |
| form = $(form); | |
| Form.getElements(form).invoke('disable'); | |
| return form; | |
| }, | |
| enable: function(form) { | |
| form = $(form); | |
| Form.getElements(form).invoke('enable'); | |
| return form; | |
| }, | |
| findFirstElement: function(form) { | |
| var elements = $(form).getElements().findAll(function(element) { | |
| return 'hidden' != element.type && !element.disabled; | |
| }); | |
| var firstByIndex = elements.findAll(function(element) { | |
| return element.hasAttribute('tabIndex') && element.tabIndex >= 0; | |
| }).sortBy(function(element) { return element.tabIndex }).first(); | |
| return firstByIndex ? firstByIndex : elements.find(function(element) { | |
| return ['input', 'select', 'textarea'].include(element.tagName.toLowerCase()); | |
| }); | |
| }, | |
| focusFirstElement: function(form) { | |
| form = $(form); | |
| form.findFirstElement().activate(); | |
| return form; | |
| }, | |
| request: function(form, options) { | |
| form = $(form), options = Object.clone(options || { }); | |
| var params = options.parameters, action = form.readAttribute('action') || ''; | |
| if (action.blank()) action = window.location.href; | |
| options.parameters = form.serialize(true); | |
| if (params) { | |
| if (Object.isString(params)) params = params.toQueryParams(); | |
| Object.extend(options.parameters, params); | |
| } | |
| if (form.hasAttribute('method') && !options.method) | |
| options.method = form.method; | |
| return new Ajax.Request(action, options); | |
| } | |
| }; | |
| /*--------------------------------------------------------------------------*/ | |
| Form.Element = { | |
| focus: function(element) { | |
| $(element).focus(); | |
| return element; | |
| }, | |
| select: function(element) { | |
| $(element).select(); | |
| return element; | |
| } | |
| }; | |
| Form.Element.Methods = { | |
| serialize: function(element) { | |
| element = $(element); | |
| if (!element.disabled && element.name) { | |
| var value = element.getValue(); | |
| if (value != undefined) { | |
| var pair = { }; | |
| pair[element.name] = value; | |
| return Object.toQueryString(pair); | |
| } | |
| } | |
| return ''; | |
| }, | |
| getValue: function(element) { | |
| element = $(element); | |
| var method = element.tagName.toLowerCase(); | |
| return Form.Element.Serializers[method](element); | |
| }, | |
| setValue: function(element, value) { | |
| element = $(element); | |
| var method = element.tagName.toLowerCase(); | |
| Form.Element.Serializers[method](element, value); | |
| return element; | |
| }, | |
| clear: function(element) { | |
| $(element).value = ''; | |
| return element; | |
| }, | |
| present: function(element) { | |
| return $(element).value != ''; | |
| }, | |
| activate: function(element) { | |
| element = $(element); | |
| try { | |
| element.focus(); | |
| if (element.select && (element.tagName.toLowerCase() != 'input' || | |
| !['button', 'reset', 'submit'].include(element.type))) | |
| element.select(); | |
| } catch (e) { } | |
| return element; | |
| }, | |
| disable: function(element) { | |
| element = $(element); | |
| element.blur(); | |
| element.disabled = true; | |
| return element; | |
| }, | |
| enable: function(element) { | |
| element = $(element); | |
| element.disabled = false; | |
| return element; | |
| } | |
| }; | |
| /*--------------------------------------------------------------------------*/ | |
| var Field = Form.Element; | |
| var $F = Form.Element.Methods.getValue; | |
| /*--------------------------------------------------------------------------*/ | |
| Form.Element.Serializers = { | |
| input: function(element, value) { | |
| switch (element.type.toLowerCase()) { | |
| case 'checkbox': | |
| case 'radio': | |
| return Form.Element.Serializers.inputSelector(element, value); | |
| default: | |
| return Form.Element.Serializers.textarea(element, value); | |
| } | |
| }, | |
| inputSelector: function(element, value) { | |
| if (Object.isUndefined(value)) return element.checked ? element.value : null; | |
| else element.checked = !!value; | |
| }, | |
| textarea: function(element, value) { | |
| if (Object.isUndefined(value)) return element.value; | |
| else element.value = value; | |
| }, | |
| select: function(element, index) { | |
| if (Object.isUndefined(index)) | |
| return this[element.type == 'select-one' ? | |
| 'selectOne' : 'selectMany'](element); | |
| else { | |
| var opt, value, single = !Object.isArray(index); | |
| for (var i = 0, length = element.length; i < length; i++) { | |
| opt = element.options[i]; | |
| value = this.optionValue(opt); | |
| if (single) { | |
| if (value == index) { | |
| opt.selected = true; | |
| return; | |
| } | |
| } | |
| else opt.selected = index.include(value); | |
| } | |
| } | |
| }, | |
| selectOne: function(element) { | |
| var index = element.selectedIndex; | |
| return index >= 0 ? this.optionValue(element.options[index]) : null; | |
| }, | |
| selectMany: function(element) { | |
| var values, length = element.length; | |
| if (!length) return null; | |
| for (var i = 0, values = []; i < length; i++) { | |
| var opt = element.options[i]; | |
| if (opt.selected) values.push(this.optionValue(opt)); | |
| } | |
| return values; | |
| }, | |
| optionValue: function(opt) { | |
| // extend element because hasAttribute may not be native | |
| return Element.extend(opt).hasAttribute('value') ? opt.value : opt.text; | |
| } | |
| }; | |
| /*--------------------------------------------------------------------------*/ | |
| Abstract.TimedObserver = Class.create(PeriodicalExecuter, { | |
| initialize: function($super, element, frequency, callback) { | |
| $super(callback, frequency); | |
| this.element = $(element); | |
| this.lastValue = this.getValue(); | |
| }, | |
| execute: function() { | |
| var value = this.getValue(); | |
| if (Object.isString(this.lastValue) && Object.isString(value) ? | |
| this.lastValue != value : String(this.lastValue) != String(value)) { | |
| this.callback(this.element, value); | |
| this.lastValue = value; | |
| } | |
| } | |
| }); | |
| Form.Element.Observer = Class.create(Abstract.TimedObserver, { | |
| getValue: function() { | |
| return Form.Element.getValue(this.element); | |
| } | |
| }); | |
| Form.Observer = Class.create(Abstract.TimedObserver, { | |
| getValue: function() { | |
| return Form.serialize(this.element); | |
| } | |
| }); | |
| /*--------------------------------------------------------------------------*/ | |
| Abstract.EventObserver = Class.create({ | |
| initialize: function(element, callback) { | |
| this.element = $(element); | |
| this.callback = callback; | |
| this.lastValue = this.getValue(); | |
| if (this.element.tagName.toLowerCase() == 'form') | |
| this.registerFormCallbacks(); | |
| else | |
| this.registerCallback(this.element); | |
| }, | |
| onElementEvent: function() { | |
| var value = this.getValue(); | |
| if (this.lastValue != value) { | |
| this.callback(this.element, value); | |
| this.lastValue = value; | |
| } | |
| }, | |
| registerFormCallbacks: function() { | |
| Form.getElements(this.element).each(this.registerCallback, this); | |
| }, | |
| registerCallback: function(element) { | |
| if (element.type) { | |
| switch (element.type.toLowerCase()) { | |
| case 'checkbox': | |
| case 'radio': | |
| Event.observe(element, 'click', this.onElementEvent.bind(this)); | |
| break; | |
| default: | |
| Event.observe(element, 'change', this.onElementEvent.bind(this)); | |
| break; | |
| } | |
| } | |
| } | |
| }); | |
| Form.Element.EventObserver = Class.create(Abstract.EventObserver, { | |
| getValue: function() { | |
| return Form.Element.getValue(this.element); | |
| } | |
| }); | |
| Form.EventObserver = Class.create(Abstract.EventObserver, { | |
| getValue: function() { | |
| return Form.serialize(this.element); | |
| } | |
| }); | |
| if (!window.Event) var Event = { }; | |
| Object.extend(Event, { | |
| KEY_BACKSPACE: 8, | |
| KEY_TAB: 9, | |
| KEY_RETURN: 13, | |
| KEY_ESC: 27, | |
| KEY_LEFT: 37, | |
| KEY_UP: 38, | |
| KEY_RIGHT: 39, | |
| KEY_DOWN: 40, | |
| KEY_DELETE: 46, | |
| KEY_HOME: 36, | |
| KEY_END: 35, | |
| KEY_PAGEUP: 33, | |
| KEY_PAGEDOWN: 34, | |
| KEY_INSERT: 45, | |
| cache: { }, | |
| relatedTarget: function(event) { | |
| var element; | |
| switch(event.type) { | |
| case 'mouseover': element = event.fromElement; break; | |
| case 'mouseout': element = event.toElement; break; | |
| default: return null; | |
| } | |
| return Element.extend(element); | |
| } | |
| }); | |
| Event.Methods = (function() { | |
| var isButton; | |
| if (Prototype.Browser.IE) { | |
| var buttonMap = { 0: 1, 1: 4, 2: 2 }; | |
| isButton = function(event, code) { | |
| return event.button == buttonMap[code]; | |
| }; | |
| } else if (Prototype.Browser.WebKit) { | |
| isButton = function(event, code) { | |
| switch (code) { | |
| case 0: return event.which == 1 && !event.metaKey; | |
| case 1: return event.which == 1 && event.metaKey; | |
| default: return false; | |
| } | |
| }; | |
| } else { | |
| isButton = function(event, code) { | |
| return event.which ? (event.which === code + 1) : (event.button === code); | |
| }; | |
| } | |
| return { | |
| isLeftClick: function(event) { return isButton(event, 0) }, | |
| isMiddleClick: function(event) { return isButton(event, 1) }, | |
| isRightClick: function(event) { return isButton(event, 2) }, | |
| element: function(event) { | |
| var node = Event.extend(event).target; | |
| return Element.extend(node.nodeType == Node.TEXT_NODE ? node.parentNode : node); | |
| }, | |
| findElement: function(event, expression) { | |
| var element = Event.element(event); | |
| if (!expression) return element; | |
| var elements = [element].concat(element.ancestors()); | |
| return Selector.findElement(elements, expression, 0); | |
| }, | |
| pointer: function(event) { | |
| return { | |
| x: event.pageX || (event.clientX + | |
| (document.documentElement.scrollLeft || document.body.scrollLeft)), | |
| y: event.pageY || (event.clientY + | |
| (document.documentElement.scrollTop || document.body.scrollTop)) | |
| }; | |
| }, | |
| pointerX: function(event) { return Event.pointer(event).x }, | |
| pointerY: function(event) { return Event.pointer(event).y }, | |
| stop: function(event) { | |
| Event.extend(event); | |
| event.preventDefault(); | |
| event.stopPropagation(); | |
| event.stopped = true; | |
| } | |
| }; | |
| })(); | |
| Event.extend = (function() { | |
| var methods = Object.keys(Event.Methods).inject({ }, function(m, name) { | |
| m[name] = Event.Methods[name].methodize(); | |
| return m; | |
| }); | |
| if (Prototype.Browser.IE) { | |
| Object.extend(methods, { | |
| stopPropagation: function() { this.cancelBubble = true }, | |
| preventDefault: function() { this.returnValue = false }, | |
| inspect: function() { return "[object Event]" } | |
| }); | |
| return function(event) { | |
| if (!event) return false; | |
| if (event._extendedByPrototype) return event; | |
| event._extendedByPrototype = Prototype.emptyFunction; | |
| var pointer = Event.pointer(event); | |
| Object.extend(event, { | |
| target: event.srcElement, | |
| relatedTarget: Event.relatedTarget(event), | |
| pageX: pointer.x, | |
| pageY: pointer.y | |
| }); | |
| return Object.extend(event, methods); | |
| }; | |
| } else { | |
| Event.prototype = Event.prototype || document.createEvent("HTMLEvents").__proto__; | |
| Object.extend(Event.prototype, methods); | |
| return Prototype.K; | |
| } | |
| })(); | |
| Object.extend(Event, (function() { | |
| var cache = Event.cache; | |
| function getEventID(element) { | |
| if (element._prototypeEventID) return element._prototypeEventID[0]; | |
| arguments.callee.id = arguments.callee.id || 1; | |
| return element._prototypeEventID = [++arguments.callee.id]; | |
| } | |
| function getDOMEventName(eventName) { | |
| if (eventName && eventName.include(':')) return "dataavailable"; | |
| return eventName; | |
| } | |
| function getCacheForID(id) { | |
| return cache[id] = cache[id] || { }; | |
| } | |
| function getWrappersForEventName(id, eventName) { | |
| var c = getCacheForID(id); | |
| return c[eventName] = c[eventName] || []; | |
| } | |
| function createWrapper(element, eventName, handler) { | |
| var id = getEventID(element); | |
| var c = getWrappersForEventName(id, eventName); | |
| if (c.pluck("handler").include(handler)) return false; | |
| var wrapper = function(event) { | |
| if (!Event || !Event.extend || | |
| (event.eventName && event.eventName != eventName)) | |
| return false; | |
| Event.extend(event); | |
| handler.call(element, event); | |
| }; | |
| wrapper.handler = handler; | |
| c.push(wrapper); | |
| return wrapper; | |
| } | |
| function findWrapper(id, eventName, handler) { | |
| var c = getWrappersForEventName(id, eventName); | |
| return c.find(function(wrapper) { return wrapper.handler == handler }); | |
| } | |
| function destroyWrapper(id, eventName, handler) { | |
| var c = getCacheForID(id); | |
| if (!c[eventName]) return false; | |
| c[eventName] = c[eventName].without(findWrapper(id, eventName, handler)); | |
| } | |
| function destroyCache() { | |
| for (var id in cache) | |
| for (var eventName in cache[id]) | |
| cache[id][eventName] = null; | |
| } | |
| if (window.attachEvent) { | |
| window.attachEvent("onunload", destroyCache); | |
| } | |
| return { | |
| observe: function(element, eventName, handler) { | |
| element = $(element); | |
| var name = getDOMEventName(eventName); | |
| var wrapper = createWrapper(element, eventName, handler); | |
| if (!wrapper) return element; | |
| if (element.addEventListener) { | |
| element.addEventListener(name, wrapper, false); | |
| } else { | |
| element.attachEvent("on" + name, wrapper); | |
| } | |
| return element; | |
| }, | |
| stopObserving: function(element, eventName, handler) { | |
| element = $(element); | |
| var id = getEventID(element), name = getDOMEventName(eventName); | |
| if (!handler && eventName) { | |
| getWrappersForEventName(id, eventName).each(function(wrapper) { | |
| element.stopObserving(eventName, wrapper.handler); | |
| }); | |
| return element; | |
| } else if (!eventName) { | |
| Object.keys(getCacheForID(id)).each(function(eventName) { | |
| element.stopObserving(eventName); | |
| }); | |
| return element; | |
| } | |
| var wrapper = findWrapper(id, eventName, handler); | |
| if (!wrapper) return element; | |
| if (element.removeEventListener) { | |
| element.removeEventListener(name, wrapper, false); | |
| } else { | |
| element.detachEvent("on" + name, wrapper); | |
| } | |
| destroyWrapper(id, eventName, handler); | |
| return element; | |
| }, | |
| fire: function(element, eventName, memo) { | |
| element = $(element); | |
| if (element == document && document.createEvent && !element.dispatchEvent) | |
| element = document.documentElement; | |
| var event; | |
| if (document.createEvent) { | |
| event = document.createEvent("HTMLEvents"); | |
| event.initEvent("dataavailable", true, true); | |
| } else { | |
| event = document.createEventObject(); | |
| event.eventType = "ondataavailable"; | |
| } | |
| event.eventName = eventName; | |
| event.memo = memo || { }; | |
| if (document.createEvent) { | |
| element.dispatchEvent(event); | |
| } else { | |
| element.fireEvent(event.eventType, event); | |
| } | |
| return Event.extend(event); | |
| } | |
| }; | |
| })()); | |
| Object.extend(Event, Event.Methods); | |
| Element.addMethods({ | |
| fire: Event.fire, | |
| observe: Event.observe, | |
| stopObserving: Event.stopObserving | |
| }); | |
| Object.extend(document, { | |
| fire: Element.Methods.fire.methodize(), | |
| observe: Element.Methods.observe.methodize(), | |
| stopObserving: Element.Methods.stopObserving.methodize(), | |
| loaded: false | |
| }); | |
| (function() { | |
| /* Support for the DOMContentLoaded event is based on work by Dan Webb, | |
| Matthias Miller, Dean Edwards and John Resig. */ | |
| var timer; | |
| function fireContentLoadedEvent() { | |
| if (document.loaded) return; | |
| if (timer) window.clearInterval(timer); | |
| document.fire("dom:loaded"); | |
| document.loaded = true; | |
| } | |
| if (document.addEventListener) { | |
| if (Prototype.Browser.WebKit) { | |
| timer = window.setInterval(function() { | |
| if (/loaded|complete/.test(document.readyState)) | |
| fireContentLoadedEvent(); | |
| }, 0); | |
| Event.observe(window, "load", fireContentLoadedEvent); | |
| } else { | |
| document.addEventListener("DOMContentLoaded", | |
| fireContentLoadedEvent, false); | |
| } | |
| } else { | |
| document.write("<script id=__onDOMContentLoaded defer src=//:><\/script>"); | |
| $("__onDOMContentLoaded").onreadystatechange = function() { | |
| if (this.readyState == "complete") { | |
| this.onreadystatechange = null; | |
| fireContentLoadedEvent(); | |
| } | |
| }; | |
| } | |
| })(); | |
| /*------------------------------- DEPRECATED -------------------------------*/ | |
| Hash.toQueryString = Object.toQueryString; | |
| var Toggle = { display: Element.toggle }; | |
| Element.Methods.childOf = Element.Methods.descendantOf; | |
| var Insertion = { | |
| Before: function(element, content) { | |
| return Element.insert(element, {before:content}); | |
| }, | |
| Top: function(element, content) { | |
| return Element.insert(element, {top:content}); | |
| }, | |
| Bottom: function(element, content) { | |
| return Element.insert(element, {bottom:content}); | |
| }, | |
| After: function(element, content) { | |
| return Element.insert(element, {after:content}); | |
| } | |
| }; | |
| var $continue = new Error('"throw $continue" is deprecated, use "return" instead'); | |
| // This should be moved to script.aculo.us; notice the deprecated methods | |
| // further below, that map to the newer Element methods. | |
| var Position = { | |
| // set to true if needed, warning: firefox performance problems | |
| // NOT neeeded for page scrolling, only if draggable contained in | |
| // scrollable elements | |
| includeScrollOffsets: false, | |
| // must be called before calling withinIncludingScrolloffset, every time the | |
| // page is scrolled | |
| prepare: function() { | |
| this.deltaX = window.pageXOffset | |
| || document.documentElement.scrollLeft | |
| || document.body.scrollLeft | |
| || 0; | |
| this.deltaY = window.pageYOffset | |
| || document.documentElement.scrollTop | |
| || document.body.scrollTop | |
| || 0; | |
| }, | |
| // caches x/y coordinate pair to use with overlap | |
| within: function(element, x, y) { | |
| if (this.includeScrollOffsets) | |
| return this.withinIncludingScrolloffsets(element, x, y); | |
| this.xcomp = x; | |
| this.ycomp = y; | |
| this.offset = Element.cumulativeOffset(element); | |
| return (y >= this.offset[1] && | |
| y < this.offset[1] + element.offsetHeight && | |
| x >= this.offset[0] && | |
| x < this.offset[0] + element.offsetWidth); | |
| }, | |
| withinIncludingScrolloffsets: function(element, x, y) { | |
| var offsetcache = Element.cumulativeScrollOffset(element); | |
| this.xcomp = x + offsetcache[0] - this.deltaX; | |
| this.ycomp = y + offsetcache[1] - this.deltaY; | |
| this.offset = Element.cumulativeOffset(element); | |
| return (this.ycomp >= this.offset[1] && | |
| this.ycomp < this.offset[1] + element.offsetHeight && | |
| this.xcomp >= this.offset[0] && | |
| this.xcomp < this.offset[0] + element.offsetWidth); | |
| }, | |
| // within must be called directly before | |
| overlap: function(mode, element) { | |
| if (!mode) return 0; | |
| if (mode == 'vertical') | |
| return ((this.offset[1] + element.offsetHeight) - this.ycomp) / | |
| element.offsetHeight; | |
| if (mode == 'horizontal') | |
| return ((this.offset[0] + element.offsetWidth) - this.xcomp) / | |
| element.offsetWidth; | |
| }, | |
| // Deprecation layer -- use newer Element methods now (1.5.2). | |
| cumulativeOffset: Element.Methods.cumulativeOffset, | |
| positionedOffset: Element.Methods.positionedOffset, | |
| absolutize: function(element) { | |
| Position.prepare(); | |
| return Element.absolutize(element); | |
| }, | |
| relativize: function(element) { | |
| Position.prepare(); | |
| return Element.relativize(element); | |
| }, | |
| realOffset: Element.Methods.cumulativeScrollOffset, | |
| offsetParent: Element.Methods.getOffsetParent, | |
| page: Element.Methods.viewportOffset, | |
| clone: function(source, target, options) { | |
| options = options || { }; | |
| return Element.clonePosition(target, source, options); | |
| } | |
| }; | |
| /*--------------------------------------------------------------------------*/ | |
| if (!document.getElementsByClassName) document.getElementsByClassName = function(instanceMethods){ | |
| function iter(name) { | |
| return name.blank() ? null : "[contains(concat(' ', @class, ' '), ' " + name + " ')]"; | |
| } | |
| instanceMethods.getElementsByClassName = Prototype.BrowserFeatures.XPath ? | |
| function(element, className) { | |
| className = className.toString().strip(); | |
| var cond = /\s/.test(className) ? $w(className).map(iter).join('') : iter(className); | |
| return cond ? document._getElementsByXPath('.//*' + cond, element) : []; | |
| } : function(element, className) { | |
| className = className.toString().strip(); | |
| var elements = [], classNames = (/\s/.test(className) ? $w(className) : null); | |
| if (!classNames && !className) return elements; | |
| var nodes = $(element).getElementsByTagName('*'); | |
| className = ' ' + className + ' '; | |
| for (var i = 0, child, cn; child = nodes[i]; i++) { | |
| if (child.className && (cn = ' ' + child.className + ' ') && (cn.include(className) || | |
| (classNames && classNames.all(function(name) { | |
| return !name.toString().blank() && cn.include(' ' + name + ' '); | |
| })))) | |
| elements.push(Element.extend(child)); | |
| } | |
| return elements; | |
| }; | |
| return function(className, parentElement) { | |
| return $(parentElement || document.body).getElementsByClassName(className); | |
| }; | |
| }(Element.Methods); | |
| /*--------------------------------------------------------------------------*/ | |
| Element.ClassNames = Class.create(); | |
| Element.ClassNames.prototype = { | |
| initialize: function(element) { | |
| this.element = $(element); | |
| }, | |
| _each: function(iterator) { | |
| this.element.className.split(/\s+/).select(function(name) { | |
| return name.length > 0; | |
| })._each(iterator); | |
| }, | |
| set: function(className) { | |
| this.element.className = className; | |
| }, | |
| add: function(classNameToAdd) { | |
| if (this.include(classNameToAdd)) return; | |
| this.set($A(this).concat(classNameToAdd).join(' ')); | |
| }, | |
| remove: function(classNameToRemove) { | |
| if (!this.include(classNameToRemove)) return; | |
| this.set($A(this).without(classNameToRemove).join(' ')); | |
| }, | |
| toString: function() { | |
| return $A(this).join(' '); | |
| } | |
| }; | |
| Object.extend(Element.ClassNames.prototype, Enumerable); | |
| /*--------------------------------------------------------------------------*/ | |
| Element.addMethods(); |
| /*! | |
| * jQuery JavaScript Library v1.6.1 | |
| * http://jquery.com/ | |
| * | |
| * Copyright 2011, John Resig | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| * | |
| * Includes Sizzle.js | |
| * http://sizzlejs.com/ | |
| * Copyright 2011, The Dojo Foundation | |
| * Released under the MIT, BSD, and GPL Licenses. | |
| * | |
| * Date: Thu May 12 15:04:36 2011 -0400 | |
| */ | |
| (function(a,b){function cy(a){return f.isWindow(a)?a:a.nodeType===9?a.defaultView||a.parentWindow:!1}function cv(a){if(!cj[a]){var b=f("<"+a+">").appendTo("body"),d=b.css("display");b.remove();if(d==="none"||d===""){ck||(ck=c.createElement("iframe"),ck.frameBorder=ck.width=ck.height=0),c.body.appendChild(ck);if(!cl||!ck.createElement)cl=(ck.contentWindow||ck.contentDocument).document,cl.write("<!doctype><html><body></body></html>");b=cl.createElement(a),cl.body.appendChild(b),d=f.css(b,"display"),c.body.removeChild(ck)}cj[a]=d}return cj[a]}function cu(a,b){var c={};f.each(cp.concat.apply([],cp.slice(0,b)),function(){c[this]=a});return c}function ct(){cq=b}function cs(){setTimeout(ct,0);return cq=f.now()}function ci(){try{return new a.ActiveXObject("Microsoft.XMLHTTP")}catch(b){}}function ch(){try{return new a.XMLHttpRequest}catch(b){}}function cb(a,c){a.dataFilter&&(c=a.dataFilter(c,a.dataType));var d=a.dataTypes,e={},g,h,i=d.length,j,k=d[0],l,m,n,o,p;for(g=1;g<i;g++){if(g===1)for(h in a.converters)typeof h=="string"&&(e[h.toLowerCase()]=a.converters[h]);l=k,k=d[g];if(k==="*")k=l;else if(l!=="*"&&l!==k){m=l+" "+k,n=e[m]||e["* "+k];if(!n){p=b;for(o in e){j=o.split(" ");if(j[0]===l||j[0]==="*"){p=e[j[1]+" "+k];if(p){o=e[o],o===!0?n=p:p===!0&&(n=o);break}}}}!n&&!p&&f.error("No conversion from "+m.replace(" "," to ")),n!==!0&&(c=n?n(c):p(o(c)))}}return c}function ca(a,c,d){var e=a.contents,f=a.dataTypes,g=a.responseFields,h,i,j,k;for(i in g)i in d&&(c[g[i]]=d[i]);while(f[0]==="*")f.shift(),h===b&&(h=a.mimeType||c.getResponseHeader("content-type"));if(h)for(i in e)if(e[i]&&e[i].test(h)){f.unshift(i);break}if(f[0]in d)j=f[0];else{for(i in d){if(!f[0]||a.converters[i+" "+f[0]]){j=i;break}k||(k=i)}j=j||k}if(j){j!==f[0]&&f.unshift(j);return d[j]}}function b_(a,b,c,d){if(f.isArray(b))f.each(b,function(b,e){c||bF.test(a)?d(a,e):b_(a+"["+(typeof e=="object"||f.isArray(e)?b:"")+"]",e,c,d)});else if(!c&&b!=null&&typeof b=="object")for(var e in b)b_(a+"["+e+"]",b[e],c,d);else d(a,b)}function b$(a,c,d,e,f,g){f=f||c.dataTypes[0],g=g||{},g[f]=!0;var h=a[f],i=0,j=h?h.length:0,k=a===bU,l;for(;i<j&&(k||!l);i++)l=h[i](c,d,e),typeof l=="string"&&(!k||g[l]?l=b:(c.dataTypes.unshift(l),l=b$(a,c,d,e,l,g)));(k||!l)&&!g["*"]&&(l=b$(a,c,d,e,"*",g));return l}function bZ(a){return function(b,c){typeof b!="string"&&(c=b,b="*");if(f.isFunction(c)){var d=b.toLowerCase().split(bQ),e=0,g=d.length,h,i,j;for(;e<g;e++)h=d[e],j=/^\+/.test(h),j&&(h=h.substr(1)||"*"),i=a[h]=a[h]||[],i[j?"unshift":"push"](c)}}}function bD(a,b,c){var d=b==="width"?bx:by,e=b==="width"?a.offsetWidth:a.offsetHeight;if(c==="border")return e;f.each(d,function(){c||(e-=parseFloat(f.css(a,"padding"+this))||0),c==="margin"?e+=parseFloat(f.css(a,"margin"+this))||0:e-=parseFloat(f.css(a,"border"+this+"Width"))||0});return e}function bn(a,b){b.src?f.ajax({url:b.src,async:!1,dataType:"script"}):f.globalEval((b.text||b.textContent||b.innerHTML||"").replace(bf,"/*$0*/")),b.parentNode&&b.parentNode.removeChild(b)}function bm(a){f.nodeName(a,"input")?bl(a):a.getElementsByTagName&&f.grep(a.getElementsByTagName("input"),bl)}function bl(a){if(a.type==="checkbox"||a.type==="radio")a.defaultChecked=a.checked}function bk(a){return"getElementsByTagName"in a?a.getElementsByTagName("*"):"querySelectorAll"in a?a.querySelectorAll("*"):[]}function bj(a,b){var c;if(b.nodeType===1){b.clearAttributes&&b.clearAttributes(),b.mergeAttributes&&b.mergeAttributes(a),c=b.nodeName.toLowerCase();if(c==="object")b.outerHTML=a.outerHTML;else if(c!=="input"||a.type!=="checkbox"&&a.type!=="radio"){if(c==="option")b.selected=a.defaultSelected;else if(c==="input"||c==="textarea")b.defaultValue=a.defaultValue}else a.checked&&(b.defaultChecked=b.checked=a.checked),b.value!==a.value&&(b.value=a.value);b.removeAttribute(f.expando)}}function bi(a,b){if(b.nodeType===1&&!!f.hasData(a)){var c=f.expando,d=f.data(a),e=f.data(b,d);if(d=d[c]){var g=d.events;e=e[c]=f.extend({},d);if(g){delete e.handle,e.events={};for(var h in g)for(var i=0,j=g[h].length;i<j;i++)f.event.add(b,h+(g[h][i].namespace?".":"")+g[h][i].namespace,g[h][i],g[h][i].data)}}}}function bh(a,b){return f.nodeName(a,"table")?a.getElementsByTagName("tbody")[0]||a.appendChild(a.ownerDocument.createElement("tbody")):a}function X(a,b,c){b=b||0;if(f.isFunction(b))return f.grep(a,function(a,d){var e=!!b.call(a,d,a);return e===c});if(b.nodeType)return f.grep(a,function(a,d){return a===b===c});if(typeof b=="string"){var d=f.grep(a,function(a){return a.nodeType===1});if(S.test(b))return f.filter(b,d,!c);b=f.filter(b,d)}return f.grep(a,function(a,d){return f.inArray(a,b)>=0===c})}function W(a){return!a||!a.parentNode||a.parentNode.nodeType===11}function O(a,b){return(a&&a!=="*"?a+".":"")+b.replace(A,"`").replace(B,"&")}function N(a){var b,c,d,e,g,h,i,j,k,l,m,n,o,p=[],q=[],r=f._data(this,"events");if(!(a.liveFired===this||!r||!r.live||a.target.disabled||a.button&&a.type==="click")){a.namespace&&(n=new RegExp("(^|\\.)"+a.namespace.split(".").join("\\.(?:.*\\.)?")+"(\\.|$)")),a.liveFired=this;var s=r.live.slice(0);for(i=0;i<s.length;i++)g=s[i],g.origType.replace(y,"")===a.type?q.push(g.selector):s.splice(i--,1);e=f(a.target).closest(q,a.currentTarget);for(j=0,k=e.length;j<k;j++){m=e[j];for(i=0;i<s.length;i++){g=s[i];if(m.selector===g.selector&&(!n||n.test(g.namespace))&&!m.elem.disabled){h=m.elem,d=null;if(g.preType==="mouseenter"||g.preType==="mouseleave")a.type=g.preType,d=f(a.relatedTarget).closest(g.selector)[0],d&&f.contains(h,d)&&(d=h);(!d||d!==h)&&p.push({elem:h,handleObj:g,level:m.level})}}}for(j=0,k=p.length;j<k;j++){e=p[j];if(c&&e.level>c)break;a.currentTarget=e.elem,a.data=e.handleObj.data,a.handleObj=e.handleObj,o=e.handleObj.origHandler.apply(e.elem,arguments);if(o===!1||a.isPropagationStopped()){c=e.level,o===!1&&(b=!1);if(a.isImmediatePropagationStopped())break}}return b}}function L(a,c,d){var e=f.extend({},d[0]);e.type=a,e.originalEvent={},e.liveFired=b,f.event.handle.call(c,e),e.isDefaultPrevented()&&d[0].preventDefault()}function F(){return!0}function E(){return!1}function m(a,c,d){var e=c+"defer",g=c+"queue",h=c+"mark",i=f.data(a,e,b,!0);i&&(d==="queue"||!f.data(a,g,b,!0))&&(d==="mark"||!f.data(a,h,b,!0))&&setTimeout(function(){!f.data(a,g,b,!0)&&!f.data(a,h,b,!0)&&(f.removeData(a,e,!0),i.resolve())},0)}function l(a){for(var b in a)if(b!=="toJSON")return!1;return!0}function k(a,c,d){if(d===b&&a.nodeType===1){var e="data-"+c.replace(j,"$1-$2").toLowerCase();d=a.getAttribute(e);if(typeof d=="string"){try{d=d==="true"?!0:d==="false"?!1:d==="null"?null:f.isNaN(d)?i.test(d)?f.parseJSON(d):d:parseFloat(d)}catch(g){}f.data(a,c,d)}else d=b}return d}var c=a.document,d=a.navigator,e=a.location,f=function(){function H(){if(!e.isReady){try{c.documentElement.doScroll("left")}catch(a){setTimeout(H,1);return}e.ready()}}var e=function(a,b){return new e.fn.init(a,b,h)},f=a.jQuery,g=a.$,h,i=/^(?:[^<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/,j=/\S/,k=/^\s+/,l=/\s+$/,m=/\d/,n=/^<(\w+)\s*\/?>(?:<\/\1>)?$/,o=/^[\],:{}\s]*$/,p=/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,q=/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,r=/(?:^|:|,)(?:\s*\[)+/g,s=/(webkit)[ \/]([\w.]+)/,t=/(opera)(?:.*version)?[ \/]([\w.]+)/,u=/(msie) ([\w.]+)/,v=/(mozilla)(?:.*? rv:([\w.]+))?/,w=d.userAgent,x,y,z,A=Object.prototype.toString,B=Object.prototype.hasOwnProperty,C=Array.prototype.push,D=Array.prototype.slice,E=String.prototype.trim,F=Array.prototype.indexOf,G={};e.fn=e.prototype={constructor:e,init:function(a,d,f){var g,h,j,k;if(!a)return this;if(a.nodeType){this.context=this[0]=a,this.length=1;return this}if(a==="body"&&!d&&c.body){this.context=c,this[0]=c.body,this.selector=a,this.length=1;return this}if(typeof a=="string"){a.charAt(0)!=="<"||a.charAt(a.length-1)!==">"||a.length<3?g=i.exec(a):g=[null,a,null];if(g&&(g[1]||!d)){if(g[1]){d=d instanceof e?d[0]:d,k=d?d.ownerDocument||d:c,j=n.exec(a),j?e.isPlainObject(d)?(a=[c.createElement(j[1])],e.fn.attr.call(a,d,!0)):a=[k.createElement(j[1])]:(j=e.buildFragment([g[1]],[k]),a=(j.cacheable?e.clone(j.fragment):j.fragment).childNodes);return e.merge(this,a)}h=c.getElementById(g[2]);if(h&&h.parentNode){if(h.id!==g[2])return f.find(a);this.length=1,this[0]=h}this.context=c,this.selector=a;return this}return!d||d.jquery?(d||f).find(a):this.constructor(d).find(a)}if(e.isFunction(a))return f.ready(a);a.selector!==b&&(this.selector=a.selector,this.context=a.context);return e.makeArray(a,this)},selector:"",jquery:"1.6.1",length:0,size:function(){return this.length},toArray:function(){return D.call(this,0)},get:function(a){return a==null?this.toArray():a<0?this[this.length+a]:this[a]},pushStack:function(a,b,c){var d=this.constructor();e.isArray(a)?C.apply(d,a):e.merge(d,a),d.prevObject=this,d.context=this.context,b==="find"?d.selector=this.selector+(this.selector?" ":"")+c:b&&(d.selector=this.selector+"."+b+"("+c+")");return d},each:function(a,b){return e.each(this,a,b)},ready:function(a){e.bindReady(),y.done(a);return this},eq:function(a){return a===-1?this.slice(a):this.slice(a,+a+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(D.apply(this,arguments),"slice",D.call(arguments).join(","))},map:function(a){return this.pushStack(e.map(this,function(b,c){return a.call(b,c,b)}))},end:function(){return this.prevObject||this.constructor(null)},push:C,sort:[].sort,splice:[].splice},e.fn.init.prototype=e.fn,e.extend=e.fn.extend=function(){var a,c,d,f,g,h,i=arguments[0]||{},j=1,k=arguments.length,l=!1;typeof i=="boolean"&&(l=i,i=arguments[1]||{},j=2),typeof i!="object"&&!e.isFunction(i)&&(i={}),k===j&&(i=this,--j);for(;j<k;j++)if((a=arguments[j])!=null)for(c in a){d=i[c],f=a[c];if(i===f)continue;l&&f&&(e.isPlainObject(f)||(g=e.isArray(f)))?(g?(g=!1,h=d&&e.isArray(d)?d:[]):h=d&&e.isPlainObject(d)?d:{},i[c]=e.extend(l,h,f)):f!==b&&(i[c]=f)}return i},e.extend({noConflict:function(b){a.$===e&&(a.$=g),b&&a.jQuery===e&&(a.jQuery=f);return e},isReady:!1,readyWait:1,holdReady:function(a){a?e.readyWait++:e.ready(!0)},ready:function(a){if(a===!0&&!--e.readyWait||a!==!0&&!e.isReady){if(!c.body)return setTimeout(e.ready,1);e.isReady=!0;if(a!==!0&&--e.readyWait>0)return;y.resolveWith(c,[e]),e.fn.trigger&&e(c).trigger("ready").unbind("ready")}},bindReady:function(){if(!y){y=e._Deferred();if(c.readyState==="complete")return setTimeout(e.ready,1);if(c.addEventListener)c.addEventListener("DOMContentLoaded",z,!1),a.addEventListener("load",e.ready,!1);else if(c.attachEvent){c.attachEvent("onreadystatechange",z),a.attachEvent("onload",e.ready);var b=!1;try{b=a.frameElement==null}catch(d){}c.documentElement.doScroll&&b&&H()}}},isFunction:function(a){return e.type(a)==="function"},isArray:Array.isArray||function(a){return e.type(a)==="array"},isWindow:function(a){return a&&typeof a=="object"&&"setInterval"in a},isNaN:function(a){return a==null||!m.test(a)||isNaN(a)},type:function(a){return a==null?String(a):G[A.call(a)]||"object"},isPlainObject:function(a){if(!a||e.type(a)!=="object"||a.nodeType||e.isWindow(a))return!1;if(a.constructor&&!B.call(a,"constructor")&&!B.call(a.constructor.prototype,"isPrototypeOf"))return!1;var c;for(c in a);return c===b||B.call(a,c)},isEmptyObject:function(a){for(var b in a)return!1;return!0},error:function(a){throw a},parseJSON:function(b){if(typeof b!="string"||!b)return null;b=e.trim(b);if(a.JSON&&a.JSON.parse)return a.JSON.parse(b);if(o.test(b.replace(p,"@").replace(q,"]").replace(r,"")))return(new Function("return "+b))();e.error("Invalid JSON: "+b)},parseXML:function(b,c,d){a.DOMParser?(d=new DOMParser,c=d.parseFromString(b,"text/xml")):(c=new ActiveXObject("Microsoft.XMLDOM"),c.async="false",c.loadXML(b)),d=c.documentElement,(!d||!d.nodeName||d.nodeName==="parsererror")&&e.error("Invalid XML: "+b);return c},noop:function(){},globalEval:function(b){b&&j.test(b)&&(a.execScript||function(b){a.eval.call(a,b)})(b)},nodeName:function(a,b){return a.nodeName&&a.nodeName.toUpperCase()===b.toUpperCase()},each:function(a,c,d){var f,g=0,h=a.length,i=h===b||e.isFunction(a);if(d){if(i){for(f in a)if(c.apply(a[f],d)===!1)break}else for(;g<h;)if(c.apply(a[g++],d)===!1)break}else if(i){for(f in a)if(c.call(a[f],f,a[f])===!1)break}else for(;g<h;)if(c.call(a[g],g,a[g++])===!1)break;return a},trim:E?function(a){return a==null?"":E.call(a)}:function(a){return a==null?"":(a+"").replace(k,"").replace(l,"")},makeArray:function(a,b){var c=b||[];if(a!=null){var d=e.type(a);a.length==null||d==="string"||d==="function"||d==="regexp"||e.isWindow(a)?C.call(c,a):e.merge(c,a)}return c},inArray:function(a,b){if(F)return F.call(b,a);for(var c=0,d=b.length;c<d;c++)if(b[c]===a)return c;return-1},merge:function(a,c){var d=a.length,e=0;if(typeof c.length=="number")for(var f=c.length;e<f;e++)a[d++]=c[e];else while(c[e]!==b)a[d++]=c[e++];a.length=d;return a},grep:function(a,b,c){var d=[],e;c=!!c;for(var f=0,g=a.length;f<g;f++)e=!!b(a[f],f),c!==e&&d.push(a[f]);return d},map:function(a,c,d){var f,g,h=[],i=0,j=a.length,k=a instanceof e||j!==b&&typeof j=="number"&&(j>0&&a[0]&&a[j-1]||j===0||e.isArray(a));if(k)for(;i<j;i++)f=c(a[i],i,d),f!=null&&(h[h.length]=f);else for(g in a)f=c(a[g],g,d),f!=null&&(h[h.length]=f);return h.concat.apply([],h)},guid:1,proxy:function(a,c){if(typeof c=="string"){var d=a[c];c=a,a=d}if(!e.isFunction(a))return b;var f=D.call(arguments,2),g=function(){return a.apply(c,f.concat(D.call(arguments)))};g.guid=a.guid=a.guid||g.guid||e.guid++;return g},access:function(a,c,d,f,g,h){var i=a.length;if(typeof c=="object"){for(var j in c)e.access(a,j,c[j],f,g,d);return a}if(d!==b){f=!h&&f&&e.isFunction(d);for(var k=0;k<i;k++)g(a[k],c,f?d.call(a[k],k,g(a[k],c)):d,h);return a}return i?g(a[0],c):b},now:function(){return(new Date).getTime()},uaMatch:function(a){a=a.toLowerCase();var b=s.exec(a)||t.exec(a)||u.exec(a)||a.indexOf("compatible")<0&&v.exec(a)||[];return{browser:b[1]||"",version:b[2]||"0"}},sub:function(){function a(b,c){return new a.fn.init(b,c)}e.extend(!0,a,this),a.superclass=this,a.fn=a.prototype=this(),a.fn.constructor=a,a.sub=this.sub,a.fn.init=function(d,f){f&&f instanceof e&&!(f instanceof a)&&(f=a(f));return e.fn.init.call(this,d,f,b)},a.fn.init.prototype=a.fn;var b=a(c);return a},browser:{}}),e.each("Boolean Number String Function Array Date RegExp Object".split(" "),function(a,b){G["[object "+b+"]"]=b.toLowerCase()}),x=e.uaMatch(w),x.browser&&(e.browser[x.browser]=!0,e.browser.version=x.version),e.browser.webkit&&(e.browser.safari=!0),j.test(" ")&&(k=/^[\s\xA0]+/,l=/[\s\xA0]+$/),h=e(c),c.addEventListener?z=function(){c.removeEventListener("DOMContentLoaded",z,!1),e.ready()}:c.attachEvent&&(z=function(){c.readyState==="complete"&&(c.detachEvent("onreadystatechange",z),e.ready())});return e}(),g="done fail isResolved isRejected promise then always pipe".split(" "),h=[].slice;f.extend({_Deferred:function(){var a=[],b,c,d,e={done:function(){if(!d){var c=arguments,g,h,i,j,k;b&&(k=b,b=0);for(g=0,h=c.length;g<h;g++)i=c[g],j=f.type(i),j==="array"?e.done.apply(e,i):j==="function"&&a.push(i);k&&e.resolveWith(k[0],k[1])}return this},resolveWith:function(e,f){if(!d&&!b&&!c){f=f||[],c=1;try{while(a[0])a.shift().apply(e,f)}finally{b=[e,f],c=0}}return this},resolve:function(){e.resolveWith(this,arguments);return this},isResolved:function(){return!!c||!!b},cancel:function(){d=1,a=[];return this}};return e},Deferred:function(a){var b=f._Deferred(),c=f._Deferred(),d;f.extend(b,{then:function(a,c){b.done(a).fail(c);return this},always:function(){return b.done.apply(b,arguments).fail.apply(this,arguments)},fail:c.done,rejectWith:c.resolveWith,reject:c.resolve,isRejected:c.isResolved,pipe:function(a,c){return f.Deferred(function(d){f.each({done:[a,"resolve"],fail:[c,"reject"]},function(a,c){var e=c[0],g=c[1],h;f.isFunction(e)?b[a](function(){h=e.apply(this,arguments),h&&f.isFunction(h.promise)?h.promise().then(d.resolve,d.reject):d[g](h)}):b[a](d[g])})}).promise()},promise:function(a){if(a==null){if(d)return d;d=a={}}var c=g.length;while(c--)a[g[c]]=b[g[c]];return a}}),b.done(c.cancel).fail(b.cancel),delete b.cancel,a&&a.call(b,b);return b},when:function(a){function i(a){return function(c){b[a]=arguments.length>1?h.call(arguments,0):c,--e||g.resolveWith(g,h.call(b,0))}}var b=arguments,c=0,d=b.length,e=d,g=d<=1&&a&&f.isFunction(a.promise)?a:f.Deferred();if(d>1){for(;c<d;c++)b[c]&&f.isFunction(b[c].promise)?b[c].promise().then(i(c),g.reject):--e;e||g.resolveWith(g,b)}else g!==a&&g.resolveWith(g,d?[a]:[]);return g.promise()}}),f.support=function(){var a=c.createElement("div"),b=c.documentElement,d,e,f,g,h,i,j,k,l,m,n,o,p,q,r;a.setAttribute("className","t"),a.innerHTML=" <link/><table></table><a href='/a' style='top:1px;float:left;opacity:.55;'>a</a><input type='checkbox'/>",d=a.getElementsByTagName("*"),e=a.getElementsByTagName("a")[0];if(!d||!d.length||!e)return{};f=c.createElement("select"),g=f.appendChild(c.createElement("option")),h=a.getElementsByTagName("input")[0],j={leadingWhitespace:a.firstChild.nodeType===3,tbody:!a.getElementsByTagName("tbody").length,htmlSerialize:!!a.getElementsByTagName("link").length,style:/top/.test(e.getAttribute("style")),hrefNormalized:e.getAttribute("href")==="/a",opacity:/^0.55$/.test(e.style.opacity),cssFloat:!!e.style.cssFloat,checkOn:h.value==="on",optSelected:g.selected,getSetAttribute:a.className!=="t",submitBubbles:!0,changeBubbles:!0,focusinBubbles:!1,deleteExpando:!0,noCloneEvent:!0,inlineBlockNeedsLayout:!1,shrinkWrapBlocks:!1,reliableMarginRight:!0},h.checked=!0,j.noCloneChecked=h.cloneNode(!0).checked,f.disabled=!0,j.optDisabled=!g.disabled;try{delete a.test}catch(s){j.deleteExpando=!1}!a.addEventListener&&a.attachEvent&&a.fireEvent&&(a.attachEvent("onclick",function b(){j.noCloneEvent=!1,a.detachEvent("onclick",b)}),a.cloneNode(!0).fireEvent("onclick")),h=c.createElement("input"),h.value="t",h.setAttribute("type","radio"),j.radioValue=h.value==="t",h.setAttribute("checked","checked"),a.appendChild(h),k=c.createDocumentFragment(),k.appendChild(a.firstChild),j.checkClone=k.cloneNode(!0).cloneNode(!0).lastChild.checked,a.innerHTML="",a.style.width=a.style.paddingLeft="1px",l=c.createElement("body"),m={visibility:"hidden",width:0,height:0,border:0,margin:0,background:"none"};for(q in m)l.style[q]=m[q];l.appendChild(a),b.insertBefore(l,b.firstChild),j.appendChecked=h.checked,j.boxModel=a.offsetWidth===2,"zoom"in a.style&&(a.style.display="inline",a.style.zoom=1,j.inlineBlockNeedsLayout=a.offsetWidth===2,a.style.display="",a.innerHTML="<div style='width:4px;'></div>",j.shrinkWrapBlocks=a.offsetWidth!==2),a.innerHTML="<table><tr><td style='padding:0;border:0;display:none'></td><td>t</td></tr></table>",n=a.getElementsByTagName("td"),r=n[0].offsetHeight===0,n[0].style.display="",n[1].style.display="none",j.reliableHiddenOffsets=r&&n[0].offsetHeight===0,a.innerHTML="",c.defaultView&&c.defaultView.getComputedStyle&&(i=c.createElement("div"),i.style.width="0",i.style.marginRight="0",a.appendChild(i),j.reliableMarginRight=(parseInt((c.defaultView.getComputedStyle(i,null)||{marginRight:0}).marginRight,10)||0)===0),l.innerHTML="",b.removeChild(l);if(a.attachEvent)for(q in{submit:1,change:1,focusin:1})p="on"+q,r=p in a,r||(a.setAttribute(p,"return;"),r=typeof a[p]=="function"),j[q+"Bubbles"]=r;return j}(),f.boxModel=f.support.boxModel;var i=/^(?:\{.*\}|\[.*\])$/,j=/([a-z])([A-Z])/g;f.extend({cache:{},uuid:0,expando:"jQuery"+(f.fn.jquery+Math.random()).replace(/\D/g,""),noData:{embed:!0,object:"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",applet:!0},hasData:function(a){a=a.nodeType?f.cache[a[f.expando]]:a[f.expando];return!!a&&!l(a)},data:function(a,c,d,e){if(!!f.acceptData(a)){var g=f.expando,h=typeof c=="string",i,j=a.nodeType,k=j?f.cache:a,l=j?a[f.expando]:a[f.expando]&&f.expando;if((!l||e&&l&&!k[l][g])&&h&&d===b)return;l||(j?a[f.expando]=l=++f.uuid:l=f.expando),k[l]||(k[l]={},j||(k[l].toJSON=f.noop));if(typeof c=="object"||typeof c=="function")e?k[l][g]=f.extend(k[l][g],c):k[l]=f.extend(k[l],c);i=k[l],e&&(i[g]||(i[g]={}),i=i[g]),d!==b&&(i[f.camelCase(c)]=d);if(c==="events"&&!i[c])return i[g]&&i[g].events;return h?i[f.camelCase(c)]:i}},removeData:function(b,c,d){if(!!f.acceptData(b)){var e=f.expando,g=b.nodeType,h=g?f.cache:b,i=g?b[f.expando]:f.expando;if(!h[i])return;if(c){var j=d?h[i][e]:h[i];if(j){delete j[c];if(!l(j))return}}if(d){delete h[i][e];if(!l(h[i]))return}var k=h[i][e];f.support.deleteExpando||h!=a?delete h[i]:h[i]=null,k?(h[i]={},g||(h[i].toJSON=f.noop),h[i][e]=k):g&&(f.support.deleteExpando?delete b[f.expando]:b.removeAttribute?b.removeAttribute(f.expando):b[f.expando]=null)}},_data:function(a,b,c){return f.data(a,b,c,!0)},acceptData:function(a){if(a.nodeName){var b=f.noData[a.nodeName.toLowerCase()];if(b)return b!==!0&&a.getAttribute("classid")===b}return!0}}),f.fn.extend({data:function(a,c){var d=null;if(typeof a=="undefined"){if(this.length){d=f.data(this[0]);if(this[0].nodeType===1){var e=this[0].attributes,g;for(var h=0,i=e.length;h<i;h++)g=e[h].name,g.indexOf("data-")===0&&(g=f.camelCase(g.substring(5)),k(this[0],g,d[g]))}}return d}if(typeof a=="object")return this.each(function(){f.data(this,a)});var j=a.split(".");j[1]=j[1]?"."+j[1]:"";if(c===b){d=this.triggerHandler("getData"+j[1]+"!",[j[0]]),d===b&&this.length&&(d=f.data(this[0],a),d=k(this[0],a,d));return d===b&&j[1]?this.data(j[0]):d}return this.each(function(){var b=f(this),d=[j[0],c];b.triggerHandler("setData"+j[1]+"!",d),f.data(this,a,c),b.triggerHandler("changeData"+j[1]+"!",d)})},removeData:function(a){return this.each(function(){f.removeData(this,a)})}}),f.extend({_mark:function(a,c){a&&(c=(c||"fx")+"mark",f.data(a,c,(f.data(a,c,b,!0)||0)+1,!0))},_unmark:function(a,c,d){a!==!0&&(d=c,c=a,a=!1);if(c){d=d||"fx";var e=d+"mark",g=a?0:(f.data(c,e,b,!0)||1)-1;g?f.data(c,e,g,!0):(f.removeData(c,e,!0),m(c,d,"mark"))}},queue:function(a,c,d){if(a){c=(c||"fx")+"queue";var e=f.data(a,c,b,!0);d&&(!e||f.isArray(d)?e=f.data(a,c,f.makeArray(d),!0):e.push(d));return e||[]}},dequeue:function(a,b){b=b||"fx";var c=f.queue(a,b),d=c.shift(),e;d==="inprogress"&&(d=c.shift()),d&&(b==="fx"&&c.unshift("inprogress"),d.call(a,function(){f.dequeue(a,b)})),c.length||(f.removeData(a,b+"queue",!0),m(a,b,"queue"))}}),f.fn.extend({queue:function(a,c){typeof a!="string"&&(c=a,a="fx");if(c===b)return f.queue(this[0],a);return this.each(function(){var b=f.queue(this,a,c);a==="fx"&&b[0]!=="inprogress"&&f.dequeue(this,a)})},dequeue:function(a){return this.each(function(){f.dequeue(this,a)})},delay:function(a,b){a=f.fx?f.fx.speeds[a]||a:a,b=b||"fx";return this.queue(b,function(){var c=this;setTimeout(function(){f.dequeue(c,b)},a)})},clearQueue:function(a){return this.queue(a||"fx",[])},promise:function(a,c){function m(){--h||d.resolveWith(e,[e])}typeof a!="string"&&(c=a,a=b),a=a||"fx";var d=f.Deferred(),e=this,g=e.length,h=1,i=a+"defer",j=a+"queue",k=a+"mark",l;while(g--)if(l=f.data(e[g],i,b,!0)||(f.data(e[g],j,b,!0)||f.data(e[g],k,b,!0))&&f.data(e[g],i,f._Deferred(),!0))h++,l.done(m);m();return d.promise()}});var n=/[\n\t\r]/g,o=/\s+/,p=/\r/g,q=/^(?:button|input)$/i,r=/^(?:button|input|object|select|textarea)$/i,s=/^a(?:rea)?$/i,t=/^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i,u=/\:/,v,w;f.fn.extend({attr:function(a,b){return f.access(this,a,b,!0,f.attr)},removeAttr:function(a){return this.each(function(){f.removeAttr(this,a)})},prop:function(a,b){return f.access(this,a,b,!0,f.prop)},removeProp:function(a){a=f.propFix[a]||a;return this.each(function(){try{this[a]=b,delete this[a]}catch(c){}})},addClass:function(a){if(f.isFunction(a))return this.each(function(b){var c=f(this);c.addClass(a.call(this,b,c.attr("class")||""))});if(a&&typeof a=="string"){var b=(a||"").split(o);for(var c=0,d=this.length;c<d;c++){var e=this[c];if(e.nodeType===1)if(!e.className)e.className=a;else{var g=" "+e.className+" ",h=e.className;for(var i=0,j=b.length;i<j;i++)g.indexOf(" "+b[i]+" ")<0&&(h+=" "+b[i]);e.className=f.trim(h)}}}return this},removeClass:function(a){if(f.isFunction(a))return this.each(function(b){var c=f(this);c.removeClass(a.call(this,b,c.attr("class")))});if(a&&typeof a=="string"||a===b){var c=(a||"").split(o);for(var d=0,e=this.length;d<e;d++){var g=this[d];if(g.nodeType===1&&g.className)if(a){var h=(" "+g.className+" ").replace(n," ");for(var i=0,j=c.length;i<j;i++)h=h.replace(" "+c[i]+" "," ");g.className=f.trim(h)}else g.className=""}}return this},toggleClass:function(a,b){var c=typeof a,d=typeof b=="boolean";if(f.isFunction(a))return this.each(function(c){var d=f(this);d.toggleClass(a.call(this,c,d.attr("class"),b),b)});return this.each(function(){if(c==="string"){var e,g=0,h=f(this),i=b,j=a.split(o);while(e=j[g++])i=d?i:!h.hasClass(e),h[i?"addClass":"removeClass"](e)}else if(c==="undefined"||c==="boolean")this.className&&f._data(this,"__className__",this.className),this.className=this.className||a===!1?"":f._data(this,"__className__")||""})},hasClass:function(a){var b=" "+a+" ";for(var c=0,d=this.length;c<d;c++)if((" "+this[c].className+" ").replace(n," ").indexOf(b)>-1)return!0;return!1},val:function(a){var c,d,e=this[0];if(!arguments.length){if(e){c=f.valHooks[e.nodeName.toLowerCase()]||f.valHooks[e.type];if(c&&"get"in c&&(d=c.get(e,"value"))!==b)return d;return(e.value||"").replace(p,"")}return b}var g=f.isFunction(a);return this.each(function(d){var e=f(this),h;if(this.nodeType===1){g?h=a.call(this,d,e.val()):h=a,h==null?h="":typeof h=="number"?h+="":f.isArray(h)&&(h=f.map(h,function(a){return a==null?"":a+""})),c=f.valHooks[this.nodeName.toLowerCase()]||f.valHooks[this.type];if(!c||!("set"in c)||c.set(this,h,"value")===b)this.value=h}})}}),f.extend({valHooks:{option:{get:function(a){var b=a.attributes.value;return!b||b.specified?a.value:a.text}},select:{get:function(a){var b,c=a.selectedIndex,d=[],e=a.options,g=a.type==="select-one";if(c<0)return null;for(var h=g?c:0,i=g?c+1:e.length;h<i;h++){var j=e[h];if(j.selected&&(f.support.optDisabled?!j.disabled:j.getAttribute("disabled")===null)&&(!j.parentNode.disabled||!f.nodeName(j.parentNode,"optgroup"))){b=f(j).val();if(g)return b;d.push(b)}}if(g&&!d.length&&e.length)return f(e[c]).val();return d},set:function(a,b){var c=f.makeArray(b);f(a).find("option").each(function(){this.selected=f.inArray(f(this).val(),c)>=0}),c.length||(a.selectedIndex=-1);return c}}},attrFn:{val:!0,css:!0,html:!0,text:!0,data:!0,width:!0,height:!0,offset:!0},attrFix:{tabindex:"tabIndex"},attr:function(a,c,d,e){var g=a.nodeType;if(!a||g===3||g===8||g===2)return b;if(e&&c in f.attrFn)return f(a)[c](d);if(!("getAttribute"in a))return f.prop(a,c,d);var h,i,j=g!==1||!f.isXMLDoc(a);c=j&&f.attrFix[c]||c,i=f.attrHooks[c],i||(!t.test(c)||typeof d!="boolean"&&d!==b&&d.toLowerCase()!==c.toLowerCase()?v&&(f.nodeName(a,"form")||u.test(c))&&(i=v):i=w);if(d!==b){if(d===null){f.removeAttr(a,c);return b}if(i&&"set"in i&&j&&(h=i.set(a,d,c))!==b)return h;a.setAttribute(c,""+d);return d}if(i&&"get"in i&&j)return i.get(a,c);h=a.getAttribute(c);return h===null?b:h},removeAttr:function(a,b){var c;a.nodeType===1&&(b=f.attrFix[b]||b,f.support.getSetAttribute?a.removeAttribute(b):(f.attr(a,b,""),a.removeAttributeNode(a.getAttributeNode(b))),t.test(b)&&(c=f.propFix[b]||b)in a&&(a[c]=!1))},attrHooks:{type:{set:function(a,b){if(q.test(a.nodeName)&&a.parentNode)f.error("type property can't be changed");else if(!f.support.radioValue&&b==="radio"&&f.nodeName(a,"input")){var c=a.value;a.setAttribute("type",b),c&&(a.value=c);return b}}},tabIndex:{get:function(a){var c=a.getAttributeNode("tabIndex");return c&&c.specified?parseInt(c.value,10):r.test(a.nodeName)||s.test(a.nodeName)&&a.href?0:b}}},propFix:{tabindex:"tabIndex",readonly:"readOnly","for":"htmlFor","class":"className",maxlength:"maxLength",cellspacing:"cellSpacing",cellpadding:"cellPadding",rowspan:"rowSpan",colspan:"colSpan",usemap:"useMap",frameborder:"frameBorder",contenteditable:"contentEditable"},prop:function(a,c,d){var e=a.nodeType;if(!a||e===3||e===8||e===2)return b;var g,h,i=e!==1||!f.isXMLDoc(a);c=i&&f.propFix[c]||c,h=f.propHooks[c];return d!==b?h&&"set"in h&&(g=h.set(a,d,c))!==b?g:a[c]=d:h&&"get"in h&&(g=h.get(a,c))!==b?g:a[c]},propHooks:{}}),w={get:function(a,c){return a[f.propFix[c]||c]?c.toLowerCase():b},set:function(a,b,c){var d;b===!1?f.removeAttr(a,c):(d=f.propFix[c]||c,d in a&&(a[d]=b),a.setAttribute(c,c.toLowerCase()));return c}},f.attrHooks.value={get:function(a,b){if(v&&f.nodeName(a,"button"))return v.get(a,b);return a.value},set:function(a,b,c){if(v&&f.nodeName(a,"button"))return v.set(a,b,c);a.value=b}},f.support.getSetAttribute||(f.attrFix=f.propFix,v=f.attrHooks.name=f.valHooks.button={get:function(a,c){var d;d=a.getAttributeNode(c);return d&&d.nodeValue!==""?d.nodeValue:b},set:function(a,b,c){var d=a.getAttributeNode(c);if(d){d.nodeValue=b;return b}}},f.each(["width","height"],function(a,b){f.attrHooks[b]=f.extend(f.attrHooks[b],{set:function(a,c){if(c===""){a.setAttribute(b,"auto");return c}}})})),f.support.hrefNormalized||f.each(["href","src","width","height"],function(a,c){f.attrHooks[c]=f.extend(f.attrHooks[c],{get:function(a){var d=a.getAttribute(c,2);return d===null?b:d}})}),f.support.style||(f.attrHooks.style={get:function(a){return a.style.cssText.toLowerCase()||b},set:function(a,b){return a.style.cssText=""+b}}),f.support.optSelected||(f.propHooks.selected=f.extend(f.propHooks.selected,{get:function(a){var b=a.parentNode;b&&(b.selectedIndex,b.parentNode&&b.parentNode.selectedIndex)}})),f.support.checkOn||f.each(["radio","checkbox"],function(){f.valHooks[this]={get:function(a){return a.getAttribute("value")===null?"on":a.value}}}),f.each(["radio","checkbox"],function(){f.valHooks[this]=f.extend(f.valHooks[this],{set:function(a,b){if(f.isArray(b))return a.checked=f.inArray(f(a).val(),b)>=0}})});var x=Object.prototype.hasOwnProperty,y=/\.(.*)$/,z=/^(?:textarea|input|select)$/i,A=/\./g,B=/ /g,C=/[^\w\s.|`]/g,D=function(a){return a.replace(C,"\\$&")};f.event={add:function(a,c,d,e){if(a.nodeType!==3&&a.nodeType!==8){if(d===!1)d=E;else if(!d)return;var g,h;d.handler&&(g=d,d=g.handler),d.guid||(d.guid=f.guid++);var i=f._data(a);if(!i)return;var j=i.events,k=i.handle;j||(i.events=j={}),k||(i.handle=k=function(a){return typeof f!="undefined"&&(!a||f.event.triggered!==a.type)?f.event.handle.apply(k.elem,arguments):b}),k.elem=a,c=c.split(" ");var l,m=0,n;while(l=c[m++]){h=g?f.extend({},g):{handler:d,data:e},l.indexOf(".")>-1?(n=l.split("."),l=n.shift(),h.namespace=n.slice(0).sort().join(".")):(n=[],h.namespace=""),h.type=l,h.guid||(h.guid=d.guid);var o=j[l],p=f.event.special[l]||{};if(!o){o=j[l]=[];if(!p.setup||p.setup.call(a,e,n,k)===!1)a.addEventListener?a.addEventListener(l,k,!1):a.attachEvent&&a.attachEvent("on"+l,k)}p.add&&(p.add.call(a,h),h.handler.guid||(h.handler.guid=d.guid)),o.push(h),f.event.global[l]=!0}a=null}},global:{},remove:function(a,c,d,e){if(a.nodeType!==3&&a.nodeType!==8){d===!1&&(d=E);var g,h,i,j,k=0,l,m,n,o,p,q,r,s=f.hasData(a)&&f._data(a),t=s&&s.events;if(!s||!t)return;c&&c.type&&(d=c.handler,c=c.type);if(!c||typeof c=="string"&&c.charAt(0)==="."){c=c||"";for(h in t)f.event.remove(a,h+c);return}c=c.split(" ");while(h=c[k++]){r=h,q=null,l=h.indexOf(".")<0,m=[],l||(m=h.split("."),h=m.shift(),n=new RegExp("(^|\\.)"+f.map(m.slice(0).sort(),D).join("\\.(?:.*\\.)?")+"(\\.|$)")),p=t[h];if(!p)continue;if(!d){for(j=0;j<p.length;j++){q=p[j];if(l||n.test(q.namespace))f.event.remove(a,r,q.handler,j),p.splice(j--,1)}continue}o=f.event.special[h]||{};for(j=e||0;j<p.length;j++){q=p[j];if(d.guid===q.guid){if(l||n.test(q.namespace))e==null&&p.splice(j--,1),o.remove&&o.remove.call(a,q);if(e!=null)break}}if(p.length===0||e!=null&&p.length===1)(!o.teardown||o.teardown.call(a,m)===!1)&&f.removeEvent(a,h,s.handle),g=null,delete t[h]}if(f.isEmptyObject(t)){var u=s.handle;u&&(u.elem=null),delete s.events,delete s.handle,f.isEmptyObject(s)&&f.removeData(a,b,!0)}}},customEvent:{getData:!0,setData:!0,changeData:!0},trigger:function(c,d,e,g){var h=c.type||c,i=[],j;h.indexOf("!")>=0&&(h=h.slice(0,-1),j=!0),h.indexOf(".")>=0&&(i=h.split("."),h=i.shift(),i.sort());if(!!e&&!f.event.customEvent[h]||!!f.event.global[h]){c=typeof c=="object"?c[f.expando]?c:new f.Event(h,c):new f.Event(h),c.type=h,c.exclusive=j,c.namespace=i.join("."),c.namespace_re=new RegExp("(^|\\.)"+i.join("\\.(?:.*\\.)?")+"(\\.|$)");if(g||!e)c.preventDefault(),c.stopPropagation();if(!e){f.each(f.cache,function(){var a=f.expando,b=this[a];b&&b.events&&b.events[h]&&f.event.trigger(c,d,b.handle.elem | |
| )});return}if(e.nodeType===3||e.nodeType===8)return;c.result=b,c.target=e,d=d?f.makeArray(d):[],d.unshift(c);var k=e,l=h.indexOf(":")<0?"on"+h:"";do{var m=f._data(k,"handle");c.currentTarget=k,m&&m.apply(k,d),l&&f.acceptData(k)&&k[l]&&k[l].apply(k,d)===!1&&(c.result=!1,c.preventDefault()),k=k.parentNode||k.ownerDocument||k===c.target.ownerDocument&&a}while(k&&!c.isPropagationStopped());if(!c.isDefaultPrevented()){var n,o=f.event.special[h]||{};if((!o._default||o._default.call(e.ownerDocument,c)===!1)&&(h!=="click"||!f.nodeName(e,"a"))&&f.acceptData(e)){try{l&&e[h]&&(n=e[l],n&&(e[l]=null),f.event.triggered=h,e[h]())}catch(p){}n&&(e[l]=n),f.event.triggered=b}}return c.result}},handle:function(c){c=f.event.fix(c||a.event);var d=((f._data(this,"events")||{})[c.type]||[]).slice(0),e=!c.exclusive&&!c.namespace,g=Array.prototype.slice.call(arguments,0);g[0]=c,c.currentTarget=this;for(var h=0,i=d.length;h<i;h++){var j=d[h];if(e||c.namespace_re.test(j.namespace)){c.handler=j.handler,c.data=j.data,c.handleObj=j;var k=j.handler.apply(this,g);k!==b&&(c.result=k,k===!1&&(c.preventDefault(),c.stopPropagation()));if(c.isImmediatePropagationStopped())break}}return c.result},props:"altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode layerX layerY metaKey newValue offsetX offsetY pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "),fix:function(a){if(a[f.expando])return a;var d=a;a=f.Event(d);for(var e=this.props.length,g;e;)g=this.props[--e],a[g]=d[g];a.target||(a.target=a.srcElement||c),a.target.nodeType===3&&(a.target=a.target.parentNode),!a.relatedTarget&&a.fromElement&&(a.relatedTarget=a.fromElement===a.target?a.toElement:a.fromElement);if(a.pageX==null&&a.clientX!=null){var h=a.target.ownerDocument||c,i=h.documentElement,j=h.body;a.pageX=a.clientX+(i&&i.scrollLeft||j&&j.scrollLeft||0)-(i&&i.clientLeft||j&&j.clientLeft||0),a.pageY=a.clientY+(i&&i.scrollTop||j&&j.scrollTop||0)-(i&&i.clientTop||j&&j.clientTop||0)}a.which==null&&(a.charCode!=null||a.keyCode!=null)&&(a.which=a.charCode!=null?a.charCode:a.keyCode),!a.metaKey&&a.ctrlKey&&(a.metaKey=a.ctrlKey),!a.which&&a.button!==b&&(a.which=a.button&1?1:a.button&2?3:a.button&4?2:0);return a},guid:1e8,proxy:f.proxy,special:{ready:{setup:f.bindReady,teardown:f.noop},live:{add:function(a){f.event.add(this,O(a.origType,a.selector),f.extend({},a,{handler:N,guid:a.handler.guid}))},remove:function(a){f.event.remove(this,O(a.origType,a.selector),a)}},beforeunload:{setup:function(a,b,c){f.isWindow(this)&&(this.onbeforeunload=c)},teardown:function(a,b){this.onbeforeunload===b&&(this.onbeforeunload=null)}}}},f.removeEvent=c.removeEventListener?function(a,b,c){a.removeEventListener&&a.removeEventListener(b,c,!1)}:function(a,b,c){a.detachEvent&&a.detachEvent("on"+b,c)},f.Event=function(a,b){if(!this.preventDefault)return new f.Event(a,b);a&&a.type?(this.originalEvent=a,this.type=a.type,this.isDefaultPrevented=a.defaultPrevented||a.returnValue===!1||a.getPreventDefault&&a.getPreventDefault()?F:E):this.type=a,b&&f.extend(this,b),this.timeStamp=f.now(),this[f.expando]=!0},f.Event.prototype={preventDefault:function(){this.isDefaultPrevented=F;var a=this.originalEvent;!a||(a.preventDefault?a.preventDefault():a.returnValue=!1)},stopPropagation:function(){this.isPropagationStopped=F;var a=this.originalEvent;!a||(a.stopPropagation&&a.stopPropagation(),a.cancelBubble=!0)},stopImmediatePropagation:function(){this.isImmediatePropagationStopped=F,this.stopPropagation()},isDefaultPrevented:E,isPropagationStopped:E,isImmediatePropagationStopped:E};var G=function(a){var b=a.relatedTarget;a.type=a.data;try{if(b&&b!==c&&!b.parentNode)return;while(b&&b!==this)b=b.parentNode;b!==this&&f.event.handle.apply(this,arguments)}catch(d){}},H=function(a){a.type=a.data,f.event.handle.apply(this,arguments)};f.each({mouseenter:"mouseover",mouseleave:"mouseout"},function(a,b){f.event.special[a]={setup:function(c){f.event.add(this,b,c&&c.selector?H:G,a)},teardown:function(a){f.event.remove(this,b,a&&a.selector?H:G)}}}),f.support.submitBubbles||(f.event.special.submit={setup:function(a,b){if(!f.nodeName(this,"form"))f.event.add(this,"click.specialSubmit",function(a){var b=a.target,c=b.type;(c==="submit"||c==="image")&&f(b).closest("form").length&&L("submit",this,arguments)}),f.event.add(this,"keypress.specialSubmit",function(a){var b=a.target,c=b.type;(c==="text"||c==="password")&&f(b).closest("form").length&&a.keyCode===13&&L("submit",this,arguments)});else return!1},teardown:function(a){f.event.remove(this,".specialSubmit")}});if(!f.support.changeBubbles){var I,J=function(a){var b=a.type,c=a.value;b==="radio"||b==="checkbox"?c=a.checked:b==="select-multiple"?c=a.selectedIndex>-1?f.map(a.options,function(a){return a.selected}).join("-"):"":f.nodeName(a,"select")&&(c=a.selectedIndex);return c},K=function(c){var d=c.target,e,g;if(!!z.test(d.nodeName)&&!d.readOnly){e=f._data(d,"_change_data"),g=J(d),(c.type!=="focusout"||d.type!=="radio")&&f._data(d,"_change_data",g);if(e===b||g===e)return;if(e!=null||g)c.type="change",c.liveFired=b,f.event.trigger(c,arguments[1],d)}};f.event.special.change={filters:{focusout:K,beforedeactivate:K,click:function(a){var b=a.target,c=f.nodeName(b,"input")?b.type:"";(c==="radio"||c==="checkbox"||f.nodeName(b,"select"))&&K.call(this,a)},keydown:function(a){var b=a.target,c=f.nodeName(b,"input")?b.type:"";(a.keyCode===13&&!f.nodeName(b,"textarea")||a.keyCode===32&&(c==="checkbox"||c==="radio")||c==="select-multiple")&&K.call(this,a)},beforeactivate:function(a){var b=a.target;f._data(b,"_change_data",J(b))}},setup:function(a,b){if(this.type==="file")return!1;for(var c in I)f.event.add(this,c+".specialChange",I[c]);return z.test(this.nodeName)},teardown:function(a){f.event.remove(this,".specialChange");return z.test(this.nodeName)}},I=f.event.special.change.filters,I.focus=I.beforeactivate}f.support.focusinBubbles||f.each({focus:"focusin",blur:"focusout"},function(a,b){function e(a){var c=f.event.fix(a);c.type=b,c.originalEvent={},f.event.trigger(c,null,c.target),c.isDefaultPrevented()&&a.preventDefault()}var d=0;f.event.special[b]={setup:function(){d++===0&&c.addEventListener(a,e,!0)},teardown:function(){--d===0&&c.removeEventListener(a,e,!0)}}}),f.each(["bind","one"],function(a,c){f.fn[c]=function(a,d,e){var g;if(typeof a=="object"){for(var h in a)this[c](h,d,a[h],e);return this}if(arguments.length===2||d===!1)e=d,d=b;c==="one"?(g=function(a){f(this).unbind(a,g);return e.apply(this,arguments)},g.guid=e.guid||f.guid++):g=e;if(a==="unload"&&c!=="one")this.one(a,d,e);else for(var i=0,j=this.length;i<j;i++)f.event.add(this[i],a,g,d);return this}}),f.fn.extend({unbind:function(a,b){if(typeof a=="object"&&!a.preventDefault)for(var c in a)this.unbind(c,a[c]);else for(var d=0,e=this.length;d<e;d++)f.event.remove(this[d],a,b);return this},delegate:function(a,b,c,d){return this.live(b,c,d,a)},undelegate:function(a,b,c){return arguments.length===0?this.unbind("live"):this.die(b,null,c,a)},trigger:function(a,b){return this.each(function(){f.event.trigger(a,b,this)})},triggerHandler:function(a,b){if(this[0])return f.event.trigger(a,b,this[0],!0)},toggle:function(a){var b=arguments,c=a.guid||f.guid++,d=0,e=function(c){var e=(f.data(this,"lastToggle"+a.guid)||0)%d;f.data(this,"lastToggle"+a.guid,e+1),c.preventDefault();return b[e].apply(this,arguments)||!1};e.guid=c;while(d<b.length)b[d++].guid=c;return this.click(e)},hover:function(a,b){return this.mouseenter(a).mouseleave(b||a)}});var M={focus:"focusin",blur:"focusout",mouseenter:"mouseover",mouseleave:"mouseout"};f.each(["live","die"],function(a,c){f.fn[c]=function(a,d,e,g){var h,i=0,j,k,l,m=g||this.selector,n=g?this:f(this.context);if(typeof a=="object"&&!a.preventDefault){for(var o in a)n[c](o,d,a[o],m);return this}if(c==="die"&&!a&&g&&g.charAt(0)==="."){n.unbind(g);return this}if(d===!1||f.isFunction(d))e=d||E,d=b;a=(a||"").split(" ");while((h=a[i++])!=null){j=y.exec(h),k="",j&&(k=j[0],h=h.replace(y,""));if(h==="hover"){a.push("mouseenter"+k,"mouseleave"+k);continue}l=h,M[h]?(a.push(M[h]+k),h=h+k):h=(M[h]||h)+k;if(c==="live")for(var p=0,q=n.length;p<q;p++)f.event.add(n[p],"live."+O(h,m),{data:d,selector:m,handler:e,origType:h,origHandler:e,preType:l});else n.unbind("live."+O(h,m),e)}return this}}),f.each("blur focus focusin focusout load resize scroll unload click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup error".split(" "),function(a,b){f.fn[b]=function(a,c){c==null&&(c=a,a=null);return arguments.length>0?this.bind(b,a,c):this.trigger(b)},f.attrFn&&(f.attrFn[b]=!0)}),function(){function u(a,b,c,d,e,f){for(var g=0,h=d.length;g<h;g++){var i=d[g];if(i){var j=!1;i=i[a];while(i){if(i.sizcache===c){j=d[i.sizset];break}if(i.nodeType===1){f||(i.sizcache=c,i.sizset=g);if(typeof b!="string"){if(i===b){j=!0;break}}else if(k.filter(b,[i]).length>0){j=i;break}}i=i[a]}d[g]=j}}}function t(a,b,c,d,e,f){for(var g=0,h=d.length;g<h;g++){var i=d[g];if(i){var j=!1;i=i[a];while(i){if(i.sizcache===c){j=d[i.sizset];break}i.nodeType===1&&!f&&(i.sizcache=c,i.sizset=g);if(i.nodeName.toLowerCase()===b){j=i;break}i=i[a]}d[g]=j}}}var a=/((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,d=0,e=Object.prototype.toString,g=!1,h=!0,i=/\\/g,j=/\W/;[0,0].sort(function(){h=!1;return 0});var k=function(b,d,f,g){f=f||[],d=d||c;var h=d;if(d.nodeType!==1&&d.nodeType!==9)return[];if(!b||typeof b!="string")return f;var i,j,n,o,q,r,s,t,u=!0,w=k.isXML(d),x=[],y=b;do{a.exec(""),i=a.exec(y);if(i){y=i[3],x.push(i[1]);if(i[2]){o=i[3];break}}}while(i);if(x.length>1&&m.exec(b))if(x.length===2&&l.relative[x[0]])j=v(x[0]+x[1],d);else{j=l.relative[x[0]]?[d]:k(x.shift(),d);while(x.length)b=x.shift(),l.relative[b]&&(b+=x.shift()),j=v(b,j)}else{!g&&x.length>1&&d.nodeType===9&&!w&&l.match.ID.test(x[0])&&!l.match.ID.test(x[x.length-1])&&(q=k.find(x.shift(),d,w),d=q.expr?k.filter(q.expr,q.set)[0]:q.set[0]);if(d){q=g?{expr:x.pop(),set:p(g)}:k.find(x.pop(),x.length===1&&(x[0]==="~"||x[0]==="+")&&d.parentNode?d.parentNode:d,w),j=q.expr?k.filter(q.expr,q.set):q.set,x.length>0?n=p(j):u=!1;while(x.length)r=x.pop(),s=r,l.relative[r]?s=x.pop():r="",s==null&&(s=d),l.relative[r](n,s,w)}else n=x=[]}n||(n=j),n||k.error(r||b);if(e.call(n)==="[object Array]")if(!u)f.push.apply(f,n);else if(d&&d.nodeType===1)for(t=0;n[t]!=null;t++)n[t]&&(n[t]===!0||n[t].nodeType===1&&k.contains(d,n[t]))&&f.push(j[t]);else for(t=0;n[t]!=null;t++)n[t]&&n[t].nodeType===1&&f.push(j[t]);else p(n,f);o&&(k(o,h,f,g),k.uniqueSort(f));return f};k.uniqueSort=function(a){if(r){g=h,a.sort(r);if(g)for(var b=1;b<a.length;b++)a[b]===a[b-1]&&a.splice(b--,1)}return a},k.matches=function(a,b){return k(a,null,null,b)},k.matchesSelector=function(a,b){return k(b,null,null,[a]).length>0},k.find=function(a,b,c){var d;if(!a)return[];for(var e=0,f=l.order.length;e<f;e++){var g,h=l.order[e];if(g=l.leftMatch[h].exec(a)){var j=g[1];g.splice(1,1);if(j.substr(j.length-1)!=="\\"){g[1]=(g[1]||"").replace(i,""),d=l.find[h](g,b,c);if(d!=null){a=a.replace(l.match[h],"");break}}}}d||(d=typeof b.getElementsByTagName!="undefined"?b.getElementsByTagName("*"):[]);return{set:d,expr:a}},k.filter=function(a,c,d,e){var f,g,h=a,i=[],j=c,m=c&&c[0]&&k.isXML(c[0]);while(a&&c.length){for(var n in l.filter)if((f=l.leftMatch[n].exec(a))!=null&&f[2]){var o,p,q=l.filter[n],r=f[1];g=!1,f.splice(1,1);if(r.substr(r.length-1)==="\\")continue;j===i&&(i=[]);if(l.preFilter[n]){f=l.preFilter[n](f,j,d,i,e,m);if(!f)g=o=!0;else if(f===!0)continue}if(f)for(var s=0;(p=j[s])!=null;s++)if(p){o=q(p,f,s,j);var t=e^!!o;d&&o!=null?t?g=!0:j[s]=!1:t&&(i.push(p),g=!0)}if(o!==b){d||(j=i),a=a.replace(l.match[n],"");if(!g)return[];break}}if(a===h)if(g==null)k.error(a);else break;h=a}return j},k.error=function(a){throw"Syntax error, unrecognized expression: "+a};var l=k.selectors={order:["ID","NAME","TAG"],match:{ID:/#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,CLASS:/\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,NAME:/\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/,ATTR:/\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(?:(['"])(.*?)\3|(#?(?:[\w\u00c0-\uFFFF\-]|\\.)*)|)|)\s*\]/,TAG:/^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/,CHILD:/:(only|nth|last|first)-child(?:\(\s*(even|odd|(?:[+\-]?\d+|(?:[+\-]?\d*)?n\s*(?:[+\-]\s*\d+)?))\s*\))?/,POS:/:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/,PSEUDO:/:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/},leftMatch:{},attrMap:{"class":"className","for":"htmlFor"},attrHandle:{href:function(a){return a.getAttribute("href")},type:function(a){return a.getAttribute("type")}},relative:{"+":function(a,b){var c=typeof b=="string",d=c&&!j.test(b),e=c&&!d;d&&(b=b.toLowerCase());for(var f=0,g=a.length,h;f<g;f++)if(h=a[f]){while((h=h.previousSibling)&&h.nodeType!==1);a[f]=e||h&&h.nodeName.toLowerCase()===b?h||!1:h===b}e&&k.filter(b,a,!0)},">":function(a,b){var c,d=typeof b=="string",e=0,f=a.length;if(d&&!j.test(b)){b=b.toLowerCase();for(;e<f;e++){c=a[e];if(c){var g=c.parentNode;a[e]=g.nodeName.toLowerCase()===b?g:!1}}}else{for(;e<f;e++)c=a[e],c&&(a[e]=d?c.parentNode:c.parentNode===b);d&&k.filter(b,a,!0)}},"":function(a,b,c){var e,f=d++,g=u;typeof b=="string"&&!j.test(b)&&(b=b.toLowerCase(),e=b,g=t),g("parentNode",b,f,a,e,c)},"~":function(a,b,c){var e,f=d++,g=u;typeof b=="string"&&!j.test(b)&&(b=b.toLowerCase(),e=b,g=t),g("previousSibling",b,f,a,e,c)}},find:{ID:function(a,b,c){if(typeof b.getElementById!="undefined"&&!c){var d=b.getElementById(a[1]);return d&&d.parentNode?[d]:[]}},NAME:function(a,b){if(typeof b.getElementsByName!="undefined"){var c=[],d=b.getElementsByName(a[1]);for(var e=0,f=d.length;e<f;e++)d[e].getAttribute("name")===a[1]&&c.push(d[e]);return c.length===0?null:c}},TAG:function(a,b){if(typeof b.getElementsByTagName!="undefined")return b.getElementsByTagName(a[1])}},preFilter:{CLASS:function(a,b,c,d,e,f){a=" "+a[1].replace(i,"")+" ";if(f)return a;for(var g=0,h;(h=b[g])!=null;g++)h&&(e^(h.className&&(" "+h.className+" ").replace(/[\t\n\r]/g," ").indexOf(a)>=0)?c||d.push(h):c&&(b[g]=!1));return!1},ID:function(a){return a[1].replace(i,"")},TAG:function(a,b){return a[1].replace(i,"").toLowerCase()},CHILD:function(a){if(a[1]==="nth"){a[2]||k.error(a[0]),a[2]=a[2].replace(/^\+|\s*/g,"");var b=/(-?)(\d*)(?:n([+\-]?\d*))?/.exec(a[2]==="even"&&"2n"||a[2]==="odd"&&"2n+1"||!/\D/.test(a[2])&&"0n+"+a[2]||a[2]);a[2]=b[1]+(b[2]||1)-0,a[3]=b[3]-0}else a[2]&&k.error(a[0]);a[0]=d++;return a},ATTR:function(a,b,c,d,e,f){var g=a[1]=a[1].replace(i,"");!f&&l.attrMap[g]&&(a[1]=l.attrMap[g]),a[4]=(a[4]||a[5]||"").replace(i,""),a[2]==="~="&&(a[4]=" "+a[4]+" ");return a},PSEUDO:function(b,c,d,e,f){if(b[1]==="not")if((a.exec(b[3])||"").length>1||/^\w/.test(b[3]))b[3]=k(b[3],null,null,c);else{var g=k.filter(b[3],c,d,!0^f);d||e.push.apply(e,g);return!1}else if(l.match.POS.test(b[0])||l.match.CHILD.test(b[0]))return!0;return b},POS:function(a){a.unshift(!0);return a}},filters:{enabled:function(a){return a.disabled===!1&&a.type!=="hidden"},disabled:function(a){return a.disabled===!0},checked:function(a){return a.checked===!0},selected:function(a){a.parentNode&&a.parentNode.selectedIndex;return a.selected===!0},parent:function(a){return!!a.firstChild},empty:function(a){return!a.firstChild},has:function(a,b,c){return!!k(c[3],a).length},header:function(a){return/h\d/i.test(a.nodeName)},text:function(a){var b=a.getAttribute("type"),c=a.type;return a.nodeName.toLowerCase()==="input"&&"text"===c&&(b===c||b===null)},radio:function(a){return a.nodeName.toLowerCase()==="input"&&"radio"===a.type},checkbox:function(a){return a.nodeName.toLowerCase()==="input"&&"checkbox"===a.type},file:function(a){return a.nodeName.toLowerCase()==="input"&&"file"===a.type},password:function(a){return a.nodeName.toLowerCase()==="input"&&"password"===a.type},submit:function(a){var b=a.nodeName.toLowerCase();return(b==="input"||b==="button")&&"submit"===a.type},image:function(a){return a.nodeName.toLowerCase()==="input"&&"image"===a.type},reset:function(a){var b=a.nodeName.toLowerCase();return(b==="input"||b==="button")&&"reset"===a.type},button:function(a){var b=a.nodeName.toLowerCase();return b==="input"&&"button"===a.type||b==="button"},input:function(a){return/input|select|textarea|button/i.test(a.nodeName)},focus:function(a){return a===a.ownerDocument.activeElement}},setFilters:{first:function(a,b){return b===0},last:function(a,b,c,d){return b===d.length-1},even:function(a,b){return b%2===0},odd:function(a,b){return b%2===1},lt:function(a,b,c){return b<c[3]-0},gt:function(a,b,c){return b>c[3]-0},nth:function(a,b,c){return c[3]-0===b},eq:function(a,b,c){return c[3]-0===b}},filter:{PSEUDO:function(a,b,c,d){var e=b[1],f=l.filters[e];if(f)return f(a,c,b,d);if(e==="contains")return(a.textContent||a.innerText||k.getText([a])||"").indexOf(b[3])>=0;if(e==="not"){var g=b[3];for(var h=0,i=g.length;h<i;h++)if(g[h]===a)return!1;return!0}k.error(e)},CHILD:function(a,b){var c=b[1],d=a;switch(c){case"only":case"first":while(d=d.previousSibling)if(d.nodeType===1)return!1;if(c==="first")return!0;d=a;case"last":while(d=d.nextSibling)if(d.nodeType===1)return!1;return!0;case"nth":var e=b[2],f=b[3];if(e===1&&f===0)return!0;var g=b[0],h=a.parentNode;if(h&&(h.sizcache!==g||!a.nodeIndex)){var i=0;for(d=h.firstChild;d;d=d.nextSibling)d.nodeType===1&&(d.nodeIndex=++i);h.sizcache=g}var j=a.nodeIndex-f;return e===0?j===0:j%e===0&&j/e>=0}},ID:function(a,b){return a.nodeType===1&&a.getAttribute("id")===b},TAG:function(a,b){return b==="*"&&a.nodeType===1||a.nodeName.toLowerCase()===b},CLASS:function(a,b){return(" "+(a.className||a.getAttribute("class"))+" ").indexOf(b)>-1},ATTR:function(a,b){var c=b[1],d=l.attrHandle[c]?l.attrHandle[c](a):a[c]!=null?a[c]:a.getAttribute(c),e=d+"",f=b[2],g=b[4];return d==null?f==="!=":f==="="?e===g:f==="*="?e.indexOf(g)>=0:f==="~="?(" "+e+" ").indexOf(g)>=0:g?f==="!="?e!==g:f==="^="?e.indexOf(g)===0:f==="$="?e.substr(e.length-g.length)===g:f==="|="?e===g||e.substr(0,g.length+1)===g+"-":!1:e&&d!==!1},POS:function(a,b,c,d){var e=b[2],f=l.setFilters[e];if(f)return f(a,c,b,d)}}},m=l.match.POS,n=function(a,b){return"\\"+(b-0+1)};for(var o in l.match)l.match[o]=new RegExp(l.match[o].source+/(?![^\[]*\])(?![^\(]*\))/.source),l.leftMatch[o]=new RegExp(/(^(?:.|\r|\n)*?)/.source+l.match[o].source.replace(/\\(\d+)/g,n));var p=function(a,b){a=Array.prototype.slice.call(a,0);if(b){b.push.apply(b,a);return b}return a};try{Array.prototype.slice.call(c.documentElement.childNodes,0)[0].nodeType}catch(q){p=function(a,b){var c=0,d=b||[];if(e.call(a)==="[object Array]")Array.prototype.push.apply(d,a);else if(typeof a.length=="number")for(var f=a.length;c<f;c++)d.push(a[c]);else for(;a[c];c++)d.push(a[c]);return d}}var r,s;c.documentElement.compareDocumentPosition?r=function(a,b){if(a===b){g=!0;return 0}if(!a.compareDocumentPosition||!b.compareDocumentPosition)return a.compareDocumentPosition?-1:1;return a.compareDocumentPosition(b)&4?-1:1}:(r=function(a,b){if(a===b){g=!0;return 0}if(a.sourceIndex&&b.sourceIndex)return a.sourceIndex-b.sourceIndex;var c,d,e=[],f=[],h=a.parentNode,i=b.parentNode,j=h;if(h===i)return s(a,b);if(!h)return-1;if(!i)return 1;while(j)e.unshift(j),j=j.parentNode;j=i;while(j)f.unshift(j),j=j.parentNode;c=e.length,d=f.length;for(var k=0;k<c&&k<d;k++)if(e[k]!==f[k])return s(e[k],f[k]);return k===c?s(a,f[k],-1):s(e[k],b,1)},s=function(a,b,c){if(a===b)return c;var d=a.nextSibling;while(d){if(d===b)return-1;d=d.nextSibling}return 1}),k.getText=function(a){var b="",c;for(var d=0;a[d];d++)c=a[d],c.nodeType===3||c.nodeType===4?b+=c.nodeValue:c.nodeType!==8&&(b+=k.getText(c.childNodes));return b},function(){var a=c.createElement("div"),d="script"+(new Date).getTime(),e=c.documentElement;a.innerHTML="<a name='"+d+"'/>",e.insertBefore(a,e.firstChild),c.getElementById(d)&&(l.find.ID=function(a,c,d){if(typeof c.getElementById!="undefined"&&!d){var e=c.getElementById(a[1]);return e?e.id===a[1]||typeof e.getAttributeNode!="undefined"&&e.getAttributeNode("id").nodeValue===a[1]?[e]:b:[]}},l.filter.ID=function(a,b){var c=typeof a.getAttributeNode!="undefined"&&a.getAttributeNode("id");return a.nodeType===1&&c&&c.nodeValue===b}),e.removeChild(a),e=a=null}(),function(){var a=c.createElement("div");a.appendChild(c.createComment("")),a.getElementsByTagName("*").length>0&&(l.find.TAG=function(a,b){var c=b.getElementsByTagName(a[1]);if(a[1]==="*"){var d=[];for(var e=0;c[e];e++)c[e].nodeType===1&&d.push(c[e]);c=d}return c}),a.innerHTML="<a href='#'></a>",a.firstChild&&typeof a.firstChild.getAttribute!="undefined"&&a.firstChild.getAttribute("href")!=="#"&&(l.attrHandle.href=function(a){return a.getAttribute("href",2)}),a=null}(),c.querySelectorAll&&function(){var a=k,b=c.createElement("div"),d="__sizzle__";b.innerHTML="<p class='TEST'></p>";if(!b.querySelectorAll||b.querySelectorAll(".TEST").length!==0){k=function(b,e,f,g){e=e||c;if(!g&&!k.isXML(e)){var h=/^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec(b);if(h&&(e.nodeType===1||e.nodeType===9)){if(h[1])return p(e.getElementsByTagName(b),f);if(h[2]&&l.find.CLASS&&e.getElementsByClassName)return p(e.getElementsByClassName(h[2]),f)}if(e.nodeType===9){if(b==="body"&&e.body)return p([e.body],f);if(h&&h[3]){var i=e.getElementById(h[3]);if(!i||!i.parentNode)return p([],f);if(i.id===h[3])return p([i],f)}try{return p(e.querySelectorAll(b),f)}catch(j){}}else if(e.nodeType===1&&e.nodeName.toLowerCase()!=="object"){var m=e,n=e.getAttribute("id"),o=n||d,q=e.parentNode,r=/^\s*[+~]/.test(b);n?o=o.replace(/'/g,"\\$&"):e.setAttribute("id",o),r&&q&&(e=e.parentNode);try{if(!r||q)return p(e.querySelectorAll("[id='"+o+"'] "+b),f)}catch(s){}finally{n||m.removeAttribute("id")}}}return a(b,e,f,g)};for(var e in a)k[e]=a[e];b=null}}(),function(){var a=c.documentElement,b=a.matchesSelector||a.mozMatchesSelector||a.webkitMatchesSelector||a.msMatchesSelector;if(b){var d=!b.call(c.createElement("div"),"div"),e=!1;try{b.call(c.documentElement,"[test!='']:sizzle")}catch(f){e=!0}k.matchesSelector=function(a,c){c=c.replace(/\=\s*([^'"\]]*)\s*\]/g,"='$1']");if(!k.isXML(a))try{if(e||!l.match.PSEUDO.test(c)&&!/!=/.test(c)){var f=b.call(a,c);if(f||!d||a.document&&a.document.nodeType!==11)return f}}catch(g){}return k(c,null,null,[a]).length>0}}}(),function(){var a=c.createElement("div");a.innerHTML="<div class='test e'></div><div class='test'></div>";if(!!a.getElementsByClassName&&a.getElementsByClassName("e").length!==0){a.lastChild.className="e";if(a.getElementsByClassName("e").length===1)return;l.order.splice(1,0,"CLASS"),l.find.CLASS=function(a,b,c){if(typeof b.getElementsByClassName!="undefined"&&!c)return b.getElementsByClassName(a[1])},a=null}}(),c.documentElement.contains?k.contains=function(a,b){return a!==b&&(a.contains?a.contains(b):!0)}:c.documentElement.compareDocumentPosition?k.contains=function(a,b){return!!(a.compareDocumentPosition(b)&16)}:k.contains=function(){return!1},k.isXML=function(a){var b=(a?a.ownerDocument||a:0).documentElement;return b?b.nodeName!=="HTML":!1};var v=function(a,b){var c,d=[],e="",f=b.nodeType?[b]:b;while(c=l.match.PSEUDO.exec(a))e+=c[0],a=a.replace(l.match.PSEUDO,"");a=l.relative[a]?a+"*":a;for(var g=0,h=f.length;g<h;g++)k(a,f[g],d);return k.filter(e,d)};f.find=k,f.expr=k.selectors,f.expr[":"]=f.expr.filters,f.unique=k.uniqueSort,f.text=k.getText,f.isXMLDoc=k.isXML,f.contains=k.contains}();var P=/Until$/,Q=/^(?:parents|prevUntil|prevAll)/,R=/,/,S=/^.[^:#\[\.,]*$/,T=Array.prototype.slice,U=f.expr.match.POS,V={children:!0,contents:!0,next:!0,prev:!0};f.fn.extend({find:function(a){var b=this,c,d;if(typeof a!="string")return f(a).filter(function(){for(c=0,d=b.length;c<d;c++)if(f.contains(b[c],this))return!0});var e=this.pushStack("","find",a),g,h,i;for(c=0,d=this.length;c<d;c++){g=e.length,f.find(a,this[c],e);if(c>0)for(h=g;h<e.length;h++)for(i=0;i<g;i++)if(e[i]===e[h]){e.splice(h--,1);break}}return e},has:function(a){var b=f(a);return this.filter(function(){for(var a=0,c=b.length;a<c;a++)if(f.contains(this,b[a]))return!0})},not:function(a){return this.pushStack(X(this,a,!1),"not",a)},filter:function(a){return this.pushStack(X(this,a,!0),"filter",a)},is:function(a){return!!a&&(typeof a=="string"?f.filter(a,this).length>0:this.filter(a).length>0)},closest:function(a,b){var c=[],d,e,g=this[0];if(f.isArray(a)){var h,i,j={},k=1;if(g&&a.length){for(d=0,e=a.length;d<e;d++)i=a[d],j[i]||(j[i]=U.test(i)?f(i,b||this.context):i);while(g&&g.ownerDocument&&g!==b){for(i in j)h=j[i],(h.jquery?h.index(g)>-1:f(g).is(h))&&c.push({selector:i,elem:g,level:k});g=g.parentNode,k++}}return c}var l=U.test(a)||typeof a!="string"?f(a,b||this.context):0;for(d=0,e=this.length;d<e;d++){g=this[d];while(g){if(l?l.index(g)>-1:f.find.matchesSelector(g,a)){c.push(g);break}g=g.parentNode;if(!g||!g.ownerDocument||g===b||g.nodeType===11)break}}c=c.length>1?f.unique(c):c;return this.pushStack(c,"closest",a)},index:function(a){if(!a||typeof a=="string")return f.inArray(this[0],a?f(a):this.parent().children());return f.inArray(a.jquery?a[0]:a,this)},add:function(a,b){var c=typeof a=="string"?f(a,b):f.makeArray(a&&a.nodeType?[a]:a),d=f.merge(this.get(),c);return this.pushStack(W(c[0])||W(d[0])?d:f.unique(d))},andSelf:function(){return this.add(this.prevObject)}}),f.each({parent:function(a){var b=a.parentNode;return b&&b.nodeType!==11?b:null},parents:function(a){return f.dir(a,"parentNode")},parentsUntil:function(a,b,c){return f.dir(a,"parentNode",c)},next:function(a){return f.nth(a,2,"nextSibling")},prev:function(a){return f.nth(a,2,"previousSibling")},nextAll:function(a){return f.dir(a,"nextSibling")},prevAll:function(a){return f.dir(a,"previousSibling")},nextUntil:function(a,b,c){return f.dir(a,"nextSibling",c)},prevUntil:function(a,b,c){return f.dir(a,"previousSibling",c)},siblings:function(a){return f.sibling(a.parentNode.firstChild,a)},children:function(a){return f.sibling(a.firstChild)},contents:function(a){return f.nodeName(a,"iframe")?a.contentDocument||a.contentWindow.document:f.makeArray(a.childNodes)}},function(a,b){f.fn[a]=function(c,d){var e=f.map(this,b,c),g=T.call(arguments);P.test(a)||(d=c),d&&typeof d=="string"&&(e=f.filter(d,e)),e=this.length>1&&!V[a]?f.unique(e):e,(this.length>1||R.test(d))&&Q.test(a)&&(e=e.reverse());return this.pushStack(e,a,g.join(","))}}),f.extend({filter:function(a,b,c){c&&(a=":not("+a+")");return b.length===1?f.find.matchesSelector(b[0],a)?[b[0]]:[]:f.find.matches(a,b)},dir:function(a,c,d){var e=[],g=a[c];while(g&&g.nodeType!==9&&(d===b||g.nodeType!==1||!f(g).is(d)))g.nodeType===1&&e.push(g),g=g[c];return e},nth:function(a,b,c,d){b=b||1;var e=0;for(;a;a=a[c])if(a.nodeType===1&&++e===b)break;return a},sibling:function(a,b){var c=[];for(;a;a=a.nextSibling)a.nodeType===1&&a!==b&&c.push(a);return c}});var Y=/ jQuery\d+="(?:\d+|null)"/g,Z=/^\s+/,$=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig,_=/<([\w:]+)/,ba=/<tbody/i,bb=/<|&#?\w+;/,bc=/<(?:script|object|embed|option|style)/i,bd=/checked\s*(?:[^=]|=\s*.checked.)/i,be=/\/(java|ecma)script/i,bf=/^\s*<!(?:\[CDATA\[|\-\-)/,bg={option:[1,"<select multiple='multiple'>","</select>"],legend:[1,"<fieldset>","</fieldset>"],thead:[1,"<table>","</table>"],tr:[2,"<table><tbody>","</tbody></table>"],td:[3,"<table><tbody><tr>","</tr></tbody></table>"],col:[2,"<table><tbody></tbody><colgroup>","</colgroup></table>"],area:[1,"<map>","</map>"],_default:[0,"",""]};bg.optgroup=bg.option,bg.tbody=bg.tfoot=bg.colgroup=bg.caption=bg.thead,bg.th=bg.td,f.support.htmlSerialize||(bg._default=[1,"div<div>","</div>"]),f.fn.extend({text:function(a){if(f.isFunction(a))return this.each(function(b){var c=f(this);c.text(a.call(this,b,c.text()))});if(typeof a!="object"&&a!==b)return this.empty().append((this[0]&&this[0].ownerDocument||c).createTextNode(a));return f.text(this)},wrapAll:function(a){if(f.isFunction(a))return this.each(function(b){f(this).wrapAll(a.call(this,b))});if(this[0]){var b=f(a,this[0].ownerDocument).eq(0).clone(!0);this[0].parentNode&&b.insertBefore(this[0]),b.map(function(){var a=this;while(a.firstChild&&a.firstChild.nodeType===1)a=a.firstChild;return a}).append(this)}return this},wrapInner:function(a){if(f.isFunction(a))return this.each(function(b){f(this).wrapInner(a.call(this,b))});return this.each(function(){var b=f(this),c=b.contents();c.length?c.wrapAll(a):b.append(a)})},wrap:function(a){return this.each(function(){f(this).wrapAll(a)})},unwrap:function(){return this.parent().each(function(){f.nodeName(this,"body")||f(this).replaceWith(this.childNodes)}).end()},append:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.appendChild(a)})},prepend:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.insertBefore(a,this.firstChild)})},before:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this)});if(arguments.length){var a=f(arguments[0]);a.push.apply(a,this.toArray());return this.pushStack(a,"before",arguments)}},after:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this.nextSibling)});if(arguments.length){var a=this.pushStack(this,"after",arguments);a.push.apply(a,f(arguments[0]).toArray());return a}},remove:function(a,b){for(var c=0,d;(d=this[c])!=null;c++)if(!a||f.filter(a,[d]).length)!b&&d.nodeType===1&&(f.cleanData(d.getElementsByTagName("*")),f.cleanData([d])),d.parentNode&&d.parentNode.removeChild(d);return this},empty:function(){for(var a=0,b;(b=this[a])!=null;a++){b.nodeType===1&&f.cleanData(b.getElementsByTagName("*"));while(b.firstChild)b.removeChild(b.firstChild)}return this},clone:function(a,b){a=a==null?!1:a,b=b==null?a:b;return this.map(function(){return f.clone(this,a,b)})},html:function(a){if(a===b)return this[0]&&this[0].nodeType===1?this[0].innerHTML.replace(Y,""):null;if(typeof a=="string"&&!bc.test(a)&&(f.support.leadingWhitespace||!Z.test(a))&&!bg[(_.exec(a)||["",""])[1].toLowerCase()]){a=a.replace($,"<$1></$2>");try{for(var c=0,d=this.length;c<d;c++)this[c].nodeType===1&&(f.cleanData(this[c].getElementsByTagName("*")),this[c].innerHTML=a)}catch(e){this.empty().append(a)}}else f.isFunction(a)?this.each(function(b){var c=f(this);c.html(a.call(this,b,c.html()))}):this.empty().append(a);return this},replaceWith:function(a){if(this[0]&&this[0].parentNode){if(f.isFunction(a))return this.each(function(b){var c=f(this),d=c.html();c.replaceWith(a.call(this,b,d))});typeof a!="string"&&(a=f(a).detach());return this.each(function(){var b=this.nextSibling,c=this.parentNode;f(this).remove(),b?f(b).before(a):f(c).append(a)})}return this.length?this.pushStack(f(f.isFunction(a)?a():a),"replaceWith",a):this},detach:function(a){return this.remove(a,!0)},domManip:function(a,c,d){var e,g,h,i,j=a[0],k=[];if(!f.support.checkClone&&arguments.length===3&&typeof j=="string"&&bd.test(j))return this.each(function(){f(this).domManip(a,c,d,!0)});if(f.isFunction(j))return this.each(function(e){var g=f(this);a[0]=j.call(this,e,c?g.html():b),g.domManip(a,c,d)});if(this[0]){i=j&&j.parentNode,f.support.parentNode&&i&&i.nodeType===11&&i.childNodes.length===this.length?e={fragment:i}:e=f.buildFragment(a,this,k),h=e.fragment,h.childNodes.length===1?g=h=h.firstChild:g=h.firstChild;if(g){c=c&&f.nodeName(g,"tr");for(var l=0,m=this.length,n=m-1;l<m;l++)d.call(c?bh(this[l],g):this[l],e.cacheable||m>1&&l<n?f.clone(h,!0,!0):h)}k.length&&f.each(k,bn)}return this}}),f.buildFragment=function(a,b,d){var e,g,h,i=b&&b[0]?b[0].ownerDocument||b[0]:c;a.length===1&&typeof a[0]=="string"&&a[0].length<512&&i===c&&a[0].charAt(0)==="<"&&!bc.test(a[0])&&(f.support.checkClone||!bd.test(a[0]))&&(g=!0,h=f.fragments[a[0]],h&&h!==1&&(e=h)),e||(e=i.createDocumentFragment(),f.clean(a,i,e,d)),g&&(f.fragments[a[0]]=h?e:1);return{fragment:e,cacheable:g}},f.fragments={},f.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(a,b){f.fn[a]=function(c){var d=[],e=f(c),g=this.length===1&&this[0].parentNode;if(g&&g.nodeType===11&&g.childNodes.length===1&&e.length===1){e[b](this[0]);return this}for(var h=0,i=e.length;h<i;h++){var j=(h>0?this.clone(!0):this).get();f(e[h])[b](j),d=d.concat(j)}return this.pushStack(d,a,e.selector)}}),f.extend({clone:function(a,b,c){var d=a.cloneNode(!0),e,g,h;if((!f.support.noCloneEvent||!f.support.noCloneChecked)&&(a.nodeType===1||a.nodeType===11)&&!f.isXMLDoc(a)){bj(a,d),e=bk(a),g=bk(d);for(h=0;e[h];++h)bj(e[h],g[h])}if(b){bi(a,d);if(c){e=bk(a),g=bk(d);for(h=0;e[h];++h)bi(e[h],g[h])}}return d},clean:function(a,b,d,e){var g;b=b||c,typeof b.createElement=="undefined"&&(b=b.ownerDocument|| | |
| b[0]&&b[0].ownerDocument||c);var h=[],i;for(var j=0,k;(k=a[j])!=null;j++){typeof k=="number"&&(k+="");if(!k)continue;if(typeof k=="string")if(!bb.test(k))k=b.createTextNode(k);else{k=k.replace($,"<$1></$2>");var l=(_.exec(k)||["",""])[1].toLowerCase(),m=bg[l]||bg._default,n=m[0],o=b.createElement("div");o.innerHTML=m[1]+k+m[2];while(n--)o=o.lastChild;if(!f.support.tbody){var p=ba.test(k),q=l==="table"&&!p?o.firstChild&&o.firstChild.childNodes:m[1]==="<table>"&&!p?o.childNodes:[];for(i=q.length-1;i>=0;--i)f.nodeName(q[i],"tbody")&&!q[i].childNodes.length&&q[i].parentNode.removeChild(q[i])}!f.support.leadingWhitespace&&Z.test(k)&&o.insertBefore(b.createTextNode(Z.exec(k)[0]),o.firstChild),k=o.childNodes}var r;if(!f.support.appendChecked)if(k[0]&&typeof (r=k.length)=="number")for(i=0;i<r;i++)bm(k[i]);else bm(k);k.nodeType?h.push(k):h=f.merge(h,k)}if(d){g=function(a){return!a.type||be.test(a.type)};for(j=0;h[j];j++)if(e&&f.nodeName(h[j],"script")&&(!h[j].type||h[j].type.toLowerCase()==="text/javascript"))e.push(h[j].parentNode?h[j].parentNode.removeChild(h[j]):h[j]);else{if(h[j].nodeType===1){var s=f.grep(h[j].getElementsByTagName("script"),g);h.splice.apply(h,[j+1,0].concat(s))}d.appendChild(h[j])}}return h},cleanData:function(a){var b,c,d=f.cache,e=f.expando,g=f.event.special,h=f.support.deleteExpando;for(var i=0,j;(j=a[i])!=null;i++){if(j.nodeName&&f.noData[j.nodeName.toLowerCase()])continue;c=j[f.expando];if(c){b=d[c]&&d[c][e];if(b&&b.events){for(var k in b.events)g[k]?f.event.remove(j,k):f.removeEvent(j,k,b.handle);b.handle&&(b.handle.elem=null)}h?delete j[f.expando]:j.removeAttribute&&j.removeAttribute(f.expando),delete d[c]}}}});var bo=/alpha\([^)]*\)/i,bp=/opacity=([^)]*)/,bq=/-([a-z])/ig,br=/([A-Z]|^ms)/g,bs=/^-?\d+(?:px)?$/i,bt=/^-?\d/,bu=/^[+\-]=/,bv=/[^+\-\.\de]+/g,bw={position:"absolute",visibility:"hidden",display:"block"},bx=["Left","Right"],by=["Top","Bottom"],bz,bA,bB,bC=function(a,b){return b.toUpperCase()};f.fn.css=function(a,c){if(arguments.length===2&&c===b)return this;return f.access(this,a,c,!0,function(a,c,d){return d!==b?f.style(a,c,d):f.css(a,c)})},f.extend({cssHooks:{opacity:{get:function(a,b){if(b){var c=bz(a,"opacity","opacity");return c===""?"1":c}return a.style.opacity}}},cssNumber:{zIndex:!0,fontWeight:!0,opacity:!0,zoom:!0,lineHeight:!0,widows:!0,orphans:!0},cssProps:{"float":f.support.cssFloat?"cssFloat":"styleFloat"},style:function(a,c,d,e){if(!!a&&a.nodeType!==3&&a.nodeType!==8&&!!a.style){var g,h,i=f.camelCase(c),j=a.style,k=f.cssHooks[i];c=f.cssProps[i]||i;if(d===b){if(k&&"get"in k&&(g=k.get(a,!1,e))!==b)return g;return j[c]}h=typeof d;if(h==="number"&&isNaN(d)||d==null)return;h==="string"&&bu.test(d)&&(d=+d.replace(bv,"")+parseFloat(f.css(a,c))),h==="number"&&!f.cssNumber[i]&&(d+="px");if(!k||!("set"in k)||(d=k.set(a,d))!==b)try{j[c]=d}catch(l){}}},css:function(a,c,d){var e,g;c=f.camelCase(c),g=f.cssHooks[c],c=f.cssProps[c]||c,c==="cssFloat"&&(c="float");if(g&&"get"in g&&(e=g.get(a,!0,d))!==b)return e;if(bz)return bz(a,c)},swap:function(a,b,c){var d={};for(var e in b)d[e]=a.style[e],a.style[e]=b[e];c.call(a);for(e in b)a.style[e]=d[e]},camelCase:function(a){return a.replace(bq,bC)}}),f.curCSS=f.css,f.each(["height","width"],function(a,b){f.cssHooks[b]={get:function(a,c,d){var e;if(c){a.offsetWidth!==0?e=bD(a,b,d):f.swap(a,bw,function(){e=bD(a,b,d)});if(e<=0){e=bz(a,b,b),e==="0px"&&bB&&(e=bB(a,b,b));if(e!=null)return e===""||e==="auto"?"0px":e}if(e<0||e==null){e=a.style[b];return e===""||e==="auto"?"0px":e}return typeof e=="string"?e:e+"px"}},set:function(a,b){if(!bs.test(b))return b;b=parseFloat(b);if(b>=0)return b+"px"}}}),f.support.opacity||(f.cssHooks.opacity={get:function(a,b){return bp.test((b&&a.currentStyle?a.currentStyle.filter:a.style.filter)||"")?parseFloat(RegExp.$1)/100+"":b?"1":""},set:function(a,b){var c=a.style,d=a.currentStyle;c.zoom=1;var e=f.isNaN(b)?"":"alpha(opacity="+b*100+")",g=d&&d.filter||c.filter||"";c.filter=bo.test(g)?g.replace(bo,e):g+" "+e}}),f(function(){f.support.reliableMarginRight||(f.cssHooks.marginRight={get:function(a,b){var c;f.swap(a,{display:"inline-block"},function(){b?c=bz(a,"margin-right","marginRight"):c=a.style.marginRight});return c}})}),c.defaultView&&c.defaultView.getComputedStyle&&(bA=function(a,c){var d,e,g;c=c.replace(br,"-$1").toLowerCase();if(!(e=a.ownerDocument.defaultView))return b;if(g=e.getComputedStyle(a,null))d=g.getPropertyValue(c),d===""&&!f.contains(a.ownerDocument.documentElement,a)&&(d=f.style(a,c));return d}),c.documentElement.currentStyle&&(bB=function(a,b){var c,d=a.currentStyle&&a.currentStyle[b],e=a.runtimeStyle&&a.runtimeStyle[b],f=a.style;!bs.test(d)&&bt.test(d)&&(c=f.left,e&&(a.runtimeStyle.left=a.currentStyle.left),f.left=b==="fontSize"?"1em":d||0,d=f.pixelLeft+"px",f.left=c,e&&(a.runtimeStyle.left=e));return d===""?"auto":d}),bz=bA||bB,f.expr&&f.expr.filters&&(f.expr.filters.hidden=function(a){var b=a.offsetWidth,c=a.offsetHeight;return b===0&&c===0||!f.support.reliableHiddenOffsets&&(a.style.display||f.css(a,"display"))==="none"},f.expr.filters.visible=function(a){return!f.expr.filters.hidden(a)});var bE=/%20/g,bF=/\[\]$/,bG=/\r?\n/g,bH=/#.*$/,bI=/^(.*?):[ \t]*([^\r\n]*)\r?$/mg,bJ=/^(?:color|date|datetime|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i,bK=/^(?:about|app|app\-storage|.+\-extension|file|widget):$/,bL=/^(?:GET|HEAD)$/,bM=/^\/\//,bN=/\?/,bO=/<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi,bP=/^(?:select|textarea)/i,bQ=/\s+/,bR=/([?&])_=[^&]*/,bS=/^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+))?)?/,bT=f.fn.load,bU={},bV={},bW,bX;try{bW=e.href}catch(bY){bW=c.createElement("a"),bW.href="",bW=bW.href}bX=bS.exec(bW.toLowerCase())||[],f.fn.extend({load:function(a,c,d){if(typeof a!="string"&&bT)return bT.apply(this,arguments);if(!this.length)return this;var e=a.indexOf(" ");if(e>=0){var g=a.slice(e,a.length);a=a.slice(0,e)}var h="GET";c&&(f.isFunction(c)?(d=c,c=b):typeof c=="object"&&(c=f.param(c,f.ajaxSettings.traditional),h="POST"));var i=this;f.ajax({url:a,type:h,dataType:"html",data:c,complete:function(a,b,c){c=a.responseText,a.isResolved()&&(a.done(function(a){c=a}),i.html(g?f("<div>").append(c.replace(bO,"")).find(g):c)),d&&i.each(d,[c,b,a])}});return this},serialize:function(){return f.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?f.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||bP.test(this.nodeName)||bJ.test(this.type))}).map(function(a,b){var c=f(this).val();return c==null?null:f.isArray(c)?f.map(c,function(a,c){return{name:b.name,value:a.replace(bG,"\r\n")}}):{name:b.name,value:c.replace(bG,"\r\n")}}).get()}}),f.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),function(a,b){f.fn[b]=function(a){return this.bind(b,a)}}),f.each(["get","post"],function(a,c){f[c]=function(a,d,e,g){f.isFunction(d)&&(g=g||e,e=d,d=b);return f.ajax({type:c,url:a,data:d,success:e,dataType:g})}}),f.extend({getScript:function(a,c){return f.get(a,b,c,"script")},getJSON:function(a,b,c){return f.get(a,b,c,"json")},ajaxSetup:function(a,b){b?f.extend(!0,a,f.ajaxSettings,b):(b=a,a=f.extend(!0,f.ajaxSettings,b));for(var c in{context:1,url:1})c in b?a[c]=b[c]:c in f.ajaxSettings&&(a[c]=f.ajaxSettings[c]);return a},ajaxSettings:{url:bW,isLocal:bK.test(bX[1]),global:!0,type:"GET",contentType:"application/x-www-form-urlencoded",processData:!0,async:!0,accepts:{xml:"application/xml, text/xml",html:"text/html",text:"text/plain",json:"application/json, text/javascript","*":"*/*"},contents:{xml:/xml/,html:/html/,json:/json/},responseFields:{xml:"responseXML",text:"responseText"},converters:{"* text":a.String,"text html":!0,"text json":f.parseJSON,"text xml":f.parseXML}},ajaxPrefilter:bZ(bU),ajaxTransport:bZ(bV),ajax:function(a,c){function w(a,c,l,m){if(s!==2){s=2,q&&clearTimeout(q),p=b,n=m||"",v.readyState=a?4:0;var o,r,u,w=l?ca(d,v,l):b,x,y;if(a>=200&&a<300||a===304){if(d.ifModified){if(x=v.getResponseHeader("Last-Modified"))f.lastModified[k]=x;if(y=v.getResponseHeader("Etag"))f.etag[k]=y}if(a===304)c="notmodified",o=!0;else try{r=cb(d,w),c="success",o=!0}catch(z){c="parsererror",u=z}}else{u=c;if(!c||a)c="error",a<0&&(a=0)}v.status=a,v.statusText=c,o?h.resolveWith(e,[r,c,v]):h.rejectWith(e,[v,c,u]),v.statusCode(j),j=b,t&&g.trigger("ajax"+(o?"Success":"Error"),[v,d,o?r:u]),i.resolveWith(e,[v,c]),t&&(g.trigger("ajaxComplete",[v,d]),--f.active||f.event.trigger("ajaxStop"))}}typeof a=="object"&&(c=a,a=b),c=c||{};var d=f.ajaxSetup({},c),e=d.context||d,g=e!==d&&(e.nodeType||e instanceof f)?f(e):f.event,h=f.Deferred(),i=f._Deferred(),j=d.statusCode||{},k,l={},m={},n,o,p,q,r,s=0,t,u,v={readyState:0,setRequestHeader:function(a,b){if(!s){var c=a.toLowerCase();a=m[c]=m[c]||a,l[a]=b}return this},getAllResponseHeaders:function(){return s===2?n:null},getResponseHeader:function(a){var c;if(s===2){if(!o){o={};while(c=bI.exec(n))o[c[1].toLowerCase()]=c[2]}c=o[a.toLowerCase()]}return c===b?null:c},overrideMimeType:function(a){s||(d.mimeType=a);return this},abort:function(a){a=a||"abort",p&&p.abort(a),w(0,a);return this}};h.promise(v),v.success=v.done,v.error=v.fail,v.complete=i.done,v.statusCode=function(a){if(a){var b;if(s<2)for(b in a)j[b]=[j[b],a[b]];else b=a[v.status],v.then(b,b)}return this},d.url=((a||d.url)+"").replace(bH,"").replace(bM,bX[1]+"//"),d.dataTypes=f.trim(d.dataType||"*").toLowerCase().split(bQ),d.crossDomain==null&&(r=bS.exec(d.url.toLowerCase()),d.crossDomain=!(!r||r[1]==bX[1]&&r[2]==bX[2]&&(r[3]||(r[1]==="http:"?80:443))==(bX[3]||(bX[1]==="http:"?80:443)))),d.data&&d.processData&&typeof d.data!="string"&&(d.data=f.param(d.data,d.traditional)),b$(bU,d,c,v);if(s===2)return!1;t=d.global,d.type=d.type.toUpperCase(),d.hasContent=!bL.test(d.type),t&&f.active++===0&&f.event.trigger("ajaxStart");if(!d.hasContent){d.data&&(d.url+=(bN.test(d.url)?"&":"?")+d.data),k=d.url;if(d.cache===!1){var x=f.now(),y=d.url.replace(bR,"$1_="+x);d.url=y+(y===d.url?(bN.test(d.url)?"&":"?")+"_="+x:"")}}(d.data&&d.hasContent&&d.contentType!==!1||c.contentType)&&v.setRequestHeader("Content-Type",d.contentType),d.ifModified&&(k=k||d.url,f.lastModified[k]&&v.setRequestHeader("If-Modified-Since",f.lastModified[k]),f.etag[k]&&v.setRequestHeader("If-None-Match",f.etag[k])),v.setRequestHeader("Accept",d.dataTypes[0]&&d.accepts[d.dataTypes[0]]?d.accepts[d.dataTypes[0]]+(d.dataTypes[0]!=="*"?", */*; q=0.01":""):d.accepts["*"]);for(u in d.headers)v.setRequestHeader(u,d.headers[u]);if(d.beforeSend&&(d.beforeSend.call(e,v,d)===!1||s===2)){v.abort();return!1}for(u in{success:1,error:1,complete:1})v[u](d[u]);p=b$(bV,d,c,v);if(!p)w(-1,"No Transport");else{v.readyState=1,t&&g.trigger("ajaxSend",[v,d]),d.async&&d.timeout>0&&(q=setTimeout(function(){v.abort("timeout")},d.timeout));try{s=1,p.send(l,w)}catch(z){status<2?w(-1,z):f.error(z)}}return v},param:function(a,c){var d=[],e=function(a,b){b=f.isFunction(b)?b():b,d[d.length]=encodeURIComponent(a)+"="+encodeURIComponent(b)};c===b&&(c=f.ajaxSettings.traditional);if(f.isArray(a)||a.jquery&&!f.isPlainObject(a))f.each(a,function(){e(this.name,this.value)});else for(var g in a)b_(g,a[g],c,e);return d.join("&").replace(bE,"+")}}),f.extend({active:0,lastModified:{},etag:{}});var cc=f.now(),cd=/(\=)\?(&|$)|\?\?/i;f.ajaxSetup({jsonp:"callback",jsonpCallback:function(){return f.expando+"_"+cc++}}),f.ajaxPrefilter("json jsonp",function(b,c,d){var e=b.contentType==="application/x-www-form-urlencoded"&&typeof b.data=="string";if(b.dataTypes[0]==="jsonp"||b.jsonp!==!1&&(cd.test(b.url)||e&&cd.test(b.data))){var g,h=b.jsonpCallback=f.isFunction(b.jsonpCallback)?b.jsonpCallback():b.jsonpCallback,i=a[h],j=b.url,k=b.data,l="$1"+h+"$2";b.jsonp!==!1&&(j=j.replace(cd,l),b.url===j&&(e&&(k=k.replace(cd,l)),b.data===k&&(j+=(/\?/.test(j)?"&":"?")+b.jsonp+"="+h))),b.url=j,b.data=k,a[h]=function(a){g=[a]},d.always(function(){a[h]=i,g&&f.isFunction(i)&&a[h](g[0])}),b.converters["script json"]=function(){g||f.error(h+" was not called");return g[0]},b.dataTypes[0]="json";return"script"}}),f.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/javascript|ecmascript/},converters:{"text script":function(a){f.globalEval(a);return a}}}),f.ajaxPrefilter("script",function(a){a.cache===b&&(a.cache=!1),a.crossDomain&&(a.type="GET",a.global=!1)}),f.ajaxTransport("script",function(a){if(a.crossDomain){var d,e=c.head||c.getElementsByTagName("head")[0]||c.documentElement;return{send:function(f,g){d=c.createElement("script"),d.async="async",a.scriptCharset&&(d.charset=a.scriptCharset),d.src=a.url,d.onload=d.onreadystatechange=function(a,c){if(c||!d.readyState||/loaded|complete/.test(d.readyState))d.onload=d.onreadystatechange=null,e&&d.parentNode&&e.removeChild(d),d=b,c||g(200,"success")},e.insertBefore(d,e.firstChild)},abort:function(){d&&d.onload(0,1)}}}});var ce=a.ActiveXObject?function(){for(var a in cg)cg[a](0,1)}:!1,cf=0,cg;f.ajaxSettings.xhr=a.ActiveXObject?function(){return!this.isLocal&&ch()||ci()}:ch,function(a){f.extend(f.support,{ajax:!!a,cors:!!a&&"withCredentials"in a})}(f.ajaxSettings.xhr()),f.support.ajax&&f.ajaxTransport(function(c){if(!c.crossDomain||f.support.cors){var d;return{send:function(e,g){var h=c.xhr(),i,j;c.username?h.open(c.type,c.url,c.async,c.username,c.password):h.open(c.type,c.url,c.async);if(c.xhrFields)for(j in c.xhrFields)h[j]=c.xhrFields[j];c.mimeType&&h.overrideMimeType&&h.overrideMimeType(c.mimeType),!c.crossDomain&&!e["X-Requested-With"]&&(e["X-Requested-With"]="XMLHttpRequest");try{for(j in e)h.setRequestHeader(j,e[j])}catch(k){}h.send(c.hasContent&&c.data||null),d=function(a,e){var j,k,l,m,n;try{if(d&&(e||h.readyState===4)){d=b,i&&(h.onreadystatechange=f.noop,ce&&delete cg[i]);if(e)h.readyState!==4&&h.abort();else{j=h.status,l=h.getAllResponseHeaders(),m={},n=h.responseXML,n&&n.documentElement&&(m.xml=n),m.text=h.responseText;try{k=h.statusText}catch(o){k=""}!j&&c.isLocal&&!c.crossDomain?j=m.text?200:404:j===1223&&(j=204)}}}catch(p){e||g(-1,p)}m&&g(j,k,m,l)},!c.async||h.readyState===4?d():(i=++cf,ce&&(cg||(cg={},f(a).unload(ce)),cg[i]=d),h.onreadystatechange=d)},abort:function(){d&&d(0,1)}}}});var cj={},ck,cl,cm=/^(?:toggle|show|hide)$/,cn=/^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i,co,cp=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]],cq,cr=a.webkitRequestAnimationFrame||a.mozRequestAnimationFrame||a.oRequestAnimationFrame;f.fn.extend({show:function(a,b,c){var d,e;if(a||a===0)return this.animate(cu("show",3),a,b,c);for(var g=0,h=this.length;g<h;g++)d=this[g],d.style&&(e=d.style.display,!f._data(d,"olddisplay")&&e==="none"&&(e=d.style.display=""),e===""&&f.css(d,"display")==="none"&&f._data(d,"olddisplay",cv(d.nodeName)));for(g=0;g<h;g++){d=this[g];if(d.style){e=d.style.display;if(e===""||e==="none")d.style.display=f._data(d,"olddisplay")||""}}return this},hide:function(a,b,c){if(a||a===0)return this.animate(cu("hide",3),a,b,c);for(var d=0,e=this.length;d<e;d++)if(this[d].style){var g=f.css(this[d],"display");g!=="none"&&!f._data(this[d],"olddisplay")&&f._data(this[d],"olddisplay",g)}for(d=0;d<e;d++)this[d].style&&(this[d].style.display="none");return this},_toggle:f.fn.toggle,toggle:function(a,b,c){var d=typeof a=="boolean";f.isFunction(a)&&f.isFunction(b)?this._toggle.apply(this,arguments):a==null||d?this.each(function(){var b=d?a:f(this).is(":hidden");f(this)[b?"show":"hide"]()}):this.animate(cu("toggle",3),a,b,c);return this},fadeTo:function(a,b,c,d){return this.filter(":hidden").css("opacity",0).show().end().animate({opacity:b},a,c,d)},animate:function(a,b,c,d){var e=f.speed(b,c,d);if(f.isEmptyObject(a))return this.each(e.complete,[!1]);a=f.extend({},a);return this[e.queue===!1?"each":"queue"](function(){e.queue===!1&&f._mark(this);var b=f.extend({},e),c=this.nodeType===1,d=c&&f(this).is(":hidden"),g,h,i,j,k,l,m,n,o;b.animatedProperties={};for(i in a){g=f.camelCase(i),i!==g&&(a[g]=a[i],delete a[i]),h=a[g],f.isArray(h)?(b.animatedProperties[g]=h[1],h=a[g]=h[0]):b.animatedProperties[g]=b.specialEasing&&b.specialEasing[g]||b.easing||"swing";if(h==="hide"&&d||h==="show"&&!d)return b.complete.call(this);c&&(g==="height"||g==="width")&&(b.overflow=[this.style.overflow,this.style.overflowX,this.style.overflowY],f.css(this,"display")==="inline"&&f.css(this,"float")==="none"&&(f.support.inlineBlockNeedsLayout?(j=cv(this.nodeName),j==="inline"?this.style.display="inline-block":(this.style.display="inline",this.style.zoom=1)):this.style.display="inline-block"))}b.overflow!=null&&(this.style.overflow="hidden");for(i in a)k=new f.fx(this,b,i),h=a[i],cm.test(h)?k[h==="toggle"?d?"show":"hide":h]():(l=cn.exec(h),m=k.cur(),l?(n=parseFloat(l[2]),o=l[3]||(f.cssNumber[i]?"":"px"),o!=="px"&&(f.style(this,i,(n||1)+o),m=(n||1)/k.cur()*m,f.style(this,i,m+o)),l[1]&&(n=(l[1]==="-="?-1:1)*n+m),k.custom(m,n,o)):k.custom(m,h,""));return!0})},stop:function(a,b){a&&this.queue([]),this.each(function(){var a=f.timers,c=a.length;b||f._unmark(!0,this);while(c--)a[c].elem===this&&(b&&a[c](!0),a.splice(c,1))}),b||this.dequeue();return this}}),f.each({slideDown:cu("show",1),slideUp:cu("hide",1),slideToggle:cu("toggle",1),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"},fadeToggle:{opacity:"toggle"}},function(a,b){f.fn[a]=function(a,c,d){return this.animate(b,a,c,d)}}),f.extend({speed:function(a,b,c){var d=a&&typeof a=="object"?f.extend({},a):{complete:c||!c&&b||f.isFunction(a)&&a,duration:a,easing:c&&b||b&&!f.isFunction(b)&&b};d.duration=f.fx.off?0:typeof d.duration=="number"?d.duration:d.duration in f.fx.speeds?f.fx.speeds[d.duration]:f.fx.speeds._default,d.old=d.complete,d.complete=function(a){d.queue!==!1?f.dequeue(this):a!==!1&&f._unmark(this),f.isFunction(d.old)&&d.old.call(this)};return d},easing:{linear:function(a,b,c,d){return c+d*a},swing:function(a,b,c,d){return(-Math.cos(a*Math.PI)/2+.5)*d+c}},timers:[],fx:function(a,b,c){this.options=b,this.elem=a,this.prop=c,b.orig=b.orig||{}}}),f.fx.prototype={update:function(){this.options.step&&this.options.step.call(this.elem,this.now,this),(f.fx.step[this.prop]||f.fx.step._default)(this)},cur:function(){if(this.elem[this.prop]!=null&&(!this.elem.style||this.elem.style[this.prop]==null))return this.elem[this.prop];var a,b=f.css(this.elem,this.prop);return isNaN(a=parseFloat(b))?!b||b==="auto"?0:b:a},custom:function(a,b,c){function h(a){return d.step(a)}var d=this,e=f.fx,g;this.startTime=cq||cs(),this.start=a,this.end=b,this.unit=c||this.unit||(f.cssNumber[this.prop]?"":"px"),this.now=this.start,this.pos=this.state=0,h.elem=this.elem,h()&&f.timers.push(h)&&!co&&(cr?(co=1,g=function(){co&&(cr(g),e.tick())},cr(g)):co=setInterval(e.tick,e.interval))},show:function(){this.options.orig[this.prop]=f.style(this.elem,this.prop),this.options.show=!0,this.custom(this.prop==="width"||this.prop==="height"?1:0,this.cur()),f(this.elem).show()},hide:function(){this.options.orig[this.prop]=f.style(this.elem,this.prop),this.options.hide=!0,this.custom(this.cur(),0)},step:function(a){var b=cq||cs(),c=!0,d=this.elem,e=this.options,g,h;if(a||b>=e.duration+this.startTime){this.now=this.end,this.pos=this.state=1,this.update(),e.animatedProperties[this.prop]=!0;for(g in e.animatedProperties)e.animatedProperties[g]!==!0&&(c=!1);if(c){e.overflow!=null&&!f.support.shrinkWrapBlocks&&f.each(["","X","Y"],function(a,b){d.style["overflow"+b]=e.overflow[a]}),e.hide&&f(d).hide();if(e.hide||e.show)for(var i in e.animatedProperties)f.style(d,i,e.orig[i]);e.complete.call(d)}return!1}e.duration==Infinity?this.now=b:(h=b-this.startTime,this.state=h/e.duration,this.pos=f.easing[e.animatedProperties[this.prop]](this.state,h,0,1,e.duration),this.now=this.start+(this.end-this.start)*this.pos),this.update();return!0}},f.extend(f.fx,{tick:function(){for(var a=f.timers,b=0;b<a.length;++b)a[b]()||a.splice(b--,1);a.length||f.fx.stop()},interval:13,stop:function(){clearInterval(co),co=null},speeds:{slow:600,fast:200,_default:400},step:{opacity:function(a){f.style(a.elem,"opacity",a.now)},_default:function(a){a.elem.style&&a.elem.style[a.prop]!=null?a.elem.style[a.prop]=(a.prop==="width"||a.prop==="height"?Math.max(0,a.now):a.now)+a.unit:a.elem[a.prop]=a.now}}}),f.expr&&f.expr.filters&&(f.expr.filters.animated=function(a){return f.grep(f.timers,function(b){return a===b.elem}).length});var cw=/^t(?:able|d|h)$/i,cx=/^(?:body|html)$/i;"getBoundingClientRect"in c.documentElement?f.fn.offset=function(a){var b=this[0],c;if(a)return this.each(function(b){f.offset.setOffset(this,a,b)});if(!b||!b.ownerDocument)return null;if(b===b.ownerDocument.body)return f.offset.bodyOffset(b);try{c=b.getBoundingClientRect()}catch(d){}var e=b.ownerDocument,g=e.documentElement;if(!c||!f.contains(g,b))return c?{top:c.top,left:c.left}:{top:0,left:0};var h=e.body,i=cy(e),j=g.clientTop||h.clientTop||0,k=g.clientLeft||h.clientLeft||0,l=i.pageYOffset||f.support.boxModel&&g.scrollTop||h.scrollTop,m=i.pageXOffset||f.support.boxModel&&g.scrollLeft||h.scrollLeft,n=c.top+l-j,o=c.left+m-k;return{top:n,left:o}}:f.fn.offset=function(a){var b=this[0];if(a)return this.each(function(b){f.offset.setOffset(this,a,b)});if(!b||!b.ownerDocument)return null;if(b===b.ownerDocument.body)return f.offset.bodyOffset(b);f.offset.initialize();var c,d=b.offsetParent,e=b,g=b.ownerDocument,h=g.documentElement,i=g.body,j=g.defaultView,k=j?j.getComputedStyle(b,null):b.currentStyle,l=b.offsetTop,m=b.offsetLeft;while((b=b.parentNode)&&b!==i&&b!==h){if(f.offset.supportsFixedPosition&&k.position==="fixed")break;c=j?j.getComputedStyle(b,null):b.currentStyle,l-=b.scrollTop,m-=b.scrollLeft,b===d&&(l+=b.offsetTop,m+=b.offsetLeft,f.offset.doesNotAddBorder&&(!f.offset.doesAddBorderForTableAndCells||!cw.test(b.nodeName))&&(l+=parseFloat(c.borderTopWidth)||0,m+=parseFloat(c.borderLeftWidth)||0),e=d,d=b.offsetParent),f.offset.subtractsBorderForOverflowNotVisible&&c.overflow!=="visible"&&(l+=parseFloat(c.borderTopWidth)||0,m+=parseFloat(c.borderLeftWidth)||0),k=c}if(k.position==="relative"||k.position==="static")l+=i.offsetTop,m+=i.offsetLeft;f.offset.supportsFixedPosition&&k.position==="fixed"&&(l+=Math.max(h.scrollTop,i.scrollTop),m+=Math.max(h.scrollLeft,i.scrollLeft));return{top:l,left:m}},f.offset={initialize:function(){var a=c.body,b=c.createElement("div"),d,e,g,h,i=parseFloat(f.css(a,"marginTop"))||0,j="<div style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;'><div></div></div><table style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;' cellpadding='0' cellspacing='0'><tr><td></td></tr></table>";f.extend(b.style,{position:"absolute",top:0,left:0,margin:0,border:0,width:"1px",height:"1px",visibility:"hidden"}),b.innerHTML=j,a.insertBefore(b,a.firstChild),d=b.firstChild,e=d.firstChild,h=d.nextSibling.firstChild.firstChild,this.doesNotAddBorder=e.offsetTop!==5,this.doesAddBorderForTableAndCells=h.offsetTop===5,e.style.position="fixed",e.style.top="20px",this.supportsFixedPosition=e.offsetTop===20||e.offsetTop===15,e.style.position=e.style.top="",d.style.overflow="hidden",d.style.position="relative",this.subtractsBorderForOverflowNotVisible=e.offsetTop===-5,this.doesNotIncludeMarginInBodyOffset=a.offsetTop!==i,a.removeChild(b),f.offset.initialize=f.noop},bodyOffset:function(a){var b=a.offsetTop,c=a.offsetLeft;f.offset.initialize(),f.offset.doesNotIncludeMarginInBodyOffset&&(b+=parseFloat(f.css(a,"marginTop"))||0,c+=parseFloat(f.css(a,"marginLeft"))||0);return{top:b,left:c}},setOffset:function(a,b,c){var d=f.css(a,"position");d==="static"&&(a.style.position="relative");var e=f(a),g=e.offset(),h=f.css(a,"top"),i=f.css(a,"left"),j=(d==="absolute"||d==="fixed")&&f.inArray("auto",[h,i])>-1,k={},l={},m,n;j?(l=e.position(),m=l.top,n=l.left):(m=parseFloat(h)||0,n=parseFloat(i)||0),f.isFunction(b)&&(b=b.call(a,c,g)),b.top!=null&&(k.top=b.top-g.top+m),b.left!=null&&(k.left=b.left-g.left+n),"using"in b?b.using.call(a,k):e.css(k)}},f.fn.extend({position:function(){if(!this[0])return null;var a=this[0],b=this.offsetParent(),c=this.offset(),d=cx.test(b[0].nodeName)?{top:0,left:0}:b.offset();c.top-=parseFloat(f.css(a,"marginTop"))||0,c.left-=parseFloat(f.css(a,"marginLeft"))||0,d.top+=parseFloat(f.css(b[0],"borderTopWidth"))||0,d.left+=parseFloat(f.css(b[0],"borderLeftWidth"))||0;return{top:c.top-d.top,left:c.left-d.left}},offsetParent:function(){return this.map(function(){var a=this.offsetParent||c.body;while(a&&!cx.test(a.nodeName)&&f.css(a,"position")==="static")a=a.offsetParent;return a})}}),f.each(["Left","Top"],function(a,c){var d="scroll"+c;f.fn[d]=function(c){var e,g;if(c===b){e=this[0];if(!e)return null;g=cy(e);return g?"pageXOffset"in g?g[a?"pageYOffset":"pageXOffset"]:f.support.boxModel&&g.document.documentElement[d]||g.document.body[d]:e[d]}return this.each(function(){g=cy(this),g?g.scrollTo(a?f(g).scrollLeft():c,a?c:f(g).scrollTop()):this[d]=c})}}),f.each(["Height","Width"],function(a,c){var d=c.toLowerCase();f.fn["inner"+c]=function(){return this[0]?parseFloat(f.css(this[0],d,"padding")):null},f.fn["outer"+c]=function(a){return this[0]?parseFloat(f.css(this[0],d,a?"margin":"border")):null},f.fn[d]=function(a){var e=this[0];if(!e)return a==null?null:this;if(f.isFunction(a))return this.each(function(b){var c=f(this);c[d](a.call(this,b,c[d]()))});if(f.isWindow(e)){var g=e.document.documentElement["client"+c];return e.document.compatMode==="CSS1Compat"&&g||e.document.body["client"+c]||g}if(e.nodeType===9)return Math.max(e.documentElement["client"+c],e.body["scroll"+c],e.documentElement["scroll"+c],e.body["offset"+c],e.documentElement["offset"+c]);if(a===b){var h=f.css(e,d),i=parseFloat(h);return f.isNaN(i)?h:i}return this.css(d,typeof a=="string"?a:a+"px")}}),a.jQuery=a.$=f})(window); |
| /*! | |
| * jQuery JavaScript Library v1.6.2 | |
| * http://jquery.com/ | |
| * | |
| * Copyright 2011, John Resig | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| * | |
| * Includes Sizzle.js | |
| * http://sizzlejs.com/ | |
| * Copyright 2011, The Dojo Foundation | |
| * Released under the MIT, BSD, and GPL Licenses. | |
| * | |
| * Date: Thu Jun 30 14:16:56 2011 -0400 | |
| */ | |
| (function(a,b){function cv(a){return f.isWindow(a)?a:a.nodeType===9?a.defaultView||a.parentWindow:!1}function cs(a){if(!cg[a]){var b=c.body,d=f("<"+a+">").appendTo(b),e=d.css("display");d.remove();if(e==="none"||e===""){ch||(ch=c.createElement("iframe"),ch.frameBorder=ch.width=ch.height=0),b.appendChild(ch);if(!ci||!ch.createElement)ci=(ch.contentWindow||ch.contentDocument).document,ci.write((c.compatMode==="CSS1Compat"?"<!doctype html>":"")+"<html><body>"),ci.close();d=ci.createElement(a),ci.body.appendChild(d),e=f.css(d,"display"),b.removeChild(ch)}cg[a]=e}return cg[a]}function cr(a,b){var c={};f.each(cm.concat.apply([],cm.slice(0,b)),function(){c[this]=a});return c}function cq(){cn=b}function cp(){setTimeout(cq,0);return cn=f.now()}function cf(){try{return new a.ActiveXObject("Microsoft.XMLHTTP")}catch(b){}}function ce(){try{return new a.XMLHttpRequest}catch(b){}}function b$(a,c){a.dataFilter&&(c=a.dataFilter(c,a.dataType));var d=a.dataTypes,e={},g,h,i=d.length,j,k=d[0],l,m,n,o,p;for(g=1;g<i;g++){if(g===1)for(h in a.converters)typeof h=="string"&&(e[h.toLowerCase()]=a.converters[h]);l=k,k=d[g];if(k==="*")k=l;else if(l!=="*"&&l!==k){m=l+" "+k,n=e[m]||e["* "+k];if(!n){p=b;for(o in e){j=o.split(" ");if(j[0]===l||j[0]==="*"){p=e[j[1]+" "+k];if(p){o=e[o],o===!0?n=p:p===!0&&(n=o);break}}}}!n&&!p&&f.error("No conversion from "+m.replace(" "," to ")),n!==!0&&(c=n?n(c):p(o(c)))}}return c}function bZ(a,c,d){var e=a.contents,f=a.dataTypes,g=a.responseFields,h,i,j,k;for(i in g)i in d&&(c[g[i]]=d[i]);while(f[0]==="*")f.shift(),h===b&&(h=a.mimeType||c.getResponseHeader("content-type"));if(h)for(i in e)if(e[i]&&e[i].test(h)){f.unshift(i);break}if(f[0]in d)j=f[0];else{for(i in d){if(!f[0]||a.converters[i+" "+f[0]]){j=i;break}k||(k=i)}j=j||k}if(j){j!==f[0]&&f.unshift(j);return d[j]}}function bY(a,b,c,d){if(f.isArray(b))f.each(b,function(b,e){c||bC.test(a)?d(a,e):bY(a+"["+(typeof e=="object"||f.isArray(e)?b:"")+"]",e,c,d)});else if(!c&&b!=null&&typeof b=="object")for(var e in b)bY(a+"["+e+"]",b[e],c,d);else d(a,b)}function bX(a,c,d,e,f,g){f=f||c.dataTypes[0],g=g||{},g[f]=!0;var h=a[f],i=0,j=h?h.length:0,k=a===bR,l;for(;i<j&&(k||!l);i++)l=h[i](c,d,e),typeof l=="string"&&(!k||g[l]?l=b:(c.dataTypes.unshift(l),l=bX(a,c,d,e,l,g)));(k||!l)&&!g["*"]&&(l=bX(a,c,d,e,"*",g));return l}function bW(a){return function(b,c){typeof b!="string"&&(c=b,b="*");if(f.isFunction(c)){var d=b.toLowerCase().split(bN),e=0,g=d.length,h,i,j;for(;e<g;e++)h=d[e],j=/^\+/.test(h),j&&(h=h.substr(1)||"*"),i=a[h]=a[h]||[],i[j?"unshift":"push"](c)}}}function bA(a,b,c){var d=b==="width"?a.offsetWidth:a.offsetHeight,e=b==="width"?bv:bw;if(d>0){c!=="border"&&f.each(e,function(){c||(d-=parseFloat(f.css(a,"padding"+this))||0),c==="margin"?d+=parseFloat(f.css(a,c+this))||0:d-=parseFloat(f.css(a,"border"+this+"Width"))||0});return d+"px"}d=bx(a,b,b);if(d<0||d==null)d=a.style[b]||0;d=parseFloat(d)||0,c&&f.each(e,function(){d+=parseFloat(f.css(a,"padding"+this))||0,c!=="padding"&&(d+=parseFloat(f.css(a,"border"+this+"Width"))||0),c==="margin"&&(d+=parseFloat(f.css(a,c+this))||0)});return d+"px"}function bm(a,b){b.src?f.ajax({url:b.src,async:!1,dataType:"script"}):f.globalEval((b.text||b.textContent||b.innerHTML||"").replace(be,"/*$0*/")),b.parentNode&&b.parentNode.removeChild(b)}function bl(a){f.nodeName(a,"input")?bk(a):"getElementsByTagName"in a&&f.grep(a.getElementsByTagName("input"),bk)}function bk(a){if(a.type==="checkbox"||a.type==="radio")a.defaultChecked=a.checked}function bj(a){return"getElementsByTagName"in a?a.getElementsByTagName("*"):"querySelectorAll"in a?a.querySelectorAll("*"):[]}function bi(a,b){var c;if(b.nodeType===1){b.clearAttributes&&b.clearAttributes(),b.mergeAttributes&&b.mergeAttributes(a),c=b.nodeName.toLowerCase();if(c==="object")b.outerHTML=a.outerHTML;else if(c!=="input"||a.type!=="checkbox"&&a.type!=="radio"){if(c==="option")b.selected=a.defaultSelected;else if(c==="input"||c==="textarea")b.defaultValue=a.defaultValue}else a.checked&&(b.defaultChecked=b.checked=a.checked),b.value!==a.value&&(b.value=a.value);b.removeAttribute(f.expando)}}function bh(a,b){if(b.nodeType===1&&!!f.hasData(a)){var c=f.expando,d=f.data(a),e=f.data(b,d);if(d=d[c]){var g=d.events;e=e[c]=f.extend({},d);if(g){delete e.handle,e.events={};for(var h in g)for(var i=0,j=g[h].length;i<j;i++)f.event.add(b,h+(g[h][i].namespace?".":"")+g[h][i].namespace,g[h][i],g[h][i].data)}}}}function bg(a,b){return f.nodeName(a,"table")?a.getElementsByTagName("tbody")[0]||a.appendChild(a.ownerDocument.createElement("tbody")):a}function W(a,b,c){b=b||0;if(f.isFunction(b))return f.grep(a,function(a,d){var e=!!b.call(a,d,a);return e===c});if(b.nodeType)return f.grep(a,function(a,d){return a===b===c});if(typeof b=="string"){var d=f.grep(a,function(a){return a.nodeType===1});if(R.test(b))return f.filter(b,d,!c);b=f.filter(b,d)}return f.grep(a,function(a,d){return f.inArray(a,b)>=0===c})}function V(a){return!a||!a.parentNode||a.parentNode.nodeType===11}function N(a,b){return(a&&a!=="*"?a+".":"")+b.replace(z,"`").replace(A,"&")}function M(a){var b,c,d,e,g,h,i,j,k,l,m,n,o,p=[],q=[],r=f._data(this,"events");if(!(a.liveFired===this||!r||!r.live||a.target.disabled||a.button&&a.type==="click")){a.namespace&&(n=new RegExp("(^|\\.)"+a.namespace.split(".").join("\\.(?:.*\\.)?")+"(\\.|$)")),a.liveFired=this;var s=r.live.slice(0);for(i=0;i<s.length;i++)g=s[i],g.origType.replace(x,"")===a.type?q.push(g.selector):s.splice(i--,1);e=f(a.target).closest(q,a.currentTarget);for(j=0,k=e.length;j<k;j++){m=e[j];for(i=0;i<s.length;i++){g=s[i];if(m.selector===g.selector&&(!n||n.test(g.namespace))&&!m.elem.disabled){h=m.elem,d=null;if(g.preType==="mouseenter"||g.preType==="mouseleave")a.type=g.preType,d=f(a.relatedTarget).closest(g.selector)[0],d&&f.contains(h,d)&&(d=h);(!d||d!==h)&&p.push({elem:h,handleObj:g,level:m.level})}}}for(j=0,k=p.length;j<k;j++){e=p[j];if(c&&e.level>c)break;a.currentTarget=e.elem,a.data=e.handleObj.data,a.handleObj=e.handleObj,o=e.handleObj.origHandler.apply(e.elem,arguments);if(o===!1||a.isPropagationStopped()){c=e.level,o===!1&&(b=!1);if(a.isImmediatePropagationStopped())break}}return b}}function K(a,c,d){var e=f.extend({},d[0]);e.type=a,e.originalEvent={},e.liveFired=b,f.event.handle.call(c,e),e.isDefaultPrevented()&&d[0].preventDefault()}function E(){return!0}function D(){return!1}function m(a,c,d){var e=c+"defer",g=c+"queue",h=c+"mark",i=f.data(a,e,b,!0);i&&(d==="queue"||!f.data(a,g,b,!0))&&(d==="mark"||!f.data(a,h,b,!0))&&setTimeout(function(){!f.data(a,g,b,!0)&&!f.data(a,h,b,!0)&&(f.removeData(a,e,!0),i.resolve())},0)}function l(a){for(var b in a)if(b!=="toJSON")return!1;return!0}function k(a,c,d){if(d===b&&a.nodeType===1){var e="data-"+c.replace(j,"$1-$2").toLowerCase();d=a.getAttribute(e);if(typeof d=="string"){try{d=d==="true"?!0:d==="false"?!1:d==="null"?null:f.isNaN(d)?i.test(d)?f.parseJSON(d):d:parseFloat(d)}catch(g){}f.data(a,c,d)}else d=b}return d}var c=a.document,d=a.navigator,e=a.location,f=function(){function J(){if(!e.isReady){try{c.documentElement.doScroll("left")}catch(a){setTimeout(J,1);return}e.ready()}}var e=function(a,b){return new e.fn.init(a,b,h)},f=a.jQuery,g=a.$,h,i=/^(?:[^<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/,j=/\S/,k=/^\s+/,l=/\s+$/,m=/\d/,n=/^<(\w+)\s*\/?>(?:<\/\1>)?$/,o=/^[\],:{}\s]*$/,p=/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,q=/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,r=/(?:^|:|,)(?:\s*\[)+/g,s=/(webkit)[ \/]([\w.]+)/,t=/(opera)(?:.*version)?[ \/]([\w.]+)/,u=/(msie) ([\w.]+)/,v=/(mozilla)(?:.*? rv:([\w.]+))?/,w=/-([a-z])/ig,x=function(a,b){return b.toUpperCase()},y=d.userAgent,z,A,B,C=Object.prototype.toString,D=Object.prototype.hasOwnProperty,E=Array.prototype.push,F=Array.prototype.slice,G=String.prototype.trim,H=Array.prototype.indexOf,I={};e.fn=e.prototype={constructor:e,init:function(a,d,f){var g,h,j,k;if(!a)return this;if(a.nodeType){this.context=this[0]=a,this.length=1;return this}if(a==="body"&&!d&&c.body){this.context=c,this[0]=c.body,this.selector=a,this.length=1;return this}if(typeof a=="string"){a.charAt(0)!=="<"||a.charAt(a.length-1)!==">"||a.length<3?g=i.exec(a):g=[null,a,null];if(g&&(g[1]||!d)){if(g[1]){d=d instanceof e?d[0]:d,k=d?d.ownerDocument||d:c,j=n.exec(a),j?e.isPlainObject(d)?(a=[c.createElement(j[1])],e.fn.attr.call(a,d,!0)):a=[k.createElement(j[1])]:(j=e.buildFragment([g[1]],[k]),a=(j.cacheable?e.clone(j.fragment):j.fragment).childNodes);return e.merge(this,a)}h=c.getElementById(g[2]);if(h&&h.parentNode){if(h.id!==g[2])return f.find(a);this.length=1,this[0]=h}this.context=c,this.selector=a;return this}return!d||d.jquery?(d||f).find(a):this.constructor(d).find(a)}if(e.isFunction(a))return f.ready(a);a.selector!==b&&(this.selector=a.selector,this.context=a.context);return e.makeArray(a,this)},selector:"",jquery:"1.6.2",length:0,size:function(){return this.length},toArray:function(){return F.call(this,0)},get:function(a){return a==null?this.toArray():a<0?this[this.length+a]:this[a]},pushStack:function(a,b,c){var d=this.constructor();e.isArray(a)?E.apply(d,a):e.merge(d,a),d.prevObject=this,d.context=this.context,b==="find"?d.selector=this.selector+(this.selector?" ":"")+c:b&&(d.selector=this.selector+"."+b+"("+c+")");return d},each:function(a,b){return e.each(this,a,b)},ready:function(a){e.bindReady(),A.done(a);return this},eq:function(a){return a===-1?this.slice(a):this.slice(a,+a+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(F.apply(this,arguments),"slice",F.call(arguments).join(","))},map:function(a){return this.pushStack(e.map(this,function(b,c){return a.call(b,c,b)}))},end:function(){return this.prevObject||this.constructor(null)},push:E,sort:[].sort,splice:[].splice},e.fn.init.prototype=e.fn,e.extend=e.fn.extend=function(){var a,c,d,f,g,h,i=arguments[0]||{},j=1,k=arguments.length,l=!1;typeof i=="boolean"&&(l=i,i=arguments[1]||{},j=2),typeof i!="object"&&!e.isFunction(i)&&(i={}),k===j&&(i=this,--j);for(;j<k;j++)if((a=arguments[j])!=null)for(c in a){d=i[c],f=a[c];if(i===f)continue;l&&f&&(e.isPlainObject(f)||(g=e.isArray(f)))?(g?(g=!1,h=d&&e.isArray(d)?d:[]):h=d&&e.isPlainObject(d)?d:{},i[c]=e.extend(l,h,f)):f!==b&&(i[c]=f)}return i},e.extend({noConflict:function(b){a.$===e&&(a.$=g),b&&a.jQuery===e&&(a.jQuery=f);return e},isReady:!1,readyWait:1,holdReady:function(a){a?e.readyWait++:e.ready(!0)},ready:function(a){if(a===!0&&!--e.readyWait||a!==!0&&!e.isReady){if(!c.body)return setTimeout(e.ready,1);e.isReady=!0;if(a!==!0&&--e.readyWait>0)return;A.resolveWith(c,[e]),e.fn.trigger&&e(c).trigger("ready").unbind("ready")}},bindReady:function(){if(!A){A=e._Deferred();if(c.readyState==="complete")return setTimeout(e.ready,1);if(c.addEventListener)c.addEventListener("DOMContentLoaded",B,!1),a.addEventListener("load",e.ready,!1);else if(c.attachEvent){c.attachEvent("onreadystatechange",B),a.attachEvent("onload",e.ready);var b=!1;try{b=a.frameElement==null}catch(d){}c.documentElement.doScroll&&b&&J()}}},isFunction:function(a){return e.type(a)==="function"},isArray:Array.isArray||function(a){return e.type(a)==="array"},isWindow:function(a){return a&&typeof a=="object"&&"setInterval"in a},isNaN:function(a){return a==null||!m.test(a)||isNaN(a)},type:function(a){return a==null?String(a):I[C.call(a)]||"object"},isPlainObject:function(a){if(!a||e.type(a)!=="object"||a.nodeType||e.isWindow(a))return!1;if(a.constructor&&!D.call(a,"constructor")&&!D.call(a.constructor.prototype,"isPrototypeOf"))return!1;var c;for(c in a);return c===b||D.call(a,c)},isEmptyObject:function(a){for(var b in a)return!1;return!0},error:function(a){throw a},parseJSON:function(b){if(typeof b!="string"||!b)return null;b=e.trim(b);if(a.JSON&&a.JSON.parse)return a.JSON.parse(b);if(o.test(b.replace(p,"@").replace(q,"]").replace(r,"")))return(new Function("return "+b))();e.error("Invalid JSON: "+b)},parseXML:function(b,c,d){a.DOMParser?(d=new DOMParser,c=d.parseFromString(b,"text/xml")):(c=new ActiveXObject("Microsoft.XMLDOM"),c.async="false",c.loadXML(b)),d=c.documentElement,(!d||!d.nodeName||d.nodeName==="parsererror")&&e.error("Invalid XML: "+b);return c},noop:function(){},globalEval:function(b){b&&j.test(b)&&(a.execScript||function(b){a.eval.call(a,b)})(b)},camelCase:function(a){return a.replace(w,x)},nodeName:function(a,b){return a.nodeName&&a.nodeName.toUpperCase()===b.toUpperCase()},each:function(a,c,d){var f,g=0,h=a.length,i=h===b||e.isFunction(a);if(d){if(i){for(f in a)if(c.apply(a[f],d)===!1)break}else for(;g<h;)if(c.apply(a[g++],d)===!1)break}else if(i){for(f in a)if(c.call(a[f],f,a[f])===!1)break}else for(;g<h;)if(c.call(a[g],g,a[g++])===!1)break;return a},trim:G?function(a){return a==null?"":G.call(a)}:function(a){return a==null?"":(a+"").replace(k,"").replace(l,"")},makeArray:function(a,b){var c=b||[];if(a!=null){var d=e.type(a);a.length==null||d==="string"||d==="function"||d==="regexp"||e.isWindow(a)?E.call(c,a):e.merge(c,a)}return c},inArray:function(a,b){if(H)return H.call(b,a);for(var c=0,d=b.length;c<d;c++)if(b[c]===a)return c;return-1},merge:function(a,c){var d=a.length,e=0;if(typeof c.length=="number")for(var f=c.length;e<f;e++)a[d++]=c[e];else while(c[e]!==b)a[d++]=c[e++];a.length=d;return a},grep:function(a,b,c){var d=[],e;c=!!c;for(var f=0,g=a.length;f<g;f++)e=!!b(a[f],f),c!==e&&d.push(a[f]);return d},map:function(a,c,d){var f,g,h=[],i=0,j=a.length,k=a instanceof e||j!==b&&typeof j=="number"&&(j>0&&a[0]&&a[j-1]||j===0||e.isArray(a));if(k)for(;i<j;i++)f=c(a[i],i,d),f!=null&&(h[h.length]=f);else for(g in a)f=c(a[g],g,d),f!=null&&(h[h.length]=f);return h.concat.apply([],h)},guid:1,proxy:function(a,c){if(typeof c=="string"){var d=a[c];c=a,a=d}if(!e.isFunction(a))return b;var f=F.call(arguments,2),g=function(){return a.apply(c,f.concat(F.call(arguments)))};g.guid=a.guid=a.guid||g.guid||e.guid++;return g},access:function(a,c,d,f,g,h){var i=a.length;if(typeof c=="object"){for(var j in c)e.access(a,j,c[j],f,g,d);return a}if(d!==b){f=!h&&f&&e.isFunction(d);for(var k=0;k<i;k++)g(a[k],c,f?d.call(a[k],k,g(a[k],c)):d,h);return a}return i?g(a[0],c):b},now:function(){return(new Date).getTime()},uaMatch:function(a){a=a.toLowerCase();var b=s.exec(a)||t.exec(a)||u.exec(a)||a.indexOf("compatible")<0&&v.exec(a)||[];return{browser:b[1]||"",version:b[2]||"0"}},sub:function(){function a(b,c){return new a.fn.init(b,c)}e.extend(!0,a,this),a.superclass=this,a.fn=a.prototype=this(),a.fn.constructor=a,a.sub=this.sub,a.fn.init=function(d,f){f&&f instanceof e&&!(f instanceof a)&&(f=a(f));return e.fn.init.call(this,d,f,b)},a.fn.init.prototype=a.fn;var b=a(c);return a},browser:{}}),e.each("Boolean Number String Function Array Date RegExp Object".split(" "),function(a,b){I["[object "+b+"]"]=b.toLowerCase()}),z=e.uaMatch(y),z.browser&&(e.browser[z.browser]=!0,e.browser.version=z.version),e.browser.webkit&&(e.browser.safari=!0),j.test(" ")&&(k=/^[\s\xA0]+/,l=/[\s\xA0]+$/),h=e(c),c.addEventListener?B=function(){c.removeEventListener("DOMContentLoaded",B,!1),e.ready()}:c.attachEvent&&(B=function(){c.readyState==="complete"&&(c.detachEvent("onreadystatechange",B),e.ready())});return e}(),g="done fail isResolved isRejected promise then always pipe".split(" "),h=[].slice;f.extend({_Deferred:function(){var a=[],b,c,d,e={done:function(){if(!d){var c=arguments,g,h,i,j,k;b&&(k=b,b=0);for(g=0,h=c.length;g<h;g++)i=c[g],j=f.type(i),j==="array"?e.done.apply(e,i):j==="function"&&a.push(i);k&&e.resolveWith(k[0],k[1])}return this},resolveWith:function(e,f){if(!d&&!b&&!c){f=f||[],c=1;try{while(a[0])a.shift().apply(e,f)}finally{b=[e,f],c=0}}return this},resolve:function(){e.resolveWith(this,arguments);return this},isResolved:function(){return!!c||!!b},cancel:function(){d=1,a=[];return this}};return e},Deferred:function(a){var b=f._Deferred(),c=f._Deferred(),d;f.extend(b,{then:function(a,c){b.done(a).fail(c);return this},always:function(){return b.done.apply(b,arguments).fail.apply(this,arguments)},fail:c.done,rejectWith:c.resolveWith,reject:c.resolve,isRejected:c.isResolved,pipe:function(a,c){return f.Deferred(function(d){f.each({done:[a,"resolve"],fail:[c,"reject"]},function(a,c){var e=c[0],g=c[1],h;f.isFunction(e)?b[a](function(){h=e.apply(this,arguments),h&&f.isFunction(h.promise)?h.promise().then(d.resolve,d.reject):d[g](h)}):b[a](d[g])})}).promise()},promise:function(a){if(a==null){if(d)return d;d=a={}}var c=g.length;while(c--)a[g[c]]=b[g[c]];return a}}),b.done(c.cancel).fail(b.cancel),delete b.cancel,a&&a.call(b,b);return b},when:function(a){function i(a){return function(c){b[a]=arguments.length>1?h.call(arguments,0):c,--e||g.resolveWith(g,h.call(b,0))}}var b=arguments,c=0,d=b.length,e=d,g=d<=1&&a&&f.isFunction(a.promise)?a:f.Deferred();if(d>1){for(;c<d;c++)b[c]&&f.isFunction(b[c].promise)?b[c].promise().then(i(c),g.reject):--e;e||g.resolveWith(g,b)}else g!==a&&g.resolveWith(g,d?[a]:[]);return g.promise()}}),f.support=function(){var a=c.createElement("div"),b=c.documentElement,d,e,g,h,i,j,k,l,m,n,o,p,q,r,s,t,u;a.setAttribute("className","t"),a.innerHTML=" <link/><table></table><a href='/a' style='top:1px;float:left;opacity:.55;'>a</a><input type='checkbox'/>",d=a.getElementsByTagName("*"),e=a.getElementsByTagName("a")[0];if(!d||!d.length||!e)return{};g=c.createElement("select"),h=g.appendChild(c.createElement("option")),i=a.getElementsByTagName("input")[0],k={leadingWhitespace:a.firstChild.nodeType===3,tbody:!a.getElementsByTagName("tbody").length,htmlSerialize:!!a.getElementsByTagName("link").length,style:/top/.test(e.getAttribute("style")),hrefNormalized:e.getAttribute("href")==="/a",opacity:/^0.55$/.test(e.style.opacity),cssFloat:!!e.style.cssFloat,checkOn:i.value==="on",optSelected:h.selected,getSetAttribute:a.className!=="t",submitBubbles:!0,changeBubbles:!0,focusinBubbles:!1,deleteExpando:!0,noCloneEvent:!0,inlineBlockNeedsLayout:!1,shrinkWrapBlocks:!1,reliableMarginRight:!0},i.checked=!0,k.noCloneChecked=i.cloneNode(!0).checked,g.disabled=!0,k.optDisabled=!h.disabled;try{delete a.test}catch(v){k.deleteExpando=!1}!a.addEventListener&&a.attachEvent&&a.fireEvent&&(a.attachEvent("onclick",function(){k.noCloneEvent=!1}),a.cloneNode(!0).fireEvent("onclick")),i=c.createElement("input"),i.value="t",i.setAttribute("type","radio"),k.radioValue=i.value==="t",i.setAttribute("checked","checked"),a.appendChild(i),l=c.createDocumentFragment(),l.appendChild(a.firstChild),k.checkClone=l.cloneNode(!0).cloneNode(!0).lastChild.checked,a.innerHTML="",a.style.width=a.style.paddingLeft="1px",m=c.getElementsByTagName("body")[0],o=c.createElement(m?"div":"body"),p={visibility:"hidden",width:0,height:0,border:0,margin:0},m&&f.extend(p,{position:"absolute",left:-1e3,top:-1e3});for(t in p)o.style[t]=p[t];o.appendChild(a),n=m||b,n.insertBefore(o,n.firstChild),k.appendChecked=i.checked,k.boxModel=a.offsetWidth===2,"zoom"in a.style&&(a.style.display="inline",a.style.zoom=1,k.inlineBlockNeedsLayout=a.offsetWidth===2,a.style.display="",a.innerHTML="<div style='width:4px;'></div>",k.shrinkWrapBlocks=a.offsetWidth!==2),a.innerHTML="<table><tr><td style='padding:0;border:0;display:none'></td><td>t</td></tr></table>",q=a.getElementsByTagName("td"),u=q[0].offsetHeight===0,q[0].style.display="",q[1].style.display="none",k.reliableHiddenOffsets=u&&q[0].offsetHeight===0,a.innerHTML="",c.defaultView&&c.defaultView.getComputedStyle&&(j=c.createElement("div"),j.style.width="0",j.style.marginRight="0",a.appendChild(j),k.reliableMarginRight=(parseInt((c.defaultView.getComputedStyle(j,null)||{marginRight:0}).marginRight,10)||0)===0),o.innerHTML="",n.removeChild(o);if(a.attachEvent)for(t in{submit:1,change:1,focusin:1})s="on"+t,u=s in a,u||(a.setAttribute(s,"return;"),u=typeof a[s]=="function"),k[t+"Bubbles"]=u;o=l=g=h=m=j=a=i=null;return k}(),f.boxModel=f.support.boxModel;var i=/^(?:\{.*\}|\[.*\])$/,j=/([a-z])([A-Z])/g;f.extend({cache:{},uuid:0,expando:"jQuery"+(f.fn.jquery+Math.random()).replace(/\D/g,""),noData:{embed:!0,object:"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",applet:!0},hasData:function(a){a=a.nodeType?f.cache[a[f.expando]]:a[f.expando];return!!a&&!l(a)},data:function(a,c,d,e){if(!!f.acceptData(a)){var g=f.expando,h=typeof c=="string",i,j=a.nodeType,k=j?f.cache:a,l=j?a[f.expando]:a[f.expando]&&f.expando;if((!l||e&&l&&!k[l][g])&&h&&d===b)return;l||(j?a[f.expando]=l=++f.uuid:l=f.expando),k[l]||(k[l]={},j||(k[l].toJSON=f.noop));if(typeof c=="object"||typeof c=="function")e?k[l][g]=f.extend(k[l][g],c):k[l]=f.extend(k[l],c);i=k[l],e&&(i[g]||(i[g]={}),i=i[g]),d!==b&&(i[f.camelCase(c)]=d);if(c==="events"&&!i[c])return i[g]&&i[g].events;return h?i[f.camelCase(c)]||i[c]:i}},removeData:function(b,c,d){if(!!f.acceptData(b)){var e=f.expando,g=b.nodeType,h=g?f.cache:b,i=g?b[f.expando]:f.expando;if(!h[i])return;if(c){var j=d?h[i][e]:h[i];if(j){delete j[c];if(!l(j))return}}if(d){delete h[i][e];if(!l(h[i]))return}var k=h[i][e];f.support.deleteExpando||h!=a?delete h[i]:h[i]=null,k?(h[i]={},g||(h[i].toJSON=f.noop),h[i][e]=k):g&&(f.support.deleteExpando?delete b[f.expando]:b.removeAttribute?b.removeAttribute(f.expando):b[f.expando]=null)}},_data:function(a,b,c){return f.data(a,b,c,!0)},acceptData:function(a){if(a.nodeName){var b=f.noData[a.nodeName.toLowerCase()];if(b)return b!==!0&&a.getAttribute("classid")===b}return!0}}),f.fn.extend({data:function(a,c){var d=null;if(typeof a=="undefined"){if(this.length){d=f.data(this[0]);if(this[0].nodeType===1){var e=this[0].attributes,g;for(var h=0,i=e.length;h<i;h++)g=e[h].name,g.indexOf("data-")===0&&(g=f.camelCase(g.substring(5)),k(this[0],g,d[g]))}}return d}if(typeof a=="object")return this.each(function(){f.data(this,a)});var j=a.split(".");j[1]=j[1]?"."+j[1]:"";if(c===b){d=this.triggerHandler("getData"+j[1]+"!",[j[0]]),d===b&&this.length&&(d=f.data(this[0],a),d=k(this[0],a,d));return d===b&&j[1]?this.data(j[0]):d}return this.each(function(){var b=f(this),d=[j[0],c];b.triggerHandler("setData"+j[1]+"!",d),f.data(this,a,c),b.triggerHandler("changeData"+j[1]+"!",d)})},removeData:function(a){return this.each(function(){f.removeData(this,a)})}}),f.extend({_mark:function(a,c){a&&(c=(c||"fx")+"mark",f.data(a,c,(f.data(a,c,b,!0)||0)+1,!0))},_unmark:function(a,c,d){a!==!0&&(d=c,c=a,a=!1);if(c){d=d||"fx";var e=d+"mark",g=a?0:(f.data(c,e,b,!0)||1)-1;g?f.data(c,e,g,!0):(f.removeData(c,e,!0),m(c,d,"mark"))}},queue:function(a,c,d){if(a){c=(c||"fx")+"queue";var e=f.data(a,c,b,!0);d&&(!e||f.isArray(d)?e=f.data(a,c,f.makeArray(d),!0):e.push(d));return e||[]}},dequeue:function(a,b){b=b||"fx";var c=f.queue(a,b),d=c.shift(),e;d==="inprogress"&&(d=c.shift()),d&&(b==="fx"&&c.unshift("inprogress"),d.call(a,function(){f.dequeue(a,b)})),c.length||(f.removeData(a,b+"queue",!0),m(a,b,"queue"))}}),f.fn.extend({queue:function(a,c){typeof a!="string"&&(c=a,a="fx");if(c===b)return f.queue(this[0],a);return this.each(function(){var b=f.queue(this,a,c);a==="fx"&&b[0]!=="inprogress"&&f.dequeue(this,a)})},dequeue:function(a){return this.each(function(){f.dequeue(this,a)})},delay:function(a,b){a=f.fx?f.fx.speeds[a]||a:a,b=b||"fx";return this.queue(b,function(){var c=this;setTimeout(function(){f.dequeue(c,b)},a)})},clearQueue:function(a){return this.queue(a||"fx",[])},promise:function(a,c){function m(){--h||d.resolveWith(e,[e])}typeof a!="string"&&(c=a,a=b),a=a||"fx";var d=f.Deferred(),e=this,g=e.length,h=1,i=a+"defer",j=a+"queue",k=a+"mark",l;while(g--)if(l=f.data(e[g],i,b,!0)||(f.data(e[g],j,b,!0)||f.data(e[g],k,b,!0))&&f.data(e[g],i,f._Deferred(),!0))h++,l.done(m);m();return d.promise()}});var n=/[\n\t\r]/g,o=/\s+/,p=/\r/g,q=/^(?:button|input)$/i,r=/^(?:button|input|object|select|textarea)$/i,s=/^a(?:rea)?$/i,t=/^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i,u=/\:|^on/,v,w;f.fn.extend({attr:function(a,b){return f.access(this,a,b,!0,f.attr)},removeAttr:function(a){return this.each(function(){f.removeAttr(this,a)})},prop:function(a,b){return f.access(this,a,b,!0,f.prop)},removeProp:function(a){a=f.propFix[a]||a;return this.each(function(){try{this[a]=b,delete this[a]}catch(c){}})},addClass:function(a){var b,c,d,e,g,h,i;if(f.isFunction(a))return this.each(function(b){f(this).addClass(a.call(this,b,this.className))});if(a&&typeof a=="string"){b=a.split(o);for(c=0,d=this.length;c<d;c++){e=this[c];if(e.nodeType===1)if(!e.className&&b.length===1)e.className=a;else{g=" "+e.className+" ";for(h=0,i=b.length;h<i;h++)~g.indexOf(" "+b[h]+" ")||(g+=b[h]+" ");e.className=f.trim(g)}}}return this},removeClass:function(a){var c,d,e,g,h,i,j;if(f.isFunction(a))return this.each(function(b){f(this).removeClass(a.call(this,b,this.className))});if(a&&typeof a=="string"||a===b){c=(a||"").split(o);for(d=0,e=this.length;d<e;d++){g=this[d];if(g.nodeType===1&&g.className)if(a){h=(" "+g.className+" ").replace(n," ");for(i=0,j=c.length;i<j;i++)h=h.replace(" "+c[i]+" "," ");g.className=f.trim(h)}else g.className=""}}return this},toggleClass:function(a,b){var c=typeof a,d=typeof b=="boolean";if(f.isFunction(a))return this.each(function(c){f(this).toggleClass(a.call(this,c,this.className,b),b)});return this.each(function(){if(c==="string"){var e,g=0,h=f(this),i=b,j=a.split(o);while(e=j[g++])i=d?i:!h.hasClass(e),h[i?"addClass":"removeClass"](e)}else if(c==="undefined"||c==="boolean")this.className&&f._data(this,"__className__",this.className),this.className=this.className||a===!1?"":f._data(this,"__className__")||""})},hasClass:function(a){var b=" "+a+" ";for(var c=0,d=this.length;c<d;c++)if((" "+this[c].className+" ").replace(n," ").indexOf(b)>-1)return!0;return!1},val:function(a){var c,d,e=this[0];if(!arguments.length){if(e){c=f.valHooks[e.nodeName.toLowerCase()]||f.valHooks[e.type];if(c&&"get"in c&&(d=c.get(e,"value"))!==b)return d;d=e.value;return typeof d=="string"?d.replace(p,""):d==null?"":d}return b}var g=f.isFunction(a);return this.each(function(d){var e=f(this),h;if(this.nodeType===1){g?h=a.call(this,d,e.val()):h=a,h==null?h="":typeof h=="number"?h+="":f.isArray(h)&&(h=f.map(h,function(a){return a==null?"":a+""})),c=f.valHooks[this.nodeName.toLowerCase()]||f.valHooks[this.type];if(!c||!("set"in c)||c.set(this,h,"value")===b)this.value=h}})}}),f.extend({valHooks:{option:{get:function(a){var b=a.attributes.value;return!b||b.specified?a.value:a.text}},select:{get:function(a){var b,c=a.selectedIndex,d=[],e=a.options,g=a.type==="select-one";if(c<0)return null;for(var h=g?c:0,i=g?c+1:e.length;h<i;h++){var j=e[h];if(j.selected&&(f.support.optDisabled?!j.disabled:j.getAttribute("disabled")===null)&&(!j.parentNode.disabled||!f.nodeName(j.parentNode,"optgroup"))){b=f(j).val();if(g)return b;d.push(b)}}if(g&&!d.length&&e.length)return f(e[c]).val();return d},set:function(a,b){var c=f.makeArray(b);f(a).find("option").each(function(){this.selected=f.inArray(f(this).val(),c)>=0}),c.length||(a.selectedIndex=-1);return c}}},attrFn:{val:!0,css:!0,html:!0,text:!0,data:!0,width:!0,height:!0,offset:!0},attrFix:{tabindex:"tabIndex"},attr:function(a,c,d,e){var g=a.nodeType;if(!a||g===3||g===8||g===2)return b;if(e&&c in f.attrFn)return f(a)[c](d);if(!("getAttribute"in a))return f.prop(a,c,d);var h,i,j=g!==1||!f.isXMLDoc(a);j&&(c=f.attrFix[c]||c,i=f.attrHooks[c],i||(t.test(c)?i=w:v&&c!=="className"&&(f.nodeName(a,"form")||u.test(c))&&(i=v)));if(d!==b){if(d===null){f.removeAttr(a,c);return b}if(i&&"set"in i&&j&&(h=i.set(a,d,c))!==b)return h;a.setAttribute(c,""+d);return d}if(i&&"get"in i&&j&&(h=i.get(a,c))!==null)return h;h=a.getAttribute(c);return h===null?b:h},removeAttr:function(a,b){var c;a.nodeType===1&&(b=f.attrFix[b]||b,f.support.getSetAttribute?a.removeAttribute(b):(f.attr(a,b,""),a.removeAttributeNode(a.getAttributeNode(b))),t.test(b)&&(c=f.propFix[b]||b)in a&&(a[c]=!1))},attrHooks:{type:{set:function(a,b){if(q.test(a.nodeName)&&a.parentNode)f.error("type property can't be changed");else if(!f.support.radioValue&&b==="radio"&&f.nodeName(a,"input")){var c=a.value;a.setAttribute("type",b),c&&(a.value=c);return b}}},tabIndex:{get:function(a){var c=a.getAttributeNode("tabIndex");return c&&c.specified?parseInt(c.value,10):r.test(a.nodeName)||s.test(a.nodeName)&&a.href?0:b}},value:{get:function(a,b){if(v&&f.nodeName(a,"button"))return v.get(a,b);return b in a?a.value:null},set:function(a,b,c){if(v&&f.nodeName(a,"button"))return v.set(a,b,c);a.value=b}}},propFix:{tabindex:"tabIndex",readonly:"readOnly","for":"htmlFor","class":"className",maxlength:"maxLength",cellspacing:"cellSpacing",cellpadding:"cellPadding",rowspan:"rowSpan",colspan:"colSpan",usemap:"useMap",frameborder:"frameBorder",contenteditable:"contentEditable"},prop:function(a,c,d){var e=a.nodeType;if(!a||e===3||e===8||e===2)return b;var g,h,i=e!==1||!f.isXMLDoc(a);i&&(c=f.propFix[c]||c,h=f.propHooks[c]);return d!==b?h&&"set"in h&&(g=h.set(a,d,c))!==b?g:a[c]=d:h&&"get"in h&&(g=h.get(a,c))!==b?g:a[c]},propHooks:{}}),w={get:function(a,c){return f.prop(a,c)?c.toLowerCase():b},set:function(a,b,c){var d;b===!1?f.removeAttr(a,c):(d=f.propFix[c]||c,d in a&&(a[d]=!0),a.setAttribute(c,c.toLowerCase()));return c}},f.support.getSetAttribute||(f.attrFix=f.propFix,v=f.attrHooks.name=f.attrHooks.title=f.valHooks.button={get:function(a,c){var d;d=a.getAttributeNode(c);return d&&d.nodeValue!==""?d.nodeValue:b},set:function(a,b,c){var d=a.getAttributeNode(c);if(d){d.nodeValue=b;return b}}},f.each(["width","height"],function(a,b){f.attrHooks[b]=f.extend(f.attrHooks[b],{set:function(a,c){if(c===""){a.setAttribute(b,"auto");return c}}})})),f.support.hrefNormalized||f.each(["href","src","width","height"],function(a,c){f.attrHooks[c]=f.extend(f.attrHooks[c],{get:function(a){var d=a.getAttribute(c,2);return d===null?b:d}})}),f.support.style||(f.attrHooks.style={get:function(a){return a.style.cssText.toLowerCase()||b},set:function(a,b){return a.style.cssText=""+b}}),f.support.optSelected||(f.propHooks.selected=f.extend(f.propHooks.selected,{get:function(a){var b=a.parentNode;b&&(b.selectedIndex,b.parentNode&&b.parentNode.selectedIndex)}})),f.support.checkOn||f.each(["radio","checkbox"],function(){f.valHooks[this]={get:function(a){return a.getAttribute("value")===null?"on":a.value}}}),f.each(["radio","checkbox"],function(){f.valHooks[this]=f.extend(f.valHooks[this],{set:function(a,b){if(f.isArray(b))return a.checked=f.inArray(f(a).val(),b)>=0}})});var x=/\.(.*)$/,y=/^(?:textarea|input|select)$/i,z=/\./g,A=/ /g,B=/[^\w\s.|`]/g,C=function(a){return a.replace(B,"\\$&")};f.event={add:function(a,c,d,e){if(a.nodeType!==3&&a.nodeType!==8){if(d===!1)d=D;else if(!d)return;var g,h;d.handler&&(g=d,d=g.handler),d.guid||(d.guid=f.guid++);var i=f._data(a);if(!i)return;var j=i.events,k=i.handle;j||(i.events=j={}),k||(i.handle=k=function(a){return typeof f!="undefined"&&(!a||f.event.triggered!==a.type)?f.event.handle.apply(k.elem,arguments):b}),k.elem=a,c=c.split(" ");var l,m=0,n;while(l=c[m++]){h=g?f.extend({},g):{handler:d,data:e},l.indexOf(".")>-1?(n=l.split("."),l=n.shift(),h.namespace=n.slice(0).sort().join(".")):(n=[],h.namespace=""),h.type=l,h.guid||(h.guid=d.guid);var o=j[l],p=f.event.special[l]||{};if(!o){o=j[l]=[];if(!p.setup||p.setup.call(a,e,n,k)===!1)a.addEventListener?a.addEventListener(l,k,!1):a.attachEvent&&a.attachEvent("on"+l,k)}p.add&&(p.add.call(a,h),h.handler.guid||(h.handler.guid=d.guid)),o.push(h),f.event.global[l]=!0}a=null}},global:{},remove:function(a,c,d,e){if(a.nodeType!==3&&a.nodeType!==8){d===!1&&(d=D);var g,h,i,j,k=0,l,m,n,o,p,q,r,s=f.hasData(a)&&f._data(a),t=s&&s.events;if(!s||!t)return;c&&c.type&&(d=c.handler,c=c.type);if(!c||typeof c=="string"&&c.charAt(0)==="."){c=c||"";for(h in t)f.event.remove(a,h+c);return}c=c.split(" ");while(h=c[k++]){r=h,q=null,l=h.indexOf(".")<0,m=[],l||(m=h.split("."),h=m.shift(),n=new RegExp("(^|\\.)"+f.map(m.slice(0).sort(),C).join("\\.(?:.*\\.)?")+"(\\.|$)")),p=t[h];if(!p)continue;if(!d){for(j=0;j<p.length;j++){q=p[j];if(l||n.test(q.namespace))f.event.remove(a,r,q.handler,j),p.splice(j--,1)}continue}o=f.event.special[h]||{};for(j=e||0;j<p.length;j++){q=p[j];if(d.guid===q.guid){if(l||n.test(q.namespace))e==null&&p.splice(j--,1),o.remove&&o.remove.call(a,q);if(e!=null)break}}if(p.length===0||e!=null&&p.length===1)(!o.teardown||o.teardown.call(a,m)===!1)&&f.removeEvent(a,h,s.handle),g=null,delete t[h]}if(f.isEmptyObject(t)){var u=s.handle;u&&(u.elem=null),delete s.events,delete s.handle,f.isEmptyObject(s)&&f.removeData(a,b,!0)}}},customEvent:{getData:!0,setData:!0,changeData:!0},trigger:function(c,d,e,g){var h=c.type||c,i=[],j;h.indexOf("!")>=0&&(h=h.slice(0,-1),j=!0),h.indexOf(".")>=0&&(i=h.split("."),h=i. | |
| shift(),i.sort());if(!!e&&!f.event.customEvent[h]||!!f.event.global[h]){c=typeof c=="object"?c[f.expando]?c:new f.Event(h,c):new f.Event(h),c.type=h,c.exclusive=j,c.namespace=i.join("."),c.namespace_re=new RegExp("(^|\\.)"+i.join("\\.(?:.*\\.)?")+"(\\.|$)");if(g||!e)c.preventDefault(),c.stopPropagation();if(!e){f.each(f.cache,function(){var a=f.expando,b=this[a];b&&b.events&&b.events[h]&&f.event.trigger(c,d,b.handle.elem)});return}if(e.nodeType===3||e.nodeType===8)return;c.result=b,c.target=e,d=d!=null?f.makeArray(d):[],d.unshift(c);var k=e,l=h.indexOf(":")<0?"on"+h:"";do{var m=f._data(k,"handle");c.currentTarget=k,m&&m.apply(k,d),l&&f.acceptData(k)&&k[l]&&k[l].apply(k,d)===!1&&(c.result=!1,c.preventDefault()),k=k.parentNode||k.ownerDocument||k===c.target.ownerDocument&&a}while(k&&!c.isPropagationStopped());if(!c.isDefaultPrevented()){var n,o=f.event.special[h]||{};if((!o._default||o._default.call(e.ownerDocument,c)===!1)&&(h!=="click"||!f.nodeName(e,"a"))&&f.acceptData(e)){try{l&&e[h]&&(n=e[l],n&&(e[l]=null),f.event.triggered=h,e[h]())}catch(p){}n&&(e[l]=n),f.event.triggered=b}}return c.result}},handle:function(c){c=f.event.fix(c||a.event);var d=((f._data(this,"events")||{})[c.type]||[]).slice(0),e=!c.exclusive&&!c.namespace,g=Array.prototype.slice.call(arguments,0);g[0]=c,c.currentTarget=this;for(var h=0,i=d.length;h<i;h++){var j=d[h];if(e||c.namespace_re.test(j.namespace)){c.handler=j.handler,c.data=j.data,c.handleObj=j;var k=j.handler.apply(this,g);k!==b&&(c.result=k,k===!1&&(c.preventDefault(),c.stopPropagation()));if(c.isImmediatePropagationStopped())break}}return c.result},props:"altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode layerX layerY metaKey newValue offsetX offsetY pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "),fix:function(a){if(a[f.expando])return a;var d=a;a=f.Event(d);for(var e=this.props.length,g;e;)g=this.props[--e],a[g]=d[g];a.target||(a.target=a.srcElement||c),a.target.nodeType===3&&(a.target=a.target.parentNode),!a.relatedTarget&&a.fromElement&&(a.relatedTarget=a.fromElement===a.target?a.toElement:a.fromElement);if(a.pageX==null&&a.clientX!=null){var h=a.target.ownerDocument||c,i=h.documentElement,j=h.body;a.pageX=a.clientX+(i&&i.scrollLeft||j&&j.scrollLeft||0)-(i&&i.clientLeft||j&&j.clientLeft||0),a.pageY=a.clientY+(i&&i.scrollTop||j&&j.scrollTop||0)-(i&&i.clientTop||j&&j.clientTop||0)}a.which==null&&(a.charCode!=null||a.keyCode!=null)&&(a.which=a.charCode!=null?a.charCode:a.keyCode),!a.metaKey&&a.ctrlKey&&(a.metaKey=a.ctrlKey),!a.which&&a.button!==b&&(a.which=a.button&1?1:a.button&2?3:a.button&4?2:0);return a},guid:1e8,proxy:f.proxy,special:{ready:{setup:f.bindReady,teardown:f.noop},live:{add:function(a){f.event.add(this,N(a.origType,a.selector),f.extend({},a,{handler:M,guid:a.handler.guid}))},remove:function(a){f.event.remove(this,N(a.origType,a.selector),a)}},beforeunload:{setup:function(a,b,c){f.isWindow(this)&&(this.onbeforeunload=c)},teardown:function(a,b){this.onbeforeunload===b&&(this.onbeforeunload=null)}}}},f.removeEvent=c.removeEventListener?function(a,b,c){a.removeEventListener&&a.removeEventListener(b,c,!1)}:function(a,b,c){a.detachEvent&&a.detachEvent("on"+b,c)},f.Event=function(a,b){if(!this.preventDefault)return new f.Event(a,b);a&&a.type?(this.originalEvent=a,this.type=a.type,this.isDefaultPrevented=a.defaultPrevented||a.returnValue===!1||a.getPreventDefault&&a.getPreventDefault()?E:D):this.type=a,b&&f.extend(this,b),this.timeStamp=f.now(),this[f.expando]=!0},f.Event.prototype={preventDefault:function(){this.isDefaultPrevented=E;var a=this.originalEvent;!a||(a.preventDefault?a.preventDefault():a.returnValue=!1)},stopPropagation:function(){this.isPropagationStopped=E;var a=this.originalEvent;!a||(a.stopPropagation&&a.stopPropagation(),a.cancelBubble=!0)},stopImmediatePropagation:function(){this.isImmediatePropagationStopped=E,this.stopPropagation()},isDefaultPrevented:D,isPropagationStopped:D,isImmediatePropagationStopped:D};var F=function(a){var b=a.relatedTarget,c=!1,d=a.type;a.type=a.data,b!==this&&(b&&(c=f.contains(this,b)),c||(f.event.handle.apply(this,arguments),a.type=d))},G=function(a){a.type=a.data,f.event.handle.apply(this,arguments)};f.each({mouseenter:"mouseover",mouseleave:"mouseout"},function(a,b){f.event.special[a]={setup:function(c){f.event.add(this,b,c&&c.selector?G:F,a)},teardown:function(a){f.event.remove(this,b,a&&a.selector?G:F)}}}),f.support.submitBubbles||(f.event.special.submit={setup:function(a,b){if(!f.nodeName(this,"form"))f.event.add(this,"click.specialSubmit",function(a){var b=a.target,c=b.type;(c==="submit"||c==="image")&&f(b).closest("form").length&&K("submit",this,arguments)}),f.event.add(this,"keypress.specialSubmit",function(a){var b=a.target,c=b.type;(c==="text"||c==="password")&&f(b).closest("form").length&&a.keyCode===13&&K("submit",this,arguments)});else return!1},teardown:function(a){f.event.remove(this,".specialSubmit")}});if(!f.support.changeBubbles){var H,I=function(a){var b=a.type,c=a.value;b==="radio"||b==="checkbox"?c=a.checked:b==="select-multiple"?c=a.selectedIndex>-1?f.map(a.options,function(a){return a.selected}).join("-"):"":f.nodeName(a,"select")&&(c=a.selectedIndex);return c},J=function(c){var d=c.target,e,g;if(!!y.test(d.nodeName)&&!d.readOnly){e=f._data(d,"_change_data"),g=I(d),(c.type!=="focusout"||d.type!=="radio")&&f._data(d,"_change_data",g);if(e===b||g===e)return;if(e!=null||g)c.type="change",c.liveFired=b,f.event.trigger(c,arguments[1],d)}};f.event.special.change={filters:{focusout:J,beforedeactivate:J,click:function(a){var b=a.target,c=f.nodeName(b,"input")?b.type:"";(c==="radio"||c==="checkbox"||f.nodeName(b,"select"))&&J.call(this,a)},keydown:function(a){var b=a.target,c=f.nodeName(b,"input")?b.type:"";(a.keyCode===13&&!f.nodeName(b,"textarea")||a.keyCode===32&&(c==="checkbox"||c==="radio")||c==="select-multiple")&&J.call(this,a)},beforeactivate:function(a){var b=a.target;f._data(b,"_change_data",I(b))}},setup:function(a,b){if(this.type==="file")return!1;for(var c in H)f.event.add(this,c+".specialChange",H[c]);return y.test(this.nodeName)},teardown:function(a){f.event.remove(this,".specialChange");return y.test(this.nodeName)}},H=f.event.special.change.filters,H.focus=H.beforeactivate}f.support.focusinBubbles||f.each({focus:"focusin",blur:"focusout"},function(a,b){function e(a){var c=f.event.fix(a);c.type=b,c.originalEvent={},f.event.trigger(c,null,c.target),c.isDefaultPrevented()&&a.preventDefault()}var d=0;f.event.special[b]={setup:function(){d++===0&&c.addEventListener(a,e,!0)},teardown:function(){--d===0&&c.removeEventListener(a,e,!0)}}}),f.each(["bind","one"],function(a,c){f.fn[c]=function(a,d,e){var g;if(typeof a=="object"){for(var h in a)this[c](h,d,a[h],e);return this}if(arguments.length===2||d===!1)e=d,d=b;c==="one"?(g=function(a){f(this).unbind(a,g);return e.apply(this,arguments)},g.guid=e.guid||f.guid++):g=e;if(a==="unload"&&c!=="one")this.one(a,d,e);else for(var i=0,j=this.length;i<j;i++)f.event.add(this[i],a,g,d);return this}}),f.fn.extend({unbind:function(a,b){if(typeof a=="object"&&!a.preventDefault)for(var c in a)this.unbind(c,a[c]);else for(var d=0,e=this.length;d<e;d++)f.event.remove(this[d],a,b);return this},delegate:function(a,b,c,d){return this.live(b,c,d,a)},undelegate:function(a,b,c){return arguments.length===0?this.unbind("live"):this.die(b,null,c,a)},trigger:function(a,b){return this.each(function(){f.event.trigger(a,b,this)})},triggerHandler:function(a,b){if(this[0])return f.event.trigger(a,b,this[0],!0)},toggle:function(a){var b=arguments,c=a.guid||f.guid++,d=0,e=function(c){var e=(f.data(this,"lastToggle"+a.guid)||0)%d;f.data(this,"lastToggle"+a.guid,e+1),c.preventDefault();return b[e].apply(this,arguments)||!1};e.guid=c;while(d<b.length)b[d++].guid=c;return this.click(e)},hover:function(a,b){return this.mouseenter(a).mouseleave(b||a)}});var L={focus:"focusin",blur:"focusout",mouseenter:"mouseover",mouseleave:"mouseout"};f.each(["live","die"],function(a,c){f.fn[c]=function(a,d,e,g){var h,i=0,j,k,l,m=g||this.selector,n=g?this:f(this.context);if(typeof a=="object"&&!a.preventDefault){for(var o in a)n[c](o,d,a[o],m);return this}if(c==="die"&&!a&&g&&g.charAt(0)==="."){n.unbind(g);return this}if(d===!1||f.isFunction(d))e=d||D,d=b;a=(a||"").split(" ");while((h=a[i++])!=null){j=x.exec(h),k="",j&&(k=j[0],h=h.replace(x,""));if(h==="hover"){a.push("mouseenter"+k,"mouseleave"+k);continue}l=h,L[h]?(a.push(L[h]+k),h=h+k):h=(L[h]||h)+k;if(c==="live")for(var p=0,q=n.length;p<q;p++)f.event.add(n[p],"live."+N(h,m),{data:d,selector:m,handler:e,origType:h,origHandler:e,preType:l});else n.unbind("live."+N(h,m),e)}return this}}),f.each("blur focus focusin focusout load resize scroll unload click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup error".split(" "),function(a,b){f.fn[b]=function(a,c){c==null&&(c=a,a=null);return arguments.length>0?this.bind(b,a,c):this.trigger(b)},f.attrFn&&(f.attrFn[b]=!0)}),function(){function u(a,b,c,d,e,f){for(var g=0,h=d.length;g<h;g++){var i=d[g];if(i){var j=!1;i=i[a];while(i){if(i.sizcache===c){j=d[i.sizset];break}if(i.nodeType===1){f||(i.sizcache=c,i.sizset=g);if(typeof b!="string"){if(i===b){j=!0;break}}else if(k.filter(b,[i]).length>0){j=i;break}}i=i[a]}d[g]=j}}}function t(a,b,c,d,e,f){for(var g=0,h=d.length;g<h;g++){var i=d[g];if(i){var j=!1;i=i[a];while(i){if(i.sizcache===c){j=d[i.sizset];break}i.nodeType===1&&!f&&(i.sizcache=c,i.sizset=g);if(i.nodeName.toLowerCase()===b){j=i;break}i=i[a]}d[g]=j}}}var a=/((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,d=0,e=Object.prototype.toString,g=!1,h=!0,i=/\\/g,j=/\W/;[0,0].sort(function(){h=!1;return 0});var k=function(b,d,f,g){f=f||[],d=d||c;var h=d;if(d.nodeType!==1&&d.nodeType!==9)return[];if(!b||typeof b!="string")return f;var i,j,n,o,q,r,s,t,u=!0,w=k.isXML(d),x=[],y=b;do{a.exec(""),i=a.exec(y);if(i){y=i[3],x.push(i[1]);if(i[2]){o=i[3];break}}}while(i);if(x.length>1&&m.exec(b))if(x.length===2&&l.relative[x[0]])j=v(x[0]+x[1],d);else{j=l.relative[x[0]]?[d]:k(x.shift(),d);while(x.length)b=x.shift(),l.relative[b]&&(b+=x.shift()),j=v(b,j)}else{!g&&x.length>1&&d.nodeType===9&&!w&&l.match.ID.test(x[0])&&!l.match.ID.test(x[x.length-1])&&(q=k.find(x.shift(),d,w),d=q.expr?k.filter(q.expr,q.set)[0]:q.set[0]);if(d){q=g?{expr:x.pop(),set:p(g)}:k.find(x.pop(),x.length===1&&(x[0]==="~"||x[0]==="+")&&d.parentNode?d.parentNode:d,w),j=q.expr?k.filter(q.expr,q.set):q.set,x.length>0?n=p(j):u=!1;while(x.length)r=x.pop(),s=r,l.relative[r]?s=x.pop():r="",s==null&&(s=d),l.relative[r](n,s,w)}else n=x=[]}n||(n=j),n||k.error(r||b);if(e.call(n)==="[object Array]")if(!u)f.push.apply(f,n);else if(d&&d.nodeType===1)for(t=0;n[t]!=null;t++)n[t]&&(n[t]===!0||n[t].nodeType===1&&k.contains(d,n[t]))&&f.push(j[t]);else for(t=0;n[t]!=null;t++)n[t]&&n[t].nodeType===1&&f.push(j[t]);else p(n,f);o&&(k(o,h,f,g),k.uniqueSort(f));return f};k.uniqueSort=function(a){if(r){g=h,a.sort(r);if(g)for(var b=1;b<a.length;b++)a[b]===a[b-1]&&a.splice(b--,1)}return a},k.matches=function(a,b){return k(a,null,null,b)},k.matchesSelector=function(a,b){return k(b,null,null,[a]).length>0},k.find=function(a,b,c){var d;if(!a)return[];for(var e=0,f=l.order.length;e<f;e++){var g,h=l.order[e];if(g=l.leftMatch[h].exec(a)){var j=g[1];g.splice(1,1);if(j.substr(j.length-1)!=="\\"){g[1]=(g[1]||"").replace(i,""),d=l.find[h](g,b,c);if(d!=null){a=a.replace(l.match[h],"");break}}}}d||(d=typeof b.getElementsByTagName!="undefined"?b.getElementsByTagName("*"):[]);return{set:d,expr:a}},k.filter=function(a,c,d,e){var f,g,h=a,i=[],j=c,m=c&&c[0]&&k.isXML(c[0]);while(a&&c.length){for(var n in l.filter)if((f=l.leftMatch[n].exec(a))!=null&&f[2]){var o,p,q=l.filter[n],r=f[1];g=!1,f.splice(1,1);if(r.substr(r.length-1)==="\\")continue;j===i&&(i=[]);if(l.preFilter[n]){f=l.preFilter[n](f,j,d,i,e,m);if(!f)g=o=!0;else if(f===!0)continue}if(f)for(var s=0;(p=j[s])!=null;s++)if(p){o=q(p,f,s,j);var t=e^!!o;d&&o!=null?t?g=!0:j[s]=!1:t&&(i.push(p),g=!0)}if(o!==b){d||(j=i),a=a.replace(l.match[n],"");if(!g)return[];break}}if(a===h)if(g==null)k.error(a);else break;h=a}return j},k.error=function(a){throw"Syntax error, unrecognized expression: "+a};var l=k.selectors={order:["ID","NAME","TAG"],match:{ID:/#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,CLASS:/\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,NAME:/\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/,ATTR:/\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(?:(['"])(.*?)\3|(#?(?:[\w\u00c0-\uFFFF\-]|\\.)*)|)|)\s*\]/,TAG:/^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/,CHILD:/:(only|nth|last|first)-child(?:\(\s*(even|odd|(?:[+\-]?\d+|(?:[+\-]?\d*)?n\s*(?:[+\-]\s*\d+)?))\s*\))?/,POS:/:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/,PSEUDO:/:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/},leftMatch:{},attrMap:{"class":"className","for":"htmlFor"},attrHandle:{href:function(a){return a.getAttribute("href")},type:function(a){return a.getAttribute("type")}},relative:{"+":function(a,b){var c=typeof b=="string",d=c&&!j.test(b),e=c&&!d;d&&(b=b.toLowerCase());for(var f=0,g=a.length,h;f<g;f++)if(h=a[f]){while((h=h.previousSibling)&&h.nodeType!==1);a[f]=e||h&&h.nodeName.toLowerCase()===b?h||!1:h===b}e&&k.filter(b,a,!0)},">":function(a,b){var c,d=typeof b=="string",e=0,f=a.length;if(d&&!j.test(b)){b=b.toLowerCase();for(;e<f;e++){c=a[e];if(c){var g=c.parentNode;a[e]=g.nodeName.toLowerCase()===b?g:!1}}}else{for(;e<f;e++)c=a[e],c&&(a[e]=d?c.parentNode:c.parentNode===b);d&&k.filter(b,a,!0)}},"":function(a,b,c){var e,f=d++,g=u;typeof b=="string"&&!j.test(b)&&(b=b.toLowerCase(),e=b,g=t),g("parentNode",b,f,a,e,c)},"~":function(a,b,c){var e,f=d++,g=u;typeof b=="string"&&!j.test(b)&&(b=b.toLowerCase(),e=b,g=t),g("previousSibling",b,f,a,e,c)}},find:{ID:function(a,b,c){if(typeof b.getElementById!="undefined"&&!c){var d=b.getElementById(a[1]);return d&&d.parentNode?[d]:[]}},NAME:function(a,b){if(typeof b.getElementsByName!="undefined"){var c=[],d=b.getElementsByName(a[1]);for(var e=0,f=d.length;e<f;e++)d[e].getAttribute("name")===a[1]&&c.push(d[e]);return c.length===0?null:c}},TAG:function(a,b){if(typeof b.getElementsByTagName!="undefined")return b.getElementsByTagName(a[1])}},preFilter:{CLASS:function(a,b,c,d,e,f){a=" "+a[1].replace(i,"")+" ";if(f)return a;for(var g=0,h;(h=b[g])!=null;g++)h&&(e^(h.className&&(" "+h.className+" ").replace(/[\t\n\r]/g," ").indexOf(a)>=0)?c||d.push(h):c&&(b[g]=!1));return!1},ID:function(a){return a[1].replace(i,"")},TAG:function(a,b){return a[1].replace(i,"").toLowerCase()},CHILD:function(a){if(a[1]==="nth"){a[2]||k.error(a[0]),a[2]=a[2].replace(/^\+|\s*/g,"");var b=/(-?)(\d*)(?:n([+\-]?\d*))?/.exec(a[2]==="even"&&"2n"||a[2]==="odd"&&"2n+1"||!/\D/.test(a[2])&&"0n+"+a[2]||a[2]);a[2]=b[1]+(b[2]||1)-0,a[3]=b[3]-0}else a[2]&&k.error(a[0]);a[0]=d++;return a},ATTR:function(a,b,c,d,e,f){var g=a[1]=a[1].replace(i,"");!f&&l.attrMap[g]&&(a[1]=l.attrMap[g]),a[4]=(a[4]||a[5]||"").replace(i,""),a[2]==="~="&&(a[4]=" "+a[4]+" ");return a},PSEUDO:function(b,c,d,e,f){if(b[1]==="not")if((a.exec(b[3])||"").length>1||/^\w/.test(b[3]))b[3]=k(b[3],null,null,c);else{var g=k.filter(b[3],c,d,!0^f);d||e.push.apply(e,g);return!1}else if(l.match.POS.test(b[0])||l.match.CHILD.test(b[0]))return!0;return b},POS:function(a){a.unshift(!0);return a}},filters:{enabled:function(a){return a.disabled===!1&&a.type!=="hidden"},disabled:function(a){return a.disabled===!0},checked:function(a){return a.checked===!0},selected:function(a){a.parentNode&&a.parentNode.selectedIndex;return a.selected===!0},parent:function(a){return!!a.firstChild},empty:function(a){return!a.firstChild},has:function(a,b,c){return!!k(c[3],a).length},header:function(a){return/h\d/i.test(a.nodeName)},text:function(a){var b=a.getAttribute("type"),c=a.type;return a.nodeName.toLowerCase()==="input"&&"text"===c&&(b===c||b===null)},radio:function(a){return a.nodeName.toLowerCase()==="input"&&"radio"===a.type},checkbox:function(a){return a.nodeName.toLowerCase()==="input"&&"checkbox"===a.type},file:function(a){return a.nodeName.toLowerCase()==="input"&&"file"===a.type},password:function(a){return a.nodeName.toLowerCase()==="input"&&"password"===a.type},submit:function(a){var b=a.nodeName.toLowerCase();return(b==="input"||b==="button")&&"submit"===a.type},image:function(a){return a.nodeName.toLowerCase()==="input"&&"image"===a.type},reset:function(a){var b=a.nodeName.toLowerCase();return(b==="input"||b==="button")&&"reset"===a.type},button:function(a){var b=a.nodeName.toLowerCase();return b==="input"&&"button"===a.type||b==="button"},input:function(a){return/input|select|textarea|button/i.test(a.nodeName)},focus:function(a){return a===a.ownerDocument.activeElement}},setFilters:{first:function(a,b){return b===0},last:function(a,b,c,d){return b===d.length-1},even:function(a,b){return b%2===0},odd:function(a,b){return b%2===1},lt:function(a,b,c){return b<c[3]-0},gt:function(a,b,c){return b>c[3]-0},nth:function(a,b,c){return c[3]-0===b},eq:function(a,b,c){return c[3]-0===b}},filter:{PSEUDO:function(a,b,c,d){var e=b[1],f=l.filters[e];if(f)return f(a,c,b,d);if(e==="contains")return(a.textContent||a.innerText||k.getText([a])||"").indexOf(b[3])>=0;if(e==="not"){var g=b[3];for(var h=0,i=g.length;h<i;h++)if(g[h]===a)return!1;return!0}k.error(e)},CHILD:function(a,b){var c=b[1],d=a;switch(c){case"only":case"first":while(d=d.previousSibling)if(d.nodeType===1)return!1;if(c==="first")return!0;d=a;case"last":while(d=d.nextSibling)if(d.nodeType===1)return!1;return!0;case"nth":var e=b[2],f=b[3];if(e===1&&f===0)return!0;var g=b[0],h=a.parentNode;if(h&&(h.sizcache!==g||!a.nodeIndex)){var i=0;for(d=h.firstChild;d;d=d.nextSibling)d.nodeType===1&&(d.nodeIndex=++i);h.sizcache=g}var j=a.nodeIndex-f;return e===0?j===0:j%e===0&&j/e>=0}},ID:function(a,b){return a.nodeType===1&&a.getAttribute("id")===b},TAG:function(a,b){return b==="*"&&a.nodeType===1||a.nodeName.toLowerCase()===b},CLASS:function(a,b){return(" "+(a.className||a.getAttribute("class"))+" ").indexOf(b)>-1},ATTR:function(a,b){var c=b[1],d=l.attrHandle[c]?l.attrHandle[c](a):a[c]!=null?a[c]:a.getAttribute(c),e=d+"",f=b[2],g=b[4];return d==null?f==="!=":f==="="?e===g:f==="*="?e.indexOf(g)>=0:f==="~="?(" "+e+" ").indexOf(g)>=0:g?f==="!="?e!==g:f==="^="?e.indexOf(g)===0:f==="$="?e.substr(e.length-g.length)===g:f==="|="?e===g||e.substr(0,g.length+1)===g+"-":!1:e&&d!==!1},POS:function(a,b,c,d){var e=b[2],f=l.setFilters[e];if(f)return f(a,c,b,d)}}},m=l.match.POS,n=function(a,b){return"\\"+(b-0+1)};for(var o in l.match)l.match[o]=new RegExp(l.match[o].source+/(?![^\[]*\])(?![^\(]*\))/.source),l.leftMatch[o]=new RegExp(/(^(?:.|\r|\n)*?)/.source+l.match[o].source.replace(/\\(\d+)/g,n));var p=function(a,b){a=Array.prototype.slice.call(a,0);if(b){b.push.apply(b,a);return b}return a};try{Array.prototype.slice.call(c.documentElement.childNodes,0)[0].nodeType}catch(q){p=function(a,b){var c=0,d=b||[];if(e.call(a)==="[object Array]")Array.prototype.push.apply(d,a);else if(typeof a.length=="number")for(var f=a.length;c<f;c++)d.push(a[c]);else for(;a[c];c++)d.push(a[c]);return d}}var r,s;c.documentElement.compareDocumentPosition?r=function(a,b){if(a===b){g=!0;return 0}if(!a.compareDocumentPosition||!b.compareDocumentPosition)return a.compareDocumentPosition?-1:1;return a.compareDocumentPosition(b)&4?-1:1}:(r=function(a,b){if(a===b){g=!0;return 0}if(a.sourceIndex&&b.sourceIndex)return a.sourceIndex-b.sourceIndex;var c,d,e=[],f=[],h=a.parentNode,i=b.parentNode,j=h;if(h===i)return s(a,b);if(!h)return-1;if(!i)return 1;while(j)e.unshift(j),j=j.parentNode;j=i;while(j)f.unshift(j),j=j.parentNode;c=e.length,d=f.length;for(var k=0;k<c&&k<d;k++)if(e[k]!==f[k])return s(e[k],f[k]);return k===c?s(a,f[k],-1):s(e[k],b,1)},s=function(a,b,c){if(a===b)return c;var d=a.nextSibling;while(d){if(d===b)return-1;d=d.nextSibling}return 1}),k.getText=function(a){var b="",c;for(var d=0;a[d];d++)c=a[d],c.nodeType===3||c.nodeType===4?b+=c.nodeValue:c.nodeType!==8&&(b+=k.getText(c.childNodes));return b},function(){var a=c.createElement("div"),d="script"+(new Date).getTime(),e=c.documentElement;a.innerHTML="<a name='"+d+"'/>",e.insertBefore(a,e.firstChild),c.getElementById(d)&&(l.find.ID=function(a,c,d){if(typeof c.getElementById!="undefined"&&!d){var e=c.getElementById(a[1]);return e?e.id===a[1]||typeof e.getAttributeNode!="undefined"&&e.getAttributeNode("id").nodeValue===a[1]?[e]:b:[]}},l.filter.ID=function(a,b){var c=typeof a.getAttributeNode!="undefined"&&a.getAttributeNode("id");return a.nodeType===1&&c&&c.nodeValue===b}),e.removeChild(a),e=a=null}(),function(){var a=c.createElement("div");a.appendChild(c.createComment("")),a.getElementsByTagName("*").length>0&&(l.find.TAG=function(a,b){var c=b.getElementsByTagName(a[1]);if(a[1]==="*"){var d=[];for(var e=0;c[e];e++)c[e].nodeType===1&&d.push(c[e]);c=d}return c}),a.innerHTML="<a href='#'></a>",a.firstChild&&typeof a.firstChild.getAttribute!="undefined"&&a.firstChild.getAttribute("href")!=="#"&&(l.attrHandle.href=function(a){return a.getAttribute("href",2)}),a=null}(),c.querySelectorAll&&function(){var a=k,b=c.createElement("div"),d="__sizzle__";b.innerHTML="<p class='TEST'></p>";if(!b.querySelectorAll||b.querySelectorAll(".TEST").length!==0){k=function(b,e,f,g){e=e||c;if(!g&&!k.isXML(e)){var h=/^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec(b);if(h&&(e.nodeType===1||e.nodeType===9)){if(h[1])return p(e.getElementsByTagName(b),f);if(h[2]&&l.find.CLASS&&e.getElementsByClassName)return p(e.getElementsByClassName(h[2]),f)}if(e.nodeType===9){if(b==="body"&&e.body)return p([e.body],f);if(h&&h[3]){var i=e.getElementById(h[3]);if(!i||!i.parentNode)return p([],f);if(i.id===h[3])return p([i],f)}try{return p(e.querySelectorAll(b),f)}catch(j){}}else if(e.nodeType===1&&e.nodeName.toLowerCase()!=="object"){var m=e,n=e.getAttribute("id"),o=n||d,q=e.parentNode,r=/^\s*[+~]/.test(b);n?o=o.replace(/'/g,"\\$&"):e.setAttribute("id",o),r&&q&&(e=e.parentNode);try{if(!r||q)return p(e.querySelectorAll("[id='"+o+"'] "+b),f)}catch(s){}finally{n||m.removeAttribute("id")}}}return a(b,e,f,g)};for(var e in a)k[e]=a[e];b=null}}(),function(){var a=c.documentElement,b=a.matchesSelector||a.mozMatchesSelector||a.webkitMatchesSelector||a.msMatchesSelector;if(b){var d=!b.call(c.createElement("div"),"div"),e=!1;try{b.call(c.documentElement,"[test!='']:sizzle")}catch(f){e=!0}k.matchesSelector=function(a,c){c=c.replace(/\=\s*([^'"\]]*)\s*\]/g,"='$1']");if(!k.isXML(a))try{if(e||!l.match.PSEUDO.test(c)&&!/!=/.test(c)){var f=b.call(a,c);if(f||!d||a.document&&a.document.nodeType!==11)return f}}catch(g){}return k(c,null,null,[a]).length>0}}}(),function(){var a=c.createElement("div");a.innerHTML="<div class='test e'></div><div class='test'></div>";if(!!a.getElementsByClassName&&a.getElementsByClassName("e").length!==0){a.lastChild.className="e";if(a.getElementsByClassName("e").length===1)return;l.order.splice(1,0,"CLASS"),l.find.CLASS=function(a,b,c){if(typeof b.getElementsByClassName!="undefined"&&!c)return b.getElementsByClassName(a[1])},a=null}}(),c.documentElement.contains?k.contains=function(a,b){return a!==b&&(a.contains?a.contains(b):!0)}:c.documentElement.compareDocumentPosition?k.contains=function(a,b){return!!(a.compareDocumentPosition(b)&16)}:k.contains=function(){return!1},k.isXML=function(a){var b=(a?a.ownerDocument||a:0).documentElement;return b?b.nodeName!=="HTML":!1};var v=function(a,b){var c,d=[],e="",f=b.nodeType?[b]:b;while(c=l.match.PSEUDO.exec(a))e+=c[0],a=a.replace(l.match.PSEUDO,"");a=l.relative[a]?a+"*":a;for(var g=0,h=f.length;g<h;g++)k(a,f[g],d);return k.filter(e,d)};f.find=k,f.expr=k.selectors,f.expr[":"]=f.expr.filters,f.unique=k.uniqueSort,f.text=k.getText,f.isXMLDoc=k.isXML,f.contains=k.contains}();var O=/Until$/,P=/^(?:parents|prevUntil|prevAll)/,Q=/,/,R=/^.[^:#\[\.,]*$/,S=Array.prototype.slice,T=f.expr.match.POS,U={children:!0,contents:!0,next:!0,prev:!0};f.fn.extend({find:function(a){var b=this,c,d;if(typeof a!="string")return f(a).filter(function(){for(c=0,d=b.length;c<d;c++)if(f.contains(b[c],this))return!0});var e=this.pushStack("","find",a),g,h,i;for(c=0,d=this.length;c<d;c++){g=e.length,f.find(a,this[c],e);if(c>0)for(h=g;h<e.length;h++)for(i=0;i<g;i++)if(e[i]===e[h]){e.splice(h--,1);break}}return e},has:function(a){var b=f(a);return this.filter(function(){for(var a=0,c=b.length;a<c;a++)if(f.contains(this,b[a]))return!0})},not:function(a){return this.pushStack(W(this,a,!1),"not",a)},filter:function(a){return this.pushStack(W(this,a,!0),"filter",a)},is:function(a){return!!a&&(typeof a=="string"?f.filter(a,this).length>0:this.filter(a).length>0)},closest:function(a,b){var c=[],d,e,g=this[0];if(f.isArray(a)){var h,i,j={},k=1;if(g&&a.length){for(d=0,e=a.length;d<e;d++)i=a[d],j[i]||(j[i]=T.test(i)?f(i,b||this.context):i);while(g&&g.ownerDocument&&g!==b){for(i in j)h=j[i],(h.jquery?h.index(g)>-1:f(g).is(h))&&c.push({selector:i,elem:g,level:k});g=g.parentNode,k++}}return c}var l=T.test(a)||typeof a!="string"?f(a,b||this.context):0;for(d=0,e=this.length;d<e;d++){g=this[d];while(g){if(l?l.index(g)>-1:f.find.matchesSelector(g,a)){c.push(g);break}g=g.parentNode;if(!g||!g.ownerDocument||g===b||g.nodeType===11)break}}c=c.length>1?f.unique(c):c;return this.pushStack(c,"closest",a)},index:function(a){if(!a||typeof a=="string")return f.inArray(this[0],a?f(a):this.parent().children());return f.inArray(a.jquery?a[0]:a,this)},add:function(a,b){var c=typeof a=="string"?f(a,b):f.makeArray(a&&a.nodeType?[a]:a),d=f.merge(this.get(),c);return this.pushStack(V(c[0])||V(d[0])?d:f.unique(d))},andSelf:function(){return this.add(this.prevObject)}}),f.each({parent:function(a){var b=a.parentNode;return b&&b.nodeType!==11?b:null},parents:function(a){return f.dir(a,"parentNode")},parentsUntil:function(a,b,c){return f.dir(a,"parentNode",c)},next:function(a){return f.nth(a,2,"nextSibling")},prev:function(a){return f.nth(a,2,"previousSibling")},nextAll:function(a){return f.dir(a,"nextSibling")},prevAll:function(a){return f.dir(a,"previousSibling")},nextUntil:function(a,b,c){return f.dir(a,"nextSibling",c)},prevUntil:function(a,b,c){return f.dir(a,"previousSibling",c)},siblings:function(a){return f.sibling(a.parentNode.firstChild,a)},children:function(a){return f.sibling(a.firstChild)},contents:function(a){return f.nodeName(a,"iframe")?a.contentDocument||a.contentWindow.document:f.makeArray(a.childNodes)}},function(a,b){f.fn[a]=function(c,d){var e=f.map(this,b,c),g=S.call(arguments);O.test(a)||(d=c),d&&typeof d=="string"&&(e=f.filter(d,e)),e=this.length>1&&!U[a]?f.unique(e):e,(this.length>1||Q.test(d))&&P.test(a)&&(e=e.reverse());return this.pushStack(e,a,g.join(","))}}),f.extend({filter:function(a,b,c){c&&(a=":not("+a+")");return b.length===1?f.find.matchesSelector(b[0],a)?[b[0]]:[]:f.find.matches(a,b)},dir:function(a,c,d){var e=[],g=a[c];while(g&&g.nodeType!==9&&(d===b||g.nodeType!==1||!f(g).is(d)))g.nodeType===1&&e.push(g),g=g[c];return e},nth:function(a,b,c,d){b=b||1;var e=0;for(;a;a=a[c])if(a.nodeType===1&&++e===b)break;return a},sibling:function(a,b){var c=[];for(;a;a=a.nextSibling)a.nodeType===1&&a!==b&&c.push(a);return c}});var X=/ jQuery\d+="(?:\d+|null)"/g,Y=/^\s+/,Z=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig,$=/<([\w:]+)/,_=/<tbody/i,ba=/<|&#?\w+;/,bb=/<(?:script|object|embed|option|style)/i,bc=/checked\s*(?:[^=]|=\s*.checked.)/i,bd=/\/(java|ecma)script/i,be=/^\s*<!(?:\[CDATA\[|\-\-)/,bf={option:[1,"<select multiple='multiple'>","</select>"],legend:[1,"<fieldset>","</fieldset>"],thead:[1,"<table>","</table>"],tr:[2,"<table><tbody>","</tbody></table>"],td:[3,"<table><tbody><tr>","</tr></tbody></table>"],col:[2,"<table><tbody></tbody><colgroup>","</colgroup></table>"],area:[1,"<map>","</map>"],_default:[0,"",""]};bf.optgroup=bf.option,bf.tbody=bf.tfoot=bf.colgroup=bf.caption=bf.thead,bf.th=bf.td,f.support.htmlSerialize||(bf._default=[1,"div<div>","</div>"]),f.fn.extend({text:function(a){if(f.isFunction(a))return this.each(function(b){var c=f(this);c.text(a.call(this,b,c.text()))});if(typeof a!="object"&&a!==b)return this.empty().append((this[0]&&this[0].ownerDocument||c).createTextNode(a));return f.text(this)},wrapAll:function(a){if(f.isFunction(a))return this.each(function(b){f(this).wrapAll(a.call(this,b))});if(this[0]){var b=f(a,this[0].ownerDocument).eq(0).clone(!0);this[0].parentNode&&b.insertBefore(this[0]),b.map(function(){var a=this;while(a.firstChild&&a.firstChild.nodeType===1)a=a.firstChild;return a}).append(this)}return this},wrapInner:function(a){if(f.isFunction(a))return this.each(function(b){f(this).wrapInner(a.call(this,b))});return this.each(function(){var b=f(this),c=b.contents();c.length?c.wrapAll(a):b.append(a)})},wrap:function(a){return this.each(function(){f(this).wrapAll(a)})},unwrap:function(){return this.parent().each(function(){f.nodeName(this,"body")||f(this).replaceWith(this.childNodes)}).end()},append:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.appendChild(a)})},prepend:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.insertBefore(a,this.firstChild)})},before:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this)});if(arguments.length){var a=f(arguments[0]);a.push.apply(a,this.toArray());return this.pushStack(a,"before",arguments)}},after:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this.nextSibling)});if(arguments.length){var a=this.pushStack(this,"after",arguments);a.push.apply(a,f(arguments[0]).toArray());return a}},remove:function(a,b){for(var c=0,d;(d=this[c])!=null;c++)if(!a||f.filter(a,[d]).length)!b&&d.nodeType===1&&(f.cleanData(d.getElementsByTagName("*")),f.cleanData([d])),d.parentNode&&d.parentNode.removeChild(d);return this},empty:function(){for(var a=0,b;(b=this[a])!=null;a++){b.nodeType===1&&f.cleanData(b.getElementsByTagName("*"));while(b.firstChild)b.removeChild(b.firstChild)}return this},clone:function(a,b){a=a==null?!1:a,b=b==null?a:b;return this.map(function(){return f.clone(this,a,b)})},html:function(a){if(a===b)return this[0]&&this[0].nodeType===1?this[0].innerHTML.replace(X,""):null;if(typeof a=="string"&&!bb.test(a)&&(f.support.leadingWhitespace||!Y.test(a))&&!bf[($.exec(a)||["",""])[1].toLowerCase()]){a=a.replace(Z,"<$1></$2>");try{for(var c=0,d=this.length;c<d;c++)this[c].nodeType===1&&(f.cleanData(this[c].getElementsByTagName("*")),this[c].innerHTML=a)}catch(e){this.empty().append(a)}}else f.isFunction(a)?this.each(function(b){var c=f(this);c.html(a.call(this,b,c.html()))}):this.empty().append(a);return this},replaceWith:function(a){if(this[0]&&this[0].parentNode){if(f.isFunction(a))return this.each(function(b){var c=f(this),d=c.html();c.replaceWith(a.call(this,b,d))});typeof a!="string"&&(a=f(a).detach());return this.each(function(){var b=this.nextSibling,c=this.parentNode;f(this).remove(),b?f(b).before(a):f(c).append(a)})}return this.length?this.pushStack(f(f.isFunction(a)?a():a),"replaceWith",a):this},detach:function(a){return this.remove(a,!0)},domManip:function(a,c,d){var e,g,h,i,j=a[0],k=[];if(!f.support.checkClone&&arguments.length===3&&typeof j=="string"&&bc.test(j))return this.each(function(){f(this).domManip(a,c,d,!0)});if(f.isFunction(j))return this.each(function(e){var g=f(this);a[0]=j.call(this,e,c?g.html():b),g.domManip(a,c,d)});if(this[0]){i=j&&j.parentNode,f.support.parentNode&&i&&i.nodeType===11&&i.childNodes.length===this.length?e={fragment:i}:e=f.buildFragment(a,this,k),h=e.fragment,h.childNodes.length===1?g=h=h.firstChild:g=h.firstChild;if(g){c=c&&f.nodeName(g,"tr");for(var l=0,m=this.length,n=m-1;l<m;l++)d.call(c?bg(this[l],g):this[l],e.cacheable||m>1&&l<n?f.clone(h,!0,!0):h)}k.length&&f.each(k,bm)}return this}}),f.buildFragment=function(a,b,d){var e,g,h,i;b&&b[0]&&(i=b[0].ownerDocument||b[0]),i.createDocumentFragment||(i=c),a.length===1&&typeof a[0]=="string"&&a[0].length<512&&i===c&&a[0].charAt(0)==="<"&&!bb.test(a[0])&&(f.support.checkClone||!bc.test(a[0]))&&(g=!0,h=f.fragments[a[0]],h&&h!==1&&(e=h)),e||(e=i.createDocumentFragment(),f.clean(a,i,e,d)),g&&(f.fragments[a[0]]=h?e:1);return{fragment:e,cacheable:g}},f.fragments={},f.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(a,b){f.fn[a]=function(c){var d=[],e=f(c),g=this.length===1&&this[0].parentNode;if(g&&g.nodeType===11&&g.childNodes.length===1&&e.length===1){e[b](this[0]);return this}for(var h=0,i=e.length;h<i;h++){var j=(h>0?this.clone(!0):this).get();f(e[h])[b](j),d=d.concat(j | |
| )}return this.pushStack(d,a,e.selector)}}),f.extend({clone:function(a,b,c){var d=a.cloneNode(!0),e,g,h;if((!f.support.noCloneEvent||!f.support.noCloneChecked)&&(a.nodeType===1||a.nodeType===11)&&!f.isXMLDoc(a)){bi(a,d),e=bj(a),g=bj(d);for(h=0;e[h];++h)bi(e[h],g[h])}if(b){bh(a,d);if(c){e=bj(a),g=bj(d);for(h=0;e[h];++h)bh(e[h],g[h])}}e=g=null;return d},clean:function(a,b,d,e){var g;b=b||c,typeof b.createElement=="undefined"&&(b=b.ownerDocument||b[0]&&b[0].ownerDocument||c);var h=[],i;for(var j=0,k;(k=a[j])!=null;j++){typeof k=="number"&&(k+="");if(!k)continue;if(typeof k=="string")if(!ba.test(k))k=b.createTextNode(k);else{k=k.replace(Z,"<$1></$2>");var l=($.exec(k)||["",""])[1].toLowerCase(),m=bf[l]||bf._default,n=m[0],o=b.createElement("div");o.innerHTML=m[1]+k+m[2];while(n--)o=o.lastChild;if(!f.support.tbody){var p=_.test(k),q=l==="table"&&!p?o.firstChild&&o.firstChild.childNodes:m[1]==="<table>"&&!p?o.childNodes:[];for(i=q.length-1;i>=0;--i)f.nodeName(q[i],"tbody")&&!q[i].childNodes.length&&q[i].parentNode.removeChild(q[i])}!f.support.leadingWhitespace&&Y.test(k)&&o.insertBefore(b.createTextNode(Y.exec(k)[0]),o.firstChild),k=o.childNodes}var r;if(!f.support.appendChecked)if(k[0]&&typeof (r=k.length)=="number")for(i=0;i<r;i++)bl(k[i]);else bl(k);k.nodeType?h.push(k):h=f.merge(h,k)}if(d){g=function(a){return!a.type||bd.test(a.type)};for(j=0;h[j];j++)if(e&&f.nodeName(h[j],"script")&&(!h[j].type||h[j].type.toLowerCase()==="text/javascript"))e.push(h[j].parentNode?h[j].parentNode.removeChild(h[j]):h[j]);else{if(h[j].nodeType===1){var s=f.grep(h[j].getElementsByTagName("script"),g);h.splice.apply(h,[j+1,0].concat(s))}d.appendChild(h[j])}}return h},cleanData:function(a){var b,c,d=f.cache,e=f.expando,g=f.event.special,h=f.support.deleteExpando;for(var i=0,j;(j=a[i])!=null;i++){if(j.nodeName&&f.noData[j.nodeName.toLowerCase()])continue;c=j[f.expando];if(c){b=d[c]&&d[c][e];if(b&&b.events){for(var k in b.events)g[k]?f.event.remove(j,k):f.removeEvent(j,k,b.handle);b.handle&&(b.handle.elem=null)}h?delete j[f.expando]:j.removeAttribute&&j.removeAttribute(f.expando),delete d[c]}}}});var bn=/alpha\([^)]*\)/i,bo=/opacity=([^)]*)/,bp=/([A-Z]|^ms)/g,bq=/^-?\d+(?:px)?$/i,br=/^-?\d/,bs=/^[+\-]=/,bt=/[^+\-\.\de]+/g,bu={position:"absolute",visibility:"hidden",display:"block"},bv=["Left","Right"],bw=["Top","Bottom"],bx,by,bz;f.fn.css=function(a,c){if(arguments.length===2&&c===b)return this;return f.access(this,a,c,!0,function(a,c,d){return d!==b?f.style(a,c,d):f.css(a,c)})},f.extend({cssHooks:{opacity:{get:function(a,b){if(b){var c=bx(a,"opacity","opacity");return c===""?"1":c}return a.style.opacity}}},cssNumber:{fillOpacity:!0,fontWeight:!0,lineHeight:!0,opacity:!0,orphans:!0,widows:!0,zIndex:!0,zoom:!0},cssProps:{"float":f.support.cssFloat?"cssFloat":"styleFloat"},style:function(a,c,d,e){if(!!a&&a.nodeType!==3&&a.nodeType!==8&&!!a.style){var g,h,i=f.camelCase(c),j=a.style,k=f.cssHooks[i];c=f.cssProps[i]||i;if(d===b){if(k&&"get"in k&&(g=k.get(a,!1,e))!==b)return g;return j[c]}h=typeof d;if(h==="number"&&isNaN(d)||d==null)return;h==="string"&&bs.test(d)&&(d=+d.replace(bt,"")+parseFloat(f.css(a,c)),h="number"),h==="number"&&!f.cssNumber[i]&&(d+="px");if(!k||!("set"in k)||(d=k.set(a,d))!==b)try{j[c]=d}catch(l){}}},css:function(a,c,d){var e,g;c=f.camelCase(c),g=f.cssHooks[c],c=f.cssProps[c]||c,c==="cssFloat"&&(c="float");if(g&&"get"in g&&(e=g.get(a,!0,d))!==b)return e;if(bx)return bx(a,c)},swap:function(a,b,c){var d={};for(var e in b)d[e]=a.style[e],a.style[e]=b[e];c.call(a);for(e in b)a.style[e]=d[e]}}),f.curCSS=f.css,f.each(["height","width"],function(a,b){f.cssHooks[b]={get:function(a,c,d){var e;if(c){if(a.offsetWidth!==0)return bA(a,b,d);f.swap(a,bu,function(){e=bA(a,b,d)});return e}},set:function(a,b){if(!bq.test(b))return b;b=parseFloat(b);if(b>=0)return b+"px"}}}),f.support.opacity||(f.cssHooks.opacity={get:function(a,b){return bo.test((b&&a.currentStyle?a.currentStyle.filter:a.style.filter)||"")?parseFloat(RegExp.$1)/100+"":b?"1":""},set:function(a,b){var c=a.style,d=a.currentStyle;c.zoom=1;var e=f.isNaN(b)?"":"alpha(opacity="+b*100+")",g=d&&d.filter||c.filter||"";c.filter=bn.test(g)?g.replace(bn,e):g+" "+e}}),f(function(){f.support.reliableMarginRight||(f.cssHooks.marginRight={get:function(a,b){var c;f.swap(a,{display:"inline-block"},function(){b?c=bx(a,"margin-right","marginRight"):c=a.style.marginRight});return c}})}),c.defaultView&&c.defaultView.getComputedStyle&&(by=function(a,c){var d,e,g;c=c.replace(bp,"-$1").toLowerCase();if(!(e=a.ownerDocument.defaultView))return b;if(g=e.getComputedStyle(a,null))d=g.getPropertyValue(c),d===""&&!f.contains(a.ownerDocument.documentElement,a)&&(d=f.style(a,c));return d}),c.documentElement.currentStyle&&(bz=function(a,b){var c,d=a.currentStyle&&a.currentStyle[b],e=a.runtimeStyle&&a.runtimeStyle[b],f=a.style;!bq.test(d)&&br.test(d)&&(c=f.left,e&&(a.runtimeStyle.left=a.currentStyle.left),f.left=b==="fontSize"?"1em":d||0,d=f.pixelLeft+"px",f.left=c,e&&(a.runtimeStyle.left=e));return d===""?"auto":d}),bx=by||bz,f.expr&&f.expr.filters&&(f.expr.filters.hidden=function(a){var b=a.offsetWidth,c=a.offsetHeight;return b===0&&c===0||!f.support.reliableHiddenOffsets&&(a.style.display||f.css(a,"display"))==="none"},f.expr.filters.visible=function(a){return!f.expr.filters.hidden(a)});var bB=/%20/g,bC=/\[\]$/,bD=/\r?\n/g,bE=/#.*$/,bF=/^(.*?):[ \t]*([^\r\n]*)\r?$/mg,bG=/^(?:color|date|datetime|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i,bH=/^(?:about|app|app\-storage|.+\-extension|file|widget):$/,bI=/^(?:GET|HEAD)$/,bJ=/^\/\//,bK=/\?/,bL=/<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi,bM=/^(?:select|textarea)/i,bN=/\s+/,bO=/([?&])_=[^&]*/,bP=/^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+))?)?/,bQ=f.fn.load,bR={},bS={},bT,bU;try{bT=e.href}catch(bV){bT=c.createElement("a"),bT.href="",bT=bT.href}bU=bP.exec(bT.toLowerCase())||[],f.fn.extend({load:function(a,c,d){if(typeof a!="string"&&bQ)return bQ.apply(this,arguments);if(!this.length)return this;var e=a.indexOf(" ");if(e>=0){var g=a.slice(e,a.length);a=a.slice(0,e)}var h="GET";c&&(f.isFunction(c)?(d=c,c=b):typeof c=="object"&&(c=f.param(c,f.ajaxSettings.traditional),h="POST"));var i=this;f.ajax({url:a,type:h,dataType:"html",data:c,complete:function(a,b,c){c=a.responseText,a.isResolved()&&(a.done(function(a){c=a}),i.html(g?f("<div>").append(c.replace(bL,"")).find(g):c)),d&&i.each(d,[c,b,a])}});return this},serialize:function(){return f.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?f.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||bM.test(this.nodeName)||bG.test(this.type))}).map(function(a,b){var c=f(this).val();return c==null?null:f.isArray(c)?f.map(c,function(a,c){return{name:b.name,value:a.replace(bD,"\r\n")}}):{name:b.name,value:c.replace(bD,"\r\n")}}).get()}}),f.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),function(a,b){f.fn[b]=function(a){return this.bind(b,a)}}),f.each(["get","post"],function(a,c){f[c]=function(a,d,e,g){f.isFunction(d)&&(g=g||e,e=d,d=b);return f.ajax({type:c,url:a,data:d,success:e,dataType:g})}}),f.extend({getScript:function(a,c){return f.get(a,b,c,"script")},getJSON:function(a,b,c){return f.get(a,b,c,"json")},ajaxSetup:function(a,b){b?f.extend(!0,a,f.ajaxSettings,b):(b=a,a=f.extend(!0,f.ajaxSettings,b));for(var c in{context:1,url:1})c in b?a[c]=b[c]:c in f.ajaxSettings&&(a[c]=f.ajaxSettings[c]);return a},ajaxSettings:{url:bT,isLocal:bH.test(bU[1]),global:!0,type:"GET",contentType:"application/x-www-form-urlencoded",processData:!0,async:!0,accepts:{xml:"application/xml, text/xml",html:"text/html",text:"text/plain",json:"application/json, text/javascript","*":"*/*"},contents:{xml:/xml/,html:/html/,json:/json/},responseFields:{xml:"responseXML",text:"responseText"},converters:{"* text":a.String,"text html":!0,"text json":f.parseJSON,"text xml":f.parseXML}},ajaxPrefilter:bW(bR),ajaxTransport:bW(bS),ajax:function(a,c){function w(a,c,l,m){if(s!==2){s=2,q&&clearTimeout(q),p=b,n=m||"",v.readyState=a?4:0;var o,r,u,w=l?bZ(d,v,l):b,x,y;if(a>=200&&a<300||a===304){if(d.ifModified){if(x=v.getResponseHeader("Last-Modified"))f.lastModified[k]=x;if(y=v.getResponseHeader("Etag"))f.etag[k]=y}if(a===304)c="notmodified",o=!0;else try{r=b$(d,w),c="success",o=!0}catch(z){c="parsererror",u=z}}else{u=c;if(!c||a)c="error",a<0&&(a=0)}v.status=a,v.statusText=c,o?h.resolveWith(e,[r,c,v]):h.rejectWith(e,[v,c,u]),v.statusCode(j),j=b,t&&g.trigger("ajax"+(o?"Success":"Error"),[v,d,o?r:u]),i.resolveWith(e,[v,c]),t&&(g.trigger("ajaxComplete",[v,d]),--f.active||f.event.trigger("ajaxStop"))}}typeof a=="object"&&(c=a,a=b),c=c||{};var d=f.ajaxSetup({},c),e=d.context||d,g=e!==d&&(e.nodeType||e instanceof f)?f(e):f.event,h=f.Deferred(),i=f._Deferred(),j=d.statusCode||{},k,l={},m={},n,o,p,q,r,s=0,t,u,v={readyState:0,setRequestHeader:function(a,b){if(!s){var c=a.toLowerCase();a=m[c]=m[c]||a,l[a]=b}return this},getAllResponseHeaders:function(){return s===2?n:null},getResponseHeader:function(a){var c;if(s===2){if(!o){o={};while(c=bF.exec(n))o[c[1].toLowerCase()]=c[2]}c=o[a.toLowerCase()]}return c===b?null:c},overrideMimeType:function(a){s||(d.mimeType=a);return this},abort:function(a){a=a||"abort",p&&p.abort(a),w(0,a);return this}};h.promise(v),v.success=v.done,v.error=v.fail,v.complete=i.done,v.statusCode=function(a){if(a){var b;if(s<2)for(b in a)j[b]=[j[b],a[b]];else b=a[v.status],v.then(b,b)}return this},d.url=((a||d.url)+"").replace(bE,"").replace(bJ,bU[1]+"//"),d.dataTypes=f.trim(d.dataType||"*").toLowerCase().split(bN),d.crossDomain==null&&(r=bP.exec(d.url.toLowerCase()),d.crossDomain=!(!r||r[1]==bU[1]&&r[2]==bU[2]&&(r[3]||(r[1]==="http:"?80:443))==(bU[3]||(bU[1]==="http:"?80:443)))),d.data&&d.processData&&typeof d.data!="string"&&(d.data=f.param(d.data,d.traditional)),bX(bR,d,c,v);if(s===2)return!1;t=d.global,d.type=d.type.toUpperCase(),d.hasContent=!bI.test(d.type),t&&f.active++===0&&f.event.trigger("ajaxStart");if(!d.hasContent){d.data&&(d.url+=(bK.test(d.url)?"&":"?")+d.data),k=d.url;if(d.cache===!1){var x=f.now(),y=d.url.replace(bO,"$1_="+x);d.url=y+(y===d.url?(bK.test(d.url)?"&":"?")+"_="+x:"")}}(d.data&&d.hasContent&&d.contentType!==!1||c.contentType)&&v.setRequestHeader("Content-Type",d.contentType),d.ifModified&&(k=k||d.url,f.lastModified[k]&&v.setRequestHeader("If-Modified-Since",f.lastModified[k]),f.etag[k]&&v.setRequestHeader("If-None-Match",f.etag[k])),v.setRequestHeader("Accept",d.dataTypes[0]&&d.accepts[d.dataTypes[0]]?d.accepts[d.dataTypes[0]]+(d.dataTypes[0]!=="*"?", */*; q=0.01":""):d.accepts["*"]);for(u in d.headers)v.setRequestHeader(u,d.headers[u]);if(d.beforeSend&&(d.beforeSend.call(e,v,d)===!1||s===2)){v.abort();return!1}for(u in{success:1,error:1,complete:1})v[u](d[u]);p=bX(bS,d,c,v);if(!p)w(-1,"No Transport");else{v.readyState=1,t&&g.trigger("ajaxSend",[v,d]),d.async&&d.timeout>0&&(q=setTimeout(function(){v.abort("timeout")},d.timeout));try{s=1,p.send(l,w)}catch(z){status<2?w(-1,z):f.error(z)}}return v},param:function(a,c){var d=[],e=function(a,b){b=f.isFunction(b)?b():b,d[d.length]=encodeURIComponent(a)+"="+encodeURIComponent(b)};c===b&&(c=f.ajaxSettings.traditional);if(f.isArray(a)||a.jquery&&!f.isPlainObject(a))f.each(a,function(){e(this.name,this.value)});else for(var g in a)bY(g,a[g],c,e);return d.join("&").replace(bB,"+")}}),f.extend({active:0,lastModified:{},etag:{}});var b_=f.now(),ca=/(\=)\?(&|$)|\?\?/i;f.ajaxSetup({jsonp:"callback",jsonpCallback:function(){return f.expando+"_"+b_++}}),f.ajaxPrefilter("json jsonp",function(b,c,d){var e=b.contentType==="application/x-www-form-urlencoded"&&typeof b.data=="string";if(b.dataTypes[0]==="jsonp"||b.jsonp!==!1&&(ca.test(b.url)||e&&ca.test(b.data))){var g,h=b.jsonpCallback=f.isFunction(b.jsonpCallback)?b.jsonpCallback():b.jsonpCallback,i=a[h],j=b.url,k=b.data,l="$1"+h+"$2";b.jsonp!==!1&&(j=j.replace(ca,l),b.url===j&&(e&&(k=k.replace(ca,l)),b.data===k&&(j+=(/\?/.test(j)?"&":"?")+b.jsonp+"="+h))),b.url=j,b.data=k,a[h]=function(a){g=[a]},d.always(function(){a[h]=i,g&&f.isFunction(i)&&a[h](g[0])}),b.converters["script json"]=function(){g||f.error(h+" was not called");return g[0]},b.dataTypes[0]="json";return"script"}}),f.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/javascript|ecmascript/},converters:{"text script":function(a){f.globalEval(a);return a}}}),f.ajaxPrefilter("script",function(a){a.cache===b&&(a.cache=!1),a.crossDomain&&(a.type="GET",a.global=!1)}),f.ajaxTransport("script",function(a){if(a.crossDomain){var d,e=c.head||c.getElementsByTagName("head")[0]||c.documentElement;return{send:function(f,g){d=c.createElement("script"),d.async="async",a.scriptCharset&&(d.charset=a.scriptCharset),d.src=a.url,d.onload=d.onreadystatechange=function(a,c){if(c||!d.readyState||/loaded|complete/.test(d.readyState))d.onload=d.onreadystatechange=null,e&&d.parentNode&&e.removeChild(d),d=b,c||g(200,"success")},e.insertBefore(d,e.firstChild)},abort:function(){d&&d.onload(0,1)}}}});var cb=a.ActiveXObject?function(){for(var a in cd)cd[a](0,1)}:!1,cc=0,cd;f.ajaxSettings.xhr=a.ActiveXObject?function(){return!this.isLocal&&ce()||cf()}:ce,function(a){f.extend(f.support,{ajax:!!a,cors:!!a&&"withCredentials"in a})}(f.ajaxSettings.xhr()),f.support.ajax&&f.ajaxTransport(function(c){if(!c.crossDomain||f.support.cors){var d;return{send:function(e,g){var h=c.xhr(),i,j;c.username?h.open(c.type,c.url,c.async,c.username,c.password):h.open(c.type,c.url,c.async);if(c.xhrFields)for(j in c.xhrFields)h[j]=c.xhrFields[j];c.mimeType&&h.overrideMimeType&&h.overrideMimeType(c.mimeType),!c.crossDomain&&!e["X-Requested-With"]&&(e["X-Requested-With"]="XMLHttpRequest");try{for(j in e)h.setRequestHeader(j,e[j])}catch(k){}h.send(c.hasContent&&c.data||null),d=function(a,e){var j,k,l,m,n;try{if(d&&(e||h.readyState===4)){d=b,i&&(h.onreadystatechange=f.noop,cb&&delete cd[i]);if(e)h.readyState!==4&&h.abort();else{j=h.status,l=h.getAllResponseHeaders(),m={},n=h.responseXML,n&&n.documentElement&&(m.xml=n),m.text=h.responseText;try{k=h.statusText}catch(o){k=""}!j&&c.isLocal&&!c.crossDomain?j=m.text?200:404:j===1223&&(j=204)}}}catch(p){e||g(-1,p)}m&&g(j,k,m,l)},!c.async||h.readyState===4?d():(i=++cc,cb&&(cd||(cd={},f(a).unload(cb)),cd[i]=d),h.onreadystatechange=d)},abort:function(){d&&d(0,1)}}}});var cg={},ch,ci,cj=/^(?:toggle|show|hide)$/,ck=/^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i,cl,cm=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]],cn,co=a.webkitRequestAnimationFrame||a.mozRequestAnimationFrame||a.oRequestAnimationFrame;f.fn.extend({show:function(a,b,c){var d,e;if(a||a===0)return this.animate(cr("show",3),a,b,c);for(var g=0,h=this.length;g<h;g++)d=this[g],d.style&&(e=d.style.display,!f._data(d,"olddisplay")&&e==="none"&&(e=d.style.display=""),e===""&&f.css(d,"display")==="none"&&f._data(d,"olddisplay",cs(d.nodeName)));for(g=0;g<h;g++){d=this[g];if(d.style){e=d.style.display;if(e===""||e==="none")d.style.display=f._data(d,"olddisplay")||""}}return this},hide:function(a,b,c){if(a||a===0)return this.animate(cr("hide",3),a,b,c);for(var d=0,e=this.length;d<e;d++)if(this[d].style){var g=f.css(this[d],"display");g!=="none"&&!f._data(this[d],"olddisplay")&&f._data(this[d],"olddisplay",g)}for(d=0;d<e;d++)this[d].style&&(this[d].style.display="none");return this},_toggle:f.fn.toggle,toggle:function(a,b,c){var d=typeof a=="boolean";f.isFunction(a)&&f.isFunction(b)?this._toggle.apply(this,arguments):a==null||d?this.each(function(){var b=d?a:f(this).is(":hidden");f(this)[b?"show":"hide"]()}):this.animate(cr("toggle",3),a,b,c);return this},fadeTo:function(a,b,c,d){return this.filter(":hidden").css("opacity",0).show().end().animate({opacity:b},a,c,d)},animate:function(a,b,c,d){var e=f.speed(b,c,d);if(f.isEmptyObject(a))return this.each(e.complete,[!1]);a=f.extend({},a);return this[e.queue===!1?"each":"queue"](function(){e.queue===!1&&f._mark(this);var b=f.extend({},e),c=this.nodeType===1,d=c&&f(this).is(":hidden"),g,h,i,j,k,l,m,n,o;b.animatedProperties={};for(i in a){g=f.camelCase(i),i!==g&&(a[g]=a[i],delete a[i]),h=a[g],f.isArray(h)?(b.animatedProperties[g]=h[1],h=a[g]=h[0]):b.animatedProperties[g]=b.specialEasing&&b.specialEasing[g]||b.easing||"swing";if(h==="hide"&&d||h==="show"&&!d)return b.complete.call(this);c&&(g==="height"||g==="width")&&(b.overflow=[this.style.overflow,this.style.overflowX,this.style.overflowY],f.css(this,"display")==="inline"&&f.css(this,"float")==="none"&&(f.support.inlineBlockNeedsLayout?(j=cs(this.nodeName),j==="inline"?this.style.display="inline-block":(this.style.display="inline",this.style.zoom=1)):this.style.display="inline-block"))}b.overflow!=null&&(this.style.overflow="hidden");for(i in a)k=new f.fx(this,b,i),h=a[i],cj.test(h)?k[h==="toggle"?d?"show":"hide":h]():(l=ck.exec(h),m=k.cur(),l?(n=parseFloat(l[2]),o=l[3]||(f.cssNumber[i]?"":"px"),o!=="px"&&(f.style(this,i,(n||1)+o),m=(n||1)/k.cur()*m,f.style(this,i,m+o)),l[1]&&(n=(l[1]==="-="?-1:1)*n+m),k.custom(m,n,o)):k.custom(m,h,""));return!0})},stop:function(a,b){a&&this.queue([]),this.each(function(){var a=f.timers,c=a.length;b||f._unmark(!0,this);while(c--)a[c].elem===this&&(b&&a[c](!0),a.splice(c,1))}),b||this.dequeue();return this}}),f.each({slideDown:cr("show",1),slideUp:cr("hide",1),slideToggle:cr("toggle",1),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"},fadeToggle:{opacity:"toggle"}},function(a,b){f.fn[a]=function(a,c,d){return this.animate(b,a,c,d)}}),f.extend({speed:function(a,b,c){var d=a&&typeof a=="object"?f.extend({},a):{complete:c||!c&&b||f.isFunction(a)&&a,duration:a,easing:c&&b||b&&!f.isFunction(b)&&b};d.duration=f.fx.off?0:typeof d.duration=="number"?d.duration:d.duration in f.fx.speeds?f.fx.speeds[d.duration]:f.fx.speeds._default,d.old=d.complete,d.complete=function(a){f.isFunction(d.old)&&d.old.call(this),d.queue!==!1?f.dequeue(this):a!==!1&&f._unmark(this)};return d},easing:{linear:function(a,b,c,d){return c+d*a},swing:function(a,b,c,d){return(-Math.cos(a*Math.PI)/2+.5)*d+c}},timers:[],fx:function(a,b,c){this.options=b,this.elem=a,this.prop=c,b.orig=b.orig||{}}}),f.fx.prototype={update:function(){this.options.step&&this.options.step.call(this.elem,this.now,this),(f.fx.step[this.prop]||f.fx.step._default)(this)},cur:function(){if(this.elem[this.prop]!=null&&(!this.elem.style||this.elem.style[this.prop]==null))return this.elem[this.prop];var a,b=f.css(this.elem,this.prop);return isNaN(a=parseFloat(b))?!b||b==="auto"?0:b:a},custom:function(a,b,c){function h(a){return d.step(a)}var d=this,e=f.fx,g;this.startTime=cn||cp(),this.start=a,this.end=b,this.unit=c||this.unit||(f.cssNumber[this.prop]?"":"px"),this.now=this.start,this.pos=this.state=0,h.elem=this.elem,h()&&f.timers.push(h)&&!cl&&(co?(cl=!0,g=function(){cl&&(co(g),e.tick())},co(g)):cl=setInterval(e.tick,e.interval))},show:function(){this.options.orig[this.prop]=f.style(this.elem,this.prop),this.options.show=!0,this.custom(this.prop==="width"||this.prop==="height"?1:0,this.cur()),f(this.elem).show()},hide:function(){this.options.orig[this.prop]=f.style(this.elem,this.prop),this.options.hide=!0,this.custom(this.cur(),0)},step:function(a){var b=cn||cp(),c=!0,d=this.elem,e=this.options,g,h;if(a||b>=e.duration+this.startTime){this.now=this.end,this.pos=this.state=1,this.update(),e.animatedProperties[this.prop]=!0;for(g in e.animatedProperties)e.animatedProperties[g]!==!0&&(c=!1);if(c){e.overflow!=null&&!f.support.shrinkWrapBlocks&&f.each(["","X","Y"],function(a,b){d.style["overflow"+b]=e.overflow[a]}),e.hide&&f(d).hide();if(e.hide||e.show)for(var i in e.animatedProperties)f.style(d,i,e.orig[i]);e.complete.call(d)}return!1}e.duration==Infinity?this.now=b:(h=b-this.startTime,this.state=h/e.duration,this.pos=f.easing[e.animatedProperties[this.prop]](this.state,h,0,1,e.duration),this.now=this.start+(this.end-this.start)*this.pos),this.update();return!0}},f.extend(f.fx,{tick:function(){for(var a=f.timers,b=0;b<a.length;++b)a[b]()||a.splice(b--,1);a.length||f.fx.stop()},interval:13,stop:function(){clearInterval(cl),cl=null},speeds:{slow:600,fast:200,_default:400},step:{opacity:function(a){f.style(a.elem,"opacity",a.now)},_default:function(a){a.elem.style&&a.elem.style[a.prop]!=null?a.elem.style[a.prop]=(a.prop==="width"||a.prop==="height"?Math.max(0,a.now):a.now)+a.unit:a.elem[a.prop]=a.now}}}),f.expr&&f.expr.filters&&(f.expr.filters.animated=function(a){return f.grep(f.timers,function(b){return a===b.elem}).length});var ct=/^t(?:able|d|h)$/i,cu=/^(?:body|html)$/i;"getBoundingClientRect"in c.documentElement?f.fn.offset=function(a){var b=this[0],c;if(a)return this.each(function(b){f.offset.setOffset(this,a,b)});if(!b||!b.ownerDocument)return null;if(b===b.ownerDocument.body)return f.offset.bodyOffset(b);try{c=b.getBoundingClientRect()}catch(d){}var e=b.ownerDocument,g=e.documentElement;if(!c||!f.contains(g,b))return c?{top:c.top,left:c.left}:{top:0,left:0};var h=e.body,i=cv(e),j=g.clientTop||h.clientTop||0,k=g.clientLeft||h.clientLeft||0,l=i.pageYOffset||f.support.boxModel&&g.scrollTop||h.scrollTop,m=i.pageXOffset||f.support.boxModel&&g.scrollLeft||h.scrollLeft,n=c.top+l-j,o=c.left+m-k;return{top:n,left:o}}:f.fn.offset=function(a){var b=this[0];if(a)return this.each(function(b){f.offset.setOffset(this,a,b)});if(!b||!b.ownerDocument)return null;if(b===b.ownerDocument.body)return f.offset.bodyOffset(b);f.offset.initialize();var c,d=b.offsetParent,e=b,g=b.ownerDocument,h=g.documentElement,i=g.body,j=g.defaultView,k=j?j.getComputedStyle(b,null):b.currentStyle,l=b.offsetTop,m=b.offsetLeft;while((b=b.parentNode)&&b!==i&&b!==h){if(f.offset.supportsFixedPosition&&k.position==="fixed")break;c=j?j.getComputedStyle(b,null):b.currentStyle,l-=b.scrollTop,m-=b.scrollLeft,b===d&&(l+=b.offsetTop,m+=b.offsetLeft,f.offset.doesNotAddBorder&&(!f.offset.doesAddBorderForTableAndCells||!ct.test(b.nodeName))&&(l+=parseFloat(c.borderTopWidth)||0,m+=parseFloat(c.borderLeftWidth)||0),e=d,d=b.offsetParent),f.offset.subtractsBorderForOverflowNotVisible&&c.overflow!=="visible"&&(l+=parseFloat(c.borderTopWidth)||0,m+=parseFloat(c.borderLeftWidth)||0),k=c}if(k.position==="relative"||k.position==="static")l+=i.offsetTop,m+=i.offsetLeft;f.offset.supportsFixedPosition&&k.position==="fixed"&&(l+=Math.max(h.scrollTop,i.scrollTop),m+=Math.max(h.scrollLeft,i.scrollLeft));return{top:l,left:m}},f.offset={initialize:function(){var a=c.body,b=c.createElement("div"),d,e,g,h,i=parseFloat(f.css(a,"marginTop"))||0,j="<div style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;'><div></div></div><table style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;' cellpadding='0' cellspacing='0'><tr><td></td></tr></table>";f.extend(b.style,{position:"absolute",top:0,left:0,margin:0,border:0,width:"1px",height:"1px",visibility:"hidden"}),b.innerHTML=j,a.insertBefore(b,a.firstChild),d=b.firstChild,e=d.firstChild,h=d.nextSibling.firstChild.firstChild,this.doesNotAddBorder=e.offsetTop!==5,this.doesAddBorderForTableAndCells=h.offsetTop===5,e.style.position="fixed",e.style.top="20px",this.supportsFixedPosition=e.offsetTop===20||e.offsetTop===15,e.style.position=e.style.top="",d.style.overflow="hidden",d.style.position="relative",this.subtractsBorderForOverflowNotVisible=e.offsetTop===-5,this.doesNotIncludeMarginInBodyOffset=a.offsetTop!==i,a.removeChild(b),f.offset.initialize=f.noop},bodyOffset:function(a){var b=a.offsetTop,c=a.offsetLeft;f.offset.initialize(),f.offset.doesNotIncludeMarginInBodyOffset&&(b+=parseFloat(f.css(a,"marginTop"))||0,c+=parseFloat(f.css(a,"marginLeft"))||0);return{top:b,left:c}},setOffset:function(a,b,c){var d=f.css(a,"position");d==="static"&&(a.style.position="relative");var e=f(a),g=e.offset(),h=f.css(a,"top"),i=f.css(a,"left"),j=(d==="absolute"||d==="fixed")&&f.inArray("auto",[h,i])>-1,k={},l={},m,n;j?(l=e.position(),m=l.top,n=l.left):(m=parseFloat(h)||0,n=parseFloat(i)||0),f.isFunction(b)&&(b=b.call(a,c,g)),b.top!=null&&(k.top=b.top-g.top+m),b.left!=null&&(k.left=b.left-g.left+n),"using"in b?b.using.call(a,k):e.css(k)}},f.fn.extend({position:function(){if(!this[0])return null;var a=this[0],b=this.offsetParent(),c=this.offset(),d=cu.test(b[0].nodeName)?{top:0,left:0}:b.offset();c.top-=parseFloat(f.css(a,"marginTop"))||0,c.left-=parseFloat(f.css(a,"marginLeft"))||0,d.top+=parseFloat(f.css(b[0],"borderTopWidth"))||0,d.left+=parseFloat(f.css(b[0],"borderLeftWidth"))||0;return{top:c.top-d.top,left:c.left-d.left}},offsetParent:function(){return this.map(function(){var a=this.offsetParent||c.body;while(a&&!cu.test(a.nodeName)&&f.css(a,"position")==="static")a=a.offsetParent;return a})}}),f.each(["Left","Top"],function(a,c){var d="scroll"+c;f.fn[d]=function(c){var e,g;if(c===b){e=this[0];if(!e)return null;g=cv(e);return g?"pageXOffset"in g?g[a?"pageYOffset":"pageXOffset"]:f.support.boxModel&&g.document.documentElement[d]||g.document.body[d]:e[d]}return this.each(function(){g=cv(this),g?g.scrollTo(a?f(g).scrollLeft():c,a?c:f(g).scrollTop()):this[d]=c})}}),f.each(["Height","Width"],function(a,c){var d=c.toLowerCase();f.fn["inner"+c]=function(){var a=this[0];return a&&a.style?parseFloat(f.css(a,d,"padding")):null},f.fn["outer"+c]=function(a){var b=this[0];return b&&b.style?parseFloat(f.css(b,d,a?"margin":"border")):null},f.fn[d]=function(a){var e=this[0];if(!e)return a==null?null:this;if(f.isFunction(a))return this.each(function(b){var c=f(this);c[d](a.call(this,b,c[d]()))});if(f.isWindow(e)){var g=e.document.documentElement["client"+c];return e.document.compatMode==="CSS1Compat"&&g||e.document.body["client"+c]||g}if(e.nodeType===9)return Math.max(e.documentElement["client"+c],e.body["scroll"+c],e.documentElement["scroll"+c],e.body["offset"+c],e.documentElement["offset"+c]);if(a===b){var h=f.css(e,d),i=parseFloat(h);return f.isNaN(i)?h:i}return this.css(d,typeof a=="string"?a:a+"px")}}),a.jQuery=a.$=f})(window); |
| /*! | |
| * jQuery Mobile v1.0b1 | |
| * http://jquerymobile.com/ | |
| * | |
| * Copyright 2010, jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| /*! | |
| * jQuery UI Widget @VERSION | |
| * | |
| * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| * | |
| * http://docs.jquery.com/UI/Widget | |
| */ | |
| (function( $, undefined ) { | |
| // jQuery 1.4+ | |
| if ( $.cleanData ) { | |
| var _cleanData = $.cleanData; | |
| $.cleanData = function( elems ) { | |
| for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { | |
| $( elem ).triggerHandler( "remove" ); | |
| } | |
| _cleanData( elems ); | |
| }; | |
| } else { | |
| var _remove = $.fn.remove; | |
| $.fn.remove = function( selector, keepData ) { | |
| return this.each(function() { | |
| if ( !keepData ) { | |
| if ( !selector || $.filter( selector, [ this ] ).length ) { | |
| $( "*", this ).add( [ this ] ).each(function() { | |
| $( this ).triggerHandler( "remove" ); | |
| }); | |
| } | |
| } | |
| return _remove.call( $(this), selector, keepData ); | |
| }); | |
| }; | |
| } | |
| $.widget = function( name, base, prototype ) { | |
| var namespace = name.split( "." )[ 0 ], | |
| fullName; | |
| name = name.split( "." )[ 1 ]; | |
| fullName = namespace + "-" + name; | |
| if ( !prototype ) { | |
| prototype = base; | |
| base = $.Widget; | |
| } | |
| // create selector for plugin | |
| $.expr[ ":" ][ fullName ] = function( elem ) { | |
| return !!$.data( elem, name ); | |
| }; | |
| $[ namespace ] = $[ namespace ] || {}; | |
| $[ namespace ][ name ] = function( options, element ) { | |
| // allow instantiation without initializing for simple inheritance | |
| if ( arguments.length ) { | |
| this._createWidget( options, element ); | |
| } | |
| }; | |
| var basePrototype = new base(); | |
| // we need to make the options hash a property directly on the new instance | |
| // otherwise we'll modify the options hash on the prototype that we're | |
| // inheriting from | |
| // $.each( basePrototype, function( key, val ) { | |
| // if ( $.isPlainObject(val) ) { | |
| // basePrototype[ key ] = $.extend( {}, val ); | |
| // } | |
| // }); | |
| basePrototype.options = $.extend( true, {}, basePrototype.options ); | |
| $[ namespace ][ name ].prototype = $.extend( true, basePrototype, { | |
| namespace: namespace, | |
| widgetName: name, | |
| widgetEventPrefix: $[ namespace ][ name ].prototype.widgetEventPrefix || name, | |
| widgetBaseClass: fullName | |
| }, prototype ); | |
| $.widget.bridge( name, $[ namespace ][ name ] ); | |
| }; | |
| $.widget.bridge = function( name, object ) { | |
| $.fn[ name ] = function( options ) { | |
| var isMethodCall = typeof options === "string", | |
| args = Array.prototype.slice.call( arguments, 1 ), | |
| returnValue = this; | |
| // allow multiple hashes to be passed on init | |
| options = !isMethodCall && args.length ? | |
| $.extend.apply( null, [ true, options ].concat(args) ) : | |
| options; | |
| // prevent calls to internal methods | |
| if ( isMethodCall && options.charAt( 0 ) === "_" ) { | |
| return returnValue; | |
| } | |
| if ( isMethodCall ) { | |
| this.each(function() { | |
| var instance = $.data( this, name ); | |
| if ( !instance ) { | |
| throw "cannot call methods on " + name + " prior to initialization; " + | |
| "attempted to call method '" + options + "'"; | |
| } | |
| if ( !$.isFunction( instance[options] ) ) { | |
| throw "no such method '" + options + "' for " + name + " widget instance"; | |
| } | |
| var methodValue = instance[ options ].apply( instance, args ); | |
| if ( methodValue !== instance && methodValue !== undefined ) { | |
| returnValue = methodValue; | |
| return false; | |
| } | |
| }); | |
| } else { | |
| this.each(function() { | |
| var instance = $.data( this, name ); | |
| if ( instance ) { | |
| instance.option( options || {} )._init(); | |
| } else { | |
| $.data( this, name, new object( options, this ) ); | |
| } | |
| }); | |
| } | |
| return returnValue; | |
| }; | |
| }; | |
| $.Widget = function( options, element ) { | |
| // allow instantiation without initializing for simple inheritance | |
| if ( arguments.length ) { | |
| this._createWidget( options, element ); | |
| } | |
| }; | |
| $.Widget.prototype = { | |
| widgetName: "widget", | |
| widgetEventPrefix: "", | |
| options: { | |
| disabled: false | |
| }, | |
| _createWidget: function( options, element ) { | |
| // $.widget.bridge stores the plugin instance, but we do it anyway | |
| // so that it's stored even before the _create function runs | |
| $.data( element, this.widgetName, this ); | |
| this.element = $( element ); | |
| this.options = $.extend( true, {}, | |
| this.options, | |
| this._getCreateOptions(), | |
| options ); | |
| var self = this; | |
| this.element.bind( "remove." + this.widgetName, function() { | |
| self.destroy(); | |
| }); | |
| this._create(); | |
| this._trigger( "create" ); | |
| this._init(); | |
| }, | |
| _getCreateOptions: function() { | |
| var options = {}; | |
| if ( $.metadata ) { | |
| options = $.metadata.get( element )[ this.widgetName ]; | |
| } | |
| return options; | |
| }, | |
| _create: function() {}, | |
| _init: function() {}, | |
| destroy: function() { | |
| this.element | |
| .unbind( "." + this.widgetName ) | |
| .removeData( this.widgetName ); | |
| this.widget() | |
| .unbind( "." + this.widgetName ) | |
| .removeAttr( "aria-disabled" ) | |
| .removeClass( | |
| this.widgetBaseClass + "-disabled " + | |
| "ui-state-disabled" ); | |
| }, | |
| widget: function() { | |
| return this.element; | |
| }, | |
| option: function( key, value ) { | |
| var options = key; | |
| if ( arguments.length === 0 ) { | |
| // don't return a reference to the internal hash | |
| return $.extend( {}, this.options ); | |
| } | |
| if (typeof key === "string" ) { | |
| if ( value === undefined ) { | |
| return this.options[ key ]; | |
| } | |
| options = {}; | |
| options[ key ] = value; | |
| } | |
| this._setOptions( options ); | |
| return this; | |
| }, | |
| _setOptions: function( options ) { | |
| var self = this; | |
| $.each( options, function( key, value ) { | |
| self._setOption( key, value ); | |
| }); | |
| return this; | |
| }, | |
| _setOption: function( key, value ) { | |
| this.options[ key ] = value; | |
| if ( key === "disabled" ) { | |
| this.widget() | |
| [ value ? "addClass" : "removeClass"]( | |
| this.widgetBaseClass + "-disabled" + " " + | |
| "ui-state-disabled" ) | |
| .attr( "aria-disabled", value ); | |
| } | |
| return this; | |
| }, | |
| enable: function() { | |
| return this._setOption( "disabled", false ); | |
| }, | |
| disable: function() { | |
| return this._setOption( "disabled", true ); | |
| }, | |
| _trigger: function( type, event, data ) { | |
| var callback = this.options[ type ]; | |
| event = $.Event( event ); | |
| event.type = ( type === this.widgetEventPrefix ? | |
| type : | |
| this.widgetEventPrefix + type ).toLowerCase(); | |
| data = data || {}; | |
| // copy original event properties over to the new event | |
| // this would happen if we could call $.event.fix instead of $.Event | |
| // but we don't have a way to force an event to be fixed multiple times | |
| if ( event.originalEvent ) { | |
| for ( var i = $.event.props.length, prop; i; ) { | |
| prop = $.event.props[ --i ]; | |
| event[ prop ] = event.originalEvent[ prop ]; | |
| } | |
| } | |
| this.element.trigger( event, data ); | |
| return !( $.isFunction(callback) && | |
| callback.call( this.element[0], event, data ) === false || | |
| event.isDefaultPrevented() ); | |
| } | |
| }; | |
| })( jQuery ); | |
| /* | |
| * jQuery Mobile Framework : widget factory extentions for mobile | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| (function($, undefined ) { | |
| $.widget( "mobile.widget", { | |
| _getCreateOptions: function() { | |
| var elem = this.element, | |
| options = {}; | |
| $.each( this.options, function( option ) { | |
| var value = elem.jqmData( option.replace( /[A-Z]/g, function( c ) { | |
| return "-" + c.toLowerCase(); | |
| } ) ); | |
| if ( value !== undefined ) { | |
| options[ option ] = value; | |
| } | |
| }); | |
| return options; | |
| } | |
| }); | |
| })( jQuery ); | |
| /* | |
| * jQuery Mobile Framework : resolution and CSS media query related helpers and behavior | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| (function($, undefined ) { | |
| var $window = $(window), | |
| $html = $( "html" ), | |
| //media-query-like width breakpoints, which are translated to classes on the html element | |
| resolutionBreakpoints = [320,480,768,1024]; | |
| /* $.mobile.media method: pass a CSS media type or query and get a bool return | |
| note: this feature relies on actual media query support for media queries, though types will work most anywhere | |
| examples: | |
| $.mobile.media('screen') //>> tests for screen media type | |
| $.mobile.media('screen and (min-width: 480px)') //>> tests for screen media type with window width > 480px | |
| $.mobile.media('@media screen and (-webkit-min-device-pixel-ratio: 2)') //>> tests for webkit 2x pixel ratio (iPhone 4) | |
| */ | |
| $.mobile.media = (function() { | |
| // TODO: use window.matchMedia once at least one UA implements it | |
| var cache = {}, | |
| testDiv = $( "<div id='jquery-mediatest'>" ), | |
| fakeBody = $( "<body>" ).append( testDiv ); | |
| return function( query ) { | |
| if ( !( query in cache ) ) { | |
| var styleBlock = document.createElement('style'), | |
| cssrule = "@media " + query + " { #jquery-mediatest { position:absolute; } }"; | |
| //must set type for IE! | |
| styleBlock.type = "text/css"; | |
| if (styleBlock.styleSheet){ | |
| styleBlock.styleSheet.cssText = cssrule; | |
| } | |
| else { | |
| styleBlock.appendChild(document.createTextNode(cssrule)); | |
| } | |
| $html.prepend( fakeBody ).prepend( styleBlock ); | |
| cache[ query ] = testDiv.css( "position" ) === "absolute"; | |
| fakeBody.add( styleBlock ).remove(); | |
| } | |
| return cache[ query ]; | |
| }; | |
| })(); | |
| /* | |
| private function for adding/removing breakpoint classes to HTML element for faux media-query support | |
| It does not require media query support, instead using JS to detect screen width > cross-browser support | |
| This function is called on orientationchange, resize, and mobileinit, and is bound via the 'htmlclass' event namespace | |
| */ | |
| function detectResolutionBreakpoints(){ | |
| var currWidth = $window.width(), | |
| minPrefix = "min-width-", | |
| maxPrefix = "max-width-", | |
| minBreakpoints = [], | |
| maxBreakpoints = [], | |
| unit = "px", | |
| breakpointClasses; | |
| $html.removeClass( minPrefix + resolutionBreakpoints.join(unit + " " + minPrefix) + unit + " " + | |
| maxPrefix + resolutionBreakpoints.join( unit + " " + maxPrefix) + unit ); | |
| $.each(resolutionBreakpoints,function( i, breakPoint ){ | |
| if( currWidth >= breakPoint ){ | |
| minBreakpoints.push( minPrefix + breakPoint + unit ); | |
| } | |
| if( currWidth <= breakPoint ){ | |
| maxBreakpoints.push( maxPrefix + breakPoint + unit ); | |
| } | |
| }); | |
| if( minBreakpoints.length ){ breakpointClasses = minBreakpoints.join(" "); } | |
| if( maxBreakpoints.length ){ breakpointClasses += " " + maxBreakpoints.join(" "); } | |
| $html.addClass( breakpointClasses ); | |
| }; | |
| /* $.mobile.addResolutionBreakpoints method: | |
| pass either a number or an array of numbers and they'll be added to the min/max breakpoint classes | |
| Examples: | |
| $.mobile.addResolutionBreakpoints( 500 ); | |
| $.mobile.addResolutionBreakpoints( [500, 1200] ); | |
| */ | |
| $.mobile.addResolutionBreakpoints = function( newbps ){ | |
| if( $.type( newbps ) === "array" ){ | |
| resolutionBreakpoints = resolutionBreakpoints.concat( newbps ); | |
| } | |
| else { | |
| resolutionBreakpoints.push( newbps ); | |
| } | |
| resolutionBreakpoints.sort(function(a,b){ return a-b; }); | |
| detectResolutionBreakpoints(); | |
| }; | |
| /* on mobileinit, add classes to HTML element | |
| and set handlers to update those on orientationchange and resize*/ | |
| $(document).bind("mobileinit.htmlclass", function(){ | |
| /* bind to orientationchange and resize | |
| to add classes to HTML element for min/max breakpoints and orientation */ | |
| var ev = $.support.orientation; | |
| $window.bind("orientationchange.htmlclass throttledResize.htmlclass", function(event){ | |
| //add orientation class to HTML element on flip/resize. | |
| if(event.orientation){ | |
| $html.removeClass( "portrait landscape" ).addClass( event.orientation ); | |
| } | |
| //add classes to HTML element for min/max breakpoints | |
| detectResolutionBreakpoints(); | |
| }); | |
| }); | |
| /* Manually trigger an orientationchange event when the dom ready event fires. | |
| This will ensure that any viewport meta tag that may have been injected | |
| has taken effect already, allowing us to properly calculate the width of the | |
| document. | |
| */ | |
| $(function(){ | |
| //trigger event manually | |
| $window.trigger( "orientationchange.htmlclass" ); | |
| }); | |
| })(jQuery);/* | |
| * jQuery Mobile Framework : support tests | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses. | |
| * Note: Code is in draft form and is subject to change | |
| */ | |
| ( function( $, undefined ) { | |
| var fakeBody = $( "<body>" ).prependTo( "html" ), | |
| fbCSS = fakeBody[ 0 ].style, | |
| vendors = [ "webkit", "moz", "o" ], | |
| webos = "palmGetResource" in window, //only used to rule out scrollTop | |
| bb = window.blackberry; //only used to rule out box shadow, as it's filled opaque on BB | |
| // thx Modernizr | |
| function propExists( prop ){ | |
| var uc_prop = prop.charAt( 0 ).toUpperCase() + prop.substr( 1 ), | |
| props = ( prop + " " + vendors.join( uc_prop + " " ) + uc_prop ).split( " " ); | |
| for( var v in props ){ | |
| if( fbCSS[ v ] !== undefined ){ | |
| return true; | |
| } | |
| } | |
| } | |
| // test for dynamic-updating base tag support ( allows us to avoid href,src attr rewriting ) | |
| function baseTagTest(){ | |
| var fauxBase = location.protocol + "//" + location.host + location.pathname + "ui-dir/", | |
| base = $( "head base" ), | |
| fauxEle = null, | |
| href = ""; | |
| if ( !base.length ) { | |
| base = fauxEle = $( "<base>", { "href": fauxBase} ).appendTo( "head" ); | |
| } | |
| else { | |
| href = base.attr( "href" ); | |
| } | |
| var link = $( "<a href='testurl'></a>" ).prependTo( fakeBody ), | |
| rebase = link[ 0 ].href; | |
| base[ 0 ].href = href ? href : location.pathname; | |
| if ( fauxEle ) { | |
| fauxEle.remove(); | |
| } | |
| return rebase.indexOf( fauxBase ) === 0; | |
| } | |
| // non-UA-based IE version check by James Padolsey, modified by jdalton - from http://gist.github.com/527683 | |
| // allows for inclusion of IE 6+, including Windows Mobile 7 | |
| $.mobile.browser = {}; | |
| $.mobile.browser.ie = ( function() { | |
| var v = 3, | |
| div = document.createElement( "div" ), | |
| a = div.all || []; | |
| while ( div.innerHTML = "<!--[if gt IE " + ( ++v ) + "]><br><![endif]-->", a[ 0 ] ); | |
| return v > 4 ? v : !v; | |
| }() ); | |
| $.extend( $.support, { | |
| orientation: "orientation" in window, | |
| touch: "ontouchend" in document, | |
| cssTransitions: "WebKitTransitionEvent" in window, | |
| pushState: !!history.pushState, | |
| mediaquery: $.mobile.media( "only all" ), | |
| cssPseudoElement: !!propExists( "content" ), | |
| boxShadow: !!propExists( "boxShadow" ) && !bb, | |
| scrollTop: ( "pageXOffset" in window || "scrollTop" in document.documentElement || "scrollTop" in fakeBody[ 0 ] ) && !webos, | |
| dynamicBaseTag: baseTagTest(), | |
| eventCapture: ( "addEventListener" in document ) // This is a weak test. We may want to beef this up later. | |
| } ); | |
| fakeBody.remove(); | |
| // for ruling out shadows via css | |
| if( !$.support.boxShadow ){ $( "html" ).addClass( "ui-mobile-nosupport-boxshadow" ); } | |
| } )( jQuery );/* | |
| * jQuery Mobile Framework : "mouse" plugin | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| // This plugin is an experiment for abstracting away the touch and mouse | |
| // events so that developers don't have to worry about which method of input | |
| // the device their document is loaded on supports. | |
| // | |
| // The idea here is to allow the developer to register listeners for the | |
| // basic mouse events, such as mousedown, mousemove, mouseup, and click, | |
| // and the plugin will take care of registering the correct listeners | |
| // behind the scenes to invoke the listener at the fastest possible time | |
| // for that device, while still retaining the order of event firing in | |
| // the traditional mouse environment, should multiple handlers be registered | |
| // on the same element for different events. | |
| // | |
| // The current version exposes the following virtual events to jQuery bind methods: | |
| // "vmouseover vmousedown vmousemove vmouseup vclick vmouseout vmousecancel" | |
| (function($, window, document, undefined) { | |
| var dataPropertyName = "virtualMouseBindings", | |
| touchTargetPropertyName = "virtualTouchID", | |
| virtualEventNames = "vmouseover vmousedown vmousemove vmouseup vclick vmouseout vmousecancel".split(" "), | |
| touchEventProps = "clientX clientY pageX pageY screenX screenY".split(" "), | |
| activeDocHandlers = {}, | |
| resetTimerID = 0, | |
| startX = 0, | |
| startY = 0, | |
| didScroll = false, | |
| clickBlockList = [], | |
| blockMouseTriggers = false, | |
| blockTouchTriggers = false, | |
| eventCaptureSupported = $.support.eventCapture, | |
| $document = $(document), | |
| nextTouchID = 1, | |
| lastTouchID = 0; | |
| $.vmouse = { | |
| moveDistanceThreshold: 10, | |
| clickDistanceThreshold: 10, | |
| resetTimerDuration: 1500 | |
| }; | |
| function getNativeEvent(event) | |
| { | |
| while (event && typeof event.originalEvent !== "undefined") { | |
| event = event.originalEvent; | |
| } | |
| return event; | |
| } | |
| function createVirtualEvent(event, eventType) | |
| { | |
| var t = event.type; | |
| event = $.Event(event); | |
| event.type = eventType; | |
| var oe = event.originalEvent; | |
| var props = $.event.props; | |
| // copy original event properties over to the new event | |
| // this would happen if we could call $.event.fix instead of $.Event | |
| // but we don't have a way to force an event to be fixed multiple times | |
| if (oe) { | |
| for ( var i = props.length, prop; i; ) { | |
| prop = props[ --i ]; | |
| event[prop] = oe[prop]; | |
| } | |
| } | |
| if (t.search(/^touch/) !== -1){ | |
| var ne = getNativeEvent(oe), | |
| t = ne.touches, | |
| ct = ne.changedTouches, | |
| touch = (t && t.length) ? t[0] : ((ct && ct.length) ? ct[0] : undefined); | |
| if (touch){ | |
| for (var i = 0, len = touchEventProps.length; i < len; i++){ | |
| var prop = touchEventProps[i]; | |
| event[prop] = touch[prop]; | |
| } | |
| } | |
| } | |
| return event; | |
| } | |
| function getVirtualBindingFlags(element) | |
| { | |
| var flags = {}; | |
| while (element){ | |
| var b = $.data(element, dataPropertyName); | |
| for (var k in b) { | |
| if (b[k]){ | |
| flags[k] = flags.hasVirtualBinding = true; | |
| } | |
| } | |
| element = element.parentNode; | |
| } | |
| return flags; | |
| } | |
| function getClosestElementWithVirtualBinding(element, eventType) | |
| { | |
| while (element){ | |
| var b = $.data(element, dataPropertyName); | |
| if (b && (!eventType || b[eventType])) { | |
| return element; | |
| } | |
| element = element.parentNode; | |
| } | |
| return null; | |
| } | |
| function enableTouchBindings() | |
| { | |
| blockTouchTriggers = false; | |
| } | |
| function disableTouchBindings() | |
| { | |
| blockTouchTriggers = true; | |
| } | |
| function enableMouseBindings() | |
| { | |
| lastTouchID = 0; | |
| clickBlockList.length = 0; | |
| blockMouseTriggers = false; | |
| // When mouse bindings are enabled, our | |
| // touch bindings are disabled. | |
| disableTouchBindings(); | |
| } | |
| function disableMouseBindings() | |
| { | |
| // When mouse bindings are disabled, our | |
| // touch bindings are enabled. | |
| enableTouchBindings(); | |
| } | |
| function startResetTimer() | |
| { | |
| clearResetTimer(); | |
| resetTimerID = setTimeout(function(){ | |
| resetTimerID = 0; | |
| enableMouseBindings(); | |
| }, $.vmouse.resetTimerDuration); | |
| } | |
| function clearResetTimer() | |
| { | |
| if (resetTimerID){ | |
| clearTimeout(resetTimerID); | |
| resetTimerID = 0; | |
| } | |
| } | |
| function triggerVirtualEvent(eventType, event, flags) | |
| { | |
| var defaultPrevented = false; | |
| if ((flags && flags[eventType]) || (!flags && getClosestElementWithVirtualBinding(event.target, eventType))) { | |
| var ve = createVirtualEvent(event, eventType); | |
| $(event.target).trigger(ve); | |
| defaultPrevented = ve.isDefaultPrevented(); | |
| } | |
| return defaultPrevented; | |
| } | |
| function mouseEventCallback(event) | |
| { | |
| var touchID = $.data(event.target, touchTargetPropertyName); | |
| if (!blockMouseTriggers && (!lastTouchID || lastTouchID !== touchID)){ | |
| triggerVirtualEvent("v" + event.type, event); | |
| } | |
| } | |
| function handleTouchStart(event) | |
| { | |
| var touches = getNativeEvent(event).touches; | |
| if (touches && touches.length === 1){ | |
| var target = event.target, | |
| flags = getVirtualBindingFlags(target); | |
| if (flags.hasVirtualBinding){ | |
| lastTouchID = nextTouchID++; | |
| $.data(target, touchTargetPropertyName, lastTouchID); | |
| clearResetTimer(); | |
| disableMouseBindings(); | |
| didScroll = false; | |
| var t = getNativeEvent(event).touches[0]; | |
| startX = t.pageX; | |
| startY = t.pageY; | |
| triggerVirtualEvent("vmouseover", event, flags); | |
| triggerVirtualEvent("vmousedown", event, flags); | |
| } | |
| } | |
| } | |
| function handleScroll(event) | |
| { | |
| if (blockTouchTriggers){ | |
| return; | |
| } | |
| if (!didScroll){ | |
| triggerVirtualEvent("vmousecancel", event, getVirtualBindingFlags(event.target)); | |
| } | |
| didScroll = true; | |
| startResetTimer(); | |
| } | |
| function handleTouchMove(event) | |
| { | |
| if (blockTouchTriggers){ | |
| return; | |
| } | |
| var t = getNativeEvent(event).touches[0]; | |
| var didCancel = didScroll, | |
| moveThreshold = $.vmouse.moveDistanceThreshold; | |
| didScroll = didScroll | |
| || (Math.abs(t.pageX - startX) > moveThreshold || Math.abs(t.pageY - startY) > moveThreshold); | |
| var flags = getVirtualBindingFlags(event.target); | |
| if (didScroll && !didCancel){ | |
| triggerVirtualEvent("vmousecancel", event, flags); | |
| } | |
| triggerVirtualEvent("vmousemove", event, flags); | |
| startResetTimer(); | |
| } | |
| function handleTouchEnd(event) | |
| { | |
| if (blockTouchTriggers){ | |
| return; | |
| } | |
| disableTouchBindings(); | |
| var flags = getVirtualBindingFlags(event.target); | |
| triggerVirtualEvent("vmouseup", event, flags); | |
| if (!didScroll){ | |
| if (triggerVirtualEvent("vclick", event, flags)){ | |
| // The target of the mouse events that follow the touchend | |
| // event don't necessarily match the target used during the | |
| // touch. This means we need to rely on coordinates for blocking | |
| // any click that is generated. | |
| var t = getNativeEvent(event).changedTouches[0]; | |
| clickBlockList.push({ touchID: lastTouchID, x: t.clientX, y: t.clientY }); | |
| // Prevent any mouse events that follow from triggering | |
| // virtual event notifications. | |
| blockMouseTriggers = true; | |
| } | |
| } | |
| triggerVirtualEvent("vmouseout", event, flags); | |
| didScroll = false; | |
| startResetTimer(); | |
| } | |
| function hasVirtualBindings(ele) | |
| { | |
| var bindings = $.data(ele, dataPropertyName), k; | |
| if (bindings){ | |
| for (k in bindings){ | |
| if (bindings[k]){ | |
| return true; | |
| } | |
| } | |
| } | |
| return false; | |
| } | |
| function dummyMouseHandler(){} | |
| function getSpecialEventObject(eventType) | |
| { | |
| var realType = eventType.substr(1); | |
| return { | |
| setup: function(data, namespace) { | |
| // If this is the first virtual mouse binding for this element, | |
| // add a bindings object to its data. | |
| if (!hasVirtualBindings(this)){ | |
| $.data(this, dataPropertyName, {}); | |
| } | |
| // If setup is called, we know it is the first binding for this | |
| // eventType, so initialize the count for the eventType to zero. | |
| var bindings = $.data(this, dataPropertyName); | |
| bindings[eventType] = true; | |
| // If this is the first virtual mouse event for this type, | |
| // register a global handler on the document. | |
| activeDocHandlers[eventType] = (activeDocHandlers[eventType] || 0) + 1; | |
| if (activeDocHandlers[eventType] === 1){ | |
| $document.bind(realType, mouseEventCallback); | |
| } | |
| // Some browsers, like Opera Mini, won't dispatch mouse/click events | |
| // for elements unless they actually have handlers registered on them. | |
| // To get around this, we register dummy handlers on the elements. | |
| $(this).bind(realType, dummyMouseHandler); | |
| // For now, if event capture is not supported, we rely on mouse handlers. | |
| if (eventCaptureSupported){ | |
| // If this is the first virtual mouse binding for the document, | |
| // register our touchstart handler on the document. | |
| activeDocHandlers["touchstart"] = (activeDocHandlers["touchstart"] || 0) + 1; | |
| if (activeDocHandlers["touchstart"] === 1) { | |
| $document.bind("touchstart", handleTouchStart) | |
| .bind("touchend", handleTouchEnd) | |
| // On touch platforms, touching the screen and then dragging your finger | |
| // causes the window content to scroll after some distance threshold is | |
| // exceeded. On these platforms, a scroll prevents a click event from being | |
| // dispatched, and on some platforms, even the touchend is suppressed. To | |
| // mimic the suppression of the click event, we need to watch for a scroll | |
| // event. Unfortunately, some platforms like iOS don't dispatch scroll | |
| // events until *AFTER* the user lifts their finger (touchend). This means | |
| // we need to watch both scroll and touchmove events to figure out whether | |
| // or not a scroll happenens before the touchend event is fired. | |
| .bind("touchmove", handleTouchMove) | |
| .bind("scroll", handleScroll); | |
| } | |
| } | |
| }, | |
| teardown: function(data, namespace) { | |
| // If this is the last virtual binding for this eventType, | |
| // remove its global handler from the document. | |
| --activeDocHandlers[eventType]; | |
| if (!activeDocHandlers[eventType]){ | |
| $document.unbind(realType, mouseEventCallback); | |
| } | |
| if (eventCaptureSupported){ | |
| // If this is the last virtual mouse binding in existence, | |
| // remove our document touchstart listener. | |
| --activeDocHandlers["touchstart"]; | |
| if (!activeDocHandlers["touchstart"]) { | |
| $document.unbind("touchstart", handleTouchStart) | |
| .unbind("touchmove", handleTouchMove) | |
| .unbind("touchend", handleTouchEnd) | |
| .unbind("scroll", handleScroll); | |
| } | |
| } | |
| var $this = $(this), | |
| bindings = $.data(this, dataPropertyName); | |
| // teardown may be called when an element was | |
| // removed from the DOM. If this is the case, | |
| // jQuery core may have already stripped the element | |
| // of any data bindings so we need to check it before | |
| // using it. | |
| if (bindings){ | |
| bindings[eventType] = false; | |
| } | |
| // Unregister the dummy event handler. | |
| $this.unbind(realType, dummyMouseHandler); | |
| // If this is the last virtual mouse binding on the | |
| // element, remove the binding data from the element. | |
| if (!hasVirtualBindings(this)){ | |
| $this.removeData(dataPropertyName); | |
| } | |
| } | |
| }; | |
| } | |
| // Expose our custom events to the jQuery bind/unbind mechanism. | |
| for (var i = 0; i < virtualEventNames.length; i++){ | |
| $.event.special[virtualEventNames[i]] = getSpecialEventObject(virtualEventNames[i]); | |
| } | |
| // Add a capture click handler to block clicks. | |
| // Note that we require event capture support for this so if the device | |
| // doesn't support it, we punt for now and rely solely on mouse events. | |
| if (eventCaptureSupported){ | |
| document.addEventListener("click", function(e){ | |
| var cnt = clickBlockList.length; | |
| var target = e.target; | |
| if (cnt) { | |
| var x = e.clientX, | |
| y = e.clientY, | |
| threshold = $.vmouse.clickDistanceThreshold; | |
| // The idea here is to run through the clickBlockList to see if | |
| // the current click event is in the proximity of one of our | |
| // vclick events that had preventDefault() called on it. If we find | |
| // one, then we block the click. | |
| // | |
| // Why do we have to rely on proximity? | |
| // | |
| // Because the target of the touch event that triggered the vclick | |
| // can be different from the target of the click event synthesized | |
| // by the browser. The target of a mouse/click event that is syntehsized | |
| // from a touch event seems to be implementation specific. For example, | |
| // some browsers will fire mouse/click events for a link that is near | |
| // a touch event, even though the target of the touchstart/touchend event | |
| // says the user touched outside the link. Also, it seems that with most | |
| // browsers, the target of the mouse/click event is not calculated until the | |
| // time it is dispatched, so if you replace an element that you touched | |
| // with another element, the target of the mouse/click will be the new | |
| // element underneath that point. | |
| // | |
| // Aside from proximity, we also check to see if the target and any | |
| // of its ancestors were the ones that blocked a click. This is necessary | |
| // because of the strange mouse/click target calculation done in the | |
| // Android 2.1 browser, where if you click on an element, and there is a | |
| // mouse/click handler on one of its ancestors, the target will be the | |
| // innermost child of the touched element, even if that child is no where | |
| // near the point of touch. | |
| var ele = target; | |
| while (ele) { | |
| for (var i = 0; i < cnt; i++) { | |
| var o = clickBlockList[i], | |
| touchID = 0; | |
| if ((ele === target && Math.abs(o.x - x) < threshold && Math.abs(o.y - y) < threshold) || $.data(ele, touchTargetPropertyName) === o.touchID){ | |
| // XXX: We may want to consider removing matches from the block list | |
| // instead of waiting for the reset timer to fire. | |
| e.preventDefault(); | |
| e.stopPropagation(); | |
| return; | |
| } | |
| } | |
| ele = ele.parentNode; | |
| } | |
| } | |
| }, true); | |
| } | |
| })(jQuery, window, document); | |
| /* | |
| * jQuery Mobile Framework : events | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| (function($, undefined ) { | |
| // add new event shortcuts | |
| $.each( "touchstart touchmove touchend orientationchange throttledresize tap taphold swipe swipeleft swiperight scrollstart scrollstop".split( " " ), function( i, name ) { | |
| $.fn[ name ] = function( fn ) { | |
| return fn ? this.bind( name, fn ) : this.trigger( name ); | |
| }; | |
| $.attrFn[ name ] = true; | |
| }); | |
| var supportTouch = $.support.touch, | |
| scrollEvent = "touchmove scroll", | |
| touchStartEvent = supportTouch ? "touchstart" : "mousedown", | |
| touchStopEvent = supportTouch ? "touchend" : "mouseup", | |
| touchMoveEvent = supportTouch ? "touchmove" : "mousemove"; | |
| function triggerCustomEvent(obj, eventType, event) | |
| { | |
| var originalType = event.type; | |
| event.type = eventType; | |
| $.event.handle.call( obj, event ); | |
| event.type = originalType; | |
| } | |
| // also handles scrollstop | |
| $.event.special.scrollstart = { | |
| enabled: true, | |
| setup: function() { | |
| var thisObject = this, | |
| $this = $( thisObject ), | |
| scrolling, | |
| timer; | |
| function trigger( event, state ) { | |
| scrolling = state; | |
| triggerCustomEvent( thisObject, scrolling ? "scrollstart" : "scrollstop", event ); | |
| } | |
| // iPhone triggers scroll after a small delay; use touchmove instead | |
| $this.bind( scrollEvent, function( event ) { | |
| if ( !$.event.special.scrollstart.enabled ) { | |
| return; | |
| } | |
| if ( !scrolling ) { | |
| trigger( event, true ); | |
| } | |
| clearTimeout( timer ); | |
| timer = setTimeout(function() { | |
| trigger( event, false ); | |
| }, 50 ); | |
| }); | |
| } | |
| }; | |
| // also handles taphold | |
| $.event.special.tap = { | |
| setup: function() { | |
| var thisObject = this, | |
| $this = $( thisObject ); | |
| $this | |
| .bind("vmousedown", function( event ) { | |
| if ( event.which && event.which !== 1 ) { | |
| return false; | |
| } | |
| var touching = true, | |
| origTarget = event.target, | |
| origEvent = event.originalEvent, | |
| timer; | |
| function clearTapHandlers() { | |
| touching = false; | |
| clearTimeout(timer); | |
| $this.unbind("vclick", clickHandler).unbind("vmousecancel", clearTapHandlers); | |
| } | |
| function clickHandler(event) { | |
| clearTapHandlers(); | |
| /* ONLY trigger a 'tap' event if the start target is | |
| * the same as the stop target. | |
| */ | |
| if ( origTarget == event.target ) { | |
| triggerCustomEvent( thisObject, "tap", event ); | |
| } | |
| } | |
| $this.bind("vmousecancel", clearTapHandlers).bind("vclick", clickHandler); | |
| timer = setTimeout(function() { | |
| if ( touching ) { | |
| triggerCustomEvent( thisObject, "taphold", event ); | |
| } | |
| }, 750 ); | |
| }); | |
| } | |
| }; | |
| // also handles swipeleft, swiperight | |
| $.event.special.swipe = { | |
| setup: function() { | |
| var thisObject = this, | |
| $this = $( thisObject ); | |
| $this | |
| .bind( touchStartEvent, function( event ) { | |
| var data = event.originalEvent.touches ? | |
| event.originalEvent.touches[ 0 ] : | |
| event, | |
| start = { | |
| time: (new Date).getTime(), | |
| coords: [ data.pageX, data.pageY ], | |
| origin: $( event.target ) | |
| }, | |
| stop; | |
| function moveHandler( event ) { | |
| if ( !start ) { | |
| return; | |
| } | |
| var data = event.originalEvent.touches ? | |
| event.originalEvent.touches[ 0 ] : | |
| event; | |
| stop = { | |
| time: (new Date).getTime(), | |
| coords: [ data.pageX, data.pageY ] | |
| }; | |
| // prevent scrolling | |
| if ( Math.abs( start.coords[0] - stop.coords[0] ) > 10 ) { | |
| event.preventDefault(); | |
| } | |
| } | |
| $this | |
| .bind( touchMoveEvent, moveHandler ) | |
| .one( touchStopEvent, function( event ) { | |
| $this.unbind( touchMoveEvent, moveHandler ); | |
| if ( start && stop ) { | |
| if ( stop.time - start.time < 1000 && | |
| Math.abs( start.coords[0] - stop.coords[0]) > 30 && | |
| Math.abs( start.coords[1] - stop.coords[1]) < 75 ) { | |
| start.origin | |
| .trigger( "swipe" ) | |
| .trigger( start.coords[0] > stop.coords[0] ? "swipeleft" : "swiperight" ); | |
| } | |
| } | |
| start = stop = undefined; | |
| }); | |
| }); | |
| } | |
| }; | |
| (function($){ | |
| // "Cowboy" Ben Alman | |
| var win = $(window), | |
| special_event, | |
| get_orientation, | |
| last_orientation; | |
| $.event.special.orientationchange = special_event = { | |
| setup: function(){ | |
| // If the event is supported natively, return false so that jQuery | |
| // will bind to the event using DOM methods. | |
| if ( $.support.orientation ) { return false; } | |
| // Get the current orientation to avoid initial double-triggering. | |
| last_orientation = get_orientation(); | |
| // Because the orientationchange event doesn't exist, simulate the | |
| // event by testing window dimensions on resize. | |
| win.bind( "throttledresize", handler ); | |
| }, | |
| teardown: function(){ | |
| // If the event is not supported natively, return false so that | |
| // jQuery will unbind the event using DOM methods. | |
| if ( $.support.orientation ) { return false; } | |
| // Because the orientationchange event doesn't exist, unbind the | |
| // resize event handler. | |
| win.unbind( "throttledresize", handler ); | |
| }, | |
| add: function( handleObj ) { | |
| // Save a reference to the bound event handler. | |
| var old_handler = handleObj.handler; | |
| handleObj.handler = function( event ) { | |
| // Modify event object, adding the .orientation property. | |
| event.orientation = get_orientation(); | |
| // Call the originally-bound event handler and return its result. | |
| return old_handler.apply( this, arguments ); | |
| }; | |
| } | |
| }; | |
| // If the event is not supported natively, this handler will be bound to | |
| // the window resize event to simulate the orientationchange event. | |
| function handler() { | |
| // Get the current orientation. | |
| var orientation = get_orientation(); | |
| if ( orientation !== last_orientation ) { | |
| // The orientation has changed, so trigger the orientationchange event. | |
| last_orientation = orientation; | |
| win.trigger( "orientationchange" ); | |
| } | |
| }; | |
| // Get the current page orientation. This method is exposed publicly, should it | |
| // be needed, as jQuery.event.special.orientationchange.orientation() | |
| $.event.special.orientationchange.orientation = get_orientation = function() { | |
| var elem = document.documentElement; | |
| return elem && elem.clientWidth / elem.clientHeight < 1.1 ? "portrait" : "landscape"; | |
| }; | |
| })(jQuery); | |
| // throttled resize event | |
| (function(){ | |
| $.event.special.throttledresize = { | |
| setup: function() { | |
| $( this ).bind( "resize", handler ); | |
| }, | |
| teardown: function(){ | |
| $( this ).unbind( "resize", handler ); | |
| } | |
| }; | |
| var throttle = 250, | |
| handler = function(){ | |
| curr = ( new Date() ).getTime(); | |
| diff = curr - lastCall; | |
| if( diff >= throttle ){ | |
| lastCall = curr; | |
| $( this ).trigger( "throttledresize" ); | |
| } | |
| else{ | |
| if( heldCall ){ | |
| clearTimeout( heldCall ); | |
| } | |
| //promise a held call will still execute | |
| heldCall = setTimeout( handler, throttle - diff ); | |
| } | |
| }, | |
| lastCall = 0, | |
| heldCall, | |
| curr, | |
| diff; | |
| })(); | |
| $.each({ | |
| scrollstop: "scrollstart", | |
| taphold: "tap", | |
| swipeleft: "swipe", | |
| swiperight: "swipe" | |
| }, function( event, sourceEvent ) { | |
| $.event.special[ event ] = { | |
| setup: function() { | |
| $( this ).bind( sourceEvent, $.noop ); | |
| } | |
| }; | |
| }); | |
| })( jQuery ); | |
| /*! | |
| * jQuery hashchange event - v1.3 - 7/21/2010 | |
| * http://benalman.com/projects/jquery-hashchange-plugin/ | |
| * | |
| * Copyright (c) 2010 "Cowboy" Ben Alman | |
| * Dual licensed under the MIT and GPL licenses. | |
| * http://benalman.com/about/license/ | |
| */ | |
| // Script: jQuery hashchange event | |
| // | |
| // *Version: 1.3, Last updated: 7/21/2010* | |
| // | |
| // Project Home - http://benalman.com/projects/jquery-hashchange-plugin/ | |
| // GitHub - http://github.com/cowboy/jquery-hashchange/ | |
| // Source - http://github.com/cowboy/jquery-hashchange/raw/master/jquery.ba-hashchange.js | |
| // (Minified) - http://github.com/cowboy/jquery-hashchange/raw/master/jquery.ba-hashchange.min.js (0.8kb gzipped) | |
| // | |
| // About: License | |
| // | |
| // Copyright (c) 2010 "Cowboy" Ben Alman, | |
| // Dual licensed under the MIT and GPL licenses. | |
| // http://benalman.com/about/license/ | |
| // | |
| // About: Examples | |
| // | |
| // These working examples, complete with fully commented code, illustrate a few | |
| // ways in which this plugin can be used. | |
| // | |
| // hashchange event - http://benalman.com/code/projects/jquery-hashchange/examples/hashchange/ | |
| // document.domain - http://benalman.com/code/projects/jquery-hashchange/examples/document_domain/ | |
| // | |
| // About: Support and Testing | |
| // | |
| // Information about what version or versions of jQuery this plugin has been | |
| // tested with, what browsers it has been tested in, and where the unit tests | |
| // reside (so you can test it yourself). | |
| // | |
| // jQuery Versions - 1.2.6, 1.3.2, 1.4.1, 1.4.2 | |
| // Browsers Tested - Internet Explorer 6-8, Firefox 2-4, Chrome 5-6, Safari 3.2-5, | |
| // Opera 9.6-10.60, iPhone 3.1, Android 1.6-2.2, BlackBerry 4.6-5. | |
| // Unit Tests - http://benalman.com/code/projects/jquery-hashchange/unit/ | |
| // | |
| // About: Known issues | |
| // | |
| // While this jQuery hashchange event implementation is quite stable and | |
| // robust, there are a few unfortunate browser bugs surrounding expected | |
| // hashchange event-based behaviors, independent of any JavaScript | |
| // window.onhashchange abstraction. See the following examples for more | |
| // information: | |
| // | |
| // Chrome: Back Button - http://benalman.com/code/projects/jquery-hashchange/examples/bug-chrome-back-button/ | |
| // Firefox: Remote XMLHttpRequest - http://benalman.com/code/projects/jquery-hashchange/examples/bug-firefox-remote-xhr/ | |
| // WebKit: Back Button in an Iframe - http://benalman.com/code/projects/jquery-hashchange/examples/bug-webkit-hash-iframe/ | |
| // Safari: Back Button from a different domain - http://benalman.com/code/projects/jquery-hashchange/examples/bug-safari-back-from-diff-domain/ | |
| // | |
| // Also note that should a browser natively support the window.onhashchange | |
| // event, but not report that it does, the fallback polling loop will be used. | |
| // | |
| // About: Release History | |
| // | |
| // 1.3 - (7/21/2010) Reorganized IE6/7 Iframe code to make it more | |
| // "removable" for mobile-only development. Added IE6/7 document.title | |
| // support. Attempted to make Iframe as hidden as possible by using | |
| // techniques from http://www.paciellogroup.com/blog/?p=604. Added | |
| // support for the "shortcut" format $(window).hashchange( fn ) and | |
| // $(window).hashchange() like jQuery provides for built-in events. | |
| // Renamed jQuery.hashchangeDelay to <jQuery.fn.hashchange.delay> and | |
| // lowered its default value to 50. Added <jQuery.fn.hashchange.domain> | |
| // and <jQuery.fn.hashchange.src> properties plus document-domain.html | |
| // file to address access denied issues when setting document.domain in | |
| // IE6/7. | |
| // 1.2 - (2/11/2010) Fixed a bug where coming back to a page using this plugin | |
| // from a page on another domain would cause an error in Safari 4. Also, | |
| // IE6/7 Iframe is now inserted after the body (this actually works), | |
| // which prevents the page from scrolling when the event is first bound. | |
| // Event can also now be bound before DOM ready, but it won't be usable | |
| // before then in IE6/7. | |
| // 1.1 - (1/21/2010) Incorporated document.documentMode test to fix IE8 bug | |
| // where browser version is incorrectly reported as 8.0, despite | |
| // inclusion of the X-UA-Compatible IE=EmulateIE7 meta tag. | |
| // 1.0 - (1/9/2010) Initial Release. Broke out the jQuery BBQ event.special | |
| // window.onhashchange functionality into a separate plugin for users | |
| // who want just the basic event & back button support, without all the | |
| // extra awesomeness that BBQ provides. This plugin will be included as | |
| // part of jQuery BBQ, but also be available separately. | |
| (function($,window,undefined){ | |
| '$:nomunge'; // Used by YUI compressor. | |
| // Reused string. | |
| var str_hashchange = 'hashchange', | |
| // Method / object references. | |
| doc = document, | |
| fake_onhashchange, | |
| special = $.event.special, | |
| // Does the browser support window.onhashchange? Note that IE8 running in | |
| // IE7 compatibility mode reports true for 'onhashchange' in window, even | |
| // though the event isn't supported, so also test document.documentMode. | |
| doc_mode = doc.documentMode, | |
| supports_onhashchange = 'on' + str_hashchange in window && ( doc_mode === undefined || doc_mode > 7 ); | |
| // Get location.hash (or what you'd expect location.hash to be) sans any | |
| // leading #. Thanks for making this necessary, Firefox! | |
| function get_fragment( url ) { | |
| url = url || location.href; | |
| return '#' + url.replace( /^[^#]*#?(.*)$/, '$1' ); | |
| }; | |
| // Method: jQuery.fn.hashchange | |
| // | |
| // Bind a handler to the window.onhashchange event or trigger all bound | |
| // window.onhashchange event handlers. This behavior is consistent with | |
| // jQuery's built-in event handlers. | |
| // | |
| // Usage: | |
| // | |
| // > jQuery(window).hashchange( [ handler ] ); | |
| // | |
| // Arguments: | |
| // | |
| // handler - (Function) Optional handler to be bound to the hashchange | |
| // event. This is a "shortcut" for the more verbose form: | |
| // jQuery(window).bind( 'hashchange', handler ). If handler is omitted, | |
| // all bound window.onhashchange event handlers will be triggered. This | |
| // is a shortcut for the more verbose | |
| // jQuery(window).trigger( 'hashchange' ). These forms are described in | |
| // the <hashchange event> section. | |
| // | |
| // Returns: | |
| // | |
| // (jQuery) The initial jQuery collection of elements. | |
| // Allow the "shortcut" format $(elem).hashchange( fn ) for binding and | |
| // $(elem).hashchange() for triggering, like jQuery does for built-in events. | |
| $.fn[ str_hashchange ] = function( fn ) { | |
| return fn ? this.bind( str_hashchange, fn ) : this.trigger( str_hashchange ); | |
| }; | |
| // Property: jQuery.fn.hashchange.delay | |
| // | |
| // The numeric interval (in milliseconds) at which the <hashchange event> | |
| // polling loop executes. Defaults to 50. | |
| // Property: jQuery.fn.hashchange.domain | |
| // | |
| // If you're setting document.domain in your JavaScript, and you want hash | |
| // history to work in IE6/7, not only must this property be set, but you must | |
| // also set document.domain BEFORE jQuery is loaded into the page. This | |
| // property is only applicable if you are supporting IE6/7 (or IE8 operating | |
| // in "IE7 compatibility" mode). | |
| // | |
| // In addition, the <jQuery.fn.hashchange.src> property must be set to the | |
| // path of the included "document-domain.html" file, which can be renamed or | |
| // modified if necessary (note that the document.domain specified must be the | |
| // same in both your main JavaScript as well as in this file). | |
| // | |
| // Usage: | |
| // | |
| // jQuery.fn.hashchange.domain = document.domain; | |
| // Property: jQuery.fn.hashchange.src | |
| // | |
| // If, for some reason, you need to specify an Iframe src file (for example, | |
| // when setting document.domain as in <jQuery.fn.hashchange.domain>), you can | |
| // do so using this property. Note that when using this property, history | |
| // won't be recorded in IE6/7 until the Iframe src file loads. This property | |
| // is only applicable if you are supporting IE6/7 (or IE8 operating in "IE7 | |
| // compatibility" mode). | |
| // | |
| // Usage: | |
| // | |
| // jQuery.fn.hashchange.src = 'path/to/file.html'; | |
| $.fn[ str_hashchange ].delay = 50; | |
| /* | |
| $.fn[ str_hashchange ].domain = null; | |
| $.fn[ str_hashchange ].src = null; | |
| */ | |
| // Event: hashchange event | |
| // | |
| // Fired when location.hash changes. In browsers that support it, the native | |
| // HTML5 window.onhashchange event is used, otherwise a polling loop is | |
| // initialized, running every <jQuery.fn.hashchange.delay> milliseconds to | |
| // see if the hash has changed. In IE6/7 (and IE8 operating in "IE7 | |
| // compatibility" mode), a hidden Iframe is created to allow the back button | |
| // and hash-based history to work. | |
| // | |
| // Usage as described in <jQuery.fn.hashchange>: | |
| // | |
| // > // Bind an event handler. | |
| // > jQuery(window).hashchange( function(e) { | |
| // > var hash = location.hash; | |
| // > ... | |
| // > }); | |
| // > | |
| // > // Manually trigger the event handler. | |
| // > jQuery(window).hashchange(); | |
| // | |
| // A more verbose usage that allows for event namespacing: | |
| // | |
| // > // Bind an event handler. | |
| // > jQuery(window).bind( 'hashchange', function(e) { | |
| // > var hash = location.hash; | |
| // > ... | |
| // > }); | |
| // > | |
| // > // Manually trigger the event handler. | |
| // > jQuery(window).trigger( 'hashchange' ); | |
| // | |
| // Additional Notes: | |
| // | |
| // * The polling loop and Iframe are not created until at least one handler | |
| // is actually bound to the 'hashchange' event. | |
| // * If you need the bound handler(s) to execute immediately, in cases where | |
| // a location.hash exists on page load, via bookmark or page refresh for | |
| // example, use jQuery(window).hashchange() or the more verbose | |
| // jQuery(window).trigger( 'hashchange' ). | |
| // * The event can be bound before DOM ready, but since it won't be usable | |
| // before then in IE6/7 (due to the necessary Iframe), recommended usage is | |
| // to bind it inside a DOM ready handler. | |
| // Override existing $.event.special.hashchange methods (allowing this plugin | |
| // to be defined after jQuery BBQ in BBQ's source code). | |
| special[ str_hashchange ] = $.extend( special[ str_hashchange ], { | |
| // Called only when the first 'hashchange' event is bound to window. | |
| setup: function() { | |
| // If window.onhashchange is supported natively, there's nothing to do.. | |
| if ( supports_onhashchange ) { return false; } | |
| // Otherwise, we need to create our own. And we don't want to call this | |
| // until the user binds to the event, just in case they never do, since it | |
| // will create a polling loop and possibly even a hidden Iframe. | |
| $( fake_onhashchange.start ); | |
| }, | |
| // Called only when the last 'hashchange' event is unbound from window. | |
| teardown: function() { | |
| // If window.onhashchange is supported natively, there's nothing to do.. | |
| if ( supports_onhashchange ) { return false; } | |
| // Otherwise, we need to stop ours (if possible). | |
| $( fake_onhashchange.stop ); | |
| } | |
| }); | |
| // fake_onhashchange does all the work of triggering the window.onhashchange | |
| // event for browsers that don't natively support it, including creating a | |
| // polling loop to watch for hash changes and in IE 6/7 creating a hidden | |
| // Iframe to enable back and forward. | |
| fake_onhashchange = (function(){ | |
| var self = {}, | |
| timeout_id, | |
| // Remember the initial hash so it doesn't get triggered immediately. | |
| last_hash = get_fragment(), | |
| fn_retval = function(val){ return val; }, | |
| history_set = fn_retval, | |
| history_get = fn_retval; | |
| // Start the polling loop. | |
| self.start = function() { | |
| timeout_id || poll(); | |
| }; | |
| // Stop the polling loop. | |
| self.stop = function() { | |
| timeout_id && clearTimeout( timeout_id ); | |
| timeout_id = undefined; | |
| }; | |
| // This polling loop checks every $.fn.hashchange.delay milliseconds to see | |
| // if location.hash has changed, and triggers the 'hashchange' event on | |
| // window when necessary. | |
| function poll() { | |
| var hash = get_fragment(), | |
| history_hash = history_get( last_hash ); | |
| if ( hash !== last_hash ) { | |
| history_set( last_hash = hash, history_hash ); | |
| $(window).trigger( str_hashchange ); | |
| } else if ( history_hash !== last_hash ) { | |
| location.href = location.href.replace( /#.*/, '' ) + history_hash; | |
| } | |
| timeout_id = setTimeout( poll, $.fn[ str_hashchange ].delay ); | |
| }; | |
| // vvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvv | |
| // vvvvvvvvvvvvvvvvvvv REMOVE IF NOT SUPPORTING IE6/7/8 vvvvvvvvvvvvvvvvvvv | |
| // vvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvv | |
| $.browser.msie && !supports_onhashchange && (function(){ | |
| // Not only do IE6/7 need the "magical" Iframe treatment, but so does IE8 | |
| // when running in "IE7 compatibility" mode. | |
| var iframe, | |
| iframe_src; | |
| // When the event is bound and polling starts in IE 6/7, create a hidden | |
| // Iframe for history handling. | |
| self.start = function(){ | |
| if ( !iframe ) { | |
| iframe_src = $.fn[ str_hashchange ].src; | |
| iframe_src = iframe_src && iframe_src + get_fragment(); | |
| // Create hidden Iframe. Attempt to make Iframe as hidden as possible | |
| // by using techniques from http://www.paciellogroup.com/blog/?p=604. | |
| iframe = $('<iframe tabindex="-1" title="empty"/>').hide() | |
| // When Iframe has completely loaded, initialize the history and | |
| // start polling. | |
| .one( 'load', function(){ | |
| iframe_src || history_set( get_fragment() ); | |
| poll(); | |
| }) | |
| // Load Iframe src if specified, otherwise nothing. | |
| .attr( 'src', iframe_src || 'javascript:0' ) | |
| // Append Iframe after the end of the body to prevent unnecessary | |
| // initial page scrolling (yes, this works). | |
| .insertAfter( 'body' )[0].contentWindow; | |
| // Whenever `document.title` changes, update the Iframe's title to | |
| // prettify the back/next history menu entries. Since IE sometimes | |
| // errors with "Unspecified error" the very first time this is set | |
| // (yes, very useful) wrap this with a try/catch block. | |
| doc.onpropertychange = function(){ | |
| try { | |
| if ( event.propertyName === 'title' ) { | |
| iframe.document.title = doc.title; | |
| } | |
| } catch(e) {} | |
| }; | |
| } | |
| }; | |
| // Override the "stop" method since an IE6/7 Iframe was created. Even | |
| // if there are no longer any bound event handlers, the polling loop | |
| // is still necessary for back/next to work at all! | |
| self.stop = fn_retval; | |
| // Get history by looking at the hidden Iframe's location.hash. | |
| history_get = function() { | |
| return get_fragment( iframe.location.href ); | |
| }; | |
| // Set a new history item by opening and then closing the Iframe | |
| // document, *then* setting its location.hash. If document.domain has | |
| // been set, update that as well. | |
| history_set = function( hash, history_hash ) { | |
| var iframe_doc = iframe.document, | |
| domain = $.fn[ str_hashchange ].domain; | |
| if ( hash !== history_hash ) { | |
| // Update Iframe with any initial `document.title` that might be set. | |
| iframe_doc.title = doc.title; | |
| // Opening the Iframe's document after it has been closed is what | |
| // actually adds a history entry. | |
| iframe_doc.open(); | |
| // Set document.domain for the Iframe document as well, if necessary. | |
| domain && iframe_doc.write( '<script>document.domain="' + domain + '"</script>' ); | |
| iframe_doc.close(); | |
| // Update the Iframe's hash, for great justice. | |
| iframe.location.hash = hash; | |
| } | |
| }; | |
| })(); | |
| // ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ | |
| // ^^^^^^^^^^^^^^^^^^^ REMOVE IF NOT SUPPORTING IE6/7/8 ^^^^^^^^^^^^^^^^^^^ | |
| // ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ | |
| return self; | |
| })(); | |
| })(jQuery,this); | |
| /* | |
| * jQuery Mobile Framework : "page" plugin | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| (function($, undefined ) { | |
| $.widget( "mobile.page", $.mobile.widget, { | |
| options: { | |
| backBtnText: "Back", | |
| addBackBtn: false, | |
| backBtnTheme: null, | |
| degradeInputs: { | |
| color: false, | |
| date: false, | |
| datetime: false, | |
| "datetime-local": false, | |
| email: false, | |
| month: false, | |
| number: false, | |
| range: "number", | |
| search: true, | |
| tel: false, | |
| time: false, | |
| url: false, | |
| week: false | |
| }, | |
| keepNative: null | |
| }, | |
| _create: function() { | |
| var $elem = this.element, | |
| o = this.options; | |
| this.keepNative = ":jqmData(role='none'), :jqmData(role='nojs')" + (o.keepNative ? ", " + o.keepNative : ""); | |
| if ( this._trigger( "beforeCreate" ) === false ) { | |
| return; | |
| } | |
| //some of the form elements currently rely on the presence of ui-page and ui-content | |
| // classes so we'll handle page and content roles outside of the main role processing | |
| // loop below. | |
| $elem.find( ":jqmData(role='page'), :jqmData(role='content')" ).andSelf().each(function() { | |
| $(this).addClass( "ui-" + $(this).jqmData( "role" ) ); | |
| }); | |
| $elem.find( ":jqmData(role='nojs')" ).addClass( "ui-nojs" ); | |
| // pre-find data els | |
| var $dataEls = $elem.find( ":jqmData(role)" ).andSelf().each(function() { | |
| var $this = $( this ), | |
| role = $this.jqmData( "role" ), | |
| theme = $this.jqmData( "theme" ); | |
| //apply theming and markup modifications to page,header,content,footer | |
| if ( role === "header" || role === "footer" ) { | |
| $this.addClass( "ui-bar-" + (theme || $this.parent( ":jqmData(role='page')" ).jqmData( "theme" ) || "a") ); | |
| // add ARIA role | |
| $this.attr( "role", role === "header" ? "banner" : "contentinfo" ); | |
| //right,left buttons | |
| var $headeranchors = $this.children( "a" ), | |
| leftbtn = $headeranchors.hasClass( "ui-btn-left" ), | |
| rightbtn = $headeranchors.hasClass( "ui-btn-right" ); | |
| if ( !leftbtn ) { | |
| leftbtn = $headeranchors.eq( 0 ).not( ".ui-btn-right" ).addClass( "ui-btn-left" ).length; | |
| } | |
| if ( !rightbtn ) { | |
| rightbtn = $headeranchors.eq( 1 ).addClass( "ui-btn-right" ).length; | |
| } | |
| // auto-add back btn on pages beyond first view | |
| if ( o.addBackBtn && role === "header" && | |
| $( ".ui-page" ).length > 1 && | |
| $elem.jqmData( "url" ) !== $.mobile.path.stripHash( location.hash ) && | |
| !leftbtn && $this.jqmData( "backbtn" ) !== false ) { | |
| var backBtn = $( "<a href='#' class='ui-btn-left' data-"+ $.mobile.ns +"rel='back' data-"+ $.mobile.ns +"icon='arrow-l'>"+ o.backBtnText +"</a>" ).prependTo( $this ); | |
| //if theme is provided, override default inheritance | |
| if( o.backBtnTheme ){ | |
| backBtn.attr( "data-"+ $.mobile.ns +"theme", o.backBtnTheme ); | |
| } | |
| } | |
| //page title | |
| $this.children( "h1, h2, h3, h4, h5, h6" ) | |
| .addClass( "ui-title" ) | |
| //regardless of h element number in src, it becomes h1 for the enhanced page | |
| .attr({ "tabindex": "0", "role": "heading", "aria-level": "1" }); | |
| } else if ( role === "content" ) { | |
| if ( theme ) { | |
| $this.addClass( "ui-body-" + theme ); | |
| } | |
| // add ARIA role | |
| $this.attr( "role", "main" ); | |
| } else if ( role === "page" ) { | |
| $this.addClass( "ui-body-" + (theme || "c") ); | |
| } | |
| switch(role) { | |
| case "header": | |
| case "footer": | |
| case "page": | |
| case "content": | |
| $this.addClass( "ui-" + role ); | |
| break; | |
| case "collapsible": | |
| case "fieldcontain": | |
| case "navbar": | |
| case "listview": | |
| case "dialog": | |
| $this[ role ](); | |
| break; | |
| } | |
| }); | |
| //enhance form controls | |
| this._enhanceControls(); | |
| //links in bars, or those with data-role become buttons | |
| $elem.find( ":jqmData(role='button'), .ui-bar > a, .ui-header > a, .ui-footer > a" ) | |
| .not( ".ui-btn" ) | |
| .not(this.keepNative) | |
| .buttonMarkup(); | |
| $elem | |
| .find(":jqmData(role='controlgroup')") | |
| .controlgroup(); | |
| //links within content areas | |
| $elem.find( "a:not(.ui-btn):not(.ui-link-inherit)" ) | |
| .not(this.keepNative) | |
| .addClass( "ui-link" ); | |
| //fix toolbars | |
| $elem.fixHeaderFooter(); | |
| }, | |
| _typeAttributeRegex: /\s+type=["']?\w+['"]?/, | |
| _enhanceControls: function() { | |
| var o = this.options, self = this; | |
| // degrade inputs to avoid poorly implemented native functionality | |
| this.element.find( "input" ).not(this.keepNative).each(function() { | |
| var type = this.getAttribute( "type" ), | |
| optType = o.degradeInputs[ type ] || "text"; | |
| if ( o.degradeInputs[ type ] ) { | |
| $( this ).replaceWith( | |
| $( "<div>" ).html( $(this).clone() ).html() | |
| .replace( self._typeAttributeRegex, " type=\""+ optType +"\" data-" + $.mobile.ns + "type=\""+type+"\" " ) ); | |
| } | |
| }); | |
| // We re-find form elements since the degredation code above | |
| // may have injected new elements. We cache the non-native control | |
| // query to reduce the number of times we search through the entire page. | |
| var allControls = this.element.find("input, textarea, select, button"), | |
| nonNativeControls = allControls.not(this.keepNative); | |
| // XXX: Temporary workaround for issue 785. Turn off autocorrect and | |
| // autocomplete since the popup they use can't be dismissed by | |
| // the user. Note that we test for the presence of the feature | |
| // by looking for the autocorrect property on the input element. | |
| var textInputs = allControls.filter( "input[type=text]" ); | |
| if (textInputs.length && typeof textInputs[0].autocorrect !== "undefined") { | |
| textInputs.each(function(){ | |
| // Set the attribute instead of the property just in case there | |
| // is code that attempts to make modifications via HTML. | |
| this.setAttribute("autocorrect", "off"); | |
| this.setAttribute("autocomplete", "off"); | |
| }); | |
| } | |
| // enchance form controls | |
| nonNativeControls | |
| .filter( "[type='radio'], [type='checkbox']" ) | |
| .checkboxradio(); | |
| nonNativeControls | |
| .filter( "button, [type='button'], [type='submit'], [type='reset'], [type='image']" ) | |
| .button(); | |
| nonNativeControls | |
| .filter( "input, textarea" ) | |
| .not( "[type='radio'], [type='checkbox'], [type='button'], [type='submit'], [type='reset'], [type='image'], [type='hidden']" ) | |
| .textinput(); | |
| nonNativeControls | |
| .filter( "input, select" ) | |
| .filter( ":jqmData(role='slider'), :jqmData(type='range')" ) | |
| .slider(); | |
| nonNativeControls | |
| .filter( "select:not(:jqmData(role='slider'))" ) | |
| .selectmenu(); | |
| } | |
| }); | |
| })( jQuery ); | |
| /*! | |
| * jQuery Mobile v@VERSION | |
| * http://jquerymobile.com/ | |
| * | |
| * Copyright 2010, jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| (function( $, window, undefined ) { | |
| //jQuery.mobile configurable options | |
| $.extend( $.mobile, { | |
| //namespace used framework-wide for data-attrs. Default is no namespace | |
| ns: "", | |
| //define the url parameter used for referencing widget-generated sub-pages. | |
| //Translates to to example.html&ui-page=subpageIdentifier | |
| //hash segment before &ui-page= is used to make Ajax request | |
| subPageUrlKey: "ui-page", | |
| //anchor links with a data-rel, or pages with a data-role, that match these selectors will be untrackable in history | |
| //(no change in URL, not bookmarkable) | |
| nonHistorySelectors: "dialog", | |
| //class assigned to page currently in view, and during transitions | |
| activePageClass: "ui-page-active", | |
| //class used for "active" button state, from CSS framework | |
| activeBtnClass: "ui-btn-active", | |
| //automatically handle clicks and form submissions through Ajax, when same-domain | |
| ajaxEnabled: true, | |
| //When enabled, clicks and taps that result in Ajax page changes will happen slightly sooner on touch devices. | |
| //Also, it will prevent the address bar from appearing on platforms like iOS during page transitions. | |
| //This option has no effect on non-touch devices, but enabling it may interfere with jQuery plugins that bind to click events | |
| useFastClick: true, | |
| //automatically load and show pages based on location.hash | |
| hashListeningEnabled: true, | |
| //set default page transition - 'none' for no transitions | |
| defaultPageTransition: "slide", | |
| //minimum scroll distance that will be remembered when returning to a page | |
| minScrollBack: screen.height / 2, | |
| //set default dialog transition - 'none' for no transitions | |
| defaultDialogTransition: "pop", | |
| //show loading message during Ajax requests | |
| //if false, message will not appear, but loading classes will still be toggled on html el | |
| loadingMessage: "loading", | |
| //error response message - appears when an Ajax page request fails | |
| pageLoadErrorMessage: "Error Loading Page", | |
| //support conditions that must be met in order to proceed | |
| //default enhanced qualifications are media query support OR IE 7+ | |
| gradeA: function(){ | |
| return $.support.mediaquery || $.mobile.browser.ie && $.mobile.browser.ie >= 7; | |
| }, | |
| //TODO might be useful upstream in jquery itself ? | |
| keyCode: { | |
| ALT: 18, | |
| BACKSPACE: 8, | |
| CAPS_LOCK: 20, | |
| COMMA: 188, | |
| COMMAND: 91, | |
| COMMAND_LEFT: 91, // COMMAND | |
| COMMAND_RIGHT: 93, | |
| CONTROL: 17, | |
| DELETE: 46, | |
| DOWN: 40, | |
| END: 35, | |
| ENTER: 13, | |
| ESCAPE: 27, | |
| HOME: 36, | |
| INSERT: 45, | |
| LEFT: 37, | |
| MENU: 93, // COMMAND_RIGHT | |
| NUMPAD_ADD: 107, | |
| NUMPAD_DECIMAL: 110, | |
| NUMPAD_DIVIDE: 111, | |
| NUMPAD_ENTER: 108, | |
| NUMPAD_MULTIPLY: 106, | |
| NUMPAD_SUBTRACT: 109, | |
| PAGE_DOWN: 34, | |
| PAGE_UP: 33, | |
| PERIOD: 190, | |
| RIGHT: 39, | |
| SHIFT: 16, | |
| SPACE: 32, | |
| TAB: 9, | |
| UP: 38, | |
| WINDOWS: 91 // COMMAND | |
| }, | |
| //scroll page vertically: scroll to 0 to hide iOS address bar, or pass a Y value | |
| silentScroll: function( ypos ) { | |
| if( $.type( ypos ) !== "number" ){ | |
| ypos = $.mobile.defaultHomeScroll; | |
| } | |
| // prevent scrollstart and scrollstop events | |
| $.event.special.scrollstart.enabled = false; | |
| setTimeout(function() { | |
| window.scrollTo( 0, ypos ); | |
| $(document).trigger( "silentscroll", { x: 0, y: ypos }); | |
| },20); | |
| setTimeout(function() { | |
| $.event.special.scrollstart.enabled = true; | |
| }, 150 ); | |
| }, | |
| // compile the namespace normalization regex once | |
| normalizeRegex: /-([a-z])/g, | |
| // take a data attribute property, prepend the namespace | |
| // and then camel case the attribute string | |
| nsNormalize: function(prop){ | |
| if(!prop) return; | |
| return $.camelCase( $.mobile.ns + prop ); | |
| } | |
| }); | |
| //mobile version of data and removeData and hasData methods | |
| //ensures all data is set and retrieved using jQuery Mobile's data namespace | |
| $.fn.jqmData = function( prop, value ){ | |
| return this.data( prop ? $.mobile.nsNormalize(prop) : prop, value ); | |
| }; | |
| $.jqmData = function( elem, prop, value ){ | |
| return $.data( elem, $.mobile.nsNormalize(prop), value ); | |
| }; | |
| $.fn.jqmRemoveData = function( prop ){ | |
| return this.removeData( $.mobile.nsNormalize(prop) ); | |
| }; | |
| $.jqmRemoveData = function( elem, prop ){ | |
| return $.removeData( elem, $.mobile.nsNormalize(prop) ); | |
| }; | |
| $.jqmHasData = function( elem, prop ){ | |
| return $.hasData( elem, $.mobile.nsNormalize(prop) ); | |
| }; | |
| // Monkey-patching Sizzle to filter the :jqmData selector | |
| var oldFind = $.find; | |
| $.find = function( selector, context, ret, extra ) { | |
| selector = selector.replace(/:jqmData\(([^)]*)\)/g, "[data-" + ($.mobile.ns || "") + "$1]"); | |
| return oldFind.call( this, selector, context, ret, extra ); | |
| }; | |
| $.extend( $.find, oldFind ); | |
| $.find.matches = function( expr, set ) { | |
| return $.find( expr, null, null, set ); | |
| }; | |
| $.find.matchesSelector = function( node, expr ) { | |
| return $.find( expr, null, null, [node] ).length > 0; | |
| }; | |
| })( jQuery, this ); | |
| /* | |
| * jQuery Mobile Framework : core utilities for auto ajax navigation, base tag mgmt, | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| ( function( $, undefined ) { | |
| //define vars for interal use | |
| var $window = $( window ), | |
| $html = $( 'html' ), | |
| $head = $( 'head' ), | |
| //url path helpers for use in relative url management | |
| path = { | |
| // This scary looking regular expression parses an absolute URL or its relative | |
| // variants (protocol, site, document, query, and hash), into the various | |
| // components (protocol, host, path, query, fragment, etc that make up the | |
| // URL as well as some other commonly used sub-parts. When used with RegExp.exec() | |
| // or String.match, it parses the URL into a results array that looks like this: | |
| // | |
| // [0]: http://jblas:password@mycompany.com:8080/mail/inbox?msg=1234&type=unread#msg-content | |
| // [1]: http://jblas:password@mycompany.com:8080/mail/inbox?msg=1234&type=unread | |
| // [2]: http://jblas:password@mycompany.com:8080/mail/inbox | |
| // [3]: http://jblas:password@mycompany.com:8080 | |
| // [4]: http: | |
| // [5]: jblas:password@mycompany.com:8080 | |
| // [6]: jblas:password | |
| // [7]: jblas | |
| // [8]: password | |
| // [9]: mycompany.com:8080 | |
| // [10]: mycompany.com | |
| // [11]: 8080 | |
| // [12]: /mail/inbox | |
| // [13]: /mail/ | |
| // [14]: inbox | |
| // [15]: ?msg=1234&type=unread | |
| // [16]: #msg-content | |
| // | |
| urlParseRE: /^(((([^:\/#\?]+:)?(?:\/\/((?:(([^:@\/#\?]+)(?:\:([^:@\/#\?]+))?)@)?(([^:\/#\?]+)(?:\:([0-9]+))?))?)?)?((\/?(?:[^\/\?#]+\/+)*)([^\?#]*)))?(\?[^#]+)?)(#.*)?/, | |
| //Parse a URL into a structure that allows easy access to | |
| //all of the URL components by name. | |
| parseUrl: function( url ) { | |
| // If we're passed an object, we'll assume that it is | |
| // a parsed url object and just return it back to the caller. | |
| if ( typeof url === "object" ) { | |
| return url; | |
| } | |
| var u = url || "", | |
| matches = path.urlParseRE.exec( url ), | |
| results; | |
| if ( matches ) { | |
| // Create an object that allows the caller to access the sub-matches | |
| // by name. Note that IE returns an empty string instead of undefined, | |
| // like all other browsers do, so we normalize everything so its consistent | |
| // no matter what browser we're running on. | |
| results = { | |
| href: matches[0] || "", | |
| hrefNoHash: matches[1] || "", | |
| hrefNoSearch: matches[2] || "", | |
| domain: matches[3] || "", | |
| protocol: matches[4] || "", | |
| authority: matches[5] || "", | |
| username: matches[7] || "", | |
| password: matches[8] || "", | |
| host: matches[9] || "", | |
| hostname: matches[10] || "", | |
| port: matches[11] || "", | |
| pathname: matches[12] || "", | |
| directory: matches[13] || "", | |
| filename: matches[14] || "", | |
| search: matches[15] || "", | |
| hash: matches[16] || "" | |
| }; | |
| } | |
| return results || {}; | |
| }, | |
| //Turn relPath into an asbolute path. absPath is | |
| //an optional absolute path which describes what | |
| //relPath is relative to. | |
| makePathAbsolute: function( relPath, absPath ) { | |
| if ( relPath && relPath.charAt( 0 ) === "/" ) { | |
| return relPath; | |
| } | |
| relPath = relPath || ""; | |
| absPath = absPath ? absPath.replace( /^\/|\/?[^\/]*$/g, "" ) : ""; | |
| var absStack = absPath ? absPath.split( "/" ) : [], | |
| relStack = relPath.split( "/" ); | |
| for ( var i = 0; i < relStack.length; i++ ) { | |
| var d = relStack[ i ]; | |
| switch ( d ) { | |
| case ".": | |
| break; | |
| case "..": | |
| if ( absStack.length ) { | |
| absStack.pop(); | |
| } | |
| break; | |
| default: | |
| absStack.push( d ); | |
| break; | |
| } | |
| } | |
| return "/" + absStack.join( "/" ); | |
| }, | |
| //Returns true if both urls have the same domain. | |
| isSameDomain: function( absUrl1, absUrl2 ) { | |
| return path.parseUrl( absUrl1 ).domain === path.parseUrl( absUrl2 ).domain; | |
| }, | |
| //Returns true for any relative variant. | |
| isRelativeUrl: function( url ) { | |
| // All relative Url variants have one thing in common, no protocol. | |
| return path.parseUrl( url ).protocol === ""; | |
| }, | |
| //Returns true for an absolute url. | |
| isAbsoluteUrl: function( url ) { | |
| return path.parseUrl( url ).protocol !== ""; | |
| }, | |
| //Turn the specified realtive URL into an absolute one. This function | |
| //can handle all relative variants (protocol, site, document, query, fragment). | |
| makeUrlAbsolute: function( relUrl, absUrl ) { | |
| if ( !path.isRelativeUrl( relUrl ) ) { | |
| return relUrl; | |
| } | |
| var relObj = path.parseUrl( relUrl ), | |
| absObj = path.parseUrl( absUrl ), | |
| protocol = relObj.protocol || absObj.protocol, | |
| authority = relObj.authority || absObj.authority, | |
| hasPath = relObj.pathname !== "", | |
| pathname = path.makePathAbsolute( relObj.pathname || absObj.filename, absObj.pathname ), | |
| search = relObj.search || ( !hasPath && absObj.search ) || "", | |
| hash = relObj.hash; | |
| return protocol + "//" + authority + pathname + search + hash; | |
| }, | |
| //Add search (aka query) params to the specified url. | |
| addSearchParams: function( url, params ) { | |
| var u = path.parseUrl( url ), | |
| p = ( typeof params === "object" ) ? $.param( params ) : params, | |
| s = u.search || "?"; | |
| return u.hrefNoSearch + s + ( s.charAt( s.length - 1 ) !== "?" ? "&" : "" ) + p + ( u.hash || "" ); | |
| }, | |
| convertUrlToDataUrl: function( absUrl ) { | |
| var u = path.parseUrl( absUrl ); | |
| if ( path.isEmbeddedPage( u ) ) { | |
| return u.hash.replace( /^#/, "" ); | |
| } else if ( path.isSameDomain( u, documentBase ) ) { | |
| return u.hrefNoHash.replace( documentBase.domain, "" ); | |
| } | |
| return absUrl; | |
| }, | |
| //get path from current hash, or from a file path | |
| get: function( newPath ) { | |
| if( newPath === undefined ) { | |
| newPath = location.hash; | |
| } | |
| return path.stripHash( newPath ).replace( /[^\/]*\.[^\/*]+$/, '' ); | |
| }, | |
| //return the substring of a filepath before the sub-page key, for making a server request | |
| getFilePath: function( path ) { | |
| var splitkey = '&' + $.mobile.subPageUrlKey; | |
| return path && path.split( splitkey )[0].split( dialogHashKey )[0]; | |
| }, | |
| //set location hash to path | |
| set: function( path ) { | |
| location.hash = path; | |
| }, | |
| //test if a given url (string) is a path | |
| //NOTE might be exceptionally naive | |
| isPath: function( url ) { | |
| return ( /\// ).test( url ); | |
| }, | |
| //return a url path with the window's location protocol/hostname/pathname removed | |
| clean: function( url ) { | |
| return url.replace( documentBase.domain, "" ); | |
| }, | |
| //just return the url without an initial # | |
| stripHash: function( url ) { | |
| return url.replace( /^#/, "" ); | |
| }, | |
| //remove the preceding hash, any query params, and dialog notations | |
| cleanHash: function( hash ) { | |
| return path.stripHash( hash.replace( /\?.*$/, "" ).replace( dialogHashKey, "" ) ); | |
| }, | |
| //check whether a url is referencing the same domain, or an external domain or different protocol | |
| //could be mailto, etc | |
| isExternal: function( url ) { | |
| var u = path.parseUrl( url ); | |
| return u.protocol && u.domain !== documentUrl.domain ? true : false; | |
| }, | |
| hasProtocol: function( url ) { | |
| return ( /^(:?\w+:)/ ).test( url ); | |
| }, | |
| isEmbeddedPage: function( url ) { | |
| var u = path.parseUrl( url ); | |
| //if the path is absolute, then we need to compare the url against | |
| //both the documentUrl and the documentBase. The main reason for this | |
| //is that links embedded within external documents will refer to the | |
| //application document, whereas links embedded within the application | |
| //document will be resolved against the document base. | |
| if ( u.protocol !== "" ) { | |
| return ( u.hash && ( u.hrefNoHash === documentUrl.hrefNoHash || ( documentBaseDiffers && u.hrefNoHash === documentBase.hrefNoHash ) ) ); | |
| } | |
| return (/^#/).test( u.href ); | |
| } | |
| }, | |
| //will be defined when a link is clicked and given an active class | |
| $activeClickedLink = null, | |
| //urlHistory is purely here to make guesses at whether the back or forward button was clicked | |
| //and provide an appropriate transition | |
| urlHistory = { | |
| //array of pages that are visited during a single page load. each has a url and optional transition | |
| stack: [], | |
| //maintain an index number for the active page in the stack | |
| activeIndex: 0, | |
| //get active | |
| getActive: function() { | |
| return urlHistory.stack[ urlHistory.activeIndex ]; | |
| }, | |
| getPrev: function() { | |
| return urlHistory.stack[ urlHistory.activeIndex - 1 ]; | |
| }, | |
| getNext: function() { | |
| return urlHistory.stack[ urlHistory.activeIndex + 1 ]; | |
| }, | |
| // addNew is used whenever a new page is added | |
| addNew: function( url, transition, title, storedTo ) { | |
| //if there's forward history, wipe it | |
| if( urlHistory.getNext() ) { | |
| urlHistory.clearForward(); | |
| } | |
| urlHistory.stack.push( {url : url, transition: transition, title: title, page: storedTo } ); | |
| urlHistory.activeIndex = urlHistory.stack.length - 1; | |
| }, | |
| //wipe urls ahead of active index | |
| clearForward: function() { | |
| urlHistory.stack = urlHistory.stack.slice( 0, urlHistory.activeIndex + 1 ); | |
| }, | |
| directHashChange: function( opts ) { | |
| var back , forward, newActiveIndex; | |
| // check if url isp in history and if it's ahead or behind current page | |
| $.each( urlHistory.stack, function( i, historyEntry ) { | |
| //if the url is in the stack, it's a forward or a back | |
| if( opts.currentUrl === historyEntry.url ) { | |
| //define back and forward by whether url is older or newer than current page | |
| back = i < urlHistory.activeIndex; | |
| forward = !back; | |
| newActiveIndex = i; | |
| } | |
| }); | |
| // save new page index, null check to prevent falsey 0 result | |
| this.activeIndex = newActiveIndex !== undefined ? newActiveIndex : this.activeIndex; | |
| if( back ) { | |
| opts.isBack(); | |
| } else if( forward ) { | |
| opts.isForward(); | |
| } | |
| }, | |
| //disable hashchange event listener internally to ignore one change | |
| //toggled internally when location.hash is updated to match the url of a successful page load | |
| ignoreNextHashChange: false | |
| }, | |
| //define first selector to receive focus when a page is shown | |
| focusable = "[tabindex],a,button:visible,select:visible,input", | |
| //queue to hold simultanious page transitions | |
| pageTransitionQueue = [], | |
| //indicates whether or not page is in process of transitioning | |
| isPageTransitioning = false, | |
| //nonsense hash change key for dialogs, so they create a history entry | |
| dialogHashKey = "&ui-state=dialog", | |
| //existing base tag? | |
| $base = $head.children( "base" ), | |
| //tuck away the original document URL minus any fragment. | |
| documentUrl = path.parseUrl( location.href ), | |
| //if the document has an embedded base tag, documentBase is set to its | |
| //initial value. If a base tag does not exist, then we default to the documentUrl. | |
| documentBase = $base.length ? path.parseUrl( path.makeUrlAbsolute( $base.attr( "href" ), documentUrl.href ) ) : documentUrl, | |
| //cache the comparison once. | |
| documentBaseDiffers = ( documentUrl.hrefNoHash !== documentBase.hrefNoHash ); | |
| //base element management, defined depending on dynamic base tag support | |
| var base = $.support.dynamicBaseTag ? { | |
| //define base element, for use in routing asset urls that are referenced in Ajax-requested markup | |
| element: ( $base.length ? $base : $( "<base>", { href: documentBase.hrefNoHash } ).prependTo( $head ) ), | |
| //set the generated BASE element's href attribute to a new page's base path | |
| set: function( href ) { | |
| base.element.attr( "href", path.makeUrlAbsolute( href, documentBase ) ); | |
| }, | |
| //set the generated BASE element's href attribute to a new page's base path | |
| reset: function() { | |
| base.element.attr( "href", documentBase.hrefNoHash ); | |
| } | |
| } : undefined; | |
| /* | |
| internal utility functions | |
| --------------------------------------*/ | |
| //direct focus to the page title, or otherwise first focusable element | |
| function reFocus( page ) { | |
| var lastClicked = page.jqmData( "lastClicked" ); | |
| if( lastClicked && lastClicked.length ) { | |
| lastClicked.focus(); | |
| } | |
| else { | |
| var pageTitle = page.find( ".ui-title:eq(0)" ); | |
| if( pageTitle.length ) { | |
| pageTitle.focus(); | |
| } | |
| else{ | |
| page.find( focusable ).eq( 0 ).focus(); | |
| } | |
| } | |
| } | |
| //remove active classes after page transition or error | |
| function removeActiveLinkClass( forceRemoval ) { | |
| if( !!$activeClickedLink && ( !$activeClickedLink.closest( '.ui-page-active' ).length || forceRemoval ) ) { | |
| $activeClickedLink.removeClass( $.mobile.activeBtnClass ); | |
| } | |
| $activeClickedLink = null; | |
| } | |
| function releasePageTransitionLock() { | |
| isPageTransitioning = false; | |
| if( pageTransitionQueue.length > 0 ) { | |
| $.mobile.changePage.apply( null, pageTransitionQueue.pop() ); | |
| } | |
| } | |
| //function for transitioning between two existing pages | |
| function transitionPages( toPage, fromPage, transition, reverse ) { | |
| //get current scroll distance | |
| var currScroll = $.support.scrollTop ? $window.scrollTop() : true, | |
| toScroll = toPage.data( "lastScroll" ) || $.mobile.defaultHomeScroll, | |
| screenHeight = getScreenHeight(); | |
| //if scrolled down, scroll to top | |
| if( currScroll ){ | |
| window.scrollTo( 0, $.mobile.defaultHomeScroll ); | |
| } | |
| //if the Y location we're scrolling to is less than 10px, let it go for sake of smoothness | |
| if( toScroll < $.mobile.minScrollBack ){ | |
| toScroll = 0; | |
| } | |
| if( fromPage ) { | |
| //set as data for returning to that spot | |
| fromPage | |
| .height( screenHeight + currScroll ) | |
| .jqmData( "lastScroll", currScroll ) | |
| .jqmData( "lastClicked", $activeClickedLink ); | |
| //trigger before show/hide events | |
| fromPage.data( "page" )._trigger( "beforehide", null, { nextPage: toPage } ); | |
| } | |
| toPage | |
| .height( screenHeight + toScroll ) | |
| .data( "page" )._trigger( "beforeshow", null, { prevPage: fromPage || $( "" ) } ); | |
| //clear page loader | |
| $.mobile.hidePageLoadingMsg(); | |
| //find the transition handler for the specified transition. If there | |
| //isn't one in our transitionHandlers dictionary, use the default one. | |
| //call the handler immediately to kick-off the transition. | |
| var th = $.mobile.transitionHandlers[transition || "none"] || $.mobile.defaultTransitionHandler, | |
| promise = th( transition, reverse, toPage, fromPage ); | |
| promise.done(function() { | |
| //reset toPage height bac | |
| toPage.height( "" ); | |
| //jump to top or prev scroll, sometimes on iOS the page has not rendered yet. | |
| if( toScroll ){ | |
| $.mobile.silentScroll( toScroll ); | |
| $( document ).one( "silentscroll", function() { reFocus( toPage ); } ); | |
| } | |
| else{ | |
| reFocus( toPage ); | |
| } | |
| //trigger show/hide events | |
| if( fromPage ) { | |
| fromPage.height("").data( "page" )._trigger( "hide", null, { nextPage: toPage } ); | |
| } | |
| //trigger pageshow, define prevPage as either fromPage or empty jQuery obj | |
| toPage.data( "page" )._trigger( "show", null, { prevPage: fromPage || $( "" ) } ); | |
| }); | |
| return promise; | |
| } | |
| //simply set the active page's minimum height to screen height, depending on orientation | |
| function getScreenHeight(){ | |
| var orientation = jQuery.event.special.orientationchange.orientation(), | |
| port = orientation === "portrait", | |
| winMin = port ? 480 : 320, | |
| screenHeight = port ? screen.availHeight : screen.availWidth, | |
| winHeight = Math.max( winMin, $( window ).height() ), | |
| pageMin = Math.min( screenHeight, winHeight ); | |
| return pageMin; | |
| } | |
| //simply set the active page's minimum height to screen height, depending on orientation | |
| function resetActivePageHeight(){ | |
| $( "." + $.mobile.activePageClass ).css( "min-height", getScreenHeight() ); | |
| } | |
| //shared page enhancements | |
| function enhancePage( $page, role ) { | |
| // If a role was specified, make sure the data-role attribute | |
| // on the page element is in sync. | |
| if( role ) { | |
| $page.attr( "data-" + $.mobile.ns + "role", role ); | |
| } | |
| //run page plugin | |
| $page.page(); | |
| } | |
| /* exposed $.mobile methods */ | |
| //animation complete callback | |
| $.fn.animationComplete = function( callback ) { | |
| if( $.support.cssTransitions ) { | |
| return $( this ).one( 'webkitAnimationEnd', callback ); | |
| } | |
| else{ | |
| // defer execution for consistency between webkit/non webkit | |
| setTimeout( callback, 0 ); | |
| return $( this ); | |
| } | |
| }; | |
| //update location.hash, with or without triggering hashchange event | |
| //TODO - deprecate this one at 1.0 | |
| $.mobile.updateHash = path.set; | |
| //expose path object on $.mobile | |
| $.mobile.path = path; | |
| //expose base object on $.mobile | |
| $.mobile.base = base; | |
| //url stack, useful when plugins need to be aware of previous pages viewed | |
| //TODO: deprecate this one at 1.0 | |
| $.mobile.urlstack = urlHistory.stack; | |
| //history stack | |
| $.mobile.urlHistory = urlHistory; | |
| //default non-animation transition handler | |
| $.mobile.noneTransitionHandler = function( name, reverse, $toPage, $fromPage ) { | |
| if ( $fromPage ) { | |
| $fromPage.removeClass( $.mobile.activePageClass ); | |
| } | |
| $toPage.addClass( $.mobile.activePageClass ); | |
| return $.Deferred().resolve( name, reverse, $toPage, $fromPage ).promise(); | |
| }; | |
| //default handler for unknown transitions | |
| $.mobile.defaultTransitionHandler = $.mobile.noneTransitionHandler; | |
| //transition handler dictionary for 3rd party transitions | |
| $.mobile.transitionHandlers = { | |
| none: $.mobile.defaultTransitionHandler | |
| }; | |
| //enable cross-domain page support | |
| $.mobile.allowCrossDomainPages = false; | |
| //return the original document url | |
| $.mobile.getDocumentUrl = function(asParsedObject) { | |
| return asParsedObject ? $.extend( {}, documentUrl ) : documentUrl.href; | |
| }; | |
| //return the original document base url | |
| $.mobile.getDocumentBase = function(asParsedObject) { | |
| return asParsedObject ? $.extend( {}, documentBase ) : documentBase.href; | |
| }; | |
| // Load a page into the DOM. | |
| $.mobile.loadPage = function( url, options ) { | |
| // This function uses deferred notifications to let callers | |
| // know when the page is done loading, or if an error has occurred. | |
| var deferred = $.Deferred(), | |
| // The default loadPage options with overrides specified by | |
| // the caller. | |
| settings = $.extend( {}, $.mobile.loadPage.defaults, options ), | |
| // The DOM element for the page after it has been loaded. | |
| page = null, | |
| // If the reloadPage option is true, and the page is already | |
| // in the DOM, dupCachedPage will be set to the page element | |
| // so that it can be removed after the new version of the | |
| // page is loaded off the network. | |
| dupCachedPage = null, | |
| // The absolute version of the URL passed into the function. This | |
| // version of the URL may contain dialog/subpage params in it. | |
| absUrl = path.makeUrlAbsolute( url, documentBase.hrefNoHash ); | |
| // If the caller provided data, and we're using "get" request, | |
| // append the data to the URL. | |
| if ( settings.data && settings.type === "get" ) { | |
| absUrl = path.addSearchParams( absUrl, settings.data ); | |
| settings.data = undefined; | |
| } | |
| // The absolute version of the URL minus any dialog/subpage params. | |
| // In otherwords the real URL of the page to be loaded. | |
| var fileUrl = path.getFilePath( absUrl ), | |
| // The version of the Url actually stored in the data-url attribute of | |
| // the page. For embedded pages, it is just the id of the page. For pages | |
| // within the same domain as the document base, it is the site relative | |
| // path. For cross-domain pages (Phone Gap only) the entire absolute Url | |
| // used to load the page. | |
| dataUrl = path.convertUrlToDataUrl( absUrl ); | |
| // Make sure we have a pageContainer to work with. | |
| settings.pageContainer = settings.pageContainer || $.mobile.pageContainer; | |
| // Check to see if the page already exists in the DOM. | |
| page = settings.pageContainer.children( ":jqmData(url='" + dataUrl + "')" ); | |
| // Reset base to the default document base. | |
| if ( base ) { | |
| base.reset(); | |
| } | |
| // If the page we are interested in is already in the DOM, | |
| // and the caller did not indicate that we should force a | |
| // reload of the file, we are done. Otherwise, track the | |
| // existing page as a duplicated. | |
| if ( page.length ) { | |
| if ( !settings.reloadPage ) { | |
| enhancePage( page, settings.role ); | |
| deferred.resolve( absUrl, options, page ); | |
| return deferred.promise(); | |
| } | |
| dupCachedPage = page; | |
| } | |
| if ( settings.showLoadMsg ) { | |
| $.mobile.showPageLoadingMsg(); | |
| } | |
| // Load the new page. | |
| $.ajax({ | |
| url: fileUrl, | |
| type: settings.type, | |
| data: settings.data, | |
| dataType: "html", | |
| success: function( html ) { | |
| //pre-parse html to check for a data-url, | |
| //use it as the new fileUrl, base path, etc | |
| var all = $( "<div></div>" ), | |
| //page title regexp | |
| newPageTitle = html.match( /<title[^>]*>([^<]*)/ ) && RegExp.$1, | |
| // TODO handle dialogs again | |
| pageElemRegex = new RegExp( ".*(<[^>]+\\bdata-" + $.mobile.ns + "role=[\"']?page[\"']?[^>]*>).*" ), | |
| dataUrlRegex = new RegExp( "\\bdata-" + $.mobile.ns + "url=[\"']?([^\"'>]*)[\"']?" ); | |
| // data-url must be provided for the base tag so resource requests can be directed to the | |
| // correct url. loading into a temprorary element makes these requests immediately | |
| if( pageElemRegex.test( html ) | |
| && RegExp.$1 | |
| && dataUrlRegex.test( RegExp.$1 ) | |
| && RegExp.$1 ) { | |
| url = fileUrl = path.getFilePath( RegExp.$1 ); | |
| } | |
| if ( base ) { | |
| base.set( fileUrl ); | |
| } | |
| //workaround to allow scripts to execute when included in page divs | |
| all.get( 0 ).innerHTML = html; | |
| page = all.find( ":jqmData(role='page'), :jqmData(role='dialog')" ).first(); | |
| if ( newPageTitle && !page.jqmData( "title" ) ) { | |
| page.jqmData( "title", newPageTitle ); | |
| } | |
| //rewrite src and href attrs to use a base url | |
| if( !$.support.dynamicBaseTag ) { | |
| var newPath = path.get( fileUrl ); | |
| page.find( "[src], link[href], a[rel='external'], :jqmData(ajax='false'), a[target]" ).each(function() { | |
| var thisAttr = $( this ).is( '[href]' ) ? 'href' : | |
| $(this).is('[src]') ? 'src' : 'action', | |
| thisUrl = $( this ).attr( thisAttr ); | |
| // XXX_jblas: We need to fix this so that it removes the document | |
| // base URL, and then prepends with the new page URL. | |
| //if full path exists and is same, chop it - helps IE out | |
| thisUrl = thisUrl.replace( location.protocol + '//' + location.host + location.pathname, '' ); | |
| if( !/^(\w+:|#|\/)/.test( thisUrl ) ) { | |
| $( this ).attr( thisAttr, newPath + thisUrl ); | |
| } | |
| }); | |
| } | |
| //append to page and enhance | |
| page | |
| .attr( "data-" + $.mobile.ns + "url", path.convertUrlToDataUrl( fileUrl ) ) | |
| .appendTo( settings.pageContainer ); | |
| enhancePage( page, settings.role ); | |
| // Enhancing the page may result in new dialogs/sub pages being inserted | |
| // into the DOM. If the original absUrl refers to a sub-page, that is the | |
| // real page we are interested in. | |
| if ( absUrl.indexOf( "&" + $.mobile.subPageUrlKey ) > -1 ) { | |
| page = settings.pageContainer.children( ":jqmData(url='" + dataUrl + "')" ); | |
| } | |
| // Remove loading message. | |
| if ( settings.showLoadMsg ) { | |
| $.mobile.hidePageLoadingMsg(); | |
| } | |
| deferred.resolve( absUrl, options, page, dupCachedPage ); | |
| }, | |
| error: function() { | |
| //set base back to current path | |
| if( base ) { | |
| base.set( path.get() ); | |
| } | |
| // Remove loading message. | |
| if ( settings.showLoadMsg ) { | |
| $.mobile.hidePageLoadingMsg(); | |
| //show error message | |
| $( "<div class='ui-loader ui-overlay-shadow ui-body-e ui-corner-all'><h1>"+ $.mobile.pageLoadErrorMessage +"</h1></div>" ) | |
| .css({ "display": "block", "opacity": 0.96, "top": $window.scrollTop() + 100 }) | |
| .appendTo( settings.pageContainer ) | |
| .delay( 800 ) | |
| .fadeOut( 400, function() { | |
| $( this ).remove(); | |
| }); | |
| } | |
| deferred.reject( absUrl, options ); | |
| } | |
| }); | |
| return deferred.promise(); | |
| }; | |
| $.mobile.loadPage.defaults = { | |
| type: "get", | |
| data: undefined, | |
| reloadPage: false, | |
| role: undefined, // By default we rely on the role defined by the @data-role attribute. | |
| showLoadMsg: true, | |
| pageContainer: undefined | |
| }; | |
| // Show a specific page in the page container. | |
| $.mobile.changePage = function( toPage, options ) { | |
| // XXX: REMOVE_BEFORE_SHIPPING_1.0 | |
| // This is temporary code that makes changePage() compatible with previous alpha versions. | |
| if ( typeof options !== "object" ) { | |
| var opts = null; | |
| // Map old-style call signature for form submit to the new options object format. | |
| if ( typeof toPage === "object" && toPage.url && toPage.type ) { | |
| opts = { | |
| type: toPage.type, | |
| data: toPage.data, | |
| forcePageLoad: true | |
| }; | |
| toPage = toPage.url; | |
| } | |
| // The arguments passed into the function need to be re-mapped | |
| // to the new options object format. | |
| var len = arguments.length; | |
| if ( len > 1 ) { | |
| var argNames = [ "transition", "reverse", "changeHash", "fromHashChange" ], i; | |
| for ( i = 1; i < len; i++ ) { | |
| var a = arguments[ i ]; | |
| if ( typeof a !== "undefined" ) { | |
| opts = opts || {}; | |
| opts[ argNames[ i - 1 ] ] = a; | |
| } | |
| } | |
| } | |
| // If an options object was created, then we know changePage() was called | |
| // with an old signature. | |
| if ( opts ) { | |
| return $.mobile.changePage( toPage, opts ); | |
| } | |
| } | |
| // XXX: REMOVE_BEFORE_SHIPPING_1.0 | |
| // If we are in the midst of a transition, queue the current request. | |
| // We'll call changePage() once we're done with the current transition to | |
| // service the request. | |
| if( isPageTransitioning ) { | |
| pageTransitionQueue.unshift( arguments ); | |
| return; | |
| } | |
| // Set the isPageTransitioning flag to prevent any requests from | |
| // entering this method while we are in the midst of loading a page | |
| // or transitioning. | |
| isPageTransitioning = true; | |
| var settings = $.extend( {}, $.mobile.changePage.defaults, options ); | |
| // Make sure we have a pageContainer to work with. | |
| settings.pageContainer = settings.pageContainer || $.mobile.pageContainer; | |
| // If the caller passed us a url, call loadPage() | |
| // to make sure it is loaded into the DOM. We'll listen | |
| // to the promise object it returns so we know when | |
| // it is done loading or if an error ocurred. | |
| if ( typeof toPage == "string" ) { | |
| $.mobile.loadPage( toPage, settings ) | |
| .done(function( url, options, newPage, dupCachedPage ) { | |
| isPageTransitioning = false; | |
| options.duplicateCachedPage = dupCachedPage; | |
| $.mobile.changePage( newPage, options ); | |
| }) | |
| .fail(function( url, options ) { | |
| // XXX_jblas: Fire off changepagefailed notificaiton. | |
| isPageTransitioning = false; | |
| //clear out the active button state | |
| removeActiveLinkClass( true ); | |
| //release transition lock so navigation is free again | |
| releasePageTransitionLock(); | |
| settings.pageContainer.trigger("changepagefailed"); | |
| }); | |
| return; | |
| } | |
| // The caller passed us a real page DOM element. Update our | |
| // internal state and then trigger a transition to the page. | |
| var mpc = settings.pageContainer, | |
| fromPage = $.mobile.activePage, | |
| url = toPage.jqmData( "url" ), | |
| fileUrl = path.getFilePath( url ), | |
| active = urlHistory.getActive(), | |
| activeIsInitialPage = urlHistory.activeIndex === 0, | |
| historyDir = 0, | |
| pageTitle = document.title, | |
| isDialog = settings.role === "dialog" || toPage.jqmData( "role" ) === "dialog"; | |
| // Let listeners know we're about to change the current page. | |
| mpc.trigger( "beforechangepage" ); | |
| // If we are trying to transition to the same page that we are currently on ignore the request. | |
| // an illegal same page request is defined by the current page being the same as the url, as long as there's history | |
| // and toPage is not an array or object (those are allowed to be "same") | |
| // | |
| // XXX_jblas: We need to remove this at some point when we allow for transitions | |
| // to the same page. | |
| if( fromPage && fromPage[0] === toPage[0] ) { | |
| isPageTransitioning = false; | |
| mpc.trigger( "changepage" ); | |
| return; | |
| } | |
| // We need to make sure the page we are given has already been enhanced. | |
| enhancePage( toPage, settings.role ); | |
| // If the changePage request was sent from a hashChange event, check to see if the | |
| // page is already within the urlHistory stack. If so, we'll assume the user hit | |
| // the forward/back button and will try to match the transition accordingly. | |
| if( settings.fromHashChange ) { | |
| urlHistory.directHashChange({ | |
| currentUrl: url, | |
| isBack: function() { historyDir = -1; }, | |
| isForward: function() { historyDir = 1; } | |
| }); | |
| } | |
| // Kill the keyboard. | |
| // XXX_jblas: We need to stop crawling the entire document to kill focus. Instead, | |
| // we should be tracking focus with a live() handler so we already have | |
| // the element in hand at this point. | |
| $( document.activeElement || "" ).add( "input:focus, textarea:focus, select:focus" ).blur(); | |
| // If we're displaying the page as a dialog, we don't want the url | |
| // for the dialog content to be used in the hash. Instead, we want | |
| // to append the dialogHashKey to the url of the current page. | |
| if ( isDialog && active ) { | |
| url = active.url + dialogHashKey; | |
| } | |
| // Set the location hash. | |
| if( settings.changeHash !== false && url ) { | |
| //disable hash listening temporarily | |
| urlHistory.ignoreNextHashChange = true; | |
| //update hash and history | |
| path.set( url ); | |
| } | |
| //if title element wasn't found, try the page div data attr too | |
| var newPageTitle = toPage.jqmData( "title" ) || toPage.children(":jqmData(role='header')").find(".ui-title" ).text(); | |
| if( !!newPageTitle && pageTitle == document.title ) { | |
| pageTitle = newPageTitle; | |
| } | |
| //add page to history stack if it's not back or forward | |
| if( !historyDir ) { | |
| urlHistory.addNew( url, settings.transition, pageTitle, toPage ); | |
| } | |
| //set page title | |
| document.title = urlHistory.getActive().title; | |
| //set "toPage" as activePage | |
| $.mobile.activePage = toPage; | |
| // Make sure we have a transition defined. | |
| settings.transition = settings.transition | |
| || ( ( historyDir && !activeIsInitialPage ) ? active.transition : undefined ) | |
| || ( settings.role === "dialog" ? $.mobile.defaultDialogTransition : $.mobile.defaultPageTransition ); | |
| // If we're navigating back in the URL history, set reverse accordingly. | |
| settings.reverse = settings.reverse || historyDir < 0; | |
| transitionPages( toPage, fromPage, settings.transition, settings.reverse ) | |
| .done(function() { | |
| removeActiveLinkClass(); | |
| //if there's a duplicateCachedPage, remove it from the DOM now that it's hidden | |
| if ( settings.duplicateCachedPage ) { | |
| settings.duplicateCachedPage.remove(); | |
| } | |
| //remove initial build class (only present on first pageshow) | |
| $html.removeClass( "ui-mobile-rendering" ); | |
| releasePageTransitionLock(); | |
| // Let listeners know we're all done changing the current page. | |
| mpc.trigger( "changepage" ); | |
| }); | |
| }; | |
| $.mobile.changePage.defaults = { | |
| transition: undefined, | |
| reverse: false, | |
| changeHash: true, | |
| fromHashChange: false, | |
| role: undefined, // By default we rely on the role defined by the @data-role attribute. | |
| duplicateCachedPage: undefined, | |
| pageContainer: undefined | |
| }; | |
| /* Event Bindings - hashchange, submit, and click */ | |
| //bind to form submit events, handle with Ajax | |
| $( "form" ).live('submit', function( event ) { | |
| var $this = $( this ); | |
| if( !$.mobile.ajaxEnabled || | |
| $this.is( ":jqmData(ajax='false')" ) ) { | |
| return; | |
| } | |
| var type = $this.attr( "method" ), | |
| url = path.makeUrlAbsolute( $this.attr( "action" ), getClosestBaseUrl($this) ), | |
| target = $this.attr( "target" ); | |
| //external submits use regular HTTP | |
| if( path.isExternal( url ) || target ) { | |
| return; | |
| } | |
| $.mobile.changePage( | |
| url, | |
| { | |
| type: type.length && type.toLowerCase() || "get", | |
| data: $this.serialize(), | |
| transition: $this.jqmData( "transition" ), | |
| direction: $this.jqmData( "direction" ), | |
| reloadPage: true | |
| } | |
| ); | |
| event.preventDefault(); | |
| }); | |
| function findClosestLink( ele ) | |
| { | |
| while ( ele ) { | |
| if ( ele.nodeName.toLowerCase() == "a" ) { | |
| break; | |
| } | |
| ele = ele.parentNode; | |
| } | |
| return ele; | |
| } | |
| // The base URL for any given element depends on the page it resides in. | |
| function getClosestBaseUrl( ele ) | |
| { | |
| // Find the closest page and extract out its url. | |
| var url = $( ele ).closest( ".ui-page" ).jqmData( "url" ), | |
| base = documentBase.hrefNoHash; | |
| if ( !url || !path.isPath( url ) ) { | |
| url = base; | |
| } | |
| return path.makeUrlAbsolute( url, base); | |
| } | |
| //add active state on vclick | |
| $( document ).bind( "vclick", function( event ) { | |
| var link = findClosestLink( event.target ); | |
| if ( link ) { | |
| if ( path.parseUrl( link.getAttribute( "href" ) || "#" ).hash !== "#" ) { | |
| $( link ).closest( ".ui-btn" ).not( ".ui-disabled" ).addClass( $.mobile.activeBtnClass ); | |
| $( "." + $.mobile.activePageClass + " .ui-btn" ).not( link ).blur(); | |
| } | |
| } | |
| }); | |
| // click routing - direct to HTTP or Ajax, accordingly | |
| // TODO: most of the time, vclick will be all we need for fastClick bulletproofing. | |
| // However, it seems that in Android 2.1, a click event | |
| // will occasionally arrive independently of the bound vclick | |
| // binding to click as well seems to help in this edge case | |
| // we'll dig into this further in the next release cycle | |
| $( document ).bind( $.mobile.useFastClick ? "vclick click" : "click", function( event ) { | |
| var link = findClosestLink( event.target ); | |
| if ( !link ) { | |
| return; | |
| } | |
| var $link = $( link ), | |
| //remove active link class if external (then it won't be there if you come back) | |
| httpCleanup = function(){ | |
| window.setTimeout( function() { removeActiveLinkClass( true ); }, 200 ); | |
| }; | |
| //if there's a data-rel=back attr, go back in history | |
| if( $link.is( ":jqmData(rel='back')" ) ) { | |
| window.history.back(); | |
| return false; | |
| } | |
| //if ajax is disabled, exit early | |
| if( !$.mobile.ajaxEnabled ){ | |
| httpCleanup(); | |
| //use default click handling | |
| return; | |
| } | |
| var baseUrl = getClosestBaseUrl( $link ), | |
| //get href, if defined, otherwise default to empty hash | |
| href = path.makeUrlAbsolute( $link.attr( "href" ) || "#", baseUrl ); | |
| // XXX_jblas: Ideally links to application pages should be specified as | |
| // an url to the application document with a hash that is either | |
| // the site relative path or id to the page. But some of the | |
| // internal code that dynamically generates sub-pages for nested | |
| // lists and select dialogs, just write a hash in the link they | |
| // create. This means the actual URL path is based on whatever | |
| // the current value of the base tag is at the time this code | |
| // is called. For now we are just assuming that any url with a | |
| // hash in it is an application page reference. | |
| if ( href.search( "#" ) != -1 ) { | |
| href = href.replace( /[^#]*#/, "" ); | |
| if ( !href ) { | |
| //link was an empty hash meant purely | |
| //for interaction, so we ignore it. | |
| event.preventDefault(); | |
| return; | |
| } else if ( path.isPath( href ) ) { | |
| //we have apath so make it the href we want to load. | |
| href = path.makeUrlAbsolute( href, baseUrl ); | |
| } else { | |
| //we have a simple id so use the documentUrl as its base. | |
| href = path.makeUrlAbsolute( "#" + href, documentUrl.hrefNoHash ); | |
| } | |
| } | |
| // Should we handle this link, or let the browser deal with it? | |
| var useDefaultUrlHandling = $link.is( "[rel='external']" ) || $link.is( ":jqmData(ajax='false')" ) || $link.is( "[target]" ), | |
| // Some embedded browsers, like the web view in Phone Gap, allow cross-domain XHR | |
| // requests if the document doing the request was loaded via the file:// protocol. | |
| // This is usually to allow the application to "phone home" and fetch app specific | |
| // data. We normally let the browser handle external/cross-domain urls, but if the | |
| // allowCrossDomainPages option is true, we will allow cross-domain http/https | |
| // requests to go through our page loading logic. | |
| isCrossDomainPageLoad = ( $.mobile.allowCrossDomainPages && documentUrl.protocol === "file:" && href.search( /^https?:/ ) != -1 ), | |
| //check for protocol or rel and its not an embedded page | |
| //TODO overlap in logic from isExternal, rel=external check should be | |
| // moved into more comprehensive isExternalLink | |
| isExternal = useDefaultUrlHandling || ( path.isExternal( href ) && !isCrossDomainPageLoad ); | |
| $activeClickedLink = $link.closest( ".ui-btn" ); | |
| if( isExternal ) { | |
| httpCleanup(); | |
| //use default click handling | |
| return; | |
| } | |
| //use ajax | |
| var transition = $link.jqmData( "transition" ), | |
| direction = $link.jqmData( "direction" ), | |
| reverse = ( direction && direction === "reverse" ) || | |
| // deprecated - remove by 1.0 | |
| $link.jqmData( "back" ), | |
| //this may need to be more specific as we use data-rel more | |
| role = $link.attr( "data-" + $.mobile.ns + "rel" ) || undefined; | |
| $.mobile.changePage( href, { transition: transition, reverse: reverse, role: role } ); | |
| event.preventDefault(); | |
| }); | |
| //hashchange event handler | |
| $window.bind( "hashchange", function( e, triggered ) { | |
| //find first page via hash | |
| var to = path.stripHash( location.hash ), | |
| //transition is false if it's the first page, undefined otherwise (and may be overridden by default) | |
| transition = $.mobile.urlHistory.stack.length === 0 ? "none" : undefined; | |
| //if listening is disabled (either globally or temporarily), or it's a dialog hash | |
| if( !$.mobile.hashListeningEnabled || urlHistory.ignoreNextHashChange ) { | |
| urlHistory.ignoreNextHashChange = false; | |
| return; | |
| } | |
| // special case for dialogs | |
| if( urlHistory.stack.length > 1 && | |
| to.indexOf( dialogHashKey ) > -1 ) { | |
| // If current active page is not a dialog skip the dialog and continue | |
| // in the same direction | |
| if(!$.mobile.activePage.is( ".ui-dialog" )) { | |
| //determine if we're heading forward or backward and continue accordingly past | |
| //the current dialog | |
| urlHistory.directHashChange({ | |
| currentUrl: to, | |
| isBack: function() { window.history.back(); }, | |
| isForward: function() { window.history.forward(); } | |
| }); | |
| // prevent changepage | |
| return; | |
| } else { | |
| var setTo = function() { to = $.mobile.urlHistory.getActive().page; }; | |
| // if the current active page is a dialog and we're navigating | |
| // to a dialog use the dialog objected saved in the stack | |
| urlHistory.directHashChange({ currentUrl: to, isBack: setTo, isForward: setTo }); | |
| } | |
| } | |
| //if to is defined, load it | |
| if ( to ) { | |
| to = ( typeof to === "string" && !path.isPath( to ) ) ? ( '#' + to ) : to; | |
| $.mobile.changePage( to, { transition: transition, changeHash: false, fromHashChange: true } ); | |
| } | |
| //there's no hash, go to the first page in the dom | |
| else { | |
| $.mobile.changePage( $.mobile.firstPage, { transition: transition, changeHash: false, fromHashChange: true } ); | |
| } | |
| }); | |
| //set page min-heights to be device specific | |
| $( document ).bind( "pageshow", resetActivePageHeight ); | |
| $( window ).bind( "throttledresize", resetActivePageHeight ); | |
| })( jQuery ); | |
| /*! | |
| * jQuery Mobile v@VERSION | |
| * http://jquerymobile.com/ | |
| * | |
| * Copyright 2010, jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| ( function( $, window, undefined ) { | |
| function css3TransitionHandler( name, reverse, $to, $from ) | |
| { | |
| var deferred = new $.Deferred(), | |
| reverseClass = reverse ? " reverse" : "", | |
| viewportClass = "ui-mobile-viewport-transitioning viewport-" + name, | |
| doneFunc = function() { | |
| $to.add( $from ).removeClass( "out in reverse " + name ); | |
| if ( $from ) { | |
| $from.removeClass( $.mobile.activePageClass ); | |
| } | |
| $to.parent().removeClass( viewportClass ); | |
| deferred.resolve( name, reverse, $to, $from ); | |
| }; | |
| $to.animationComplete( doneFunc ); | |
| $to.parent().addClass( viewportClass ); | |
| if ( $from ) { | |
| $from.addClass( name + " out" + reverseClass ); | |
| } | |
| $to.addClass( $.mobile.activePageClass + " " + name + " in" + reverseClass ); | |
| return deferred.promise(); | |
| } | |
| // Make our transition handler public. | |
| $.mobile.css3TransitionHandler = css3TransitionHandler; | |
| // If the default transition handler is the 'none' handler, replace it with our handler. | |
| if ( $.mobile.defaultTransitionHandler === $.mobile.noneTransitionHandler ) { | |
| $.mobile.defaultTransitionHandler = css3TransitionHandler; | |
| } | |
| })( jQuery, this ); | |
| /* | |
| * jQuery Mobile Framework : "fixHeaderFooter" plugin - on-demand positioning for headers,footers | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| (function($, undefined ) { | |
| $.fn.fixHeaderFooter = function(options){ | |
| if( !$.support.scrollTop ){ return this; } | |
| return this.each(function(){ | |
| var $this = $(this); | |
| if( $this.jqmData('fullscreen') ){ $this.addClass('ui-page-fullscreen'); } | |
| $this.find( ".ui-header:jqmData(position='fixed')" ).addClass('ui-header-fixed ui-fixed-inline fade'); //should be slidedown | |
| $this.find( ".ui-footer:jqmData(position='fixed')" ).addClass('ui-footer-fixed ui-fixed-inline fade'); //should be slideup | |
| }); | |
| }; | |
| //single controller for all showing,hiding,toggling | |
| $.fixedToolbars = (function(){ | |
| if( !$.support.scrollTop ){ return; } | |
| var currentstate = 'inline', | |
| autoHideMode = false, | |
| showDelay = 100, | |
| delayTimer, | |
| ignoreTargets = 'a,input,textarea,select,button,label,.ui-header-fixed,.ui-footer-fixed', | |
| toolbarSelector = '.ui-header-fixed:first, .ui-footer-fixed:not(.ui-footer-duplicate):last', | |
| stickyFooter, //for storing quick references to duplicate footers | |
| supportTouch = $.support.touch, | |
| touchStartEvent = supportTouch ? "touchstart" : "mousedown", | |
| touchStopEvent = supportTouch ? "touchend" : "mouseup", | |
| stateBefore = null, | |
| scrollTriggered = false, | |
| touchToggleEnabled = true; | |
| function showEventCallback(event) | |
| { | |
| // An event that affects the dimensions of the visual viewport has | |
| // been triggered. If the header and/or footer for the current page are in overlay | |
| // mode, we want to hide them, and then fire off a timer to show them at a later | |
| // point. Events like a resize can be triggered continuously during a scroll, on | |
| // some platforms, so the timer is used to delay the actual positioning until the | |
| // flood of events have subsided. | |
| // | |
| // If we are in autoHideMode, we don't do anything because we know the scroll | |
| // callbacks for the plugin will fire off a show when the scrolling has stopped. | |
| if (!autoHideMode && currentstate == 'overlay') { | |
| if (!delayTimer) | |
| $.fixedToolbars.hide(true); | |
| $.fixedToolbars.startShowTimer(); | |
| } | |
| } | |
| $(function() { | |
| $(document) | |
| .bind( "vmousedown",function(event){ | |
| if( touchToggleEnabled ) { | |
| stateBefore = currentstate; | |
| } | |
| }) | |
| .bind( "vclick",function(event){ | |
| if( touchToggleEnabled ) { | |
| if( $(event.target).closest(ignoreTargets).length ){ return; } | |
| if( !scrollTriggered ){ | |
| $.fixedToolbars.toggle(stateBefore); | |
| stateBefore = null; | |
| } | |
| } | |
| }) | |
| .bind('silentscroll', showEventCallback); | |
| /* | |
| The below checks first for a $(document).scrollTop() value, and if zero, binds scroll events to $(window) instead. If the scrollTop value is actually zero, both will return zero anyway. | |
| Works with $(document), not $(window) : Opera Mobile (WinMO phone; kinda broken anyway) | |
| Works with $(window), not $(document) : IE 7/8 | |
| Works with either $(window) or $(document) : Chrome, FF 3.6/4, Android 1.6/2.1, iOS | |
| Needs work either way : BB5, Opera Mobile (iOS) | |
| */ | |
| (( $(document).scrollTop() == 0 ) ? $(window) : $(document)) | |
| .bind('scrollstart',function(event){ | |
| scrollTriggered = true; | |
| if(stateBefore == null){ stateBefore = currentstate; } | |
| // We only enter autoHideMode if the headers/footers are in | |
| // an overlay state or the show timer was started. If the | |
| // show timer is set, clear it so the headers/footers don't | |
| // show up until after we're done scrolling. | |
| var isOverlayState = stateBefore == 'overlay'; | |
| autoHideMode = isOverlayState || !!delayTimer; | |
| if (autoHideMode){ | |
| $.fixedToolbars.clearShowTimer(); | |
| if (isOverlayState) { | |
| $.fixedToolbars.hide(true); | |
| } | |
| } | |
| }) | |
| .bind('scrollstop',function(event){ | |
| if( $(event.target).closest(ignoreTargets).length ){ return; } | |
| scrollTriggered = false; | |
| if (autoHideMode) { | |
| autoHideMode = false; | |
| $.fixedToolbars.startShowTimer(); | |
| } | |
| stateBefore = null; | |
| }); | |
| $(window).bind('resize', showEventCallback); | |
| }); | |
| //before page is shown, check for duplicate footer | |
| $('.ui-page').live('pagebeforeshow', function(event, ui){ | |
| var page = $(event.target), | |
| footer = page.find( ":jqmData(role='footer')" ), | |
| id = footer.data('id'), | |
| prevPage = ui.prevPage, | |
| prevFooter = prevPage && prevPage.find( ":jqmData(role='footer')" ), | |
| prevFooterMatches = prevFooter.length && prevFooter.jqmData( "id" ) === id; | |
| if( id && prevFooterMatches ){ | |
| stickyFooter = footer; | |
| setTop( stickyFooter.removeClass( "fade in out" ).appendTo( $.mobile.pageContainer ) ); | |
| } | |
| }); | |
| //after page is shown, append footer to new page | |
| $('.ui-page').live('pageshow', function(event, ui){ | |
| var $this = $(this); | |
| if( stickyFooter && stickyFooter.length ){ | |
| setTimeout(function(){ | |
| setTop( stickyFooter.appendTo( $this ).addClass("fade") ); | |
| stickyFooter = null; | |
| }, 500); | |
| } | |
| $.fixedToolbars.show(true, this); | |
| }); | |
| //When a collapsiable is hidden or shown we need to trigger the fixed toolbar to reposition itself (#1635) | |
| $( ".ui-collapsible-contain" ).live( "collapse expand", showEventCallback ); | |
| // element.getBoundingClientRect() is broken in iOS 3.2.1 on the iPad. The | |
| // coordinates inside of the rect it returns don't have the page scroll position | |
| // factored out of it like the other platforms do. To get around this, | |
| // we'll just calculate the top offset the old fashioned way until core has | |
| // a chance to figure out how to handle this situation. | |
| // | |
| // TODO: We'll need to get rid of getOffsetTop() once a fix gets folded into core. | |
| function getOffsetTop(ele) | |
| { | |
| var top = 0; | |
| if (ele) | |
| { | |
| var op = ele.offsetParent, body = document.body; | |
| top = ele.offsetTop; | |
| while (ele && ele != body) | |
| { | |
| top += ele.scrollTop || 0; | |
| if (ele == op) | |
| { | |
| top += op.offsetTop; | |
| op = ele.offsetParent; | |
| } | |
| ele = ele.parentNode; | |
| } | |
| } | |
| return top; | |
| } | |
| function setTop(el){ | |
| var fromTop = $(window).scrollTop(), | |
| thisTop = getOffsetTop(el[0]), // el.offset().top returns the wrong value on iPad iOS 3.2.1, call our workaround instead. | |
| thisCSStop = el.css('top') == 'auto' ? 0 : parseFloat(el.css('top')), | |
| screenHeight = window.innerHeight, | |
| thisHeight = el.outerHeight(), | |
| useRelative = el.parents('.ui-page:not(.ui-page-fullscreen)').length, | |
| relval; | |
| if( el.is('.ui-header-fixed') ){ | |
| relval = fromTop - thisTop + thisCSStop; | |
| if( relval < thisTop){ relval = 0; } | |
| return el.css('top', ( useRelative ) ? relval : fromTop); | |
| } | |
| else{ | |
| //relval = -1 * (thisTop - (fromTop + screenHeight) + thisCSStop + thisHeight); | |
| //if( relval > thisTop ){ relval = 0; } | |
| relval = fromTop + screenHeight - thisHeight - (thisTop - thisCSStop); | |
| return el.css('top', ( useRelative ) ? relval : fromTop + screenHeight - thisHeight ); | |
| } | |
| } | |
| //exposed methods | |
| return { | |
| show: function(immediately, page){ | |
| $.fixedToolbars.clearShowTimer(); | |
| currentstate = 'overlay'; | |
| var $ap = page ? $(page) : ($.mobile.activePage ? $.mobile.activePage : $(".ui-page-active")); | |
| return $ap.children( toolbarSelector ).each(function(){ | |
| var el = $(this), | |
| fromTop = $(window).scrollTop(), | |
| thisTop = getOffsetTop(el[0]), // el.offset().top returns the wrong value on iPad iOS 3.2.1, call our workaround instead. | |
| screenHeight = window.innerHeight, | |
| thisHeight = el.outerHeight(), | |
| alreadyVisible = (el.is('.ui-header-fixed') && fromTop <= thisTop + thisHeight) || (el.is('.ui-footer-fixed') && thisTop <= fromTop + screenHeight); | |
| //add state class | |
| el.addClass('ui-fixed-overlay').removeClass('ui-fixed-inline'); | |
| if( !alreadyVisible && !immediately ){ | |
| el.animationComplete(function(){ | |
| el.removeClass('in'); | |
| }).addClass('in'); | |
| } | |
| setTop(el); | |
| }); | |
| }, | |
| hide: function(immediately){ | |
| currentstate = 'inline'; | |
| var $ap = $.mobile.activePage ? $.mobile.activePage : $(".ui-page-active"); | |
| return $ap.children( toolbarSelector ).each(function(){ | |
| var el = $(this); | |
| var thisCSStop = el.css('top'); thisCSStop = thisCSStop == 'auto' ? 0 : parseFloat(thisCSStop); | |
| //add state class | |
| el.addClass('ui-fixed-inline').removeClass('ui-fixed-overlay'); | |
| if (thisCSStop < 0 || (el.is('.ui-header-fixed') && thisCSStop != 0)) | |
| { | |
| if(immediately){ | |
| el.css('top',0); | |
| } | |
| else{ | |
| if( el.css('top') !== 'auto' && parseFloat(el.css('top')) !== 0 ){ | |
| var classes = 'out reverse'; | |
| el.animationComplete(function(){ | |
| el.removeClass(classes); | |
| el.css('top',0); | |
| }).addClass(classes); | |
| } | |
| } | |
| } | |
| }); | |
| }, | |
| startShowTimer: function(){ | |
| $.fixedToolbars.clearShowTimer(); | |
| var args = $.makeArray(arguments); | |
| delayTimer = setTimeout(function(){ | |
| delayTimer = undefined; | |
| $.fixedToolbars.show.apply(null, args); | |
| }, showDelay); | |
| }, | |
| clearShowTimer: function() { | |
| if (delayTimer) { | |
| clearTimeout(delayTimer); | |
| } | |
| delayTimer = undefined; | |
| }, | |
| toggle: function(from){ | |
| if(from){ currentstate = from; } | |
| return (currentstate == 'overlay') ? $.fixedToolbars.hide() : $.fixedToolbars.show(); | |
| }, | |
| setTouchToggleEnabled: function(enabled) { | |
| touchToggleEnabled = enabled; | |
| } | |
| }; | |
| })(); | |
| })(jQuery); | |
| /* | |
| * jQuery Mobile Framework : "checkboxradio" plugin | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| (function($, undefined ) { | |
| $.widget( "mobile.checkboxradio", $.mobile.widget, { | |
| options: { | |
| theme: null | |
| }, | |
| _create: function(){ | |
| var self = this, | |
| input = this.element, | |
| //NOTE: Windows Phone could not find the label through a selector | |
| //filter works though. | |
| label = input.closest("form,fieldset,:jqmData(role='page')").find("label").filter('[for="' + input[0].id + '"]'), | |
| inputtype = input.attr( "type" ), | |
| checkedicon = "ui-icon-" + inputtype + "-on", | |
| uncheckedicon = "ui-icon-" + inputtype + "-off"; | |
| if ( inputtype != "checkbox" && inputtype != "radio" ) { return; } | |
| //expose for other methods | |
| $.extend( this,{ | |
| label : label, | |
| inputtype : inputtype, | |
| checkedicon : checkedicon, | |
| uncheckedicon : uncheckedicon | |
| }); | |
| // If there's no selected theme... | |
| if( !this.options.theme ) { | |
| this.options.theme = this.element.jqmData( "theme" ); | |
| } | |
| label | |
| .buttonMarkup({ | |
| theme: this.options.theme, | |
| icon: this.element.parents( ":jqmData(type='horizontal')" ).length ? undefined : uncheckedicon, | |
| shadow: false | |
| }); | |
| // wrap the input + label in a div | |
| input | |
| .add( label ) | |
| .wrapAll( "<div class='ui-" + inputtype +"'></div>" ); | |
| label.bind({ | |
| vmouseover: function() { | |
| if( $(this).parent().is('.ui-disabled') ){ return false; } | |
| }, | |
| vclick: function( event ){ | |
| if ( input.is( ":disabled" ) ){ | |
| event.preventDefault(); | |
| return; | |
| } | |
| self._cacheVals(); | |
| input.prop( "checked", inputtype === "radio" && true || !(input.prop("checked")) ); | |
| // input set for common radio buttons will contain all the radio | |
| // buttons, but will not for checkboxes. clearing the checked status | |
| // of other radios ensures the active button state is applied properly | |
| self._getInputSet().not(input).prop('checked', false); | |
| self._updateAll(); | |
| return false; | |
| } | |
| }); | |
| input | |
| .bind({ | |
| vmousedown: function(){ | |
| this._cacheVals(); | |
| }, | |
| vclick: function(){ | |
| // adds checked attribute to checked input when keyboard is used | |
| if ($(this).is(":checked")) { | |
| $(this).prop( "checked", true); | |
| self._getInputSet().not($(this)).prop('checked', false); | |
| } else { | |
| $(this).prop("checked", false); | |
| } | |
| self._updateAll(); | |
| }, | |
| focus: function() { | |
| label.addClass( "ui-focus" ); | |
| }, | |
| blur: function() { | |
| label.removeClass( "ui-focus" ); | |
| } | |
| }); | |
| this.refresh(); | |
| }, | |
| _cacheVals: function(){ | |
| this._getInputSet().each(function(){ | |
| $(this).jqmData("cacheVal", $(this).is(":checked") ); | |
| }); | |
| }, | |
| //returns either a set of radios with the same name attribute, or a single checkbox | |
| _getInputSet: function(){ | |
| return this.element.closest( "form,fieldset,:jqmData(role='page')" ) | |
| .find( "input[name='"+ this.element.attr( "name" ) +"'][type='"+ this.inputtype +"']" ); | |
| }, | |
| _updateAll: function(){ | |
| var self = this; | |
| this._getInputSet().each(function(){ | |
| if( $(this).is(":checked") || self.inputtype === "checkbox" ){ | |
| $(this).trigger("change"); | |
| } | |
| }) | |
| .checkboxradio( "refresh" ); | |
| }, | |
| refresh: function( ){ | |
| var input = this.element, | |
| label = this.label, | |
| icon = label.find( ".ui-icon" ); | |
| // input[0].checked expando doesn't always report the proper value | |
| // for checked='checked' | |
| if ( $(input[0]).prop('checked') ) { | |
| label.addClass( $.mobile.activeBtnClass ); | |
| icon.addClass( this.checkedicon ).removeClass( this.uncheckedicon ); | |
| } else { | |
| label.removeClass( $.mobile.activeBtnClass ); | |
| icon.removeClass( this.checkedicon ).addClass( this.uncheckedicon ); | |
| } | |
| if( input.is( ":disabled" ) ){ | |
| this.disable(); | |
| } | |
| else { | |
| this.enable(); | |
| } | |
| }, | |
| disable: function(){ | |
| this.element.prop("disabled",true).parent().addClass("ui-disabled"); | |
| }, | |
| enable: function(){ | |
| this.element.prop("disabled",false).parent().removeClass("ui-disabled"); | |
| } | |
| }); | |
| })( jQuery ); | |
| /* | |
| * jQuery Mobile Framework : "textinput" plugin for text inputs, textareas | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| (function($, undefined ) { | |
| $.widget( "mobile.textinput", $.mobile.widget, { | |
| options: { | |
| theme: null | |
| }, | |
| _create: function(){ | |
| var input = this.element, | |
| o = this.options, | |
| theme = o.theme, | |
| themeclass; | |
| if ( !theme ) { | |
| var themedParent = this.element.closest("[class*='ui-bar-'],[class*='ui-body-']"), | |
| themeLetter = themedParent.length && /ui-(bar|body)-([a-z])/.exec( themedParent.attr("class") ), | |
| theme = themeLetter && themeLetter[2] || "c"; | |
| } | |
| themeclass = " ui-body-" + theme; | |
| $('label[for="'+input.attr('id')+'"]').addClass('ui-input-text'); | |
| input.addClass('ui-input-text ui-body-'+ o.theme); | |
| var focusedEl = input; | |
| //"search" input widget | |
| if( input.is( "[type='search'],:jqmData(type='search')" ) ){ | |
| focusedEl = input.wrap('<div class="ui-input-search ui-shadow-inset ui-btn-corner-all ui-btn-shadow ui-icon-searchfield'+ themeclass +'"></div>').parent(); | |
| var clearbtn = $('<a href="#" class="ui-input-clear" title="clear text">clear text</a>') | |
| .tap(function( e ){ | |
| input.val('').focus(); | |
| input.trigger('change'); | |
| clearbtn.addClass('ui-input-clear-hidden'); | |
| e.preventDefault(); | |
| }) | |
| .appendTo(focusedEl) | |
| .buttonMarkup({icon: 'delete', iconpos: 'notext', corners:true, shadow:true}); | |
| function toggleClear(){ | |
| if(input.val() == ''){ | |
| clearbtn.addClass('ui-input-clear-hidden'); | |
| } | |
| else{ | |
| clearbtn.removeClass('ui-input-clear-hidden'); | |
| } | |
| } | |
| toggleClear(); | |
| input.keyup(toggleClear); | |
| input.focus(toggleClear); | |
| } | |
| else{ | |
| input.addClass('ui-corner-all ui-shadow-inset' + themeclass); | |
| } | |
| input | |
| .focus(function(){ | |
| focusedEl.addClass('ui-focus'); | |
| }) | |
| .blur(function(){ | |
| focusedEl.removeClass('ui-focus'); | |
| }); | |
| //autogrow | |
| if ( input.is('textarea') ) { | |
| var extraLineHeight = 15, | |
| keyupTimeoutBuffer = 100, | |
| keyup = function() { | |
| var scrollHeight = input[0].scrollHeight, | |
| clientHeight = input[0].clientHeight; | |
| if ( clientHeight < scrollHeight ) { | |
| input.css({ height: (scrollHeight + extraLineHeight) }); | |
| } | |
| }, | |
| keyupTimeout; | |
| input.keyup(function() { | |
| clearTimeout( keyupTimeout ); | |
| keyupTimeout = setTimeout( keyup, keyupTimeoutBuffer ); | |
| }); | |
| } | |
| }, | |
| disable: function(){ | |
| ( this.element.attr("disabled",true).is( "[type='search'],:jqmData(type='search')" ) ? this.element.parent() : this.element ).addClass("ui-disabled"); | |
| }, | |
| enable: function(){ | |
| ( this.element.attr("disabled", false).is( "[type='search'],:jqmData(type='search')" ) ? this.element.parent() : this.element ).removeClass("ui-disabled"); | |
| } | |
| }); | |
| })( jQuery ); | |
| /* | |
| * jQuery Mobile Framework : "selectmenu" plugin | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| (function($, undefined ) { | |
| $.widget( "mobile.selectmenu", $.mobile.widget, { | |
| options: { | |
| theme: null, | |
| disabled: false, | |
| icon: 'arrow-d', | |
| iconpos: 'right', | |
| inline: null, | |
| corners: true, | |
| shadow: true, | |
| iconshadow: true, | |
| menuPageTheme: 'b', | |
| overlayTheme: 'a', | |
| hidePlaceholderMenuItems: true, | |
| closeText: 'Close', | |
| nativeMenu: true | |
| }, | |
| _create: function(){ | |
| var self = this, | |
| o = this.options, | |
| select = this.element | |
| .wrap( "<div class='ui-select'>" ), | |
| selectID = select.attr( "id" ), | |
| label = $( 'label[for="'+ selectID +'"]' ).addClass( "ui-select" ), | |
| //IE throws an exception at options.item() function when | |
| //there is no selected item | |
| //select first in this case | |
| selectedIndex = select[0].selectedIndex == -1 ? 0 : select[0].selectedIndex, | |
| button = ( self.options.nativeMenu ? $( "<div/>" ) : $( "<a>", { | |
| "href": "#", | |
| "role": "button", | |
| "id": buttonId, | |
| "aria-haspopup": "true", | |
| "aria-owns": menuId | |
| }) ) | |
| .text( $( select[0].options.item( selectedIndex ) ).text() ) | |
| .insertBefore( select ) | |
| .buttonMarkup({ | |
| theme: o.theme, | |
| icon: o.icon, | |
| iconpos: o.iconpos, | |
| inline: o.inline, | |
| corners: o.corners, | |
| shadow: o.shadow, | |
| iconshadow: o.iconshadow | |
| }), | |
| //multi select or not | |
| isMultiple = self.isMultiple = select[0].multiple; | |
| //Opera does not properly support opacity on select elements | |
| //In Mini, it hides the element, but not its text | |
| //On the desktop,it seems to do the opposite | |
| //for these reasons, using the nativeMenu option results in a full native select in Opera | |
| if( o.nativeMenu && window.opera && window.opera.version ){ | |
| select.addClass( "ui-select-nativeonly" ); | |
| } | |
| //vars for non-native menus | |
| if( !o.nativeMenu ){ | |
| var options = select.find("option"), | |
| buttonId = selectID + "-button", | |
| menuId = selectID + "-menu", | |
| thisPage = select.closest( ".ui-page" ), | |
| //button theme | |
| theme = /ui-btn-up-([a-z])/.exec( button.attr("class") )[1], | |
| menuPage = $( "<div data-" + $.mobile.ns + "role='dialog' data-" +$.mobile.ns + "theme='"+ o.menuPageTheme +"'>" + | |
| "<div data-" + $.mobile.ns + "role='header'>" + | |
| "<div class='ui-title'>" + label.text() + "</div>"+ | |
| "</div>"+ | |
| "<div data-" + $.mobile.ns + "role='content'></div>"+ | |
| "</div>" ) | |
| .appendTo( $.mobile.pageContainer ) | |
| .page(), | |
| menuPageContent = menuPage.find( ".ui-content" ), | |
| menuPageClose = menuPage.find( ".ui-header a" ), | |
| screen = $( "<div>", {"class": "ui-selectmenu-screen ui-screen-hidden"}) | |
| .appendTo( thisPage ), | |
| listbox = $( "<div>", { "class": "ui-selectmenu ui-selectmenu-hidden ui-overlay-shadow ui-corner-all pop ui-body-" + o.overlayTheme } ) | |
| .insertAfter(screen), | |
| list = $( "<ul>", { | |
| "class": "ui-selectmenu-list", | |
| "id": menuId, | |
| "role": "listbox", | |
| "aria-labelledby": buttonId | |
| }) | |
| .attr( "data-" + $.mobile.ns + "theme", theme ) | |
| .appendTo( listbox ), | |
| header = $( "<div>", { | |
| "class": "ui-header ui-bar-" + theme | |
| }) | |
| .prependTo( listbox ), | |
| headerTitle = $( "<h1>", { | |
| "class": "ui-title" | |
| }) | |
| .appendTo( header ), | |
| headerClose = $( "<a>", { | |
| "text": o.closeText, | |
| "href": "#", | |
| "class": "ui-btn-left" | |
| }) | |
| .attr( "data-" + $.mobile.ns + "iconpos", "notext" ) | |
| .attr( "data-" + $.mobile.ns + "icon", "delete" ) | |
| .appendTo( header ) | |
| .buttonMarkup(), | |
| menuType; | |
| } //end non native vars | |
| // add counter for multi selects | |
| if( isMultiple ){ | |
| self.buttonCount = $('<span>') | |
| .addClass( 'ui-li-count ui-btn-up-c ui-btn-corner-all' ) | |
| .hide() | |
| .appendTo( button ); | |
| } | |
| //disable if specified | |
| if( o.disabled ){ this.disable(); } | |
| //events on native select | |
| select | |
| .change(function(){ | |
| self.refresh(); | |
| }); | |
| //expose to other methods | |
| $.extend(self, { | |
| select: select, | |
| optionElems: options, | |
| selectID: selectID, | |
| label: label, | |
| buttonId:buttonId, | |
| menuId:menuId, | |
| thisPage:thisPage, | |
| button:button, | |
| menuPage:menuPage, | |
| menuPageContent:menuPageContent, | |
| screen:screen, | |
| listbox:listbox, | |
| list:list, | |
| menuType:menuType, | |
| header:header, | |
| headerClose:headerClose, | |
| headerTitle:headerTitle, | |
| placeholder: '' | |
| }); | |
| //support for using the native select menu with a custom button | |
| if( o.nativeMenu ){ | |
| select | |
| .appendTo(button) | |
| .bind( "vmousedown", function( e ){ | |
| //add active class to button | |
| button.addClass( $.mobile.activeBtnClass ); | |
| }) | |
| .bind( "focus vmouseover", function(){ | |
| button.trigger( "vmouseover" ); | |
| }) | |
| .bind( "vmousemove", function(){ | |
| //remove active class on scroll/touchmove | |
| button.removeClass( $.mobile.activeBtnClass ); | |
| }) | |
| .bind( "change blur vmouseout", function(){ | |
| button | |
| .trigger( "vmouseout" ) | |
| .removeClass( $.mobile.activeBtnClass ); | |
| }); | |
| } else { | |
| //create list from select, update state | |
| self.refresh(); | |
| select | |
| .attr( "tabindex", "-1" ) | |
| .focus(function(){ | |
| $(this).blur(); | |
| button.focus(); | |
| }); | |
| //button events | |
| button | |
| .bind( "vclick keydown" , function( event ){ | |
| if( event.type == "vclick" || | |
| event.keyCode && ( event.keyCode === $.mobile.keyCode.ENTER || event.keyCode === $.mobile.keyCode.SPACE ) ){ | |
| self.open(); | |
| event.preventDefault(); | |
| } | |
| }); | |
| //events for list items | |
| list | |
| .attr( "role", "listbox" ) | |
| .delegate( ".ui-li>a", "focusin", function() { | |
| $( this ).attr( "tabindex", "0" ); | |
| }) | |
| .delegate( ".ui-li>a", "focusout", function() { | |
| $( this ).attr( "tabindex", "-1" ); | |
| }) | |
| .delegate("li:not(.ui-disabled, .ui-li-divider)", "vclick", function(event){ | |
| // index of option tag to be selected | |
| var oldIndex = select[0].selectedIndex, | |
| newIndex = list.find( "li:not(.ui-li-divider)" ).index( this ), | |
| option = self.optionElems.eq( newIndex )[0]; | |
| // toggle selected status on the tag for multi selects | |
| option.selected = isMultiple ? !option.selected : true; | |
| // toggle checkbox class for multiple selects | |
| if( isMultiple ){ | |
| $(this) | |
| .find('.ui-icon') | |
| .toggleClass('ui-icon-checkbox-on', option.selected) | |
| .toggleClass('ui-icon-checkbox-off', !option.selected); | |
| } | |
| // trigger change if value changed | |
| if( isMultiple || oldIndex !== newIndex ){ | |
| select.trigger( "change" ); | |
| } | |
| //hide custom select for single selects only | |
| if( !isMultiple ){ | |
| self.close(); | |
| } | |
| event.preventDefault(); | |
| }) | |
| //keyboard events for menu items | |
| .keydown(function( e ) { | |
| var target = $( e.target ), | |
| li = target.closest( "li" ); | |
| // switch logic based on which key was pressed | |
| switch ( e.keyCode ) { | |
| // up or left arrow keys | |
| case 38: | |
| var prev = li.prev(); | |
| // if there's a previous option, focus it | |
| if ( prev.length ) { | |
| target | |
| .blur() | |
| .attr( "tabindex", "-1" ); | |
| prev.find( "a" ).first().focus(); | |
| } | |
| return false; | |
| break; | |
| // down or right arrow keys | |
| case 40: | |
| var next = li.next(); | |
| // if there's a next option, focus it | |
| if ( next.length ) { | |
| target | |
| .blur() | |
| .attr( "tabindex", "-1" ); | |
| next.find( "a" ).first().focus(); | |
| } | |
| return false; | |
| break; | |
| // if enter or space is pressed, trigger click | |
| case 13: | |
| case 32: | |
| target.trigger( "vclick" ); | |
| return false; | |
| break; | |
| } | |
| }); | |
| //events on "screen" overlay | |
| screen.bind("vclick", function( event ){ | |
| self.close(); | |
| }); | |
| //close button on small overlays | |
| self.headerClose.click(function(){ | |
| if( self.menuType == "overlay" ){ | |
| self.close(); | |
| return false; | |
| } | |
| }) | |
| } | |
| }, | |
| _buildList: function(){ | |
| var self = this, | |
| o = this.options, | |
| placeholder = this.placeholder, | |
| optgroups = [], | |
| lis = [], | |
| dataIcon = self.isMultiple ? "checkbox-off" : "false"; | |
| self.list.empty().filter('.ui-listview').listview('destroy'); | |
| //populate menu with options from select element | |
| self.select.find( "option" ).each(function( i ){ | |
| var $this = $(this), | |
| $parent = $this.parent(), | |
| text = $this.text(), | |
| anchor = "<a href='#'>"+ text +"</a>", | |
| classes = [], | |
| extraAttrs = []; | |
| // are we inside an optgroup? | |
| if( $parent.is("optgroup") ){ | |
| var optLabel = $parent.attr("label"); | |
| // has this optgroup already been built yet? | |
| if( $.inArray(optLabel, optgroups) === -1 ){ | |
| lis.push( "<li data-" + $.mobile.ns + "role='list-divider'>"+ optLabel +"</li>" ); | |
| optgroups.push( optLabel ); | |
| } | |
| } | |
| //find placeholder text | |
| if( !this.getAttribute('value') || text.length == 0 || $this.jqmData('placeholder') ){ | |
| if( o.hidePlaceholderMenuItems ){ | |
| classes.push( "ui-selectmenu-placeholder" ); | |
| } | |
| placeholder = self.placeholder = text; | |
| } | |
| // support disabled option tags | |
| if( this.disabled ){ | |
| classes.push( "ui-disabled" ); | |
| extraAttrs.push( "aria-disabled='true'" ); | |
| } | |
| lis.push( "<li data-" + $.mobile.ns + "icon='"+ dataIcon +"' class='"+ classes.join(" ") + "' " + extraAttrs.join(" ") +">"+ anchor +"</li>" ) | |
| }); | |
| self.list.html( lis.join(" ") ); | |
| self.list.find( "li" ) | |
| .attr({ "role": "option", "tabindex": "-1" }) | |
| .first().attr( "tabindex", "0" ); | |
| // hide header close link for single selects | |
| if( !this.isMultiple ){ | |
| this.headerClose.hide(); | |
| } | |
| // hide header if it's not a multiselect and there's no placeholder | |
| if( !this.isMultiple && !placeholder.length ){ | |
| this.header.hide(); | |
| } else { | |
| this.headerTitle.text( this.placeholder ); | |
| } | |
| //now populated, create listview | |
| self.list.listview(); | |
| }, | |
| refresh: function( forceRebuild ){ | |
| var self = this, | |
| select = this.element, | |
| isMultiple = this.isMultiple, | |
| options = this.optionElems = select.find("option"), | |
| selected = options.filter(":selected"), | |
| // return an array of all selected index's | |
| indicies = selected.map(function(){ | |
| return options.index( this ); | |
| }).get(); | |
| if( !self.options.nativeMenu && ( forceRebuild || select[0].options.length != self.list.find('li').length )){ | |
| self._buildList(); | |
| } | |
| self.button | |
| .find( ".ui-btn-text" ) | |
| .text(function(){ | |
| if( !isMultiple ){ | |
| return selected.text(); | |
| } | |
| return selected.length ? | |
| selected.map(function(){ return $(this).text(); }).get().join(', ') : | |
| self.placeholder; | |
| }); | |
| // multiple count inside button | |
| if( isMultiple ){ | |
| self.buttonCount[ selected.length > 1 ? 'show' : 'hide' ]().text( selected.length ); | |
| } | |
| if( !self.options.nativeMenu ){ | |
| self.list | |
| .find( 'li:not(.ui-li-divider)' ) | |
| .removeClass( $.mobile.activeBtnClass ) | |
| .attr( 'aria-selected', false ) | |
| .each(function( i ){ | |
| if( $.inArray(i, indicies) > -1 ){ | |
| var item = $(this).addClass( $.mobile.activeBtnClass ); | |
| // aria selected attr | |
| item.find( 'a' ).attr( 'aria-selected', true ); | |
| // multiple selects: add the "on" checkbox state to the icon | |
| if( isMultiple ){ | |
| item.find('.ui-icon').removeClass('ui-icon-checkbox-off').addClass('ui-icon-checkbox-on'); | |
| } | |
| } | |
| }); | |
| } | |
| }, | |
| open: function(){ | |
| if( this.options.disabled || this.options.nativeMenu ){ return; } | |
| var self = this, | |
| menuHeight = self.list.parent().outerHeight(), | |
| menuWidth = self.list.parent().outerWidth(), | |
| scrollTop = $(window).scrollTop(), | |
| btnOffset = self.button.offset().top, | |
| screenHeight = window.innerHeight, | |
| screenWidth = window.innerWidth; | |
| //add active class to button | |
| self.button.addClass( $.mobile.activeBtnClass ); | |
| //remove after delay | |
| setTimeout(function(){ | |
| self.button.removeClass( $.mobile.activeBtnClass ); | |
| }, 300); | |
| function focusMenuItem(){ | |
| self.list.find( ".ui-btn-active" ).focus(); | |
| } | |
| if( menuHeight > screenHeight - 80 || !$.support.scrollTop ){ | |
| //for webos (set lastscroll using button offset) | |
| if( scrollTop == 0 && btnOffset > screenHeight ){ | |
| self.thisPage.one('pagehide',function(){ | |
| $(this).jqmData('lastScroll', btnOffset); | |
| }); | |
| } | |
| self.menuPage.one('pageshow', function() { | |
| // silentScroll() is called whenever a page is shown to restore | |
| // any previous scroll position the page may have had. We need to | |
| // wait for the "silentscroll" event before setting focus to avoid | |
| // the browser's "feature" which offsets rendering to make sure | |
| // whatever has focus is in view. | |
| $(window).one("silentscroll", function(){ focusMenuItem(); }); | |
| }); | |
| self.menuType = "page"; | |
| self.menuPageContent.append( self.list ); | |
| $.mobile.changePage( self.menuPage, { transition: 'pop' } ); | |
| } | |
| else { | |
| self.menuType = "overlay"; | |
| self.screen | |
| .height( $(document).height() ) | |
| .removeClass('ui-screen-hidden'); | |
| //try and center the overlay over the button | |
| var roomtop = btnOffset - scrollTop, | |
| roombot = scrollTop + screenHeight - btnOffset, | |
| halfheight = menuHeight / 2, | |
| maxwidth = parseFloat(self.list.parent().css('max-width')), | |
| newtop, newleft; | |
| if( roomtop > menuHeight / 2 && roombot > menuHeight / 2 ){ | |
| newtop = btnOffset + ( self.button.outerHeight() / 2 ) - halfheight; | |
| } | |
| else{ | |
| //30px tolerance off the edges | |
| newtop = roomtop > roombot ? scrollTop + screenHeight - menuHeight - 30 : scrollTop + 30; | |
| } | |
| // if the menuwidth is smaller than the screen center is | |
| if (menuWidth < maxwidth) { | |
| newleft = (screenWidth - menuWidth) / 2; | |
| } else { //otherwise insure a >= 30px offset from the left | |
| newleft = self.button.offset().left + self.button.outerWidth() / 2 - menuWidth / 2; | |
| // 30px tolerance off the edges | |
| if (newleft < 30) { | |
| newleft = 30; | |
| } else if ((newleft + menuWidth) > screenWidth) { | |
| newleft = screenWidth - menuWidth - 30; | |
| } | |
| } | |
| self.listbox | |
| .append( self.list ) | |
| .removeClass( "ui-selectmenu-hidden" ) | |
| .css({ | |
| top: newtop, | |
| left: newleft | |
| }) | |
| .addClass("in"); | |
| focusMenuItem(); | |
| } | |
| // wait before the dialog can be closed | |
| setTimeout(function(){ | |
| self.isOpen = true; | |
| }, 400); | |
| }, | |
| close: function(){ | |
| if( this.options.disabled || !this.isOpen || this.options.nativeMenu ){ return; } | |
| var self = this; | |
| function focusButton(){ | |
| setTimeout(function(){ | |
| self.button.focus(); | |
| }, 40); | |
| self.listbox.removeAttr('style').append( self.list ); | |
| } | |
| if(self.menuType == "page"){ | |
| // button refocus ensures proper height calculation | |
| // by removing the inline style and ensuring page inclusion | |
| self.menuPage.one("pagehide", focusButton); | |
| // doesn't solve the possible issue with calling change page | |
| // where the objects don't define data urls which prevents dialog key | |
| // stripping - changePage has incoming refactor | |
| window.history.back(); | |
| } | |
| else{ | |
| self.screen.addClass( "ui-screen-hidden" ); | |
| self.listbox.addClass( "ui-selectmenu-hidden" ).removeAttr( "style" ).removeClass("in"); | |
| focusButton(); | |
| } | |
| // allow the dialog to be closed again | |
| this.isOpen = false; | |
| }, | |
| disable: function(){ | |
| this.element.attr("disabled",true); | |
| this.button.addClass('ui-disabled').attr("aria-disabled", true); | |
| return this._setOption( "disabled", true ); | |
| }, | |
| enable: function(){ | |
| this.element.attr("disabled",false); | |
| this.button.removeClass('ui-disabled').attr("aria-disabled", false); | |
| return this._setOption( "disabled", false ); | |
| } | |
| }); | |
| })( jQuery ); | |
| /* | |
| * jQuery Mobile Framework : plugin for making button-like links | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| ( function( $, undefined ) { | |
| $.fn.buttonMarkup = function( options ) { | |
| return this.each( function() { | |
| var el = $( this ), | |
| o = $.extend( {}, $.fn.buttonMarkup.defaults, el.jqmData(), options ), | |
| // Classes Defined | |
| buttonClass, | |
| innerClass = "ui-btn-inner", | |
| iconClass; | |
| if ( attachEvents ) { | |
| attachEvents(); | |
| } | |
| // if not, try to find closest theme container | |
| if ( !o.theme ) { | |
| var themedParent = el.closest( "[class*='ui-bar-'],[class*='ui-body-']" ); | |
| o.theme = themedParent.length ? | |
| /ui-(bar|body)-([a-z])/.exec( themedParent.attr( "class" ) )[2] : | |
| "c"; | |
| } | |
| buttonClass = "ui-btn ui-btn-up-" + o.theme; | |
| if ( o.inline ) { | |
| buttonClass += " ui-btn-inline"; | |
| } | |
| if ( o.icon ) { | |
| o.icon = "ui-icon-" + o.icon; | |
| o.iconpos = o.iconpos || "left"; | |
| iconClass = "ui-icon " + o.icon; | |
| if ( o.shadow ) { | |
| iconClass += " ui-icon-shadow"; | |
| } | |
| } | |
| if ( o.iconpos ) { | |
| buttonClass += " ui-btn-icon-" + o.iconpos; | |
| if ( o.iconpos == "notext" && !el.attr( "title" ) ) { | |
| el.attr( "title", el.text() ); | |
| } | |
| } | |
| if ( o.corners ) { | |
| buttonClass += " ui-btn-corner-all"; | |
| innerClass += " ui-btn-corner-all"; | |
| } | |
| if ( o.shadow ) { | |
| buttonClass += " ui-shadow"; | |
| } | |
| el | |
| .attr( "data-" + $.mobile.ns + "theme", o.theme ) | |
| .addClass( buttonClass ); | |
| var wrap = ( "<D class='" + innerClass + "'><D class='ui-btn-text'></D>" + | |
| ( o.icon ? "<span class='" + iconClass + "'></span>" : "" ) + | |
| "</D>" ).replace( /D/g, o.wrapperEls ); | |
| el.wrapInner( wrap ); | |
| }); | |
| }; | |
| $.fn.buttonMarkup.defaults = { | |
| corners: true, | |
| shadow: true, | |
| iconshadow: true, | |
| wrapperEls: "span" | |
| }; | |
| function closestEnabledButton( element ) | |
| { | |
| while ( element ) { | |
| var $ele = $( element ); | |
| if ( $ele.hasClass( "ui-btn" ) && !$ele.hasClass( "ui-disabled" ) ) { | |
| break; | |
| } | |
| element = element.parentNode; | |
| } | |
| return element; | |
| } | |
| var attachEvents = function() { | |
| $( document ).bind( { | |
| "vmousedown": function( event ) { | |
| var btn = closestEnabledButton( event.target ); | |
| if ( btn ) { | |
| var $btn = $( btn ), | |
| theme = $btn.attr( "data-" + $.mobile.ns + "theme" ); | |
| $btn.removeClass( "ui-btn-up-" + theme ).addClass( "ui-btn-down-" + theme ); | |
| } | |
| }, | |
| "vmousecancel vmouseup": function( event ) { | |
| var btn = closestEnabledButton( event.target ); | |
| if ( btn ) { | |
| var $btn = $( btn ), | |
| theme = $btn.attr( "data-" + $.mobile.ns + "theme" ); | |
| $btn.removeClass( "ui-btn-down-" + theme ).addClass( "ui-btn-up-" + theme ); | |
| } | |
| }, | |
| "vmouseover focus": function( event ) { | |
| var btn = closestEnabledButton( event.target ); | |
| if ( btn ) { | |
| var $btn = $( btn ), | |
| theme = $btn.attr( "data-" + $.mobile.ns + "theme" ); | |
| $btn.removeClass( "ui-btn-up-" + theme ).addClass( "ui-btn-hover-" + theme ); | |
| } | |
| }, | |
| "vmouseout blur": function( event ) { | |
| var btn = closestEnabledButton( event.target ); | |
| if ( btn ) { | |
| var $btn = $( btn ), | |
| theme = $btn.attr( "data-" + $.mobile.ns + "theme" ); | |
| $btn.removeClass( "ui-btn-hover-" + theme ).addClass( "ui-btn-up-" + theme ); | |
| } | |
| } | |
| }); | |
| attachEvents = null; | |
| }; | |
| })( jQuery ); | |
| /* | |
| * jQuery Mobile Framework : "button" plugin - links that proxy to native input/buttons | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| (function($, undefined ) { | |
| $.widget( "mobile.button", $.mobile.widget, { | |
| options: { | |
| theme: null, | |
| icon: null, | |
| iconpos: null, | |
| inline: null, | |
| corners: true, | |
| shadow: true, | |
| iconshadow: true | |
| }, | |
| _create: function(){ | |
| var $el = this.element, | |
| o = this.options; | |
| //add ARIA role | |
| this.button = $( "<div></div>" ) | |
| .text( $el.text() || $el.val() ) | |
| .buttonMarkup({ | |
| theme: o.theme, | |
| icon: o.icon, | |
| iconpos: o.iconpos, | |
| inline: o.inline, | |
| corners: o.corners, | |
| shadow: o.shadow, | |
| iconshadow: o.iconshadow | |
| }) | |
| .insertBefore( $el ) | |
| .append( $el.addClass('ui-btn-hidden') ); | |
| //add hidden input during submit | |
| var type = $el.attr('type'); | |
| if( type !== 'button' && type !== 'reset' ){ | |
| $el.bind("vclick", function(){ | |
| var $buttonPlaceholder = $("<input>", | |
| {type: "hidden", name: $el.attr("name"), value: $el.attr("value")}) | |
| .insertBefore($el); | |
| //bind to doc to remove after submit handling | |
| $(document).submit(function(){ | |
| $buttonPlaceholder.remove(); | |
| }); | |
| }); | |
| } | |
| this.refresh(); | |
| }, | |
| enable: function(){ | |
| this.element.attr("disabled", false); | |
| this.button.removeClass("ui-disabled").attr("aria-disabled", false); | |
| return this._setOption("disabled", false); | |
| }, | |
| disable: function(){ | |
| this.element.attr("disabled", true); | |
| this.button.addClass("ui-disabled").attr("aria-disabled", true); | |
| return this._setOption("disabled", true); | |
| }, | |
| refresh: function(){ | |
| if( this.element.attr('disabled') ){ | |
| this.disable(); | |
| } | |
| else{ | |
| this.enable(); | |
| } | |
| } | |
| }); | |
| })( jQuery );/* | |
| * jQuery Mobile Framework : "slider" plugin | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| (function($, undefined ) { | |
| $.widget( "mobile.slider", $.mobile.widget, { | |
| options: { | |
| theme: null, | |
| trackTheme: null, | |
| disabled: false | |
| }, | |
| _create: function(){ | |
| var self = this, | |
| control = this.element, | |
| parentTheme = control.parents('[class*=ui-bar-],[class*=ui-body-]').eq(0), | |
| parentTheme = parentTheme.length ? parentTheme.attr('class').match(/ui-(bar|body)-([a-z])/)[2] : 'c', | |
| theme = this.options.theme ? this.options.theme : parentTheme, | |
| trackTheme = this.options.trackTheme ? this.options.trackTheme : parentTheme, | |
| cType = control[0].nodeName.toLowerCase(), | |
| selectClass = (cType == 'select') ? 'ui-slider-switch' : '', | |
| controlID = control.attr('id'), | |
| labelID = controlID + '-label', | |
| label = $('[for="'+ controlID +'"]').attr('id',labelID), | |
| val = function(){ | |
| return (cType == 'input') ? parseFloat(control.val()) : control[0].selectedIndex; | |
| }, | |
| min = (cType == 'input') ? parseFloat(control.attr('min')) : 0, | |
| max = (cType == 'input') ? parseFloat(control.attr('max')) : control.find('option').length-1, | |
| step = window.parseFloat(control.attr('step') || 1), | |
| slider = $('<div class="ui-slider '+ selectClass +' ui-btn-down-'+ trackTheme+' ui-btn-corner-all" role="application"></div>'), | |
| handle = $('<a href="#" class="ui-slider-handle"></a>') | |
| .appendTo(slider) | |
| .buttonMarkup({corners: true, theme: theme, shadow: true}) | |
| .attr({ | |
| 'role': 'slider', | |
| 'aria-valuemin': min, | |
| 'aria-valuemax': max, | |
| 'aria-valuenow': val(), | |
| 'aria-valuetext': val(), | |
| 'title': val(), | |
| 'aria-labelledby': labelID | |
| }); | |
| $.extend(this, { | |
| slider: slider, | |
| handle: handle, | |
| dragging: false, | |
| beforeStart: null | |
| }); | |
| if(cType == 'select'){ | |
| slider.wrapInner('<div class="ui-slider-inneroffset"></div>'); | |
| var options = control.find('option'); | |
| control.find('option').each(function(i){ | |
| var side = (i==0) ?'b':'a', | |
| corners = (i==0) ? 'right' :'left', | |
| theme = (i==0) ? ' ui-btn-down-' + trackTheme :' ui-btn-active'; | |
| $('<div class="ui-slider-labelbg ui-slider-labelbg-'+ side + theme +' ui-btn-corner-'+ corners+'"></div>').prependTo(slider); | |
| $('<span class="ui-slider-label ui-slider-label-'+ side + theme +' ui-btn-corner-'+ corners+'" role="img">'+$(this).text()+'</span>').prependTo(handle); | |
| }); | |
| } | |
| label.addClass('ui-slider'); | |
| // monitor the input for updated values | |
| control | |
| .addClass((cType == 'input') ? 'ui-slider-input' : 'ui-slider-switch') | |
| .change(function(){ | |
| self.refresh( val(), true ); | |
| }) | |
| .keyup(function(){ // necessary? | |
| self.refresh( val(), true, true ); | |
| }) | |
| .blur(function(){ | |
| self.refresh( val(), true ); | |
| }); | |
| // prevent screen drag when slider activated | |
| $(document).bind( "vmousemove", function(event){ | |
| if ( self.dragging ) { | |
| self.refresh( event ); | |
| return false; | |
| } | |
| }); | |
| slider | |
| .bind( "vmousedown", function(event){ | |
| self.dragging = true; | |
| if ( cType === "select" ) { | |
| self.beforeStart = control[0].selectedIndex; | |
| } | |
| self.refresh( event ); | |
| return false; | |
| }); | |
| slider | |
| .add(document) | |
| .bind( "vmouseup", function(){ | |
| if ( self.dragging ) { | |
| self.dragging = false; | |
| if ( cType === "select" ) { | |
| if ( self.beforeStart === control[0].selectedIndex ) { | |
| //tap occurred, but value didn't change. flip it! | |
| self.refresh( self.beforeStart === 0 ? 1 : 0 ); | |
| } | |
| var curval = val(); | |
| var snapped = Math.round( curval / (max - min) * 100 ); | |
| handle | |
| .addClass("ui-slider-handle-snapping") | |
| .css("left", snapped + "%") | |
| .animationComplete(function(){ | |
| handle.removeClass("ui-slider-handle-snapping"); | |
| }); | |
| } | |
| return false; | |
| } | |
| }); | |
| slider.insertAfter(control); | |
| // NOTE force focus on handle | |
| this.handle | |
| .bind( "vmousedown", function(){ | |
| $(this).focus(); | |
| }) | |
| .bind( "vclick", false ); | |
| this.handle | |
| .bind( "keydown", function( event ) { | |
| var index = val(); | |
| if ( self.options.disabled ) { | |
| return; | |
| } | |
| // In all cases prevent the default and mark the handle as active | |
| switch ( event.keyCode ) { | |
| case $.mobile.keyCode.HOME: | |
| case $.mobile.keyCode.END: | |
| case $.mobile.keyCode.PAGE_UP: | |
| case $.mobile.keyCode.PAGE_DOWN: | |
| case $.mobile.keyCode.UP: | |
| case $.mobile.keyCode.RIGHT: | |
| case $.mobile.keyCode.DOWN: | |
| case $.mobile.keyCode.LEFT: | |
| event.preventDefault(); | |
| if ( !self._keySliding ) { | |
| self._keySliding = true; | |
| $( this ).addClass( "ui-state-active" ); | |
| } | |
| break; | |
| } | |
| // move the slider according to the keypress | |
| switch ( event.keyCode ) { | |
| case $.mobile.keyCode.HOME: | |
| self.refresh(min); | |
| break; | |
| case $.mobile.keyCode.END: | |
| self.refresh(max); | |
| break; | |
| case $.mobile.keyCode.PAGE_UP: | |
| case $.mobile.keyCode.UP: | |
| case $.mobile.keyCode.RIGHT: | |
| self.refresh(index + step); | |
| break; | |
| case $.mobile.keyCode.PAGE_DOWN: | |
| case $.mobile.keyCode.DOWN: | |
| case $.mobile.keyCode.LEFT: | |
| self.refresh(index - step); | |
| break; | |
| } | |
| }) // remove active mark | |
| .keyup(function( event ) { | |
| if ( self._keySliding ) { | |
| self._keySliding = false; | |
| $( this ).removeClass( "ui-state-active" ); | |
| } | |
| }); | |
| this.refresh(); | |
| }, | |
| refresh: function(val, isfromControl, preventInputUpdate){ | |
| if ( this.options.disabled ) { return; } | |
| var control = this.element, percent, | |
| cType = control[0].nodeName.toLowerCase(), | |
| min = (cType === "input") ? parseFloat(control.attr("min")) : 0, | |
| max = (cType === "input") ? parseFloat(control.attr("max")) : control.find("option").length - 1; | |
| if ( typeof val === "object" ) { | |
| var data = val, | |
| // a slight tolerance helped get to the ends of the slider | |
| tol = 8; | |
| if ( !this.dragging | |
| || data.pageX < this.slider.offset().left - tol | |
| || data.pageX > this.slider.offset().left + this.slider.width() + tol ) { | |
| return; | |
| } | |
| percent = Math.round( ((data.pageX - this.slider.offset().left) / this.slider.width() ) * 100 ); | |
| } else { | |
| if ( val == null ) { | |
| val = (cType === "input") ? parseFloat(control.val()) : control[0].selectedIndex; | |
| } | |
| percent = (parseFloat(val) - min) / (max - min) * 100; | |
| } | |
| if ( isNaN(percent) ) { return; } | |
| if ( percent < 0 ) { percent = 0; } | |
| if ( percent > 100 ) { percent = 100; } | |
| var newval = Math.round( (percent / 100) * (max - min) ) + min; | |
| if ( newval < min ) { newval = min; } | |
| if ( newval > max ) { newval = max; } | |
| //flip the stack of the bg colors | |
| if ( percent > 60 && cType === "select" ) { | |
| } | |
| this.handle.css("left", percent + "%"); | |
| this.handle.attr({ | |
| "aria-valuenow": (cType === "input") ? newval : control.find("option").eq(newval).attr("value"), | |
| "aria-valuetext": (cType === "input") ? newval : control.find("option").eq(newval).text(), | |
| title: newval | |
| }); | |
| // add/remove classes for flip toggle switch | |
| if ( cType === "select" ) { | |
| if ( newval === 0 ) { | |
| this.slider.addClass("ui-slider-switch-a") | |
| .removeClass("ui-slider-switch-b"); | |
| } else { | |
| this.slider.addClass("ui-slider-switch-b") | |
| .removeClass("ui-slider-switch-a"); | |
| } | |
| } | |
| if(!preventInputUpdate){ | |
| // update control's value | |
| if ( cType === "input" ) { | |
| control.val(newval); | |
| } else { | |
| control[ 0 ].selectedIndex = newval; | |
| } | |
| if (!isfromControl) { control.trigger("change"); } | |
| } | |
| }, | |
| enable: function(){ | |
| this.element.attr("disabled", false); | |
| this.slider.removeClass("ui-disabled").attr("aria-disabled", false); | |
| return this._setOption("disabled", false); | |
| }, | |
| disable: function(){ | |
| this.element.attr("disabled", true); | |
| this.slider.addClass("ui-disabled").attr("aria-disabled", true); | |
| return this._setOption("disabled", true); | |
| } | |
| }); | |
| })( jQuery ); | |
| /* | |
| * jQuery Mobile Framework : "collapsible" plugin | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| ( function( $, undefined ) { | |
| $.widget( "mobile.collapsible", $.mobile.widget, { | |
| options: { | |
| expandCueText: " click to expand contents", | |
| collapseCueText: " click to collapse contents", | |
| collapsed: false, | |
| heading: ">:header,>legend", | |
| theme: null, | |
| iconTheme: "d" | |
| }, | |
| _create: function() { | |
| var $el = this.element, | |
| o = this.options, | |
| collapsibleContain = $el.addClass( "ui-collapsible-contain" ), | |
| collapsibleHeading = $el.find( o.heading ).eq( 0 ), | |
| collapsibleContent = collapsibleContain.wrapInner( '<div class="ui-collapsible-content"></div>' ).find( ".ui-collapsible-content" ), | |
| collapsibleParent = $el.closest( ":jqmData(role='collapsible-set')" ).addClass( "ui-collapsible-set" ); | |
| //replace collapsibleHeading if it's a legend | |
| if ( collapsibleHeading.is( "legend" ) ) { | |
| collapsibleHeading = $( '<div role="heading">'+ collapsibleHeading.html() +"</div>" ).insertBefore( collapsibleHeading ); | |
| collapsibleHeading.next().remove(); | |
| } | |
| collapsibleHeading | |
| //drop heading in before content | |
| .insertBefore( collapsibleContent ) | |
| //modify markup & attributes | |
| .addClass( "ui-collapsible-heading" ) | |
| .append( '<span class="ui-collapsible-heading-status"></span>' ) | |
| .wrapInner( '<a href="#" class="ui-collapsible-heading-toggle"></a>' ) | |
| .find( "a:eq(0)" ) | |
| .buttonMarkup( { | |
| shadow: !collapsibleParent.length, | |
| corners: false, | |
| iconPos: "left", | |
| icon: "plus", | |
| theme: o.theme | |
| } ) | |
| .find( ".ui-icon" ) | |
| .removeAttr( "class" ) | |
| .buttonMarkup( { | |
| shadow: true, | |
| corners: true, | |
| iconPos: "notext", | |
| icon: "plus", | |
| theme: o.iconTheme | |
| } ); | |
| if ( ! collapsibleParent.length ) { | |
| collapsibleHeading | |
| .find( "a:eq(0)" ) | |
| .addClass( "ui-corner-all" ) | |
| .find( ".ui-btn-inner" ) | |
| .addClass( "ui-corner-all" ); | |
| } | |
| else { | |
| if ( collapsibleContain.jqmData( "collapsible-last" ) ) { | |
| collapsibleHeading | |
| .find( "a:eq(0), .ui-btn-inner" ) | |
| .addClass( "ui-corner-bottom" ); | |
| } | |
| } | |
| //events | |
| collapsibleContain | |
| .bind( "collapse", function( event ) { | |
| if ( ! event.isDefaultPrevented() && $( event.target ).closest( ".ui-collapsible-contain" ).is( collapsibleContain ) ) { | |
| event.preventDefault(); | |
| collapsibleHeading | |
| .addClass( "ui-collapsible-heading-collapsed" ) | |
| .find( ".ui-collapsible-heading-status" ) | |
| .text( o.expandCueText ) | |
| .end() | |
| .find( ".ui-icon" ) | |
| .removeClass( "ui-icon-minus" ) | |
| .addClass( "ui-icon-plus" ); | |
| collapsibleContent.addClass( "ui-collapsible-content-collapsed" ).attr( "aria-hidden", true ); | |
| if ( collapsibleContain.jqmData( "collapsible-last" ) ) { | |
| collapsibleHeading | |
| .find( "a:eq(0), .ui-btn-inner" ) | |
| .addClass( "ui-corner-bottom" ); | |
| } | |
| } | |
| } ) | |
| .bind( "expand", function( event ) { | |
| if ( ! event.isDefaultPrevented() ) { | |
| event.preventDefault(); | |
| collapsibleHeading | |
| .removeClass( "ui-collapsible-heading-collapsed" ) | |
| .find( ".ui-collapsible-heading-status" ).text( o.collapseCueText ); | |
| collapsibleHeading.find( ".ui-icon" ).removeClass( "ui-icon-plus" ).addClass( "ui-icon-minus" ); | |
| collapsibleContent.removeClass( "ui-collapsible-content-collapsed" ).attr( "aria-hidden", false ); | |
| if ( collapsibleContain.jqmData( "collapsible-last" ) ) { | |
| collapsibleHeading | |
| .find( "a:eq(0), .ui-btn-inner" ) | |
| .removeClass( "ui-corner-bottom" ); | |
| } | |
| } | |
| } ) | |
| .trigger( o.collapsed ? "collapse" : "expand" ); | |
| //close others in a set | |
| if ( collapsibleParent.length && !collapsibleParent.jqmData( "collapsiblebound" ) ) { | |
| collapsibleParent | |
| .jqmData( "collapsiblebound", true ) | |
| .bind( "expand", function( event ){ | |
| $( event.target ) | |
| .closest( ".ui-collapsible-contain" ) | |
| .siblings( ".ui-collapsible-contain" ) | |
| .trigger( "collapse" ); | |
| } ); | |
| var set = collapsibleParent.find( ":jqmData(role='collapsible'):first" ); | |
| set.first() | |
| .find( "a:eq(0)" ) | |
| .addClass( "ui-corner-top" ) | |
| .find( ".ui-btn-inner" ) | |
| .addClass( "ui-corner-top" ); | |
| set.last().jqmData( "collapsible-last", true ); | |
| } | |
| collapsibleHeading | |
| .bind( "vclick", function( e ) { | |
| if ( collapsibleHeading.is( ".ui-collapsible-heading-collapsed" ) ) { | |
| collapsibleContain.trigger( "expand" ); | |
| } | |
| else { | |
| collapsibleContain.trigger( "collapse" ); | |
| } | |
| e.preventDefault(); | |
| } ); | |
| } | |
| } ); | |
| } )( jQuery ); | |
| /* | |
| * jQuery Mobile Framework: "controlgroup" plugin - corner-rounding for groups of buttons, checks, radios, etc | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| (function($, undefined ) { | |
| $.fn.controlgroup = function(options){ | |
| return this.each(function(){ | |
| var o = $.extend({ | |
| direction: $( this ).jqmData( "type" ) || "vertical", | |
| shadow: false | |
| },options); | |
| var groupheading = $(this).find('>legend'), | |
| flCorners = o.direction == 'horizontal' ? ['ui-corner-left', 'ui-corner-right'] : ['ui-corner-top', 'ui-corner-bottom'], | |
| type = $(this).find('input:eq(0)').attr('type'); | |
| //replace legend with more stylable replacement div | |
| if( groupheading.length ){ | |
| $(this).wrapInner('<div class="ui-controlgroup-controls"></div>'); | |
| $('<div role="heading" class="ui-controlgroup-label">'+ groupheading.html() +'</div>').insertBefore( $(this).children(0) ); | |
| groupheading.remove(); | |
| } | |
| $(this).addClass('ui-corner-all ui-controlgroup ui-controlgroup-'+o.direction); | |
| function flipClasses(els){ | |
| els | |
| .removeClass('ui-btn-corner-all ui-shadow') | |
| .eq(0).addClass(flCorners[0]) | |
| .end() | |
| .filter(':last').addClass(flCorners[1]).addClass('ui-controlgroup-last'); | |
| } | |
| flipClasses($(this).find('.ui-btn')); | |
| flipClasses($(this).find('.ui-btn-inner')); | |
| if(o.shadow){ | |
| $(this).addClass('ui-shadow'); | |
| } | |
| }); | |
| }; | |
| })(jQuery);/* | |
| * jQuery Mobile Framework : "fieldcontain" plugin - simple class additions to make form row separators | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| (function($, undefined ) { | |
| $.fn.fieldcontain = function(options){ | |
| return this.addClass('ui-field-contain ui-body ui-br'); | |
| }; | |
| })(jQuery);/* | |
| * jQuery Mobile Framework : "listview" plugin | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| (function($, undefined ) { | |
| //Keeps track of the number of lists per page UID | |
| //This allows support for multiple nested list in the same page | |
| //https://github.com/jquery/jquery-mobile/issues/1617 | |
| var listCountPerPage = {}; | |
| $.widget( "mobile.listview", $.mobile.widget, { | |
| options: { | |
| theme: "c", | |
| countTheme: "c", | |
| headerTheme: "b", | |
| dividerTheme: "b", | |
| splitIcon: "arrow-r", | |
| splitTheme: "b", | |
| inset: false | |
| }, | |
| _create: function() { | |
| var t = this; | |
| // create listview markup | |
| t.element.addClass(function( i, orig ) { | |
| return orig + " ui-listview " + ( t.options.inset ? " ui-listview-inset ui-corner-all ui-shadow " : "" ); | |
| }); | |
| t.refresh(); | |
| }, | |
| _itemApply: function( $list, item ) { | |
| // TODO class has to be defined in markup | |
| item.find( ".ui-li-count" ) | |
| .addClass( "ui-btn-up-" + ($list.jqmData( "counttheme" ) || this.options.countTheme) + " ui-btn-corner-all" ).end() | |
| .find( "h1, h2, h3, h4, h5, h6" ).addClass( "ui-li-heading" ).end() | |
| .find( "p, dl" ).addClass( "ui-li-desc" ).end() | |
| .find( ">img:eq(0), .ui-link-inherit>img:eq(0)" ).addClass( "ui-li-thumb" ).each(function() { | |
| item.addClass( $(this).is( ".ui-li-icon" ) ? "ui-li-has-icon" : "ui-li-has-thumb" ); | |
| }).end() | |
| .find( ".ui-li-aside" ).each(function() { | |
| var $this = $(this); | |
| $this.prependTo( $this.parent() ); //shift aside to front for css float | |
| }); | |
| }, | |
| _removeCorners: function( li ) { | |
| li | |
| .add( li.find(".ui-btn-inner, .ui-li-link-alt, .ui-li-thumb") ) | |
| .removeClass( "ui-corner-top ui-corner-bottom ui-corner-br ui-corner-bl ui-corner-tr ui-corner-tl" ); | |
| }, | |
| refresh: function( create ) { | |
| this._createSubPages(); | |
| var o = this.options, | |
| $list = this.element, | |
| self = this, | |
| dividertheme = $list.jqmData( "dividertheme" ) || o.dividerTheme, | |
| listsplittheme = $list.jqmData( "splittheme" ), | |
| listspliticon = $list.jqmData( "spliticon" ), | |
| li = $list.children( "li" ), | |
| counter = $.support.cssPseudoElement || !$.nodeName( $list[0], "ol" ) ? 0 : 1; | |
| if ( counter ) { | |
| $list.find( ".ui-li-dec" ).remove(); | |
| } | |
| for (var pos = 0, numli = li.length; pos < numli; pos++) { | |
| var item = li.eq(pos), | |
| itemClass = "ui-li"; | |
| // If we're creating the element, we update it regardless | |
| if ( create || !item.hasClass( "ui-li" ) ) { | |
| var itemTheme = item.jqmData("theme") || o.theme, | |
| a = item.children( "a" ); | |
| if ( a.length ) { | |
| var icon = item.jqmData("icon"); | |
| item | |
| .buttonMarkup({ | |
| wrapperEls: "div", | |
| shadow: false, | |
| corners: false, | |
| iconpos: "right", | |
| icon: a.length > 1 || icon === false ? false : icon || "arrow-r", | |
| theme: itemTheme | |
| }); | |
| a.first().addClass( "ui-link-inherit" ); | |
| if ( a.length > 1 ) { | |
| itemClass += " ui-li-has-alt"; | |
| var last = a.last(), | |
| splittheme = listsplittheme || last.jqmData( "theme" ) || o.splitTheme; | |
| last | |
| .appendTo(item) | |
| .attr( "title", last.text() ) | |
| .addClass( "ui-li-link-alt" ) | |
| .empty() | |
| .buttonMarkup({ | |
| shadow: false, | |
| corners: false, | |
| theme: itemTheme, | |
| icon: false, | |
| iconpos: false | |
| }) | |
| .find( ".ui-btn-inner" ) | |
| .append( $( "<span />" ).buttonMarkup({ | |
| shadow: true, | |
| corners: true, | |
| theme: splittheme, | |
| iconpos: "notext", | |
| icon: listspliticon || last.jqmData( "icon" ) || o.splitIcon | |
| } ) ); | |
| } | |
| } else if ( item.jqmData( "role" ) === "list-divider" ) { | |
| itemClass += " ui-li-divider ui-btn ui-bar-" + dividertheme; | |
| item.attr( "role", "heading" ); | |
| //reset counter when a divider heading is encountered | |
| if ( counter ) { | |
| counter = 1; | |
| } | |
| } else { | |
| itemClass += " ui-li-static ui-body-" + itemTheme; | |
| } | |
| } | |
| if( o.inset ){ | |
| if ( pos === 0 ) { | |
| itemClass += " ui-corner-top"; | |
| item | |
| .add( item.find( ".ui-btn-inner" ) ) | |
| .find( ".ui-li-link-alt" ) | |
| .addClass( "ui-corner-tr" ) | |
| .end() | |
| .find( ".ui-li-thumb" ) | |
| .addClass( "ui-corner-tl" ); | |
| if(item.next().next().length){ | |
| self._removeCorners( item.next() ); | |
| } | |
| } | |
| if ( pos === li.length - 1 ) { | |
| itemClass += " ui-corner-bottom"; | |
| item | |
| .add( item.find( ".ui-btn-inner" ) ) | |
| .find( ".ui-li-link-alt" ) | |
| .addClass( "ui-corner-br" ) | |
| .end() | |
| .find( ".ui-li-thumb" ) | |
| .addClass( "ui-corner-bl" ); | |
| if(item.prev().prev().length){ | |
| self._removeCorners( item.prev() ); | |
| } | |
| } | |
| } | |
| if ( counter && itemClass.indexOf( "ui-li-divider" ) < 0 ) { | |
| var countParent = item.is(".ui-li-static:first") ? item : item.find( ".ui-link-inherit" ); | |
| countParent | |
| .addClass( "ui-li-jsnumbering" ) | |
| .prepend( "<span class='ui-li-dec'>" + (counter++) + ". </span>" ); | |
| } | |
| item.add( item.children( ".ui-btn-inner" ) ).addClass( itemClass ); | |
| if ( !create ) { | |
| self._itemApply( $list, item ); | |
| } | |
| } | |
| }, | |
| //create a string for ID/subpage url creation | |
| _idStringEscape: function( str ){ | |
| return str.replace(/[^a-zA-Z0-9]/g, '-'); | |
| }, | |
| _createSubPages: function() { | |
| var parentList = this.element, | |
| parentPage = parentList.closest( ".ui-page" ), | |
| parentUrl = parentPage.jqmData( "url" ), | |
| parentId = parentUrl || parentPage[ 0 ][ $.expando ], | |
| parentListId = parentList.attr( "id" ), | |
| o = this.options, | |
| dns = "data-" + $.mobile.ns, | |
| self = this, | |
| persistentFooterID = parentPage.find( ":jqmData(role='footer')" ).jqmData( "id" ); | |
| if ( typeof( listCountPerPage[ parentId ] ) === 'undefined' ) { | |
| listCountPerPage[ parentId ] = -1; | |
| } | |
| parentListId = parentListId || ++listCountPerPage[ parentId ]; | |
| $( parentList.find( "li>ul, li>ol" ).toArray().reverse() ).each(function( i ) { | |
| var list = $( this ), | |
| listId = list.attr( "id" ) || parentListId + "-" + i, | |
| parent = list.parent(), | |
| nodeEls = $( list.prevAll().toArray().reverse() ), | |
| nodeEls = nodeEls.length ? nodeEls : $( "<span>" + $.trim(parent.contents()[ 0 ].nodeValue) + "</span>" ), | |
| title = nodeEls.first().text(),//url limits to first 30 chars of text | |
| id = ( parentUrl || "" ) + "&" + $.mobile.subPageUrlKey + "=" + listId; | |
| theme = list.jqmData( "theme" ) || o.theme, | |
| countTheme = list.jqmData( "counttheme" ) || parentList.jqmData( "counttheme" ) || o.countTheme, | |
| newPage = list.detach() | |
| .wrap( "<div " + dns + "role='page' " + dns + "url='" + id + "' " + dns + "theme='" + theme + "' " + dns + "count-theme='" + countTheme + "'><div " + dns + "role='content'></div></div>" ) | |
| .parent() | |
| .before( "<div " + dns + "role='header' " + dns + "theme='" + o.headerTheme + "'><div class='ui-title'>" + title + "</div></div>" ) | |
| .after( persistentFooterID ? $( "<div " + dns + "role='footer' " + dns + "id='"+ persistentFooterID +"'>") : "" ) | |
| .parent() | |
| .appendTo( $.mobile.pageContainer ); | |
| newPage.page(); | |
| var anchor = parent.find('a:first'); | |
| if ( !anchor.length ) { | |
| anchor = $("<a />").html( nodeEls || title ).prependTo( parent.empty() ); | |
| } | |
| anchor.attr('href','#' + id); | |
| }).listview(); | |
| } | |
| }); | |
| })( jQuery ); | |
| /* | |
| * jQuery Mobile Framework : "listview" filter extension | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| (function($, undefined ) { | |
| $.mobile.listview.prototype.options.filter = false; | |
| $.mobile.listview.prototype.options.filterPlaceholder = "Filter items..."; | |
| $.mobile.listview.prototype.options.filterTheme = "c"; | |
| $( ":jqmData(role='listview')" ).live( "listviewcreate", function() { | |
| var list = $( this ), | |
| listview = list.data( "listview" ); | |
| if ( !listview.options.filter ) { | |
| return; | |
| } | |
| var wrapper = $( "<form>", { "class": "ui-listview-filter ui-bar-" + listview.options.filterTheme, "role": "search" } ), | |
| search = $( "<input>", { | |
| placeholder: listview.options.filterPlaceholder | |
| }) | |
| .attr( "data-" + $.mobile.ns + "type", "search" ) | |
| .jqmData( 'lastval', "" ) | |
| .bind( "keyup change", function() { | |
| var val = this.value.toLowerCase(), | |
| listItems=null, | |
| lastval = $( this ).jqmData('lastval')+""; | |
| //change val as lastval for next execution | |
| $(this).jqmData( 'lastval' , val ); | |
| change = val.replace( new RegExp( "^" + lastval ) , "" ); | |
| if( val.length < lastval.length || change.length != ( val.length - lastval.length ) ){ | |
| //removed chars or pasted something totaly different, check all items | |
| listItems = list.children(); | |
| } else { | |
| //only chars added, not removed, only use visible subset | |
| listItems = list.children( ':not(.ui-screen-hidden)' ); | |
| } | |
| if ( val ) { | |
| // This handles hiding regular rows without the text we search for | |
| // and any list dividers without regular rows shown under it | |
| var item, | |
| childItems = false, | |
| itemtext=""; | |
| for ( var i = listItems.length - 1; i >= 0; i-- ) { | |
| item = $( listItems[i] ); | |
| itemtext = item.jqmData( 'filtertext' ) || item.text(); | |
| if ( item.is( "li:jqmData(role=list-divider)" ) ) { | |
| item.toggleClass( 'ui-filter-hidequeue' , !childItems ); | |
| // New bucket! | |
| childItems = false; | |
| } else if ( itemtext.toLowerCase().indexOf( val ) === -1) { | |
| //mark to be hidden | |
| item.toggleClass( 'ui-filter-hidequeue' , true ); | |
| } else { | |
| // There's a shown item in the bucket | |
| childItems = true; | |
| } | |
| } | |
| // show items, not marked to be hidden | |
| listItems | |
| .filter( ':not(.ui-filter-hidequeue)' ) | |
| .toggleClass('ui-screen-hidden',false); | |
| // hide items, marked to be hidden | |
| listItems | |
| .filter( '.ui-filter-hidequeue' ) | |
| .toggleClass('ui-screen-hidden',true) | |
| .toggleClass( 'ui-filter-hidequeue' , false ); | |
| }else{ | |
| //filtervalue is empty => show all | |
| listItems.toggleClass('ui-screen-hidden',false); | |
| } | |
| }) | |
| .appendTo( wrapper ) | |
| .textinput(); | |
| if ($( this ).jqmData( "inset" ) ) { | |
| wrapper.addClass( "ui-listview-filter-inset" ); | |
| } | |
| wrapper.insertBefore( list ); | |
| }); | |
| })( jQuery );/* | |
| * jQuery Mobile Framework : "dialog" plugin. | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses. | |
| * Note: Code is in draft form and is subject to change | |
| */ | |
| ( function( $, undefined ) { | |
| $.widget( "mobile.dialog", $.mobile.widget, { | |
| options: { | |
| closeBtnText: "Close" | |
| }, | |
| _create: function() { | |
| var $el = this.element; | |
| /* class the markup for dialog styling */ | |
| $el | |
| //add ARIA role | |
| .attr( "role", "dialog" ) | |
| .addClass( "ui-page ui-dialog ui-body-a" ) | |
| .find( ":jqmData(role=header)" ) | |
| .addClass( "ui-corner-top ui-overlay-shadow" ) | |
| .prepend( "<a href='#' data-" + $.mobile.ns + "icon='delete' data-" + $.mobile.ns + "rel='back' data-" + $.mobile.ns + "iconpos='notext'>"+ this.options.closeBtnText +"</a>" ) | |
| .end() | |
| .find( '.ui-content:not([class*="ui-body-"])' ) | |
| .addClass( 'ui-body-c' ) | |
| .end() | |
| .find( ".ui-content,:jqmData(role='footer')" ) | |
| .last() | |
| .addClass( "ui-corner-bottom ui-overlay-shadow" ); | |
| /* bind events | |
| - clicks and submits should use the closing transition that the dialog opened with | |
| unless a data-transition is specified on the link/form | |
| - if the click was on the close button, or the link has a data-rel="back" it'll go back in history naturally | |
| */ | |
| $el | |
| .bind( "vclick submit", function( e ) { | |
| var $target = $( e.target ).closest( e.type === "vclick" ? "a" : "form" ); | |
| if( $target.length && ! $target.jqmData( "transition" ) ) { | |
| var active = $.mobile.urlHistory.getActive() || {}; | |
| $target | |
| .attr( "data-" + $.mobile.ns + "transition", ( active.transition || $.mobile.defaultDialogTransition ) ) | |
| .attr( "data-" + $.mobile.ns + "direction", "reverse" ); | |
| } | |
| }) | |
| .bind( "pagehide", function() { | |
| $( this ).find( "." + $.mobile.activeBtnClass ).removeClass( $.mobile.activeBtnClass ); | |
| }); | |
| }, | |
| //close method goes back in history | |
| close: function() { | |
| window.history.back(); | |
| } | |
| }); | |
| })( jQuery ); | |
| /* | |
| * jQuery Mobile Framework : "navbar" plugin | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| (function($, undefined ) { | |
| $.widget( "mobile.navbar", $.mobile.widget, { | |
| options: { | |
| iconpos: 'top', | |
| grid: null | |
| }, | |
| _create: function(){ | |
| var $navbar = this.element, | |
| $navbtns = $navbar.find("a"), | |
| iconpos = $navbtns.filter( ":jqmData(icon)").length ? this.options.iconpos : undefined; | |
| $navbar | |
| .addClass('ui-navbar') | |
| .attr("role","navigation") | |
| .find("ul") | |
| .grid({grid: this.options.grid }); | |
| if( !iconpos ){ | |
| $navbar.addClass("ui-navbar-noicons"); | |
| } | |
| $navbtns | |
| .buttonMarkup({ | |
| corners: false, | |
| shadow: false, | |
| iconpos: iconpos | |
| }); | |
| $navbar.delegate("a", "vclick",function(event){ | |
| $navbtns.not( ".ui-state-persist" ).removeClass( $.mobile.activeBtnClass ); | |
| $( this ).addClass( $.mobile.activeBtnClass ); | |
| }); | |
| } | |
| }); | |
| })( jQuery ); | |
| /* | |
| * jQuery Mobile Framework : plugin for creating CSS grids | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| (function($, undefined ) { | |
| $.fn.grid = function(options){ | |
| return this.each(function(){ | |
| var o = $.extend({ | |
| grid: null | |
| },options); | |
| var $kids = $(this).children(), | |
| gridCols = {solo:1, a:2, b:3, c:4, d:5}, | |
| grid = o.grid, | |
| iterator; | |
| if( !grid ){ | |
| if( $kids.length <= 5 ){ | |
| for(var letter in gridCols){ | |
| if(gridCols[letter] == $kids.length){ grid = letter; } | |
| } | |
| } | |
| else{ | |
| grid = 'a'; | |
| } | |
| } | |
| iterator = gridCols[grid]; | |
| $(this).addClass('ui-grid-' + grid); | |
| $kids.filter(':nth-child(' + iterator + 'n+1)').addClass('ui-block-a'); | |
| if(iterator > 1){ | |
| $kids.filter(':nth-child(' + iterator + 'n+2)').addClass('ui-block-b'); | |
| } | |
| if(iterator > 2){ | |
| $kids.filter(':nth-child(3n+3)').addClass('ui-block-c'); | |
| } | |
| if(iterator > 3){ | |
| $kids.filter(':nth-child(4n+4)').addClass('ui-block-d'); | |
| } | |
| if(iterator > 4){ | |
| $kids.filter(':nth-child(5n+5)').addClass('ui-block-e'); | |
| } | |
| }); | |
| }; | |
| })(jQuery);/*! | |
| * jQuery Mobile v@VERSION | |
| * http://jquerymobile.com/ | |
| * | |
| * Copyright 2010, jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| (function( $, window, undefined ) { | |
| var $html = $( "html" ), | |
| $head = $( "head" ), | |
| $window = $( window ); | |
| //trigger mobileinit event - useful hook for configuring $.mobile settings before they're used | |
| $( window.document ).trigger( "mobileinit" ); | |
| //support conditions | |
| //if device support condition(s) aren't met, leave things as they are -> a basic, usable experience, | |
| //otherwise, proceed with the enhancements | |
| if ( !$.mobile.gradeA() ) { | |
| return; | |
| } | |
| // override ajaxEnabled on platforms that have known conflicts with hash history updates | |
| // or generally work better browsing in regular http for full page refreshes (BB5, Opera Mini) | |
| if( window.blackberry && !window.WebKitPoint || window.operamini && Object.prototype.toString.call( window.operamini ) === "[object OperaMini]" ){ | |
| $.mobile.ajaxEnabled = false; | |
| } | |
| //add mobile, initial load "rendering" classes to docEl | |
| $html.addClass( "ui-mobile ui-mobile-rendering" ); | |
| //loading div which appears during Ajax requests | |
| //will not appear if $.mobile.loadingMessage is false | |
| var $loader = $.mobile.loadingMessage ? $( "<div class='ui-loader ui-body-a ui-corner-all'>" + "<span class='ui-icon ui-icon-loading spin'></span>" + "<h1>" + $.mobile.loadingMessage + "</h1>" + "</div>" ) : undefined; | |
| $.extend($.mobile, { | |
| // turn on/off page loading message. | |
| showPageLoadingMsg: function() { | |
| if( $.mobile.loadingMessage ){ | |
| var activeBtn = $( "." + $.mobile.activeBtnClass ).first(); | |
| $loader | |
| .appendTo( $.mobile.pageContainer ) | |
| //position at y center (if scrollTop supported), above the activeBtn (if defined), or just 100px from top | |
| .css( { | |
| top: $.support.scrollTop && $(window).scrollTop() + $(window).height() / 2 || | |
| activeBtn.length && activeBtn.offset().top || 100 | |
| } ); | |
| } | |
| $html.addClass( "ui-loading" ); | |
| }, | |
| hidePageLoadingMsg: function() { | |
| $html.removeClass( "ui-loading" ); | |
| }, | |
| // XXX: deprecate for 1.0 | |
| pageLoading: function ( done ) { | |
| if ( done ) { | |
| $.mobile.hidePageLoadingMsg(); | |
| } else { | |
| $.mobile.showPageLoadingMsg(); | |
| } | |
| }, | |
| // find and enhance the pages in the dom and transition to the first page. | |
| initializePage: function(){ | |
| //find present pages | |
| var $pages = $( ":jqmData(role='page')" ); | |
| //add dialogs, set data-url attrs | |
| $pages.add( ":jqmData(role='dialog')" ).each(function(){ | |
| var $this = $(this); | |
| // unless the data url is already set set it to the id | |
| if( !$this.jqmData('url') ){ | |
| $this.attr( "data-" + $.mobile.ns + "url", $this.attr( "id" ) ); | |
| } | |
| }); | |
| //define first page in dom case one backs out to the directory root (not always the first page visited, but defined as fallback) | |
| $.mobile.firstPage = $pages.first(); | |
| //define page container | |
| $.mobile.pageContainer = $pages.first().parent().addClass( "ui-mobile-viewport" ); | |
| //cue page loading message | |
| $.mobile.showPageLoadingMsg(); | |
| // if hashchange listening is disabled or there's no hash deeplink, change to the first page in the DOM | |
| if( !$.mobile.hashListeningEnabled || !$.mobile.path.stripHash( location.hash ) ){ | |
| $.mobile.changePage( $.mobile.firstPage, { transition: "none", reverse: true, changeHash: false, fromHashChange: true } ); | |
| } | |
| // otherwise, trigger a hashchange to load a deeplink | |
| else { | |
| $window.trigger( "hashchange", [ true ] ); | |
| } | |
| } | |
| }); | |
| //check which scrollTop value should be used by scrolling to 1 immediately at domready | |
| //then check what the scroll top is. Android will report 0... others 1 | |
| //note that this initial scroll won't hide the address bar. It's just for the check. | |
| $(function(){ | |
| window.scrollTo( 0, 1 ); | |
| //if defaultHomeScroll hasn't been set yet, see if scrollTop is 1 | |
| //it should be 1 in most browsers, but android treats 1 as 0 (for hiding addr bar) | |
| //so if it's 1, use 0 from now on | |
| $.mobile.defaultHomeScroll = ( !$.support.scrollTop || $(window).scrollTop() === 1 ) ? 0 : 1; | |
| //dom-ready inits | |
| $( $.mobile.initializePage ); | |
| //window load event | |
| //hide iOS browser chrome on load | |
| $window.load( $.mobile.silentScroll ); | |
| }); | |
| })( jQuery, this ); | |
| /*! | |
| * jQuery Mobile v1.0b2 | |
| * http://jquerymobile.com/ | |
| * | |
| * Copyright 2010, jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| /*! | |
| * jQuery UI Widget @VERSION | |
| * | |
| * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| * | |
| * http://docs.jquery.com/UI/Widget | |
| */ | |
| (function( $, undefined ) { | |
| // jQuery 1.4+ | |
| if ( $.cleanData ) { | |
| var _cleanData = $.cleanData; | |
| $.cleanData = function( elems ) { | |
| for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { | |
| $( elem ).triggerHandler( "remove" ); | |
| } | |
| _cleanData( elems ); | |
| }; | |
| } else { | |
| var _remove = $.fn.remove; | |
| $.fn.remove = function( selector, keepData ) { | |
| return this.each(function() { | |
| if ( !keepData ) { | |
| if ( !selector || $.filter( selector, [ this ] ).length ) { | |
| $( "*", this ).add( [ this ] ).each(function() { | |
| $( this ).triggerHandler( "remove" ); | |
| }); | |
| } | |
| } | |
| return _remove.call( $(this), selector, keepData ); | |
| }); | |
| }; | |
| } | |
| $.widget = function( name, base, prototype ) { | |
| var namespace = name.split( "." )[ 0 ], | |
| fullName; | |
| name = name.split( "." )[ 1 ]; | |
| fullName = namespace + "-" + name; | |
| if ( !prototype ) { | |
| prototype = base; | |
| base = $.Widget; | |
| } | |
| // create selector for plugin | |
| $.expr[ ":" ][ fullName ] = function( elem ) { | |
| return !!$.data( elem, name ); | |
| }; | |
| $[ namespace ] = $[ namespace ] || {}; | |
| $[ namespace ][ name ] = function( options, element ) { | |
| // allow instantiation without initializing for simple inheritance | |
| if ( arguments.length ) { | |
| this._createWidget( options, element ); | |
| } | |
| }; | |
| var basePrototype = new base(); | |
| // we need to make the options hash a property directly on the new instance | |
| // otherwise we'll modify the options hash on the prototype that we're | |
| // inheriting from | |
| // $.each( basePrototype, function( key, val ) { | |
| // if ( $.isPlainObject(val) ) { | |
| // basePrototype[ key ] = $.extend( {}, val ); | |
| // } | |
| // }); | |
| basePrototype.options = $.extend( true, {}, basePrototype.options ); | |
| $[ namespace ][ name ].prototype = $.extend( true, basePrototype, { | |
| namespace: namespace, | |
| widgetName: name, | |
| widgetEventPrefix: $[ namespace ][ name ].prototype.widgetEventPrefix || name, | |
| widgetBaseClass: fullName | |
| }, prototype ); | |
| $.widget.bridge( name, $[ namespace ][ name ] ); | |
| }; | |
| $.widget.bridge = function( name, object ) { | |
| $.fn[ name ] = function( options ) { | |
| var isMethodCall = typeof options === "string", | |
| args = Array.prototype.slice.call( arguments, 1 ), | |
| returnValue = this; | |
| // allow multiple hashes to be passed on init | |
| options = !isMethodCall && args.length ? | |
| $.extend.apply( null, [ true, options ].concat(args) ) : | |
| options; | |
| // prevent calls to internal methods | |
| if ( isMethodCall && options.charAt( 0 ) === "_" ) { | |
| return returnValue; | |
| } | |
| if ( isMethodCall ) { | |
| this.each(function() { | |
| var instance = $.data( this, name ); | |
| if ( !instance ) { | |
| throw "cannot call methods on " + name + " prior to initialization; " + | |
| "attempted to call method '" + options + "'"; | |
| } | |
| if ( !$.isFunction( instance[options] ) ) { | |
| throw "no such method '" + options + "' for " + name + " widget instance"; | |
| } | |
| var methodValue = instance[ options ].apply( instance, args ); | |
| if ( methodValue !== instance && methodValue !== undefined ) { | |
| returnValue = methodValue; | |
| return false; | |
| } | |
| }); | |
| } else { | |
| this.each(function() { | |
| var instance = $.data( this, name ); | |
| if ( instance ) { | |
| instance.option( options || {} )._init(); | |
| } else { | |
| $.data( this, name, new object( options, this ) ); | |
| } | |
| }); | |
| } | |
| return returnValue; | |
| }; | |
| }; | |
| $.Widget = function( options, element ) { | |
| // allow instantiation without initializing for simple inheritance | |
| if ( arguments.length ) { | |
| this._createWidget( options, element ); | |
| } | |
| }; | |
| $.Widget.prototype = { | |
| widgetName: "widget", | |
| widgetEventPrefix: "", | |
| options: { | |
| disabled: false | |
| }, | |
| _createWidget: function( options, element ) { | |
| // $.widget.bridge stores the plugin instance, but we do it anyway | |
| // so that it's stored even before the _create function runs | |
| $.data( element, this.widgetName, this ); | |
| this.element = $( element ); | |
| this.options = $.extend( true, {}, | |
| this.options, | |
| this._getCreateOptions(), | |
| options ); | |
| var self = this; | |
| this.element.bind( "remove." + this.widgetName, function() { | |
| self.destroy(); | |
| }); | |
| this._create(); | |
| this._trigger( "create" ); | |
| this._init(); | |
| }, | |
| _getCreateOptions: function() { | |
| var options = {}; | |
| if ( $.metadata ) { | |
| options = $.metadata.get( element )[ this.widgetName ]; | |
| } | |
| return options; | |
| }, | |
| _create: function() {}, | |
| _init: function() {}, | |
| destroy: function() { | |
| this.element | |
| .unbind( "." + this.widgetName ) | |
| .removeData( this.widgetName ); | |
| this.widget() | |
| .unbind( "." + this.widgetName ) | |
| .removeAttr( "aria-disabled" ) | |
| .removeClass( | |
| this.widgetBaseClass + "-disabled " + | |
| "ui-state-disabled" ); | |
| }, | |
| widget: function() { | |
| return this.element; | |
| }, | |
| option: function( key, value ) { | |
| var options = key; | |
| if ( arguments.length === 0 ) { | |
| // don't return a reference to the internal hash | |
| return $.extend( {}, this.options ); | |
| } | |
| if (typeof key === "string" ) { | |
| if ( value === undefined ) { | |
| return this.options[ key ]; | |
| } | |
| options = {}; | |
| options[ key ] = value; | |
| } | |
| this._setOptions( options ); | |
| return this; | |
| }, | |
| _setOptions: function( options ) { | |
| var self = this; | |
| $.each( options, function( key, value ) { | |
| self._setOption( key, value ); | |
| }); | |
| return this; | |
| }, | |
| _setOption: function( key, value ) { | |
| this.options[ key ] = value; | |
| if ( key === "disabled" ) { | |
| this.widget() | |
| [ value ? "addClass" : "removeClass"]( | |
| this.widgetBaseClass + "-disabled" + " " + | |
| "ui-state-disabled" ) | |
| .attr( "aria-disabled", value ); | |
| } | |
| return this; | |
| }, | |
| enable: function() { | |
| return this._setOption( "disabled", false ); | |
| }, | |
| disable: function() { | |
| return this._setOption( "disabled", true ); | |
| }, | |
| _trigger: function( type, event, data ) { | |
| var callback = this.options[ type ]; | |
| event = $.Event( event ); | |
| event.type = ( type === this.widgetEventPrefix ? | |
| type : | |
| this.widgetEventPrefix + type ).toLowerCase(); | |
| data = data || {}; | |
| // copy original event properties over to the new event | |
| // this would happen if we could call $.event.fix instead of $.Event | |
| // but we don't have a way to force an event to be fixed multiple times | |
| if ( event.originalEvent ) { | |
| for ( var i = $.event.props.length, prop; i; ) { | |
| prop = $.event.props[ --i ]; | |
| event[ prop ] = event.originalEvent[ prop ]; | |
| } | |
| } | |
| this.element.trigger( event, data ); | |
| return !( $.isFunction(callback) && | |
| callback.call( this.element[0], event, data ) === false || | |
| event.isDefaultPrevented() ); | |
| } | |
| }; | |
| })( jQuery ); | |
| /* | |
| * jQuery Mobile Framework : widget factory extentions for mobile | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| (function( $, undefined ) { | |
| $.widget( "mobile.widget", { | |
| _getCreateOptions: function() { | |
| var elem = this.element, | |
| options = {}; | |
| $.each( this.options, function( option ) { | |
| var value = elem.jqmData( option.replace( /[A-Z]/g, function( c ) { | |
| return "-" + c.toLowerCase(); | |
| }) | |
| ); | |
| if ( value !== undefined ) { | |
| options[ option ] = value; | |
| } | |
| }); | |
| return options; | |
| } | |
| }); | |
| })( jQuery ); | |
| /* | |
| * jQuery Mobile Framework : resolution and CSS media query related helpers and behavior | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| (function( $, undefined ) { | |
| var $window = $( window ), | |
| $html = $( "html" ); | |
| /* $.mobile.media method: pass a CSS media type or query and get a bool return | |
| note: this feature relies on actual media query support for media queries, though types will work most anywhere | |
| examples: | |
| $.mobile.media('screen') //>> tests for screen media type | |
| $.mobile.media('screen and (min-width: 480px)') //>> tests for screen media type with window width > 480px | |
| $.mobile.media('@media screen and (-webkit-min-device-pixel-ratio: 2)') //>> tests for webkit 2x pixel ratio (iPhone 4) | |
| */ | |
| $.mobile.media = (function() { | |
| // TODO: use window.matchMedia once at least one UA implements it | |
| var cache = {}, | |
| testDiv = $( "<div id='jquery-mediatest'>" ), | |
| fakeBody = $( "<body>" ).append( testDiv ); | |
| return function( query ) { | |
| if ( !( query in cache ) ) { | |
| var styleBlock = document.createElement( "style" ), | |
| cssrule = "@media " + query + " { #jquery-mediatest { position:absolute; } }"; | |
| //must set type for IE! | |
| styleBlock.type = "text/css"; | |
| if ( styleBlock.styleSheet ){ | |
| styleBlock.styleSheet.cssText = cssrule; | |
| } else { | |
| styleBlock.appendChild( document.createTextNode(cssrule) ); | |
| } | |
| $html.prepend( fakeBody ).prepend( styleBlock ); | |
| cache[ query ] = testDiv.css( "position" ) === "absolute"; | |
| fakeBody.add( styleBlock ).remove(); | |
| } | |
| return cache[ query ]; | |
| }; | |
| })(); | |
| })(jQuery);/* | |
| * jQuery Mobile Framework : support tests | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| (function( $, undefined ) { | |
| var fakeBody = $( "<body>" ).prependTo( "html" ), | |
| fbCSS = fakeBody[ 0 ].style, | |
| vendors = [ "webkit", "moz", "o" ], | |
| webos = "palmGetResource" in window, //only used to rule out scrollTop | |
| bb = window.blackberry; //only used to rule out box shadow, as it's filled opaque on BB | |
| // thx Modernizr | |
| function propExists( prop ) { | |
| var uc_prop = prop.charAt( 0 ).toUpperCase() + prop.substr( 1 ), | |
| props = ( prop + " " + vendors.join( uc_prop + " " ) + uc_prop ).split( " " ); | |
| for ( var v in props ){ | |
| if ( fbCSS[ v ] !== undefined ) { | |
| return true; | |
| } | |
| } | |
| } | |
| // Test for dynamic-updating base tag support ( allows us to avoid href,src attr rewriting ) | |
| function baseTagTest() { | |
| var fauxBase = location.protocol + "//" + location.host + location.pathname + "ui-dir/", | |
| base = $( "head base" ), | |
| fauxEle = null, | |
| href = "", | |
| link, rebase; | |
| if ( !base.length ) { | |
| base = fauxEle = $( "<base>", { "href": fauxBase }).appendTo( "head" ); | |
| } else { | |
| href = base.attr( "href" ); | |
| } | |
| link = $( "<a href='testurl'></a>" ).prependTo( fakeBody ); | |
| rebase = link[ 0 ].href; | |
| base[ 0 ].href = href ? href : location.pathname; | |
| if ( fauxEle ) { | |
| fauxEle.remove(); | |
| } | |
| return rebase.indexOf( fauxBase ) === 0; | |
| } | |
| // non-UA-based IE version check by James Padolsey, modified by jdalton - from http://gist.github.com/527683 | |
| // allows for inclusion of IE 6+, including Windows Mobile 7 | |
| $.mobile.browser = {}; | |
| $.mobile.browser.ie = (function() { | |
| var v = 3, | |
| div = document.createElement( "div" ), | |
| a = div.all || []; | |
| while ( div.innerHTML = "<!--[if gt IE " + ( ++v ) + "]><br><![endif]-->", a[ 0 ] ); | |
| return v > 4 ? v : !v; | |
| })(); | |
| $.extend( $.support, { | |
| orientation: "orientation" in window, | |
| touch: "ontouchend" in document, | |
| cssTransitions: "WebKitTransitionEvent" in window, | |
| pushState: !!history.pushState, | |
| mediaquery: $.mobile.media( "only all" ), | |
| cssPseudoElement: !!propExists( "content" ), | |
| boxShadow: !!propExists( "boxShadow" ) && !bb, | |
| scrollTop: ( "pageXOffset" in window || "scrollTop" in document.documentElement || "scrollTop" in fakeBody[ 0 ] ) && !webos, | |
| dynamicBaseTag: baseTagTest(), | |
| // TODO: This is a weak test. We may want to beef this up later. | |
| eventCapture: "addEventListener" in document | |
| }); | |
| fakeBody.remove(); | |
| // $.mobile.ajaxBlacklist is used to override ajaxEnabled on platforms that have known conflicts with hash history updates (BB5, Symbian) | |
| // or that generally work better browsing in regular http for full page refreshes (Opera Mini) | |
| // Note: This detection below is used as a last resort. | |
| // We recommend only using these detection methods when all other more reliable/forward-looking approaches are not possible | |
| var nokiaLTE7_3 = (function(){ | |
| var ua = window.navigator.userAgent; | |
| //The following is an attempt to match Nokia browsers that are running Symbian/s60, with webkit, version 7.3 or older | |
| return ua.indexOf( "Nokia" ) > -1 && | |
| ( ua.indexOf( "Symbian/3" ) > -1 || ua.indexOf( "Series60/5" ) > -1 ) && | |
| ua.indexOf( "AppleWebKit" ) > -1 && | |
| ua.match( /(BrowserNG|NokiaBrowser)\/7\.[0-3]/ ); | |
| })(); | |
| $.mobile.ajaxBlacklist = | |
| // BlackBerry browsers, pre-webkit | |
| window.blackberry && !window.WebKitPoint || | |
| // Opera Mini | |
| window.operamini && Object.prototype.toString.call( window.operamini ) === "[object OperaMini]" || | |
| // Symbian webkits pre 7.3 | |
| nokiaLTE7_3; | |
| // Lastly, this workaround is the only way we've found so far to get pre 7.3 Symbian webkit devices | |
| // to render the stylesheets when they're referenced before this script, as we'd recommend doing. | |
| // This simply reappends the CSS in place, which for some reason makes it apply | |
| if ( nokiaLTE7_3 ) { | |
| $(function() { | |
| $( "head link[rel=stylesheet]" ).attr( "rel", "alternate stylesheet" ).attr( "rel", "stylesheet" ); | |
| }); | |
| } | |
| // For ruling out shadows via css | |
| if ( !$.support.boxShadow ) { | |
| $( "html" ).addClass( "ui-mobile-nosupport-boxshadow" ); | |
| } | |
| })( jQuery );/* | |
| * jQuery Mobile Framework : "mouse" plugin | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| // This plugin is an experiment for abstracting away the touch and mouse | |
| // events so that developers don't have to worry about which method of input | |
| // the device their document is loaded on supports. | |
| // | |
| // The idea here is to allow the developer to register listeners for the | |
| // basic mouse events, such as mousedown, mousemove, mouseup, and click, | |
| // and the plugin will take care of registering the correct listeners | |
| // behind the scenes to invoke the listener at the fastest possible time | |
| // for that device, while still retaining the order of event firing in | |
| // the traditional mouse environment, should multiple handlers be registered | |
| // on the same element for different events. | |
| // | |
| // The current version exposes the following virtual events to jQuery bind methods: | |
| // "vmouseover vmousedown vmousemove vmouseup vclick vmouseout vmousecancel" | |
| (function( $, window, document, undefined ) { | |
| var dataPropertyName = "virtualMouseBindings", | |
| touchTargetPropertyName = "virtualTouchID", | |
| virtualEventNames = "vmouseover vmousedown vmousemove vmouseup vclick vmouseout vmousecancel".split( " " ), | |
| touchEventProps = "clientX clientY pageX pageY screenX screenY".split( " " ), | |
| activeDocHandlers = {}, | |
| resetTimerID = 0, | |
| startX = 0, | |
| startY = 0, | |
| didScroll = false, | |
| clickBlockList = [], | |
| blockMouseTriggers = false, | |
| blockTouchTriggers = false, | |
| eventCaptureSupported = $.support.eventCapture, | |
| $document = $( document ), | |
| nextTouchID = 1, | |
| lastTouchID = 0; | |
| $.vmouse = { | |
| moveDistanceThreshold: 10, | |
| clickDistanceThreshold: 10, | |
| resetTimerDuration: 1500 | |
| }; | |
| function getNativeEvent( event ) { | |
| while ( event && typeof event.originalEvent !== "undefined" ) { | |
| event = event.originalEvent; | |
| } | |
| return event; | |
| } | |
| function createVirtualEvent( event, eventType ) { | |
| var t = event.type, | |
| oe, props, ne, prop, ct, touch, i, j; | |
| event = $.Event(event); | |
| event.type = eventType; | |
| oe = event.originalEvent; | |
| props = $.event.props; | |
| // copy original event properties over to the new event | |
| // this would happen if we could call $.event.fix instead of $.Event | |
| // but we don't have a way to force an event to be fixed multiple times | |
| if ( oe ) { | |
| for ( i = props.length, prop; i; ) { | |
| prop = props[ --i ]; | |
| event[ prop ] = oe[ prop ]; | |
| } | |
| } | |
| if ( t.search(/^touch/) !== -1 ) { | |
| ne = getNativeEvent( oe ); | |
| t = ne.touches; | |
| ct = ne.changedTouches; | |
| touch = ( t && t.length ) ? t[0] : ( (ct && ct.length) ? ct[ 0 ] : undefined ); | |
| if ( touch ) { | |
| for ( j = 0, len = touchEventProps.length; j < len; j++){ | |
| prop = touchEventProps[ j ]; | |
| event[ prop ] = touch[ prop ]; | |
| } | |
| } | |
| } | |
| return event; | |
| } | |
| function getVirtualBindingFlags( element ) { | |
| var flags = {}, | |
| b, k; | |
| while ( element ) { | |
| b = $.data( element, dataPropertyName ); | |
| for ( k in b ) { | |
| if ( b[ k ] ) { | |
| flags[ k ] = flags.hasVirtualBinding = true; | |
| } | |
| } | |
| element = element.parentNode; | |
| } | |
| return flags; | |
| } | |
| function getClosestElementWithVirtualBinding( element, eventType ) { | |
| var b; | |
| while ( element ) { | |
| b = $.data( element, dataPropertyName ); | |
| if ( b && ( !eventType || b[ eventType ] ) ) { | |
| return element; | |
| } | |
| element = element.parentNode; | |
| } | |
| return null; | |
| } | |
| function enableTouchBindings() { | |
| blockTouchTriggers = false; | |
| } | |
| function disableTouchBindings() { | |
| blockTouchTriggers = true; | |
| } | |
| function enableMouseBindings() { | |
| lastTouchID = 0; | |
| clickBlockList.length = 0; | |
| blockMouseTriggers = false; | |
| // When mouse bindings are enabled, our | |
| // touch bindings are disabled. | |
| disableTouchBindings(); | |
| } | |
| function disableMouseBindings() { | |
| // When mouse bindings are disabled, our | |
| // touch bindings are enabled. | |
| enableTouchBindings(); | |
| } | |
| function startResetTimer() { | |
| clearResetTimer(); | |
| resetTimerID = setTimeout(function(){ | |
| resetTimerID = 0; | |
| enableMouseBindings(); | |
| }, $.vmouse.resetTimerDuration ); | |
| } | |
| function clearResetTimer() { | |
| if ( resetTimerID ){ | |
| clearTimeout( resetTimerID ); | |
| resetTimerID = 0; | |
| } | |
| } | |
| function triggerVirtualEvent( eventType, event, flags ) { | |
| var defaultPrevented = false, | |
| ve; | |
| if ( ( flags && flags[ eventType ] ) || | |
| ( !flags && getClosestElementWithVirtualBinding( event.target, eventType ) ) ) { | |
| ve = createVirtualEvent( event, eventType ); | |
| $( event.target).trigger( ve ); | |
| defaultPrevented = ve.isDefaultPrevented(); | |
| } | |
| return defaultPrevented; | |
| } | |
| function mouseEventCallback( event ) { | |
| var touchID = $.data(event.target, touchTargetPropertyName); | |
| if ( !blockMouseTriggers && ( !lastTouchID || lastTouchID !== touchID ) ){ | |
| triggerVirtualEvent( "v" + event.type, event ); | |
| } | |
| } | |
| function handleTouchStart( event ) { | |
| var touches = getNativeEvent( event ).touches, | |
| target, flags; | |
| if ( touches && touches.length === 1 ) { | |
| target = event.target; | |
| flags = getVirtualBindingFlags( target ); | |
| if ( flags.hasVirtualBinding ) { | |
| lastTouchID = nextTouchID++; | |
| $.data( target, touchTargetPropertyName, lastTouchID ); | |
| clearResetTimer(); | |
| disableMouseBindings(); | |
| didScroll = false; | |
| var t = getNativeEvent( event ).touches[ 0 ]; | |
| startX = t.pageX; | |
| startY = t.pageY; | |
| triggerVirtualEvent( "vmouseover", event, flags ); | |
| triggerVirtualEvent( "vmousedown", event, flags ); | |
| } | |
| } | |
| } | |
| function handleScroll( event ) { | |
| if ( blockTouchTriggers ) { | |
| return; | |
| } | |
| if ( !didScroll ) { | |
| triggerVirtualEvent( "vmousecancel", event, getVirtualBindingFlags( event.target ) ); | |
| } | |
| didScroll = true; | |
| startResetTimer(); | |
| } | |
| function handleTouchMove( event ) { | |
| if ( blockTouchTriggers ) { | |
| return; | |
| } | |
| var t = getNativeEvent( event ).touches[ 0 ], | |
| didCancel = didScroll, | |
| moveThreshold = $.vmouse.moveDistanceThreshold; | |
| didScroll = didScroll || | |
| ( Math.abs(t.pageX - startX) > moveThreshold || | |
| Math.abs(t.pageY - startY) > moveThreshold ), | |
| flags = getVirtualBindingFlags( event.target ); | |
| if ( didScroll && !didCancel ) { | |
| triggerVirtualEvent( "vmousecancel", event, flags ); | |
| } | |
| triggerVirtualEvent( "vmousemove", event, flags ); | |
| startResetTimer(); | |
| } | |
| function handleTouchEnd( event ) { | |
| if ( blockTouchTriggers ) { | |
| return; | |
| } | |
| disableTouchBindings(); | |
| var flags = getVirtualBindingFlags( event.target ), | |
| t; | |
| triggerVirtualEvent( "vmouseup", event, flags ); | |
| if ( !didScroll ) { | |
| if ( triggerVirtualEvent( "vclick", event, flags ) ) { | |
| // The target of the mouse events that follow the touchend | |
| // event don't necessarily match the target used during the | |
| // touch. This means we need to rely on coordinates for blocking | |
| // any click that is generated. | |
| t = getNativeEvent( event ).changedTouches[ 0 ]; | |
| clickBlockList.push({ | |
| touchID: lastTouchID, | |
| x: t.clientX, | |
| y: t.clientY | |
| }); | |
| // Prevent any mouse events that follow from triggering | |
| // virtual event notifications. | |
| blockMouseTriggers = true; | |
| } | |
| } | |
| triggerVirtualEvent( "vmouseout", event, flags); | |
| didScroll = false; | |
| startResetTimer(); | |
| } | |
| function hasVirtualBindings( ele ) { | |
| var bindings = $.data( ele, dataPropertyName ), | |
| k; | |
| if ( bindings ) { | |
| for ( k in bindings ) { | |
| if ( bindings[ k ] ) { | |
| return true; | |
| } | |
| } | |
| } | |
| return false; | |
| } | |
| function dummyMouseHandler(){} | |
| function getSpecialEventObject( eventType ) { | |
| var realType = eventType.substr( 1 ); | |
| return { | |
| setup: function( data, namespace ) { | |
| // If this is the first virtual mouse binding for this element, | |
| // add a bindings object to its data. | |
| if ( !hasVirtualBindings( this ) ) { | |
| $.data( this, dataPropertyName, {}); | |
| } | |
| // If setup is called, we know it is the first binding for this | |
| // eventType, so initialize the count for the eventType to zero. | |
| var bindings = $.data( this, dataPropertyName ); | |
| bindings[ eventType ] = true; | |
| // If this is the first virtual mouse event for this type, | |
| // register a global handler on the document. | |
| activeDocHandlers[ eventType ] = ( activeDocHandlers[ eventType ] || 0 ) + 1; | |
| if ( activeDocHandlers[ eventType ] === 1 ) { | |
| $document.bind( realType, mouseEventCallback ); | |
| } | |
| // Some browsers, like Opera Mini, won't dispatch mouse/click events | |
| // for elements unless they actually have handlers registered on them. | |
| // To get around this, we register dummy handlers on the elements. | |
| $( this ).bind( realType, dummyMouseHandler ); | |
| // For now, if event capture is not supported, we rely on mouse handlers. | |
| if ( eventCaptureSupported ) { | |
| // If this is the first virtual mouse binding for the document, | |
| // register our touchstart handler on the document. | |
| activeDocHandlers[ "touchstart" ] = ( activeDocHandlers[ "touchstart" ] || 0) + 1; | |
| if (activeDocHandlers[ "touchstart" ] === 1) { | |
| $document.bind( "touchstart", handleTouchStart ) | |
| .bind( "touchend", handleTouchEnd ) | |
| // On touch platforms, touching the screen and then dragging your finger | |
| // causes the window content to scroll after some distance threshold is | |
| // exceeded. On these platforms, a scroll prevents a click event from being | |
| // dispatched, and on some platforms, even the touchend is suppressed. To | |
| // mimic the suppression of the click event, we need to watch for a scroll | |
| // event. Unfortunately, some platforms like iOS don't dispatch scroll | |
| // events until *AFTER* the user lifts their finger (touchend). This means | |
| // we need to watch both scroll and touchmove events to figure out whether | |
| // or not a scroll happenens before the touchend event is fired. | |
| .bind( "touchmove", handleTouchMove ) | |
| .bind( "scroll", handleScroll ); | |
| } | |
| } | |
| }, | |
| teardown: function( data, namespace ) { | |
| // If this is the last virtual binding for this eventType, | |
| // remove its global handler from the document. | |
| --activeDocHandlers[ eventType ]; | |
| if ( !activeDocHandlers[ eventType ] ) { | |
| $document.unbind( realType, mouseEventCallback ); | |
| } | |
| if ( eventCaptureSupported ) { | |
| // If this is the last virtual mouse binding in existence, | |
| // remove our document touchstart listener. | |
| --activeDocHandlers[ "touchstart" ]; | |
| if ( !activeDocHandlers[ "touchstart" ] ) { | |
| $document.unbind( "touchstart", handleTouchStart ) | |
| .unbind( "touchmove", handleTouchMove ) | |
| .unbind( "touchend", handleTouchEnd ) | |
| .unbind( "scroll", handleScroll ); | |
| } | |
| } | |
| var $this = $( this ), | |
| bindings = $.data( this, dataPropertyName ); | |
| // teardown may be called when an element was | |
| // removed from the DOM. If this is the case, | |
| // jQuery core may have already stripped the element | |
| // of any data bindings so we need to check it before | |
| // using it. | |
| if ( bindings ) { | |
| bindings[ eventType ] = false; | |
| } | |
| // Unregister the dummy event handler. | |
| $this.unbind( realType, dummyMouseHandler ); | |
| // If this is the last virtual mouse binding on the | |
| // element, remove the binding data from the element. | |
| if ( !hasVirtualBindings( this ) ) { | |
| $this.removeData( dataPropertyName ); | |
| } | |
| } | |
| }; | |
| } | |
| // Expose our custom events to the jQuery bind/unbind mechanism. | |
| for ( var i = 0; i < virtualEventNames.length; i++ ){ | |
| $.event.special[ virtualEventNames[ i ] ] = getSpecialEventObject( virtualEventNames[ i ] ); | |
| } | |
| // Add a capture click handler to block clicks. | |
| // Note that we require event capture support for this so if the device | |
| // doesn't support it, we punt for now and rely solely on mouse events. | |
| if ( eventCaptureSupported ) { | |
| document.addEventListener( "click", function( e ){ | |
| var cnt = clickBlockList.length, | |
| target = e.target, | |
| x, y, ele, i, o, touchID; | |
| if ( cnt ) { | |
| x = e.clientX; | |
| y = e.clientY; | |
| threshold = $.vmouse.clickDistanceThreshold; | |
| // The idea here is to run through the clickBlockList to see if | |
| // the current click event is in the proximity of one of our | |
| // vclick events that had preventDefault() called on it. If we find | |
| // one, then we block the click. | |
| // | |
| // Why do we have to rely on proximity? | |
| // | |
| // Because the target of the touch event that triggered the vclick | |
| // can be different from the target of the click event synthesized | |
| // by the browser. The target of a mouse/click event that is syntehsized | |
| // from a touch event seems to be implementation specific. For example, | |
| // some browsers will fire mouse/click events for a link that is near | |
| // a touch event, even though the target of the touchstart/touchend event | |
| // says the user touched outside the link. Also, it seems that with most | |
| // browsers, the target of the mouse/click event is not calculated until the | |
| // time it is dispatched, so if you replace an element that you touched | |
| // with another element, the target of the mouse/click will be the new | |
| // element underneath that point. | |
| // | |
| // Aside from proximity, we also check to see if the target and any | |
| // of its ancestors were the ones that blocked a click. This is necessary | |
| // because of the strange mouse/click target calculation done in the | |
| // Android 2.1 browser, where if you click on an element, and there is a | |
| // mouse/click handler on one of its ancestors, the target will be the | |
| // innermost child of the touched element, even if that child is no where | |
| // near the point of touch. | |
| ele = target; | |
| while ( ele ) { | |
| for ( i = 0; i < cnt; i++ ) { | |
| o = clickBlockList[ i ]; | |
| touchID = 0; | |
| if ( ( ele === target && Math.abs( o.x - x ) < threshold && Math.abs( o.y - y ) < threshold ) || | |
| $.data( ele, touchTargetPropertyName ) === o.touchID ) { | |
| // XXX: We may want to consider removing matches from the block list | |
| // instead of waiting for the reset timer to fire. | |
| e.preventDefault(); | |
| e.stopPropagation(); | |
| return; | |
| } | |
| } | |
| ele = ele.parentNode; | |
| } | |
| } | |
| }, true); | |
| } | |
| })( jQuery, window, document ); | |
| /* | |
| * jQuery Mobile Framework : events | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| (function( $, window, undefined ) { | |
| // add new event shortcuts | |
| $.each( ( "touchstart touchmove touchend orientationchange throttledresize " + | |
| "tap taphold swipe swipeleft swiperight scrollstart scrollstop" ).split( " " ), function( i, name ) { | |
| $.fn[ name ] = function( fn ) { | |
| return fn ? this.bind( name, fn ) : this.trigger( name ); | |
| }; | |
| $.attrFn[ name ] = true; | |
| }); | |
| var supportTouch = $.support.touch, | |
| scrollEvent = "touchmove scroll", | |
| touchStartEvent = supportTouch ? "touchstart" : "mousedown", | |
| touchStopEvent = supportTouch ? "touchend" : "mouseup", | |
| touchMoveEvent = supportTouch ? "touchmove" : "mousemove"; | |
| function triggerCustomEvent( obj, eventType, event ) { | |
| var originalType = event.type; | |
| event.type = eventType; | |
| $.event.handle.call( obj, event ); | |
| event.type = originalType; | |
| } | |
| // also handles scrollstop | |
| $.event.special.scrollstart = { | |
| enabled: true, | |
| setup: function() { | |
| var thisObject = this, | |
| $this = $( thisObject ), | |
| scrolling, | |
| timer; | |
| function trigger( event, state ) { | |
| scrolling = state; | |
| triggerCustomEvent( thisObject, scrolling ? "scrollstart" : "scrollstop", event ); | |
| } | |
| // iPhone triggers scroll after a small delay; use touchmove instead | |
| $this.bind( scrollEvent, function( event ) { | |
| if ( !$.event.special.scrollstart.enabled ) { | |
| return; | |
| } | |
| if ( !scrolling ) { | |
| trigger( event, true ); | |
| } | |
| clearTimeout( timer ); | |
| timer = setTimeout(function() { | |
| trigger( event, false ); | |
| }, 50 ); | |
| }); | |
| } | |
| }; | |
| // also handles taphold | |
| $.event.special.tap = { | |
| setup: function() { | |
| var thisObject = this, | |
| $this = $( thisObject ); | |
| $this.bind( "vmousedown", function( event ) { | |
| if ( event.which && event.which !== 1 ) { | |
| return false; | |
| } | |
| var touching = true, | |
| origTarget = event.target, | |
| origEvent = event.originalEvent, | |
| timer; | |
| function clearTapHandlers() { | |
| touching = false; | |
| clearTimeout(timer); | |
| $this.unbind( "vclick", clickHandler ) | |
| .unbind( "vmousecancel", clearTapHandlers ); | |
| } | |
| function clickHandler(event) { | |
| clearTapHandlers(); | |
| // ONLY trigger a 'tap' event if the start target is | |
| // the same as the stop target. | |
| if ( origTarget == event.target ) { | |
| triggerCustomEvent( thisObject, "tap", event ); | |
| } | |
| } | |
| $this.bind( "vmousecancel", clearTapHandlers ) | |
| .bind( "vclick", clickHandler ); | |
| timer = setTimeout(function() { | |
| if ( touching ) { | |
| triggerCustomEvent( thisObject, "taphold", event ); | |
| } | |
| }, 750 ); | |
| }); | |
| } | |
| }; | |
| // also handles swipeleft, swiperight | |
| $.event.special.swipe = { | |
| scrollSupressionThreshold: 10, // More than this horizontal displacement, and we will suppress scrolling. | |
| durationThreshold: 1000, // More time than this, and it isn't a swipe. | |
| horizontalDistanceThreshold: 30, // Swipe horizontal displacement must be more than this. | |
| verticalDistanceThreshold: 75, // Swipe vertical displacement must be less than this. | |
| setup: function() { | |
| var thisObject = this, | |
| $this = $( thisObject ); | |
| $this.bind( touchStartEvent, function( event ) { | |
| var data = event.originalEvent.touches ? | |
| event.originalEvent.touches[ 0 ] : event, | |
| start = { | |
| time: ( new Date() ).getTime(), | |
| coords: [ data.pageX, data.pageY ], | |
| origin: $( event.target ) | |
| }, | |
| stop; | |
| function moveHandler( event ) { | |
| if ( !start ) { | |
| return; | |
| } | |
| var data = event.originalEvent.touches ? | |
| event.originalEvent.touches[ 0 ] : event; | |
| stop = { | |
| time: ( new Date() ).getTime(), | |
| coords: [ data.pageX, data.pageY ] | |
| }; | |
| // prevent scrolling | |
| if ( Math.abs( start.coords[ 0 ] - stop.coords[ 0 ] ) > $.event.special.swipe.scrollSupressionThreshold ) { | |
| event.preventDefault(); | |
| } | |
| } | |
| $this.bind( touchMoveEvent, moveHandler ) | |
| .one( touchStopEvent, function( event ) { | |
| $this.unbind( touchMoveEvent, moveHandler ); | |
| if ( start && stop ) { | |
| if ( stop.time - start.time < $.event.special.swipe.durationThreshold && | |
| Math.abs( start.coords[ 0 ] - stop.coords[ 0 ] ) > $.event.special.swipe.horizontalDistanceThreshold && | |
| Math.abs( start.coords[ 1 ] - stop.coords[ 1 ] ) < $.event.special.swipe.verticalDistanceThreshold ) { | |
| start.origin.trigger( "swipe" ) | |
| .trigger( start.coords[0] > stop.coords[ 0 ] ? "swipeleft" : "swiperight" ); | |
| } | |
| } | |
| start = stop = undefined; | |
| }); | |
| }); | |
| } | |
| }; | |
| (function( $, window ) { | |
| // "Cowboy" Ben Alman | |
| var win = $( window ), | |
| special_event, | |
| get_orientation, | |
| last_orientation; | |
| $.event.special.orientationchange = special_event = { | |
| setup: function() { | |
| // If the event is supported natively, return false so that jQuery | |
| // will bind to the event using DOM methods. | |
| if ( $.support.orientation ) { | |
| return false; | |
| } | |
| // Get the current orientation to avoid initial double-triggering. | |
| last_orientation = get_orientation(); | |
| // Because the orientationchange event doesn't exist, simulate the | |
| // event by testing window dimensions on resize. | |
| win.bind( "throttledresize", handler ); | |
| }, | |
| teardown: function(){ | |
| // If the event is not supported natively, return false so that | |
| // jQuery will unbind the event using DOM methods. | |
| if ( $.support.orientation ) { | |
| return false; | |
| } | |
| // Because the orientationchange event doesn't exist, unbind the | |
| // resize event handler. | |
| win.unbind( "throttledresize", handler ); | |
| }, | |
| add: function( handleObj ) { | |
| // Save a reference to the bound event handler. | |
| var old_handler = handleObj.handler; | |
| handleObj.handler = function( event ) { | |
| // Modify event object, adding the .orientation property. | |
| event.orientation = get_orientation(); | |
| // Call the originally-bound event handler and return its result. | |
| return old_handler.apply( this, arguments ); | |
| }; | |
| } | |
| }; | |
| // If the event is not supported natively, this handler will be bound to | |
| // the window resize event to simulate the orientationchange event. | |
| function handler() { | |
| // Get the current orientation. | |
| var orientation = get_orientation(); | |
| if ( orientation !== last_orientation ) { | |
| // The orientation has changed, so trigger the orientationchange event. | |
| last_orientation = orientation; | |
| win.trigger( "orientationchange" ); | |
| } | |
| }; | |
| // Get the current page orientation. This method is exposed publicly, should it | |
| // be needed, as jQuery.event.special.orientationchange.orientation() | |
| $.event.special.orientationchange.orientation = get_orientation = function() { | |
| var elem = document.documentElement; | |
| return elem && elem.clientWidth / elem.clientHeight < 1.1 ? "portrait" : "landscape"; | |
| }; | |
| })( jQuery, window ); | |
| // throttled resize event | |
| (function() { | |
| $.event.special.throttledresize = { | |
| setup: function() { | |
| $( this ).bind( "resize", handler ); | |
| }, | |
| teardown: function(){ | |
| $( this ).unbind( "resize", handler ); | |
| } | |
| }; | |
| var throttle = 250, | |
| handler = function() { | |
| curr = ( new Date() ).getTime(); | |
| diff = curr - lastCall; | |
| if ( diff >= throttle ) { | |
| lastCall = curr; | |
| $( this ).trigger( "throttledresize" ); | |
| } else { | |
| if ( heldCall ) { | |
| clearTimeout( heldCall ); | |
| } | |
| // Promise a held call will still execute | |
| heldCall = setTimeout( handler, throttle - diff ); | |
| } | |
| }, | |
| lastCall = 0, | |
| heldCall, | |
| curr, | |
| diff; | |
| })(); | |
| $.each({ | |
| scrollstop: "scrollstart", | |
| taphold: "tap", | |
| swipeleft: "swipe", | |
| swiperight: "swipe" | |
| }, function( event, sourceEvent ) { | |
| $.event.special[ event ] = { | |
| setup: function() { | |
| $( this ).bind( sourceEvent, $.noop ); | |
| } | |
| }; | |
| }); | |
| })( jQuery, this ); | |
| /*! | |
| * jQuery hashchange event - v1.3 - 7/21/2010 | |
| * http://benalman.com/projects/jquery-hashchange-plugin/ | |
| * | |
| * Copyright (c) 2010 "Cowboy" Ben Alman | |
| * Dual licensed under the MIT and GPL licenses. | |
| * http://benalman.com/about/license/ | |
| */ | |
| // Script: jQuery hashchange event | |
| // | |
| // *Version: 1.3, Last updated: 7/21/2010* | |
| // | |
| // Project Home - http://benalman.com/projects/jquery-hashchange-plugin/ | |
| // GitHub - http://github.com/cowboy/jquery-hashchange/ | |
| // Source - http://github.com/cowboy/jquery-hashchange/raw/master/jquery.ba-hashchange.js | |
| // (Minified) - http://github.com/cowboy/jquery-hashchange/raw/master/jquery.ba-hashchange.min.js (0.8kb gzipped) | |
| // | |
| // About: License | |
| // | |
| // Copyright (c) 2010 "Cowboy" Ben Alman, | |
| // Dual licensed under the MIT and GPL licenses. | |
| // http://benalman.com/about/license/ | |
| // | |
| // About: Examples | |
| // | |
| // These working examples, complete with fully commented code, illustrate a few | |
| // ways in which this plugin can be used. | |
| // | |
| // hashchange event - http://benalman.com/code/projects/jquery-hashchange/examples/hashchange/ | |
| // document.domain - http://benalman.com/code/projects/jquery-hashchange/examples/document_domain/ | |
| // | |
| // About: Support and Testing | |
| // | |
| // Information about what version or versions of jQuery this plugin has been | |
| // tested with, what browsers it has been tested in, and where the unit tests | |
| // reside (so you can test it yourself). | |
| // | |
| // jQuery Versions - 1.2.6, 1.3.2, 1.4.1, 1.4.2 | |
| // Browsers Tested - Internet Explorer 6-8, Firefox 2-4, Chrome 5-6, Safari 3.2-5, | |
| // Opera 9.6-10.60, iPhone 3.1, Android 1.6-2.2, BlackBerry 4.6-5. | |
| // Unit Tests - http://benalman.com/code/projects/jquery-hashchange/unit/ | |
| // | |
| // About: Known issues | |
| // | |
| // While this jQuery hashchange event implementation is quite stable and | |
| // robust, there are a few unfortunate browser bugs surrounding expected | |
| // hashchange event-based behaviors, independent of any JavaScript | |
| // window.onhashchange abstraction. See the following examples for more | |
| // information: | |
| // | |
| // Chrome: Back Button - http://benalman.com/code/projects/jquery-hashchange/examples/bug-chrome-back-button/ | |
| // Firefox: Remote XMLHttpRequest - http://benalman.com/code/projects/jquery-hashchange/examples/bug-firefox-remote-xhr/ | |
| // WebKit: Back Button in an Iframe - http://benalman.com/code/projects/jquery-hashchange/examples/bug-webkit-hash-iframe/ | |
| // Safari: Back Button from a different domain - http://benalman.com/code/projects/jquery-hashchange/examples/bug-safari-back-from-diff-domain/ | |
| // | |
| // Also note that should a browser natively support the window.onhashchange | |
| // event, but not report that it does, the fallback polling loop will be used. | |
| // | |
| // About: Release History | |
| // | |
| // 1.3 - (7/21/2010) Reorganized IE6/7 Iframe code to make it more | |
| // "removable" for mobile-only development. Added IE6/7 document.title | |
| // support. Attempted to make Iframe as hidden as possible by using | |
| // techniques from http://www.paciellogroup.com/blog/?p=604. Added | |
| // support for the "shortcut" format $(window).hashchange( fn ) and | |
| // $(window).hashchange() like jQuery provides for built-in events. | |
| // Renamed jQuery.hashchangeDelay to <jQuery.fn.hashchange.delay> and | |
| // lowered its default value to 50. Added <jQuery.fn.hashchange.domain> | |
| // and <jQuery.fn.hashchange.src> properties plus document-domain.html | |
| // file to address access denied issues when setting document.domain in | |
| // IE6/7. | |
| // 1.2 - (2/11/2010) Fixed a bug where coming back to a page using this plugin | |
| // from a page on another domain would cause an error in Safari 4. Also, | |
| // IE6/7 Iframe is now inserted after the body (this actually works), | |
| // which prevents the page from scrolling when the event is first bound. | |
| // Event can also now be bound before DOM ready, but it won't be usable | |
| // before then in IE6/7. | |
| // 1.1 - (1/21/2010) Incorporated document.documentMode test to fix IE8 bug | |
| // where browser version is incorrectly reported as 8.0, despite | |
| // inclusion of the X-UA-Compatible IE=EmulateIE7 meta tag. | |
| // 1.0 - (1/9/2010) Initial Release. Broke out the jQuery BBQ event.special | |
| // window.onhashchange functionality into a separate plugin for users | |
| // who want just the basic event & back button support, without all the | |
| // extra awesomeness that BBQ provides. This plugin will be included as | |
| // part of jQuery BBQ, but also be available separately. | |
| (function($,window,undefined){ | |
| '$:nomunge'; // Used by YUI compressor. | |
| // Reused string. | |
| var str_hashchange = 'hashchange', | |
| // Method / object references. | |
| doc = document, | |
| fake_onhashchange, | |
| special = $.event.special, | |
| // Does the browser support window.onhashchange? Note that IE8 running in | |
| // IE7 compatibility mode reports true for 'onhashchange' in window, even | |
| // though the event isn't supported, so also test document.documentMode. | |
| doc_mode = doc.documentMode, | |
| supports_onhashchange = 'on' + str_hashchange in window && ( doc_mode === undefined || doc_mode > 7 ); | |
| // Get location.hash (or what you'd expect location.hash to be) sans any | |
| // leading #. Thanks for making this necessary, Firefox! | |
| function get_fragment( url ) { | |
| url = url || location.href; | |
| return '#' + url.replace( /^[^#]*#?(.*)$/, '$1' ); | |
| }; | |
| // Method: jQuery.fn.hashchange | |
| // | |
| // Bind a handler to the window.onhashchange event or trigger all bound | |
| // window.onhashchange event handlers. This behavior is consistent with | |
| // jQuery's built-in event handlers. | |
| // | |
| // Usage: | |
| // | |
| // > jQuery(window).hashchange( [ handler ] ); | |
| // | |
| // Arguments: | |
| // | |
| // handler - (Function) Optional handler to be bound to the hashchange | |
| // event. This is a "shortcut" for the more verbose form: | |
| // jQuery(window).bind( 'hashchange', handler ). If handler is omitted, | |
| // all bound window.onhashchange event handlers will be triggered. This | |
| // is a shortcut for the more verbose | |
| // jQuery(window).trigger( 'hashchange' ). These forms are described in | |
| // the <hashchange event> section. | |
| // | |
| // Returns: | |
| // | |
| // (jQuery) The initial jQuery collection of elements. | |
| // Allow the "shortcut" format $(elem).hashchange( fn ) for binding and | |
| // $(elem).hashchange() for triggering, like jQuery does for built-in events. | |
| $.fn[ str_hashchange ] = function( fn ) { | |
| return fn ? this.bind( str_hashchange, fn ) : this.trigger( str_hashchange ); | |
| }; | |
| // Property: jQuery.fn.hashchange.delay | |
| // | |
| // The numeric interval (in milliseconds) at which the <hashchange event> | |
| // polling loop executes. Defaults to 50. | |
| // Property: jQuery.fn.hashchange.domain | |
| // | |
| // If you're setting document.domain in your JavaScript, and you want hash | |
| // history to work in IE6/7, not only must this property be set, but you must | |
| // also set document.domain BEFORE jQuery is loaded into the page. This | |
| // property is only applicable if you are supporting IE6/7 (or IE8 operating | |
| // in "IE7 compatibility" mode). | |
| // | |
| // In addition, the <jQuery.fn.hashchange.src> property must be set to the | |
| // path of the included "document-domain.html" file, which can be renamed or | |
| // modified if necessary (note that the document.domain specified must be the | |
| // same in both your main JavaScript as well as in this file). | |
| // | |
| // Usage: | |
| // | |
| // jQuery.fn.hashchange.domain = document.domain; | |
| // Property: jQuery.fn.hashchange.src | |
| // | |
| // If, for some reason, you need to specify an Iframe src file (for example, | |
| // when setting document.domain as in <jQuery.fn.hashchange.domain>), you can | |
| // do so using this property. Note that when using this property, history | |
| // won't be recorded in IE6/7 until the Iframe src file loads. This property | |
| // is only applicable if you are supporting IE6/7 (or IE8 operating in "IE7 | |
| // compatibility" mode). | |
| // | |
| // Usage: | |
| // | |
| // jQuery.fn.hashchange.src = 'path/to/file.html'; | |
| $.fn[ str_hashchange ].delay = 50; | |
| /* | |
| $.fn[ str_hashchange ].domain = null; | |
| $.fn[ str_hashchange ].src = null; | |
| */ | |
| // Event: hashchange event | |
| // | |
| // Fired when location.hash changes. In browsers that support it, the native | |
| // HTML5 window.onhashchange event is used, otherwise a polling loop is | |
| // initialized, running every <jQuery.fn.hashchange.delay> milliseconds to | |
| // see if the hash has changed. In IE6/7 (and IE8 operating in "IE7 | |
| // compatibility" mode), a hidden Iframe is created to allow the back button | |
| // and hash-based history to work. | |
| // | |
| // Usage as described in <jQuery.fn.hashchange>: | |
| // | |
| // > // Bind an event handler. | |
| // > jQuery(window).hashchange( function(e) { | |
| // > var hash = location.hash; | |
| // > ... | |
| // > }); | |
| // > | |
| // > // Manually trigger the event handler. | |
| // > jQuery(window).hashchange(); | |
| // | |
| // A more verbose usage that allows for event namespacing: | |
| // | |
| // > // Bind an event handler. | |
| // > jQuery(window).bind( 'hashchange', function(e) { | |
| // > var hash = location.hash; | |
| // > ... | |
| // > }); | |
| // > | |
| // > // Manually trigger the event handler. | |
| // > jQuery(window).trigger( 'hashchange' ); | |
| // | |
| // Additional Notes: | |
| // | |
| // * The polling loop and Iframe are not created until at least one handler | |
| // is actually bound to the 'hashchange' event. | |
| // * If you need the bound handler(s) to execute immediately, in cases where | |
| // a location.hash exists on page load, via bookmark or page refresh for | |
| // example, use jQuery(window).hashchange() or the more verbose | |
| // jQuery(window).trigger( 'hashchange' ). | |
| // * The event can be bound before DOM ready, but since it won't be usable | |
| // before then in IE6/7 (due to the necessary Iframe), recommended usage is | |
| // to bind it inside a DOM ready handler. | |
| // Override existing $.event.special.hashchange methods (allowing this plugin | |
| // to be defined after jQuery BBQ in BBQ's source code). | |
| special[ str_hashchange ] = $.extend( special[ str_hashchange ], { | |
| // Called only when the first 'hashchange' event is bound to window. | |
| setup: function() { | |
| // If window.onhashchange is supported natively, there's nothing to do.. | |
| if ( supports_onhashchange ) { return false; } | |
| // Otherwise, we need to create our own. And we don't want to call this | |
| // until the user binds to the event, just in case they never do, since it | |
| // will create a polling loop and possibly even a hidden Iframe. | |
| $( fake_onhashchange.start ); | |
| }, | |
| // Called only when the last 'hashchange' event is unbound from window. | |
| teardown: function() { | |
| // If window.onhashchange is supported natively, there's nothing to do.. | |
| if ( supports_onhashchange ) { return false; } | |
| // Otherwise, we need to stop ours (if possible). | |
| $( fake_onhashchange.stop ); | |
| } | |
| }); | |
| // fake_onhashchange does all the work of triggering the window.onhashchange | |
| // event for browsers that don't natively support it, including creating a | |
| // polling loop to watch for hash changes and in IE 6/7 creating a hidden | |
| // Iframe to enable back and forward. | |
| fake_onhashchange = (function(){ | |
| var self = {}, | |
| timeout_id, | |
| // Remember the initial hash so it doesn't get triggered immediately. | |
| last_hash = get_fragment(), | |
| fn_retval = function(val){ return val; }, | |
| history_set = fn_retval, | |
| history_get = fn_retval; | |
| // Start the polling loop. | |
| self.start = function() { | |
| timeout_id || poll(); | |
| }; | |
| // Stop the polling loop. | |
| self.stop = function() { | |
| timeout_id && clearTimeout( timeout_id ); | |
| timeout_id = undefined; | |
| }; | |
| // This polling loop checks every $.fn.hashchange.delay milliseconds to see | |
| // if location.hash has changed, and triggers the 'hashchange' event on | |
| // window when necessary. | |
| function poll() { | |
| var hash = get_fragment(), | |
| history_hash = history_get( last_hash ); | |
| if ( hash !== last_hash ) { | |
| history_set( last_hash = hash, history_hash ); | |
| $(window).trigger( str_hashchange ); | |
| } else if ( history_hash !== last_hash ) { | |
| location.href = location.href.replace( /#.*/, '' ) + history_hash; | |
| } | |
| timeout_id = setTimeout( poll, $.fn[ str_hashchange ].delay ); | |
| }; | |
| // vvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvv | |
| // vvvvvvvvvvvvvvvvvvv REMOVE IF NOT SUPPORTING IE6/7/8 vvvvvvvvvvvvvvvvvvv | |
| // vvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvv | |
| $.browser.msie && !supports_onhashchange && (function(){ | |
| // Not only do IE6/7 need the "magical" Iframe treatment, but so does IE8 | |
| // when running in "IE7 compatibility" mode. | |
| var iframe, | |
| iframe_src; | |
| // When the event is bound and polling starts in IE 6/7, create a hidden | |
| // Iframe for history handling. | |
| self.start = function(){ | |
| if ( !iframe ) { | |
| iframe_src = $.fn[ str_hashchange ].src; | |
| iframe_src = iframe_src && iframe_src + get_fragment(); | |
| // Create hidden Iframe. Attempt to make Iframe as hidden as possible | |
| // by using techniques from http://www.paciellogroup.com/blog/?p=604. | |
| iframe = $('<iframe tabindex="-1" title="empty"/>').hide() | |
| // When Iframe has completely loaded, initialize the history and | |
| // start polling. | |
| .one( 'load', function(){ | |
| iframe_src || history_set( get_fragment() ); | |
| poll(); | |
| }) | |
| // Load Iframe src if specified, otherwise nothing. | |
| .attr( 'src', iframe_src || 'javascript:0' ) | |
| // Append Iframe after the end of the body to prevent unnecessary | |
| // initial page scrolling (yes, this works). | |
| .insertAfter( 'body' )[0].contentWindow; | |
| // Whenever `document.title` changes, update the Iframe's title to | |
| // prettify the back/next history menu entries. Since IE sometimes | |
| // errors with "Unspecified error" the very first time this is set | |
| // (yes, very useful) wrap this with a try/catch block. | |
| doc.onpropertychange = function(){ | |
| try { | |
| if ( event.propertyName === 'title' ) { | |
| iframe.document.title = doc.title; | |
| } | |
| } catch(e) {} | |
| }; | |
| } | |
| }; | |
| // Override the "stop" method since an IE6/7 Iframe was created. Even | |
| // if there are no longer any bound event handlers, the polling loop | |
| // is still necessary for back/next to work at all! | |
| self.stop = fn_retval; | |
| // Get history by looking at the hidden Iframe's location.hash. | |
| history_get = function() { | |
| return get_fragment( iframe.location.href ); | |
| }; | |
| // Set a new history item by opening and then closing the Iframe | |
| // document, *then* setting its location.hash. If document.domain has | |
| // been set, update that as well. | |
| history_set = function( hash, history_hash ) { | |
| var iframe_doc = iframe.document, | |
| domain = $.fn[ str_hashchange ].domain; | |
| if ( hash !== history_hash ) { | |
| // Update Iframe with any initial `document.title` that might be set. | |
| iframe_doc.title = doc.title; | |
| // Opening the Iframe's document after it has been closed is what | |
| // actually adds a history entry. | |
| iframe_doc.open(); | |
| // Set document.domain for the Iframe document as well, if necessary. | |
| domain && iframe_doc.write( '<script>document.domain="' + domain + '"</script>' ); | |
| iframe_doc.close(); | |
| // Update the Iframe's hash, for great justice. | |
| iframe.location.hash = hash; | |
| } | |
| }; | |
| })(); | |
| // ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ | |
| // ^^^^^^^^^^^^^^^^^^^ REMOVE IF NOT SUPPORTING IE6/7/8 ^^^^^^^^^^^^^^^^^^^ | |
| // ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ | |
| return self; | |
| })(); | |
| })(jQuery,this); | |
| /* | |
| * jQuery Mobile Framework : "page" plugin | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| (function( $, undefined ) { | |
| $.widget( "mobile.page", $.mobile.widget, { | |
| options: { | |
| theme: "c", | |
| domCache: false | |
| }, | |
| _create: function() { | |
| var $elem = this.element, | |
| o = this.options; | |
| if ( this._trigger( "beforeCreate" ) === false ) { | |
| return; | |
| } | |
| $elem.addClass( "ui-page ui-body-" + o.theme ); | |
| } | |
| }); | |
| })( jQuery ); | |
| /*! | |
| * jQuery Mobile v@VERSION | |
| * http://jquerymobile.com/ | |
| * | |
| * Copyright 2010, jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| (function( $, window, undefined ) { | |
| // jQuery.mobile configurable options | |
| $.extend( $.mobile, { | |
| // Namespace used framework-wide for data-attrs. Default is no namespace | |
| ns: "", | |
| // Define the url parameter used for referencing widget-generated sub-pages. | |
| // Translates to to example.html&ui-page=subpageIdentifier | |
| // hash segment before &ui-page= is used to make Ajax request | |
| subPageUrlKey: "ui-page", | |
| // Class assigned to page currently in view, and during transitions | |
| activePageClass: "ui-page-active", | |
| // Class used for "active" button state, from CSS framework | |
| activeBtnClass: "ui-btn-active", | |
| // Automatically handle clicks and form submissions through Ajax, when same-domain | |
| ajaxEnabled: true, | |
| // Automatically load and show pages based on location.hash | |
| hashListeningEnabled: true, | |
| // Set default page transition - 'none' for no transitions | |
| defaultPageTransition: "slide", | |
| // Minimum scroll distance that will be remembered when returning to a page | |
| minScrollBack: screen.height / 2, | |
| // Set default dialog transition - 'none' for no transitions | |
| defaultDialogTransition: "pop", | |
| // Show loading message during Ajax requests | |
| // if false, message will not appear, but loading classes will still be toggled on html el | |
| loadingMessage: "loading", | |
| // Error response message - appears when an Ajax page request fails | |
| pageLoadErrorMessage: "Error Loading Page", | |
| //automatically initialize the DOM when it's ready | |
| autoInitializePage: true, | |
| // Support conditions that must be met in order to proceed | |
| // default enhanced qualifications are media query support OR IE 7+ | |
| gradeA: function(){ | |
| return $.support.mediaquery || $.mobile.browser.ie && $.mobile.browser.ie >= 7; | |
| }, | |
| // TODO might be useful upstream in jquery itself ? | |
| keyCode: { | |
| ALT: 18, | |
| BACKSPACE: 8, | |
| CAPS_LOCK: 20, | |
| COMMA: 188, | |
| COMMAND: 91, | |
| COMMAND_LEFT: 91, // COMMAND | |
| COMMAND_RIGHT: 93, | |
| CONTROL: 17, | |
| DELETE: 46, | |
| DOWN: 40, | |
| END: 35, | |
| ENTER: 13, | |
| ESCAPE: 27, | |
| HOME: 36, | |
| INSERT: 45, | |
| LEFT: 37, | |
| MENU: 93, // COMMAND_RIGHT | |
| NUMPAD_ADD: 107, | |
| NUMPAD_DECIMAL: 110, | |
| NUMPAD_DIVIDE: 111, | |
| NUMPAD_ENTER: 108, | |
| NUMPAD_MULTIPLY: 106, | |
| NUMPAD_SUBTRACT: 109, | |
| PAGE_DOWN: 34, | |
| PAGE_UP: 33, | |
| PERIOD: 190, | |
| RIGHT: 39, | |
| SHIFT: 16, | |
| SPACE: 32, | |
| TAB: 9, | |
| UP: 38, | |
| WINDOWS: 91 // COMMAND | |
| }, | |
| // Scroll page vertically: scroll to 0 to hide iOS address bar, or pass a Y value | |
| silentScroll: function( ypos ) { | |
| if ( $.type( ypos ) !== "number" ) { | |
| ypos = $.mobile.defaultHomeScroll; | |
| } | |
| // prevent scrollstart and scrollstop events | |
| $.event.special.scrollstart.enabled = false; | |
| setTimeout(function() { | |
| window.scrollTo( 0, ypos ); | |
| $( document ).trigger( "silentscroll", { x: 0, y: ypos }); | |
| }, 20 ); | |
| setTimeout(function() { | |
| $.event.special.scrollstart.enabled = true; | |
| }, 150 ); | |
| }, | |
| // Take a data attribute property, prepend the namespace | |
| // and then camel case the attribute string | |
| nsNormalize: function( prop ) { | |
| if ( !prop ) { | |
| return; | |
| } | |
| return $.camelCase( $.mobile.ns + prop ); | |
| } | |
| }); | |
| // Mobile version of data and removeData and hasData methods | |
| // ensures all data is set and retrieved using jQuery Mobile's data namespace | |
| $.fn.jqmData = function( prop, value ) { | |
| return this.data( prop ? $.mobile.nsNormalize( prop ) : prop, value ); | |
| }; | |
| $.jqmData = function( elem, prop, value ) { | |
| return $.data( elem, $.mobile.nsNormalize( prop ), value ); | |
| }; | |
| $.fn.jqmRemoveData = function( prop ) { | |
| return this.removeData( $.mobile.nsNormalize( prop ) ); | |
| }; | |
| $.jqmRemoveData = function( elem, prop ) { | |
| return $.removeData( elem, $.mobile.nsNormalize( prop ) ); | |
| }; | |
| $.jqmHasData = function( elem, prop ) { | |
| return $.hasData( elem, $.mobile.nsNormalize( prop ) ); | |
| }; | |
| // Monkey-patching Sizzle to filter the :jqmData selector | |
| var oldFind = $.find; | |
| $.find = function( selector, context, ret, extra ) { | |
| selector = selector.replace(/:jqmData\(([^)]*)\)/g, "[data-" + ( $.mobile.ns || "" ) + "$1]"); | |
| return oldFind.call( this, selector, context, ret, extra ); | |
| }; | |
| $.extend( $.find, oldFind ); | |
| $.find.matches = function( expr, set ) { | |
| return $.find( expr, null, null, set ); | |
| }; | |
| $.find.matchesSelector = function( node, expr ) { | |
| return $.find( expr, null, null, [ node ] ).length > 0; | |
| }; | |
| })( jQuery, this ); | |
| /* | |
| * jQuery Mobile Framework : core utilities for auto ajax navigation, base tag mgmt, | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| ( function( $, undefined ) { | |
| //define vars for interal use | |
| var $window = $( window ), | |
| $html = $( 'html' ), | |
| $head = $( 'head' ), | |
| //url path helpers for use in relative url management | |
| path = { | |
| // This scary looking regular expression parses an absolute URL or its relative | |
| // variants (protocol, site, document, query, and hash), into the various | |
| // components (protocol, host, path, query, fragment, etc that make up the | |
| // URL as well as some other commonly used sub-parts. When used with RegExp.exec() | |
| // or String.match, it parses the URL into a results array that looks like this: | |
| // | |
| // [0]: http://jblas:password@mycompany.com:8080/mail/inbox?msg=1234&type=unread#msg-content | |
| // [1]: http://jblas:password@mycompany.com:8080/mail/inbox?msg=1234&type=unread | |
| // [2]: http://jblas:password@mycompany.com:8080/mail/inbox | |
| // [3]: http://jblas:password@mycompany.com:8080 | |
| // [4]: http: | |
| // [5]: jblas:password@mycompany.com:8080 | |
| // [6]: jblas:password | |
| // [7]: jblas | |
| // [8]: password | |
| // [9]: mycompany.com:8080 | |
| // [10]: mycompany.com | |
| // [11]: 8080 | |
| // [12]: /mail/inbox | |
| // [13]: /mail/ | |
| // [14]: inbox | |
| // [15]: ?msg=1234&type=unread | |
| // [16]: #msg-content | |
| // | |
| urlParseRE: /^(((([^:\/#\?]+:)?(?:\/\/((?:(([^:@\/#\?]+)(?:\:([^:@\/#\?]+))?)@)?(([^:\/#\?]+)(?:\:([0-9]+))?))?)?)?((\/?(?:[^\/\?#]+\/+)*)([^\?#]*)))?(\?[^#]+)?)(#.*)?/, | |
| //Parse a URL into a structure that allows easy access to | |
| //all of the URL components by name. | |
| parseUrl: function( url ) { | |
| // If we're passed an object, we'll assume that it is | |
| // a parsed url object and just return it back to the caller. | |
| if ( $.type( url ) === "object" ) { | |
| return url; | |
| } | |
| var u = url || "", | |
| matches = path.urlParseRE.exec( url ), | |
| results; | |
| if ( matches ) { | |
| // Create an object that allows the caller to access the sub-matches | |
| // by name. Note that IE returns an empty string instead of undefined, | |
| // like all other browsers do, so we normalize everything so its consistent | |
| // no matter what browser we're running on. | |
| results = { | |
| href: matches[0] || "", | |
| hrefNoHash: matches[1] || "", | |
| hrefNoSearch: matches[2] || "", | |
| domain: matches[3] || "", | |
| protocol: matches[4] || "", | |
| authority: matches[5] || "", | |
| username: matches[7] || "", | |
| password: matches[8] || "", | |
| host: matches[9] || "", | |
| hostname: matches[10] || "", | |
| port: matches[11] || "", | |
| pathname: matches[12] || "", | |
| directory: matches[13] || "", | |
| filename: matches[14] || "", | |
| search: matches[15] || "", | |
| hash: matches[16] || "" | |
| }; | |
| } | |
| return results || {}; | |
| }, | |
| //Turn relPath into an asbolute path. absPath is | |
| //an optional absolute path which describes what | |
| //relPath is relative to. | |
| makePathAbsolute: function( relPath, absPath ) { | |
| if ( relPath && relPath.charAt( 0 ) === "/" ) { | |
| return relPath; | |
| } | |
| relPath = relPath || ""; | |
| absPath = absPath ? absPath.replace( /^\/|(\/[^\/]*|[^\/]+)$/g, "" ) : ""; | |
| var absStack = absPath ? absPath.split( "/" ) : [], | |
| relStack = relPath.split( "/" ); | |
| for ( var i = 0; i < relStack.length; i++ ) { | |
| var d = relStack[ i ]; | |
| switch ( d ) { | |
| case ".": | |
| break; | |
| case "..": | |
| if ( absStack.length ) { | |
| absStack.pop(); | |
| } | |
| break; | |
| default: | |
| absStack.push( d ); | |
| break; | |
| } | |
| } | |
| return "/" + absStack.join( "/" ); | |
| }, | |
| //Returns true if both urls have the same domain. | |
| isSameDomain: function( absUrl1, absUrl2 ) { | |
| return path.parseUrl( absUrl1 ).domain === path.parseUrl( absUrl2 ).domain; | |
| }, | |
| //Returns true for any relative variant. | |
| isRelativeUrl: function( url ) { | |
| // All relative Url variants have one thing in common, no protocol. | |
| return path.parseUrl( url ).protocol === ""; | |
| }, | |
| //Returns true for an absolute url. | |
| isAbsoluteUrl: function( url ) { | |
| return path.parseUrl( url ).protocol !== ""; | |
| }, | |
| //Turn the specified realtive URL into an absolute one. This function | |
| //can handle all relative variants (protocol, site, document, query, fragment). | |
| makeUrlAbsolute: function( relUrl, absUrl ) { | |
| if ( !path.isRelativeUrl( relUrl ) ) { | |
| return relUrl; | |
| } | |
| var relObj = path.parseUrl( relUrl ), | |
| absObj = path.parseUrl( absUrl ), | |
| protocol = relObj.protocol || absObj.protocol, | |
| authority = relObj.authority || absObj.authority, | |
| hasPath = relObj.pathname !== "", | |
| pathname = path.makePathAbsolute( relObj.pathname || absObj.filename, absObj.pathname ), | |
| search = relObj.search || ( !hasPath && absObj.search ) || "", | |
| hash = relObj.hash; | |
| return protocol + "//" + authority + pathname + search + hash; | |
| }, | |
| //Add search (aka query) params to the specified url. | |
| addSearchParams: function( url, params ) { | |
| var u = path.parseUrl( url ), | |
| p = ( typeof params === "object" ) ? $.param( params ) : params, | |
| s = u.search || "?"; | |
| return u.hrefNoSearch + s + ( s.charAt( s.length - 1 ) !== "?" ? "&" : "" ) + p + ( u.hash || "" ); | |
| }, | |
| convertUrlToDataUrl: function( absUrl ) { | |
| var u = path.parseUrl( absUrl ); | |
| if ( path.isEmbeddedPage( u ) ) { | |
| // For embedded pages, remove the dialog hash key as in getFilePath(), | |
| // otherwise the Data Url won't match the id of the embedded Page. | |
| return u.hash.split( dialogHashKey )[0].replace( /^#/, "" ); | |
| } else if ( path.isSameDomain( u, documentBase ) ) { | |
| return u.hrefNoHash.replace( documentBase.domain, "" ); | |
| } | |
| return absUrl; | |
| }, | |
| //get path from current hash, or from a file path | |
| get: function( newPath ) { | |
| if( newPath === undefined ) { | |
| newPath = location.hash; | |
| } | |
| return path.stripHash( newPath ).replace( /[^\/]*\.[^\/*]+$/, '' ); | |
| }, | |
| //return the substring of a filepath before the sub-page key, for making a server request | |
| getFilePath: function( path ) { | |
| var splitkey = '&' + $.mobile.subPageUrlKey; | |
| return path && path.split( splitkey )[0].split( dialogHashKey )[0]; | |
| }, | |
| //set location hash to path | |
| set: function( path ) { | |
| location.hash = path; | |
| }, | |
| //test if a given url (string) is a path | |
| //NOTE might be exceptionally naive | |
| isPath: function( url ) { | |
| return ( /\// ).test( url ); | |
| }, | |
| //return a url path with the window's location protocol/hostname/pathname removed | |
| clean: function( url ) { | |
| return url.replace( documentBase.domain, "" ); | |
| }, | |
| //just return the url without an initial # | |
| stripHash: function( url ) { | |
| return url.replace( /^#/, "" ); | |
| }, | |
| //remove the preceding hash, any query params, and dialog notations | |
| cleanHash: function( hash ) { | |
| return path.stripHash( hash.replace( /\?.*$/, "" ).replace( dialogHashKey, "" ) ); | |
| }, | |
| //check whether a url is referencing the same domain, or an external domain or different protocol | |
| //could be mailto, etc | |
| isExternal: function( url ) { | |
| var u = path.parseUrl( url ); | |
| return u.protocol && u.domain !== documentUrl.domain ? true : false; | |
| }, | |
| hasProtocol: function( url ) { | |
| return ( /^(:?\w+:)/ ).test( url ); | |
| }, | |
| isEmbeddedPage: function( url ) { | |
| var u = path.parseUrl( url ); | |
| //if the path is absolute, then we need to compare the url against | |
| //both the documentUrl and the documentBase. The main reason for this | |
| //is that links embedded within external documents will refer to the | |
| //application document, whereas links embedded within the application | |
| //document will be resolved against the document base. | |
| if ( u.protocol !== "" ) { | |
| return ( u.hash && ( u.hrefNoHash === documentUrl.hrefNoHash || ( documentBaseDiffers && u.hrefNoHash === documentBase.hrefNoHash ) ) ); | |
| } | |
| return (/^#/).test( u.href ); | |
| } | |
| }, | |
| //will be defined when a link is clicked and given an active class | |
| $activeClickedLink = null, | |
| //urlHistory is purely here to make guesses at whether the back or forward button was clicked | |
| //and provide an appropriate transition | |
| urlHistory = { | |
| // Array of pages that are visited during a single page load. | |
| // Each has a url and optional transition, title, and pageUrl (which represents the file path, in cases where URL is obscured, such as dialogs) | |
| stack: [], | |
| //maintain an index number for the active page in the stack | |
| activeIndex: 0, | |
| //get active | |
| getActive: function() { | |
| return urlHistory.stack[ urlHistory.activeIndex ]; | |
| }, | |
| getPrev: function() { | |
| return urlHistory.stack[ urlHistory.activeIndex - 1 ]; | |
| }, | |
| getNext: function() { | |
| return urlHistory.stack[ urlHistory.activeIndex + 1 ]; | |
| }, | |
| // addNew is used whenever a new page is added | |
| addNew: function( url, transition, title, pageUrl ) { | |
| //if there's forward history, wipe it | |
| if( urlHistory.getNext() ) { | |
| urlHistory.clearForward(); | |
| } | |
| urlHistory.stack.push( {url : url, transition: transition, title: title, pageUrl: pageUrl } ); | |
| urlHistory.activeIndex = urlHistory.stack.length - 1; | |
| }, | |
| //wipe urls ahead of active index | |
| clearForward: function() { | |
| urlHistory.stack = urlHistory.stack.slice( 0, urlHistory.activeIndex + 1 ); | |
| }, | |
| directHashChange: function( opts ) { | |
| var back , forward, newActiveIndex; | |
| // check if url isp in history and if it's ahead or behind current page | |
| $.each( urlHistory.stack, function( i, historyEntry ) { | |
| //if the url is in the stack, it's a forward or a back | |
| if( opts.currentUrl === historyEntry.url ) { | |
| //define back and forward by whether url is older or newer than current page | |
| back = i < urlHistory.activeIndex; | |
| forward = !back; | |
| newActiveIndex = i; | |
| } | |
| }); | |
| // save new page index, null check to prevent falsey 0 result | |
| this.activeIndex = newActiveIndex !== undefined ? newActiveIndex : this.activeIndex; | |
| if( back ) { | |
| opts.isBack(); | |
| } else if( forward ) { | |
| opts.isForward(); | |
| } | |
| }, | |
| //disable hashchange event listener internally to ignore one change | |
| //toggled internally when location.hash is updated to match the url of a successful page load | |
| ignoreNextHashChange: false | |
| }, | |
| //define first selector to receive focus when a page is shown | |
| focusable = "[tabindex],a,button:visible,select:visible,input", | |
| //queue to hold simultanious page transitions | |
| pageTransitionQueue = [], | |
| //indicates whether or not page is in process of transitioning | |
| isPageTransitioning = false, | |
| //nonsense hash change key for dialogs, so they create a history entry | |
| dialogHashKey = "&ui-state=dialog", | |
| //existing base tag? | |
| $base = $head.children( "base" ), | |
| //tuck away the original document URL minus any fragment. | |
| documentUrl = path.parseUrl( location.href ), | |
| //if the document has an embedded base tag, documentBase is set to its | |
| //initial value. If a base tag does not exist, then we default to the documentUrl. | |
| documentBase = $base.length ? path.parseUrl( path.makeUrlAbsolute( $base.attr( "href" ), documentUrl.href ) ) : documentUrl, | |
| //cache the comparison once. | |
| documentBaseDiffers = ( documentUrl.hrefNoHash !== documentBase.hrefNoHash ); | |
| //base element management, defined depending on dynamic base tag support | |
| var base = $.support.dynamicBaseTag ? { | |
| //define base element, for use in routing asset urls that are referenced in Ajax-requested markup | |
| element: ( $base.length ? $base : $( "<base>", { href: documentBase.hrefNoHash } ).prependTo( $head ) ), | |
| //set the generated BASE element's href attribute to a new page's base path | |
| set: function( href ) { | |
| base.element.attr( "href", path.makeUrlAbsolute( href, documentBase ) ); | |
| }, | |
| //set the generated BASE element's href attribute to a new page's base path | |
| reset: function() { | |
| base.element.attr( "href", documentBase.hrefNoHash ); | |
| } | |
| } : undefined; | |
| /* | |
| internal utility functions | |
| --------------------------------------*/ | |
| //direct focus to the page title, or otherwise first focusable element | |
| function reFocus( page ) { | |
| var lastClicked = page.jqmData( "lastClicked" ); | |
| if( lastClicked && lastClicked.length ) { | |
| lastClicked.focus(); | |
| } | |
| else { | |
| var pageTitle = page.find( ".ui-title:eq(0)" ); | |
| if( pageTitle.length ) { | |
| pageTitle.focus(); | |
| } | |
| else{ | |
| page.find( focusable ).eq( 0 ).focus(); | |
| } | |
| } | |
| } | |
| //remove active classes after page transition or error | |
| function removeActiveLinkClass( forceRemoval ) { | |
| if( !!$activeClickedLink && ( !$activeClickedLink.closest( '.ui-page-active' ).length || forceRemoval ) ) { | |
| $activeClickedLink.removeClass( $.mobile.activeBtnClass ); | |
| } | |
| $activeClickedLink = null; | |
| } | |
| function releasePageTransitionLock() { | |
| isPageTransitioning = false; | |
| if( pageTransitionQueue.length > 0 ) { | |
| $.mobile.changePage.apply( null, pageTransitionQueue.pop() ); | |
| } | |
| } | |
| //function for transitioning between two existing pages | |
| function transitionPages( toPage, fromPage, transition, reverse ) { | |
| //get current scroll distance | |
| var currScroll = $.support.scrollTop ? $window.scrollTop() : true, | |
| toScroll = toPage.data( "lastScroll" ) || $.mobile.defaultHomeScroll, | |
| screenHeight = getScreenHeight(); | |
| //if scrolled down, scroll to top | |
| if( currScroll ){ | |
| window.scrollTo( 0, $.mobile.defaultHomeScroll ); | |
| } | |
| //if the Y location we're scrolling to is less than 10px, let it go for sake of smoothness | |
| if( toScroll < $.mobile.minScrollBack ){ | |
| toScroll = 0; | |
| } | |
| if( fromPage ) { | |
| //set as data for returning to that spot | |
| fromPage | |
| .height( screenHeight + currScroll ) | |
| .jqmData( "lastScroll", currScroll ) | |
| .jqmData( "lastClicked", $activeClickedLink ); | |
| //trigger before show/hide events | |
| fromPage.data( "page" )._trigger( "beforehide", null, { nextPage: toPage } ); | |
| } | |
| toPage | |
| .height( screenHeight + toScroll ) | |
| .data( "page" )._trigger( "beforeshow", null, { prevPage: fromPage || $( "" ) } ); | |
| //clear page loader | |
| $.mobile.hidePageLoadingMsg(); | |
| //find the transition handler for the specified transition. If there | |
| //isn't one in our transitionHandlers dictionary, use the default one. | |
| //call the handler immediately to kick-off the transition. | |
| var th = $.mobile.transitionHandlers[transition || "none"] || $.mobile.defaultTransitionHandler, | |
| promise = th( transition, reverse, toPage, fromPage ); | |
| promise.done(function() { | |
| //reset toPage height bac | |
| toPage.height( "" ); | |
| //jump to top or prev scroll, sometimes on iOS the page has not rendered yet. | |
| if( toScroll ){ | |
| $.mobile.silentScroll( toScroll ); | |
| $( document ).one( "silentscroll", function() { reFocus( toPage ); } ); | |
| } | |
| else{ | |
| reFocus( toPage ); | |
| } | |
| //trigger show/hide events | |
| if( fromPage ) { | |
| fromPage.height("").data( "page" )._trigger( "hide", null, { nextPage: toPage } ); | |
| } | |
| //trigger pageshow, define prevPage as either fromPage or empty jQuery obj | |
| toPage.data( "page" )._trigger( "show", null, { prevPage: fromPage || $( "" ) } ); | |
| }); | |
| return promise; | |
| } | |
| //simply set the active page's minimum height to screen height, depending on orientation | |
| function getScreenHeight(){ | |
| var orientation = jQuery.event.special.orientationchange.orientation(), | |
| port = orientation === "portrait", | |
| winMin = port ? 480 : 320, | |
| screenHeight = port ? screen.availHeight : screen.availWidth, | |
| winHeight = Math.max( winMin, $( window ).height() ), | |
| pageMin = Math.min( screenHeight, winHeight ); | |
| return pageMin; | |
| } | |
| //simply set the active page's minimum height to screen height, depending on orientation | |
| function resetActivePageHeight(){ | |
| $( "." + $.mobile.activePageClass ).css( "min-height", getScreenHeight() ); | |
| } | |
| //shared page enhancements | |
| function enhancePage( $page, role ) { | |
| // If a role was specified, make sure the data-role attribute | |
| // on the page element is in sync. | |
| if( role ) { | |
| $page.attr( "data-" + $.mobile.ns + "role", role ); | |
| } | |
| //run page plugin | |
| $page.page(); | |
| } | |
| /* exposed $.mobile methods */ | |
| //animation complete callback | |
| $.fn.animationComplete = function( callback ) { | |
| if( $.support.cssTransitions ) { | |
| return $( this ).one( 'webkitAnimationEnd', callback ); | |
| } | |
| else{ | |
| // defer execution for consistency between webkit/non webkit | |
| setTimeout( callback, 0 ); | |
| return $( this ); | |
| } | |
| }; | |
| //update location.hash, with or without triggering hashchange event | |
| //TODO - deprecate this one at 1.0 | |
| $.mobile.updateHash = path.set; | |
| //expose path object on $.mobile | |
| $.mobile.path = path; | |
| //expose base object on $.mobile | |
| $.mobile.base = base; | |
| //url stack, useful when plugins need to be aware of previous pages viewed | |
| //TODO: deprecate this one at 1.0 | |
| $.mobile.urlstack = urlHistory.stack; | |
| //history stack | |
| $.mobile.urlHistory = urlHistory; | |
| //default non-animation transition handler | |
| $.mobile.noneTransitionHandler = function( name, reverse, $toPage, $fromPage ) { | |
| if ( $fromPage ) { | |
| $fromPage.removeClass( $.mobile.activePageClass ); | |
| } | |
| $toPage.addClass( $.mobile.activePageClass ); | |
| return $.Deferred().resolve( name, reverse, $toPage, $fromPage ).promise(); | |
| }; | |
| //default handler for unknown transitions | |
| $.mobile.defaultTransitionHandler = $.mobile.noneTransitionHandler; | |
| //transition handler dictionary for 3rd party transitions | |
| $.mobile.transitionHandlers = { | |
| none: $.mobile.defaultTransitionHandler | |
| }; | |
| //enable cross-domain page support | |
| $.mobile.allowCrossDomainPages = false; | |
| //return the original document url | |
| $.mobile.getDocumentUrl = function(asParsedObject) { | |
| return asParsedObject ? $.extend( {}, documentUrl ) : documentUrl.href; | |
| }; | |
| //return the original document base url | |
| $.mobile.getDocumentBase = function(asParsedObject) { | |
| return asParsedObject ? $.extend( {}, documentBase ) : documentBase.href; | |
| }; | |
| // Load a page into the DOM. | |
| $.mobile.loadPage = function( url, options ) { | |
| // This function uses deferred notifications to let callers | |
| // know when the page is done loading, or if an error has occurred. | |
| var deferred = $.Deferred(), | |
| // The default loadPage options with overrides specified by | |
| // the caller. | |
| settings = $.extend( {}, $.mobile.loadPage.defaults, options ), | |
| // The DOM element for the page after it has been loaded. | |
| page = null, | |
| // If the reloadPage option is true, and the page is already | |
| // in the DOM, dupCachedPage will be set to the page element | |
| // so that it can be removed after the new version of the | |
| // page is loaded off the network. | |
| dupCachedPage = null, | |
| // determine the current base url | |
| findBaseWithDefault = function(){ | |
| var closestBase = ( $.mobile.activePage && getClosestBaseUrl( $.mobile.activePage ) ); | |
| return closestBase || documentBase.hrefNoHash; | |
| }, | |
| // The absolute version of the URL passed into the function. This | |
| // version of the URL may contain dialog/subpage params in it. | |
| absUrl = path.makeUrlAbsolute( url, findBaseWithDefault() ); | |
| // If the caller provided data, and we're using "get" request, | |
| // append the data to the URL. | |
| if ( settings.data && settings.type === "get" ) { | |
| absUrl = path.addSearchParams( absUrl, settings.data ); | |
| settings.data = undefined; | |
| } | |
| // The absolute version of the URL minus any dialog/subpage params. | |
| // In otherwords the real URL of the page to be loaded. | |
| var fileUrl = path.getFilePath( absUrl ), | |
| // The version of the Url actually stored in the data-url attribute of | |
| // the page. For embedded pages, it is just the id of the page. For pages | |
| // within the same domain as the document base, it is the site relative | |
| // path. For cross-domain pages (Phone Gap only) the entire absolute Url | |
| // used to load the page. | |
| dataUrl = path.convertUrlToDataUrl( absUrl ); | |
| // Make sure we have a pageContainer to work with. | |
| settings.pageContainer = settings.pageContainer || $.mobile.pageContainer; | |
| // Check to see if the page already exists in the DOM. | |
| page = settings.pageContainer.children( ":jqmData(url='" + dataUrl + "')" ); | |
| // Reset base to the default document base. | |
| if ( base ) { | |
| base.reset(); | |
| } | |
| // If the page we are interested in is already in the DOM, | |
| // and the caller did not indicate that we should force a | |
| // reload of the file, we are done. Otherwise, track the | |
| // existing page as a duplicated. | |
| if ( page.length ) { | |
| if ( !settings.reloadPage ) { | |
| enhancePage( page, settings.role ); | |
| deferred.resolve( absUrl, options, page ); | |
| return deferred.promise(); | |
| } | |
| dupCachedPage = page; | |
| } | |
| if ( settings.showLoadMsg ) { | |
| // This configurable timeout allows cached pages a brief delay to load without showing a message | |
| var loadMsgDelay = setTimeout(function(){ | |
| $.mobile.showPageLoadingMsg(); | |
| }, settings.loadMsgDelay ), | |
| // Shared logic for clearing timeout and removing message. | |
| hideMsg = function(){ | |
| // Stop message show timer | |
| clearTimeout( loadMsgDelay ); | |
| // Hide loading message | |
| $.mobile.hidePageLoadingMsg(); | |
| }; | |
| } | |
| if ( !( $.mobile.allowCrossDomainPages || path.isSameDomain( documentUrl, absUrl ) ) ) { | |
| deferred.reject( absUrl, options ); | |
| } else { | |
| // Load the new page. | |
| $.ajax({ | |
| url: fileUrl, | |
| type: settings.type, | |
| data: settings.data, | |
| dataType: "html", | |
| success: function( html ) { | |
| //pre-parse html to check for a data-url, | |
| //use it as the new fileUrl, base path, etc | |
| var all = $( "<div></div>" ), | |
| //page title regexp | |
| newPageTitle = html.match( /<title[^>]*>([^<]*)/ ) && RegExp.$1, | |
| // TODO handle dialogs again | |
| pageElemRegex = new RegExp( ".*(<[^>]+\\bdata-" + $.mobile.ns + "role=[\"']?page[\"']?[^>]*>).*" ), | |
| dataUrlRegex = new RegExp( "\\bdata-" + $.mobile.ns + "url=[\"']?([^\"'>]*)[\"']?" ); | |
| // data-url must be provided for the base tag so resource requests can be directed to the | |
| // correct url. loading into a temprorary element makes these requests immediately | |
| if( pageElemRegex.test( html ) | |
| && RegExp.$1 | |
| && dataUrlRegex.test( RegExp.$1 ) | |
| && RegExp.$1 ) { | |
| url = fileUrl = path.getFilePath( RegExp.$1 ); | |
| } | |
| else{ | |
| } | |
| if ( base ) { | |
| base.set( fileUrl ); | |
| } | |
| //workaround to allow scripts to execute when included in page divs | |
| all.get( 0 ).innerHTML = html; | |
| page = all.find( ":jqmData(role='page'), :jqmData(role='dialog')" ).first(); | |
| //if page elem couldn't be found, create one and insert the body element's contents | |
| if( !page.length ){ | |
| page = $( "<div data-" + $.mobile.ns + "role='page'>" + html.split( /<\/?body[^>]*>/gmi )[1] + "</div>" ); | |
| } | |
| if ( newPageTitle && !page.jqmData( "title" ) ) { | |
| page.jqmData( "title", newPageTitle ); | |
| } | |
| //rewrite src and href attrs to use a base url | |
| if( !$.support.dynamicBaseTag ) { | |
| var newPath = path.get( fileUrl ); | |
| page.find( "[src], link[href], a[rel='external'], :jqmData(ajax='false'), a[target]" ).each(function() { | |
| var thisAttr = $( this ).is( '[href]' ) ? 'href' : | |
| $(this).is('[src]') ? 'src' : 'action', | |
| thisUrl = $( this ).attr( thisAttr ); | |
| // XXX_jblas: We need to fix this so that it removes the document | |
| // base URL, and then prepends with the new page URL. | |
| //if full path exists and is same, chop it - helps IE out | |
| thisUrl = thisUrl.replace( location.protocol + '//' + location.host + location.pathname, '' ); | |
| if( !/^(\w+:|#|\/)/.test( thisUrl ) ) { | |
| $( this ).attr( thisAttr, newPath + thisUrl ); | |
| } | |
| }); | |
| } | |
| //append to page and enhance | |
| page | |
| .attr( "data-" + $.mobile.ns + "url", path.convertUrlToDataUrl( fileUrl ) ) | |
| .appendTo( settings.pageContainer ); | |
| // wait for page creation to leverage options defined on widget | |
| page.one('pagecreate', function(){ | |
| // when dom caching is not enabled bind to remove the page on hide | |
| if( !page.data("page").options.domCache ){ | |
| page.bind( "pagehide.remove", function(){ | |
| $(this).remove(); | |
| }); | |
| } | |
| }); | |
| enhancePage( page, settings.role ); | |
| // Enhancing the page may result in new dialogs/sub pages being inserted | |
| // into the DOM. If the original absUrl refers to a sub-page, that is the | |
| // real page we are interested in. | |
| if ( absUrl.indexOf( "&" + $.mobile.subPageUrlKey ) > -1 ) { | |
| page = settings.pageContainer.children( ":jqmData(url='" + dataUrl + "')" ); | |
| } | |
| //bind pageHide to removePage after it's hidden, if the page options specify to do so | |
| // Remove loading message. | |
| if ( settings.showLoadMsg ) { | |
| hideMsg(); | |
| } | |
| deferred.resolve( absUrl, options, page, dupCachedPage ); | |
| }, | |
| error: function() { | |
| //set base back to current path | |
| if( base ) { | |
| base.set( path.get() ); | |
| } | |
| // Remove loading message. | |
| if ( settings.showLoadMsg ) { | |
| // Remove loading message. | |
| hideMsg(); | |
| //show error message | |
| $( "<div class='ui-loader ui-overlay-shadow ui-body-e ui-corner-all'><h1>"+ $.mobile.pageLoadErrorMessage +"</h1></div>" ) | |
| .css({ "display": "block", "opacity": 0.96, "top": $window.scrollTop() + 100 }) | |
| .appendTo( settings.pageContainer ) | |
| .delay( 800 ) | |
| .fadeOut( 400, function() { | |
| $( this ).remove(); | |
| }); | |
| } | |
| deferred.reject( absUrl, options ); | |
| } | |
| }); | |
| } | |
| return deferred.promise(); | |
| }; | |
| $.mobile.loadPage.defaults = { | |
| type: "get", | |
| data: undefined, | |
| reloadPage: false, | |
| role: undefined, // By default we rely on the role defined by the @data-role attribute. | |
| showLoadMsg: false, | |
| pageContainer: undefined, | |
| loadMsgDelay: 50 // This delay allows loads that pull from browser cache to occur without showing the loading message. | |
| }; | |
| // Show a specific page in the page container. | |
| $.mobile.changePage = function( toPage, options ) { | |
| // XXX: REMOVE_BEFORE_SHIPPING_1.0 | |
| // This is temporary code that makes changePage() compatible with previous alpha versions. | |
| if ( typeof options !== "object" ) { | |
| var opts = null; | |
| // Map old-style call signature for form submit to the new options object format. | |
| if ( typeof toPage === "object" && toPage.url && toPage.type ) { | |
| opts = { | |
| type: toPage.type, | |
| data: toPage.data, | |
| forcePageLoad: true | |
| }; | |
| toPage = toPage.url; | |
| } | |
| // The arguments passed into the function need to be re-mapped | |
| // to the new options object format. | |
| var len = arguments.length; | |
| if ( len > 1 ) { | |
| var argNames = [ "transition", "reverse", "changeHash", "fromHashChange" ], i; | |
| for ( i = 1; i < len; i++ ) { | |
| var a = arguments[ i ]; | |
| if ( typeof a !== "undefined" ) { | |
| opts = opts || {}; | |
| opts[ argNames[ i - 1 ] ] = a; | |
| } | |
| } | |
| } | |
| // If an options object was created, then we know changePage() was called | |
| // with an old signature. | |
| if ( opts ) { | |
| return $.mobile.changePage( toPage, opts ); | |
| } | |
| } | |
| // XXX: REMOVE_BEFORE_SHIPPING_1.0 | |
| // If we are in the midst of a transition, queue the current request. | |
| // We'll call changePage() once we're done with the current transition to | |
| // service the request. | |
| if( isPageTransitioning ) { | |
| pageTransitionQueue.unshift( arguments ); | |
| return; | |
| } | |
| // Set the isPageTransitioning flag to prevent any requests from | |
| // entering this method while we are in the midst of loading a page | |
| // or transitioning. | |
| isPageTransitioning = true; | |
| var settings = $.extend( {}, $.mobile.changePage.defaults, options ); | |
| // Make sure we have a pageContainer to work with. | |
| settings.pageContainer = settings.pageContainer || $.mobile.pageContainer; | |
| // If the caller passed us a url, call loadPage() | |
| // to make sure it is loaded into the DOM. We'll listen | |
| // to the promise object it returns so we know when | |
| // it is done loading or if an error ocurred. | |
| if ( typeof toPage == "string" ) { | |
| $.mobile.loadPage( toPage, settings ) | |
| .done(function( url, options, newPage, dupCachedPage ) { | |
| isPageTransitioning = false; | |
| options.duplicateCachedPage = dupCachedPage; | |
| $.mobile.changePage( newPage, options ); | |
| }) | |
| .fail(function( url, options ) { | |
| // XXX_jblas: Fire off changepagefailed notificaiton. | |
| isPageTransitioning = false; | |
| //clear out the active button state | |
| removeActiveLinkClass( true ); | |
| //release transition lock so navigation is free again | |
| releasePageTransitionLock(); | |
| settings.pageContainer.trigger("changepagefailed"); | |
| }); | |
| return; | |
| } | |
| // The caller passed us a real page DOM element. Update our | |
| // internal state and then trigger a transition to the page. | |
| var mpc = settings.pageContainer, | |
| fromPage = $.mobile.activePage, | |
| url = toPage.jqmData( "url" ), | |
| // The pageUrl var is usually the same as url, except when url is obscured as a dialog url. pageUrl always contains the file path | |
| pageUrl = url, | |
| fileUrl = path.getFilePath( url ), | |
| active = urlHistory.getActive(), | |
| activeIsInitialPage = urlHistory.activeIndex === 0, | |
| historyDir = 0, | |
| pageTitle = document.title, | |
| isDialog = settings.role === "dialog" || toPage.jqmData( "role" ) === "dialog"; | |
| // Let listeners know we're about to change the current page. | |
| mpc.trigger( "beforechangepage" ); | |
| // If we are trying to transition to the same page that we are currently on ignore the request. | |
| // an illegal same page request is defined by the current page being the same as the url, as long as there's history | |
| // and toPage is not an array or object (those are allowed to be "same") | |
| // | |
| // XXX_jblas: We need to remove this at some point when we allow for transitions | |
| // to the same page. | |
| if( fromPage && fromPage[0] === toPage[0] ) { | |
| isPageTransitioning = false; | |
| mpc.trigger( "changepage" ); | |
| return; | |
| } | |
| // We need to make sure the page we are given has already been enhanced. | |
| enhancePage( toPage, settings.role ); | |
| // If the changePage request was sent from a hashChange event, check to see if the | |
| // page is already within the urlHistory stack. If so, we'll assume the user hit | |
| // the forward/back button and will try to match the transition accordingly. | |
| if( settings.fromHashChange ) { | |
| urlHistory.directHashChange({ | |
| currentUrl: url, | |
| isBack: function() { historyDir = -1; }, | |
| isForward: function() { historyDir = 1; } | |
| }); | |
| } | |
| // Kill the keyboard. | |
| // XXX_jblas: We need to stop crawling the entire document to kill focus. Instead, | |
| // we should be tracking focus with a live() handler so we already have | |
| // the element in hand at this point. | |
| // Wrap this in a try/catch block since IE9 throw "Unspecified error" if document.activeElement | |
| // is undefined when we are in an IFrame. | |
| try { | |
| $( document.activeElement || "" ).add( "input:focus, textarea:focus, select:focus" ).blur(); | |
| } catch(e) {} | |
| // If we're displaying the page as a dialog, we don't want the url | |
| // for the dialog content to be used in the hash. Instead, we want | |
| // to append the dialogHashKey to the url of the current page. | |
| if ( isDialog && active ) { | |
| url = active.url + dialogHashKey; | |
| } | |
| // Set the location hash. | |
| if( settings.changeHash !== false && url ) { | |
| //disable hash listening temporarily | |
| urlHistory.ignoreNextHashChange = true; | |
| //update hash and history | |
| path.set( url ); | |
| } | |
| //if title element wasn't found, try the page div data attr too | |
| var newPageTitle = toPage.jqmData( "title" ) || toPage.children(":jqmData(role='header')").find(".ui-title" ).text(); | |
| if( !!newPageTitle && pageTitle == document.title ) { | |
| pageTitle = newPageTitle; | |
| } | |
| //add page to history stack if it's not back or forward | |
| if( !historyDir ) { | |
| urlHistory.addNew( url, settings.transition, pageTitle, pageUrl ); | |
| } | |
| //set page title | |
| document.title = urlHistory.getActive().title; | |
| //set "toPage" as activePage | |
| $.mobile.activePage = toPage; | |
| // Make sure we have a transition defined. | |
| settings.transition = settings.transition | |
| || ( ( historyDir && !activeIsInitialPage ) ? active.transition : undefined ) | |
| || ( isDialog ? $.mobile.defaultDialogTransition : $.mobile.defaultPageTransition ); | |
| // If we're navigating back in the URL history, set reverse accordingly. | |
| settings.reverse = settings.reverse || historyDir < 0; | |
| transitionPages( toPage, fromPage, settings.transition, settings.reverse ) | |
| .done(function() { | |
| removeActiveLinkClass(); | |
| //if there's a duplicateCachedPage, remove it from the DOM now that it's hidden | |
| if ( settings.duplicateCachedPage ) { | |
| settings.duplicateCachedPage.remove(); | |
| } | |
| //remove initial build class (only present on first pageshow) | |
| $html.removeClass( "ui-mobile-rendering" ); | |
| releasePageTransitionLock(); | |
| // Let listeners know we're all done changing the current page. | |
| mpc.trigger( "changepage" ); | |
| }); | |
| }; | |
| $.mobile.changePage.defaults = { | |
| transition: undefined, | |
| reverse: false, | |
| changeHash: true, | |
| fromHashChange: false, | |
| role: undefined, // By default we rely on the role defined by the @data-role attribute. | |
| duplicateCachedPage: undefined, | |
| pageContainer: undefined, | |
| showLoadMsg: true //loading message shows by default when pages are being fetched during changePage | |
| }; | |
| /* Event Bindings - hashchange, submit, and click */ | |
| function findClosestLink( ele ) | |
| { | |
| while ( ele ) { | |
| if ( ele.nodeName.toLowerCase() == "a" ) { | |
| break; | |
| } | |
| ele = ele.parentNode; | |
| } | |
| return ele; | |
| } | |
| // The base URL for any given element depends on the page it resides in. | |
| function getClosestBaseUrl( ele ) | |
| { | |
| // Find the closest page and extract out its url. | |
| var url = $( ele ).closest( ".ui-page" ).jqmData( "url" ), | |
| base = documentBase.hrefNoHash; | |
| if ( !url || !path.isPath( url ) ) { | |
| url = base; | |
| } | |
| return path.makeUrlAbsolute( url, base); | |
| } | |
| //The following event bindings should be bound after mobileinit has been triggered | |
| //the following function is called in the init file | |
| $.mobile._registerInternalEvents = function(){ | |
| //bind to form submit events, handle with Ajax | |
| $( "form" ).live('submit', function( event ) { | |
| var $this = $( this ); | |
| if( !$.mobile.ajaxEnabled || | |
| $this.is( ":jqmData(ajax='false')" ) ) { | |
| return; | |
| } | |
| var type = $this.attr( "method" ), | |
| target = $this.attr( "target" ), | |
| url = $this.attr( "action" ); | |
| // If no action is specified, browsers default to using the | |
| // URL of the document containing the form. Since we dynamically | |
| // pull in pages from external documents, the form should submit | |
| // to the URL for the source document of the page containing | |
| // the form. | |
| if ( !url ) { | |
| // Get the @data-url for the page containing the form. | |
| url = getClosestBaseUrl( $this ); | |
| if ( url === documentBase.hrefNoHash ) { | |
| // The url we got back matches the document base, | |
| // which means the page must be an internal/embedded page, | |
| // so default to using the actual document url as a browser | |
| // would. | |
| url = documentUrl.hrefNoSearch; | |
| } | |
| } | |
| url = path.makeUrlAbsolute( url, getClosestBaseUrl($this) ); | |
| //external submits use regular HTTP | |
| if( path.isExternal( url ) || target ) { | |
| return; | |
| } | |
| $.mobile.changePage( | |
| url, | |
| { | |
| type: type && type.length && type.toLowerCase() || "get", | |
| data: $this.serialize(), | |
| transition: $this.jqmData( "transition" ), | |
| direction: $this.jqmData( "direction" ), | |
| reloadPage: true | |
| } | |
| ); | |
| event.preventDefault(); | |
| }); | |
| //add active state on vclick | |
| $( document ).bind( "vclick", function( event ) { | |
| var link = findClosestLink( event.target ); | |
| if ( link ) { | |
| if ( path.parseUrl( link.getAttribute( "href" ) || "#" ).hash !== "#" ) { | |
| $( link ).closest( ".ui-btn" ).not( ".ui-disabled" ).addClass( $.mobile.activeBtnClass ); | |
| $( "." + $.mobile.activePageClass + " .ui-btn" ).not( link ).blur(); | |
| } | |
| } | |
| }); | |
| // click routing - direct to HTTP or Ajax, accordingly | |
| $( document ).bind( "click", function( event ) { | |
| var link = findClosestLink( event.target ); | |
| if ( !link ) { | |
| return; | |
| } | |
| var $link = $( link ), | |
| //remove active link class if external (then it won't be there if you come back) | |
| httpCleanup = function(){ | |
| window.setTimeout( function() { removeActiveLinkClass( true ); }, 200 ); | |
| }; | |
| //if there's a data-rel=back attr, go back in history | |
| if( $link.is( ":jqmData(rel='back')" ) ) { | |
| window.history.back(); | |
| return false; | |
| } | |
| //if ajax is disabled, exit early | |
| if( !$.mobile.ajaxEnabled ){ | |
| httpCleanup(); | |
| //use default click handling | |
| return; | |
| } | |
| var baseUrl = getClosestBaseUrl( $link ), | |
| //get href, if defined, otherwise default to empty hash | |
| href = path.makeUrlAbsolute( $link.attr( "href" ) || "#", baseUrl ); | |
| // XXX_jblas: Ideally links to application pages should be specified as | |
| // an url to the application document with a hash that is either | |
| // the site relative path or id to the page. But some of the | |
| // internal code that dynamically generates sub-pages for nested | |
| // lists and select dialogs, just write a hash in the link they | |
| // create. This means the actual URL path is based on whatever | |
| // the current value of the base tag is at the time this code | |
| // is called. For now we are just assuming that any url with a | |
| // hash in it is an application page reference. | |
| if ( href.search( "#" ) != -1 ) { | |
| href = href.replace( /[^#]*#/, "" ); | |
| if ( !href ) { | |
| //link was an empty hash meant purely | |
| //for interaction, so we ignore it. | |
| event.preventDefault(); | |
| return; | |
| } else if ( path.isPath( href ) ) { | |
| //we have apath so make it the href we want to load. | |
| href = path.makeUrlAbsolute( href, baseUrl ); | |
| } else { | |
| //we have a simple id so use the documentUrl as its base. | |
| href = path.makeUrlAbsolute( "#" + href, documentUrl.hrefNoHash ); | |
| } | |
| } | |
| // Should we handle this link, or let the browser deal with it? | |
| var useDefaultUrlHandling = $link.is( "[rel='external']" ) || $link.is( ":jqmData(ajax='false')" ) || $link.is( "[target]" ), | |
| // Some embedded browsers, like the web view in Phone Gap, allow cross-domain XHR | |
| // requests if the document doing the request was loaded via the file:// protocol. | |
| // This is usually to allow the application to "phone home" and fetch app specific | |
| // data. We normally let the browser handle external/cross-domain urls, but if the | |
| // allowCrossDomainPages option is true, we will allow cross-domain http/https | |
| // requests to go through our page loading logic. | |
| isCrossDomainPageLoad = ( $.mobile.allowCrossDomainPages && documentUrl.protocol === "file:" && href.search( /^https?:/ ) != -1 ), | |
| //check for protocol or rel and its not an embedded page | |
| //TODO overlap in logic from isExternal, rel=external check should be | |
| // moved into more comprehensive isExternalLink | |
| isExternal = useDefaultUrlHandling || ( path.isExternal( href ) && !isCrossDomainPageLoad ); | |
| $activeClickedLink = $link.closest( ".ui-btn" ); | |
| if( isExternal ) { | |
| httpCleanup(); | |
| //use default click handling | |
| return; | |
| } | |
| //use ajax | |
| var transition = $link.jqmData( "transition" ), | |
| direction = $link.jqmData( "direction" ), | |
| reverse = ( direction && direction === "reverse" ) || | |
| // deprecated - remove by 1.0 | |
| $link.jqmData( "back" ), | |
| //this may need to be more specific as we use data-rel more | |
| role = $link.attr( "data-" + $.mobile.ns + "rel" ) || undefined; | |
| $.mobile.changePage( href, { transition: transition, reverse: reverse, role: role } ); | |
| event.preventDefault(); | |
| }); | |
| //prefetch pages when anchors with data-prefetch are encountered | |
| $( ".ui-page" ).live( "pageshow.prefetch", function(){ | |
| var urls = []; | |
| $( this ).find( "a:jqmData(prefetch)" ).each(function(){ | |
| var url = $( this ).attr( "href" ); | |
| if ( url && $.inArray( url, urls ) === -1 ) { | |
| urls.push( url ); | |
| $.mobile.loadPage( url ); | |
| } | |
| }); | |
| } ); | |
| //hashchange event handler | |
| $window.bind( "hashchange", function( e, triggered ) { | |
| //find first page via hash | |
| var to = path.stripHash( location.hash ), | |
| //transition is false if it's the first page, undefined otherwise (and may be overridden by default) | |
| transition = $.mobile.urlHistory.stack.length === 0 ? "none" : undefined; | |
| //if listening is disabled (either globally or temporarily), or it's a dialog hash | |
| if( !$.mobile.hashListeningEnabled || urlHistory.ignoreNextHashChange ) { | |
| urlHistory.ignoreNextHashChange = false; | |
| return; | |
| } | |
| // special case for dialogs | |
| if( urlHistory.stack.length > 1 && | |
| to.indexOf( dialogHashKey ) > -1 ) { | |
| // If current active page is not a dialog skip the dialog and continue | |
| // in the same direction | |
| if(!$.mobile.activePage.is( ".ui-dialog" )) { | |
| //determine if we're heading forward or backward and continue accordingly past | |
| //the current dialog | |
| urlHistory.directHashChange({ | |
| currentUrl: to, | |
| isBack: function() { window.history.back(); }, | |
| isForward: function() { window.history.forward(); } | |
| }); | |
| // prevent changepage | |
| return; | |
| } else { | |
| var setTo = function() { to = $.mobile.urlHistory.getActive().pageUrl; }; | |
| // if the current active page is a dialog and we're navigating | |
| // to a dialog use the dialog objected saved in the stack | |
| urlHistory.directHashChange({ currentUrl: to, isBack: setTo, isForward: setTo }); | |
| } | |
| } | |
| //if to is defined, load it | |
| if ( to ) { | |
| to = ( typeof to === "string" && !path.isPath( to ) ) ? ( '#' + to ) : to; | |
| $.mobile.changePage( to, { transition: transition, changeHash: false, fromHashChange: true } ); | |
| } | |
| //there's no hash, go to the first page in the dom | |
| else { | |
| $.mobile.changePage( $.mobile.firstPage, { transition: transition, changeHash: false, fromHashChange: true } ); | |
| } | |
| }); | |
| //set page min-heights to be device specific | |
| $( document ).bind( "pageshow", resetActivePageHeight ); | |
| $( window ).bind( "throttledresize", resetActivePageHeight ); | |
| };//_registerInternalEvents callback | |
| })( jQuery ); | |
| /*! | |
| * jQuery Mobile v@VERSION | |
| * http://jquerymobile.com/ | |
| * | |
| * Copyright 2010, jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| (function( $, window, undefined ) { | |
| function css3TransitionHandler( name, reverse, $to, $from ) { | |
| var deferred = new $.Deferred(), | |
| reverseClass = reverse ? " reverse" : "", | |
| viewportClass = "ui-mobile-viewport-transitioning viewport-" + name, | |
| doneFunc = function() { | |
| $to.add( $from ).removeClass( "out in reverse " + name ); | |
| if ( $from ) { | |
| $from.removeClass( $.mobile.activePageClass ); | |
| } | |
| $to.parent().removeClass( viewportClass ); | |
| deferred.resolve( name, reverse, $to, $from ); | |
| }; | |
| $to.animationComplete( doneFunc ); | |
| $to.parent().addClass( viewportClass ); | |
| if ( $from ) { | |
| $from.addClass( name + " out" + reverseClass ); | |
| } | |
| $to.addClass( $.mobile.activePageClass + " " + name + " in" + reverseClass ); | |
| return deferred.promise(); | |
| } | |
| // Make our transition handler public. | |
| $.mobile.css3TransitionHandler = css3TransitionHandler; | |
| // If the default transition handler is the 'none' handler, replace it with our handler. | |
| if ( $.mobile.defaultTransitionHandler === $.mobile.noneTransitionHandler ) { | |
| $.mobile.defaultTransitionHandler = css3TransitionHandler; | |
| } | |
| })( jQuery, this ); | |
| /* | |
| * jQuery Mobile Framework : "degradeInputs" plugin - degrades inputs to another type after custom enhancements are made. | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| (function( $, undefined ) { | |
| $.mobile.page.prototype.options.degradeInputs = { | |
| color: false, | |
| date: false, | |
| datetime: false, | |
| "datetime-local": false, | |
| email: false, | |
| month: false, | |
| number: false, | |
| range: "number", | |
| search: true, | |
| tel: false, | |
| time: false, | |
| url: false, | |
| week: false | |
| }; | |
| $.mobile.page.prototype.options.keepNative = ":jqmData(role='none'), :jqmData(role='nojs')"; | |
| //auto self-init widgets | |
| $( document ).bind( "pagecreate enhance", function( e ){ | |
| var page = $( e.target ).data( "page" ), | |
| o = page.options; | |
| // degrade inputs to avoid poorly implemented native functionality | |
| $( e.target ).find( "input" ).not( o.keepNative ).each(function() { | |
| var $this = $( this ), | |
| type = this.getAttribute( "type" ), | |
| optType = o.degradeInputs[ type ] || "text"; | |
| if ( o.degradeInputs[ type ] ) { | |
| $this.replaceWith( | |
| $( "<div>" ).html( $this.clone() ).html() | |
| .replace( /\s+type=["']?\w+['"]?/, " type=\"" + optType + "\" data-" + $.mobile.ns + "type=\"" + type + "\" " ) | |
| ); | |
| } | |
| }); | |
| }); | |
| })( jQuery );/* | |
| * jQuery Mobile Framework : "dialog" plugin. | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses. | |
| */ | |
| (function( $, window, undefined ) { | |
| $.widget( "mobile.dialog", $.mobile.widget, { | |
| options: { | |
| closeBtnText : "Close", | |
| theme : "a", | |
| initSelector : ":jqmData(role='dialog')" | |
| }, | |
| _create: function() { | |
| var $el = this.element, | |
| pageTheme = $el.attr( "class" ).match( /ui-body-[a-z]/ ); | |
| if( pageTheme.length ){ | |
| $el.removeClass( pageTheme[ 0 ] ); | |
| } | |
| $el.addClass( "ui-body-" + this.options.theme ); | |
| // Class the markup for dialog styling | |
| // Set aria role | |
| $el.attr( "role", "dialog" ) | |
| .addClass( "ui-dialog" ) | |
| .find( ":jqmData(role='header')" ) | |
| .addClass( "ui-corner-top ui-overlay-shadow" ) | |
| .prepend( "<a href='#' data-" + $.mobile.ns + "icon='delete' data-" + $.mobile.ns + "rel='back' data-" + $.mobile.ns + "iconpos='notext'>"+ this.options.closeBtnText + "</a>" ) | |
| .end() | |
| .find( ":jqmData(role='content'),:jqmData(role='footer')" ) | |
| .last() | |
| .addClass( "ui-corner-bottom ui-overlay-shadow" ); | |
| /* bind events | |
| - clicks and submits should use the closing transition that the dialog opened with | |
| unless a data-transition is specified on the link/form | |
| - if the click was on the close button, or the link has a data-rel="back" it'll go back in history naturally | |
| */ | |
| $el.bind( "vclick submit", function( event ) { | |
| var $target = $( event.target ).closest( event.type === "vclick" ? "a" : "form" ), | |
| active; | |
| if ( $target.length && !$target.jqmData( "transition" ) ) { | |
| active = $.mobile.urlHistory.getActive() || {}; | |
| $target.attr( "data-" + $.mobile.ns + "transition", ( active.transition || $.mobile.defaultDialogTransition ) ) | |
| .attr( "data-" + $.mobile.ns + "direction", "reverse" ); | |
| } | |
| }) | |
| .bind( "pagehide", function() { | |
| $( this ).find( "." + $.mobile.activeBtnClass ).removeClass( $.mobile.activeBtnClass ); | |
| }); | |
| }, | |
| // Close method goes back in history | |
| close: function() { | |
| window.history.back(); | |
| } | |
| }); | |
| //auto self-init widgets | |
| $( $.mobile.dialog.prototype.options.initSelector ).live( "pagecreate", function(){ | |
| $( this ).dialog(); | |
| }); | |
| })( jQuery, this ); | |
| /* | |
| * jQuery Mobile Framework : This plugin handles theming and layout of headers, footers, and content areas | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| (function( $, undefined ) { | |
| $.mobile.page.prototype.options.backBtnText = "Back"; | |
| $.mobile.page.prototype.options.addBackBtn = false; | |
| $.mobile.page.prototype.options.backBtnTheme = null; | |
| $.mobile.page.prototype.options.headerTheme = "a"; | |
| $.mobile.page.prototype.options.footerTheme = "a"; | |
| $.mobile.page.prototype.options.contentTheme = null; | |
| $( ":jqmData(role='page'), :jqmData(role='dialog')" ).live( "pagecreate", function( e ) { | |
| var $page = $( this ), | |
| o = $page.data( "page" ).options, | |
| pageTheme = o.theme; | |
| $( ":jqmData(role='header'), :jqmData(role='footer'), :jqmData(role='content')", this ).each(function() { | |
| var $this = $( this ), | |
| role = $this.jqmData( "role" ), | |
| theme = $this.jqmData( "theme" ), | |
| $headeranchors, | |
| leftbtn, | |
| rightbtn, | |
| backBtn; | |
| $this.addClass( "ui-" + role ); | |
| //apply theming and markup modifications to page,header,content,footer | |
| if ( role === "header" || role === "footer" ) { | |
| var thisTheme = theme || ( role === "header" ? o.headerTheme : o.footerTheme ) || pageTheme; | |
| //add theme class | |
| $this.addClass( "ui-bar-" + thisTheme ); | |
| // Add ARIA role | |
| $this.attr( "role", role === "header" ? "banner" : "contentinfo" ); | |
| // Right,left buttons | |
| $headeranchors = $this.children( "a" ); | |
| leftbtn = $headeranchors.hasClass( "ui-btn-left" ); | |
| rightbtn = $headeranchors.hasClass( "ui-btn-right" ); | |
| if ( !leftbtn ) { | |
| leftbtn = $headeranchors.eq( 0 ).not( ".ui-btn-right" ).addClass( "ui-btn-left" ).length; | |
| } | |
| if ( !rightbtn ) { | |
| rightbtn = $headeranchors.eq( 1 ).addClass( "ui-btn-right" ).length; | |
| } | |
| // Auto-add back btn on pages beyond first view | |
| if ( o.addBackBtn && role === "header" && | |
| $( ".ui-page" ).length > 1 && | |
| $this.jqmData( "url" ) !== $.mobile.path.stripHash( location.hash ) && | |
| !leftbtn ) { | |
| backBtn = $( "<a href='#' class='ui-btn-left' data-"+ $.mobile.ns +"rel='back' data-"+ $.mobile.ns +"icon='arrow-l'>"+ o.backBtnText +"</a>" ).prependTo( $this ); | |
| // If theme is provided, override default inheritance | |
| backBtn.attr( "data-"+ $.mobile.ns +"theme", o.backBtnTheme || thisTheme ); | |
| } | |
| // Page title | |
| $this.children( "h1, h2, h3, h4, h5, h6" ) | |
| .addClass( "ui-title" ) | |
| // Regardless of h element number in src, it becomes h1 for the enhanced page | |
| .attr({ | |
| "tabindex": "0", | |
| "role": "heading", | |
| "aria-level": "1" | |
| }); | |
| } else if ( role === "content" ) { | |
| $this.addClass( "ui-body-" + ( theme || pageTheme || o.contentTheme ) ); | |
| // Add ARIA role | |
| $this.attr( "role", "main" ); | |
| } | |
| }); | |
| }); | |
| })( jQuery );/* | |
| * jQuery Mobile Framework : "collapsible" plugin | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| (function( $, undefined ) { | |
| $.widget( "mobile.collapsible", $.mobile.widget, { | |
| options: { | |
| expandCueText: " click to expand contents", | |
| collapseCueText: " click to collapse contents", | |
| collapsed: false, | |
| heading: ">:header,>legend", | |
| theme: null, | |
| iconTheme: "d", | |
| initSelector: ":jqmData(role='collapsible')" | |
| }, | |
| _create: function() { | |
| var $el = this.element, | |
| o = this.options, | |
| collapsibleContain = $el.addClass( "ui-collapsible-contain" ), | |
| collapsibleHeading = $el.find( o.heading ).eq( 0 ), | |
| collapsibleContent = collapsibleContain.wrapInner( "<div class='ui-collapsible-content'></div>" ).find( ".ui-collapsible-content" ), | |
| collapsibleParent = $el.closest( ":jqmData(role='collapsible-set')" ).addClass( "ui-collapsible-set" ); | |
| // Replace collapsibleHeading if it's a legend | |
| if ( collapsibleHeading.is( "legend" ) ) { | |
| collapsibleHeading = $( "<div role='heading'>"+ collapsibleHeading.html() +"</div>" ).insertBefore( collapsibleHeading ); | |
| collapsibleHeading.next().remove(); | |
| } | |
| collapsibleHeading | |
| //drop heading in before content | |
| .insertBefore( collapsibleContent ) | |
| //modify markup & attributes | |
| .addClass( "ui-collapsible-heading" ) | |
| .append( "<span class='ui-collapsible-heading-status'></span>" ) | |
| .wrapInner( "<a href='#' class='ui-collapsible-heading-toggle'></a>" ) | |
| .find( "a:eq(0)" ) | |
| .buttonMarkup({ | |
| shadow: !collapsibleParent.length, | |
| corners: false, | |
| iconPos: "left", | |
| icon: "plus", | |
| theme: o.theme | |
| }) | |
| .find( ".ui-icon" ) | |
| .removeAttr( "class" ) | |
| .buttonMarkup({ | |
| shadow: true, | |
| corners: true, | |
| iconPos: "notext", | |
| icon: "plus", | |
| theme: o.iconTheme | |
| }); | |
| if ( !collapsibleParent.length ) { | |
| collapsibleHeading | |
| .find( "a:eq(0)" ) | |
| .addClass( "ui-corner-all" ) | |
| .find( ".ui-btn-inner" ) | |
| .addClass( "ui-corner-all" ); | |
| } else { | |
| if ( collapsibleContain.jqmData( "collapsible-last" ) ) { | |
| collapsibleHeading | |
| .find( "a:eq(0), .ui-btn-inner" ) | |
| .addClass( "ui-corner-bottom" ); | |
| } | |
| } | |
| //events | |
| collapsibleContain | |
| .bind( "collapse", function( event ) { | |
| if ( ! event.isDefaultPrevented() && | |
| $( event.target ).closest( ".ui-collapsible-contain" ).is( collapsibleContain ) ) { | |
| event.preventDefault(); | |
| collapsibleHeading | |
| .addClass( "ui-collapsible-heading-collapsed" ) | |
| .find( ".ui-collapsible-heading-status" ) | |
| .text( o.expandCueText ) | |
| .end() | |
| .find( ".ui-icon" ) | |
| .removeClass( "ui-icon-minus" ) | |
| .addClass( "ui-icon-plus" ); | |
| collapsibleContent.addClass( "ui-collapsible-content-collapsed" ).attr( "aria-hidden", true ); | |
| if ( collapsibleContain.jqmData( "collapsible-last" ) ) { | |
| collapsibleHeading | |
| .find( "a:eq(0), .ui-btn-inner" ) | |
| .addClass( "ui-corner-bottom" ); | |
| } | |
| } | |
| }) | |
| .bind( "expand", function( event ) { | |
| if ( !event.isDefaultPrevented() ) { | |
| event.preventDefault(); | |
| collapsibleHeading | |
| .removeClass( "ui-collapsible-heading-collapsed" ) | |
| .find( ".ui-collapsible-heading-status" ).text( o.collapseCueText ); | |
| collapsibleHeading.find( ".ui-icon" ).removeClass( "ui-icon-plus" ).addClass( "ui-icon-minus" ); | |
| collapsibleContent.removeClass( "ui-collapsible-content-collapsed" ).attr( "aria-hidden", false ); | |
| if ( collapsibleContain.jqmData( "collapsible-last" ) ) { | |
| collapsibleHeading | |
| .find( "a:eq(0), .ui-btn-inner" ) | |
| .removeClass( "ui-corner-bottom" ); | |
| } | |
| } | |
| }) | |
| .trigger( o.collapsed ? "collapse" : "expand" ); | |
| // Close others in a set | |
| if ( collapsibleParent.length && !collapsibleParent.jqmData( "collapsiblebound" ) ) { | |
| collapsibleParent | |
| .jqmData( "collapsiblebound", true ) | |
| .bind( "expand", function( event ) { | |
| $( event.target ) | |
| .closest( ".ui-collapsible-contain" ) | |
| .siblings( ".ui-collapsible-contain" ) | |
| .trigger( "collapse" ); | |
| }); | |
| var set = collapsibleParent.children( ":jqmData(role='collapsible')" ); | |
| set.first() | |
| .find( "a:eq(0)" ) | |
| .addClass( "ui-corner-top" ) | |
| .find( ".ui-btn-inner" ) | |
| .addClass( "ui-corner-top" ); | |
| set.last().jqmData( "collapsible-last", true ); | |
| } | |
| collapsibleHeading | |
| .bind( "vclick", function( event ) { | |
| var type = collapsibleHeading.is( ".ui-collapsible-heading-collapsed" ) ? | |
| "expand" : "collapse"; | |
| collapsibleContain.trigger( type ); | |
| event.preventDefault(); | |
| }); | |
| } | |
| }); | |
| //auto self-init widgets | |
| $( document ).bind( "pagecreate create", function( e ){ | |
| $( $.mobile.collapsible.prototype.options.initSelector, e.target ).collapsible(); | |
| }); | |
| })( jQuery ); | |
| /* | |
| * jQuery Mobile Framework : "fieldcontain" plugin - simple class additions to make form row separators | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| (function( $, undefined ) { | |
| $.fn.fieldcontain = function( options ) { | |
| return this.addClass( "ui-field-contain ui-body ui-br" ); | |
| }; | |
| //auto self-init widgets | |
| $( document ).bind( "pagecreate create", function( e ){ | |
| $( ":jqmData(role='fieldcontain')", e.target ).fieldcontain(); | |
| }); | |
| })( jQuery );/* | |
| * jQuery Mobile Framework : plugin for creating CSS grids | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| (function( $, undefined ) { | |
| $.fn.grid = function( options ) { | |
| return this.each(function() { | |
| var $this = $( this ), | |
| o = $.extend({ | |
| grid: null | |
| },options), | |
| $kids = $this.children(), | |
| gridCols = {solo:1, a:2, b:3, c:4, d:5}, | |
| grid = o.grid, | |
| iterator; | |
| if ( !grid ) { | |
| if ( $kids.length <= 5 ) { | |
| for ( var letter in gridCols ) { | |
| if ( gridCols[ letter ] === $kids.length ) { | |
| grid = letter; | |
| } | |
| } | |
| } else { | |
| grid = "a"; | |
| } | |
| } | |
| iterator = gridCols[grid]; | |
| $this.addClass( "ui-grid-" + grid ); | |
| $kids.filter( ":nth-child(" + iterator + "n+1)" ).addClass( "ui-block-a" ); | |
| if ( iterator > 1 ) { | |
| $kids.filter( ":nth-child(" + iterator + "n+2)" ).addClass( "ui-block-b" ); | |
| } | |
| if ( iterator > 2 ) { | |
| $kids.filter( ":nth-child(3n+3)" ).addClass( "ui-block-c" ); | |
| } | |
| if ( iterator > 3 ) { | |
| $kids.filter( ":nth-child(4n+4)" ).addClass( "ui-block-d" ); | |
| } | |
| if ( iterator > 4 ) { | |
| $kids.filter( ":nth-child(5n+5)" ).addClass( "ui-block-e" ); | |
| } | |
| }); | |
| }; | |
| })( jQuery );/* | |
| * jQuery Mobile Framework : "navbar" plugin | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| (function( $, undefined ) { | |
| $.widget( "mobile.navbar", $.mobile.widget, { | |
| options: { | |
| iconpos: "top", | |
| grid: null, | |
| initSelector: ":jqmData(role='navbar')" | |
| }, | |
| _create: function(){ | |
| var $navbar = this.element, | |
| $navbtns = $navbar.find( "a" ), | |
| iconpos = $navbtns.filter( ":jqmData(icon)" ).length ? | |
| this.options.iconpos : undefined; | |
| $navbar.addClass( "ui-navbar" ) | |
| .attr( "role","navigation" ) | |
| .find( "ul" ) | |
| .grid({ grid: this.options.grid }); | |
| if ( !iconpos ) { | |
| $navbar.addClass( "ui-navbar-noicons" ); | |
| } | |
| $navbtns.buttonMarkup({ | |
| corners: false, | |
| shadow: false, | |
| iconpos: iconpos | |
| }); | |
| $navbar.delegate( "a", "vclick", function( event ) { | |
| $navbtns.not( ".ui-state-persist" ).removeClass( $.mobile.activeBtnClass ); | |
| $( this ).addClass( $.mobile.activeBtnClass ); | |
| }); | |
| } | |
| }); | |
| //auto self-init widgets | |
| $( document ).bind( "pagecreate create", function( e ){ | |
| $( $.mobile.navbar.prototype.options.initSelector, e.target ).navbar(); | |
| }); | |
| })( jQuery ); | |
| /* | |
| * jQuery Mobile Framework : "listview" plugin | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| (function( $, undefined ) { | |
| //Keeps track of the number of lists per page UID | |
| //This allows support for multiple nested list in the same page | |
| //https://github.com/jquery/jquery-mobile/issues/1617 | |
| var listCountPerPage = {}; | |
| $.widget( "mobile.listview", $.mobile.widget, { | |
| options: { | |
| theme: "c", | |
| countTheme: "c", | |
| headerTheme: "b", | |
| dividerTheme: "b", | |
| splitIcon: "arrow-r", | |
| splitTheme: "b", | |
| inset: false, | |
| initSelector: ":jqmData(role='listview')" | |
| }, | |
| _create: function() { | |
| var t = this; | |
| // create listview markup | |
| t.element.addClass(function( i, orig ) { | |
| return orig + " ui-listview " + ( t.options.inset ? " ui-listview-inset ui-corner-all ui-shadow " : "" ); | |
| }); | |
| t.refresh(); | |
| }, | |
| _itemApply: function( $list, item ) { | |
| // TODO class has to be defined in markup | |
| item.find( ".ui-li-count" ) | |
| .addClass( "ui-btn-up-" + ( $list.jqmData( "counttheme" ) || this.options.countTheme ) + " ui-btn-corner-all" ).end() | |
| .find( "h1, h2, h3, h4, h5, h6" ).addClass( "ui-li-heading" ).end() | |
| .find( "p, dl" ).addClass( "ui-li-desc" ).end() | |
| .find( ">img:eq(0), .ui-link-inherit>img:eq(0)" ).addClass( "ui-li-thumb" ).each(function() { | |
| item.addClass( $(this).is( ".ui-li-icon" ) ? "ui-li-has-icon" : "ui-li-has-thumb" ); | |
| }).end() | |
| .find( ".ui-li-aside" ).each(function() { | |
| var $this = $(this); | |
| $this.prependTo( $this.parent() ); //shift aside to front for css float | |
| }); | |
| }, | |
| _removeCorners: function( li, which ) { | |
| var top = "ui-corner-top ui-corner-tr ui-corner-tl", | |
| bot = "ui-corner-bottom ui-corner-br ui-corner-bl"; | |
| li = li.add( li.find( ".ui-btn-inner, .ui-li-link-alt, .ui-li-thumb" ) ); | |
| if ( which === "top" ) { | |
| li.removeClass( top ); | |
| } else if ( which === "bottom" ) { | |
| li.removeClass( bot ); | |
| } else { | |
| li.removeClass( top + " " + bot ); | |
| } | |
| }, | |
| refresh: function( create ) { | |
| this.parentPage = this.element.closest( ".ui-page" ); | |
| this._createSubPages(); | |
| var o = this.options, | |
| $list = this.element, | |
| self = this, | |
| dividertheme = $list.jqmData( "dividertheme" ) || o.dividerTheme, | |
| listsplittheme = $list.jqmData( "splittheme" ), | |
| listspliticon = $list.jqmData( "spliticon" ), | |
| li = $list.children( "li" ), | |
| counter = $.support.cssPseudoElement || !$.nodeName( $list[ 0 ], "ol" ) ? 0 : 1, | |
| item, itemClass, itemTheme, | |
| a, last, splittheme, countParent, icon; | |
| if ( counter ) { | |
| $list.find( ".ui-li-dec" ).remove(); | |
| } | |
| for ( var pos = 0, numli = li.length; pos < numli; pos++ ) { | |
| item = li.eq( pos ); | |
| itemClass = "ui-li"; | |
| // If we're creating the element, we update it regardless | |
| if ( create || !item.hasClass( "ui-li" ) ) { | |
| itemTheme = item.jqmData("theme") || o.theme; | |
| a = item.children( "a" ); | |
| if ( a.length ) { | |
| icon = item.jqmData("icon"); | |
| item.buttonMarkup({ | |
| wrapperEls: "div", | |
| shadow: false, | |
| corners: false, | |
| iconpos: "right", | |
| icon: a.length > 1 || icon === false ? false : icon || "arrow-r", | |
| theme: itemTheme | |
| }); | |
| a.first().addClass( "ui-link-inherit" ); | |
| if ( a.length > 1 ) { | |
| itemClass += " ui-li-has-alt"; | |
| last = a.last(); | |
| splittheme = listsplittheme || last.jqmData( "theme" ) || o.splitTheme; | |
| last.appendTo(item) | |
| .attr( "title", last.text() ) | |
| .addClass( "ui-li-link-alt" ) | |
| .empty() | |
| .buttonMarkup({ | |
| shadow: false, | |
| corners: false, | |
| theme: itemTheme, | |
| icon: false, | |
| iconpos: false | |
| }) | |
| .find( ".ui-btn-inner" ) | |
| .append( | |
| $( "<span />" ).buttonMarkup({ | |
| shadow: true, | |
| corners: true, | |
| theme: splittheme, | |
| iconpos: "notext", | |
| icon: listspliticon || last.jqmData( "icon" ) || o.splitIcon | |
| }) | |
| ); | |
| } | |
| } else if ( item.jqmData( "role" ) === "list-divider" ) { | |
| itemClass += " ui-li-divider ui-btn ui-bar-" + dividertheme; | |
| item.attr( "role", "heading" ); | |
| //reset counter when a divider heading is encountered | |
| if ( counter ) { | |
| counter = 1; | |
| } | |
| } else { | |
| itemClass += " ui-li-static ui-body-" + itemTheme; | |
| } | |
| } | |
| if ( o.inset ) { | |
| if ( pos === 0 ) { | |
| itemClass += " ui-corner-top"; | |
| item.add( item.find( ".ui-btn-inner" ) ) | |
| .find( ".ui-li-link-alt" ) | |
| .addClass( "ui-corner-tr" ) | |
| .end() | |
| .find( ".ui-li-thumb" ) | |
| .addClass( "ui-corner-tl" ); | |
| if ( item.next().next().length ) { | |
| self._removeCorners( item.next() ); | |
| } | |
| } | |
| if ( pos === li.length - 1 ) { | |
| itemClass += " ui-corner-bottom"; | |
| item.add( item.find( ".ui-btn-inner" ) ) | |
| .find( ".ui-li-link-alt" ) | |
| .addClass( "ui-corner-br" ) | |
| .end() | |
| .find( ".ui-li-thumb" ) | |
| .addClass( "ui-corner-bl" ); | |
| if ( item.prev().prev().length ) { | |
| self._removeCorners( item.prev() ); | |
| } else if ( item.prev().length ) { | |
| self._removeCorners( item.prev(), "bottom" ); | |
| } | |
| } | |
| } | |
| if ( counter && itemClass.indexOf( "ui-li-divider" ) < 0 ) { | |
| countParent = item.is( ".ui-li-static:first" ) ? item : item.find( ".ui-link-inherit" ); | |
| countParent.addClass( "ui-li-jsnumbering" ) | |
| .prepend( "<span class='ui-li-dec'>" + (counter++) + ". </span>" ); | |
| } | |
| item.add( item.children( ".ui-btn-inner" ) ).addClass( itemClass ); | |
| if ( !create ) { | |
| self._itemApply( $list, item ); | |
| } | |
| } | |
| }, | |
| //create a string for ID/subpage url creation | |
| _idStringEscape: function( str ) { | |
| return str.replace(/[^a-zA-Z0-9]/g, '-'); | |
| }, | |
| _createSubPages: function() { | |
| var parentList = this.element, | |
| parentPage = parentList.closest( ".ui-page" ), | |
| parentUrl = parentPage.jqmData( "url" ), | |
| parentId = parentUrl || parentPage[ 0 ][ $.expando ], | |
| parentListId = parentList.attr( "id" ), | |
| o = this.options, | |
| dns = "data-" + $.mobile.ns, | |
| self = this, | |
| persistentFooterID = parentPage.find( ":jqmData(role='footer')" ).jqmData( "id" ), | |
| hasSubPages; | |
| if ( typeof listCountPerPage[ parentId ] === "undefined" ) { | |
| listCountPerPage[ parentId ] = -1; | |
| } | |
| parentListId = parentListId || ++listCountPerPage[ parentId ]; | |
| $( parentList.find( "li>ul, li>ol" ).toArray().reverse() ).each(function( i ) { | |
| var self = this, | |
| list = $( this ), | |
| listId = list.attr( "id" ) || parentListId + "-" + i, | |
| parent = list.parent(), | |
| nodeEls = $( list.prevAll().toArray().reverse() ), | |
| nodeEls = nodeEls.length ? nodeEls : $( "<span>" + $.trim(parent.contents()[ 0 ].nodeValue) + "</span>" ), | |
| title = nodeEls.first().text(),//url limits to first 30 chars of text | |
| id = ( parentUrl || "" ) + "&" + $.mobile.subPageUrlKey + "=" + listId, | |
| theme = list.jqmData( "theme" ) || o.theme, | |
| countTheme = list.jqmData( "counttheme" ) || parentList.jqmData( "counttheme" ) || o.countTheme, | |
| newPage, anchor; | |
| //define hasSubPages for use in later removal | |
| hasSubPages = true; | |
| newPage = list.detach() | |
| .wrap( "<div " + dns + "role='page' " + dns + "url='" + id + "' " + dns + "theme='" + theme + "' " + dns + "count-theme='" + countTheme + "'><div " + dns + "role='content'></div></div>" ) | |
| .parent() | |
| .before( "<div " + dns + "role='header' " + dns + "theme='" + o.headerTheme + "'><div class='ui-title'>" + title + "</div></div>" ) | |
| .after( persistentFooterID ? $( "<div " + dns + "role='footer' " + dns + "id='"+ persistentFooterID +"'>") : "" ) | |
| .parent() | |
| .appendTo( $.mobile.pageContainer ); | |
| newPage.page(); | |
| anchor = parent.find('a:first'); | |
| if ( !anchor.length ) { | |
| anchor = $( "<a/>" ).html( nodeEls || title ).prependTo( parent.empty() ); | |
| } | |
| anchor.attr( "href", "#" + id ); | |
| }).listview(); | |
| //on pagehide, remove any nested pages along with the parent page, as long as they aren't active | |
| if( hasSubPages && parentPage.data("page").options.domCache === false ){ | |
| var newRemove = function( e, ui ){ | |
| var nextPage = ui.nextPage, npURL; | |
| if( ui.nextPage ){ | |
| npURL = nextPage.jqmData( "url" ); | |
| if( npURL.indexOf( parentUrl + "&" + $.mobile.subPageUrlKey ) !== 0 ){ | |
| self.childPages().remove(); | |
| parentPage.remove(); | |
| } | |
| } | |
| }; | |
| // unbind the original page remove and replace with our specialized version | |
| parentPage | |
| .unbind( "pagehide.remove" ) | |
| .bind( "pagehide.remove", newRemove); | |
| } | |
| }, | |
| // TODO sort out a better way to track sub pages of the listview this is brittle | |
| childPages: function(){ | |
| var parentUrl = this.parentPage.jqmData( "url" ); | |
| return $( ":jqmData(url^='"+ parentUrl + "&" + $.mobile.subPageUrlKey +"')"); | |
| } | |
| }); | |
| //auto self-init widgets | |
| $( document ).bind( "pagecreate create", function( e ){ | |
| $( $.mobile.listview.prototype.options.initSelector, e.target ).listview(); | |
| }); | |
| })( jQuery ); | |
| /* | |
| * jQuery Mobile Framework : "listview" filter extension | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| (function( $, undefined ) { | |
| $.mobile.listview.prototype.options.filter = false; | |
| $.mobile.listview.prototype.options.filterPlaceholder = "Filter items..."; | |
| $.mobile.listview.prototype.options.filterTheme = "c"; | |
| $( ":jqmData(role='listview')" ).live( "listviewcreate", function() { | |
| var list = $( this ), | |
| listview = list.data( "listview" ); | |
| if ( !listview.options.filter ) { | |
| return; | |
| } | |
| var wrapper = $( "<form>", { | |
| "class": "ui-listview-filter ui-bar-" + listview.options.filterTheme, | |
| "role": "search" | |
| }), | |
| search = $( "<input>", { | |
| placeholder: listview.options.filterPlaceholder | |
| }) | |
| .attr( "data-" + $.mobile.ns + "type", "search" ) | |
| .jqmData( "lastval", "" ) | |
| .bind( "keyup change", function() { | |
| var $this = $(this), | |
| val = this.value.toLowerCase(), | |
| listItems = null, | |
| lastval = $this.jqmData( "lastval" ) + "", | |
| childItems = false, | |
| itemtext = "", | |
| item; | |
| // Change val as lastval for next execution | |
| $this.jqmData( "lastval" , val ); | |
| change = val.replace( new RegExp( "^" + lastval ) , "" ); | |
| if ( val.length < lastval.length || change.length != ( val.length - lastval.length ) ) { | |
| // Removed chars or pasted something totaly different, check all items | |
| listItems = list.children(); | |
| } else { | |
| // Only chars added, not removed, only use visible subset | |
| listItems = list.children( ":not(.ui-screen-hidden)" ); | |
| } | |
| if ( val ) { | |
| // This handles hiding regular rows without the text we search for | |
| // and any list dividers without regular rows shown under it | |
| for ( var i = listItems.length - 1; i >= 0; i-- ) { | |
| item = $( listItems[ i ] ); | |
| itemtext = item.jqmData( "filtertext" ) || item.text(); | |
| if ( item.is( "li:jqmData(role=list-divider)" ) ) { | |
| item.toggleClass( "ui-filter-hidequeue" , !childItems ); | |
| // New bucket! | |
| childItems = false; | |
| } else if ( itemtext.toLowerCase().indexOf( val ) === -1 ) { | |
| //mark to be hidden | |
| item.toggleClass( "ui-filter-hidequeue" , true ); | |
| } else { | |
| // There"s a shown item in the bucket | |
| childItems = true; | |
| } | |
| } | |
| // Show items, not marked to be hidden | |
| listItems | |
| .filter( ":not(.ui-filter-hidequeue)" ) | |
| .toggleClass( "ui-screen-hidden", false ); | |
| // Hide items, marked to be hidden | |
| listItems | |
| .filter( ".ui-filter-hidequeue" ) | |
| .toggleClass( "ui-screen-hidden", true ) | |
| .toggleClass( "ui-filter-hidequeue", false ); | |
| } else { | |
| //filtervalue is empty => show all | |
| listItems.toggleClass( "ui-screen-hidden", false ); | |
| } | |
| }) | |
| .appendTo( wrapper ) | |
| .textinput(); | |
| if ( $( this ).jqmData( "inset" ) ) { | |
| wrapper.addClass( "ui-listview-filter-inset" ); | |
| } | |
| wrapper.bind( "submit", function() { | |
| return false; | |
| }) | |
| .insertBefore( list ); | |
| }); | |
| })( jQuery );/* | |
| * jQuery Mobile Framework : "fieldcontain" plugin - simple class additions to make form row separators | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| (function( $, undefined ) { | |
| $( document ).bind( "pagecreate create", function( e ){ | |
| $( ":jqmData(role='nojs')", e.target ).addClass( "ui-nojs" ); | |
| }); | |
| })( jQuery );/* | |
| * jQuery Mobile Framework : "checkboxradio" plugin | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| (function( $, undefined ) { | |
| $.widget( "mobile.checkboxradio", $.mobile.widget, { | |
| options: { | |
| theme: null, | |
| initSelector: "input[type='checkbox'],input[type='radio']" | |
| }, | |
| _create: function() { | |
| var self = this, | |
| input = this.element, | |
| // NOTE: Windows Phone could not find the label through a selector | |
| // filter works though. | |
| label = input.closest( "form,fieldset,:jqmData(role='page')" ).find( "label" ).filter( "[for='" + input[ 0 ].id + "']"), | |
| inputtype = input.attr( "type" ), | |
| checkedState = inputtype + "-on", | |
| uncheckedState = inputtype + "-off", | |
| icon = input.parents( ":jqmData(type='horizontal')" ).length ? undefined : uncheckedState, | |
| activeBtn = icon ? "" : " " + $.mobile.activeBtnClass, | |
| checkedClass = "ui-" + checkedState + activeBtn, | |
| uncheckedClass = "ui-" + uncheckedState, | |
| checkedicon = "ui-icon-" + checkedState, | |
| uncheckedicon = "ui-icon-" + uncheckedState; | |
| if ( inputtype !== "checkbox" && inputtype !== "radio" ) { | |
| return; | |
| } | |
| // Expose for other methods | |
| $.extend( this, { | |
| label: label, | |
| inputtype: inputtype, | |
| checkedClass: checkedClass, | |
| uncheckedClass: uncheckedClass, | |
| checkedicon: checkedicon, | |
| uncheckedicon: uncheckedicon | |
| }); | |
| // If there's no selected theme... | |
| if( !this.options.theme ) { | |
| this.options.theme = this.element.jqmData( "theme" ); | |
| } | |
| label.buttonMarkup({ | |
| theme: this.options.theme, | |
| icon: icon, | |
| shadow: false | |
| }); | |
| // Wrap the input + label in a div | |
| input.add( label ) | |
| .wrapAll( "<div class='ui-" + inputtype + "'></div>" ); | |
| label.bind({ | |
| vmouseover: function() { | |
| if ( $( this ).parent().is( ".ui-disabled" ) ) { | |
| return false; | |
| } | |
| }, | |
| vclick: function( event ) { | |
| if ( input.is( ":disabled" ) ) { | |
| event.preventDefault(); | |
| return; | |
| } | |
| self._cacheVals(); | |
| input.prop( "checked", inputtype === "radio" && true || !input.prop( "checked" ) ); | |
| // Input set for common radio buttons will contain all the radio | |
| // buttons, but will not for checkboxes. clearing the checked status | |
| // of other radios ensures the active button state is applied properly | |
| self._getInputSet().not( input ).prop( "checked", false ); | |
| self._updateAll(); | |
| return false; | |
| } | |
| }); | |
| input | |
| .bind({ | |
| vmousedown: function() { | |
| this._cacheVals(); | |
| }, | |
| vclick: function() { | |
| var $this = $(this); | |
| // Adds checked attribute to checked input when keyboard is used | |
| if ( $this.is( ":checked" ) ) { | |
| $this.prop( "checked", true); | |
| self._getInputSet().not($this).prop( "checked", false ); | |
| } else { | |
| $this.prop( "checked", false ); | |
| } | |
| self._updateAll(); | |
| }, | |
| focus: function() { | |
| label.addClass( "ui-focus" ); | |
| }, | |
| blur: function() { | |
| label.removeClass( "ui-focus" ); | |
| } | |
| }); | |
| this.refresh(); | |
| }, | |
| _cacheVals: function() { | |
| this._getInputSet().each(function() { | |
| var $this = $(this); | |
| $this.jqmData( "cacheVal", $this.is( ":checked" ) ); | |
| }); | |
| }, | |
| //returns either a set of radios with the same name attribute, or a single checkbox | |
| _getInputSet: function(){ | |
| if(this.inputtype == "checkbox") { | |
| return this.element; | |
| } | |
| return this.element.closest( "form,fieldset,:jqmData(role='page')" ) | |
| .find( "input[name='"+ this.element.attr( "name" ) +"'][type='"+ this.inputtype +"']" ); | |
| }, | |
| _updateAll: function() { | |
| var self = this; | |
| this._getInputSet().each(function() { | |
| var $this = $(this); | |
| if ( $this.is( ":checked" ) || self.inputtype === "checkbox" ) { | |
| $this.trigger( "change" ); | |
| } | |
| }) | |
| .checkboxradio( "refresh" ); | |
| }, | |
| refresh: function() { | |
| var input = this.element, | |
| label = this.label, | |
| icon = label.find( ".ui-icon" ); | |
| // input[0].checked expando doesn't always report the proper value | |
| // for checked='checked' | |
| if ( $( input[ 0 ] ).prop( "checked" ) ) { | |
| label.addClass( this.checkedClass ).removeClass( this.uncheckedClass ); | |
| icon.addClass( this.checkedicon ).removeClass( this.uncheckedicon ); | |
| } else { | |
| label.removeClass( this.checkedClass ).addClass( this.uncheckedClass ); | |
| icon.removeClass( this.checkedicon ).addClass( this.uncheckedicon ); | |
| } | |
| if ( input.is( ":disabled" ) ) { | |
| this.disable(); | |
| } else { | |
| this.enable(); | |
| } | |
| }, | |
| disable: function() { | |
| this.element.prop( "disabled", true ).parent().addClass( "ui-disabled" ); | |
| }, | |
| enable: function() { | |
| this.element.prop( "disabled", false ).parent().removeClass( "ui-disabled" ); | |
| } | |
| }); | |
| //auto self-init widgets | |
| $( document ).bind( "pagecreate create", function( e ){ | |
| $( $.mobile.checkboxradio.prototype.options.initSelector, e.target ) | |
| .not( ":jqmData(role='none'), :jqmData(role='nojs')" ) | |
| .checkboxradio(); | |
| }); | |
| })( jQuery ); | |
| /* | |
| * jQuery Mobile Framework : "button" plugin - links that proxy to native input/buttons | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| (function( $, undefined ) { | |
| $.widget( "mobile.button", $.mobile.widget, { | |
| options: { | |
| theme: null, | |
| icon: null, | |
| iconpos: null, | |
| inline: null, | |
| corners: true, | |
| shadow: true, | |
| iconshadow: true, | |
| initSelector: "button, [type='button'], [type='submit'], [type='reset'], [type='image']" | |
| }, | |
| _create: function() { | |
| var $el = this.element, | |
| o = this.options, | |
| type; | |
| // Add ARIA role | |
| this.button = $( "<div></div>" ) | |
| .text( $el.text() || $el.val() ) | |
| .buttonMarkup({ | |
| theme: o.theme, | |
| icon: o.icon, | |
| iconpos: o.iconpos, | |
| inline: o.inline, | |
| corners: o.corners, | |
| shadow: o.shadow, | |
| iconshadow: o.iconshadow | |
| }) | |
| .insertBefore( $el ) | |
| .append( $el.addClass( "ui-btn-hidden" ) ); | |
| // Add hidden input during submit | |
| type = $el.attr( "type" ); | |
| if ( type !== "button" && type !== "reset" ) { | |
| $el.bind( "vclick", function() { | |
| var $buttonPlaceholder = $( "<input>", { | |
| type: "hidden", | |
| name: $el.attr( "name" ), | |
| value: $el.attr( "value" ) | |
| }) | |
| .insertBefore( $el ); | |
| // Bind to doc to remove after submit handling | |
| $( document ).submit(function(){ | |
| $buttonPlaceholder.remove(); | |
| }); | |
| }); | |
| } | |
| this.refresh(); | |
| }, | |
| enable: function() { | |
| this.element.attr( "disabled", false ); | |
| this.button.removeClass( "ui-disabled" ).attr( "aria-disabled", false ); | |
| return this._setOption( "disabled", false ); | |
| }, | |
| disable: function() { | |
| this.element.attr( "disabled", true ); | |
| this.button.addClass( "ui-disabled" ).attr( "aria-disabled", true ); | |
| return this._setOption( "disabled", true ); | |
| }, | |
| refresh: function() { | |
| if ( this.element.attr( "disabled" ) ) { | |
| this.disable(); | |
| } else { | |
| this.enable(); | |
| } | |
| } | |
| }); | |
| //auto self-init widgets | |
| $( document ).bind( "pagecreate create", function( e ){ | |
| $( $.mobile.button.prototype.options.initSelector, e.target ) | |
| .not( ":jqmData(role='none'), :jqmData(role='nojs')" ) | |
| .button(); | |
| }); | |
| })( jQuery );/* | |
| * jQuery Mobile Framework : "slider" plugin | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| ( function( $, undefined ) { | |
| $.widget( "mobile.slider", $.mobile.widget, { | |
| options: { | |
| theme: null, | |
| trackTheme: null, | |
| disabled: false, | |
| initSelector: "input[type='range'], :jqmData(type='range'), :jqmData(role='slider')" | |
| }, | |
| _create: function() { | |
| // TODO: Each of these should have comments explain what they're for | |
| var self = this, | |
| control = this.element, | |
| parentTheme = control.parents( "[class*='ui-bar-'],[class*='ui-body-']" ).eq( 0 ), | |
| parentTheme = parentTheme.length ? parentTheme.attr( "class" ).match( /ui-(bar|body)-([a-z])/ )[ 2 ] : "c", | |
| theme = this.options.theme ? this.options.theme : parentTheme, | |
| trackTheme = this.options.trackTheme ? this.options.trackTheme : parentTheme, | |
| cType = control[ 0 ].nodeName.toLowerCase(), | |
| selectClass = ( cType == "select" ) ? "ui-slider-switch" : "", | |
| controlID = control.attr( "id" ), | |
| labelID = controlID + "-label", | |
| label = $( "[for='"+ controlID +"']" ).attr( "id", labelID ), | |
| val = function() { | |
| return cType == "input" ? parseFloat( control.val() ) : control[0].selectedIndex; | |
| }, | |
| min = cType == "input" ? parseFloat( control.attr( "min" ) ) : 0, | |
| max = cType == "input" ? parseFloat( control.attr( "max" ) ) : control.find( "option" ).length-1, | |
| step = window.parseFloat( control.attr( "step" ) || 1 ), | |
| slider = $( "<div class='ui-slider " + selectClass + " ui-btn-down-" + trackTheme + | |
| " ui-btn-corner-all' role='application'></div>" ), | |
| handle = $( "<a href='#' class='ui-slider-handle'></a>" ) | |
| .appendTo( slider ) | |
| .buttonMarkup({ corners: true, theme: theme, shadow: true }) | |
| .attr({ | |
| "role": "slider", | |
| "aria-valuemin": min, | |
| "aria-valuemax": max, | |
| "aria-valuenow": val(), | |
| "aria-valuetext": val(), | |
| "title": val(), | |
| "aria-labelledby": labelID | |
| }), | |
| options; | |
| $.extend( this, { | |
| slider: slider, | |
| handle: handle, | |
| dragging: false, | |
| beforeStart: null | |
| }); | |
| if ( cType == "select" ) { | |
| slider.wrapInner( "<div class='ui-slider-inneroffset'></div>" ); | |
| options = control.find( "option" ); | |
| control.find( "option" ).each(function( i ) { | |
| var side = !i ? "b":"a", | |
| corners = !i ? "right" :"left", | |
| theme = !i ? " ui-btn-down-" + trackTheme :" ui-btn-active"; | |
| $( "<div class='ui-slider-labelbg ui-slider-labelbg-" + side + theme + " ui-btn-corner-" + corners + "'></div>" ) | |
| .prependTo( slider ); | |
| $( "<span class='ui-slider-label ui-slider-label-" + side + theme + " ui-btn-corner-" + corners + "' role='img'>" + $( this ).text() + "</span>" ) | |
| .prependTo( handle ); | |
| }); | |
| } | |
| label.addClass( "ui-slider" ); | |
| // monitor the input for updated values | |
| control.addClass( cType === "input" ? "ui-slider-input" : "ui-slider-switch" ) | |
| .change( function() { | |
| self.refresh( val(), true ); | |
| }) | |
| .keyup( function() { // necessary? | |
| self.refresh( val(), true, true ); | |
| }) | |
| .blur( function() { | |
| self.refresh( val(), true ); | |
| }); | |
| // prevent screen drag when slider activated | |
| $( document ).bind( "vmousemove", function( event ) { | |
| if ( self.dragging ) { | |
| self.refresh( event ); | |
| return false; | |
| } | |
| }); | |
| slider.bind( "vmousedown", function( event ) { | |
| self.dragging = true; | |
| if ( cType === "select" ) { | |
| self.beforeStart = control[0].selectedIndex; | |
| } | |
| self.refresh( event ); | |
| return false; | |
| }); | |
| slider.add( document ) | |
| .bind( "vmouseup", function() { | |
| if ( self.dragging ) { | |
| self.dragging = false; | |
| if ( cType === "select" ) { | |
| if ( self.beforeStart === control[ 0 ].selectedIndex ) { | |
| //tap occurred, but value didn't change. flip it! | |
| self.refresh( !self.beforeStart ? 1 : 0 ); | |
| } | |
| var curval = val(); | |
| var snapped = Math.round( curval / ( max - min ) * 100 ); | |
| handle | |
| .addClass( "ui-slider-handle-snapping" ) | |
| .css( "left", snapped + "%" ) | |
| .animationComplete( function() { | |
| handle.removeClass( "ui-slider-handle-snapping" ); | |
| }); | |
| } | |
| return false; | |
| } | |
| }); | |
| slider.insertAfter( control ); | |
| // NOTE force focus on handle | |
| this.handle | |
| .bind( "vmousedown", function() { | |
| $( this ).focus(); | |
| }) | |
| .bind( "vclick", false ); | |
| this.handle | |
| .bind( "keydown", function( event ) { | |
| var index = val(); | |
| if ( self.options.disabled ) { | |
| return; | |
| } | |
| // In all cases prevent the default and mark the handle as active | |
| switch ( event.keyCode ) { | |
| case $.mobile.keyCode.HOME: | |
| case $.mobile.keyCode.END: | |
| case $.mobile.keyCode.PAGE_UP: | |
| case $.mobile.keyCode.PAGE_DOWN: | |
| case $.mobile.keyCode.UP: | |
| case $.mobile.keyCode.RIGHT: | |
| case $.mobile.keyCode.DOWN: | |
| case $.mobile.keyCode.LEFT: | |
| event.preventDefault(); | |
| if ( !self._keySliding ) { | |
| self._keySliding = true; | |
| $( this ).addClass( "ui-state-active" ); | |
| } | |
| break; | |
| } | |
| // move the slider according to the keypress | |
| switch ( event.keyCode ) { | |
| case $.mobile.keyCode.HOME: | |
| self.refresh( min ); | |
| break; | |
| case $.mobile.keyCode.END: | |
| self.refresh( max ); | |
| break; | |
| case $.mobile.keyCode.PAGE_UP: | |
| case $.mobile.keyCode.UP: | |
| case $.mobile.keyCode.RIGHT: | |
| self.refresh( index + step ); | |
| break; | |
| case $.mobile.keyCode.PAGE_DOWN: | |
| case $.mobile.keyCode.DOWN: | |
| case $.mobile.keyCode.LEFT: | |
| self.refresh( index - step ); | |
| break; | |
| } | |
| }) // remove active mark | |
| .keyup( function( event ) { | |
| if ( self._keySliding ) { | |
| self._keySliding = false; | |
| $( this ).removeClass( "ui-state-active" ); | |
| } | |
| }); | |
| this.refresh(undefined, undefined, true); | |
| }, | |
| refresh: function( val, isfromControl, preventInputUpdate ) { | |
| if ( this.options.disabled ) { return; } | |
| var control = this.element, percent, | |
| cType = control[0].nodeName.toLowerCase(), | |
| min = cType === "input" ? parseFloat( control.attr( "min" ) ) : 0, | |
| max = cType === "input" ? parseFloat( control.attr( "max" ) ) : control.find( "option" ).length - 1; | |
| if ( typeof val === "object" ) { | |
| var data = val, | |
| // a slight tolerance helped get to the ends of the slider | |
| tol = 8; | |
| if ( !this.dragging || | |
| data.pageX < this.slider.offset().left - tol || | |
| data.pageX > this.slider.offset().left + this.slider.width() + tol ) { | |
| return; | |
| } | |
| percent = Math.round( ( ( data.pageX - this.slider.offset().left ) / this.slider.width() ) * 100 ); | |
| } else { | |
| if ( val == null ) { | |
| val = cType === "input" ? parseFloat( control.val() ) : control[0].selectedIndex; | |
| } | |
| percent = ( parseFloat( val ) - min ) / ( max - min ) * 100; | |
| } | |
| if ( isNaN( percent ) ) { | |
| return; | |
| } | |
| if ( percent < 0 ) { | |
| percent = 0; | |
| } | |
| if ( percent > 100 ) { | |
| percent = 100; | |
| } | |
| var newval = Math.round( ( percent / 100 ) * ( max - min ) ) + min; | |
| if ( newval < min ) { | |
| newval = min; | |
| } | |
| if ( newval > max ) { | |
| newval = max; | |
| } | |
| // Flip the stack of the bg colors | |
| if ( percent > 60 && cType === "select" ) { | |
| // TODO: Dead path? | |
| } | |
| this.handle.css( "left", percent + "%" ); | |
| this.handle.attr( { | |
| "aria-valuenow": cType === "input" ? newval : control.find( "option" ).eq( newval ).attr( "value" ), | |
| "aria-valuetext": cType === "input" ? newval : control.find( "option" ).eq( newval ).text(), | |
| title: newval | |
| }); | |
| // add/remove classes for flip toggle switch | |
| if ( cType === "select" ) { | |
| if ( newval === 0 ) { | |
| this.slider.addClass( "ui-slider-switch-a" ) | |
| .removeClass( "ui-slider-switch-b" ); | |
| } else { | |
| this.slider.addClass( "ui-slider-switch-b" ) | |
| .removeClass( "ui-slider-switch-a" ); | |
| } | |
| } | |
| if ( !preventInputUpdate ) { | |
| // update control"s value | |
| if ( cType === "input" ) { | |
| control.val( newval ); | |
| } else { | |
| control[ 0 ].selectedIndex = newval; | |
| } | |
| if ( !isfromControl ) { | |
| control.trigger( "change" ); | |
| } | |
| } | |
| }, | |
| enable: function() { | |
| this.element.attr( "disabled", false ); | |
| this.slider.removeClass( "ui-disabled" ).attr( "aria-disabled", false ); | |
| return this._setOption( "disabled", false ); | |
| }, | |
| disable: function() { | |
| this.element.attr( "disabled", true ); | |
| this.slider.addClass( "ui-disabled" ).attr( "aria-disabled", true ); | |
| return this._setOption( "disabled", true ); | |
| } | |
| }); | |
| //auto self-init widgets | |
| $( document ).bind( "pagecreate create", function( e ){ | |
| $( $.mobile.slider.prototype.options.initSelector, e.target ) | |
| .not( ":jqmData(role='none'), :jqmData(role='nojs')" ) | |
| .slider(); | |
| }); | |
| })( jQuery );/* | |
| * jQuery Mobile Framework : "textinput" plugin for text inputs, textareas | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| (function( $, undefined ) { | |
| $.widget( "mobile.textinput", $.mobile.widget, { | |
| options: { | |
| theme: null, | |
| initSelector: "input[type='text'], input[type='search'], :jqmData(type='search'), input[type='number'], :jqmData(type='number'), input[type='password'], input[type='email'], input[type='url'], input[type='tel'], textarea" | |
| }, | |
| _create: function() { | |
| var input = this.element, | |
| o = this.options, | |
| theme = o.theme, | |
| themedParent, themeclass, themeLetter, focusedEl, clearbtn; | |
| if ( !theme ) { | |
| themedParent = this.element.closest( "[class*='ui-bar-'],[class*='ui-body-']" ); | |
| themeLetter = themedParent.length && /ui-(bar|body)-([a-z])/.exec( themedParent.attr( "class" ) ); | |
| theme = themeLetter && themeLetter[2] || "c"; | |
| } | |
| themeclass = " ui-body-" + theme; | |
| $( "label[for='" + input.attr( "id" ) + "']" ).addClass( "ui-input-text" ); | |
| input.addClass("ui-input-text ui-body-"+ o.theme ); | |
| focusedEl = input; | |
| // XXX: Temporary workaround for issue 785. Turn off autocorrect and | |
| // autocomplete since the popup they use can't be dismissed by | |
| // the user. Note that we test for the presence of the feature | |
| // by looking for the autocorrect property on the input element. | |
| if ( typeof input[0].autocorrect !== "undefined" ) { | |
| // Set the attribute instead of the property just in case there | |
| // is code that attempts to make modifications via HTML. | |
| input[0].setAttribute( "autocorrect", "off" ); | |
| input[0].setAttribute( "autocomplete", "off" ); | |
| } | |
| //"search" input widget | |
| if ( input.is( "[type='search'],:jqmData(type='search')" ) ) { | |
| focusedEl = input.wrap( "<div class='ui-input-search ui-shadow-inset ui-btn-corner-all ui-btn-shadow ui-icon-searchfield" + themeclass + "'></div>" ).parent(); | |
| clearbtn = $( "<a href='#' class='ui-input-clear' title='clear text'>clear text</a>" ) | |
| .tap(function( event ) { | |
| input.val( "" ).focus(); | |
| input.trigger( "change" ); | |
| clearbtn.addClass( "ui-input-clear-hidden" ); | |
| event.preventDefault(); | |
| }) | |
| .appendTo( focusedEl ) | |
| .buttonMarkup({ | |
| icon: "delete", | |
| iconpos: "notext", | |
| corners: true, | |
| shadow: true | |
| }); | |
| function toggleClear() { | |
| if ( !input.val() ) { | |
| clearbtn.addClass( "ui-input-clear-hidden" ); | |
| } else { | |
| clearbtn.removeClass( "ui-input-clear-hidden" ); | |
| } | |
| } | |
| toggleClear(); | |
| input.keyup( toggleClear ) | |
| .focus( toggleClear ); | |
| } else { | |
| input.addClass( "ui-corner-all ui-shadow-inset" + themeclass ); | |
| } | |
| input.focus(function() { | |
| focusedEl.addClass( "ui-focus" ); | |
| }) | |
| .blur(function(){ | |
| focusedEl.removeClass( "ui-focus" ); | |
| }); | |
| // Autogrow | |
| if ( input.is( "textarea" ) ) { | |
| var extraLineHeight = 15, | |
| keyupTimeoutBuffer = 100, | |
| keyup = function() { | |
| var scrollHeight = input[ 0 ].scrollHeight, | |
| clientHeight = input[ 0 ].clientHeight; | |
| if ( clientHeight < scrollHeight ) { | |
| input.css({ | |
| height: (scrollHeight + extraLineHeight) | |
| }); | |
| } | |
| }, | |
| keyupTimeout; | |
| input.keyup(function() { | |
| clearTimeout( keyupTimeout ); | |
| keyupTimeout = setTimeout( keyup, keyupTimeoutBuffer ); | |
| }); | |
| } | |
| }, | |
| disable: function(){ | |
| ( this.element.attr( "disabled", true ).is( "[type='search'],:jqmData(type='search')" ) ? | |
| this.element.parent() : this.element ).addClass( "ui-disabled" ); | |
| }, | |
| enable: function(){ | |
| ( this.element.attr( "disabled", false).is( "[type='search'],:jqmData(type='search')" ) ? | |
| this.element.parent() : this.element ).removeClass( "ui-disabled" ); | |
| } | |
| }); | |
| //auto self-init widgets | |
| $( document ).bind( "pagecreate create", function( e ){ | |
| $( $.mobile.textinput.prototype.options.initSelector, e.target ) | |
| .not( ":jqmData(role='none'), :jqmData(role='nojs')" ) | |
| .textinput(); | |
| }); | |
| })( jQuery ); | |
| /* | |
| * jQuery Mobile Framework : "selectmenu" plugin | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| (function( $, undefined ) { | |
| $.widget( "mobile.selectmenu", $.mobile.widget, { | |
| options: { | |
| theme: null, | |
| disabled: false, | |
| icon: "arrow-d", | |
| iconpos: "right", | |
| inline: null, | |
| corners: true, | |
| shadow: true, | |
| iconshadow: true, | |
| menuPageTheme: "b", | |
| overlayTheme: "a", | |
| hidePlaceholderMenuItems: true, | |
| closeText: "Close", | |
| nativeMenu: true, | |
| initSelector: "select:not(:jqmData(role='slider'))" | |
| }, | |
| _create: function() { | |
| var self = this, | |
| o = this.options, | |
| select = this.element | |
| .wrap( "<div class='ui-select'>" ), | |
| selectID = select.attr( "id" ), | |
| label = $( "label[for='"+ selectID +"']" ).addClass( "ui-select" ), | |
| // IE throws an exception at options.item() function when | |
| // there is no selected item | |
| // select first in this case | |
| selectedIndex = select[ 0 ].selectedIndex == -1 ? 0 : select[ 0 ].selectedIndex, | |
| button = ( self.options.nativeMenu ? $( "<div/>" ) : $( "<a>", { | |
| "href": "#", | |
| "role": "button", | |
| "id": buttonId, | |
| "aria-haspopup": "true", | |
| "aria-owns": menuId | |
| }) ) | |
| .text( $( select[ 0 ].options.item( selectedIndex ) ).text() ) | |
| .insertBefore( select ) | |
| .buttonMarkup({ | |
| theme: o.theme, | |
| icon: o.icon, | |
| iconpos: o.iconpos, | |
| inline: o.inline, | |
| corners: o.corners, | |
| shadow: o.shadow, | |
| iconshadow: o.iconshadow | |
| }), | |
| // Multi select or not | |
| isMultiple = self.isMultiple = select[ 0 ].multiple; | |
| // Opera does not properly support opacity on select elements | |
| // In Mini, it hides the element, but not its text | |
| // On the desktop,it seems to do the opposite | |
| // for these reasons, using the nativeMenu option results in a full native select in Opera | |
| if ( o.nativeMenu && window.opera && window.opera.version ) { | |
| select.addClass( "ui-select-nativeonly" ); | |
| } | |
| //vars for non-native menus | |
| if ( !o.nativeMenu ) { | |
| var options = select.find("option"), | |
| buttonId = selectID + "-button", | |
| menuId = selectID + "-menu", | |
| thisPage = select.closest( ".ui-page" ), | |
| //button theme | |
| theme = /ui-btn-up-([a-z])/.exec( button.attr( "class" ) )[1], | |
| menuPage = $( "<div data-" + $.mobile.ns + "role='dialog' data-" +$.mobile.ns + "theme='"+ o.menuPageTheme +"'>" + | |
| "<div data-" + $.mobile.ns + "role='header'>" + | |
| "<div class='ui-title'>" + label.text() + "</div>"+ | |
| "</div>"+ | |
| "<div data-" + $.mobile.ns + "role='content'></div>"+ | |
| "</div>" ) | |
| .appendTo( $.mobile.pageContainer ) | |
| .page(), | |
| menuPageContent = menuPage.find( ".ui-content" ), | |
| menuPageClose = menuPage.find( ".ui-header a" ), | |
| screen = $( "<div>", {"class": "ui-selectmenu-screen ui-screen-hidden"}) | |
| .appendTo( thisPage ), | |
| listbox = $("<div>", { "class": "ui-selectmenu ui-selectmenu-hidden ui-overlay-shadow ui-corner-all ui-body-" + o.overlayTheme + " " + $.mobile.defaultDialogTransition }) | |
| .insertAfter(screen), | |
| list = $( "<ul>", { | |
| "class": "ui-selectmenu-list", | |
| "id": menuId, | |
| "role": "listbox", | |
| "aria-labelledby": buttonId | |
| }) | |
| .attr( "data-" + $.mobile.ns + "theme", theme ) | |
| .appendTo( listbox ), | |
| header = $( "<div>", { | |
| "class": "ui-header ui-bar-" + theme | |
| }) | |
| .prependTo( listbox ), | |
| headerTitle = $( "<h1>", { | |
| "class": "ui-title" | |
| }) | |
| .appendTo( header ), | |
| headerClose = $( "<a>", { | |
| "text": o.closeText, | |
| "href": "#", | |
| "class": "ui-btn-left" | |
| }) | |
| .attr( "data-" + $.mobile.ns + "iconpos", "notext" ) | |
| .attr( "data-" + $.mobile.ns + "icon", "delete" ) | |
| .appendTo( header ) | |
| .buttonMarkup(), | |
| menuType; | |
| } // End non native vars | |
| // Add counter for multi selects | |
| if ( isMultiple ) { | |
| self.buttonCount = $( "<span>" ) | |
| .addClass( "ui-li-count ui-btn-up-c ui-btn-corner-all" ) | |
| .hide() | |
| .appendTo( button ); | |
| } | |
| // Disable if specified | |
| if ( o.disabled ) { | |
| this.disable(); | |
| } | |
| // Events on native select | |
| select.change(function() { | |
| self.refresh(); | |
| }); | |
| // Expose to other methods | |
| $.extend( self, { | |
| select: select, | |
| optionElems: options, | |
| selectID: selectID, | |
| label: label, | |
| buttonId: buttonId, | |
| menuId: menuId, | |
| thisPage: thisPage, | |
| button: button, | |
| menuPage: menuPage, | |
| menuPageContent: menuPageContent, | |
| screen: screen, | |
| listbox: listbox, | |
| list: list, | |
| menuType: menuType, | |
| header: header, | |
| headerClose: headerClose, | |
| headerTitle: headerTitle, | |
| placeholder: "" | |
| }); | |
| // Support for using the native select menu with a custom button | |
| if ( o.nativeMenu ) { | |
| select.appendTo( button ) | |
| .bind( "vmousedown", function() { | |
| // Add active class to button | |
| button.addClass( $.mobile.activeBtnClass ); | |
| }) | |
| .bind( "focus vmouseover", function() { | |
| button.trigger( "vmouseover" ); | |
| }) | |
| .bind( "vmousemove", function() { | |
| // Remove active class on scroll/touchmove | |
| button.removeClass( $.mobile.activeBtnClass ); | |
| }) | |
| .bind( "change blur vmouseout", function() { | |
| button.trigger( "vmouseout" ) | |
| .removeClass( $.mobile.activeBtnClass ); | |
| }); | |
| } else { | |
| // Create list from select, update state | |
| self.refresh(); | |
| select.attr( "tabindex", "-1" ) | |
| .focus(function() { | |
| $(this).blur(); | |
| button.focus(); | |
| }); | |
| // Button events | |
| button.bind( "vclick keydown" , function( event ) { | |
| if ( event.type == "vclick" || | |
| event.keyCode && ( event.keyCode === $.mobile.keyCode.ENTER || | |
| event.keyCode === $.mobile.keyCode.SPACE ) ) { | |
| self.open(); | |
| event.preventDefault(); | |
| } | |
| }); | |
| // Events for list items | |
| list.attr( "role", "listbox" ) | |
| .delegate( ".ui-li>a", "focusin", function() { | |
| $( this ).attr( "tabindex", "0" ); | |
| }) | |
| .delegate( ".ui-li>a", "focusout", function() { | |
| $( this ).attr( "tabindex", "-1" ); | |
| }) | |
| .delegate( "li:not(.ui-disabled, .ui-li-divider)", "vclick", function( event ) { | |
| var $this = $( this ), | |
| // index of option tag to be selected | |
| oldIndex = select[ 0 ].selectedIndex, | |
| newIndex = $this.jqmData( "option-index" ), | |
| option = self.optionElems[ newIndex ]; | |
| // toggle selected status on the tag for multi selects | |
| option.selected = isMultiple ? !option.selected : true; | |
| // toggle checkbox class for multiple selects | |
| if ( isMultiple ) { | |
| $this.find( ".ui-icon" ) | |
| .toggleClass( "ui-icon-checkbox-on", option.selected ) | |
| .toggleClass( "ui-icon-checkbox-off", !option.selected ); | |
| } | |
| // trigger change if value changed | |
| if ( isMultiple || oldIndex !== newIndex ) { | |
| select.trigger( "change" ); | |
| } | |
| //hide custom select for single selects only | |
| if ( !isMultiple ) { | |
| self.close(); | |
| } | |
| event.preventDefault(); | |
| }) | |
| //keyboard events for menu items | |
| .keydown(function( event ) { | |
| var target = $( event.target ), | |
| li = target.closest( "li" ), | |
| prev, next; | |
| // switch logic based on which key was pressed | |
| switch ( event.keyCode ) { | |
| // up or left arrow keys | |
| case 38: | |
| prev = li.prev(); | |
| // if there's a previous option, focus it | |
| if ( prev.length ) { | |
| target | |
| .blur() | |
| .attr( "tabindex", "-1" ); | |
| prev.find( "a" ).first().focus(); | |
| } | |
| return false; | |
| break; | |
| // down or right arrow keys | |
| case 40: | |
| next = li.next(); | |
| // if there's a next option, focus it | |
| if ( next.length ) { | |
| target | |
| .blur() | |
| .attr( "tabindex", "-1" ); | |
| next.find( "a" ).first().focus(); | |
| } | |
| return false; | |
| break; | |
| // If enter or space is pressed, trigger click | |
| case 13: | |
| case 32: | |
| target.trigger( "vclick" ); | |
| return false; | |
| break; | |
| } | |
| }); | |
| // button refocus ensures proper height calculation | |
| // by removing the inline style and ensuring page inclusion | |
| self.menuPage.bind( "pagehide", function(){ | |
| self.list.appendTo( self.listbox ); | |
| self._focusButton(); | |
| }); | |
| // Events on "screen" overlay | |
| screen.bind( "vclick", function( event ) { | |
| self.close(); | |
| }); | |
| // Close button on small overlays | |
| self.headerClose.click(function() { | |
| if ( self.menuType == "overlay" ) { | |
| self.close(); | |
| return false; | |
| } | |
| }); | |
| } | |
| }, | |
| _buildList: function() { | |
| var self = this, | |
| o = this.options, | |
| placeholder = this.placeholder, | |
| optgroups = [], | |
| lis = [], | |
| dataIcon = self.isMultiple ? "checkbox-off" : "false"; | |
| self.list.empty().filter( ".ui-listview" ).listview( "destroy" ); | |
| // Populate menu with options from select element | |
| self.select.find( "option" ).each(function( i ) { | |
| var $this = $( this ), | |
| $parent = $this.parent(), | |
| text = $this.text(), | |
| anchor = "<a href='#'>"+ text +"</a>", | |
| classes = [], | |
| extraAttrs = []; | |
| // Are we inside an optgroup? | |
| if ( $parent.is( "optgroup" ) ) { | |
| var optLabel = $parent.attr( "label" ); | |
| // has this optgroup already been built yet? | |
| if ( $.inArray( optLabel, optgroups ) === -1 ) { | |
| lis.push( "<li data-" + $.mobile.ns + "role='list-divider'>"+ optLabel +"</li>" ); | |
| optgroups.push( optLabel ); | |
| } | |
| } | |
| // Find placeholder text | |
| // TODO: Are you sure you want to use getAttribute? ^RW | |
| if ( !this.getAttribute( "value" ) || text.length == 0 || $this.jqmData( "placeholder" ) ) { | |
| if ( o.hidePlaceholderMenuItems ) { | |
| classes.push( "ui-selectmenu-placeholder" ); | |
| } | |
| placeholder = self.placeholder = text; | |
| } | |
| // support disabled option tags | |
| if ( this.disabled ) { | |
| classes.push( "ui-disabled" ); | |
| extraAttrs.push( "aria-disabled='true'" ); | |
| } | |
| lis.push( "<li data-" + $.mobile.ns + "option-index='" + i + "' data-" + $.mobile.ns + "icon='"+ dataIcon +"' class='"+ classes.join(" ") + "' " + extraAttrs.join(" ") +">"+ anchor +"</li>" ) | |
| }); | |
| self.list.html( lis.join(" ") ); | |
| self.list.find( "li" ) | |
| .attr({ "role": "option", "tabindex": "-1" }) | |
| .first().attr( "tabindex", "0" ); | |
| // Hide header close link for single selects | |
| if ( !this.isMultiple ) { | |
| this.headerClose.hide(); | |
| } | |
| // Hide header if it's not a multiselect and there's no placeholder | |
| if ( !this.isMultiple && !placeholder.length ) { | |
| this.header.hide(); | |
| } else { | |
| this.headerTitle.text( this.placeholder ); | |
| } | |
| // Now populated, create listview | |
| self.list.listview(); | |
| }, | |
| refresh: function( forceRebuild ) { | |
| var self = this, | |
| select = this.element, | |
| isMultiple = this.isMultiple, | |
| options = this.optionElems = select.find( "option" ), | |
| selected = options.filter( ":selected" ), | |
| // return an array of all selected index's | |
| indicies = selected.map(function() { | |
| return options.index( this ); | |
| }).get(); | |
| if ( !self.options.nativeMenu && | |
| ( forceRebuild || select[0].options.length != self.list.find( "li" ).length ) ) { | |
| self._buildList(); | |
| } | |
| self.button.find( ".ui-btn-text" ) | |
| .text(function() { | |
| if ( !isMultiple ) { | |
| return selected.text(); | |
| } | |
| return selected.length ? selected.map(function() { | |
| return $( this ).text(); | |
| }).get().join( ", " ) : self.placeholder; | |
| }); | |
| // multiple count inside button | |
| if ( isMultiple ) { | |
| self.buttonCount[ selected.length > 1 ? "show" : "hide" ]().text( selected.length ); | |
| } | |
| if ( !self.options.nativeMenu ) { | |
| self.list.find( "li:not(.ui-li-divider)" ) | |
| .removeClass( $.mobile.activeBtnClass ) | |
| .attr( "aria-selected", false ) | |
| .each(function( i ) { | |
| if ( $.inArray( i, indicies ) > -1 ) { | |
| var item = $( this ).addClass( $.mobile.activeBtnClass ); | |
| // Aria selected attr | |
| item.find( "a" ).attr( "aria-selected", true ); | |
| // Multiple selects: add the "on" checkbox state to the icon | |
| if ( isMultiple ) { | |
| item.find( ".ui-icon" ).removeClass( "ui-icon-checkbox-off" ).addClass( "ui-icon-checkbox-on" ); | |
| } | |
| } | |
| }); | |
| } | |
| }, | |
| open: function() { | |
| if ( this.options.disabled || this.options.nativeMenu ) { | |
| return; | |
| } | |
| var self = this, | |
| menuHeight = self.list.parent().outerHeight(), | |
| menuWidth = self.list.parent().outerWidth(), | |
| scrollTop = $( window ).scrollTop(), | |
| btnOffset = self.button.offset().top, | |
| screenHeight = window.innerHeight, | |
| screenWidth = window.innerWidth; | |
| //add active class to button | |
| self.button.addClass( $.mobile.activeBtnClass ); | |
| //remove after delay | |
| setTimeout(function() { | |
| self.button.removeClass( $.mobile.activeBtnClass ); | |
| }, 300); | |
| function focusMenuItem() { | |
| self.list.find( ".ui-btn-active" ).focus(); | |
| } | |
| if ( menuHeight > screenHeight - 80 || !$.support.scrollTop ) { | |
| // prevent the parent page from being removed from the DOM, | |
| // otherwise the results of selecting a list item in the dialog | |
| // fall into a black hole | |
| self.thisPage.unbind( "pagehide.remove" ); | |
| //for webos (set lastscroll using button offset) | |
| if ( scrollTop == 0 && btnOffset > screenHeight ) { | |
| self.thisPage.one( "pagehide", function() { | |
| $( this ).jqmData( "lastScroll", btnOffset ); | |
| }); | |
| } | |
| self.menuPage.one( "pageshow", function() { | |
| // silentScroll() is called whenever a page is shown to restore | |
| // any previous scroll position the page may have had. We need to | |
| // wait for the "silentscroll" event before setting focus to avoid | |
| // the browser"s "feature" which offsets rendering to make sure | |
| // whatever has focus is in view. | |
| $( window ).one( "silentscroll", function() { | |
| focusMenuItem(); | |
| }); | |
| self.isOpen = true; | |
| }); | |
| self.menuType = "page"; | |
| self.menuPageContent.append( self.list ); | |
| $.mobile.changePage( self.menuPage, { | |
| transition: $.mobile.defaultDialogTransition | |
| }); | |
| } else { | |
| self.menuType = "overlay"; | |
| self.screen.height( $(document).height() ) | |
| .removeClass( "ui-screen-hidden" ); | |
| // Try and center the overlay over the button | |
| var roomtop = btnOffset - scrollTop, | |
| roombot = scrollTop + screenHeight - btnOffset, | |
| halfheight = menuHeight / 2, | |
| maxwidth = parseFloat( self.list.parent().css( "max-width" ) ), | |
| newtop, newleft; | |
| if ( roomtop > menuHeight / 2 && roombot > menuHeight / 2 ) { | |
| newtop = btnOffset + ( self.button.outerHeight() / 2 ) - halfheight; | |
| } else { | |
| // 30px tolerance off the edges | |
| newtop = roomtop > roombot ? scrollTop + screenHeight - menuHeight - 30 : scrollTop + 30; | |
| } | |
| // If the menuwidth is smaller than the screen center is | |
| if ( menuWidth < maxwidth ) { | |
| newleft = ( screenWidth - menuWidth ) / 2; | |
| } else { | |
| //otherwise insure a >= 30px offset from the left | |
| newleft = self.button.offset().left + self.button.outerWidth() / 2 - menuWidth / 2; | |
| // 30px tolerance off the edges | |
| if ( newleft < 30 ) { | |
| newleft = 30; | |
| } else if ( ( newleft + menuWidth ) > screenWidth ) { | |
| newleft = screenWidth - menuWidth - 30; | |
| } | |
| } | |
| self.listbox.append( self.list ) | |
| .removeClass( "ui-selectmenu-hidden" ) | |
| .css({ | |
| top: newtop, | |
| left: newleft | |
| }) | |
| .addClass( "in" ); | |
| focusMenuItem(); | |
| // duplicate with value set in page show for dialog sized selects | |
| self.isOpen = true; | |
| } | |
| }, | |
| _focusButton : function(){ | |
| var self = this; | |
| setTimeout(function() { | |
| self.button.focus(); | |
| }, 40); | |
| }, | |
| close: function() { | |
| if ( this.options.disabled || !this.isOpen || this.options.nativeMenu ) { | |
| return; | |
| } | |
| var self = this; | |
| if ( self.menuType == "page" ) { | |
| // rebind the page remove that was unbound in the open function | |
| // to allow for the parent page removal from actions other than the use | |
| // of a dialog sized custom select | |
| self.thisPage.bind( "pagehide.remove", function(){ | |
| $(this).remove(); | |
| }); | |
| // doesn't solve the possible issue with calling change page | |
| // where the objects don't define data urls which prevents dialog key | |
| // stripping - changePage has incoming refactor | |
| window.history.back(); | |
| } else{ | |
| self.screen.addClass( "ui-screen-hidden" ); | |
| self.listbox.addClass( "ui-selectmenu-hidden" ).removeAttr( "style" ).removeClass( "in" ); | |
| self.list.appendTo( self.listbox ); | |
| self._focusButton(); | |
| } | |
| // allow the dialog to be closed again | |
| this.isOpen = false; | |
| }, | |
| disable: function() { | |
| this.element.attr( "disabled", true ); | |
| this.button.addClass( "ui-disabled" ).attr( "aria-disabled", true ); | |
| return this._setOption( "disabled", true ); | |
| }, | |
| enable: function() { | |
| this.element.attr( "disabled", false ); | |
| this.button.removeClass( "ui-disabled" ).attr( "aria-disabled", false ); | |
| return this._setOption( "disabled", false ); | |
| } | |
| }); | |
| //auto self-init widgets | |
| $( document ).bind( "pagecreate create", function( e ){ | |
| $( $.mobile.selectmenu.prototype.options.initSelector, e.target ) | |
| .not( ":jqmData(role='none'), :jqmData(role='nojs')" ) | |
| .selectmenu(); | |
| }); | |
| })( jQuery ); | |
| /* | |
| * jQuery Mobile Framework : plugin for making button-like links | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| ( function( $, undefined ) { | |
| $.fn.buttonMarkup = function( options ) { | |
| return this.each( function() { | |
| var el = $( this ), | |
| o = $.extend( {}, $.fn.buttonMarkup.defaults, el.jqmData(), options ), | |
| // Classes Defined | |
| innerClass = "ui-btn-inner", | |
| buttonClass, iconClass, | |
| themedParent, wrap; | |
| if ( attachEvents ) { | |
| attachEvents(); | |
| } | |
| // if not, try to find closest theme container | |
| if ( !o.theme ) { | |
| themedParent = el.closest( "[class*='ui-bar-'],[class*='ui-body-']" ); | |
| o.theme = themedParent.length ? | |
| /ui-(bar|body)-([a-z])/.exec( themedParent.attr( "class" ) )[2] : | |
| "c"; | |
| } | |
| buttonClass = "ui-btn ui-btn-up-" + o.theme; | |
| if ( o.inline ) { | |
| buttonClass += " ui-btn-inline"; | |
| } | |
| if ( o.icon ) { | |
| o.icon = "ui-icon-" + o.icon; | |
| o.iconpos = o.iconpos || "left"; | |
| iconClass = "ui-icon " + o.icon; | |
| if ( o.iconshadow ) { | |
| iconClass += " ui-icon-shadow"; | |
| } | |
| } | |
| if ( o.iconpos ) { | |
| buttonClass += " ui-btn-icon-" + o.iconpos; | |
| if ( o.iconpos == "notext" && !el.attr( "title" ) ) { | |
| el.attr( "title", el.text() ); | |
| } | |
| } | |
| if ( o.corners ) { | |
| buttonClass += " ui-btn-corner-all"; | |
| innerClass += " ui-btn-corner-all"; | |
| } | |
| if ( o.shadow ) { | |
| buttonClass += " ui-shadow"; | |
| } | |
| el.attr( "data-" + $.mobile.ns + "theme", o.theme ) | |
| .addClass( buttonClass ); | |
| wrap = ( "<D class='" + innerClass + "'><D class='ui-btn-text'></D>" + | |
| ( o.icon ? "<span class='" + iconClass + "'></span>" : "" ) + | |
| "</D>" ).replace( /D/g, o.wrapperEls ); | |
| el.wrapInner( wrap ); | |
| }); | |
| }; | |
| $.fn.buttonMarkup.defaults = { | |
| corners: true, | |
| shadow: true, | |
| iconshadow: true, | |
| wrapperEls: "span" | |
| }; | |
| function closestEnabledButton( element ) { | |
| while ( element ) { | |
| var $ele = $( element ); | |
| if ( $ele.hasClass( "ui-btn" ) && !$ele.hasClass( "ui-disabled" ) ) { | |
| break; | |
| } | |
| element = element.parentNode; | |
| } | |
| return element; | |
| } | |
| var attachEvents = function() { | |
| $( document ).bind( { | |
| "vmousedown": function( event ) { | |
| var btn = closestEnabledButton( event.target ), | |
| $btn, theme; | |
| if ( btn ) { | |
| $btn = $( btn ); | |
| theme = $btn.attr( "data-" + $.mobile.ns + "theme" ); | |
| $btn.removeClass( "ui-btn-up-" + theme ).addClass( "ui-btn-down-" + theme ); | |
| } | |
| }, | |
| "vmousecancel vmouseup": function( event ) { | |
| var btn = closestEnabledButton( event.target ), | |
| $btn, theme; | |
| if ( btn ) { | |
| $btn = $( btn ); | |
| theme = $btn.attr( "data-" + $.mobile.ns + "theme" ); | |
| $btn.removeClass( "ui-btn-down-" + theme ).addClass( "ui-btn-up-" + theme ); | |
| } | |
| }, | |
| "vmouseover focus": function( event ) { | |
| var btn = closestEnabledButton( event.target ), | |
| $btn, theme; | |
| if ( btn ) { | |
| $btn = $( btn ); | |
| theme = $btn.attr( "data-" + $.mobile.ns + "theme" ); | |
| $btn.removeClass( "ui-btn-up-" + theme ).addClass( "ui-btn-hover-" + theme ); | |
| } | |
| }, | |
| "vmouseout blur": function( event ) { | |
| var btn = closestEnabledButton( event.target ), | |
| $btn, theme; | |
| if ( btn ) { | |
| $btn = $( btn ); | |
| theme = $btn.attr( "data-" + $.mobile.ns + "theme" ); | |
| $btn.removeClass( "ui-btn-hover-" + theme ).addClass( "ui-btn-up-" + theme ); | |
| } | |
| } | |
| }); | |
| attachEvents = null; | |
| }; | |
| //links in bars, or those with data-role become buttons | |
| //auto self-init widgets | |
| $( document ).bind( "pagecreate create", function( e ){ | |
| $( ":jqmData(role='button'), .ui-bar > a, .ui-header > a, .ui-footer > a, .ui-bar > :jqmData(role='controlgroup') > a", e.target ) | |
| .not( ".ui-btn, :jqmData(role='none'), :jqmData(role='nojs')" ) | |
| .buttonMarkup(); | |
| }); | |
| })( jQuery ); | |
| /* | |
| * jQuery Mobile Framework: "controlgroup" plugin - corner-rounding for groups of buttons, checks, radios, etc | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| (function( $, undefined ) { | |
| $.fn.controlgroup = function( options ) { | |
| return this.each(function() { | |
| var $el = $( this ), | |
| o = $.extend({ | |
| direction: $el.jqmData( "type" ) || "vertical", | |
| shadow: false, | |
| excludeInvisible: true | |
| }, options ), | |
| groupheading = $el.find( ">legend" ), | |
| flCorners = o.direction == "horizontal" ? [ "ui-corner-left", "ui-corner-right" ] : [ "ui-corner-top", "ui-corner-bottom" ], | |
| type = $el.find( "input:eq(0)" ).attr( "type" ); | |
| // Replace legend with more stylable replacement div | |
| if ( groupheading.length ) { | |
| $el.wrapInner( "<div class='ui-controlgroup-controls'></div>" ); | |
| $( "<div role='heading' class='ui-controlgroup-label'>" + groupheading.html() + "</div>" ).insertBefore( $el.children(0) ); | |
| groupheading.remove(); | |
| } | |
| $el.addClass( "ui-corner-all ui-controlgroup ui-controlgroup-" + o.direction ); | |
| // TODO: This should be moved out to the closure | |
| // otherwise it is redefined each time controlgroup() is called | |
| function flipClasses( els ) { | |
| els.removeClass( "ui-btn-corner-all ui-shadow" ) | |
| .eq( 0 ).addClass( flCorners[ 0 ] ) | |
| .end() | |
| .filter( ":last" ).addClass( flCorners[ 1 ] ).addClass( "ui-controlgroup-last" ); | |
| } | |
| flipClasses( $el.find( ".ui-btn" + ( o.excludeInvisible ? ":visible" : "" ) ) ); | |
| flipClasses( $el.find( ".ui-btn-inner" ) ); | |
| if ( o.shadow ) { | |
| $el.addClass( "ui-shadow" ); | |
| } | |
| }); | |
| }; | |
| //auto self-init widgets | |
| $( document ).bind( "pagecreate create", function( e ){ | |
| $( ":jqmData(role='controlgroup')", e.target ).controlgroup({ excludeInvisible: false }); | |
| }); | |
| })(jQuery);/* | |
| * jQuery Mobile Framework : "fieldcontain" plugin - simple class additions to make form row separators | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| (function( $, undefined ) { | |
| $( document ).bind( "pagecreate create", function( e ){ | |
| //links within content areas | |
| $( e.target ) | |
| .find( "a" ) | |
| .not( ".ui-btn, .ui-link-inherit, :jqmData(role='none'), :jqmData(role='nojs')" ) | |
| .addClass( "ui-link" ); | |
| }); | |
| })( jQuery );/* | |
| * jQuery Mobile Framework : "fixHeaderFooter" plugin - on-demand positioning for headers,footers | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| (function( $, undefined ) { | |
| var slideDownClass = "ui-header-fixed ui-fixed-inline fade", | |
| slideUpClass = "ui-footer-fixed ui-fixed-inline fade", | |
| slideDownSelector = ".ui-header:jqmData(position='fixed')", | |
| slideUpSelector = ".ui-footer:jqmData(position='fixed')"; | |
| $.fn.fixHeaderFooter = function( options ) { | |
| if ( !$.support.scrollTop ) { | |
| return this; | |
| } | |
| return this.each(function() { | |
| var $this = $( this ); | |
| if ( $this.jqmData( "fullscreen" ) ) { | |
| $this.addClass( "ui-page-fullscreen" ); | |
| } | |
| // Should be slidedown | |
| $this.find( slideDownSelector ).addClass( slideDownClass ); | |
| // Should be slideup | |
| $this.find( slideUpSelector ).addClass( slideUpClass ); | |
| }); | |
| }; | |
| // single controller for all showing,hiding,toggling | |
| $.mobile.fixedToolbars = (function() { | |
| if ( !$.support.scrollTop ) { | |
| return; | |
| } | |
| var stickyFooter, delayTimer, | |
| currentstate = "inline", | |
| autoHideMode = false, | |
| showDelay = 100, | |
| ignoreTargets = "a,input,textarea,select,button,label,.ui-header-fixed,.ui-footer-fixed", | |
| toolbarSelector = ".ui-header-fixed:first, .ui-footer-fixed:not(.ui-footer-duplicate):last", | |
| // for storing quick references to duplicate footers | |
| supportTouch = $.support.touch, | |
| touchStartEvent = supportTouch ? "touchstart" : "mousedown", | |
| touchStopEvent = supportTouch ? "touchend" : "mouseup", | |
| stateBefore = null, | |
| scrollTriggered = false, | |
| touchToggleEnabled = true; | |
| function showEventCallback( event ) { | |
| // An event that affects the dimensions of the visual viewport has | |
| // been triggered. If the header and/or footer for the current page are in overlay | |
| // mode, we want to hide them, and then fire off a timer to show them at a later | |
| // point. Events like a resize can be triggered continuously during a scroll, on | |
| // some platforms, so the timer is used to delay the actual positioning until the | |
| // flood of events have subsided. | |
| // | |
| // If we are in autoHideMode, we don't do anything because we know the scroll | |
| // callbacks for the plugin will fire off a show when the scrolling has stopped. | |
| if ( !autoHideMode && currentstate === "overlay" ) { | |
| if ( !delayTimer ) { | |
| $.mobile.fixedToolbars.hide( true ); | |
| } | |
| $.mobile.fixedToolbars.startShowTimer(); | |
| } | |
| } | |
| $(function() { | |
| var $document = $( document ), | |
| $window = $( window ); | |
| $document | |
| .bind( "vmousedown", function( event ) { | |
| if ( touchToggleEnabled ) { | |
| stateBefore = currentstate; | |
| } | |
| }) | |
| .bind( "vclick", function( event ) { | |
| if ( touchToggleEnabled ) { | |
| if ( $(event.target).closest( ignoreTargets ).length ) { | |
| return; | |
| } | |
| if ( !scrollTriggered ) { | |
| $.mobile.fixedToolbars.toggle( stateBefore ); | |
| stateBefore = null; | |
| } | |
| } | |
| }) | |
| .bind( "silentscroll", showEventCallback ); | |
| // The below checks first for a $(document).scrollTop() value, and if zero, binds scroll events to $(window) instead. | |
| // If the scrollTop value is actually zero, both will return zero anyway. | |
| // | |
| // Works with $(document), not $(window) : Opera Mobile (WinMO phone; kinda broken anyway) | |
| // Works with $(window), not $(document) : IE 7/8 | |
| // Works with either $(window) or $(document) : Chrome, FF 3.6/4, Android 1.6/2.1, iOS | |
| // Needs work either way : BB5, Opera Mobile (iOS) | |
| ( ( $document.scrollTop() === 0 ) ? $window : $document ) | |
| .bind( "scrollstart", function( event ) { | |
| scrollTriggered = true; | |
| if ( stateBefore === null ) { | |
| stateBefore = currentstate; | |
| } | |
| // We only enter autoHideMode if the headers/footers are in | |
| // an overlay state or the show timer was started. If the | |
| // show timer is set, clear it so the headers/footers don't | |
| // show up until after we're done scrolling. | |
| var isOverlayState = stateBefore == "overlay"; | |
| autoHideMode = isOverlayState || !!delayTimer; | |
| if ( autoHideMode ) { | |
| $.mobile.fixedToolbars.clearShowTimer(); | |
| if ( isOverlayState ) { | |
| $.mobile.fixedToolbars.hide( true ); | |
| } | |
| } | |
| }) | |
| .bind( "scrollstop", function( event ) { | |
| if ( $( event.target ).closest( ignoreTargets ).length ) { | |
| return; | |
| } | |
| scrollTriggered = false; | |
| if ( autoHideMode ) { | |
| $.mobile.fixedToolbars.startShowTimer(); | |
| autoHideMode = false; | |
| } | |
| stateBefore = null; | |
| }); | |
| $window.bind( "resize", showEventCallback ); | |
| }); | |
| // 1. Before page is shown, check for duplicate footer | |
| // 2. After page is shown, append footer to new page | |
| $( ".ui-page" ) | |
| .live( "pagebeforeshow", function( event, ui ) { | |
| var page = $( event.target ), | |
| footer = page.find( ":jqmData(role='footer')" ), | |
| id = footer.data( "id" ), | |
| prevPage = ui.prevPage, | |
| prevFooter = prevPage && prevPage.find( ":jqmData(role='footer')" ), | |
| prevFooterMatches = prevFooter.length && prevFooter.jqmData( "id" ) === id; | |
| if ( id && prevFooterMatches ) { | |
| stickyFooter = footer; | |
| setTop( stickyFooter.removeClass( "fade in out" ).appendTo( $.mobile.pageContainer ) ); | |
| } | |
| }) | |
| .live( "pageshow", function( event, ui ) { | |
| var $this = $( this ); | |
| if ( stickyFooter && stickyFooter.length ) { | |
| setTimeout(function() { | |
| setTop( stickyFooter.appendTo( $this ).addClass( "fade" ) ); | |
| stickyFooter = null; | |
| }, 500); | |
| } | |
| $.mobile.fixedToolbars.show( true, this ); | |
| }); | |
| // When a collapsiable is hidden or shown we need to trigger the fixed toolbar to reposition itself (#1635) | |
| $( ".ui-collapsible-contain" ).live( "collapse expand", showEventCallback ); | |
| // element.getBoundingClientRect() is broken in iOS 3.2.1 on the iPad. The | |
| // coordinates inside of the rect it returns don't have the page scroll position | |
| // factored out of it like the other platforms do. To get around this, | |
| // we'll just calculate the top offset the old fashioned way until core has | |
| // a chance to figure out how to handle this situation. | |
| // | |
| // TODO: We'll need to get rid of getOffsetTop() once a fix gets folded into core. | |
| function getOffsetTop( ele ) { | |
| var top = 0, | |
| op, body; | |
| if ( ele ) { | |
| body = document.body; | |
| op = ele.offsetParent; | |
| top = ele.offsetTop; | |
| while ( ele && ele != body ) { | |
| top += ele.scrollTop || 0; | |
| if ( ele == op ) { | |
| top += op.offsetTop; | |
| op = ele.offsetParent; | |
| } | |
| ele = ele.parentNode; | |
| } | |
| } | |
| return top; | |
| } | |
| function setTop( el ) { | |
| var fromTop = $(window).scrollTop(), | |
| thisTop = getOffsetTop( el[ 0 ] ), // el.offset().top returns the wrong value on iPad iOS 3.2.1, call our workaround instead. | |
| thisCSStop = el.css( "top" ) == "auto" ? 0 : parseFloat(el.css( "top" )), | |
| screenHeight = window.innerHeight, | |
| thisHeight = el.outerHeight(), | |
| useRelative = el.parents( ".ui-page:not(.ui-page-fullscreen)" ).length, | |
| relval; | |
| if ( el.is( ".ui-header-fixed" ) ) { | |
| relval = fromTop - thisTop + thisCSStop; | |
| if ( relval < thisTop ) { | |
| relval = 0; | |
| } | |
| return el.css( "top", useRelative ? relval : fromTop ); | |
| } else { | |
| // relval = -1 * (thisTop - (fromTop + screenHeight) + thisCSStop + thisHeight); | |
| // if ( relval > thisTop ) { relval = 0; } | |
| relval = fromTop + screenHeight - thisHeight - (thisTop - thisCSStop ); | |
| return el.css( "top", useRelative ? relval : fromTop + screenHeight - thisHeight ); | |
| } | |
| } | |
| // Exposed methods | |
| return { | |
| show: function( immediately, page ) { | |
| $.mobile.fixedToolbars.clearShowTimer(); | |
| currentstate = "overlay"; | |
| var $ap = page ? $( page ) : | |
| ( $.mobile.activePage ? $.mobile.activePage : | |
| $( ".ui-page-active" ) ); | |
| return $ap.children( toolbarSelector ).each(function() { | |
| var el = $( this ), | |
| fromTop = $( window ).scrollTop(), | |
| // el.offset().top returns the wrong value on iPad iOS 3.2.1, call our workaround instead. | |
| thisTop = getOffsetTop( el[ 0 ] ), | |
| screenHeight = window.innerHeight, | |
| thisHeight = el.outerHeight(), | |
| alreadyVisible = ( el.is( ".ui-header-fixed" ) && fromTop <= thisTop + thisHeight ) || | |
| ( el.is( ".ui-footer-fixed" ) && thisTop <= fromTop + screenHeight ); | |
| // Add state class | |
| el.addClass( "ui-fixed-overlay" ).removeClass( "ui-fixed-inline" ); | |
| if ( !alreadyVisible && !immediately ) { | |
| el.animationComplete(function() { | |
| el.removeClass( "in" ); | |
| }).addClass( "in" ); | |
| } | |
| setTop(el); | |
| }); | |
| }, | |
| hide: function( immediately ) { | |
| currentstate = "inline"; | |
| var $ap = $.mobile.activePage ? $.mobile.activePage : | |
| $( ".ui-page-active" ); | |
| return $ap.children( toolbarSelector ).each(function() { | |
| var el = $(this), | |
| thisCSStop = el.css( "top" ), | |
| classes; | |
| thisCSStop = thisCSStop == "auto" ? 0 : | |
| parseFloat(thisCSStop); | |
| // Add state class | |
| el.addClass( "ui-fixed-inline" ).removeClass( "ui-fixed-overlay" ); | |
| if ( thisCSStop < 0 || ( el.is( ".ui-header-fixed" ) && thisCSStop !== 0 ) ) { | |
| if ( immediately ) { | |
| el.css( "top", 0); | |
| } else { | |
| if ( el.css( "top" ) !== "auto" && parseFloat( el.css( "top" ) ) !== 0 ) { | |
| classes = "out reverse"; | |
| el.animationComplete(function() { | |
| el.removeClass( classes ).css( "top", 0 ); | |
| }).addClass( classes ); | |
| } | |
| } | |
| } | |
| }); | |
| }, | |
| startShowTimer: function() { | |
| $.mobile.fixedToolbars.clearShowTimer(); | |
| var args = [].slice.call( arguments ); | |
| delayTimer = setTimeout(function() { | |
| delayTimer = undefined; | |
| $.mobile.fixedToolbars.show.apply( null, args ); | |
| }, showDelay); | |
| }, | |
| clearShowTimer: function() { | |
| if ( delayTimer ) { | |
| clearTimeout( delayTimer ); | |
| } | |
| delayTimer = undefined; | |
| }, | |
| toggle: function( from ) { | |
| if ( from ) { | |
| currentstate = from; | |
| } | |
| return ( currentstate === "overlay" ) ? $.mobile.fixedToolbars.hide() : | |
| $.mobile.fixedToolbars.show(); | |
| }, | |
| setTouchToggleEnabled: function( enabled ) { | |
| touchToggleEnabled = enabled; | |
| } | |
| }; | |
| })(); | |
| // TODO - Deprecated namepace on $. Remove in a later release | |
| $.fixedToolbars = $.mobile.fixedToolbars; | |
| //auto self-init widgets | |
| $( document ).bind( "pagecreate create", function( event ) { | |
| if ( $( ":jqmData(position='fixed')", event.target ).length ) { | |
| $( event.target ).each(function() { | |
| if ( !$.support.scrollTop ) { | |
| return this; | |
| } | |
| var $this = $( this ); | |
| if ( $this.jqmData( "fullscreen" ) ) { | |
| $this.addClass( "ui-page-fullscreen" ); | |
| } | |
| // Should be slidedown | |
| $this.find( slideDownSelector ).addClass( slideDownClass ); | |
| // Should be slideup | |
| $this.find( slideUpSelector ).addClass( slideUpClass ); | |
| }) | |
| } | |
| }); | |
| })( jQuery ); | |
| /* | |
| * jQuery Mobile Framework : resolution and CSS media query related helpers and behavior | |
| * Copyright (c) jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| (function( $, undefined ) { | |
| var $window = $( window ), | |
| $html = $( "html" ), | |
| //media-query-like width breakpoints, which are translated to classes on the html element | |
| resolutionBreakpoints = [ 320, 480, 768, 1024 ]; | |
| /* | |
| private function for adding/removing breakpoint classes to HTML element for faux media-query support | |
| It does not require media query support, instead using JS to detect screen width > cross-browser support | |
| This function is called on orientationchange, resize, and mobileinit, and is bound via the 'htmlclass' event namespace | |
| */ | |
| function detectResolutionBreakpoints() { | |
| var currWidth = $window.width(), | |
| minPrefix = "min-width-", | |
| maxPrefix = "max-width-", | |
| minBreakpoints = [], | |
| maxBreakpoints = [], | |
| unit = "px", | |
| breakpointClasses; | |
| $html.removeClass( minPrefix + resolutionBreakpoints.join(unit + " " + minPrefix) + unit + " " + | |
| maxPrefix + resolutionBreakpoints.join( unit + " " + maxPrefix) + unit ); | |
| $.each( resolutionBreakpoints, function( i, breakPoint ) { | |
| if( currWidth >= breakPoint ) { | |
| minBreakpoints.push( minPrefix + breakPoint + unit ); | |
| } | |
| if( currWidth <= breakPoint ) { | |
| maxBreakpoints.push( maxPrefix + breakPoint + unit ); | |
| } | |
| }); | |
| if ( minBreakpoints.length ) { | |
| breakpointClasses = minBreakpoints.join(" "); | |
| } | |
| if ( maxBreakpoints.length ) { | |
| breakpointClasses += " " + maxBreakpoints.join(" "); | |
| } | |
| $html.addClass( breakpointClasses ); | |
| }; | |
| /* $.mobile.addResolutionBreakpoints method: | |
| pass either a number or an array of numbers and they'll be added to the min/max breakpoint classes | |
| Examples: | |
| $.mobile.addResolutionBreakpoints( 500 ); | |
| $.mobile.addResolutionBreakpoints( [500, 1200] ); | |
| */ | |
| $.mobile.addResolutionBreakpoints = function( newbps ) { | |
| if( $.type( newbps ) === "array" ){ | |
| resolutionBreakpoints = resolutionBreakpoints.concat( newbps ); | |
| } else { | |
| resolutionBreakpoints.push( newbps ); | |
| } | |
| resolutionBreakpoints.sort(function( a, b ) { | |
| return a - b; | |
| }); | |
| detectResolutionBreakpoints(); | |
| }; | |
| /* on mobileinit, add classes to HTML element | |
| and set handlers to update those on orientationchange and resize | |
| */ | |
| $( document ).bind( "mobileinit.htmlclass", function() { | |
| // bind to orientationchange and resize | |
| // to add classes to HTML element for min/max breakpoints and orientation | |
| var ev = $.support.orientation; | |
| $window.bind( "orientationchange.htmlclass throttledResize.htmlclass", function( event ) { | |
| // add orientation class to HTML element on flip/resize. | |
| if ( event.orientation ) { | |
| $html.removeClass( "portrait landscape" ).addClass( event.orientation ); | |
| } | |
| // add classes to HTML element for min/max breakpoints | |
| detectResolutionBreakpoints(); | |
| }); | |
| }); | |
| /* Manually trigger an orientationchange event when the dom ready event fires. | |
| This will ensure that any viewport meta tag that may have been injected | |
| has taken effect already, allowing us to properly calculate the width of the | |
| document. | |
| */ | |
| $(function() { | |
| //trigger event manually | |
| $window.trigger( "orientationchange.htmlclass" ); | |
| }); | |
| })(jQuery);/*! | |
| * jQuery Mobile v@VERSION | |
| * http://jquerymobile.com/ | |
| * | |
| * Copyright 2010, jQuery Project | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| */ | |
| (function( $, window, undefined ) { | |
| var $html = $( "html" ), | |
| $head = $( "head" ), | |
| $window = $( window ); | |
| //trigger mobileinit event - useful hook for configuring $.mobile settings before they're used | |
| $( window.document ).trigger( "mobileinit" ); | |
| //support conditions | |
| //if device support condition(s) aren't met, leave things as they are -> a basic, usable experience, | |
| //otherwise, proceed with the enhancements | |
| if ( !$.mobile.gradeA() ) { | |
| return; | |
| } | |
| // override ajaxEnabled on platforms that have known conflicts with hash history updates | |
| // or generally work better browsing in regular http for full page refreshes (BB5, Opera Mini) | |
| if( $.mobile.ajaxBlacklist ){ | |
| $.mobile.ajaxEnabled = false; | |
| } | |
| //add mobile, initial load "rendering" classes to docEl | |
| $html.addClass( "ui-mobile ui-mobile-rendering" ); | |
| //loading div which appears during Ajax requests | |
| //will not appear if $.mobile.loadingMessage is false | |
| var $loader = $( "<div class='ui-loader ui-body-a ui-corner-all'><span class='ui-icon ui-icon-loading spin'></span><h1></h1></div>" ); | |
| $.extend($.mobile, { | |
| // turn on/off page loading message. | |
| showPageLoadingMsg: function() { | |
| if( $.mobile.loadingMessage ){ | |
| var activeBtn = $( "." + $.mobile.activeBtnClass ).first(); | |
| $loader | |
| .find( "h1" ) | |
| .text( $.mobile.loadingMessage ) | |
| .end() | |
| .appendTo( $.mobile.pageContainer ) | |
| //position at y center (if scrollTop supported), above the activeBtn (if defined), or just 100px from top | |
| .css( { | |
| top: $.support.scrollTop && $(window).scrollTop() + $(window).height() / 2 || | |
| activeBtn.length && activeBtn.offset().top || 100 | |
| } ); | |
| } | |
| $html.addClass( "ui-loading" ); | |
| }, | |
| hidePageLoadingMsg: function() { | |
| $html.removeClass( "ui-loading" ); | |
| }, | |
| // XXX: deprecate for 1.0 | |
| pageLoading: function ( done ) { | |
| if ( done ) { | |
| $.mobile.hidePageLoadingMsg(); | |
| } else { | |
| $.mobile.showPageLoadingMsg(); | |
| } | |
| }, | |
| // find and enhance the pages in the dom and transition to the first page. | |
| initializePage: function(){ | |
| //find present pages | |
| var $pages = $( ":jqmData(role='page')" ); | |
| //if no pages are found, create one with body's inner html | |
| if( !$pages.length ){ | |
| $pages = $( "body" ).wrapInner( "<div data-" + $.mobile.ns + "role='page'></div>" ).children( 0 ); | |
| } | |
| //add dialogs, set data-url attrs | |
| $pages.add( ":jqmData(role='dialog')" ).each(function(){ | |
| var $this = $(this); | |
| // unless the data url is already set set it to the id | |
| if( !$this.jqmData('url') ){ | |
| $this.attr( "data-" + $.mobile.ns + "url", $this.attr( "id" ) ); | |
| } | |
| }); | |
| //define first page in dom case one backs out to the directory root (not always the first page visited, but defined as fallback) | |
| $.mobile.firstPage = $pages.first(); | |
| //define page container | |
| $.mobile.pageContainer = $pages.first().parent().addClass( "ui-mobile-viewport" ); | |
| //cue page loading message | |
| $.mobile.showPageLoadingMsg(); | |
| // if hashchange listening is disabled or there's no hash deeplink, change to the first page in the DOM | |
| if( !$.mobile.hashListeningEnabled || !$.mobile.path.stripHash( location.hash ) ){ | |
| $.mobile.changePage( $.mobile.firstPage, { transition: "none", reverse: true, changeHash: false, fromHashChange: true } ); | |
| } | |
| // otherwise, trigger a hashchange to load a deeplink | |
| else { | |
| $window.trigger( "hashchange", [ true ] ); | |
| } | |
| } | |
| }); | |
| //initialize events now, after mobileinit has occurred | |
| $.mobile._registerInternalEvents(); | |
| //check which scrollTop value should be used by scrolling to 1 immediately at domready | |
| //then check what the scroll top is. Android will report 0... others 1 | |
| //note that this initial scroll won't hide the address bar. It's just for the check. | |
| $(function(){ | |
| window.scrollTo( 0, 1 ); | |
| //if defaultHomeScroll hasn't been set yet, see if scrollTop is 1 | |
| //it should be 1 in most browsers, but android treats 1 as 0 (for hiding addr bar) | |
| //so if it's 1, use 0 from now on | |
| $.mobile.defaultHomeScroll = ( !$.support.scrollTop || $(window).scrollTop() === 1 ) ? 0 : 1; | |
| //dom-ready inits | |
| if( $.mobile.autoInitializePage ){ | |
| $( $.mobile.initializePage ); | |
| } | |
| //window load event | |
| //hide iOS browser chrome on load | |
| $window.load( $.mobile.silentScroll ); | |
| }); | |
| })( jQuery, this ); | |
| <?php | <?php |
| include ('../include/common.inc.php'); | include ('../include/common.inc.php'); |
| $debugOkay = Array(); | $debugOkay = Array(); |
| /* | /* |
| *DISCLAIMER | *DISCLAIMER |
| * http://blog.gmapify.fr/create-beautiful-tiled-heat-maps-with-php-and-gd | * http://blog.gmapify.fr/create-beautiful-tiled-heat-maps-with-php-and-gd |
| *THIS SOFTWARE IS PROVIDED BY THE AUTHOR 'AS IS' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES *OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, *INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF *USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT *(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. | *THIS SOFTWARE IS PROVIDED BY THE AUTHOR 'AS IS' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES *OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, *INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF *USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT *(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. |
| * | * |
| * @author: Olivier G. <olbibigo_AT_gmail_DOT_com> | * @author: Olivier G. <olbibigo_AT_gmail_DOT_com> |
| * @version: 1.0 | * @version: 1.0 |
| * @history: | * @history: |
| * 1.0 creation | * 1.0 creation |
| */ | */ |
| set_time_limit(120);//2mn | set_time_limit(120);//2mn |
| ini_set('memory_limit', '256M'); | ini_set('memory_limit', '256M'); |
| error_reporting(E_ALL ^ E_DEPRECATED); | error_reporting(E_ALL ^ E_DEPRECATED); |
| require_once ('lib/GoogleMapUtility.php'); | require_once ($labsPath . 'lib/GoogleMapUtility.php'); |
| require_once ('lib/HeatMap.php'); | require_once ($labsPath . 'lib/HeatMap.php'); |
| //Root folder to store generated tiles | //Root folder to store generated tiles |
| define('TILE_DIR', 'tiles/'); | define('TILE_DIR', 'tiles/'); |
| //Covered geographic areas | //Covered geographic areas |
| define('MIN_LAT', -35.48); | define('MIN_LAT', -35.48); |
| define('MAX_LAT', -35.15); | define('MAX_LAT', -35.15); |
| define('MIN_LNG', 148.98); | define('MIN_LNG', 148.98); |
| define('MAX_LNG', 149.25); | define('MAX_LNG', 149.25); |
| define('TILE_SIZE_FACTOR', 0.5); | define('TILE_SIZE_FACTOR', 0.5); |
| define('SPOT_RADIUS', 30); | define('SPOT_RADIUS', 30); |
| define('SPOT_DIMMING_LEVEL', 50); | define('SPOT_DIMMING_LEVEL', 50); |
| //Input parameters | //Input parameters |
| if(isset($_GET['x'])) | if(isset($_GET['x'])) |
| $X = (int)$_GET['x']; | $X = (int)$_GET['x']; |
| else | else |
| exit("x missing"); | exit("x missing"); |
| if(isset($_GET['y'])) | if(isset($_GET['y'])) |
| $Y = (int)$_GET['y']; | $Y = (int)$_GET['y']; |
| else | else |
| exit("y missing"); | exit("y missing"); |
| if(isset($_GET['zoom'])) | if(isset($_GET['zoom'])) |
| $zoom = (int)$_GET['zoom']; | $zoom = (int)$_GET['zoom']; |
| else | else |
| exit("zoom missing"); | exit("zoom missing"); |
| if ($zoom < 12) { //enforce minimum zoom | if ($zoom < 12) { //enforce minimum zoom |
| header('Content-type: image/png'); | header('Content-type: image/png'); |
| echo file_get_contents(TILE_DIR.'empty.png'); | echo file_get_contents(TILE_DIR.'empty.png'); |
| } | } |
| $dir = TILE_DIR.$zoom; | $dir = TILE_DIR.$zoom; |
| $tilename = $dir.'/'.$X.'_'.$Y.'.png'; | $tilename = $dir.'/'.$X.'_'.$Y.'.png'; |
| //HTTP headers (data type and caching rule) | //HTTP headers (data type and caching rule) |
| header("Cache-Control: must-revalidate"); | header("Cache-Control: must-revalidate"); |
| header("Expires: " . gmdate("D, d M Y H:i:s", time() + 86400) . " GMT"); | header("Expires: " . gmdate("D, d M Y H:i:s", time() + 86400) . " GMT"); |
| if(!file_exists($tilename)){ | if(!file_exists($tilename)){ |
| $rect = GoogleMapUtility::getTileRect($X, $Y, $zoom); | $rect = GoogleMapUtility::getTileRect($X, $Y, $zoom); |
| //A tile can contain part of a spot with center in an adjacent tile (overlaps). | //A tile can contain part of a spot with center in an adjacent tile (overlaps). |
| //Knowing the spot radius (in pixels) and zoom level, a smart way to process tiles would be to compute the box (in decimal degrees) containing only spots that can be drawn on current tile. We choose a simpler solution by increeasing geo bounds by 2*TILE_SIZE_FACTOR whatever the zoom level and spot radius. | //Knowing the spot radius (in pixels) and zoom level, a smart way to process tiles would be to compute the box (in decimal degrees) containing only spots that can be drawn on current tile. We choose a simpler solution by increeasing geo bounds by 2*TILE_SIZE_FACTOR whatever the zoom level and spot radius. |
| $extend_X = $rect->width * TILE_SIZE_FACTOR;//in decimal degrees | $extend_X = $rect->width * TILE_SIZE_FACTOR;//in decimal degrees |
| $extend_Y = $rect->height * TILE_SIZE_FACTOR;//in decimal degrees | $extend_Y = $rect->height * TILE_SIZE_FACTOR;//in decimal degrees |
| $swlat = $rect->y - $extend_Y; | $swlat = $rect->y - $extend_Y; |
| $swlng = $rect->x - $extend_X; | $swlng = $rect->x - $extend_X; |
| $nelat = $swlat + $rect->height + 2 * $extend_Y; | $nelat = $swlat + $rect->height + 2 * $extend_Y; |
| $nelng = $swlng + $rect->width + 2 * $extend_X; | $nelng = $swlng + $rect->width + 2 * $extend_X; |
| if( ($nelat <= MIN_LAT) || ($swlat >= MAX_LAT) || ($nelng <= MIN_LNG) || ($swlng >= MAX_LNG)){ | if( ($nelat <= MIN_LAT) || ($swlat >= MAX_LAT) || ($nelng <= MIN_LNG) || ($swlng >= MAX_LNG)){ |
| //No geodata so return generic empty tile | //No geodata so return generic empty tile |
| echo file_get_contents(TILE_DIR.'empty.png'); | echo file_get_contents(TILE_DIR.'empty.png'); |
| exit(); | exit(); |
| } | } |
| //Get McDonald's spots | //Get McDonald's spots |
| $spots = fGetPOI('Select * from stops where | $spots = fGetPOI('Select * from stops where |
| (stop_lon > '.$swlng.' AND stop_lon < '.$nelng.') | (stop_lon > '.$swlng.' AND stop_lon < '.$nelng.') |
| AND (stop_lat < '.$nelat.' AND stop_lat > '.$swlat.')', $im, $X, $Y, $zoom, SPOT_RADIUS); | AND (stop_lat < '.$nelat.' AND stop_lat > '.$swlat.')', $im, $X, $Y, $zoom, SPOT_RADIUS); |
| if(empty($spots)){ | if(empty($spots)){ |
| //No geodata so return generic empty tile | //No geodata so return generic empty tile |
| header('Content-type: image/png'); | header('Content-type: image/png'); |
| echo file_get_contents(TILE_DIR.'empty.png'); | echo file_get_contents(TILE_DIR.'empty.png'); |
| }else{ | }else{ |
| if(!file_exists($dir)){ | if(!file_exists($dir)){ |
| mkdir($dir, 0705); | mkdir($dir, 0705); |
| } | } |
| //All the magics is in HeatMap class :) | //All the magics is in HeatMap class :) |
| $im = HeatMap::createImage($spots, GoogleMapUtility::TILE_SIZE, GoogleMapUtility::TILE_SIZE, heatMap::$WITH_ALPHA, SPOT_RADIUS, SPOT_DIMMING_LEVEL, HeatMap::$GRADIENT_FIRE); | $im = HeatMap::createImage($spots, GoogleMapUtility::TILE_SIZE, GoogleMapUtility::TILE_SIZE, heatMap::$WITH_ALPHA, SPOT_RADIUS, SPOT_DIMMING_LEVEL, HeatMap::$GRADIENT_FIRE); |
| //Store tile for reuse and output it | //Store tile for reuse and output it |
| header('content-type:image/png;'); | header('content-type:image/png;'); |
| imagepng($im, $tilename); | imagepng($im, $tilename); |
| echo file_get_contents($tilename); | echo file_get_contents($tilename); |
| imagedestroy($im); | imagedestroy($im); |
| unset($im); | unset($im); |
| } | } |
| }else{ | }else{ |
| //Output stored tile | //Output stored tile |
| header('content-type:image/png;'); | header('content-type:image/png;'); |
| echo file_get_contents($tilename); | echo file_get_contents($tilename); |
| } | } |
| ///////////// | ///////////// |
| //Functions// | //Functions// |
| ///////////// | ///////////// |
| function fGetPOI($query, &$im, $X, $Y, $zoom, $offset){ | function fGetPOI($query, &$im, $X, $Y, $zoom, $offset){ |
| global $conn; | global $conn; |
| $nbPOIInsideTile = 0; | $nbPOIInsideTile = 0; |
| $result = pg_query($conn, $query); | |
| $spots = Array(); | $spots = Array(); |
| if (!$result) { | $query = $conn->prepare($query); |
| databaseError(pg_result_error($result)); | $query->execute(); |
| if (!$query) { | |
| databaseError($conn->errorInfo()); | |
| return Array(); | return Array(); |
| } | } |
| foreach( pg_fetch_all($result) as $row){ | foreach( $query->fetchAll() as $row){ |
| $point = GoogleMapUtility::getOffsetPixelCoords($row['stop_lat'], $row['stop_lon'], $zoom, $X, $Y); | $point = GoogleMapUtility::getOffsetPixelCoords($row['stop_lat'], $row['stop_lon'], $zoom, $X, $Y); |
| //Count result only in the tile | //Count result only in the tile |
| if( ($point->x > -$offset) && ($point->x < (GoogleMapUtility::TILE_SIZE+$offset)) && ($point->y > -$offset) && ($point->y < (GoogleMapUtility::TILE_SIZE+$offset))){ | if( ($point->x > -$offset) && ($point->x < (GoogleMapUtility::TILE_SIZE+$offset)) && ($point->y > -$offset) && ($point->y < (GoogleMapUtility::TILE_SIZE+$offset))){ |
| $spots[] = new HeatMapPoint($point->x, $point->y); | $spots[] = new HeatMapPoint($point->x, $point->y); |
| } | } |
| }//while | }//while |
| return $spots; | return $spots; |
| }//fAddPOI | }//fAddPOI |
| ?> | ?> |
| <?php | <?php |
| include ('../include/common.inc.php'); | include ('../include/common.inc.php'); |
| include_header("Busness R&D", "index") | include_header("Busness R&D", "index") |
| ?> | ?> |
| <ul data-role="listview" data-theme="e" data-groupingtheme="e"> | <ul data-role="listview" data-theme="e" data-groupingtheme="e"> |
| <li data-role="list-divider" > Experimental Features </li> | <li data-role="list-divider" > Experimental Features </li> |
| <li><a href="mywaybalance.php"><h3>MyWay Balance for mobile</h3> | <li><a href="mywaybalance.php"><h3>MyWay Balance for mobile</h3> |
| <p>Mobile viewer for MyWay balance. Warning! No HTTPS security.</p></a></li> | <p>Mobile viewer for MyWay balance. Warning! No HTTPS security.</p></a></li> |
| <li><a href="networkstats.php"><h3>Route Statistics</h3> | |
| <p>Analysis of route timing points</p></a></li> | |
| <li><a href="busstopdensity.php"><h3>Bus Stop Density Map</h3> | <li><a href="busstopdensity.php"><h3>Bus Stop Density Map</h3> |
| <p>Analysis of bus stop coverage</p></a></li> | <p>Analysis of bus stop coverage</p></a></li> |
| <li><a href="stopBrowser.php"><h3>Bus Stop Browser Map</h3> | <li><a href="stopBrowser.php"><h3>Bus Stop Browser Map</h3> |
| <p>Bus stop location/route browser</p></a></li> | <p>Bus stop location/route browser</p></a></li> |
| <li>More coming soon!</li> | </ul> |
| <ul data-role="listview" data-theme="e" data-groupingtheme="e"> | |
| <li data-role="list-divider" > MyWay Timeliness Graphs </li> | |
| <li><a href="myway_timeliness.php"><h3>Timeliness over Day</h3> | |
| <p>Displays the deviation from the timetable over the day</p></a></li> | |
| <li><a href="myway_timeliness_freqdist.php"><h3>Frequency Distribution of Time Deviation</h3> | |
| <p>Displays spread of time deviations</p></a></li> | |
| <li><a href="myway_timeliness_route.php"><h3>Timeliness over Route</h3> | |
| <p>Displays the deviation from timetable as a specific route progresses</p></a></li> | |
| <li><a href="myway_timeliness_stop.php"><h3>Timeliness at Stop</h3> | |
| <p>Displays the deviation from the timetable at a specific stop</p></a></li> | |
| </ul> | </ul> |
| </div> | </div> |
| <?php | <?php |
| include_footer() | include_footer() |
| ?> | ?> |
| <?php | <?php |
| function cleanString($subject) | function cleanString($subject) |
| { | { |
| $subject = str_replace(" ", " ", $subject); | $subject = str_replace(" ", " ", $subject); |
| $subject = str_replace("&", "&", $subject); | $subject = str_replace("&", "&", $subject); |
| $subject = preg_replace('/[^\r\n\t\x20-\x7E\xA0-\xFF]/', '', $subject); | $subject = preg_replace('/[^\r\n\t\x20-\x7E\xA0-\xFF]/', '', $subject); |
| $subject = str_replace(" ", " ", $subject); | $subject = str_replace(" ", " ", $subject); |
| return trim($subject); | return trim($subject); |
| } | } |
| $return = Array(); | $return = Array(); |
| /*if (file_exists("mywayresponse.txt")) { | /*if (file_exists("mywayresponse.txt")) { |
| @$fh = fopen("mywayresponse.txt", 'r'); | @$fh = fopen("mywayresponse.txt", 'r'); |
| if ($fh) { | if ($fh) { |
| $pageHTML = fread($fh, filesize("mywayresponse.txt")); | $pageHTML = fread($fh, filesize("mywayresponse.txt")); |
| fclose($fh); | fclose($fh); |
| } | } |
| }*/ | }*/ |
| //set POST variables | //set POST variables |
| $url = 'https://www.action.act.gov.au/ARTS/use_Funcs.asp'; | $url = 'https://www.action.act.gov.au/ARTS/use_Funcs.asp'; |
| //$url = 'http://localhost/myway.htm'; | |
| $field_mapping = Array( | $field_mapping = Array( |
| "card_number" => "SRNO", | "card_number" => "SRNO", |
| "DOBmonth" => "month", | "DOBmonth" => "month", |
| "DOBday" => "day", | "DOBday" => "day", |
| "DOByear" => "year", | "DOByear" => "year", |
| "secret_answer" => "pwrd", | "secret_answer" => "pwrd", |
| "button" => "Submit" | "button" => "Submit" |
| ); | ); |
| foreach (Array( | foreach (Array( |
| "card_number", | "card_number", |
| "DOBday", | "DOBday", |
| "DOBmonth", | "DOBmonth", |
| "DOByear" | "DOByear" |
| ) as $field_name) { | ) as $field_name) { |
| if (isset($_REQUEST[$field_name])) { | if (isset($_REQUEST[$field_name])) { |
| $fields[$field_name] = filter_var($_REQUEST[$field_name], FILTER_SANITIZE_NUMBER_INT); | $fields[$field_name] = filter_var($_REQUEST[$field_name], FILTER_SANITIZE_NUMBER_INT); |
| } | } |
| else { | else { |
| $return["error"][] = $field_name. " parameter invalid or unspecified"; | $return["error"][] = $field_name. " parameter invalid or unspecified"; |
| } | } |
| } | } |
| if (isset($_REQUEST['secret_answer'])) { | if (isset($_REQUEST['secret_answer'])) { |
| $fields['secret_answer'] = filter_var($_REQUEST['secret_answer'], FILTER_SANITIZE_STRING, Array( | $fields['secret_answer'] = filter_var($_REQUEST['secret_answer'], FILTER_SANITIZE_STRING, Array( |
| FILTER_FLAG_NO_ENCODE_QUOTES, | FILTER_FLAG_NO_ENCODE_QUOTES, |
| FILTER_FLAG_STRIP_HIGH, | FILTER_FLAG_STRIP_HIGH, |
| FILTER_FLAG_STRIP_LOW | FILTER_FLAG_STRIP_LOW |
| )); | )); |
| } | } |
| else { | else { |
| $return["error"][] = "secret_answer parameter invalid or unspecified"; | $return["error"][] = "secret_answer parameter invalid or unspecified"; |
| } | } |
| $fields['button'] = 'Submit'; | $fields['button'] = 'Submit'; |
| $fields_string = ""; | $fields_string = ""; |
| //url-ify the data for the POST | //url-ify the data for the POST |
| foreach ($fields as $key => $value) { | foreach ($fields as $key => $value) { |
| if (sizeof($value) === 0) $return['error'][] = $key . " parameter invalid or unspecified"; | if (sizeof($value) === 0) $return['error'][] = $key . " parameter invalid or unspecified"; |
| $fields_string.= $field_mapping[$key] . '=' . $value . '&'; | $fields_string.= $field_mapping[$key] . '=' . $value . '&'; |
| } | } |
| $fields_string = rtrim($fields_string, '&'); | $fields_string = rtrim($fields_string, '&'); |
| if (!isset($return['error'])) { | if (!isset($return['error'])) { |
| //open connection | //open connection |
| $ch = curl_init(); | $ch = curl_init(); |
| //set the url, number of POST vars, POST data | //set the url, number of POST vars, POST data |
| curl_setopt($ch, CURLOPT_URL, $url); | curl_setopt($ch, CURLOPT_URL, $url); |
| curl_setopt($ch, CURLOPT_POST, count($fields)); | curl_setopt($ch, CURLOPT_POST, count($fields)); |
| curl_setopt($ch, CURLOPT_POSTFIELDS, $fields_string); | curl_setopt($ch, CURLOPT_POSTFIELDS, $fields_string); |
| curl_setopt($ch, CURLOPT_RETURNTRANSFER, 1); | curl_setopt($ch, CURLOPT_RETURNTRANSFER, 1); |
| curl_setopt($ch, CURLOPT_REFERER, "https://www.action.act.gov.au/ARTS/getbalance.asp"); | curl_setopt($ch, CURLOPT_REFERER, "https://www.action.act.gov.au/ARTS/getbalance.asp"); |
| curl_setopt($ch, CURLOPT_HEADER, 0); | curl_setopt($ch, CURLOPT_HEADER, 0); |
| curl_setopt($ch, CURLOPT_TIMEOUT, 30); | curl_setopt($ch, CURLOPT_TIMEOUT, 30); |
| //execute post | //execute post |
| $pageHTML = curl_exec($ch); | $pageHTML = curl_exec($ch); |
| if (curl_errno($ch)) $return["error"][] = "Network error " . curl_errno($ch) . " " . curl_error($ch) . " " . $url . $fields_string; | if (curl_errno($ch)) $return["error"][] = "Network error " . curl_errno($ch) . " " . curl_error($ch) . " " . $url . $fields_string; |
| //close connection | //close connection |
| curl_close($ch); | curl_close($ch); |
| } | } |
| if (!isset($return['error'])) { | if (!isset($return['error'])) { |
| include_once ('lib/simple_html_dom.php'); | include_once ('../lib/simple_html_dom.php'); |
| //print_r($pageHTML); | //print_r($pageHTML); |
| $page = str_get_html($pageHTML); | $page = str_get_html($pageHTML); |
| $pageAlerts = $page->find(".smartCardAlert"); | $pageAlerts = $page->find(".smartCardAlert"); |
| if (sizeof($pageAlerts) > 0) { | if (sizeof($pageAlerts) > 0) { |
| $return['error'][] = $pageAlerts[0]->plaintext; | $return['error'][] = $pageAlerts[0]->plaintext; |
| } | } |
| if (!isset($return['error'])) { | if (!isset($return['error'])) { |
| $tableNum = 0; | $tableNum = 0; |
| $tableName = Array( | $tableName = Array( |
| 1 => "myway_carddetails", | 1 => "myway_carddetails", |
| 2 => "myway_transactions" | 2 => "myway_transactions" |
| ); | ); |
| foreach ($page->find("table") as $table) { | foreach ($page->find("table") as $table) { |
| $tableNum++; | $tableNum++; |
| $tableColumns = Array(); | $tableColumns = Array(); |
| $tableColumnNum = 0; | $tableColumnNum = 0; |
| foreach ($table->find("th") as $th) { | foreach ($table->find("th") as $th) { |
| $tableColumns[$tableColumnNum] = cleanString($th->plaintext); | $tableColumns[$tableColumnNum] = cleanString($th->plaintext); |
| $tableColumnNum++; | $tableColumnNum++; |
| } | } |
| //print_r($tableColumns); | //print_r($tableColumns); |
| $tableRowNum = 0; | $tableRowNum = 0; |
| foreach ($table->find("tr") as $tr) { | foreach ($table->find("tr") as $tr) { |
| $tableColumnNum = 0; | $tableColumnNum = 0; |
| foreach ($tr->find("td") as $td) { | foreach ($tr->find("td") as $td) { |
| if ($tableNum == 1) $return[$tableName[$tableNum]][$tableColumns[$tableColumnNum]] = cleanString($td->plaintext); | if ($tableNum == 1) { |
| else $return[$tableName[$tableNum]][$tableRowNum][$tableColumns[$tableColumnNum]] = cleanString($td->plaintext); | // first table has card/cardholder details |
| $return[$tableName[$tableNum]][$tableColumns[$tableColumnNum]] = cleanString($td->plaintext); | |
| } else { | |
| // second table has transactions | |
| if ($tableColumns[$tableColumnNum] == "TX Reference No / Type") { | |
| $return[$tableName[$tableNum]][$tableRowNum]["TX Reference No"] = substr(cleanString($td->plaintext), 0,6); | |
| $return[$tableName[$tableNum]][$tableRowNum]["TX Type"] = substr(cleanString($td->plaintext), 7); | |
| } else { | |
| $return[$tableName[$tableNum]][$tableRowNum][$tableColumns[$tableColumnNum]] = cleanString($td->plaintext); | |
| } | |
| } | |
| //print_r($return); | //print_r($return); |
| $tableColumnNum++; | $tableColumnNum++; |
| } | } |
| $tableRowNum++; | $tableRowNum++; |
| } | } |
| } | } |
| } | } |
| } | } |
| if (sizeof($return) == 0) { | if (sizeof($return) == 0) { |
| $return['error'][] = "No data extracted from MyWay website - API may be out of date"; | $return['error'][] = "No data extracted from MyWay website - API may be out of date"; |
| } | } |
| if (basename(__FILE__) == "myway_api.json.php") { | |
| header('Content-Type: text/javascript; charset=utf8'); | header('Content-Type: text/javascript; charset=utf8'); |
| // header('Access-Control-Allow-Origin: http://bus.lambdacomplex.org/'); | // header('Access-Control-Allow-Origin: http://bus.lambdacomplex.org/'); |
| header('Access-Control-Max-Age: 3628800'); | header('Access-Control-Max-Age: 3628800'); |
| header('Access-Control-Allow-Methods: GET, POST, PUT, DELETE'); | header('Access-Control-Allow-Methods: GET, POST, PUT, DELETE'); |
| if (isset($_GET['callback'])) { | if (isset($_GET['callback'])) { |
| $json = '(' . json_encode($return) . ');'; //must wrap in parens and end with semicolon | $json = '(' . json_encode($return) . ');'; //must wrap in parens and end with semicolon |
| print_r($_GET['callback'] . $json); //callback is prepended for json-p | print_r($_GET['callback'] . $json); //callback is prepended for json-p |
| } | } |
| else echo json_encode($return); | else echo json_encode($return); |
| } | |
| ?> | ?> |
| <?php | |
| include ('../include/common.inc.php'); | |
| include_header("MyWay Deltas", "mywayDelta"); | |
| ?> | |
| <!--[if lte IE 8]><script language="javascript" type="text/javascript" src="../js/flot/excanvas.min.js"></script><![endif]--> | |
| <script language="javascript" type="text/javascript" src="../js/flot/jquery.flot.js"></script> | |
| <center><div id="placeholder" style="width:900px;height:550px"></div></center> | |
| <script type="text/javascript"> | |
| $(function () { | |
| var d = new Date(); | |
| d.setUTCMinutes(0); | |
| d.setUTCHours(0); | |
| var midnight = d.getTime(); | |
| <?php | |
| $query = "select * from myway_timingdeltas where abs(timing_delta) < 2*(select stddev(timing_delta) from myway_timingdeltas) order by route_full_name;"; | |
| $query = $conn -> prepare($query); | |
| $query -> execute(); | |
| if (!$query) { | |
| databaseError($conn -> errorInfo()); | |
| return Array(); | |
| } | |
| $i = 0; | |
| $labels = Array(); | |
| $lastRoute = ""; | |
| foreach ($query -> fetchAll() as $delta) { | |
| $routeName = $delta['route_full_name']; | |
| if (strstr($routeName, " 3")) $routeName = "312-319"; | |
| else $routeName = preg_replace('/\D/', '', $routeName); | |
| if ($routeName != $lastRoute) { | |
| $i++; | |
| echo " var d$i = [];"; | |
| $lastRoute = $routeName; | |
| $labels[$i] = $routeName; | |
| } | |
| echo "d$i.push([ midnight+ (1000*" . midnight_seconds(strtotime($delta['time'])) . "), " . intval($delta['timing_delta']) . "]); \n"; | |
| } ; | |
| ?> | |
| var placeholder = $("#placeholder"); | |
| var plot = $.plot(placeholder, [ | |
| <?php | |
| foreach ($labels as $key => $label) { | |
| echo " { | |
| data: d$key, | |
| points: { show: true }, | |
| label: '$label' | |
| },"; | |
| } | |
| ?> | |
| ], | |
| { | |
| xaxis: { | |
| mode: "time", | |
| min: midnight + (1000*60*60*8), | |
| max: midnight + (1000*60*60*23.5) | |
| }, | |
| yaxis: { | |
| tickFormatter: yformatter | |
| }, | |
| grid: { hoverable: true, clickable: true, labelMargin: 32 }, | |
| }); | |
| var o; | |
| o = plot.pointOffset({ x: midnight+ (9*60*60*1000), y: -1.2}); | |
| placeholder.append('<div style="position:absolute;left:' + (o.left + 4) + 'px;top:' + o.top + 'px;color:#666;font-size:smaller">9am</div>'); | |
| o = plot.pointOffset({ x: midnight+ (16*60*60*1000), y: -1.2}); | |
| placeholder.append('<div style="position:absolute;left:' + (o.left + 4) + 'px;top:' + o.top + 'px;color:#666;font-size:smaller">4pm</div>'); | |
| }); | |
| function yformatter(v) { | |
| if (Math.floor(v/60) < -9) return ""; | |
| return Math.abs(Math.floor(v/60)) + " min " + (v == 0 ? "" : (v >0 ? "early":"late")) | |
| } | |
| function showTooltip(x, y, contents) { | |
| $('<div id="tooltip">' + contents + '</div>').css( { | |
| position: 'absolute', | |
| display: 'none', | |
| top: y + 5, | |
| left: x + 5, | |
| border: '1px solid #fdd', | |
| padding: '2px', | |
| 'background-color': '#fee', | |
| opacity: 0.80 | |
| }).appendTo("body").fadeIn(200); | |
| } | |
| var previousPoint = null; | |
| $("#placeholder").bind("plothover", function (event, pos, item) { | |
| $("#x").text(pos.x.toFixed(2)); | |
| $("#y").text(pos.y.toFixed(2)); | |
| if (item) { | |
| if (previousPoint != item.dataIndex) { | |
| previousPoint = item.dataIndex; | |
| $("#tooltip").remove(); | |
| var x = item.datapoint[0].toFixed(2), | |
| y = item.datapoint[1].toFixed(2); | |
| var d = new Date(); | |
| d.setTime(x); | |
| var time = d.getUTCHours() +':'+ (d.getUTCMinutes().toString().length == 1 ? '0'+ d.getMinutes(): d.getUTCMinutes()) | |
| showTooltip(item.pageX, item.pageY, | |
| item.series.label + " at "+ time +" = " + Math.abs(new Number(y/60).toFixed(2))+" minutes "+(y >0 ? "early":"late")); | |
| } | |
| } | |
| else { | |
| $("#tooltip").remove(); | |
| previousPoint = null; | |
| } | |
| }); | |
| </script> |
| <?php | |
| include ('../include/common.inc.php'); | |
| include_header("MyWay Delta Calculate", "mywayDeltaCalc"); | |
| flush(); | |
| ob_flush(); | |
| function abssort($a, $b) | |
| { | |
| if ($a['timeDiff'] == $b['timeDiff']) { | |
| return 0; | |
| } | |
| return (abs($a['timeDiff']) < abs($b['timeDiff'])) ? -1 : 1; | |
| } | |
| //collect all observation not in delta | |
| $query = "select * from myway_observations INNER JOIN myway_stops | |
| ON myway_observations.myway_stop=myway_stops.myway_stop INNER JOIN myway_routes | |
| ON myway_observations.myway_route=myway_routes.myway_route | |
| WHERE observation_id NOT IN | |
| ( | |
| SELECT observation_id | |
| FROM myway_timingdeltas | |
| )"; | |
| debug($query, "database"); | |
| $query = $conn->prepare($query); | |
| $query->execute(); | |
| if (!$query) { | |
| databaseError($conn->errorInfo()); | |
| return Array(); | |
| } | |
| $uncalcdObservations = $query->fetchAll(); | |
| //Display count | |
| echo "<h3>" . sizeof($uncalcdObservations) . " observations not yet processed</h2>"; | |
| //foreach observation not in delta | |
| foreach ($uncalcdObservations as $obsv) { | |
| //var_dump($obsv); | |
| echo "<h3>Observation {$obsv['observation_id']}:</h1> | |
| <small>{$obsv['myway_stop']} @ {$obsv['time']} on {$obsv['myway_route']}</small><br>"; | |
| if ($obsv["stop_code"] == "") { | |
| echo "error, stop '{$obsv['myway_stop']}' unknown"; | |
| continue; | |
| } | |
| if ($obsv["route_full_name"] == "") { | |
| echo "error, route '{$obsv['myway_route']}' unknown"; | |
| continue; | |
| } | |
| // convert timestamp into time of day and date | |
| // timezones from http://www.postgresql.org/docs/8.0/static/datetime-keywords.html | |
| $time = date("H:i:s", strtotime($obsv['time'])); | |
| $time_tz = date("H:i:s", strtotime($obsv['time']))." AESST"; | |
| $search_time = date("H:i:s", strtotime($obsv['time'])-(30*60)); // 30 minutes margin | |
| $date = date("c", strtotime($obsv['time'])); | |
| $timing_period = service_period(strtotime($date)); | |
| $potentialStops = getStopsByStopCode($obsv["stop_code"], $obsv["stop_street"]); | |
| //:get myway_stops records | |
| //:search by starts with stopcode and starts with street if street is not null | |
| //no result, skip and display error | |
| if (sizeof($potentialStops) < 1) { | |
| echo "error, potential stops for stopcode {$obsv["stop_code"]} street {$obsv["stop_street"]} unknown"; | |
| continue; | |
| } | |
| //print out stops | |
| echo "Matched stops: "; | |
| foreach ($potentialStops as $potentialStop) echo $potentialStop['stop_code'] . " "; | |
| echo "<br>"; | |
| //:get myway_route record | |
| //no result, skip and display error | |
| //print out route | |
| $potentialRoute = getRouteByFullName($obsv["route_full_name"]); | |
| if ($potentialRoute["route_short_name"] == "") { | |
| echo "error, route '{$obsv["route_full_name"]}' unknown"; | |
| continue; | |
| } | |
| echo "Matched route: {$potentialRoute['route_short_name']}{$potentialRoute['route_long_name']} {$timing_period}<br>"; | |
| $timeDeltas = Array(); | |
| foreach ($potentialStops as $potentialStop) { | |
| $stopRoutes = getStopRoutes($potentialStop['stop_id'], $timing_period); | |
| $foundRoute = Array(); | |
| foreach ($stopRoutes as $stopRoute) { | |
| //Check if this route stops at each stop | |
| if ($stopRoute['route_short_name'] . $stopRoute['route_long_name'] == $obsv["route_full_name"]) { | |
| echo "Matching route {$stopRoute['route_id']} found at {$potentialStop['stop_code']}<br>"; | |
| $foundRoute = $stopRoute; | |
| //if does get tripstoptimes for this route | |
| $trips = getStopTrips($potentialStop['stop_id'], $timing_period, $search_time); | |
| foreach ($trips as $trip) { | |
| //echo $trip['route_id']." ".$stopRoute['route_id'].";"; | |
| if ($trip['route_id'] == $stopRoute['route_id']) { | |
| $timedTrip = getTimeInterpolatedTripAtStop($trip['trip_id'], $trip['stop_sequence']); | |
| $actual_time = strtotime($time); | |
| $trip_time = strtotime($timedTrip['arrival_time']); | |
| $timeDiff = $actual_time - $trip_time; | |
| //work out time delta, put into array with index of delta | |
| $timeDeltas[] = Array( | |
| "timeDiff" => $timeDiff, | |
| "stop_code" => $potentialStop['stop_code'], | |
| "stop_sequence" => $timedTrip['stop_sequence'] | |
| ); | |
| echo "Found trip {$trip['trip_id']} at stop {$potentialStop['stop_code']} (#{$potentialStop['stop_id']}, sequence #{$trip['stop_sequence']})<br>"; | |
| echo "Arriving at {$timedTrip['arrival_time']}, difference of " . round($timeDiff / 60, 2) . " minutes<br>"; | |
| } | |
| } | |
| break; // because have found route | |
| } | |
| } | |
| if (sizeof($foundRoute) < 1) { | |
| //print out that stops/does not stop | |
| echo "No matching routes found at {$potentialStop['stop_code']}<br>"; | |
| var_dump($stopRoutes); | |
| flush(); | |
| } | |
| } | |
| // lowest delta is recorded delta | |
| usort($timeDeltas, "abssort"); | |
| $lowestDelta = $timeDeltas[0]["timeDiff"]; | |
| if (sizeof($timeDeltas) != 0) { | |
| echo "Lowest difference of " . round($lowestDelta / 60, 2) . " minutes will be recorded for this observation<br>"; | |
| $observation_id = $obsv['observation_id']; | |
| $route_full_name = $obsv['route_full_name']; | |
| $stop_code = $timeDeltas[0]["stop_code"]; | |
| $stop_sequence = $timeDeltas[0]["stop_sequence"]; | |
| $stmt = $conn->prepare("insert into myway_timingdeltas (observation_id, route_full_name, stop_code, timing_delta, time, date, timing_period, stop_sequence) | |
| values (:observation_id, :route_full_name, :stop_code, :timing_delta, :time, :date, :timing_period, :stop_sequence)"); | |
| $stmt->bindParam(':observation_id', $observation_id); | |
| $stmt->bindParam(':route_full_name', $route_full_name); | |
| $stmt->bindParam(':stop_code', $stop_code); | |
| $stmt->bindParam(':timing_delta', $lowestDelta); | |
| $stmt->bindParam(':time', $time_tz); | |
| $stmt->bindParam(':date', $date); | |
| $stmt->bindParam(':timing_period', $timing_period); | |
| $stmt->bindParam(':stop_sequence', $stop_sequence); | |
| // insert a record | |
| $stmt->execute(); | |
| if ($stmt->rowCount() > 0) { | |
| echo "Recorded.<br>"; | |
| } | |
| var_dump($conn->errorInfo()); | |
| flush(); | |
| } | |
| flush(); | |
| } | |
| <?php | |
| include ('../include/common.inc.php'); | |
| include_header("MyWay Deltas", "mywayDelta"); | |
| ?> | |
| <!--[if lte IE 8]><script language="javascript" type="text/javascript" src="../js/flot/excanvas.min.js"></script><![endif]--> | |
| <script language="javascript" type="text/javascript" src="../js/flot/jquery.flot.js"></script> | |
| <center><div id="placeholder" style="width:900px;height:550px"></div></center> | |
| <script type="text/javascript"> | |
| $(function () { | |
| var d1 = []; | |
| <?php | |
| $query = "select td, count(*) from (select (timing_delta - MOD(timing_delta,10)) as td from myway_timingdeltas where abs(timing_delta) < 2*(select stddev(timing_delta) from myway_timingdeltas)) as a group by td order by td"; | |
| $query = $conn->prepare($query); | |
| $query->execute(); | |
| if (!$query) { | |
| databaseError($conn->errorInfo()); | |
| return Array(); | |
| } | |
| foreach ($query->fetchAll() as $delta) { | |
| echo "d1.push([ ".intval($delta['td']).", ".intval($delta['count'])."]); \n"; | |
| }; | |
| ?> | |
| var placeholder = $("#placeholder"); | |
| var plot = $.plot(placeholder, [ | |
| { | |
| data: d1, | |
| bars: { show: true } | |
| }, | |
| ], | |
| { | |
| grid: { hoverable: true, clickable: true, labelMargin: 17 }, | |
| }); | |
| }); | |
| </script> |
| <?php | |
| include ('../include/common.inc.php'); | |
| include_header("MyWay Deltas", "mywayDelta"); | |
| ?> | |
| <table> | |
| <tr><td></td><td>Mean</td><td>Standard<br>Deviation</td><td>Sample Size</td></tr> | |
| <th> Overall </th> | |
| <?php | |
| $query = "select '', avg(timing_delta), stddev(timing_delta), count(*) from myway_timingdeltas "; | |
| $query = $conn->prepare($query); | |
| $query->execute(); | |
| if (!$query) { | |
| databaseError($conn->errorInfo()); | |
| return Array(); | |
| } | |
| foreach ($query->fetchAll() as $row) { | |
| echo "<tr><td>{$row[0]}</td><td>" . floor($row[1]) . "</td><td>" . floor($row[2]) . "</td><td>{$row[3]}</td></tr>"; | |
| }; | |
| ?> | |
| <th> Hour of Day </th> | |
| <?php | |
| $query = "select extract(hour from time), avg(timing_delta), stddev(timing_delta), count(*) from myway_timingdeltas group by extract(hour from time) order by extract(hour from time)"; | |
| $query = $conn->prepare($query); | |
| $query->execute(); | |
| if (!$query) { | |
| databaseError($conn->errorInfo()); | |
| return Array(); | |
| } | |
| foreach ($query->fetchAll() as $row) { | |
| echo "<tr><td>{$row[0]}</td><td>" . floor($row[1]) . "</td><td>" . floor($row[2]) . "</td><td>{$row[3]}</td></tr>"; | |
| }; | |
| ?> | |
| <th> Day of Week </th> | |
| <?php | |
| $query = "select to_char(date, 'Day'), avg(timing_delta), stddev(timing_delta), count(*) from myway_timingdeltas group by to_char(date, 'Day') order by to_char(date, 'Day')"; | |
| $query = $conn->prepare($query); | |
| $query->execute(); | |
| if (!$query) { | |
| databaseError($conn->errorInfo()); | |
| return Array(); | |
| } | |
| foreach ($query->fetchAll() as $row) { | |
| echo "<tr><td>{$row[0]}</td><td>" . floor($row[1]) . "</td><td>" . floor($row[2]) . "</td><td>{$row[3]}</td></tr>"; | |
| }; | |
| ?> | |
| <th>Month </th> | |
| <?php | |
| $query = "select to_char(date, 'Month'), avg(timing_delta), stddev(timing_delta), count(*) from myway_timingdeltas group by to_char(date, 'Month') order by to_char(date, 'Month')"; | |
| $query = $conn->prepare($query); | |
| $query->execute(); | |
| if (!$query) { | |
| databaseError($conn->errorInfo()); | |
| return Array(); | |
| } | |
| foreach ($query->fetchAll() as $row) { | |
| echo "<tr><td>{$row[0]}</td><td>" . floor($row[1]) . "</td><td>" . floor($row[2]) . "</td><td>{$row[3]}</td></tr>"; | |
| }; | |
| ?> | |
| <th>Stop </th> | |
| <?php | |
| $query = "select myway_stop, avg(timing_delta), stddev(timing_delta), count(*) from myway_timingdeltas INNER JOIN myway_observations | |
| ON myway_observations.observation_id=myway_timingdeltas.observation_id group by myway_stop having count(*) > 1 order by myway_stop"; | |
| $query = $conn->prepare($query); | |
| $query->execute(); | |
| if (!$query) { | |
| databaseError($conn->errorInfo()); | |
| return Array(); | |
| } | |
| foreach ($query->fetchAll() as $row) { | |
| echo "<tr><td>{$row[0]}</td><td>" . floor($row[1]) . "</td><td>" . floor($row[2]) . "</td><td>{$row[3]}</td></tr>"; | |
| }; | |
| ?> | |
| <th>Route </th> | |
| <?php | |
| $query = "select route_full_name, avg(timing_delta), stddev(timing_delta), count(*) from myway_timingdeltas group by route_full_name having count(*) > 1 order by route_full_name"; | |
| $query = $conn->prepare($query); | |
| $query->execute(); | |
| if (!$query) { | |
| databaseError($conn->errorInfo()); | |
| return Array(); | |
| } | |
| foreach ($query->fetchAll() as $row) { | |
| echo "<tr><td>{$row[0]}</td><td>" . floor($row[1]) . "</td><td>" . floor($row[2]) . "</td><td>{$row[3]}</td></tr>"; | |
| }; | |
| ?> | |
| </table> | |
| <?php | |
| include_footer(); | |
| ?> | |
| <?php | |
| include ('../include/common.inc.php'); | |
| foreach ($_REQUEST as $key => $value) { | |
| if (strstr($key, "route") && !strstr($value, "Select")) { | |
| $myway_route = str_replace("route", "", $key); | |
| $route_full_name = $value; | |
| $query = "update myway_routes set route_full_name = :route_full_name where myway_route = :myway_route"; | |
| debug($query, "database"); | |
| $query = $conn->prepare($query); | |
| $query->bindParam(":myway_route", $myway_route,PDO::PARAM_STR, 5); | |
| $query->bindParam(":route_full_name", $route_full_name,PDO::PARAM_STR, 42); | |
| $query->execute(); | |
| die(print_r($conn->errorInfo() , true)); | |
| } | |
| if (strstr($key, "myway_stop")) { | |
| $myway_stop = $value; | |
| $stop_code = $_REQUEST['stop_code']; | |
| $stop_street = $_REQUEST['stop_street']; | |
| $query = "update myway_stops set stop_code = :stop_code, stop_street = :stop_street where myway_stop = :myway_stop"; | |
| debug($query, "database"); | |
| $query = $conn->prepare($query); | |
| $query->bindParam(":myway_stop", $myway_stop, PDO::PARAM_STR, 25); | |
| $query->bindParam(":stop_code", $stop_code, PDO::PARAM_STR, 32); | |
| $query->bindParam(":stop_street", $stop_street); | |
| $query->execute(); | |
| die(print_r($conn->errorInfo() , true)); | |
| } | |
| } | |
| include_header("MyWay Data Reconcile", "mywayTimeRec"); | |
| // initialise | |
| $count = $conn->exec("insert into myway_stops | |
| select distinct myway_stop from myway_observations | |
| WHERE myway_stop NOT IN | |
| ( | |
| SELECT myway_stop | |
| FROM myway_stops | |
| )"); | |
| echo "$count new stops.<br>"; | |
| if (!$count) { | |
| print_r($conn->errorInfo()); | |
| } | |
| $count = $conn->exec("insert into myway_routes select distinct myway_route from myway_observations | |
| WHERE myway_route NOT IN | |
| ( | |
| SELECT myway_route | |
| FROM myway_routes | |
| )"); | |
| echo "$count new routes.<br>"; | |
| if (!$count) { | |
| print_r($conn->errorInfo()); | |
| } | |
| echo "<h2>Stops</h2>"; | |
| /*stops | |
| search start of name, display map and table nuimbered, two text boxes */ | |
| $query = "Select * from myway_stops where stop_code is NULL and stop_street is NUll;"; | |
| debug($query, "database"); | |
| $query = $conn->prepare($query); | |
| $query->execute(); | |
| if (!$query) { | |
| databaseError($conn->errorInfo()); | |
| return Array(); | |
| } | |
| foreach ($query->fetchAll() as $myway_stop) { | |
| echo "<h3>{$myway_stop[0]}</h3>"; | |
| $stopNameParts = explode(" ", $myway_stop[0]); | |
| $markers = array(); | |
| $stopKey = 1; | |
| $foundStops = getStops(false, "", $stopNameParts[0] . " " . $stopNameParts[1]); | |
| if (sizeof($foundStops) > 0) { | |
| echo "<table>"; | |
| foreach ($foundStops as $stopResult) { | |
| $markers[] = array( | |
| $stopResult['stop_lat'], | |
| $stopResult['stop_lon'] | |
| ); | |
| echo "<tr><td>" . $stopKey++ . "</td><td>" . $stopResult['stop_name'] . "</td><td>" . $stopResult['stop_code'] . "</td></tr>"; | |
| } | |
| echo '</table>'; | |
| echo "" . staticmap($markers, 0, "icong", false) . "<br>\n"; | |
| } | |
| echo '<form id="inputform' .md5($myway_stop[0]).'"> | |
| <input type="hidden" name="myway_stop" value="' .$myway_stop[0].'"> | |
| <div data-role="fieldcontain"> | |
| <label for="stop_code">Stop Code</label> | |
| <input type="text" name="stop_code" id="stop_code" value="' . $foundStops[0]['stop_code'] . '" /> | |
| </div> | |
| <div data-role="fieldcontain"> | |
| <label for="stop_street">Stop Street </label> | |
| <input type="text" name="stop_street" id="stop_street" value="' . $foundStops[0]['stop_name'] . '" /> | |
| </div> <input type="button" onclick="$.post(\'myway_timeliness_reconcile.php\', $(\'#inputform' .md5($myway_stop[0]) . '\').serialize())" value="Go!"></form> | |
| '; | |
| echo '<hr>'; | |
| } | |
| echo '<h2>Routes</h2>'; | |
| /*routes | |
| remove alpha char, search present dropdown*/ | |
| $query = "Select * from myway_routes where route_full_name is NUll;"; | |
| debug($query, "database"); | |
| $query = $conn->prepare($query); | |
| $query->execute(); | |
| if (!$query) { | |
| databaseError($conn->errorInfo()); | |
| return Array(); | |
| } | |
| foreach ($query->fetchAll() as $myway_route) { | |
| echo "<h3>{$myway_route[0]}</h3>"; | |
| $query = "Select * from myway_observations where myway_route = :route order by time"; | |
| debug($query, "database"); | |
| $query = $conn->prepare($query); | |
| $query->bindParam(":route", $myway_route[0]); | |
| $query->execute(); | |
| if (!$query) { | |
| databaseError($conn->errorInfo()); | |
| return Array(); | |
| } | |
| foreach ($query->fetchAll() as $myway_obvs) { | |
| echo $myway_obvs['myway_stop'] . $myway_obvs['time'] . "<br>"; | |
| } | |
| $searchRouteNo = preg_replace("/[A-Z]/", "", $myway_route[0]); | |
| echo $searchRouteNo; | |
| echo '<form id="inputform' . $myway_route[0] . '"> | |
| <select name="route' . $myway_route[0] . '" onchange=\'$.post("myway_timeliness_reconcile.php", $("#inputform' . $myway_route[0] . '").serialize())\'> | |
| <option>Select a from/to pair...</option>'; | |
| foreach (getRoutesByNumber($searchRouteNo) as $routeResult) { | |
| echo "<option value=\"{$routeResult['route_short_name']}{$routeResult['route_long_name']}\"> {$routeResult['route_short_name']}{$routeResult['route_long_name']} </option>\n"; | |
| } | |
| echo "</select></form>"; | |
| echo '<hr>'; | |
| } | |
| include_footer(); | |
| ?> | |
| <?php | |
| include ('../include/common.inc.php'); | |
| header('Content-Type: text/javascript; charset=utf8'); | |
| // header('Access-Control-Allow-Origin: http://bus.lambdacomplex.org/'); | |
| header('Access-Control-Max-Age: 3628800'); | |
| header('Access-Control-Allow-Methods: GET, POST, PUT, DELETE'); | |
| ?> | |
| { | |
| "label": "<?php echo $_REQUEST['routeid']; ?>", | |
| "data": <?php | |
| $query = "select * from myway_timingdeltas where route_full_name = :route_full_name AND abs(timing_delta) < 2*(select stddev(timing_delta) from myway_timingdeltas) order by stop_sequence;"; | |
| $query = $conn->prepare($query); | |
| $query->bindParam(':route_full_name', $_REQUEST['routeid'],PDO::PARAM_STR, 42); | |
| $query->execute(); | |
| if (!$query) { | |
| databaseError($conn->errorInfo()); | |
| return Array(); | |
| } | |
| foreach ($query->fetchAll() as $delta) { | |
| $points[] = "[{$delta['stop_sequence']}, {$delta['timing_delta']}]"; | |
| }; | |
| echo "[".implode(",",$points)."]"; | |
| ?> | |
| } |
| <?php | |
| include ('../include/common.inc.php'); | |
| include_header("MyWay Deltas", "mywayDelta"); | |
| ?> | |
| <!--[if lte IE 8]><script language="javascript" type="text/javascript" src="../js/flot/excanvas.min.js"></script><![endif]--> | |
| <script language="javascript" type="text/javascript" src="../js/flot/jquery.flot.js"></script> | |
| <form method="get" action=""> | |
| <select id="routeid" name="routeid"> | |
| <?php | |
| $query = "select distinct route_full_name from myway_routes where myway_route != '' order by route_full_name"; | |
| $query = $conn->prepare($query); | |
| $query->execute(); | |
| if (!$query) { | |
| databaseError($conn->errorInfo()); | |
| return Array(); | |
| } | |
| foreach ($query->fetchAll() as $route) { | |
| echo "<option value=\"{$route['route_full_name']}\">{$route['route_full_name']}</option>"; | |
| }; | |
| ?> </select> | |
| <center><div id="placeholder" style="width:900px;height:550px"></div></center> | |
| <script type="text/javascript"> | |
| $(function () { | |
| var placeholder = $("#placeholder"); | |
| var data = []; | |
| var options = { | |
| xaxis: { | |
| }, | |
| yaxis: { | |
| tickFormatter: yformatter | |
| }, | |
| grid: { hoverable: true, clickable: true, labelMargin: 32 }, | |
| series: { | |
| lines: { show: false }, | |
| points: { show: true } | |
| } | |
| }; | |
| var plot = $.plot(placeholder, data, options); | |
| // fetch one series, adding to what we got | |
| var alreadyFetched = {}; | |
| $("#routeid").change(function () { | |
| var select = $(this); | |
| // find the URL in the link right next to us | |
| // var dataurl = button.siblings('a').attr('href'); | |
| var dataurl = "myway_timeliness_route.json.php?routeid=" + select.val(); | |
| // then fetch the data with jQuery | |
| function onDataReceived(series) { | |
| // extract the first coordinate pair so you can see that | |
| // data is now an ordinary Javascript object | |
| var firstcoordinate = '(' + series.data[0][0] + ', ' + series.data[0][1] + ')'; | |
| // let's add it to our current data | |
| if (!alreadyFetched[series.label]) { | |
| alreadyFetched[series.label] = true; | |
| data.push(series); | |
| } | |
| // and plot all we got | |
| $.plot(placeholder, data, options); | |
| } | |
| $.ajax({ | |
| url: dataurl, | |
| method: 'GET', | |
| dataType: 'json', | |
| success: onDataReceived | |
| }); | |
| }); | |
| }); | |
| function yformatter(v) { | |
| if (Math.floor(v/60) < -9) return ""; | |
| return Math.abs(Math.floor(v/60)) + " min " + (v == 0 ? "" : (v >0 ? "early":"late")) | |
| } | |
| function showTooltip(x, y, contents) { | |
| $('<div id="tooltip">' + contents + '</div>').css( { | |
| position: 'absolute', | |
| display: 'none', | |
| top: y + 5, | |
| left: x + 5, | |
| border: '1px solid #fdd', | |
| padding: '2px', | |
| 'background-color': '#fee', | |
| opacity: 0.80 | |
| }).appendTo("body").fadeIn(200); | |
| } | |
| var previousPoint = null; | |
| $("#placeholder").bind("plothover", function (event, pos, item) { | |
| $("#x").text(pos.x.toFixed(2)); | |
| $("#y").text(pos.y.toFixed(2)); | |
| if (item) { | |
| if (previousPoint != item.dataIndex) { | |
| previousPoint = item.dataIndex; | |
| $("#tooltip").remove(); | |
| var x = item.datapoint[0], | |
| y = item.datapoint[1].toFixed(2); | |
| showTooltip(item.pageX, item.pageY, | |
| item.series.label + " at stop_sequence "+ x +" = " + Math.abs(new Number(y/60).toFixed(2))+" minutes "+(y >0 ? "early":"late")); | |
| } | |
| } | |
| else { | |
| $("#tooltip").remove(); | |
| previousPoint = null; | |
| } | |
| }); | |
| </script> | |
| <?php | |
| include ('../include/common.inc.php'); | |
| header('Content-Type: text/javascript; charset=utf8'); | |
| // header('Access-Control-Allow-Origin: http://bus.lambdacomplex.org/'); | |
| header('Access-Control-Max-Age: 3628800'); | |
| header('Access-Control-Allow-Methods: GET, POST, PUT, DELETE'); | |
| ?> | |
| { | |
| "label": "<?php echo $_REQUEST['stopid']; ?>", | |
| "data": <?php | |
| $query = "select * from myway_timingdeltas INNER JOIN myway_observations | |
| ON myway_observations.observation_id=myway_timingdeltas.observation_id | |
| where myway_stop = :myway_stop | |
| AND abs(timing_delta) < 2*(select stddev(timing_delta) from myway_timingdeltas) | |
| order by myway_timingdeltas.time;"; | |
| $query = $conn->prepare($query); | |
| $query->bindParam(':myway_stop', $_REQUEST['stopid'],PDO::PARAM_STR, 42); | |
| $query->execute(); | |
| if (!$query) { | |
| databaseError($conn->errorInfo()); | |
| return Array(); | |
| } | |
| foreach ($query->fetchAll() as $delta) { | |
| $points[] = "[".((strtotime("00:00Z") + midnight_seconds(strtotime($delta['time'])))*1000).", {$delta['timing_delta']}]"; | |
| }; | |
| if (count($points) == 0) { | |
| echo "[]"; } | |
| else echo "[".implode(",",$points)."]"; | |
| ?> | |
| } | |
| <?php | |
| include ('../include/common.inc.php'); | |
| include_header("MyWay Deltas", "mywayDelta"); | |
| ?> | |
| <!--[if lte IE 8]><script language="javascript" type="text/javascript" src="../js/flot/excanvas.min.js"></script><![endif]--> | |
| <script language="javascript" type="text/javascript" src="../js/flot/jquery.flot.js"></script> | |
| <form method="get" action=""> | |
| <select id="stopid" name="stopid"> | |
| <?php | |
| $query = "select distinct myway_stop from myway_stops where myway_stop != '' order by myway_stop"; | |
| $query = $conn->prepare($query); | |
| $query->execute(); | |
| if (!$query) { | |
| databaseError($conn->errorInfo()); | |
| return Array(); | |
| } | |
| foreach ($query->fetchAll() as $stop) { | |
| echo "<option value=\"{$stop['myway_stop']}\">{$stop['myway_stop']}</option>"; | |
| }; | |
| ?> </select> <center><div id="placeholder" style="width:900px;height:550px"></div></center> | |
| <script type="text/javascript"> | |
| $(function () { | |
| var d = new Date(); | |
| d.setUTCMinutes(0); | |
| d.setUTCHours(0); | |
| var midnight = d.getTime(); | |
| var placeholder = $("#placeholder"); | |
| var data = []; | |
| var options = { | |
| xaxis: { | |
| mode: "time", | |
| min: midnight + (1000*60*60*8), | |
| max: midnight + (1000*60*60*23.5) | |
| }, | |
| yaxis: { | |
| tickFormatter: yformatter | |
| }, | |
| grid: { hoverable: true, clickable: true, labelMargin: 32 }, | |
| series: { | |
| lines: { show: false }, | |
| points: { show: true } | |
| } | |
| }; | |
| var plot = $.plot(placeholder, data, options); | |
| var o; | |
| o = plot.pointOffset({ x: midnight+ (9*60*60*1000), y: -1.2}); | |
| placeholder.append('<div style="position:absolute;left:' + (o.left + 4) + 'px;top:' + o.top + 'px;color:#666;font-size:smaller">9am</div>'); | |
| o = plot.pointOffset({ x: midnight+ (16*60*60*1000), y: -1.2}); | |
| placeholder.append('<div style="position:absolute;left:' + (o.left + 4) + 'px;top:' + o.top + 'px;color:#666;font-size:smaller">4pm</div>'); | |
| // fetch one series, adding to what we got | |
| var alreadyFetched = {}; | |
| $("#stopid").change(function () { | |
| var select = $(this); | |
| // find the URL in the link right next to us | |
| // var dataurl = button.siblings('a').attr('href'); | |
| var dataurl = "myway_timeliness_stop.json.php?stopid=" + select.val(); | |
| // then fetch the data with jQuery | |
| function onDataReceived(series) { | |
| // extract the first coordinate pair so you can see that | |
| // data is now an ordinary Javascript object | |
| var firstcoordinate = '(' + series.data[0][0] + ', ' + series.data[0][1] + ')'; | |
| // let's add it to our current data | |
| if (!alreadyFetched[series.label]) { | |
| alreadyFetched[series.label] = true; | |
| data.push(series); | |
| } | |
| // and plot all we got | |
| $.plot(placeholder, data, options); | |
| } | |
| $.ajax({ | |
| url: dataurl, | |
| method: 'GET', | |
| dataType: 'json', | |
| success: onDataReceived | |
| }); | |
| }); | |
| }); | |
| function yformatter(v) { | |
| if (Math.floor(v/60) < -9) return ""; | |
| return Math.abs(Math.floor(v/60)) + " min " + (v == 0 ? "" : (v >0 ? "early":"late")) | |
| } | |
| function showTooltip(x, y, contents) { | |
| $('<div id="tooltip">' + contents + '</div>').css( { | |
| position: 'absolute', | |
| display: 'none', | |
| top: y + 5, | |
| left: x + 5, | |
| border: '1px solid #fdd', | |
| padding: '2px', | |
| 'background-color': '#fee', | |
| opacity: 0.80 | |
| }).appendTo("body").fadeIn(200); | |
| } | |
| var previousPoint = null; | |
| $("#placeholder").bind("plothover", function (event, pos, item) { | |
| $("#x").text(pos.x.toFixed(2)); | |
| $("#y").text(pos.y.toFixed(2)); | |
| if (item) { | |
| if (previousPoint != item.dataIndex) { | |
| previousPoint = item.dataIndex; | |
| $("#tooltip").remove(); | |
| var x = item.datapoint[0].toFixed(2), | |
| y = item.datapoint[1].toFixed(2); | |
| var d = new Date(); | |
| d.setTime(x); | |
| var time = d.getUTCHours() +':'+ (d.getUTCMinutes().toString().length == 1 ? '0'+ d.getMinutes(): d.getUTCMinutes()) | |
| showTooltip(item.pageX, item.pageY, | |
| item.series.label + " at "+ time +" = " + Math.abs(new Number(y/60).toFixed(2))+" minutes "+(y >0 ? "early":"late")); | |
| } | |
| } | |
| else { | |
| $("#tooltip").remove(); | |
| previousPoint = null; | |
| } | |
| }); | |
| </script> | |
| <?php | <?php |
| include ('../include/common.inc.php'); | include ('../include/common.inc.php'); |
| include_header("MyWay Balance", "mywayBalance", false, false, true); | include_header("MyWay Balance", "mywayBalance", false, false, true); |
| echo '<div data-role="page"> | echo '<div data-role="page"> |
| <div data-role="header" data-position="inline"> | <div data-role="header" data-position="inline"> |
| <a href="' . $_SERVER["HTTP_REFERER"] . '" data-icon="arrow-l" data-rel="back" class="ui-btn-left">Back</a> | <a href="' . $_SERVER["HTTP_REFERER"] . '" data-icon="arrow-l" data-rel="back" class="ui-btn-left">Back</a> |
| <h1>MyWay Balance</h1> | <h1>MyWay Balance</h1> |
| <a href="mywaybalance.php?logout=yes" data-icon="delete" class="ui-btn-right">Logout</a> | <a href="mywaybalance.php?logout=yes" data-icon="delete" class="ui-btn-right">Logout</a> |
| </div><!-- /header --> | </div><!-- /header --> |
| <a name="maincontent" id="maincontent"></a> | <a name="maincontent" id="maincontent"></a> |
| <div data-role="content"> '; | <div data-role="content"> '; |
| $return = Array(); | $return = Array(); |
| function logout() { | function logout() |
| { | |
| setcookie("card_number", "", time() - 60 * 60 * 24 * 100, "/"); | setcookie("card_number", "", time() - 60 * 60 * 24 * 100, "/"); |
| setcookie("date", "", time() - 60 * 60 * 24 * 100, "/"); | setcookie("date", "", time() - 60 * 60 * 24 * 100, "/"); |
| setcookie("secret_answer", "", time() - 60 * 60 * 24 * 100, "/"); | setcookie("secret_answer", "", time() - 60 * 60 * 24 * 100, "/"); |
| setcookie("contribute_myway", "", time() - 60 * 60 * 24 * 100, "/"); | |
| } | } |
| function printBalance($cardNumber, $date, $pwrd) | function printBalance($mywayResult) |
| { | { |
| global $return; | if (isset($mywayResult['error'])) { |
| $return = json_decode(getPage(curPageURL() . "/myway_api.json.php?card_number=$cardNumber&DOBday={$date[0]}&DOBmonth={$date[1]}&DOByear={$date[2]}&secret_answer=$pwrd") , true); | |
| if (isset($return['error'])) { | |
| logout(); | logout(); |
| echo '<h3><font color="red">' . $return['error'][0] . "</font></h3>"; | echo '<h3><font color="red">' . $mywayResult['error'][0] . "</font></h3>"; |
| } | } |
| else { | else { |
| echo "<h2>Balance: " . $return['myway_carddetails']['Card Balance'] . "</h2>"; | echo "<h2>Balance: " . $mywayResult['myway_carddetails']['Card Balance'] . "</h2>"; |
| echo '<ul data-role="listview" data-inset="true"><li data-role="list-divider"> Recent Transactions </li>'; | echo '<ul data-role="listview" data-inset="true"><li data-role="list-divider"> Recent Transactions </li>'; |
| $txCount=0; | $txCount = 0; |
| foreach ($return['myway_transactions'] as $transaction) { | foreach ($mywayResult['myway_transactions'] as $transaction) { |
| echo "<li>"; | echo "<li>"; |
| if ($transaction["Deduction Type"] == "DEFAULT") echo '<img src="css/images/warning.png" alt="Failed to tap off: " class="ui-li-icon">'; | if ($transaction["Deduction Type"] == "DEFAULT") echo '<img src="css/images/warning.png" alt="Failed to tap off: " class="ui-li-icon">'; |
| echo"<b>" . $transaction["Date / Time"] . "</b>"; | echo "<b>" . $transaction["Date / Time"] . "</b>"; |
| echo "<br><small>" .$transaction["Route"] ." at " . $transaction["Stop Name"]. "<br>". $transaction["TX Reference No / Type"] . "</small>"; | echo "<br><small>" . $transaction["Route"] . " at " . $transaction["Stop Name"] . "<br>"; |
| echo $transaction["TX Reference No"] . " " . $transaction["TX Type"] . "</small>"; | |
| echo '<p class="ui-li-aside">' . $transaction["TX Amount"] . '</p>'; | echo '<p class="ui-li-aside">' . $transaction["TX Amount"] . '</p>'; |
| echo "</li>"; | echo "</li>"; |
| $txCount++; | $txCount++; |
| if ($txCount > 10) break; | if ($txCount > 10) break; |
| } | } |
| echo "</ul>"; | echo "</ul>"; |
| } | |
| } | |
| function recordMyWayObservations($mywayResult) | |
| { | |
| global $conn; | |
| if (!isset($mywayResult['error'])) { | |
| $stmt = $conn->prepare("insert into myway_observations (observation_id, myway_stop, time, myway_route) | |
| values (:observation_id, :myway_stop, :time, :myway_route)"); | |
| $stmt->bindParam(':observation_id', $observation_hash); | |
| $stmt->bindParam(':myway_stop', $myway_stop); | |
| $stmt->bindParam(':time', $timestamp); | |
| $stmt->bindParam(':myway_route', $myway_route); | |
| // insert a record | |
| $resultCount = 0; | |
| foreach ($mywayResult['myway_transactions'] as $transaction) { | |
| if ($transaction["Stop Name"] != "" && $transaction["Deduction Type"] != "DEFAULT") { | |
| $observation_hash = md5($mywayResult['myway_carddetails']['MyWay Number'] . $transaction["TX Reference No"]); | |
| $timestamp = date("c", strtotime($transaction["Date / Time"])); | |
| $myway_stop = $transaction["Stop Name"]; | |
| $myway_route = $transaction["Route"]; | |
| if ($stmt->execute()) $resultCount++; | |
| } | |
| } | |
| echo "<h3>Thanks for participating in the study! $resultCount transactions were recorded</h3>"; | |
| } | } |
| } | } |
| if (isset($_REQUEST['card_number']) && isset($_REQUEST['date']) && isset($_REQUEST['secret_answer'])) { | if (isset($_REQUEST['card_number']) && isset($_REQUEST['date']) && isset($_REQUEST['secret_answer'])) { |
| $cardNumber = $_REQUEST['card_number']; | $cardNumber = $_REQUEST['card_number']; |
| $date = explode("/", $_REQUEST['date']); | $date = explode("/", $_REQUEST['date']); |
| $pwrd = $_REQUEST['secret_answer']; | $pwrd = $_REQUEST['secret_answer']; |
| if ($_REQUEST['remember'] == "on") { | if ($_REQUEST['remember'] == "on") { |
| setcookie("card_number", $cardNumber, time() + 60 * 60 * 24 * 100, "/"); | setcookie("card_number", $cardNumber, time() + 60 * 60 * 24 * 100, "/"); |
| setcookie("date", $_REQUEST['date'], time() + 60 * 60 * 24 * 100, "/"); | setcookie("date", $_REQUEST['date'], time() + 60 * 60 * 24 * 100, "/"); |
| setcookie("contribute_myway", $_REQUEST['contribute_myway'], time() + 60 * 60 * 24 * 100, "/"); | |
| setcookie("secret_answer", $pwrd, time() + 60 * 60 * 24 * 100, "/"); | setcookie("secret_answer", $pwrd, time() + 60 * 60 * 24 * 100, "/"); |
| } | } |
| printBalance($cardNumber, $date, $pwrd); | $mywayResult = json_decode(getPage(curPageURL() . "/myway_api.json.php?card_number=$cardNumber&DOBday={$date[0]}&DOBmonth={$date[1]}&DOByear={$date[2]}&secret_answer=$pwrd") , true); |
| if ($_REQUEST['contribute_myway'] == "on") recordMyWayObservations($mywayResult); | |
| printBalance($mywayResult); | |
| } | } |
| else if (isset($_REQUEST['logout'])) { | else if (isset($_REQUEST['logout'])) { |
| echo '<center><h3> Logged out of MyWay balance </h3><a href="/index.php">Back to main menu...</a><center>'; | echo '<center><h3> Logged out of MyWay balance </h3><a href="/index.php">Back to main menu...</a><center>'; |
| } | } |
| else if (isset($_COOKIE['card_number']) && isset($_COOKIE['date']) && isset($_COOKIE['secret_answer'])) { | else if (isset($_COOKIE['card_number']) && isset($_COOKIE['date']) && isset($_COOKIE['secret_answer'])) { |
| $cardNumber = $_COOKIE['card_number']; | $cardNumber = $_COOKIE['card_number']; |
| $date = explode("/", $_COOKIE['date']); | $date = explode("/", $_COOKIE['date']); |
| $pwrd = $_COOKIE['secret_answer']; | $pwrd = $_COOKIE['secret_answer']; |
| printBalance($cardNumber, $date, $pwrd); | $mywayResult = json_decode(getPage(curPageURL() . "/myway_api.json.php?card_number=$cardNumber&DOBday={$date[0]}&DOBmonth={$date[1]}&DOByear={$date[2]}&secret_answer=$pwrd") , true); |
| if ($_COOKIE['contribute_myway'] == "on") recordMyWayObservations($mywayResult); | |
| printBalance($mywayResult); | |
| } | } |
| else { | else { |
| $date = (isset($_REQUEST['date']) ? filter_var($_REQUEST['date'], FILTER_SANITIZE_STRING) : date("m/d/Y")); | $date = (isset($_REQUEST['date']) ? filter_var($_REQUEST['date'], FILTER_SANITIZE_STRING) : date("m/d/Y")); |
| echo '<form action="" method="post"> | echo '<form action="" method="post"> |
| <div data-role="fieldcontain"> | <div data-role="fieldcontain"> |
| <label for="card_number">Card number</label> | <label for="card_number">Card number</label> |
| <input type="text" name="card_number" id="card_number" value="' . $card_number . '" /> | <input type="text" name="card_number" id="card_number" value="' . $card_number . '" /> |
| </div> | </div> |
| <div data-role="fieldcontain"> | <div data-role="fieldcontain"> |
| <label for="date"> Date of birth </label> | <label for="date"> Date of birth </label> |
| <input type="text" name="date" id="date" value="' . $date . '" /> | <input type="text" name="date" id="date" value="' . $date . '" /> |
| </div> | </div> |
| <div data-role="fieldcontain"> | <div data-role="fieldcontain"> |
| <label for="secret_answer"> Secret question answer </label> | <label for="secret_answer"> Secret question answer </label> |
| <input type="text" name="secret_answer" id="secret_answer" value="' . $secret_answer . '" /> | <input type="text" name="secret_answer" id="secret_answer" value="' . $secret_answer . '" /> |
| </div> | </div> |
| <div data-role="fieldcontain"> | <div data-role="fieldcontain"> |
| <label for="remember"> Remember these details? </label> | <label for="remember"> Remember these details? </label> |
| <input type="checkbox" name="remember" id="remember" checked="yes" /> | <input type="checkbox" name="remember" id="remember" checked="yes" /> |
| </div> | </div> |
| <div data-role="fieldcontain"> | |
| <label for="contribute_myway">Contribute MyWay records to timeliness study? </label> | |
| <input type="checkbox" name="contribute_myway" id="contribute_myway" defaultChecked="no" /> | |
| </div> | |
| <div data-role="fieldcontain"> | |
| <label for="accept_warning">I accept that Transport for Canberra <a href="http://transport.act.gov.au/myway/protect.html">advise against the use of third party MyWay applications</a> </label> | |
| <input type="checkbox" name="accept_warning" id="accept_warning" defaultChecked="no" /> | |
| </div> | |
| <input type="submit" value="Go!"></form>'; | <input type="submit" value="Go!"></form>'; |
| } | } |
| include_footer(); | include_footer(); |
| ?> | ?> |
| <?php | |
| include ('../include/common.inc.php'); | |
| include_header("Route Statistics", "networkstats") | |
| ?> | |
| <script type="text/javascript" src="js/flotr/lib/prototype-1.6.0.2.js"></script> | |
| <!--[if IE]> | |
| <script type="text/javascript" src="js/flotr/lib/excanvas.js"></script> | |
| <script type="text/javascript" src="js/flotr/lib/base64.js"></script> | |
| <![endif]--> | |
| <script type="text/javascript" src="js/flotr/lib/canvas2image.js"></script> | |
| <script type="text/javascript" src="js/flotr/lib/canvastext.js"></script> | |
| <script type="text/javascript" src="js/flotr/flotr.debug-0.2.0-alpha_radar1.js"></script> | |
| <form method="get" action="networkstats.php"> | |
| <select id="routeid" name="routeid"> | |
| <?php | |
| foreach (getRoutes() as $route) { | |
| echo "<option value=\"{$route['route_id']}\">{$route['route_short_name']} {$route['route_long_name']}</option>"; | |
| } | |
| ?> | |
| </select> | |
| <input type="submit" value="View"/> | |
| </form> | |
| <?php | |
| // middle of graph = 6am | |
| $adjustFactor = 0; | |
| $route = getRoute($routeid); | |
| echo "<h1>{$route['route_short_name']} {$route['route_long_name']}</h1>"; | |
| foreach (getRouteTrips($routeid) as $key => $trip) { | |
| $dLabel[$key] = $trip['arrival_time']; | |
| if ($key == 0) { | |
| $time = strtotime($trip['arrival_time']); | |
| $adjustFactor = (date("G", $time) * 3600); | |
| } | |
| $tripStops = viaPoints($trip['trip_id']); | |
| foreach ($tripStops as $i => $stop) { | |
| if ($key == 0) { | |
| $dTicks[$i] = $stop['stop_name']; | |
| } | |
| $time = strtotime($stop['arrival_time']); | |
| $d[$key][$i] = (date("G", $time) * 3600) + (date("i", $time) * 60) + date("s", $time) - $adjustFactor; | |
| } | |
| } | |
| ?> | |
| <div id="container" style="width:100%;height:900px;"></div> | |
| <script type="text/javascript"> | |
| /** | |
| * Wait till dom's finished loading. | |
| */ | |
| document.observe('dom:loaded', function(){ | |
| /** | |
| * Fill series d1 and d2. | |
| */ | |
| <?php | |
| foreach ($d as $key => $dataseries) { | |
| echo "var d$key =["; | |
| foreach ($dataseries as $i => $datapoint) { | |
| echo "[$i, $datapoint],"; | |
| } | |
| echo "];\n"; | |
| } | |
| ?> | |
| var f = Flotr.draw($('container'), | |
| [ | |
| <?php | |
| foreach ($d as $key => $dataseries) { | |
| echo '{data:d'.$key.", label:'{$dLabel[$key]}'".', radar:{fill:false}},'."\n"; | |
| } | |
| ?> | |
| ], | |
| {defaultType: 'radar', | |
| radarChartMode: true, | |
| HtmlText: false, | |
| fontSize: 9, | |
| xaxis:{ | |
| ticks: [ | |
| <?php | |
| foreach ($dTicks as $key => $tickName) { | |
| echo '['.$key.', "'.$tickName.'"],'; | |
| } | |
| ?> | |
| ]}, | |
| mouse:{ // Setup point tracking | |
| track: true, | |
| lineColor: 'black', | |
| relative: true, | |
| sensibility: 70, | |
| trackFormatter: function(obj){ | |
| var d = new Date(); | |
| d.setMinutes(0); | |
| d.setHours(0); | |
| d.setTime(d.getTime() + Math.floor(obj.radarData*1000) + <?php echo $adjustFactor*1000 ?>); | |
| return d.getHours() +':'+ (d.getMinutes().toString().length == 1 ? '0'+ d.getMinutes(): d.getMinutes()); | |
| }}}); | |
| }); | |
| </script> | |
| </div> | |
| <?php | |
| include_footer() | |
| ?> | |
| <?php | |
| include ('../include/common.inc.php'); | |
| include_header("Service Alert Editor", "serviceAlertEditor"); | |
| /** | |
| * Currently support: | |
| * network inform | |
| * stop remove: trip patch, route inform | |
| * - stop search | |
| * street inform: route inform, trip inform, stop inform | |
| * - street search | |
| * trip remove: route patch, stop inform | |
| * - trip search by route | |
| */ | |
| if (isset($_REQUEST['saveedit'])) { | |
| if ($_REQUEST['saveedit'] != "") updateServiceAlert($_REQUEST['saveedit'], $_REQUEST['startdate'], $_REQUEST['enddate'], $_REQUEST['description'], $_REQUEST['url']); | |
| else addServiceAlert($_REQUEST['startdate'], $_REQUEST['enddate'], $_REQUEST['description'], $_REQUEST['url']); | |
| echo "Saved " . $_REQUEST['saveedit']; | |
| die(); | |
| } | |
| if ($_REQUEST['delete']) { | |
| $deleteParts = explode(";", $_REQUEST['delete']); | |
| deleteInformedAlert($deleteParts[0], $deleteParts[1], $deleteParts[2]); | |
| echo "Deleted network inform for {$deleteParts[0]} ({$deleteParts[1]},{$deleteParts[2]})<br>\n"; | |
| die(); | |
| } | |
| if ($_REQUEST['networkinform']) { | |
| addInformedAlert($_REQUEST['networkinform'], "network", "network", "inform"); | |
| echo "Added network inform for" . $_REQUEST['networkinform']; | |
| die(); | |
| } | |
| if ($_REQUEST['stopsearch']) { | |
| addInformedAlert($_REQUEST['stopsearch'], "stop", $_REQUEST['stopid'], "remove"); | |
| echo "Added stop remove for" . $_REQUEST['stopsearch'] . ", stop" . $_REQUEST['stopid'] . "<br>\n"; | |
| foreach ($service_periods as $sp) { | |
| echo "Patching $sp trips<br>\n"; | |
| foreach (getStopTrips($_REQUEST['stopid'], $sp) as $trip) { | |
| addInformedAlert($_REQUEST['stopsearch'], "trip", $trip['trip_id'], "patch"); | |
| echo "Added trip patch for" . $_REQUEST['stopsearch'] . ", trip" . $trip['trip_id'] . "<br>\n"; | |
| } | |
| echo "Informing $sp routes<br>\n"; | |
| foreach (getStopRoutes($_REQUEST['stopid'], $sp) as $route) { | |
| addInformedAlert($_REQUEST['stopsearch'], "route", $route['route_id'], "inform"); | |
| echo "Added route inform for" . $_REQUEST['stopsearch'] . ", route" . $route['route_id'] . "<br>\n"; | |
| } | |
| } | |
| die(); | |
| } | |
| if ($_REQUEST['routesearch']) { | |
| echo "Informing route<br>\n"; | |
| getRouteTrips(); | |
| echo "Informing trips<br>\n"; | |
| echo "Informing stops<br>\n"; | |
| die(); | |
| } | |
| if ($_REQUEST['streetsearch']) { | |
| echo "Informing stops<br>\n"; | |
| foreach(getStopByName() as $stop) { | |
| addInformedAlert($_REQUEST['stopsearch'], "stop", $_REQUEST['stopid'], "remove"); | |
| echo "Added stop inform for" . $_REQUEST['stopsearch'] . ", stop" . $_REQUEST['stopid'] . "<br>\n"; | |
| foreach ($service_periods as $sp) { | |
| echo "Patching $sp trips<br>\n"; | |
| foreach (getStopTrips($_REQUEST['stopid'], $sp) as $trip) { | |
| addInformedAlert($_REQUEST['stopsearch'], "trip", $trip['trip_id'], "patch"); | |
| echo "Added trip inform for" . $_REQUEST['stopsearch'] . ", trip" . $trip['trip_id'] . "<br>\n"; | |
| } | |
| echo "Informing $sp routes<br>\n"; | |
| foreach (getStopRoutes($_REQUEST['stopid'], $sp) as $route) { | |
| addInformedAlert($_REQUEST['stopsearch'], "route", $route['route_id'], "inform"); | |
| echo "Added route inform for" . $_REQUEST['stopsearch'] . ", route" . $route['route_id'] . "<br>\n"; | |
| } | |
| } | |
| die(); | |
| } | |
| } | |
| ?> | |
| Active and Future Alerts: | |
| <table> | |
| <?php | |
| foreach(getFutureAlerts() as $alert) { | |
| echo "<tr><td>{$alert['start']}</td><td>{$alert['end']}</td><td>" . substr($alert['description'], 0, 999) . '</td><td><a href="?edit=' . $alert['id'] . '">edit</a></td></tr>'; | |
| } | |
| ?> | |
| </table> | |
| <?php | |
| $alert = getServiceAlert($_REQUEST['edit']); | |
| ?> | |
| <form action="<?php echo basename(__FILE__) ; | |
| ?>" method="get"> | |
| <div data-role="fieldcontain"> | |
| <label for="startdate"> Start Date</label> | |
| <input type="text" name="startdate" id="startdate" value="<?php | |
| if ($alert['start']) echo $alert['start']; | |
| else echo date("c", strtotime("0:00")); | |
| ?>" /> | |
| </div> | |
| <div data-role="fieldcontain"> | |
| <label for="enddate"> End Date </label> | |
| <input type="text" name="enddate" id="enddate" value="<?php | |
| if ($alert['end']) echo $alert['end']; | |
| else echo date("c", strtotime("23:59")); | |
| ?>" /> | |
| </div> | |
| <div data-role="fieldcontain"> | |
| <label for="description">Description</label> | |
| <textarea name="description"> | |
| <?php echo $alert['description']; | |
| ?></textarea> | |
| </div> | |
| <div data-role="fieldcontain"> | |
| <label for="url">URL</label> | |
| <input type="text" name="url" id="url" value="<?php echo $alert['url']; | |
| ?>" /> | |
| </div> | |
| <input type="hidden" name="saveedit" value="<?php echo $_REQUEST['edit']; | |
| ?>"/> | |
| <input type="submit" value="Save"/> | |
| </div></form> | |
| <?php | |
| if ($_REQUEST['edit']) { | |
| echo "Informed Entities for ID {$_REQUEST['edit']}:"; | |
| echo '<table>'; | |
| foreach(getInformedAlerts($_REQUEST['edit'], "", "") as $informed) { | |
| echo "<tr><td>{$informed['informed_class']}</td><td>{$informed['informed_id']}</td><td>{$informed['informed_action']}" . '</td><td><a href="?delete=' . $_REQUEST['edit'] . ';' . $informed['informed_class'] . ';' . $informed['informed_id'] . '">delete</a></td></tr>'; | |
| } | |
| echo '</table>'; | |
| ?> | |
| <form action="<?php echo basename(__FILE__) ; | |
| ?>" method="get"> | |
| <input type="hidden" name="networkinform" value="<?php echo $_REQUEST['edit']; | |
| ?>"/> | |
| <input type="submit" value="Add Network Inform"/> | |
| </form> | |
| <form action="<?php echo basename(__FILE__) ; | |
| ?>" method="get"> | |
| <div data-role="fieldcontain"> | |
| <label for="stopid">StopID</label> | |
| <input type="text" name="stopid" /> | |
| </div> | |
| <input type="hidden" name="stopsearch" value="<?php echo $_REQUEST['edit']; | |
| ?>"/> | |
| <input type="submit" value="Stop Search"/> | |
| </form> | |
| <form action="<?php echo basename(__FILE__) ; | |
| ?>" method="get"> | |
| <div data-role="fieldcontain"> | |
| <label for="street">Street</label> | |
| <input type="text" name="street" /> | |
| </div> | |
| <input type="hidden" name="streetsearch" value="<?php echo $_REQUEST['edit']; | |
| ?>"/> | |
| <input type="submit" value="Street Search"/> | |
| </form> | |
| <form action="<?php echo basename(__FILE__) ; | |
| ?>" method="get"> | |
| <div data-role="fieldcontain"> | |
| <label for="routeid">routeID</label> | |
| <input type="text" name="routeid" /> | |
| </div> | |
| <input type="hidden" name="routesearch" value="<?php echo $_REQUEST['edit']; | |
| ?>"/> | |
| <input type="submit" value="Route Search"/> | |
| </form> | |
| <?php | |
| } | |
| include_footer(); | |
| ?> |
| <?php | |
| include ('../include/common.inc.php'); | |
| $query = "Select route_short_name,max(route_id) as route_id from routes where route_short_name NOT LIKE '7__' AND route_short_name != '170' AND route_short_name NOT LIKE '9__' group by route_short_name order by route_short_name ;"; | |
| debug($query, "database"); | |
| $query = $conn->prepare($query); | |
| $query->execute(); | |
| echo "<table><tr><th>Route Number</th><th>First Trip Start</th><th>First Trip End</th><th>Length</th>"; | |
| $total = 0; | |
| $count = 0; | |
| foreach($query->fetchAll() as $r) { | |
| $trips = getRouteTrips($r['route_id']); | |
| $startTime = $trips[0]['arrival_time']; | |
| $endTime = getTripEndTime($trips[0]['trip_id']); | |
| $timeDiff = strtotime($endTime) - strtotime($startTime); | |
| $total += $timeDiff; | |
| $count ++; | |
| echo "<tr><td>{$r['route_short_name']}</td><td>$startTime</td><td>$endTime</td><td>$timeDiff seconds ie. ". ($timeDiff/60). " minutes</td></tr>"; | |
| } | |
| echo "</table>"; | |
| echo "Total time: $total seconds ie. " .($total/60/60). " hours<br>"; | |
| echo "$count Routes"; | |
| ?> |
| Busness Time - An ACT bus timetable webapp | Busness Time - An ACT bus timetable webapp |
| Based on the maxious-canberra-transit-feed @ http://s3-ap-southeast-1.amazonaws.com/busresources/cbrfeed.zip | Based on the maxious-canberra-transit-feed @ http://s3-ap-southeast-1.amazonaws.com/busresources/cbrfeed.zip |
| Source code for the https://github.com/maxious/ACTBus-data transit | Source code for the https://github.com/maxious/ACTBus-data transit |
| feed and https://github.com/maxious/ACTBus-ui this site available from github. | feed and https://github.com/maxious/ACTBus-ui this site available from github. |
| Uses jQuery Mobile, PHP, PostgreSQL, OpenTripPlanner, OpenLayers, OpenStreetMap, Cloudmade Geocoder | Uses jQuery Mobile, PHP, PostgreSQL, OpenTripPlanner, OpenLayers, OpenStreetMap, Cloudmade Geocoder |
| and Tile Service | and Tile Service |
| See aws/awsStartup.sh for example startup steps. You need to load the included database dump; | See aws/awsStartup.sh for example startup steps. You need to load the included database dump; |
| for other transit networks you can use the updatedb.php script to load. | for other transit networks you can use the updatedb.php script to load. |
| For openstreetmap static maps, may have to do | For openstreetmap static maps, may have to do |
| /usr/sbin/setsebool -P httpd_can_network_connect=1 | /usr/sbin/setsebool -P httpd_can_network_connect=1 |
| on Fedora and other SELinux systems. | on Fedora and other SELinux systems. |
| To enter a service override, you can use the psql tool. eg. | To enter a service override, you can use the psql tool. eg. |
| transitdata=# COPY calendar_dates (service_id, date, exception_type) FROM stdin; | transitdata=# COPY calendar_dates (service_id, date, exception_type) FROM stdin; |
| Enter data to be copied [spaced with tabs] followed by a newline. | Enter data to be copied [spaced with tabs] followed by a newline. |
| End with a backslash and a period on a line by itself. | End with a backslash and a period on a line by itself. |
| >> saturday 20110416 2 | >> saturday 20110416 2 |
| >> sunday 20110416 1 | >> sunday 20110416 1 |
| >> saturday 20110423 2 | >> saturday 20110423 2 |
| >> sunday 20110423 1 | >> sunday 20110423 1 |
| >> weekday 20110425 2 | >> weekday 20110425 2 |
| >> sunday 20110425 1 | >> sunday 20110425 1 |
| >> weekday 20110422 2 | >> weekday 20110422 2 |
| >> noservice 20110422 1 | >> noservice 20110422 1 |
| >> weekday 20110426 2 | >> weekday 20110426 2 |
| >> noservice 20110426 1 | >> noservice 20110426 1 |
| >> sunday 20110424 2 | >> sunday 20110424 2 |
| >> noservice 20110424 1 | >> noservice 20110424 1 |
| >> weekday 20110613 2 | |
| >> sunday 20110613 1 | |
| >> \. | >> \. |
| <?php | <?php |
| include ('include/common.inc.php'); | include ('include/common.inc.php'); |
| function navbar() | function navbar() |
| { | { |
| echo ' | echo ' |
| <div data-role="navbar"> | <div data-role="navbar"> |
| <ul> | <ul> |
| <li><a href="routeList.php">By Final Destination...</a></li> | <li><a href="routeList.php">By Final Destination...</a></li> |
| <li><a href="routeList.php?bynumber=yes">By Number... </a></li> | <li><a href="routeList.php?bynumber=yes">By Number... </a></li> |
| <li><a href="routeList.php?bysuburbs=yes">By Suburb... </a></li> | <li><a href="routeList.php?bysuburbs=yes">By Suburb... </a></li> |
| <li><a href="routeList.php?nearby=yes">Nearby... </a></li> | <li><a href="routeList.php?nearby=yes">Nearby... </a></li> |
| </ul> | </ul> |
| </div> | </div> |
| '; | '; |
| } | } |
| if (isset($bysuburbs)) { | if (isset($bysuburbs)) { |
| include_header("Routes by Suburb", "routeList"); | include_header("Routes by Suburb", "routeList"); |
| navbar(); | navbar(); |
| echo ' <ul data-role="listview" data-filter="true" data-inset="true" >'; | echo ' <ul data-role="listview" data-filter="true" data-inset="true" >'; |
| if (!isset($firstLetter)) { | if (!isset($firstLetter)) { |
| foreach (range('A', 'Z') as $letter) { | foreach (range('A', 'Z') as $letter) { |
| echo "<li><a href=\"routeList.php?firstLetter=$letter&bysuburbs=yes\">$letter...</a></li>\n"; | echo "<li><a href=\"routeList.php?firstLetter=$letter&bysuburbs=yes\">$letter...</a></li>\n"; |
| } | } |
| } | } |
| else { | else { |
| foreach ($suburbs as $suburb) { | foreach ($suburbs as $suburb) { |
| if (startsWith($suburb, $firstLetter)) { | if (startsWith($suburb, $firstLetter)) { |
| echo '<li><a href="routeList.php?suburb=' . urlencode($suburb) . '">' . $suburb . '</a></li>'; | echo '<li><a href="routeList.php?suburb=' . urlencode($suburb) . '">' . $suburb . '</a></li>'; |
| } | } |
| } | } |
| } | } |
| echo '</ul>'; | echo '</ul>'; |
| } | } |
| else if (isset($nearby) || isset($suburb)) { | else if (isset($nearby) || isset($suburb)) { |
| $routes = Array(); | $routes = Array(); |
| if ($suburb) { | if ($suburb) { |
| include_header($suburb . " - " . ucwords(service_period()) , "routeList"); | include_header($suburb . " - " . ucwords(service_period()) , "routeList"); |
| navbar(); | navbar(); |
| timePlaceSettings(); | timePlaceSettings(); |
| trackEvent("Route Lists", "Routes By Suburb", $suburb); | trackEvent("Route Lists", "Routes By Suburb", $suburb); |
| $routes = getRoutesbysuburbs($suburb); | $routes = getRoutesBySuburb($suburb); |
| } | } |
| if (isset($nearby)) { | if (isset($nearby)) { |
| include_header("Routes Nearby", "routeList", true, true); | include_header("Routes Nearby", "routeList", true, true); |
| trackEvent("Route Lists", "Routes Nearby", $_SESSION['lat'] . "," . $_SESSION['lon']); | trackEvent("Route Lists", "Routes Nearby", $_SESSION['lat'] . "," . $_SESSION['lon']); |
| navbar(); | navbar(); |
| timePlaceSettings(true); | placeSettings(); |
| if (!isset($_SESSION['lat']) || !isset($_SESSION['lat']) || $_SESSION['lat'] == "" || $_SESSION['lon'] == "") { | if (!isset($_SESSION['lat']) || !isset($_SESSION['lat']) || $_SESSION['lat'] == "" || $_SESSION['lon'] == "") { |
| include_footer(); | include_footer(); |
| die(); | die(); |
| } | } |
| $routes = getRoutesNearby($_SESSION['lat'], $_SESSION['lon']); | $routes = getRoutesNearby($_SESSION['lat'], $_SESSION['lon']); |
| } | } |
| echo ' <ul data-role="listview" data-filter="true" data-inset="true" >'; | echo ' <ul data-role="listview" data-filter="true" data-inset="true" >'; |
| if ($routes) { | if ($routes) { |
| foreach ($routes as $route) { | foreach ($routes as $route) { |
| echo '<li><a href="trip.php?routeid=' . $route['route_id'] . '"><h3>' . $route['route_short_name'] . "</h3><p>" . $route['route_long_name'] . " (" . ucwords($route['service_id']) . ")</p>"; | echo '<li><a href="trip.php?routeid=' . $route['route_id'] . '"><h3>' . $route['route_short_name'] . "</h3><p>" . $route['route_long_name'] . " (" . ucwords($route['service_id']) . ")</p>"; |
| if (isset($nearby)) { | if (isset($nearby)) { |
| $time = getTimeInterpolatedRouteAtStop($route['route_id'], $route['stop_id']); | $time = getTimeInterpolatedRouteAtStop($route['route_id'], $route['stop_id']); |
| echo '<span class="ui-li-count">' . ($time['arrival_time'] ? $time['arrival_time'] : "No more trips today") . "<br>" . floor($route['distance']) . 'm away</span>'; | echo '<span class="ui-li-count">' . ($time['arrival_time'] ? $time['arrival_time'] : "No more trips today") . "<br>" . floor($route['distance']) . 'm away</span>'; |
| } | } |
| echo "</a></li>\n"; | echo "</a></li>\n"; |
| } | } |
| } | } |
| else { | else { |
| echo "<li style='text-align: center;'> No routes nearby.</li>"; | echo "<li style='text-align: center;'> No routes nearby.</li>"; |
| } | } |
| } | } |
| else if (isset($bynumber) || isset($numberSeries)) { | else if (isset($bynumber) || isset($numberSeries)) { |
| include_header("Routes by Number", "routeList"); | include_header("Routes by Number", "routeList"); |
| navbar(); | navbar(); |
| echo ' <ul data-role="listview" data-inset="true">'; | echo ' <ul data-role="listview" data-inset="true">'; |
| if (isset($bynumber)) { | if (isset($bynumber)) { |
| $routes = getRoutesByNumber(); | $routes = getRoutesByNumber(); |
| $routeSeries = Array(); | $routeSeries = Array(); |
| $seriesRange = Array(); | $seriesRange = Array(); |
| foreach ($routes as $key => $routeNumber) { | foreach ($routes as $key => $routeNumber) { |
| foreach (explode(" ", $routeNumber['route_short_name']) as $routeNumber) { | foreach (explode(" ", $routeNumber['route_short_name']) as $routeNumber) { |
| $seriesNum = substr($routeNumber, 0, -1) . "0"; | $seriesNum = substr($routeNumber, 0, -1) . "0"; |
| if ($seriesNum == "0") $seriesNum = $routeNumber; | if ($seriesNum == "0") $seriesNum = $routeNumber; |
| $finalDigit = substr($routeNumber, sizeof($routeNumber) - 1, 1); | $finalDigit = substr($routeNumber, sizeof($routeNumber) - 1, 1); |
| if (isset($seriesRange[$seriesNum])) { | if (isset($seriesRange[$seriesNum])) { |
| if ($finalDigit < $seriesRange[$seriesNum]['max']) $seriesRange[$seriesNum]['max'] = $routeNumber; | if ($finalDigit < $seriesRange[$seriesNum]['max']) $seriesRange[$seriesNum]['max'] = $routeNumber; |
| if ($finalDigit > $seriesRange[$seriesNum]['min']) $seriesRange[$seriesNum]['min'] = $routeNumber; | if ($finalDigit > $seriesRange[$seriesNum]['min']) $seriesRange[$seriesNum]['min'] = $routeNumber; |
| } | } |
| else { | else { |
| $seriesRange[$seriesNum]['max'] = $routeNumber; | $seriesRange[$seriesNum]['max'] = $routeNumber; |
| $seriesRange[$seriesNum]['min'] = $routeNumber; | $seriesRange[$seriesNum]['min'] = $routeNumber; |
| } | } |
| $routeSeries[$seriesNum][$seriesNum . "-" . $row[1] . "-" . $row[0]] = $row; | $routeSeries[$seriesNum][$seriesNum . "-" . $row[1] . "-" . $row[0]] = $row; |
| } | } |
| } | } |
| ksort($routeSeries); | ksort($routeSeries); |
| ksort($seriesRange); | ksort($seriesRange); |
| foreach ($routeSeries as $series => $routes) { | foreach ($routeSeries as $series => $routes) { |
| echo '<li><a href="' . curPageURL() . '/routeList.php?numberSeries=' . $series . '">'; | echo '<li><a href="' . curPageURL() . '/routeList.php?numberSeries=' . $series . '">'; |
| if ($series <= 9) echo $series; | if ($series <= 9) echo $series; |
| else echo "{$seriesRange[$series]['min']}-{$seriesRange[$series]['max']}"; | else echo "{$seriesRange[$series]['min']}-{$seriesRange[$series]['max']}"; |
| echo "</a></li>\n"; | echo "</a></li>\n"; |
| } | } |
| } | } |
| else if ($numberSeries) { | else if ($numberSeries) { |
| $routes = getRoutesByNumberSeries($numberSeries); | $routes = getRoutesByNumberSeries($numberSeries); |
| foreach ($routes as $route) { | foreach ($routes as $route) { |
| echo '<li> <a href="trip.php?routeid=' . $route['route_id'] . '"><h3>' . $route['route_short_name'] . "</h3><p>" . $route['route_long_name'] . " (" . ucwords($route['service_id']) . ")</p></a></li>\n"; | echo '<li> <a href="trip.php?routeid=' . $route['route_id'] . '"><h3>' . $route['route_short_name'] . "</h3><p>" . $route['route_long_name'] . " (" . ucwords($route['service_id']) . ")</p></a></li>\n"; |
| } | } |
| } | } |
| } | } |
| else { | else { |
| include_header("Routes by Destination", "routeList"); | include_header("Routes by Destination", "routeList"); |
| navbar(); | navbar(); |
| echo ' <ul data-role="listview" data-inset="true">'; | echo ' <ul data-role="listview" data-inset="true">'; |
| if (isset($routeDestination)) { | if (isset($routeDestination)) { |
| foreach (getRoutesByDestination($routeDestination) as $route) { | foreach (getRoutesByDestination($routeDestination) as $route) { |
| echo '<li><a href="trip.php?routeid=' . $route["route_id"] . '"><h3>' . $route["route_short_name"] . '</h3><p>' . $route["route_long_name"] . " (" . ucwords($route['service_id']) . ")</p></a></li>\n"; | echo '<li><a href="trip.php?routeid=' . $route["route_id"] . '"><h3>' . $route["route_short_name"] . '</h3><p>' . $route["route_long_name"] . " (" . ucwords($route['service_id']) . ")</p></a></li>\n"; |
| } | } |
| } | } |
| else { | else { |
| foreach (getRoutesByDestination() as $destination) { | foreach (getRoutesByDestination() as $destination) { |
| echo '<li><a href="' . curPageURL() . '/routeList.php?routeDestination=' . urlencode($destination['route_long_name']) . '">' . $destination['route_long_name'] . "... </a></li>\n"; | echo '<li><a href="' . curPageURL() . '/routeList.php?routeDestination=' . urlencode($destination['route_long_name']) . '">' . $destination['route_long_name'] . "... </a></li>\n"; |
| } | } |
| } | } |
| } | } |
| echo "</ul>\n"; | echo "</ul>\n"; |
| include_footer(); | include_footer(); |
| ?> | ?> |
| <?php | <?php |
| include ('include/common.inc.php'); | include ('include/common.inc.php'); |
| /* | |
| also need last modified epoch of client gtfs | |
| - add,remove,patch | |
| - stop | |
| - trip | |
| - patterns (WHERE=) | |
| - route (short_name or route_id) | |
| - street | |
| - stop | |
| - trip */ | |
| /* header { | |
| gtrtfs_version: "1" | |
| timestamp: 1307926866 | |
| } | |
| entity { | |
| id: "21393" | |
| alert { | |
| active_period { | |
| start: 1307955600 | |
| end: 1307988000 | |
| } | |
| informed_entity { | |
| route_id: "100" | |
| route_type: 1 | |
| } | |
| url { | |
| translation { | |
| text: "http://trimet.org/alerts/" | |
| } | |
| } | |
| description_text { | |
| translation { | |
| text: "Rose Festival fleet departures will cause bridge lifts until around 10 a.m. Expect delays." | |
| } | |
| } | |
| } | |
| }*/ | |
| $return = Array(); | |
| if (basename(__FILE__) == "servicealerts_api.php") { | |
| $return = getServiceAlerts($_REQUEST['filter_class'],$_REQUEST['filter_id']); | |
| header('Content-Type: text/javascript; charset=utf8'); | header('Content-Type: text/javascript; charset=utf8'); |
| // header('Access-Control-Allow-Origin: http://bus.lambdacomplex.org/'); | // header('Access-Control-Allow-Origin: http://bus.lambdacomplex.org/'); |
| header('Access-Control-Max-Age: 3628800'); | header('Access-Control-Max-Age: 3628800'); |
| header('Access-Control-Allow-Methods: GET, POST, PUT, DELETE'); | header('Access-Control-Allow-Methods: GET, POST, PUT, DELETE'); |
| if (isset($_GET['callback'])) { | if (isset($_GET['callback'])) { |
| $json = '(' . json_encode($return) . ');'; //must wrap in parens and end with semicolon | $json = '(' . json_encode($return) . ');'; //must wrap in parens and end with semicolon |
| print_r($_GET['callback'] . $json); //callback is prepended for json-p | //print_r($_GET['callback'] . $json); //callback is prepended for json-p |
| } | } |
| else echo json_encode($return); | else echo json_encode($return); |
| } | |
| ?> | ?> |
| <?php | <?php |
| include ('include/common.inc.php'); | include ('include/common.inc.php'); |
| $last_updated = date('Y-m-d',@filemtime('cbrfeed.zip')); | $last_updated = date('Y-m-d',@filemtime('cbrfeed.zip')); |
| header("Content-Type: text/xml"); | header("Content-Type: text/xml"); |
| echo "<?xml version='1.0' encoding='UTF-8'?>"; | echo "<?xml version='1.0' encoding='UTF-8'?>"; |
| echo '<urlset xmlns="http://www.sitemaps.org/schemas/sitemap/0.9">' . "\n"; | echo '<urlset xmlns="http://www.sitemaps.org/schemas/sitemap/0.9" xmlns:geo="http://www.google.com/geo/schemas/sitemap/1.0">' . "\n"; |
| echo " <url><loc>".curPageURL()."index.php</loc><priority>1.0</priority></url>\n"; | echo " <url><loc>".curPageURL()."index.php</loc><priority>1.0</priority></url>\n"; |
| foreach (scandir("./") as $file) { | foreach (scandir("./") as $file) { |
| if (strpos($file,".php") !== false && $file != "index.php" && $file != "sitemap.xml.php") echo " <url><loc>".curPageURL()."$file</loc><priority>0.3</priority></url>\n"; | if (strpos($file,".php") !== false && $file != "index.php" && $file != "sitemap.xml.php") echo " <url><loc>".curPageURL()."$file</loc><priority>0.3</priority></url>\n"; |
| } | |
| foreach (scandir("./labs") as $file) { | |
| if (strpos($file,".php") !== false) echo " <url><loc>".curPageURL()."/labs/$file</loc><priority>0.3</priority></url>\n"; | |
| } | } |
| foreach (getStops() as $stop) { | foreach (getStops() as $stop) { |
| echo " <url><loc>".curPageURL()."stop.php?stopid=".htmlspecialchars ($stop["stop_id"])."</loc>"; | echo " <url><loc>".curPageURL()."stop.php?stopid=".htmlspecialchars ($stop["stop_id"])."</loc>"; |
| echo "<lastmod>" . $last_updated . "</lastmod>"; | echo "<lastmod>" . $last_updated . "</lastmod>"; |
| echo "<changefreq>monthly</changefreq>"; | echo "<changefreq>monthly</changefreq>"; |
| echo "<priority>0.9</priority>"; | echo "<priority>0.9</priority>"; |
| echo "</url>\n"; | echo "</url>\n"; |
| } | } |
| foreach (getRoutes() as $route) { | foreach (getRoutes() as $route) { |
| echo " <url><loc>".curPageURL()."trip.php?routeid=".htmlspecialchars ($route["route_id"])."</loc>"; | echo " <url><loc>".curPageURL()."trip.php?routeid=".htmlspecialchars ($route["route_id"])."</loc>"; |
| echo "<lastmod>" . $last_updated . "</lastmod>"; | echo "<lastmod>" . $last_updated . "</lastmod>"; |
| echo "<changefreq>monthly</changefreq>"; | echo "<changefreq>monthly</changefreq>"; |
| echo "<priority>0.9</priority>"; | echo "<priority>0.9</priority>"; |
| echo "</url>\n"; | echo "</url>\n"; |
| } | } |
| // geosite map | // geosite map |
| foreach (getRoutes() as $route) { | foreach (getRoutes() as $route) { |
| echo " <url><loc>".curPageURL()."geo/route.kml.php?routeid=".htmlspecialchars ($route["route_id"])."</loc>"; | echo " <url><loc>".curPageURL()."geo/route.kml.php?routeid=".htmlspecialchars ($route["route_id"])."</loc>"; |
| echo "<lastmod>" . $last_updated . "</lastmod>"; | echo "<lastmod>" . $last_updated . "</lastmod>"; |
| echo "<geo:geo> | echo "<geo:geo> |
| <geo:format>kml</geo:format> | <geo:format>kml</geo:format> |
| </geo:geo>"; | </geo:geo>"; |
| echo "</url>\n"; | echo "</url>\n"; |
| } | } |
| echo '</urlset>'; | echo '</urlset>'; |
| ?> | ?> |
| <?php | <?php |
| include ('include/common.inc.php'); | include ('include/common.inc.php'); |
| if ($stopid) $stop = getStop($stopid); | if ($stopid) $stop = getStop($stopid); |
| /*if ($stopcode != "" && $stop[5] != $stopcode) { | /*if ($stopcode != "" && $stop[5] != $stopcode) { |
| $url = $APIurl . "/json/stopcodesearch?q=" . $stopcode; | $url = $APIurl . "/json/stopcodesearch?q=" . $stopcode; |
| $stopsearch = json_decode(getPage($url)); | $stopsearch = json_decode(getPage($url)); |
| $stopid = $stopsearch[0][0]; | $stopid = $stopsearch[0][0]; |
| $url = $APIurl . "/json/stop?stop_id=" . $stopid; | $url = $APIurl . "/json/stop?stop_id=" . $stopid; |
| $stop = json_decode(getPage($url)); | $stop = json_decode(getPage($url)); |
| } | } |
| if (!startsWith($stop[5], "Wj") && strpos($stop[1], "Platform") === false) { | if (!startsWith($stop[5], "Wj") && strpos($stop[1], "Platform") === false) { |
| // expand out to all platforms | // expand out to all platforms |
| }*/ | }*/ |
| $stops = Array(); | $stops = Array(); |
| $stopPositions = Array(); | $stopPositions = Array(); |
| $stopNames = Array(); | $stopNames = Array(); |
| $tripStopNumbers = Array(); | $tripStopNumbers = Array(); |
| $allStopsTrips = Array(); | $allStopsTrips = Array(); |
| $fetchedTripSequences = Array(); | $fetchedTripSequences = Array(); |
| $stopLinks = ""; | $stopLinks = ""; |
| if (isset($stopids)) { | if (isset($stopids)) { |
| foreach ($stopids as $sub_stopid) { | foreach ($stopids as $sub_stopid) { |
| $stops[] = getStop($sub_stopid); | $stops[] = getStop($sub_stopid); |
| } | } |
| $stop = $stops[0]; | $stop = $stops[0]; |
| $stopid = $stops[0]["stop_id"]; | $stopid = $stops[0]["stop_id"]; |
| $stopLinks.= "Individual stop pages: "; | $stopLinks.= "Individual stop pages: "; |
| foreach ($stops as $key => $sub_stop) { | foreach ($stops as $key => $sub_stop) { |
| // $stopNames[$key] = $sub_stop[1] . ' Stop #' . ($key + 1); | // $stopNames[$key] = $sub_stop[1] . ' Stop #' . ($key + 1); |
| if (strpos($stop["stop_name"], "Station")) { | if (strpos($stop["stop_name"], "Station")) { |
| $stopNames[$key] = 'Platform ' . ($key + 1); | $stopNames[$key] = 'Platform ' . ($key + 1); |
| $stopLinks.= '<a href="stop.php?stopid=' . $sub_stop["stop_id"] . '&stopcode=' . $sub_stop["stop_code"] . '">' . $sub_stop["stop_name"] . '</a> '; | $stopLinks.= '<a href="stop.php?stopid=' . $sub_stop["stop_id"] . '&stopcode=' . $sub_stop["stop_code"] . '">' . $sub_stop["stop_name"] . '</a> '; |
| } | } |
| else { | else { |
| $stopNames[$key] = '#' . ($key + 1); | $stopNames[$key] = '#' . ($key + 1); |
| $stopLinks.= '<a href="stop.php?stopid=' . $sub_stop["stop_id"] . '&stopcode=' . $sub_stop["stop_code"] . '">' . $sub_stop["stop_name"] . ' Stop #' . ($key + 1) . '</a> '; | $stopLinks.= '<a href="stop.php?stopid=' . $sub_stop["stop_id"] . '&stopcode=' . $sub_stop["stop_code"] . '">' . $sub_stop["stop_name"] . ' Stop #' . ($key + 1) . '</a> '; |
| } | } |
| $stopPositions[$key] = Array( | $stopPositions[$key] = Array( |
| $sub_stop["stop_lat"], | $sub_stop["stop_lat"], |
| $sub_stop["stop_lon"] | $sub_stop["stop_lon"] |
| ); | ); |
| $trips = getStopTrips($sub_stop["stop_id"]); | $trips = getStopTrips($sub_stop["stop_id"]); |
| $tripSequence = ""; | $tripSequence = ""; |
| foreach ($trips as $trip) { | foreach ($trips as $trip) { |
| $tripSequence.= "{$trip['trip_id']},"; | $tripSequence.= "{$trip['trip_id']},"; |
| $tripStopNumbers[$trip['trip_id']][] = $key; | $tripStopNumbers[$trip['trip_id']][] = $key; |
| } | } |
| if (!in_array($tripSequence, $fetchedTripSequences)) { | if (!in_array($tripSequence, $fetchedTripSequences)) { |
| // only fetch new trip sequences | // only fetch new trip sequences |
| $fetchedTripSequences[] = $tripSequence; | $fetchedTripSequences[] = $tripSequence; |
| $trips = getStopTripsWithTimes($sub_stop["stop_id"]); | $trips = getStopTripsWithTimes($sub_stop["stop_id"]); |
| foreach ($trips as $trip) { | foreach ($trips as $trip) { |
| if (!isset($allStopsTrips[$trip["trip_id"]])) $allStopsTrips[$trip["trip_id"]] = $trip; | if (!isset($allStopsTrips[$trip["trip_id"]])) $allStopsTrips[$trip["trip_id"]] = $trip; |
| } | } |
| } | } |
| //else { | //else { |
| // echo "skipped sequence $tripSequence"; | // echo "skipped sequence $tripSequence"; |
| //} | //} |
| } | } |
| } | } |
| include_header($stop['stop_name'], "stop"); | include_header($stop['stop_name'], "stop"); |
| echo '<span id="leftcolumn">'; | |
| timePlaceSettings(); | /*$serviceAlerts = json_decode(getPage(curPageURL() . "/servicealerts_api.php?filter_class=stop&filter_id=".$stopid) , true); |
| foreach($serviceAlerts['entities'] as $serviceAlert) { | |
| echo '<div id="servicewarning">'.$serviceAlert['alert']['description']['translation'].'</div>'; | |
| }*/ | |
| echo '<span class="content-secondary">'; | |
| echo $stopLinks; | echo $stopLinks; |
| if (sizeof($stops) > 0) { | if (sizeof($stops) > 0) { |
| trackEvent("View Stops", "View Combined Stops", $stop["stop_name"], $stop["stop_id"]); | trackEvent("View Stops", "View Combined Stops", $stop["stop_name"], $stop["stop_id"]); |
| echo staticmap($stopPositions); | echo staticmap($stopPositions); |
| } | } |
| else { | else { |
| trackEvent("View Stops", "View Single Stop", $stop["stop_name"], $stop["stop_id"]); | trackEvent("View Stops", "View Single Stop", $stop["stop_name"], $stop["stop_id"]); |
| echo staticmap(Array( | echo staticmap(Array( |
| 0 => Array( | 0 => Array( |
| $stop["stop_lat"], | $stop["stop_lat"], |
| $stop["stop_lon"] | $stop["stop_lon"] |
| ) | ) |
| )) ; | )) ; |
| } | } |
| echo '</span><span id="rightcolumn">'; | |
| // time settings | |
| echo '<div id="settings" data-role="collapsible" data-collapsed="true"> | |
| <h3>Change Time (' . (isset($_SESSION['time']) ? $_SESSION['time'] : "Current Time,") . ' ' . ucwords(service_period()) . ')...</h3> | |
| <form action="' . basename($_SERVER['PHP_SELF']) . "?" . $_SERVER['QUERY_STRING'] . '" method="post"> | |
| <div class="ui-body"> | |
| <div data-role="fieldcontain"> | |
| <label for="time"> Time: </label> | |
| <input type="time" name="time" id="time" value="' . (isset($_SESSION['time']) ? $_SESSION['time'] : date("H:i")) . '"/> | |
| <a href="#" name="currentTime" id="currentTime" onClick="var d = new Date();' . "$('#time').val(d.getHours() +':'+ (d.getMinutes().toString().length == 1 ? '0'+ d.getMinutes(): d.getMinutes()));" . '">Current Time?</a> | |
| </div> | |
| <div data-role="fieldcontain"> | |
| <label for="service_period"> Service Period: </label> | |
| <select name="service_period" id="service_period">'; | |
| foreach ($service_periods as $service_period) { | |
| echo "<option value=\"$service_period\"" . (service_period() === $service_period ? " SELECTED" : "") . '>' . ucwords($service_period) . '</option>'; | |
| } | |
| echo '</select> | |
| <a href="#" style="display:none" name="currentPeriod" id="currentPeriod">Current Period?</a> | |
| </div> | |
| <input type="submit" value="Update"/> | |
| </div></form> | |
| </div>'; | |
| echo '</span><span class="content-primary">'; | |
| echo ' <ul data-role="listview" data-inset="true">'; | echo ' <ul data-role="listview" data-inset="true">'; |
| if (sizeof($allStopsTrips) > 0) { | if (sizeof($allStopsTrips) > 0) { |
| sktimesort($allStopsTrips,"arrival_time", true); | sktimesort($allStopsTrips,"arrival_time", true); |
| $trips = $allStopsTrips; | $trips = $allStopsTrips; |
| } | } |
| else { | else { |
| $trips = getStopTripsWithTimes($stopid); | $trips = getStopTripsWithTimes($stopid); |
| } | } |
| if (sizeof($trips) == 0) { | if (sizeof($trips) == 0) { |
| echo "<li style='text-align: center;'>No trips in the near future.</li>"; | echo "<li style='text-align: center;'>No trips in the near future.</li>"; |
| } | } |
| else { | else { |
| foreach ($trips as $trip) { | foreach ($trips as $trip) { |
| echo '<li>'; | echo '<li>'; |
| echo '<a href="trip.php?stopid=' . $stopid . '&tripid=' . $trip['trip_id'] . '"><h3>' . $trip['route_short_name'] . " " . $trip['route_long_name'] . "</h3><p>"; | echo '<a href="trip.php?stopid=' . $stopid . '&tripid=' . $trip['trip_id'] . '"><h3>' . $trip['route_short_name'] . " " . $trip['route_long_name'] . "</h3><p>"; |
| $viaPoints = viaPointNames($trip['trip_id'], $trip['stop_sequence']); | $viaPoints = viaPointNames($trip['trip_id'], $trip['stop_sequence']); |
| if ($viaPoints != "") echo '<br><span class="viaPoints">Via: ' . $viaPoints . '</span>'; | if ($viaPoints != "") echo '<br><span class="viaPoints">Via: ' . $viaPoints . '</span>'; |
| if (sizeof($tripStopNumbers) > 0) { | if (sizeof($tripStopNumbers) > 0) { |
| echo '<br><small>Boarding At: '; | echo '<br><small>Boarding At: '; |
| foreach ($tripStopNumbers[$trip['trip_id']] as $key) { | foreach ($tripStopNumbers[$trip['trip_id']] as $key) { |
| echo $stopNames[$key] . ' '; | echo $stopNames[$key] . ' '; |
| } | } |
| echo '</small>'; | echo '</small>'; |
| } | } |
| echo '</p>'; | echo '</p>'; |
| echo '<p class="ui-li-aside"><strong>' . $trip['arrival_time'] . '</strong></p>'; | echo '<p class="ui-li-aside"><strong>' . $trip['arrival_time'] . '</strong></p>'; |
| echo '</a></li>'; | echo '</a></li>'; |
| flush(); | flush(); |
| @ob_flush(); | @ob_flush(); |
| } | } |
| } | } |
| echo '</ul>'; | echo '</ul>'; |
| echo '</span>'; | echo '</span>'; |
| include_footer(); | include_footer(); |
| ?> | ?> |
| <?php | <?php |
| include ('include/common.inc.php'); | include ('include/common.inc.php'); |
| $stops = Array(); | $stops = Array(); |
| function navbar() | function navbar() |
| { | { |
| echo ' | echo ' |
| <div data-role="navbar"> | <div data-role="navbar"> |
| <ul> | <ul> |
| <li><a href="stopList.php">Timing Points</a></li> | <li><a href="stopList.php">Timing Points</a></li> |
| <li><a href="stopList.php?bysuburbs=yes">By Suburb</a></li> | <li><a href="stopList.php?bysuburbs=yes">By Suburb</a></li> |
| <li><a href="stopList.php?nearby=yes">Nearby Stops</a></li> | <li><a href="stopList.php?nearby=yes">Nearby Stops</a></li> |
| <li><a href="stopList.php?allstops=yes">All Stops</a></li> | <li><a href="stopList.php?allstops=yes">All Stops</a></li> |
| </ul> | </ul> |
| </div> | </div> |
| '; | '; |
| } | } |
| // By suburb | // By suburb |
| if (isset($bysuburbs)) { | if (isset($bysuburbs)) { |
| include_header("Stops by Suburb", "stopList"); | include_header("Stops by Suburb", "stopList"); |
| navbar(); | navbar(); |
| echo ' <ul data-role="listview" data-filter="true" data-inset="true" >'; | echo ' <ul data-role="listview" data-filter="true" data-inset="true" >'; |
| if (!isset($firstLetter)) { | if (!isset($firstLetter)) { |
| foreach (range('A', 'Z') as $letter) { | foreach (range('A', 'Z') as $letter) { |
| echo "<li><a href=\"stopList.php?firstLetter=$letter&bysuburbs=yes\">$letter...</a></li>\n"; | echo "<li><a href=\"stopList.php?firstLetter=$letter&bysuburbs=yes\">$letter...</a></li>\n"; |
| } | } |
| } | } |
| else { | else { |
| foreach ($suburbs as $suburb) { | foreach ($suburbs as $suburb) { |
| if (startsWith($suburb, $firstLetter)) { | if (startsWith($suburb, $firstLetter)) { |
| echo '<li><a href="stopList.php?suburb=' . urlencode($suburb) . '">' . $suburb . '</a></li>'; | echo '<li><a href="stopList.php?suburb=' . urlencode($suburb) . '">' . $suburb . '</a></li>'; |
| } | } |
| } | } |
| } | } |
| echo '</ul>'; | echo '</ul>'; |
| } | } |
| else { | else { |
| // Timing Points / All stops | // Timing Points / All stops |
| if (isset($allstops)) { | if (isset($allstops)) { |
| $listType = 'allstops=yes'; | $listType = 'allstops=yes'; |
| $stops = getStops(); | $stops = getStops(); |
| include_header("All Stops", "stopList"); | include_header("All Stops", "stopList"); |
| navbar(); | navbar(); |
| timePlaceSettings(); | |
| } | } |
| else if (isset($nearby)) { | else if (isset($nearby)) { |
| $listType = 'nearby=yes'; | $listType = 'nearby=yes'; |
| include_header("Nearby Stops", "stopList", true, true); | include_header("Nearby Stops", "stopList", true, true); |
| trackEvent("Stop Lists", "Stops Nearby", $_SESSION['lat'] . "," . $_SESSION['lon']); | trackEvent("Stop Lists", "Stops Nearby", $_SESSION['lat'] . "," . $_SESSION['lon']); |
| navbar(); | navbar(); |
| timePlaceSettings(true); | |
| if (!isset($_SESSION['lat']) || !isset($_SESSION['lat']) || $_SESSION['lat'] == "" || $_SESSION['lon'] == "") { | if (!isset($_SESSION['lat']) || !isset($_SESSION['lat']) || $_SESSION['lat'] == "" || $_SESSION['lon'] == "") { |
| placeSettings(); | |
| include_footer(); | include_footer(); |
| die(); | die(); |
| } | } |
| $stops = getNearbyStops($_SESSION['lat'], $_SESSION['lon'], 15); | $stops = getNearbyStops($_SESSION['lat'], $_SESSION['lon'], 15); |
| echo '<span class="content-secondary">'; | |
| $stopPositions[] = Array( | |
| $_SESSION['lat'], | |
| $_SESSION['lon'] | |
| ); | |
| foreach ($stops as $sub_stop) { | |
| $stopPositions[] = Array( | |
| $sub_stop["stop_lat"], | |
| $sub_stop["stop_lon"] | |
| ); | |
| } | |
| echo staticmap($stopPositions, 0, "iconb", true, true); | |
| placeSettings(); | |
| echo '</span><span class="content-primary">'; | |
| } | } |
| else if (isset($suburb)) { | else if (isset($suburb)) { |
| $stops = getStopsBySuburb($suburb); | $stops = getStopsBySuburb($suburb); |
| include_header("Stops in " . ucwords($suburb) , "stopList"); | include_header("Stops in " . ucwords($suburb) , "stopList"); |
| navbar(); | navbar(); |
| trackEvent("Stop Lists", "Stops By Suburb", $suburb); | trackEvent("Stop Lists", "Stops By Suburb", $suburb); |
| } | } |
| else { | else { |
| $stops = getStops(true, $firstLetter); | $stops = getStops(true, $firstLetter); |
| include_header("Timing Points / Major Stops", "stopList"); | include_header("Timing Points / Major Stops", "stopList"); |
| navbar(); | navbar(); |
| timePlaceSettings(); | |
| } | } |
| echo ' <ul data-role="listview" data-filter="true" data-inset="true" >'; | echo ' <ul data-role="listview" data-filter="true" data-inset="true" >'; |
| if (!isset($firstLetter) && !isset($suburb) && !isset($nearby)) { | if (!isset($firstLetter) && !isset($suburb) && !isset($nearby)) { |
| foreach (range('A', 'Z') as $letter) { | foreach (range('A', 'Z') as $letter) { |
| echo "<li><a href=\"stopList.php?firstLetter=$letter&$listType\">$letter...</a></li>\n"; | echo "<li><a href=\"stopList.php?firstLetter=$letter&$listType\">$letter...</a></li>\n"; |
| } | } |
| } | } |
| else { | else { |
| //var_dump($stops); | //var_dump($stops); |
| $stopsGrouped = Array(); | $stopsGrouped = Array(); |
| foreach ($stops as $key => $stop) { | foreach ($stops as $key => $stop) { |
| if ((trim(preg_replace("/\(Platform.*/", "", $stops[$key]["stop_name"])) != trim(preg_replace("/\(Platform.*/", "", $stops[$key + 1]["stop_name"]))) || $key + 1 >= sizeof($stops)) { | if ((trim(preg_replace("/\(Platform.*/", "", $stops[$key]["stop_name"])) != trim(preg_replace("/\(Platform.*/", "", $stops[$key + 1]["stop_name"]))) || $key + 1 >= sizeof($stops)) { |
| if (sizeof($stopsGrouped) > 0) { | if (sizeof($stopsGrouped) > 0) { |
| // print and empty grouped stops | // print and empty grouped stops |
| // subsequent duplicates | // subsequent duplicates |
| $stopsGrouped["stop_ids"][] = $stop['stop_id']; | $stopsGrouped["stop_ids"][] = $stop['stop_id']; |
| echo '<li>'; | echo '<li>'; |
| if (!startsWith($stopsGrouped['stop_codes'][0], "Wj")) echo '<img src="css/images/time.png" alt="Timing Point: " class="ui-li-icon">'; | if (!startsWith($stopsGrouped['stop_codes'][0], "Wj")) echo '<img src="css/images/time.png" alt="Timing Point: " class="ui-li-icon">'; |
| echo '<a href="stop.php?stopids=' . implode(",", $stopsGrouped['stop_ids']) . '">'; | echo '<a href="stop.php?stopids=' . implode(",", $stopsGrouped['stop_ids']) . '">'; |
| if (isset($_SESSION['lat']) && isset($_SESSION['lon'])) { | if (isset($_SESSION['lat']) && isset($_SESSION['lon'])) { |
| echo '<span class="ui-li-count">' . distance($stop['stop_lat'], $stop['stop_lon'], $_SESSION['lat'], $_SESSION['lon'], true) . 'm away</span>'; | echo '<span class="ui-li-count">' . distance($stop['stop_lat'], $stop['stop_lon'], $_SESSION['lat'], $_SESSION['lon'], true) . 'm away</span>'; |
| } | } |
| echo bracketsMeanNewLine(trim(preg_replace("/\(Platform.*/", "", $stop['stop_name'])) . '(' . sizeof($stopsGrouped["stop_ids"]) . ' stops)'); | echo bracketsMeanNewLine(trim(preg_replace("/\(Platform.*/", "", $stop['stop_name'])) . '(' . sizeof($stopsGrouped["stop_ids"]) . ' stops)'); |
| echo "</a></li>\n"; | echo "</a></li>\n"; |
| flush(); | flush(); |
| @ob_flush(); | @ob_flush(); |
| $stopsGrouped = Array(); | $stopsGrouped = Array(); |
| } | } |
| else { | else { |
| // just a normal stop | // just a normal stop |
| echo '<li>'; | echo '<li>'; |
| if (!startsWith($stop['stop_code'], "Wj")) echo '<img src="css/images/time.png" alt="Timing Point" class="ui-li-icon">'; | if (!startsWith($stop['stop_code'], "Wj")) echo '<img src="css/images/time.png" alt="Timing Point" class="ui-li-icon">'; |
| echo '<a href="stop.php?stopid=' . $stop['stop_id'] . (startsWith($stop['stop_code'], "Wj") ? '&stopcode=' . $stop['stop_code'] : "") . '">'; | echo '<a href="stop.php?stopid=' . $stop['stop_id'] . (startsWith($stop['stop_code'], "Wj") ? '&stopcode=' . $stop['stop_code'] : "") . '">'; |
| if (isset($_SESSION['lat']) && isset($_SESSION['lon'])) { | if (isset($_SESSION['lat']) && isset($_SESSION['lon'])) { |
| echo '<span class="ui-li-count">' . distance($stop['stop_lat'], $stop['stop_lon'], $_SESSION['lat'], $_SESSION['lon'], true) . 'm away</span>'; | echo '<span class="ui-li-count">' . distance($stop['stop_lat'], $stop['stop_lon'], $_SESSION['lat'], $_SESSION['lon'], true) . 'm away</span>'; |
| } | } |
| echo bracketsMeanNewLine($stop['stop_name']); | echo bracketsMeanNewLine($stop['stop_name']); |
| echo "</a></li>\n"; | echo "</a></li>\n"; |
| flush(); | flush(); |
| @ob_flush(); | @ob_flush(); |
| } | } |
| } | } |
| else { | else { |
| // this is a duplicated line item | // this is a duplicated line item |
| if ($key - 1 <= 0 || (trim(preg_replace("/\(Platform.*/", "", $stops[$key]['stop_name'])) != trim(preg_replace("/\(Platform.*/", "", $stops[$key - 1]['stop_name'])))) { | if ($key - 1 <= 0 || (trim(preg_replace("/\(Platform.*/", "", $stops[$key]['stop_name'])) != trim(preg_replace("/\(Platform.*/", "", $stops[$key - 1]['stop_name'])))) { |
| // first duplicate | // first duplicate |
| $stopsGrouped = Array( | $stopsGrouped = Array( |
| "name" => trim(preg_replace("/\(Platform.*/", "", $stop['stop_name'])) , | "name" => trim(preg_replace("/\(Platform.*/", "", $stop['stop_name'])) , |
| "stop_ids" => Array( | "stop_ids" => Array( |
| $stop['stop_id'] | $stop['stop_id'] |
| ) , | ) , |
| "stop_codes" => Array( | "stop_codes" => Array( |
| $stop['stop_code'] | $stop['stop_code'] |
| ) | ) |
| ); | ); |
| } | } |
| else { | else { |
| // subsequent duplicates | // subsequent duplicates |
| $stopsGrouped["stop_ids"][] = $stop['stop_id'];; | $stopsGrouped["stop_ids"][] = $stop['stop_id'];; |
| } | } |
| } | } |
| } | } |
| } | } |
| echo '</ul>'; | echo '</ul>'; |
| if (isset($nearby)) echo '</span>'; | |
| } | } |
| include_footer(); | include_footer(); |
| ?> | ?> |
| <?php | <?php |
| include ('include/common.inc.php'); | include ('include/common.inc.php'); |
| $routetrips = Array(); | $routetrips = Array(); |
| if (isset($routeid) && !isset($tripid)) { | if (isset($routeid) && !isset($tripid)) { |
| $trip = getRouteNextTrip($routeid); | $trip = getRouteNextTrip($routeid); |
| $tripid = $trip['trip_id']; | $tripid = $trip['trip_id']; |
| } else { | } |
| $trip = getTrip($tripid); | else { |
| $routeid = $trip["route_id"]; | $trip = getTrip($tripid); |
| $routeid = $trip["route_id"]; | |
| } | } |
| $routetrips = getRouteTrips($routeid); | |
| include_header("Stops on " . $trip['route_short_name'] . ' ' . $trip['route_long_name'], "trip"); | include_header("Stops on " . $trip['route_short_name'] . ' ' . $trip['route_long_name'], "trip"); |
| trackEvent("Route/Trip View","View Route", $trip['route_short_name'] . ' ' . $trip['route_long_name'], $routeid); | trackEvent("Route/Trip View", "View Route", $trip['route_short_name'] . ' ' . $trip['route_long_name'], $routeid); |
| echo '<span class="content-secondary">'; | |
| echo '<span id="leftcolumn">'; | echo '<a href="' . $trip['route_url'] . '">View Original Timetable/Map</a>'; |
| echo '<h2>Via:</h2> <small>' . viaPointNames($tripid) . '</small>'; | echo '<h2>Via:</h2> <small>' . viaPointNames($tripid) . '</small>'; |
| echo '<h2>Other Trips:</h2> '; | echo '<h2>Other Trips:</h2> '; |
| foreach (getRouteTrips($routeid) as $othertrip) { | $routeTrips = getRouteTrips($routeid); |
| echo '<a href="trip.php?tripid=' . $othertrip['trip_id'] . "&routeid=" . $routeid . '">' . str_replace(" ",":00",str_replace(":00"," ",$othertrip['arrival_time'])). '</a> '; | foreach ($routeTrips as $key => $othertrip) { |
| if ($othertrip['trip_id']!= $tripid) { | |
| echo '<a href="trip.php?tripid=' . $othertrip['trip_id'] . "&routeid=" . $routeid . '">' . str_replace(" ", ":00", str_replace(":00", " ", $othertrip['arrival_time'])) . '</a> '; | |
| } else { | |
| // skip this trip but look forward/back | |
| if ($key-1 > 0) $prevTrip = $routeTrips[$key-1]['trip_id']; | |
| if ($key+1 < sizeof($routeTrips)) $nextTrip = $routeTrips[$key+1]['trip_id']; | |
| } | |
| } | } |
| flush(); @ob_flush(); | flush(); |
| @ob_flush(); | |
| echo '<h2>Other directions/timing periods:</h2> '; | echo '<h2>Other directions/timing periods:</h2> '; |
| $otherDir = 0; | |
| foreach (getRoutesByNumber($trip['route_short_name']) as $row) { | foreach (getRoutesByNumber($trip['route_short_name']) as $row) { |
| if ($row['route_id'] != $routeid) echo '<a href="trip.php?routeid=' . $row['route_id'] . '">' . $row['route_long_name'] . ' (' . ucwords($row['service_id']) . ')</a> '; | if ($row['route_id'] != $routeid) { |
| echo '<a href="trip.php?routeid=' . $row['route_id'] . '">' . $row['route_long_name'] . ' (' . ucwords($row['service_id']) . ')</a> '; | |
| $otherDir++; | |
| } | |
| } | } |
| echo '</span><span id="rightcolumn">'; | if ($otherDir == 0) echo "None"; |
| flush(); @ob_flush(); | echo '</span><span class="content-primary">'; |
| flush(); | |
| @ob_flush(); | |
| echo "<div class='ui-header' style='overflow: visible; height: 1.5em'>"; | |
| if($nextTrip) echo '<a href="trip.php?tripid=' . $nextTrip . "&routeid=" . $routeid . '" data-icon="arrow-r" class="ui-btn-right">Next Trip</a>'; | |
| if($prevTrip) echo '<a href="trip.php?tripid=' . $prevTrip . "&routeid=" . $routeid . '" data-icon="arrow-l" class="ui-btn-left">Previous Trip</a>'; | |
| echo "</div>"; | |
| echo ' <ul data-role="listview" data-inset="true">'; | echo ' <ul data-role="listview" data-inset="true">'; |
| $stopsGrouped = Array(); | $stopsGrouped = Array(); |
| $tripStopTimes = getTimeInterpolatedTrip($tripid); | $tripStopTimes = getTimeInterpolatedTrip($tripid); |
| echo '<li data-role="list-divider">' . $tripStopTimes[0]['arrival_time'] . ' to ' . $tripStopTimes[sizeof($tripStopTimes) - 1]['arrival_time'] . ' ' . $trip['route_long_name'] . ' (' . ucwords($tripStopTimes[0]['service_id']).')</li>'; | echo '<li data-role="list-divider">' . $tripStopTimes[0]['arrival_time'] . ' to ' . $tripStopTimes[sizeof($tripStopTimes) - 1]['arrival_time'] . ' ' . $trip['route_long_name'] . ' (' . ucwords($tripStopTimes[0]['service_id']) . ')</li>'; |
| foreach ($tripStopTimes as $key => $tripStopTime) { | foreach ($tripStopTimes as $key => $tripStopTime) { |
| if (($tripStopTimes[$key]["stop_name"] != $tripStopTimes[$key + 1]["stop_name"]) || $key + 1 >= sizeof($tripStopTimes)) { | if (($tripStopTimes[$key]["stop_name"] != $tripStopTimes[$key + 1]["stop_name"]) || $key + 1 >= sizeof($tripStopTimes)) { |
| echo '<li>'; | echo '<li>'; |
| if (!startsWith($tripStopTime['stop_code'], "Wj")) echo '<img src="css/images/time.png" alt="Timing Point" class="ui-li-icon">'; | if (!startsWith($tripStopTime['stop_code'], "Wj")) echo '<img src="css/images/time.png" alt="Timing Point" class="ui-li-icon">'; |
| if (sizeof($stopsGrouped) > 0) { | if (sizeof($stopsGrouped) > 0) { |
| // print and empty grouped stops | // print and empty grouped stops |
| // subsequent duplicates | // subsequent duplicates |
| $stopsGrouped["stop_ids"][] = $tripStopTime['stop_id']; | $stopsGrouped["stop_ids"][] = $tripStopTime['stop_id']; |
| $stopsGrouped["endTime"] = $tripStopTime['arrival_time']; | $stopsGrouped["endTime"] = $tripStopTime['arrival_time']; |
| echo '<a href="stop.php?stopids=' . implode(",", $stopsGrouped['stop_ids']) . '">'; | echo '<a href="stop.php?stopids=' . implode(",", $stopsGrouped['stop_ids']) . '">'; |
| echo '<p class="ui-li-aside">' . $stopsGrouped['startTime'] . ' to ' . $stopsGrouped['endTime']; | echo '<p class="ui-li-aside">' . $stopsGrouped['startTime'] . ' to ' . $stopsGrouped['endTime']; |
| if (isset($_SESSION['lat']) && isset($_SESSION['lon'])) { | |
| if (isset($_SESSION['lat']) && isset($_SESSION['lon'])) { | echo '<br>' . distance($tripStopTime['stop_lat'], $tripStopTime['stop_lon'], $_SESSION['lat'], $_SESSION['lon'], true) . 'm away'; |
| echo '<br>' . distance($tripStopTime['stop_lat'],$tripStopTime['stop_lon'], $_SESSION['lat'], $_SESSION['lon'], true) . 'm away'; | } |
| } | echo '</p>'; |
| echo '</p>'; | |
| echo bracketsMeanNewLine($tripStopTime["stop_name"]); | echo bracketsMeanNewLine($tripStopTime["stop_name"]); |
| echo '</a></li>'; | echo '</a></li>'; |
| flush(); @ob_flush(); | flush(); |
| @ob_flush(); | |
| $stopsGrouped = Array(); | $stopsGrouped = Array(); |
| } | } |
| else { | else { |
| // just a normal stop | // just a normal stop |
| echo '<a href="stop.php?stopid=' . $tripStopTime['stop_id'] . (startsWith($tripStopTime['stop_code'], "Wj") ? '&stopcode=' . $tripStopTime['stop_code'] : "") . '">'; | echo '<a href="stop.php?stopid=' . $tripStopTime['stop_id'] . (startsWith($tripStopTime['stop_code'], "Wj") ? '&stopcode=' . $tripStopTime['stop_code'] : "") . '">'; |
| echo '<p class="ui-li-aside">' . $tripStopTime['arrival_time']; | echo '<p class="ui-li-aside">' . $tripStopTime['arrival_time']; |
| if (isset($_SESSION['lat']) && isset($_SESSION['lon'])) { | if (isset($_SESSION['lat']) && isset($_SESSION['lon'])) { |
| echo '<br>' . distance($tripStopTime['stop_lat'],$tripStopTime['stop_lon'], $_SESSION['lat'], $_SESSION['lon'], true) . 'm away'; | echo '<br>' . distance($tripStopTime['stop_lat'], $tripStopTime['stop_lon'], $_SESSION['lat'], $_SESSION['lon'], true) . 'm away'; |
| } | } |
| echo '</p>'; | echo '</p>'; |
| echo bracketsMeanNewLine($tripStopTime['stop_name']); | echo bracketsMeanNewLine($tripStopTime['stop_name']); |
| echo '</a></li>'; | echo '</a></li>'; |
| flush(); @ob_flush(); | flush(); |
| @ob_flush(); | |
| } | } |
| } | } |
| else { | else { |
| // this is a duplicated line item | // this is a duplicated line item |
| if ($key - 1 <= 0 || ($tripStopTimes[$key]['stop_name'] != $tripStopTimes[$key - 1]['stop_name'])) { | if ($key - 1 <= 0 || ($tripStopTimes[$key]['stop_name'] != $tripStopTimes[$key - 1]['stop_name'])) { |
| // first duplicate | // first duplicate |
| $stopsGrouped = Array( | $stopsGrouped = Array( |
| "name" => $tripStopTime['stop_name'], | "name" => $tripStopTime['stop_name'], |
| "startTime" => $tripStopTime['arrival_time'], | "startTime" => $tripStopTime['arrival_time'], |
| "stop_ids" => Array( | "stop_ids" => Array( |
| $tripStopTime['stop_id'] | $tripStopTime['stop_id'] |
| ) | ) |
| ); | ); |
| } | } |
| else { | else { |
| // subsequent duplicates | // subsequent duplicates |
| $stopsGrouped["stop_ids"][] = $tripStopTime['stop_id']; | $stopsGrouped["stop_ids"][] = $tripStopTime['stop_id']; |
| $stopsGrouped["endTime"] = $tripStopTime['arrival_time']; | $stopsGrouped["endTime"] = $tripStopTime['arrival_time']; |
| } | } |
| } | } |
| } | } |
| echo '</ul>'; | echo '</ul>'; |
| echo '</span>'; | echo '</span>'; |
| include_footer(); | include_footer(); |
| ?> | ?> |
| <?php | <?php |
| include ('include/common.inc.php'); | include ('include/common.inc.php'); |
| include_header("Trip Planner", "tripPlanner", true, true, true); | include_header("Trip Planner", "tripPlanner", true, false, true); |
| $from = (isset($_REQUEST['from']) ? filter_var($_REQUEST['from'], FILTER_SANITIZE_STRING) : ""); | $from = (isset($_REQUEST['from']) ? filter_var($_REQUEST['from'], FILTER_SANITIZE_STRING) : ""); |
| $to = (isset($_REQUEST['to']) ? filter_var($_REQUEST['to'], FILTER_SANITIZE_STRING) : ""); | $to = (isset($_REQUEST['to']) ? filter_var($_REQUEST['to'], FILTER_SANITIZE_STRING) : ""); |
| $date = (isset($_REQUEST['date']) ? filter_var($_REQUEST['date'], FILTER_SANITIZE_STRING) : date("m/d/Y")); | $date = (isset($_REQUEST['date']) ? filter_var($_REQUEST['date'], FILTER_SANITIZE_STRING) : date("m/d/Y")); |
| $time = (isset($_REQUEST['time']) ? filter_var($_REQUEST['time'], FILTER_SANITIZE_STRING) : date("H:i")); | $time = (isset($_REQUEST['time']) ? filter_var($_REQUEST['time'], FILTER_SANITIZE_STRING) : date("H:i")); |
| function formatTime($timeString) | function formatTime($timeString) |
| { | { |
| $timeParts = explode("T", $timeString); | $timeParts = explode("T", $timeString); |
| return str_replace("Z", "", $timeParts[1]); | return str_replace("Z", "", $timeParts[1]); |
| } | } |
| function tripPlanForm($errorMessage = "") | function tripPlanForm($errorMessage = "") |
| { | { |
| global $date, $time, $from, $to; | global $date, $time, $from, $to; |
| echo "<font color=red>$errorMessage</font>"; | echo "<div class='error'>$errorMessage</font>"; |
| echo '<form action="tripPlanner.php" method="post"> | echo '<form action="tripPlanner.php" method="post"> |
| <div data-role="fieldcontain"> | <div data-role="fieldcontain"> |
| <label for="from">I would like to go from</label> | <label for="from">I would like to go from</label> |
| <input type="text" name="from" id="from" value="' . $from . '" /> | <input type="text" name="from" id="from" value="' . $from . '" /> |
| <a href="#" style="display:none" name="fromHere" id="fromHere"/>Here?</a> | <a href="#" style="display:none" name="fromHere" id="fromHere">Here?</a> |
| </div> | </div> |
| <div data-role="fieldcontain"> | <div data-role="fieldcontain"> |
| <label for="to"> to </label> | <label for="to"> to </label> |
| <input type="text" name="to" id="to" value="' . $to . '" /> | <input type="text" name="to" id="to" value="' . $to . '" /> |
| <a href="#" style="display:none" name="toHere" id="toHere"/>Here?</a> | <a href="#" style="display:none" name="toHere" id="toHere">Here?</a> |
| </div> | </div> |
| <div data-role="fieldcontain"> | <div data-role="fieldcontain"> |
| <label for="date"> on </label> | <label for="date"> on </label> |
| <input type="text" name="date" id="date" value="' . $date . '" /> | <input type="text" name="date" id="date" value="' . $date . '" /> |
| </div> | </div> |
| <div data-role="fieldcontain"> | <div data-role="fieldcontain"> |
| <label for="time"> at </label> | <label for="time"> at </label> |
| <input type="time" name="time" id="time" value="' . $time . '" /> | <input type="time" name="time" id="time" value="' . $time . '" /> |
| </div> | </div> |
| <input type="submit" value="Go!"></form>'; | <input type="submit" value="Go!"></form>'; |
| echo "<script> | |
| $('#toHere').click(function(event) { $('#to').val(getCookie('geolocate')); return false;}); | |
| $('#toHere').show(); | |
| $('#fromHere').click(function(event) { $('#from').val(getCookie('geolocate')); return false;}); | |
| $('#fromHere').show(); | |
| </script>"; | |
| } | } |
| function processItinerary($itineraryNumber, $itinerary) | function processItinerary($itineraryNumber, $itinerary) |
| { | { |
| echo '<div data-role="collapsible" ' . ($itineraryNumber > 0 ? 'data-collapsed="true"' : "") . '> <h3> Option #' . ($itineraryNumber + 1) . ": " . floor($itinerary->duration / 60000) . " minutes (" . formatTime($itinerary->startTime) . " to " . formatTime($itinerary->endTime) . ")</h3><p>"; | echo '<div data-role="collapsible" ' . ($itineraryNumber > 0 ? 'data-collapsed="true"' : "") . '> <h3> Option #' . ($itineraryNumber + 1) . ": " . floor($itinerary->duration / 60000) . " minutes (" . formatTime($itinerary->startTime) . " to " . formatTime($itinerary->endTime) . ")</h3><p>"; |
| echo "Walking time: " . floor($itinerary->walkTime / 60000) . " minutes (" . floor($itinerary->walkDistance) . " meters)<br>\n"; | echo "Walking time: " . floor($itinerary->walkTime / 60000) . " minutes (" . floor($itinerary->walkDistance) . " meters)<br>\n"; |
| echo "Transit time: " . floor($itinerary->transitTime / 60000) . " minutes<br>\n"; | echo "Transit time: " . floor($itinerary->transitTime / 60000) . " minutes<br>\n"; |
| echo "Waiting time: " . floor($itinerary->waitingTime / 60000) . " minutes<br>\n"; | echo "Waiting time: " . floor($itinerary->waitingTime / 60000) . " minutes<br>\n"; |
| if (is_array($itinerary->legs->leg)) { | if (is_array($itinerary->legs->leg)) { |
| $legMarkers = array(); | $legMarkers = array(); |
| foreach ($itinerary->legs->leg as $legNumber => $leg) { | foreach ($itinerary->legs->leg as $legNumber => $leg) { |
| $legMarkers[] = array( | $legMarkers[] = array( |
| $leg->from->lat, | $leg->from->lat, |
| $leg->from->lon | $leg->from->lon |
| ); | ); |
| } | } |
| echo '' . staticmap($legMarkers, 0, "iconb", false) . "<br>\n"; | echo '' . staticmap($legMarkers, 0, "iconb", false) . "<br>\n"; |
| echo '<ul>'; | echo '<ul>'; |
| foreach ($itinerary->legs->leg as $legNumber => $leg) { | foreach ($itinerary->legs->leg as $legNumber => $leg) { |
| echo '<li>'; | echo '<li>'; |
| processLeg($legNumber, $leg); | processLeg($legNumber, $leg); |
| echo "</li>"; | echo "</li>"; |
| flush(); | flush(); |
| @ob_flush(); | @ob_flush(); |
| } | } |
| echo "</ul>"; | echo "</ul>"; |
| } | } |
| else { | else { |
| echo '' . staticmap(array( | echo '' . staticmap(array( |
| array( | array( |
| $itinerary->legs->leg->from->lat, | $itinerary->legs->leg->from->lat, |
| $itinerary->legs->leg->from->lon | $itinerary->legs->leg->from->lon |
| ) | ) |
| ) , 0, "iconb", false) . "<br>\n"; | ) , 0, "iconb", false) . "<br>\n"; |
| processLeg(0, $itinerary->legs->leg); | processLeg(0, $itinerary->legs->leg); |
| } | } |
| echo "</p></div>"; | echo "</p></div>"; |
| } | } |
| function processLeg($legNumber, $leg) | function processLeg($legNumber, $leg) |
| { | { |
| $legArray = object2array($leg); | $legArray = object2array($leg); |
| echo '<h3>Leg #' . ($legNumber + 1) . " ( {$legArray['@mode']} from: {$leg->from->name} to {$leg->to->name}, " . floor($leg->duration / 60000) . " minutes) </h3>\n"; | echo '<h3>Leg #' . ($legNumber + 1) . " ( {$legArray['@mode']} from: {$leg->from->name} to {$leg->to->name}, " . floor($leg->duration / 60000) . " minutes) </h3>\n"; |
| if ($legArray["@mode"] === "BUS") { | if ($legArray["@mode"] === "BUS") { |
| echo "Take bus {$legArray['@route']} " . str_replace("To", "towards", $legArray['@headsign']) . "<br>"; | echo "Take bus {$legArray['@route']} " . str_replace("To", "towards", $legArray['@headsign']) . " departing at ". formatTime($leg->startTime)."<br>"; |
| } | } |
| else { | else { |
| $walkStepMarkers = array(); | $walkStepMarkers = array(); |
| foreach ($leg->steps->walkSteps as $stepNumber => $step) { | foreach ($leg->steps->walkSteps as $stepNumber => $step) { |
| $walkStepMarkers[] = array( | $walkStepMarkers[] = array( |
| $step->lat, | $step->lat, |
| $step->lon | $step->lon |
| ); | ); |
| } | } |
| echo "" . staticmap($walkStepMarkers, 0, "icong", false) . "<br>\n"; | echo "" . staticmap($walkStepMarkers, 0, "icong", false) . "<br>\n"; |
| foreach ($leg->steps->walkSteps as $stepNumber => $step) { | foreach ($leg->steps->walkSteps as $stepNumber => $step) { |
| echo "Walking step " . ($stepNumber + 1) . ": "; | echo "Walking step " . ($stepNumber + 1) . ": "; |
| if ($step->relativeDirection == "CONTINUE") { | if ($step->relativeDirection == "CONTINUE") { |
| echo "Continue, "; | echo "Continue, "; |
| } | } |
| else if ($step->relativeDirection) echo "Turn " . ucwords(strtolower(str_replace("_", " ", $step->relativeDirection))) . ", "; | else if ($step->relativeDirection) echo "Turn " . ucwords(strtolower(str_replace("_", " ", $step->relativeDirection))) . ", "; |
| echo "Go " . ucwords(strtolower($step->absoluteDirection)) . " on "; | echo "Go " . ucwords(strtolower($step->absoluteDirection)) . " on "; |
| if (strpos($step->streetName, "from") !== false && strpos($step->streetName, "way") !== false) { | if (strpos($step->streetName, "from") !== false && strpos($step->streetName, "way") !== false) { |
| echo "footpath"; | echo "footpath"; |
| } | } |
| else { | else { |
| echo $step->streetName; | echo $step->streetName; |
| } | } |
| echo " for " . floor($step->distance) . " meters<br>\n"; | echo " for " . floor($step->distance) . " meters<br>\n"; |
| } | } |
| } | } |
| } | } |
| if ($_REQUEST['time']) { | if ($_REQUEST['time']) { |
| if (startsWith($to, "-")) { | if (startsWith($to, "-")) { |
| $toPlace = $to; | $toPlace = $to; |
| } | } |
| else if (strpos($to, "(") !== false) { | else if (strpos($to, "(") !== false) { |
| $toParts = explode("(", $to); | $toParts = explode("(", $to); |
| print_r($toParts); | |
| $toPlace = str_replace( ")", "", $toParts[1]); | $toPlace = str_replace( ")", "", $toParts[1]); |
| } | } |
| else { | else { |
| $toPlace = geocode($to, false); | $toPlace = geocode($to, false); |
| } | } |
| if (startsWith($from, "-")) { | if (startsWith($from, "-")) { |
| $fromPlace = $from; | $fromPlace = $from; |
| } | } |
| else if (strpos($from, "(") !== false) { | else if (strpos($from, "(") !== false) { |
| $fromParts = explode("(", urldecode($from)); | $fromParts = explode("(", urldecode($from)); |
| $fromPlace = str_replace(")", "", $fromParts[1]); | $fromPlace = str_replace(")", "", $fromParts[1]); |
| } | } |
| else { | else { |
| $fromPlace = geocode($from, false); | $fromPlace = geocode($from, false); |
| } | } |
| if ($toPlace == "" || $fromPlace == "") { | if ($toPlace == "" || $fromPlace == "") { |
| $errorMessage = ""; | $errorMessage = ""; |
| if ($toPlace == "") { | if ($toPlace == "") { |
| $errorMessage.= urlencode($to) . " not found.<br>\n"; | $errorMessage.= urlencode($to) . " not found.<br>\n"; |
| trackEvent("Trip Planner", "Geocoder Failed", $to); | trackEvent("Trip Planner", "Geocoder Failed", $to); |
| } | } |
| if ($fromPlace == "") { | if ($fromPlace == "") { |
| $errorMessage.= urlencode($from) . " not found.<br>\n"; | $errorMessage.= urlencode($from) . " not found.<br>\n"; |
| trackEvent("Trip Planner", "Geocoder Failed", $from); | trackEvent("Trip Planner", "Geocoder Failed", $from); |
| } | } |
| tripPlanForm($errorMessage); | tripPlanForm($errorMessage); |
| } | } |
| else { | else { |
| $url = $otpAPIurl . "ws/plan?date=" . urlencode($_REQUEST['date']) . "&time=" . urlencode($_REQUEST['time']) . "&mode=TRANSIT%2CWALK&optimize=QUICK&maxWalkDistance=840&wheelchair=false&toPlace=$toPlace&fromPlace=$fromPlace&intermediatePlaces="; | $url = $otpAPIurl . "ws/plan?date=" . urlencode($_REQUEST['date']) . "&time=" . urlencode($_REQUEST['time']) . "&mode=TRANSIT%2CWALK&optimize=QUICK&maxWalkDistance=840&wheelchair=false&toPlace=$toPlace&fromPlace=$fromPlace&intermediatePlaces="; |
| debug($url); | debug($url); |
| $ch = curl_init($url); | $ch = curl_init($url); |
| curl_setopt($ch, CURLOPT_RETURNTRANSFER, 1); | curl_setopt($ch, CURLOPT_RETURNTRANSFER, 1); |
| curl_setopt($ch, CURLOPT_HEADER, 0); | curl_setopt($ch, CURLOPT_HEADER, 0); |
| curl_setopt($ch, CURLOPT_HTTPHEADER, array( | curl_setopt($ch, CURLOPT_HTTPHEADER, array( |
| "Accept: application/json" | "Accept: application/json" |
| )); | )); |
| curl_setopt($ch, CURLOPT_TIMEOUT, 10); | curl_setopt($ch, CURLOPT_TIMEOUT, 10); |
| $page = curl_exec($ch); | $page = curl_exec($ch); |
| if (curl_errno($ch) || curl_getinfo($ch, CURLINFO_HTTP_CODE) != 200) { | if (curl_errno($ch) || curl_getinfo($ch, CURLINFO_HTTP_CODE) != 200) { |
| tripPlanForm("Trip planner temporarily unavailable: " . curl_errno($ch) . " " . curl_error($ch) . " " . curl_getinfo($ch, CURLINFO_HTTP_CODE) . (isDebug() ? "<br>" . $url : "")); | tripPlanForm("Trip planner temporarily unavailable: " . curl_errno($ch) . " " . curl_error($ch) . " " . curl_getinfo($ch, CURLINFO_HTTP_CODE) . (isDebug() ? "<br>" . $url : "")); |
| trackEvent("Trip Planner", "Trip Planner Failed", $url); | trackEvent("Trip Planner", "Trip Planner Failed", $url); |
| } | } |
| else { | else { |
| trackEvent("Trip Planner", "Plan Trip From", $from); | trackEvent("Trip Planner", "Plan Trip From", $from); |
| trackEvent("Trip Planner", "Plan Trip To", $to); | trackEvent("Trip Planner", "Plan Trip To", $to); |
| $tripplan = json_decode($page); | $tripplan = json_decode($page); |
| debug(print_r($tripplan, true)); | debug(print_r($tripplan, true)); |
| echo "<h1> From: {$tripplan->plan->from->name} To: {$tripplan->plan->to->name} </h1>"; | echo "<h1> From: {$tripplan->plan->from->name} To: {$tripplan->plan->to->name} </h1>"; |
| echo "<h1> At: " . formatTime($tripplan->plan->date) . " </h1>"; | echo "<h1> At: " . formatTime($tripplan->plan->date) . " </h1>"; |
| if (is_array($tripplan->plan->itineraries->itinerary)) { | if (is_array($tripplan->plan->itineraries->itinerary)) { |
| echo '<div data-role="collapsible-set">'; | echo '<div data-role="collapsible-set">'; |
| foreach ($tripplan->plan->itineraries->itinerary as $itineraryNumber => $itinerary) { | foreach ($tripplan->plan->itineraries->itinerary as $itineraryNumber => $itinerary) { |
| processItinerary($itineraryNumber, $itinerary); | processItinerary($itineraryNumber, $itinerary); |
| } | } |
| echo "</div>"; | echo "</div>"; |
| } | } |
| else { | else { |
| processItinerary(0, $tripplan->plan->itineraries->itinerary); | processItinerary(0, $tripplan->plan->itineraries->itinerary); |
| } | } |
| } | } |
| curl_close($ch); | curl_close($ch); |
| } | } |
| } | } |
| else { | else { |
| tripPlanForm(); | tripPlanForm(); |
| } | } |
| include_footer(); | include_footer(); |
| ?> | ?> |
| <?php | <?php |
| include('include/common-db.inc.php'); | if ( php_sapi_name() == "cli") { |
| include ('include/common.inc.php'); | |
| $conn = pg_connect("dbname=transitdata user=postgres password=snmc host=localhost") or die('connection failed'); | |
| $pdconn = new PDO("pgsql:dbname=transitdata;user=postgres;password=snmc;host=localhost"); | |
| /* | |
| delete from agency; | |
| delete from calendar; | |
| delete from calendar_dates; | |
| delete from routes; | |
| delete from shapes; | |
| delete from stop_times; | |
| delete from stops; | |
| delete from trips; | |
| */ | |
| // Unzip cbrfeed.zip, import all csv files to database | // Unzip cbrfeed.zip, import all csv files to database |
| $unzip = true; | $unzip = true; |
| $zip = zip_open(dirname(__FILE__) . "/cbrfeed.zip"); | $zip = zip_open(dirname(__FILE__) . "/cbrfeed.zip"); |
| $tmpdir = "/tmp/cbrfeed/"; | $tmpdir = "/tmp/cbrfeed/"; |
| mkdir($tmpdir); | mkdir($tmpdir); |
| if ($unzip) { | if ($unzip) { |
| if (is_resource($zip)) { | if (is_resource($zip)) { |
| while ($zip_entry = zip_read($zip)) { | while ($zip_entry = zip_read($zip)) { |
| $fp = fopen($tmpdir . zip_entry_name($zip_entry) , "w"); | $fp = fopen($tmpdir . zip_entry_name($zip_entry) , "w"); |
| if (zip_entry_open($zip, $zip_entry, "r")) { | if (zip_entry_open($zip, $zip_entry, "r")) { |
| echo "Extracting " . zip_entry_name($zip_entry) . "\n"; | echo "Extracting " . zip_entry_name($zip_entry) . "\n"; |
| $buf = zip_entry_read($zip_entry, zip_entry_filesize($zip_entry)); | $buf = zip_entry_read($zip_entry, zip_entry_filesize($zip_entry)); |
| fwrite($fp, "$buf"); | fwrite($fp, "$buf"); |
| zip_entry_close($zip_entry); | zip_entry_close($zip_entry); |
| fclose($fp); | fclose($fp); |
| } | } |
| } | } |
| zip_close($zip); | zip_close($zip); |
| } | } |
| } | } |
| foreach (scandir($tmpdir) as $file) { | foreach (scandir($tmpdir) as $file) { |
| if (!strpos($file, ".txt") === false) { | if (!strpos($file, ".txt") === false) { |
| $fieldseparator = ","; | $fieldseparator = ","; |
| $lineseparator = "\n"; | $lineseparator = "\n"; |
| $tablename = str_replace(".txt", "", $file); | $tablename = str_replace(".txt", "", $file); |
| echo "Opening $file \n"; | echo "Opening $file \n"; |
| $line = 0; | $line = 0; |
| $handle = fopen($tmpdir . $file, "r"); | $handle = fopen($tmpdir . $file, "r"); |
| if ($tablename =="stop_times") { | |
| $stmt = $pdconn->prepare("insert into stop_times (trip_id,stop_id,stop_sequence,arrival_time,departure_time) values(:trip_id, :stop_id, :stop_sequence,:arrival_time,:departure_time);"); | |
| $stmt->bindParam(':trip_id',$trip_id); | |
| $stmt->bindParam(':stop_id',$stop_id); | |
| $stmt->bindParam(':stop_sequence',$stop_sequence); | |
| $stmt->bindParam(':arrival_time',$time); | |
| $stmt->bindParam(':departure_time',$time); | |
| } | |
| while (($data = fgetcsv($handle, 1000, ",")) !== FALSE) { | while (($data = fgetcsv($handle, 1000, ",")) !== FALSE) { |
| if ($line > 0) { | if ($line == 0) { |
| } else { | |
| $query = "insert into $tablename values("; | $query = "insert into $tablename values("; |
| $valueCount = 0; | $valueCount = 0; |
| foreach ($data as $value) { | foreach ($data as $value) { |
| $query.=($valueCount >0 ? "','" :"'").pg_escape_string($value); | $query.=($valueCount >0 ? "','" :"'").pg_escape_string($value); |
| $valueCount++; | $valueCount++; |
| } | } |
| if ($tablename == "stops") { | if ($tablename == "stops") { |
| $query.= "', ST_GeographyFromText('SRID=4326;POINT({$data[2]} {$data[0]})'));"; | $query.= "', ST_GeographyFromText('SRID=4326;POINT({$data[2]} {$data[0]})'));"; |
| } else { | } else { |
| $query.= "');"; | $query.= "');"; |
| } | } |
| if ($tablename =="stop_times" && $data[1] == "") { | if ($tablename =="stop_times") { |
| $query = "insert into $tablename (trip_id,stop_id,stop_sequence) values('{$data[0]}','{$data[3]}','{$data[4]}');"; | // $query = "insert into $tablename (trip_id,stop_id,stop_sequence) values('{$data[0]}','{$data[3]}','{$data[4]}');"; |
| } | $trip_id=$data[0]; |
| $stop_id=$data[3]; | |
| $stop_sequence=$data[4]; | |
| $time=($data[1] == "" ? null : $data[1]); | |
| } | |
| } | } |
| $result = pg_query($conn, $query); | if ($tablename =="stop_times") { |
| $stmt->execute(); | |
| } | |
| else { | |
| $result = pg_query($conn, $query); | |
| } | |
| $line++; | $line++; |
| if ($line % 10000 == 0) echo "$line records... \n"; | if ($line % 10000 == 0) echo "$line records... ".date('c')."\n"; |
| } | } |
| fclose($handle); | fclose($handle); |
| echo "Found a total of $line records in $file.\n"; | echo "Found a total of $line records in $file.\n"; |
| } | } |
| } | } |
| } | |
| ?> | ?> |