Add OpenID auth for editing pages
Add OpenID auth for editing pages

file:b/.box (new)
--- /dev/null
+++ b/.box
@@ -1,1 +1,5 @@
+shared_writable_dirs:
+    - /labs/tiles
+    - /lib/staticmaplite/cache
+php_extensions: [pgsql, pdo, pdo_pgsql, curl]
 

file:b/.gitignore (new)
--- /dev/null
+++ b/.gitignore
@@ -1,1 +1,8 @@
 
+/labs/tiles/12
+/labs/tiles/13
+/labs/tiles/14
+/labs/tiles/15
+/labs/tiles/16
+/labs/tiles/17
+/labs/tiles/19

file:a/about.php -> file:b/about.php
--- a/about.php
+++ b/about.php
@@ -17,6 +17,10 @@
 Feedback encouraged; contact maxious@lambdacomplex.org<br />
     <br />
 Some icons by Joseph Wain / glyphish.com<br />
+Native clients also available for iPhone(<a href="http://itunes.apple.com/au/app/cbrtimetable/id444287349?mt=8">cbrTimetable by Sandor Kolotenko</a>
+, <a href="http://itunes.apple.com/au/app/act-buses/id376634797?mt=8">ACT Buses by David Sullivan</a>) 
+and Android (<a href="https://market.android.com/details?id=com.action">MyBus 2.0 by Imagine Team</a>)
+<br />
 <br />
 <small>Disclaimer: The content of this website is of a general and informative nature. Please check with printed timetables or those available on http://action.act.gov.au before your trip.
 Whilst every effort has been made to ensure the high quality and accuracy of the Site, the Author makes no warranty, 

--- a/aws/awsStartup.sh
+++ b/aws/awsStartup.sh
@@ -5,35 +5,9 @@
 #postgres postgres-server php-pg
 #http://www.how2forge.org/installing-lighttpd-with-php5-and-mysql-support-on-fedora-12
 
-cp /root/aws.php /tmp/
-mkdir /var/www/lib/staticmaplite/cache 
-chcon -h system_u:object_r:httpd_sys_content_t /var/www
-chcon -R -h root:object_r:httpd_sys_content_t /var/www/*
-chcon -R -t httpd_sys_content_rw_t /var/www/lib/staticmaplite/cache
-chmod -R 777 /var/www/lib/staticmaplite/cache 
-chcon -R -t httpd_sys_content_rw_t /var/www/labs/tiles
-chmod -R 777 /var/www/labs/tiles
-wget http://s3-ap-southeast-1.amazonaws.com/busresources/cbrfeed.zip \
--O /var/www/cbrfeed.zip
+sh busuiphp.sh
+sh busuidb.sh
+sh busuiotp.sh
 
-createdb transitdata
-createlang -d transitdata plpgsql
-psql -d transitdata -f /var/www/lib/postgis.sql
-# curl https://github.com/maxious/ACTBus-ui/raw/master/transitdata.cbrfeed.sql.gz -o transitdata.cbrfeed.sql.gz 
-#made with pg_dump transitdata | gzip -c >  transitdata.cbrfeed.sql.gz
-gunzip /var/www/transitdata.cbrfeed.sql.gz
-psql -d transitdata -f /var/www/transitdata.cbrfeed.sql
-#createuser transitdata -SDRP
-#password transitdata
-#psql -d transitdata -c \"GRANT SELECT ON TABLE agency,calendar,calendar_dates,routes,stop_times,stops,trips TO transitdata;\"
-php /var/www/updatedb.php
 
-wget http://s3-ap-southeast-1.amazonaws.com/busresources/Graph.obj \
--O /tmp/Graph.obj
-rm -rfv /usr/share/tomcat6/webapps/opentripplanner*
-wget http://s3-ap-southeast-1.amazonaws.com/busresources/opentripplanner-webapp.war \
--O /usr/share/tomcat6/webapps/opentripplanner-webapp.war
-wget http://s3-ap-southeast-1.amazonaws.com/busresources/opentripplanner-api-webapp.war \
--O /usr/share/tomcat6/webapps/opentripplanner-api-webapp.war
-/etc/init.d/tomcat6 restart
 

file:b/aws/busuidb.sh (new)
--- /dev/null
+++ b/aws/busuidb.sh
@@ -1,1 +1,14 @@
-
+createdb transitdata
+createlang -d transitdata plpgsql
+psql -d transitdata -f /var/www/lib/postgis.sql
+# curl https://github.com/maxious/ACTBus-ui/raw/master/transitdata.cbrfeed.sql.gz -o transitdata.cbrfeed.sql.gz 
+#made with pg_dump transitdata | gzip -c >  transitdata.cbrfeed.sql.gz
+gunzip /var/www/transitdata.cbrfeed.sql.gz
+psql -d transitdata -f /var/www/transitdata.cbrfeed.sql
+#createuser transitdata -SDRP
+#password transitdata
+#psql -d transitdata -c "GRANT SELECT ON TABLE agency,calendar,calendar_dates,routes,stop_times,stops,trips TO transitdata;"
+#psql -d transitdata -c "GRANT SELECT,INSERT ON	TABLE myway_observations,myway_routes,myway_stops,myway_timingdeltas TO transitdata;"
+#psql -d transitdata -c	"GRANT SELECT,INSERT,UPDATE ON TABLE myway_routes,myway_stops TO transitdata;"
+##psql -d transitdata -c "GRANT SELECT ON ALL TABLES IN SCHEMA public TO transitdata;"
+php /var/www/updatedb.php

file:b/aws/busuiotp.sh (new)
--- /dev/null
+++ b/aws/busuiotp.sh
@@ -1,1 +1,10 @@
+wget http://s3-ap-southeast-1.amazonaws.com/busresources/Graph.obj \
+-O /tmp/Graph.obj
+/etc/init.d/tomcat6 stop
+rm -rfv /usr/share/tomcat6/webapps/opentripplanner*
+wget http://s3-ap-southeast-1.amazonaws.com/busresources/opentripplanner-webapp.war \
+-O /usr/share/tomcat6/webapps/opentripplanner-webapp.war
+wget http://s3-ap-southeast-1.amazonaws.com/busresources/opentripplanner-api-webapp.war \
+-O /usr/share/tomcat6/webapps/opentripplanner-api-webapp.war
+/etc/init.d/tomcat6 restart
 

--- /dev/null
+++ b/aws/busuiotp.testing.sh
@@ -1,1 +1,10 @@
+wget http://s3-ap-southeast-1.amazonaws.com/busresources/testing/Graph.obj \
+-O /tmp/Graph.obj
+/etc/init.d/tomcat6 stop
+rm -rfv /usr/share/tomcat6/webapps/opentripplanner*
+wget http://s3-ap-southeast-1.amazonaws.com/busresources/testing/opentripplanner-webapp.war \
+-O /usr/share/tomcat6/webapps/opentripplanner-webapp.war
+wget http://s3-ap-southeast-1.amazonaws.com/busresources/testing/opentripplanner-api-webapp.war \
+-O /usr/share/tomcat6/webapps/opentripplanner-api-webapp.war
+/etc/init.d/tomcat6 restart
 

file:b/aws/busuiphp.sh (new)
--- /dev/null
+++ b/aws/busuiphp.sh
@@ -1,1 +1,16 @@
+cp /root/aws.php /tmp/
+mkdir /var/www/lib/staticmaplite/cache 
+chcon -h system_u:object_r:httpd_sys_content_t /var/www
+chcon -R -h root:object_r:httpd_sys_content_t /var/www/*
 
+chcon -R -t httpd_sys_content_rw_t /var/www/lib/staticmaplite/cache
+chmod -R 777 /var/www/lib/staticmaplite/cache 
+
+chcon -R -t httpd_sys_content_rw_t /var/www/labs/tiles
+chmod -R 777 /var/www/labs/tiles
+
+chcon -R -t httpd_sys_content_rw_t /var/www/lib/openid-php/oid_store
+chmod -R 777 /var/www/lib/openid-php/oid_store
+
+wget http://s3-ap-southeast-1.amazonaws.com/busresources/cbrfeed.zip \
+-O /var/www/cbrfeed.zip

--- /dev/null
+++ b/aws/data-sources.xml
@@ -1,1 +1,13 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<beans xmlns="http://www.springframework.org/schema/beans" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance"
+    xsi:schemaLocation="http://www.springframework.org/schema/beans http://www.springframework.org/schema/beans/spring-beans-2.5.xsd">
 
+        <!-- Single graph -->
+        <import resource="classpath:org/opentripplanner/api/application-context.xml" />
+
+        <bean id="graphBundle" class="org.opentripplanner.model.GraphBundle">
+                <property name="path" value="/tmp/" />
+        </bean>
+
+</beans>
+

--- a/css/jquery.mobile-1.0b1.css
+++ /dev/null
@@ -1,1662 +1,1 @@
-/*!
- * jQuery Mobile v1.0b1
- * http://jquerymobile.com/
- *
- * Copyright 2010, jQuery Project
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- */
-/*
-* jQuery Mobile Framework
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.
-* Note: Code is in draft form and is subject to change 
-*/
 
-
-/* A
------------------------------------------------------------------------------------------------------------*/
-
-.ui-bar-a {
-	border: 1px solid 		#2A2A2A;
-	background: 			#111111;
-	color: 					#ffffff;
-	font-weight: bold;
-	text-shadow: 0 -1px 1px #000000;
-	background-image: -moz-linear-gradient(top, 
-							#3c3c3c, 
-							#111111);
-	background-image: -webkit-gradient(linear,left top,left bottom,
-		color-stop(0, 	#3c3c3c),
-		color-stop(1, 		#111111));
-  	-ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#3c3c3c', EndColorStr='#111111')";
-}
-.ui-bar-a, 
-.ui-bar-a input, 
-.ui-bar-a select, 
-.ui-bar-a textarea, 
-.ui-bar-a button {
-	font-family: Helvetica, Arial, sans-serif;
-}
-.ui-bar-a .ui-link-inherit {
-	color: 					#fff;
-}
-.ui-bar-a .ui-link {
-	color: 					#7cc4e7;
-	font-weight: bold;
-}
-.ui-body-a {
-	border: 1px solid 		#2A2A2A;
-	background: 			#222222;
-	color: 					#fff;
-	 text-shadow: 0 1px 0 	#000;
-	font-weight: normal;
-	background-image: -moz-linear-gradient(top, 
-							#666666, 
-							#222222);
-	background-image: -webkit-gradient(linear,left top,left bottom,
-		color-stop(0, 		#666666),
-		color-stop(1, 		#222222));
-	-ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#666666', EndColorStr='#222222)')";
-}
-.ui-body-a,
-.ui-body-a input,
-.ui-body-a select,
-.ui-body-a textarea,
-.ui-body-a button {
-	font-family: Helvetica, Arial, sans-serif;
-}
-.ui-body-a .ui-link-inherit {
-	color: 					#fff;
-}
-.ui-body-a .ui-link {
-	color: 					#2489CE;
-	font-weight: bold;
-}
-.ui-br {
-	border-bottom: rgb(130,130,130);
-	border-bottom: rgba(130,130,130,.3);
-	border-bottom-width: 1px;
-	border-bottom-style: solid;
-}
-.ui-btn-up-a {
-	border: 1px solid 		#222;
-	background: 			#333333;
-	font-weight: bold;
-	color: 					#fff;
-	text-shadow: 0 -1px 1px #000;
-	background-image: -moz-linear-gradient(top, 
-							#555555, 
-							#333333);
-	background-image: -webkit-gradient(linear,left top,left bottom,
-		color-stop(0, 		#555555),
-		color-stop(1, 		#333333));
-	-ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#555555', EndColorStr='#333333')";
-}
-.ui-btn-up-a a.ui-link-inherit {
-	color: 					#fff;
-}
-.ui-btn-hover-a {
-	border: 1px solid 		#000;
-	background: 			#444444;
-	font-weight: bold;
-	color: 					#fff;
-	text-shadow: 0 -1px 1px #000;
-	background-image: -moz-linear-gradient(top, 
-							#666666, 
-							#444444);
-	background-image: -webkit-gradient(linear,left top,left bottom,
-		color-stop(0, 		#666666),
-		color-stop(1, 		#444444));
-	-ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#666666', EndColorStr='#444444')";
-}
-.ui-btn-hover-a a.ui-link-inherit {
-	color: 					#fff;
-}
-.ui-btn-down-a {
-	border: 1px solid 		#000;
-	background: 			#3d3d3d;
-	font-weight: bold;
-	color: 					#fff;
-	text-shadow: 0 -1px 1px #000;
-	background-image: -moz-linear-gradient(top, 
-							#333333, 
-							#5a5a5a);
-	background-image: -webkit-gradient(linear,left top,left bottom,
-		color-stop(0, 		#333333),
-		color-stop(1, 		#5a5a5a));
-	-ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#333333', EndColorStr='#5a5a5a')";
-}
-.ui-btn-down-a a.ui-link-inherit {
-	color: 					#fff;
-}
-.ui-btn-up-a,
-.ui-btn-hover-a,
-.ui-btn-down-a {
-	font-family: Helvetica, Arial, sans-serif;
-	text-decoration: none;
-}
-
-
-/* B
------------------------------------------------------------------------------------------------------------*/
-
-.ui-bar-b {
-	border: 1px solid 		#456f9a;
-	background: 			#5e87b0;
-	color: 					#fff;
-	font-weight: bold;
-	text-shadow: 0 -1px 1px #254f7a;
-	background-image: -moz-linear-gradient(top, 
-							#81a8ce, 
-							#5e87b0);
-	background-image: -webkit-gradient(linear,left top,left bottom,
-		color-stop(0, 		#81a8ce),
-		color-stop(1, 		#5e87b0));
-	-ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#81a8ce', EndColorStr='#5e87b0')";
-}
-.ui-bar-b,
-.ui-bar-b input,
-.ui-bar-b select,
-.ui-bar-b textarea,
-.ui-bar-b button {
-	font-family: Helvetica, Arial, sans-serif;
-}
-.ui-bar-b .ui-link-inherit {
-	color: 					#fff;
-}
-.ui-bar-b .ui-link {
-	color: 					#7cc4e7;
-	font-weight: bold;
-}
-
-.ui-body-b {
-	border: 1px solid 		#C6C6C6;
-	background: 			#cccccc;
-	color: 					#333333;
-	text-shadow: 0 1px 0 	#fff;
-	font-weight: normal;
-	background-image: -moz-linear-gradient(top, 
-							#e6e6e6, 
-							#cccccc);
-	background-image: -webkit-gradient(linear,left top,left bottom,
-		color-stop(0, 		#e6e6e6),
-		color-stop(1, 		#cccccc));
-	 -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#e6e6e6', EndColorStr='#cccccc')";
-}
-.ui-body-b,
-.ui-body-b input,
-.ui-body-b select,
-.ui-body-b textarea,
-.ui-body-b button {
-	font-family: Helvetica, Arial, sans-serif;
-}
-.ui-body-b .ui-link-inherit {
-	color: 					#333333;
-}
-.ui-body-b .ui-link {
-	color: 					#2489CE;
-	font-weight: bold;
-}
-.ui-btn-up-b {
-	border: 1px solid 		#145072;
-	background: 			#2567ab;
-	font-weight: bold;
-	color: 					#fff;
-	text-shadow: 0 -1px 1px #145072;
-	background-image: -moz-linear-gradient(top, 
-							#4e89c5, 
-							#2567ab);
-	background-image: -webkit-gradient(linear,left top,left bottom,
-			color-stop(0, 	#5f9cc5),
-			color-stop(1, 	#396b9e));
-	-ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#4e89c5', EndColorStr='#2567ab')";
-}
-.ui-btn-up-b a.ui-link-inherit {
-	color: 					#fff;
-}
-.ui-btn-hover-b {
-	border: 1px solid 		#00516e;
-	background: 			#4b88b6;
-	font-weight: bold;
-	color: 					#fff;
-	text-shadow: 0 -1px 1px #014D68;
-	background-image: -moz-linear-gradient(top, 
-							#72b0d4, 
-							#4b88b6);
-	background-image: -webkit-gradient(linear,left top,left bottom,
-			color-stop(0, 	#72b0d4),
-			color-stop(1, 	#4b88b6));
-	-ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#72b0d4', EndColorStr='#4b88b6')";
-}
-.ui-btn-hover-b a.ui-link-inherit {
-	color: 					#fff;
-}
-.ui-btn-down-b {
-	border: 1px solid 		#225377;
-	background: 			#4e89c5;
-	font-weight: bold;
-	color: 					#fff;
-	text-shadow: 0 -1px 1px #225377;
-	background-image: -moz-linear-gradient(top, 
-							#396b9e, 
-							#4e89c5);
-	background-image: -webkit-gradient(linear,left top,left bottom,
-		color-stop(0, 		#396b9e),
-		color-stop(1, 		#4e89c5));
-	-ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#396b9e', EndColorStr='#4e89c5')";
-}
-.ui-btn-down-b a.ui-link-inherit {
-	color: 					#fff;
-}
-.ui-btn-up-b,
-.ui-btn-hover-b,
-.ui-btn-down-b {
-	font-family: Helvetica, Arial, sans-serif;
-	text-decoration: none;
-}
-
-
-/* C
------------------------------------------------------------------------------------------------------------*/
-
-.ui-bar-c {
-	border: 1px solid 		#B3B3B3;
-	background: 			#e9eaeb;
-	color: 					#3E3E3E;
-	font-weight: bold;
-	text-shadow: 0 1px 1px 	#fff;
-	background-image: -moz-linear-gradient(top, 
-							#f0f0f0,
-							#e9eaeb);
-	background-image: -webkit-gradient(linear,left top,left bottom,
-			color-stop(0, 	#f0f0f0),
-			color-stop(1, 	#e9eaeb));
-	-ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#f0f0f0', EndColorStr='#e9eaeb')";
-}
-.ui-bar-c,
-.ui-bar-c input,
-.ui-bar-c select,
-.ui-bar-c textarea,
-.ui-bar-c button {
-	font-family: Helvetica, Arial, sans-serif;
-}
-.ui-body-c {
-	border: 1px solid 		#B3B3B3;
-	color: 					#333333;
-	text-shadow: 0 1px 0 	#fff;
-	background: 			#f0f0f0;
-	background-image: -moz-linear-gradient(top, 
-							#eeeeee, 
-							#dddddd);
-	background-image: -webkit-gradient(linear,left top,left bottom,
-		color-stop(0, 		#eeeeee),
-		color-stop(1, 		#dddddd));
-	-ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#eeeeee', EndColorStr='#dddddd')";
-}
-.ui-body-c,
-.ui-body-c input,
-.ui-body-c select,
-.ui-body-c textarea,
-.ui-body-c button {
-	font-family: Helvetica, Arial, sans-serif;
-}
-.ui-body-c .ui-link-inherit {
-	color: 					#333333;
-}
-.ui-body-c .ui-link {
-	color: 					#2489CE;
-	font-weight: bold;
-}
-
-.ui-btn-up-c {
-	border: 1px solid 		#ccc;
-	background: 			#eee;
-	font-weight: bold;
-	color: 					#444;
-	text-shadow: 0 1px 1px #f6f6f6;
-	background-image: -moz-linear-gradient(top, 
-							#fefefe, 
-							#eeeeee);
-	background-image: -webkit-gradient(linear,left top,left bottom,
-		color-stop(0, 		#fdfdfd),
-		color-stop(1, 		#eeeeee));
-	-ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#fdfdfd', EndColorStr='#eeeeee')";
-}
-.ui-btn-up-c a.ui-link-inherit {
-	color: 					#2F3E46;
-}
-
-.ui-btn-hover-c {
-	border: 1px solid 		#bbb;
-	background: 			#dadada;
-	font-weight: bold;
-	color: 					#101010;
-	text-shadow: 0 1px 1px 	#fff;
-	background-image: -moz-linear-gradient(top, 
-							#ededed, 
-							#dadada);
-	background-image: -webkit-gradient(linear,left top,left bottom,
-		color-stop(0, 		#ededed),
-		color-stop(1, 		#dadada));
-	-ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#ededed', EndColorStr='#dadada')";
-}
-.ui-btn-hover-c a.ui-link-inherit {
-	color: 					#2F3E46;
-}
-.ui-btn-down-c {
-	border: 1px solid 		#808080;
-	background: 			#fdfdfd;
-	font-weight: bold;
-	color: 					#111111;
-	text-shadow: 0 1px 1px 	#ffffff;
-	background-image: -moz-linear-gradient(top, 
-							#eeeeee, 
-							#fdfdfd);
-	background-image: -webkit-gradient(linear,left top,left bottom,
-		color-stop(0, 		#eeeeee),
-		color-stop(1, 		#fdfdfd));
-  	-ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#eeeeee', EndColorStr='#fdfdfd')";
-}
-.ui-btn-down-c a.ui-link-inherit {
-	color: 					#2F3E46;
-}
-.ui-btn-up-c,
-.ui-btn-hover-c,
-.ui-btn-down-c {
-	font-family: Helvetica, Arial, sans-serif;
-	text-decoration: none;
-}
-
-
-/* D
------------------------------------------------------------------------------------------------------------*/
-
-.ui-bar-d {
-	border: 1px solid 		#ccc;
-	background: 			#bbb;
-	color: 					#333;
-	text-shadow: 0 1px 0 #eee;
-	background-image: -moz-linear-gradient(top, 
-							#ddd, 
-							#bbb);
-	background-image: -webkit-gradient(linear,left top,left bottom,
-		color-stop(0, 		#ddd),
-		color-stop(1, 		#bbb));
-  	-ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#dddddd', EndColorStr='#bbbbbb')";
-}
-.ui-bar-d,
-.ui-bar-d input,
-.ui-bar-d select,
-.ui-bar-d textarea,
-.ui-bar-d button {
-	font-family: Helvetica, Arial, sans-serif;
-}
-.ui-bar-d .ui-link-inherit {
-	color: 					#333;
-}
-.ui-bar-d .ui-link {
-	color: 					#2489CE;
-	font-weight: bold;
-}
-.ui-body-d {
-	border: 1px solid 		#ccc;
-	color: 					#333333;
-	text-shadow: 0 1px 0 	#fff;
-	background: 			#ffffff;
-}
-.ui-body-d,
-.ui-body-d input,
-.ui-body-d select,
-.ui-body-d textarea,
-.ui-body-d button {
-	font-family: Helvetica, Arial, sans-serif;
-}
-.ui-body-d .ui-link-inherit {
-	color: 					#333333;
-}
-.ui-body-d .ui-link {
-	color: 					#2489CE;
-	font-weight: bold;
-}
-.ui-btn-up-d {
-	border: 1px solid 		#ccc;
-	background: 			#fff;
-	font-weight: bold;
-	color: 					#444;
-	text-shadow: 0 1px 1px #fff;
-}
-.ui-btn-up-d a.ui-link-inherit {
-	color: 					#333;
-}
-.ui-btn-hover-d {
-	border: 1px solid 		#aaa;
-	background: 			#eeeeee;
-	font-weight: bold;
-	color: 					#222;
-	cursor: pointer;
-	text-shadow: 0 1px 1px 	#fff;
-	background-image: -moz-linear-gradient(top, 
-							#fdfdfd, 
-							#eeeeee);
-	background-image: -webkit-gradient(linear,left top,left bottom,
-		color-stop(0, 		#fdfdfd),
-		color-stop(1, 		#eeeeee));
-  	-ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#fdfdfd', EndColorStr='#eeeeee')";
-}
-.ui-btn-hover-d a.ui-link-inherit {
-	color: 					#222;
-}
-.ui-btn-down-d {
-	border: 1px solid 		#aaaaaa;
-	background: 			#ffffff;
-	font-weight: bold;
-	color: 					#111;
-	text-shadow: 0 1px 1px 	#ffffff;
-	background-image: -moz-linear-gradient(top, 
-							#eeeeee, 
-							#ffffff);
-	background-image: -webkit-gradient(linear,left top,left bottom,
-		color-stop(0, 		#eeeeee),
-		color-stop(1, 		#ffffff));
-  	-ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#eeeeee', EndColorStr='#ffffff')";
-}
-.ui-btn-down-d a.ui-link-inherit {
-	color: 					#111;
-}
-.ui-btn-up-d,
-.ui-btn-hover-d,
-.ui-btn-down-d {
-	font-family: Helvetica, Arial, sans-serif;
-	text-decoration: none;
-}
-
-
-/* E
------------------------------------------------------------------------------------------------------------*/
-
-.ui-bar-e {
-	border: 1px solid 		#F7C942;
-	background: 			#fadb4e;
-	color: 					#333;
-	text-shadow: 0 1px 0 	#fff;
-	background-image: -moz-linear-gradient(top, 
-							#fceda7, 
-							#fadb4e);
-	background-image: -webkit-gradient(linear,left top,left bottom,
-		color-stop(0, 		#fceda7),
-		color-stop(1, 		#fadb4e));
-  	-ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#fceda7', EndColorStr='#fadb4e')";
-}
-.ui-bar-e,
-.ui-bar-e input,
-.ui-bar-e select,
-.ui-bar-e textarea,
-.ui-bar-d button {
-	font-family: Helvetica, Arial, sans-serif;
-}
-.ui-bar-e .ui-link-inherit {
-	color: 					#333;
-}
-.ui-bar-e .ui-link {
-	color: 					#2489CE;
-	font-weight: bold;
-}
-.ui-body-e {
-	border: 1px solid 		#F7C942;
-	color: 					#333333;
-	text-shadow: 0 1px 0 	#fff;
-	background: 			#faeb9e;
-	background-image: -moz-linear-gradient(top, 
-							#fff, 
-							#faeb9e);
-	background-image: -webkit-gradient(linear,left top,left bottom,
-		color-stop(0, 		#fff),
-		color-stop(1, 		#faeb9e));
-  	-ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#ffffff', EndColorStr='#faeb9e')";
-}
-.ui-body-e,
-.ui-body-e input,
-.ui-body-e select,
-.ui-body-e textarea,
-.ui-body-e button {
-	font-family: Helvetica, Arial, sans-serif;
-}
-.ui-body-e .ui-link-inherit {
-	color: 					#333333;
-}
-.ui-body-e .ui-link {
-	color: 					#2489CE;
-	font-weight: bold;
-}
-.ui-btn-up-e {
-	border: 1px solid 		#F7C942;
-	background: 			#fadb4e;
-	font-weight: bold;
-	color: 					#333;
-	text-shadow: 0 1px 0 	#fff;
-	background-image: -moz-linear-gradient(top, 
-							#fceda7, 
-							#fadb4e);
-	background-image: -webkit-gradient(linear,left top,left bottom,
-		color-stop(0, 		#fceda7),
-		color-stop(1, 		#fadb4e));
-	-ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#fceda7', EndColorStr='#fadb4e')";
-}
-.ui-btn-up-e a.ui-link-inherit {
-	color: 					#333;
-}
-.ui-btn-hover-e {
-	border: 1px solid 		#e79952;
-	background: 			#fbe26f;
-	font-weight: bold;
-	color: 					#111;
-	text-shadow: 0 1px 1px 	#fff;
-	background-image: -moz-linear-gradient(top, 
-							#fcf0b5, 
-							#fbe26f);
-	background-image: -webkit-gradient(linear,left top,left bottom,
-		color-stop(0, 		#fcf0b5),
-		color-stop(1, 		#fbe26f));
-  	-ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#fcf0b5', EndColorStr='#fbe26f')";
-}
-
-.ui-btn-hover-e a.ui-link-inherit {
-	color: 					#333;
-}
-.ui-btn-down-e {
-	border: 1px solid 		#F7C942;
-	background: 			#fceda7;
-	font-weight: bold;
-	color: 					#111;
-	text-shadow: 0 1px 1px 	#ffffff;
-	background-image: -moz-linear-gradient(top, 
-							#fadb4e, 
-							#fceda7);
-	background-image: -webkit-gradient(linear,left top,left bottom,
-		color-stop(0, 		#fadb4e),
-		color-stop(1, 		#fceda7));
-	-ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#fadb4e', EndColorStr='#fceda7')";
-}
-.ui-btn-down-e a.ui-link-inherit {
-	color: 					#333;
-}
-.ui-btn-up-e,
-.ui-btn-hover-e,
-.ui-btn-down-e {
-	font-family: Helvetica, Arial, sans-serif;
-	text-decoration: none;
-}
-
-
-/* links within "buttons" 
------------------------------------------------------------------------------------------------------------*/
-
-a.ui-link-inherit {
-	text-decoration: none !important;
-}
-
-
-/* Active class used as the "on" state across all themes
------------------------------------------------------------------------------------------------------------*/
-
-.ui-btn-active {
-	border: 1px solid 		#155678;
-	background: 			#4596ce;
-	font-weight: bold;
-	color: 					#fff;
-	cursor: pointer;
-	text-shadow: 0 -1px 1px #145072;
-	text-decoration: none;
-	background-image: -moz-linear-gradient(top, 
-							#85bae4, 
-							#5393c5);
-	background-image: -webkit-gradient(linear,left top,left bottom,
-		color-stop(0, 		#85bae4),
-		color-stop(1, 		#5393c5));
-  	-ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#85bae4', EndColorStr='#5393c5')";
-  	outline: none;
-}
-.ui-btn-active a.ui-link-inherit {
-	color: 					#fff;
-}
-
-
-/* button inner top highlight
------------------------------------------------------------------------------------------------------------*/
-
-.ui-btn-inner {
-	border-top: 1px solid 	#fff;
-	border-color: 			rgba(255,255,255,.3);
-}
-
-
-/* corner rounding classes
------------------------------------------------------------------------------------------------------------*/
-
-.ui-corner-tl {
-	-moz-border-radius-topleft: 		.6em;
-	-webkit-border-top-left-radius: 	.6em;
-	border-top-left-radius: 			.6em;
-}
-.ui-corner-tr {
-	-moz-border-radius-topright: 		.6em;
-	-webkit-border-top-right-radius: 	.6em;
-	border-top-right-radius: 			.6em;
-}
-.ui-corner-bl {
-	-moz-border-radius-bottomleft: 		.6em;
-	-webkit-border-bottom-left-radius: 	.6em;
-	border-bottom-left-radius: 			.6em;
-}
-.ui-corner-br {
-	-moz-border-radius-bottomright: 	.6em;
-	-webkit-border-bottom-right-radius: .6em;
-	border-bottom-right-radius: 		.6em;
-}
-.ui-corner-top {
-	-moz-border-radius-topleft: 		.6em;
-	-webkit-border-top-left-radius: 	.6em;
-	border-top-left-radius: 			.6em;
-	-moz-border-radius-topright: 		.6em;
-	-webkit-border-top-right-radius: 	.6em;
-	border-top-right-radius: 			.6em;
-}
-.ui-corner-bottom {
-	-moz-border-radius-bottomleft: 		.6em;
-	-webkit-border-bottom-left-radius: 	.6em;
-	border-bottom-left-radius: 			.6em;
-	-moz-border-radius-bottomright: 	.6em;
-	-webkit-border-bottom-right-radius: .6em;
-	border-bottom-right-radius: 		.6em;
-	}
-.ui-corner-right {
-	-moz-border-radius-topright: 		.6em;
-	-webkit-border-top-right-radius: 	.6em;
-	border-top-right-radius: 			.6em;
-	-moz-border-radius-bottomright: 	.6em;
-	-webkit-border-bottom-right-radius: .6em;
-	border-bottom-right-radius: 		.6em;
-}
-.ui-corner-left {
-	-moz-border-radius-topleft: 		.6em;
-	-webkit-border-top-left-radius: 	.6em;
-	border-top-left-radius: 			.6em;
-	-moz-border-radius-bottomleft: 		.6em;
-	-webkit-border-bottom-left-radius: 	.6em;
-	border-bottom-left-radius: 			.6em;
-}
-.ui-corner-all {
-	-moz-border-radius: 				.6em;
-	-webkit-border-radius: 				.6em;
-	border-radius: 						.6em;
-}
-
-
-
-/* Interaction cues
------------------------------------------------------------------------------------------------------------*/
-.ui-disabled {
-	opacity: 							.3;
-}
-.ui-disabled,
-.ui-disabled a {
-	cursor: default;
-}
-
-/* Icons
------------------------------------------------------------------------------------------------------------*/
-
-.ui-icon {
-	background: 						#666;
-	background: 						rgba(0,0,0,.4);
-	background-image: url(images/icons-18-white.png);
-	background-repeat: no-repeat;
-	-moz-border-radius: 				9px;
-	-webkit-border-radius: 				9px;
-	border-radius: 						9px;
-}
-
-
-/* Alt icon color
------------------------------------------------------------------------------------------------------------*/
-
-.ui-icon-alt {
-	background: 						#fff;
-	background: 						rgba(255,255,255,.3);
-	background-image: url(images/icons-18-black.png);
-	background-repeat: no-repeat;
-}
-
-/* HD/"retina" sprite
------------------------------------------------------------------------------------------------------------*/
-
-@media only screen and (-webkit-min-device-pixel-ratio: 1.5),
-       only screen and (min--moz-device-pixel-ratio: 1.5),
-       only screen and (min-resolution: 240dpi) {
-	
-	.ui-icon-plus, .ui-icon-minus, .ui-icon-delete, .ui-icon-arrow-r,
-	.ui-icon-arrow-l, .ui-icon-arrow-u, .ui-icon-arrow-d, .ui-icon-check,
-	.ui-icon-gear, .ui-icon-refresh, .ui-icon-forward, .ui-icon-back,
-	.ui-icon-grid, .ui-icon-star, .ui-icon-alert, .ui-icon-info, .ui-icon-home, .ui-icon-search, 
-	.ui-icon-checkbox-off, .ui-icon-checkbox-on, .ui-icon-radio-off, .ui-icon-radio-on {
-		background-image: url(images/icons-36-white.png);
-		-moz-background-size: 776px 18px;
-		-o-background-size: 776px 18px;
-		-webkit-background-size: 776px 18px;
-		background-size: 776px 18px;
-	}
-	.ui-icon-alt {
-		background-image: url(images/icons-36-black.png);
-	}
-}
-
-/* plus minus */
-.ui-icon-plus {
-	background-position: 	-0 50%;
-}
-.ui-icon-minus {
-	background-position: 	-36px 50%;
-}
-
-/* delete/close */
-.ui-icon-delete {
-	background-position: 	-72px 50%;
-}
-
-/* arrows */
-.ui-icon-arrow-r {
-	background-position: 	-108px 50%;
-}
-.ui-icon-arrow-l {
-	background-position: 	-144px 50%;
-}
-.ui-icon-arrow-u {
-	background-position: 	-180px 50%;
-}
-.ui-icon-arrow-d {
-	background-position: 	-216px 50%;
-}
-
-/* misc */
-.ui-icon-check {
-	background-position: 	-252px 50%;
-}
-.ui-icon-gear {
-	background-position: 	-288px 50%;
-}
-.ui-icon-refresh {
-	background-position: 	-324px 50%;
-}
-.ui-icon-forward {
-	background-position: 	-360px 50%;
-}
-.ui-icon-back {
-	background-position: 	-396px 50%;
-}
-.ui-icon-grid {
-	background-position: 	-432px 50%;
-}
-.ui-icon-star {
-	background-position: 	-468px 50%;
-}
-.ui-icon-alert {
-	background-position: 	-504px 50%;
-}
-.ui-icon-info {
-	background-position: 	-540px 50%;
-}
-.ui-icon-home {
-	background-position: 	-576px 50%;
-}
-.ui-icon-search {
-	background-position: 	-612px 50%;
-}
-.ui-icon-checkbox-off {
-	background-position: 	-684px 50%;
-}
-.ui-icon-checkbox-on {
-	background-position: 	-648px 50%;
-}
-.ui-icon-radio-off {
-	background-position: 	-756px 50%;
-}
-.ui-icon-radio-on {
-	background-position: 	-720px 50%;
-}
-
-
-/* checks,radios */
-.ui-icon-checkbox-off,
-.ui-icon-checkbox-on,
-.ui-icon-radio-off,
-.ui-icon-radio-on {
-	background-color: transparent;
-	-moz-border-radius: 0;
-	-webkit-border-radius: 0;
-	border-radius: 0;
-}
-.ui-icon-searchfield {
-	background-image: url(images/icon-search-black.png);
-	background-size: 16px 16px;
-}
-
-/* loading icon */
-.ui-icon-loading {
-	background-image: url(images/ajax-loader.png);
-	width: 40px;
-	height: 40px;
-	-moz-border-radius: 20px;
-	-webkit-border-radius: 20px;
-	border-radius: 20px;
-	background-size: 35px 35px;
-}
-
-
-/* Button corner classes
------------------------------------------------------------------------------------------------------------*/
-
-.ui-btn-corner-tl {
-	-moz-border-radius-topleft: 		1em;
-	-webkit-border-top-left-radius: 	1em;
-	border-top-left-radius: 			1em;
-}
-.ui-btn-corner-tr {
-	-moz-border-radius-topright: 		1em;
-	-webkit-border-top-right-radius: 	1em;
-	border-top-right-radius: 			1em;
-}
-.ui-btn-corner-bl {
-	-moz-border-radius-bottomleft: 		1em;
-	-webkit-border-bottom-left-radius: 	1em;
-	border-bottom-left-radius: 			1em;
-}
-.ui-btn-corner-br {
-	-moz-border-radius-bottomright: 	1em;
-	-webkit-border-bottom-right-radius: 1em;
-	border-bottom-right-radius: 		1em;
-}
-.ui-btn-corner-top {
-	-moz-border-radius-topleft: 		1em;
-	-webkit-border-top-left-radius: 	1em;
-	border-top-left-radius: 			1em;
-	-moz-border-radius-topright: 		1em;
-	-webkit-border-top-right-radius: 	1em;
-	border-top-right-radius: 			1em;
-}
-.ui-btn-corner-bottom {
-	-moz-border-radius-bottomleft: 		1em;
-	-webkit-border-bottom-left-radius: 	1em;
-	border-bottom-left-radius: 			1em;
-	-moz-border-radius-bottomright: 	1em;
-	-webkit-border-bottom-right-radius: 1em;
-	border-bottom-right-radius: 		1em;
-}
-.ui-btn-corner-right {
-	 -moz-border-radius-topright: 		1em;
-	-webkit-border-top-right-radius: 	1em;
-	border-top-right-radius: 			1em;
-	-moz-border-radius-bottomright: 	1em;
-	-webkit-border-bottom-right-radius: 1em;
-	border-bottom-right-radius: 		1em;
-}
-.ui-btn-corner-left {
-	-moz-border-radius-topleft: 		1em;
-	-webkit-border-top-left-radius: 	1em;
-	border-top-left-radius: 			1em;
-	-moz-border-radius-bottomleft: 		1em;
-	-webkit-border-bottom-left-radius: 	1em;
-	border-bottom-left-radius: 			1em;
-}
-.ui-btn-corner-all {
-	-moz-border-radius: 				1em;
-	-webkit-border-radius: 				1em;
-	border-radius: 						1em;
-}
-
-/* radius clip workaround for cleaning up corner trapping */
-.ui-corner-tl,
-.ui-corner-tr,
-.ui-corner-bl, 
-.ui-corner-br,
-.ui-corner-top,
-.ui-corner-bottom, 
-.ui-corner-right,
-.ui-corner-left,
-.ui-corner-all,
-.ui-btn-corner-tl,
-.ui-btn-corner-tr,
-.ui-btn-corner-bl, 
-.ui-btn-corner-br,
-.ui-btn-corner-top,
-.ui-btn-corner-bottom, 
-.ui-btn-corner-right,
-.ui-btn-corner-left,
-.ui-btn-corner-all {
-  -webkit-background-clip: padding-box;
-     -moz-background-clip: padding-box;
-          background-clip: padding-box;
-}
-
-/* Overlay / modal
------------------------------------------------------------------------------------------------------------*/
-
-.ui-overlay {
-	background: #666;
-	opacity: .5;
-	filter: Alpha(Opacity=50);
-	position: absolute;
-	width: 100%;
-	height: 100%;
-}
-.ui-overlay-shadow {
-	-moz-box-shadow: 0px 0px 12px 			rgba(0,0,0,.6);
-	-webkit-box-shadow: 0px 0px 12px 		rgba(0,0,0,.6);
-	box-shadow: 0px 0px 12px 				rgba(0,0,0,.6);
-}
-.ui-shadow {
-	-moz-box-shadow: 0px 1px 4px 			rgba(0,0,0,.3);
-	-webkit-box-shadow: 0px 1px 4px 		rgba(0,0,0,.3);
-	box-shadow: 0px 1px 4px 				rgba(0,0,0,.3);
-}
-.ui-bar-a .ui-shadow,
-.ui-bar-b .ui-shadow ,
-.ui-bar-c .ui-shadow  {
-	-moz-box-shadow: 0px 1px 0 				rgba(255,255,255,.3);
-	-webkit-box-shadow: 0px 1px 0 			rgba(255,255,255,.3);
-	box-shadow: 0px 1px 0 					rgba(255,255,255,.3);
-}
-.ui-shadow-inset {
-	-moz-box-shadow: inset 0px 1px 4px 		rgba(0,0,0,.2);
-	-webkit-box-shadow: inset 0px 1px 4px 	rgba(0,0,0,.2);
-	box-shadow: inset 0px 1px 4px 			rgba(0,0,0,.2);
-}
-.ui-icon-shadow {
-	-moz-box-shadow: 0px 1px 0 				rgba(255,255,255,.4);
-	-webkit-box-shadow: 0px 1px 0 			rgba(255,255,255,.4);
-	box-shadow: 0px 1px 0 					rgba(255,255,255,.4);
-}
-
-
-/* Focus state - set here for specificity
------------------------------------------------------------------------------------------------------------*/
-
-.ui-focus {
-	-moz-box-shadow: 0px 0px 12px 		#387bbe;
-	-webkit-box-shadow: 0px 0px 12px 	#387bbe;
-	box-shadow: 0px 0px 12px 			#387bbe;
-}
-
-/* unset box shadow in browsers that don't do it right
------------------------------------------------------------------------------------------------------------*/
-
-.ui-mobile-nosupport-boxshadow * {
-	-moz-box-shadow: none !important;
-	-webkit-box-shadow: none !important;
-	box-shadow: none !important;
-}
-
-/* ...and bring back focus */
-.ui-mobile-nosupport-boxshadow .ui-focus {
-	outline-width: 2px;
-}/*
-* jQuery Mobile Framework
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.
-* Note: Code is in draft form and is subject to change 
-*/
-
-/* some unsets - more probably needed */
-.ui-mobile, .ui-mobile body { height: 100%; }
-.ui-mobile fieldset, .ui-page { padding: 0; margin: 0; }
-.ui-mobile a img, .ui-mobile fieldset { border: 0; }
-
-/* responsive page widths */
-.ui-mobile-viewport {  margin: 0; overflow-x: hidden; -webkit-text-size-adjust: none; -ms-text-size-adjust:none; -webkit-tap-highlight-color: rgba(0, 0, 0, 0); }
-
-/* "page" containers - full-screen views, one should always be in view post-pageload */
-.ui-mobile [data-role=page], .ui-mobile [data-role=dialog], .ui-page { top: 0; left: 0; width: 100%; min-height: 100%; position: absolute; display: none; border: 0; } 
-.ui-mobile .ui-page-active { display: block; overflow: visible; }
-
-/*orientations from js are available */
-.portrait,
-.portrait .ui-page { min-height: 420px; }
-.landscape,
-.landscape .ui-page  { min-height: 300px; }
-
-/* loading screen */
-.ui-loading .ui-mobile-viewport { overflow: hidden !important; }
-.ui-loading .ui-loader { display: block; }
-.ui-loading .ui-page { overflow: hidden;  }
-.ui-loader { display: none; position: absolute; opacity: .85; z-index: 100; left: 50%; width: 200px; margin-left: -130px; margin-top: -35px; padding: 10px 30px; }
-.ui-loader h1 { font-size: 15px; text-align: center; }
-.ui-loader .ui-icon { position: static; display: block; opacity: .9; margin: 0 auto; width: 35px; height: 35px; background-color: transparent; }
-
-/*fouc*/
-.ui-mobile-rendering > * { visibility: hidden; }
-
-/*headers, content panels*/
-.ui-bar, .ui-body { position: relative; padding: .4em 15px;  overflow: hidden; display: block;  clear:both;  }
-.ui-bar { font-size: 16px; margin: 0; }
-.ui-bar h1, .ui-bar h2, .ui-bar h3, .ui-bar h4, .ui-bar h5, .ui-bar h6 { margin: 0; padding: 0; font-size: 16px; display: inline-block; }
-
-.ui-header, .ui-footer { display: block; }
-.ui-page .ui-header, .ui-page .ui-footer { position: relative; }
-.ui-header .ui-btn-left { position: absolute; left: 10px; top: .4em;  }
-.ui-header .ui-btn-right { position: absolute; right: 10px; top: .4em; }
-.ui-header .ui-title, .ui-footer .ui-title { min-height: 1.1em; text-align: center; font-size: 16px; display: block; margin: .6em 90px .8em;  padding: 0;  text-overflow: ellipsis; overflow: hidden; white-space: nowrap; outline: 0 !important; }
-
-/*content area*/
-.ui-content { border-width: 0; overflow: visible; overflow-x: hidden; padding: 15px; }
-.ui-page-fullscreen .ui-content { padding:0; }
-
-/* icons sizing */
-.ui-icon { width: 18px; height: 18px; }
-
-/* fullscreen class on ui-content div */
-.ui-fullscreen {  }
-.ui-fullscreen img { max-width: 100%; }
-
-/* non-js content hiding */
-.ui-nojs { position: absolute; left: -9999px; }
-/*
-* jQuery Mobile Framework
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
-*/
-.spin  {
-	-webkit-transform: rotate(360deg);
-	-webkit-animation-name: spin;
-	-webkit-animation-duration: 1s;
-	-webkit-animation-iteration-count:  infinite;
-}
-@-webkit-keyframes spin {
-	from {-webkit-transform: rotate(0deg);}
-  	to {-webkit-transform: rotate(360deg);}
-}
-
-/* Transitions from jQtouch (with small modifications): http://www.jqtouch.com/
-Built by David Kaneda and maintained by Jonathan Stark.
-*/
-.in, .out {
-	-webkit-animation-timing-function: ease-in-out;
-	-webkit-animation-duration: 350ms;
-}
-
-.slide.in {
-	-webkit-transform: translateX(0);
-	-webkit-animation-name: slideinfromright;
-}
-
-.slide.out {
-	-webkit-transform: translateX(-100%);
-	-webkit-animation-name: slideouttoleft;
-}
-
-.slide.in.reverse {
-	-webkit-transform: translateX(0);
-	-webkit-animation-name: slideinfromleft;
-}
-
-.slide.out.reverse {
-	-webkit-transform: translateX(100%);
-	-webkit-animation-name: slideouttoright;
-}
-
-.slideup.in {
-	-webkit-transform: translateY(0);
-	-webkit-animation-name: slideinfrombottom;
-	z-index: 10;
-}
-
-.slideup.out {
-	-webkit-animation-name: dontmove;
-	z-index: 0;
-}
-
-.slideup.out.reverse {
-	-webkit-transform: translateY(100%);
-	z-index: 10;
-	-webkit-animation-name: slideouttobottom;
-}
-
-.slideup.in.reverse {
-	z-index: 0;
-	-webkit-animation-name: dontmove;
-}
-.slidedown.in {
-	-webkit-transform: translateY(0);
-	-webkit-animation-name: slideinfromtop;
-	z-index: 10;
-}
-
-.slidedown.out {
-	-webkit-animation-name: dontmove;
-	z-index: 0;
-}
-
-.slidedown.out.reverse {
-	-webkit-transform: translateY(-100%);
-	z-index: 10;
-	-webkit-animation-name: slideouttotop;
-}
-
-.slidedown.in.reverse {
-	z-index: 0;
-	-webkit-animation-name: dontmove;
-}
-
-@-webkit-keyframes slideinfromright {
-    from { -webkit-transform: translateX(100%); }
-    to { -webkit-transform: translateX(0); }
-}
-
-@-webkit-keyframes slideinfromleft {
-    from { -webkit-transform: translateX(-100%); }
-    to { -webkit-transform: translateX(0); }
-}
-
-@-webkit-keyframes slideouttoleft {
-    from { -webkit-transform: translateX(0); }
-    to { -webkit-transform: translateX(-100%); }
-}
-
-@-webkit-keyframes slideouttoright {
-    from { -webkit-transform: translateX(0); }
-    to { -webkit-transform: translateX(100%); }
-}
-
-
-@-webkit-keyframes slideinfromtop {
-    from { -webkit-transform: translateY(-100%); }
-    to { -webkit-transform: translateY(0); }
-}
-
-@-webkit-keyframes slideinfrombottom {
-    from { -webkit-transform: translateY(100%); }
-    to { -webkit-transform: translateY(0); }
-}
-
-@-webkit-keyframes slideouttobottom {
-    from { -webkit-transform: translateY(0); }
-    to { -webkit-transform: translateY(100%); }
-}
-
-@-webkit-keyframes slideouttotop {
-    from { -webkit-transform: translateY(0); }
-    to { -webkit-transform: translateY(-100%); }
-}
-@-webkit-keyframes fadein {
-    from { opacity: 0; }
-    to { opacity: 1; }
-}
-
-@-webkit-keyframes fadeout {
-    from { opacity: 1; }
-    to { opacity: 0; }
-}
-
-.fade.in {
-	opacity: 1;
-	z-index: 10;
-	-webkit-animation-name: fadein;
-}
-.fade.out {
-	z-index: 0;
-	-webkit-animation-name: fadeout;
-}
-
-/* The properties in this rule are only necessary for the 'flip' transition.
- * We need specify the perspective to create a projection matrix. This will add
- * some depth as the element flips. The depth number represents the distance of
- * the viewer from the z-plane. According to the CSS3 spec, 1000 is a moderate
- * value.
- */
-.viewport-flip {
-	-webkit-perspective: 1000;
-	position: absolute;
-}
-
-.ui-mobile-viewport-transitioning,
-.ui-mobile-viewport-transitioning .ui-page {
-	width: 100%;
-	height: 100%;
-	overflow: hidden;
-}
-
-.flip {
-	-webkit-animation-duration: .65s;
-	-webkit-backface-visibility:hidden;
-	-webkit-transform:translateX(0); /* Needed to work around an iOS 3.1 bug that causes listview thumbs to disappear when -webkit-visibility:hidden is used. */
-}
-
-.flip.in {
-	-webkit-transform: rotateY(0) scale(1);
-	-webkit-animation-name: flipinfromleft;
-}
-
-.flip.out {
-	-webkit-transform: rotateY(-180deg) scale(.8);
-	-webkit-animation-name: flipouttoleft;
-}
-
-/* Shake it all about */
-
-.flip.in.reverse {
-	-webkit-transform: rotateY(0) scale(1);
-	-webkit-animation-name: flipinfromright;
-}
-
-.flip.out.reverse {
-	-webkit-transform: rotateY(180deg) scale(.8);
-	-webkit-animation-name: flipouttoright;
-}
-
-@-webkit-keyframes flipinfromright {
-    from { -webkit-transform: rotateY(-180deg) scale(.8); }
-    to { -webkit-transform: rotateY(0) scale(1); }
-}
-
-@-webkit-keyframes flipinfromleft {
-    from { -webkit-transform: rotateY(180deg) scale(.8); }
-    to { -webkit-transform: rotateY(0) scale(1); }
-}
-
-@-webkit-keyframes flipouttoleft {
-    from { -webkit-transform: rotateY(0) scale(1); }
-    to { -webkit-transform: rotateY(-180deg) scale(.8); }
-}
-
-@-webkit-keyframes flipouttoright {
-    from { -webkit-transform: rotateY(0) scale(1); }
-    to { -webkit-transform: rotateY(180deg) scale(.8); }
-}
-
-
-/* Hackish, but reliable. */
-
-@-webkit-keyframes dontmove {
-    from { opacity: 1; }
-    to { opacity: 1; }
-}
-
-.pop {
-	-webkit-transform-origin: 50% 50%;
-}
-
-.pop.in {
-	-webkit-transform: scale(1);
-    opacity: 1;
-	-webkit-animation-name: popin;
-	z-index: 10;
-}
-
-.pop.out.reverse {
-	-webkit-transform: scale(.2);
-	opacity: 0;
-	-webkit-animation-name: popout;
-	z-index: 10;
-}
-
-.pop.in.reverse {
-	z-index: 0;
-	-webkit-animation-name: dontmove;
-}
-
-@-webkit-keyframes popin {
-    from {
-        -webkit-transform: scale(.2);
-        opacity: 0;
-    }
-    to {
-        -webkit-transform: scale(1);
-        opacity: 1;
-    }
-}
-
-@-webkit-keyframes popout {
-    from {
-        -webkit-transform: scale(1);
-        opacity: 1;
-    }
-    to {
-        -webkit-transform: scale(.2);
-        opacity: 0;
-    }
-}/*
-* jQuery Mobile Framework
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
-*/
-
-/* content configurations. */
-.ui-grid-a, .ui-grid-b, .ui-grid-c, .ui-grid-d { overflow: hidden; }
-.ui-block-a, .ui-block-b, .ui-block-c, .ui-block-d, .ui-block-e { margin: 0; padding: 0; border: 0; float: left; min-height:1px;}
-
-/* grid solo: 100 - single item fallback */
-.ui-grid-solo .ui-block-a { width: 100%; float: none; }
-
-/* grid a: 50/50 */
-.ui-grid-a .ui-block-a, .ui-grid-a .ui-block-b { width: 50%; }
-.ui-grid-a .ui-block-a { clear: left; }
-
-/* grid b: 33/33/33 */
-.ui-grid-b .ui-block-a, .ui-grid-b .ui-block-b, .ui-grid-b .ui-block-c { width: 33.333%; }
-.ui-grid-b .ui-block-a { clear: left; }
-
-/* grid c: 25/25/25/25 */
-.ui-grid-c .ui-block-a, .ui-grid-c .ui-block-b, .ui-grid-c .ui-block-c, .ui-grid-c .ui-block-d { width: 25%; }
-.ui-grid-c .ui-block-a { clear: left; }
-
-/* grid d: 20/20/20/20/20 */
-.ui-grid-d .ui-block-a, .ui-grid-d .ui-block-b, .ui-grid-d .ui-block-c, .ui-grid-d .ui-block-d, .ui-grid-d .ui-block-e { width: 20%; }
-.ui-grid-d .ui-block-a { clear: left; }
-/*
-* jQuery Mobile Framework
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
-*/
-/* fixed page header & footer configuration */
-.ui-header, .ui-footer, .ui-page-fullscreen .ui-header, .ui-page-fullscreen .ui-footer  { position: absolute;  overflow: hidden; width: 100%; border-left-width: 0; border-right-width: 0; }
-.ui-header-fixed, .ui-footer-fixed {
-	z-index: 1000;
-	-webkit-transform: translateZ(0); /* Force header/footer rendering to go through the same rendering pipeline as native page scrolling. */
-}
-.ui-footer-duplicate, .ui-page-fullscreen .ui-fixed-inline { display: none; }
-.ui-page-fullscreen .ui-header, .ui-page-fullscreen .ui-footer { opacity: .9; }
-/*
-* jQuery Mobile Framework
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
-*/
-.ui-navbar { overflow: hidden;  }
-.ui-navbar ul, .ui-navbar-expanded ul { list-style:none; padding: 0; margin: 0; position: relative; display: block; border: 0;}
-.ui-navbar-collapsed ul { float: left; width: 75%; margin-right: -2px; }
-.ui-navbar-collapsed .ui-navbar-toggle { float: left; width: 25%; }
-.ui-navbar li.ui-navbar-truncate { position: absolute; left: -9999px; top: -9999px; }
-.ui-navbar li .ui-btn, .ui-navbar .ui-navbar-toggle .ui-btn { display: block; font-size: 12px; text-align: center; margin: 0; border-right-width: 0; }
-.ui-navbar li .ui-btn {  margin-right: -1px; }
-.ui-navbar li .ui-btn:last-child { margin-right: 0; }
-.ui-header .ui-navbar li .ui-btn, .ui-header .ui-navbar .ui-navbar-toggle .ui-btn,
-.ui-footer .ui-navbar li .ui-btn, .ui-footer .ui-navbar .ui-navbar-toggle .ui-btn { border-top-width: 0; border-bottom-width: 0; }
-.ui-navbar .ui-btn-inner { padding-left: 2px; padding-right: 2px; }
-.ui-navbar-noicons li .ui-btn .ui-btn-inner, .ui-navbar-noicons .ui-navbar-toggle .ui-btn-inner { padding-top: .8em; padding-bottom: .9em; }
-/*expanded page styles*/
-.ui-navbar-expanded .ui-btn { margin: 0; font-size: 14px; }
-.ui-navbar-expanded .ui-btn-inner { padding-left: 5px; padding-right: 5px;  }
-.ui-navbar-expanded .ui-btn-icon-top .ui-btn-inner { padding: 45px 5px 15px; text-align: center; }
-.ui-navbar-expanded .ui-btn-icon-top .ui-icon { top: 15px; }
-.ui-navbar-expanded .ui-btn-icon-bottom .ui-btn-inner { padding: 15px 5px 45px; text-align: center; }
-.ui-navbar-expanded .ui-btn-icon-bottom .ui-icon { bottom: 15px; }
-.ui-navbar-expanded li .ui-btn .ui-btn-inner { min-height: 2.5em; }
-.ui-navbar-expanded .ui-navbar-noicons .ui-btn .ui-btn-inner { padding-top: 1.8em; padding-bottom: 1.9em; }
-/*
-* jQuery Mobile Framework
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
-*/
-.ui-btn { display: block; text-align: center; cursor:pointer;  position: relative; margin: .5em 5px; padding: 0; }
-.ui-btn:focus, .ui-btn:active { outline: none; }
-.ui-header .ui-btn, .ui-footer .ui-btn, .ui-bar .ui-btn { display: inline-block; font-size: 13px; margin: 0; }
-.ui-btn-inline { display: inline-block; }
-.ui-btn-inner { padding: .6em 25px; display: block; text-overflow: ellipsis; overflow: hidden; white-space: nowrap; position: relative; }
-.ui-header .ui-btn-inner, .ui-footer .ui-btn-inner, .ui-bar .ui-btn-inner { padding: .4em 8px .5em; }
-.ui-btn-icon-notext { display: inline-block; width: 20px; height: 20px; padding: 2px 1px 2px 3px; text-indent: -9999px; }
-.ui-btn-icon-notext .ui-btn-inner { padding: 0; }
-.ui-btn-icon-notext .ui-btn-text { position: absolute; left: -999px; }
-.ui-btn-icon-left .ui-btn-inner { padding-left: 33px; }
-.ui-header .ui-btn-icon-left .ui-btn-inner,
-.ui-footer .ui-btn-icon-left .ui-btn-inner,
-.ui-bar .ui-btn-icon-left .ui-btn-inner { padding-left: 27px; }
-.ui-btn-icon-right .ui-btn-inner { padding-right: 33px; }
-.ui-header .ui-btn-icon-right .ui-btn-inner,
-.ui-footer .ui-btn-icon-right .ui-btn-inner,
-.ui-bar .ui-btn-icon-right .ui-btn-inner { padding-right: 27px; }
-.ui-btn-icon-top .ui-btn-inner { padding-top: 33px; }
-.ui-header .ui-btn-icon-top .ui-btn-inner,
-.ui-footer .ui-btn-icon-top .ui-btn-inner,
-.ui-bar .ui-btn-icon-top .ui-btn-inner { padding-top: 27px; }
-.ui-btn-icon-bottom .ui-btn-inner { padding-bottom: 33px; }
-.ui-header .ui-btn-icon-bottom .ui-btn-inner,
-.ui-footer .ui-btn-icon-bottom .ui-btn-inner,
-.ui-bar .ui-btn-icon-bottom .ui-btn-inner { padding-bottom: 27px; }
-
-/*btn icon positioning*/
-.ui-btn-icon-notext .ui-icon { display: block; }
-.ui-btn-icon-left .ui-icon, .ui-btn-icon-right .ui-icon { position: absolute; top: 50%; margin-top: -9px; }
-.ui-btn-icon-top .ui-icon, .ui-btn-icon-bottom .ui-icon { position: absolute; left: 50%;  margin-left: -9px; }
-.ui-btn-icon-left .ui-icon { left: 10px; }
-.ui-btn-icon-right .ui-icon {right: 10px; }
-.ui-header .ui-btn-icon-left .ui-icon,
-.ui-footer .ui-btn-icon-left .ui-icon,
-.ui-bar .ui-btn-icon-left .ui-icon { left: 4px; }
-.ui-header .ui-btn-icon-right .ui-icon,
-.ui-footer .ui-btn-icon-right .ui-icon,
-.ui-bar .ui-btn-icon-right .ui-icon { right: 4px; }
-.ui-header .ui-btn-icon-top .ui-icon,
-.ui-footer .ui-btn-icon-top .ui-icon,
-.ui-bar .ui-btn-icon-top .ui-icon { top: 4px; }
-.ui-header .ui-btn-icon-bottom .ui-icon,
-.ui-footer .ui-btn-icon-bottom .ui-icon,
-.ui-bar .ui-btn-icon-bottom .ui-icon { bottom: 4px; }
-.ui-btn-icon-top .ui-icon { top: 5px; }
-.ui-btn-icon-bottom .ui-icon { bottom: 5px; }
-/*hiding native button,inputs */
-.ui-btn-hidden {  position: absolute; top: 0; left: 0; width: 100%; height: 100%; -webkit-appearance: button; opacity: 0; cursor: pointer; -ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=0)"; filter: alpha(opacity=0); background: transparent; }
-/*
-* jQuery Mobile Framework
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
-*/
-.ui-collapsible-contain { margin: .5em 0; }
-.ui-collapsible-heading { font-size: 16px; display: block; margin: 0 -8px; padding: 0; border-width: 0 0 1px 0; position: relative; }
-.ui-collapsible-heading a { text-align: left; margin: 0;  }
-.ui-collapsible-heading a .ui-btn-inner { padding-left: 40px; }
-.ui-collapsible-heading a span.ui-btn { position: absolute; left: 6px; top: 50%; margin: -12px 0 0 0; width: 20px; height: 20px; padding: 1px 0px 1px 2px; text-indent: -9999px; }
-.ui-collapsible-heading a span.ui-btn .ui-btn-inner { padding: 10px 0; }
-.ui-collapsible-heading a span.ui-btn .ui-icon { left: 0; margin-top: -10px; }
-.ui-collapsible-heading-status { position:absolute; left:-9999px; }
-.ui-collapsible-content {  display: block; padding: 10px 0 10px 8px; }
-.ui-collapsible-content-collapsed { display: none; }
-
-.ui-collapsible-set { margin: .5em 0; }
-.ui-collapsible-set .ui-collapsible-contain { margin: -1px 0 0; }
-/*
-* jQuery Mobile Framework
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
-*/
-.ui-controlgroup, fieldset.ui-controlgroup { padding: 0; margin: .5em 0 1em; }
-.ui-bar .ui-controlgroup { margin: 0 .3em; }
-.ui-controlgroup-label { font-size: 16px; line-height: 1.4; font-weight: normal; margin: 0 0 .3em; }
-.ui-controlgroup-controls { display: block; width: 95%;}
-.ui-controlgroup li { list-style: none; }
-.ui-controlgroup-vertical .ui-btn,
-.ui-controlgroup-vertical .ui-checkbox, .ui-controlgroup-vertical .ui-radio { margin: 0; border-bottom-width: 0;  }
-.ui-controlgroup-vertical .ui-controlgroup-last { border-bottom-width: 1px; }
-.ui-controlgroup-horizontal { padding: 0; }
-.ui-controlgroup-horizontal .ui-btn,
-.ui-controlgroup-horizontal .ui-checkbox, .ui-controlgroup-horizontal .ui-radio { display: inline-block; margin: 0 -5px 0 0; }
-.ui-controlgroup-horizontal .ui-checkbox, .ui-controlgroup-horizontal .ui-radio { display: inline; }
-.ui-controlgroup-horizontal .ui-checkbox .ui-btn, .ui-controlgroup-horizontal .ui-radio .ui-btn,
-.ui-controlgroup-horizontal .ui-checkbox:last-child, .ui-controlgroup-horizontal .ui-radio:last-child { margin-right: 0; }
-.ui-controlgroup-horizontal .ui-controlgroup-last { margin-right: 0; }
-.ui-controlgroup .ui-checkbox label, .ui-controlgroup .ui-radio label { font-size: 16px;  }
-/* conflicts with listview..
-.ui-controlgroup .ui-btn-icon-notext { width: 30px; height: 30px; text-indent: -9999px; }
-.ui-controlgroup .ui-btn-icon-notext .ui-btn-inner {  padding: 5px 6px 5px 5px; }
-*/
-
-@media all and (min-width: 450px){
-	.ui-controlgroup-label { vertical-align: top; display: inline-block;  width: 20%;  margin: 0 2% 0 0;  }
-	.ui-controlgroup-controls { width: 60%; display: inline-block; } 
-}	/*
-* jQuery Mobile Framework
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
-*/
-.ui-dialog { min-height: 480px; }
-.ui-dialog .ui-header, .ui-dialog .ui-content,  .ui-dialog .ui-footer { margin: 15px; position: relative; }
-.ui-dialog .ui-header, .ui-dialog .ui-footer { z-index: 10; width: auto; }
-.ui-dialog .ui-content, .ui-dialog .ui-footer { margin-top: -15px;  }/*
-* jQuery Mobile Framework
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
-*/
-.ui-checkbox, .ui-radio { position:relative;  margin: .2em 0 .5em; z-index: 1;  }
-.ui-checkbox .ui-btn, .ui-radio .ui-btn { margin: 0; text-align: left; z-index: 2; }
-.ui-checkbox .ui-btn-inner, .ui-radio .ui-btn-inner { white-space: normal; }
-.ui-checkbox .ui-btn-icon-left .ui-btn-inner,.ui-radio .ui-btn-icon-left .ui-btn-inner { padding-left: 45px; }
-.ui-checkbox .ui-btn-icon-right .ui-btn-inner, .ui-radio .ui-btn-icon-right .ui-btn-inner { padding-right: 45px; }
-.ui-checkbox .ui-icon, .ui-radio .ui-icon { top: 1.1em; }
-.ui-checkbox .ui-btn-icon-left .ui-icon, .ui-radio .ui-btn-icon-left .ui-icon {left: 15px; }
-.ui-checkbox .ui-btn-icon-right .ui-icon, .ui-radio .ui-btn-icon-right .ui-icon {right: 15px; }
-/* input, label positioning */
-.ui-checkbox input,.ui-radio input { position:absolute; left:20px; top:50%; width: 10px; height: 10px;  margin:-5px 0 0 0; outline: 0 !important; z-index: 1; }/*
-* jQuery Mobile Framework
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
-*/
-.ui-field-contain { background: none; padding: 1.5em 0; margin: 0; border-bottom-width: 1px; overflow: visible; }
-.ui-field-contain:first-child { border-top-width: 0; }
-@media all and (min-width: 450px){
-	.ui-field-contain { border-width: 0; padding: 0; margin: 1em 0; }
-}	/*
-* jQuery Mobile Framework
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
-*/
-.ui-select { display: block; position: relative; }
-.ui-select select { position: absolute; left: -9999px; top: -9999px; }
-.ui-select .ui-btn { overflow: hidden; }
-.ui-select .ui-btn select { cursor: pointer; -webkit-appearance: button; left: 0; top:0; width: 100%; height: 100%; opacity: 0; -ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=0)"; filter: alpha(opacity=0); }
-@-moz-document url-prefix() {.ui-select .ui-btn select { opacity: 0.0001; }}
-.ui-select .ui-btn select.ui-select-nativeonly { opacity: 1; text-indent: 0; }
-
-.ui-select .ui-btn-icon-right .ui-btn-inner { padding-right: 45px; } 
-.ui-select .ui-btn-icon-right .ui-icon { right: 15px;  }
-
-/* labels */
-label.ui-select { font-size: 16px; line-height: 1.4;  font-weight: normal; margin: 0 0 .3em; display: block; }
-
-/*listbox*/
-.ui-select .ui-btn-text, .ui-selectmenu .ui-btn-text { display: inline-block; min-height: 1em; }
-.ui-select .ui-btn-text { text-overflow: ellipsis; overflow: hidden; display: block;}
-
-.ui-selectmenu { position: absolute; padding: 0; z-index: 100 !important; width: 80%; max-width: 350px; padding: 6px; }
-.ui-selectmenu .ui-listview { margin: 0; }
-.ui-selectmenu .ui-btn.ui-li-divider { cursor: default; }
-.ui-selectmenu-hidden { top: -9999px; left: -9999px; }
-.ui-selectmenu-screen { position: absolute; top: 0; left: 0; width: 100%; height: 100%;  z-index: 99; }
-.ui-screen-hidden, .ui-selectmenu-list .ui-li .ui-icon { display: none; }
-.ui-selectmenu-list .ui-li .ui-icon { display: block; }
-.ui-li.ui-selectmenu-placeholder { display: none; }
-.ui-selectmenu .ui-header .ui-title { margin: 0.6em 46px 0.8em; }
-
-@media all and (min-width: 450px){
-	label.ui-select { display: inline-block;  width: 20%;  margin: 0 2% 0 0; }
-	.ui-select { width: 60%; display: inline-block; }
-}	
-
-/* when no placeholder is defined in a multiple select, the header height doesn't even extend past the close button.  this shim's content in there */
-.ui-selectmenu .ui-header h1:after { content: '.'; visibility: hidden; }/*
-* jQuery Mobile Framework
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
-*/
-label.ui-input-text { font-size: 16px; line-height: 1.4; display: block; font-weight: normal; margin: 0 0 .3em; }
-input.ui-input-text, textarea.ui-input-text { background-image: none; padding: .4em; line-height: 1.4; font-size: 16px; display: block; width: 95%; }
-input.ui-input-text { -webkit-appearance: none; }
-textarea.ui-input-text { height: 50px; -webkit-transition: height 200ms linear; -moz-transition: height 200ms linear; -o-transition: height 200ms linear; transition: height 200ms linear; }
-.ui-input-search { padding: 0 30px; width: 77%; background-position: 8px 50%; background-repeat: no-repeat; position: relative; }
-.ui-input-search input.ui-input-text { border: none; width: 98%; padding: .4em 0; margin: 0; display: block; background: transparent none; outline: 0 !important; }
-.ui-input-search .ui-input-clear { position: absolute; right: 0; top: 50%; margin-top: -14px; }
-.ui-input-search .ui-input-clear-hidden { display: none; }
-
-/* orientation adjustments - incomplete!*/
-@media all and (min-width: 450px){
-	label.ui-input-text  { vertical-align: top; display: inline-block;  width: 20%;  margin: 0 2% 0 0 }
-	input.ui-input-text, 
-	textarea.ui-input-text, 
-	.ui-input-search { width: 60%; display: inline-block; } 
-	.ui-input-search { width: 50%; }
-	.ui-input-search input.ui-input-text { width: 98%; /*echos rule from above*/ }
-}/*
-* jQuery Mobile Framework
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
-*/
-.ui-listview { margin: 0; counter-reset: listnumbering; }
-.ui-content .ui-listview { margin: -15px; }
-.ui-content .ui-listview-inset { margin: 1em 0;  }
-.ui-listview, .ui-li { list-style:none; padding:0; }
-.ui-li, .ui-li.ui-field-contain { display: block; margin:0; position: relative; overflow: visible; text-align: left; border-width: 0; border-top-width: 1px; }
-.ui-li .ui-btn-text a.ui-link-inherit { text-overflow: ellipsis; overflow: hidden; white-space: nowrap;  }
-.ui-li-divider, .ui-li-static { padding: .5em 15px; font-size: 14px; font-weight: bold;  }
-.ui-li-divider { counter-reset: listnumbering;  }
-ol.ui-listview .ui-link-inherit:before, ol.ui-listview .ui-li-static:before, .ui-li-dec { font-size: .8em; display: inline-block; padding-right: .3em; font-weight: normal;counter-increment: listnumbering; content: counter(listnumbering) ". "; }
-ol.ui-listview .ui-li-jsnumbering:before { content: "" !important; } /* to avoid chance of duplication */
-.ui-listview-inset .ui-li { border-right-width: 1px; border-left-width: 1px; }
-.ui-li:last-child, .ui-li.ui-field-contain:last-child { border-bottom-width: 1px; }
-.ui-li>.ui-btn-inner { display: block; position: relative; padding: 0; }
-.ui-li .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li { padding: .7em 75px .7em 15px; display: block; }
-.ui-li-has-thumb .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li-has-thumb  { min-height: 60px; padding-left: 100px; }
-.ui-li-has-icon .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li-has-icon {  min-height: 20px; padding-left: 40px; }
-.ui-li-heading { font-size: 16px; font-weight: bold; display: block; margin: .6em 0; text-overflow: ellipsis; overflow: hidden; white-space: nowrap;  }
-.ui-li-desc {  font-size: 12px; font-weight: normal; display: block; margin: -.5em 0 .6em; text-overflow: ellipsis; overflow: hidden; white-space: nowrap; }
-.ui-li-thumb, .ui-li-icon { position: absolute; left: 1px; top: 0; max-height: 80px; max-width: 80px; }
-.ui-li-icon { max-height: 40px; max-width: 40px; left: 10px; top: .9em; }
-.ui-li-thumb, .ui-li-icon, .ui-li-content { float: left; margin-right: 10px; }
-
-.ui-li-aside { float: right; width: 50%; text-align: right; margin: .3em 0; }
-@media all and (min-width: 480px){
-	 .ui-li-aside { width: 45%; }
-}	 
-.ui-li-divider { cursor: default; }
-.ui-li-has-alt .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li-has-alt { padding-right: 95px; }
-.ui-li-count { position: absolute; font-size: 11px; font-weight: bold; padding: .2em .5em; top: 50%; margin-top: -.9em; right: 38px; }
-.ui-li-divider .ui-li-count, .ui-li-static .ui-li-count { right: 10px; }
-.ui-li-has-alt .ui-li-count { right: 55px; }
-.ui-li-link-alt { position: absolute; width: 40px; height: 100%; border-width: 0; border-left-width: 1px; top: 0; right: 0; margin: 0; padding: 0; }
-.ui-li-link-alt .ui-btn { overflow: hidden; position: absolute; right: 8px; top: 50%; margin: -11px 0 0 0; border-bottom-width: 1px; }
-.ui-li-link-alt .ui-btn-inner { padding: 0; position: static; }
-.ui-li-link-alt .ui-btn .ui-icon { right: 50%; margin-right: -9px;  }
-
-.ui-listview-filter { border-width: 0; overflow: hidden; margin: -15px -15px 15px -15px }
-.ui-listview-filter .ui-input-search { margin: 5px; width: auto; display: block; }
-
-.ui-listview-filter-inset { margin: -15px -5px -15px -5px; background: transparent; }
-.ui-li.ui-screen-hidden{display:none;}
-/* Odd iPad positioning issue. */
-@media only screen and (min-device-width: 768px) and (max-device-width: 1024px) {
-    .ui-li .ui-btn-text { overflow:  visible; }
-}/*
-* jQuery Mobile Framework
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
-*/
-label.ui-slider { display: block; }
-input.ui-slider-input  { display: inline-block; width: 50px; }
-select.ui-slider-switch { display: none; }
-div.ui-slider { position: relative; display: inline-block; overflow: visible; height: 15px; padding: 0; margin: 0 2% 0 20px; top: 4px; width: 66%; }
-a.ui-slider-handle { position: absolute; z-index: 10;  top: 50%; width: 28px; height: 28px; margin-top: -15px; margin-left: -15px; }
-a.ui-slider-handle .ui-btn-inner { padding-left: 0; padding-right: 0; }
-@media all and (min-width: 480px){
-	label.ui-slider { display: inline-block;  width: 20%;  margin: 0 2% 0 0; }
-	div.ui-slider { width: 45%; }
-}	
-
-div.ui-slider-switch { height: 32px;  overflow: hidden; margin-left: 0; }
-div.ui-slider-inneroffset { margin-left: 50%; position: absolute; top: 1px; height: 100%; width: 50%; }
-div.ui-slider-handle-snapping { -webkit-transition: left 100ms linear; }
-div.ui-slider-labelbg { position: absolute; top:0; margin: 0; border-width: 0; }
-div.ui-slider-switch div.ui-slider-labelbg-a { width: 60%; height: 100%; left: 0; }
-div.ui-slider-switch div.ui-slider-labelbg-b { width: 60%; height: 100%; right: 0; }
-.ui-slider-switch-a div.ui-slider-labelbg-a, .ui-slider-switch-b div.ui-slider-labelbg-b { z-index: -1; }
-.ui-slider-switch-a div.ui-slider-labelbg-b, .ui-slider-switch-b div.ui-slider-labelbg-a { z-index: 0; }
-
-div.ui-slider-switch a.ui-slider-handle { z-index: 20;  width: 101%; height: 32px; margin-top: -18px; margin-left: -101%; }
-span.ui-slider-label { width: 100%; position: absolute;height: 32px;  font-size: 16px; text-align: center; line-height: 2; background: none; border-color: transparent; }
-span.ui-slider-label-a { left: -100%;  margin-right: -1px }
-span.ui-slider-label-b { right: -100%;  margin-left: -1px }
-

--- /dev/null
+++ b/css/jquery.mobile-1.0b2.css
@@ -1,1 +1,1641 @@
-
+/*!
+ * jQuery Mobile v1.0b2
+ * http://jquerymobile.com/
+ *
+ * Copyright 2010, jQuery Project
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ */
+/*
+* jQuery Mobile Framework
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.
+*/
+
+
+/* A
+-----------------------------------------------------------------------------------------------------------*/
+
+.ui-bar-a {
+	border: 1px solid 		#2A2A2A;
+	background: 			#111111;
+	color: 					#ffffff;
+	font-weight: bold;
+	text-shadow: 0 -1px 1px #000000;
+	background-image: -webkit-gradient(linear, left top, left bottom, from(#3c3c3c), to(#111)); /* Saf4+, Chrome */
+	background-image: -webkit-linear-gradient(top, #3c3c3c, #111); /* Chrome 10+, Saf5.1+ */
+	background-image:    -moz-linear-gradient(top, #3c3c3c, #111); /* FF3.6 */
+	background-image:     -ms-linear-gradient(top, #3c3c3c, #111); /* IE10 */
+	background-image:      -o-linear-gradient(top, #3c3c3c, #111); /* Opera 11.10+ */
+	background-image:         linear-gradient(top, #3c3c3c, #111);
+}
+.ui-bar-a, 
+.ui-bar-a input, 
+.ui-bar-a select, 
+.ui-bar-a textarea, 
+.ui-bar-a button {
+	font-family: Helvetica, Arial, sans-serif;
+}
+.ui-bar-a .ui-link-inherit {
+	color: 					#fff;
+}
+.ui-bar-a .ui-link {
+	color: 					#7cc4e7;
+	font-weight: bold;
+}
+.ui-body-a {
+	border: 1px solid 		#2A2A2A;
+	background: 			#222222;
+	color: 					#fff;
+	 text-shadow: 0 1px 0 	#000;
+	font-weight: normal;
+	background-image: -webkit-gradient(linear, left top, left bottom, from(#666), to(#222)); /* Saf4+, Chrome */
+	background-image: -webkit-linear-gradient(top, #666, #222); /* Chrome 10+, Saf5.1+ */
+	background-image:    -moz-linear-gradient(top, #666, #222); /* FF3.6 */
+	background-image:     -ms-linear-gradient(top, #666, #222); /* IE10 */
+	background-image:      -o-linear-gradient(top, #666, #222); /* Opera 11.10+ */
+	background-image:         linear-gradient(top, #666, #222);	
+}
+.ui-body-a,
+.ui-body-a input,
+.ui-body-a select,
+.ui-body-a textarea,
+.ui-body-a button {
+	font-family: Helvetica, Arial, sans-serif;
+}
+.ui-body-a .ui-link-inherit {
+	color: 					#fff;
+}
+.ui-body-a .ui-link {
+	color: 					#2489CE;
+	font-weight: bold;
+}
+.ui-br {
+	border-bottom: rgb(130,130,130);
+	border-bottom: rgba(130,130,130,.3);
+	border-bottom-width: 1px;
+	border-bottom-style: solid;
+}
+.ui-btn-up-a {
+	border: 1px solid 		#222;
+	background: 			#333333;
+	font-weight: bold;
+	color: 					#fff;
+	text-shadow: 0 -1px 1px #000;
+	background-image: -webkit-gradient(linear, left top, left bottom, from(#555), to(#333)); /* Saf4+, Chrome */
+	background-image: -webkit-linear-gradient(top, #555, #333); /* Chrome 10+, Saf5.1+ */
+	background-image:    -moz-linear-gradient(top, #555, #333); /* FF3.6 */
+	background-image:     -ms-linear-gradient(top, #555, #333); /* IE10 */
+	background-image:      -o-linear-gradient(top, #555, #333); /* Opera 11.10+ */
+	background-image:         linear-gradient(top, #555, #333);
+}
+.ui-btn-up-a a.ui-link-inherit {
+	color: 					#fff;
+}
+.ui-btn-hover-a {
+	border: 1px solid 		#000;
+	background: 			#444444;
+	font-weight: bold;
+	color: 					#fff;
+	text-shadow: 0 -1px 1px #000;
+	background-image: -webkit-gradient(linear, left top, left bottom, from(#666), to(#444)); /* Saf4+, Chrome */
+	background-image: -webkit-linear-gradient(top, #666, #444); /* Chrome 10+, Saf5.1+ */
+	background-image:    -moz-linear-gradient(top, #666, #444); /* FF3.6 */
+	background-image:     -ms-linear-gradient(top, #666, #444); /* IE10 */
+	background-image:      -o-linear-gradient(top, #666, #444); /* Opera 11.10+ */
+	background-image:         linear-gradient(top, #666, #444);
+}
+.ui-btn-hover-a a.ui-link-inherit {
+	color: 					#fff;
+}
+.ui-btn-down-a {
+	border: 1px solid 		#000;
+	background: 			#3d3d3d;
+	font-weight: bold;
+	color: 					#fff;
+	text-shadow: 0 -1px 1px #000;
+	background-image: -webkit-gradient(linear, left top, left bottom, from(#333), to(#5a5a5a)); /* Saf4+, Chrome */
+	background-image: -webkit-linear-gradient(top, #333, #5a5a5a); /* Chrome 10+, Saf5.1+ */
+	background-image:    -moz-linear-gradient(top, #333, #5a5a5a); /* FF3.6 */
+	background-image:     -ms-linear-gradient(top, #333, #5a5a5a); /* IE10 */
+	background-image:      -o-linear-gradient(top, #333, #5a5a5a); /* Opera 11.10+ */
+	background-image:         linear-gradient(top, #333, #5a5a5a);
+}
+.ui-btn-down-a a.ui-link-inherit {
+	color: 					#fff;
+}
+.ui-btn-up-a,
+.ui-btn-hover-a,
+.ui-btn-down-a {
+	font-family: Helvetica, Arial, sans-serif;
+	text-decoration: none;
+}
+
+
+/* B
+-----------------------------------------------------------------------------------------------------------*/
+
+.ui-bar-b {
+	border: 1px solid 		#456f9a;
+	background: 			#5e87b0;
+	color: 					#fff;
+	font-weight: bold;
+	text-shadow: 0 -1px 1px #254f7a;
+	background-image: -webkit-gradient(linear, left top, left bottom, from(#81a8ce), to(#5e87b0)); /* Saf4+, Chrome */
+	background-image: -webkit-linear-gradient(top, #81a8ce, #5e87b0); /* Chrome 10+, Saf5.1+ */
+	background-image:    -moz-linear-gradient(top, #81a8ce, #5e87b0); /* FF3.6 */
+	background-image:     -ms-linear-gradient(top, #81a8ce, #5e87b0); /* IE10 */
+	background-image:      -o-linear-gradient(top, #81a8ce, #5e87b0); /* Opera 11.10+ */
+	background-image:         linear-gradient(top, #81a8ce, #5e87b0);
+}
+.ui-bar-b,
+.ui-bar-b input,
+.ui-bar-b select,
+.ui-bar-b textarea,
+.ui-bar-b button {
+	font-family: Helvetica, Arial, sans-serif;
+}
+.ui-bar-b .ui-link-inherit {
+	color: 					#fff;
+}
+.ui-bar-b .ui-link {
+	color: 					#7cc4e7;
+	font-weight: bold;
+}
+
+.ui-body-b {
+	border: 1px solid 		#C6C6C6;
+	background: 			#cccccc;
+	color: 					#333333;
+	text-shadow: 0 1px 0 	#fff;
+	font-weight: normal;
+	background-image: -webkit-gradient(linear, left top, left bottom, from(#e6e6e6), to(#ccc)); /* Saf4+, Chrome */
+	background-image: -webkit-linear-gradient(top, #e6e6e6, #ccc); /* Chrome 10+, Saf5.1+ */
+	background-image:    -moz-linear-gradient(top, #e6e6e6, #ccc); /* FF3.6 */
+	background-image:     -ms-linear-gradient(top, #e6e6e6, #ccc); /* IE10 */
+	background-image:      -o-linear-gradient(top, #e6e6e6, #ccc); /* Opera 11.10+ */
+	background-image:         linear-gradient(top, #e6e6e6, #ccc);
+}
+.ui-body-b,
+.ui-body-b input,
+.ui-body-b select,
+.ui-body-b textarea,
+.ui-body-b button {
+	font-family: Helvetica, Arial, sans-serif;
+}
+.ui-body-b .ui-link-inherit {
+	color: 					#333333;
+}
+.ui-body-b .ui-link {
+	color: 					#2489CE;
+	font-weight: bold;
+}
+.ui-btn-up-b {
+	border: 1px solid 		#145072;
+	background: 			#2567ab;
+	font-weight: bold;
+	color: 					#fff;
+	text-shadow: 0 -1px 1px #145072;
+	background-image: -webkit-gradient(linear, left top, left bottom, from(#5f9cc5), to(#396b9e)); /* Saf4+, Chrome */
+	background-image: -webkit-linear-gradient(top, #5f9cc5, #396b9e); /* Chrome 10+, Saf5.1+ */
+	background-image:    -moz-linear-gradient(top, #5f9cc5, #396b9e); /* FF3.6 */
+	background-image:     -ms-linear-gradient(top, #5f9cc5, #396b9e); /* IE10 */
+	background-image:      -o-linear-gradient(top, #5f9cc5, #396b9e); /* Opera 11.10+ */
+	background-image:         linear-gradient(top, #5f9cc5, #396b9e);
+}
+.ui-btn-up-b a.ui-link-inherit {
+	color: 					#fff;
+}
+.ui-btn-hover-b {
+	border: 1px solid 		#00516e;
+	background: 			#4b88b6;
+	font-weight: bold;
+	color: 					#fff;
+	text-shadow: 0 -1px 1px #014D68;
+	background-image: -webkit-gradient(linear, left top, left bottom, from(#72b0d4), to(#4b88b6)); /* Saf4+, Chrome */
+	background-image: -webkit-linear-gradient(top, #72b0d4, #4b88b6); /* Chrome 10+, Saf5.1+ */
+	background-image:    -moz-linear-gradient(top, #72b0d4, #4b88b6); /* FF3.6 */
+	background-image:     -ms-linear-gradient(top, #72b0d4, #4b88b6); /* IE10 */
+	background-image:      -o-linear-gradient(top, #72b0d4, #4b88b6); /* Opera 11.10+ */
+	background-image:         linear-gradient(top, #72b0d4, #4b88b6);
+}
+.ui-btn-hover-b a.ui-link-inherit {
+	color: 					#fff;
+}
+.ui-btn-down-b {
+	border: 1px solid 		#225377;
+	background: 			#4e89c5;
+	font-weight: bold;
+	color: 					#fff;
+	text-shadow: 0 -1px 1px #225377;
+	background-image: -webkit-gradient(linear, left top, left bottom, from(#396b9e), to(#4e89c5)); /* Saf4+, Chrome */
+	background-image: -webkit-linear-gradient(top, #396b9e, #4e89c5); /* Chrome 10+, Saf5.1+ */
+	background-image:    -moz-linear-gradient(top, #396b9e, #4e89c5); /* FF3.6 */
+	background-image:     -ms-linear-gradient(top, #396b9e, #4e89c5); /* IE10 */
+	background-image:      -o-linear-gradient(top, #396b9e, #4e89c5); /* Opera 11.10+ */
+	background-image:         linear-gradient(top, #396b9e, #4e89c5);
+}
+.ui-btn-down-b a.ui-link-inherit {
+	color: 					#fff;
+}
+.ui-btn-up-b,
+.ui-btn-hover-b,
+.ui-btn-down-b {
+	font-family: Helvetica, Arial, sans-serif;
+	text-decoration: none;
+}
+
+
+/* C
+-----------------------------------------------------------------------------------------------------------*/
+
+.ui-bar-c {
+	border: 1px solid 		#B3B3B3;
+	background: 			#e9eaeb;
+	color: 					#3E3E3E;
+	font-weight: bold;
+	text-shadow: 0 1px 1px 	#fff;
+	background-image: -webkit-gradient(linear, left top, left bottom, from(#f0f0f0), to(#e9eaeb)); /* Saf4+, Chrome */
+	background-image: -webkit-linear-gradient(top, #f0f0f0, #e9eaeb); /* Chrome 10+, Saf5.1+ */
+	background-image:    -moz-linear-gradient(top, #f0f0f0, #e9eaeb); /* FF3.6 */
+	background-image:     -ms-linear-gradient(top, #f0f0f0, #e9eaeb); /* IE10 */
+	background-image:      -o-linear-gradient(top, #f0f0f0, #e9eaeb); /* Opera 11.10+ */
+	background-image:         linear-gradient(top, #f0f0f0, #e9eaeb);
+}
+.ui-bar-c,
+.ui-bar-c input,
+.ui-bar-c select,
+.ui-bar-c textarea,
+.ui-bar-c button {
+	font-family: Helvetica, Arial, sans-serif;
+}
+.ui-body-c {
+	border: 1px solid 		#B3B3B3;
+	color: 					#333333;
+	text-shadow: 0 1px 0 	#fff;
+	background: 			#f0f0f0;
+	background-image: -webkit-gradient(linear, left top, left bottom, from(#eee), to(#ddd)); /* Saf4+, Chrome */
+	background-image: -webkit-linear-gradient(top, #eee, #ddd); /* Chrome 10+, Saf5.1+ */
+	background-image:    -moz-linear-gradient(top, #eee, #ddd); /* FF3.6 */
+	background-image:     -ms-linear-gradient(top, #eee, #ddd); /* IE10 */
+	background-image:      -o-linear-gradient(top, #eee, #ddd); /* Opera 11.10+ */
+	background-image:         linear-gradient(top, #eee, #ddd);
+}
+.ui-body-c,
+.ui-body-c input,
+.ui-body-c select,
+.ui-body-c textarea,
+.ui-body-c button {
+	font-family: Helvetica, Arial, sans-serif;
+}
+.ui-body-c .ui-link-inherit {
+	color: 					#333333;
+}
+.ui-body-c .ui-link {
+	color: 					#2489CE;
+	font-weight: bold;
+}
+
+.ui-btn-up-c {
+	border: 1px solid 		#ccc;
+	background: 			#eee;
+	font-weight: bold;
+	color: 					#444;
+	text-shadow: 0 1px 1px #f6f6f6;
+	background-image: -webkit-gradient(linear, left top, left bottom, from(#fdfdfd), to(#eee)); /* Saf4+, Chrome */
+	background-image: -webkit-linear-gradient(top, #fdfdfd, #eee); /* Chrome 10+, Saf5.1+ */
+	background-image:    -moz-linear-gradient(top, #fdfdfd, #eee); /* FF3.6 */
+	background-image:     -ms-linear-gradient(top, #fdfdfd, #eee); /* IE10 */
+	background-image:      -o-linear-gradient(top, #fdfdfd, #eee); /* Opera 11.10+ */
+	background-image:         linear-gradient(top, #fdfdfd, #eee);
+}
+.ui-btn-up-c a.ui-link-inherit {
+	color: 					#2F3E46;
+}
+
+.ui-btn-hover-c {
+	border: 1px solid 		#bbb;
+	background: 			#dadada;
+	font-weight: bold;
+	color: 					#101010;
+	text-shadow: 0 1px 1px 	#fff;
+	background-image: -webkit-gradient(linear, left top, left bottom, from(#ededed), to(#dadada)); /* Saf4+, Chrome */
+	background-image: -webkit-linear-gradient(top, #ededed, #dadada); /* Chrome 10+, Saf5.1+ */
+	background-image:    -moz-linear-gradient(top, #ededed, #dadada); /* FF3.6 */
+	background-image:     -ms-linear-gradient(top, #ededed, #dadada); /* IE10 */
+	background-image:      -o-linear-gradient(top, #ededed, #dadada); /* Opera 11.10+ */
+	background-image:         linear-gradient(top, #ededed, #dadada);
+}
+.ui-btn-hover-c a.ui-link-inherit {
+	color: 					#2F3E46;
+}
+.ui-btn-down-c {
+	border: 1px solid 		#808080;
+	background: 			#fdfdfd;
+	font-weight: bold;
+	color: 					#111111;
+	text-shadow: 0 1px 1px 	#ffffff;
+	background-image: -webkit-gradient(linear, left top, left bottom, from(#eee), to(#fdfdfd)); /* Saf4+, Chrome */
+	background-image: -webkit-linear-gradient(top, #eee, #fdfdfd); /* Chrome 10+, Saf5.1+ */
+	background-image:    -moz-linear-gradient(top, #eee, #fdfdfd); /* FF3.6 */
+	background-image:     -ms-linear-gradient(top, #eee, #fdfdfd); /* IE10 */
+	background-image:      -o-linear-gradient(top, #eee, #fdfdfd); /* Opera 11.10+ */
+	background-image:         linear-gradient(top, #eee, #fdfdfd);
+}
+.ui-btn-down-c a.ui-link-inherit {
+	color: 					#2F3E46;
+}
+.ui-btn-up-c,
+.ui-btn-hover-c,
+.ui-btn-down-c {
+	font-family: Helvetica, Arial, sans-serif;
+	text-decoration: none;
+}
+
+
+/* D
+-----------------------------------------------------------------------------------------------------------*/
+
+.ui-bar-d {
+	border: 1px solid 		#ccc;
+	background: 			#bbb;
+	color: 					#333;
+	text-shadow: 0 1px 0 #eee;
+	background-image: -webkit-gradient(linear, left top, left bottom, from(#ddd), to(#bbb)); /* Saf4+, Chrome */
+	background-image: -webkit-linear-gradient(top, #ddd, #bbb); /* Chrome 10+, Saf5.1+ */
+	background-image:    -moz-linear-gradient(top, #ddd, #bbb); /* FF3.6 */
+	background-image:     -ms-linear-gradient(top, #ddd, #bbb); /* IE10 */
+	background-image:      -o-linear-gradient(top, #ddd, #bbb); /* Opera 11.10+ */
+	background-image:         linear-gradient(top, #ddd, #bbb);
+}
+.ui-bar-d,
+.ui-bar-d input,
+.ui-bar-d select,
+.ui-bar-d textarea,
+.ui-bar-d button {
+	font-family: Helvetica, Arial, sans-serif;
+}
+.ui-bar-d .ui-link-inherit {
+	color: 					#333;
+}
+.ui-bar-d .ui-link {
+	color: 					#2489CE;
+	font-weight: bold;
+}
+.ui-body-d {
+	border: 1px solid 		#ccc;
+	color: 					#333333;
+	text-shadow: 0 1px 0 	#fff;
+	background: 			#ffffff;
+}
+.ui-body-d,
+.ui-body-d input,
+.ui-body-d select,
+.ui-body-d textarea,
+.ui-body-d button {
+	font-family: Helvetica, Arial, sans-serif;
+}
+.ui-body-d .ui-link-inherit {
+	color: 					#333333;
+}
+.ui-body-d .ui-link {
+	color: 					#2489CE;
+	font-weight: bold;
+}
+.ui-btn-up-d {
+	border: 1px solid 		#ccc;
+	background: 			#fff;
+	font-weight: bold;
+	color: 					#444;
+	text-shadow: 0 1px 1px #fff;
+}
+.ui-btn-up-d a.ui-link-inherit {
+	color: 					#333;
+}
+.ui-btn-hover-d {
+	border: 1px solid 		#aaa;
+	background: 			#eeeeee;
+	font-weight: bold;
+	color: 					#222;
+	cursor: pointer;
+	text-shadow: 0 1px 1px 	#fff;
+	background-image: -webkit-gradient(linear, left top, left bottom, from(#fdfdfd), to(#eee)); /* Saf4+, Chrome */
+	background-image: -webkit-linear-gradient(top, #fdfdfd, #eee); /* Chrome 10+, Saf5.1+ */
+	background-image:    -moz-linear-gradient(top, #fdfdfd, #eee); /* FF3.6 */
+	background-image:     -ms-linear-gradient(top, #fdfdfd, #eee); /* IE10 */
+	background-image:      -o-linear-gradient(top, #fdfdfd, #eee); /* Opera 11.10+ */
+	background-image:         linear-gradient(top, #fdfdfd, #eee);
+}
+.ui-btn-hover-d a.ui-link-inherit {
+	color: 					#222;
+}
+.ui-btn-down-d {
+	border: 1px solid 		#aaaaaa;
+	background: 			#ffffff;
+	font-weight: bold;
+	color: 					#111;
+	text-shadow: 0 1px 1px 	#ffffff;
+	background-image: -webkit-gradient(linear, left top, left bottom, from(#eee), to(#fff)); /* Saf4+, Chrome */
+	background-image: -webkit-linear-gradient(top, #eee, #fff); /* Chrome 10+, Saf5.1+ */
+	background-image:    -moz-linear-gradient(top, #eee, #fff); /* FF3.6 */
+	background-image:     -ms-linear-gradient(top, #eee, #fff); /* IE10 */
+	background-image:      -o-linear-gradient(top, #eee, #fff); /* Opera 11.10+ */
+	background-image:         linear-gradient(top, #eee, #fff);
+}
+.ui-btn-down-d a.ui-link-inherit {
+	color: 					#111;
+}
+.ui-btn-up-d,
+.ui-btn-hover-d,
+.ui-btn-down-d {
+	font-family: Helvetica, Arial, sans-serif;
+	text-decoration: none;
+}
+
+
+/* E
+-----------------------------------------------------------------------------------------------------------*/
+
+.ui-bar-e {
+	border: 1px solid 		#F7C942;
+	background: 			#fadb4e;
+	color: 					#333;
+	text-shadow: 0 1px 0 	#fff;
+	background-image: -webkit-gradient(linear, left top, left bottom, from(#fceda7), to(#fadb4e)); /* Saf4+, Chrome */
+	background-image: -webkit-linear-gradient(top, #fceda7, #fadb4e); /* Chrome 10+, Saf5.1+ */
+	background-image:    -moz-linear-gradient(top, #fceda7, #fadb4e); /* FF3.6 */
+	background-image:     -ms-linear-gradient(top, #fceda7, #fadb4e); /* IE10 */
+	background-image:      -o-linear-gradient(top, #fceda7, #fadb4e); /* Opera 11.10+ */
+	background-image:         linear-gradient(top, #fceda7, #fadb4e);
+}
+.ui-bar-e,
+.ui-bar-e input,
+.ui-bar-e select,
+.ui-bar-e textarea,
+.ui-bar-e button {
+	font-family: Helvetica, Arial, sans-serif;
+}
+.ui-bar-e .ui-link-inherit {
+	color: 					#333;
+}
+.ui-bar-e .ui-link {
+	color: 					#2489CE;
+	font-weight: bold;
+}
+.ui-body-e {
+	border: 1px solid 		#F7C942;
+	color: 					#333333;
+	text-shadow: 0 1px 0 	#fff;
+	background: 			#faeb9e;
+	background-image: -webkit-gradient(linear, left top, left bottom, from(#fff), to(#faeb9e)); /* Saf4+, Chrome */
+	background-image: -webkit-linear-gradient(top, #fff, #faeb9e); /* Chrome 10+, Saf5.1+ */
+	background-image:    -moz-linear-gradient(top, #fff, #faeb9e); /* FF3.6 */
+	background-image:     -ms-linear-gradient(top, #fff, #faeb9e); /* IE10 */
+	background-image:      -o-linear-gradient(top, #fff, #faeb9e); /* Opera 11.10+ */
+	background-image:         linear-gradient(top, #fff, #faeb9e);
+}
+.ui-body-e,
+.ui-body-e input,
+.ui-body-e select,
+.ui-body-e textarea,
+.ui-body-e button {
+	font-family: Helvetica, Arial, sans-serif;
+}
+.ui-body-e .ui-link-inherit {
+	color: 					#333333;
+}
+.ui-body-e .ui-link {
+	color: 					#2489CE;
+	font-weight: bold;
+}
+.ui-btn-up-e {
+	border: 1px solid 		#F7C942;
+	background: 			#fadb4e;
+	font-weight: bold;
+	color: 					#333;
+	text-shadow: 0 1px 0 	#fff;
+	background-image: -webkit-gradient(linear, left top, left bottom, from(#fceda7), to(#fadb4e)); /* Saf4+, Chrome */
+	background-image: -webkit-linear-gradient(top, #fceda7, #fadb4e); /* Chrome 10+, Saf5.1+ */
+	background-image:    -moz-linear-gradient(top, #fceda7, #fadb4e); /* FF3.6 */
+	background-image:     -ms-linear-gradient(top, #fceda7, #fadb4e); /* IE10 */
+	background-image:      -o-linear-gradient(top, #fceda7, #fadb4e); /* Opera 11.10+ */
+	background-image:         linear-gradient(top, #fceda7, #fadb4e);
+}
+.ui-btn-up-e a.ui-link-inherit {
+	color: 					#333;
+}
+.ui-btn-hover-e {
+	border: 1px solid 		#e79952;
+	background: 			#fbe26f;
+	font-weight: bold;
+	color: 					#111;
+	text-shadow: 0 1px 1px 	#fff;
+	background-image: -webkit-gradient(linear, left top, left bottom, from(#fcf0b5), to(#fbe26f)); /* Saf4+, Chrome */
+	background-image: -webkit-linear-gradient(top, #fcf0b5, #fbe26f); /* Chrome 10+, Saf5.1+ */
+	background-image:    -moz-linear-gradient(top, #fcf0b5, #fbe26f); /* FF3.6 */
+	background-image:     -ms-linear-gradient(top, #fcf0b5, #fbe26f); /* IE10 */
+	background-image:      -o-linear-gradient(top, #fcf0b5, #fbe26f); /* Opera 11.10+ */
+	background-image:         linear-gradient(top, #fcf0b5, #fbe26f);
+}
+
+.ui-btn-hover-e a.ui-link-inherit {
+	color: 					#333;
+}
+.ui-btn-down-e {
+	border: 1px solid 		#F7C942;
+	background: 			#fceda7;
+	font-weight: bold;
+	color: 					#111;
+	text-shadow: 0 1px 1px 	#ffffff;
+	background-image: -webkit-gradient(linear, left top, left bottom, from(#fadb4e), to(#fceda7)); /* Saf4+, Chrome */
+	background-image: -webkit-linear-gradient(top, #fadb4e, #fceda7); /* Chrome 10+, Saf5.1+ */
+	background-image:    -moz-linear-gradient(top, #fadb4e, #fceda7); /* FF3.6 */
+	background-image:     -ms-linear-gradient(top, #fadb4e, #fceda7); /* IE10 */
+	background-image:      -o-linear-gradient(top, #fadb4e, #fceda7); /* Opera 11.10+ */
+	background-image:         linear-gradient(top, #fadb4e, #fceda7);
+}
+.ui-btn-down-e a.ui-link-inherit {
+	color: 					#333;
+}
+.ui-btn-up-e,
+.ui-btn-hover-e,
+.ui-btn-down-e {
+	font-family: Helvetica, Arial, sans-serif;
+	text-decoration: none;
+}
+
+
+/* links within "buttons" 
+-----------------------------------------------------------------------------------------------------------*/
+
+a.ui-link-inherit {
+	text-decoration: none !important;
+}
+
+
+/* Active class used as the "on" state across all themes
+-----------------------------------------------------------------------------------------------------------*/
+
+.ui-btn-active {
+	border: 1px solid 		#155678;
+	background: 			#4596ce;
+	font-weight: bold;
+	color: 					#fff;
+	cursor: pointer;
+	text-shadow: 0 -1px 1px #145072;
+	text-decoration: none;
+	background-image: -webkit-gradient(linear, left top, left bottom, from(#85bae4), to(#5393c5)); /* Saf4+, Chrome */
+	background-image: -webkit-linear-gradient(top, #85bae4, #5393c5); /* Chrome 10+, Saf5.1+ */
+	background-image:    -moz-linear-gradient(top, #85bae4, #5393c5); /* FF3.6 */
+	background-image:     -ms-linear-gradient(top, #85bae4, #5393c5); /* IE10 */
+	background-image:      -o-linear-gradient(top, #85bae4, #5393c5); /* Opera 11.10+ */
+	background-image:         linear-gradient(top, #85bae4, #5393c5);
+  	outline: none;
+}
+.ui-btn-active a.ui-link-inherit {
+	color: 					#fff;
+}
+
+
+/* button inner top highlight
+-----------------------------------------------------------------------------------------------------------*/
+
+.ui-btn-inner {
+	border-top: 1px solid 	#fff;
+	border-color: 			rgba(255,255,255,.3);
+}
+
+
+/* corner rounding classes
+-----------------------------------------------------------------------------------------------------------*/
+
+.ui-corner-tl {
+	-moz-border-radius-topleft: 		.6em;
+	-webkit-border-top-left-radius: 	.6em;
+	border-top-left-radius: 			.6em;
+}
+.ui-corner-tr {
+	-moz-border-radius-topright: 		.6em;
+	-webkit-border-top-right-radius: 	.6em;
+	border-top-right-radius: 			.6em;
+}
+.ui-corner-bl {
+	-moz-border-radius-bottomleft: 		.6em;
+	-webkit-border-bottom-left-radius: 	.6em;
+	border-bottom-left-radius: 			.6em;
+}
+.ui-corner-br {
+	-moz-border-radius-bottomright: 	.6em;
+	-webkit-border-bottom-right-radius: .6em;
+	border-bottom-right-radius: 		.6em;
+}
+.ui-corner-top {
+	-moz-border-radius-topleft: 		.6em;
+	-webkit-border-top-left-radius: 	.6em;
+	border-top-left-radius: 			.6em;
+	-moz-border-radius-topright: 		.6em;
+	-webkit-border-top-right-radius: 	.6em;
+	border-top-right-radius: 			.6em;
+}
+.ui-corner-bottom {
+	-moz-border-radius-bottomleft: 		.6em;
+	-webkit-border-bottom-left-radius: 	.6em;
+	border-bottom-left-radius: 			.6em;
+	-moz-border-radius-bottomright: 	.6em;
+	-webkit-border-bottom-right-radius: .6em;
+	border-bottom-right-radius: 		.6em;
+	}
+.ui-corner-right {
+	-moz-border-radius-topright: 		.6em;
+	-webkit-border-top-right-radius: 	.6em;
+	border-top-right-radius: 			.6em;
+	-moz-border-radius-bottomright: 	.6em;
+	-webkit-border-bottom-right-radius: .6em;
+	border-bottom-right-radius: 		.6em;
+}
+.ui-corner-left {
+	-moz-border-radius-topleft: 		.6em;
+	-webkit-border-top-left-radius: 	.6em;
+	border-top-left-radius: 			.6em;
+	-moz-border-radius-bottomleft: 		.6em;
+	-webkit-border-bottom-left-radius: 	.6em;
+	border-bottom-left-radius: 			.6em;
+}
+.ui-corner-all {
+	-moz-border-radius: 				.6em;
+	-webkit-border-radius: 				.6em;
+	border-radius: 						.6em;
+}
+
+
+
+/* Interaction cues
+-----------------------------------------------------------------------------------------------------------*/
+.ui-disabled {
+	opacity: 							.3;
+}
+.ui-disabled,
+.ui-disabled a {
+	cursor: default;
+}
+
+/* Icons
+-----------------------------------------------------------------------------------------------------------*/
+
+.ui-icon {
+	background: 						#666;
+	background: 						rgba(0,0,0,.4);
+	background-image: url(images/icons-18-white.png);
+	background-repeat: no-repeat;
+	-moz-border-radius: 				9px;
+	-webkit-border-radius: 				9px;
+	border-radius: 						9px;
+}
+
+
+/* Alt icon color
+-----------------------------------------------------------------------------------------------------------*/
+
+.ui-icon-alt {
+	background: 						#fff;
+	background: 						rgba(255,255,255,.3);
+	background-image: url(images/icons-18-black.png);
+	background-repeat: no-repeat;
+}
+
+/* HD/"retina" sprite
+-----------------------------------------------------------------------------------------------------------*/
+
+@media only screen and (-webkit-min-device-pixel-ratio: 1.5),
+       only screen and (min--moz-device-pixel-ratio: 1.5),
+       only screen and (min-resolution: 240dpi) {
+	
+	.ui-icon-plus, .ui-icon-minus, .ui-icon-delete, .ui-icon-arrow-r,
+	.ui-icon-arrow-l, .ui-icon-arrow-u, .ui-icon-arrow-d, .ui-icon-check,
+	.ui-icon-gear, .ui-icon-refresh, .ui-icon-forward, .ui-icon-back,
+	.ui-icon-grid, .ui-icon-star, .ui-icon-alert, .ui-icon-info, .ui-icon-home, .ui-icon-search, 
+	.ui-icon-checkbox-off, .ui-icon-checkbox-on, .ui-icon-radio-off, .ui-icon-radio-on {
+		background-image: url(images/icons-36-white.png);
+		-moz-background-size: 776px 18px;
+		-o-background-size: 776px 18px;
+		-webkit-background-size: 776px 18px;
+		background-size: 776px 18px;
+	}
+	.ui-icon-alt {
+		background-image: url(images/icons-36-black.png);
+	}
+}
+
+/* plus minus */
+.ui-icon-plus {
+	background-position: 	-0 50%;
+}
+.ui-icon-minus {
+	background-position: 	-36px 50%;
+}
+
+/* delete/close */
+.ui-icon-delete {
+	background-position: 	-72px 50%;
+}
+
+/* arrows */
+.ui-icon-arrow-r {
+	background-position: 	-108px 50%;
+}
+.ui-icon-arrow-l {
+	background-position: 	-144px 50%;
+}
+.ui-icon-arrow-u {
+	background-position: 	-180px 50%;
+}
+.ui-icon-arrow-d {
+	background-position: 	-216px 50%;
+}
+
+/* misc */
+.ui-icon-check {
+	background-position: 	-252px 50%;
+}
+.ui-icon-gear {
+	background-position: 	-288px 50%;
+}
+.ui-icon-refresh {
+	background-position: 	-324px 50%;
+}
+.ui-icon-forward {
+	background-position: 	-360px 50%;
+}
+.ui-icon-back {
+	background-position: 	-396px 50%;
+}
+.ui-icon-grid {
+	background-position: 	-432px 50%;
+}
+.ui-icon-star {
+	background-position: 	-468px 50%;
+}
+.ui-icon-alert {
+	background-position: 	-504px 50%;
+}
+.ui-icon-info {
+	background-position: 	-540px 50%;
+}
+.ui-icon-home {
+	background-position: 	-576px 50%;
+}
+.ui-icon-search {
+	background-position: 	-612px 50%;
+}
+.ui-icon-checkbox-off {
+	background-position: 	-684px 50%;
+}
+.ui-icon-checkbox-on {
+	background-position: 	-648px 50%;
+}
+.ui-icon-radio-off {
+	background-position: 	-756px 50%;
+}
+.ui-icon-radio-on {
+	background-position: 	-720px 50%;
+}
+
+
+/* checks,radios */
+.ui-checkbox .ui-icon {
+	-moz-border-radius: 3px;
+	-webkit-border-radius: 3px;
+	border-radius: 3px;
+}
+.ui-icon-checkbox-off,
+.ui-icon-radio-off {
+	background-color: transparent;	
+}
+.ui-checkbox-on .ui-icon,
+.ui-radio-on .ui-icon {
+	background-color: #4596ce; /* NOTE: this hex should match the active state color. It's repeated here for cascade */
+}
+.ui-icon-searchfield {
+	background-image: url(images/icon-search-black.png);
+	background-size: 16px 16px;
+}
+
+/* loading icon */
+.ui-icon-loading {
+	background-image: url(images/ajax-loader.png);
+	width: 40px;
+	height: 40px;
+	-moz-border-radius: 20px;
+	-webkit-border-radius: 20px;
+	border-radius: 20px;
+	background-size: 35px 35px;
+}
+
+
+/* Button corner classes
+-----------------------------------------------------------------------------------------------------------*/
+
+.ui-btn-corner-tl {
+	-moz-border-radius-topleft: 		1em;
+	-webkit-border-top-left-radius: 	1em;
+	border-top-left-radius: 			1em;
+}
+.ui-btn-corner-tr {
+	-moz-border-radius-topright: 		1em;
+	-webkit-border-top-right-radius: 	1em;
+	border-top-right-radius: 			1em;
+}
+.ui-btn-corner-bl {
+	-moz-border-radius-bottomleft: 		1em;
+	-webkit-border-bottom-left-radius: 	1em;
+	border-bottom-left-radius: 			1em;
+}
+.ui-btn-corner-br {
+	-moz-border-radius-bottomright: 	1em;
+	-webkit-border-bottom-right-radius: 1em;
+	border-bottom-right-radius: 		1em;
+}
+.ui-btn-corner-top {
+	-moz-border-radius-topleft: 		1em;
+	-webkit-border-top-left-radius: 	1em;
+	border-top-left-radius: 			1em;
+	-moz-border-radius-topright: 		1em;
+	-webkit-border-top-right-radius: 	1em;
+	border-top-right-radius: 			1em;
+}
+.ui-btn-corner-bottom {
+	-moz-border-radius-bottomleft: 		1em;
+	-webkit-border-bottom-left-radius: 	1em;
+	border-bottom-left-radius: 			1em;
+	-moz-border-radius-bottomright: 	1em;
+	-webkit-border-bottom-right-radius: 1em;
+	border-bottom-right-radius: 		1em;
+}
+.ui-btn-corner-right {
+	 -moz-border-radius-topright: 		1em;
+	-webkit-border-top-right-radius: 	1em;
+	border-top-right-radius: 			1em;
+	-moz-border-radius-bottomright: 	1em;
+	-webkit-border-bottom-right-radius: 1em;
+	border-bottom-right-radius: 		1em;
+}
+.ui-btn-corner-left {
+	-moz-border-radius-topleft: 		1em;
+	-webkit-border-top-left-radius: 	1em;
+	border-top-left-radius: 			1em;
+	-moz-border-radius-bottomleft: 		1em;
+	-webkit-border-bottom-left-radius: 	1em;
+	border-bottom-left-radius: 			1em;
+}
+.ui-btn-corner-all {
+	-moz-border-radius: 				1em;
+	-webkit-border-radius: 				1em;
+	border-radius: 						1em;
+}
+
+/* radius clip workaround for cleaning up corner trapping */
+.ui-corner-tl,
+.ui-corner-tr,
+.ui-corner-bl, 
+.ui-corner-br,
+.ui-corner-top,
+.ui-corner-bottom, 
+.ui-corner-right,
+.ui-corner-left,
+.ui-corner-all,
+.ui-btn-corner-tl,
+.ui-btn-corner-tr,
+.ui-btn-corner-bl, 
+.ui-btn-corner-br,
+.ui-btn-corner-top,
+.ui-btn-corner-bottom, 
+.ui-btn-corner-right,
+.ui-btn-corner-left,
+.ui-btn-corner-all {
+  -webkit-background-clip: padding-box;
+     -moz-background-clip: padding;
+          background-clip: padding-box;
+}
+
+/* Overlay / modal
+-----------------------------------------------------------------------------------------------------------*/
+
+.ui-overlay {
+	background: #666;
+	opacity: .5;
+	filter: Alpha(Opacity=50);
+	position: absolute;
+	width: 100%;
+	height: 100%;
+}
+.ui-overlay-shadow {
+	-moz-box-shadow: 0px 0px 12px 			rgba(0,0,0,.6);
+	-webkit-box-shadow: 0px 0px 12px 		rgba(0,0,0,.6);
+	box-shadow: 0px 0px 12px 				rgba(0,0,0,.6);
+}
+.ui-shadow {
+	-moz-box-shadow: 0px 1px 4px 			rgba(0,0,0,.3);
+	-webkit-box-shadow: 0px 1px 4px 		rgba(0,0,0,.3);
+	box-shadow: 0px 1px 4px 				rgba(0,0,0,.3);
+}
+.ui-bar-a .ui-shadow,
+.ui-bar-b .ui-shadow ,
+.ui-bar-c .ui-shadow  {
+	-moz-box-shadow: 0px 1px 0 				rgba(255,255,255,.3);
+	-webkit-box-shadow: 0px 1px 0 			rgba(255,255,255,.3);
+	box-shadow: 0px 1px 0 					rgba(255,255,255,.3);
+}
+.ui-shadow-inset {
+	-moz-box-shadow: inset 0px 1px 4px 		rgba(0,0,0,.2);
+	-webkit-box-shadow: inset 0px 1px 4px 	rgba(0,0,0,.2);
+	box-shadow: inset 0px 1px 4px 			rgba(0,0,0,.2);
+}
+.ui-icon-shadow {
+	-moz-box-shadow: 0px 1px 0 				rgba(255,255,255,.4);
+	-webkit-box-shadow: 0px 1px 0 			rgba(255,255,255,.4);
+	box-shadow: 0px 1px 0 					rgba(255,255,255,.4);
+}
+
+
+/* Focus state - set here for specificity
+-----------------------------------------------------------------------------------------------------------*/
+
+.ui-focus {
+	-moz-box-shadow: 0px 0px 12px 		#387bbe;
+	-webkit-box-shadow: 0px 0px 12px 	#387bbe;
+	box-shadow: 0px 0px 12px 			#387bbe;
+}
+
+/* unset box shadow in browsers that don't do it right
+-----------------------------------------------------------------------------------------------------------*/
+
+.ui-mobile-nosupport-boxshadow * {
+	-moz-box-shadow: none !important;
+	-webkit-box-shadow: none !important;
+	box-shadow: none !important;
+}
+
+/* ...and bring back focus */
+.ui-mobile-nosupport-boxshadow .ui-focus {
+	outline-width: 2px;
+}/*
+* jQuery Mobile Framework
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.
+*/
+
+/* some unsets - more probably needed */
+.ui-mobile, .ui-mobile body { height: 100%; }
+.ui-mobile fieldset, .ui-page { padding: 0; margin: 0; }
+.ui-mobile a img, .ui-mobile fieldset { border: 0; }
+
+/* responsive page widths */
+.ui-mobile-viewport {  margin: 0; overflow-x: hidden; -webkit-text-size-adjust: none; -ms-text-size-adjust:none; -webkit-tap-highlight-color: rgba(0, 0, 0, 0); }
+
+/* "page" containers - full-screen views, one should always be in view post-pageload */
+.ui-mobile [data-role=page], .ui-mobile [data-role=dialog], .ui-page { top: 0; left: 0; width: 100%; min-height: 100%; position: absolute; display: none; border: 0; } 
+.ui-mobile .ui-page-active { display: block; overflow: visible; }
+
+/*orientations from js are available */
+.portrait,
+.portrait .ui-page { min-height: 420px; }
+.landscape,
+.landscape .ui-page  { min-height: 300px; }
+
+/* loading screen */
+.ui-loading .ui-mobile-viewport { overflow: hidden !important; }
+.ui-loading .ui-loader { display: block; }
+.ui-loading .ui-page { overflow: hidden;  }
+.ui-loader { display: none; position: absolute; opacity: .85; z-index: 100; left: 50%; width: 200px; margin-left: -130px; margin-top: -35px; padding: 10px 30px; }
+.ui-loader h1 { font-size: 15px; text-align: center; }
+.ui-loader .ui-icon { position: static; display: block; opacity: .9; margin: 0 auto; width: 35px; height: 35px; background-color: transparent; }
+
+/*fouc*/
+.ui-mobile-rendering > * { visibility: hidden; }
+
+/*headers, content panels*/
+.ui-bar, .ui-body { position: relative; padding: .4em 15px;  overflow: hidden; display: block;  clear:both;  }
+.ui-bar { font-size: 16px; margin: 0; }
+.ui-bar h1, .ui-bar h2, .ui-bar h3, .ui-bar h4, .ui-bar h5, .ui-bar h6 { margin: 0; padding: 0; font-size: 16px; display: inline-block; }
+
+.ui-header, .ui-footer { display: block; }
+.ui-page .ui-header, .ui-page .ui-footer { position: relative; }
+.ui-header .ui-btn-left { position: absolute; left: 10px; top: .4em;  }
+.ui-header .ui-btn-right { position: absolute; right: 10px; top: .4em; }
+.ui-header .ui-title, .ui-footer .ui-title { min-height: 1.1em; text-align: center; font-size: 16px; display: block; margin: .6em 90px .8em;  padding: 0;  text-overflow: ellipsis; overflow: hidden; white-space: nowrap; outline: 0 !important; }
+
+/*content area*/
+.ui-content { border-width: 0; overflow: visible; overflow-x: hidden; padding: 15px; }
+.ui-page-fullscreen .ui-content { padding:0; }
+
+/* icons sizing */
+.ui-icon { width: 18px; height: 18px; }
+
+/* fullscreen class on ui-content div */
+.ui-fullscreen {  }
+.ui-fullscreen img { max-width: 100%; }
+
+/* non-js content hiding */
+.ui-nojs { position: absolute; left: -9999px; }
+/*
+* jQuery Mobile Framework
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
+*/
+.spin  {
+	-webkit-transform: rotate(360deg);
+	-webkit-animation-name: spin;
+	-webkit-animation-duration: 1s;
+	-webkit-animation-iteration-count:  infinite;
+	-webkit-animation-timing-function: linear;
+}
+@-webkit-keyframes spin {
+	from {-webkit-transform: rotate(0deg);}
+  	to {-webkit-transform: rotate(360deg);}
+}
+
+/* Transitions from jQtouch (with small modifications): http://www.jqtouch.com/
+Built by David Kaneda and maintained by Jonathan Stark.
+*/
+.in, .out {
+	-webkit-animation-timing-function: ease-in-out;
+	-webkit-animation-duration: 350ms;
+}
+
+.slide.in {
+	-webkit-transform: translateX(0);
+	-webkit-animation-name: slideinfromright;
+}
+
+.slide.out {
+	-webkit-transform: translateX(-100%);
+	-webkit-animation-name: slideouttoleft;
+}
+
+.slide.in.reverse {
+	-webkit-transform: translateX(0);
+	-webkit-animation-name: slideinfromleft;
+}
+
+.slide.out.reverse {
+	-webkit-transform: translateX(100%);
+	-webkit-animation-name: slideouttoright;
+}
+
+.slideup.in {
+	-webkit-transform: translateY(0);
+	-webkit-animation-name: slideinfrombottom;
+	z-index: 10;
+}
+
+.slideup.out {
+	-webkit-animation-name: dontmove;
+	z-index: 0;
+}
+
+.slideup.out.reverse {
+	-webkit-transform: translateY(100%);
+	z-index: 10;
+	-webkit-animation-name: slideouttobottom;
+}
+
+.slideup.in.reverse {
+	z-index: 0;
+	-webkit-animation-name: dontmove;
+}
+.slidedown.in {
+	-webkit-transform: translateY(0);
+	-webkit-animation-name: slideinfromtop;
+	z-index: 10;
+}
+
+.slidedown.out {
+	-webkit-animation-name: dontmove;
+	z-index: 0;
+}
+
+.slidedown.out.reverse {
+	-webkit-transform: translateY(-100%);
+	z-index: 10;
+	-webkit-animation-name: slideouttotop;
+}
+
+.slidedown.in.reverse {
+	z-index: 0;
+	-webkit-animation-name: dontmove;
+}
+
+@-webkit-keyframes slideinfromright {
+    from { -webkit-transform: translateX(100%); }
+    to { -webkit-transform: translateX(0); }
+}
+
+@-webkit-keyframes slideinfromleft {
+    from { -webkit-transform: translateX(-100%); }
+    to { -webkit-transform: translateX(0); }
+}
+
+@-webkit-keyframes slideouttoleft {
+    from { -webkit-transform: translateX(0); }
+    to { -webkit-transform: translateX(-100%); }
+}
+
+@-webkit-keyframes slideouttoright {
+    from { -webkit-transform: translateX(0); }
+    to { -webkit-transform: translateX(100%); }
+}
+
+
+@-webkit-keyframes slideinfromtop {
+    from { -webkit-transform: translateY(-100%); }
+    to { -webkit-transform: translateY(0); }
+}
+
+@-webkit-keyframes slideinfrombottom {
+    from { -webkit-transform: translateY(100%); }
+    to { -webkit-transform: translateY(0); }
+}
+
+@-webkit-keyframes slideouttobottom {
+    from { -webkit-transform: translateY(0); }
+    to { -webkit-transform: translateY(100%); }
+}
+
+@-webkit-keyframes slideouttotop {
+    from { -webkit-transform: translateY(0); }
+    to { -webkit-transform: translateY(-100%); }
+}
+@-webkit-keyframes fadein {
+    from { opacity: 0; }
+    to { opacity: 1; }
+}
+
+@-webkit-keyframes fadeout {
+    from { opacity: 1; }
+    to { opacity: 0; }
+}
+
+.fade.in {
+	opacity: 1;
+	z-index: 10;
+	-webkit-animation-name: fadein;
+}
+.fade.out {
+	z-index: 0;
+	-webkit-animation-name: fadeout;
+}
+
+/* The properties in this rule are only necessary for the 'flip' transition.
+ * We need specify the perspective to create a projection matrix. This will add
+ * some depth as the element flips. The depth number represents the distance of
+ * the viewer from the z-plane. According to the CSS3 spec, 1000 is a moderate
+ * value.
+ */
+.viewport-flip {
+	-webkit-perspective: 1000;
+	position: absolute;
+}
+
+.ui-mobile-viewport-transitioning,
+.ui-mobile-viewport-transitioning .ui-page {
+	width: 100%;
+	height: 100%;
+	overflow: hidden;
+}
+
+.flip {
+	-webkit-animation-duration: .65s;
+	-webkit-backface-visibility:hidden;
+	-webkit-transform:translateX(0); /* Needed to work around an iOS 3.1 bug that causes listview thumbs to disappear when -webkit-visibility:hidden is used. */
+}
+
+.flip.in {
+	-webkit-transform: rotateY(0) scale(1);
+	-webkit-animation-name: flipinfromleft;
+}
+
+.flip.out {
+	-webkit-transform: rotateY(-180deg) scale(.8);
+	-webkit-animation-name: flipouttoleft;
+}
+
+/* Shake it all about */
+
+.flip.in.reverse {
+	-webkit-transform: rotateY(0) scale(1);
+	-webkit-animation-name: flipinfromright;
+}
+
+.flip.out.reverse {
+	-webkit-transform: rotateY(180deg) scale(.8);
+	-webkit-animation-name: flipouttoright;
+}
+
+@-webkit-keyframes flipinfromright {
+    from { -webkit-transform: rotateY(-180deg) scale(.8); }
+    to { -webkit-transform: rotateY(0) scale(1); }
+}
+
+@-webkit-keyframes flipinfromleft {
+    from { -webkit-transform: rotateY(180deg) scale(.8); }
+    to { -webkit-transform: rotateY(0) scale(1); }
+}
+
+@-webkit-keyframes flipouttoleft {
+    from { -webkit-transform: rotateY(0) scale(1); }
+    to { -webkit-transform: rotateY(-180deg) scale(.8); }
+}
+
+@-webkit-keyframes flipouttoright {
+    from { -webkit-transform: rotateY(0) scale(1); }
+    to { -webkit-transform: rotateY(180deg) scale(.8); }
+}
+
+
+/* Hackish, but reliable. */
+
+@-webkit-keyframes dontmove {
+    from { opacity: 1; }
+    to { opacity: 1; }
+}
+
+.pop {
+	-webkit-transform-origin: 50% 50%;
+}
+
+.pop.in {
+	-webkit-transform: scale(1);
+    opacity: 1;
+	-webkit-animation-name: popin;
+	z-index: 10;
+}
+
+.pop.out.reverse {
+	-webkit-transform: scale(.2);
+	opacity: 0;
+	-webkit-animation-name: popout;
+	z-index: 10;
+}
+
+.pop.in.reverse {
+	z-index: 0;
+	-webkit-animation-name: dontmove;
+}
+
+@-webkit-keyframes popin {
+    from {
+        -webkit-transform: scale(.2);
+        opacity: 0;
+    }
+    to {
+        -webkit-transform: scale(1);
+        opacity: 1;
+    }
+}
+
+@-webkit-keyframes popout {
+    from {
+        -webkit-transform: scale(1);
+        opacity: 1;
+    }
+    to {
+        -webkit-transform: scale(.2);
+        opacity: 0;
+    }
+}/*
+* jQuery Mobile Framework
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
+*/
+
+/* content configurations. */
+.ui-grid-a, .ui-grid-b, .ui-grid-c, .ui-grid-d { overflow: hidden; }
+.ui-block-a, .ui-block-b, .ui-block-c, .ui-block-d, .ui-block-e { margin: 0; padding: 0; border: 0; float: left; min-height:1px;}
+
+/* grid solo: 100 - single item fallback */
+.ui-grid-solo .ui-block-a { width: 100%; float: none; }
+
+/* grid a: 50/50 */
+.ui-grid-a .ui-block-a, .ui-grid-a .ui-block-b { width: 50%; }
+.ui-grid-a .ui-block-a { clear: left; }
+
+/* grid b: 33/33/33 */
+.ui-grid-b .ui-block-a, .ui-grid-b .ui-block-b, .ui-grid-b .ui-block-c { width: 33.333%; }
+.ui-grid-b .ui-block-a { clear: left; }
+
+/* grid c: 25/25/25/25 */
+.ui-grid-c .ui-block-a, .ui-grid-c .ui-block-b, .ui-grid-c .ui-block-c, .ui-grid-c .ui-block-d { width: 25%; }
+.ui-grid-c .ui-block-a { clear: left; }
+
+/* grid d: 20/20/20/20/20 */
+.ui-grid-d .ui-block-a, .ui-grid-d .ui-block-b, .ui-grid-d .ui-block-c, .ui-grid-d .ui-block-d, .ui-grid-d .ui-block-e { width: 20%; }
+.ui-grid-d .ui-block-a { clear: left; }
+/*
+* jQuery Mobile Framework
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
+*/
+/* fixed page header & footer configuration */
+.ui-header, .ui-footer, .ui-page-fullscreen .ui-header, .ui-page-fullscreen .ui-footer  { position: absolute;  overflow: hidden; width: 100%; border-left-width: 0; border-right-width: 0; }
+.ui-header-fixed, .ui-footer-fixed {
+	z-index: 1000;
+	-webkit-transform: translateZ(0); /* Force header/footer rendering to go through the same rendering pipeline as native page scrolling. */
+}
+.ui-footer-duplicate, .ui-page-fullscreen .ui-fixed-inline { display: none; }
+.ui-page-fullscreen .ui-header, .ui-page-fullscreen .ui-footer { opacity: .9; }
+/*
+* jQuery Mobile Framework
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
+*/
+.ui-navbar { overflow: hidden;  }
+.ui-navbar ul, .ui-navbar-expanded ul { list-style:none; padding: 0; margin: 0; position: relative; display: block; border: 0;}
+.ui-navbar-collapsed ul { float: left; width: 75%; margin-right: -2px; }
+.ui-navbar-collapsed .ui-navbar-toggle { float: left; width: 25%; }
+.ui-navbar li.ui-navbar-truncate { position: absolute; left: -9999px; top: -9999px; }
+.ui-navbar li .ui-btn, .ui-navbar .ui-navbar-toggle .ui-btn { display: block; font-size: 12px; text-align: center; margin: 0; border-right-width: 0; }
+.ui-navbar li .ui-btn {  margin-right: -1px; }
+.ui-navbar li .ui-btn:last-child { margin-right: 0; }
+.ui-header .ui-navbar li .ui-btn, .ui-header .ui-navbar .ui-navbar-toggle .ui-btn,
+.ui-footer .ui-navbar li .ui-btn, .ui-footer .ui-navbar .ui-navbar-toggle .ui-btn { border-top-width: 0; border-bottom-width: 0; }
+.ui-navbar .ui-btn-inner { padding-left: 2px; padding-right: 2px; }
+.ui-navbar-noicons li .ui-btn .ui-btn-inner, .ui-navbar-noicons .ui-navbar-toggle .ui-btn-inner { padding-top: .8em; padding-bottom: .9em; }
+/*expanded page styles*/
+.ui-navbar-expanded .ui-btn { margin: 0; font-size: 14px; }
+.ui-navbar-expanded .ui-btn-inner { padding-left: 5px; padding-right: 5px;  }
+.ui-navbar-expanded .ui-btn-icon-top .ui-btn-inner { padding: 45px 5px 15px; text-align: center; }
+.ui-navbar-expanded .ui-btn-icon-top .ui-icon { top: 15px; }
+.ui-navbar-expanded .ui-btn-icon-bottom .ui-btn-inner { padding: 15px 5px 45px; text-align: center; }
+.ui-navbar-expanded .ui-btn-icon-bottom .ui-icon { bottom: 15px; }
+.ui-navbar-expanded li .ui-btn .ui-btn-inner { min-height: 2.5em; }
+.ui-navbar-expanded .ui-navbar-noicons .ui-btn .ui-btn-inner { padding-top: 1.8em; padding-bottom: 1.9em; }
+/*
+* jQuery Mobile Framework
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
+*/
+.ui-btn { display: block; text-align: center; cursor:pointer;  position: relative; margin: .5em 5px; padding: 0; }
+.ui-btn:focus, .ui-btn:active { outline: none; }
+.ui-header .ui-btn, .ui-footer .ui-btn, .ui-bar .ui-btn { display: inline-block; font-size: 13px; margin: 0; }
+.ui-btn-inline { display: inline-block; }
+.ui-btn-inner { padding: .6em 25px; display: block; text-overflow: ellipsis; overflow: hidden; white-space: nowrap; position: relative; zoom: 1; }
+.ui-header .ui-btn-inner, .ui-footer .ui-btn-inner, .ui-bar .ui-btn-inner { padding: .4em 8px .5em; }
+.ui-btn-icon-notext { display: inline-block; width: 20px; height: 20px; padding: 2px 1px 2px 3px; text-indent: -9999px; }
+.ui-btn-icon-notext .ui-btn-inner { padding: 0; }
+.ui-btn-icon-notext .ui-btn-text { position: absolute; left: -999px; }
+.ui-btn-icon-left .ui-btn-inner { padding-left: 33px; }
+.ui-header .ui-btn-icon-left .ui-btn-inner,
+.ui-footer .ui-btn-icon-left .ui-btn-inner,
+.ui-bar .ui-btn-icon-left .ui-btn-inner { padding-left: 27px; }
+.ui-btn-icon-right .ui-btn-inner { padding-right: 33px; }
+.ui-header .ui-btn-icon-right .ui-btn-inner,
+.ui-footer .ui-btn-icon-right .ui-btn-inner,
+.ui-bar .ui-btn-icon-right .ui-btn-inner { padding-right: 27px; }
+.ui-btn-icon-top .ui-btn-inner { padding-top: 33px; }
+.ui-header .ui-btn-icon-top .ui-btn-inner,
+.ui-footer .ui-btn-icon-top .ui-btn-inner,
+.ui-bar .ui-btn-icon-top .ui-btn-inner { padding-top: 27px; }
+.ui-btn-icon-bottom .ui-btn-inner { padding-bottom: 33px; }
+.ui-header .ui-btn-icon-bottom .ui-btn-inner,
+.ui-footer .ui-btn-icon-bottom .ui-btn-inner,
+.ui-bar .ui-btn-icon-bottom .ui-btn-inner { padding-bottom: 27px; }
+
+/*btn icon positioning*/
+.ui-btn-icon-notext .ui-icon { display: block; }
+.ui-btn-icon-left .ui-icon, .ui-btn-icon-right .ui-icon { position: absolute; top: 50%; margin-top: -9px; }
+.ui-btn-icon-top .ui-icon, .ui-btn-icon-bottom .ui-icon { position: absolute; left: 50%;  margin-left: -9px; }
+.ui-btn-icon-left .ui-icon { left: 10px; }
+.ui-btn-icon-right .ui-icon {right: 10px; }
+.ui-header .ui-btn-icon-left .ui-icon,
+.ui-footer .ui-btn-icon-left .ui-icon,
+.ui-bar .ui-btn-icon-left .ui-icon { left: 4px; }
+.ui-header .ui-btn-icon-right .ui-icon,
+.ui-footer .ui-btn-icon-right .ui-icon,
+.ui-bar .ui-btn-icon-right .ui-icon { right: 4px; }
+.ui-header .ui-btn-icon-top .ui-icon,
+.ui-footer .ui-btn-icon-top .ui-icon,
+.ui-bar .ui-btn-icon-top .ui-icon { top: 4px; }
+.ui-header .ui-btn-icon-bottom .ui-icon,
+.ui-footer .ui-btn-icon-bottom .ui-icon,
+.ui-bar .ui-btn-icon-bottom .ui-icon { bottom: 4px; }
+.ui-btn-icon-top .ui-icon { top: 5px; }
+.ui-btn-icon-bottom .ui-icon { bottom: 5px; }
+/*hiding native button,inputs */
+.ui-btn-hidden {  position: absolute; top: 0; left: 0; width: 100%; height: 100%; -webkit-appearance: button; opacity: 0; cursor: pointer; -ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=0)"; filter: alpha(opacity=0); background: transparent; }
+/*
+* jQuery Mobile Framework
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
+*/
+.ui-collapsible-contain { margin: .5em 0; }
+.ui-collapsible-heading { font-size: 16px; display: block; margin: 0 -8px; padding: 0; border-width: 0 0 1px 0; position: relative; }
+.ui-collapsible-heading a { text-align: left; margin: 0;  }
+.ui-collapsible-heading a .ui-btn-inner { padding-left: 40px; }
+.ui-collapsible-heading a span.ui-btn { position: absolute; left: 6px; top: 50%; margin: -12px 0 0 0; width: 20px; height: 20px; padding: 1px 0px 1px 2px; text-indent: -9999px; }
+.ui-collapsible-heading a span.ui-btn .ui-btn-inner { padding: 10px 0; }
+.ui-collapsible-heading a span.ui-btn .ui-icon { left: 0; margin-top: -10px; }
+.ui-collapsible-heading-status { position:absolute; left:-9999px; }
+.ui-collapsible-content {  display: block; padding: 10px 0 10px 8px; }
+.ui-collapsible-content-collapsed { display: none; }
+
+.ui-collapsible-set { margin: .5em 0; }
+.ui-collapsible-set .ui-collapsible-contain { margin: -1px 0 0; }
+/*
+* jQuery Mobile Framework
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
+*/
+.ui-controlgroup, fieldset.ui-controlgroup { padding: 0; margin: .5em 0 1em; }
+.ui-bar .ui-controlgroup { margin: 0 .3em; }
+.ui-controlgroup-label { font-size: 16px; line-height: 1.4; font-weight: normal; margin: 0 0 .3em; }
+.ui-controlgroup-controls { display: block; width: 95%;}
+.ui-controlgroup li { list-style: none; }
+.ui-controlgroup-vertical .ui-btn,
+.ui-controlgroup-vertical .ui-checkbox, .ui-controlgroup-vertical .ui-radio { margin: 0; border-bottom-width: 0;  }
+.ui-controlgroup-vertical .ui-controlgroup-last { border-bottom-width: 1px; }
+.ui-controlgroup-horizontal { padding: 0; }
+.ui-controlgroup-horizontal .ui-btn,
+.ui-controlgroup-horizontal .ui-checkbox, .ui-controlgroup-horizontal .ui-radio { display: inline-block; margin: 0 -5px 0 0; }
+.ui-controlgroup-horizontal .ui-checkbox, .ui-controlgroup-horizontal .ui-radio { display: inline; }
+.ui-controlgroup-horizontal .ui-checkbox .ui-btn, .ui-controlgroup-horizontal .ui-radio .ui-btn,
+.ui-controlgroup-horizontal .ui-checkbox:last-child, .ui-controlgroup-horizontal .ui-radio:last-child { margin-right: 0; }
+.ui-controlgroup-horizontal .ui-controlgroup-last { margin-right: 0; }
+.ui-controlgroup .ui-checkbox label, .ui-controlgroup .ui-radio label { font-size: 16px;  }
+/* conflicts with listview..
+.ui-controlgroup .ui-btn-icon-notext { width: 30px; height: 30px; text-indent: -9999px; }
+.ui-controlgroup .ui-btn-icon-notext .ui-btn-inner {  padding: 5px 6px 5px 5px; }
+*/
+
+@media all and (min-width: 450px){
+	.ui-controlgroup-label { vertical-align: top; display: inline-block;  width: 20%;  margin: 0 2% 0 0;  }
+	.ui-controlgroup-controls { width: 60%; display: inline-block; } 
+}	/*
+* jQuery Mobile Framework
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
+*/
+.ui-dialog { min-height: 480px; }
+.ui-dialog .ui-header, .ui-dialog .ui-content,  .ui-dialog .ui-footer { margin: 15px; position: relative; }
+.ui-dialog .ui-header, .ui-dialog .ui-footer { z-index: 10; width: auto; }
+.ui-dialog .ui-content, .ui-dialog .ui-footer { margin-top: -15px;  }/*
+* jQuery Mobile Framework
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
+*/
+.ui-checkbox, .ui-radio { position:relative;  margin: .2em 0 .5em; z-index: 1;  }
+.ui-checkbox .ui-btn, .ui-radio .ui-btn { margin: 0; text-align: left; z-index: 2; }
+.ui-checkbox .ui-btn-inner, .ui-radio .ui-btn-inner { white-space: normal; }
+.ui-checkbox .ui-btn-icon-left .ui-btn-inner,.ui-radio .ui-btn-icon-left .ui-btn-inner { padding-left: 45px; }
+.ui-checkbox .ui-btn-icon-right .ui-btn-inner, .ui-radio .ui-btn-icon-right .ui-btn-inner { padding-right: 45px; }
+.ui-checkbox .ui-icon, .ui-radio .ui-icon { top: 1.1em; }
+.ui-checkbox .ui-btn-icon-left .ui-icon, .ui-radio .ui-btn-icon-left .ui-icon {left: 15px; }
+.ui-checkbox .ui-btn-icon-right .ui-icon, .ui-radio .ui-btn-icon-right .ui-icon {right: 15px; }
+/* input, label positioning */
+.ui-checkbox input,.ui-radio input { position:absolute; left:20px; top:50%; width: 10px; height: 10px;  margin:-5px 0 0 0; outline: 0 !important; z-index: 1; }/*
+* jQuery Mobile Framework
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
+*/
+.ui-field-contain { padding: 1.5em 0; margin: 0; border-bottom-width: 1px; overflow: visible; }
+.ui-field-contain:first-child { border-top-width: 0; }
+@media all and (min-width: 450px){
+	.ui-field-contain { border-width: 0; padding: 0; margin: 1em 0; }
+}	/*
+* jQuery Mobile Framework
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
+*/
+.ui-select { display: block; position: relative; }
+.ui-select select { position: absolute; left: -9999px; top: -9999px; }
+.ui-select .ui-btn { overflow: hidden; }
+.ui-select .ui-btn select { cursor: pointer; -webkit-appearance: button; left: 0; top:0; width: 100%; height: 100%; opacity: 0; -ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=0)"; filter: alpha(opacity=0); }
+@-moz-document url-prefix() {.ui-select .ui-btn select { opacity: 0.0001; }}
+.ui-select .ui-btn select.ui-select-nativeonly { opacity: 1; text-indent: 0; }
+
+.ui-select .ui-btn-icon-right .ui-btn-inner { padding-right: 45px; } 
+.ui-select .ui-btn-icon-right .ui-icon { right: 15px;  }
+
+/* labels */
+label.ui-select { font-size: 16px; line-height: 1.4;  font-weight: normal; margin: 0 0 .3em; display: block; }
+
+/*listbox*/
+.ui-select .ui-btn-text, .ui-selectmenu .ui-btn-text { display: block; min-height: 1em; }
+.ui-select .ui-btn-text { text-overflow: ellipsis; overflow: hidden;}
+
+.ui-selectmenu { position: absolute; padding: 0; z-index: 100 !important; width: 80%; max-width: 350px; padding: 6px; }
+.ui-selectmenu .ui-listview { margin: 0; }
+.ui-selectmenu .ui-btn.ui-li-divider { cursor: default; }
+.ui-selectmenu-hidden { top: -9999px; left: -9999px; }
+.ui-selectmenu-screen { position: absolute; top: 0; left: 0; width: 100%; height: 100%;  z-index: 99; }
+.ui-screen-hidden, .ui-selectmenu-list .ui-li .ui-icon { display: none; }
+.ui-selectmenu-list .ui-li .ui-icon { display: block; }
+.ui-li.ui-selectmenu-placeholder { display: none; }
+.ui-selectmenu .ui-header .ui-title { margin: 0.6em 46px 0.8em; }
+
+@media all and (min-width: 450px){
+	label.ui-select { display: inline-block;  width: 20%;  margin: 0 2% 0 0; }
+	.ui-select { width: 60%; display: inline-block; }
+}	
+
+/* when no placeholder is defined in a multiple select, the header height doesn't even extend past the close button.  this shim's content in there */
+.ui-selectmenu .ui-header h1:after { content: '.'; visibility: hidden; }/*
+* jQuery Mobile Framework
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
+*/
+label.ui-input-text { font-size: 16px; line-height: 1.4; display: block; font-weight: normal; margin: 0 0 .3em; }
+input.ui-input-text, textarea.ui-input-text { background-image: none; padding: .4em; line-height: 1.4; font-size: 16px; display: block; width: 95%; }
+input.ui-input-text { -webkit-appearance: none; }
+textarea.ui-input-text { height: 50px; -webkit-transition: height 200ms linear; -moz-transition: height 200ms linear; -o-transition: height 200ms linear; transition: height 200ms linear; }
+.ui-input-search { padding: 0 30px; width: 77%; background-position: 8px 50%; background-repeat: no-repeat; position: relative; }
+.ui-input-search input.ui-input-text { border: none; width: 98%; padding: .4em 0; margin: 0; display: block; background: transparent none; outline: 0 !important; }
+.ui-input-search .ui-input-clear { position: absolute; right: 0; top: 50%; margin-top: -14px; }
+.ui-input-search .ui-input-clear-hidden { display: none; }
+
+/* orientation adjustments - incomplete!*/
+@media all and (min-width: 450px){
+	label.ui-input-text  { vertical-align: top; display: inline-block;  width: 20%;  margin: 0 2% 0 0 }
+	input.ui-input-text, 
+	textarea.ui-input-text, 
+	.ui-input-search { width: 60%; display: inline-block; } 
+	.ui-input-search { width: 50%; }
+	.ui-input-search input.ui-input-text { width: 98%; /*echos rule from above*/ }
+}/*
+* jQuery Mobile Framework
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
+*/
+.ui-listview { margin: 0; counter-reset: listnumbering; }
+.ui-content .ui-listview { margin: -15px; }
+.ui-content .ui-listview-inset { margin: 1em 0;  }
+.ui-listview, .ui-li { list-style:none; padding:0; }
+.ui-li, .ui-li.ui-field-contain { display: block; margin:0; position: relative; overflow: visible; text-align: left; border-width: 0; border-top-width: 1px; }
+.ui-li .ui-btn-text a.ui-link-inherit { text-overflow: ellipsis; overflow: hidden; white-space: nowrap;  }
+.ui-li-divider, .ui-li-static { padding: .5em 15px; font-size: 14px; font-weight: bold;  }
+.ui-li-divider { counter-reset: listnumbering;  }
+ol.ui-listview .ui-link-inherit:before, ol.ui-listview .ui-li-static:before, .ui-li-dec { font-size: .8em; display: inline-block; padding-right: .3em; font-weight: normal;counter-increment: listnumbering; content: counter(listnumbering) ". "; }
+ol.ui-listview .ui-li-jsnumbering:before { content: "" !important; } /* to avoid chance of duplication */
+.ui-listview-inset .ui-li { border-right-width: 1px; border-left-width: 1px; }
+.ui-li:last-child, .ui-li.ui-field-contain:last-child { border-bottom-width: 1px; }
+.ui-li>.ui-btn-inner { display: block; position: relative; padding: 0; }
+.ui-li .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li { padding: .7em 75px .7em 15px; display: block; }
+.ui-li-has-thumb .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li-has-thumb  { min-height: 60px; padding-left: 100px; }
+.ui-li-has-icon .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li-has-icon {  min-height: 20px; padding-left: 40px; }
+.ui-li-heading { font-size: 16px; font-weight: bold; display: block; margin: .6em 0; text-overflow: ellipsis; overflow: hidden; white-space: nowrap;  }
+.ui-li-desc {  font-size: 12px; font-weight: normal; display: block; margin: -.5em 0 .6em; text-overflow: ellipsis; overflow: hidden; white-space: nowrap; }
+.ui-li-thumb, .ui-li-icon { position: absolute; left: 1px; top: 0; max-height: 80px; max-width: 80px; }
+.ui-li-icon { max-height: 40px; max-width: 40px; left: 10px; top: .9em; }
+.ui-li-thumb, .ui-li-icon, .ui-li-content { float: left; margin-right: 10px; }
+
+.ui-li-aside { float: right; width: 50%; text-align: right; margin: .3em 0; }
+@media all and (min-width: 480px){
+	 .ui-li-aside { width: 45%; }
+}	 
+.ui-li-divider { cursor: default; }
+.ui-li-has-alt .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li-has-alt { padding-right: 95px; }
+.ui-li-count { position: absolute; font-size: 11px; font-weight: bold; padding: .2em .5em; top: 50%; margin-top: -.9em; right: 38px; }
+.ui-li-divider .ui-li-count, .ui-li-static .ui-li-count { right: 10px; }
+.ui-li-has-alt .ui-li-count { right: 55px; }
+.ui-li-link-alt { position: absolute; width: 40px; height: 100%; border-width: 0; border-left-width: 1px; top: 0; right: 0; margin: 0; padding: 0; }
+.ui-li-link-alt .ui-btn { overflow: hidden; position: absolute; right: 8px; top: 50%; margin: -11px 0 0 0; border-bottom-width: 1px; }
+.ui-li-link-alt .ui-btn-inner { padding: 0; position: static; }
+.ui-li-link-alt .ui-btn .ui-icon { right: 50%; margin-right: -9px;  }
+
+.ui-listview-filter { border-width: 0; overflow: hidden; margin: -15px -15px 15px -15px }
+.ui-listview-filter .ui-input-search { margin: 5px; width: auto; display: block; }
+
+.ui-listview-filter-inset { margin: -15px -5px -15px -5px; background: transparent; }
+.ui-li.ui-screen-hidden{display:none;}
+/* Odd iPad positioning issue. */
+@media only screen and (min-device-width: 768px) and (max-device-width: 1024px) {
+    .ui-li .ui-btn-text { overflow:  visible; }
+}/*
+* jQuery Mobile Framework
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
+*/
+label.ui-slider { display: block; }
+input.ui-slider-input  { display: inline-block; width: 50px; }
+select.ui-slider-switch { display: none; }
+div.ui-slider { position: relative; display: inline-block; overflow: visible; height: 15px; padding: 0; margin: 0 2% 0 20px; top: 4px; width: 66%; }
+a.ui-slider-handle { position: absolute; z-index: 10;  top: 50%; width: 28px; height: 28px; margin-top: -15px; margin-left: -15px; }
+a.ui-slider-handle .ui-btn-inner { padding-left: 0; padding-right: 0; }
+@media all and (min-width: 480px){
+	label.ui-slider { display: inline-block;  width: 20%;  margin: 0 2% 0 0; }
+	div.ui-slider { width: 45%; }
+}	
+
+div.ui-slider-switch { height: 32px;  overflow: hidden; margin-left: 0; }
+div.ui-slider-inneroffset { margin-left: 50%; position: absolute; top: 1px; height: 100%; width: 50%; }
+div.ui-slider-handle-snapping { -webkit-transition: left 100ms linear; }
+div.ui-slider-labelbg { position: absolute; top:0; margin: 0; border-width: 0; }
+div.ui-slider-switch div.ui-slider-labelbg-a { width: 60%; height: 100%; left: 0; }
+div.ui-slider-switch div.ui-slider-labelbg-b { width: 60%; height: 100%; right: 0; }
+.ui-slider-switch-a div.ui-slider-labelbg-a, .ui-slider-switch-b div.ui-slider-labelbg-b { z-index: -1; }
+.ui-slider-switch-a div.ui-slider-labelbg-b, .ui-slider-switch-b div.ui-slider-labelbg-a { z-index: 0; }
+
+div.ui-slider-switch a.ui-slider-handle { z-index: 20;  width: 101%; height: 32px; margin-top: -18px; margin-left: -101%; }
+span.ui-slider-label { width: 100%; position: absolute;height: 32px;  font-size: 16px; text-align: center; line-height: 2; background: none; border-color: transparent; }
+span.ui-slider-label-a { left: -100%;  margin-right: -1px }
+span.ui-slider-label-b { right: -100%;  margin-left: -1px }
+

file:b/css/local.css.php (new)
--- /dev/null
+++ b/css/local.css.php
@@ -1,1 +1,216 @@
-
+<?php
+  header('Content-type: text/css');
+  ob_start("compress");
+  function compress($buffer) {
+    /* remove comments */
+    $buffer = preg_replace('!/\*[^*]*\*+([^/][^*]*\*+)*/!', '', $buffer);
+    /* remove tabs, spaces, newlines, etc. */
+    $buffer = str_replace(array("\r\n", "\r", "\n", "\t", '  ', '    ', '    '), '', $buffer);
+    return $buffer;
+  }
+
+echo '
+.ui-li-thumb, .ui-li-icon { position: relative; }
+
+     .ui-navbar {
+     width: 100%;
+     }
+     .ui-btn-inner {
+        white-space: normal !important;
+     }
+     .ui-li-heading {
+        white-space: normal !important;
+     }
+    .ui-listview-filter {
+        margin: 0 !important;
+     }
+    .ui-icon-navigation {
+        background-image: url(images/113-navigation.png);
+        background-position: 1px 0;
+     }
+    .ui-icon-beaker {
+        background-image: url(images/91-beaker-2.png);
+        background-position: 1px 0;
+    }
+    #footer {
+        text-size: 0.75em;
+        text-align: center;
+    }
+    body {
+        background-color: #F0F0F0;
+    }
+    #jqm-homeheader {
+        text-align: center;
+    }        
+    .viaPoints {
+        display: none;
+        text-size: 0.2em;
+    }
+    .min-width-480px .viaPoints {
+        display: inline;
+    }
+    #extrainfo {
+    visibility: hidden;
+    display: none;
+    }
+    #servicewarning {
+    padding: 1em;
+    margin-bottom: 0.5em;
+    text-size: 0.2em;
+    background-color: #FF9;
+    -moz-border-radius: 15px;
+border-radius: 15px;
+    }
+
+
+#footer {
+clear:both;
+text-align:center;
+}
+    // source http://webaim.org/techniques/skipnav/
+    #skip a, #skip a:hover, #skip a:visited 
+{ 
+position:absolute; 
+left:0px; 
+top:-500px; 
+width:1px; 
+height:1px; 
+overflow:hidden;
+} 
+
+#skip a:active, #skip a:focus 
+{ 
+position:static; 
+width:auto; 
+height:auto; 
+}';
+
+//if (false)
+ echo '
+// adaptive layout from jQuery Mobile docs site
+.type-interior .content-secondary {
+	border-right: 0;
+	border-left: 0;
+	margin: 10px -15px 0;
+	background: #fff;
+	border-top: 1px solid #ccc;
+}
+.type-home .ui-content {
+	margin-top: 5px;
+}
+.type-interior .ui-content {
+	padding-bottom: 0;
+}
+.content-secondary .ui-collapsible-contain {
+	padding: 10px 15px;
+
+}
+.content-secondary .ui-collapsible-heading {
+	margin: 0 0 30px;
+}
+.content-secondary .ui-collapsible-heading-collapsed,
+.content-secondary .ui-collapsible-content {
+	padding:0;
+	margin: 0;
+}
+@media all and (min-width: 650px){
+.content-secondary {
+		text-align: left;
+		float: left;
+		width: 45%;
+		background: none;
+		border-top: 0;
+	}
+	.content-secondary,
+	.type-interior .content-secondary {
+		margin: 30px 0 20px 2%;
+		padding: 20px 4% 0 0;
+			background: none;
+	}
+	.type-index .content-secondary {
+		padding: 0;
+	}
+	.type-index .content-secondary .ui-listview {
+		margin: 0;
+	}
+	.content-primary {
+		width: 45%;
+		float: right;
+		margin-top: 30px;
+		margin-right: 1%;
+		padding-right: 1%;
+	}
+	.content-primary ul:first-child {
+		margin-top: 0;
+	}
+
+	.type-interior .content-primary {
+		padding: 1.5em 6% 3em 0;
+		margin: 0;
+	}
+	/* fix up the collapsibles - expanded on desktop */
+	.content-secondary .ui-collapsible-heading {
+		display: none;
+	}
+	.content-secondary .ui-collapsible-contain {
+		margin:0;
+	}
+	.content-secondary .ui-collapsible-content {
+		display: block;
+		margin: 0;
+		padding: 0;
+	}
+		.type-interior  .content-secondary .ui-li-divider {
+		padding-top: 1em;
+		padding-bottom: 1em;
+	}
+	.type-interior .content-secondary {
+		margin: 0;
+		padding: 0;
+	}
+}
+@media all and (min-width: 750px){
+	.type-home .ui-content,
+	.type-interior .ui-content {
+		background-position: 39%;
+	}
+	.content-secondary {
+		width: 34%;
+	}
+	.content-primary {
+		width: 56%;
+		padding-right: 1%;
+	}	
+	.type-interior .ui-content {
+		background-position: 34%;
+	}
+}
+
+@media all and (min-width: 1200px){
+	.type-home .ui-content{
+		background-position: 38.5%;
+	}
+	.type-interior .ui-content {
+		background-position: 30%;
+	}
+	.content-secondary {
+		width: 30%;
+		padding-right:6%;
+		margin: 30px 0 20px 5%;
+	}
+	.type-interior .content-secondary {
+		margin: 0;
+		padding: 0;
+	}
+	.content-primary {
+		width: 50%;
+		margin-right: 5%;
+		padding-right: 3%;
+	}
+	.type-interior .content-primary {
+		width: 60%;
+	}
+}';
+  ob_end_flush();
+?>
+

--- a/dotcloud/postinstall
+++ b/dotcloud/postinstall
@@ -3,8 +3,8 @@
 
 curl http://s3-ap-southeast-1.amazonaws.com/busresources/cbrfeed.zip \
 -o /home/dotcloud/current/cbrfeed.zip
-wget http://s3-ap-southeast-1.amazonaws.com/busresources/Graph.obj \
--O /tmp/Graph.obj
+curl http://s3-ap-southeast-1.amazonaws.com/busresources/Graph.obj \
+-o /tmp/Graph.obj
 
 #db setup
 #curl https://github.com/maxious/ACTBus-ui/raw/master/transitdata.cbrfeed.sql.gz -o transitdata.cbrfeed.sql.gz

--- /dev/null
+++ b/include/common-auth.inc.php
@@ -1,1 +1,91 @@
+<?php
+function getScheme()
+{
+     $scheme = 'http';
+     if (isset($_SERVER['HTTPS']) and $_SERVER['HTTPS'] == 'on') {
+        $scheme .= 's';
+         } 
+    return $scheme;
+    } 
 
+function getTrustRoot()
+{
+     return sprintf("%s://%s:%s%s/",
+         getScheme(), $_SERVER['SERVER_NAME'],
+         $_SERVER['SERVER_PORT'],
+         dirname($_SERVER['PHP_SELF']));
+    } 
+
+
+// Includes required files
+set_include_path(get_include_path() . PATH_SEPARATOR . $labsPath."lib/openid-php/");
+require_once "Auth/OpenID/Consumer.php";
+require_once "Auth/OpenID/FileStore.php";
+require_once "Auth/OpenID/AX.php";
+
+
+
+function login()
+{
+  // Just tested this with/for Google, needs trying with others ...
+$oid_identifier = 'https://www.google.com/accounts/o8/id';
+    // Create file storage area for OpenID data
+    $store = new Auth_OpenID_FileStore('lib/openid-php/oid_store');
+    // Create OpenID consumer
+    $consumer = new Auth_OpenID_Consumer($store);
+    // Create an authentication request to the OpenID provider
+    $auth = $consumer -> begin($oid_identifier);
+    
+    // Create attribute request object
+    // See http://code.google.com/apis/accounts/docs/OpenID.html#Parameters for parameters
+    // Usage: make($type_uri, $count=1, $required=false, $alias=null)
+    $attribute[] = Auth_OpenID_AX_AttrInfo :: make('http://axschema.org/contact/email', 2, 1, 'email');
+    $attribute[] = Auth_OpenID_AX_AttrInfo :: make('http://axschema.org/namePerson/first', 1, 1, 'firstname');
+    $attribute[] = Auth_OpenID_AX_AttrInfo :: make('http://axschema.org/namePerson/last', 1, 1, 'lastname');
+    
+    // Create AX fetch request
+    $ax = new Auth_OpenID_AX_FetchRequest;
+    
+    // Add attributes to AX fetch request
+    foreach($attribute as $attr) {
+        $ax -> add($attr);
+        } 
+    
+    // Add AX fetch request to authentication request
+    $auth -> addExtension($ax);
+    $_SESSION['returnURL'] = curPageURL();
+    // Redirect to OpenID provider for authentication
+    $url = $auth -> redirectURL(getTrustRoot(), $_SESSION['returnURL']);
+    header('Location: ' . $url);
+    } 
+
+
+function auth()
+
+{
+  if ($_SESSION['authed'] == true) return true;
+
+     // Create file storage area for OpenID data
+    $store = new Auth_OpenID_FileStore('lib/openid-php/oid_store');
+     // Create OpenID consumer
+    $consumer = new Auth_OpenID_Consumer($store);
+     // Create an authentication request to the OpenID provider
+    $response = $consumer -> complete($_SESSION['returnURL']);
+    
+     if ($response -> status == Auth_OpenID_SUCCESS) {
+        // Get registration informations
+        $ax = new Auth_OpenID_AX_FetchResponse();
+         $obj = $ax -> fromSuccessResponse($response);
+         $email = $obj -> data['http://axschema.org/contact/email'][0];
+         var_dump($email);
+         if ($email != "maxious@gmail.com") {
+            die("Access Denied");
+             } else {
+               $_SESSION['authed'] = true;
+             }
+        } else {
+        login();
+         } 
+    } 
+    if ($_REQUEST['janrain_nonce']) auth();
+?>

--- a/include/common-template.inc.php
+++ b/include/common-template.inc.php
@@ -23,43 +23,42 @@
 	$url.= "&guid=ON";
 	return str_replace("&", "&amp;", $url);
 }
-
 function include_header($pageTitle, $pageType, $opendiv = true, $geolocate = false, $datepicker = false)
 {
-global $labsPath;
+	global $labsPath,$serviceAlertsEnabled;
 	echo '
 <!DOCTYPE html> 
 <html lang="en">
 	<head>
         <meta charset="UTF-8">
-	<title>' . $pageTitle . '</title>
-        <meta name="google-site-verification" 
-content="-53T5Qn4TB_de1NyfR_ZZkEVdUNcNFSaYKSFkWKx-sY" />
-	<link rel="stylesheet"  href="'.$labsPath.'css/jquery-ui-1.8.12.custom.css" />';
+<meta name="viewport" content="width=device-width, initial-scale=1"> 	
+<title>' . $pageTitle . '</title>
+        <meta name="google-site-verification" content="-53T5Qn4TB_de1NyfR_ZZkEVdUNcNFSaYKSFkWKx-sY" />
+<link rel="dns-prefetch" href="//code.jquery.com">
+<link rel="dns-prefetch" href="//ajax.googleapis.com">
+	<link rel="stylesheet"  href="' . $labsPath . 'css/jquery-ui-1.8.12.custom.css" />';
 	if (isDebugServer()) {
-		echo '<link rel="stylesheet"  href="'.$labsPath.'css/jquery.mobile-1.0b1.css" />
-	
-         <script type="text/javascript" src="'.$labsPath.'js/jquery-1.6.1.min.js"></script>
-	 <script>$(document).bind("mobileinit", function(){
+		$jqmcss = $labsPath . 'css/jquery.mobile-1.0b2.css';
+		$jqjs = $labsPath . 'js/jquery-1.6.2.min.js';
+		$jqmjs = $labsPath . 'js/jquery.mobile-1.0b2.js';
+	}
+	else {
+		$jqmcss = "//code.jquery.com/mobile/1.0b2/jquery.mobile-1.0b2.min.css";
+		$jqjs = "//ajax.googleapis.com/ajax/libs/jquery/1.6.2/jquery.min.js";
+		$jqmjs = "//code.jquery.com/mobile/1.0b2/jquery.mobile-1.0b2.min.js";
+	}
+	echo '<link rel="stylesheet"  href="' . $jqmcss . '" />
+	<script src="'.$jqjs.'"></script>
+		 <script>$(document).bind("mobileinit", function(){
   $.mobile.ajaxEnabled = false;
 });
-</script>
-        <script type="text/javascript" src="'.$labsPath.'js/jquery.mobile-1.0b1.js"></script>';
-	}
-	else {
-		echo '<link rel="stylesheet"  href="http://code.jquery.com/mobile/1.0b1/jquery.mobile-1.0b1.min.css" />
-        <script type="text/javascript" src="http://ajax.googleapis.com/ajax/libs/jquery/1.6.1/jquery.min.js"></script>
-	 <script>$(document).bind("mobileinit", function(){
-  $.mobile.ajaxEnabled = false;
-});
-</script>
-        <script type="text/javascript" src="http://code.jquery.com/mobile/1.0b1/jquery.mobile-1.0b1.min.js"></script>';
-	}
-	echo '
-	<script src="'.$labsPath.'js/jquery.ui.autocomplete.min.js"></script>
-<script src="'.$labsPath.'js/jquery.ui.core.min.js"></script>
-<script src="'.$labsPath.'js/jquery.ui.position.min.js"></script>
-<script src="'.$labsPath.'js/jquery.ui.widget.min.js"></script>
+</script> 
+	<script src="'.$jqmjs.'"></script>
+
+<script src="' . $labsPath . 'js/jquery.ui.core.min.js"></script>
+<script src="' . $labsPath . 'js/jquery.ui.position.min.js"></script>
+<script src="' . $labsPath . 'js/jquery.ui.widget.min.js"></script>
+  <script src="' . $labsPath . 'js/jquery.ui.autocomplete.min.js"></script>
   <script>
 	$(function() {
 		$( "#geolocate" ).autocomplete({
@@ -75,12 +74,9 @@
 			minLength: 2
 		});
 	});
-	</script>
-	';
-	echo '<style type="text/css">
-.ui-li-thumb, .ui-li-icon { position: relative; }';
-
-if (strstr($_SERVER['HTTP_USER_AGENT'], 'Android')) echo '.ui-shadow,.ui-btn-up-a,.ui-btn-hover-a,.ui-btn-down-a,.ui-body-b,.ui-btn-up-b,.ui-btn-hover-b,
+	</script>';
+	echo '<style type="text/css">';
+	if (strstr($_SERVER['HTTP_USER_AGENT'], 'Android')) echo '.ui-shadow,.ui-btn-up-a,.ui-btn-hover-a,.ui-btn-down-a,.ui-body-b,.ui-btn-up-b,.ui-btn-hover-b,
 .ui-btn-down-b,.ui-bar-c,.ui-body-c,.ui-btn-up-c,.ui-btn-hover-c,.ui-btn-down-c,.ui-bar-c,.ui-body-d,
 .ui-btn-up-d,.ui-btn-hover-d,.ui-btn-down-d,.ui-bar-d,.ui-body-e,.ui-btn-up-e,.ui-btn-hover-e,
 .ui-btn-down-e,.ui-bar-e,.ui-overlay-shadow,.ui-shadow,.ui-btn-active,.ui-body-a,.ui-bar-a {
@@ -88,208 +84,8 @@
  box-shadow: none;
  -webkit-box-shadow: none;
 }';
-echo '
-     .ui-navbar {
-     width: 100%;
-     }
-     .ui-btn-inner {
-        white-space: normal !important;
-     }
-     .ui-li-heading {
-        white-space: normal !important;
-     }
-    .ui-listview-filter {
-        margin: 0 !important;
-     }
-    .ui-icon-navigation {
-        background-image: url('.$labsPath.'css/images/113-navigation.png);
-        background-position: 1px 0;
-     }
-    .ui-icon-beaker {
-        background-image: url('.$labsPath.'css/images/91-beaker-2.png);
-        background-position: 1px 0;
-    }
-    #footer {
-        text-size: 0.75em;
-        text-align: center;
-    }
-    body {
-        background-color: #F0F0F0;
-    }
-    #jqm-homeheader {
-        text-align: center;
-    }        
-    .viaPoints {
-        display: none;
-        text-size: 0.2em;
-    }
-    .min-width-480px .viaPoints {
-        display: inline;
-    }
-    #extrainfo {
-    visibility: hidden;
-    display: none;
-    }
-    #servicewarning {
-    padding: 1em;
-    margin-bottom: 0.5em;
-    text-size: 0.2em;
-    background-color: #FF9;
-    -moz-border-radius: 15px;
-border-radius: 15px;
-    }
-
-
-#footer {
-clear:both;
-text-align:center;
-}
-    // source http://webaim.org/techniques/skipnav/
-    #skip a, #skip a:hover, #skip a:visited 
-{ 
-position:absolute; 
-left:0px; 
-top:-500px; 
-width:1px; 
-height:1px; 
-overflow:hidden;
-} 
-
-#skip a:active, #skip a:focus 
-{ 
-position:static; 
-width:auto; 
-height:auto; 
-}
-
-
-// adaptive layout from jQuery Mobile docs site
-.type-interior .content-secondary {
-	border-right: 0;
-	border-left: 0;
-	margin: 10px -15px 0;
-	background: #fff;
-	border-top: 1px solid #ccc;
-}
-.type-home .ui-content {
-	margin-top: 5px;
-}
-.type-interior .ui-content {
-	padding-bottom: 0;
-}
-.content-secondary .ui-collapsible-contain {
-	padding: 10px 15px;
-
-}
-.content-secondary .ui-collapsible-heading {
-	margin: 0 0 30px;
-}
-.content-secondary .ui-collapsible-heading-collapsed,
-.content-secondary .ui-collapsible-content {
-	padding:0;
-	margin: 0;
-}
-@media all and (min-width: 650px){
-.content-secondary {
-		text-align: left;
-		float: left;
-		width: 45%;
-		background: none;
-		border-top: 0;
-	}
-	.content-secondary,
-	.type-interior .content-secondary {
-		margin: 30px 0 20px 2%;
-		padding: 20px 4% 0 0;
-			background: none;
-	}
-	.type-index .content-secondary {
-		padding: 0;
-	}
-	.type-index .content-secondary .ui-listview {
-		margin: 0;
-	}
-	.content-primary {
-		width: 45%;
-		float: right;
-		margin-top: 30px;
-		margin-right: 1%;
-		padding-right: 1%;
-	}
-	.content-primary ul:first-child {
-		margin-top: 0;
-	}
-
-	.type-interior .content-primary {
-		padding: 1.5em 6% 3em 0;
-		margin: 0;
-	}
-	/* fix up the collapsibles - expanded on desktop */
-	.content-secondary .ui-collapsible-heading {
-		display: none;
-	}
-	.content-secondary .ui-collapsible-contain {
-		margin:0;
-	}
-	.content-secondary .ui-collapsible-content {
-		display: block;
-		margin: 0;
-		padding: 0;
-	}
-		.type-interior  .content-secondary .ui-li-divider {
-		padding-top: 1em;
-		padding-bottom: 1em;
-	}
-	.type-interior .content-secondary {
-		margin: 0;
-		padding: 0;
-	}
-	
-}
-@media all and (min-width: 750px){
-	.type-home .ui-content,
-	.type-interior .ui-content {
-		background-position: 39%;
-	}
-	.content-secondary {
-		width: 34%;
-	}
-	.content-primary {
-		width: 56%;
-		padding-right: 1%;
-	}	
-	.type-interior .ui-content {
-		background-position: 34%;
-	}
-}
-
-@media all and (min-width: 1200px){
-	.type-home .ui-content{
-		background-position: 38.5%;
-	}
-	.type-interior .ui-content {
-		background-position: 30%;
-	}
-	.content-secondary {
-		width: 30%;
-		padding-right:6%;
-		margin: 30px 0 20px 5%;
-	}
-	.type-interior .content-secondary {
-		margin: 0;
-		padding: 0;
-	}
-	.content-primary {
-		width: 50%;
-		margin-right: 5%;
-		padding-right: 3%;
-	}
-	.type-interior .content-primary {
-		width: 60%;
-	}
-}
-
-</style>';
+	echo '</style>';
+	echo '<link rel="stylesheet"  href="' . $labsPath . 'css/local.css.php" />';
 	if (strstr($_SERVER['HTTP_USER_AGENT'], 'iPhone') || strstr($_SERVER['HTTP_USER_AGENT'], 'iPod') || strstr($_SERVER['HTTP_USER_AGENT'], 'iPad')) {
 		echo '<meta name="apple-mobile-web-app-capable" content="yes" />
  <meta name="apple-mobile-web-app-status-bar-style" content="black" />
@@ -346,28 +142,33 @@
 	<div data-role="header" data-position="inline">
 	<a href="' . (isset($_SERVER["HTTP_REFERER"]) ? $_SERVER["HTTP_REFERER"] : "javascript:history.go(-1)") . '" data-icon="arrow-l" data-rel="back" class="ui-btn-left">Back</a> 
 		<h1>' . $pageTitle . '</h1>
-		<a href="'.$labsPath.'/index.php" data-icon="home" class="ui-btn-right">Home</a>
+		<a href="' . $labsPath . '/index.php" data-icon="home" class="ui-btn-right">Home</a>
 	</div><!-- /header -->
         <a name="maincontent" id="maincontent"></a>
         <div data-role="content"> ';
 		$overrides = getServiceOverride();
 		if ($overrides['service_id']) {
-				if ($overrides['service_id'] == "noservice") {
-					echo '<div id="servicewarning">Buses are <strong>not running today</strong> due to industrial action/public holiday. See <a 
+			if ($overrides['service_id'] == "noservice") {
+				echo '<div id="servicewarning">Buses are <strong>not running today</strong> due to industrial action/public holiday. See <a 
 href="http://www.action.act.gov.au">http://www.action.act.gov.au</a> for details.</div>';
-				}
-				else {
-					echo '<div id="servicewarning">Buses are running on an altered timetable today due to industrial action/public holiday. See <a href="http://www.action.act.gov.au">http://www.action.act.gov.au</a> for details.</div>';
-				}
+			}
+			else {
+				echo '<div id="servicewarning">Buses are running on an altered timetable today due to industrial action/public holiday. See <a href="http://www.action.act.gov.au">http://www.action.act.gov.au</a> for details.</div>';
 			}
 		}
-
+		if ($serviceAlertsEnabled) {
+		$serviceAlerts = getServiceAlerts("network","network");
+		foreach ($serviceAlerts['entities'] as $entity) {
+			echo "<div id='servicewarning'>".date("F j, g:i a",strtotime($entity['alert']['active_period']['start']))." to ". date("F j, g:i a", strtotime($entity['alert']['active_period']['end']))."<br>Warning: {$entity['alert']['description']['translation']} 
+			<br><a href='{$entity['alert']['url']['translation']}'>Source</a>  </div>";
+		}
+	}
+	}
 }
 function include_footer()
 {
-
-global $labsPath;
-	echo '<div id="footer"><a href="'.$labsPath.'about.php">About/Contact Us</a>&nbsp;<a href="'.$labsPath.'feedback.php">Feedback/Bug Report</a>&nbsp;<a href="'.$labsPath.'privacy.php">Privacy Policy</a>';
+	global $labsPath;
+	echo '<div id="footer"><a href="' . $labsPath . 'about.php">About/Contact Us</a>&nbsp;<a href="' . $labsPath . 'feedback.php">Feedback/Bug Report</a>&nbsp;<a href="' . $labsPath . 'privacy.php">Privacy Policy</a>';
 	echo '</div>';
 	if (isAnalyticsOn()) {
 		echo "<script>  (function() {
@@ -380,17 +181,15 @@
   })();</script>";
 		$googleAnalyticsImageUrl = googleAnalyticsGetImageUrl();
 		echo '<noscript><img src="' . $googleAnalyticsImageUrl . '" /></noscript>';
-
-	}
-			echo "\n</div></div></body></html>";
-}
-function timePlaceSettings($geolocate = false)
+	}
+	echo "\n</div></div></body></html>";
+}
+function placeSettings()
 {
 	global $service_periods;
 	$geoerror = false;
-	if ($geolocate == true) {
 		$geoerror = !isset($_SESSION['lat']) || !isset($_SESSION['lat']) || $_SESSION['lat'] == "" || $_SESSION['lon'] == "";
-	}
+
 	echo '<div id="error">';
 	if ($geoerror) {
 		echo 'Sorry, but your location could not currently be detected.
@@ -399,27 +198,13 @@
 	}
 	echo '</div>';
 	echo '<div id="settings" data-role="collapsible" data-collapsed="' . !$geoerror . '">
-        <h3>Change Time/Place (' . (isset($_SESSION['time']) ? $_SESSION['time'] : "Current Time,") . ' ' . ucwords(service_period()) . ')...</h3>
+        <h3>Change Location...</h3>
         <form action="' . basename($_SERVER['PHP_SELF']) . "?" . $_SERVER['QUERY_STRING'] . '" method="post">
         <div class="ui-body"> 
 		<div data-role="fieldcontain">
 	            <label for="geolocate"> Current Location: </label>
 			<input type="text" id="geolocate" name="geolocate" value="' . (isset($_SESSION['lat']) && isset($_SESSION['lon']) ? $_SESSION['lat'] . "," . $_SESSION['lon'] : "Enter co-ordinates or address here") . '"/> <a href="#" style="display:none" name="here" id="here">Here?</a>
 	        </div>
-    		<div data-role="fieldcontain">
-		        <label for="time"> Time: </label>
-		    	<input type="time" name="time" id="time" value="' . (isset($_SESSION['time']) ? $_SESSION['time'] : date("H:i")) . '"/>
-			<a href="#" name="currentTime" id="currentTime" onClick="var d = new Date();' . "$('#time').val(d.getHours() +':'+ (d.getMinutes().toString().length == 1 ? '0'+ d.getMinutes():  d.getMinutes()));" . '">Current Time?</a>
-	        </div>
-		<div data-role="fieldcontain">
-		    <label for="service_period"> Service Period:  </label>
-			<select name="service_period" id="service_period">';
-	foreach ($service_periods as $service_period) {
-		echo "<option value=\"$service_period\"" . (service_period() === $service_period ? " SELECTED" : "") . '>' . ucwords($service_period) . '</option>';
-	}
-	echo '</select>
-			<a href="#" style="display:none" name="currentPeriod" id="currentPeriod">Current Period?</a>
-		</div>
 		
 		<input type="submit" value="Update"/>
                 </div></form>

--- a/include/common-transit.inc.php
+++ b/include/common-transit.inc.php
@@ -45,5 +45,68 @@
 		return "";
 	}
 }
+function getServiceAlerts($filter_class, $filter_id) {
+/*
+
+  also need last modified epoch of client gtfs
+  
+         - add,remove,patch,inform (null)
+            - stop
+            - trip
+            - network
+          - classes (WHERE=)
+            - route (short_name or route_id)
+            - street
+            - stop
+            - trip 
+            Currently support:
+            network inform
+            trip patch: stop remove
+            street inform: route inform, trip inform, stop inform
+            route patch: trip remove
+            */
+$return = Array();
+$return['header']['gtrtfs_version'] = "1";
+$return['header']['timestamp'] = time();
+$return['entities'] = Array();
+foreach(getCurrentAlerts() as $alert) {
+	$informedEntities = getInformedAlerts($alert['id'],$_REQUEST['filter_class'],$_REQUEST['filter_id']);
+	if (sizeof($informedEntities) >0) {
+		$entity = Array();
+		$entity['id'] = $alert['id'];
+		$entity['alert']['active_period']['start'] = $alert['start'];
+		$entity['alert']['active_period']['end'] = $alert['end'];
+		$entity['alert']['url']['translation'] = $alert['url'];
+		$entity['alert']['description']['translation'] = $alert['description'];
+		
+		foreach ($informedEntities as $informedEntity) {
+			$informed = Array();
+			$informed[$informedEntity['informed_class']."_id"] = $informedEntity['informed_id'];
+			if ($informedEntity['informed_action'] != "") $informed["x-action"] = $informedEntity['informed_action'];
+			$informed[$informedEntity['class']."_type"] = $informedEntity['type'];
+			$entity['informed'][] = $informed; 
+		}
+		$return['entities'][] = $entity;
+	}
+}
+return $return;
+}
+function getServiceAlertsByClass() {
+	$return = Array();
+	$alerts = getServiceAlerts("","");
+	foreach ($alerts['entities'] as $entity) {
+		foreach ($entity['informed'] as $informed) {
+			foreach($informed as $key => $value){
+				if (strpos("_id",$key) > 0) {
+					$parts = explode($key);
+					$class = $parts[0];
+					$id = $value;
+				}
+			}
+		$return[$class][$id][]['entity'] = $entity;
+		$return[$class][$id][]['action'] = $informed["x-action"];
+	}
+	}
+}
 ?>
 

--- a/include/common.inc.php
+++ b/include/common.inc.php
@@ -10,6 +10,7 @@
 	"database",
 	"other"
 );
+$serviceAlertsEnabled = true;
 $cloudmadeAPIkey = "daa03470bb8740298d4b10e3f03d63e6";
 $googleMapsAPIkey = "ABQIAAAA95XYXN0cki3Yj_Sb71CFvBTPaLd08ONybQDjcH_VdYtHHLgZvRTw2INzI_m17_IoOUqH3RNNmlTk1Q";
 $otpAPIurl = 'http://localhost:8080/opentripplanner-api-webapp/';
@@ -31,7 +32,8 @@
 
 function isDebugServer()
 {
-	return !isset($_SERVER['SERVER_NAME']) || $_SERVER['SERVER_NAME'] == "10.0.1.154" || $_SERVER['SERVER_NAME'] == "10.1.0.4" || $_SERVER['SERVER_NAME'] == "localhost" || $_SERVER['SERVER_NAME'] == "127.0.0.1" ;
+	return php_sapi_name() == "cli" || isset($_SERVER['SERVER_NAME']) && ( $_SERVER['SERVER_NAME'] == "10.0.1.154" || $_SERVER['SERVER_NAME'] == "10.1.0.4" || $_SERVER['SERVER_NAME'] == 
+"localhost" || $_SERVER['SERVER_NAME'] == "127.0.0.1") ;
 }
 
 include_once ("common-geo.inc.php");
@@ -41,6 +43,7 @@
 
 include_once ("common-request.inc.php");
 include_once ("common-session.inc.php");
+include_once ("common-auth.inc.php");
 include_once ("common-template.inc.php");
 
 
@@ -53,6 +56,7 @@
 	global $debugOkay;
 	return in_array($debugReason, $debugOkay, false) && isDebugServer();
 }
+
 function debug($msg, $debugReason = "other")
 {
 	if (isDebug($debugReason)) echo "\n<!-- " . date(DATE_RFC822) . "\n $msg -->\n";
@@ -185,5 +189,6 @@
   } 
   return implode( $glue, $retVal ); 
 } 
+
 ?>
 

--- a/include/db/route-dao.inc.php
+++ b/include/db/route-dao.inc.php
@@ -1,211 +1,222 @@
 <?php
 function getRoute($routeID)
-{
-	global $conn;
-	$query = "Select * from routes where route_id = :routeID LIMIT 1";
-	debug($query, "database");
-	$query = $conn->prepare($query);
-	$query->bindParam(":routeID", $routeID);
-	$query->execute();
-	if (!$query) {
-		databaseError($conn->errorInfo());
-		return Array();
-	}
-	return $query->fetch(PDO::FETCH_ASSOC);
-}
+
+{
+     global $conn;
+     $query = "Select * from routes where route_id = :routeID LIMIT 1";
+     debug($query, "database");
+     $query = $conn -> prepare($query);
+     $query -> bindParam(":routeID", $routeID);
+     $query -> execute();
+     if (!$query) {
+        databaseError($conn -> errorInfo());
+         return Array();
+         } 
+    return $query -> fetch(PDO :: FETCH_ASSOC);
+    } 
 
 function getRouteByFullName($routeFullName)
-{
-	global $conn;
-	$query = "Select * from routes where route_short_name||route_long_name = :routeFullName LIMIT 1";
-	debug($query, "database");
-	$query = $conn->prepare($query);
-	$query->bindParam(":routeFullName", $routeFullName);
-	$query->execute();
-	if (!$query) {
-		databaseError($conn->errorInfo());
-		return Array();
-	}
-	return $query->fetch(PDO::FETCH_ASSOC);
-}
+
+{
+     global $conn;
+     $query = "Select * from routes where route_short_name||route_long_name = :routeFullName LIMIT 1";
+     debug($query, "database");
+     $query = $conn -> prepare($query);
+     $query -> bindParam(":routeFullName", $routeFullName);
+     $query -> execute();
+     if (!$query) {
+        databaseError($conn -> errorInfo());
+         return Array();
+         } 
+    return $query -> fetch(PDO :: FETCH_ASSOC);
+    } 
 
 function getRoutes()
-{
-	global $conn;
-	$query = "Select * from routes order by route_short_name;";
-	debug($query, "database");
-	$query = $conn->prepare($query);
-	$query->execute();
-	if (!$query) {
-		databaseError($conn->errorInfo());
-		return Array();
-	}
-	return $query->fetchAll();
-}
+
+{
+     global $conn;
+     $query = "Select * from routes order by route_short_name;";
+     debug($query, "database");
+     $query = $conn -> prepare($query);
+     $query -> execute();
+     if (!$query) {
+        databaseError($conn -> errorInfo());
+         return Array();
+         } 
+    return $query -> fetchAll();
+    } 
 function getRoutesByNumber($routeNumber = "")
-{
-	global $conn;
-	if ($routeNumber != "") {
-		$query = "Select distinct routes.route_id,routes.route_short_name,routes.route_long_name,service_id from routes  join trips on trips.route_id =
+
+{
+     global $conn;
+     if ($routeNumber != "") {
+        $query = "Select distinct routes.route_id,routes.route_short_name,routes.route_long_name,service_id from routes  join trips on trips.route_id =
 routes.route_id join stop_times on stop_times.trip_id = trips.trip_id
 where route_short_name = :routeNumber OR route_short_name LIKE :routeNumber2 order by route_short_name;";
-	}
-	else {
-		$query = "SELECT DISTINCT route_short_name from routes order by route_short_name";
-	}
-	debug($query, "database");
-	$query = $conn->prepare($query);
-	if ($routeNumber != "") {
-		$query->bindParam(":routeNumber", $routeNumber);
-                $routeNumber2 = "% ".$routeNumber;
-		$query->bindParam(":routeNumber2", $routeNumber2);
-	}
-	$query->execute();
-	if (!$query) {
-		databaseError($conn->errorInfo());
-		return Array();
-	}
-	return $query->fetchAll();
-}
+         } 
+    else {
+        $query = "SELECT DISTINCT route_short_name from routes order by route_short_name";
+         } 
+    debug($query, "database");
+     $query = $conn -> prepare($query);
+     if ($routeNumber != "") {
+        $query -> bindParam(":routeNumber", $routeNumber);
+         $routeNumber2 = "% " . $routeNumber;
+         $query -> bindParam(":routeNumber2", $routeNumber2);
+         } 
+    $query -> execute();
+     if (!$query) {
+        databaseError($conn -> errorInfo());
+         return Array();
+         } 
+    return $query -> fetchAll();
+    } 
 function getRoutesByNumberSeries($routeNumberSeries = "")
-{
-	global $conn;
-	if (strlen($routeNumberSeries) == 1) {
-		return getRoutesByNumber($routeNumberSeries);
-	}
-	$seriesMin = substr($routeNumberSeries, 0, -1) . "0";
-	$seriesMax = substr($routeNumberSeries, 0, -1) . "9";
-	$query = "Select distinct routes.route_id,routes.route_short_name,routes.route_long_name,service_id from routes  join trips on trips.route_id =
+
+{
+     global $conn;
+     if (strlen($routeNumberSeries) == 1) {
+        return getRoutesByNumber($routeNumberSeries);
+         } 
+    $seriesMin = substr($routeNumberSeries, 0, -1) . "0";
+     $seriesMax = substr($routeNumberSeries, 0, -1) . "9";
+     $query = "Select distinct routes.route_id,routes.route_short_name,routes.route_long_name,service_id from routes  join trips on trips.route_id =
 routes.route_id join stop_times on stop_times.trip_id = trips.trip_id where to_number(route_short_name, 'FM999') between :seriesMin and :seriesMax OR route_short_name LIKE :routeNumberSeries order by route_short_name;";
-	debug($query, "database");
-	$query = $conn->prepare($query);
-	$query->bindParam(":seriesMin", $seriesMin);
-	$query->bindParam(":seriesMax", $seriesMax);
-        $routeNumberSeries = "% ".substr($routeNumberSeries, 0, -1)."%";
-        $query->bindParam(":routeNumberSeries", $routeNumberSeries);
-	$query->execute();
-	if (!$query) {
-		databaseError($conn->errorInfo());
-		return Array();
-	}
-	return $query->fetchAll();
-}
+     debug($query, "database");
+     $query = $conn -> prepare($query);
+     $query -> bindParam(":seriesMin", $seriesMin);
+     $query -> bindParam(":seriesMax", $seriesMax);
+     $routeNumberSeries = "% " . substr($routeNumberSeries, 0, -1) . "%";
+     $query -> bindParam(":routeNumberSeries", $routeNumberSeries);
+     $query -> execute();
+     if (!$query) {
+        databaseError($conn -> errorInfo());
+         return Array();
+         } 
+    return $query -> fetchAll();
+    } 
 function getRouteNextTrip($routeID)
-{
-	global $conn;
-	$query = "select * from routes join trips on trips.route_id = routes.route_id
+
+{
+     global $conn;
+     $query = "select * from routes join trips on trips.route_id = routes.route_id
 join stop_times on stop_times.trip_id = trips.trip_id where
 arrival_time > :currentTime and routes.route_id = :routeID order by
 arrival_time limit 1";
-	debug($query, "database");
-	$query = $conn->prepare($query);
-	$query->bindParam(":currentTime", current_time());
-	$query->bindParam(":routeID", $routeID);
-	$query->execute();
-	if (!$query) {
-		databaseError($conn->errorInfo());
-		return Array();
-	}
-	$r = $query->fetch(PDO::FETCH_ASSOC);
-
-	// past last trip of the day special case
-	if (sizeof($r) < 16) {
-		$query = "select * from routes join trips on trips.route_id = routes.route_id
+     debug($query, "database");
+     $query = $conn -> prepare($query);
+     $query -> bindParam(":currentTime", current_time());
+     $query -> bindParam(":routeID", $routeID);
+     $query -> execute();
+     if (!$query) {
+        databaseError($conn -> errorInfo());
+         return Array();
+         } 
+    $r = $query -> fetch(PDO :: FETCH_ASSOC);
+    
+     // past last trip of the day special case
+    if (sizeof($r) < 16) {
+        $query = "select * from routes join trips on trips.route_id = routes.route_id
 join stop_times on stop_times.trip_id = trips.trip_id where routes.route_id = :routeID order by
 arrival_time DESC limit 1";
-		debug($query, "database");
-		$query = $conn->prepare($query);
-		$query->bindParam(":routeID", $routeID);
-		$query->execute();
-		if (!$query) {
-			databaseError($conn->errorInfo());
-			return Array();
-		}
-            
-		$r = $query->fetch(PDO::FETCH_ASSOC);
-	}
-	return $r;
-}
+         debug($query, "database");
+         $query = $conn -> prepare($query);
+         $query -> bindParam(":routeID", $routeID);
+         $query -> execute();
+         if (!$query) {
+            databaseError($conn -> errorInfo());
+             return Array();
+             } 
+        
+        $r = $query -> fetch(PDO :: FETCH_ASSOC);
+         } 
+    return $r;
+    } 
 function getTimeInterpolatedRouteAtStop($routeID, $stop_id)
-{
-	$nextTrip = getRouteNextTrip($routeID);
-	if ($nextTrip['trip_id']) {
-		foreach (getTimeInterpolatedTrip($nextTrip['trip_id']) as $tripStop) {
-			if ($tripStop['stop_id'] == $stop_id) return $tripStop;
-		}
-	}
-	return Array();
-}
+
+{
+     $nextTrip = getRouteNextTrip($routeID);
+     if ($nextTrip['trip_id']) {
+        foreach (getTimeInterpolatedTrip($nextTrip['trip_id']) as $tripStop) {
+            if ($tripStop['stop_id'] == $stop_id) return $tripStop;
+             } 
+        } 
+    return Array();
+    } 
 function getRouteTrips($routeID)
-{
-	global $conn;
-	$query = "select routes.route_id,trips.trip_id,service_id,arrival_time, stop_id, stop_sequence from routes join trips on trips.route_id = routes.route_id
+
+{
+     global $conn;
+     $query = "select routes.route_id,trips.trip_id,service_id,arrival_time, stop_id, stop_sequence from routes join trips on trips.route_id = routes.route_id
 join stop_times on stop_times.trip_id = trips.trip_id where routes.route_id = :routeID and stop_sequence = '1' order by
 arrival_time ";
-	debug($query, "database");
-	$query = $conn->prepare($query);
-	$query->bindParam(":routeID", $routeID);
-	$query->execute();
-	if (!$query) {
-		databaseError($conn->errorInfo());
-		return Array();
-	}
-	return $query->fetchAll();
-}
+     debug($query, "database");
+     $query = $conn -> prepare($query);
+     $query -> bindParam(":routeID", $routeID);
+     $query -> execute();
+     if (!$query) {
+        databaseError($conn -> errorInfo());
+         return Array();
+         } 
+    return $query -> fetchAll();
+    } 
 function getRoutesByDestination($destination = "", $service_period = "")
-{
-	global $conn;
-	if ($service_period == "") $service_period = service_period();
-	if ($destination != "") {
-		$query = "SELECT DISTINCT trips.route_id,route_short_name,route_long_name, service_id
+
+{
+     global $conn;
+     if ($service_period == "") $service_period = service_period();
+     if ($destination != "") {
+        $query = "SELECT DISTINCT trips.route_id,route_short_name,route_long_name, service_id
 FROM stop_times join trips on trips.trip_id =
 stop_times.trip_id join routes on trips.route_id = routes.route_id
 WHERE route_long_name = :destination AND  service_id=:service_period order by route_short_name";
-	}
-	else {
-		$query = "SELECT DISTINCT route_long_name
+         } 
+    else {
+        $query = "SELECT DISTINCT route_long_name
 FROM stop_times join trips on trips.trip_id =
 stop_times.trip_id join routes on trips.route_id = routes.route_id
 WHERE service_id= :service_period order by route_long_name";
-	}
-	debug($query, "database");
-	$query = $conn->prepare($query);
-	$query->bindParam(":service_period", $service_period);
-	if ($destination != "") $query->bindParam(":destination", $destination);
-	$query->execute();
-	if (!$query) {
-		databaseError($conn->errorInfo());
-		return Array();
-	}
-	return $query->fetchAll();
-}
+         } 
+    debug($query, "database");
+     $query = $conn -> prepare($query);
+     $query -> bindParam(":service_period", $service_period);
+     if ($destination != "") $query -> bindParam(":destination", $destination);
+     $query -> execute();
+     if (!$query) {
+        databaseError($conn -> errorInfo());
+         return Array();
+         } 
+    return $query -> fetchAll();
+    } 
 function getRoutesBySuburb($suburb, $service_period = "")
-{
-	if ($service_period == "") $service_period = service_period();
-	global $conn;
-	$query = "SELECT DISTINCT service_id,trips.route_id,route_short_name,route_long_name
+
+{
+     if ($service_period == "") $service_period = service_period();
+     global $conn;
+     $query = "SELECT DISTINCT service_id,trips.route_id,route_short_name,route_long_name
 FROM stop_times join trips on trips.trip_id = stop_times.trip_id
 join routes on trips.route_id = routes.route_id
 join stops on stops.stop_id = stop_times.stop_id
 WHERE zone_id LIKE ':suburb AND service_id=:service_period ORDER BY route_short_name";
-	debug($query, "database");
-	$query = $conn->prepare($query);
-	$query->bindParam(":service_period", $service_period);
-        $suburb = "%" . $suburb . ";%";
-	$query->bindParam(":suburb", $suburb);
-	$query->execute();
-	if (!$query) {
-		databaseError($conn->errorInfo());
-		return Array();
-	}
-	return $query->fetchAll();
-}
+     debug($query, "database");
+     $query = $conn -> prepare($query);
+     $query -> bindParam(":service_period", $service_period);
+     $suburb = "%" . $suburb . ";%";
+     $query -> bindParam(":suburb", $suburb);
+     $query -> execute();
+     if (!$query) {
+        databaseError($conn -> errorInfo());
+         return Array();
+         } 
+    return $query -> fetchAll();
+    } 
 function getRoutesNearby($lat, $lng, $limit = "", $distance = 500)
-{
-	if ($service_period == "") $service_period = service_period();
-	if ($limit != "") $limitSQL = " LIMIT :limit ";
-	global $conn;
-	$query = "SELECT service_id,trips.route_id,route_short_name,route_long_name,min(stops.stop_id) as stop_id,
+
+{
+     if ($service_period == "") $service_period = service_period();
+     if ($limit != "") $limitSQL = " LIMIT :limit ";
+     global $conn;
+     $query = "SELECT service_id,trips.route_id,route_short_name,route_long_name,min(stops.stop_id) as stop_id,
         min(ST_Distance(position, ST_GeographyFromText('SRID=4326;POINT($lng $lat)'), FALSE)) as distance
 FROM stop_times
 join trips on trips.trip_id = stop_times.trip_id
@@ -215,16 +226,16 @@
 AND ST_DWithin(position, ST_GeographyFromText('SRID=4326;POINT($lng $lat)'), :distance, FALSE)
         group by service_id,trips.route_id,route_short_name,route_long_name
         order by distance $limitSQL";
-	debug($query, "database");
-	$query = $conn->prepare($query);
-	$query->bindParam(":service_period", $service_period);
-	$query->bindParam(":distance", $distance);
-	if ($limit != "") $query->bindParam(":limit", $limit);
-	$query->execute();
-	if (!$query) {
-		databaseError($conn->errorInfo());
-		return Array();
-	}
-	return $query->fetchAll();
-}
+     debug($query, "database");
+     $query = $conn -> prepare($query);
+     $query -> bindParam(":service_period", $service_period);
+     $query -> bindParam(":distance", $distance);
+     if ($limit != "") $query -> bindParam(":limit", $limit);
+     $query -> execute();
+     if (!$query) {
+        databaseError($conn -> errorInfo());
+         return Array();
+         } 
+    return $query -> fetchAll();
+    } 
 ?>

--- a/include/db/servicealert-dao.inc.php
+++ b/include/db/servicealert-dao.inc.php
@@ -1,44 +1,167 @@
 <?php
-function getServiceOverride($date="") {
-	global $conn;
-	$query = "Select * from calendar_dates where date = :date and exception_type = '1' LIMIT 1";
-	 debug($query,"database");
-	$query = $conn->prepare($query); // Create a prepared statement
-	$query->bindParam(":date", date("Ymd",($date != "" ? $date : time())));
-	$query->execute();
-	if (!$query) {
-		databaseError($conn->errorInfo());
-		return Array();
-	}
-	return $query->fetch(PDO::FETCH_ASSOC);
-}
+function getServiceOverride($date = "")
+{
+     global $conn;
+     $query = "Select * from calendar_dates where date = :date and exception_type = '1' LIMIT 1";
+     // debug($query,"database");
+    $query = $conn -> prepare($query); // Create a prepared statement
+     $query -> bindParam(":date", date("Ymd", ($date != "" ? $date : time())));
+     $query -> execute();
+     if (!$query) {
+        databaseError($conn -> errorInfo());
+         return Array();
+         } 
+    return $query -> fetch(PDO :: FETCH_ASSOC);
+    } 
 
-function getCurrentAlerts() {
-		global $conn;
-	$query = "SELECT * from servicealerts_alerts";
-	debug($query, "database");
-	$query = $conn->prepare($query);
-	//if ($stop_sequence != "") $query->bindParam(":stop_sequence", $stop_sequence);
-	$query->execute();
-	if (!$query) {
-		databaseError($conn->errorInfo());
-		return Array();
-	}
-	return $query->fetchAll();
-}
-function getInformedAlerts($id,$filter_class,$filter_id) {
-	
-		global $conn;
-	$query = "SELECT * from servicealerts_informed where servicealert_id = :id";
-	debug($query, "database");
-	$query = $conn->prepare($query);
-	$query->bindParam(":id", $id);
-	$query->execute();
-	if (!$query) {
-		databaseError($conn->errorInfo());
-		return Array();
-	}
-	return $query->fetchAll();
-}
+function getServiceAlert($alertID)
+{
+     global $conn;
+     $query = 'SELECT * from servicealerts_alerts where id = :servicealert_id';
+     debug($query, "database");
+     $query = $conn -> prepare($query);
+     $query -> bindParam(":servicealert_id", $alertID);
+     $query -> execute();
+     if (!$query) {
+        databaseError($conn -> errorInfo());
+         return Array();
+         } 
+    return $query -> fetch(PDO :: FETCH_ASSOC);
+    } 
 
+
+function updateServiceAlert($alertID, $start, $end, $description, $url)
+{
+     global $conn;
+     $query = 'update servicealerts_alerts set start=:start, "end"=:end, description=:description, url=:url where id = :servicealert_id';
+     debug($query, "database");
+     $query = $conn -> prepare($query);
+     $query -> bindParam(":servicealert_id", $alertID);
+     $query -> bindParam(":start", $start);
+     $query -> bindParam(":end", $end);
+     $query -> bindParam(":description", $description);
+     $query -> bindParam(":url", $url);
+     $query -> execute();
+
+     print_r($conn -> errorInfo());
+     if (!$query) {
+        databaseError($conn -> errorInfo());
+         return Array();
+         } 
+    return $query -> fetch(PDO :: FETCH_ASSOC);
+    } 
+
+    function addServiceAlert($start, $end, $description, $url)
+{
+     global $conn;
+     $query = 'INSERT INTO servicealerts_alerts (start, "end", description, url) VALUES (:start, :end, :description, :url) ';
+     debug($query, "database");
+     $query = $conn -> prepare($query);
+     $query -> bindParam(":start", $start);
+     $query -> bindParam(":end", $end);
+     $query -> bindParam(":description", $description);
+     $query -> bindParam(":url", $url);
+     $query -> execute();
+
+     print_r($conn -> errorInfo());
+     if (!$query) {
+        databaseError($conn -> errorInfo());
+         return Array();
+         } 
+    return $query -> fetch(PDO :: FETCH_ASSOC);
+    } 
+
+function getCurrentAlerts()
+{
+     global $conn;
+     $query = 'SELECT * from servicealerts_alerts where NOW() > start and NOW() < "end"';
+     // debug($query, "database");
+    $query = $conn -> prepare($query);
+     $query -> execute();
+     if (!$query) {
+        databaseError($conn -> errorInfo());
+         return Array();
+         } 
+    return $query -> fetchAll();
+    } 
+
+function getFutureAlerts()
+{
+     global $conn;
+     $query = 'SELECT * from servicealerts_alerts where NOW() > start or NOW() < "end"';
+     // debug($query, "database");
+    $query = $conn -> prepare($query);
+     $query -> execute();
+     if (!$query) {
+        databaseError($conn -> errorInfo());
+         return Array();
+         } 
+    return $query -> fetchAll();
+    } 
+function getInformedAlerts($id, $filter_class, $filter_id)
+{
+    
+     global $conn;
+     $query = "SELECT * from servicealerts_informed where servicealert_id = :servicealert_id";
+    
+     if ($filter_class != "") {
+        $query .= " AND informed_class = :informed_class  ";
+        
+         } 
+    if ($filter_id != "") {
+        $query .= " AND informed_id = :informed_id ";
+        
+         } 
+    // debug($query, "database");
+    $query = $conn -> prepare($query);
+     if ($filter_class != "") {
+        $query -> bindParam(":informed_class", $filter_class);
+         } 
+    if ($filter_id != "") {
+        $query -> bindParam(":informed_id", $filter_id);
+         } 
+    $query -> bindParam(":servicealert_id", $id);
+     $query -> execute();
+     if (!$query) {
+        databaseError($conn -> errorInfo());
+         return Array();
+         } 
+    return $query -> fetchAll();
+    } 
+function deleteInformedAlert($serviceAlertID, $class, $id)
+{
+     global $conn;
+     $query = 'DELETE from servicealerts_informed where servicealert_id = :servicealert_id and informed_class = :informed_class  AND informed_id = :informed_id';
+     debug($query, "database");
+     $query = $conn -> prepare($query);
+     $query -> bindParam(":servicealert_id", $serviceAlertID);
+     $query -> bindParam(":informed_class", $class);
+     $query -> bindParam(":informed_id", $id);
+     $query -> execute();
+     print_r($conn -> errorInfo());
+     if (!$query) {
+        databaseError($conn -> errorInfo());
+         return Array();
+         } 
+    return null;
+    } 
+function addInformedAlert($serviceAlertID, $class, $id, $action)
+{
+     global $conn;
+     $query = 'INSERT INTO servicealerts_informed (servicealert_id , informed_class , informed_id) VALUES(:servicealert_id ,:informed_class, :informed_id)';
+     debug($query, "database");
+     $query = $conn -> prepare($query);
+     $query -> bindParam(":servicealert_id", $serviceAlertID);
+     $query -> bindParam(":informed_class", $class);
+     $query -> bindParam(":informed_id", $id);
+     $query -> execute();
+
+     print_r($conn -> errorInfo());
+     if (!$query) {
+        databaseError($conn -> errorInfo());
+         return Array();
+         } 
+    return null;
+    
+    } 
 ?>

--- a/include/db/stop-dao.inc.php
+++ b/include/db/stop-dao.inc.php
@@ -1,131 +1,154 @@
 <?php
 function getStop($stopID)
-{
-	global $conn;
-	$query = "Select * from stops where stop_id = :stopID LIMIT 1";
-	debug($query, "database");
-	$query = $conn->prepare($query);
-	$query->bindParam(":stopID", $stopID);
-	$query->execute();
-	if (!$query) {
-		databaseError($conn->errorInfo());
-		return Array();
-	}
-	return $query->fetch(PDO::FETCH_ASSOC);
-}
+
+{
+     global $conn;
+     $query = "Select * from stops where stop_id = :stopID LIMIT 1";
+     debug($query, "database");
+     $query = $conn -> prepare($query);
+     $query -> bindParam(":stopID", $stopID);
+     $query -> execute();
+     if (!$query) {
+        databaseError($conn -> errorInfo());
+         return Array();
+         } 
+    return $query -> fetch(PDO :: FETCH_ASSOC);
+    } 
 function getStops($timingPointsOnly = false, $firstLetter = "", $startsWith = "")
-{
-	global $conn;
-	$conditions = Array();
-	if ($timingPointsOnly) $conditions[] = "substr(stop_code,1,2) != 'Wj'";
-	if ($firstLetter != "") $conditions[] = "substr(stop_name,1,1) = :firstLetter";
-	if ($startsWith != "") $conditions[] = "stop_name like :startsWith";
-	$query = "Select * from stops";
-	if (sizeof($conditions) > 0) {
-		if (sizeof($conditions) > 1) {
-			$query.= " Where " . implode(" AND ", $conditions) . " ";
-		}
-		else {
-			$query.= " Where " . $conditions[0] . " ";
-		}
-	}
-	$query.= " order by stop_name;";
-	$query = $conn->prepare($query);
-        if ($firstLetter != "") $query->bindParam(":firstLetter", $firstLetter);
-        
-        if ($startsWith != "") {
-            $startsWith = $startsWith."%";
-            $query->bindParam(":startsWith", $startsWith);
-        }
-	$query->execute();
-	if (!$query) {
-		databaseError($conn->errorInfo());
-		return Array();
-	}
-	return $query->fetchAll();
-}
+
+{
+     global $conn;
+     $conditions = Array();
+     if ($timingPointsOnly) $conditions[] = "substr(stop_code,1,2) != 'Wj'";
+     if ($firstLetter != "") $conditions[] = "substr(stop_name,1,1) = :firstLetter";
+     if ($startsWith != "") $conditions[] = "stop_name like :startsWith";
+     $query = "Select * from stops";
+     if (sizeof($conditions) > 0) {
+        if (sizeof($conditions) > 1) {
+            $query .= " Where " . implode(" AND ", $conditions) . " ";
+             } 
+        else {
+            $query .= " Where " . $conditions[0] . " ";
+             } 
+        } 
+    $query .= " order by stop_name;";
+     $query = $conn -> prepare($query);
+     if ($firstLetter != "") $query -> bindParam(":firstLetter", $firstLetter);
+    
+     if ($startsWith != "") {
+        $startsWith = $startsWith . "%";
+         $query -> bindParam(":startsWith", $startsWith);
+         } 
+    $query -> execute();
+     if (!$query) {
+        databaseError($conn -> errorInfo());
+         return Array();
+         } 
+    return $query -> fetchAll();
+    } 
 function getNearbyStops($lat, $lng, $limit = "", $distance = 1000)
-{
-	if ($lat == null || $lng == null) return Array();
-	if ($limit != "") $limitSQL = " LIMIT :limit ";
-	global $conn;
-	$query = "Select *, ST_Distance(position, ST_GeographyFromText('SRID=4326;POINT($lng $lat)'), FALSE) as distance
+
+{
+     if ($lat == null || $lng == null) return Array();
+     if ($limit != "") $limitSQL = " LIMIT :limit ";
+     global $conn;
+     $query = "Select *, ST_Distance(position, ST_GeographyFromText('SRID=4326;POINT($lng $lat)'), FALSE) as distance
         from stops WHERE ST_DWithin(position, ST_GeographyFromText('SRID=4326;POINT($lng $lat)'), :distance, FALSE)
         order by distance $limitSQL;";
-	debug($query, "database");
-        $query = $conn->prepare($query);
-	$query->bindParam(":distance", $distance);
-	$query->bindParam(":limit", $limit);
-	$query->execute();
-	if (!$query) {
-		databaseError($conn->errorInfo());
-		return Array();
-	}
-	return $query->fetchAll();
-}
+     debug($query, "database");
+     $query = $conn -> prepare($query);
+     $query -> bindParam(":distance", $distance);
+     $query -> bindParam(":limit", $limit);
+     $query -> execute();
+     if (!$query) {
+        databaseError($conn -> errorInfo());
+         return Array();
+         } 
+    return $query -> fetchAll();
+    } 
+function getStopsByName($name)
+
+{
+     global $conn;
+     $query = "Select * from stops where stop_name LIKE :name;";
+     debug($query, "database");
+     $query = $conn -> prepare($query);
+     $name = "%" . $name . ";%";
+     $query -> bindParam(":name", $name);
+     $query -> execute();
+     if (!$query) {
+        databaseError($conn -> errorInfo());
+         return Array();
+         } 
+    return $query -> fetchAll();
+    } 
 function getStopsBySuburb($suburb)
-{
-	global $conn;
-	$query = "Select * from stops where zone_id LIKE :suburb order by stop_name;";
-	debug($query, "database");
-	$query = $conn->prepare($query);
-        $suburb = "%" . $suburb . ";%";
-	$query->bindParam(":suburb", $suburb);
-	$query->execute();
-	if (!$query) {
-		databaseError($conn->errorInfo());
-		return Array();
-	}
-	return $query->fetchAll();
-}
-function getStopsByStopCode($stop_code,$startsWith = "")
-{
-	global $conn;
-	$query = "Select * from stops where (stop_code = :stop_code OR stop_code LIKE :stop_code2)";
-                if ($startsWith != "") $query .= " AND stop_name like :startsWith";
-
-	debug($query, "database");
-	$query = $conn->prepare($query);
-        
-	$query->bindParam(":stop_code", $stop_code);
-        $stop_code2 = $stop_code . "%";
-	$query->bindParam(":stop_code2", $stop_code2);
- if ($startsWith != "") {
-            $startsWith = $startsWith."%";
-            $query->bindParam(":startsWith", $startsWith);
-        }
-	$query->execute();
-	if (!$query) {
-		databaseError($conn->errorInfo());
-		return Array();
-	}
-	return $query->fetchAll();
-}
+
+{
+     global $conn;
+     $query = "Select * from stops where zone_id LIKE :suburb order by stop_name;";
+     debug($query, "database");
+     $query = $conn -> prepare($query);
+     $suburb = "%" . $suburb . ";%";
+     $query -> bindParam(":suburb", $suburb);
+     $query -> execute();
+     if (!$query) {
+        databaseError($conn -> errorInfo());
+         return Array();
+         } 
+    return $query -> fetchAll();
+    } 
+function getStopsByStopCode($stop_code, $startsWith = "")
+
+{
+     global $conn;
+     $query = "Select * from stops where (stop_code = :stop_code OR stop_code LIKE :stop_code2)";
+     if ($startsWith != "") $query .= " AND stop_name like :startsWith";
+    
+     debug($query, "database");
+     $query = $conn -> prepare($query);
+    
+     $query -> bindParam(":stop_code", $stop_code);
+     $stop_code2 = $stop_code . "%";
+     $query -> bindParam(":stop_code2", $stop_code2);
+     if ($startsWith != "") {
+        $startsWith = $startsWith . "%";
+         $query -> bindParam(":startsWith", $startsWith);
+         } 
+    $query -> execute();
+     if (!$query) {
+        databaseError($conn -> errorInfo());
+         return Array();
+         } 
+    return $query -> fetchAll();
+    } 
 function getStopRoutes($stopID, $service_period)
-{
-	if ($service_period == "") $service_period = service_period();
-	global $conn;
-	$query = "SELECT distinct service_id,trips.route_id,route_short_name,route_long_name
+
+{
+     if ($service_period == "") $service_period = service_period();
+     global $conn;
+     $query = "SELECT distinct service_id,trips.route_id,route_short_name,route_long_name
 FROM stop_times join trips on trips.trip_id =
 stop_times.trip_id join routes on trips.route_id = routes.route_id WHERE stop_id = :stopID AND service_id=:service_period";
-	debug($query, "database");
-	$query = $conn->prepare($query);
-	$query->bindParam(":service_period", $service_period);
-	$query->bindParam(":stopID", $stopID);
-	$query->execute();
-	if (!$query) {
-		databaseError($conn->errorInfo());
-		return Array();
-	}
-	return $query->fetchAll();
-}
+     debug($query, "database");
+     $query = $conn -> prepare($query);
+     $query -> bindParam(":service_period", $service_period);
+     $query -> bindParam(":stopID", $stopID);
+     $query -> execute();
+     if (!$query) {
+        databaseError($conn -> errorInfo());
+         return Array();
+         } 
+    return $query -> fetchAll();
+    } 
 function getStopTrips($stopID, $service_period = "", $afterTime = "", $limit = "")
-{
-	if ($service_period == "") $service_period = service_period();
-        	if ($limit != "") $limitSQL = " LIMIT :limit ";
-	global $conn;
-	if ($afterTime != "") {
-		$query = " SELECT stop_times.trip_id,stop_times.arrival_time,stop_times.stop_id,stop_sequence,service_id,trips.route_id,route_short_name,route_long_name, end_times.arrival_time as end_time
+
+{
+     if ($service_period == "") $service_period = service_period();
+     if ($limit != "") $limitSQL = " LIMIT :limit ";
+     global $conn;
+     if ($afterTime != "") {
+        $query = " SELECT stop_times.trip_id,stop_times.arrival_time,stop_times.stop_id,stop_sequence,service_id,trips.route_id,route_short_name,route_long_name, end_times.arrival_time as end_time
 FROM stop_times
 join trips on trips.trip_id =
 stop_times.trip_id
@@ -136,9 +159,9 @@
 AND service_id=:service_period
 AND end_times.arrival_time > :afterTime
 ORDER BY end_time $limitSQL";
-	}
-	else {
-		$query = "SELECT stop_times.trip_id,arrival_time,stop_times.stop_id,stop_sequence,service_id,trips.route_id,route_short_name,route_long_name
+         } 
+    else {
+        $query = "SELECT stop_times.trip_id,arrival_time,stop_times.stop_id,stop_sequence,service_id,trips.route_id,route_short_name,route_long_name
 FROM stop_times
 join trips on trips.trip_id =
 stop_times.trip_id
@@ -146,45 +169,46 @@
 WHERE stop_times.stop_id = :stopID
 AND service_id=:service_period
 ORDER BY arrival_time $limitSQL";
-	}
-	debug($query, "database");
-	$query = $conn->prepare($query);
-	$query->bindParam(":service_period", $service_period);
-	$query->bindParam(":stopID", $stopID);
-        if ($limit != "") $query->bindParam(":limit", $limit);
-        if ($afterTime != "") $query->bindParam(":afterTime", $afterTime);
-	$query->execute();
-	if (!$query) {
-		databaseError($conn->errorInfo());
-		return Array();
-	}
-	return $query->fetchAll();
-}
+         } 
+    debug($query, "database");
+     $query = $conn -> prepare($query);
+     $query -> bindParam(":service_period", $service_period);
+     $query -> bindParam(":stopID", $stopID);
+     if ($limit != "") $query -> bindParam(":limit", $limit);
+     if ($afterTime != "") $query -> bindParam(":afterTime", $afterTime);
+     $query -> execute();
+     if (!$query) {
+        databaseError($conn -> errorInfo());
+         return Array();
+         } 
+    return $query -> fetchAll();
+    } 
 function getStopTripsWithTimes($stopID, $time = "", $service_period = "", $time_range = "", $limit = "")
-{
-	if ($service_period == "") $service_period = service_period();
-	if ($time_range == "") $time_range = (24 * 60 * 60);
-	if ($time == "") $time = current_time();
-	if ($limit == "") $limit = 10;
-	$trips = getStopTrips($stopID, $service_period, $time);
-	$timedTrips = Array();
-	if ($trips && sizeof($trips) > 0) {
-            foreach ($trips as $trip) {
-		if ($trip['arrival_time'] != "") {
-			if (strtotime($trip['arrival_time']) > strtotime($time) and strtotime($trip['arrival_time']) < (strtotime($time) + $time_range)) {
-				$timedTrips[] = $trip;
-			}
-		}
-		else {
-			$timedTrip = getTimeInterpolatedTripAtStop($trip['trip_id'], $trip['stop_sequence']);
-			if ($timedTrip['arrival_time'] > $time and strtotime($timedTrip['arrival_time']) < (strtotime($time) + $time_range)) {
-				$timedTrips[] = $timedTrip;
-			}
-		}
-		if (sizeof($timedTrips) > $limit) break;
-	}
-	sktimesort($timedTrips, "arrival_time", true);
-        }
-	return $timedTrips;
-}
+
+{
+     if ($service_period == "") $service_period = service_period();
+     if ($time_range == "") $time_range = (24 * 60 * 60);
+     if ($time == "") $time = current_time();
+     if ($limit == "") $limit = 10;
+     $trips = getStopTrips($stopID, $service_period, $time);
+     $timedTrips = Array();
+     if ($trips && sizeof($trips) > 0) {
+        foreach ($trips as $trip) {
+            if ($trip['arrival_time'] != "") {
+                if (strtotime($trip['arrival_time']) > strtotime($time) and strtotime($trip['arrival_time']) < (strtotime($time) + $time_range)) {
+                    $timedTrips[] = $trip;
+                     } 
+                } 
+            else {
+                $timedTrip = getTimeInterpolatedTripAtStop($trip['trip_id'], $trip['stop_sequence']);
+                 if ($timedTrip['arrival_time'] > $time and strtotime($timedTrip['arrival_time']) < (strtotime($time) + $time_range)) {
+                    $timedTrips[] = $timedTrip;
+                     } 
+                } 
+            if (sizeof($timedTrips) > $limit) break;
+             } 
+        sktimesort($timedTrips, "arrival_time", true);
+         } 
+    return $timedTrips;
+    } 
 ?>

--- a/include/db/trip-dao.inc.php
+++ b/include/db/trip-dao.inc.php
@@ -1,224 +1,251 @@
 <?php
 function getTrip($tripID)
-{
-	global $conn;
-	$query = "Select * from trips
+
+{
+     global $conn;
+     $query = "Select * from trips
 	join routes on trips.route_id = routes.route_id
 	where trip_id =	:tripID
 	LIMIT 1";
-	debug($query, "database");
-	$query = $conn->prepare($query);
-	$query->bindParam(":tripID", $tripID);
-	$query->execute();
-	if (!$query) {
-		databaseError($conn->errorInfo());
-		return Array();
-	}
-	return $query->fetch(PDO::FETCH_ASSOC);
-}
+     debug($query, "database");
+     $query = $conn -> prepare($query);
+     $query -> bindParam(":tripID", $tripID);
+     $query -> execute();
+     if (!$query) {
+        databaseError($conn -> errorInfo());
+         return Array();
+         } 
+    return $query -> fetch(PDO :: FETCH_ASSOC);
+    } 
 function getTripShape($tripID)
-{
-	global $conn;
-	$query = "SELECT ST_AsKML(ST_MakeLine(geometry(a.position))) as the_route
+
+{
+     global $conn;
+     $query = "SELECT ST_AsKML(ST_MakeLine(geometry(a.position))) as the_route
 FROM (SELECT position,
 	stop_sequence, trips.trip_id
 FROM stop_times
 join trips on trips.trip_id = stop_times.trip_id
 join stops on stops.stop_id = stop_times.stop_id
 WHERE trips.trip_id = :tripID ORDER BY stop_sequence) as a group by a.trip_id";
-	debug($query, "database");
-	$query = $conn->prepare($query);
-	$query->bindParam(":tripID", $tripID);
-	$query->execute();
-	if (!$query) {
-		databaseError($conn->errorInfo());
-		return Array();
-	}
-	return $query->fetchColumn(0);
-}
+     debug($query, "database");
+     $query = $conn -> prepare($query);
+     $query -> bindParam(":tripID", $tripID);
+     $query -> execute();
+     if (!$query) {
+        databaseError($conn -> errorInfo());
+         return Array();
+         } 
+    return $query -> fetchColumn(0);
+    } 
 function getTimeInterpolatedTrip($tripID, $range = "")
-{
-	global $conn;
-	$query = "SELECT stop_times.trip_id,arrival_time,stop_times.stop_id,stop_lat,stop_lon,stop_name,stop_code,
+
+{
+     global $conn;
+     $query = "SELECT stop_times.trip_id,arrival_time,stop_times.stop_id,stop_lat,stop_lon,stop_name,stop_code,
 	stop_sequence,service_id,trips.route_id,route_short_name,route_long_name
 FROM stop_times
 join trips on trips.trip_id = stop_times.trip_id
 join routes on trips.route_id = routes.route_id
 join stops on stops.stop_id = stop_times.stop_id
 WHERE trips.trip_id = :tripID $range ORDER BY stop_sequence";
-	debug($query, "database");
-	$query = $conn->prepare($query);
-	$query->bindParam(":tripID", $tripID);
-	$query->execute();
-	if (!$query) {
-		databaseError($conn->errorInfo());
-		return Array();
-	}
-	$stopTimes = $query->fetchAll();
-	$cur_timepoint = Array();
-	$next_timepoint = Array();
-	$distance_between_timepoints = 0.0;
-	$distance_traveled_between_timepoints = 0.0;
-	$rv = Array();
-	foreach ($stopTimes as $i => $stopTime) {
-		if ($stopTime['arrival_time'] != "") {
-			// is timepoint
-			$cur_timepoint = $stopTime;
-			$distance_between_timepoints = 0.0;
-			$distance_traveled_between_timepoints = 0.0;
-			if ($i + 1 < sizeof($stopTimes)) {
-				$k = $i + 1;
-				$distance_between_timepoints+= distance($stopTimes[$k - 1]["stop_lat"], $stopTimes[$k - 1]["stop_lon"], $stopTimes[$k]["stop_lat"], $stopTimes[$k]["stop_lon"]);
-				while ($stopTimes[$k]["arrival_time"] == "" && $k + 1 < sizeof($stopTimes)) {
-					$k+= 1;
-					//echo "k".$k;
-					$distance_between_timepoints+= distance($stopTimes[$k - 1]["stop_lat"], $stopTimes[$k - 1]["stop_lon"], $stopTimes[$k]["stop_lat"], $stopTimes[$k]["stop_lon"]);
-				}
-				$next_timepoint = $stopTimes[$k];
-				
-			}
-			$rv[] = $stopTime;
-		}
-		else {
-			// is untimed point
-			//echo "i".$i;
-			$distance_traveled_between_timepoints+= distance($stopTimes[$i - 1]["stop_lat"], $stopTimes[$i - 1]["stop_lon"], $stopTimes[$i]["stop_lat"], $stopTimes[$i]["stop_lon"]);
-			//echo "$distance_traveled_between_timepoints / $distance_between_timepoints<br>";
-			$distance_percent = $distance_traveled_between_timepoints / $distance_between_timepoints;
-			if ($next_timepoint["arrival_time"] != "") {
-				$total_time = strtotime($next_timepoint["arrival_time"]) - strtotime($cur_timepoint["arrival_time"]);
-				//echo strtotime($next_timepoint["arrival_time"])." - ".strtotime($cur_timepoint["arrival_time"])."<br>";
-				$time_estimate = ($distance_percent * $total_time) + strtotime($cur_timepoint["arrival_time"]);
-				$stopTime["arrival_time"] = date("H:i:s", $time_estimate);
-			}
-			else {
-				$stopTime["arrival_time"] = $cur_timepoint["arrival_time"];
-			}
-			$rv[] = $stopTime;
-			
-			
-		}
-	}
-	//var_dump($rv);
-	return $rv;
-}
+     debug($query, "database");
+     $query = $conn -> prepare($query);
+     $query -> bindParam(":tripID", $tripID);
+     $query -> execute();
+     if (!$query) {
+        databaseError($conn -> errorInfo());
+         return Array();
+         } 
+    $stopTimes = $query -> fetchAll();
+     $cur_timepoint = Array();
+     $next_timepoint = Array();
+     $distance_between_timepoints = 0.0;
+     $distance_traveled_between_timepoints = 0.0;
+     $rv = Array();
+     foreach ($stopTimes as $i => $stopTime) {
+        if ($stopTime['arrival_time'] != "") {
+            // is timepoint
+            $cur_timepoint = $stopTime;
+             $distance_between_timepoints = 0.0;
+             $distance_traveled_between_timepoints = 0.0;
+             if ($i + 1 < sizeof($stopTimes)) {
+                $k = $i + 1;
+                 $distance_between_timepoints += distance($stopTimes[$k - 1]["stop_lat"], $stopTimes[$k - 1]["stop_lon"], $stopTimes[$k]["stop_lat"], $stopTimes[$k]["stop_lon"]);
+                 while ($stopTimes[$k]["arrival_time"] == "" && $k + 1 < sizeof($stopTimes)) {
+                    $k += 1;
+                     // echo "k".$k;
+                    $distance_between_timepoints += distance($stopTimes[$k - 1]["stop_lat"], $stopTimes[$k - 1]["stop_lon"], $stopTimes[$k]["stop_lat"], $stopTimes[$k]["stop_lon"]);
+                     } 
+                $next_timepoint = $stopTimes[$k];
+                
+                 } 
+            $rv[] = $stopTime;
+             } 
+        else {
+            // is untimed point
+            // echo "i".$i;
+            $distance_traveled_between_timepoints += distance($stopTimes[$i - 1]["stop_lat"], $stopTimes[$i - 1]["stop_lon"], $stopTimes[$i]["stop_lat"], $stopTimes[$i]["stop_lon"]);
+             // echo "$distance_traveled_between_timepoints / $distance_between_timepoints<br>";
+            $distance_percent = $distance_traveled_between_timepoints / $distance_between_timepoints;
+             if ($next_timepoint["arrival_time"] != "") {
+                $total_time = strtotime($next_timepoint["arrival_time"]) - strtotime($cur_timepoint["arrival_time"]);
+                 // echo strtotime($next_timepoint["arrival_time"])." - ".strtotime($cur_timepoint["arrival_time"])."<br>";
+                $time_estimate = ($distance_percent * $total_time) + strtotime($cur_timepoint["arrival_time"]);
+                 $stopTime["arrival_time"] = date("H:i:s", $time_estimate);
+                 } 
+            else {
+                $stopTime["arrival_time"] = $cur_timepoint["arrival_time"];
+                 } 
+            $rv[] = $stopTime;
+            
+            
+             } 
+        } 
+    // var_dump($rv);
+    return $rv;
+    } 
 function getTripPreviousTimePoint($tripID, $stop_sequence)
-{
-	global $conn;
-	$query = " SELECT trip_id,stop_id,
+
+{
+     global $conn;
+     $query = " SELECT trip_id,stop_id,
 	stop_sequence
 FROM stop_times
 WHERE trip_id = :tripID and stop_sequence < :stop_sequence
 and stop_times.arrival_time IS NOT NULL ORDER BY stop_sequence DESC LIMIT 1";
-	debug($query, "database");
-	$query = $conn->prepare($query);
-	$query->bindParam(":tripID", $tripID);
-	$query->bindParam(":stop_sequence", $stop_sequence);
-	$query->execute();
-	if (!$query) {
-		databaseError($conn->errorInfo());
-		return Array();
-	}
-	return $query->fetch(PDO::FETCH_ASSOC);
-}
+     debug($query, "database");
+     $query = $conn -> prepare($query);
+     $query -> bindParam(":tripID", $tripID);
+     $query -> bindParam(":stop_sequence", $stop_sequence);
+     $query -> execute();
+     if (!$query) {
+        databaseError($conn -> errorInfo());
+         return Array();
+         } 
+    return $query -> fetch(PDO :: FETCH_ASSOC);
+    } 
 function getTripNextTimePoint($tripID, $stop_sequence)
-{
-	global $conn;
-	$query = " SELECT trip_id,stop_id,
+
+{
+     global $conn;
+     $query = " SELECT trip_id,stop_id,
 	stop_sequence
 FROM stop_times
 WHERE trip_id = :tripID and stop_sequence > :stop_sequence
 and stop_times.arrival_time IS NOT NULL ORDER BY stop_sequence LIMIT 1";
-	debug($query, "database");
-	$query = $conn->prepare($query);
-	$query->bindParam(":tripID", $tripID);
-	$query->bindParam(":stop_sequence", $stop_sequence);
-	$query->execute();
-	if (!$query) {
-		databaseError($conn->errorInfo());
-		return Array();
-	}
-	return $query->fetch(PDO::FETCH_ASSOC);
-}
+     debug($query, "database");
+     $query = $conn -> prepare($query);
+     $query -> bindParam(":tripID", $tripID);
+     $query -> bindParam(":stop_sequence", $stop_sequence);
+     $query -> execute();
+     if (!$query) {
+        databaseError($conn -> errorInfo());
+         return Array();
+         } 
+    return $query -> fetch(PDO :: FETCH_ASSOC);
+    } 
 function getTimeInterpolatedTripAtStop($tripID, $stop_sequence)
-{
-	global $conn;
-	// limit interpolation to between nearest actual points.
-	$prevTimePoint = getTripPreviousTimePoint($tripID, $stop_sequence);
-	$nextTimePoint = getTripNextTimePoint($tripID, $stop_sequence);
-	//echo " prev {$lowestDelta['stop_sequence']} next {$nextTimePoint['stop_sequence']} ";
-	$range = "";
-	if ($prevTimePoint != "") $range .= " AND stop_sequence >= '{$prevTimePoint['stop_sequence']}'";
-	if ($nextTimePoint != "") $range .= " AND stop_sequence <= '{$nextTimePoint['stop_sequence']}'";
-	foreach (getTimeInterpolatedTrip($tripID, $range) as $tripStop) {
-		if ($tripStop['stop_sequence'] == $stop_sequence) return $tripStop;
-	}
-	return Array();
-}
+
+{
+     global $conn;
+     // limit interpolation to between nearest actual points.
+    $prevTimePoint = getTripPreviousTimePoint($tripID, $stop_sequence);
+     $nextTimePoint = getTripNextTimePoint($tripID, $stop_sequence);
+     // echo " prev {$lowestDelta['stop_sequence']} next {$nextTimePoint['stop_sequence']} ";
+    $range = "";
+     if ($prevTimePoint != "") $range .= " AND stop_sequence >= '{$prevTimePoint['stop_sequence']}'";
+     if ($nextTimePoint != "") $range .= " AND stop_sequence <= '{$nextTimePoint['stop_sequence']}'";
+     foreach (getTimeInterpolatedTrip($tripID, $range) as $tripStop) {
+        if ($tripStop['stop_sequence'] == $stop_sequence) return $tripStop;
+         } 
+    return Array();
+    } 
 function getTripStartTime($tripID)
-{
-	global $conn;
-	$query = "Select * from stop_times
+
+{
+     global $conn;
+     $query = "Select * from stop_times
 	where trip_id = :tripID
 	AND arrival_time IS NOT NULL
 	AND stop_sequence = '1'";
-	debug($query, "database");
-	$query = $conn->prepare($query);
-	$query->bindParam(":tripID", $tripID);
-	$query->execute();
-	if (!$query) {
-		databaseError($conn->errorInfo());
-		return Array();
-	}
-	$r = $query->fetch(PDO::FETCH_ASSOC);
-	return $r['arrival_time'];
-}
+     debug($query, "database");
+     $query = $conn -> prepare($query);
+     $query -> bindParam(":tripID", $tripID);
+     $query -> execute();
+     if (!$query) {
+        databaseError($conn -> errorInfo());
+         return Array();
+         } 
+    $r = $query -> fetch(PDO :: FETCH_ASSOC);
+     return $r['arrival_time'];
+    } 
+function getTripEndTime($tripID)
+
+{
+     global $conn;
+     $query = "SELECT trip_id,max(arrival_time) as arrival_time from stop_times
+	WHERE stop_times.arrival_time IS NOT NULL and trip_id = :tripID group by trip_id";
+     debug($query, "database");
+     $query = $conn -> prepare($query);
+     $query -> bindParam(":tripID", $tripID);
+     $query -> execute();
+     if (!$query) {
+        databaseError($conn -> errorInfo());
+         return Array();
+         } 
+    $r = $query -> fetch(PDO :: FETCH_ASSOC);
+     return $r['arrival_time'];
+    } 
 function getActiveTrips($time)
-{
-	global $conn;
-	if ($time == "") $time = current_time();
-	$query = "Select distinct stop_times.trip_id, start_times.arrival_time as start_time, end_times.arrival_time as end_time from stop_times, (SELECT trip_id,arrival_time from stop_times WHERE stop_times.arrival_time IS NOT NULL
+
+{
+     global $conn;
+     if ($time == "") $time = current_time();
+     $query = "Select distinct stop_times.trip_id, start_times.arrival_time as start_time, end_times.arrival_time as end_time from stop_times, (SELECT trip_id,arrival_time from stop_times WHERE stop_times.arrival_time IS NOT NULL
 AND stop_sequence = '1') as start_times, (SELECT trip_id,max(arrival_time) as arrival_time from stop_times WHERE stop_times.arrival_time IS NOT NULL group by trip_id) as end_times
 WHERE start_times.trip_id = end_times.trip_id AND stop_times.trip_id = end_times.trip_id AND :time > start_times.arrival_time  AND :time < end_times.arrival_time";
-	debug($query, "database");
-	$query = $conn->prepare($query);
-	$query->bindParam(":time", $time);
-	$query->execute();
-	if (!$query) {
-		databaseError($conn->errorInfo());
-		return Array();
-	}
-	return $query->fetchAll();
-}
-function viaPoints($tripID, $stop_sequence = "")
-{
-	global $conn;
-	$query = "SELECT stops.stop_id, stop_name, arrival_time
+     debug($query, "database");
+     $query = $conn -> prepare($query);
+     $query -> bindParam(":time", $time);
+     $query -> execute();
+     if (!$query) {
+        databaseError($conn -> errorInfo());
+         return Array();
+         } 
+    return $query -> fetchAll();
+    } 
+function viaPoints($tripID, $stop_sequence = "", $timing_points_only = true)
+
+{
+     global $conn;
+     $query = "SELECT stops.stop_id, stop_name, arrival_time
 FROM stop_times join stops on stops.stop_id = stop_times.stop_id
 WHERE stop_times.trip_id = :tripID
-" . ($stop_sequence != "" ? " AND stop_sequence > :stop_sequence " : "") . "AND substr(stop_code,1,2) != 'Wj' ORDER BY stop_sequence";
-	debug($query, "database");
-	$query = $conn->prepare($query);
-	if ($stop_sequence != "") $query->bindParam(":stop_sequence", $stop_sequence);
-	$query->bindParam(":tripID", $tripID);
-	$query->execute();
-	if (!$query) {
-		databaseError($conn->errorInfo());
-		return Array();
-	}
-	return $query->fetchAll();
-}
+" . ($stop_sequence != "" ? " AND stop_sequence > :stop_sequence " : "") . ($timing_points_only ? "AND substr(stop_code,1,2) != 'Wj' ": ""). " ORDER BY stop_sequence";
+     debug($query, "database");
+     $query = $conn -> prepare($query);
+     if ($stop_sequence != "") $query -> bindParam(":stop_sequence", $stop_sequence);
+     $query -> bindParam(":tripID", $tripID);
+     $query -> execute();
+     if (!$query) {
+        databaseError($conn -> errorInfo());
+         return Array();
+         } 
+    return $query -> fetchAll();
+    } 
 function viaPointNames($tripid, $stop_sequence = "")
-{
-	$viaPointNames = Array();
-	foreach (viaPoints($tripid, $stop_sequence) as $point) {
-		$viaPointNames[] = $point['stop_name'];
-	}
-	if (sizeof($viaPointNames) > 0) {
-		return r_implode(", ", $viaPointNames);
-	}
-	else {
-		return "";
-	}
-}
+
+{
+     $viaPointNames = Array();
+     foreach (viaPoints($tripid, $stop_sequence) as $point) {
+        $viaPointNames[] = $point['stop_name'];
+         } 
+    if (sizeof($viaPointNames) > 0) {
+        return r_implode(", ", $viaPointNames);
+         } 
+    else {
+        return "";
+         } 
+    } 
 ?>

file:a/index.php -> file:b/index.php
--- a/index.php
+++ b/index.php
@@ -24,7 +24,6 @@
 		<li><a class="nearby" href="routeList.php?nearby=yes">Nearby Routes</a></li>
             </ul>
 <?php
-echo timePlaceSettings();
 echo ' <a href="labs/index.php" data-role="button" data-icon="beaker">Busness R&amp;D</a>';
 include_footer(true)
 ?>

file:b/js/LAB.min.js (new)
--- /dev/null
+++ b/js/LAB.min.js
@@ -1,1 +1,5 @@
-
+/*! LAB.js (LABjs :: Loading And Blocking JavaScript)
+    v2.0.1 (c) Kyle Simpson
+    MIT License
+*/
+(function(o){var K=o.$LAB,y="UseLocalXHR",z="AlwaysPreserveOrder",u="AllowDuplicates",A="CacheBust",B="BasePath",C=/^[^?#]*\//.exec(location.href)[0],D=/^\w+\:\/\/\/?[^\/]+/.exec(C)[0],i=document.head||document.getElementsByTagName("head"),L=(o.opera&&Object.prototype.toString.call(o.opera)=="[object Opera]")||("MozAppearance"in document.documentElement.style),q=document.createElement("script"),E=typeof q.preload=="boolean",r=E||(q.readyState&&q.readyState=="uninitialized"),F=!r&&q.async===true,M=!r&&!F&&!L;function G(a){return Object.prototype.toString.call(a)=="[object Function]"}function H(a){return Object.prototype.toString.call(a)=="[object Array]"}function N(a,c){var b=/^\w+\:\/\//;if(/^\/\/\/?/.test(a)){a=location.protocol+a}else if(!b.test(a)&&a.charAt(0)!="/"){a=(c||"")+a}return b.test(a)?a:((a.charAt(0)=="/"?D:C)+a)}function s(a,c){for(var b in a){if(a.hasOwnProperty(b)){c[b]=a[b]}}return c}function O(a){var c=false;for(var b=0;b<a.scripts.length;b++){if(a.scripts[b].ready&&a.scripts[b].exec_trigger){c=true;a.scripts[b].exec_trigger();a.scripts[b].exec_trigger=null}}return c}function t(a,c,b,d){a.onload=a.onreadystatechange=function(){if((a.readyState&&a.readyState!="complete"&&a.readyState!="loaded")||c[b])return;a.onload=a.onreadystatechange=null;d()}}function I(a){a.ready=a.finished=true;for(var c=0;c<a.finished_listeners.length;c++){setTimeout(a.finished_listeners[c],0)}a.ready_listeners=[];a.finished_listeners=[]}function P(d,f,e,g,h){setTimeout(function(){var a,c=f.real_src,b;if("item"in i){if(!i[0]){setTimeout(arguments.callee,25);return}i=i[0]}a=document.createElement("script");if(f.type)a.type=f.type;if(f.charset)a.charset=f.charset;if(h){if(r){e.elem=a;if(E){a.preload=true;a.onpreload=g}else{a.onreadystatechange=function(){if(a.readyState=="loaded")g();a.onreadystatechange=null}}a.src=c}else if(h&&c.indexOf(D)==0&&d[y]){b=new XMLHttpRequest();b.onreadystatechange=function(){if(b.readyState==4){b.onreadystatechange=function(){};e.text=b.responseText+"\n//@ sourceURL="+c;g()}};b.open("GET",c);b.send()}else{a.type="text/cache-script";t(a,e,"ready",function(){i.removeChild(a);g()});a.src=c;i.insertBefore(a,i.firstChild)}}else if(F){a.async=false;t(a,e,"finished",g);a.src=c;i.insertBefore(a,i.firstChild)}else{t(a,e,"finished",g);a.src=c;i.insertBefore(a,i.firstChild)}},0)}function J(){var l={},Q=r||M,n=[],p={},m;l[y]=true;l[z]=false;l[u]=false;l[A]=false;l[B]="";function R(a,c,b){var d;function f(){if(d!=null){I(b);d=null}}if(p[c.src].finished)return;if(!a[u])p[c.src].finished=true;d=b.elem||document.createElement("script");if(c.type)d.type=c.type;if(c.charset)d.charset=c.charset;t(d,b,"finished",f);if(b.elem){b.elem=null}else if(b.text){d.onload=d.onreadystatechange=null;d.text=b.text}else{d.src=c.real_src}i.insertBefore(d,i.firstChild);if(b.text){f()}}function S(c,b,d,f){var e,g,h=function(){b.ready_cb(b,function(){R(c,b,e)})},j=function(){b.finished_cb(b,d)};b.src=N(b.src,c[B]);b.real_src=b.src+(c[A]?((/\?.*$/.test(b.src)?"&_":"?_")+~~(Math.random()*1E9)+"="):"");if(!p[b.src])p[b.src]={items:[],finished:false};g=p[b.src].items;if(c[u]||g.length==0){e=g[g.length]={ready:false,finished:false,ready_listeners:[h],finished_listeners:[j]};P(c,b,e,((f)?function(){e.ready=true;for(var a=0;a<e.ready_listeners.length;a++){setTimeout(e.ready_listeners[a],0)}e.ready_listeners=[]}:function(){I(e)}),f)}else{e=g[0];if(e.finished){setTimeout(j,0)}else{e.finished_listeners.push(j)}}}function v(){var e,g=s(l,{}),h=[],j=0,w=false,k;function T(a,c){a.ready=true;a.exec_trigger=c;x()}function U(a,c){a.ready=a.finished=true;a.exec_trigger=null;for(var b=0;b<c.scripts.length;b++){if(!c.scripts[b].finished)return}c.finished=true;x()}function x(){while(j<h.length){if(G(h[j])){try{h[j]()}catch(err){}}else if(!h[j].finished){if(O(h[j]))continue;break}j++}if(j==h.length){w=false;k=false}}function V(){if(!k||!k.scripts){h.push(k={scripts:[],finished:true})}}e={script:function(){for(var f=0;f<arguments.length;f++){(function(a,c){var b;if(!H(a)){c=[a]}for(var d=0;d<c.length;d++){V();a=c[d];if(G(a))a=a();if(!a)continue;if(H(a)){b=[].slice.call(a);b.push(d,1);c.splice.call(c,b);d--;continue}if(typeof a=="string")a={src:a};a=s(a,{ready:false,ready_cb:T,finished:false,finished_cb:U});k.finished=false;k.scripts.push(a);S(g,a,k,(Q&&w));w=true;if(g[z])e.wait()}})(arguments[f],arguments[f])}return e},wait:function(){if(arguments.length>0){for(var a=0;a<arguments.length;a++){h.push(arguments[a])}k=h[h.length-1]}else k=false;x();return e}};return{script:e.script,wait:e.wait,setOptions:function(a){s(a,g);return e}}}m={setGlobalDefaults:function(a){s(a,l);return m},setOptions:function(){return v().setOptions.apply(null,arguments)},script:function(){return v().script.apply(null,arguments)},wait:function(){return v().wait.apply(null,arguments)},queueScript:function(){n[n.length]={type:"script",args:[].slice.call(arguments)};return m},queueWait:function(){n[n.length]={type:"wait",args:[].slice.call(arguments)};return m},runQueue:function(){var a=m,c=n.length,b=c,d;for(;--b>=0;){d=n.shift();a=a[d.type].apply(null,d.args)}return a},noConflict:function(){o.$LAB=K;return m},sandbox:function(){return J()}};return m}o.$LAB=J();(function(a,c,b){if(document.readyState==null&&document[a]){document.readyState="loading";document[a](c,b=function(){document.removeEventListener(c,b,false);document.readyState="complete"},false)}})("addEventListener","DOMContentLoaded")})(this);

--- a/js/flotr/flotr-0.2.0-alpha.js
+++ /dev/null
@@ -1,2 +1,1 @@
-//Flotr 0.2.0-alpha Copyright (c) 2009 Bas Wenneker, <http://solutoire.com>, MIT License.
-var Flotr={version:"0.2.0-alpha",author:"Bas Wenneker",website:"http://www.solutoire.com",_registeredTypes:{lines:"drawSeriesLines",points:"drawSeriesPoints",bars:"drawSeriesBars",candles:"drawSeriesCandles",pie:"drawSeriesPie"},register:function(A,B){Flotr._registeredTypes[A]=B+""},draw:function(B,D,A,C){C=C||Flotr.Graph;return new C(B,D,A)},getSeries:function(A){return A.collect(function(C){var B,C=(C.data)?Object.clone(C):{data:C};for(B=C.data.length-1;B>-1;--B){C.data[B][1]=(C.data[B][1]===null?null:parseFloat(C.data[B][1]))}return C})},merge:function(D,B){var A=B||{};for(var C in D){A[C]=(D[C]!=null&&typeof (D[C])=="object"&&!(D[C].constructor==Array||D[C].constructor==RegExp)&&!Object.isElement(D[C]))?Flotr.merge(D[C],B[C]):A[C]=D[C]}return A},getTickSize:function(E,D,A,B){var H=(A-D)/E;var G=Flotr.getMagnitude(H);var C=H/G;var F=10;if(C<1.5){F=1}else{if(C<2.25){F=2}else{if(C<3){F=((B==0)?2:2.5)}else{if(C<7.5){F=5}}}}return F*G},defaultTickFormatter:function(A){return A+""},defaultTrackFormatter:function(A){return"("+A.x+", "+A.y+")"},defaultPieLabelFormatter:function(A){return(A.fraction*100).toFixed(2)+"%"},getMagnitude:function(A){return Math.pow(10,Math.floor(Math.log(A)/Math.LN10))},toPixel:function(A){return Math.floor(A)+0.5},toRad:function(A){return -A*(Math.PI/180)},parseColor:function(D){if(D instanceof Flotr.Color){return D}var A,C=Flotr.Color;if((A=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(D))){return new C(parseInt(A[1]),parseInt(A[2]),parseInt(A[3]))}if((A=/rgba\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(D))){return new C(parseInt(A[1]),parseInt(A[2]),parseInt(A[3]),parseFloat(A[4]))}if((A=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(D))){return new C(parseFloat(A[1])*2.55,parseFloat(A[2])*2.55,parseFloat(A[3])*2.55)}if((A=/rgba\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(D))){return new C(parseFloat(A[1])*2.55,parseFloat(A[2])*2.55,parseFloat(A[3])*2.55,parseFloat(A[4]))}if((A=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(D))){return new C(parseInt(A[1],16),parseInt(A[2],16),parseInt(A[3],16))}if((A=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(D))){return new C(parseInt(A[1]+A[1],16),parseInt(A[2]+A[2],16),parseInt(A[3]+A[3],16))}var B=D.strip().toLowerCase();if(B=="transparent"){return new C(255,255,255,0)}return((A=C.lookupColors[B]))?new C(A[0],A[1],A[2]):false},extractColor:function(B){var A;do{A=B.getStyle("background-color").toLowerCase();if(!(A==""||A=="transparent")){break}B=B.up(0)}while(!B.nodeName.match(/^body$/i));return(A=="rgba(0, 0, 0, 0)")?"transparent":A}};Flotr.Graph=Class.create({initialize:function(B,C,A){this.el=$(B);if(!this.el){throw"The target container doesn't exist"}this.data=C;this.series=Flotr.getSeries(C);this.setOptions(A);this.lastMousePos={pageX:null,pageY:null};this.selection={first:{x:-1,y:-1},second:{x:-1,y:-1}};this.prevSelection=null;this.selectionInterval=null;this.ignoreClick=false;this.prevHit=null;this.constructCanvas();this.initEvents();this.findDataRanges();this.calculateTicks(this.axes.x);this.calculateTicks(this.axes.x2);this.calculateTicks(this.axes.y);this.calculateTicks(this.axes.y2);this.calculateSpacing();this.draw();this.insertLegend();if(this.options.spreadsheet.show){this.constructTabs()}},setOptions:function(B){var P={colors:["#00A8F0","#C0D800","#CB4B4B","#4DA74D","#9440ED"],title:null,subtitle:null,legend:{show:true,noColumns:1,labelFormatter:Prototype.K,labelBoxBorderColor:"#CCCCCC",labelBoxWidth:14,labelBoxHeight:10,labelBoxMargin:5,container:null,position:"nw",margin:5,backgroundColor:null,backgroundOpacity:0.85},xaxis:{ticks:null,showLabels:true,labelsAngle:0,title:null,titleAngle:0,noTicks:5,tickFormatter:Flotr.defaultTickFormatter,tickDecimals:null,min:null,max:null,autoscaleMargin:0,color:null},x2axis:{},yaxis:{ticks:null,showLabels:true,labelsAngle:0,title:null,titleAngle:90,noTicks:5,tickFormatter:Flotr.defaultTickFormatter,tickDecimals:null,min:null,max:null,autoscaleMargin:0,color:null},y2axis:{titleAngle:270},points:{show:false,radius:3,lineWidth:2,fill:true,fillColor:"#FFFFFF",fillOpacity:0.4},lines:{show:false,lineWidth:2,fill:false,fillColor:null,fillOpacity:0.4},bars:{show:false,lineWidth:2,barWidth:1,fill:true,fillColor:null,fillOpacity:0.4,horizontal:false,stacked:false},candles:{show:false,lineWidth:1,wickLineWidth:1,candleWidth:0.6,fill:true,upFillColor:"#00A8F0",downFillColor:"#CB4B4B",fillOpacity:0.5,barcharts:false},pie:{show:false,lineWidth:1,fill:true,fillColor:null,fillOpacity:0.6,explode:6,sizeRatio:0.6,startAngle:Math.PI/4,labelFormatter:Flotr.defaultPieLabelFormatter,pie3D:false,pie3DviewAngle:(Math.PI/2*0.8),pie3DspliceThickness:20},grid:{color:"#545454",backgroundColor:null,tickColor:"#DDDDDD",labelMargin:3,verticalLines:true,horizontalLines:true,outlineWidth:2},selection:{mode:null,color:"#B6D9FF",fps:20},mouse:{track:false,position:"se",relative:false,trackFormatter:Flotr.defaultTrackFormatter,margin:5,lineColor:"#FF3F19",trackDecimals:1,sensibility:2,radius:3},shadowSize:4,defaultType:"lines",HtmlText:true,fontSize:7.5,spreadsheet:{show:false,tabGraphLabel:"Graph",tabDataLabel:"Data",toolbarDownload:"Download CSV",toolbarSelectAll:"Select all"}};P.x2axis=Object.extend(Object.clone(P.xaxis),P.x2axis);P.y2axis=Object.extend(Object.clone(P.yaxis),P.y2axis);this.options=Flotr.merge((B||{}),P);this.axes={x:{options:this.options.xaxis,n:1},x2:{options:this.options.x2axis,n:2},y:{options:this.options.yaxis,n:1},y2:{options:this.options.y2axis,n:2}};var H=[],C=[],K=this.series.length,N=this.series.length,D=this.options.colors,A=[],G=0,M,J,I,O,E;for(J=N-1;J>-1;--J){M=this.series[J].color;if(M!=null){--N;if(Object.isNumber(M)){H.push(M)}else{A.push(Flotr.parseColor(M))}}}for(J=H.length-1;J>-1;--J){N=Math.max(N,H[J]+1)}for(J=0;C.length<N;){M=(D.length==J)?new Flotr.Color(100,100,100):Flotr.parseColor(D[J]);var F=G%2==1?-1:1;var L=1+F*Math.ceil(G/2)*0.2;M.scale(L,L,L);C.push(M);if(++J>=D.length){J=0;++G}}for(J=0,I=0;J<K;++J){O=this.series[J];if(O.color==null){O.color=C[I++].toString()}else{if(Object.isNumber(O.color)){O.color=C[O.color].toString()}}if(!O.xaxis){O.xaxis=this.axes.x}if(O.xaxis==1){O.xaxis=this.axes.x}else{if(O.xaxis==2){O.xaxis=this.axes.x2}}if(!O.yaxis){O.yaxis=this.axes.y}if(O.yaxis==1){O.yaxis=this.axes.y}else{if(O.yaxis==2){O.yaxis=this.axes.y2}}O.lines=Object.extend(Object.clone(this.options.lines),O.lines);O.points=Object.extend(Object.clone(this.options.points),O.points);O.bars=Object.extend(Object.clone(this.options.bars),O.bars);O.candles=Object.extend(Object.clone(this.options.candles),O.candles);O.pie=Object.extend(Object.clone(this.options.pie),O.pie);O.mouse=Object.extend(Object.clone(this.options.mouse),O.mouse);if(O.shadowSize==null){O.shadowSize=this.options.shadowSize}}},constructCanvas:function(){var C=this.el,B,D,A;this.canvas=C.select(".flotr-canvas")[0];this.overlay=C.select(".flotr-overlay")[0];C.childElements().invoke("remove");C.setStyle({position:"relative",cursor:"default"});this.canvasWidth=C.getWidth();this.canvasHeight=C.getHeight();B={width:this.canvasWidth,height:this.canvasHeight};if(this.canvasWidth<=0||this.canvasHeight<=0){throw"Invalid dimensions for plot, width = "+this.canvasWidth+", height = "+this.canvasHeight}if(!this.canvas){D=this.canvas=new Element("canvas",B);D.className="flotr-canvas";D=D.writeAttribute("style","position:absolute;left:0px;top:0px;")}else{D=this.canvas.writeAttribute(B)}C.insert(D);if(Prototype.Browser.IE){D=window.G_vmlCanvasManager.initElement(D)}this.ctx=D.getContext("2d");if(!this.overlay){A=this.overlay=new Element("canvas",B);A.className="flotr-overlay";A=A.writeAttribute("style","position:absolute;left:0px;top:0px;")}else{A=this.overlay.writeAttribute(B)}C.insert(A);if(Prototype.Browser.IE){A=window.G_vmlCanvasManager.initElement(A)}this.octx=A.getContext("2d");if(window.CanvasText){CanvasText.enable(this.ctx);CanvasText.enable(this.octx);this.textEnabled=true}},getTextDimensions:function(F,C,B,D){if(!F){return{width:0,height:0}}if(!this.options.HtmlText&&this.textEnabled){var E=this.ctx.getTextBounds(F,C);return{width:E.width+2,height:E.height+6}}else{var A=this.el.insert('<div style="position:absolute;top:-10000px;'+B+'" class="'+D+' flotr-dummy-div">'+F+"</div>").select(".flotr-dummy-div")[0];dim=A.getDimensions();A.remove();return dim}},loadDataGrid:function(){if(this.seriesData){return this.seriesData}var A=this.series;var B=[];for(i=0;i<A.length;++i){A[i].data.each(function(D){var C=D[0],F=D[1];if(r=B.find(function(G){return G[0]==C})){r[i+1]=F}else{var E=[];E[0]=C;E[i+1]=F;B.push(E)}})}B=B.sortBy(function(C){return C[0]});return this.seriesData=B},showTab:function(B,C){var A="canvas, .flotr-labels, .flotr-legend, .flotr-legend-bg, .flotr-title, .flotr-subtitle";switch(B){case"graph":this.datagrid.up().hide();this.el.select(A).invoke("show");this.tabs.data.removeClassName("selected");this.tabs.graph.addClassName("selected");break;case"data":this.constructDataGrid();this.datagrid.up().show();this.el.select(A).invoke("hide");this.tabs.data.addClassName("selected");this.tabs.graph.removeClassName("selected");break}},constructTabs:function(){var A=new Element("div",{className:"flotr-tabs-group",style:"position:absolute;left:0px;top:"+this.canvasHeight+"px;width:"+this.canvasWidth+"px;"});this.el.insert({bottom:A});this.tabs={graph:new Element("div",{className:"flotr-tab selected",style:"float:left;"}).update(this.options.spreadsheet.tabGraphLabel),data:new Element("div",{className:"flotr-tab",style:"float:left;"}).update(this.options.spreadsheet.tabDataLabel)};A.insert(this.tabs.graph).insert(this.tabs.data);this.el.setStyle({height:this.canvasHeight+this.tabs.data.getHeight()+2+"px"});this.tabs.graph.observe("click",(function(){this.showTab("graph")}).bind(this));this.tabs.data.observe("click",(function(){this.showTab("data")}).bind(this))},constructDataGrid:function(){if(this.datagrid){return this.datagrid}var D,B,L=this.series,J=this.loadDataGrid();var K=this.datagrid=new Element("table",{className:"flotr-datagrid",style:"height:100px;"});var C=["<colgroup><col />"];var F=['<tr class="first-row">'];F.push("<th>&nbsp;</th>");for(D=0;D<L.length;++D){F.push('<th scope="col">'+(L[D].label||String.fromCharCode(65+D))+"</th>");C.push("<col />")}F.push("</tr>");for(B=0;B<J.length;++B){F.push("<tr>");for(D=0;D<L.length+1;++D){var M="td";var G=(J[B][D]!=null?Math.round(J[B][D]*100000)/100000:"");if(D==0){M="th";var I;if(this.options.xaxis.ticks){var E=this.options.xaxis.ticks.find(function(N){return N[0]==J[B][D]});if(E){I=E[1]}}else{I=this.options.xaxis.tickFormatter(G)}if(I){G=I}}F.push("<"+M+(M=="th"?' scope="row"':"")+">"+G+"</"+M+">")}F.push("</tr>")}C.push("</colgroup>");K.update(C.join("")+F.join(""));if(!Prototype.Browser.IE){K.select("td").each(function(N){N.observe("mouseover",function(O){N=O.element();var P=N.previousSiblings();K.select("th[scope=col]")[P.length-1].addClassName("hover");K.select("colgroup col")[P.length].addClassName("hover")});N.observe("mouseout",function(){K.select("colgroup col.hover, th.hover").each(function(O){O.removeClassName("hover")})})})}var H=new Element("div",{className:"flotr-datagrid-toolbar"}).insert(new Element("button",{type:"button",className:"flotr-datagrid-toolbar-button"}).update(this.options.spreadsheet.toolbarDownload).observe("click",this.downloadCSV.bind(this))).insert(new Element("button",{type:"button",className:"flotr-datagrid-toolbar-button"}).update(this.options.spreadsheet.toolbarSelectAll).observe("click",this.selectAllData.bind(this)));var A=new Element("div",{className:"flotr-datagrid-container",style:"left:0px;top:0px;width:"+this.canvasWidth+"px;height:"+this.canvasHeight+"px;overflow:auto;"});A.insert(H);K.wrap(A.hide());this.el.insert(A);return K},selectAllData:function(){if(this.tabs){var B,A,E,D,C=this.constructDataGrid();this.showTab("data");(function(){if((E=C.ownerDocument)&&(D=E.defaultView)&&D.getSelection&&E.createRange&&(B=window.getSelection())&&B.removeAllRanges){A=E.createRange();A.selectNode(C);B.removeAllRanges();B.addRange(A)}else{if(document.body&&document.body.createTextRange&&(A=document.body.createTextRange())){A.moveToElementText(C);A.select()}}}).defer();return true}else{return false}},downloadCSV:function(){var D,A='"x"',C=this.series,E=this.loadDataGrid();for(D=0;D<C.length;++D){A+='%09"'+(C[D].label||String.fromCharCode(65+D))+'"'}A+="%0D%0A";for(D=0;D<E.length;++D){if(this.options.xaxis.ticks){var B=this.options.xaxis.ticks.find(function(F){return F[0]==E[D][0]});if(B){E[D][0]=B[1]}}else{E[D][0]=this.options.xaxis.tickFormatter(E[D][0])}A+=E[D].join("%09")+"%0D%0A"}if(Prototype.Browser.IE){A=A.gsub("%09","\t").gsub("%0A","\n").gsub("%0D","\r");window.open().document.write(A)}else{window.open("data:text/csv,"+A)}},initEvents:function(){this.overlay.stopObserving();this.overlay.observe("mousedown",this.mouseDownHandler.bind(this));this.overlay.observe("mousemove",this.mouseMoveHandler.bind(this));this.overlay.observe("click",this.clickHandler.bind(this))},findDataRanges:function(){var J=this.series,G=this.axes;G.x.datamin=0;G.x.datamax=0;G.x2.datamin=0;G.x2.datamax=0;G.y.datamin=0;G.y.datamax=0;G.y2.datamin=0;G.y2.datamax=0;if(J.length>0){var C,A,D,H,F,B,I,E;for(C=0;C<J.length;++C){B=J[C].data,I=J[C].xaxis,E=J[C].yaxis;if(B.length>0&&!J[C].hide){if(!I.used){I.datamin=I.datamax=B[0][0]}if(!E.used){E.datamin=E.datamax=B[0][1]}I.used=true;E.used=true;for(D=B.length-1;D>-1;--D){H=B[D][0];if(H<I.datamin){I.datamin=H}else{if(H>I.datamax){I.datamax=H}}for(A=1;A<B[D].length;A++){F=B[D][A];if(F<E.datamin){E.datamin=F}else{if(F>E.datamax){E.datamax=F}}}}}}}this.findXAxesValues();this.calculateRange(G.x);this.extendXRangeIfNeededByBar(G.x);if(G.x2.used){this.calculateRange(G.x2);this.extendXRangeIfNeededByBar(G.x2)}this.calculateRange(G.y);this.extendYRangeIfNeededByBar(G.y);if(G.y2.used){this.calculateRange(G.y2);this.extendYRangeIfNeededByBar(G.y2)}},calculateRange:function(D){var F=D.options,C=F.min!=null?F.min:D.datamin,A=F.max!=null?F.max:D.datamax,E;if(A-C==0){var B=(A==0)?1:0.01;C-=B;A+=B}D.tickSize=Flotr.getTickSize(F.noTicks,C,A,F.tickDecimals);if(F.min==null){E=F.autoscaleMargin;if(E!=0){C-=D.tickSize*E;if(C<0&&D.datamin>=0){C=0}C=D.tickSize*Math.floor(C/D.tickSize)}}if(F.max==null){E=F.autoscaleMargin;if(E!=0){A+=D.tickSize*E;if(A>0&&D.datamax<=0){A=0}A=D.tickSize*Math.ceil(A/D.tickSize)}}D.min=C;D.max=A},extendXRangeIfNeededByBar:function(A){if(A.options.max==null){var D=A.max,B,I,F,E,H=[],C=null;for(B=0;B<this.series.length;++B){I=this.series[B];F=I.bars;E=I.candles;if(I.axis==A&&(F.show||E.show)){if(!F.horizontal&&(F.barWidth+A.datamax>D)||(E.candleWidth+A.datamax>D)){D=A.max+I.bars.barWidth}if(F.stacked&&F.horizontal){for(j=0;j<I.data.length;j++){if(I.bars.show&&I.bars.stacked){var G=I.data[j][0];H[G]=(H[G]||0)+I.data[j][1];C=I}}for(j=0;j<H.length;j++){D=Math.max(H[j],D)}}}}A.lastSerie=C;A.max=D}},extendYRangeIfNeededByBar:function(A){if(A.options.max==null){var D=A.max,B,I,F,E,H=[],C=null;for(B=0;B<this.series.length;++B){I=this.series[B];F=I.bars;E=I.candles;if(I.yaxis==A&&F.show&&!I.hide){if(F.horizontal&&(F.barWidth+A.datamax>D)||(E.candleWidth+A.datamax>D)){D=A.max+F.barWidth}if(F.stacked&&!F.horizontal){for(j=0;j<I.data.length;j++){if(I.bars.show&&I.bars.stacked){var G=I.data[j][0];H[G]=(H[G]||0)+I.data[j][1];C=I}}for(j=0;j<H.length;j++){D=Math.max(H[j],D)}}}}A.lastSerie=C;A.max=D}},findXAxesValues:function(){for(i=this.series.length-1;i>-1;--i){s=this.series[i];s.xaxis.values=s.xaxis.values||[];for(j=s.data.length-1;j>-1;--j){s.xaxis.values[s.data[j][0]]={}}}},calculateTicks:function(D){var B=D.options,E,H;D.ticks=[];if(B.ticks){var G=B.ticks,I,F;if(Object.isFunction(G)){G=G({min:D.min,max:D.max})}for(E=0;E<G.length;++E){I=G[E];if(typeof (I)=="object"){H=I[0];F=(I.length>1)?I[1]:B.tickFormatter(H)}else{H=I;F=B.tickFormatter(H)}D.ticks[E]={v:H,label:F}}}else{var A=D.tickSize*Math.ceil(D.min/D.tickSize),C;for(E=0;A+E*D.tickSize<=D.max;++E){H=A+E*D.tickSize;C=B.tickDecimals;if(C==null){C=1-Math.floor(Math.log(D.tickSize)/Math.LN10)}if(C<0){C=0}H=H.toFixed(C);D.ticks.push({v:H,label:B.tickFormatter(H)})}}},calculateSpacing:function(){var L=this.axes,N=this.options,H=this.series,D=N.grid.labelMargin,M=L.x,A=L.x2,J=L.y,K=L.y2,F=2,G,E,C,I;[M,A,J,K].each(function(P){var O="";if(P.options.showLabels){for(G=0;G<P.ticks.length;++G){C=P.ticks[G].label.length;if(C>O.length){O=P.ticks[G].label}}}P.maxLabel=this.getTextDimensions(O,{size:N.fontSize,angle:Flotr.toRad(P.options.labelsAngle)},"font-size:smaller;","flotr-grid-label");P.titleSize=this.getTextDimensions(P.options.title,{size:N.fontSize*1.2,angle:Flotr.toRad(P.options.titleAngle)},"font-weight:bold;","flotr-axis-title")},this);I=this.getTextDimensions(N.title,{size:N.fontSize*1.5},"font-size:1em;font-weight:bold;","flotr-title");this.titleHeight=I.height;I=this.getTextDimensions(N.subtitle,{size:N.fontSize},"font-size:smaller;","flotr-subtitle");this.subtitleHeight=I.height;if(N.show){F=Math.max(F,N.points.radius+N.points.lineWidth/2)}for(E=0;E<N.length;++E){if(H[E].points.show){F=Math.max(F,H[E].points.radius+H[E].points.lineWidth/2)}}var B=this.plotOffset={left:0,right:0,top:0,bottom:0};B.left=B.right=B.top=B.bottom=F;B.bottom+=(M.options.showLabels?(M.maxLabel.height+D):0)+(M.options.title?(M.titleSize.height+D):0);B.top+=(A.options.showLabels?(A.maxLabel.height+D):0)+(A.options.title?(A.titleSize.height+D):0)+this.subtitleHeight+this.titleHeight;B.left+=(J.options.showLabels?(J.maxLabel.width+D):0)+(J.options.title?(J.titleSize.width+D):0);B.right+=(K.options.showLabels?(K.maxLabel.width+D):0)+(K.options.title?(K.titleSize.width+D):0);B.top=Math.floor(B.top);this.plotWidth=this.canvasWidth-B.left-B.right;this.plotHeight=this.canvasHeight-B.bottom-B.top;M.scale=this.plotWidth/(M.max-M.min);A.scale=this.plotWidth/(A.max-A.min);J.scale=this.plotHeight/(J.max-J.min);K.scale=this.plotHeight/(K.max-K.min)},draw:function(){this.drawGrid();this.drawLabels();this.drawTitles();if(this.series.length){this.el.fire("flotr:beforedraw",[this.series,this]);for(var A=0;A<this.series.length;A++){if(!this.series[A].hide){this.drawSeries(this.series[A])}}}this.el.fire("flotr:afterdraw",[this.series,this])},tHoz:function(A,B){B=B||this.axes.x;return(A-B.min)*B.scale},tVert:function(B,A){A=A||this.axes.y;return this.plotHeight-(B-A.min)*A.scale},drawGrid:function(){var B,E=this.options,A=this.ctx;if(E.grid.verticalLines||E.grid.horizontalLines){this.el.fire("flotr:beforegrid",[this.axes.x,this.axes.y,E,this])}A.save();A.translate(this.plotOffset.left,this.plotOffset.top);if(E.grid.backgroundColor!=null){A.fillStyle=E.grid.backgroundColor;A.fillRect(0,0,this.plotWidth,this.plotHeight)}A.lineWidth=1;A.strokeStyle=E.grid.tickColor;A.beginPath();if(E.grid.verticalLines){for(var D=0;D<this.axes.x.ticks.length;++D){B=this.axes.x.ticks[D].v;if((B==this.axes.x.min||B==this.axes.x.max)&&E.grid.outlineWidth!=0){continue}A.moveTo(Math.floor(this.tHoz(B))+A.lineWidth/2,0);A.lineTo(Math.floor(this.tHoz(B))+A.lineWidth/2,this.plotHeight)}}if(E.grid.horizontalLines){for(var C=0;C<this.axes.y.ticks.length;++C){B=this.axes.y.ticks[C].v;if((B==this.axes.y.min||B==this.axes.y.max)&&E.grid.outlineWidth!=0){continue}A.moveTo(0,Math.floor(this.tVert(B))+A.lineWidth/2);A.lineTo(this.plotWidth,Math.floor(this.tVert(B))+A.lineWidth/2)}}A.stroke();if(E.grid.outlineWidth!=0){A.lineWidth=E.grid.outlineWidth;A.strokeStyle=E.grid.color;A.lineJoin="round";A.strokeRect(0,0,this.plotWidth,this.plotHeight)}A.restore();if(E.grid.verticalLines||E.grid.horizontalLines){this.el.fire("flotr:aftergrid",[this.axes.x,this.axes.y,E,this])}},drawLabels:function(){var C=0,D,B,E,F,G,J=this.options,I=this.ctx,H=this.axes;for(E=0;E<H.x.ticks.length;++E){if(H.x.ticks[E].label){++C}}B=this.plotWidth/C;if(!J.HtmlText&&this.textEnabled){var A={size:J.fontSize,adjustAlign:true};D=H.x;A.color=D.options.color||J.grid.color;for(E=0;E<D.ticks.length&&D.options.showLabels&&D.used;++E){G=D.ticks[E];if(!G.label||G.label.length==0){continue}A.angle=Flotr.toRad(D.options.labelsAngle);A.halign="c";A.valign="t";I.drawText(G.label,this.plotOffset.left+this.tHoz(G.v,D),this.plotOffset.top+this.plotHeight+J.grid.labelMargin,A)}D=H.x2;A.color=D.options.color||J.grid.color;for(E=0;E<D.ticks.length&&D.options.showLabels&&D.used;++E){G=D.ticks[E];if(!G.label||G.label.length==0){continue}A.angle=Flotr.toRad(D.options.labelsAngle);A.halign="c";A.valign="b";I.drawText(G.label,this.plotOffset.left+this.tHoz(G.v,D),this.plotOffset.top+J.grid.labelMargin,A)}D=H.y;A.color=D.options.color||J.grid.color;for(E=0;E<D.ticks.length&&D.options.showLabels&&D.used;++E){G=D.ticks[E];if(!G.label||G.label.length==0){continue}A.angle=Flotr.toRad(D.options.labelsAngle);A.halign="r";A.valign="m";I.drawText(G.label,this.plotOffset.left-J.grid.labelMargin,this.plotOffset.top+this.tVert(G.v,D),A)}D=H.y2;A.color=D.options.color||J.grid.color;for(E=0;E<D.ticks.length&&D.options.showLabels&&D.used;++E){G=D.ticks[E];if(!G.label||G.label.length==0){continue}A.angle=Flotr.toRad(D.options.labelsAngle);A.halign="l";A.valign="m";I.drawText(G.label,this.plotOffset.left+this.plotWidth+J.grid.labelMargin,this.plotOffset.top+this.tVert(G.v,D),A);I.save();I.strokeStyle=A.color;I.beginPath();I.moveTo(this.plotOffset.left+this.plotWidth-8,this.plotOffset.top+this.tVert(G.v,D));I.lineTo(this.plotOffset.left+this.plotWidth,this.plotOffset.top+this.tVert(G.v,D));I.stroke();I.restore()}}else{if(H.x.options.showLabels||H.x2.options.showLabels||H.y.options.showLabels||H.y2.options.showLabels){F=['<div style="font-size:smaller;color:'+J.grid.color+';" class="flotr-labels">'];D=H.x;if(D.options.showLabels){for(E=0;E<D.ticks.length;++E){G=D.ticks[E];if(!G.label||G.label.length==0){continue}F.push('<div style="position:absolute;top:'+(this.plotOffset.top+this.plotHeight+J.grid.labelMargin)+"px;left:"+(this.plotOffset.left+this.tHoz(G.v,D)-B/2)+"px;width:"+B+"px;text-align:center;"+(D.options.color?("color:"+D.options.color+";"):"")+'" class="flotr-grid-label">'+G.label+"</div>")}}D=H.x2;if(D.options.showLabels&&D.used){for(E=0;E<D.ticks.length;++E){G=D.ticks[E];if(!G.label||G.label.length==0){continue}F.push('<div style="position:absolute;top:'+(this.plotOffset.top-J.grid.labelMargin-D.maxLabel.height)+"px;left:"+(this.plotOffset.left+this.tHoz(G.v,D)-B/2)+"px;width:"+B+"px;text-align:center;"+(D.options.color?("color:"+D.options.color+";"):"")+'" class="flotr-grid-label">'+G.label+"</div>")}}D=H.y;if(D.options.showLabels){for(E=0;E<D.ticks.length;++E){G=D.ticks[E];if(!G.label||G.label.length==0){continue}F.push('<div style="position:absolute;top:'+(this.plotOffset.top+this.tVert(G.v,D)-D.maxLabel.height/2)+"px;left:0;width:"+(this.plotOffset.left-J.grid.labelMargin)+"px;text-align:right;"+(D.options.color?("color:"+D.options.color+";"):"")+'" class="flotr-grid-label">'+G.label+"</div>")}}D=H.y2;if(D.options.showLabels&&D.used){I.save();I.strokeStyle=D.options.color||J.grid.color;I.beginPath();for(E=0;E<D.ticks.length;++E){G=D.ticks[E];if(!G.label||G.label.length==0){continue}F.push('<div style="position:absolute;top:'+(this.plotOffset.top+this.tVert(G.v,D)-D.maxLabel.height/2)+"px;right:0;width:"+(this.plotOffset.right-J.grid.labelMargin)+"px;text-align:left;"+(D.options.color?("color:"+D.options.color+";"):"")+'" class="flotr-grid-label">'+G.label+"</div>");I.moveTo(this.plotOffset.left+this.plotWidth-8,this.plotOffset.top+this.tVert(G.v,D));I.lineTo(this.plotOffset.left+this.plotWidth,this.plotOffset.top+this.tVert(G.v,D))}I.stroke();I.restore()}F.push("</div>");this.el.insert(F.join(""))}}},drawTitles:function(){var D,C=this.options,F=C.grid.labelMargin,B=this.ctx,A=this.axes;if(!C.HtmlText&&this.textEnabled){var E={size:C.fontSize,color:C.grid.color,halign:"c"};if(C.subtitle){B.drawText(C.subtitle,this.plotOffset.left+this.plotWidth/2,this.titleHeight+this.subtitleHeight-2,E)}E.weight=1.5;E.size*=1.5;if(C.title){B.drawText(C.title,this.plotOffset.left+this.plotWidth/2,this.titleHeight-2,E)}E.weight=1.8;E.size*=0.8;E.adjustAlign=true;if(A.x.options.title&&A.x.used){E.halign="c";E.valign="t";E.angle=Flotr.toRad(A.x.options.titleAngle);B.drawText(A.x.options.title,this.plotOffset.left+this.plotWidth/2,this.plotOffset.top+A.x.maxLabel.height+this.plotHeight+2*F,E)}if(A.x2.options.title&&A.x2.used){E.halign="c";E.valign="b";E.angle=Flotr.toRad(A.x2.options.titleAngle);B.drawText(A.x2.options.title,this.plotOffset.left+this.plotWidth/2,this.plotOffset.top-A.x2.maxLabel.height-2*F,E)}if(A.y.options.title&&A.y.used){E.halign="r";E.valign="m";E.angle=Flotr.toRad(A.y.options.titleAngle);B.drawText(A.y.options.title,this.plotOffset.left-A.y.maxLabel.width-2*F,this.plotOffset.top+this.plotHeight/2,E)}if(A.y2.options.title&&A.y2.used){E.halign="l";E.valign="m";E.angle=Flotr.toRad(A.y2.options.titleAngle);B.drawText(A.y2.options.title,this.plotOffset.left+this.plotWidth+A.y2.maxLabel.width+2*F,this.plotOffset.top+this.plotHeight/2,E)}}else{D=['<div style="color:'+C.grid.color+';" class="flotr-titles">'];if(C.title){D.push('<div style="position:absolute;top:0;left:'+this.plotOffset.left+"px;font-size:1em;font-weight:bold;text-align:center;width:"+this.plotWidth+'px;" class="flotr-title">'+C.title+"</div>")}if(C.subtitle){D.push('<div style="position:absolute;top:'+this.titleHeight+"px;left:"+this.plotOffset.left+"px;font-size:smaller;text-align:center;width:"+this.plotWidth+'px;" class="flotr-subtitle">'+C.subtitle+"</div>")}D.push("</div>");D.push('<div class="flotr-axis-title" style="font-weight:bold;">');if(A.x.options.title&&A.x.used){D.push('<div style="position:absolute;top:'+(this.plotOffset.top+this.plotHeight+C.grid.labelMargin+A.x.titleSize.height)+"px;left:"+this.plotOffset.left+"px;width:"+this.plotWidth+'px;text-align:center;" class="flotr-axis-title">'+A.x.options.title+"</div>")}if(A.x2.options.title&&A.x2.used){D.push('<div style="position:absolute;top:0;left:'+this.plotOffset.left+"px;width:"+this.plotWidth+'px;text-align:center;" class="flotr-axis-title">'+A.x2.options.title+"</div>")}if(A.y.options.title&&A.y.used){D.push('<div style="position:absolute;top:'+(this.plotOffset.top+this.plotHeight/2-A.y.titleSize.height/2)+'px;left:0;text-align:right;" class="flotr-axis-title">'+A.y.options.title+"</div>")}if(A.y2.options.title&&A.y2.used){D.push('<div style="position:absolute;top:'+(this.plotOffset.top+this.plotHeight/2-A.y.titleSize.height/2)+'px;right:0;text-align:right;" class="flotr-axis-title">'+A.y2.options.title+"</div>")}D.push("</div>");this.el.insert(D.join(""))}},drawSeries:function(A){A=A||this.series;var C=false;for(var B in Flotr._registeredTypes){if(A[B]&&A[B].show){this[Flotr._registeredTypes[B]](A);C=true}}if(!C){this[Flotr._registeredTypes[this.options.defaultType]](A)}},plotLine:function(I,F){var O=this.ctx,A=I.xaxis,K=I.yaxis,J=this.tHoz.bind(this),M=this.tVert.bind(this),H=I.data;if(H.length<2){return }var E=J(H[0][0],A),D=M(H[0][1],K)+F;O.beginPath();O.moveTo(E,D);for(var G=0;G<H.length-1;++G){var C=H[G][0],N=H[G][1],B=H[G+1][0],L=H[G+1][1];if(N===null||L===null){continue}if(N<=L&&N<K.min){if(L<K.min){continue}C=(K.min-N)/(L-N)*(B-C)+C;N=K.min}else{if(L<=N&&L<K.min){if(N<K.min){continue}B=(K.min-N)/(L-N)*(B-C)+C;L=K.min}}if(N>=L&&N>K.max){if(L>K.max){continue}C=(K.max-N)/(L-N)*(B-C)+C;N=K.max}else{if(L>=N&&L>K.max){if(N>K.max){continue}B=(K.max-N)/(L-N)*(B-C)+C;L=K.max}}if(C<=B&&C<A.min){if(B<A.min){continue}N=(A.min-C)/(B-C)*(L-N)+N;C=A.min}else{if(B<=C&&B<A.min){if(C<A.min){continue}L=(A.min-C)/(B-C)*(L-N)+N;B=A.min}}if(C>=B&&C>A.max){if(B>A.max){continue}N=(A.max-C)/(B-C)*(L-N)+N;C=A.max}else{if(B>=C&&B>A.max){if(C>A.max){continue}L=(A.max-C)/(B-C)*(L-N)+N;B=A.max}}if(E!=J(C,A)||D!=M(N,K)+F){O.moveTo(J(C,A),M(N,K)+F)}E=J(B,A);D=M(L,K)+F;O.lineTo(E,D)}O.stroke()},plotLineArea:function(J,D){var S=J.data;if(S.length<2){return }var L,G=0,N=this.ctx,Q=J.xaxis,B=J.yaxis,E=this.tHoz.bind(this),M=this.tVert.bind(this),H=Math.min(Math.max(0,B.min),B.max),F=true;N.beginPath();for(var O=0;O<S.length-1;++O){var R=S[O][0],C=S[O][1],P=S[O+1][0],A=S[O+1][1];if(R<=P&&R<Q.min){if(P<Q.min){continue}C=(Q.min-R)/(P-R)*(A-C)+C;R=Q.min}else{if(P<=R&&P<Q.min){if(R<Q.min){continue}A=(Q.min-R)/(P-R)*(A-C)+C;P=Q.min}}if(R>=P&&R>Q.max){if(P>Q.max){continue}C=(Q.max-R)/(P-R)*(A-C)+C;R=Q.max}else{if(P>=R&&P>Q.max){if(R>Q.max){continue}A=(Q.max-R)/(P-R)*(A-C)+C;P=Q.max}}if(F){N.moveTo(E(R,Q),M(H,B)+D);F=false}if(C>=B.max&&A>=B.max){N.lineTo(E(R,Q),M(B.max,B)+D);N.lineTo(E(P,Q),M(B.max,B)+D);continue}else{if(C<=B.min&&A<=B.min){N.lineTo(E(R,Q),M(B.min,B)+D);N.lineTo(E(P,Q),M(B.min,B)+D);continue}}var I=R,K=P;if(C<=A&&C<B.min&&A>=B.min){R=(B.min-C)/(A-C)*(P-R)+R;C=B.min}else{if(A<=C&&A<B.min&&C>=B.min){P=(B.min-C)/(A-C)*(P-R)+R;A=B.min}}if(C>=A&&C>B.max&&A<=B.max){R=(B.max-C)/(A-C)*(P-R)+R;C=B.max}else{if(A>=C&&A>B.max&&C<=B.max){P=(B.max-C)/(A-C)*(P-R)+R;A=B.max}}if(R!=I){L=(C<=B.min)?L=B.min:B.max;N.lineTo(E(I,Q),M(L,B)+D);N.lineTo(E(R,Q),M(L,B)+D)}N.lineTo(E(R,Q),M(C,B)+D);N.lineTo(E(P,Q),M(A,B)+D);if(P!=K){L=(A<=B.min)?B.min:B.max;N.lineTo(E(K,Q),M(L,B)+D);N.lineTo(E(P,Q),M(L,B)+D)}G=Math.max(P,K)}N.lineTo(E(G,Q),M(H,B)+D);N.closePath();N.fill()},drawSeriesLines:function(C){C=C||this.series;var B=this.ctx;B.save();B.translate(this.plotOffset.left,this.plotOffset.top);B.lineJoin="round";var D=C.lines.lineWidth;var A=C.shadowSize;if(A>0){B.lineWidth=A/2;var E=D/2+B.lineWidth/2;B.strokeStyle="rgba(0,0,0,0.1)";this.plotLine(C,E+A/2);B.strokeStyle="rgba(0,0,0,0.2)";this.plotLine(C,E);if(C.lines.fill){B.fillStyle="rgba(0,0,0,0.05)";this.plotLineArea(C,E+A/2)}}B.lineWidth=D;B.strokeStyle=C.color;if(C.lines.fill){B.fillStyle=C.lines.fillColor!=null?C.lines.fillColor:Flotr.parseColor(C.color).scale(null,null,null,C.lines.fillOpacity).toString();this.plotLineArea(C,0)}this.plotLine(C,0);B.restore()},drawSeriesPoints:function(C){var B=this.ctx;B.save();B.translate(this.plotOffset.left,this.plotOffset.top);var D=C.lines.lineWidth;var A=C.shadowSize;if(A>0){B.lineWidth=A/2;B.strokeStyle="rgba(0,0,0,0.1)";this.plotPointShadows(C,A/2+B.lineWidth/2,C.points.radius);B.strokeStyle="rgba(0,0,0,0.2)";this.plotPointShadows(C,B.lineWidth/2,C.points.radius)}B.lineWidth=C.points.lineWidth;B.strokeStyle=C.color;B.fillStyle=C.points.fillColor!=null?C.points.fillColor:C.color;this.plotPoints(C,C.points.radius,C.points.fill);B.restore()},plotPoints:function(C,E,I){var A=C.xaxis,F=C.yaxis,J=this.ctx,D,B=C.data;for(D=B.length-1;D>-1;--D){var H=B[D][0],G=B[D][1];if(H<A.min||H>A.max||G<F.min||G>F.max){continue}J.beginPath();J.arc(this.tHoz(H,A),this.tVert(G,F),E,0,2*Math.PI,true);if(I){J.fill()}J.stroke()}},plotPointShadows:function(D,B,F){var A=D.xaxis,G=D.yaxis,J=this.ctx,E,C=D.data;for(E=C.length-1;E>-1;--E){var I=C[E][0],H=C[E][1];if(I<A.min||I>A.max||H<G.min||H>G.max){continue}J.beginPath();J.arc(this.tHoz(I,A),this.tVert(H,G)+B,F,0,Math.PI,false);J.stroke()}},drawSeriesBars:function(B){var A=this.ctx,D=B.bars.barWidth,C=Math.min(B.bars.lineWidth,D);A.save();A.translate(this.plotOffset.left,this.plotOffset.top);A.lineJoin="miter";A.lineWidth=C;A.strokeStyle=B.color;this.plotBarsShadows(B,D,0,B.bars.fill);if(B.bars.fill){A.fillStyle=B.bars.fillColor!=null?B.bars.fillColor:Flotr.parseColor(B.color).scale(null,null,null,B.bars.fillOpacity).toString()}this.plotBars(B,D,0,B.bars.fill);A.restore()},plotBars:function(K,N,D,Q){var U=K.data;if(U.length<1){return }var S=K.xaxis,B=K.yaxis,P=this.ctx,F=this.tHoz.bind(this),O=this.tVert.bind(this);for(var R=0;R<U.length;R++){var J=U[R][0],I=U[R][1];var E=true,L=true,A=true;var H=0;if(K.bars.stacked){S.values.each(function(W,V){if(V==J){H=W.stack||0;W.stack=H+I}})}if(K.bars.horizontal){var C=H,T=J+H,G=I,M=I+N}else{var C=J,T=J+N,G=H,M=I+H}if(T<S.min||C>S.max||M<B.min||G>B.max){continue}if(C<S.min){C=S.min;E=false}if(T>S.max){T=S.max;if(S.lastSerie!=K&&K.bars.horizontal){L=false}}if(G<B.min){G=B.min}if(M>B.max){M=B.max;if(B.lastSerie!=K&&!K.bars.horizontal){L=false}}if(Q){P.beginPath();P.moveTo(F(C,S),O(G,B)+D);P.lineTo(F(C,S),O(M,B)+D);P.lineTo(F(T,S),O(M,B)+D);P.lineTo(F(T,S),O(G,B)+D);P.fill()}if(K.bars.lineWidth!=0&&(E||A||L)){P.beginPath();P.moveTo(F(C,S),O(G,B)+D);P[E?"lineTo":"moveTo"](F(C,S),O(M,B)+D);P[L?"lineTo":"moveTo"](F(T,S),O(M,B)+D);P[A?"lineTo":"moveTo"](F(T,S),O(G,B)+D);P.stroke()}}},plotBarsShadows:function(I,K,C){var T=I.data;if(T.length<1){return }var R=I.xaxis,A=I.yaxis,P=this.ctx,D=this.tHoz.bind(this),M=this.tVert.bind(this),N=this.options.shadowSize;for(var Q=0;Q<T.length;Q++){var H=T[Q][0],G=T[Q][1];var E=0;if(I.bars.stacked){R.values.each(function(V,U){if(U==H){E=V.stackShadow||0;V.stackShadow=E+G}})}if(I.bars.horizontal){var B=E,S=H+E,F=G,J=G+K}else{var B=H,S=H+K,F=E,J=G+E}if(S<R.min||B>R.max||J<A.min||F>A.max){continue}if(B<R.min){B=R.min}if(S>R.max){S=R.max}if(F<A.min){F=A.min}if(J>A.max){J=A.max}var O=D(S,R)-D(B,R)-((D(S,R)+N<=this.plotWidth)?0:N);var L=Math.max(0,M(F,A)-M(J,A)-((M(F,A)+N<=this.plotHeight)?0:N));P.fillStyle="rgba(0,0,0,0.05)";P.fillRect(Math.min(D(B,R)+N,this.plotWidth),Math.min(M(J,A)+N,this.plotWidth),O,L)}},drawSeriesCandles:function(B){var A=this.ctx,C=B.candles.candleWidth;A.save();A.translate(this.plotOffset.left,this.plotOffset.top);A.lineJoin="miter";A.lineWidth=B.candles.lineWidth;this.plotCandlesShadows(B,C/2);this.plotCandles(B,C/2);A.restore()},plotCandles:function(K,D){var W=K.data;if(W.length<1){return }var T=K.xaxis,B=K.yaxis,P=this.ctx,E=this.tHoz.bind(this),O=this.tVert.bind(this);for(var S=0;S<W.length;S++){var U=W[S],J=U[0],L=U[1],I=U[2],X=U[3],N=U[4];var C=J,V=J+K.candles.candleWidth,G=Math.max(B.min,X),M=Math.min(B.max,I),A=Math.max(B.min,Math.min(L,N)),R=Math.min(B.max,Math.max(L,N));if(V<T.min||C>T.max||M<B.min||G>B.max){continue}var Q=K.candles[L>N?"downFillColor":"upFillColor"];if(K.candles.fill&&!K.candles.barcharts){P.fillStyle=Flotr.parseColor(Q).scale(null,null,null,K.candles.fillOpacity).toString();P.fillRect(E(C,T),O(R,B)+D,E(V,T)-E(C,T),O(A,B)-O(R,B))}if(K.candles.lineWidth||K.candles.wickLineWidth){var J,H,F=(K.candles.wickLineWidth%2)/2;J=Math.floor(E((C+V)/2),T)+F;P.save();P.strokeStyle=Q;P.lineWidth=K.candles.wickLineWidth;P.lineCap="butt";if(K.candles.barcharts){P.beginPath();P.moveTo(J,Math.floor(O(M,B)+D));P.lineTo(J,Math.floor(O(G,B)+D));H=Math.floor(O(L,B)+D)+0.5;P.moveTo(Math.floor(E(C,T))+F,H);P.lineTo(J,H);H=Math.floor(O(N,B)+D)+0.5;P.moveTo(Math.floor(E(V,T))+F,H);P.lineTo(J,H)}else{P.strokeRect(E(C,T),O(R,B)+D,E(V,T)-E(C,T),O(A,B)-O(R,B));P.beginPath();P.moveTo(J,Math.floor(O(R,B)+D));P.lineTo(J,Math.floor(O(M,B)+D));P.moveTo(J,Math.floor(O(A,B)+D));P.lineTo(J,Math.floor(O(G,B)+D))}P.stroke();P.restore()}}},plotCandlesShadows:function(H,C){var T=H.data;if(T.length<1||H.candles.barcharts){return }var Q=H.xaxis,A=H.yaxis,D=this.tHoz.bind(this),M=this.tVert.bind(this),N=this.options.shadowSize;for(var P=0;P<T.length;P++){var R=T[P],G=R[0],I=R[1],F=R[2],U=R[3],K=R[4];var B=G,S=G+H.candles.candleWidth,E=Math.max(A.min,Math.min(I,K)),J=Math.min(A.max,Math.max(I,K));if(S<Q.min||B>Q.max||J<A.min||E>A.max){continue}var O=D(S,Q)-D(B,Q)-((D(S,Q)+N<=this.plotWidth)?0:N);var L=Math.max(0,M(E,A)-M(J,A)-((M(E,A)+N<=this.plotHeight)?0:N));this.ctx.fillStyle="rgba(0,0,0,0.05)";this.ctx.fillRect(Math.min(D(B,Q)+N,this.plotWidth),Math.min(M(J,A)+N,this.plotWidth),O,L)}},drawSeriesPie:function(G){if(!this.options.pie.drawn){var K=this.ctx,C=this.options,E=G.pie.lineWidth,I=G.shadowSize,R=G.data,D=(Math.min(this.canvasWidth,this.canvasHeight)*G.pie.sizeRatio)/2,H=[];var L=1;var P=Math.sin(G.pie.viewAngle)*G.pie.spliceThickness/L;var M={size:C.fontSize*1.2,color:C.grid.color,weight:1.5};var Q={x:(this.canvasWidth+this.plotOffset.left)/2,y:(this.canvasHeight-this.plotOffset.bottom)/2};var O=this.series.collect(function(T,S){if(T.pie.show){return{name:(T.label||T.data[0][1]),value:[S,T.data[0][1]],explode:T.pie.explode}}});var B=O.pluck("value").pluck(1).inject(0,function(S,T){return S+T});var F=0,N=G.pie.startAngle,J=0;var A=O.collect(function(S){N+=F;J=parseFloat(S.value[1]);F=J/B;return{name:S.name,fraction:F,x:S.value[0],y:J,explode:S.explode,startAngle:2*N*Math.PI,endAngle:2*(N+F)*Math.PI}});K.save();if(I>0){A.each(function(V){var S=(V.startAngle+V.endAngle)/2;var T=Q.x+Math.cos(S)*V.explode+I;var U=Q.y+Math.sin(S)*V.explode+I;this.plotSlice(T,U,D,V.startAngle,V.endAngle,false,L);K.fillStyle="rgba(0,0,0,0.1)";K.fill()},this)}if(C.HtmlText){H=['<div style="color:'+this.options.grid.color+'" class="flotr-labels">']}A.each(function(c,X){var W=(c.startAngle+c.endAngle)/2;var V=C.colors[X];var Y=Q.x+Math.cos(W)*c.explode;var U=Q.y+Math.sin(W)*c.explode;this.plotSlice(Y,U,D,c.startAngle,c.endAngle,false,L);if(G.pie.fill){K.fillStyle=Flotr.parseColor(V).scale(null,null,null,G.pie.fillOpacity).toString();K.fill()}K.lineWidth=E;K.strokeStyle=V;K.stroke();var b=C.pie.labelFormatter(c);var S=(Math.cos(W)<0);var a=Y+Math.cos(W)*(G.pie.explode+D);var Z=U+Math.sin(W)*(G.pie.explode+D);if(c.fraction&&b){if(C.HtmlText){var T="position:absolute;top:"+(Z-5)+"px;";if(S){T+="right:"+(this.canvasWidth-a)+"px;text-align:right;"}else{T+="left:"+a+"px;text-align:left;"}H.push('<div style="'+T+'" class="flotr-grid-label">'+b+"</div>")}else{M.halign=S?"r":"l";K.drawText(b,a,Z+M.size/2,M)}}},this);if(C.HtmlText){H.push("</div>");this.el.insert(H.join(""))}K.restore();C.pie.drawn=true}},plotSlice:function(B,H,A,E,D,F,G){var C=this.ctx;G=G||1;C.save();C.scale(1,G);C.beginPath();C.moveTo(B,H);C.arc(B,H,A,E,D,F);C.lineTo(B,H);C.closePath();C.restore()},plotPie:function(){},insertLegend:function(){if(!this.options.legend.show){return }var H=this.series,I=this.plotOffset,B=this.options,b=[],A=false,O=this.ctx,R;var Q=H.findAll(function(c){return(c.label&&!c.hide)}).size();if(Q){if(!B.HtmlText&&this.textEnabled){var T={size:B.fontSize*1.1,color:B.grid.color};var M=B.legend.position,N=B.legend.margin,L=B.legend.labelBoxWidth,Z=B.legend.labelBoxHeight,S=B.legend.labelBoxMargin,W=I.left+N,U=I.top+N;var a=0;for(R=H.length-1;R>-1;--R){if(!H[R].label||H[R].hide){continue}var E=B.legend.labelFormatter(H[R].label);a=Math.max(a,O.measureText(E,T))}var K=Math.round(L+S*3+a),C=Math.round(Q*(S+Z)+S);if(M.charAt(0)=="s"){U=I.top+this.plotHeight-(N+C)}if(M.charAt(1)=="e"){W=I.left+this.plotWidth-(N+K)}var P=Flotr.parseColor(B.legend.backgroundColor||"rgb(240,240,240)").scale(null,null,null,B.legend.backgroundOpacity||0.1).toString();O.fillStyle=P;O.fillRect(W,U,K,C);O.strokeStyle=B.legend.labelBoxBorderColor;O.strokeRect(Flotr.toPixel(W),Flotr.toPixel(U),K,C);var G=W+S;var F=U+S;for(R=0;R<H.length;R++){if(!H[R].label||H[R].hide){continue}var E=B.legend.labelFormatter(H[R].label);O.fillStyle=H[R].color;O.fillRect(G,F,L-1,Z-1);O.strokeStyle=B.legend.labelBoxBorderColor;O.lineWidth=1;O.strokeRect(Math.ceil(G)-1.5,Math.ceil(F)-1.5,L+2,Z+2);O.drawText(E,G+L+S,F+(Z+T.size-O.fontDescent(T))/2,T);F+=Z+S}}else{for(R=0;R<H.length;++R){if(!H[R].label||H[R].hide){continue}if(R%B.legend.noColumns==0){b.push(A?"</tr><tr>":"<tr>");A=true}var E=B.legend.labelFormatter(H[R].label);b.push('<td class="flotr-legend-color-box"><div style="border:1px solid '+B.legend.labelBoxBorderColor+';padding:1px"><div style="width:'+B.legend.labelBoxWidth+"px;height:"+B.legend.labelBoxHeight+"px;background-color:"+H[R].color+'"></div></div></td><td class="flotr-legend-label">'+E+"</td>")}if(A){b.push("</tr>")}if(b.length>0){var V='<table style="font-size:smaller;color:'+B.grid.color+'">'+b.join("")+"</table>";if(B.legend.container!=null){$(B.legend.container).update(V)}else{var D="";var M=B.legend.position,N=B.legend.margin;if(M.charAt(0)=="n"){D+="top:"+(N+I.top)+"px;"}else{if(M.charAt(0)=="s"){D+="bottom:"+(N+I.bottom)+"px;"}}if(M.charAt(1)=="e"){D+="right:"+(N+I.right)+"px;"}else{if(M.charAt(1)=="w"){D+="left:"+(N+I.left)+"px;"}}var J=this.el.insert('<div class="flotr-legend" style="position:absolute;z-index:2;'+D+'">'+V+"</div>").select("div.flotr-legend").first();if(B.legend.backgroundOpacity!=0){var Y=B.legend.backgroundColor;if(Y==null){var X=(B.grid.backgroundColor!=null)?B.grid.backgroundColor:Flotr.extractColor(J);Y=Flotr.parseColor(X).adjust(null,null,null,1).toString()}this.el.insert('<div class="flotr-legend-bg" style="position:absolute;width:'+J.getWidth()+"px;height:"+J.getHeight()+"px;"+D+"background-color:"+Y+';"> </div>').select("div.flotr-legend-bg").first().setStyle({opacity:B.legend.backgroundOpacity})}}}}}},getEventPosition:function(C){var G=this.overlay.cumulativeOffset(),F=(C.pageX-G.left-this.plotOffset.left),E=(C.pageY-G.top-this.plotOffset.top),D=0,B=0;if(C.pageX==null&&C.clientX!=null){var H=document.documentElement,A=document.body;D=C.clientX+(H&&H.scrollLeft||A.scrollLeft||0);B=C.clientY+(H&&H.scrollTop||A.scrollTop||0)}else{D=C.pageX;B=C.pageY}return{x:this.axes.x.min+F/this.axes.x.scale,x2:this.axes.x2.min+F/this.axes.x2.scale,y:this.axes.y.max-E/this.axes.y.scale,y2:this.axes.y2.max-E/this.axes.y2.scale,relX:F,relY:E,absX:D,absY:B}},clickHandler:function(A){if(this.ignoreClick){this.ignoreClick=false;return }this.el.fire("flotr:click",[this.getEventPosition(A),this])},mouseMoveHandler:function(A){var B=this.getEventPosition(A);this.lastMousePos.pageX=B.absX;this.lastMousePos.pageY=B.absY;if(this.selectionInterval==null&&(this.options.mouse.track||this.series.any(function(C){return C.mouse&&C.mouse.track}))){this.hit(B)}this.el.fire("flotr:mousemove",[A,B,this])},mouseDownHandler:function(C){if(C.isRightClick()){C.stop();var B=this.overlay;B.hide();function A(){B.show();$(document).stopObserving("mousemove",A)}$(document).observe("mousemove",A);return }if(!this.options.selection.mode||!C.isLeftClick()){return }this.setSelectionPos(this.selection.first,C);if(this.selectionInterval!=null){clearInterval(this.selectionInterval)}this.lastMousePos.pageX=null;this.selectionInterval=setInterval(this.updateSelection.bind(this),1000/this.options.selection.fps);this.mouseUpHandler=this.mouseUpHandler.bind(this);$(document).observe("mouseup",this.mouseUpHandler)},fireSelectEvent:function(){var A=this.axes,F=this.selection,C=(F.first.x<=F.second.x)?F.first.x:F.second.x,B=(F.first.x<=F.second.x)?F.second.x:F.first.x,E=(F.first.y>=F.second.y)?F.first.y:F.second.y,D=(F.first.y>=F.second.y)?F.second.y:F.first.y;C=A.x.min+C/A.x.scale;B=A.x.min+B/A.x.scale;E=A.y.max-E/A.y.scale;D=A.y.max-D/A.y.scale;this.el.fire("flotr:select",[{x1:C,y1:E,x2:B,y2:D},this])},mouseUpHandler:function(A){$(document).stopObserving("mouseup",this.mouseUpHandler);A.stop();if(this.selectionInterval!=null){clearInterval(this.selectionInterval);this.selectionInterval=null}this.setSelectionPos(this.selection.second,A);this.clearSelection();if(this.selectionIsSane()){this.drawSelection();this.fireSelectEvent();this.ignoreClick=true}},setSelectionPos:function(D,B){var A=this.options,C=$(this.overlay).cumulativeOffset();if(A.selection.mode.indexOf("x")==-1){D.x=(D==this.selection.first)?0:this.plotWidth}else{D.x=B.pageX-C.left-this.plotOffset.left;D.x=Math.min(Math.max(0,D.x),this.plotWidth)}if(A.selection.mode.indexOf("y")==-1){D.y=(D==this.selection.first)?0:this.plotHeight}else{D.y=B.pageY-C.top-this.plotOffset.top;D.y=Math.min(Math.max(0,D.y),this.plotHeight)}},updateSelection:function(){if(this.lastMousePos.pageX==null){return }this.setSelectionPos(this.selection.second,this.lastMousePos);this.clearSelection();if(this.selectionIsSane()){this.drawSelection()}},clearSelection:function(){if(this.prevSelection==null){return }var G=this.prevSelection,E=this.octx,C=this.plotOffset,A=Math.min(G.first.x,G.second.x),F=Math.min(G.first.y,G.second.y),B=Math.abs(G.second.x-G.first.x),D=Math.abs(G.second.y-G.first.y);E.clearRect(A+C.left-E.lineWidth,F+C.top-E.lineWidth,B+E.lineWidth*2,D+E.lineWidth*2);this.prevSelection=null},setSelection:function(G){var B=this.options,H=this.axes.x,A=this.axes.y,F=yaxis.scale,D=xaxis.scale,E=B.selection.mode.indexOf("x")!=-1,C=B.selection.mode.indexOf("y")!=-1;this.clearSelection();this.selection.first.y=E?0:(A.max-G.y1)*F;this.selection.second.y=E?this.plotHeight:(A.max-G.y2)*F;this.selection.first.x=C?0:(G.x1-H.min)*D;this.selection.second.x=C?this.plotWidth:(G.x2-H.min)*D;this.drawSelection();this.fireSelectEvent()},drawSelection:function(){var C=this.prevSelection,F=this.selection,H=this.octx,I=this.options,A=this.plotOffset;if(C!=null&&F.first.x==C.first.x&&F.first.y==C.first.y&&F.second.x==C.second.x&&F.second.y==C.second.y){return }H.strokeStyle=Flotr.parseColor(I.selection.color).scale(null,null,null,0.8).toString();H.lineWidth=1;H.lineJoin="round";H.fillStyle=Flotr.parseColor(I.selection.color).scale(null,null,null,0.4).toString();this.prevSelection={first:{x:F.first.x,y:F.first.y},second:{x:F.second.x,y:F.second.y}};var E=Math.min(F.first.x,F.second.x),D=Math.min(F.first.y,F.second.y),G=Math.abs(F.second.x-F.first.x),B=Math.abs(F.second.y-F.first.y);H.fillRect(E+A.left,D+A.top,G,B);H.strokeRect(E+A.left,D+A.top,G,B)},selectionIsSane:function(){var A=this.selection;return Math.abs(A.second.x-A.first.x)>=5&&Math.abs(A.second.y-A.first.y)>=5},clearHit:function(){if(this.prevHit){var B=this.options,A=this.plotOffset,C=this.prevHit;this.octx.clearRect(this.tHoz(C.x)+A.left-B.points.radius*2,this.tVert(C.y)+A.top-B.points.radius*2,B.points.radius*3+B.points.lineWidth*3,B.points.radius*3+B.points.lineWidth*3);this.prevHit=null}},hit:function(I){var G=this.series,C=this.options,R=this.prevHit,H=this.plotOffset,D=this.octx,S,A,M,Q,L={dist:Number.MAX_VALUE,x:null,y:null,relX:I.relX,relY:I.relY,absX:I.absX,absY:I.absY,mouse:null};for(Q=0;Q<G.length;Q++){s=G[Q];if(!s.mouse.track){continue}S=s.data;A=(s.xaxis.scale*s.mouse.sensibility);M=(s.yaxis.scale*s.mouse.sensibility);for(var P=0,B,E;P<S.length;P++){if(S[P][1]===null){continue}B=Math.pow(s.xaxis.scale*(S[P][0]-I.x),2);E=Math.pow(s.yaxis.scale*(S[P][1]-I.y),2);if(B<A&&E<M&&Math.sqrt(B+E)<L.dist){L.dist=Math.sqrt(B+E);L.x=S[P][0];L.y=S[P][1];L.mouse=s.mouse}}}if(L.mouse&&L.mouse.track&&!R||(R&&(L.x!=R.x||L.y!=R.y))){var K=this.mouseTrack||this.el.select(".flotr-mouse-value")[0],F="",J=C.mouse.position,N=C.mouse.margin,O="opacity:0.7;background-color:#000;color:#fff;display:none;position:absolute;padding:2px 8px;-moz-border-radius:4px;border-radius:4px;white-space:nowrap;";if(!C.mouse.relative){if(J.charAt(0)=="n"){F+="top:"+(N+H.top)+"px;"}else{if(J.charAt(0)=="s"){F+="bottom:"+(N+H.bottom)+"px;"}}if(J.charAt(1)=="e"){F+="right:"+(N+H.right)+"px;"}else{if(J.charAt(1)=="w"){F+="left:"+(N+H.left)+"px;"}}}else{if(J.charAt(0)=="n"){F+="bottom:"+(N-H.top-this.tVert(L.y)+this.canvasHeight)+"px;"}else{if(J.charAt(0)=="s"){F+="top:"+(N+H.top+this.tVert(L.y))+"px;"}}if(J.charAt(1)=="e"){F+="left:"+(N+H.left+this.tHoz(L.x))+"px;"}else{if(J.charAt(1)=="w"){F+="right:"+(N-H.left-this.tHoz(L.x)+this.canvasWidth)+"px;"}}}O+=F;if(!K){this.el.insert('<div class="flotr-mouse-value" style="'+O+'"></div>');K=this.mouseTrack=this.el.select(".flotr-mouse-value").first()}else{this.mouseTrack=K.setStyle(O)}if(L.x!==null&&L.y!==null){K.show();this.clearHit();if(L.mouse.lineColor!=null){D.save();D.translate(H.left,H.top);D.lineWidth=C.points.lineWidth;D.strokeStyle=L.mouse.lineColor;D.fillStyle="#ffffff";D.beginPath();D.arc(this.tHoz(L.x),this.tVert(L.y),C.mouse.radius,0,2*Math.PI,true);D.fill();D.stroke();D.restore()}this.prevHit=L;var T=L.mouse.trackDecimals;if(T==null||T<0){T=0}K.innerHTML=L.mouse.trackFormatter({x:L.x.toFixed(T),y:L.y.toFixed(T)});K.fire("flotr:hit",[L,this])}else{if(R){K.hide();this.clearHit()}}}},saveImage:function(D,C,A,B){var E=null;switch(D){case"jpeg":case"jpg":E=Canvas2Image.saveAsJPEG(this.canvas,B,C,A);break;default:case"png":E=Canvas2Image.saveAsPNG(this.canvas,B,C,A);break;case"bmp":E=Canvas2Image.saveAsBMP(this.canvas,B,C,A);break}if(Object.isElement(E)&&B){this.restoreCanvas();this.canvas.hide();this.overlay.hide();this.el.insert(E.setStyle({position:"absolute"}))}},restoreCanvas:function(){this.canvas.show();this.overlay.show();this.el.select("img").invoke("remove")}});Flotr.Color=Class.create({initialize:function(E,D,B,C){this.rgba=["r","g","b","a"];var A=4;while(-1<--A){this[this.rgba[A]]=arguments[A]||((A==3)?1:0)}this.normalize()},adjust:function(D,C,E,B){var A=4;while(-1<--A){if(arguments[A]!=null){this[this.rgba[A]]+=arguments[A]}}return this.normalize()},clone:function(){return new Flotr.Color(this.r,this.b,this.g,this.a)},limit:function(B,A,C){return Math.max(Math.min(B,C),A)},normalize:function(){var A=this.limit;this.r=A(parseInt(this.r),0,255);this.g=A(parseInt(this.g),0,255);this.b=A(parseInt(this.b),0,255);this.a=A(this.a,0,1);return this},scale:function(D,C,E,B){var A=4;while(-1<--A){if(arguments[A]!=null){this[this.rgba[A]]*=arguments[A]}}return this.normalize()},distance:function(B){if(!B){return }B=new Flotr.parseColor(B);var C=0;var A=3;while(-1<--A){C+=Math.abs(this[this.rgba[A]]-B[this.rgba[A]])}return C},toString:function(){return(this.a>=1)?"rgb("+[this.r,this.g,this.b].join(",")+")":"rgba("+[this.r,this.g,this.b,this.a].join(",")+")"}});Flotr.Color.lookupColors={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0]};Flotr.Date={format:function(F,E){if(!F){return }var A=function(H){H=H.toString();return H.length==1?"0"+H:H};var D=[];var C=false;for(var B=0;B<E.length;++B){var G=E.charAt(B);if(C){switch(G){case"h":G=F.getUTCHours().toString();break;case"H":G=A(F.getUTCHours());break;case"M":G=A(F.getUTCMinutes());break;case"S":G=A(F.getUTCSeconds());break;case"d":G=F.getUTCDate().toString();break;case"m":G=(F.getUTCMonth()+1).toString();break;case"y":G=F.getUTCFullYear().toString();break;case"b":G=Flotr.Date.monthNames[F.getUTCMonth()];break}D.push(G);C=false}else{if(G=="%"){C=true}else{D.push(G)}}}return D.join("")},timeUnits:{second:1000,minute:60*1000,hour:60*60*1000,day:24*60*60*1000,month:30*24*60*60*1000,year:365.2425*24*60*60*1000},spec:[[1,"second"],[2,"second"],[5,"second"],[10,"second"],[30,"second"],[1,"minute"],[2,"minute"],[5,"minute"],[10,"minute"],[30,"minute"],[1,"hour"],[2,"hour"],[4,"hour"],[8,"hour"],[12,"hour"],[1,"day"],[2,"day"],[3,"day"],[0.25,"month"],[0.5,"month"],[1,"month"],[2,"month"],[3,"month"],[6,"month"],[1,"year"]],monthNames:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"]};
+

--- a/js/flotr/flotr.debug-0.2.0-alpha_radar1.js
+++ /dev/null
@@ -1,3349 +1,1 @@
-//Flotr 0.2.0-alpha Copyright (c) 2009 Bas Wenneker, <http://solutoire.com>, MIT License.

-//

-//Radar chart added by Ryan Simmons

-//
-/* $Id: flotr.js 82 2009-01-12 19:19:31Z fabien.menager $ */

-

-var Flotr = {

-	version: '0.2.0-alpha',

-	author: 'Bas Wenneker',

-	website: 'http://www.solutoire.com',

-	/**

-	 * An object of the default registered graph types. Use Flotr.register(type, functionName)

-	 * to add your own type.

-	 */

-	_registeredTypes:{

-		'lines': 'drawSeriesLines',

-		'points': 'drawSeriesPoints',

-		'bars': 'drawSeriesBars',

-		'candles': 'drawSeriesCandles',

-		'pie': 'drawSeriesPie',

-		'radar':'drawSeriesRadar'

-	},

-	/**

-	 * Can be used to register your own chart type. Default types are 'lines', 'points' and 'bars'.

-	 * This is still experimental.

-	 * @todo Test and confirm.

-	 * @param {String} type - type of chart, like 'pies', 'bars' etc.

-	 * @param {String} functionName - Name of the draw function, like 'drawSeriesPies', 'drawSeriesBars' etc.

-	 */

-	register: function(type, functionName){

-		Flotr._registeredTypes[type] = functionName+'';	

-	},

-	/**

-	 * Draws the graph. This function is here for backwards compatibility with Flotr version 0.1.0alpha.

-	 * You could also draw graphs by directly calling Flotr.Graph(element, data, options).

-	 * @param {Element} el - element to insert the graph into

-	 * @param {Object} data - an array or object of dataseries

-	 * @param {Object} options - an object containing options

-	 * @param {Class} _GraphKlass_ - (optional) Class to pass the arguments to, defaults to Flotr.Graph

-	 * @return {Class} returns a new graph object and of course draws the graph.

-	 */

-	draw: function(el, data, options, _GraphKlass_){	

-		_GraphKlass_ = _GraphKlass_ || Flotr.Graph;

-		return new _GraphKlass_(el, data, options);

-	},

-	/**

-	 * Collects dataseries from input and parses the series into the right format. It returns an Array 

-	 * of Objects each having at least the 'data' key set.

-	 * @param {Array/Object} data - Object or array of dataseries

-	 * @return {Array} Array of Objects parsed into the right format ({(...,) data: [[x1,y1], [x2,y2], ...] (, ...)})

-	 */

-	getSeries: function(data){

-		return data.collect(function(serie){

-			var i, serie = (serie.data) ? Object.clone(serie) : {'data': serie};

-			for (i = serie.data.length-1; i > -1; --i) {

-				serie.data[i][1] = (serie.data[i][1] === null ? null : parseFloat(serie.data[i][1])); 

-			}

-			return serie;

-		});

-	},

-	/**

-	 * Recursively merges two objects.

-	 * @param {Object} src - source object (likely the object with the least properties)

-	 * @param {Object} dest - destination object (optional, object with the most properties)

-	 * @return {Object} recursively merged Object

-	 */

-	merge: function(src, dest){

-		var result = dest || {};

-		for(var i in src){

-			result[i] = (src[i] != null && typeof(src[i]) == 'object' && !(src[i].constructor == Array || src[i].constructor == RegExp) && !Object.isElement(src[i])) ? Flotr.merge(src[i], dest[i]) : result[i] = src[i];		

-		}

-		return result;

-	},	

-	/**

-	 * Function calculates the ticksize and returns it.

-	 * @param {Integer} noTicks - number of ticks

-	 * @param {Integer} min - lower bound integer value for the current axis

-	 * @param {Integer} max - upper bound integer value for the current axis

-	 * @param {Integer} decimals - number of decimals for the ticks

-	 * @return {Integer} returns the ticksize in pixels

-	 */

-	getTickSize: function(noTicks, min, max, decimals){

-		var delta = (max - min) / noTicks;	

-		var magn = Flotr.getMagnitude(delta);

-		

-		// Norm is between 1.0 and 10.0.

-		var norm = delta / magn;

-		

-		var tickSize = 10;

-		if(norm < 1.5) tickSize = 1;

-		else if(norm < 2.25) tickSize = 2;

-		else if(norm < 3) tickSize = ((decimals == 0) ? 2 : 2.5);

-		else if(norm < 7.5) tickSize = 5;

-		

-		return tickSize * magn;

-	},

-	/**

-	 * Default tick formatter.

-	 * @param {String/Integer} val - tick value integer

-	 * @return {String} formatted tick string

-	 */

-	defaultTickFormatter: function(val){

-		return val+'';

-	},

-	/**

-	 * Formats the mouse tracker values.

-	 * @param {Object} obj - Track value Object {x:..,y:..}

-	 * @return {String} Formatted track string

-	 */

-	defaultTrackFormatter: function(obj){

-		return '('+obj.x+', '+obj.y+')';

-	}, 

-	defaultPieLabelFormatter: function(slice) {

-	  return (slice.fraction*100).toFixed(2)+'%';

-	},

-	/**

-	 * Returns the magnitude of the input value.

-	 * @param {Integer/Float} x - integer or float value

-	 * @return {Integer/Float} returns the magnitude of the input value

-	 */

-	getMagnitude: function(x){

-		return Math.pow(10, Math.floor(Math.log(x) / Math.LN10));

-	},

-	toPixel: function(val){

-		return Math.floor(val)+0.5;//((val-Math.round(val) < 0.4) ? (Math.floor(val)-0.5) : val);

-	},

-	toRad: function(angle){

-		return -angle * (Math.PI/180);

-	},

-	/**

-	 * Parses a color string and returns a corresponding Color.

-	 * @param {String} str - string thats representing a color

-	 * @return {Color} returns a Color object or false

-	 */

-	parseColor: function(str){

-		if (str instanceof Flotr.Color) return str;

-		

-		var result, Color = Flotr.Color;

-

-		// rgb(num,num,num)

-		if((result = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(str)))

-			return new Color(parseInt(result[1]), parseInt(result[2]), parseInt(result[3]));

-	

-		// rgba(num,num,num,num)

-		if((result = /rgba\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(str)))

-			return new Color(parseInt(result[1]), parseInt(result[2]), parseInt(result[3]), parseFloat(result[4]));

-			

-		// rgb(num%,num%,num%)

-		if((result = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(str)))

-			return new Color(parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55);

-	

-		// rgba(num%,num%,num%,num)

-		if((result = /rgba\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(str)))

-			return new Color(parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55, parseFloat(result[4]));

-			

-		// #a0b1c2

-		if((result = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(str)))

-			return new Color(parseInt(result[1],16), parseInt(result[2],16), parseInt(result[3],16));

-	

-		// #fff

-		if((result = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(str)))

-			return new Color(parseInt(result[1]+result[1],16), parseInt(result[2]+result[2],16), parseInt(result[3]+result[3],16));

-

-		// Otherwise, we're most likely dealing with a named color.

-		var name = str.strip().toLowerCase();

-		if(name == 'transparent'){

-			return new Color(255, 255, 255, 0);

-		}

-		return ((result = Color.lookupColors[name])) ? new Color(result[0], result[1], result[2]) : false;

-	},

-	/**

-	 * Extracts the background-color of the passed element.

-	 * @param {Element} element

-	 * @return {String} color string

-	 */

-	extractColor: function(element){

-		var color;

-		// Loop until we find an element with a background color and stop when we hit the body element. 

-		do {

-			color = element.getStyle('background-color').toLowerCase();

-			if(!(color == '' || color == 'transparent')) break;

-			element = element.up(0);

-		} while(!element.nodeName.match(/^body$/i));

-

-		// Catch Safari's way of signaling transparent.

-		return (color == 'rgba(0, 0, 0, 0)') ? 'transparent' : color;

-	}

-};

-/**

- * Flotr Graph class that plots a graph on creation.

-

- */

-Flotr.Graph = Class.create({

-	/**

-	 * Flotr Graph constructor.

-	 * @param {Element} el - element to insert the graph into

-	 * @param {Object} data - an array or object of dataseries

- 	 * @param {Object} options - an object containing options

-	 */

-	initialize: function(el, data, options){

-		this.el = $(el);

-		

-		if (!this.el) throw 'The target container doesn\'t exist';

-		

-		this.data = data;

-		this.series = Flotr.getSeries(data);

-		this.setOptions(options);

-		

-		// Initialize some variables

-		this.lastMousePos = { pageX: null, pageY: null };

-		this.selection = { first: { x: -1, y: -1}, second: { x: -1, y: -1} };

-		this.prevSelection = null;

-		this.selectionInterval = null;

-		this.ignoreClick = false;   

-		this.prevHit = null;

-    

-		// Create and prepare canvas.

-		this.constructCanvas();

-		

-		// Add event handlers for mouse tracking, clicking and selection

-		this.initEvents();

-		

-		this.findDataRanges();

-		this.calculateTicks(this.axes.x);

-		this.calculateTicks(this.axes.x2);

-		this.calculateTicks(this.axes.y);

-		this.calculateTicks(this.axes.y2);

-		

-		this.calculateSpacing();

-		this.draw();

-		this.insertLegend();

-    

-		// Graph and Data tabs

-		if (this.options.spreadsheet.show) 

-		this.constructTabs();

-	},

-	/**

-	 * Sets options and initializes some variables and color specific values, used by the constructor. 

-	 * @param {Object} opts - options object

-	 */

-  setOptions: function(opts){

-    var options = {

-      colors: ['#00A8F0', '#C0D800', '#CB4B4B', '#4DA74D', '#9440ED'], //=> The default colorscheme. When there are > 5 series, additional colors are generated.

-      title: null,

-      subtitle: null,

-      legend: {

-        show: true,            // => setting to true will show the legend, hide otherwise

-        noColumns: 1,          // => number of colums in legend table // @todo: doesn't work for HtmlText = false

-        labelFormatter: Prototype.K, // => fn: string -> string

-        labelBoxBorderColor: '#CCCCCC', // => border color for the little label boxes

-        labelBoxWidth: 14,

-        labelBoxHeight: 10,

-        labelBoxMargin: 5,

-        container: null,       // => container (as jQuery object) to put legend in, null means default on top of graph

-        position: 'nw',        // => position of default legend container within plot

-        margin: 5,             // => distance from grid edge to default legend container within plot

-        backgroundColor: null, // => null means auto-detect

-        backgroundOpacity: 0.85// => set to 0 to avoid background, set to 1 for a solid background

-      },

-      xaxis: {

-        ticks: null,           // => format: either [1, 3] or [[1, 'a'], 3]

-        showLabels: true,      // => setting to true will show the axis ticks labels, hide otherwise

-        labelsAngle: 0,        // => Labels' angle, in degrees

-        title: null,           // => axis title

-        titleAngle: 0,         // => axis title's angle, in degrees

-        noTicks: 5,            // => number of ticks for automagically generated ticks

-        tickFormatter: Flotr.defaultTickFormatter, // => fn: number -> string

-        tickDecimals: null,    // => no. of decimals, null means auto

-        min: null,             // => min. value to show, null means set automatically

-        max: null,             // => max. value to show, null means set automatically

-        autoscaleMargin: 0,    // => margin in % to add if auto-setting min/max

-        color: null

-      },

-      x2axis: {},

-      yaxis: {

-        ticks: null,           // => format: either [1, 3] or [[1, 'a'], 3]

-        showLabels: true,      // => setting to true will show the axis ticks labels, hide otherwise

-        labelsAngle: 0,        // => Labels' angle, in degrees

-        title: null,           // => axis title

-        titleAngle: 90,        // => axis title's angle, in degrees

-        noTicks: 5,            // => number of ticks for automagically generated ticks

-        tickFormatter: Flotr.defaultTickFormatter, // => fn: number -> string

-        tickDecimals: null,    // => no. of decimals, null means auto

-        min: null,             // => min. value to show, null means set automatically

-        max: null,             // => max. value to show, null means set automatically

-        autoscaleMargin: 0,    // => margin in % to add if auto-setting min/max

-        color: null

-      },

-      y2axis: {

-      	titleAngle: 270

-      },

-      points: {

-        show: false,           // => setting to true will show points, false will hide

-        radius: 3,             // => point radius (pixels)

-        lineWidth: 2,          // => line width in pixels

-        fill: true,            // => true to fill the points with a color, false for (transparent) no fill

-        fillColor: '#FFFFFF',  // => fill color

-        fillOpacity: 0.4

-      },

-      lines: {

-        show: false,           // => setting to true will show lines, false will hide

-        lineWidth: 2,          // => line width in pixels

-        fill: false,           // => true to fill the area from the line to the x axis, false for (transparent) no fill

-        fillColor: null,       // => fill color

-        fillOpacity: 0.4       // => opacity of the fill color, set to 1 for a solid fill, 0 hides the fill

-      },

-      radar: {

-        show: false,           // => setting to true will show radar chart, false will hide

-        lineWidth: 2,          // => line width in pixels

-        fill: false,           // => true to fill the area from the line to the x axis, false for (transparent) no fill

-        fillColor: null,       // => fill color

-        fillOpacity: 0.4       // => opacity of the fill color, set to 1 for a solid fill, 0 hides the fill

-      },

-      bars: {

-        show: false,           // => setting to true will show bars, false will hide

-        lineWidth: 2,          // => in pixels

-        barWidth: 1,           // => in units of the x axis

-        fill: true,            // => true to fill the area from the line to the x axis, false for (transparent) no fill

-        fillColor: null,       // => fill color

-        fillOpacity: 0.4,      // => opacity of the fill color, set to 1 for a solid fill, 0 hides the fill

-        horizontal: false,

-        stacked: false

-      },

-      candles: {

-        show: false,           // => setting to true will show candle sticks, false will hide

-        lineWidth: 1,          // => in pixels

-        wickLineWidth: 1,      // => in pixels

-        candleWidth: 0.6,      // => in units of the x axis

-        fill: true,            // => true to fill the area from the line to the x axis, false for (transparent) no fill

-        upFillColor: '#00A8F0',// => up sticks fill color

-        downFillColor: '#CB4B4B',// => down sticks fill color

-        fillOpacity: 0.5,      // => opacity of the fill color, set to 1 for a solid fill, 0 hides the fill

-        barcharts: false       // => draw as barcharts (not standard bars but financial barcharts)

-      },

-      pie: {

-        show: false,           // => setting to true will show bars, false will hide

-        lineWidth: 1,          // => in pixels

-        fill: true,            // => true to fill the area from the line to the x axis, false for (transparent) no fill

-        fillColor: null,       // => fill color

-        fillOpacity: 0.6,      // => opacity of the fill color, set to 1 for a solid fill, 0 hides the fill

-        explode: 6,

-        sizeRatio: 0.6,

-        startAngle: Math.PI/4,

-        labelFormatter: Flotr.defaultPieLabelFormatter,

-        pie3D: false,

-        pie3DviewAngle: (Math.PI/2 * 0.8),

-        pie3DspliceThickness: 20

-      },

-      grid: {

-        color: '#545454',      // => primary color used for outline and labels

-        backgroundColor: null, // => null for transparent, else color

-        tickColor: '#DDDDDD',  // => color used for the ticks

-        labelMargin: 3,        // => margin in pixels

-        verticalLines: true,   // => whether to show gridlines in vertical direction

-        horizontalLines: true, // => whether to show gridlines in horizontal direction

-        outlineWidth: 2        // => width of the grid outline/border in pixels

-      },

-      selection: {

-        mode: null,            // => one of null, 'x', 'y' or 'xy'

-        color: '#B6D9FF',      // => selection box color

-        fps: 20                // => frames-per-second

-      },

-      mouse: {

-        track: false,          // => true to track the mouse, no tracking otherwise

-        position: 'se',        // => position of the value box (default south-east)

-        relative: false,       // => next to the mouse cursor

-        trackFormatter: Flotr.defaultTrackFormatter, // => formats the values in the value box

-        margin: 5,             // => margin in pixels of the valuebox

-        lineColor: '#FF3F19',  // => line color of points that are drawn when mouse comes near a value of a series

-        trackDecimals: 1,      // => decimals for the track values

-        sensibility: 2,        // => the lower this number, the more precise you have to aim to show a value

-        radius: 3              // => radius of the track point

-      },

-      radarChartMode: false, // => true to render radar grid / and setup scaling for radar chart

-      shadowSize: 4,           // => size of the 'fake' shadow

-      defaultType: 'lines',    // => default series type

-      HtmlText: true,          // => wether to draw the text using HTML or on the canvas

-      fontSize: 7.5,             // => canvas' text font size

-      spreadsheet: {

-      	show: false,           // => show the data grid using two tabs

-      	tabGraphLabel: 'Graph',

-      	tabDataLabel: 'Data',

-      	toolbarDownload: 'Download CSV', // @todo: add language support

-      	toolbarSelectAll: 'Select all'

-      }

-    }

-    

-    options.x2axis = Object.extend(Object.clone(options.xaxis), options.x2axis);

-    options.y2axis = Object.extend(Object.clone(options.yaxis), options.y2axis);

-    this.options = Flotr.merge((opts || {}), options);

-    

-    this.axes = {

-      x:  {options: this.options.xaxis,  n: 1}, 

-      x2: {options: this.options.x2axis, n: 2}, 

-      y:  {options: this.options.yaxis,  n: 1}, 

-      y2: {options: this.options.y2axis, n: 2}

-    };

-		

-		// Initialize some variables used throughout this function.

-		var assignedColors = [],

-		    colors = [],

-		    ln = this.series.length,

-		    neededColors = this.series.length,

-		    oc = this.options.colors, 

-		    usedColors = [],

-		    variation = 0,

-		    c, i, j, s, tooClose;

-

-		// Collect user-defined colors from series.

-		for(i = neededColors - 1; i > -1; --i){

-			c = this.series[i].color;

-			if(c != null){

-				--neededColors;

-				if(Object.isNumber(c)) assignedColors.push(c);

-				else usedColors.push(Flotr.parseColor(c));

-			}

-		}

-		

-		// Calculate the number of colors that need to be generated.

-		for(i = assignedColors.length - 1; i > -1; --i)

-			neededColors = Math.max(neededColors, assignedColors[i] + 1);

-

-		// Generate needed number of colors.

-		for(i = 0; colors.length < neededColors;){

-			c = (oc.length == i) ? new Flotr.Color(100, 100, 100) : Flotr.parseColor(oc[i]);

-			

-			// Make sure each serie gets a different color.

-			var sign = variation % 2 == 1 ? -1 : 1;

-			var factor = 1 + sign * Math.ceil(variation / 2) * 0.2;

-			c.scale(factor, factor, factor);

-

-			/**

-			 * @todo if we're getting too close to something else, we should probably skip this one

-			 */

-			colors.push(c);

-			

-			if(++i >= oc.length){

-				i = 0;

-				++variation;

-			}

-		}

-	

-		// Fill the options with the generated colors.

-		for(i = 0, j = 0; i < ln; ++i){

-			s = this.series[i];

-

-			// Assign the color.

-			if(s.color == null){

-				s.color = colors[j++].toString();

-			}else if(Object.isNumber(s.color)){

-				s.color = colors[s.color].toString();

-			}

-			

-      if (!s.xaxis) s.xaxis = this.axes.x;

-           if (s.xaxis == 1) s.xaxis = this.axes.x;

-      else if (s.xaxis == 2) s.xaxis = this.axes.x2;

-  

-      if (!s.yaxis) s.yaxis = this.axes.y;

-           if (s.yaxis == 1) s.yaxis = this.axes.y;

-      else if (s.yaxis == 2) s.yaxis = this.axes.y2;

-			

-			// Apply missing options to the series.

-			s.lines   = Object.extend(Object.clone(this.options.lines), s.lines);

-			s.points  = Object.extend(Object.clone(this.options.points), s.points);

-			s.bars    = Object.extend(Object.clone(this.options.bars), s.bars);

-			s.candles = Object.extend(Object.clone(this.options.candles), s.candles);

-			s.pie     = Object.extend(Object.clone(this.options.pie), s.pie);

-			s.radar   = Object.extend(Object.clone(this.options.radar), s.radar);

-			s.mouse   = Object.extend(Object.clone(this.options.mouse), s.mouse);

-			

-			if(s.shadowSize == null) s.shadowSize = this.options.shadowSize;

-		}

-	},

-	/**

-	 * Initializes the canvas and it's overlay canvas element. When the browser is IE, this makes use 

-	 * of excanvas. The overlay canvas is inserted for displaying interactions. After the canvas elements

-	 * are created, the elements are inserted into the container element.

-	 */

-	constructCanvas: function(){

-		var el = this.el,

-			size, c, oc;

-		

-  	this.canvas = el.select('.flotr-canvas')[0];

-		this.overlay = el.select('.flotr-overlay')[0];

-		

-		el.childElements().invoke('remove');

-

-		// For positioning labels and overlay.

-		el.setStyle({position:'relative', cursor:'default'});

-

-		this.canvasWidth = el.getWidth();

-		this.canvasHeight = el.getHeight();

-		size = {'width': this.canvasWidth, 'height': this.canvasHeight};

-

-		if(this.canvasWidth <= 0 || this.canvasHeight <= 0){

-			throw 'Invalid dimensions for plot, width = ' + this.canvasWidth + ', height = ' + this.canvasHeight;

-		}

-

-		// Insert main canvas.

-		if (!this.canvas) {

-			c = this.canvas = new Element('canvas', size);

-			c.className = 'flotr-canvas';

-			c = c.writeAttribute('style', 'position:absolute;left:0px;top:0px;');

-		} else {

-			c = this.canvas.writeAttribute(size);

-		}

-		el.insert(c);

-		

-		if(Prototype.Browser.IE){

-			c = window.G_vmlCanvasManager.initElement(c);

-		}

-		this.ctx = c.getContext('2d');

-    

-		// Insert overlay canvas for interactive features.

-		if (!this.overlay) {

-			oc = this.overlay = new Element('canvas', size);

-			oc.className = 'flotr-overlay';

-			oc = oc.writeAttribute('style', 'position:absolute;left:0px;top:0px;');

-		} else {

-			oc = this.overlay.writeAttribute(size);

-		}

-		el.insert(oc);

-		

-		if(Prototype.Browser.IE){

-			oc = window.G_vmlCanvasManager.initElement(oc);

-		}

-		this.octx = oc.getContext('2d');

-

-		// Enable text functions

-		if (window.CanvasText) {

-		  CanvasText.enable(this.ctx);

-		  CanvasText.enable(this.octx);

-		  this.textEnabled = true;

-		}

-	},

-  getTextDimensions: function(text, canvasStyle, HtmlStyle, className) {

-    if (!text) return {width:0, height:0};

-    

-    if (!this.options.HtmlText && this.textEnabled) {

-      var bounds = this.ctx.getTextBounds(text, canvasStyle);

-      return {

-        width: bounds.width+2, 

-        height: bounds.height+6

-      };

-    }

-    else {

-      var dummyDiv = this.el.insert('<div style="position:absolute;top:-10000px;'+HtmlStyle+'" class="'+className+' flotr-dummy-div">' + text + '</div>').select(".flotr-dummy-div")[0];

-      dim = dummyDiv.getDimensions();

-      dummyDiv.remove();

-      return dim;

-    }

-  },

-	loadDataGrid: function(){

-    if (this.seriesData) return this.seriesData;

-

-		var s = this.series;

-		var dg = [];

-

-    /* The data grid is a 2 dimensions array. There is a row for each X value.

-     * Each row contains the x value and the corresponding y value for each serie ('undefined' if there isn't one)

-    **/

-		for(i = 0; i < s.length; ++i){

-			s[i].data.each(function(v) {

-				var x = v[0],

-				    y = v[1];

-				if (r = dg.find(function(row) {return row[0] == x})) {

-					r[i+1] = y;

-				}

-				else {

-					var newRow = [];

-					newRow[0] = x;

-					newRow[i+1] = y

-					dg.push(newRow);

-				}

-			});

-		}

-		

-    // The data grid is sorted by x value

-		dg = dg.sortBy(function(v) {

-			return v[0];

-		});

-		return this.seriesData = dg;

-	},

-	

-	// @todo: make a tab manager (Flotr.Tabs)

-  showTab: function(tabName, onComplete){

-    var elementsClassNames = 'canvas, .flotr-labels, .flotr-legend, .flotr-legend-bg, .flotr-title, .flotr-subtitle';

-    switch(tabName) {

-      case 'graph':

-        this.datagrid.up().hide();

-        this.el.select(elementsClassNames).invoke('show');

-        this.tabs.data.removeClassName('selected');

-        this.tabs.graph.addClassName('selected');

-      break;

-      case 'data':

-        this.constructDataGrid();

-        this.datagrid.up().show();

-        this.el.select(elementsClassNames).invoke('hide');

-        this.tabs.data.addClassName('selected');

-        this.tabs.graph.removeClassName('selected');

-      break;

-    }

-  },

-  constructTabs: function(){

-    var tabsContainer = new Element('div', {className:'flotr-tabs-group', style:'position:absolute;left:0px;top:'+this.canvasHeight+'px;width:'+this.canvasWidth+'px;'});

-    this.el.insert({bottom: tabsContainer});

-    this.tabs = {

-    	graph: new Element('div', {className:'flotr-tab selected', style:'float:left;'}).update(this.options.spreadsheet.tabGraphLabel),

-    	data: new Element('div', {className:'flotr-tab', style:'float:left;'}).update(this.options.spreadsheet.tabDataLabel)

-    }

-    

-    tabsContainer.insert(this.tabs.graph).insert(this.tabs.data);

-    

-    this.el.setStyle({height: this.canvasHeight+this.tabs.data.getHeight()+2+'px'});

-

-    this.tabs.graph.observe('click', (function() {this.showTab('graph')}).bind(this));

-    this.tabs.data.observe('click', (function() {this.showTab('data')}).bind(this));

-  },

-  

-  // @todo: make a spreadsheet manager (Flotr.Spreadsheet)

-	constructDataGrid: function(){

-    // If the data grid has already been built, nothing to do here

-    if (this.datagrid) return this.datagrid;

-    

-		var i, j, 

-        s = this.series,

-        datagrid = this.loadDataGrid();

-

-		var t = this.datagrid = new Element('table', {className:'flotr-datagrid', style:'height:100px;'});

-		var colgroup = ['<colgroup><col />'];

-		

-		// First row : series' labels

-		var html = ['<tr class="first-row">'];

-		html.push('<th>&nbsp;</th>');

-		for (i = 0; i < s.length; ++i) {

-			html.push('<th scope="col">'+(s[i].label || String.fromCharCode(65+i))+'</th>');

-			colgroup.push('<col />');

-		}

-		html.push('</tr>');

-		

-		// Data rows

-		for (j = 0; j < datagrid.length; ++j) {

-			html.push('<tr>');

-			for (i = 0; i < s.length+1; ++i) {

-        var tag = 'td';

-        var content = (datagrid[j][i] != null ? Math.round(datagrid[j][i]*100000)/100000 : '');

-        

-        if (i == 0) {

-          tag = 'th';

-          var label;

-          if(this.options.xaxis.ticks) {

-            var tick = this.options.xaxis.ticks.find(function (x) { return x[0] == datagrid[j][i] });

-            if (tick) label = tick[1];

-          } 

-          else {

-            label = this.options.xaxis.tickFormatter(content);

-          }

-          

-          if (label) content = label;

-        }

-

-				html.push('<'+tag+(tag=='th'?' scope="row"':'')+'>'+content+'</'+tag+'>');

-			}

-			html.push('</tr>');

-		}

-		colgroup.push('</colgroup>');

-    t.update(colgroup.join('')+html.join(''));

-    

-    if (!Prototype.Browser.IE) {

-      t.select('td').each(function(td) {

-      	td.observe('mouseover', function(e){

-      		td = e.element();

-      		var siblings = td.previousSiblings();

-      		

-      		t.select('th[scope=col]')[siblings.length-1].addClassName('hover');

-      		t.select('colgroup col')[siblings.length].addClassName('hover');

-      	});

-      	

-      	td.observe('mouseout', function(){

-      		t.select('colgroup col.hover, th.hover').each(function(e){e.removeClassName('hover')});

-      	});

-      });

-    }

-    

-		var toolbar = new Element('div', {className: 'flotr-datagrid-toolbar'}).

-	    insert(new Element('button', {type:'button', className:'flotr-datagrid-toolbar-button'}).update(this.options.spreadsheet.toolbarDownload).observe('click', this.downloadCSV.bind(this))).

-	    insert(new Element('button', {type:'button', className:'flotr-datagrid-toolbar-button'}).update(this.options.spreadsheet.toolbarSelectAll).observe('click', this.selectAllData.bind(this)));

-		

-		var container = new Element('div', {className:'flotr-datagrid-container', style:'left:0px;top:0px;width:'+this.canvasWidth+'px;height:'+this.canvasHeight+'px;overflow:auto;'});

-		container.insert(toolbar);

-		t.wrap(container.hide());

-		

-		this.el.insert(container);

-    return t;

-  },

-  selectAllData: function(){

-    if (this.tabs) {

-      var selection, range, doc, win, node = this.constructDataGrid();

-  

-      this.showTab('data');

-      

-      // deferred to be able to select the table

-      (function () {

-        if ((doc = node.ownerDocument) && (win = doc.defaultView) && 

-          win.getSelection && doc.createRange && 

-          (selection = window.getSelection()) && 

-          selection.removeAllRanges) {

-           range = doc.createRange();

-           range.selectNode(node);

-           selection.removeAllRanges();

-           selection.addRange(range);

-        }

-        else if (document.body && document.body.createTextRange && 

-          (range = document.body.createTextRange())) {

-           range.moveToElementText(node);

-           range.select();

-        }

-      }).defer();

-      return true;

-    }

-    else return false;

-  },

-  downloadCSV: function(){

-    var i, csv = '"x"',

-        series = this.series,

-        dg = this.loadDataGrid();

-    

-    for (i = 0; i < series.length; ++i) {

-      csv += '%09"'+(series[i].label || String.fromCharCode(65+i))+'"'; // \t

-    }

-    csv += "%0D%0A"; // \r\n

-    

-    for (i = 0; i < dg.length; ++i) {

-      if (this.options.xaxis.ticks) {

-        var tick = this.options.xaxis.ticks.find(function (x) { return x[0] == dg[i][0] });

-        if (tick) dg[i][0] = tick[1];

-      } else {

-        dg[i][0] = this.options.xaxis.tickFormatter(dg[i][0]);

-      }

-      csv += dg[i].join('%09')+"%0D%0A"; // \t and \r\n

-    }

-    if (Prototype.Browser.IE) {

-      csv = csv.gsub('%09', '\t').gsub('%0A', '\n').gsub('%0D', '\r');

-      window.open().document.write(csv);

-    }

-    else {

-      window.open('data:text/csv,'+csv);

-    }

-  },

-	/**

-	 * Initializes event some handlers.

-	 */

-	initEvents: function () {

-  	//@todo: maybe stopObserving with only flotr functions

-  	this.overlay.stopObserving();

-  	this.overlay.observe('mousedown', this.mouseDownHandler.bind(this));

-		this.overlay.observe('mousemove', this.mouseMoveHandler.bind(this));

-		this.overlay.observe('click', this.clickHandler.bind(this));

-	},

-	/**

-	 * Function determines the min and max values for the xaxis and yaxis.

-	 */

-	findDataRanges: function(){

-		var s = this.series, 

-		    a = this.axes;

-		

-		a.x.datamin = 0;  a.x.datamax  = 0;

-		a.x2.datamin = 0; a.x2.datamax = 0;

-		a.y.datamin = 0;  a.y.datamax  = 0;

-		a.y2.datamin = 0; a.y2.datamax = 0;

-		

-		if(s.length > 0){

-			var i, j, h, x, y, data, xaxis, yaxis;

-		

-			// Get datamin, datamax start values 

-			for(i = 0; i < s.length; ++i) {

-				data = s[i].data, 

-				xaxis = s[i].xaxis, 

-				yaxis = s[i].yaxis;

-				

-				if (data.length > 0 && !s[i].hide) {

-					if (!xaxis.used) xaxis.datamin = xaxis.datamax = data[0][0];

-					if (!yaxis.used) yaxis.datamin = yaxis.datamax = data[0][1];

-					xaxis.used = true;

-					yaxis.used = true;

-

-					for(h = data.length - 1; h > -1; --h){

-  					x = data[h][0];

-  			         if(x < xaxis.datamin) xaxis.datamin = x;

-   					else if(x > xaxis.datamax) xaxis.datamax = x;

-  			    

-  					for(j = 1; j < data[h].length; j++){

-  						y = data[h][j];

-  				         if(y < yaxis.datamin) yaxis.datamin = y;

-  	  				else if(y > yaxis.datamax) yaxis.datamax = y;

-  					}

-					}

-				}

-				if (this.options.radarChartMode) {

-					xaxis.datamin = yaxis.datamin = - yaxis.datamax;

-					xaxis.datamax = yaxis.datamax;

-					if (!this.options.radarChartSides) this.options.radarChartSides = data.length;

-				}

-			}

-		}

-		

-		this.findXAxesValues();

-		

-		this.calculateRange(a.x);

-		this.extendXRangeIfNeededByBar(a.x);

-		

-		if (a.x2.used) {

-			this.calculateRange(a.x2);

-		  this.extendXRangeIfNeededByBar(a.x2);

-		}

-		

-		this.calculateRange(a.y);

-		this.extendYRangeIfNeededByBar(a.y);

-		

-		if (a.y2.used) {

-  		this.calculateRange(a.y2);

-  		this.extendYRangeIfNeededByBar(a.y2);

-		}

-	},

-	/**

-	 * Calculates the range of an axis to apply autoscaling.

-	 */

-	calculateRange: function(axis){

-		var o = axis.options,

-		  min = o.min != null ? o.min : axis.datamin,

-			max = o.max != null ? o.max : axis.datamax,

-			margin;

-

-		if(max - min == 0.0){

-			var widen = (max == 0.0) ? 1.0 : 0.01;

-			min -= widen;

-			max += widen;

-		}

-		axis.tickSize = Flotr.getTickSize(o.noTicks, ((this.options.radarChartMode) ? 0 : min), max, o.tickDecimals);

-

-		// Autoscaling.

-		if(o.min == null){

-			// Add a margin.

-			margin = o.autoscaleMargin;

-			if(margin != 0){

-				min -= axis.tickSize * margin;

-				

-				// Make sure we don't go below zero if all values are positive.

-				if(min < 0 && axis.datamin >= 0) min = 0;

-				min = axis.tickSize * Math.floor(min / axis.tickSize);

-			}

-		}

-		if(o.max == null){

-			margin = o.autoscaleMargin;

-			if(margin != 0){

-				max += axis.tickSize * margin;

-				if(max > 0 && axis.datamax <= 0) max = 0;				

-				max = axis.tickSize * Math.ceil(max / axis.tickSize);

-			}

-		}

-		axis.min = min;

-		axis.max = max;

-	},

-	/**

-	 * Bar series autoscaling in x direction.

-	 */

-	extendXRangeIfNeededByBar: function(axis){

-		if(axis.options.max == null){

-			var newmax = axis.max,

-			    i, s, b, c,

-			    stackedSums = [], 

-			    lastSerie = null;

-

-			for(i = 0; i < this.series.length; ++i){

-				s = this.series[i];

-				b = s.bars;

-				c = s.candles;

-				if(s.axis == axis && (b.show || c.show)) {

-					if (!b.horizontal && (b.barWidth + axis.datamax > newmax) || (c.candleWidth + axis.datamax > newmax)){

-						newmax = axis.max + s.bars.barWidth;

-					}

-					if(b.stacked && b.horizontal){

-						for (j = 0; j < s.data.length; j++) {

-							if (s.bars.show && s.bars.stacked) {

-								var x = s.data[j][0];

-								stackedSums[x] = (stackedSums[x] || 0) + s.data[j][1];

-								lastSerie = s;

-							}

-						}

-				    

-						for (j = 0; j < stackedSums.length; j++) {

-				    	newmax = Math.max(stackedSums[j], newmax);

-						}

-					}

-				}

-			}

-			axis.lastSerie = lastSerie;

-			axis.max = newmax;

-		}

-	},

-	/**

-	 * Bar series autoscaling in y direction.

-	 */

-	extendYRangeIfNeededByBar: function(axis){

-		if(axis.options.max == null){

-			var newmax = axis.max,

-				  i, s, b, c,

-				  stackedSums = [],

-				  lastSerie = null;

-									

-			for(i = 0; i < this.series.length; ++i){

-				s = this.series[i];

-				b = s.bars;

-				c = s.candles;

-				if (s.yaxis == axis && b.show && !s.hide) {

-					if (b.horizontal && (b.barWidth + axis.datamax > newmax) || (c.candleWidth + axis.datamax > newmax)){

-						newmax = axis.max + b.barWidth;

-					}

-					if(b.stacked && !b.horizontal){

-						for (j = 0; j < s.data.length; j++) {

-							if (s.bars.show && s.bars.stacked) {

-								var x = s.data[j][0];

-								stackedSums[x] = (stackedSums[x] || 0) + s.data[j][1];

-								lastSerie = s;

-							}

-						}

-						

-						for (j = 0; j < stackedSums.length; j++) {

-							newmax = Math.max(stackedSums[j], newmax);

-						}

-					}

-				}

-			}

-			axis.lastSerie = lastSerie;

-			axis.max = newmax;

-		}

-	},

-	/** 

-	 * Find every values of the x axes

-	 */

-	findXAxesValues: function(){

-		for(i = this.series.length-1; i > -1 ; --i){

-			s = this.series[i];

-			s.xaxis.values = s.xaxis.values || [];

-			for (j = s.data.length-1; j > -1 ; --j){

-				s.xaxis.values[s.data[j][0]] = {};

-			}

-		}

-	},

-	/**

-	 * Calculate axis ticks.

-	 * @param {Object} axis - axis object

-	 * @param {Object} o - axis options

-	 */

-	calculateTicks: function(axis){

-		var o = axis.options, i, v;

-		

-		axis.ticks = [];	

-		if(o.ticks){

-			var ticks = o.ticks, t, label;

-

-			if(Object.isFunction(ticks)){

-				ticks = ticks({min: axis.min, max: axis.max});

-			}

-			

-			// Clean up the user-supplied ticks, copy them over.

-			for(i = 0; i < ticks.length; ++i){

-				t = ticks[i];

-				if(typeof(t) == 'object'){

-					v = t[0];

-					label = (t.length > 1) ? t[1] : o.tickFormatter(v);

-				}else{

-					v = t;

-					label = o.tickFormatter(v);

-				}

-				axis.ticks[i] = { v: v, label: label };

-			}

-		}

-    else {

-			// Round to nearest multiple of tick size.

-			var start = axis.tickSize * Math.ceil(axis.min / axis.tickSize),

-				  decimals;

-			

-			// Then store all possible ticks.

-			for(i = 0; start + i * axis.tickSize <= axis.max; ++i){

-				v = start + i * axis.tickSize;

-				

-				// Round (this is always needed to fix numerical instability).

-				decimals = o.tickDecimals;

-				if(decimals == null) decimals = 1 - Math.floor(Math.log(axis.tickSize) / Math.LN10);

-				if(decimals < 0) decimals = 0;

-				

-				v = v.toFixed(decimals);

-				axis.ticks.push({ v: v, label: o.tickFormatter(v) });

-			}

-		}

-	},

-	/**

-	 * Calculates axis label sizes.

-	 */

-	calculateSpacing: function(){

-		var a = this.axes,

-  			options = this.options,

-  			series = this.series,

-  			margin = options.grid.labelMargin,

-  			x = a.x,

-  			x2 = a.x2,

-  			y = a.y,

-  			y2 = a.y2,

-  			maxOutset = 2,

-  			i, j, l, dim;

-		

-		// Labels width and height

-		[x, x2, y, y2].each(function(axis) {

-			var maxLabel = '';

-			

-		  if (axis.options.showLabels) {

-				for(i = 0; i < axis.ticks.length; ++i){

-					l = axis.ticks[i].label.length;

-					if(l > maxLabel.length){

-						maxLabel = axis.ticks[i].label;

-					}

-				}

-	    }

-		  axis.maxLabel  = this.getTextDimensions(maxLabel, {size:options.fontSize, angle: Flotr.toRad(axis.options.labelsAngle)}, 'font-size:smaller;', 'flotr-grid-label');

-		  axis.titleSize = this.getTextDimensions(axis.options.title, {size: options.fontSize*1.2, angle: Flotr.toRad(axis.options.titleAngle)}, 'font-weight:bold;', 'flotr-axis-title');

-		}, this);

-

-    // Title height

-    dim = this.getTextDimensions(options.title, {size: options.fontSize*1.5}, 'font-size:1em;font-weight:bold;', 'flotr-title');

-    this.titleHeight = dim.height;

-    

-    // Subtitle height

-    dim = this.getTextDimensions(options.subtitle, {size: options.fontSize}, 'font-size:smaller;', 'flotr-subtitle');

-    this.subtitleHeight = dim.height;

-

-		// Grid outline line width.

-		if(options.show){

-			maxOutset = Math.max(maxOutset, options.points.radius + options.points.lineWidth/2);

-		}

-		for(j = 0; j < options.length; ++j){

-			if (series[j].points.show){

-				maxOutset = Math.max(maxOutset, series[j].points.radius + series[j].points.lineWidth/2);

-			}

-		}

-		

-		var p = this.plotOffset = {left: 0, right: 0, top: 0, bottom: 0};

-		p.left = p.right = p.top = p.bottom = maxOutset;

-		

-		p.bottom += (x.options.showLabels ?  (x.maxLabel.height  + margin) : 0) + 

-		            (x.options.title ?       (x.titleSize.height + margin) : 0);

-		

-    p.top    += (x2.options.showLabels ? (x2.maxLabel.height  + margin) : 0) + 

-                (x2.options.title ?      (x2.titleSize.height + margin) : 0) + this.subtitleHeight + this.titleHeight + 

-		this.options.radarChartMode ? (y.options.showLabels ?  (y.maxLabel.height  + margin) : 0) : 0;

-    

-		p.left   += (y.options.showLabels ?  (y.maxLabel.width  + margin) : 0) + 

-                (y.options.title ?       (y.titleSize.width + margin) : 0);

-		

-		p.right  += (y2.options.showLabels ? (y2.maxLabel.width  + margin) : 0) + 

-                (y2.options.title ?      (y2.titleSize.width + margin) : 0) + 

-		this.options.radarChartMode ? (x.options.showLabels ?  (x.maxLabel.width  + margin) : 0) : 0;

-    

-    p.top = Math.floor(p.top); // In order the outline not to be blured

-    

-		this.plotWidth  = this.canvasWidth - p.left - p.right;

-		this.plotHeight = this.canvasHeight - p.bottom - p.top;

-		

-		x.scale  = this.plotWidth / (x.max - x.min);

-		x2.scale = this.plotWidth / (x2.max - x2.min);

-		y.scale  = this.plotHeight / (y.max - y.min);

-		y2.scale = this.plotHeight / (y2.max - y2.min);

-	},

-	/**

-	 * Draws grid, labels and series.

-	 */

-	draw: function() {

-		this.drawGrid();

-		this.drawLabels();

-    this.drawTitles();

-    

-		if(this.series.length){

-			this.el.fire('flotr:beforedraw', [this.series, this]);

-			for(var i = 0; i < this.series.length; i++){

-				if (!this.series[i].hide)

-					this.drawSeries(this.series[i]);

-			}

-		}

-		this.el.fire('flotr:afterdraw', [this.series, this]);

-	},

-	/**

-	 * Translates absolute horizontal x coordinates to relative coordinates.

-	 * @param {Integer} x - absolute integer x coordinate

-	 * @return {Integer} translated relative x coordinate

-	 */

-	tHoz: function(x, axis){

-		axis = axis || this.axes.x;

-		return (x - axis.min) * axis.scale;

-	},

-	/**

-	 * Translates absolute vertical x coordinates to relative coordinates.

-	 * @param {Integer} y - absolute integer y coordinate

-	 * @return {Integer} translated relative y coordinate

-	 */

-	tVert: function(y, axis){

-		axis = axis || this.axes.y;

-		return this.plotHeight - (y - axis.min) * axis.scale;

-	},

-	/**

-	 * Draws a grid for the graph.

-	 */

-	drawGrid: function(){

-		if (this.options.radarChartMode) { // If we are in radar chart mode call drawRadarGrid instead and exit

-			this.drawRadarGrid();

-			return;

-		}

-		var v, o = this.options,

-		    ctx = this.ctx;

-		if(o.grid.verticalLines || o.grid.horizontalLines){

-			this.el.fire('flotr:beforegrid', [this.axes.x, this.axes.y, o, this]);

-		}

-		ctx.save();

-		ctx.translate(this.plotOffset.left, this.plotOffset.top);

-

-		// Draw grid background, if present in options.

-		if(o.grid.backgroundColor != null){

-			ctx.fillStyle = o.grid.backgroundColor;

-			ctx.fillRect(0, 0, this.plotWidth, this.plotHeight);

-		}

-		

-		// Draw grid lines in vertical direction.

-		ctx.lineWidth = 1;

-		ctx.strokeStyle = o.grid.tickColor;

-		ctx.beginPath();

-		if(o.grid.verticalLines){

-			for(var i = 0; i < this.axes.x.ticks.length; ++i){

-				v = this.axes.x.ticks[i].v;

-				// Don't show lines on upper and lower bounds.

-				if ((v == this.axes.x.min || v == this.axes.x.max) && o.grid.outlineWidth != 0)

-					continue;

-	

-				ctx.moveTo(Math.floor(this.tHoz(v)) + ctx.lineWidth/2, 0);

-				ctx.lineTo(Math.floor(this.tHoz(v)) + ctx.lineWidth/2, this.plotHeight);

-			}

-		}

-		

-		// Draw grid lines in horizontal direction.

-		if(o.grid.horizontalLines){

-			for(var j = 0; j < this.axes.y.ticks.length; ++j){

-				v = this.axes.y.ticks[j].v;

-				// Don't show lines on upper and lower bounds.

-				if ((v == this.axes.y.min || v == this.axes.y.max) && o.grid.outlineWidth != 0)

-					continue;

-	

-				ctx.moveTo(0, Math.floor(this.tVert(v)) + ctx.lineWidth/2);

-				ctx.lineTo(this.plotWidth, Math.floor(this.tVert(v)) + ctx.lineWidth/2);

-			}

-		}

-		ctx.stroke();

-		

-		// Draw axis/grid border.

-		if(o.grid.outlineWidth != 0) {

-			ctx.lineWidth = o.grid.outlineWidth;

-			ctx.strokeStyle = o.grid.color;

-			ctx.lineJoin = 'round';

-			ctx.strokeRect(0, 0, this.plotWidth, this.plotHeight);

-		}

-		ctx.restore();

-		if(o.grid.verticalLines || o.grid.horizontalLines){

-			this.el.fire('flotr:aftergrid', [this.axes.x, this.axes.y, o, this]);

-		}

-	},

-	/**

-	 * Draws a grid for the graph.

-	 */

-	drawRadarGrid: function(){

-		

-		var v, o = this.options,

-		    ctx = this.ctx;

-		    

-		var sides = this.options.radarChartSides,

-		    degreesInRadiansForAngle = Math.PI * 2 / sides,

-		    nintyDegrees = Math.PI / 2;

-		

-		if(o.grid.verticalLines || o.grid.horizontalLines){

-			this.el.fire('flotr:beforegrid', [this.axes.x, this.axes.y, o, this]);

-		}

-		ctx.save();

-		ctx.translate(this.plotOffset.left, this.plotOffset.top);

-		ctx.lineJoin = 'round';

-

-		// Draw grid background, if present in options.

-		if(o.grid.backgroundColor != null){

-			ctx.fillStyle = o.grid.backgroundColor;

-			ctx.fillRect(0, 0, this.plotWidth, this.plotHeight);

-		}

-		

-		// Draw grid lines

-		var regPoly = {};

-		regPoly.xaxis = {};

-		regPoly.yaxis = {};

-		regPoly.xaxis.min = regPoly.yaxis.min = this.axes.x.min;

-		regPoly.xaxis.max = regPoly.yaxis.max = this.axes.x.max;

-		regPoly.xaxis.scale = this.plotWidth / (this.axes.x.max - this.axes.x.min);

-		regPoly.yaxis.scale = this.plotHeight / (this.axes.x.max - this.axes.x.min);

-		

-		ctx.lineWidth = 1;

-		ctx.strokeStyle = o.grid.tickColor;

-		

-		if(o.grid.horizontalLines){

-			for(var j = 0; j < this.axes.y.ticks.length; ++j){

-				v = this.axes.y.ticks[j].v;

-				if (v < 0) continue;

-				// Don't show lines on upper and lower bounds.

-				if ((v == this.axes.y.min || v == this.axes.y.max) && o.grid.outlineWidth != 0)

-					continue;

-				regPoly.data = new Array();

-				for (i = 0; i < sides; i++) {

-					angle = nintyDegrees + (degreesInRadiansForAngle * i);

-					regPoly.data[i] = [v * Math.cos(angle), v * Math.sin(angle)]

-				}

-				regPoly.data[sides] = regPoly.data[0];

-				this.plotLine(regPoly,0);

-			}

-		}

-		

-		// Draw axis/grid border.

-		if(o.grid.outlineWidth != 0) {

-			ctx.lineWidth = o.grid.outlineWidth;

-			ctx.strokeStyle = o.grid.color;

-			regPoly.data = new Array();

-			var radius = this.axes.x.max;

-			for (i = 0; i < sides; i++) {

-				angle = nintyDegrees + (degreesInRadiansForAngle * i);

-				regPoly.data[i] = [radius * Math.cos(angle), radius * Math.sin(angle)]

-				}

-				regPoly.data[sides] = regPoly.data[0];

-				this.plotLine(regPoly,0);

-		}

-		

-		ctx.lineWidth = 1;

-		ctx.strokeStyle = o.grid.tickColor;

-		ctx.beginPath();

-		

-		if(o.grid.verticalLines){

-			for(var i = 0; i < sides; ++i){

-				ctx.moveTo(Math.floor(this.tHoz(0)) + ctx.lineWidth/2, 

-						Math.floor(this.tVert(0)) + ctx.lineWidth/2);

-				ctx.lineTo(Math.floor(this.tHoz(regPoly.data[i][0])) + ctx.lineWidth/2, 

-						Math.floor(this.tVert(regPoly.data[i][1])) + ctx.lineWidth/2);

-			}

-		}

-		

-		ctx.stroke();

-		

-		ctx.restore();

-		if(o.grid.verticalLines || o.grid.horizontalLines){

-			this.el.fire('flotr:aftergrid', [this.axes.x, this.axes.y, o, this]);

-		}

-	},

-	/**

-	* Draws labels aroung radar chart

-	*/

-	drawRadarLabels:function(){

-		var ctx = this.ctx,

-			options = this.options,

-			axis = this.axes.x,

-			tick, minY = 0, maxY = 0,

-			xOffset, yOffset;

-		var style = {

-		    size: options.fontSize,

-		    adjustAlign: true

-		  };

-		style.color = axis.options.color || options.grid.color;

-		style.angle = Flotr.toRad(axis.options.labelsAngle);

-		var radius = axis.max * 1,

-		      closeTo = axis.max * 0.1,

-		      sides = this.options.radarChartSides,

-		      degreesInRadiansForAngle = Math.PI * 2 / sides,

-		      nintyDegrees = Math.PI / 2,

-		      posdata = new Array();

-		for (i = 0; i < sides; i++) {

-				angle = nintyDegrees + (degreesInRadiansForAngle * i);

-				posdata[i] = [radius * Math.cos(angle), radius * Math.sin(angle)];

-				if (minY > posdata[i][1]) minY = posdata[i][1];

-				if (maxY < posdata[i][1]) maxY = posdata[i][1];

-				}

-		for (i = 0; i < sides; i++) {

-				tick = axis.ticks[i];

-				if(!tick.label || tick.label.length == 0) continue;

-				yOffset = 0;

-				if (posdata[i][0] > 0) {

-					style.halign = 'l';

-					xOffset = options.grid.labelMargin;

-				} else {

-					style.halign = 'r';

-					xOffset = - options.grid.labelMargin;

-				}

-				style.valign = 'm';

-				

-				if ((posdata[i][1] + closeTo) >= minY && (posdata[i][1] - closeTo) <= minY) {

-					style.valign = 't' ; 

-					style.halign = 'c';

-					yOffset = options.grid.labelMargin; 

-				};

-				if (posdata[i][1] == maxY) {

-					style.valign = 'b' ; 

-					style.halign = 'c';

-					yOffset = - options.grid.labelMargin; 

-				}

-				ctx.drawText(

-					tick.label,

-					this.plotOffset.left + this.tHoz(posdata[i][0]) + xOffset, 

-					this.plotOffset.top + this.tVert(posdata[i][1]) + yOffset,

-					style

-				);

-				}

-		

-	},

-	/**

-	 * Draws labels for x and y axis.

-	 */   

-	drawLabels: function(){		

-		// Construct fixed width label boxes, which can be styled easily. 

-		var noLabels = 0, axis,

-			xBoxWidth, i, html, tick,

-			options = this.options,

-      ctx = this.ctx,

-      a = this.axes;

-		

-		for(i = 0; i < a.x.ticks.length; ++i){

-			if (a.x.ticks[i].label) {

-				++noLabels;

-			}

-		}

-		xBoxWidth = this.plotWidth / noLabels;

-    

-		if (!options.HtmlText && this.textEnabled) {

-		  var style = {

-		    size: options.fontSize,

-        adjustAlign: true

-		  };

-

-		  // Add x labels.

-		  if (options.radarChartMode) {

-			this.drawRadarLabels();} else {

-		  axis = a.x;

-		  style.color = axis.options.color || options.grid.color;

-		  for(i = 0; i < axis.ticks.length && axis.options.showLabels && axis.used; ++i){

-		    tick = axis.ticks[i];

-		    if(!tick.label || tick.label.length == 0) continue;

-        

-        style.angle = Flotr.toRad(axis.options.labelsAngle);

-        style.halign = 'c';

-        style.valign = 't';

-        

-		    ctx.drawText(

-		      tick.label,

-		      this.plotOffset.left + this.tHoz(tick.v, axis), 

-		      this.plotOffset.top + this.plotHeight + options.grid.labelMargin,

-		      style

-		    );

-		  }}

-		  

-		  // Add x2 labels.

-		  axis = a.x2;

-		  style.color = axis.options.color || options.grid.color;

-		  for(i = 0; i < axis.ticks.length && axis.options.showLabels && axis.used; ++i){

-		    tick = axis.ticks[i];

-		    if(!tick.label || tick.label.length == 0) continue;

-        

-        style.angle = Flotr.toRad(axis.options.labelsAngle);

-        style.halign = 'c';

-        style.valign = 'b';

-        

-		    ctx.drawText(

-		      tick.label,

-		      this.plotOffset.left + this.tHoz(tick.v, axis), 

-		      this.plotOffset.top + options.grid.labelMargin,

-		      style

-		    );

-		  }

-		  

-		  // Add y labels.

-		  axis = a.y;

-		  style.color = axis.options.color || options.grid.color;

-		  for(i = 0; i < axis.ticks.length && axis.options.showLabels && axis.used; ++i){

-		    tick = axis.ticks[i];

-		    if (!tick.label || tick.label.length == 0 || (tick.v < 0 && this.options.radarChartMode)) continue;

-        

-        style.angle = Flotr.toRad(axis.options.labelsAngle);

-        style.halign = 'r';

-        style.valign = 'm';

-        

-		    ctx.drawText(

-		      tick.label,

-		      this.plotOffset.left + (this.options.radarChartMode ? this.tHoz(0) : 0) - options.grid.labelMargin, 

-		      this.plotOffset.top + this.tVert(tick.v, axis),

-		      style

-		    );

-		  }

-		  

-		  // Add y2 labels.

-		  axis = a.y2;

-		  style.color = axis.options.color || options.grid.color;

-		  for(i = 0; i < axis.ticks.length && axis.options.showLabels && axis.used; ++i){

-		    tick = axis.ticks[i];

-		    if (!tick.label || tick.label.length == 0) continue;

-        

-        style.angle = Flotr.toRad(axis.options.labelsAngle);

-        style.halign = 'l';

-        style.valign = 'm';

-        

-		    ctx.drawText(

-		      tick.label,

-		      this.plotOffset.left + this.plotWidth + options.grid.labelMargin, 

-		      this.plotOffset.top + this.tVert(tick.v, axis),

-		      style

-		    );

-		    

-				ctx.save();

-				ctx.strokeStyle = style.color;

-				ctx.beginPath();

-				ctx.moveTo(this.plotOffset.left + this.plotWidth - 8, this.plotOffset.top + this.tVert(tick.v, axis));

-				ctx.lineTo(this.plotOffset.left + this.plotWidth,     this.plotOffset.top + this.tVert(tick.v, axis));

-				ctx.stroke();

-				ctx.restore();

-		  }

-		} 

-		else if (a.x.options.showLabels || 

-				     a.x2.options.showLabels || 

-				     a.y.options.showLabels || 

-				     a.y2.options.showLabels) {

-			html = ['<div style="font-size:smaller;color:' + options.grid.color + ';" class="flotr-labels">'];

-			

-			// Add x labels.

-			axis = a.x;

-			if (axis.options.showLabels){

-				for(i = 0; i < axis.ticks.length; ++i){

-					tick = axis.ticks[i];

-					if(!tick.label || tick.label.length == 0) continue;

-					html.push('<div style="position:absolute;top:' + (this.plotOffset.top + this.plotHeight + options.grid.labelMargin) + 'px;left:' + (this.plotOffset.left + this.tHoz(tick.v, axis) - xBoxWidth/2) + 'px;width:' + xBoxWidth + 'px;text-align:center;'+(axis.options.color?('color:'+axis.options.color+';'):'')+'" class="flotr-grid-label">' + tick.label + '</div>');

-				}

-			}

-			

-			// Add x2 labels.

-			axis = a.x2;

-			if (axis.options.showLabels && axis.used){

-				for(i = 0; i < axis.ticks.length; ++i){

-					tick = axis.ticks[i];

-					if(!tick.label || tick.label.length == 0) continue;

-					html.push('<div style="position:absolute;top:' + (this.plotOffset.top - options.grid.labelMargin - axis.maxLabel.height) + 'px;left:' + (this.plotOffset.left + this.tHoz(tick.v, axis) - xBoxWidth/2) + 'px;width:' + xBoxWidth + 'px;text-align:center;'+(axis.options.color?('color:'+axis.options.color+';'):'')+'" class="flotr-grid-label">' + tick.label + '</div>');

-				}

-			}

-			

-			// Add y labels.

-			axis = a.y;

-			if (axis.options.showLabels){

-				for(i = 0; i < axis.ticks.length; ++i){

-					tick = axis.ticks[i];

-					if (!tick.label || tick.label.length == 0) continue;

-					html.push('<div style="position:absolute;top:' + (this.plotOffset.top + this.tVert(tick.v, axis) - axis.maxLabel.height/2) + 'px;left:0;width:' + (this.plotOffset.left - options.grid.labelMargin) + 'px;text-align:right;'+(axis.options.color?('color:'+axis.options.color+';'):'')+'" class="flotr-grid-label">' + tick.label + '</div>');

-				}

-			}

-			

-			// Add y2 labels.

-			axis = a.y2;

-			if (axis.options.showLabels && axis.used){

-				ctx.save();

-				ctx.strokeStyle = axis.options.color || options.grid.color;

-				ctx.beginPath();

-				

-				for(i = 0; i < axis.ticks.length; ++i){

-					tick = axis.ticks[i];

-					if (!tick.label || tick.label.length == 0) continue;

-					html.push('<div style="position:absolute;top:' + (this.plotOffset.top + this.tVert(tick.v, axis) - axis.maxLabel.height/2) + 'px;right:0;width:' + (this.plotOffset.right - options.grid.labelMargin) + 'px;text-align:left;'+(axis.options.color?('color:'+axis.options.color+';'):'')+'" class="flotr-grid-label">' + tick.label + '</div>');

-

-					ctx.moveTo(this.plotOffset.left + this.plotWidth - 8, this.plotOffset.top + this.tVert(tick.v, axis));

-					ctx.lineTo(this.plotOffset.left + this.plotWidth,     this.plotOffset.top + this.tVert(tick.v, axis));

-				}

-				ctx.stroke();

-				ctx.restore();

-			}

-			

-			html.push('</div>');

-			this.el.insert(html.join(''));

-		}

-	},

-  /**

-   * Draws the title and the subtitle

-   */   

-  drawTitles: function(){

-    var html,

-        options = this.options,

-        margin = options.grid.labelMargin,

-        ctx = this.ctx,

-        a = this.axes;

-      

-    if (!options.HtmlText && this.textEnabled) {

-      var style = {

-        size: options.fontSize,

-        color: options.grid.color,

-        halign: 'c'

-      };

-

-      // Add subtitle

-      if (options.subtitle){

-        ctx.drawText(

-          options.subtitle,

-          this.plotOffset.left + this.plotWidth/2, 

-          this.titleHeight + this.subtitleHeight - 2,

-          style

-        );

-      }

-      

-			style.weight = 1.5;

-      style.size *= 1.5;

-      

-      // Add title

-      if (options.title){

-        ctx.drawText(

-          options.title,

-          this.plotOffset.left + this.plotWidth/2, 

-          this.titleHeight - 2,

-          style

-        );

-      }

-      

-      style.weight = 1.8;

-      style.size *= 0.8;

-      style.adjustAlign = true;

-      

-			// Add x axis title

-			if (a.x.options.title && a.x.used){

-				style.halign = 'c';

-				style.valign = 't';

-				style.angle = Flotr.toRad(a.x.options.titleAngle);

-        ctx.drawText(

-          a.x.options.title,

-          this.plotOffset.left + this.plotWidth/2, 

-          this.plotOffset.top + a.x.maxLabel.height + this.plotHeight + 2 * margin,

-          style

-        );

-      }

-			

-			// Add x2 axis title

-			if (a.x2.options.title && a.x2.used){

-				style.halign = 'c';

-				style.valign = 'b';

-				style.angle = Flotr.toRad(a.x2.options.titleAngle);

-        ctx.drawText(

-          a.x2.options.title,

-          this.plotOffset.left + this.plotWidth/2, 

-          this.plotOffset.top - a.x2.maxLabel.height - 2 * margin,

-          style

-        );

-      }

-			

-			// Add y axis title

-			if (a.y.options.title && a.y.used){

-				style.halign = 'r';

-				style.valign = 'm';

-				style.angle = Flotr.toRad(a.y.options.titleAngle);

-        ctx.drawText(

-          a.y.options.title,

-          this.plotOffset.left - a.y.maxLabel.width - 2 * margin, 

-          this.plotOffset.top + this.plotHeight / 2,

-          style

-        );

-      }

-			

-			// Add y2 axis title

-			if (a.y2.options.title && a.y2.used){

-				style.halign = 'l';

-				style.valign = 'm';

-				style.angle = Flotr.toRad(a.y2.options.titleAngle);

-        ctx.drawText(

-          a.y2.options.title,

-          this.plotOffset.left + this.plotWidth + a.y2.maxLabel.width + 2 * margin, 

-          this.plotOffset.top + this.plotHeight / 2,

-          style

-        );

-      }

-    } 

-    else {

-      html = ['<div style="color:'+options.grid.color+';" class="flotr-titles">'];

-      

-      // Add title

-      if (options.title){

-        html.push('<div style="position:absolute;top:0;left:'+this.plotOffset.left+'px;font-size:1em;font-weight:bold;text-align:center;width:'+this.plotWidth+'px;" class="flotr-title">'+options.title+'</div>');

-      }

-      

-      // Add subtitle

-      if (options.subtitle){

-        html.push('<div style="position:absolute;top:'+this.titleHeight+'px;left:'+this.plotOffset.left+'px;font-size:smaller;text-align:center;width:'+this.plotWidth+'px;" class="flotr-subtitle">'+options.subtitle+'</div>');

-      }

-      html.push('</div>');

-      

-      

-      html.push('<div class="flotr-axis-title" style="font-weight:bold;">');

-			// Add x axis title

-			if (a.x.options.title && a.x.used){

-				html.push('<div style="position:absolute;top:' + (this.plotOffset.top + this.plotHeight + options.grid.labelMargin + a.x.titleSize.height) + 'px;left:' + this.plotOffset.left + 'px;width:' + this.plotWidth + 'px;text-align:center;" class="flotr-axis-title">' + a.x.options.title + '</div>');

-			}

-			

-			// Add x2 axis title

-			if (a.x2.options.title && a.x2.used){

-				html.push('<div style="position:absolute;top:0;left:' + this.plotOffset.left + 'px;width:' + this.plotWidth + 'px;text-align:center;" class="flotr-axis-title">' + a.x2.options.title + '</div>');

-			}

-			

-			// Add y axis title

-			if (a.y.options.title && a.y.used){

-				html.push('<div style="position:absolute;top:' + (this.plotOffset.top + this.plotHeight/2 - a.y.titleSize.height/2) + 'px;left:0;text-align:right;" class="flotr-axis-title">' + a.y.options.title + '</div>');

-			}

-			

-			// Add y2 axis title

-			if (a.y2.options.title && a.y2.used){

-				html.push('<div style="position:absolute;top:' + (this.plotOffset.top + this.plotHeight/2 - a.y.titleSize.height/2) + 'px;right:0;text-align:right;" class="flotr-axis-title">' + a.y2.options.title + '</div>');

-			}

-			html.push('</div>');

-      

-      this.el.insert(html.join(''));

-    }

-  },

-	/**

-	 * Actually draws the graph.

-	 * @param {Object} series - series to draw

-	 */

-	drawSeries: function(series){

-		series = series || this.series;

-		

-		var drawn = false;

-		for(var type in Flotr._registeredTypes){

-			if(series[type] && series[type].show){

-				this[Flotr._registeredTypes[type]](series);

-				drawn = true;

-			}

-		}

-		

-		if(!drawn){

-			this[Flotr._registeredTypes[this.options.defaultType]](series);

-		}

-	},

-	

-	plotLine: function(series, offset){

-		var ctx = this.ctx,

-		    xa = series.xaxis,

-		    ya = series.yaxis,

-  			tHoz = this.tHoz.bind(this),

-  			tVert = this.tVert.bind(this),

-  			data = series.data;

-			

-		if(data.length < 2) return;

-

-		var prevx = tHoz(data[0][0], xa),

-		    prevy = tVert(data[0][1], ya) + offset;

-		ctx.beginPath();

-		ctx.moveTo(prevx, prevy);

-		for(var i = 0; i < data.length - 1; ++i){

-			var x1 = data[i][0],   y1 = data[i][1],

-			    x2 = data[i+1][0], y2 = data[i+1][1];

-

-      // To allow empty values

-      if (y1 === null || y2 === null) continue;

-      

-			/**

-			 * Clip with ymin.

-			 */

-			if(y1 <= y2 && y1 < ya.min){

-				/**

-				 * Line segment is outside the drawing area.

-				 */

-				if(y2 < ya.min) continue;

-				

-				/**

-				 * Compute new intersection point.

-				 */

-				x1 = (ya.min - y1) / (y2 - y1) * (x2 - x1) + x1;

-				y1 = ya.min;

-			}else if(y2 <= y1 && y2 < ya.min){

-				if(y1 < ya.min) continue;

-				x2 = (ya.min - y1) / (y2 - y1) * (x2 - x1) + x1;

-				y2 = ya.min;

-			}

-

-			/**

-			 * Clip with ymax.

-			 */ 

-			if(y1 >= y2 && y1 > ya.max) {

-				if(y2 > ya.max) continue;

-				x1 = (ya.max - y1) / (y2 - y1) * (x2 - x1) + x1;

-				y1 = ya.max;

-			}

-			else if(y2 >= y1 && y2 > ya.max){

-				if(y1 > ya.max) continue;

-				x2 = (ya.max - y1) / (y2 - y1) * (x2 - x1) + x1;

-				y2 = ya.max;

-			}

-

-			/**

-			 * Clip with xmin.

-			 */

-			if(x1 <= x2 && x1 < xa.min){

-				if(x2 < xa.min) continue;

-				y1 = (xa.min - x1) / (x2 - x1) * (y2 - y1) + y1;

-				x1 = xa.min;

-			}else if(x2 <= x1 && x2 < xa.min){

-				if(x1 < xa.min) continue;

-				y2 = (xa.min - x1) / (x2 - x1) * (y2 - y1) + y1;

-				x2 = xa.min;

-			}

-

-			/**

-			 * Clip with xmax.

-			 */

-			if(x1 >= x2 && x1 > xa.max){

-				if (x2 > xa.max) continue;

-				y1 = (xa.max - x1) / (x2 - x1) * (y2 - y1) + y1;

-				x1 = xa.max;

-			}else if(x2 >= x1 && x2 > xa.max){

-				if(x1 > xa.max) continue;

-				y2 = (xa.max - x1) / (x2 - x1) * (y2 - y1) + y1;

-				x2 = xa.max;

-			}

-

-			if(prevx != tHoz(x1, xa) || prevy != tVert(y1, ya) + offset)

-				ctx.moveTo(tHoz(x1, xa), tVert(y1, ya) + offset);

-			

-			prevx = tHoz(x2, xa);

-			prevy = tVert(y2, ya) + offset;

-			ctx.lineTo(prevx, prevy);

-		}

-		ctx.stroke();

-	},

-	/**

-	 * Function used to fill

-	 * @param {Object} data

-	 */

-	plotLineArea: function(series, offset){

-		var data = series.data;

-		if(data.length < 2) return;

-

-		var top, lastX = 0,

-			ctx = this.ctx,

-	    xa = series.xaxis,

-	    ya = series.yaxis,

-			tHoz = this.tHoz.bind(this),

-			tVert = this.tVert.bind(this),

-			bottom = Math.min(Math.max(0, ya.min), ya.max),

-			first = true;

-		

-		ctx.beginPath();

-		for(var i = 0; i < data.length - 1; ++i){

-			

-			var x1 = data[i][0], y1 = data[i][1],

-			    x2 = data[i+1][0], y2 = data[i+1][1];

-			

-			if(x1 <= x2 && x1 < xa.min){

-				if(x2 < xa.min) continue;

-				y1 = (xa.min - x1) / (x2 - x1) * (y2 - y1) + y1;

-				x1 = xa.min;

-			}else if(x2 <= x1 && x2 < xa.min){

-				if(x1 < xa.min) continue;

-				y2 = (xa.min - x1) / (x2 - x1) * (y2 - y1) + y1;

-				x2 = xa.min;

-			}

-								

-			if(x1 >= x2 && x1 > xa.max){

-				if(x2 > xa.max) continue;

-				y1 = (xa.max - x1) / (x2 - x1) * (y2 - y1) + y1;

-				x1 = xa.max;

-			}else if(x2 >= x1 && x2 > xa.max){

-				if (x1 > xa.max) continue;

-				y2 = (xa.max - x1) / (x2 - x1) * (y2 - y1) + y1;

-				x2 = xa.max;

-			}

-

-			if(first){

-				ctx.moveTo(tHoz(x1, xa), tVert(bottom, ya) + offset);

-				first = false;

-			}

-			

-			/**

-			 * Now check the case where both is outside.

-			 */

-			if(y1 >= ya.max && y2 >= ya.max){

-				ctx.lineTo(tHoz(x1, xa), tVert(ya.max, ya) + offset);

-				ctx.lineTo(tHoz(x2, xa), tVert(ya.max, ya) + offset);

-				continue;

-			}else if(y1 <= ya.min && y2 <= ya.min){

-				ctx.lineTo(tHoz(x1, xa), tVert(ya.min, ya) + offset);

-				ctx.lineTo(tHoz(x2, xa), tVert(ya.min, ya) + offset);

-				continue;

-			}

-			

-			/**

-			 * Else it's a bit more complicated, there might

-			 * be two rectangles and two triangles we need to fill

-			 * in; to find these keep track of the current x values.

-			 */

-			var x1old = x1, x2old = x2;

-			

-			/**

-			 * And clip the y values, without shortcutting.

-			 * Clip with ymin.

-			 */

-			if(y1 <= y2 && y1 < ya.min && y2 >= ya.min){

-				x1 = (ya.min - y1) / (y2 - y1) * (x2 - x1) + x1;

-				y1 = ya.min;

-			}else if(y2 <= y1 && y2 < ya.min && y1 >= ya.min){

-				x2 = (ya.min - y1) / (y2 - y1) * (x2 - x1) + x1;

-				y2 = ya.min;

-			}

-

-			/**

-			 * Clip with ymax.

-			 */

-			if(y1 >= y2 && y1 > ya.max && y2 <= ya.max){

-				x1 = (ya.max - y1) / (y2 - y1) * (x2 - x1) + x1;

-				y1 = ya.max;

-			}else if(y2 >= y1 && y2 > ya.max && y1 <= ya.max){

-				x2 = (ya.max - y1) / (y2 - y1) * (x2 - x1) + x1;

-				y2 = ya.max;

-			}

-

-			/**

-			 * If the x value was changed we got a rectangle to fill.

-			 */

-			if(x1 != x1old){

-				top = (y1 <= ya.min) ? top = ya.min : ya.max;

-				ctx.lineTo(tHoz(x1old, xa), tVert(top, ya) + offset);

-				ctx.lineTo(tHoz(x1, xa), tVert(top, ya) + offset);

-			}

-		   	

-			/**

-			 * Fill the triangles.

-			 */

-			ctx.lineTo(tHoz(x1, xa), tVert(y1, ya) + offset);

-			ctx.lineTo(tHoz(x2, xa), tVert(y2, ya) + offset);

-

-			/**

-			 * Fill the other rectangle if it's there.

-			 */

-			if(x2 != x2old){

-				top = (y2 <= ya.min) ? ya.min : ya.max;

-				ctx.lineTo(tHoz(x2old, xa), tVert(top, ya) + offset);

-				ctx.lineTo(tHoz(x2, xa), tVert(top, ya) + offset);

-			}

-

-			lastX = Math.max(x2, x2old);

-		}

-		

-		ctx.lineTo(tHoz(lastX, xa), tVert(bottom, ya) + offset);

-		ctx.closePath();

-		ctx.fill();

-	},

-	/**

-	 * Function: (private) drawSeriesLines

-	 * 

-	 * Function draws lines series in the canvas element.

-	 * 

-	 * Parameters:

-	 * 		series - Series with options.lines.show = true.

-	 * 

-	 * Returns:

-	 * 		void

-	 */

-	drawSeriesLines: function(series){

-		series = series || this.series;

-		var ctx = this.ctx;

-		ctx.save();

-		ctx.translate(this.plotOffset.left, this.plotOffset.top);

-		ctx.lineJoin = 'round';

-

-		var lw = series.lines.lineWidth;

-		var sw = series.shadowSize;

-

-		if(sw > 0){

-			ctx.lineWidth = sw / 2;

-

-			var offset = lw/2 + ctx.lineWidth/2;

-			

-			ctx.strokeStyle = "rgba(0,0,0,0.1)";

-			this.plotLine(series, offset + sw/2);

-

-			ctx.strokeStyle = "rgba(0,0,0,0.2)";

-			this.plotLine(series, offset);

-

-			if(series.lines.fill) {

-				ctx.fillStyle = "rgba(0,0,0,0.05)";

-				this.plotLineArea(series, offset + sw/2);

-			}

-		}

-

-		ctx.lineWidth = lw;

-		ctx.strokeStyle = series.color;

-		if(series.lines.fill){

-			ctx.fillStyle = series.lines.fillColor != null ? series.lines.fillColor : Flotr.parseColor(series.color).scale(null, null, null, series.lines.fillOpacity).toString();

-			this.plotLineArea(series, 0);

-		}

-

-		this.plotLine(series, 0);

-		ctx.restore();

-	},

-	/**

-	 * Function: drawSeriesPoints

-	 * 

-	 * Function draws point series in the canvas element.

-	 * 

-	 * Parameters:

-	 * 		series - Series with options.points.show = true.

-	 * 

-	 * Returns:

-	 * 		void

-	 */

-	drawSeriesPoints: function(series) {

-		var ctx = this.ctx;

-		

-		ctx.save();

-		ctx.translate(this.plotOffset.left, this.plotOffset.top);

-

-		var lw = series.lines.lineWidth;

-		var sw = series.shadowSize;

-		

-		if(sw > 0){

-			ctx.lineWidth = sw / 2;

-      

-			ctx.strokeStyle = 'rgba(0,0,0,0.1)';

-			this.plotPointShadows(series, sw/2 + ctx.lineWidth/2, series.points.radius);

-

-			ctx.strokeStyle = 'rgba(0,0,0,0.2)';

-			this.plotPointShadows(series, ctx.lineWidth/2, series.points.radius);

-		}

-

-		ctx.lineWidth = series.points.lineWidth;

-		ctx.strokeStyle = series.color;

-		ctx.fillStyle = series.points.fillColor != null ? series.points.fillColor : series.color;

-		this.plotPoints(series, series.points.radius, series.points.fill);

-		ctx.restore();

-	},

-	plotPoints: function (series, radius, fill) {

-    var xa = series.xaxis,

-        ya = series.yaxis,

-		    ctx = this.ctx, i,

-		    data = series.data;

-			

-		for(i = data.length - 1; i > -1; --i){

-			var x = data[i][0], y = data[i][1];

-			if(x < xa.min || x > xa.max || y < ya.min || y > ya.max)

-				continue;

-			

-			ctx.beginPath();

-			ctx.arc(this.tHoz(x, xa), this.tVert(y, ya), radius, 0, 2 * Math.PI, true);

-			if(fill) ctx.fill();

-			ctx.stroke();

-		}

-	},

-	plotPointShadows: function(series, offset, radius){

-    var xa = series.xaxis,

-        ya = series.yaxis,

-		    ctx = this.ctx, i,

-		    data = series.data;

-			

-		for(i = data.length - 1; i > -1; --i){

-			var x = data[i][0], y = data[i][1];

-			if (x < xa.min || x > xa.max || y < ya.min || y > ya.max)

-				continue;

-			ctx.beginPath();

-			ctx.arc(this.tHoz(x, xa), this.tVert(y, ya) + offset, radius, 0, Math.PI, false);

-			ctx.stroke();

-		}

-	},

-	/**

-	 * Function: drawSeriesBars

-	 * 

-	 * Function draws bar series in the canvas element.

-	 * 

-	 * Parameters:

-	 * 		series - Series with options.bars.show = true.

-	 * 

-	 * Returns:

-	 * 		void

-	 */

-	drawSeriesBars: function(series) {

-		var ctx = this.ctx,

-			bw = series.bars.barWidth,

-			lw = Math.min(series.bars.lineWidth, bw);

-		

-		ctx.save();

-		ctx.translate(this.plotOffset.left, this.plotOffset.top);

-		ctx.lineJoin = 'miter';

-

-		/**

-		 * @todo linewidth not interpreted the right way.

-		 */

-		ctx.lineWidth = lw;

-		ctx.strokeStyle = series.color;

-    

-		this.plotBarsShadows(series, bw, 0, series.bars.fill);

-

-		if(series.bars.fill){

-			ctx.fillStyle = series.bars.fillColor != null ? series.bars.fillColor : Flotr.parseColor(series.color).scale(null, null, null, series.bars.fillOpacity).toString();

-		}

-    

-		this.plotBars(series, bw, 0, series.bars.fill);

-		ctx.restore();

-	},

-	plotBars: function(series, barWidth, offset, fill){

-		var data = series.data;

-		if(data.length < 1) return;

-		

-    var xa = series.xaxis,

-        ya = series.yaxis,

-  			ctx = this.ctx,

-  			tHoz = this.tHoz.bind(this),

-  			tVert = this.tVert.bind(this);

-

-		for(var i = 0; i < data.length; i++){

-			var x = data[i][0],

-			    y = data[i][1];

-			var drawLeft = true, drawTop = true, drawRight = true;

-			

-			// Stacked bars

-			var stackOffset = 0;

-			if(series.bars.stacked) {

-			  xa.values.each(function(o, v) {

-			    if (v == x) {

-			      stackOffset = o.stack || 0;

-			      o.stack = stackOffset + y;

-			    }

-			  });

-			}

-

-			// @todo: fix horizontal bars support

-			// Horizontal bars

-			if(series.bars.horizontal)

-				var left = stackOffset, right = x + stackOffset, bottom = y, top = y + barWidth;

-			else 

-				var left = x, right = x + barWidth, bottom = stackOffset, top = y + stackOffset;

-

-			if(right < xa.min || left > xa.max || top < ya.min || bottom > ya.max)

-				continue;

-

-			if(left < xa.min){

-				left = xa.min;

-				drawLeft = false;

-			}

-

-			if(right > xa.max){

-				right = xa.max;

-				if (xa.lastSerie != series && series.bars.horizontal)

-					drawTop = false;

-			}

-

-			if(bottom < ya.min)

-				bottom = ya.min;

-

-			if(top > ya.max){

-				top = ya.max;

-				if (ya.lastSerie != series && !series.bars.horizontal)

-					drawTop = false;

-			}

-      

-			/**

-			 * Fill the bar.

-			 */

-			if(fill){

-				ctx.beginPath();

-				ctx.moveTo(tHoz(left, xa), tVert(bottom, ya) + offset);

-				ctx.lineTo(tHoz(left, xa), tVert(top, ya) + offset);

-				ctx.lineTo(tHoz(right, xa), tVert(top, ya) + offset);

-				ctx.lineTo(tHoz(right, xa), tVert(bottom, ya) + offset);

-				ctx.fill();

-			}

-

-			/**

-			 * Draw bar outline/border.

-			 */

-			if(series.bars.lineWidth != 0 && (drawLeft || drawRight || drawTop)){

-				ctx.beginPath();

-				ctx.moveTo(tHoz(left, xa), tVert(bottom, ya) + offset);

-				

-				ctx[drawLeft ?'lineTo':'moveTo'](tHoz(left, xa), tVert(top, ya) + offset);

-				ctx[drawTop  ?'lineTo':'moveTo'](tHoz(right, xa), tVert(top, ya) + offset);

-				ctx[drawRight?'lineTo':'moveTo'](tHoz(right, xa), tVert(bottom, ya) + offset);

-				         

-				ctx.stroke();

-			}

-		}

-	},

-  plotBarsShadows: function(series, barWidth, offset){

-		var data = series.data;

-    if(data.length < 1) return;

-    

-    var xa = series.xaxis,

-        ya = series.yaxis,

-        ctx = this.ctx,

-        tHoz = this.tHoz.bind(this),

-        tVert = this.tVert.bind(this),

-        sw = this.options.shadowSize;

-

-    for(var i = 0; i < data.length; i++){

-      var x = data[i][0],

-          y = data[i][1];

-      

-      // Stacked bars

-      var stackOffset = 0;

-			if(series.bars.stacked) {

-			  xa.values.each(function(o, v) {

-			    if (v == x) {

-			      stackOffset = o.stackShadow || 0;

-			      o.stackShadow = stackOffset + y;

-			    }

-			  });

-			}

-      

-      // Horizontal bars

-      if(series.bars.horizontal) 

-        var left = stackOffset, right = x + stackOffset, bottom = y, top = y + barWidth;

-      else 

-        var left = x, right = x + barWidth, bottom = stackOffset, top = y + stackOffset;

-

-      if(right < xa.min || left > xa.max || top < ya.min || bottom > ya.max)

-        continue;

-

-      if(left < xa.min)   left = xa.min;

-      if(right > xa.max)  right = xa.max;

-      if(bottom < ya.min) bottom = ya.min;

-      if(top > ya.max)    top = ya.max;

-      

-      var width =  tHoz(right, xa)-tHoz(left, xa)-((tHoz(right, xa)+sw <= this.plotWidth) ? 0 : sw);

-      var height = Math.max(0, tVert(bottom, ya)-tVert(top, ya)-((tVert(bottom, ya)+sw <= this.plotHeight) ? 0 : sw));

-

-      ctx.fillStyle = 'rgba(0,0,0,0.05)';

-      ctx.fillRect(Math.min(tHoz(left, xa)+sw, this.plotWidth), Math.min(tVert(top, ya)+sw, this.plotWidth), width, height);

-    }

-  },

-	/**

-	 * Function: drawSeriesCandles

-	 * 

-	 * Function draws candles series in the canvas element.

-	 * 

-	 * Parameters:

-	 * 		series - Series with options.candles.show = true.

-	 * 

-	 * Returns:

-	 * 		void

-	 */

-	drawSeriesCandles: function(series) {

-		var ctx = this.ctx,

-			  bw = series.candles.candleWidth;

-		

-		ctx.save();

-		ctx.translate(this.plotOffset.left, this.plotOffset.top);

-		ctx.lineJoin = 'miter';

-

-		/**

-		 * @todo linewidth not interpreted the right way.

-		 */

-		ctx.lineWidth = series.candles.lineWidth;

-		this.plotCandlesShadows(series, bw/2);

-		this.plotCandles(series, bw/2);

-		

-		ctx.restore();

-	},

-	plotCandles: function(series, offset){

-		var data = series.data;

-		if(data.length < 1) return;

-		

-    var xa = series.xaxis,

-        ya = series.yaxis,

-  			ctx = this.ctx,

-  			tHoz = this.tHoz.bind(this),

-  			tVert = this.tVert.bind(this);

-

-		for(var i = 0; i < data.length; i++){

-      var d     = data[i],

-  		    x     = d[0],

-  		    open  = d[1],

-  		    high  = d[2],

-  		    low   = d[3],

-  		    close = d[4];

-

-			var left    = x,

-			    right   = x + series.candles.candleWidth,

-          bottom  = Math.max(ya.min, low),

-	        top     = Math.min(ya.max, high),

-          bottom2 = Math.max(ya.min, Math.min(open, close)),

-	        top2    = Math.min(ya.max, Math.max(open, close));

-

-			if(right < xa.min || left > xa.max || top < ya.min || bottom > ya.max)

-				continue;

-

-			var color = series.candles[open>close?'downFillColor':'upFillColor'];

-			/**

-			 * Fill the candle.

-			 */

-			if(series.candles.fill && !series.candles.barcharts){

-				ctx.fillStyle = Flotr.parseColor(color).scale(null, null, null, series.candles.fillOpacity).toString();

-				ctx.fillRect(tHoz(left, xa), tVert(top2, ya) + offset, tHoz(right, xa) - tHoz(left, xa), tVert(bottom2, ya) - tVert(top2, ya));

-			}

-

-			/**

-			 * Draw candle outline/border, high, low.

-			 */

-			if(series.candles.lineWidth || series.candles.wickLineWidth){

-				var x, y, pixelOffset = (series.candles.wickLineWidth % 2) / 2;

-

-				x = Math.floor(tHoz((left + right) / 2), xa) + pixelOffset;

-				

-			  ctx.save();

-			  ctx.strokeStyle = color;

-			  ctx.lineWidth = series.candles.wickLineWidth;

-			  ctx.lineCap = 'butt';

-			  

-				if (series.candles.barcharts) {

-					ctx.beginPath();

-					

-					ctx.moveTo(x, Math.floor(tVert(top, ya) + offset));

-					ctx.lineTo(x, Math.floor(tVert(bottom, ya) + offset));

-					

-					y = Math.floor(tVert(open, ya) + offset)+0.5;

-					ctx.moveTo(Math.floor(tHoz(left, xa))+pixelOffset, y);

-					ctx.lineTo(x, y);

-					

-					y = Math.floor(tVert(close, ya) + offset)+0.5;

-					ctx.moveTo(Math.floor(tHoz(right, xa))+pixelOffset, y);

-					ctx.lineTo(x, y);

-				} 

-				else {

-  				ctx.strokeRect(tHoz(left, xa), tVert(top2, ya) + offset, tHoz(right, xa) - tHoz(left, xa), tVert(bottom2, ya) - tVert(top2, ya));

-

-  				ctx.beginPath();

-  				ctx.moveTo(x, Math.floor(tVert(top2,    ya) + offset));

-  				ctx.lineTo(x, Math.floor(tVert(top,     ya) + offset));

-  				ctx.moveTo(x, Math.floor(tVert(bottom2, ya) + offset));

-  				ctx.lineTo(x, Math.floor(tVert(bottom,  ya) + offset));

-				}

-				

-				ctx.stroke();

-				ctx.restore();

-			}

-		}

-	},

-  plotCandlesShadows: function(series, offset){

-		var data = series.data;

-    if(data.length < 1 || series.candles.barcharts) return;

-    

-    var xa = series.xaxis,

-        ya = series.yaxis,

-        tHoz = this.tHoz.bind(this),

-        tVert = this.tVert.bind(this),

-        sw = this.options.shadowSize;

-

-    for(var i = 0; i < data.length; i++){

-      var d     = data[i],

-      		x     = d[0],

-	        open  = d[1],

-	        high  = d[2],

-	        low   = d[3],

-	        close = d[4];

-      

-			var left   = x,

-	        right  = x + series.candles.candleWidth,

-          bottom = Math.max(ya.min, Math.min(open, close)),

-	        top    = Math.min(ya.max, Math.max(open, close));

-

-      if(right < xa.min || left > xa.max || top < ya.min || bottom > ya.max)

-        continue;

-

-      var width =  tHoz(right, xa)-tHoz(left, xa)-((tHoz(right, xa)+sw <= this.plotWidth) ? 0 : sw);

-      var height = Math.max(0, tVert(bottom, ya)-tVert(top, ya)-((tVert(bottom, ya)+sw <= this.plotHeight) ? 0 : sw));

-

-      this.ctx.fillStyle = 'rgba(0,0,0,0.05)';

-      this.ctx.fillRect(Math.min(tHoz(left, xa)+sw, this.plotWidth), Math.min(tVert(top, ya)+sw, this.plotWidth), width, height);

-    }

-  },

-  /**

-   * Function: drawSeriesRadar

-   * 

-   * Function draws a radar chart on the canvas element.

-   * 

-   * Parameters:

-   *    series - Series with options.radar.show = true.

-   * 

-   * Returns:

-   *    void

-   */

-  drawSeriesRadar: function(series) {

-	var ctx = this.ctx,

-		options = this.options, sides= series.data.length;

-		

-	var degreesInRadiansForAngle = Math.PI * 2 / sides,

-	      nintyDegrees = Math.PI / 2;

-	

-	var poly = {};

-	

-	/* 

-	Draw radar grid

-	

-	poly.xaxis = series.xaxis;

-	poly.yaxis = series.yaxis;

-	ctx.save();

-	ctx.translate(this.plotOffset.left, this.plotOffset.top);

-	ctx.lineJoin = 'round';

-	for (radius = 20; radius <= 100; radius += 20) {

-	poly.data = new Array();

-	for (i = 0; i < sides; i++) {

-		angle = nintyDegrees + (degreesInRadiansForAngle * i);

-		poly.data[i] = [radius * Math.cos(angle), radius * Math.sin(angle)]

-	}

-	poly.data[sides] = poly.data[0];

-	this.plotLine(poly,0);}

-	

-	var outside = poly.data;

-	for (i = 0; i < sides; i++) {

-		poly.data = new Array();

-		poly.data[0] = [0,0];

-		poly.data[1] = outside[i];

-		this.plotLine(poly,0);

-	}

-	*/

-	

-	/*

-	Convert Series data into X, Y co-ordinates

-	*/

-	if (!series.dataInRadarFormat) {

-	poly.data = new Array();

-	for (i = 0; i < sides; i++) {

-		angle = nintyDegrees + (degreesInRadiansForAngle * i);

-		poly.data[i] = [series.data[i][1] * Math.cos(angle), series.data[i][1] * Math.sin(angle), series.data[i][0], series.data[i][1]]

-	}

-	poly.data[sides] = poly.data[0];

-	series.data = poly.data;

-	series.lines = series.radar;

-	series.lines.show = false;

-	series.dataInRadarFormat = true;

-	}

-	

-	this.drawSeriesLines(series);

-	

-},

-  

-  

-  /**

-   * Function: drawSeriesPie

-   * 

-   * Function draws a pie in the canvas element.

-   * 

-   * Parameters:

-   *    series - Series with options.pie.show = true.

-   * 

-   * Returns:

-   *    void

-   */

-  drawSeriesPie: function(series) {

-    if (!this.options.pie.drawn) {

-    var ctx = this.ctx,

-        options = this.options,

-        lw = series.pie.lineWidth,

-        sw = series.shadowSize,

-        data = series.data,

-        radius = (Math.min(this.canvasWidth, this.canvasHeight) * series.pie.sizeRatio) / 2,

-        html = [];

-    

-    var vScale = 1;//Math.cos(series.pie.viewAngle);

-    var plotTickness = Math.sin(series.pie.viewAngle)*series.pie.spliceThickness / vScale;

-    

-    var style = {

-      size: options.fontSize*1.2,

-      color: options.grid.color,

-      weight: 1.5

-    };

-    

-    var center = {

-      x: (this.canvasWidth+this.plotOffset.left)/2,

-      y: (this.canvasHeight-this.plotOffset.bottom)/2

-    };

-    

-    // Pie portions

-    var portions = this.series.collect(function(hash, index){

-    	if (hash.pie.show)

-      return {

-        name: (hash.label || hash.data[0][1]),

-        value: [index, hash.data[0][1]],

-        explode: hash.pie.explode

-      };

-    });

-    

-    // Sum of the portions' angles

-    var sum = portions.pluck('value').pluck(1).inject(0, function(acc, n) { return acc + n; });

-    

-    var fraction = 0.0,

-        angle = series.pie.startAngle,

-        value = 0.0;

-    

-    var slices = portions.collect(function(slice){

-      angle += fraction;

-      value = parseFloat(slice.value[1]); // @warning : won't support null values !!

-      fraction = value/sum;

-      return {

-        name:     slice.name,

-        fraction: fraction,

-        x:        slice.value[0],

-        y:        value,

-        explode:  slice.explode,

-        startAngle: 2 * angle * Math.PI,

-        endAngle:   2 * (angle + fraction) * Math.PI

-      };

-    });

-    

-    ctx.save();

-

-    if(sw > 0){

-	    slices.each(function (slice) {

-        var bisection = (slice.startAngle + slice.endAngle) / 2;

-        

-        var xOffset = center.x + Math.cos(bisection) * slice.explode + sw;

-        var yOffset = center.y + Math.sin(bisection) * slice.explode + sw;

-        

-		    this.plotSlice(xOffset, yOffset, radius, slice.startAngle, slice.endAngle, false, vScale);

-

-        ctx.fillStyle = 'rgba(0,0,0,0.1)';

-        ctx.fill();

-      }, this);

-    }

-    

-    if (options.HtmlText) {

-      html = ['<div style="color:' + this.options.grid.color + '" class="flotr-labels">'];

-    }

-    

-    slices.each(function (slice, index) {

-      var bisection = (slice.startAngle + slice.endAngle) / 2;

-      var color = options.colors[index];

-      

-      var xOffset = center.x + Math.cos(bisection) * slice.explode;

-      var yOffset = center.y + Math.sin(bisection) * slice.explode;

-      

-      this.plotSlice(xOffset, yOffset, radius, slice.startAngle, slice.endAngle, false, vScale);

-      

-      if(series.pie.fill){

-        ctx.fillStyle = Flotr.parseColor(color).scale(null, null, null, series.pie.fillOpacity).toString();

-        ctx.fill();

-      }

-      ctx.lineWidth = lw;

-      ctx.strokeStyle = color;

-      ctx.stroke();

-      

-      /*ctx.save();

-      ctx.scale(1, vScale);

-      

-      ctx.moveTo(xOffset, yOffset);

-      ctx.beginPath();

-      ctx.lineTo(xOffset, yOffset+plotTickness);

-      ctx.lineTo(xOffset+Math.cos(slice.startAngle)*radius, yOffset+Math.sin(slice.startAngle)*radius+plotTickness);

-      ctx.lineTo(xOffset+Math.cos(slice.startAngle)*radius, yOffset+Math.sin(slice.startAngle)*radius);

-      ctx.lineTo(xOffset, yOffset);

-      ctx.closePath();

-      ctx.fill();ctx.stroke();

-      

-      ctx.moveTo(xOffset, yOffset);

-      ctx.beginPath();

-      ctx.lineTo(xOffset, yOffset+plotTickness);

-      ctx.lineTo(xOffset+Math.cos(slice.endAngle)*radius, yOffset+Math.sin(slice.endAngle)*radius+plotTickness);

-      ctx.lineTo(xOffset+Math.cos(slice.endAngle)*radius, yOffset+Math.sin(slice.endAngle)*radius);

-      ctx.lineTo(xOffset, yOffset);

-      ctx.closePath();

-      ctx.fill();ctx.stroke();

-      

-      ctx.moveTo(xOffset+Math.cos(slice.startAngle)*radius, yOffset+Math.sin(slice.startAngle)*radius);

-      ctx.beginPath();

-      ctx.lineTo(xOffset+Math.cos(slice.startAngle)*radius, yOffset+Math.sin(slice.startAngle)*radius+plotTickness);

-      ctx.arc(xOffset, yOffset+plotTickness, radius, slice.startAngle, slice.endAngle, false);

-      ctx.lineTo(xOffset+Math.cos(slice.endAngle)*radius, yOffset+Math.sin(slice.endAngle)*radius);

-      ctx.arc(xOffset, yOffset, radius, slice.endAngle, slice.startAngle, true);

-      ctx.closePath();

-      ctx.fill();ctx.stroke();

-      

-      ctx.scale(1, 1/vScale);

-      this.plotSlice(xOffset, yOffset+plotTickness, radius, slice.startAngle, slice.endAngle, false, vScale);

-      ctx.stroke();

-      if(series.pie.fill){

-        ctx.fillStyle = Flotr.parseColor(color).scale(null, null, null, series.pie.fillOpacity).toString();

-        ctx.fill();

-      }

-      

-      ctx.restore();*/

-      

-      var label = options.pie.labelFormatter(slice);

-      

-      var textAlignRight = (Math.cos(bisection) < 0);

-      var distX = xOffset + Math.cos(bisection) * (series.pie.explode + radius);

-      var distY = yOffset + Math.sin(bisection) * (series.pie.explode + radius);

-      

-      if (slice.fraction && label) {

-        if (options.HtmlText) {

-          var divStyle = 'position:absolute;top:' + (distY - 5) + 'px;'; //@todo: change

-          if (textAlignRight) {

-            divStyle += 'right:'+(this.canvasWidth - distX)+'px;text-align:right;';

-          }

-          else {

-            divStyle += 'left:'+distX+'px;text-align:left;';

-          }

-          html.push('<div style="' + divStyle + '" class="flotr-grid-label">' + label + '</div>');

-        }

-        else {

-          style.halign = textAlignRight ? 'r' : 'l';

-          ctx.drawText(

-            label, 

-            distX, 

-            distY + style.size / 2, 

-            style

-          );

-        }

-      }

-    }, this);

-

-    if (options.HtmlText) {

-      html.push('</div>');    

-      this.el.insert(html.join(''));

-    }

-    

-    ctx.restore();

-    options.pie.drawn = true;

-    }

-  },

-  plotSlice: function(x, y, radius, startAngle, endAngle, fill, vScale) {

-    var ctx = this.ctx;

-    vScale = vScale || 1;

-    

-    ctx.save();

-    ctx.scale(1, vScale);

-    ctx.beginPath();

-    ctx.moveTo(x, y);

-    ctx.arc   (x, y, radius, startAngle, endAngle, fill);

-    ctx.lineTo(x, y);

-    ctx.closePath();

-    ctx.restore();

-  },

-  plotPie: function() {}, 

-	/**

-	 * Function: insertLegend

-	 * 

-	 * Function adds a legend div to the canvas container or draws it on the canvas.

-	 * 

-	 * Parameters:

-	 * 		none

-	 * 

-	 * Returns:

-	 * 		void

-	 */

-	insertLegend: function(){

-		if(!this.options.legend.show)

-			return;

-			

-		var series = this.series,

-			plotOffset = this.plotOffset,

-			options = this.options,

-			fragments = [],

-			rowStarted = false, 

-			ctx = this.ctx,

-			i;

-			

-		var noLegendItems = series.findAll(function(s) {return (s.label && !s.hide)}).size();

-

-    if (noLegendItems) {

-	    if (!options.HtmlText && this.textEnabled) {

-	      var style = {

-	        size: options.fontSize*1.1,

-	        color: options.grid.color

-	      };

-	      

-	      // @todo: take css into account

-	      //var dummyDiv = this.el.insert('<div class="flotr-legend" style="position:absolute;top:-10000px;"></div>');

-	      

-	      var p = options.legend.position, 

-	          m = options.legend.margin,

-	          lbw = options.legend.labelBoxWidth,

-	          lbh = options.legend.labelBoxHeight,

-	          lbm = options.legend.labelBoxMargin,

-	          offsetX = plotOffset.left + m,

-	          offsetY = plotOffset.top + m;

-	      

-	      // We calculate the labels' max width

-	      var labelMaxWidth = 0;

-	      for(i = series.length - 1; i > -1; --i){

-	        if(!series[i].label || series[i].hide) continue;

-	        var label = options.legend.labelFormatter(series[i].label);	

-	        labelMaxWidth = Math.max(labelMaxWidth, ctx.measureText(label, style));

-	      }

-	      

-	      var legendWidth  = Math.round(lbw + lbm*3 + labelMaxWidth),

-	          legendHeight = Math.round(noLegendItems*(lbm+lbh) + lbm);

-	

-	      if(p.charAt(0) == 's') offsetY = plotOffset.top + this.plotHeight - (m + legendHeight);

-	      if(p.charAt(1) == 'e') offsetX = plotOffset.left + this.plotWidth - (m + legendWidth);

-

-	      // Legend box

-	      var color = Flotr.parseColor(options.legend.backgroundColor || 'rgb(240,240,240)').scale(null, null, null, options.legend.backgroundOpacity || 0.1).toString();

-	      

-	      ctx.fillStyle = color;

-	      ctx.fillRect(offsetX, offsetY, legendWidth, legendHeight);

-	      ctx.strokeStyle = options.legend.labelBoxBorderColor;

-	      ctx.strokeRect(Flotr.toPixel(offsetX), Flotr.toPixel(offsetY), legendWidth, legendHeight);

-	      

-	      // Legend labels

-	      var x = offsetX + lbm;

-	      var y = offsetY + lbm;

-	      for(i = 0; i < series.length; i++){

-	        if(!series[i].label || series[i].hide) continue;

-	        var label = options.legend.labelFormatter(series[i].label);

-

-	        ctx.fillStyle = series[i].color;

-	        ctx.fillRect(x, y, lbw-1, lbh-1);

-	        

-	        ctx.strokeStyle = options.legend.labelBoxBorderColor;

-	        ctx.lineWidth = 1;

-	        ctx.strokeRect(Math.ceil(x)-1.5, Math.ceil(y)-1.5, lbw+2, lbh+2);

-	        

-	        // Legend text

-	        ctx.drawText(

-	          label,

-	          x + lbw + lbm,

-	          y + (lbh + style.size - ctx.fontDescent(style))/2,

-	          style

-	        );

-	        

-	        y += lbh + lbm;

-	      }

-	    }

-	    else {

-	  		for(i = 0; i < series.length; ++i){

-	  			if(!series[i].label || series[i].hide) continue;

-	  			

-	  			if(i % options.legend.noColumns == 0){

-	  				fragments.push(rowStarted ? '</tr><tr>' : '<tr>');

-	  				rowStarted = true;

-	  			}

-	  

-	  			var label = options.legend.labelFormatter(series[i].label);

-	  			

-	  			fragments.push('<td class="flotr-legend-color-box"><div style="border:1px solid ' + options.legend.labelBoxBorderColor + ';padding:1px"><div style="width:' + options.legend.labelBoxWidth + 'px;height:' + options.legend.labelBoxHeight + 'px;background-color:' + series[i].color + '"></div></div></td>' +

-	  				'<td class="flotr-legend-label">' + label + '</td>');

-	  		}

-	  		if(rowStarted) fragments.push('</tr>');

-	  		

-	  		if(fragments.length > 0){

-	  			var table = '<table style="font-size:smaller;color:' + options.grid.color + '">' + fragments.join("") + '</table>';

-	  			if(options.legend.container != null){

-	  				$(options.legend.container).update(table);

-	  			}else{

-	  				var pos = '';

-	  				var p = options.legend.position, m = options.legend.margin;

-	  				

-	  				     if(p.charAt(0) == 'n') pos += 'top:' + (m + plotOffset.top) + 'px;';

-	  				else if(p.charAt(0) == 's') pos += 'bottom:' + (m + plotOffset.bottom) + 'px;';					

-	  				     if(p.charAt(1) == 'e') pos += 'right:' + (m + plotOffset.right) + 'px;';

-	  				else if(p.charAt(1) == 'w') pos += 'left:' + (m + plotOffset.left) + 'px;';

-	  				     

-	  				var div = this.el.insert('<div class="flotr-legend" style="position:absolute;z-index:2;' + pos +'">' + table + '</div>').select('div.flotr-legend').first();

-	  				

-	  				if(options.legend.backgroundOpacity != 0.0){

-	  					/**

-	  					 * Put in the transparent background separately to avoid blended labels and

-	  					 * label boxes.

-	  					 */

-	  					var c = options.legend.backgroundColor;

-	  					if(c == null){

-	  						var tmp = (options.grid.backgroundColor != null) ? options.grid.backgroundColor : Flotr.extractColor(div);

-	  						c = Flotr.parseColor(tmp).adjust(null, null, null, 1).toString();

-	  					}

-	  					this.el.insert('<div class="flotr-legend-bg" style="position:absolute;width:' + div.getWidth() + 'px;height:' + div.getHeight() + 'px;' + pos +'background-color:' + c + ';"> </div>').select('div.flotr-legend-bg').first().setStyle({

-	  						'opacity': options.legend.backgroundOpacity

-	  					});						

-	  				}

-	  			}

-	  		}

-	    }

-    }

-	},

-	/**

-	 * Function: getEventPosition

-	 * 

-	 * Calculates the coordinates from a mouse event object.

-	 * 

-	 * Parameters:

-	 * 		event - Mouse Event object.

-	 * 

-	 * Returns:

-	 * 		Object with x and y coordinates of the mouse.

-	 */

-	getEventPosition: function (event){

-		var offset = this.overlay.cumulativeOffset(),

-			rx = (event.pageX - offset.left - this.plotOffset.left),

-			ry = (event.pageY - offset.top - this.plotOffset.top),

-			ax = 0, ay = 0

-			

-		if(event.pageX == null && event.clientX != null){

-			var de = document.documentElement, b = document.body;

-			ax = event.clientX + (de && de.scrollLeft || b.scrollLeft || 0);

-			ay = event.clientY + (de && de.scrollTop || b.scrollTop || 0);

-		}else{

-			ax = event.pageX;

-			ay = event.pageY;

-		}

-		

-		return {

-			x:  this.axes.x.min  + rx / this.axes.x.scale,

-			x2: this.axes.x2.min + rx / this.axes.x2.scale,

-			y:  this.axes.y.max  - ry / this.axes.y.scale,

-			y2: this.axes.y2.max - ry / this.axes.y2.scale,

-			relX: rx,

-			relY: ry,

-			absX: ax,

-			absY: ay

-		};

-	},

-	/**

-	 * Function: clickHandler

-	 * 

-	 * Handler observes the 'click' event and fires the 'flotr:click' event.

-	 * 

-	 * Parameters:

-	 * 		event - 'click' Event object.

-	 * 

-	 * Returns:

-	 * 		void

-	 */

-	clickHandler: function(event){

-		if(this.ignoreClick){

-			this.ignoreClick = false;

-			return;

-		}

-		this.el.fire('flotr:click', [this.getEventPosition(event), this]);

-	},

-	/**

-	 * Function: mouseMoveHandler

-	 * 

-	 * Handler observes mouse movement over the graph area. Fires the 

-	 * 'flotr:mousemove' event.

-	 * 

-	 * Parameters:

-	 * 		event - 'mousemove' Event object.

-	 * 

-	 * Returns:

-	 * 		void

-	 */

-	mouseMoveHandler: function(event){

- 		var pos = this.getEventPosition(event);

-    

-		this.lastMousePos.pageX = pos.absX;

-		this.lastMousePos.pageY = pos.absY;	

-		if(this.selectionInterval == null && (this.options.mouse.track || this.series.any(function(s){return s.mouse && s.mouse.track;}))){	

-			this.hit(pos);

-		}

-    

-		this.el.fire('flotr:mousemove', [event, pos, this]);

-	},

-	/**

-	 * Function: mouseDownHandler

-	 * 

-	 * Handler observes the 'mousedown' event.

-	 * 

-	 * Parameters:

-	 * 		event - 'mousedown' Event object.

-	 * 

-	 * Returns:

-	 * 		void

-	 */

-	mouseDownHandler: function (event){

-    if(event.isRightClick()) {

-      event.stop();

-      var overlay = this.overlay;

-      overlay.hide();

-      

-      function cancelContextMenu () {

-        overlay.show();

-        $(document).stopObserving('mousemove', cancelContextMenu);

-      }

-      $(document).observe('mousemove', cancelContextMenu);

-      return;

-    }

-    

-		if(!this.options.selection.mode || !event.isLeftClick()) return;

-		

-		this.setSelectionPos(this.selection.first, event);				

-		if(this.selectionInterval != null){

-			clearInterval(this.selectionInterval);

-		}

-		this.lastMousePos.pageX = null;

-		this.selectionInterval = setInterval(this.updateSelection.bind(this), 1000/this.options.selection.fps);

-		

-		this.mouseUpHandler = this.mouseUpHandler.bind(this);

-		$(document).observe('mouseup', this.mouseUpHandler);

-	},

-	/**

-	 * Function: (private) fireSelectEvent

-	 * 

-	 * Fires the 'flotr:select' event when the user made a selection.

-	 * 

-	 * Parameters:

-	 * 		none

-	 * 

-	 * Returns:

-	 * 		void

-	 */

-	fireSelectEvent: function(){

-		var a = this.axes, selection = this.selection,

-			x1 = (selection.first.x <= selection.second.x) ? selection.first.x : selection.second.x,

-			x2 = (selection.first.x <= selection.second.x) ? selection.second.x : selection.first.x,

-			y1 = (selection.first.y >= selection.second.y) ? selection.first.y : selection.second.y,

-			y2 = (selection.first.y >= selection.second.y) ? selection.second.y : selection.first.y;

-		

-		x1 = a.x.min + x1 / a.x.scale;

-		x2 = a.x.min + x2 / a.x.scale;

-		y1 = a.y.max - y1 / a.y.scale;

-		y2 = a.y.max - y2 / a.y.scale;

-

-		this.el.fire('flotr:select', [{x1:x1, y1:y1, x2:x2, y2:y2}, this]);

-	},

-	/**

-	 * Function: (private) mouseUpHandler

-	 * 

-	 * Handler observes the mouseup event for the document. 

-	 * 

-	 * Parameters:

-	 * 		event - 'mouseup' Event object.

-	 * 

-	 * Returns:

-	 * 		void

-	 */

-	mouseUpHandler: function(event){

-    $(document).stopObserving('mouseup', this.mouseUpHandler);

-    event.stop();

-    

-		if(this.selectionInterval != null){

-			clearInterval(this.selectionInterval);

-			this.selectionInterval = null;

-		}

-

-		this.setSelectionPos(this.selection.second, event);

-		this.clearSelection();

-		

-		if(this.selectionIsSane()){

-			this.drawSelection();

-			this.fireSelectEvent();

-			this.ignoreClick = true;

-		}

-	},

-	/**

-	 * Function: setSelectionPos

-	 * 

-	 * Calculates the position of the selection.

-	 * 

-	 * Parameters:

-	 * 		pos - Position object.

-	 * 		event - Event object.

-	 * 

-	 * Returns:

-	 * 		void

-	 */

-	setSelectionPos: function(pos, event) {

-		var options = this.options,

-		    offset = $(this.overlay).cumulativeOffset();

-		

-		if(options.selection.mode.indexOf('x') == -1){

-			pos.x = (pos == this.selection.first) ? 0 : this.plotWidth;			   

-		}else{

-			pos.x = event.pageX - offset.left - this.plotOffset.left;

-			pos.x = Math.min(Math.max(0, pos.x), this.plotWidth);

-		}

-

-		if (options.selection.mode.indexOf('y') == -1){

-			pos.y = (pos == this.selection.first) ? 0 : this.plotHeight;

-		}else{

-			pos.y = event.pageY - offset.top - this.plotOffset.top;

-			pos.y = Math.min(Math.max(0, pos.y), this.plotHeight);

-		}

-	},

-	/**

-	 * Function: updateSelection

-	 * 

-	 * Updates (draws) the selection box.

-	 * 

-	 * Parameters:

-	 * 		none

-	 * 

-	 * Returns:

-	 * 		void

-	 */

-	updateSelection: function(){

-		if(this.lastMousePos.pageX == null) return;

-		

-		this.setSelectionPos(this.selection.second, this.lastMousePos);

-		this.clearSelection();

-		

-		if(this.selectionIsSane()) this.drawSelection();

-	},

-	/**

-	 * Function: clearSelection

-	 * 

-	 * Removes the selection box from the overlay canvas.

-	 * 

-	 * Parameters:

-	 * 		none

-	 * 

-	 * Returns:

-	 * 		void

-	 */

-	clearSelection: function() {

-		if(this.prevSelection == null) return;

-			

-		var prevSelection = this.prevSelection,

-			octx = this.octx,

-			plotOffset = this.plotOffset,

-			x = Math.min(prevSelection.first.x, prevSelection.second.x),

-			y = Math.min(prevSelection.first.y, prevSelection.second.y),

-			w = Math.abs(prevSelection.second.x - prevSelection.first.x),

-			h = Math.abs(prevSelection.second.y - prevSelection.first.y);

-		

-		octx.clearRect(x + plotOffset.left - octx.lineWidth,

-		               y + plotOffset.top - octx.lineWidth,

-		               w + octx.lineWidth*2,

-		               h + octx.lineWidth*2);

-		

-		this.prevSelection = null;

-	},

-	/**

-	 * Function: setSelection

-	 * 

-	 * Allows the user the manually select an area.

-	 * 

-	 * Parameters:

-	 * 		area - Object with coordinates to select.

-	 * 

-	 * Returns:

-	 * 		void

-	 */

-	setSelection: function(area){

-		var options = this.options,

-			xa = this.axes.x,

-			ya = this.axes.y,

-			vertScale = yaxis.scale,

-			hozScale = xaxis.scale,

-			selX = options.selection.mode.indexOf('x') != -1,

-			selY = options.selection.mode.indexOf('y') != -1;

-		

-		this.clearSelection();

-

-		this.selection.first.y  = selX ? 0 : (ya.max - area.y1) * vertScale;

-		this.selection.second.y = selX ? this.plotHeight : (ya.max - area.y2) * vertScale;			

-		this.selection.first.x  = selY ? 0 : (area.x1 - xa.min) * hozScale;

-		this.selection.second.x = selY ? this.plotWidth : (area.x2 - xa.min) * hozScale;

-		

-		this.drawSelection();

-		this.fireSelectEvent();

-	},

-	/**

-	 * Function: (private) drawSelection

-	 * 

-	 * Draws the selection box.

-	 * 

-	 * Parameters:

-	 * 		none

-	 * 

-	 * Returns:

-	 * 		void

-	 */

-	drawSelection: function() {

-		var prevSelection = this.prevSelection,

-			selection = this.selection,

-			octx = this.octx,

-			options = this.options,

-			plotOffset = this.plotOffset;

-		

-		if(prevSelection != null &&

-			selection.first.x == prevSelection.first.x &&

-			selection.first.y == prevSelection.first.y && 

-			selection.second.x == prevSelection.second.x &&

-			selection.second.y == prevSelection.second.y)

-			return;

-		

-		octx.strokeStyle = Flotr.parseColor(options.selection.color).scale(null, null, null, 0.8).toString();

-		octx.lineWidth = 1;

-		octx.lineJoin = 'round';

-		octx.fillStyle = Flotr.parseColor(options.selection.color).scale(null, null, null, 0.4).toString();

-

-		this.prevSelection = {

-			first: { x: selection.first.x, y: selection.first.y },

-			second: { x: selection.second.x, y: selection.second.y }

-		};

-

-		var x = Math.min(selection.first.x, selection.second.x),

-		    y = Math.min(selection.first.y, selection.second.y),

-		    w = Math.abs(selection.second.x - selection.first.x),

-		    h = Math.abs(selection.second.y - selection.first.y);

-		

-		octx.fillRect(x + plotOffset.left, y + plotOffset.top, w, h);

-		octx.strokeRect(x + plotOffset.left, y + plotOffset.top, w, h);

-	},

-	/**

-	 * Function: (private) selectionIsSane

-	 * 

-	 * Determines whether or not the selection is sane and should be drawn.

-	 * 

-	 * Parameters:

-	 * 		none

-	 * 

-	 * Returns:

-	 * 		boolean - True when sane, false otherwise.

-	 */

-	selectionIsSane: function(){

-		var selection = this.selection;

-		return Math.abs(selection.second.x - selection.first.x) >= 5 &&

-		       Math.abs(selection.second.y - selection.first.y) >= 5;

-	},

-	/**

-	 * Function: clearHit

-	 * 

-	 * Removes the mouse tracking point from the overlay.

-	 * 

-	 * Parameters:

-	 * 		none

-	 * 

-	 * Returns:

-	 * 		void

-	 */

-	clearHit: function(){

-		if(this.prevHit){

-			var options = this.options,

-			    plotOffset = this.plotOffset,

-			    prevHit = this.prevHit;

-					

-			this.octx.clearRect(

-				this.tHoz(prevHit.x) + plotOffset.left - options.points.radius*2,

-				this.tVert(prevHit.y) + plotOffset.top - options.points.radius*2,

-				options.points.radius*3 + options.points.lineWidth*3, 

-				options.points.radius*3 + options.points.lineWidth*3

-			);

-			this.prevHit = null;

-		}		

-	},

-	/**

-	 * Function: hit

-	 * 

-	 * Retrieves the nearest data point from the mouse cursor. If it's within

-	 * a certain range, draw a point on the overlay canvas and display the x and y

-	 * value of the data.

-	 * 

-	 * Parameters:

-	 * 		mouse - Object that holds the relative x and y coordinates of the cursor.

-	 * 

-	 * Returns:

-	 * 		void

-	 */

-	hit: function(mouse){

-		var series = this.series,

-			options = this.options,

-			prevHit = this.prevHit,

-			plotOffset = this.plotOffset,

-			octx = this.octx, 

-			data, xsens, ysens,

-			/**

-			 * Nearest data element.

-			 */

-			i, n = {

-				dist:Number.MAX_VALUE,

-				x:null,

-				y:null,

-				relX:mouse.relX,

-				relY:mouse.relY,

-				absX:mouse.absX,

-				absY:mouse.absY,

-				mouse:null,

-				radarData:null

-			};

-		

-		for(i = 0; i < series.length; i++){

-			s = series[i];

-			if(!s.mouse.track) continue;

-			data = s.data;

-			xsens = (s.xaxis.scale*s.mouse.sensibility);

-			ysens = (s.yaxis.scale*s.mouse.sensibility);

-

-			for(var j = 0, xpow, ypow; j < data.length; j++){

-				if (data[j][1] === null) continue;

-				xpow = Math.pow(s.xaxis.scale*(data[j][0] - mouse.x), 2);

-				ypow = Math.pow(s.yaxis.scale*(data[j][1] - mouse.y), 2);

-				if(xpow < xsens && ypow < ysens && Math.sqrt(xpow+ypow) < n.dist){

-					n.dist = Math.sqrt(xpow+ypow);

-					n.x = data[j][0];

-					n.y = data[j][1];

-					n.radarLabel = data[j][2];

-					n.radarData = data[j][3];

-					n.mouse = s.mouse;

-				}

-			}

-		}

-		

-		if(n.mouse && n.mouse.track && !prevHit || (prevHit && (n.x != prevHit.x || n.y != prevHit.y))){

-			var mt = this.mouseTrack || this.el.select(".flotr-mouse-value")[0],

-			    pos = '', 

-			    p = options.mouse.position, 

-			    m = options.mouse.margin,

-			    elStyle = 'opacity:0.7;background-color:#000;color:#fff;display:none;position:absolute;padding:2px 8px;-moz-border-radius:4px;border-radius:4px;white-space:nowrap;';

-

-			if (!options.mouse.relative) { // absolute to the canvas

-						 if(p.charAt(0) == 'n') pos += 'top:' + (m + plotOffset.top) + 'px;';

-				else if(p.charAt(0) == 's') pos += 'bottom:' + (m + plotOffset.bottom) + 'px;';					

-				     if(p.charAt(1) == 'e') pos += 'right:' + (m + plotOffset.right) + 'px;';

-				else if(p.charAt(1) == 'w') pos += 'left:' + (m + plotOffset.left) + 'px;';

-			}

-			else { // relative to the mouse

-			       if(p.charAt(0) == 'n') pos += 'bottom:' + (m - plotOffset.top - this.tVert(n.y) + this.canvasHeight) + 'px;';

-				else if(p.charAt(0) == 's') pos += 'top:' + (m + plotOffset.top + this.tVert(n.y)) + 'px;';

-				     if(p.charAt(1) == 'e') pos += 'left:' + (m + plotOffset.left + this.tHoz(n.x)) + 'px;';

-				else if(p.charAt(1) == 'w') pos += 'right:' + (m - plotOffset.left - this.tHoz(n.x) + this.canvasWidth) + 'px;';

-			}

-			

-			elStyle += pos;

-				     

-			if(!mt){

-				this.el.insert('<div class="flotr-mouse-value" style="'+elStyle+'"></div>');

-				mt = this.mouseTrack = this.el.select('.flotr-mouse-value').first();

-			}

-			else {

-				this.mouseTrack = mt.setStyle(elStyle);

-			}

-			

-			if(n.x !== null && n.y !== null){

-				mt.show();

-				

-				this.clearHit();

-				if(n.mouse.lineColor != null){

-					octx.save();

-					octx.translate(plotOffset.left, plotOffset.top);

-					octx.lineWidth = options.points.lineWidth;

-					octx.strokeStyle = n.mouse.lineColor;

-					octx.fillStyle = '#ffffff';

-					octx.beginPath();

-					octx.arc(this.tHoz(n.x), this.tVert(n.y), options.mouse.radius, 0, 2 * Math.PI, true);

-					octx.fill();

-					octx.stroke();

-					octx.restore();

-				}

-				this.prevHit = n;

-				

-				var decimals = n.mouse.trackDecimals;

-				if(decimals == null || decimals < 0) decimals = 0;

-				

-				mt.innerHTML = n.mouse.trackFormatter({x: n.x.toFixed(decimals), y: n.y.toFixed(decimals), 

-												radarLabel: n.radarLabel, radarData: n.radarData.toFixed(decimals)});

-				mt.fire('flotr:hit', [n, this]);

-			}

-			else if(prevHit){

-				mt.hide();

-				this.clearHit();

-			}

-		}

-	},

-	saveImage: function (type, width, height, replaceCanvas) {

-		var image = null;

-	  switch (type) {

-	  	case 'jpeg':

-	    case 'jpg': image = Canvas2Image.saveAsJPEG(this.canvas, replaceCanvas, width, height); break;

-      default:

-      case 'png': image = Canvas2Image.saveAsPNG(this.canvas, replaceCanvas, width, height); break;

-      case 'bmp': image = Canvas2Image.saveAsBMP(this.canvas, replaceCanvas, width, height); break;

-	  }

-	  if (Object.isElement(image) && replaceCanvas) {

-	    this.restoreCanvas();

-	    this.canvas.hide();

-	    this.overlay.hide();

-	  	this.el.insert(image.setStyle({position: 'absolute'}));

-	  }

-	},

-	restoreCanvas: function() {

-    this.canvas.show();

-    this.overlay.show();

-    this.el.select('img').invoke('remove');

-	}

-});

-

-Flotr.Color = Class.create({

-	initialize: function(r, g, b, a){

-		this.rgba = ['r','g','b','a'];

-		var x = 4;

-		while(-1<--x){

-			this[this.rgba[x]] = arguments[x] || ((x==3) ? 1.0 : 0);

-		}

-		this.normalize();

-	},

-	

-	adjust: function(rd, gd, bd, ad) {

-		var x = 4;

-		while(-1<--x){

-			if(arguments[x] != null)

-				this[this.rgba[x]] += arguments[x];

-		}

-		return this.normalize();

-	},

-	

-	clone: function(){

-		return new Flotr.Color(this.r, this.b, this.g, this.a);

-	},

-	

-	limit: function(val,minVal,maxVal){

-		return Math.max(Math.min(val, maxVal), minVal);

-	},

-	

-	normalize: function(){

-		var limit = this.limit;

-		this.r = limit(parseInt(this.r), 0, 255);

-		this.g = limit(parseInt(this.g), 0, 255);

-		this.b = limit(parseInt(this.b), 0, 255);

-		this.a = limit(this.a, 0, 1);

-		return this;

-	},

-	

-	scale: function(rf, gf, bf, af){

-		var x = 4;

-		while(-1<--x){

-			if(arguments[x] != null)

-				this[this.rgba[x]] *= arguments[x];

-		}

-		return this.normalize();

-	},

-	

-	distance: function(color){

-		if (!color) return;

-		color = new Flotr.parseColor(color);

-	  var dist = 0;

-		var x = 3;

-		while(-1<--x){

-			dist += Math.abs(this[this.rgba[x]] - color[this.rgba[x]]);

-		}

-		return dist;

-	},

-	

-	toString: function(){

-		return (this.a >= 1.0) ? 'rgb('+[this.r,this.g,this.b].join(',')+')' : 'rgba('+[this.r,this.g,this.b,this.a].join(',')+')';

-	}

-});

-

-Flotr.Color.lookupColors = {

-	aqua:[0,255,255],

-	azure:[240,255,255],

-	beige:[245,245,220],

-	black:[0,0,0],

-	blue:[0,0,255],

-	brown:[165,42,42],

-	cyan:[0,255,255],

-	darkblue:[0,0,139],

-	darkcyan:[0,139,139],

-	darkgrey:[169,169,169],

-	darkgreen:[0,100,0],

-	darkkhaki:[189,183,107],

-	darkmagenta:[139,0,139],

-	darkolivegreen:[85,107,47],

-	darkorange:[255,140,0],

-	darkorchid:[153,50,204],

-	darkred:[139,0,0],

-	darksalmon:[233,150,122],

-	darkviolet:[148,0,211],

-	fuchsia:[255,0,255],

-	gold:[255,215,0],

-	green:[0,128,0],

-	indigo:[75,0,130],

-	khaki:[240,230,140],

-	lightblue:[173,216,230],

-	lightcyan:[224,255,255],

-	lightgreen:[144,238,144],

-	lightgrey:[211,211,211],

-	lightpink:[255,182,193],

-	lightyellow:[255,255,224],

-	lime:[0,255,0],

-	magenta:[255,0,255],

-	maroon:[128,0,0],

-	navy:[0,0,128],

-	olive:[128,128,0],

-	orange:[255,165,0],

-	pink:[255,192,203],

-	purple:[128,0,128],

-	violet:[128,0,128],

-	red:[255,0,0],

-	silver:[192,192,192],

-	white:[255,255,255],

-	yellow:[255,255,0]

-};

-

-// not used yet

-Flotr.Date = {

-  format: function(d, format) {

-		if (!d) return;

-

-    var leftPad = function(n) {

-      n = n.toString();

-      return n.length == 1 ? "0" + n : n;

-    };

-    

-    var r = [];

-    var escape = false;

-    

-    for (var i = 0; i < format.length; ++i) {

-      var c = format.charAt(i);

-      

-      if (escape) {

-        switch (c) {

-	        case 'h': c = d.getUTCHours().toString(); break;

-	        case 'H': c = leftPad(d.getUTCHours()); break;

-	        case 'M': c = leftPad(d.getUTCMinutes()); break;

-	        case 'S': c = leftPad(d.getUTCSeconds()); break;

-	        case 'd': c = d.getUTCDate().toString(); break;

-	        case 'm': c = (d.getUTCMonth() + 1).toString(); break;

-	        case 'y': c = d.getUTCFullYear().toString(); break;

-	        case 'b': c = Flotr.Date.monthNames[d.getUTCMonth()]; break;

-        }

-        r.push(c);

-        escape = false;

-      }

-      else {

-        if (c == "%")

-          escape = true;

-        else

-          r.push(c);

-      }

-    }

-    return r.join("");

-  },

-  timeUnits: {

-    "second": 1000,

-    "minute": 60 * 1000,

-    "hour": 60 * 60 * 1000,

-    "day": 24 * 60 * 60 * 1000,

-    "month": 30 * 24 * 60 * 60 * 1000,

-    "year": 365.2425 * 24 * 60 * 60 * 1000

-  },

-  // the allowed tick sizes, after 1 year we use an integer algorithm

-  spec: [

-    [1, "second"], [2, "second"], [5, "second"], [10, "second"], [30, "second"], 

-    [1, "minute"], [2, "minute"], [5, "minute"], [10, "minute"], [30, "minute"], 

-    [1, "hour"], [2, "hour"], [4, "hour"], [8, "hour"], [12, "hour"],

-    [1, "day"], [2, "day"], [3, "day"],

-    [0.25, "month"], [0.5, "month"], [1, "month"], [2, "month"], [3, "month"], [6, "month"],

-    [1, "year"]

-  ],

-  monthNames: ["Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug", "Sep", "Oct", "Nov", "Dec"]

-};

 

file:a/js/flotr/lib/base64.js (deleted)
--- a/js/flotr/lib/base64.js
+++ /dev/null
@@ -1,113 +1,1 @@
-/* Copyright (C) 1999 Masanao Izumo <iz@onicos.co.jp>

- * Version: 1.0

- * LastModified: Dec 25 1999

- * This library is free.  You can redistribute it and/or modify it.

- */

-

-/*

- * Interfaces:

- * b64 = base64encode(data);

- * data = base64decode(b64);

- */

-

-(function() {

-

-var base64EncodeChars = "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/";

-var base64DecodeChars = [

-    -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1,

-    -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1,

-    -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, 62, -1, -1, -1, 63,

-    52, 53, 54, 55, 56, 57, 58, 59, 60, 61, -1, -1, -1, -1, -1, -1,

-    -1,  0,  1,  2,  3,  4,  5,  6,  7,  8,  9, 10, 11, 12, 13, 14,

-    15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, -1, -1, -1, -1, -1,

-    -1, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40,

-    41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, -1, -1, -1, -1, -1];

-

-function base64encode(str) {

-    var out, i, len;

-    var c1, c2, c3;

-

-    len = str.length;

-    i = 0;

-    out = "";

-    while(i < len) {

-	c1 = str.charCodeAt(i++) & 0xff;

-	if(i == len)

-	{

-	    out += base64EncodeChars.charAt(c1 >> 2);

-	    out += base64EncodeChars.charAt((c1 & 0x3) << 4);

-	    out += "==";

-	    break;

-	}

-	c2 = str.charCodeAt(i++);

-	if(i == len)

-	{

-	    out += base64EncodeChars.charAt(c1 >> 2);

-	    out += base64EncodeChars.charAt(((c1 & 0x3)<< 4) | ((c2 & 0xF0) >> 4));

-	    out += base64EncodeChars.charAt((c2 & 0xF) << 2);

-	    out += "=";

-	    break;

-	}

-	c3 = str.charCodeAt(i++);

-	out += base64EncodeChars.charAt(c1 >> 2);

-	out += base64EncodeChars.charAt(((c1 & 0x3)<< 4) | ((c2 & 0xF0) >> 4));

-	out += base64EncodeChars.charAt(((c2 & 0xF) << 2) | ((c3 & 0xC0) >>6));

-	out += base64EncodeChars.charAt(c3 & 0x3F);

-    }

-    return out;

-}

-

-function base64decode(str) {

-    var c1, c2, c3, c4;

-    var i, len, out;

-

-    len = str.length;

-    i = 0;

-    out = "";

-    while(i < len) {

-	/* c1 */

-	do {

-	    c1 = base64DecodeChars[str.charCodeAt(i++) & 0xff];

-	} while(i < len && c1 == -1);

-	if(c1 == -1)

-	    break;

-

-	/* c2 */

-	do {

-	    c2 = base64DecodeChars[str.charCodeAt(i++) & 0xff];

-	} while(i < len && c2 == -1);

-	if(c2 == -1)

-	    break;

-

-	out += String.fromCharCode((c1 << 2) | ((c2 & 0x30) >> 4));

-

-	/* c3 */

-	do {

-	    c3 = str.charCodeAt(i++) & 0xff;

-	    if(c3 == 61)

-		return out;

-	    c3 = base64DecodeChars[c3];

-	} while(i < len && c3 == -1);

-	if(c3 == -1)

-	    break;

-

-	out += String.fromCharCode(((c2 & 0XF) << 4) | ((c3 & 0x3C) >> 2));

-

-	/* c4 */

-	do {

-	    c4 = str.charCodeAt(i++) & 0xff;

-	    if(c4 == 61)

-		return out;

-	    c4 = base64DecodeChars[c4];

-	} while(i < len && c4 == -1);

-	if(c4 == -1)

-	    break;

-	out += String.fromCharCode(((c3 & 0x03) << 6) | c4);

-    }

-    return out;

-}

-

-if (!window.btoa) window.btoa = base64encode;

-if (!window.atob) window.atob = base64decode;

-

-})();
+

--- a/js/flotr/lib/canvas2image.js
+++ /dev/null
@@ -1,230 +1,1 @@
-/*

- * Canvas2Image v0.1

- * Copyright (c) 2008 Jacob Seidelin, cupboy@gmail.com

- * MIT License [http://www.opensource.org/licenses/mit-license.php]

- */

-

-var Canvas2Image = (function() {

-	// check if we have canvas support

-	var oCanvas = document.createElement("canvas");

-  

-	// no canvas, bail out.

-	if (!oCanvas.getContext) {

-		return {

-			saveAsBMP : function(){},

-			saveAsPNG : function(){},

-			saveAsJPEG : function(){}

-		}

-	}

-

-	var bHasImageData = !!(oCanvas.getContext("2d").getImageData);

-	var bHasDataURL = !!(oCanvas.toDataURL);

-	var bHasBase64 = !!(window.btoa);

-

-	var strDownloadMime = "image/octet-stream";

-

-	// ok, we're good

-	var readCanvasData = function(oCanvas) {

-		var iWidth = parseInt(oCanvas.width);

-		var iHeight = parseInt(oCanvas.height);

-		return oCanvas.getContext("2d").getImageData(0,0,iWidth,iHeight);

-	}

-

-	// base64 encodes either a string or an array of charcodes

-	var encodeData = function(data) {

-		var strData = "";

-		if (typeof data == "string") {

-			strData = data;

-		} else {

-			var aData = data;

-			for (var i = 0; i < aData.length; i++) {

-				strData += String.fromCharCode(aData[i]);

-			}

-		}

-		return btoa(strData);

-	}

-

-	// creates a base64 encoded string containing BMP data

-	// takes an imagedata object as argument

-	var createBMP = function(oData) {

-		var aHeader = [];

-	

-		var iWidth = oData.width;

-		var iHeight = oData.height;

-

-		aHeader.push(0x42); // magic 1

-		aHeader.push(0x4D); 

-	

-		var iFileSize = iWidth*iHeight*3 + 54; // total header size = 54 bytes

-		aHeader.push(iFileSize % 256); iFileSize = Math.floor(iFileSize / 256);

-		aHeader.push(iFileSize % 256); iFileSize = Math.floor(iFileSize / 256);

-		aHeader.push(iFileSize % 256); iFileSize = Math.floor(iFileSize / 256);

-		aHeader.push(iFileSize % 256);

-

-		aHeader.push(0); // reserved

-		aHeader.push(0);

-		aHeader.push(0); // reserved

-		aHeader.push(0);

-

-		aHeader.push(54); // data offset

-		aHeader.push(0);

-		aHeader.push(0);

-		aHeader.push(0);

-

-		var aInfoHeader = [];

-		aInfoHeader.push(40); // info header size

-		aInfoHeader.push(0);

-		aInfoHeader.push(0);

-		aInfoHeader.push(0);

-

-		var iImageWidth = iWidth;

-		aInfoHeader.push(iImageWidth % 256); iImageWidth = Math.floor(iImageWidth / 256);

-		aInfoHeader.push(iImageWidth % 256); iImageWidth = Math.floor(iImageWidth / 256);

-		aInfoHeader.push(iImageWidth % 256); iImageWidth = Math.floor(iImageWidth / 256);

-		aInfoHeader.push(iImageWidth % 256);

-	

-		var iImageHeight = iHeight;

-		aInfoHeader.push(iImageHeight % 256); iImageHeight = Math.floor(iImageHeight / 256);

-		aInfoHeader.push(iImageHeight % 256); iImageHeight = Math.floor(iImageHeight / 256);

-		aInfoHeader.push(iImageHeight % 256); iImageHeight = Math.floor(iImageHeight / 256);

-		aInfoHeader.push(iImageHeight % 256);

-	

-		aInfoHeader.push(1); // num of planes

-		aInfoHeader.push(0);

-	

-		aInfoHeader.push(24); // num of bits per pixel

-		aInfoHeader.push(0);

-	

-		aInfoHeader.push(0); // compression = none

-		aInfoHeader.push(0);

-		aInfoHeader.push(0);

-		aInfoHeader.push(0);

-	

-		var iDataSize = iWidth*iHeight*3; 

-		aInfoHeader.push(iDataSize % 256); iDataSize = Math.floor(iDataSize / 256);

-		aInfoHeader.push(iDataSize % 256); iDataSize = Math.floor(iDataSize / 256);

-		aInfoHeader.push(iDataSize % 256); iDataSize = Math.floor(iDataSize / 256);

-		aInfoHeader.push(iDataSize % 256); 

-	

-		for (var i = 0; i < 16; i++) {

-			aInfoHeader.push(0);	// these bytes not used

-		}

-	

-		var iPadding = (4 - ((iWidth * 3) % 4)) % 4;

-

-		var aImgData = oData.data;

-

-		var strPixelData = "";

-		var y = iHeight;

-		do {

-			var iOffsetY = iWidth*(y-1)*4;

-			var strPixelRow = "";

-			for (var x=0;x<iWidth;x++) {

-				var iOffsetX = 4*x;

-

-				strPixelRow += String.fromCharCode(aImgData[iOffsetY+iOffsetX+2]);

-				strPixelRow += String.fromCharCode(aImgData[iOffsetY+iOffsetX+1]);

-				strPixelRow += String.fromCharCode(aImgData[iOffsetY+iOffsetX]);

-			}

-			for (var c=0;c<iPadding;c++) {

-				strPixelRow += String.fromCharCode(0);

-			}

-			strPixelData += strPixelRow;

-		} while (--y);

-

-		return encodeData(aHeader.concat(aInfoHeader)) + encodeData(strPixelData);

-	}

-

-	// sends the generated file to the client

-	var saveFile = function(strData) {

-    if (!window.open(strData)) {

-      document.location.href = strData;

-    }

-	}

-

-	var makeDataURI = function(strData, strMime) {

-		return "data:" + strMime + ";base64," + strData;

-	}

-

-	// generates a <img> object containing the imagedata

-	var makeImageObject = function(strSource) {

-		var oImgElement = document.createElement("img");

-		oImgElement.src = strSource;

-		return oImgElement;

-	}

-

-	var scaleCanvas = function(oCanvas, iWidth, iHeight) {

-		if (iWidth && iHeight) {

-			var oSaveCanvas = document.createElement("canvas");

-			

-			oSaveCanvas.width = iWidth;

-			oSaveCanvas.height = iHeight;

-			oSaveCanvas.style.width = iWidth+"px";

-			oSaveCanvas.style.height = iHeight+"px";

-

-			var oSaveCtx = oSaveCanvas.getContext("2d");

-

-			oSaveCtx.drawImage(oCanvas, 0, 0, oCanvas.width, oCanvas.height, 0, 0, iWidth, iWidth);

-			

-			return oSaveCanvas;

-		}

-		return oCanvas;

-	}

-

-	return {

-		saveAsPNG : function(oCanvas, bReturnImg, iWidth, iHeight) {

-			if (!bHasDataURL) {

-				return false;

-			}

-			var oScaledCanvas = scaleCanvas(oCanvas, iWidth, iHeight);

-			var strData = oScaledCanvas.toDataURL("image/png");

-			if (bReturnImg) {

-				return makeImageObject(strData);

-			} else {

-				saveFile(strData.replace("image/png", strDownloadMime));

-			}

-			return true;

-		},

-

-		saveAsJPEG : function(oCanvas, bReturnImg, iWidth, iHeight) {

-			if (!bHasDataURL) {

-				return false;

-			}

-

-			var oScaledCanvas = scaleCanvas(oCanvas, iWidth, iHeight);

-			var strMime = "image/jpeg";

-			var strData = oScaledCanvas.toDataURL(strMime);

-	

-			// check if browser actually supports jpeg by looking for the mime type in the data uri.

-			// if not, return false

-			if (strData.indexOf(strMime) != 5) {

-				return false;

-			}

-

-			if (bReturnImg) {

-				return makeImageObject(strData);

-			} else {

-				saveFile(strData.replace(strMime, strDownloadMime));

-			}

-			return true;

-		},

-

-		saveAsBMP : function(oCanvas, bReturnImg, iWidth, iHeight) {

-			if (!(bHasImageData && bHasBase64)) {

-				return false;

-			}

-

-			var oScaledCanvas = scaleCanvas(oCanvas, iWidth, iHeight);

-

-			var oData = readCanvasData(oScaledCanvas);

-			var strImgData = createBMP(oData);

-			if (bReturnImg) {

-				return makeImageObject(makeDataURI(strImgData, "image/bmp"));

-			} else {

-				saveFile(makeDataURI(strImgData, strDownloadMime));

-			}

-			return true;

-		}

-	};

-

-})();
+

--- a/js/flotr/lib/canvastext.js
+++ /dev/null
@@ -1,397 +1,1 @@
-/**

- * This code is released to the public domain by Jim Studt, 2007.

- * He may keep some sort of up to date copy at http://www.federated.com/~jim/canvastext/


- * A partial support for accentuated letters as been added too.

- */

-var CanvasText = {

-	/** The letters definition. It is a list of letters, 

-	 * with their width, and the coordinates of points compositing them.

-	 * The syntax for the points is : [x, y], null value means "pen up"

-	 */

-  letters: {

-		'\n':{ width: -1, points: [] },

-    ' ': { width: 10, points: [] },

-    '!': { width: 10, points: [[5,21],[5,7],null,[5,2],[4,1],[5,0],[6,1],[5,2]] },

-    '"': { width: 16, points: [[4,21],[4,14],null,[12,21],[12,14]] },

-    '#': { width: 21, points: [[11,25],[4,-7],null,[17,25],[10,-7],null,[4,12],[18,12],null,[3,6],[17,6]] },

-    '$': { width: 20, points: [[8,25],[8,-4],null,[12,25],[12,-4],null,[17,18],[15,20],[12,21],[8,21],[5,20],[3,18],[3,16],[4,14],[5,13],[7,12],[13,10],[15,9],[16,8],[17,6],[17,3],[15,1],[12,0],[8,0],[5,1],[3,3]] },

-    '%': { width: 24, points: [[21,21],[3,0],null,[8,21],[10,19],[10,17],[9,15],[7,14],[5,14],[3,16],[3,18],[4,20],[6,21],[8,21],null,[17,7],[15,6],[14,4],[14,2],[16,0],[18,0],[20,1],[21,3],[21,5],[19,7],[17,7]] },

-    '&': { width: 26, points: [[23,12],[23,13],[22,14],[21,14],[20,13],[19,11],[17,6],[15,3],[13,1],[11,0],[7,0],[5,1],[4,2],[3,4],[3,6],[4,8],[5,9],[12,13],[13,14],[14,16],[14,18],[13,20],[11,21],[9,20],[8,18],[8,16],[9,13],[11,10],[16,3],[18,1],[20,0],[22,0],[23,1],[23,2]] },

-    '\'':{ width: 10, points: [[5,19],[4,20],[5,21],[6,20],[6,18],[5,16],[4,15]] },

-    '(': { width: 14, points: [[11,25],[9,23],[7,20],[5,16],[4,11],[4,7],[5,2],[7,-2],[9,-5],[11,-7]] },

-    ')': { width: 14, points: [[3,25],[5,23],[7,20],[9,16],[10,11],[10,7],[9,2],[7,-2],[5,-5],[3,-7]] },

-    '*': { width: 16, points: [[8,21],[8,9],null,[3,18],[13,12],null,[13,18],[3,12]] },

-    '+': { width: 26, points: [[13,18],[13,0],null,[4,9],[22,9]] },

-    ',': { width: 10, points: [[6,1],[5,0],[4,1],[5,2],[6,1],[6,-1],[5,-3],[4,-4]] },

-    '-': { width: 26, points: [[4,9],[22,9]] },

-    '.': { width: 10, points: [[5,2],[4,1],[5,0],[6,1],[5,2]] },

-    '/': { width: 22, points: [[20,25],[2,-7]] },

-    '0': { width: 20, points: [[9,21],[6,20],[4,17],[3,12],[3,9],[4,4],[6,1],[9,0],[11,0],[14,1],[16,4],[17,9],[17,12],[16,17],[14,20],[11,21],[9,21]] },

-    '1': { width: 20, points: [[6,17],[8,18],[11,21],[11,0]] },

-    '2': { width: 20, points: [[4,16],[4,17],[5,19],[6,20],[8,21],[12,21],[14,20],[15,19],[16,17],[16,15],[15,13],[13,10],[3,0],[17,0]] },

-    '3': { width: 20, points: [[5,21],[16,21],[10,13],[13,13],[15,12],[16,11],[17,8],[17,6],[16,3],[14,1],[11,0],[8,0],[5,1],[4,2],[3,4]] },

-    '4': { width: 20, points: [[13,21],[3,7],[18,7],null,[13,21],[13,0]] },

-    '5': { width: 20, points: [[15,21],[5,21],[4,12],[5,13],[8,14],[11,14],[14,13],[16,11],[17,8],[17,6],[16,3],[14,1],[11,0],[8,0],[5,1],[4,2],[3,4]] },

-    '6': { width: 20, points: [[16,18],[15,20],[12,21],[10,21],[7,20],[5,17],[4,12],[4,7],[5,3],[7,1],[10,0],[11,0],[14,1],[16,3],[17,6],[17,7],[16,10],[14,12],[11,13],[10,13],[7,12],[5,10],[4,7]] },

-    '7': { width: 20, points: [[17,21],[7,0],null,[3,21],[17,21]] },

-    '8': { width: 20, points: [[8,21],[5,20],[4,18],[4,16],[5,14],[7,13],[11,12],[14,11],[16,9],[17,7],[17,4],[16,2],[15,1],[12,0],[8,0],[5,1],[4,2],[3,4],[3,7],[4,9],[6,11],[9,12],[13,13],[15,14],[16,16],[16,18],[15,20],[12,21],[8,21]] },

-    '9': { width: 20, points: [[16,14],[15,11],[13,9],[10,8],[9,8],[6,9],[4,11],[3,14],[3,15],[4,18],[6,20],[9,21],[10,21],[13,20],[15,18],[16,14],[16,9],[15,4],[13,1],[10,0],[8,0],[5,1],[4,3]] },

-    ':': { width: 10, points: [[5,14],[4,13],[5,12],[6,13],[5,14],null,[5,2],[4,1],[5,0],[6,1],[5,2]] },

-    ';': { width: 10, points: [[5,14],[4,13],[5,12],[6,13],[5,14],null,[6,1],[5,0],[4,1],[5,2],[6,1],[6,-1],[5,-3],[4,-4]] },

-    '<': { width: 24, points: [[20,18],[4,9],[20,0]] },

-    '=': { width: 26, points: [[4,12],[22,12],null,[4,6],[22,6]] },

-    '>': { width: 24, points: [[4,18],[20,9],[4,0]] },

-    '?': { width: 18, points: [[3,16],[3,17],[4,19],[5,20],[7,21],[11,21],[13,20],[14,19],[15,17],[15,15],[14,13],[13,12],[9,10],[9,7],null,[9,2],[8,1],[9,0],[10,1],[9,2]] },

-    '@': { width: 27, points: [[18,13],[17,15],[15,16],[12,16],[10,15],[9,14],[8,11],[8,8],[9,6],[11,5],[14,5],[16,6],[17,8],null,[12,16],[10,14],[9,11],[9,8],[10,6],[11,5],null,[18,16],[17,8],[17,6],[19,5],[21,5],[23,7],[24,10],[24,12],[23,15],[22,17],[20,19],[18,20],[15,21],[12,21],[9,20],[7,19],[5,17],[4,15],[3,12],[3,9],[4,6],[5,4],[7,2],[9,1],[12,0],[15,0],[18,1],[20,2],[21,3],null,[19,16],[18,8],[18,6],[19,5]] },

-    'A': { width: 18, points: [[9,21],[1,0],null,[9,21],[17,0],null,[4,7],[14,7]] },

-    'B': { width: 21, points: [[4,21],[4,0],null,[4,21],[13,21],[16,20],[17,19],[18,17],[18,15],[17,13],[16,12],[13,11],null,[4,11],[13,11],[16,10],[17,9],[18,7],[18,4],[17,2],[16,1],[13,0],[4,0]] },

-    'C': { width: 21, points: [[18,16],[17,18],[15,20],[13,21],[9,21],[7,20],[5,18],[4,16],[3,13],[3,8],[4,5],[5,3],[7,1],[9,0],[13,0],[15,1],[17,3],[18,5]] },

-    'D': { width: 21, points: [[4,21],[4,0],null,[4,21],[11,21],[14,20],[16,18],[17,16],[18,13],[18,8],[17,5],[16,3],[14,1],[11,0],[4,0]] },

-    'E': { width: 19, points: [[4,21],[4,0],null,[4,21],[17,21],null,[4,11],[12,11],null,[4,0],[17,0]] },

-    'F': { width: 18, points: [[4,21],[4,0],null,[4,21],[17,21],null,[4,11],[12,11]] },

-    'G': { width: 21, points: [[18,16],[17,18],[15,20],[13,21],[9,21],[7,20],[5,18],[4,16],[3,13],[3,8],[4,5],[5,3],[7,1],[9,0],[13,0],[15,1],[17,3],[18,5],[18,8],null,[13,8],[18,8]] },

-    'H': { width: 22, points: [[4,21],[4,0],null,[18,21],[18,0],null,[4,11],[18,11]] },

-    'I': { width: 8,  points: [[4,21],[4,0]] },

-    'J': { width: 16, points: [[12,21],[12,5],[11,2],[10,1],[8,0],[6,0],[4,1],[3,2],[2,5],[2,7]] },

-    'K': { width: 21, points: [[4,21],[4,0],null,[18,21],[4,7],null,[9,12],[18,0]] },

-    'L': { width: 17, points: [[4,21],[4,0],null,[4,0],[16,0]] },

-    'M': { width: 24, points: [[4,21],[4,0],null,[4,21],[12,0],null,[20,21],[12,0],null,[20,21],[20,0]] },

-    'N': { width: 22, points: [[4,21],[4,0],null,[4,21],[18,0],null,[18,21],[18,0]] },

-    'O': { width: 22, points: [[9,21],[7,20],[5,18],[4,16],[3,13],[3,8],[4,5],[5,3],[7,1],[9,0],[13,0],[15,1],[17,3],[18,5],[19,8],[19,13],[18,16],[17,18],[15,20],[13,21],[9,21]] },

-    'P': { width: 21, points: [[4,21],[4,0],null,[4,21],[13,21],[16,20],[17,19],[18,17],[18,14],[17,12],[16,11],[13,10],[4,10]] },

-    'Q': { width: 22, points: [[9,21],[7,20],[5,18],[4,16],[3,13],[3,8],[4,5],[5,3],[7,1],[9,0],[13,0],[15,1],[17,3],[18,5],[19,8],[19,13],[18,16],[17,18],[15,20],[13,21],[9,21],null,[12,4],[18,-2]] },

-    'R': { width: 21, points: [[4,21],[4,0],null,[4,21],[13,21],[16,20],[17,19],[18,17],[18,15],[17,13],[16,12],[13,11],[4,11],null,[11,11],[18,0]] },

-    'S': { width: 20, points: [[17,18],[15,20],[12,21],[8,21],[5,20],[3,18],[3,16],[4,14],[5,13],[7,12],[13,10],[15,9],[16,8],[17,6],[17,3],[15,1],[12,0],[8,0],[5,1],[3,3]] },

-    'T': { width: 16, points: [[8,21],[8,0],null,[1,21],[15,21]] },

-    'U': { width: 22, points: [[4,21],[4,6],[5,3],[7,1],[10,0],[12,0],[15,1],[17,3],[18,6],[18,21]] },

-    'V': { width: 18, points: [[1,21],[9,0],null,[17,21],[9,0]] },

-    'W': { width: 24, points: [[2,21],[7,0],null,[12,21],[7,0],null,[12,21],[17,0],null,[22,21],[17,0]] },

-    'X': { width: 20, points: [[3,21],[17,0],null,[17,21],[3,0]] },

-    'Y': { width: 18, points: [[1,21],[9,11],[9,0],null,[17,21],[9,11]] },

-    'Z': { width: 20, points: [[17,21],[3,0],null,[3,21],[17,21],null,[3,0],[17,0]] },

-    '[': { width: 14, points: [[4,25],[4,-7],null,[5,25],[5,-7],null,[4,25],[11,25],null,[4,-7],[11,-7]] },

-    '\\':{ width: 14, points: [[0,21],[14,-3]] },

-    ']': { width: 14, points: [[9,25],[9,-7],null,[10,25],[10,-7],null,[3,25],[10,25],null,[3,-7],[10,-7]] },

-    '^': { width: 14, points: [[3,10],[8,18],[13,10]] },

-    '_': { width: 16, points: [[0,-2],[16,-2]] },

-    '`': { width: 10, points: [[6,21],[5,20],[4,18],[4,16],[5,15],[6,16],[5,17]] },

-    'a': { width: 19, points: [[15,14],[15,0],null,[15,11],[13,13],[11,14],[8,14],[6,13],[4,11],[3,8],[3,6],[4,3],[6,1],[8,0],[11,0],[13,1],[15,3]] },

-    'b': { width: 19, points: [[4,21],[4,0],null,[4,11],[6,13],[8,14],[11,14],[13,13],[15,11],[16,8],[16,6],[15,3],[13,1],[11,0],[8,0],[6,1],[4,3]] },

-    'c': { width: 18, points: [[15,11],[13,13],[11,14],[8,14],[6,13],[4,11],[3,8],[3,6],[4,3],[6,1],[8,0],[11,0],[13,1],[15,3]] },

-    'd': { width: 19, points: [[15,21],[15,0],null,[15,11],[13,13],[11,14],[8,14],[6,13],[4,11],[3,8],[3,6],[4,3],[6,1],[8,0],[11,0],[13,1],[15,3]] },

-    'e': { width: 18, points: [[3,8],[15,8],[15,10],[14,12],[13,13],[11,14],[8,14],[6,13],[4,11],[3,8],[3,6],[4,3],[6,1],[8,0],[11,0],[13,1],[15,3]] },

-    'f': { width: 12, points: [[10,21],[8,21],[6,20],[5,17],[5,0],null,[2,14],[9,14]] },

-    'g': { width: 19, points: [[15,14],[15,-2],[14,-5],[13,-6],[11,-7],[8,-7],[6,-6],null,[15,11],[13,13],[11,14],[8,14],[6,13],[4,11],[3,8],[3,6],[4,3],[6,1],[8,0],[11,0],[13,1],[15,3]] },

-    'h': { width: 19, points: [[4,21],[4,0],null,[4,10],[7,13],[9,14],[12,14],[14,13],[15,10],[15,0]] },

-    'i': { width: 8,  points: [[3,21],[4,20],[5,21],[4,22],[3,21],null,[4,14],[4,0]] },

-    'j': { width: 10, points: [[5,21],[6,20],[7,21],[6,22],[5,21],null,[6,14],[6,-3],[5,-6],[3,-7],[1,-7]] },

-    'k': { width: 17, points: [[4,21],[4,0],null,[14,14],[4,4],null,[8,8],[15,0]] },

-    'l': { width: 8,  points: [[4,21],[4,0]] },

-    'm': { width: 30, points: [[4,14],[4,0],null,[4,10],[7,13],[9,14],[12,14],[14,13],[15,10],[15,0],null,[15,10],[18,13],[20,14],[23,14],[25,13],[26,10],[26,0]] },

-    'n': { width: 19, points: [[4,14],[4,0],null,[4,10],[7,13],[9,14],[12,14],[14,13],[15,10],[15,0]] },

-    'o': { width: 19, points: [[8,14],[6,13],[4,11],[3,8],[3,6],[4,3],[6,1],[8,0],[11,0],[13,1],[15,3],[16,6],[16,8],[15,11],[13,13],[11,14],[8,14]] },

-    'p': { width: 19, points: [[4,14],[4,-7],null,[4,11],[6,13],[8,14],[11,14],[13,13],[15,11],[16,8],[16,6],[15,3],[13,1],[11,0],[8,0],[6,1],[4,3]] },

-    'q': { width: 19, points: [[15,14],[15,-7],null,[15,11],[13,13],[11,14],[8,14],[6,13],[4,11],[3,8],[3,6],[4,3],[6,1],[8,0],[11,0],[13,1],[15,3]] },

-    'r': { width: 13, points: [[4,14],[4,0],null,[4,8],[5,11],[7,13],[9,14],[12,14]] },

-    's': { width: 17, points: [[14,11],[13,13],[10,14],[7,14],[4,13],[3,11],[4,9],[6,8],[11,7],[13,6],[14,4],[14,3],[13,1],[10,0],[7,0],[4,1],[3,3]] },

-    't': { width: 12, points: [[5,21],[5,4],[6,1],[8,0],[10,0],null,[2,14],[9,14]] },

-    'u': { width: 19, points: [[4,14],[4,4],[5,1],[7,0],[10,0],[12,1],[15,4],null,[15,14],[15,0]] },

-    'v': { width: 16, points: [[2,14],[8,0],null,[14,14],[8,0]] },

-    'w': { width: 22, points: [[3,14],[7,0],null,[11,14],[7,0],null,[11,14],[15,0],null,[19,14],[15,0]] },

-    'x': { width: 17, points: [[3,14],[14,0],null,[14,14],[3,0]] },

-    'y': { width: 16, points: [[2,14],[8,0],null,[14,14],[8,0],[6,-4],[4,-6],[2,-7],[1,-7]] },

-    'z': { width: 17, points: [[14,14],[3,0],null,[3,14],[14,14],null,[3,0],[14,0]] },

-    '{': { width: 14, points: [[9,25],[7,24],[6,23],[5,21],[5,19],[6,17],[7,16],[8,14],[8,12],[6,10],null,[7,24],[6,22],[6,20],[7,18],[8,17],[9,15],[9,13],[8,11],[4,9],[8,7],[9,5],[9,3],[8,1],[7,0],[6,-2],[6,-4],[7,-6],null,[6,8],[8,6],[8,4],[7,2],[6,1],[5,-1],[5,-3],[6,-5],[7,-6],[9,-7]] },

-    '|': { width: 8,  points: [[4,25],[4,-7]] },

-    '}': { width: 14, points: [[5,25],[7,24],[8,23],[9,21],[9,19],[8,17],[7,16],[6,14],[6,12],[8,10],null,[7,24],[8,22],[8,20],[7,18],[6,17],[5,15],[5,13],[6,11],[10,9],[6,7],[5,5],[5,3],[6,1],[7,0],[8,-2],[8,-4],[7,-6],null,[8,8],[6,6],[6,4],[7,2],[8,1],[9,-1],[9,-3],[8,-5],[7,-6],[5,-7]] },

-    '~': { width: 24, points: [[3,6],[3,8],[4,11],[6,12],[8,12],[10,11],[14,8],[16,7],[18,7],[20,8],[21,10],null,[3,8],[4,10],[6,11],[8,11],[10,10],[14,7],[16,6],[18,6],[20,7],[21,10],[21,12]] },

















-  },

-  

-  specialchars: {

-  	'pi': { width: 19, points: [[6,14],[6,0],null,[14,14],[14,0],null,[2,13],[6,16],[13,13],[17,16]] }

-  },

-  

-  /** Diacritics, used to draw accentuated letters */

-  diacritics: {



-    '`': { entity: 'grave', points: [[7,22],[12,19]] },

-    '^': { entity: 'circ',  points: [[5.5,19],[9.5,23],[12.5,19]] },


-    '~': { entity: 'tilde', points: [[4,18],[7,22],[10,18],[13,22]] }

-  },

-  

-  /** The default font styling */

-  style: {

-    size: 8,          // font height in pixels

-    font: null,       // not yet implemented

-    color: '#000000', // 

-    weight: 1,        // float, 1 for 'normal'

-    halign: 'l',      // l: left, r: right, c: center

-    valign: 'b',      // t: top, m: middle, b: bottom 

-    adjustAlign: false, // modifies the alignments if the angle is different from 0 to make the spin point always at the good position

-    angle: 0,         // in radians, anticlockwise

-    tracking: 1,      // space between the letters, float, 1 for 'normal'

-    boundingBoxColor: '#ff0000', //null // color of the bounding box (null to hide), can be used for debug and font drawing

-    originPointColor: '#000000' //null // color of the bounding box (null to hide), can be used for debug and font drawing

-  },

-  

-  debug: false,

-  _bufferLexemes: {},

-  

-  /** Get the letter data corresponding to a char

-   * @param {String} ch - The char

-   */

-  letter: function(ch) {

-    return CanvasText.letters[ch];

-  },

-  

-  parseLexemes: function(str) {

-    if (CanvasText._bufferLexemes[str]) 

-      return CanvasText._bufferLexemes[str];

-    

-  	var i, c, matches = str.match(/&[A-Za-z]{2,5};|\s|./g);

-  	var result = [], chars = [];

-  	for (i = 0; i < matches.length; i++) {

-  		c = matches[i];

-  		if (c.length == 1) 

-  			chars.push(c);

-  		else {

-  			var entity = c.substring(1, c.length-1);

-  			if (CanvasText.specialchars[entity]) 

-  				chars.push(entity);

-  			else

-  				chars = chars.concat(c.toArray());

-  		}

-  	}

-  	for (i = 0; i < chars.length; i++) {

-  		c = chars[i];

-  		if (c = CanvasText.letters[c] || CanvasText.specialchars[c])

-  		  result.push(c);

-  	}

-  	return CanvasText._bufferLexemes[str] = result.compact();

-  },

-

-  /** Get the font ascent for a given style

-   * @param {Object} style - The reference style

-   */

-  ascent: function(style) {

-  	style = style || {};

-    return (style.size || CanvasText.style.size);

-  },

-  

-  /** Get the font descent for a given style 

-   * @param {Object} style - The reference style

-   * */

-  descent: function(style) {

-  	style = style || {};

-    return 7.0*(style.size || CanvasText.style.size)/25.0;

-  },

-  

-  /** Measure the text horizontal size 

-   * @param {String} str - The text

-   * @param {Object} style - Text style

-   * */

-  measure: function(str, style) {

-    if (!str) return;

-    style = style || {};

-    

-    var i, width, lexemes = CanvasText.parseLexemes(str),

-        total = 0;

-

-    for (i = lexemes.length-1; i > -1; --i) {

-    	c = lexemes[i];

-    	width = (c.diacritic) ? CanvasText.letter(c.letter).width : c.width;

-      total += width * (style.tracking || CanvasText.style.tracking) * (style.size || CanvasText.style.size) / 25.0;

-    }

-    return total;

-  },

-  

-  getDimensions: function(str, style) {

-    var width = CanvasText.measure(str, style),

-        height = style.size || CanvasText.style.size,

-        angle = style.angle || CanvasText.style.angle;

-

-    if (style.angle == 0) return {width: width, height: height};

-    return {

-      width:  Math.abs(Math.cos(angle) * width) + Math.abs(Math.sin(angle) * height),

-      height: Math.abs(Math.sin(angle) * width) + Math.abs(Math.cos(angle) * height)

-    }

-  },

-  

-  getBestAlign: function(angle, style) {

-    angle += CanvasText.getAngleFromAlign(style.halign, style.valign);

-    var a = {h:'c', v:'m'};

-    if (Math.round(Math.cos(angle)*1000)/1000 != 0) 

-      a.h = (Math.cos(angle) > 0 ? 'r' : 'l');

-    

-    if (Math.round(Math.sin(angle)*1000)/1000 != 0) 

-      a.v = (Math.sin(angle) > 0 ? 't' : 'b');

-    return a;

-  },

-  

-  getAngleFromAlign: function(halign, valign) {

-    var pi = Math.PI, table = {

-      'rm': 0,

-      'rt': pi/4,

-      'ct': pi/2,

-      'lt': 3*(pi/4),

-      'lm': pi,

-      'lb': -3*(pi/4),

-      'cb': -pi/2,

-      'rb': -pi/4,

-      'cm': 0

-    }

-    return table[halign+valign];

-  },

-  

-  /** Draws serie of points at given coordinates 

-   * @param {Canvas context} ctx - The canvas context

-   * @param {Array} points - The points to draw

-   * @param {Number} x - The X coordinate

-   * @param {Number} y - The Y coordinate

-   * @param {Number} mag - The scale 

-   */

-  drawPoints: function (ctx, points, x, y, mag, offset) {

-    var i, a, penUp = true, needStroke = 0;

-    offset = offset || {x:0, y:0};

-    

-    ctx.beginPath();

-    for (i = 0; i < points.length; i++) {

-      a = points[i];

-      if (!a) {

-        penUp = true;

-        continue;

-      }

-      if (penUp) {

-        ctx.moveTo(x + a[0]*mag + offset.x, y - a[1]*mag + offset.y);

-        penUp = false;

-      }

-      else {

-        ctx.lineTo(x + a[0]*mag + offset.x, y - a[1]*mag + offset.y);

-      }

-    }

-    ctx.stroke();

-  },

-  

-  /** Draws a text at given coordinates and with a given style

-   * @param {Canvas context} ctx - The canvas context

-   * @param {String} str - The text to draw

-   * @param {Number} xOrig - The X coordinate

-   * @param {Number} yOrig - The Y coordinate

-   * @param {Object} style - The font style

-   */

-  draw: function(ctx, str, xOrig, yOrig, style) {

-    if (!str) return;

-    style = style || CanvasText.style;

-    style.halign = style.halign || CanvasText.style.halign;

-    style.valign = style.valign || CanvasText.style.valign;

-    style.angle = style.angle || CanvasText.style.angle;

-    style.size = style.size || CanvasText.style.size;

-    style.adjustAlign = style.adjustAlign || CanvasText.style.adjustAlign;

-    

-    var i, c, total = 0,

-        mag = style.size / 25.0,

-        x = 0, y = 0,

-        lexemes = CanvasText.parseLexemes(str);

-    

-    var offset = {x:0, y:0}, 

-        measure = CanvasText.measure(str, style),

-        align;

-        

-    if (style.adjustAlign) {

-      align = CanvasText.getBestAlign(style.angle, style);

-      style.halign = align.h;

-      style.valign = align.v;

-    }

-        

-    switch (style.halign) {

-      case 'l': break;

-      case 'c': offset.x = -measure / 2; break;

-      case 'r': offset.x = -measure; break;

-    }

-    

-    switch (style.valign) {

-      case 'b': break;

-      case 'm': offset.y = style.size / 2; break;

-      case 't': offset.y = style.size; break;

-    }

-    

-    ctx.save();

-    ctx.translate(xOrig, yOrig);

-    ctx.rotate(style.angle);

-    ctx.lineCap = "round";

-    ctx.lineWidth = 2.0 * mag * (style.weight || CanvasText.style.weight);

-    ctx.strokeStyle = style.color || CanvasText.style.color;

-    

-    for (i = 0; i < lexemes.length; i++) {

-    	c = lexemes[i];

-      if (c.width == -1) {

-        x = 0;

-        y = style.size * 1.4;

-        continue;

-      }

-    

-      var points = c.points,

-          width = c.width;

-          

-      if (c.diacritic) {

-        var dia = CanvasText.diacritics[c.diacritic];

-        var char = CanvasText.letter(c.letter);

-

-        CanvasText.drawPoints(ctx, dia.points, x, y - (c.letter.toUpperCase() == c.letter ? 3 : 0), mag, offset);

-        points = char.points;

-        width = char.width;

-      }

-

-      CanvasText.drawPoints(ctx, points, x, y, mag, offset);

-      

-      if (CanvasText.debug) {

-      	ctx.save();

-        ctx.lineJoin = "miter";

-        ctx.lineWidth = 0.5;

-        ctx.strokeStyle = (style.boundingBoxColor || CanvasText.style.boundingBoxColor);

-      	ctx.strokeRect(x+offset.x, y+offset.y, width*mag, -style.size);

-        

-        ctx.fillStyle = (style.originPointColor || CanvasText.style.originPointColor);

-        ctx.beginPath();

-        ctx.arc(0, 0, 1.5, 0, Math.PI*2, true);

-        ctx.fill();

-        

-      	ctx.restore();

-      }

-      

-      x += width*mag*(style.tracking || CanvasText.style.tracking);

-    }

-    ctx.restore();

-    return total;

-  },

-  

-  /** Enables the text function for a Canvas context

-   * @param {Canvas context} ctx - The canvas context

-   */

-  enable: function(ctx) {

-    ctx.drawText    = function(text, x, y, style) { return CanvasText.draw(ctx, text, x, y, style); };

-    ctx.measureText = function(text, style) { return CanvasText.measure(text, style); };

-    ctx.getTextBounds = function(text, style) { return CanvasText.getDimensions(text, style); };

-    ctx.fontAscent  = function(style) { return CanvasText.ascent(style); };

-    ctx.fontDescent = function(style) { return CanvasText.descent(style); };

-  }

-};
+

--- a/js/flotr/lib/excanvas.js
+++ /dev/null
@@ -1,885 +1,1 @@
-// Copyright 2006 Google Inc.
-//
-// Licensed under the Apache License, Version 2.0 (the "License");
-// you may not use this file except in compliance with the License.
-// You may obtain a copy of the License at
-//
-//   http://www.apache.org/licenses/LICENSE-2.0
-//
-// Unless required by applicable law or agreed to in writing, software
-// distributed under the License is distributed on an "AS IS" BASIS,
-// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
-// See the License for the specific language governing permissions and
-// limitations under the License.
 
-
-// Known Issues:
-//
-// * Patterns are not implemented.
-// * Radial gradient are not implemented. The VML version of these look very
-//   different from the canvas one.
-// * Clipping paths are not implemented.
-// * Coordsize. The width and height attribute have higher priority than the
-//   width and height style values which isn't correct.
-// * Painting mode isn't implemented.
-// * Canvas width/height should is using content-box by default. IE in
-//   Quirks mode will draw the canvas using border-box. Either change your
-//   doctype to HTML5
-//   (http://www.whatwg.org/specs/web-apps/current-work/#the-doctype)
-//   or use Box Sizing Behavior from WebFX
-//   (http://webfx.eae.net/dhtml/boxsizing/boxsizing.html)
-// * Non uniform scaling does not correctly scale strokes.
-// * Optimize. There is always room for speed improvements.
-
-// Only add this code if we do not already have a canvas implementation
-if (!document.createElement('canvas').getContext) {
-
-(function() {
-
-  // alias some functions to make (compiled) code shorter
-  var m = Math;
-  var mr = m.round;
-  var ms = m.sin;
-  var mc = m.cos;
-  var abs = m.abs;
-  var sqrt = m.sqrt;
-
-  // this is used for sub pixel precision
-  var Z = 10;
-  var Z2 = Z / 2;
-
-  /**
-   * This funtion is assigned to the <canvas> elements as element.getContext().
-   * @this {HTMLElement}
-   * @return {CanvasRenderingContext2D_}
-   */
-  function getContext() {
-    return this.context_ ||
-        (this.context_ = new CanvasRenderingContext2D_(this));
-  }
-
-  var slice = Array.prototype.slice;
-
-  /**
-   * Binds a function to an object. The returned function will always use the
-   * passed in {@code obj} as {@code this}.
-   *
-   * Example:
-   *
-   *   g = bind(f, obj, a, b)
-   *   g(c, d) // will do f.call(obj, a, b, c, d)
-   *
-   * @param {Function} f The function to bind the object to
-   * @param {Object} obj The object that should act as this when the function
-   *     is called
-   * @param {*} var_args Rest arguments that will be used as the initial
-   *     arguments when the function is called
-   * @return {Function} A new function that has bound this
-   */
-  function bind(f, obj, var_args) {
-    var a = slice.call(arguments, 2);
-    return function() {
-      return f.apply(obj, a.concat(slice.call(arguments)));
-    };
-  }
-
-  var G_vmlCanvasManager_ = {
-    init: function(opt_doc) {
-      if (/MSIE/.test(navigator.userAgent) && !window.opera) {
-        var doc = opt_doc || document;
-        // Create a dummy element so that IE will allow canvas elements to be
-        // recognized.
-        doc.createElement('canvas');
-        doc.attachEvent('onreadystatechange', bind(this.init_, this, doc));
-      }
-    },
-
-    init_: function(doc) {
-      // create xmlns
-      if (!doc.namespaces['g_vml_']) {
-        doc.namespaces.add('g_vml_', 'urn:schemas-microsoft-com:vml',
-                           '#default#VML');
-
-      }
-      if (!doc.namespaces['g_o_']) {
-        doc.namespaces.add('g_o_', 'urn:schemas-microsoft-com:office:office',
-                           '#default#VML');
-      }
-
-      // Setup default CSS.  Only add one style sheet per document
-      if (!doc.styleSheets['ex_canvas_']) {
-        var ss = doc.createStyleSheet();
-        ss.owningElement.id = 'ex_canvas_';
-        ss.cssText = 'canvas{display:inline-block;overflow:hidden;' +
-            // default size is 300x150 in Gecko and Opera
-            'text-align:left;width:300px;height:150px}' +
-            'g_vml_\\:*{behavior:url(#default#VML)}' +
-            'g_o_\\:*{behavior:url(#default#VML)}';
-
-      }
-
-      // find all canvas elements
-      var els = doc.getElementsByTagName('canvas');
-      for (var i = 0; i < els.length; i++) {
-        this.initElement(els[i]);
-      }
-    },
-
-    /**
-     * Public initializes a canvas element so that it can be used as canvas
-     * element from now on. This is called automatically before the page is
-     * loaded but if you are creating elements using createElement you need to
-     * make sure this is called on the element.
-     * @param {HTMLElement} el The canvas element to initialize.
-     * @return {HTMLElement} the element that was created.
-     */
-    initElement: function(el) {
-      if (!el.getContext) {
-
-        el.getContext = getContext;
-
-        // Remove fallback content. There is no way to hide text nodes so we
-        // just remove all childNodes. We could hide all elements and remove
-        // text nodes but who really cares about the fallback content.
-        el.innerHTML = '';
-
-        // do not use inline function because that will leak memory
-        el.attachEvent('onpropertychange', onPropertyChange);
-        el.attachEvent('onresize', onResize);
-
-        var attrs = el.attributes;
-        if (attrs.width && attrs.width.specified) {
-          // TODO: use runtimeStyle and coordsize
-          // el.getContext().setWidth_(attrs.width.nodeValue);
-          el.style.width = attrs.width.nodeValue + 'px';
-        } else {
-          el.width = el.clientWidth;
-        }
-        if (attrs.height && attrs.height.specified) {
-          // TODO: use runtimeStyle and coordsize
-          // el.getContext().setHeight_(attrs.height.nodeValue);
-          el.style.height = attrs.height.nodeValue + 'px';
-        } else {
-          el.height = el.clientHeight;
-        }
-        //el.getContext().setCoordsize_()
-      }
-      return el;
-    }
-  };
-
-  function onPropertyChange(e) {
-    var el = e.srcElement;
-
-    switch (e.propertyName) {
-      case 'width':
-        el.style.width = el.attributes.width.nodeValue + 'px';
-        el.getContext().clearRect();
-        break;
-      case 'height':
-        el.style.height = el.attributes.height.nodeValue + 'px';
-        el.getContext().clearRect();
-        break;
-    }
-  }
-
-  function onResize(e) {
-    var el = e.srcElement;
-    if (el.firstChild) {
-      el.firstChild.style.width =  el.clientWidth + 'px';
-      el.firstChild.style.height = el.clientHeight + 'px';
-    }
-  }
-
-  G_vmlCanvasManager_.init();
-
-  // precompute "00" to "FF"
-  var dec2hex = [];
-  for (var i = 0; i < 16; i++) {
-    for (var j = 0; j < 16; j++) {
-      dec2hex[i * 16 + j] = i.toString(16) + j.toString(16);
-    }
-  }
-
-  function createMatrixIdentity() {
-    return [
-      [1, 0, 0],
-      [0, 1, 0],
-      [0, 0, 1]
-    ];
-  }
-
-  function matrixMultiply(m1, m2) {
-    var result = createMatrixIdentity();
-
-    for (var x = 0; x < 3; x++) {
-      for (var y = 0; y < 3; y++) {
-        var sum = 0;
-
-        for (var z = 0; z < 3; z++) {
-          sum += m1[x][z] * m2[z][y];
-        }
-
-        result[x][y] = sum;
-      }
-    }
-    return result;
-  }
-
-  function copyState(o1, o2) {
-    o2.fillStyle     = o1.fillStyle;
-    o2.lineCap       = o1.lineCap;
-    o2.lineJoin      = o1.lineJoin;
-    o2.lineWidth     = o1.lineWidth;
-    o2.miterLimit    = o1.miterLimit;
-    o2.shadowBlur    = o1.shadowBlur;
-    o2.shadowColor   = o1.shadowColor;
-    o2.shadowOffsetX = o1.shadowOffsetX;
-    o2.shadowOffsetY = o1.shadowOffsetY;
-    o2.strokeStyle   = o1.strokeStyle;
-    o2.globalAlpha   = o1.globalAlpha;
-    o2.arcScaleX_    = o1.arcScaleX_;
-    o2.arcScaleY_    = o1.arcScaleY_;
-    o2.lineScale_    = o1.lineScale_;
-  }
-
-  function processStyle(styleString) {
-    var str, alpha = 1;
-
-    styleString = String(styleString);
-    if (styleString.substring(0, 3) == 'rgb') {
-      var start = styleString.indexOf('(', 3);
-      var end = styleString.indexOf(')', start + 1);
-      var guts = styleString.substring(start + 1, end).split(',');
-
-      str = '#';
-      for (var i = 0; i < 3; i++) {
-        str += dec2hex[Number(guts[i])];
-      }
-
-      if (guts.length == 4 && styleString.substr(3, 1) == 'a') {
-        alpha = guts[3];
-      }
-    } else {
-      str = styleString;
-    }
-
-    return {color: str, alpha: alpha};
-  }
-
-  function processLineCap(lineCap) {
-    switch (lineCap) {
-      case 'butt':
-        return 'flat';
-      case 'round':
-        return 'round';
-      case 'square':
-      default:
-        return 'square';
-    }
-  }
-
-  /**
-   * This class implements CanvasRenderingContext2D interface as described by
-   * the WHATWG.
-   * @param {HTMLElement} surfaceElement The element that the 2D context should
-   * be associated with
-   */
-  function CanvasRenderingContext2D_(surfaceElement) {
-    this.m_ = createMatrixIdentity();
-
-    this.mStack_ = [];
-    this.aStack_ = [];
-    this.currentPath_ = [];
-
-    // Canvas context properties
-    this.strokeStyle = '#000';
-    this.fillStyle = '#000';
-
-    this.lineWidth = 1;
-    this.lineJoin = 'miter';
-    this.lineCap = 'butt';
-    this.miterLimit = Z * 1;
-    this.globalAlpha = 1;
-    this.canvas = surfaceElement;
-
-    var el = surfaceElement.ownerDocument.createElement('div');
-    el.style.width =  surfaceElement.clientWidth + 'px';
-    el.style.height = surfaceElement.clientHeight + 'px';
-    el.style.overflow = 'hidden';
-    el.style.position = 'absolute';
-    surfaceElement.appendChild(el);
-
-    this.element_ = el;
-    this.arcScaleX_ = 1;
-    this.arcScaleY_ = 1;
-    this.lineScale_ = 1;
-  }
-
-  var contextPrototype = CanvasRenderingContext2D_.prototype;
-  contextPrototype.clearRect = function() {
-    this.element_.innerHTML = '';
-  };
-
-  contextPrototype.beginPath = function() {
-    // TODO: Branch current matrix so that save/restore has no effect
-    //       as per safari docs.
-    this.currentPath_ = [];
-  };
-
-  contextPrototype.moveTo = function(aX, aY) {
-    var p = this.getCoords_(aX, aY);
-    this.currentPath_.push({type: 'moveTo', x: p.x, y: p.y});
-    this.currentX_ = p.x;
-    this.currentY_ = p.y;
-  };
-
-  contextPrototype.lineTo = function(aX, aY) {
-    var p = this.getCoords_(aX, aY);
-    this.currentPath_.push({type: 'lineTo', x: p.x, y: p.y});
-
-    this.currentX_ = p.x;
-    this.currentY_ = p.y;
-  };
-
-  contextPrototype.bezierCurveTo = function(aCP1x, aCP1y,
-                                            aCP2x, aCP2y,
-                                            aX, aY) {
-    var p = this.getCoords_(aX, aY);
-    var cp1 = this.getCoords_(aCP1x, aCP1y);
-    var cp2 = this.getCoords_(aCP2x, aCP2y);
-    bezierCurveTo(this, cp1, cp2, p);
-  };
-
-  // Helper function that takes the already fixed cordinates.
-  function bezierCurveTo(self, cp1, cp2, p) {
-    self.currentPath_.push({
-      type: 'bezierCurveTo',
-      cp1x: cp1.x,
-      cp1y: cp1.y,
-      cp2x: cp2.x,
-      cp2y: cp2.y,
-      x: p.x,
-      y: p.y
-    });
-    self.currentX_ = p.x;
-    self.currentY_ = p.y;
-  }
-
-  contextPrototype.quadraticCurveTo = function(aCPx, aCPy, aX, aY) {
-    // the following is lifted almost directly from
-    // http://developer.mozilla.org/en/docs/Canvas_tutorial:Drawing_shapes
-
-    var cp = this.getCoords_(aCPx, aCPy);
-    var p = this.getCoords_(aX, aY);
-
-    var cp1 = {
-      x: this.currentX_ + 2.0 / 3.0 * (cp.x - this.currentX_),
-      y: this.currentY_ + 2.0 / 3.0 * (cp.y - this.currentY_)
-    };
-    var cp2 = {
-      x: cp1.x + (p.x - this.currentX_) / 3.0,
-      y: cp1.y + (p.y - this.currentY_) / 3.0
-    };
-
-    bezierCurveTo(this, cp1, cp2, p);
-  };
-
-  contextPrototype.arc = function(aX, aY, aRadius,
-                                  aStartAngle, aEndAngle, aClockwise) {
-    aRadius *= Z;
-    var arcType = aClockwise ? 'at' : 'wa';
-
-    var xStart = aX + mc(aStartAngle) * aRadius - Z2;
-    var yStart = aY + ms(aStartAngle) * aRadius - Z2;
-
-    var xEnd = aX + mc(aEndAngle) * aRadius - Z2;
-    var yEnd = aY + ms(aEndAngle) * aRadius - Z2;
-
-    // IE won't render arches drawn counter clockwise if xStart == xEnd.
-    if (xStart == xEnd && !aClockwise) {
-      xStart += 0.125; // Offset xStart by 1/80 of a pixel. Use something
-                       // that can be represented in binary
-    }
-
-    var p = this.getCoords_(aX, aY);
-    var pStart = this.getCoords_(xStart, yStart);
-    var pEnd = this.getCoords_(xEnd, yEnd);
-
-    this.currentPath_.push({type: arcType,
-                           x: p.x,
-                           y: p.y,
-                           radius: aRadius,
-                           xStart: pStart.x,
-                           yStart: pStart.y,
-                           xEnd: pEnd.x,
-                           yEnd: pEnd.y});
-
-  };
-
-  contextPrototype.rect = function(aX, aY, aWidth, aHeight) {
-    this.moveTo(aX, aY);
-    this.lineTo(aX + aWidth, aY);
-    this.lineTo(aX + aWidth, aY + aHeight);
-    this.lineTo(aX, aY + aHeight);
-    this.closePath();
-  };
-
-  contextPrototype.strokeRect = function(aX, aY, aWidth, aHeight) {
-    var oldPath = this.currentPath_;
-    this.beginPath();
-
-    this.moveTo(aX, aY);
-    this.lineTo(aX + aWidth, aY);
-    this.lineTo(aX + aWidth, aY + aHeight);
-    this.lineTo(aX, aY + aHeight);
-    this.closePath();
-    this.stroke();
-
-    this.currentPath_ = oldPath;
-  };
-
-  contextPrototype.fillRect = function(aX, aY, aWidth, aHeight) {
-    var oldPath = this.currentPath_;
-    this.beginPath();
-
-    this.moveTo(aX, aY);
-    this.lineTo(aX + aWidth, aY);
-    this.lineTo(aX + aWidth, aY + aHeight);
-    this.lineTo(aX, aY + aHeight);
-    this.closePath();
-    this.fill();
-
-    this.currentPath_ = oldPath;
-  };
-
-  contextPrototype.createLinearGradient = function(aX0, aY0, aX1, aY1) {
-    var gradient = new CanvasGradient_('gradient');
-    gradient.x0_ = aX0;
-    gradient.y0_ = aY0;
-    gradient.x1_ = aX1;
-    gradient.y1_ = aY1;
-    return gradient;
-  };
-
-  contextPrototype.createRadialGradient = function(aX0, aY0, aR0,
-                                                   aX1, aY1, aR1) {
-    var gradient = new CanvasGradient_('gradientradial');
-    gradient.x0_ = aX0;
-    gradient.y0_ = aY0;
-    gradient.r0_ = aR0;
-    gradient.x1_ = aX1;
-    gradient.y1_ = aY1;
-    gradient.r1_ = aR1;
-    return gradient;
-  };
-
-  contextPrototype.drawImage = function(image, var_args) {
-    var dx, dy, dw, dh, sx, sy, sw, sh;
-
-    // to find the original width we overide the width and height
-    var oldRuntimeWidth = image.runtimeStyle.width;
-    var oldRuntimeHeight = image.runtimeStyle.height;
-    image.runtimeStyle.width = 'auto';
-    image.runtimeStyle.height = 'auto';
-
-    // get the original size
-    var w = image.width;
-    var h = image.height;
-
-    // and remove overides
-    image.runtimeStyle.width = oldRuntimeWidth;
-    image.runtimeStyle.height = oldRuntimeHeight;
-
-    if (arguments.length == 3) {
-      dx = arguments[1];
-      dy = arguments[2];
-      sx = sy = 0;
-      sw = dw = w;
-      sh = dh = h;
-    } else if (arguments.length == 5) {
-      dx = arguments[1];
-      dy = arguments[2];
-      dw = arguments[3];
-      dh = arguments[4];
-      sx = sy = 0;
-      sw = w;
-      sh = h;
-    } else if (arguments.length == 9) {
-      sx = arguments[1];
-      sy = arguments[2];
-      sw = arguments[3];
-      sh = arguments[4];
-      dx = arguments[5];
-      dy = arguments[6];
-      dw = arguments[7];
-      dh = arguments[8];
-    } else {
-      throw Error('Invalid number of arguments');
-    }
-
-    var d = this.getCoords_(dx, dy);
-
-    var w2 = sw / 2;
-    var h2 = sh / 2;
-
-    var vmlStr = [];
-
-    var W = 10;
-    var H = 10;
-
-    // For some reason that I've now forgotten, using divs didn't work
-    vmlStr.push(' <g_vml_:group',
-                ' coordsize="', Z * W, ',', Z * H, '"',
-                ' coordorigin="0,0"' ,
-                ' style="width:', W, 'px;height:', H, 'px;position:absolute;');
-
-    // If filters are necessary (rotation exists), create them
-    // filters are bog-slow, so only create them if abbsolutely necessary
-    // The following check doesn't account for skews (which don't exist
-    // in the canvas spec (yet) anyway.
-
-    if (this.m_[0][0] != 1 || this.m_[0][1]) {
-      var filter = [];
-
-      // Note the 12/21 reversal
-      filter.push('M11=', this.m_[0][0], ',',
-                  'M12=', this.m_[1][0], ',',
-                  'M21=', this.m_[0][1], ',',
-                  'M22=', this.m_[1][1], ',',
-                  'Dx=', mr(d.x / Z), ',',
-                  'Dy=', mr(d.y / Z), '');
-
-      // Bounding box calculation (need to minimize displayed area so that
-      // filters don't waste time on unused pixels.
-      var max = d;
-      var c2 = this.getCoords_(dx + dw, dy);
-      var c3 = this.getCoords_(dx, dy + dh);
-      var c4 = this.getCoords_(dx + dw, dy + dh);
-
-      max.x = m.max(max.x, c2.x, c3.x, c4.x);
-      max.y = m.max(max.y, c2.y, c3.y, c4.y);
-
-      vmlStr.push('padding:0 ', mr(max.x / Z), 'px ', mr(max.y / Z),
-                  'px 0;filter:progid:DXImageTransform.Microsoft.Matrix(',
-                  filter.join(''), ", sizingmethod='clip');")
-    } else {
-      vmlStr.push('top:', mr(d.y / Z), 'px;left:', mr(d.x / Z), 'px;');
-    }
-
-    vmlStr.push(' ">' ,
-                '<g_vml_:image src="', image.src, '"',
-                ' style="width:', Z * dw, 'px;',
-                ' height:', Z * dh, 'px;"',
-                ' cropleft="', sx / w, '"',
-                ' croptop="', sy / h, '"',
-                ' cropright="', (w - sx - sw) / w, '"',
-                ' cropbottom="', (h - sy - sh) / h, '"',
-                ' />',
-                '</g_vml_:group>');
-
-    this.element_.insertAdjacentHTML('BeforeEnd',
-                                    vmlStr.join(''));
-  };
-
-  contextPrototype.stroke = function(aFill) {
-    var lineStr = [];
-    var lineOpen = false;
-    var a = processStyle(aFill ? this.fillStyle : this.strokeStyle);
-    var color = a.color;
-    var opacity = a.alpha * this.globalAlpha;
-
-    var W = 10;
-    var H = 10;
-
-    lineStr.push('<g_vml_:shape',
-                 ' filled="', !!aFill, '"',
-                 ' style="position:absolute;width:', W, 'px;height:', H, 'px;"',
-                 ' coordorigin="0 0" coordsize="', Z * W, ' ', Z * H, '"',
-                 ' stroked="', !aFill, '"',
-                 ' path="');
-
-    var newSeq = false;
-    var min = {x: null, y: null};
-    var max = {x: null, y: null};
-
-    for (var i = 0; i < this.currentPath_.length; i++) {
-      var p = this.currentPath_[i];
-      var c;
-
-      switch (p.type) {
-        case 'moveTo':
-          c = p;
-          lineStr.push(' m ', mr(p.x), ',', mr(p.y));
-          break;
-        case 'lineTo':
-          lineStr.push(' l ', mr(p.x), ',', mr(p.y));
-          break;
-        case 'close':
-          lineStr.push(' x ');
-          p = null;
-          break;
-        case 'bezierCurveTo':
-          lineStr.push(' c ',
-                       mr(p.cp1x), ',', mr(p.cp1y), ',',
-                       mr(p.cp2x), ',', mr(p.cp2y), ',',
-                       mr(p.x), ',', mr(p.y));
-          break;
-        case 'at':
-        case 'wa':
-          lineStr.push(' ', p.type, ' ',
-                       mr(p.x - this.arcScaleX_ * p.radius), ',',
-                       mr(p.y - this.arcScaleY_ * p.radius), ' ',
-                       mr(p.x + this.arcScaleX_ * p.radius), ',',
-                       mr(p.y + this.arcScaleY_ * p.radius), ' ',
-                       mr(p.xStart), ',', mr(p.yStart), ' ',
-                       mr(p.xEnd), ',', mr(p.yEnd));
-          break;
-      }
-
-
-      // TODO: Following is broken for curves due to
-      //       move to proper paths.
-
-      // Figure out dimensions so we can do gradient fills
-      // properly
-      if (p) {
-        if (min.x == null || p.x < min.x) {
-          min.x = p.x;
-        }
-        if (max.x == null || p.x > max.x) {
-          max.x = p.x;
-        }
-        if (min.y == null || p.y < min.y) {
-          min.y = p.y;
-        }
-        if (max.y == null || p.y > max.y) {
-          max.y = p.y;
-        }
-      }
-    }
-    lineStr.push(' ">');
-
-    if (!aFill) {
-      var lineWidth = this.lineScale_ * this.lineWidth;
-
-      // VML cannot correctly render a line if the width is less than 1px.
-      // In that case, we dilute the color to make the line look thinner.
-      if (lineWidth < 1) {
-        opacity *= lineWidth;
-      }
-
-      lineStr.push(
-        '<g_vml_:stroke',
-        ' opacity="', opacity, '"',
-        ' joinstyle="', this.lineJoin, '"',
-        ' miterlimit="', this.miterLimit, '"',
-        ' endcap="', processLineCap(this.lineCap), '"',
-        ' weight="', lineWidth, 'px"',
-        ' color="', color, '" />'
-      );
-    } else if (typeof this.fillStyle == 'object') {
-      var fillStyle = this.fillStyle;
-      var angle = 0;
-      var focus = {x: 0, y: 0};
-
-      // additional offset
-      var shift = 0;
-      // scale factor for offset
-      var expansion = 1;
-
-      if (fillStyle.type_ == 'gradient') {
-        var x0 = fillStyle.x0_ / this.arcScaleX_;
-        var y0 = fillStyle.y0_ / this.arcScaleY_;
-        var x1 = fillStyle.x1_ / this.arcScaleX_;
-        var y1 = fillStyle.y1_ / this.arcScaleY_;
-        var p0 = this.getCoords_(x0, y0);
-        var p1 = this.getCoords_(x1, y1);
-        var dx = p1.x - p0.x;
-        var dy = p1.y - p0.y;
-        angle = Math.atan2(dx, dy) * 180 / Math.PI;
-
-        // The angle should be a non-negative number.
-        if (angle < 0) {
-          angle += 360;
-        }
-
-        // Very small angles produce an unexpected result because they are
-        // converted to a scientific notation string.
-        if (angle < 1e-6) {
-          angle = 0;
-        }
-      } else {
-        var p0 = this.getCoords_(fillStyle.x0_, fillStyle.y0_);
-        var width  = max.x - min.x;
-        var height = max.y - min.y;
-        focus = {
-          x: (p0.x - min.x) / width,
-          y: (p0.y - min.y) / height
-        };
-
-        width  /= this.arcScaleX_ * Z;
-        height /= this.arcScaleY_ * Z;
-        var dimension = m.max(width, height);
-        shift = 2 * fillStyle.r0_ / dimension;
-        expansion = 2 * fillStyle.r1_ / dimension - shift;
-      }
-
-      // We need to sort the color stops in ascending order by offset,
-      // otherwise IE won't interpret it correctly.
-      var stops = fillStyle.colors_;
-      stops.sort(function(cs1, cs2) {
-        return cs1.offset - cs2.offset;
-      });
-
-      var length = stops.length;
-      var color1 = stops[0].color;
-      var color2 = stops[length - 1].color;
-      var opacity1 = stops[0].alpha * this.globalAlpha;
-      var opacity2 = stops[length - 1].alpha * this.globalAlpha;
-
-      var colors = [];
-      for (var i = 0; i < length; i++) {
-        var stop = stops[i];
-        colors.push(stop.offset * expansion + shift + ' ' + stop.color);
-      }
-
-      // When colors attribute is used, the meanings of opacity and o:opacity2
-      // are reversed.
-      lineStr.push('<g_vml_:fill type="', fillStyle.type_, '"',
-                   ' method="none" focus="100%"',
-                   ' color="', color1, '"',
-                   ' color2="', color2, '"',
-                   ' colors="', colors.join(','), '"',
-                   ' opacity="', opacity2, '"',
-                   ' g_o_:opacity2="', opacity1, '"',
-                   ' angle="', angle, '"',
-                   ' focusposition="', focus.x, ',', focus.y, '" />');
-    } else {
-      lineStr.push('<g_vml_:fill color="', color, '" opacity="', opacity,
-                   '" />');
-    }
-
-    lineStr.push('</g_vml_:shape>');
-
-    this.element_.insertAdjacentHTML('beforeEnd', lineStr.join(''));
-  };
-
-  contextPrototype.fill = function() {
-    this.stroke(true);
-  }
-
-  contextPrototype.closePath = function() {
-    this.currentPath_.push({type: 'close'});
-  };
-
-  /**
-   * @private
-   */
-  contextPrototype.getCoords_ = function(aX, aY) {
-    var m = this.m_;
-    return {
-      x: Z * (aX * m[0][0] + aY * m[1][0] + m[2][0]) - Z2,
-      y: Z * (aX * m[0][1] + aY * m[1][1] + m[2][1]) - Z2
-    }
-  };
-
-  contextPrototype.save = function() {
-    var o = {};
-    copyState(this, o);
-    this.aStack_.push(o);
-    this.mStack_.push(this.m_);
-    this.m_ = matrixMultiply(createMatrixIdentity(), this.m_);
-  };
-
-  contextPrototype.restore = function() {
-    copyState(this.aStack_.pop(), this);
-    this.m_ = this.mStack_.pop();
-  };
-
-  contextPrototype.translate = function(aX, aY) {
-    var m1 = [
-      [1,  0,  0],
-      [0,  1,  0],
-      [aX, aY, 1]
-    ];
-
-    this.m_ = matrixMultiply(m1, this.m_);
-  };
-
-  contextPrototype.rotate = function(aRot) {
-    var c = mc(aRot);
-    var s = ms(aRot);
-
-    var m1 = [
-      [c,  s, 0],
-      [-s, c, 0],
-      [0,  0, 1]
-    ];
-
-    this.m_ = matrixMultiply(m1, this.m_);
-  };
-
-  contextPrototype.scale = function(aX, aY) {
-    this.arcScaleX_ *= aX;
-    this.arcScaleY_ *= aY;
-    var m1 = [
-      [aX, 0,  0],
-      [0,  aY, 0],
-      [0,  0,  1]
-    ];
-
-    var m = this.m_ = matrixMultiply(m1, this.m_);
-
-    // Get the line scale.
-    // Determinant of this.m_ means how much the area is enlarged by the
-    // transformation. So its square root can be used as a scale factor
-    // for width.
-    var det = m[0][0] * m[1][1] - m[0][1] * m[1][0];
-    this.lineScale_ = sqrt(abs(det));
-  };
-
-  /******** STUBS ********/
-  contextPrototype.clip = function() {
-    // TODO: Implement
-  };
-
-  contextPrototype.arcTo = function() {
-    // TODO: Implement
-  };
-
-  contextPrototype.createPattern = function() {
-    return new CanvasPattern_;
-  };
-
-  // Gradient / Pattern Stubs
-  function CanvasGradient_(aType) {
-    this.type_ = aType;
-    this.x0_ = 0;
-    this.y0_ = 0;
-    this.r0_ = 0;
-    this.x1_ = 0;
-    this.y1_ = 0;
-    this.r1_ = 0;
-    this.colors_ = [];
-  }
-
-  CanvasGradient_.prototype.addColorStop = function(aOffset, aColor) {
-    aColor = processStyle(aColor);
-    this.colors_.push({offset: aOffset,
-                       color: aColor.color,
-                       alpha: aColor.alpha});
-  };
-
-  function CanvasPattern_() {}
-
-  // set up externs
-  G_vmlCanvasManager = G_vmlCanvasManager_;
-  CanvasRenderingContext2D = CanvasRenderingContext2D_;
-  CanvasGradient = CanvasGradient_;
-  CanvasPattern = CanvasPattern_;
-
-})();
-
-} // if
-

--- a/js/flotr/lib/prototype-1.6.0.2.js
+++ /dev/null
@@ -1,4221 +1,1 @@
-/*  Prototype JavaScript framework, version 1.6.0.2

- *  (c) 2005-2008 Sam Stephenson

- *

- *  Prototype is freely distributable under the terms of an MIT-style license.

- *  For details, see the Prototype web site: http://www.prototypejs.org/

- *

- *--------------------------------------------------------------------------*/

-

-var Prototype = {

-  Version: '1.6.0.2',

-

-  Browser: {

-    IE:     !!(window.attachEvent && !window.opera),

-    Opera:  !!window.opera,

-    WebKit: navigator.userAgent.indexOf('AppleWebKit/') > -1,

-    Gecko:  navigator.userAgent.indexOf('Gecko') > -1 && navigator.userAgent.indexOf('KHTML') == -1,

-    MobileSafari: !!navigator.userAgent.match(/Apple.*Mobile.*Safari/)

-  },

-

-  BrowserFeatures: {

-    XPath: !!document.evaluate,

-    ElementExtensions: !!window.HTMLElement,

-    SpecificElementExtensions:

-      document.createElement('div').__proto__ &&

-      document.createElement('div').__proto__ !==

-        document.createElement('form').__proto__

-  },

-

-  ScriptFragment: '<script[^>]*>([\\S\\s]*?)<\/script>',

-  JSONFilter: /^\/\*-secure-([\s\S]*)\*\/\s*$/,

-

-  emptyFunction: function() { },

-  K: function(x) { return x }

-};

-

-if (Prototype.Browser.MobileSafari)

-  Prototype.BrowserFeatures.SpecificElementExtensions = false;

-

-

-/* Based on Alex Arnell's inheritance implementation. */

-var Class = {

-  create: function() {

-    var parent = null, properties = $A(arguments);

-    if (Object.isFunction(properties[0]))

-      parent = properties.shift();

-

-    function klass() {

-      this.initialize.apply(this, arguments);

-    }

-

-    Object.extend(klass, Class.Methods);

-    klass.superclass = parent;

-    klass.subclasses = [];

-

-    if (parent) {

-      var subclass = function() { };

-      subclass.prototype = parent.prototype;

-      klass.prototype = new subclass;

-      parent.subclasses.push(klass);

-    }

-

-    for (var i = 0; i < properties.length; i++)

-      klass.addMethods(properties[i]);

-

-    if (!klass.prototype.initialize)

-      klass.prototype.initialize = Prototype.emptyFunction;

-

-    klass.prototype.constructor = klass;

-

-    return klass;

-  }

-};

-

-Class.Methods = {

-  addMethods: function(source) {

-    var ancestor   = this.superclass && this.superclass.prototype;

-    var properties = Object.keys(source);

-

-    if (!Object.keys({ toString: true }).length)

-      properties.push("toString", "valueOf");

-

-    for (var i = 0, length = properties.length; i < length; i++) {

-      var property = properties[i], value = source[property];

-      if (ancestor && Object.isFunction(value) &&

-          value.argumentNames().first() == "$super") {

-        var method = value, value = Object.extend((function(m) {

-          return function() { return ancestor[m].apply(this, arguments) };

-        })(property).wrap(method), {

-          valueOf:  function() { return method },

-          toString: function() { return method.toString() }

-        });

-      }

-      this.prototype[property] = value;

-    }

-

-    return this;

-  }

-};

-

-var Abstract = { };

-

-Object.extend = function(destination, source) {

-  for (var property in source)

-    destination[property] = source[property];

-  return destination;

-};

-

-Object.extend(Object, {

-  inspect: function(object) {

-    try {

-      if (Object.isUndefined(object)) return 'undefined';

-      if (object === null) return 'null';

-      return object.inspect ? object.inspect() : String(object);

-    } catch (e) {

-      if (e instanceof RangeError) return '...';

-      throw e;

-    }

-  },

-

-  toJSON: function(object) {

-    var type = typeof object;

-    switch (type) {

-      case 'undefined':

-      case 'function':

-      case 'unknown': return;

-      case 'boolean': return object.toString();

-    }

-

-    if (object === null) return 'null';

-    if (object.toJSON) return object.toJSON();

-    if (Object.isElement(object)) return;

-

-    var results = [];

-    for (var property in object) {

-      var value = Object.toJSON(object[property]);

-      if (!Object.isUndefined(value))

-        results.push(property.toJSON() + ': ' + value);

-    }

-

-    return '{' + results.join(', ') + '}';

-  },

-

-  toQueryString: function(object) {

-    return $H(object).toQueryString();

-  },

-

-  toHTML: function(object) {

-    return object && object.toHTML ? object.toHTML() : String.interpret(object);

-  },

-

-  keys: function(object) {

-    var keys = [];

-    for (var property in object)

-      keys.push(property);

-    return keys;

-  },

-

-  values: function(object) {

-    var values = [];

-    for (var property in object)

-      values.push(object[property]);

-    return values;

-  },

-

-  clone: function(object) {

-    return Object.extend({ }, object);

-  },

-

-  isElement: function(object) {

-    return object && object.nodeType == 1;

-  },

-

-  isArray: function(object) {

-    return object != null && typeof object == "object" &&

-      'splice' in object && 'join' in object;

-  },

-

-  isHash: function(object) {

-    return object instanceof Hash;

-  },

-

-  isFunction: function(object) {

-    return typeof object == "function";

-  },

-

-  isString: function(object) {

-    return typeof object == "string";

-  },

-

-  isNumber: function(object) {

-    return typeof object == "number";

-  },

-

-  isUndefined: function(object) {

-    return typeof object == "undefined";

-  }

-});

-

-Object.extend(Function.prototype, {

-  argumentNames: function() {

-    var names = this.toString().match(/^[\s\(]*function[^(]*\((.*?)\)/)[1].split(",").invoke("strip");

-    return names.length == 1 && !names[0] ? [] : names;

-  },

-

-  bind: function() {

-    if (arguments.length < 2 && Object.isUndefined(arguments[0])) return this;

-    var __method = this, args = $A(arguments), object = args.shift();

-    return function() {

-      return __method.apply(object, args.concat($A(arguments)));

-    }

-  },

-

-  bindAsEventListener: function() {

-    var __method = this, args = $A(arguments), object = args.shift();

-    return function(event) {

-      return __method.apply(object, [event || window.event].concat(args));

-    }

-  },

-

-  curry: function() {

-    if (!arguments.length) return this;

-    var __method = this, args = $A(arguments);

-    return function() {

-      return __method.apply(this, args.concat($A(arguments)));

-    }

-  },

-

-  delay: function() {

-    var __method = this, args = $A(arguments), timeout = args.shift() * 1000;

-    return window.setTimeout(function() {

-      return __method.apply(__method, args);

-    }, timeout);

-  },

-

-  wrap: function(wrapper) {

-    var __method = this;

-    return function() {

-      return wrapper.apply(this, [__method.bind(this)].concat($A(arguments)));

-    }

-  },

-

-  methodize: function() {

-    if (this._methodized) return this._methodized;

-    var __method = this;

-    return this._methodized = function() {

-      return __method.apply(null, [this].concat($A(arguments)));

-    };

-  }

-});

-

-Function.prototype.defer = Function.prototype.delay.curry(0.01);

-

-Date.prototype.toJSON = function() {

-  return '"' + this.getUTCFullYear() + '-' +

-    (this.getUTCMonth() + 1).toPaddedString(2) + '-' +

-    this.getUTCDate().toPaddedString(2) + 'T' +

-    this.getUTCHours().toPaddedString(2) + ':' +

-    this.getUTCMinutes().toPaddedString(2) + ':' +

-    this.getUTCSeconds().toPaddedString(2) + 'Z"';

-};

-

-var Try = {

-  these: function() {

-    var returnValue;

-

-    for (var i = 0, length = arguments.length; i < length; i++) {

-      var lambda = arguments[i];

-      try {

-        returnValue = lambda();

-        break;

-      } catch (e) { }

-    }

-

-    return returnValue;

-  }

-};

-

-RegExp.prototype.match = RegExp.prototype.test;

-

-RegExp.escape = function(str) {

-  return String(str).replace(/([.*+?^=!:${}()|[\]\/\\])/g, '\\$1');

-};

-

-/*--------------------------------------------------------------------------*/

-

-var PeriodicalExecuter = Class.create({

-  initialize: function(callback, frequency) {

-    this.callback = callback;

-    this.frequency = frequency;

-    this.currentlyExecuting = false;

-

-    this.registerCallback();

-  },

-

-  registerCallback: function() {

-    this.timer = setInterval(this.onTimerEvent.bind(this), this.frequency * 1000);

-  },

-

-  execute: function() {

-    this.callback(this);

-  },

-

-  stop: function() {

-    if (!this.timer) return;

-    clearInterval(this.timer);

-    this.timer = null;

-  },

-

-  onTimerEvent: function() {

-    if (!this.currentlyExecuting) {

-      try {

-        this.currentlyExecuting = true;

-        this.execute();

-      } finally {

-        this.currentlyExecuting = false;

-      }

-    }

-  }

-});

-Object.extend(String, {

-  interpret: function(value) {

-    return value == null ? '' : String(value);

-  },

-  specialChar: {

-    '\b': '\\b',

-    '\t': '\\t',

-    '\n': '\\n',

-    '\f': '\\f',

-    '\r': '\\r',

-    '\\': '\\\\'

-  }

-});

-

-Object.extend(String.prototype, {

-  gsub: function(pattern, replacement) {

-    var result = '', source = this, match;

-    replacement = arguments.callee.prepareReplacement(replacement);

-

-    while (source.length > 0) {

-      if (match = source.match(pattern)) {

-        result += source.slice(0, match.index);

-        result += String.interpret(replacement(match));

-        source  = source.slice(match.index + match[0].length);

-      } else {

-        result += source, source = '';

-      }

-    }

-    return result;

-  },

-

-  sub: function(pattern, replacement, count) {

-    replacement = this.gsub.prepareReplacement(replacement);

-    count = Object.isUndefined(count) ? 1 : count;

-

-    return this.gsub(pattern, function(match) {

-      if (--count < 0) return match[0];

-      return replacement(match);

-    });

-  },

-

-  scan: function(pattern, iterator) {

-    this.gsub(pattern, iterator);

-    return String(this);

-  },

-

-  truncate: function(length, truncation) {

-    length = length || 30;

-    truncation = Object.isUndefined(truncation) ? '...' : truncation;

-    return this.length > length ?

-      this.slice(0, length - truncation.length) + truncation : String(this);

-  },

-

-  strip: function() {

-    return this.replace(/^\s+/, '').replace(/\s+$/, '');

-  },

-

-  stripTags: function() {

-    return this.replace(/<\/?[^>]+>/gi, '');

-  },

-

-  stripScripts: function() {

-    return this.replace(new RegExp(Prototype.ScriptFragment, 'img'), '');

-  },

-

-  extractScripts: function() {

-    var matchAll = new RegExp(Prototype.ScriptFragment, 'img');

-    var matchOne = new RegExp(Prototype.ScriptFragment, 'im');

-    return (this.match(matchAll) || []).map(function(scriptTag) {

-      return (scriptTag.match(matchOne) || ['', ''])[1];

-    });

-  },

-

-  evalScripts: function() {

-    return this.extractScripts().map(function(script) { return eval(script) });

-  },

-

-  escapeHTML: function() {

-    var self = arguments.callee;

-    self.text.data = this;

-    return self.div.innerHTML;

-  },

-

-  unescapeHTML: function() {

-    var div = new Element('div');

-    div.innerHTML = this.stripTags();

-    return div.childNodes[0] ? (div.childNodes.length > 1 ?

-      $A(div.childNodes).inject('', function(memo, node) { return memo+node.nodeValue }) :

-      div.childNodes[0].nodeValue) : '';

-  },

-

-  toQueryParams: function(separator) {

-    var match = this.strip().match(/([^?#]*)(#.*)?$/);

-    if (!match) return { };

-

-    return match[1].split(separator || '&').inject({ }, function(hash, pair) {

-      if ((pair = pair.split('='))[0]) {

-        var key = decodeURIComponent(pair.shift());

-        var value = pair.length > 1 ? pair.join('=') : pair[0];

-        if (value != undefined) value = decodeURIComponent(value);

-

-        if (key in hash) {

-          if (!Object.isArray(hash[key])) hash[key] = [hash[key]];

-          hash[key].push(value);

-        }

-        else hash[key] = value;

-      }

-      return hash;

-    });

-  },

-

-  toArray: function() {

-    return this.split('');

-  },

-

-  succ: function() {

-    return this.slice(0, this.length - 1) +

-      String.fromCharCode(this.charCodeAt(this.length - 1) + 1);

-  },

-

-  times: function(count) {

-    return count < 1 ? '' : new Array(count + 1).join(this);

-  },

-

-  camelize: function() {

-    var parts = this.split('-'), len = parts.length;

-    if (len == 1) return parts[0];

-

-    var camelized = this.charAt(0) == '-'

-      ? parts[0].charAt(0).toUpperCase() + parts[0].substring(1)

-      : parts[0];

-

-    for (var i = 1; i < len; i++)

-      camelized += parts[i].charAt(0).toUpperCase() + parts[i].substring(1);

-

-    return camelized;

-  },

-

-  capitalize: function() {

-    return this.charAt(0).toUpperCase() + this.substring(1).toLowerCase();

-  },

-

-  underscore: function() {

-    return this.gsub(/::/, '/').gsub(/([A-Z]+)([A-Z][a-z])/,'#{1}_#{2}').gsub(/([a-z\d])([A-Z])/,'#{1}_#{2}').gsub(/-/,'_').toLowerCase();

-  },

-

-  dasherize: function() {

-    return this.gsub(/_/,'-');

-  },

-

-  inspect: function(useDoubleQuotes) {

-    var escapedString = this.gsub(/[\x00-\x1f\\]/, function(match) {

-      var character = String.specialChar[match[0]];

-      return character ? character : '\\u00' + match[0].charCodeAt().toPaddedString(2, 16);

-    });

-    if (useDoubleQuotes) return '"' + escapedString.replace(/"/g, '\\"') + '"';

-    return "'" + escapedString.replace(/'/g, '\\\'') + "'";

-  },

-

-  toJSON: function() {

-    return this.inspect(true);

-  },

-

-  unfilterJSON: function(filter) {

-    return this.sub(filter || Prototype.JSONFilter, '#{1}');

-  },

-

-  isJSON: function() {

-    var str = this;

-    if (str.blank()) return false;

-    str = this.replace(/\\./g, '@').replace(/"[^"\\\n\r]*"/g, '');

-    return (/^[,:{}\[\]0-9.\-+Eaeflnr-u \n\r\t]*$/).test(str);

-  },

-

-  evalJSON: function(sanitize) {

-    var json = this.unfilterJSON();

-    try {

-      if (!sanitize || json.isJSON()) return eval('(' + json + ')');

-    } catch (e) { }

-    throw new SyntaxError('Badly formed JSON string: ' + this.inspect());

-  },

-

-  include: function(pattern) {

-    return this.indexOf(pattern) > -1;

-  },

-

-  startsWith: function(pattern) {

-    return this.indexOf(pattern) === 0;

-  },

-

-  endsWith: function(pattern) {

-    var d = this.length - pattern.length;

-    return d >= 0 && this.lastIndexOf(pattern) === d;

-  },

-

-  empty: function() {

-    return this == '';

-  },

-

-  blank: function() {

-    return /^\s*$/.test(this);

-  },

-

-  interpolate: function(object, pattern) {

-    return new Template(this, pattern).evaluate(object);

-  }

-});

-

-if (Prototype.Browser.WebKit || Prototype.Browser.IE) Object.extend(String.prototype, {

-  escapeHTML: function() {

-    return this.replace(/&/g,'&amp;').replace(/</g,'&lt;').replace(/>/g,'&gt;');

-  },

-  unescapeHTML: function() {

-    return this.replace(/&amp;/g,'&').replace(/&lt;/g,'<').replace(/&gt;/g,'>');

-  }

-});

-

-String.prototype.gsub.prepareReplacement = function(replacement) {

-  if (Object.isFunction(replacement)) return replacement;

-  var template = new Template(replacement);

-  return function(match) { return template.evaluate(match) };

-};

-

-String.prototype.parseQuery = String.prototype.toQueryParams;

-

-Object.extend(String.prototype.escapeHTML, {

-  div:  document.createElement('div'),

-  text: document.createTextNode('')

-});

-

-with (String.prototype.escapeHTML) div.appendChild(text);

-

-var Template = Class.create({

-  initialize: function(template, pattern) {

-    this.template = template.toString();

-    this.pattern = pattern || Template.Pattern;

-  },

-

-  evaluate: function(object) {

-    if (Object.isFunction(object.toTemplateReplacements))

-      object = object.toTemplateReplacements();

-

-    return this.template.gsub(this.pattern, function(match) {

-      if (object == null) return '';

-

-      var before = match[1] || '';

-      if (before == '\\') return match[2];

-

-      var ctx = object, expr = match[3];

-      var pattern = /^([^.[]+|\[((?:.*?[^\\])?)\])(\.|\[|$)/;

-      match = pattern.exec(expr);

-      if (match == null) return before;

-

-      while (match != null) {

-        var comp = match[1].startsWith('[') ? match[2].gsub('\\\\]', ']') : match[1];

-        ctx = ctx[comp];

-        if (null == ctx || '' == match[3]) break;

-        expr = expr.substring('[' == match[3] ? match[1].length : match[0].length);

-        match = pattern.exec(expr);

-      }

-

-      return before + String.interpret(ctx);

-    });

-  }

-});

-Template.Pattern = /(^|.|\r|\n)(#\{(.*?)\})/;

-

-var $break = { };

-

-var Enumerable = {

-  each: function(iterator, context) {

-    var index = 0;

-    iterator = iterator.bind(context);

-    try {

-      this._each(function(value) {

-        iterator(value, index++);

-      });

-    } catch (e) {

-      if (e != $break) throw e;

-    }

-    return this;

-  },

-

-  eachSlice: function(number, iterator, context) {

-    iterator = iterator ? iterator.bind(context) : Prototype.K;

-    var index = -number, slices = [], array = this.toArray();

-    while ((index += number) < array.length)

-      slices.push(array.slice(index, index+number));

-    return slices.collect(iterator, context);

-  },

-

-  all: function(iterator, context) {

-    iterator = iterator ? iterator.bind(context) : Prototype.K;

-    var result = true;

-    this.each(function(value, index) {

-      result = result && !!iterator(value, index);

-      if (!result) throw $break;

-    });

-    return result;

-  },

-

-  any: function(iterator, context) {

-    iterator = iterator ? iterator.bind(context) : Prototype.K;

-    var result = false;

-    this.each(function(value, index) {

-      if (result = !!iterator(value, index))

-        throw $break;

-    });

-    return result;

-  },

-

-  collect: function(iterator, context) {

-    iterator = iterator ? iterator.bind(context) : Prototype.K;

-    var results = [];

-    this.each(function(value, index) {

-      results.push(iterator(value, index));

-    });

-    return results;

-  },

-

-  detect: function(iterator, context) {

-    iterator = iterator.bind(context);

-    var result;

-    this.each(function(value, index) {

-      if (iterator(value, index)) {

-        result = value;

-        throw $break;

-      }

-    });

-    return result;

-  },

-

-  findAll: function(iterator, context) {

-    iterator = iterator.bind(context);

-    var results = [];

-    this.each(function(value, index) {

-      if (iterator(value, index))

-        results.push(value);

-    });

-    return results;

-  },

-

-  grep: function(filter, iterator, context) {

-    iterator = iterator ? iterator.bind(context) : Prototype.K;

-    var results = [];

-

-    if (Object.isString(filter))

-      filter = new RegExp(filter);

-

-    this.each(function(value, index) {

-      if (filter.match(value))

-        results.push(iterator(value, index));

-    });

-    return results;

-  },

-

-  include: function(object) {

-    if (Object.isFunction(this.indexOf))

-      if (this.indexOf(object) != -1) return true;

-

-    var found = false;

-    this.each(function(value) {

-      if (value == object) {

-        found = true;

-        throw $break;

-      }

-    });

-    return found;

-  },

-

-  inGroupsOf: function(number, fillWith) {

-    fillWith = Object.isUndefined(fillWith) ? null : fillWith;

-    return this.eachSlice(number, function(slice) {

-      while(slice.length < number) slice.push(fillWith);

-      return slice;

-    });

-  },

-

-  inject: function(memo, iterator, context) {

-    iterator = iterator.bind(context);

-    this.each(function(value, index) {

-      memo = iterator(memo, value, index);

-    });

-    return memo;

-  },

-

-  invoke: function(method) {

-    var args = $A(arguments).slice(1);

-    return this.map(function(value) {

-      return value[method].apply(value, args);

-    });

-  },

-

-  max: function(iterator, context) {

-    iterator = iterator ? iterator.bind(context) : Prototype.K;

-    var result;

-    this.each(function(value, index) {

-      value = iterator(value, index);

-      if (result == null || value >= result)

-        result = value;

-    });

-    return result;

-  },

-

-  min: function(iterator, context) {

-    iterator = iterator ? iterator.bind(context) : Prototype.K;

-    var result;

-    this.each(function(value, index) {

-      value = iterator(value, index);

-      if (result == null || value < result)

-        result = value;

-    });

-    return result;

-  },

-

-  partition: function(iterator, context) {

-    iterator = iterator ? iterator.bind(context) : Prototype.K;

-    var trues = [], falses = [];

-    this.each(function(value, index) {

-      (iterator(value, index) ?

-        trues : falses).push(value);

-    });

-    return [trues, falses];

-  },

-

-  pluck: function(property) {

-    var results = [];

-    this.each(function(value) {

-      results.push(value[property]);

-    });

-    return results;

-  },

-

-  reject: function(iterator, context) {

-    iterator = iterator.bind(context);

-    var results = [];

-    this.each(function(value, index) {

-      if (!iterator(value, index))

-        results.push(value);

-    });

-    return results;

-  },

-

-  sortBy: function(iterator, context) {

-    iterator = iterator.bind(context);

-    return this.map(function(value, index) {

-      return {value: value, criteria: iterator(value, index)};

-    }).sort(function(left, right) {

-      var a = left.criteria, b = right.criteria;

-      return a < b ? -1 : a > b ? 1 : 0;

-    }).pluck('value');

-  },

-

-  toArray: function() {

-    return this.map();

-  },

-

-  zip: function() {

-    var iterator = Prototype.K, args = $A(arguments);

-    if (Object.isFunction(args.last()))

-      iterator = args.pop();

-

-    var collections = [this].concat(args).map($A);

-    return this.map(function(value, index) {

-      return iterator(collections.pluck(index));

-    });

-  },

-

-  size: function() {

-    return this.toArray().length;

-  },

-

-  inspect: function() {

-    return '#<Enumerable:' + this.toArray().inspect() + '>';

-  }

-};

-

-Object.extend(Enumerable, {

-  map:     Enumerable.collect,

-  find:    Enumerable.detect,

-  select:  Enumerable.findAll,

-  filter:  Enumerable.findAll,

-  member:  Enumerable.include,

-  entries: Enumerable.toArray,

-  every:   Enumerable.all,

-  some:    Enumerable.any

-});

-function $A(iterable) {

-  if (!iterable) return [];

-  if (iterable.toArray) return iterable.toArray();

-  var length = iterable.length || 0, results = new Array(length);

-  while (length--) results[length] = iterable[length];

-  return results;

-}

-

-if (Prototype.Browser.WebKit) {

-  $A = function(iterable) {

-    if (!iterable) return [];

-    if (!(Object.isFunction(iterable) && iterable == '[object NodeList]') &&

-        iterable.toArray) return iterable.toArray();

-    var length = iterable.length || 0, results = new Array(length);

-    while (length--) results[length] = iterable[length];

-    return results;

-  };

-}

-

-Array.from = $A;

-

-Object.extend(Array.prototype, Enumerable);

-

-if (!Array.prototype._reverse) Array.prototype._reverse = Array.prototype.reverse;

-

-Object.extend(Array.prototype, {

-  _each: function(iterator) {

-    for (var i = 0, length = this.length; i < length; i++)

-      iterator(this[i]);

-  },

-

-  clear: function() {

-    this.length = 0;

-    return this;

-  },

-

-  first: function() {

-    return this[0];

-  },

-

-  last: function() {

-    return this[this.length - 1];

-  },

-

-  compact: function() {

-    return this.select(function(value) {

-      return value != null;

-    });

-  },

-

-  flatten: function() {

-    return this.inject([], function(array, value) {

-      return array.concat(Object.isArray(value) ?

-        value.flatten() : [value]);

-    });

-  },

-

-  without: function() {

-    var values = $A(arguments);

-    return this.select(function(value) {

-      return !values.include(value);

-    });

-  },

-

-  reverse: function(inline) {

-    return (inline !== false ? this : this.toArray())._reverse();

-  },

-

-  reduce: function() {

-    return this.length > 1 ? this : this[0];

-  },

-

-  uniq: function(sorted) {

-    return this.inject([], function(array, value, index) {

-      if (0 == index || (sorted ? array.last() != value : !array.include(value)))

-        array.push(value);

-      return array;

-    });

-  },

-

-  intersect: function(array) {

-    return this.uniq().findAll(function(item) {

-      return array.detect(function(value) { return item === value });

-    });

-  },

-

-  clone: function() {

-    return [].concat(this);

-  },

-

-  size: function() {

-    return this.length;

-  },

-

-  inspect: function() {

-    return '[' + this.map(Object.inspect).join(', ') + ']';

-  },

-

-  toJSON: function() {

-    var results = [];

-    this.each(function(object) {

-      var value = Object.toJSON(object);

-      if (!Object.isUndefined(value)) results.push(value);

-    });

-    return '[' + results.join(', ') + ']';

-  }

-});

-

-// use native browser JS 1.6 implementation if available

-if (Object.isFunction(Array.prototype.forEach))

-  Array.prototype._each = Array.prototype.forEach;

-

-if (!Array.prototype.indexOf) Array.prototype.indexOf = function(item, i) {

-  i || (i = 0);

-  var length = this.length;

-  if (i < 0) i = length + i;

-  for (; i < length; i++)

-    if (this[i] === item) return i;

-  return -1;

-};

-

-if (!Array.prototype.lastIndexOf) Array.prototype.lastIndexOf = function(item, i) {

-  i = isNaN(i) ? this.length : (i < 0 ? this.length + i : i) + 1;

-  var n = this.slice(0, i).reverse().indexOf(item);

-  return (n < 0) ? n : i - n - 1;

-};

-

-Array.prototype.toArray = Array.prototype.clone;

-

-function $w(string) {

-  if (!Object.isString(string)) return [];

-  string = string.strip();

-  return string ? string.split(/\s+/) : [];

-}

-

-if (Prototype.Browser.Opera){

-  Array.prototype.concat = function() {

-    var array = [];

-    for (var i = 0, length = this.length; i < length; i++) array.push(this[i]);

-    for (var i = 0, length = arguments.length; i < length; i++) {

-      if (Object.isArray(arguments[i])) {

-        for (var j = 0, arrayLength = arguments[i].length; j < arrayLength; j++)

-          array.push(arguments[i][j]);

-      } else {

-        array.push(arguments[i]);

-      }

-    }

-    return array;

-  };

-}

-Object.extend(Number.prototype, {

-  toColorPart: function() {

-    return this.toPaddedString(2, 16);

-  },

-

-  succ: function() {

-    return this + 1;

-  },

-

-  times: function(iterator) {

-    $R(0, this, true).each(iterator);

-    return this;

-  },

-

-  toPaddedString: function(length, radix) {

-    var string = this.toString(radix || 10);

-    return '0'.times(length - string.length) + string;

-  },

-

-  toJSON: function() {

-    return isFinite(this) ? this.toString() : 'null';

-  }

-});

-

-$w('abs round ceil floor').each(function(method){

-  Number.prototype[method] = Math[method].methodize();

-});

-function $H(object) {

-  return new Hash(object);

-};

-

-var Hash = Class.create(Enumerable, (function() {

-

-  function toQueryPair(key, value) {

-    if (Object.isUndefined(value)) return key;

-    return key + '=' + encodeURIComponent(String.interpret(value));

-  }

-

-  return {

-    initialize: function(object) {

-      this._object = Object.isHash(object) ? object.toObject() : Object.clone(object);

-    },

-

-    _each: function(iterator) {

-      for (var key in this._object) {

-        var value = this._object[key], pair = [key, value];

-        pair.key = key;

-        pair.value = value;

-        iterator(pair);

-      }

-    },

-

-    set: function(key, value) {

-      return this._object[key] = value;

-    },

-

-    get: function(key) {

-      return this._object[key];

-    },

-

-    unset: function(key) {

-      var value = this._object[key];

-      delete this._object[key];

-      return value;

-    },

-

-    toObject: function() {

-      return Object.clone(this._object);

-    },

-

-    keys: function() {

-      return this.pluck('key');

-    },

-

-    values: function() {

-      return this.pluck('value');

-    },

-

-    index: function(value) {

-      var match = this.detect(function(pair) {

-        return pair.value === value;

-      });

-      return match && match.key;

-    },

-

-    merge: function(object) {

-      return this.clone().update(object);

-    },

-

-    update: function(object) {

-      return new Hash(object).inject(this, function(result, pair) {

-        result.set(pair.key, pair.value);

-        return result;

-      });

-    },

-

-    toQueryString: function() {

-      return this.map(function(pair) {

-        var key = encodeURIComponent(pair.key), values = pair.value;

-

-        if (values && typeof values == 'object') {

-          if (Object.isArray(values))

-            return values.map(toQueryPair.curry(key)).join('&');

-        }

-        return toQueryPair(key, values);

-      }).join('&');

-    },

-

-    inspect: function() {

-      return '#<Hash:{' + this.map(function(pair) {

-        return pair.map(Object.inspect).join(': ');

-      }).join(', ') + '}>';

-    },

-

-    toJSON: function() {

-      return Object.toJSON(this.toObject());

-    },

-

-    clone: function() {

-      return new Hash(this);

-    }

-  }

-})());

-

-Hash.prototype.toTemplateReplacements = Hash.prototype.toObject;

-Hash.from = $H;

-var ObjectRange = Class.create(Enumerable, {

-  initialize: function(start, end, exclusive) {

-    this.start = start;

-    this.end = end;

-    this.exclusive = exclusive;

-  },

-

-  _each: function(iterator) {

-    var value = this.start;

-    while (this.include(value)) {

-      iterator(value);

-      value = value.succ();

-    }

-  },

-

-  include: function(value) {

-    if (value < this.start)

-      return false;

-    if (this.exclusive)

-      return value < this.end;

-    return value <= this.end;

-  }

-});

-

-var $R = function(start, end, exclusive) {

-  return new ObjectRange(start, end, exclusive);

-};

-

-var Ajax = {

-  getTransport: function() {

-    return Try.these(

-      function() {return new XMLHttpRequest()},

-      function() {return new ActiveXObject('Msxml2.XMLHTTP')},

-      function() {return new ActiveXObject('Microsoft.XMLHTTP')}

-    ) || false;

-  },

-

-  activeRequestCount: 0

-};

-

-Ajax.Responders = {

-  responders: [],

-

-  _each: function(iterator) {

-    this.responders._each(iterator);

-  },

-

-  register: function(responder) {

-    if (!this.include(responder))

-      this.responders.push(responder);

-  },

-

-  unregister: function(responder) {

-    this.responders = this.responders.without(responder);

-  },

-

-  dispatch: function(callback, request, transport, json) {

-    this.each(function(responder) {

-      if (Object.isFunction(responder[callback])) {

-        try {

-          responder[callback].apply(responder, [request, transport, json]);

-        } catch (e) { }

-      }

-    });

-  }

-};

-

-Object.extend(Ajax.Responders, Enumerable);

-

-Ajax.Responders.register({

-  onCreate:   function() { Ajax.activeRequestCount++ },

-  onComplete: function() { Ajax.activeRequestCount-- }

-});

-

-Ajax.Base = Class.create({

-  initialize: function(options) {

-    this.options = {

-      method:       'post',

-      asynchronous: true,

-      contentType:  'application/x-www-form-urlencoded',

-      encoding:     'UTF-8',

-      parameters:   '',

-      evalJSON:     true,

-      evalJS:       true

-    };

-    Object.extend(this.options, options || { });

-

-    this.options.method = this.options.method.toLowerCase();

-

-    if (Object.isString(this.options.parameters))

-      this.options.parameters = this.options.parameters.toQueryParams();

-    else if (Object.isHash(this.options.parameters))

-      this.options.parameters = this.options.parameters.toObject();

-  }

-});

-

-Ajax.Request = Class.create(Ajax.Base, {

-  _complete: false,

-

-  initialize: function($super, url, options) {

-    $super(options);

-    this.transport = Ajax.getTransport();

-    this.request(url);

-  },

-

-  request: function(url) {

-    this.url = url;

-    this.method = this.options.method;

-    var params = Object.clone(this.options.parameters);

-

-    if (!['get', 'post'].include(this.method)) {

-      // simulate other verbs over post

-      params['_method'] = this.method;

-      this.method = 'post';

-    }

-

-    this.parameters = params;

-

-    if (params = Object.toQueryString(params)) {

-      // when GET, append parameters to URL

-      if (this.method == 'get')

-        this.url += (this.url.include('?') ? '&' : '?') + params;

-      else if (/Konqueror|Safari|KHTML/.test(navigator.userAgent))

-        params += '&_=';

-    }

-

-    try {

-      var response = new Ajax.Response(this);

-      if (this.options.onCreate) this.options.onCreate(response);

-      Ajax.Responders.dispatch('onCreate', this, response);

-

-      this.transport.open(this.method.toUpperCase(), this.url,

-        this.options.asynchronous);

-

-      if (this.options.asynchronous) this.respondToReadyState.bind(this).defer(1);

-

-      this.transport.onreadystatechange = this.onStateChange.bind(this);

-      this.setRequestHeaders();

-

-      this.body = this.method == 'post' ? (this.options.postBody || params) : null;

-      this.transport.send(this.body);

-

-      /* Force Firefox to handle ready state 4 for synchronous requests */

-      if (!this.options.asynchronous && this.transport.overrideMimeType)

-        this.onStateChange();

-

-    }

-    catch (e) {

-      this.dispatchException(e);

-    }

-  },

-

-  onStateChange: function() {

-    var readyState = this.transport.readyState;

-    if (readyState > 1 && !((readyState == 4) && this._complete))

-      this.respondToReadyState(this.transport.readyState);

-  },

-

-  setRequestHeaders: function() {

-    var headers = {

-      'X-Requested-With': 'XMLHttpRequest',

-      'X-Prototype-Version': Prototype.Version,

-      'Accept': 'text/javascript, text/html, application/xml, text/xml, */*'

-    };

-

-    if (this.method == 'post') {

-      headers['Content-type'] = this.options.contentType +

-        (this.options.encoding ? '; charset=' + this.options.encoding : '');

-

-      /* Force "Connection: close" for older Mozilla browsers to work

-       * around a bug where XMLHttpRequest sends an incorrect

-       * Content-length header. See Mozilla Bugzilla #246651.

-       */

-      if (this.transport.overrideMimeType &&

-          (navigator.userAgent.match(/Gecko\/(\d{4})/) || [0,2005])[1] < 2005)

-            headers['Connection'] = 'close';

-    }

-

-    // user-defined headers

-    if (typeof this.options.requestHeaders == 'object') {

-      var extras = this.options.requestHeaders;

-

-      if (Object.isFunction(extras.push))

-        for (var i = 0, length = extras.length; i < length; i += 2)

-          headers[extras[i]] = extras[i+1];

-      else

-        $H(extras).each(function(pair) { headers[pair.key] = pair.value });

-    }

-

-    for (var name in headers)

-      this.transport.setRequestHeader(name, headers[name]);

-  },

-

-  success: function() {

-    var status = this.getStatus();

-    return !status || (status >= 200 && status < 300);

-  },

-

-  getStatus: function() {

-    try {

-      return this.transport.status || 0;

-    } catch (e) { return 0 }

-  },

-

-  respondToReadyState: function(readyState) {

-    var state = Ajax.Request.Events[readyState], response = new Ajax.Response(this);

-

-    if (state == 'Complete') {

-      try {

-        this._complete = true;

-        (this.options['on' + response.status]

-         || this.options['on' + (this.success() ? 'Success' : 'Failure')]

-         || Prototype.emptyFunction)(response, response.headerJSON);

-      } catch (e) {

-        this.dispatchException(e);

-      }

-

-      var contentType = response.getHeader('Content-type');

-      if (this.options.evalJS == 'force'

-          || (this.options.evalJS && this.isSameOrigin() && contentType

-          && contentType.match(/^\s*(text|application)\/(x-)?(java|ecma)script(;.*)?\s*$/i)))

-        this.evalResponse();

-    }

-

-    try {

-      (this.options['on' + state] || Prototype.emptyFunction)(response, response.headerJSON);

-      Ajax.Responders.dispatch('on' + state, this, response, response.headerJSON);

-    } catch (e) {

-      this.dispatchException(e);

-    }

-

-    if (state == 'Complete') {

-      // avoid memory leak in MSIE: clean up

-      this.transport.onreadystatechange = Prototype.emptyFunction;

-    }

-  },

-

-  isSameOrigin: function() {

-    var m = this.url.match(/^\s*https?:\/\/[^\/]*/);

-    return !m || (m[0] == '#{protocol}//#{domain}#{port}'.interpolate({

-      protocol: location.protocol,

-      domain: document.domain,

-      port: location.port ? ':' + location.port : ''

-    }));

-  },

-

-  getHeader: function(name) {

-    try {

-      return this.transport.getResponseHeader(name) || null;

-    } catch (e) { return null }

-  },

-

-  evalResponse: function() {

-    try {

-      return eval((this.transport.responseText || '').unfilterJSON());

-    } catch (e) {

-      this.dispatchException(e);

-    }

-  },

-

-  dispatchException: function(exception) {

-    (this.options.onException || Prototype.emptyFunction)(this, exception);

-    Ajax.Responders.dispatch('onException', this, exception);

-  }

-});

-

-Ajax.Request.Events =

-  ['Uninitialized', 'Loading', 'Loaded', 'Interactive', 'Complete'];

-

-Ajax.Response = Class.create({

-  initialize: function(request){

-    this.request = request;

-    var transport  = this.transport  = request.transport,

-        readyState = this.readyState = transport.readyState;

-

-    if((readyState > 2 && !Prototype.Browser.IE) || readyState == 4) {

-      this.status       = this.getStatus();

-      this.statusText   = this.getStatusText();

-      this.responseText = String.interpret(transport.responseText);

-      this.headerJSON   = this._getHeaderJSON();

-    }

-

-    if(readyState == 4) {

-      var xml = transport.responseXML;

-      this.responseXML  = Object.isUndefined(xml) ? null : xml;

-      this.responseJSON = this._getResponseJSON();

-    }

-  },

-

-  status:      0,

-  statusText: '',

-

-  getStatus: Ajax.Request.prototype.getStatus,

-

-  getStatusText: function() {

-    try {

-      return this.transport.statusText || '';

-    } catch (e) { return '' }

-  },

-

-  getHeader: Ajax.Request.prototype.getHeader,

-

-  getAllHeaders: function() {

-    try {

-      return this.getAllResponseHeaders();

-    } catch (e) { return null }

-  },

-

-  getResponseHeader: function(name) {

-    return this.transport.getResponseHeader(name);

-  },

-

-  getAllResponseHeaders: function() {

-    return this.transport.getAllResponseHeaders();

-  },

-

-  _getHeaderJSON: function() {

-    var json = this.getHeader('X-JSON');

-    if (!json) return null;

-    json = decodeURIComponent(escape(json));

-    try {

-      return json.evalJSON(this.request.options.sanitizeJSON ||

-        !this.request.isSameOrigin());

-    } catch (e) {

-      this.request.dispatchException(e);

-    }

-  },

-

-  _getResponseJSON: function() {

-    var options = this.request.options;

-    if (!options.evalJSON || (options.evalJSON != 'force' &&

-      !(this.getHeader('Content-type') || '').include('application/json')) ||

-        this.responseText.blank())

-          return null;

-    try {

-      return this.responseText.evalJSON(options.sanitizeJSON ||

-        !this.request.isSameOrigin());

-    } catch (e) {

-      this.request.dispatchException(e);

-    }

-  }

-});

-

-Ajax.Updater = Class.create(Ajax.Request, {

-  initialize: function($super, container, url, options) {

-    this.container = {

-      success: (container.success || container),

-      failure: (container.failure || (container.success ? null : container))

-    };

-

-    options = Object.clone(options);

-    var onComplete = options.onComplete;

-    options.onComplete = (function(response, json) {

-      this.updateContent(response.responseText);

-      if (Object.isFunction(onComplete)) onComplete(response, json);

-    }).bind(this);

-

-    $super(url, options);

-  },

-

-  updateContent: function(responseText) {

-    var receiver = this.container[this.success() ? 'success' : 'failure'],

-        options = this.options;

-

-    if (!options.evalScripts) responseText = responseText.stripScripts();

-

-    if (receiver = $(receiver)) {

-      if (options.insertion) {

-        if (Object.isString(options.insertion)) {

-          var insertion = { }; insertion[options.insertion] = responseText;

-          receiver.insert(insertion);

-        }

-        else options.insertion(receiver, responseText);

-      }

-      else receiver.update(responseText);

-    }

-  }

-});

-

-Ajax.PeriodicalUpdater = Class.create(Ajax.Base, {

-  initialize: function($super, container, url, options) {

-    $super(options);

-    this.onComplete = this.options.onComplete;

-

-    this.frequency = (this.options.frequency || 2);

-    this.decay = (this.options.decay || 1);

-

-    this.updater = { };

-    this.container = container;

-    this.url = url;

-

-    this.start();

-  },

-

-  start: function() {

-    this.options.onComplete = this.updateComplete.bind(this);

-    this.onTimerEvent();

-  },

-

-  stop: function() {

-    this.updater.options.onComplete = undefined;

-    clearTimeout(this.timer);

-    (this.onComplete || Prototype.emptyFunction).apply(this, arguments);

-  },

-

-  updateComplete: function(response) {

-    if (this.options.decay) {

-      this.decay = (response.responseText == this.lastText ?

-        this.decay * this.options.decay : 1);

-

-      this.lastText = response.responseText;

-    }

-    this.timer = this.onTimerEvent.bind(this).delay(this.decay * this.frequency);

-  },

-

-  onTimerEvent: function() {

-    this.updater = new Ajax.Updater(this.container, this.url, this.options);

-  }

-});

-function $(element) {

-  if (arguments.length > 1) {

-    for (var i = 0, elements = [], length = arguments.length; i < length; i++)

-      elements.push($(arguments[i]));

-    return elements;

-  }

-  if (Object.isString(element))

-    element = document.getElementById(element);

-  return Element.extend(element);

-}

-

-if (Prototype.BrowserFeatures.XPath) {

-  document._getElementsByXPath = function(expression, parentElement) {

-    var results = [];

-    var query = document.evaluate(expression, $(parentElement) || document,

-      null, XPathResult.ORDERED_NODE_SNAPSHOT_TYPE, null);

-    for (var i = 0, length = query.snapshotLength; i < length; i++)

-      results.push(Element.extend(query.snapshotItem(i)));

-    return results;

-  };

-}

-

-/*--------------------------------------------------------------------------*/

-

-if (!window.Node) var Node = { };

-

-if (!Node.ELEMENT_NODE) {

-  // DOM level 2 ECMAScript Language Binding

-  Object.extend(Node, {

-    ELEMENT_NODE: 1,

-    ATTRIBUTE_NODE: 2,

-    TEXT_NODE: 3,

-    CDATA_SECTION_NODE: 4,

-    ENTITY_REFERENCE_NODE: 5,

-    ENTITY_NODE: 6,

-    PROCESSING_INSTRUCTION_NODE: 7,

-    COMMENT_NODE: 8,

-    DOCUMENT_NODE: 9,

-    DOCUMENT_TYPE_NODE: 10,

-    DOCUMENT_FRAGMENT_NODE: 11,

-    NOTATION_NODE: 12

-  });

-}

-

-(function() {

-  var element = this.Element;

-  this.Element = function(tagName, attributes) {

-    attributes = attributes || { };

-    tagName = tagName.toLowerCase();

-    var cache = Element.cache;

-    if (Prototype.Browser.IE && attributes.name) {

-      tagName = '<' + tagName + ' name="' + attributes.name + '">';

-      delete attributes.name;

-      return Element.writeAttribute(document.createElement(tagName), attributes);

-    }

-    if (!cache[tagName]) cache[tagName] = Element.extend(document.createElement(tagName));

-    return Element.writeAttribute(cache[tagName].cloneNode(false), attributes);

-  };

-  Object.extend(this.Element, element || { });

-}).call(window);

-

-Element.cache = { };

-

-Element.Methods = {

-  visible: function(element) {

-    return $(element).style.display != 'none';

-  },

-

-  toggle: function(element) {

-    element = $(element);

-    Element[Element.visible(element) ? 'hide' : 'show'](element);

-    return element;

-  },

-

-  hide: function(element) {

-    $(element).style.display = 'none';

-    return element;

-  },

-

-  show: function(element) {

-    $(element).style.display = '';

-    return element;

-  },

-

-  remove: function(element) {

-    element = $(element);

-    element.parentNode.removeChild(element);

-    return element;

-  },

-

-  update: function(element, content) {

-    element = $(element);

-    if (content && content.toElement) content = content.toElement();

-    if (Object.isElement(content)) return element.update().insert(content);

-    content = Object.toHTML(content);

-    element.innerHTML = content.stripScripts();

-    content.evalScripts.bind(content).defer();

-    return element;

-  },

-

-  replace: function(element, content) {

-    element = $(element);

-    if (content && content.toElement) content = content.toElement();

-    else if (!Object.isElement(content)) {

-      content = Object.toHTML(content);

-      var range = element.ownerDocument.createRange();

-      range.selectNode(element);

-      content.evalScripts.bind(content).defer();

-      content = range.createContextualFragment(content.stripScripts());

-    }

-    element.parentNode.replaceChild(content, element);

-    return element;

-  },

-

-  insert: function(element, insertions) {

-    element = $(element);

-

-    if (Object.isString(insertions) || Object.isNumber(insertions) ||

-        Object.isElement(insertions) || (insertions && (insertions.toElement || insertions.toHTML)))

-          insertions = {bottom:insertions};

-

-    var content, insert, tagName, childNodes;

-

-    for (var position in insertions) {

-      content  = insertions[position];

-      position = position.toLowerCase();

-      insert = Element._insertionTranslations[position];

-

-      if (content && content.toElement) content = content.toElement();

-      if (Object.isElement(content)) {

-        insert(element, content);

-        continue;

-      }

-

-      content = Object.toHTML(content);

-

-      tagName = ((position == 'before' || position == 'after')

-        ? element.parentNode : element).tagName.toUpperCase();

-

-      childNodes = Element._getContentFromAnonymousElement(tagName, content.stripScripts());

-

-      if (position == 'top' || position == 'after') childNodes.reverse();

-      childNodes.each(insert.curry(element));

-

-      content.evalScripts.bind(content).defer();

-    }

-

-    return element;

-  },

-

-  wrap: function(element, wrapper, attributes) {

-    element = $(element);

-    if (Object.isElement(wrapper))

-      $(wrapper).writeAttribute(attributes || { });

-    else if (Object.isString(wrapper)) wrapper = new Element(wrapper, attributes);

-    else wrapper = new Element('div', wrapper);

-    if (element.parentNode)

-      element.parentNode.replaceChild(wrapper, element);

-    wrapper.appendChild(element);

-    return wrapper;

-  },

-

-  inspect: function(element) {

-    element = $(element);

-    var result = '<' + element.tagName.toLowerCase();

-    $H({'id': 'id', 'className': 'class'}).each(function(pair) {

-      var property = pair.first(), attribute = pair.last();

-      var value = (element[property] || '').toString();

-      if (value) result += ' ' + attribute + '=' + value.inspect(true);

-    });

-    return result + '>';

-  },

-

-  recursivelyCollect: function(element, property) {

-    element = $(element);

-    var elements = [];

-    while (element = element[property])

-      if (element.nodeType == 1)

-        elements.push(Element.extend(element));

-    return elements;

-  },

-

-  ancestors: function(element) {

-    return $(element).recursivelyCollect('parentNode');

-  },

-

-  descendants: function(element) {

-    return $(element).select("*");

-  },

-

-  firstDescendant: function(element) {

-    element = $(element).firstChild;

-    while (element && element.nodeType != 1) element = element.nextSibling;

-    return $(element);

-  },

-

-  immediateDescendants: function(element) {

-    if (!(element = $(element).firstChild)) return [];

-    while (element && element.nodeType != 1) element = element.nextSibling;

-    if (element) return [element].concat($(element).nextSiblings());

-    return [];

-  },

-

-  previousSiblings: function(element) {

-    return $(element).recursivelyCollect('previousSibling');

-  },

-

-  nextSiblings: function(element) {

-    return $(element).recursivelyCollect('nextSibling');

-  },

-

-  siblings: function(element) {

-    element = $(element);

-    return element.previousSiblings().reverse().concat(element.nextSiblings());

-  },

-

-  match: function(element, selector) {

-    if (Object.isString(selector))

-      selector = new Selector(selector);

-    return selector.match($(element));

-  },

-

-  up: function(element, expression, index) {

-    element = $(element);

-    if (arguments.length == 1) return $(element.parentNode);

-    var ancestors = element.ancestors();

-    return Object.isNumber(expression) ? ancestors[expression] :

-      Selector.findElement(ancestors, expression, index);

-  },

-

-  down: function(element, expression, index) {

-    element = $(element);

-    if (arguments.length == 1) return element.firstDescendant();

-    return Object.isNumber(expression) ? element.descendants()[expression] :

-      element.select(expression)[index || 0];

-  },

-

-  previous: function(element, expression, index) {

-    element = $(element);

-    if (arguments.length == 1) return $(Selector.handlers.previousElementSibling(element));

-    var previousSiblings = element.previousSiblings();

-    return Object.isNumber(expression) ? previousSiblings[expression] :

-      Selector.findElement(previousSiblings, expression, index);

-  },

-

-  next: function(element, expression, index) {

-    element = $(element);

-    if (arguments.length == 1) return $(Selector.handlers.nextElementSibling(element));

-    var nextSiblings = element.nextSiblings();

-    return Object.isNumber(expression) ? nextSiblings[expression] :

-      Selector.findElement(nextSiblings, expression, index);

-  },

-

-  select: function() {

-    var args = $A(arguments), element = $(args.shift());

-    return Selector.findChildElements(element, args);

-  },

-

-  adjacent: function() {

-    var args = $A(arguments), element = $(args.shift());

-    return Selector.findChildElements(element.parentNode, args).without(element);

-  },

-

-  identify: function(element) {

-    element = $(element);

-    var id = element.readAttribute('id'), self = arguments.callee;

-    if (id) return id;

-    do { id = 'anonymous_element_' + self.counter++ } while ($(id));

-    element.writeAttribute('id', id);

-    return id;

-  },

-

-  readAttribute: function(element, name) {

-    element = $(element);

-    if (Prototype.Browser.IE) {

-      var t = Element._attributeTranslations.read;

-      if (t.values[name]) return t.values[name](element, name);

-      if (t.names[name]) name = t.names[name];

-      if (name.include(':')) {

-        return (!element.attributes || !element.attributes[name]) ? null :

-         element.attributes[name].value;

-      }

-    }

-    return element.getAttribute(name);

-  },

-

-  writeAttribute: function(element, name, value) {

-    element = $(element);

-    var attributes = { }, t = Element._attributeTranslations.write;

-

-    if (typeof name == 'object') attributes = name;

-    else attributes[name] = Object.isUndefined(value) ? true : value;

-

-    for (var attr in attributes) {

-      name = t.names[attr] || attr;

-      value = attributes[attr];

-      if (t.values[attr]) name = t.values[attr](element, value);

-      if (value === false || value === null)

-        element.removeAttribute(name);

-      else if (value === true)

-        element.setAttribute(name, name);

-      else element.setAttribute(name, value);

-    }

-    return element;

-  },

-

-  getHeight: function(element) {

-    return $(element).getDimensions().height;

-  },

-

-  getWidth: function(element) {

-    return $(element).getDimensions().width;

-  },

-

-  classNames: function(element) {

-    return new Element.ClassNames(element);

-  },

-

-  hasClassName: function(element, className) {

-    if (!(element = $(element))) return;

-    var elementClassName = element.className;

-    return (elementClassName.length > 0 && (elementClassName == className ||

-      new RegExp("(^|\\s)" + className + "(\\s|$)").test(elementClassName)));

-  },

-

-  addClassName: function(element, className) {

-    if (!(element = $(element))) return;

-    if (!element.hasClassName(className))

-      element.className += (element.className ? ' ' : '') + className;

-    return element;

-  },

-

-  removeClassName: function(element, className) {

-    if (!(element = $(element))) return;

-    element.className = element.className.replace(

-      new RegExp("(^|\\s+)" + className + "(\\s+|$)"), ' ').strip();

-    return element;

-  },

-

-  toggleClassName: function(element, className) {

-    if (!(element = $(element))) return;

-    return element[element.hasClassName(className) ?

-      'removeClassName' : 'addClassName'](className);

-  },

-

-  // removes whitespace-only text node children

-  cleanWhitespace: function(element) {

-    element = $(element);

-    var node = element.firstChild;

-    while (node) {

-      var nextNode = node.nextSibling;

-      if (node.nodeType == 3 && !/\S/.test(node.nodeValue))

-        element.removeChild(node);

-      node = nextNode;

-    }

-    return element;

-  },

-

-  empty: function(element) {

-    return $(element).innerHTML.blank();

-  },

-

-  descendantOf: function(element, ancestor) {

-    element = $(element), ancestor = $(ancestor);

-    var originalAncestor = ancestor;

-

-    if (element.compareDocumentPosition)

-      return (element.compareDocumentPosition(ancestor) & 8) === 8;

-

-    if (element.sourceIndex && !Prototype.Browser.Opera) {

-      var e = element.sourceIndex, a = ancestor.sourceIndex,

-       nextAncestor = ancestor.nextSibling;

-      if (!nextAncestor) {

-        do { ancestor = ancestor.parentNode; }

-        while (!(nextAncestor = ancestor.nextSibling) && ancestor.parentNode);

-      }

-      if (nextAncestor && nextAncestor.sourceIndex)

-       return (e > a && e < nextAncestor.sourceIndex);

-    }

-

-    while (element = element.parentNode)

-      if (element == originalAncestor) return true;

-    return false;

-  },

-

-  scrollTo: function(element) {

-    element = $(element);

-    var pos = element.cumulativeOffset();

-    window.scrollTo(pos[0], pos[1]);

-    return element;

-  },

-

-  getStyle: function(element, style) {

-    element = $(element);

-    style = style == 'float' ? 'cssFloat' : style.camelize();

-    var value = element.style[style];

-    if (!value) {

-      var css = document.defaultView.getComputedStyle(element, null);

-      value = css ? css[style] : null;

-    }

-    if (style == 'opacity') return value ? parseFloat(value) : 1.0;

-    return value == 'auto' ? null : value;

-  },

-

-  getOpacity: function(element) {

-    return $(element).getStyle('opacity');

-  },

-

-  setStyle: function(element, styles) {

-    element = $(element);

-    var elementStyle = element.style, match;

-    if (Object.isString(styles)) {

-      element.style.cssText += ';' + styles;

-      return styles.include('opacity') ?

-        element.setOpacity(styles.match(/opacity:\s*(\d?\.?\d*)/)[1]) : element;

-    }

-    for (var property in styles)

-      if (property == 'opacity') element.setOpacity(styles[property]);

-      else

-        elementStyle[(property == 'float' || property == 'cssFloat') ?

-          (Object.isUndefined(elementStyle.styleFloat) ? 'cssFloat' : 'styleFloat') :

-            property] = styles[property];

-

-    return element;

-  },

-

-  setOpacity: function(element, value) {

-    element = $(element);

-    element.style.opacity = (value == 1 || value === '') ? '' :

-      (value < 0.00001) ? 0 : value;

-    return element;

-  },

-

-  getDimensions: function(element) {

-    element = $(element);

-    var display = $(element).getStyle('display');

-    if (display != 'none' && display != null) // Safari bug

-      return {width: element.offsetWidth, height: element.offsetHeight};

-

-    // All *Width and *Height properties give 0 on elements with display none,

-    // so enable the element temporarily

-    var els = element.style;

-    var originalVisibility = els.visibility;

-    var originalPosition = els.position;

-    var originalDisplay = els.display;

-    els.visibility = 'hidden';

-    els.position = 'absolute';

-    els.display = 'block';

-    var originalWidth = element.clientWidth;

-    var originalHeight = element.clientHeight;

-    els.display = originalDisplay;

-    els.position = originalPosition;

-    els.visibility = originalVisibility;

-    return {width: originalWidth, height: originalHeight};

-  },

-

-  makePositioned: function(element) {

-    element = $(element);

-    var pos = Element.getStyle(element, 'position');

-    if (pos == 'static' || !pos) {

-      element._madePositioned = true;

-      element.style.position = 'relative';

-      // Opera returns the offset relative to the positioning context, when an

-      // element is position relative but top and left have not been defined

-      if (window.opera) {

-        element.style.top = 0;

-        element.style.left = 0;

-      }

-    }

-    return element;

-  },

-

-  undoPositioned: function(element) {

-    element = $(element);

-    if (element._madePositioned) {

-      element._madePositioned = undefined;

-      element.style.position =

-        element.style.top =

-        element.style.left =

-        element.style.bottom =

-        element.style.right = '';

-    }

-    return element;

-  },

-

-  makeClipping: function(element) {

-    element = $(element);

-    if (element._overflow) return element;

-    element._overflow = Element.getStyle(element, 'overflow') || 'auto';

-    if (element._overflow !== 'hidden')

-      element.style.overflow = 'hidden';

-    return element;

-  },

-

-  undoClipping: function(element) {

-    element = $(element);

-    if (!element._overflow) return element;

-    element.style.overflow = element._overflow == 'auto' ? '' : element._overflow;

-    element._overflow = null;

-    return element;

-  },

-

-  cumulativeOffset: function(element) {

-    var valueT = 0, valueL = 0;

-    do {

-      valueT += element.offsetTop  || 0;

-      valueL += element.offsetLeft || 0;

-      element = element.offsetParent;

-    } while (element);

-    return Element._returnOffset(valueL, valueT);

-  },

-

-  positionedOffset: function(element) {

-    var valueT = 0, valueL = 0;

-    do {

-      valueT += element.offsetTop  || 0;

-      valueL += element.offsetLeft || 0;

-      element = element.offsetParent;

-      if (element) {

-        if (element.tagName == 'BODY') break;

-        var p = Element.getStyle(element, 'position');

-        if (p !== 'static') break;

-      }

-    } while (element);

-    return Element._returnOffset(valueL, valueT);

-  },

-

-  absolutize: function(element) {

-    element = $(element);

-    if (element.getStyle('position') == 'absolute') return;

-    // Position.prepare(); // To be done manually by Scripty when it needs it.

-

-    var offsets = element.positionedOffset();

-    var top     = offsets[1];

-    var left    = offsets[0];

-    var width   = element.clientWidth;

-    var height  = element.clientHeight;

-

-    element._originalLeft   = left - parseFloat(element.style.left  || 0);

-    element._originalTop    = top  - parseFloat(element.style.top || 0);

-    element._originalWidth  = element.style.width;

-    element._originalHeight = element.style.height;

-

-    element.style.position = 'absolute';

-    element.style.top    = top + 'px';

-    element.style.left   = left + 'px';

-    element.style.width  = width + 'px';

-    element.style.height = height + 'px';

-    return element;

-  },

-

-  relativize: function(element) {

-    element = $(element);

-    if (element.getStyle('position') == 'relative') return;

-    // Position.prepare(); // To be done manually by Scripty when it needs it.

-

-    element.style.position = 'relative';

-    var top  = parseFloat(element.style.top  || 0) - (element._originalTop || 0);

-    var left = parseFloat(element.style.left || 0) - (element._originalLeft || 0);

-

-    element.style.top    = top + 'px';

-    element.style.left   = left + 'px';

-    element.style.height = element._originalHeight;

-    element.style.width  = element._originalWidth;

-    return element;

-  },

-

-  cumulativeScrollOffset: function(element) {

-    var valueT = 0, valueL = 0;

-    do {

-      valueT += element.scrollTop  || 0;

-      valueL += element.scrollLeft || 0;

-      element = element.parentNode;

-    } while (element);

-    return Element._returnOffset(valueL, valueT);

-  },

-

-  getOffsetParent: function(element) {

-    if (element.offsetParent) return $(element.offsetParent);

-    if (element == document.body) return $(element);

-

-    while ((element = element.parentNode) && element != document.body)

-      if (Element.getStyle(element, 'position') != 'static')

-        return $(element);

-

-    return $(document.body);

-  },

-

-  viewportOffset: function(forElement) {

-    var valueT = 0, valueL = 0;

-

-    var element = forElement;

-    do {

-      valueT += element.offsetTop  || 0;

-      valueL += element.offsetLeft || 0;

-

-      // Safari fix

-      if (element.offsetParent == document.body &&

-        Element.getStyle(element, 'position') == 'absolute') break;

-

-    } while (element = element.offsetParent);

-

-    element = forElement;

-    do {

-      if (!Prototype.Browser.Opera || element.tagName == 'BODY') {

-        valueT -= element.scrollTop  || 0;

-        valueL -= element.scrollLeft || 0;

-      }

-    } while (element = element.parentNode);

-

-    return Element._returnOffset(valueL, valueT);

-  },

-

-  clonePosition: function(element, source) {

-    var options = Object.extend({

-      setLeft:    true,

-      setTop:     true,

-      setWidth:   true,

-      setHeight:  true,

-      offsetTop:  0,

-      offsetLeft: 0

-    }, arguments[2] || { });

-

-    // find page position of source

-    source = $(source);

-    var p = source.viewportOffset();

-

-    // find coordinate system to use

-    element = $(element);

-    var delta = [0, 0];

-    var parent = null;

-    // delta [0,0] will do fine with position: fixed elements,

-    // position:absolute needs offsetParent deltas

-    if (Element.getStyle(element, 'position') == 'absolute') {

-      parent = element.getOffsetParent();

-      delta = parent.viewportOffset();

-    }

-

-    // correct by body offsets (fixes Safari)

-    if (parent == document.body) {

-      delta[0] -= document.body.offsetLeft;

-      delta[1] -= document.body.offsetTop;

-    }

-

-    // set position

-    if (options.setLeft)   element.style.left  = (p[0] - delta[0] + options.offsetLeft) + 'px';

-    if (options.setTop)    element.style.top   = (p[1] - delta[1] + options.offsetTop) + 'px';

-    if (options.setWidth)  element.style.width = source.offsetWidth + 'px';

-    if (options.setHeight) element.style.height = source.offsetHeight + 'px';

-    return element;

-  }

-};

-

-Element.Methods.identify.counter = 1;

-

-Object.extend(Element.Methods, {

-  getElementsBySelector: Element.Methods.select,

-  childElements: Element.Methods.immediateDescendants

-});

-

-Element._attributeTranslations = {

-  write: {

-    names: {

-      className: 'class',

-      htmlFor:   'for'

-    },

-    values: { }

-  }

-};

-

-if (Prototype.Browser.Opera) {

-  Element.Methods.getStyle = Element.Methods.getStyle.wrap(

-    function(proceed, element, style) {

-      switch (style) {

-        case 'left': case 'top': case 'right': case 'bottom':

-          if (proceed(element, 'position') === 'static') return null;

-        case 'height': case 'width':

-          // returns '0px' for hidden elements; we want it to return null

-          if (!Element.visible(element)) return null;

-

-          // returns the border-box dimensions rather than the content-box

-          // dimensions, so we subtract padding and borders from the value

-          var dim = parseInt(proceed(element, style), 10);

-

-          if (dim !== element['offset' + style.capitalize()])

-            return dim + 'px';

-

-          var properties;

-          if (style === 'height') {

-            properties = ['border-top-width', 'padding-top',

-             'padding-bottom', 'border-bottom-width'];

-          }

-          else {

-            properties = ['border-left-width', 'padding-left',

-             'padding-right', 'border-right-width'];

-          }

-          return properties.inject(dim, function(memo, property) {

-            var val = proceed(element, property);

-            return val === null ? memo : memo - parseInt(val, 10);

-          }) + 'px';

-        default: return proceed(element, style);

-      }

-    }

-  );

-

-  Element.Methods.readAttribute = Element.Methods.readAttribute.wrap(

-    function(proceed, element, attribute) {

-      if (attribute === 'title') return element.title;

-      return proceed(element, attribute);

-    }

-  );

-}

-

-else if (Prototype.Browser.IE) {

-  // IE doesn't report offsets correctly for static elements, so we change them

-  // to "relative" to get the values, then change them back.

-  Element.Methods.getOffsetParent = Element.Methods.getOffsetParent.wrap(

-    function(proceed, element) {

-      element = $(element);

-      var position = element.getStyle('position');

-      if (position !== 'static') return proceed(element);

-      element.setStyle({ position: 'relative' });

-      var value = proceed(element);

-      element.setStyle({ position: position });

-      return value;

-    }

-  );

-

-  $w('positionedOffset viewportOffset').each(function(method) {

-    Element.Methods[method] = Element.Methods[method].wrap(

-      function(proceed, element) {

-        element = $(element);

-        var position = element.getStyle('position');

-        if (position !== 'static') return proceed(element);

-        // Trigger hasLayout on the offset parent so that IE6 reports

-        // accurate offsetTop and offsetLeft values for position: fixed.

-        var offsetParent = element.getOffsetParent();

-        if (offsetParent && offsetParent.getStyle('position') === 'fixed')

-          offsetParent.setStyle({ zoom: 1 });

-        element.setStyle({ position: 'relative' });

-        var value = proceed(element);

-        element.setStyle({ position: position });

-        return value;

-      }

-    );

-  });

-

-  Element.Methods.getStyle = function(element, style) {

-    element = $(element);

-    style = (style == 'float' || style == 'cssFloat') ? 'styleFloat' : style.camelize();

-    var value = element.style[style];

-    if (!value && element.currentStyle) value = element.currentStyle[style];

-

-    if (style == 'opacity') {

-      if (value = (element.getStyle('filter') || '').match(/alpha\(opacity=(.*)\)/))

-        if (value[1]) return parseFloat(value[1]) / 100;

-      return 1.0;

-    }

-

-    if (value == 'auto') {

-      if ((style == 'width' || style == 'height') && (element.getStyle('display') != 'none'))

-        return element['offset' + style.capitalize()] + 'px';

-      return null;

-    }

-    return value;

-  };

-

-  Element.Methods.setOpacity = function(element, value) {

-    function stripAlpha(filter){

-      return filter.replace(/alpha\([^\)]*\)/gi,'');

-    }

-    element = $(element);

-    var currentStyle = element.currentStyle;

-    if ((currentStyle && !currentStyle.hasLayout) ||

-      (!currentStyle && element.style.zoom == 'normal'))

-        element.style.zoom = 1;

-

-    var filter = element.getStyle('filter'), style = element.style;

-    if (value == 1 || value === '') {

-      (filter = stripAlpha(filter)) ?

-        style.filter = filter : style.removeAttribute('filter');

-      return element;

-    } else if (value < 0.00001) value = 0;

-    style.filter = stripAlpha(filter) +

-      'alpha(opacity=' + (value * 100) + ')';

-    return element;

-  };

-

-  Element._attributeTranslations = {

-    read: {

-      names: {

-        'class': 'className',

-        'for':   'htmlFor'

-      },

-      values: {

-        _getAttr: function(element, attribute) {

-          return element.getAttribute(attribute, 2);

-        },

-        _getAttrNode: function(element, attribute) {

-          var node = element.getAttributeNode(attribute);

-          return node ? node.value : "";

-        },

-        _getEv: function(element, attribute) {

-          attribute = element.getAttribute(attribute);

-          return attribute ? attribute.toString().slice(23, -2) : null;

-        },

-        _flag: function(element, attribute) {

-          return $(element).hasAttribute(attribute) ? attribute : null;

-        },

-        style: function(element) {

-          return element.style.cssText.toLowerCase();

-        },

-        title: function(element) {

-          return element.title;

-        }

-      }

-    }

-  };

-

-  Element._attributeTranslations.write = {

-    names: Object.extend({

-      cellpadding: 'cellPadding',

-      cellspacing: 'cellSpacing'

-    }, Element._attributeTranslations.read.names),

-    values: {

-      checked: function(element, value) {

-        element.checked = !!value;

-      },

-

-      style: function(element, value) {

-        element.style.cssText = value ? value : '';

-      }

-    }

-  };

-

-  Element._attributeTranslations.has = {};

-

-  $w('colSpan rowSpan vAlign dateTime accessKey tabIndex ' +

-      'encType maxLength readOnly longDesc').each(function(attr) {

-    Element._attributeTranslations.write.names[attr.toLowerCase()] = attr;

-    Element._attributeTranslations.has[attr.toLowerCase()] = attr;

-  });

-

-  (function(v) {

-    Object.extend(v, {

-      href:        v._getAttr,

-      src:         v._getAttr,

-      type:        v._getAttr,

-      action:      v._getAttrNode,

-      disabled:    v._flag,

-      checked:     v._flag,

-      readonly:    v._flag,

-      multiple:    v._flag,

-      onload:      v._getEv,

-      onunload:    v._getEv,

-      onclick:     v._getEv,

-      ondblclick:  v._getEv,

-      onmousedown: v._getEv,

-      onmouseup:   v._getEv,

-      onmouseover: v._getEv,

-      onmousemove: v._getEv,

-      onmouseout:  v._getEv,

-      onfocus:     v._getEv,

-      onblur:      v._getEv,

-      onkeypress:  v._getEv,

-      onkeydown:   v._getEv,

-      onkeyup:     v._getEv,

-      onsubmit:    v._getEv,

-      onreset:     v._getEv,

-      onselect:    v._getEv,

-      onchange:    v._getEv

-    });

-  })(Element._attributeTranslations.read.values);

-}

-

-else if (Prototype.Browser.Gecko && /rv:1\.8\.0/.test(navigator.userAgent)) {

-  Element.Methods.setOpacity = function(element, value) {

-    element = $(element);

-    element.style.opacity = (value == 1) ? 0.999999 :

-      (value === '') ? '' : (value < 0.00001) ? 0 : value;

-    return element;

-  };

-}

-

-else if (Prototype.Browser.WebKit) {

-  Element.Methods.setOpacity = function(element, value) {

-    element = $(element);

-    element.style.opacity = (value == 1 || value === '') ? '' :

-      (value < 0.00001) ? 0 : value;

-

-    if (value == 1)

-      if(element.tagName == 'IMG' && element.width) {

-        element.width++; element.width--;

-      } else try {

-        var n = document.createTextNode(' ');

-        element.appendChild(n);

-        element.removeChild(n);

-      } catch (e) { }

-

-    return element;

-  };

-

-  // Safari returns margins on body which is incorrect if the child is absolutely

-  // positioned.  For performance reasons, redefine Element#cumulativeOffset for

-  // KHTML/WebKit only.

-  Element.Methods.cumulativeOffset = function(element) {

-    var valueT = 0, valueL = 0;

-    do {

-      valueT += element.offsetTop  || 0;

-      valueL += element.offsetLeft || 0;

-      if (element.offsetParent == document.body)

-        if (Element.getStyle(element, 'position') == 'absolute') break;

-

-      element = element.offsetParent;

-    } while (element);

-

-    return Element._returnOffset(valueL, valueT);

-  };

-}

-

-if (Prototype.Browser.IE || Prototype.Browser.Opera) {

-  // IE and Opera are missing .innerHTML support for TABLE-related and SELECT elements

-  Element.Methods.update = function(element, content) {

-    element = $(element);

-

-    if (content && content.toElement) content = content.toElement();

-    if (Object.isElement(content)) return element.update().insert(content);

-

-    content = Object.toHTML(content);

-    var tagName = element.tagName.toUpperCase();

-

-    if (tagName in Element._insertionTranslations.tags) {

-      $A(element.childNodes).each(function(node) { element.removeChild(node) });

-      Element._getContentFromAnonymousElement(tagName, content.stripScripts())

-        .each(function(node) { element.appendChild(node) });

-    }

-    else element.innerHTML = content.stripScripts();

-

-    content.evalScripts.bind(content).defer();

-    return element;

-  };

-}

-

-if ('outerHTML' in document.createElement('div')) {

-  Element.Methods.replace = function(element, content) {

-    element = $(element);

-

-    if (content && content.toElement) content = content.toElement();

-    if (Object.isElement(content)) {

-      element.parentNode.replaceChild(content, element);

-      return element;

-    }

-

-    content = Object.toHTML(content);

-    var parent = element.parentNode, tagName = parent.tagName.toUpperCase();

-

-    if (Element._insertionTranslations.tags[tagName]) {

-      var nextSibling = element.next();

-      var fragments = Element._getContentFromAnonymousElement(tagName, content.stripScripts());

-      parent.removeChild(element);

-      if (nextSibling)

-        fragments.each(function(node) { parent.insertBefore(node, nextSibling) });

-      else

-        fragments.each(function(node) { parent.appendChild(node) });

-    }

-    else element.outerHTML = content.stripScripts();

-

-    content.evalScripts.bind(content).defer();

-    return element;

-  };

-}

-

-Element._returnOffset = function(l, t) {

-  var result = [l, t];

-  result.left = l;

-  result.top = t;

-  return result;

-};

-

-Element._getContentFromAnonymousElement = function(tagName, html) {

-  var div = new Element('div'), t = Element._insertionTranslations.tags[tagName];

-  if (t) {

-    div.innerHTML = t[0] + html + t[1];

-    t[2].times(function() { div = div.firstChild });

-  } else div.innerHTML = html;

-  return $A(div.childNodes);

-};

-

-Element._insertionTranslations = {

-  before: function(element, node) {

-    element.parentNode.insertBefore(node, element);

-  },

-  top: function(element, node) {

-    element.insertBefore(node, element.firstChild);

-  },

-  bottom: function(element, node) {

-    element.appendChild(node);

-  },

-  after: function(element, node) {

-    element.parentNode.insertBefore(node, element.nextSibling);

-  },

-  tags: {

-    TABLE:  ['<table>',                '</table>',                   1],

-    TBODY:  ['<table><tbody>',         '</tbody></table>',           2],

-    TR:     ['<table><tbody><tr>',     '</tr></tbody></table>',      3],

-    TD:     ['<table><tbody><tr><td>', '</td></tr></tbody></table>', 4],

-    SELECT: ['<select>',               '</select>',                  1]

-  }

-};

-

-(function() {

-  Object.extend(this.tags, {

-    THEAD: this.tags.TBODY,

-    TFOOT: this.tags.TBODY,

-    TH:    this.tags.TD

-  });

-}).call(Element._insertionTranslations);

-

-Element.Methods.Simulated = {

-  hasAttribute: function(element, attribute) {

-    attribute = Element._attributeTranslations.has[attribute] || attribute;

-    var node = $(element).getAttributeNode(attribute);

-    return node && node.specified;

-  }

-};

-

-Element.Methods.ByTag = { };

-

-Object.extend(Element, Element.Methods);

-

-if (!Prototype.BrowserFeatures.ElementExtensions &&

-    document.createElement('div').__proto__) {

-  window.HTMLElement = { };

-  window.HTMLElement.prototype = document.createElement('div').__proto__;

-  Prototype.BrowserFeatures.ElementExtensions = true;

-}

-

-Element.extend = (function() {

-  if (Prototype.BrowserFeatures.SpecificElementExtensions)

-    return Prototype.K;

-

-  var Methods = { }, ByTag = Element.Methods.ByTag;

-

-  var extend = Object.extend(function(element) {

-    if (!element || element._extendedByPrototype ||

-        element.nodeType != 1 || element == window) return element;

-

-    var methods = Object.clone(Methods),

-      tagName = element.tagName, property, value;

-

-    // extend methods for specific tags

-    if (ByTag[tagName]) Object.extend(methods, ByTag[tagName]);

-

-    for (property in methods) {

-      value = methods[property];

-      if (Object.isFunction(value) && !(property in element))

-        element[property] = value.methodize();

-    }

-

-    element._extendedByPrototype = Prototype.emptyFunction;

-    return element;

-

-  }, {

-    refresh: function() {

-      // extend methods for all tags (Safari doesn't need this)

-      if (!Prototype.BrowserFeatures.ElementExtensions) {

-        Object.extend(Methods, Element.Methods);

-        Object.extend(Methods, Element.Methods.Simulated);

-      }

-    }

-  });

-

-  extend.refresh();

-  return extend;

-})();

-

-Element.hasAttribute = function(element, attribute) {

-  if (element.hasAttribute) return element.hasAttribute(attribute);

-  return Element.Methods.Simulated.hasAttribute(element, attribute);

-};

-

-Element.addMethods = function(methods) {

-  var F = Prototype.BrowserFeatures, T = Element.Methods.ByTag;

-

-  if (!methods) {

-    Object.extend(Form, Form.Methods);

-    Object.extend(Form.Element, Form.Element.Methods);

-    Object.extend(Element.Methods.ByTag, {

-      "FORM":     Object.clone(Form.Methods),

-      "INPUT":    Object.clone(Form.Element.Methods),

-      "SELECT":   Object.clone(Form.Element.Methods),

-      "TEXTAREA": Object.clone(Form.Element.Methods)

-    });

-  }

-

-  if (arguments.length == 2) {

-    var tagName = methods;

-    methods = arguments[1];

-  }

-

-  if (!tagName) Object.extend(Element.Methods, methods || { });

-  else {

-    if (Object.isArray(tagName)) tagName.each(extend);

-    else extend(tagName);

-  }

-

-  function extend(tagName) {

-    tagName = tagName.toUpperCase();

-    if (!Element.Methods.ByTag[tagName])

-      Element.Methods.ByTag[tagName] = { };

-    Object.extend(Element.Methods.ByTag[tagName], methods);

-  }

-

-  function copy(methods, destination, onlyIfAbsent) {

-    onlyIfAbsent = onlyIfAbsent || false;

-    for (var property in methods) {

-      var value = methods[property];

-      if (!Object.isFunction(value)) continue;

-      if (!onlyIfAbsent || !(property in destination))

-        destination[property] = value.methodize();

-    }

-  }

-

-  function findDOMClass(tagName) {

-    var klass;

-    var trans = {

-      "OPTGROUP": "OptGroup", "TEXTAREA": "TextArea", "P": "Paragraph",

-      "FIELDSET": "FieldSet", "UL": "UList", "OL": "OList", "DL": "DList",

-      "DIR": "Directory", "H1": "Heading", "H2": "Heading", "H3": "Heading",

-      "H4": "Heading", "H5": "Heading", "H6": "Heading", "Q": "Quote",

-      "INS": "Mod", "DEL": "Mod", "A": "Anchor", "IMG": "Image", "CAPTION":

-      "TableCaption", "COL": "TableCol", "COLGROUP": "TableCol", "THEAD":

-      "TableSection", "TFOOT": "TableSection", "TBODY": "TableSection", "TR":

-      "TableRow", "TH": "TableCell", "TD": "TableCell", "FRAMESET":

-      "FrameSet", "IFRAME": "IFrame"

-    };

-    if (trans[tagName]) klass = 'HTML' + trans[tagName] + 'Element';

-    if (window[klass]) return window[klass];

-    klass = 'HTML' + tagName + 'Element';

-    if (window[klass]) return window[klass];

-    klass = 'HTML' + tagName.capitalize() + 'Element';

-    if (window[klass]) return window[klass];

-

-    window[klass] = { };

-    window[klass].prototype = document.createElement(tagName).__proto__;

-    return window[klass];

-  }

-

-  if (F.ElementExtensions) {

-    copy(Element.Methods, HTMLElement.prototype);

-    copy(Element.Methods.Simulated, HTMLElement.prototype, true);

-  }

-

-  if (F.SpecificElementExtensions) {

-    for (var tag in Element.Methods.ByTag) {

-      var klass = findDOMClass(tag);

-      if (Object.isUndefined(klass)) continue;

-      copy(T[tag], klass.prototype);

-    }

-  }

-

-  Object.extend(Element, Element.Methods);

-  delete Element.ByTag;

-

-  if (Element.extend.refresh) Element.extend.refresh();

-  Element.cache = { };

-};

-

-document.viewport = {

-  getDimensions: function() {

-    var dimensions = { };

-    var B = Prototype.Browser;

-    $w('width height').each(function(d) {

-      var D = d.capitalize();

-      dimensions[d] = (B.WebKit && !document.evaluate) ? self['inner' + D] :

-        (B.Opera) ? document.body['client' + D] : document.documentElement['client' + D];

-    });

-    return dimensions;

-  },

-

-  getWidth: function() {

-    return this.getDimensions().width;

-  },

-

-  getHeight: function() {

-    return this.getDimensions().height;

-  },

-

-  getScrollOffsets: function() {

-    return Element._returnOffset(

-      window.pageXOffset || document.documentElement.scrollLeft || document.body.scrollLeft,

-      window.pageYOffset || document.documentElement.scrollTop || document.body.scrollTop);

-  }

-};

-/* Portions of the Selector class are derived from Jack Slocum’s DomQuery,

- * part of YUI-Ext version 0.40, distributed under the terms of an MIT-style

- * license.  Please see http://www.yui-ext.com/ for more information. */

-

-var Selector = Class.create({

-  initialize: function(expression) {

-    this.expression = expression.strip();

-    this.compileMatcher();

-  },

-

-  shouldUseXPath: function() {

-    if (!Prototype.BrowserFeatures.XPath) return false;

-

-    var e = this.expression;

-

-    // Safari 3 chokes on :*-of-type and :empty

-    if (Prototype.Browser.WebKit &&

-     (e.include("-of-type") || e.include(":empty")))

-      return false;

-

-    // XPath can't do namespaced attributes, nor can it read

-    // the "checked" property from DOM nodes

-    if ((/(\[[\w-]*?:|:checked)/).test(this.expression))

-      return false;

-

-    return true;

-  },

-

-  compileMatcher: function() {

-    if (this.shouldUseXPath())

-      return this.compileXPathMatcher();

-

-    var e = this.expression, ps = Selector.patterns, h = Selector.handlers,

-        c = Selector.criteria, le, p, m;

-

-    if (Selector._cache[e]) {

-      this.matcher = Selector._cache[e];

-      return;

-    }

-

-    this.matcher = ["this.matcher = function(root) {",

-                    "var r = root, h = Selector.handlers, c = false, n;"];

-

-    while (e && le != e && (/\S/).test(e)) {

-      le = e;

-      for (var i in ps) {

-        p = ps[i];

-        if (m = e.match(p)) {

-          this.matcher.push(Object.isFunction(c[i]) ? c[i](m) :

-    	      new Template(c[i]).evaluate(m));

-          e = e.replace(m[0], '');

-          break;

-        }

-      }

-    }

-

-    this.matcher.push("return h.unique(n);\n}");

-    eval(this.matcher.join('\n'));

-    Selector._cache[this.expression] = this.matcher;

-  },

-

-  compileXPathMatcher: function() {

-    var e = this.expression, ps = Selector.patterns,

-        x = Selector.xpath, le, m;

-

-    if (Selector._cache[e]) {

-      this.xpath = Selector._cache[e]; return;

-    }

-

-    this.matcher = ['.//*'];

-    while (e && le != e && (/\S/).test(e)) {

-      le = e;

-      for (var i in ps) {

-        if (m = e.match(ps[i])) {

-          this.matcher.push(Object.isFunction(x[i]) ? x[i](m) :

-            new Template(x[i]).evaluate(m));

-          e = e.replace(m[0], '');

-          break;

-        }

-      }

-    }

-

-    this.xpath = this.matcher.join('');

-    Selector._cache[this.expression] = this.xpath;

-  },

-

-  findElements: function(root) {

-    root = root || document;

-    if (this.xpath) return document._getElementsByXPath(this.xpath, root);

-    return this.matcher(root);

-  },

-

-  match: function(element) {

-    this.tokens = [];

-

-    var e = this.expression, ps = Selector.patterns, as = Selector.assertions;

-    var le, p, m;

-

-    while (e && le !== e && (/\S/).test(e)) {

-      le = e;

-      for (var i in ps) {

-        p = ps[i];

-        if (m = e.match(p)) {

-          // use the Selector.assertions methods unless the selector

-          // is too complex.

-          if (as[i]) {

-            this.tokens.push([i, Object.clone(m)]);

-            e = e.replace(m[0], '');

-          } else {

-            // reluctantly do a document-wide search

-            // and look for a match in the array

-            return this.findElements(document).include(element);

-          }

-        }

-      }

-    }

-

-    var match = true, name, matches;

-    for (var i = 0, token; token = this.tokens[i]; i++) {

-      name = token[0], matches = token[1];

-      if (!Selector.assertions[name](element, matches)) {

-        match = false; break;

-      }

-    }

-

-    return match;

-  },

-

-  toString: function() {

-    return this.expression;

-  },

-

-  inspect: function() {

-    return "#<Selector:" + this.expression.inspect() + ">";

-  }

-});

-

-Object.extend(Selector, {

-  _cache: { },

-

-  xpath: {

-    descendant:   "//*",

-    child:        "/*",

-    adjacent:     "/following-sibling::*[1]",

-    laterSibling: '/following-sibling::*',

-    tagName:      function(m) {

-      if (m[1] == '*') return '';

-      return "[local-name()='" + m[1].toLowerCase() +

-             "' or local-name()='" + m[1].toUpperCase() + "']";

-    },

-    className:    "[contains(concat(' ', @class, ' '), ' #{1} ')]",

-    id:           "[@id='#{1}']",

-    attrPresence: function(m) {

-      m[1] = m[1].toLowerCase();

-      return new Template("[@#{1}]").evaluate(m);

-    },

-    attr: function(m) {

-      m[1] = m[1].toLowerCase();

-      m[3] = m[5] || m[6];

-      return new Template(Selector.xpath.operators[m[2]]).evaluate(m);

-    },

-    pseudo: function(m) {

-      var h = Selector.xpath.pseudos[m[1]];

-      if (!h) return '';

-      if (Object.isFunction(h)) return h(m);

-      return new Template(Selector.xpath.pseudos[m[1]]).evaluate(m);

-    },

-    operators: {

-      '=':  "[@#{1}='#{3}']",

-      '!=': "[@#{1}!='#{3}']",

-      '^=': "[starts-with(@#{1}, '#{3}')]",

-      '$=': "[substring(@#{1}, (string-length(@#{1}) - string-length('#{3}') + 1))='#{3}']",

-      '*=': "[contains(@#{1}, '#{3}')]",

-      '~=': "[contains(concat(' ', @#{1}, ' '), ' #{3} ')]",

-      '|=': "[contains(concat('-', @#{1}, '-'), '-#{3}-')]"

-    },

-    pseudos: {

-      'first-child': '[not(preceding-sibling::*)]',

-      'last-child':  '[not(following-sibling::*)]',

-      'only-child':  '[not(preceding-sibling::* or following-sibling::*)]',

-      'empty':       "[count(*) = 0 and (count(text()) = 0 or translate(text(), ' \t\r\n', '') = '')]",

-      'checked':     "[@checked]",

-      'disabled':    "[@disabled]",

-      'enabled':     "[not(@disabled)]",

-      'not': function(m) {

-        var e = m[6], p = Selector.patterns,

-            x = Selector.xpath, le, v;

-

-        var exclusion = [];

-        while (e && le != e && (/\S/).test(e)) {

-          le = e;

-          for (var i in p) {

-            if (m = e.match(p[i])) {

-              v = Object.isFunction(x[i]) ? x[i](m) : new Template(x[i]).evaluate(m);

-              exclusion.push("(" + v.substring(1, v.length - 1) + ")");

-              e = e.replace(m[0], '');

-              break;

-            }

-          }

-        }

-        return "[not(" + exclusion.join(" and ") + ")]";

-      },

-      'nth-child':      function(m) {

-        return Selector.xpath.pseudos.nth("(count(./preceding-sibling::*) + 1) ", m);

-      },

-      'nth-last-child': function(m) {

-        return Selector.xpath.pseudos.nth("(count(./following-sibling::*) + 1) ", m);

-      },

-      'nth-of-type':    function(m) {

-        return Selector.xpath.pseudos.nth("position() ", m);

-      },

-      'nth-last-of-type': function(m) {

-        return Selector.xpath.pseudos.nth("(last() + 1 - position()) ", m);

-      },

-      'first-of-type':  function(m) {

-        m[6] = "1"; return Selector.xpath.pseudos['nth-of-type'](m);

-      },

-      'last-of-type':   function(m) {

-        m[6] = "1"; return Selector.xpath.pseudos['nth-last-of-type'](m);

-      },

-      'only-of-type':   function(m) {

-        var p = Selector.xpath.pseudos; return p['first-of-type'](m) + p['last-of-type'](m);

-      },

-      nth: function(fragment, m) {

-        var mm, formula = m[6], predicate;

-        if (formula == 'even') formula = '2n+0';

-        if (formula == 'odd')  formula = '2n+1';

-        if (mm = formula.match(/^(\d+)$/)) // digit only

-          return '[' + fragment + "= " + mm[1] + ']';

-        if (mm = formula.match(/^(-?\d*)?n(([+-])(\d+))?/)) { // an+b

-          if (mm[1] == "-") mm[1] = -1;

-          var a = mm[1] ? Number(mm[1]) : 1;

-          var b = mm[2] ? Number(mm[2]) : 0;

-          predicate = "[((#{fragment} - #{b}) mod #{a} = 0) and " +

-          "((#{fragment} - #{b}) div #{a} >= 0)]";

-          return new Template(predicate).evaluate({

-            fragment: fragment, a: a, b: b });

-        }

-      }

-    }

-  },

-

-  criteria: {

-    tagName:      'n = h.tagName(n, r, "#{1}", c);      c = false;',

-    className:    'n = h.className(n, r, "#{1}", c);    c = false;',

-    id:           'n = h.id(n, r, "#{1}", c);           c = false;',

-    attrPresence: 'n = h.attrPresence(n, r, "#{1}", c); c = false;',

-    attr: function(m) {

-      m[3] = (m[5] || m[6]);

-      return new Template('n = h.attr(n, r, "#{1}", "#{3}", "#{2}", c); c = false;').evaluate(m);

-    },

-    pseudo: function(m) {

-      if (m[6]) m[6] = m[6].replace(/"/g, '\\"');

-      return new Template('n = h.pseudo(n, "#{1}", "#{6}", r, c); c = false;').evaluate(m);

-    },

-    descendant:   'c = "descendant";',

-    child:        'c = "child";',

-    adjacent:     'c = "adjacent";',

-    laterSibling: 'c = "laterSibling";'

-  },

-

-  patterns: {

-    // combinators must be listed first

-    // (and descendant needs to be last combinator)

-    laterSibling: /^\s*~\s*/,

-    child:        /^\s*>\s*/,

-    adjacent:     /^\s*\+\s*/,

-    descendant:   /^\s/,

-

-    // selectors follow

-    tagName:      /^\s*(\*|[\w\-]+)(\b|$)?/,

-    id:           /^#([\w\-\*]+)(\b|$)/,

-    className:    /^\.([\w\-\*]+)(\b|$)/,

-    pseudo:

-/^:((first|last|nth|nth-last|only)(-child|-of-type)|empty|checked|(en|dis)abled|not)(\((.*?)\))?(\b|$|(?=\s|[:+~>]))/,

-    attrPresence: /^\[([\w]+)\]/,

-    attr:         /\[((?:[\w-]*:)?[\w-]+)\s*(?:([!^$*~|]?=)\s*((['"])([^\4]*?)\4|([^'"][^\]]*?)))?\]/

-  },

-

-  // for Selector.match and Element#match

-  assertions: {

-    tagName: function(element, matches) {

-      return matches[1].toUpperCase() == element.tagName.toUpperCase();

-    },

-

-    className: function(element, matches) {

-      return Element.hasClassName(element, matches[1]);

-    },

-

-    id: function(element, matches) {

-      return element.id === matches[1];

-    },

-

-    attrPresence: function(element, matches) {

-      return Element.hasAttribute(element, matches[1]);

-    },

-

-    attr: function(element, matches) {

-      var nodeValue = Element.readAttribute(element, matches[1]);

-      return nodeValue && Selector.operators[matches[2]](nodeValue, matches[5] || matches[6]);

-    }

-  },

-

-  handlers: {

-    // UTILITY FUNCTIONS

-    // joins two collections

-    concat: function(a, b) {

-      for (var i = 0, node; node = b[i]; i++)

-        a.push(node);

-      return a;

-    },

-

-    // marks an array of nodes for counting

-    mark: function(nodes) {

-      var _true = Prototype.emptyFunction;

-      for (var i = 0, node; node = nodes[i]; i++)

-        node._countedByPrototype = _true;

-      return nodes;

-    },

-

-    unmark: function(nodes) {

-      for (var i = 0, node; node = nodes[i]; i++)

-        node._countedByPrototype = undefined;

-      return nodes;

-    },

-

-    // mark each child node with its position (for nth calls)

-    // "ofType" flag indicates whether we're indexing for nth-of-type

-    // rather than nth-child

-    index: function(parentNode, reverse, ofType) {

-      parentNode._countedByPrototype = Prototype.emptyFunction;

-      if (reverse) {

-        for (var nodes = parentNode.childNodes, i = nodes.length - 1, j = 1; i >= 0; i--) {

-          var node = nodes[i];

-          if (node.nodeType == 1 && (!ofType || node._countedByPrototype)) node.nodeIndex = j++;

-        }

-      } else {

-        for (var i = 0, j = 1, nodes = parentNode.childNodes; node = nodes[i]; i++)

-          if (node.nodeType == 1 && (!ofType || node._countedByPrototype)) node.nodeIndex = j++;

-      }

-    },

-

-    // filters out duplicates and extends all nodes

-    unique: function(nodes) {

-      if (nodes.length == 0) return nodes;

-      var results = [], n;

-      for (var i = 0, l = nodes.length; i < l; i++)

-        if (!(n = nodes[i])._countedByPrototype) {

-          n._countedByPrototype = Prototype.emptyFunction;

-          results.push(Element.extend(n));

-        }

-      return Selector.handlers.unmark(results);

-    },

-

-    // COMBINATOR FUNCTIONS

-    descendant: function(nodes) {

-      var h = Selector.handlers;

-      for (var i = 0, results = [], node; node = nodes[i]; i++)

-        h.concat(results, node.getElementsByTagName('*'));

-      return results;

-    },

-

-    child: function(nodes) {

-      var h = Selector.handlers;

-      for (var i = 0, results = [], node; node = nodes[i]; i++) {

-        for (var j = 0, child; child = node.childNodes[j]; j++)

-          if (child.nodeType == 1 && child.tagName != '!') results.push(child);

-      }

-      return results;

-    },

-

-    adjacent: function(nodes) {

-      for (var i = 0, results = [], node; node = nodes[i]; i++) {

-        var next = this.nextElementSibling(node);

-        if (next) results.push(next);

-      }

-      return results;

-    },

-

-    laterSibling: function(nodes) {

-      var h = Selector.handlers;

-      for (var i = 0, results = [], node; node = nodes[i]; i++)

-        h.concat(results, Element.nextSiblings(node));

-      return results;

-    },

-

-    nextElementSibling: function(node) {

-      while (node = node.nextSibling)

-	      if (node.nodeType == 1) return node;

-      return null;

-    },

-

-    previousElementSibling: function(node) {

-      while (node = node.previousSibling)

-        if (node.nodeType == 1) return node;

-      return null;

-    },

-

-    // TOKEN FUNCTIONS

-    tagName: function(nodes, root, tagName, combinator) {

-      var uTagName = tagName.toUpperCase();

-      var results = [], h = Selector.handlers;

-      if (nodes) {

-        if (combinator) {

-          // fastlane for ordinary descendant combinators

-          if (combinator == "descendant") {

-            for (var i = 0, node; node = nodes[i]; i++)

-              h.concat(results, node.getElementsByTagName(tagName));

-            return results;

-          } else nodes = this[combinator](nodes);

-          if (tagName == "*") return nodes;

-        }

-        for (var i = 0, node; node = nodes[i]; i++)

-          if (node.tagName.toUpperCase() === uTagName) results.push(node);

-        return results;

-      } else return root.getElementsByTagName(tagName);

-    },

-

-    id: function(nodes, root, id, combinator) {

-      var targetNode = $(id), h = Selector.handlers;

-      if (!targetNode) return [];

-      if (!nodes && root == document) return [targetNode];

-      if (nodes) {

-        if (combinator) {

-          if (combinator == 'child') {

-            for (var i = 0, node; node = nodes[i]; i++)

-              if (targetNode.parentNode == node) return [targetNode];

-          } else if (combinator == 'descendant') {

-            for (var i = 0, node; node = nodes[i]; i++)

-              if (Element.descendantOf(targetNode, node)) return [targetNode];

-          } else if (combinator == 'adjacent') {

-            for (var i = 0, node; node = nodes[i]; i++)

-              if (Selector.handlers.previousElementSibling(targetNode) == node)

-                return [targetNode];

-          } else nodes = h[combinator](nodes);

-        }

-        for (var i = 0, node; node = nodes[i]; i++)

-          if (node == targetNode) return [targetNode];

-        return [];

-      }

-      return (targetNode && Element.descendantOf(targetNode, root)) ? [targetNode] : [];

-    },

-

-    className: function(nodes, root, className, combinator) {

-      if (nodes && combinator) nodes = this[combinator](nodes);

-      return Selector.handlers.byClassName(nodes, root, className);

-    },

-

-    byClassName: function(nodes, root, className) {

-      if (!nodes) nodes = Selector.handlers.descendant([root]);

-      var needle = ' ' + className + ' ';

-      for (var i = 0, results = [], node, nodeClassName; node = nodes[i]; i++) {

-        nodeClassName = node.className;

-        if (nodeClassName.length == 0) continue;

-        if (nodeClassName == className || (' ' + nodeClassName + ' ').include(needle))

-          results.push(node);

-      }

-      return results;

-    },

-

-    attrPresence: function(nodes, root, attr, combinator) {

-      if (!nodes) nodes = root.getElementsByTagName("*");

-      if (nodes && combinator) nodes = this[combinator](nodes);

-      var results = [];

-      for (var i = 0, node; node = nodes[i]; i++)

-        if (Element.hasAttribute(node, attr)) results.push(node);

-      return results;

-    },

-

-    attr: function(nodes, root, attr, value, operator, combinator) {

-      if (!nodes) nodes = root.getElementsByTagName("*");

-      if (nodes && combinator) nodes = this[combinator](nodes);

-      var handler = Selector.operators[operator], results = [];

-      for (var i = 0, node; node = nodes[i]; i++) {

-        var nodeValue = Element.readAttribute(node, attr);

-        if (nodeValue === null) continue;

-        if (handler(nodeValue, value)) results.push(node);

-      }

-      return results;

-    },

-

-    pseudo: function(nodes, name, value, root, combinator) {

-      if (nodes && combinator) nodes = this[combinator](nodes);

-      if (!nodes) nodes = root.getElementsByTagName("*");

-      return Selector.pseudos[name](nodes, value, root);

-    }

-  },

-

-  pseudos: {

-    'first-child': function(nodes, value, root) {

-      for (var i = 0, results = [], node; node = nodes[i]; i++) {

-        if (Selector.handlers.previousElementSibling(node)) continue;

-          results.push(node);

-      }

-      return results;

-    },

-    'last-child': function(nodes, value, root) {

-      for (var i = 0, results = [], node; node = nodes[i]; i++) {

-        if (Selector.handlers.nextElementSibling(node)) continue;

-          results.push(node);

-      }

-      return results;

-    },

-    'only-child': function(nodes, value, root) {

-      var h = Selector.handlers;

-      for (var i = 0, results = [], node; node = nodes[i]; i++)

-        if (!h.previousElementSibling(node) && !h.nextElementSibling(node))

-          results.push(node);

-      return results;

-    },

-    'nth-child':        function(nodes, formula, root) {

-      return Selector.pseudos.nth(nodes, formula, root);

-    },

-    'nth-last-child':   function(nodes, formula, root) {

-      return Selector.pseudos.nth(nodes, formula, root, true);

-    },

-    'nth-of-type':      function(nodes, formula, root) {

-      return Selector.pseudos.nth(nodes, formula, root, false, true);

-    },

-    'nth-last-of-type': function(nodes, formula, root) {

-      return Selector.pseudos.nth(nodes, formula, root, true, true);

-    },

-    'first-of-type':    function(nodes, formula, root) {

-      return Selector.pseudos.nth(nodes, "1", root, false, true);

-    },

-    'last-of-type':     function(nodes, formula, root) {

-      return Selector.pseudos.nth(nodes, "1", root, true, true);

-    },

-    'only-of-type':     function(nodes, formula, root) {

-      var p = Selector.pseudos;

-      return p['last-of-type'](p['first-of-type'](nodes, formula, root), formula, root);

-    },

-

-    // handles the an+b logic

-    getIndices: function(a, b, total) {

-      if (a == 0) return b > 0 ? [b] : [];

-      return $R(1, total).inject([], function(memo, i) {

-        if (0 == (i - b) % a && (i - b) / a >= 0) memo.push(i);

-        return memo;

-      });

-    },

-

-    // handles nth(-last)-child, nth(-last)-of-type, and (first|last)-of-type

-    nth: function(nodes, formula, root, reverse, ofType) {

-      if (nodes.length == 0) return [];

-      if (formula == 'even') formula = '2n+0';

-      if (formula == 'odd')  formula = '2n+1';

-      var h = Selector.handlers, results = [], indexed = [], m;

-      h.mark(nodes);

-      for (var i = 0, node; node = nodes[i]; i++) {

-        if (!node.parentNode._countedByPrototype) {

-          h.index(node.parentNode, reverse, ofType);

-          indexed.push(node.parentNode);

-        }

-      }

-      if (formula.match(/^\d+$/)) { // just a number

-        formula = Number(formula);

-        for (var i = 0, node; node = nodes[i]; i++)

-          if (node.nodeIndex == formula) results.push(node);

-      } else if (m = formula.match(/^(-?\d*)?n(([+-])(\d+))?/)) { // an+b

-        if (m[1] == "-") m[1] = -1;

-        var a = m[1] ? Number(m[1]) : 1;

-        var b = m[2] ? Number(m[2]) : 0;

-        var indices = Selector.pseudos.getIndices(a, b, nodes.length);

-        for (var i = 0, node, l = indices.length; node = nodes[i]; i++) {

-          for (var j = 0; j < l; j++)

-            if (node.nodeIndex == indices[j]) results.push(node);

-        }

-      }

-      h.unmark(nodes);

-      h.unmark(indexed);

-      return results;

-    },

-

-    'empty': function(nodes, value, root) {

-      for (var i = 0, results = [], node; node = nodes[i]; i++) {

-        // IE treats comments as element nodes

-        if (node.tagName == '!' || (node.firstChild && !node.innerHTML.match(/^\s*$/))) continue;

-        results.push(node);

-      }

-      return results;

-    },

-

-    'not': function(nodes, selector, root) {

-      var h = Selector.handlers, selectorType, m;

-      var exclusions = new Selector(selector).findElements(root);

-      h.mark(exclusions);

-      for (var i = 0, results = [], node; node = nodes[i]; i++)

-        if (!node._countedByPrototype) results.push(node);

-      h.unmark(exclusions);

-      return results;

-    },

-

-    'enabled': function(nodes, value, root) {

-      for (var i = 0, results = [], node; node = nodes[i]; i++)

-        if (!node.disabled) results.push(node);

-      return results;

-    },

-

-    'disabled': function(nodes, value, root) {

-      for (var i = 0, results = [], node; node = nodes[i]; i++)

-        if (node.disabled) results.push(node);

-      return results;

-    },

-

-    'checked': function(nodes, value, root) {

-      for (var i = 0, results = [], node; node = nodes[i]; i++)

-        if (node.checked) results.push(node);

-      return results;

-    }

-  },

-

-  operators: {

-    '=':  function(nv, v) { return nv == v; },

-    '!=': function(nv, v) { return nv != v; },

-    '^=': function(nv, v) { return nv.startsWith(v); },

-    '$=': function(nv, v) { return nv.endsWith(v); },

-    '*=': function(nv, v) { return nv.include(v); },

-    '~=': function(nv, v) { return (' ' + nv + ' ').include(' ' + v + ' '); },

-    '|=': function(nv, v) { return ('-' + nv.toUpperCase() + '-').include('-' + v.toUpperCase() + '-'); }

-  },

-

-  split: function(expression) {

-    var expressions = [];

-    expression.scan(/(([\w#:.~>+()\s-]+|\*|\[.*?\])+)\s*(,|$)/, function(m) {

-      expressions.push(m[1].strip());

-    });

-    return expressions;

-  },

-

-  matchElements: function(elements, expression) {

-    var matches = $$(expression), h = Selector.handlers;

-    h.mark(matches);

-    for (var i = 0, results = [], element; element = elements[i]; i++)

-      if (element._countedByPrototype) results.push(element);

-    h.unmark(matches);

-    return results;

-  },

-

-  findElement: function(elements, expression, index) {

-    if (Object.isNumber(expression)) {

-      index = expression; expression = false;

-    }

-    return Selector.matchElements(elements, expression || '*')[index || 0];

-  },

-

-  findChildElements: function(element, expressions) {

-    expressions = Selector.split(expressions.join(','));

-    var results = [], h = Selector.handlers;

-    for (var i = 0, l = expressions.length, selector; i < l; i++) {

-      selector = new Selector(expressions[i].strip());

-      h.concat(results, selector.findElements(element));

-    }

-    return (l > 1) ? h.unique(results) : results;

-  }

-});

-

-if (Prototype.Browser.IE) {

-  Object.extend(Selector.handlers, {

-    // IE returns comment nodes on getElementsByTagName("*").

-    // Filter them out.

-    concat: function(a, b) {

-      for (var i = 0, node; node = b[i]; i++)

-        if (node.tagName !== "!") a.push(node);

-      return a;

-    },

-

-    // IE improperly serializes _countedByPrototype in (inner|outer)HTML.

-    unmark: function(nodes) {

-      for (var i = 0, node; node = nodes[i]; i++)

-        node.removeAttribute('_countedByPrototype');

-      return nodes;

-    }

-  });

-}

-

-function $$() {

-  return Selector.findChildElements(document, $A(arguments));

-}

-var Form = {

-  reset: function(form) {

-    $(form).reset();

-    return form;

-  },

-

-  serializeElements: function(elements, options) {

-    if (typeof options != 'object') options = { hash: !!options };

-    else if (Object.isUndefined(options.hash)) options.hash = true;

-    var key, value, submitted = false, submit = options.submit;

-

-    var data = elements.inject({ }, function(result, element) {

-      if (!element.disabled && element.name) {

-        key = element.name; value = $(element).getValue();

-        if (value != null && (element.type != 'submit' || (!submitted &&

-            submit !== false && (!submit || key == submit) && (submitted = true)))) {

-          if (key in result) {

-            // a key is already present; construct an array of values

-            if (!Object.isArray(result[key])) result[key] = [result[key]];

-            result[key].push(value);

-          }

-          else result[key] = value;

-        }

-      }

-      return result;

-    });

-

-    return options.hash ? data : Object.toQueryString(data);

-  }

-};

-

-Form.Methods = {

-  serialize: function(form, options) {

-    return Form.serializeElements(Form.getElements(form), options);

-  },

-

-  getElements: function(form) {

-    return $A($(form).getElementsByTagName('*')).inject([],

-      function(elements, child) {

-        if (Form.Element.Serializers[child.tagName.toLowerCase()])

-          elements.push(Element.extend(child));

-        return elements;

-      }

-    );

-  },

-

-  getInputs: function(form, typeName, name) {

-    form = $(form);

-    var inputs = form.getElementsByTagName('input');

-

-    if (!typeName && !name) return $A(inputs).map(Element.extend);

-

-    for (var i = 0, matchingInputs = [], length = inputs.length; i < length; i++) {

-      var input = inputs[i];

-      if ((typeName && input.type != typeName) || (name && input.name != name))

-        continue;

-      matchingInputs.push(Element.extend(input));

-    }

-

-    return matchingInputs;

-  },

-

-  disable: function(form) {

-    form = $(form);

-    Form.getElements(form).invoke('disable');

-    return form;

-  },

-

-  enable: function(form) {

-    form = $(form);

-    Form.getElements(form).invoke('enable');

-    return form;

-  },

-

-  findFirstElement: function(form) {

-    var elements = $(form).getElements().findAll(function(element) {

-      return 'hidden' != element.type && !element.disabled;

-    });

-    var firstByIndex = elements.findAll(function(element) {

-      return element.hasAttribute('tabIndex') && element.tabIndex >= 0;

-    }).sortBy(function(element) { return element.tabIndex }).first();

-

-    return firstByIndex ? firstByIndex : elements.find(function(element) {

-      return ['input', 'select', 'textarea'].include(element.tagName.toLowerCase());

-    });

-  },

-

-  focusFirstElement: function(form) {

-    form = $(form);

-    form.findFirstElement().activate();

-    return form;

-  },

-

-  request: function(form, options) {

-    form = $(form), options = Object.clone(options || { });

-

-    var params = options.parameters, action = form.readAttribute('action') || '';

-    if (action.blank()) action = window.location.href;

-    options.parameters = form.serialize(true);

-

-    if (params) {

-      if (Object.isString(params)) params = params.toQueryParams();

-      Object.extend(options.parameters, params);

-    }

-

-    if (form.hasAttribute('method') && !options.method)

-      options.method = form.method;

-

-    return new Ajax.Request(action, options);

-  }

-};

-

-/*--------------------------------------------------------------------------*/

-

-Form.Element = {

-  focus: function(element) {

-    $(element).focus();

-    return element;

-  },

-

-  select: function(element) {

-    $(element).select();

-    return element;

-  }

-};

-

-Form.Element.Methods = {

-  serialize: function(element) {

-    element = $(element);

-    if (!element.disabled && element.name) {

-      var value = element.getValue();

-      if (value != undefined) {

-        var pair = { };

-        pair[element.name] = value;

-        return Object.toQueryString(pair);

-      }

-    }

-    return '';

-  },

-

-  getValue: function(element) {

-    element = $(element);

-    var method = element.tagName.toLowerCase();

-    return Form.Element.Serializers[method](element);

-  },

-

-  setValue: function(element, value) {

-    element = $(element);

-    var method = element.tagName.toLowerCase();

-    Form.Element.Serializers[method](element, value);

-    return element;

-  },

-

-  clear: function(element) {

-    $(element).value = '';

-    return element;

-  },

-

-  present: function(element) {

-    return $(element).value != '';

-  },

-

-  activate: function(element) {

-    element = $(element);

-    try {

-      element.focus();

-      if (element.select && (element.tagName.toLowerCase() != 'input' ||

-          !['button', 'reset', 'submit'].include(element.type)))

-        element.select();

-    } catch (e) { }

-    return element;

-  },

-

-  disable: function(element) {

-    element = $(element);

-    element.blur();

-    element.disabled = true;

-    return element;

-  },

-

-  enable: function(element) {

-    element = $(element);

-    element.disabled = false;

-    return element;

-  }

-};

-

-/*--------------------------------------------------------------------------*/

-

-var Field = Form.Element;

-var $F = Form.Element.Methods.getValue;

-

-/*--------------------------------------------------------------------------*/

-

-Form.Element.Serializers = {

-  input: function(element, value) {

-    switch (element.type.toLowerCase()) {

-      case 'checkbox':

-      case 'radio':

-        return Form.Element.Serializers.inputSelector(element, value);

-      default:

-        return Form.Element.Serializers.textarea(element, value);

-    }

-  },

-

-  inputSelector: function(element, value) {

-    if (Object.isUndefined(value)) return element.checked ? element.value : null;

-    else element.checked = !!value;

-  },

-

-  textarea: function(element, value) {

-    if (Object.isUndefined(value)) return element.value;

-    else element.value = value;

-  },

-

-  select: function(element, index) {

-    if (Object.isUndefined(index))

-      return this[element.type == 'select-one' ?

-        'selectOne' : 'selectMany'](element);

-    else {

-      var opt, value, single = !Object.isArray(index);

-      for (var i = 0, length = element.length; i < length; i++) {

-        opt = element.options[i];

-        value = this.optionValue(opt);

-        if (single) {

-          if (value == index) {

-            opt.selected = true;

-            return;

-          }

-        }

-        else opt.selected = index.include(value);

-      }

-    }

-  },

-

-  selectOne: function(element) {

-    var index = element.selectedIndex;

-    return index >= 0 ? this.optionValue(element.options[index]) : null;

-  },

-

-  selectMany: function(element) {

-    var values, length = element.length;

-    if (!length) return null;

-

-    for (var i = 0, values = []; i < length; i++) {

-      var opt = element.options[i];

-      if (opt.selected) values.push(this.optionValue(opt));

-    }

-    return values;

-  },

-

-  optionValue: function(opt) {

-    // extend element because hasAttribute may not be native

-    return Element.extend(opt).hasAttribute('value') ? opt.value : opt.text;

-  }

-};

-

-/*--------------------------------------------------------------------------*/

-

-Abstract.TimedObserver = Class.create(PeriodicalExecuter, {

-  initialize: function($super, element, frequency, callback) {

-    $super(callback, frequency);

-    this.element   = $(element);

-    this.lastValue = this.getValue();

-  },

-

-  execute: function() {

-    var value = this.getValue();

-    if (Object.isString(this.lastValue) && Object.isString(value) ?

-        this.lastValue != value : String(this.lastValue) != String(value)) {

-      this.callback(this.element, value);

-      this.lastValue = value;

-    }

-  }

-});

-

-Form.Element.Observer = Class.create(Abstract.TimedObserver, {

-  getValue: function() {

-    return Form.Element.getValue(this.element);

-  }

-});

-

-Form.Observer = Class.create(Abstract.TimedObserver, {

-  getValue: function() {

-    return Form.serialize(this.element);

-  }

-});

-

-/*--------------------------------------------------------------------------*/

-

-Abstract.EventObserver = Class.create({

-  initialize: function(element, callback) {

-    this.element  = $(element);

-    this.callback = callback;

-

-    this.lastValue = this.getValue();

-    if (this.element.tagName.toLowerCase() == 'form')

-      this.registerFormCallbacks();

-    else

-      this.registerCallback(this.element);

-  },

-

-  onElementEvent: function() {

-    var value = this.getValue();

-    if (this.lastValue != value) {

-      this.callback(this.element, value);

-      this.lastValue = value;

-    }

-  },

-

-  registerFormCallbacks: function() {

-    Form.getElements(this.element).each(this.registerCallback, this);

-  },

-

-  registerCallback: function(element) {

-    if (element.type) {

-      switch (element.type.toLowerCase()) {

-        case 'checkbox':

-        case 'radio':

-          Event.observe(element, 'click', this.onElementEvent.bind(this));

-          break;

-        default:

-          Event.observe(element, 'change', this.onElementEvent.bind(this));

-          break;

-      }

-    }

-  }

-});

-

-Form.Element.EventObserver = Class.create(Abstract.EventObserver, {

-  getValue: function() {

-    return Form.Element.getValue(this.element);

-  }

-});

-

-Form.EventObserver = Class.create(Abstract.EventObserver, {

-  getValue: function() {

-    return Form.serialize(this.element);

-  }

-});

-if (!window.Event) var Event = { };

-

-Object.extend(Event, {

-  KEY_BACKSPACE: 8,

-  KEY_TAB:       9,

-  KEY_RETURN:   13,

-  KEY_ESC:      27,

-  KEY_LEFT:     37,

-  KEY_UP:       38,

-  KEY_RIGHT:    39,

-  KEY_DOWN:     40,

-  KEY_DELETE:   46,

-  KEY_HOME:     36,

-  KEY_END:      35,

-  KEY_PAGEUP:   33,

-  KEY_PAGEDOWN: 34,

-  KEY_INSERT:   45,

-

-  cache: { },

-

-  relatedTarget: function(event) {

-    var element;

-    switch(event.type) {

-      case 'mouseover': element = event.fromElement; break;

-      case 'mouseout':  element = event.toElement;   break;

-      default: return null;

-    }

-    return Element.extend(element);

-  }

-});

-

-Event.Methods = (function() {

-  var isButton;

-

-  if (Prototype.Browser.IE) {

-    var buttonMap = { 0: 1, 1: 4, 2: 2 };

-    isButton = function(event, code) {

-      return event.button == buttonMap[code];

-    };

-

-  } else if (Prototype.Browser.WebKit) {

-    isButton = function(event, code) {

-      switch (code) {

-        case 0: return event.which == 1 && !event.metaKey;

-        case 1: return event.which == 1 && event.metaKey;

-        default: return false;

-      }

-    };

-

-  } else {

-    isButton = function(event, code) {

-      return event.which ? (event.which === code + 1) : (event.button === code);

-    };

-  }

-

-  return {

-    isLeftClick:   function(event) { return isButton(event, 0) },

-    isMiddleClick: function(event) { return isButton(event, 1) },

-    isRightClick:  function(event) { return isButton(event, 2) },

-

-    element: function(event) {

-      var node = Event.extend(event).target;

-      return Element.extend(node.nodeType == Node.TEXT_NODE ? node.parentNode : node);

-    },

-

-    findElement: function(event, expression) {

-      var element = Event.element(event);

-      if (!expression) return element;

-      var elements = [element].concat(element.ancestors());

-      return Selector.findElement(elements, expression, 0);

-    },

-

-    pointer: function(event) {

-      return {

-        x: event.pageX || (event.clientX +

-          (document.documentElement.scrollLeft || document.body.scrollLeft)),

-        y: event.pageY || (event.clientY +

-          (document.documentElement.scrollTop || document.body.scrollTop))

-      };

-    },

-

-    pointerX: function(event) { return Event.pointer(event).x },

-    pointerY: function(event) { return Event.pointer(event).y },

-

-    stop: function(event) {

-      Event.extend(event);

-      event.preventDefault();

-      event.stopPropagation();

-      event.stopped = true;

-    }

-  };

-})();

-

-Event.extend = (function() {

-  var methods = Object.keys(Event.Methods).inject({ }, function(m, name) {

-    m[name] = Event.Methods[name].methodize();

-    return m;

-  });

-

-  if (Prototype.Browser.IE) {

-    Object.extend(methods, {

-      stopPropagation: function() { this.cancelBubble = true },

-      preventDefault:  function() { this.returnValue = false },

-      inspect: function() { return "[object Event]" }

-    });

-

-    return function(event) {

-      if (!event) return false;

-      if (event._extendedByPrototype) return event;

-

-      event._extendedByPrototype = Prototype.emptyFunction;

-      var pointer = Event.pointer(event);

-      Object.extend(event, {

-        target: event.srcElement,

-        relatedTarget: Event.relatedTarget(event),

-        pageX:  pointer.x,

-        pageY:  pointer.y

-      });

-      return Object.extend(event, methods);

-    };

-

-  } else {

-    Event.prototype = Event.prototype || document.createEvent("HTMLEvents").__proto__;

-    Object.extend(Event.prototype, methods);

-    return Prototype.K;

-  }

-})();

-

-Object.extend(Event, (function() {

-  var cache = Event.cache;

-

-  function getEventID(element) {

-    if (element._prototypeEventID) return element._prototypeEventID[0];

-    arguments.callee.id = arguments.callee.id || 1;

-    return element._prototypeEventID = [++arguments.callee.id];

-  }

-

-  function getDOMEventName(eventName) {

-    if (eventName && eventName.include(':')) return "dataavailable";

-    return eventName;

-  }

-

-  function getCacheForID(id) {

-    return cache[id] = cache[id] || { };

-  }

-

-  function getWrappersForEventName(id, eventName) {

-    var c = getCacheForID(id);

-    return c[eventName] = c[eventName] || [];

-  }

-

-  function createWrapper(element, eventName, handler) {

-    var id = getEventID(element);

-    var c = getWrappersForEventName(id, eventName);

-    if (c.pluck("handler").include(handler)) return false;

-

-    var wrapper = function(event) {

-      if (!Event || !Event.extend ||

-        (event.eventName && event.eventName != eventName))

-          return false;

-

-      Event.extend(event);

-      handler.call(element, event);

-    };

-

-    wrapper.handler = handler;

-    c.push(wrapper);

-    return wrapper;

-  }

-

-  function findWrapper(id, eventName, handler) {

-    var c = getWrappersForEventName(id, eventName);

-    return c.find(function(wrapper) { return wrapper.handler == handler });

-  }

-

-  function destroyWrapper(id, eventName, handler) {

-    var c = getCacheForID(id);

-    if (!c[eventName]) return false;

-    c[eventName] = c[eventName].without(findWrapper(id, eventName, handler));

-  }

-

-  function destroyCache() {

-    for (var id in cache)

-      for (var eventName in cache[id])

-        cache[id][eventName] = null;

-  }

-

-  if (window.attachEvent) {

-    window.attachEvent("onunload", destroyCache);

-  }

-

-  return {

-    observe: function(element, eventName, handler) {

-      element = $(element);

-      var name = getDOMEventName(eventName);

-

-      var wrapper = createWrapper(element, eventName, handler);

-      if (!wrapper) return element;

-

-      if (element.addEventListener) {

-        element.addEventListener(name, wrapper, false);

-      } else {

-        element.attachEvent("on" + name, wrapper);

-      }

-

-      return element;

-    },

-

-    stopObserving: function(element, eventName, handler) {

-      element = $(element);

-      var id = getEventID(element), name = getDOMEventName(eventName);

-

-      if (!handler && eventName) {

-        getWrappersForEventName(id, eventName).each(function(wrapper) {

-          element.stopObserving(eventName, wrapper.handler);

-        });

-        return element;

-

-      } else if (!eventName) {

-        Object.keys(getCacheForID(id)).each(function(eventName) {

-          element.stopObserving(eventName);

-        });

-        return element;

-      }

-

-      var wrapper = findWrapper(id, eventName, handler);

-      if (!wrapper) return element;

-

-      if (element.removeEventListener) {

-        element.removeEventListener(name, wrapper, false);

-      } else {

-        element.detachEvent("on" + name, wrapper);

-      }

-

-      destroyWrapper(id, eventName, handler);

-

-      return element;

-    },

-

-    fire: function(element, eventName, memo) {

-      element = $(element);

-      if (element == document && document.createEvent && !element.dispatchEvent)

-        element = document.documentElement;

-

-      var event;

-      if (document.createEvent) {

-        event = document.createEvent("HTMLEvents");

-        event.initEvent("dataavailable", true, true);

-      } else {

-        event = document.createEventObject();

-        event.eventType = "ondataavailable";

-      }

-

-      event.eventName = eventName;

-      event.memo = memo || { };

-

-      if (document.createEvent) {

-        element.dispatchEvent(event);

-      } else {

-        element.fireEvent(event.eventType, event);

-      }

-

-      return Event.extend(event);

-    }

-  };

-})());

-

-Object.extend(Event, Event.Methods);

-

-Element.addMethods({

-  fire:          Event.fire,

-  observe:       Event.observe,

-  stopObserving: Event.stopObserving

-});

-

-Object.extend(document, {

-  fire:          Element.Methods.fire.methodize(),

-  observe:       Element.Methods.observe.methodize(),

-  stopObserving: Element.Methods.stopObserving.methodize(),

-  loaded:        false

-});

-

-(function() {

-  /* Support for the DOMContentLoaded event is based on work by Dan Webb,

-     Matthias Miller, Dean Edwards and John Resig. */

-

-  var timer;

-

-  function fireContentLoadedEvent() {

-    if (document.loaded) return;

-    if (timer) window.clearInterval(timer);

-    document.fire("dom:loaded");

-    document.loaded = true;

-  }

-

-  if (document.addEventListener) {

-    if (Prototype.Browser.WebKit) {

-      timer = window.setInterval(function() {

-        if (/loaded|complete/.test(document.readyState))

-          fireContentLoadedEvent();

-      }, 0);

-

-      Event.observe(window, "load", fireContentLoadedEvent);

-

-    } else {

-      document.addEventListener("DOMContentLoaded",

-        fireContentLoadedEvent, false);

-    }

-

-  } else {

-    document.write("<script id=__onDOMContentLoaded defer src=//:><\/script>");

-    $("__onDOMContentLoaded").onreadystatechange = function() {

-      if (this.readyState == "complete") {

-        this.onreadystatechange = null;

-        fireContentLoadedEvent();

-      }

-    };

-  }

-})();

-/*------------------------------- DEPRECATED -------------------------------*/

-

-Hash.toQueryString = Object.toQueryString;

-

-var Toggle = { display: Element.toggle };

-

-Element.Methods.childOf = Element.Methods.descendantOf;

-

-var Insertion = {

-  Before: function(element, content) {

-    return Element.insert(element, {before:content});

-  },

-

-  Top: function(element, content) {

-    return Element.insert(element, {top:content});

-  },

-

-  Bottom: function(element, content) {

-    return Element.insert(element, {bottom:content});

-  },

-

-  After: function(element, content) {

-    return Element.insert(element, {after:content});

-  }

-};

-

-var $continue = new Error('"throw $continue" is deprecated, use "return" instead');

-

-// This should be moved to script.aculo.us; notice the deprecated methods

-// further below, that map to the newer Element methods.

-var Position = {

-  // set to true if needed, warning: firefox performance problems

-  // NOT neeeded for page scrolling, only if draggable contained in

-  // scrollable elements

-  includeScrollOffsets: false,

-

-  // must be called before calling withinIncludingScrolloffset, every time the

-  // page is scrolled

-  prepare: function() {

-    this.deltaX =  window.pageXOffset

-                || document.documentElement.scrollLeft

-                || document.body.scrollLeft

-                || 0;

-    this.deltaY =  window.pageYOffset

-                || document.documentElement.scrollTop

-                || document.body.scrollTop

-                || 0;

-  },

-

-  // caches x/y coordinate pair to use with overlap

-  within: function(element, x, y) {

-    if (this.includeScrollOffsets)

-      return this.withinIncludingScrolloffsets(element, x, y);

-    this.xcomp = x;

-    this.ycomp = y;

-    this.offset = Element.cumulativeOffset(element);

-

-    return (y >= this.offset[1] &&

-            y <  this.offset[1] + element.offsetHeight &&

-            x >= this.offset[0] &&

-            x <  this.offset[0] + element.offsetWidth);

-  },

-

-  withinIncludingScrolloffsets: function(element, x, y) {

-    var offsetcache = Element.cumulativeScrollOffset(element);

-

-    this.xcomp = x + offsetcache[0] - this.deltaX;

-    this.ycomp = y + offsetcache[1] - this.deltaY;

-    this.offset = Element.cumulativeOffset(element);

-

-    return (this.ycomp >= this.offset[1] &&

-            this.ycomp <  this.offset[1] + element.offsetHeight &&

-            this.xcomp >= this.offset[0] &&

-            this.xcomp <  this.offset[0] + element.offsetWidth);

-  },

-

-  // within must be called directly before

-  overlap: function(mode, element) {

-    if (!mode) return 0;

-    if (mode == 'vertical')

-      return ((this.offset[1] + element.offsetHeight) - this.ycomp) /

-        element.offsetHeight;

-    if (mode == 'horizontal')

-      return ((this.offset[0] + element.offsetWidth) - this.xcomp) /

-        element.offsetWidth;

-  },

-

-  // Deprecation layer -- use newer Element methods now (1.5.2).

-

-  cumulativeOffset: Element.Methods.cumulativeOffset,

-

-  positionedOffset: Element.Methods.positionedOffset,

-

-  absolutize: function(element) {

-    Position.prepare();

-    return Element.absolutize(element);

-  },

-

-  relativize: function(element) {

-    Position.prepare();

-    return Element.relativize(element);

-  },

-

-  realOffset: Element.Methods.cumulativeScrollOffset,

-

-  offsetParent: Element.Methods.getOffsetParent,

-

-  page: Element.Methods.viewportOffset,

-

-  clone: function(source, target, options) {

-    options = options || { };

-    return Element.clonePosition(target, source, options);

-  }

-};

-

-/*--------------------------------------------------------------------------*/

-

-if (!document.getElementsByClassName) document.getElementsByClassName = function(instanceMethods){

-  function iter(name) {

-    return name.blank() ? null : "[contains(concat(' ', @class, ' '), ' " + name + " ')]";

-  }

-

-  instanceMethods.getElementsByClassName = Prototype.BrowserFeatures.XPath ?

-  function(element, className) {

-    className = className.toString().strip();

-    var cond = /\s/.test(className) ? $w(className).map(iter).join('') : iter(className);

-    return cond ? document._getElementsByXPath('.//*' + cond, element) : [];

-  } : function(element, className) {

-    className = className.toString().strip();

-    var elements = [], classNames = (/\s/.test(className) ? $w(className) : null);

-    if (!classNames && !className) return elements;

-

-    var nodes = $(element).getElementsByTagName('*');

-    className = ' ' + className + ' ';

-

-    for (var i = 0, child, cn; child = nodes[i]; i++) {

-      if (child.className && (cn = ' ' + child.className + ' ') && (cn.include(className) ||

-          (classNames && classNames.all(function(name) {

-            return !name.toString().blank() && cn.include(' ' + name + ' ');

-          }))))

-        elements.push(Element.extend(child));

-    }

-    return elements;

-  };

-

-  return function(className, parentElement) {

-    return $(parentElement || document.body).getElementsByClassName(className);

-  };

-}(Element.Methods);

-

-/*--------------------------------------------------------------------------*/

-

-Element.ClassNames = Class.create();

-Element.ClassNames.prototype = {

-  initialize: function(element) {

-    this.element = $(element);

-  },

-

-  _each: function(iterator) {

-    this.element.className.split(/\s+/).select(function(name) {

-      return name.length > 0;

-    })._each(iterator);

-  },

-

-  set: function(className) {

-    this.element.className = className;

-  },

-

-  add: function(classNameToAdd) {

-    if (this.include(classNameToAdd)) return;

-    this.set($A(this).concat(classNameToAdd).join(' '));

-  },

-

-  remove: function(classNameToRemove) {

-    if (!this.include(classNameToRemove)) return;

-    this.set($A(this).without(classNameToRemove).join(' '));

-  },

-

-  toString: function() {

-    return $A(this).join(' ');

-  }

-};

-

-Object.extend(Element.ClassNames.prototype, Enumerable);

-

-/*--------------------------------------------------------------------------*/

-

-Element.addMethods();
+

file:a/js/jquery-1.6.1.min.js (deleted)
--- a/js/jquery-1.6.1.min.js
+++ /dev/null
@@ -1,18 +1,1 @@
-/*!
- * jQuery JavaScript Library v1.6.1
- * http://jquery.com/
- *
- * Copyright 2011, John Resig
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * Includes Sizzle.js
- * http://sizzlejs.com/
- * Copyright 2011, The Dojo Foundation
- * Released under the MIT, BSD, and GPL Licenses.
- *
- * Date: Thu May 12 15:04:36 2011 -0400
- */
-(function(a,b){function cy(a){return f.isWindow(a)?a:a.nodeType===9?a.defaultView||a.parentWindow:!1}function cv(a){if(!cj[a]){var b=f("<"+a+">").appendTo("body"),d=b.css("display");b.remove();if(d==="none"||d===""){ck||(ck=c.createElement("iframe"),ck.frameBorder=ck.width=ck.height=0),c.body.appendChild(ck);if(!cl||!ck.createElement)cl=(ck.contentWindow||ck.contentDocument).document,cl.write("<!doctype><html><body></body></html>");b=cl.createElement(a),cl.body.appendChild(b),d=f.css(b,"display"),c.body.removeChild(ck)}cj[a]=d}return cj[a]}function cu(a,b){var c={};f.each(cp.concat.apply([],cp.slice(0,b)),function(){c[this]=a});return c}function ct(){cq=b}function cs(){setTimeout(ct,0);return cq=f.now()}function ci(){try{return new a.ActiveXObject("Microsoft.XMLHTTP")}catch(b){}}function ch(){try{return new a.XMLHttpRequest}catch(b){}}function cb(a,c){a.dataFilter&&(c=a.dataFilter(c,a.dataType));var d=a.dataTypes,e={},g,h,i=d.length,j,k=d[0],l,m,n,o,p;for(g=1;g<i;g++){if(g===1)for(h in a.converters)typeof h=="string"&&(e[h.toLowerCase()]=a.converters[h]);l=k,k=d[g];if(k==="*")k=l;else if(l!=="*"&&l!==k){m=l+" "+k,n=e[m]||e["* "+k];if(!n){p=b;for(o in e){j=o.split(" ");if(j[0]===l||j[0]==="*"){p=e[j[1]+" "+k];if(p){o=e[o],o===!0?n=p:p===!0&&(n=o);break}}}}!n&&!p&&f.error("No conversion from "+m.replace(" "," to ")),n!==!0&&(c=n?n(c):p(o(c)))}}return c}function ca(a,c,d){var e=a.contents,f=a.dataTypes,g=a.responseFields,h,i,j,k;for(i in g)i in d&&(c[g[i]]=d[i]);while(f[0]==="*")f.shift(),h===b&&(h=a.mimeType||c.getResponseHeader("content-type"));if(h)for(i in e)if(e[i]&&e[i].test(h)){f.unshift(i);break}if(f[0]in d)j=f[0];else{for(i in d){if(!f[0]||a.converters[i+" "+f[0]]){j=i;break}k||(k=i)}j=j||k}if(j){j!==f[0]&&f.unshift(j);return d[j]}}function b_(a,b,c,d){if(f.isArray(b))f.each(b,function(b,e){c||bF.test(a)?d(a,e):b_(a+"["+(typeof e=="object"||f.isArray(e)?b:"")+"]",e,c,d)});else if(!c&&b!=null&&typeof b=="object")for(var e in b)b_(a+"["+e+"]",b[e],c,d);else d(a,b)}function b$(a,c,d,e,f,g){f=f||c.dataTypes[0],g=g||{},g[f]=!0;var h=a[f],i=0,j=h?h.length:0,k=a===bU,l;for(;i<j&&(k||!l);i++)l=h[i](c,d,e),typeof l=="string"&&(!k||g[l]?l=b:(c.dataTypes.unshift(l),l=b$(a,c,d,e,l,g)));(k||!l)&&!g["*"]&&(l=b$(a,c,d,e,"*",g));return l}function bZ(a){return function(b,c){typeof b!="string"&&(c=b,b="*");if(f.isFunction(c)){var d=b.toLowerCase().split(bQ),e=0,g=d.length,h,i,j;for(;e<g;e++)h=d[e],j=/^\+/.test(h),j&&(h=h.substr(1)||"*"),i=a[h]=a[h]||[],i[j?"unshift":"push"](c)}}}function bD(a,b,c){var d=b==="width"?bx:by,e=b==="width"?a.offsetWidth:a.offsetHeight;if(c==="border")return e;f.each(d,function(){c||(e-=parseFloat(f.css(a,"padding"+this))||0),c==="margin"?e+=parseFloat(f.css(a,"margin"+this))||0:e-=parseFloat(f.css(a,"border"+this+"Width"))||0});return e}function bn(a,b){b.src?f.ajax({url:b.src,async:!1,dataType:"script"}):f.globalEval((b.text||b.textContent||b.innerHTML||"").replace(bf,"/*$0*/")),b.parentNode&&b.parentNode.removeChild(b)}function bm(a){f.nodeName(a,"input")?bl(a):a.getElementsByTagName&&f.grep(a.getElementsByTagName("input"),bl)}function bl(a){if(a.type==="checkbox"||a.type==="radio")a.defaultChecked=a.checked}function bk(a){return"getElementsByTagName"in a?a.getElementsByTagName("*"):"querySelectorAll"in a?a.querySelectorAll("*"):[]}function bj(a,b){var c;if(b.nodeType===1){b.clearAttributes&&b.clearAttributes(),b.mergeAttributes&&b.mergeAttributes(a),c=b.nodeName.toLowerCase();if(c==="object")b.outerHTML=a.outerHTML;else if(c!=="input"||a.type!=="checkbox"&&a.type!=="radio"){if(c==="option")b.selected=a.defaultSelected;else if(c==="input"||c==="textarea")b.defaultValue=a.defaultValue}else a.checked&&(b.defaultChecked=b.checked=a.checked),b.value!==a.value&&(b.value=a.value);b.removeAttribute(f.expando)}}function bi(a,b){if(b.nodeType===1&&!!f.hasData(a)){var c=f.expando,d=f.data(a),e=f.data(b,d);if(d=d[c]){var g=d.events;e=e[c]=f.extend({},d);if(g){delete e.handle,e.events={};for(var h in g)for(var i=0,j=g[h].length;i<j;i++)f.event.add(b,h+(g[h][i].namespace?".":"")+g[h][i].namespace,g[h][i],g[h][i].data)}}}}function bh(a,b){return f.nodeName(a,"table")?a.getElementsByTagName("tbody")[0]||a.appendChild(a.ownerDocument.createElement("tbody")):a}function X(a,b,c){b=b||0;if(f.isFunction(b))return f.grep(a,function(a,d){var e=!!b.call(a,d,a);return e===c});if(b.nodeType)return f.grep(a,function(a,d){return a===b===c});if(typeof b=="string"){var d=f.grep(a,function(a){return a.nodeType===1});if(S.test(b))return f.filter(b,d,!c);b=f.filter(b,d)}return f.grep(a,function(a,d){return f.inArray(a,b)>=0===c})}function W(a){return!a||!a.parentNode||a.parentNode.nodeType===11}function O(a,b){return(a&&a!=="*"?a+".":"")+b.replace(A,"`").replace(B,"&")}function N(a){var b,c,d,e,g,h,i,j,k,l,m,n,o,p=[],q=[],r=f._data(this,"events");if(!(a.liveFired===this||!r||!r.live||a.target.disabled||a.button&&a.type==="click")){a.namespace&&(n=new RegExp("(^|\\.)"+a.namespace.split(".").join("\\.(?:.*\\.)?")+"(\\.|$)")),a.liveFired=this;var s=r.live.slice(0);for(i=0;i<s.length;i++)g=s[i],g.origType.replace(y,"")===a.type?q.push(g.selector):s.splice(i--,1);e=f(a.target).closest(q,a.currentTarget);for(j=0,k=e.length;j<k;j++){m=e[j];for(i=0;i<s.length;i++){g=s[i];if(m.selector===g.selector&&(!n||n.test(g.namespace))&&!m.elem.disabled){h=m.elem,d=null;if(g.preType==="mouseenter"||g.preType==="mouseleave")a.type=g.preType,d=f(a.relatedTarget).closest(g.selector)[0],d&&f.contains(h,d)&&(d=h);(!d||d!==h)&&p.push({elem:h,handleObj:g,level:m.level})}}}for(j=0,k=p.length;j<k;j++){e=p[j];if(c&&e.level>c)break;a.currentTarget=e.elem,a.data=e.handleObj.data,a.handleObj=e.handleObj,o=e.handleObj.origHandler.apply(e.elem,arguments);if(o===!1||a.isPropagationStopped()){c=e.level,o===!1&&(b=!1);if(a.isImmediatePropagationStopped())break}}return b}}function L(a,c,d){var e=f.extend({},d[0]);e.type=a,e.originalEvent={},e.liveFired=b,f.event.handle.call(c,e),e.isDefaultPrevented()&&d[0].preventDefault()}function F(){return!0}function E(){return!1}function m(a,c,d){var e=c+"defer",g=c+"queue",h=c+"mark",i=f.data(a,e,b,!0);i&&(d==="queue"||!f.data(a,g,b,!0))&&(d==="mark"||!f.data(a,h,b,!0))&&setTimeout(function(){!f.data(a,g,b,!0)&&!f.data(a,h,b,!0)&&(f.removeData(a,e,!0),i.resolve())},0)}function l(a){for(var b in a)if(b!=="toJSON")return!1;return!0}function k(a,c,d){if(d===b&&a.nodeType===1){var e="data-"+c.replace(j,"$1-$2").toLowerCase();d=a.getAttribute(e);if(typeof d=="string"){try{d=d==="true"?!0:d==="false"?!1:d==="null"?null:f.isNaN(d)?i.test(d)?f.parseJSON(d):d:parseFloat(d)}catch(g){}f.data(a,c,d)}else d=b}return d}var c=a.document,d=a.navigator,e=a.location,f=function(){function H(){if(!e.isReady){try{c.documentElement.doScroll("left")}catch(a){setTimeout(H,1);return}e.ready()}}var e=function(a,b){return new e.fn.init(a,b,h)},f=a.jQuery,g=a.$,h,i=/^(?:[^<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/,j=/\S/,k=/^\s+/,l=/\s+$/,m=/\d/,n=/^<(\w+)\s*\/?>(?:<\/\1>)?$/,o=/^[\],:{}\s]*$/,p=/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,q=/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,r=/(?:^|:|,)(?:\s*\[)+/g,s=/(webkit)[ \/]([\w.]+)/,t=/(opera)(?:.*version)?[ \/]([\w.]+)/,u=/(msie) ([\w.]+)/,v=/(mozilla)(?:.*? rv:([\w.]+))?/,w=d.userAgent,x,y,z,A=Object.prototype.toString,B=Object.prototype.hasOwnProperty,C=Array.prototype.push,D=Array.prototype.slice,E=String.prototype.trim,F=Array.prototype.indexOf,G={};e.fn=e.prototype={constructor:e,init:function(a,d,f){var g,h,j,k;if(!a)return this;if(a.nodeType){this.context=this[0]=a,this.length=1;return this}if(a==="body"&&!d&&c.body){this.context=c,this[0]=c.body,this.selector=a,this.length=1;return this}if(typeof a=="string"){a.charAt(0)!=="<"||a.charAt(a.length-1)!==">"||a.length<3?g=i.exec(a):g=[null,a,null];if(g&&(g[1]||!d)){if(g[1]){d=d instanceof e?d[0]:d,k=d?d.ownerDocument||d:c,j=n.exec(a),j?e.isPlainObject(d)?(a=[c.createElement(j[1])],e.fn.attr.call(a,d,!0)):a=[k.createElement(j[1])]:(j=e.buildFragment([g[1]],[k]),a=(j.cacheable?e.clone(j.fragment):j.fragment).childNodes);return e.merge(this,a)}h=c.getElementById(g[2]);if(h&&h.parentNode){if(h.id!==g[2])return f.find(a);this.length=1,this[0]=h}this.context=c,this.selector=a;return this}return!d||d.jquery?(d||f).find(a):this.constructor(d).find(a)}if(e.isFunction(a))return f.ready(a);a.selector!==b&&(this.selector=a.selector,this.context=a.context);return e.makeArray(a,this)},selector:"",jquery:"1.6.1",length:0,size:function(){return this.length},toArray:function(){return D.call(this,0)},get:function(a){return a==null?this.toArray():a<0?this[this.length+a]:this[a]},pushStack:function(a,b,c){var d=this.constructor();e.isArray(a)?C.apply(d,a):e.merge(d,a),d.prevObject=this,d.context=this.context,b==="find"?d.selector=this.selector+(this.selector?" ":"")+c:b&&(d.selector=this.selector+"."+b+"("+c+")");return d},each:function(a,b){return e.each(this,a,b)},ready:function(a){e.bindReady(),y.done(a);return this},eq:function(a){return a===-1?this.slice(a):this.slice(a,+a+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(D.apply(this,arguments),"slice",D.call(arguments).join(","))},map:function(a){return this.pushStack(e.map(this,function(b,c){return a.call(b,c,b)}))},end:function(){return this.prevObject||this.constructor(null)},push:C,sort:[].sort,splice:[].splice},e.fn.init.prototype=e.fn,e.extend=e.fn.extend=function(){var a,c,d,f,g,h,i=arguments[0]||{},j=1,k=arguments.length,l=!1;typeof i=="boolean"&&(l=i,i=arguments[1]||{},j=2),typeof i!="object"&&!e.isFunction(i)&&(i={}),k===j&&(i=this,--j);for(;j<k;j++)if((a=arguments[j])!=null)for(c in a){d=i[c],f=a[c];if(i===f)continue;l&&f&&(e.isPlainObject(f)||(g=e.isArray(f)))?(g?(g=!1,h=d&&e.isArray(d)?d:[]):h=d&&e.isPlainObject(d)?d:{},i[c]=e.extend(l,h,f)):f!==b&&(i[c]=f)}return i},e.extend({noConflict:function(b){a.$===e&&(a.$=g),b&&a.jQuery===e&&(a.jQuery=f);return e},isReady:!1,readyWait:1,holdReady:function(a){a?e.readyWait++:e.ready(!0)},ready:function(a){if(a===!0&&!--e.readyWait||a!==!0&&!e.isReady){if(!c.body)return setTimeout(e.ready,1);e.isReady=!0;if(a!==!0&&--e.readyWait>0)return;y.resolveWith(c,[e]),e.fn.trigger&&e(c).trigger("ready").unbind("ready")}},bindReady:function(){if(!y){y=e._Deferred();if(c.readyState==="complete")return setTimeout(e.ready,1);if(c.addEventListener)c.addEventListener("DOMContentLoaded",z,!1),a.addEventListener("load",e.ready,!1);else if(c.attachEvent){c.attachEvent("onreadystatechange",z),a.attachEvent("onload",e.ready);var b=!1;try{b=a.frameElement==null}catch(d){}c.documentElement.doScroll&&b&&H()}}},isFunction:function(a){return e.type(a)==="function"},isArray:Array.isArray||function(a){return e.type(a)==="array"},isWindow:function(a){return a&&typeof a=="object"&&"setInterval"in a},isNaN:function(a){return a==null||!m.test(a)||isNaN(a)},type:function(a){return a==null?String(a):G[A.call(a)]||"object"},isPlainObject:function(a){if(!a||e.type(a)!=="object"||a.nodeType||e.isWindow(a))return!1;if(a.constructor&&!B.call(a,"constructor")&&!B.call(a.constructor.prototype,"isPrototypeOf"))return!1;var c;for(c in a);return c===b||B.call(a,c)},isEmptyObject:function(a){for(var b in a)return!1;return!0},error:function(a){throw a},parseJSON:function(b){if(typeof b!="string"||!b)return null;b=e.trim(b);if(a.JSON&&a.JSON.parse)return a.JSON.parse(b);if(o.test(b.replace(p,"@").replace(q,"]").replace(r,"")))return(new Function("return "+b))();e.error("Invalid JSON: "+b)},parseXML:function(b,c,d){a.DOMParser?(d=new DOMParser,c=d.parseFromString(b,"text/xml")):(c=new ActiveXObject("Microsoft.XMLDOM"),c.async="false",c.loadXML(b)),d=c.documentElement,(!d||!d.nodeName||d.nodeName==="parsererror")&&e.error("Invalid XML: "+b);return c},noop:function(){},globalEval:function(b){b&&j.test(b)&&(a.execScript||function(b){a.eval.call(a,b)})(b)},nodeName:function(a,b){return a.nodeName&&a.nodeName.toUpperCase()===b.toUpperCase()},each:function(a,c,d){var f,g=0,h=a.length,i=h===b||e.isFunction(a);if(d){if(i){for(f in a)if(c.apply(a[f],d)===!1)break}else for(;g<h;)if(c.apply(a[g++],d)===!1)break}else if(i){for(f in a)if(c.call(a[f],f,a[f])===!1)break}else for(;g<h;)if(c.call(a[g],g,a[g++])===!1)break;return a},trim:E?function(a){return a==null?"":E.call(a)}:function(a){return a==null?"":(a+"").replace(k,"").replace(l,"")},makeArray:function(a,b){var c=b||[];if(a!=null){var d=e.type(a);a.length==null||d==="string"||d==="function"||d==="regexp"||e.isWindow(a)?C.call(c,a):e.merge(c,a)}return c},inArray:function(a,b){if(F)return F.call(b,a);for(var c=0,d=b.length;c<d;c++)if(b[c]===a)return c;return-1},merge:function(a,c){var d=a.length,e=0;if(typeof c.length=="number")for(var f=c.length;e<f;e++)a[d++]=c[e];else while(c[e]!==b)a[d++]=c[e++];a.length=d;return a},grep:function(a,b,c){var d=[],e;c=!!c;for(var f=0,g=a.length;f<g;f++)e=!!b(a[f],f),c!==e&&d.push(a[f]);return d},map:function(a,c,d){var f,g,h=[],i=0,j=a.length,k=a instanceof e||j!==b&&typeof j=="number"&&(j>0&&a[0]&&a[j-1]||j===0||e.isArray(a));if(k)for(;i<j;i++)f=c(a[i],i,d),f!=null&&(h[h.length]=f);else for(g in a)f=c(a[g],g,d),f!=null&&(h[h.length]=f);return h.concat.apply([],h)},guid:1,proxy:function(a,c){if(typeof c=="string"){var d=a[c];c=a,a=d}if(!e.isFunction(a))return b;var f=D.call(arguments,2),g=function(){return a.apply(c,f.concat(D.call(arguments)))};g.guid=a.guid=a.guid||g.guid||e.guid++;return g},access:function(a,c,d,f,g,h){var i=a.length;if(typeof c=="object"){for(var j in c)e.access(a,j,c[j],f,g,d);return a}if(d!==b){f=!h&&f&&e.isFunction(d);for(var k=0;k<i;k++)g(a[k],c,f?d.call(a[k],k,g(a[k],c)):d,h);return a}return i?g(a[0],c):b},now:function(){return(new Date).getTime()},uaMatch:function(a){a=a.toLowerCase();var b=s.exec(a)||t.exec(a)||u.exec(a)||a.indexOf("compatible")<0&&v.exec(a)||[];return{browser:b[1]||"",version:b[2]||"0"}},sub:function(){function a(b,c){return new a.fn.init(b,c)}e.extend(!0,a,this),a.superclass=this,a.fn=a.prototype=this(),a.fn.constructor=a,a.sub=this.sub,a.fn.init=function(d,f){f&&f instanceof e&&!(f instanceof a)&&(f=a(f));return e.fn.init.call(this,d,f,b)},a.fn.init.prototype=a.fn;var b=a(c);return a},browser:{}}),e.each("Boolean Number String Function Array Date RegExp Object".split(" "),function(a,b){G["[object "+b+"]"]=b.toLowerCase()}),x=e.uaMatch(w),x.browser&&(e.browser[x.browser]=!0,e.browser.version=x.version),e.browser.webkit&&(e.browser.safari=!0),j.test(" ")&&(k=/^[\s\xA0]+/,l=/[\s\xA0]+$/),h=e(c),c.addEventListener?z=function(){c.removeEventListener("DOMContentLoaded",z,!1),e.ready()}:c.attachEvent&&(z=function(){c.readyState==="complete"&&(c.detachEvent("onreadystatechange",z),e.ready())});return e}(),g="done fail isResolved isRejected promise then always pipe".split(" "),h=[].slice;f.extend({_Deferred:function(){var a=[],b,c,d,e={done:function(){if(!d){var c=arguments,g,h,i,j,k;b&&(k=b,b=0);for(g=0,h=c.length;g<h;g++)i=c[g],j=f.type(i),j==="array"?e.done.apply(e,i):j==="function"&&a.push(i);k&&e.resolveWith(k[0],k[1])}return this},resolveWith:function(e,f){if(!d&&!b&&!c){f=f||[],c=1;try{while(a[0])a.shift().apply(e,f)}finally{b=[e,f],c=0}}return this},resolve:function(){e.resolveWith(this,arguments);return this},isResolved:function(){return!!c||!!b},cancel:function(){d=1,a=[];return this}};return e},Deferred:function(a){var b=f._Deferred(),c=f._Deferred(),d;f.extend(b,{then:function(a,c){b.done(a).fail(c);return this},always:function(){return b.done.apply(b,arguments).fail.apply(this,arguments)},fail:c.done,rejectWith:c.resolveWith,reject:c.resolve,isRejected:c.isResolved,pipe:function(a,c){return f.Deferred(function(d){f.each({done:[a,"resolve"],fail:[c,"reject"]},function(a,c){var e=c[0],g=c[1],h;f.isFunction(e)?b[a](function(){h=e.apply(this,arguments),h&&f.isFunction(h.promise)?h.promise().then(d.resolve,d.reject):d[g](h)}):b[a](d[g])})}).promise()},promise:function(a){if(a==null){if(d)return d;d=a={}}var c=g.length;while(c--)a[g[c]]=b[g[c]];return a}}),b.done(c.cancel).fail(b.cancel),delete b.cancel,a&&a.call(b,b);return b},when:function(a){function i(a){return function(c){b[a]=arguments.length>1?h.call(arguments,0):c,--e||g.resolveWith(g,h.call(b,0))}}var b=arguments,c=0,d=b.length,e=d,g=d<=1&&a&&f.isFunction(a.promise)?a:f.Deferred();if(d>1){for(;c<d;c++)b[c]&&f.isFunction(b[c].promise)?b[c].promise().then(i(c),g.reject):--e;e||g.resolveWith(g,b)}else g!==a&&g.resolveWith(g,d?[a]:[]);return g.promise()}}),f.support=function(){var a=c.createElement("div"),b=c.documentElement,d,e,f,g,h,i,j,k,l,m,n,o,p,q,r;a.setAttribute("className","t"),a.innerHTML="   <link/><table></table><a href='/a' style='top:1px;float:left;opacity:.55;'>a</a><input type='checkbox'/>",d=a.getElementsByTagName("*"),e=a.getElementsByTagName("a")[0];if(!d||!d.length||!e)return{};f=c.createElement("select"),g=f.appendChild(c.createElement("option")),h=a.getElementsByTagName("input")[0],j={leadingWhitespace:a.firstChild.nodeType===3,tbody:!a.getElementsByTagName("tbody").length,htmlSerialize:!!a.getElementsByTagName("link").length,style:/top/.test(e.getAttribute("style")),hrefNormalized:e.getAttribute("href")==="/a",opacity:/^0.55$/.test(e.style.opacity),cssFloat:!!e.style.cssFloat,checkOn:h.value==="on",optSelected:g.selected,getSetAttribute:a.className!=="t",submitBubbles:!0,changeBubbles:!0,focusinBubbles:!1,deleteExpando:!0,noCloneEvent:!0,inlineBlockNeedsLayout:!1,shrinkWrapBlocks:!1,reliableMarginRight:!0},h.checked=!0,j.noCloneChecked=h.cloneNode(!0).checked,f.disabled=!0,j.optDisabled=!g.disabled;try{delete a.test}catch(s){j.deleteExpando=!1}!a.addEventListener&&a.attachEvent&&a.fireEvent&&(a.attachEvent("onclick",function b(){j.noCloneEvent=!1,a.detachEvent("onclick",b)}),a.cloneNode(!0).fireEvent("onclick")),h=c.createElement("input"),h.value="t",h.setAttribute("type","radio"),j.radioValue=h.value==="t",h.setAttribute("checked","checked"),a.appendChild(h),k=c.createDocumentFragment(),k.appendChild(a.firstChild),j.checkClone=k.cloneNode(!0).cloneNode(!0).lastChild.checked,a.innerHTML="",a.style.width=a.style.paddingLeft="1px",l=c.createElement("body"),m={visibility:"hidden",width:0,height:0,border:0,margin:0,background:"none"};for(q in m)l.style[q]=m[q];l.appendChild(a),b.insertBefore(l,b.firstChild),j.appendChecked=h.checked,j.boxModel=a.offsetWidth===2,"zoom"in a.style&&(a.style.display="inline",a.style.zoom=1,j.inlineBlockNeedsLayout=a.offsetWidth===2,a.style.display="",a.innerHTML="<div style='width:4px;'></div>",j.shrinkWrapBlocks=a.offsetWidth!==2),a.innerHTML="<table><tr><td style='padding:0;border:0;display:none'></td><td>t</td></tr></table>",n=a.getElementsByTagName("td"),r=n[0].offsetHeight===0,n[0].style.display="",n[1].style.display="none",j.reliableHiddenOffsets=r&&n[0].offsetHeight===0,a.innerHTML="",c.defaultView&&c.defaultView.getComputedStyle&&(i=c.createElement("div"),i.style.width="0",i.style.marginRight="0",a.appendChild(i),j.reliableMarginRight=(parseInt((c.defaultView.getComputedStyle(i,null)||{marginRight:0}).marginRight,10)||0)===0),l.innerHTML="",b.removeChild(l);if(a.attachEvent)for(q in{submit:1,change:1,focusin:1})p="on"+q,r=p in a,r||(a.setAttribute(p,"return;"),r=typeof a[p]=="function"),j[q+"Bubbles"]=r;return j}(),f.boxModel=f.support.boxModel;var i=/^(?:\{.*\}|\[.*\])$/,j=/([a-z])([A-Z])/g;f.extend({cache:{},uuid:0,expando:"jQuery"+(f.fn.jquery+Math.random()).replace(/\D/g,""),noData:{embed:!0,object:"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",applet:!0},hasData:function(a){a=a.nodeType?f.cache[a[f.expando]]:a[f.expando];return!!a&&!l(a)},data:function(a,c,d,e){if(!!f.acceptData(a)){var g=f.expando,h=typeof c=="string",i,j=a.nodeType,k=j?f.cache:a,l=j?a[f.expando]:a[f.expando]&&f.expando;if((!l||e&&l&&!k[l][g])&&h&&d===b)return;l||(j?a[f.expando]=l=++f.uuid:l=f.expando),k[l]||(k[l]={},j||(k[l].toJSON=f.noop));if(typeof c=="object"||typeof c=="function")e?k[l][g]=f.extend(k[l][g],c):k[l]=f.extend(k[l],c);i=k[l],e&&(i[g]||(i[g]={}),i=i[g]),d!==b&&(i[f.camelCase(c)]=d);if(c==="events"&&!i[c])return i[g]&&i[g].events;return h?i[f.camelCase(c)]:i}},removeData:function(b,c,d){if(!!f.acceptData(b)){var e=f.expando,g=b.nodeType,h=g?f.cache:b,i=g?b[f.expando]:f.expando;if(!h[i])return;if(c){var j=d?h[i][e]:h[i];if(j){delete j[c];if(!l(j))return}}if(d){delete h[i][e];if(!l(h[i]))return}var k=h[i][e];f.support.deleteExpando||h!=a?delete h[i]:h[i]=null,k?(h[i]={},g||(h[i].toJSON=f.noop),h[i][e]=k):g&&(f.support.deleteExpando?delete b[f.expando]:b.removeAttribute?b.removeAttribute(f.expando):b[f.expando]=null)}},_data:function(a,b,c){return f.data(a,b,c,!0)},acceptData:function(a){if(a.nodeName){var b=f.noData[a.nodeName.toLowerCase()];if(b)return b!==!0&&a.getAttribute("classid")===b}return!0}}),f.fn.extend({data:function(a,c){var d=null;if(typeof a=="undefined"){if(this.length){d=f.data(this[0]);if(this[0].nodeType===1){var e=this[0].attributes,g;for(var h=0,i=e.length;h<i;h++)g=e[h].name,g.indexOf("data-")===0&&(g=f.camelCase(g.substring(5)),k(this[0],g,d[g]))}}return d}if(typeof a=="object")return this.each(function(){f.data(this,a)});var j=a.split(".");j[1]=j[1]?"."+j[1]:"";if(c===b){d=this.triggerHandler("getData"+j[1]+"!",[j[0]]),d===b&&this.length&&(d=f.data(this[0],a),d=k(this[0],a,d));return d===b&&j[1]?this.data(j[0]):d}return this.each(function(){var b=f(this),d=[j[0],c];b.triggerHandler("setData"+j[1]+"!",d),f.data(this,a,c),b.triggerHandler("changeData"+j[1]+"!",d)})},removeData:function(a){return this.each(function(){f.removeData(this,a)})}}),f.extend({_mark:function(a,c){a&&(c=(c||"fx")+"mark",f.data(a,c,(f.data(a,c,b,!0)||0)+1,!0))},_unmark:function(a,c,d){a!==!0&&(d=c,c=a,a=!1);if(c){d=d||"fx";var e=d+"mark",g=a?0:(f.data(c,e,b,!0)||1)-1;g?f.data(c,e,g,!0):(f.removeData(c,e,!0),m(c,d,"mark"))}},queue:function(a,c,d){if(a){c=(c||"fx")+"queue";var e=f.data(a,c,b,!0);d&&(!e||f.isArray(d)?e=f.data(a,c,f.makeArray(d),!0):e.push(d));return e||[]}},dequeue:function(a,b){b=b||"fx";var c=f.queue(a,b),d=c.shift(),e;d==="inprogress"&&(d=c.shift()),d&&(b==="fx"&&c.unshift("inprogress"),d.call(a,function(){f.dequeue(a,b)})),c.length||(f.removeData(a,b+"queue",!0),m(a,b,"queue"))}}),f.fn.extend({queue:function(a,c){typeof a!="string"&&(c=a,a="fx");if(c===b)return f.queue(this[0],a);return this.each(function(){var b=f.queue(this,a,c);a==="fx"&&b[0]!=="inprogress"&&f.dequeue(this,a)})},dequeue:function(a){return this.each(function(){f.dequeue(this,a)})},delay:function(a,b){a=f.fx?f.fx.speeds[a]||a:a,b=b||"fx";return this.queue(b,function(){var c=this;setTimeout(function(){f.dequeue(c,b)},a)})},clearQueue:function(a){return this.queue(a||"fx",[])},promise:function(a,c){function m(){--h||d.resolveWith(e,[e])}typeof a!="string"&&(c=a,a=b),a=a||"fx";var d=f.Deferred(),e=this,g=e.length,h=1,i=a+"defer",j=a+"queue",k=a+"mark",l;while(g--)if(l=f.data(e[g],i,b,!0)||(f.data(e[g],j,b,!0)||f.data(e[g],k,b,!0))&&f.data(e[g],i,f._Deferred(),!0))h++,l.done(m);m();return d.promise()}});var n=/[\n\t\r]/g,o=/\s+/,p=/\r/g,q=/^(?:button|input)$/i,r=/^(?:button|input|object|select|textarea)$/i,s=/^a(?:rea)?$/i,t=/^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i,u=/\:/,v,w;f.fn.extend({attr:function(a,b){return f.access(this,a,b,!0,f.attr)},removeAttr:function(a){return this.each(function(){f.removeAttr(this,a)})},prop:function(a,b){return f.access(this,a,b,!0,f.prop)},removeProp:function(a){a=f.propFix[a]||a;return this.each(function(){try{this[a]=b,delete this[a]}catch(c){}})},addClass:function(a){if(f.isFunction(a))return this.each(function(b){var c=f(this);c.addClass(a.call(this,b,c.attr("class")||""))});if(a&&typeof a=="string"){var b=(a||"").split(o);for(var c=0,d=this.length;c<d;c++){var e=this[c];if(e.nodeType===1)if(!e.className)e.className=a;else{var g=" "+e.className+" ",h=e.className;for(var i=0,j=b.length;i<j;i++)g.indexOf(" "+b[i]+" ")<0&&(h+=" "+b[i]);e.className=f.trim(h)}}}return this},removeClass:function(a){if(f.isFunction(a))return this.each(function(b){var c=f(this);c.removeClass(a.call(this,b,c.attr("class")))});if(a&&typeof a=="string"||a===b){var c=(a||"").split(o);for(var d=0,e=this.length;d<e;d++){var g=this[d];if(g.nodeType===1&&g.className)if(a){var h=(" "+g.className+" ").replace(n," ");for(var i=0,j=c.length;i<j;i++)h=h.replace(" "+c[i]+" "," ");g.className=f.trim(h)}else g.className=""}}return this},toggleClass:function(a,b){var c=typeof a,d=typeof b=="boolean";if(f.isFunction(a))return this.each(function(c){var d=f(this);d.toggleClass(a.call(this,c,d.attr("class"),b),b)});return this.each(function(){if(c==="string"){var e,g=0,h=f(this),i=b,j=a.split(o);while(e=j[g++])i=d?i:!h.hasClass(e),h[i?"addClass":"removeClass"](e)}else if(c==="undefined"||c==="boolean")this.className&&f._data(this,"__className__",this.className),this.className=this.className||a===!1?"":f._data(this,"__className__")||""})},hasClass:function(a){var b=" "+a+" ";for(var c=0,d=this.length;c<d;c++)if((" "+this[c].className+" ").replace(n," ").indexOf(b)>-1)return!0;return!1},val:function(a){var c,d,e=this[0];if(!arguments.length){if(e){c=f.valHooks[e.nodeName.toLowerCase()]||f.valHooks[e.type];if(c&&"get"in c&&(d=c.get(e,"value"))!==b)return d;return(e.value||"").replace(p,"")}return b}var g=f.isFunction(a);return this.each(function(d){var e=f(this),h;if(this.nodeType===1){g?h=a.call(this,d,e.val()):h=a,h==null?h="":typeof h=="number"?h+="":f.isArray(h)&&(h=f.map(h,function(a){return a==null?"":a+""})),c=f.valHooks[this.nodeName.toLowerCase()]||f.valHooks[this.type];if(!c||!("set"in c)||c.set(this,h,"value")===b)this.value=h}})}}),f.extend({valHooks:{option:{get:function(a){var b=a.attributes.value;return!b||b.specified?a.value:a.text}},select:{get:function(a){var b,c=a.selectedIndex,d=[],e=a.options,g=a.type==="select-one";if(c<0)return null;for(var h=g?c:0,i=g?c+1:e.length;h<i;h++){var j=e[h];if(j.selected&&(f.support.optDisabled?!j.disabled:j.getAttribute("disabled")===null)&&(!j.parentNode.disabled||!f.nodeName(j.parentNode,"optgroup"))){b=f(j).val();if(g)return b;d.push(b)}}if(g&&!d.length&&e.length)return f(e[c]).val();return d},set:function(a,b){var c=f.makeArray(b);f(a).find("option").each(function(){this.selected=f.inArray(f(this).val(),c)>=0}),c.length||(a.selectedIndex=-1);return c}}},attrFn:{val:!0,css:!0,html:!0,text:!0,data:!0,width:!0,height:!0,offset:!0},attrFix:{tabindex:"tabIndex"},attr:function(a,c,d,e){var g=a.nodeType;if(!a||g===3||g===8||g===2)return b;if(e&&c in f.attrFn)return f(a)[c](d);if(!("getAttribute"in a))return f.prop(a,c,d);var h,i,j=g!==1||!f.isXMLDoc(a);c=j&&f.attrFix[c]||c,i=f.attrHooks[c],i||(!t.test(c)||typeof d!="boolean"&&d!==b&&d.toLowerCase()!==c.toLowerCase()?v&&(f.nodeName(a,"form")||u.test(c))&&(i=v):i=w);if(d!==b){if(d===null){f.removeAttr(a,c);return b}if(i&&"set"in i&&j&&(h=i.set(a,d,c))!==b)return h;a.setAttribute(c,""+d);return d}if(i&&"get"in i&&j)return i.get(a,c);h=a.getAttribute(c);return h===null?b:h},removeAttr:function(a,b){var c;a.nodeType===1&&(b=f.attrFix[b]||b,f.support.getSetAttribute?a.removeAttribute(b):(f.attr(a,b,""),a.removeAttributeNode(a.getAttributeNode(b))),t.test(b)&&(c=f.propFix[b]||b)in a&&(a[c]=!1))},attrHooks:{type:{set:function(a,b){if(q.test(a.nodeName)&&a.parentNode)f.error("type property can't be changed");else if(!f.support.radioValue&&b==="radio"&&f.nodeName(a,"input")){var c=a.value;a.setAttribute("type",b),c&&(a.value=c);return b}}},tabIndex:{get:function(a){var c=a.getAttributeNode("tabIndex");return c&&c.specified?parseInt(c.value,10):r.test(a.nodeName)||s.test(a.nodeName)&&a.href?0:b}}},propFix:{tabindex:"tabIndex",readonly:"readOnly","for":"htmlFor","class":"className",maxlength:"maxLength",cellspacing:"cellSpacing",cellpadding:"cellPadding",rowspan:"rowSpan",colspan:"colSpan",usemap:"useMap",frameborder:"frameBorder",contenteditable:"contentEditable"},prop:function(a,c,d){var e=a.nodeType;if(!a||e===3||e===8||e===2)return b;var g,h,i=e!==1||!f.isXMLDoc(a);c=i&&f.propFix[c]||c,h=f.propHooks[c];return d!==b?h&&"set"in h&&(g=h.set(a,d,c))!==b?g:a[c]=d:h&&"get"in h&&(g=h.get(a,c))!==b?g:a[c]},propHooks:{}}),w={get:function(a,c){return a[f.propFix[c]||c]?c.toLowerCase():b},set:function(a,b,c){var d;b===!1?f.removeAttr(a,c):(d=f.propFix[c]||c,d in a&&(a[d]=b),a.setAttribute(c,c.toLowerCase()));return c}},f.attrHooks.value={get:function(a,b){if(v&&f.nodeName(a,"button"))return v.get(a,b);return a.value},set:function(a,b,c){if(v&&f.nodeName(a,"button"))return v.set(a,b,c);a.value=b}},f.support.getSetAttribute||(f.attrFix=f.propFix,v=f.attrHooks.name=f.valHooks.button={get:function(a,c){var d;d=a.getAttributeNode(c);return d&&d.nodeValue!==""?d.nodeValue:b},set:function(a,b,c){var d=a.getAttributeNode(c);if(d){d.nodeValue=b;return b}}},f.each(["width","height"],function(a,b){f.attrHooks[b]=f.extend(f.attrHooks[b],{set:function(a,c){if(c===""){a.setAttribute(b,"auto");return c}}})})),f.support.hrefNormalized||f.each(["href","src","width","height"],function(a,c){f.attrHooks[c]=f.extend(f.attrHooks[c],{get:function(a){var d=a.getAttribute(c,2);return d===null?b:d}})}),f.support.style||(f.attrHooks.style={get:function(a){return a.style.cssText.toLowerCase()||b},set:function(a,b){return a.style.cssText=""+b}}),f.support.optSelected||(f.propHooks.selected=f.extend(f.propHooks.selected,{get:function(a){var b=a.parentNode;b&&(b.selectedIndex,b.parentNode&&b.parentNode.selectedIndex)}})),f.support.checkOn||f.each(["radio","checkbox"],function(){f.valHooks[this]={get:function(a){return a.getAttribute("value")===null?"on":a.value}}}),f.each(["radio","checkbox"],function(){f.valHooks[this]=f.extend(f.valHooks[this],{set:function(a,b){if(f.isArray(b))return a.checked=f.inArray(f(a).val(),b)>=0}})});var x=Object.prototype.hasOwnProperty,y=/\.(.*)$/,z=/^(?:textarea|input|select)$/i,A=/\./g,B=/ /g,C=/[^\w\s.|`]/g,D=function(a){return a.replace(C,"\\$&")};f.event={add:function(a,c,d,e){if(a.nodeType!==3&&a.nodeType!==8){if(d===!1)d=E;else if(!d)return;var g,h;d.handler&&(g=d,d=g.handler),d.guid||(d.guid=f.guid++);var i=f._data(a);if(!i)return;var j=i.events,k=i.handle;j||(i.events=j={}),k||(i.handle=k=function(a){return typeof f!="undefined"&&(!a||f.event.triggered!==a.type)?f.event.handle.apply(k.elem,arguments):b}),k.elem=a,c=c.split(" ");var l,m=0,n;while(l=c[m++]){h=g?f.extend({},g):{handler:d,data:e},l.indexOf(".")>-1?(n=l.split("."),l=n.shift(),h.namespace=n.slice(0).sort().join(".")):(n=[],h.namespace=""),h.type=l,h.guid||(h.guid=d.guid);var o=j[l],p=f.event.special[l]||{};if(!o){o=j[l]=[];if(!p.setup||p.setup.call(a,e,n,k)===!1)a.addEventListener?a.addEventListener(l,k,!1):a.attachEvent&&a.attachEvent("on"+l,k)}p.add&&(p.add.call(a,h),h.handler.guid||(h.handler.guid=d.guid)),o.push(h),f.event.global[l]=!0}a=null}},global:{},remove:function(a,c,d,e){if(a.nodeType!==3&&a.nodeType!==8){d===!1&&(d=E);var g,h,i,j,k=0,l,m,n,o,p,q,r,s=f.hasData(a)&&f._data(a),t=s&&s.events;if(!s||!t)return;c&&c.type&&(d=c.handler,c=c.type);if(!c||typeof c=="string"&&c.charAt(0)==="."){c=c||"";for(h in t)f.event.remove(a,h+c);return}c=c.split(" ");while(h=c[k++]){r=h,q=null,l=h.indexOf(".")<0,m=[],l||(m=h.split("."),h=m.shift(),n=new RegExp("(^|\\.)"+f.map(m.slice(0).sort(),D).join("\\.(?:.*\\.)?")+"(\\.|$)")),p=t[h];if(!p)continue;if(!d){for(j=0;j<p.length;j++){q=p[j];if(l||n.test(q.namespace))f.event.remove(a,r,q.handler,j),p.splice(j--,1)}continue}o=f.event.special[h]||{};for(j=e||0;j<p.length;j++){q=p[j];if(d.guid===q.guid){if(l||n.test(q.namespace))e==null&&p.splice(j--,1),o.remove&&o.remove.call(a,q);if(e!=null)break}}if(p.length===0||e!=null&&p.length===1)(!o.teardown||o.teardown.call(a,m)===!1)&&f.removeEvent(a,h,s.handle),g=null,delete t[h]}if(f.isEmptyObject(t)){var u=s.handle;u&&(u.elem=null),delete s.events,delete s.handle,f.isEmptyObject(s)&&f.removeData(a,b,!0)}}},customEvent:{getData:!0,setData:!0,changeData:!0},trigger:function(c,d,e,g){var h=c.type||c,i=[],j;h.indexOf("!")>=0&&(h=h.slice(0,-1),j=!0),h.indexOf(".")>=0&&(i=h.split("."),h=i.shift(),i.sort());if(!!e&&!f.event.customEvent[h]||!!f.event.global[h]){c=typeof c=="object"?c[f.expando]?c:new f.Event(h,c):new f.Event(h),c.type=h,c.exclusive=j,c.namespace=i.join("."),c.namespace_re=new RegExp("(^|\\.)"+i.join("\\.(?:.*\\.)?")+"(\\.|$)");if(g||!e)c.preventDefault(),c.stopPropagation();if(!e){f.each(f.cache,function(){var a=f.expando,b=this[a];b&&b.events&&b.events[h]&&f.event.trigger(c,d,b.handle.elem
-)});return}if(e.nodeType===3||e.nodeType===8)return;c.result=b,c.target=e,d=d?f.makeArray(d):[],d.unshift(c);var k=e,l=h.indexOf(":")<0?"on"+h:"";do{var m=f._data(k,"handle");c.currentTarget=k,m&&m.apply(k,d),l&&f.acceptData(k)&&k[l]&&k[l].apply(k,d)===!1&&(c.result=!1,c.preventDefault()),k=k.parentNode||k.ownerDocument||k===c.target.ownerDocument&&a}while(k&&!c.isPropagationStopped());if(!c.isDefaultPrevented()){var n,o=f.event.special[h]||{};if((!o._default||o._default.call(e.ownerDocument,c)===!1)&&(h!=="click"||!f.nodeName(e,"a"))&&f.acceptData(e)){try{l&&e[h]&&(n=e[l],n&&(e[l]=null),f.event.triggered=h,e[h]())}catch(p){}n&&(e[l]=n),f.event.triggered=b}}return c.result}},handle:function(c){c=f.event.fix(c||a.event);var d=((f._data(this,"events")||{})[c.type]||[]).slice(0),e=!c.exclusive&&!c.namespace,g=Array.prototype.slice.call(arguments,0);g[0]=c,c.currentTarget=this;for(var h=0,i=d.length;h<i;h++){var j=d[h];if(e||c.namespace_re.test(j.namespace)){c.handler=j.handler,c.data=j.data,c.handleObj=j;var k=j.handler.apply(this,g);k!==b&&(c.result=k,k===!1&&(c.preventDefault(),c.stopPropagation()));if(c.isImmediatePropagationStopped())break}}return c.result},props:"altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode layerX layerY metaKey newValue offsetX offsetY pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "),fix:function(a){if(a[f.expando])return a;var d=a;a=f.Event(d);for(var e=this.props.length,g;e;)g=this.props[--e],a[g]=d[g];a.target||(a.target=a.srcElement||c),a.target.nodeType===3&&(a.target=a.target.parentNode),!a.relatedTarget&&a.fromElement&&(a.relatedTarget=a.fromElement===a.target?a.toElement:a.fromElement);if(a.pageX==null&&a.clientX!=null){var h=a.target.ownerDocument||c,i=h.documentElement,j=h.body;a.pageX=a.clientX+(i&&i.scrollLeft||j&&j.scrollLeft||0)-(i&&i.clientLeft||j&&j.clientLeft||0),a.pageY=a.clientY+(i&&i.scrollTop||j&&j.scrollTop||0)-(i&&i.clientTop||j&&j.clientTop||0)}a.which==null&&(a.charCode!=null||a.keyCode!=null)&&(a.which=a.charCode!=null?a.charCode:a.keyCode),!a.metaKey&&a.ctrlKey&&(a.metaKey=a.ctrlKey),!a.which&&a.button!==b&&(a.which=a.button&1?1:a.button&2?3:a.button&4?2:0);return a},guid:1e8,proxy:f.proxy,special:{ready:{setup:f.bindReady,teardown:f.noop},live:{add:function(a){f.event.add(this,O(a.origType,a.selector),f.extend({},a,{handler:N,guid:a.handler.guid}))},remove:function(a){f.event.remove(this,O(a.origType,a.selector),a)}},beforeunload:{setup:function(a,b,c){f.isWindow(this)&&(this.onbeforeunload=c)},teardown:function(a,b){this.onbeforeunload===b&&(this.onbeforeunload=null)}}}},f.removeEvent=c.removeEventListener?function(a,b,c){a.removeEventListener&&a.removeEventListener(b,c,!1)}:function(a,b,c){a.detachEvent&&a.detachEvent("on"+b,c)},f.Event=function(a,b){if(!this.preventDefault)return new f.Event(a,b);a&&a.type?(this.originalEvent=a,this.type=a.type,this.isDefaultPrevented=a.defaultPrevented||a.returnValue===!1||a.getPreventDefault&&a.getPreventDefault()?F:E):this.type=a,b&&f.extend(this,b),this.timeStamp=f.now(),this[f.expando]=!0},f.Event.prototype={preventDefault:function(){this.isDefaultPrevented=F;var a=this.originalEvent;!a||(a.preventDefault?a.preventDefault():a.returnValue=!1)},stopPropagation:function(){this.isPropagationStopped=F;var a=this.originalEvent;!a||(a.stopPropagation&&a.stopPropagation(),a.cancelBubble=!0)},stopImmediatePropagation:function(){this.isImmediatePropagationStopped=F,this.stopPropagation()},isDefaultPrevented:E,isPropagationStopped:E,isImmediatePropagationStopped:E};var G=function(a){var b=a.relatedTarget;a.type=a.data;try{if(b&&b!==c&&!b.parentNode)return;while(b&&b!==this)b=b.parentNode;b!==this&&f.event.handle.apply(this,arguments)}catch(d){}},H=function(a){a.type=a.data,f.event.handle.apply(this,arguments)};f.each({mouseenter:"mouseover",mouseleave:"mouseout"},function(a,b){f.event.special[a]={setup:function(c){f.event.add(this,b,c&&c.selector?H:G,a)},teardown:function(a){f.event.remove(this,b,a&&a.selector?H:G)}}}),f.support.submitBubbles||(f.event.special.submit={setup:function(a,b){if(!f.nodeName(this,"form"))f.event.add(this,"click.specialSubmit",function(a){var b=a.target,c=b.type;(c==="submit"||c==="image")&&f(b).closest("form").length&&L("submit",this,arguments)}),f.event.add(this,"keypress.specialSubmit",function(a){var b=a.target,c=b.type;(c==="text"||c==="password")&&f(b).closest("form").length&&a.keyCode===13&&L("submit",this,arguments)});else return!1},teardown:function(a){f.event.remove(this,".specialSubmit")}});if(!f.support.changeBubbles){var I,J=function(a){var b=a.type,c=a.value;b==="radio"||b==="checkbox"?c=a.checked:b==="select-multiple"?c=a.selectedIndex>-1?f.map(a.options,function(a){return a.selected}).join("-"):"":f.nodeName(a,"select")&&(c=a.selectedIndex);return c},K=function(c){var d=c.target,e,g;if(!!z.test(d.nodeName)&&!d.readOnly){e=f._data(d,"_change_data"),g=J(d),(c.type!=="focusout"||d.type!=="radio")&&f._data(d,"_change_data",g);if(e===b||g===e)return;if(e!=null||g)c.type="change",c.liveFired=b,f.event.trigger(c,arguments[1],d)}};f.event.special.change={filters:{focusout:K,beforedeactivate:K,click:function(a){var b=a.target,c=f.nodeName(b,"input")?b.type:"";(c==="radio"||c==="checkbox"||f.nodeName(b,"select"))&&K.call(this,a)},keydown:function(a){var b=a.target,c=f.nodeName(b,"input")?b.type:"";(a.keyCode===13&&!f.nodeName(b,"textarea")||a.keyCode===32&&(c==="checkbox"||c==="radio")||c==="select-multiple")&&K.call(this,a)},beforeactivate:function(a){var b=a.target;f._data(b,"_change_data",J(b))}},setup:function(a,b){if(this.type==="file")return!1;for(var c in I)f.event.add(this,c+".specialChange",I[c]);return z.test(this.nodeName)},teardown:function(a){f.event.remove(this,".specialChange");return z.test(this.nodeName)}},I=f.event.special.change.filters,I.focus=I.beforeactivate}f.support.focusinBubbles||f.each({focus:"focusin",blur:"focusout"},function(a,b){function e(a){var c=f.event.fix(a);c.type=b,c.originalEvent={},f.event.trigger(c,null,c.target),c.isDefaultPrevented()&&a.preventDefault()}var d=0;f.event.special[b]={setup:function(){d++===0&&c.addEventListener(a,e,!0)},teardown:function(){--d===0&&c.removeEventListener(a,e,!0)}}}),f.each(["bind","one"],function(a,c){f.fn[c]=function(a,d,e){var g;if(typeof a=="object"){for(var h in a)this[c](h,d,a[h],e);return this}if(arguments.length===2||d===!1)e=d,d=b;c==="one"?(g=function(a){f(this).unbind(a,g);return e.apply(this,arguments)},g.guid=e.guid||f.guid++):g=e;if(a==="unload"&&c!=="one")this.one(a,d,e);else for(var i=0,j=this.length;i<j;i++)f.event.add(this[i],a,g,d);return this}}),f.fn.extend({unbind:function(a,b){if(typeof a=="object"&&!a.preventDefault)for(var c in a)this.unbind(c,a[c]);else for(var d=0,e=this.length;d<e;d++)f.event.remove(this[d],a,b);return this},delegate:function(a,b,c,d){return this.live(b,c,d,a)},undelegate:function(a,b,c){return arguments.length===0?this.unbind("live"):this.die(b,null,c,a)},trigger:function(a,b){return this.each(function(){f.event.trigger(a,b,this)})},triggerHandler:function(a,b){if(this[0])return f.event.trigger(a,b,this[0],!0)},toggle:function(a){var b=arguments,c=a.guid||f.guid++,d=0,e=function(c){var e=(f.data(this,"lastToggle"+a.guid)||0)%d;f.data(this,"lastToggle"+a.guid,e+1),c.preventDefault();return b[e].apply(this,arguments)||!1};e.guid=c;while(d<b.length)b[d++].guid=c;return this.click(e)},hover:function(a,b){return this.mouseenter(a).mouseleave(b||a)}});var M={focus:"focusin",blur:"focusout",mouseenter:"mouseover",mouseleave:"mouseout"};f.each(["live","die"],function(a,c){f.fn[c]=function(a,d,e,g){var h,i=0,j,k,l,m=g||this.selector,n=g?this:f(this.context);if(typeof a=="object"&&!a.preventDefault){for(var o in a)n[c](o,d,a[o],m);return this}if(c==="die"&&!a&&g&&g.charAt(0)==="."){n.unbind(g);return this}if(d===!1||f.isFunction(d))e=d||E,d=b;a=(a||"").split(" ");while((h=a[i++])!=null){j=y.exec(h),k="",j&&(k=j[0],h=h.replace(y,""));if(h==="hover"){a.push("mouseenter"+k,"mouseleave"+k);continue}l=h,M[h]?(a.push(M[h]+k),h=h+k):h=(M[h]||h)+k;if(c==="live")for(var p=0,q=n.length;p<q;p++)f.event.add(n[p],"live."+O(h,m),{data:d,selector:m,handler:e,origType:h,origHandler:e,preType:l});else n.unbind("live."+O(h,m),e)}return this}}),f.each("blur focus focusin focusout load resize scroll unload click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup error".split(" "),function(a,b){f.fn[b]=function(a,c){c==null&&(c=a,a=null);return arguments.length>0?this.bind(b,a,c):this.trigger(b)},f.attrFn&&(f.attrFn[b]=!0)}),function(){function u(a,b,c,d,e,f){for(var g=0,h=d.length;g<h;g++){var i=d[g];if(i){var j=!1;i=i[a];while(i){if(i.sizcache===c){j=d[i.sizset];break}if(i.nodeType===1){f||(i.sizcache=c,i.sizset=g);if(typeof b!="string"){if(i===b){j=!0;break}}else if(k.filter(b,[i]).length>0){j=i;break}}i=i[a]}d[g]=j}}}function t(a,b,c,d,e,f){for(var g=0,h=d.length;g<h;g++){var i=d[g];if(i){var j=!1;i=i[a];while(i){if(i.sizcache===c){j=d[i.sizset];break}i.nodeType===1&&!f&&(i.sizcache=c,i.sizset=g);if(i.nodeName.toLowerCase()===b){j=i;break}i=i[a]}d[g]=j}}}var a=/((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,d=0,e=Object.prototype.toString,g=!1,h=!0,i=/\\/g,j=/\W/;[0,0].sort(function(){h=!1;return 0});var k=function(b,d,f,g){f=f||[],d=d||c;var h=d;if(d.nodeType!==1&&d.nodeType!==9)return[];if(!b||typeof b!="string")return f;var i,j,n,o,q,r,s,t,u=!0,w=k.isXML(d),x=[],y=b;do{a.exec(""),i=a.exec(y);if(i){y=i[3],x.push(i[1]);if(i[2]){o=i[3];break}}}while(i);if(x.length>1&&m.exec(b))if(x.length===2&&l.relative[x[0]])j=v(x[0]+x[1],d);else{j=l.relative[x[0]]?[d]:k(x.shift(),d);while(x.length)b=x.shift(),l.relative[b]&&(b+=x.shift()),j=v(b,j)}else{!g&&x.length>1&&d.nodeType===9&&!w&&l.match.ID.test(x[0])&&!l.match.ID.test(x[x.length-1])&&(q=k.find(x.shift(),d,w),d=q.expr?k.filter(q.expr,q.set)[0]:q.set[0]);if(d){q=g?{expr:x.pop(),set:p(g)}:k.find(x.pop(),x.length===1&&(x[0]==="~"||x[0]==="+")&&d.parentNode?d.parentNode:d,w),j=q.expr?k.filter(q.expr,q.set):q.set,x.length>0?n=p(j):u=!1;while(x.length)r=x.pop(),s=r,l.relative[r]?s=x.pop():r="",s==null&&(s=d),l.relative[r](n,s,w)}else n=x=[]}n||(n=j),n||k.error(r||b);if(e.call(n)==="[object Array]")if(!u)f.push.apply(f,n);else if(d&&d.nodeType===1)for(t=0;n[t]!=null;t++)n[t]&&(n[t]===!0||n[t].nodeType===1&&k.contains(d,n[t]))&&f.push(j[t]);else for(t=0;n[t]!=null;t++)n[t]&&n[t].nodeType===1&&f.push(j[t]);else p(n,f);o&&(k(o,h,f,g),k.uniqueSort(f));return f};k.uniqueSort=function(a){if(r){g=h,a.sort(r);if(g)for(var b=1;b<a.length;b++)a[b]===a[b-1]&&a.splice(b--,1)}return a},k.matches=function(a,b){return k(a,null,null,b)},k.matchesSelector=function(a,b){return k(b,null,null,[a]).length>0},k.find=function(a,b,c){var d;if(!a)return[];for(var e=0,f=l.order.length;e<f;e++){var g,h=l.order[e];if(g=l.leftMatch[h].exec(a)){var j=g[1];g.splice(1,1);if(j.substr(j.length-1)!=="\\"){g[1]=(g[1]||"").replace(i,""),d=l.find[h](g,b,c);if(d!=null){a=a.replace(l.match[h],"");break}}}}d||(d=typeof b.getElementsByTagName!="undefined"?b.getElementsByTagName("*"):[]);return{set:d,expr:a}},k.filter=function(a,c,d,e){var f,g,h=a,i=[],j=c,m=c&&c[0]&&k.isXML(c[0]);while(a&&c.length){for(var n in l.filter)if((f=l.leftMatch[n].exec(a))!=null&&f[2]){var o,p,q=l.filter[n],r=f[1];g=!1,f.splice(1,1);if(r.substr(r.length-1)==="\\")continue;j===i&&(i=[]);if(l.preFilter[n]){f=l.preFilter[n](f,j,d,i,e,m);if(!f)g=o=!0;else if(f===!0)continue}if(f)for(var s=0;(p=j[s])!=null;s++)if(p){o=q(p,f,s,j);var t=e^!!o;d&&o!=null?t?g=!0:j[s]=!1:t&&(i.push(p),g=!0)}if(o!==b){d||(j=i),a=a.replace(l.match[n],"");if(!g)return[];break}}if(a===h)if(g==null)k.error(a);else break;h=a}return j},k.error=function(a){throw"Syntax error, unrecognized expression: "+a};var l=k.selectors={order:["ID","NAME","TAG"],match:{ID:/#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,CLASS:/\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,NAME:/\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/,ATTR:/\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(?:(['"])(.*?)\3|(#?(?:[\w\u00c0-\uFFFF\-]|\\.)*)|)|)\s*\]/,TAG:/^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/,CHILD:/:(only|nth|last|first)-child(?:\(\s*(even|odd|(?:[+\-]?\d+|(?:[+\-]?\d*)?n\s*(?:[+\-]\s*\d+)?))\s*\))?/,POS:/:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/,PSEUDO:/:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/},leftMatch:{},attrMap:{"class":"className","for":"htmlFor"},attrHandle:{href:function(a){return a.getAttribute("href")},type:function(a){return a.getAttribute("type")}},relative:{"+":function(a,b){var c=typeof b=="string",d=c&&!j.test(b),e=c&&!d;d&&(b=b.toLowerCase());for(var f=0,g=a.length,h;f<g;f++)if(h=a[f]){while((h=h.previousSibling)&&h.nodeType!==1);a[f]=e||h&&h.nodeName.toLowerCase()===b?h||!1:h===b}e&&k.filter(b,a,!0)},">":function(a,b){var c,d=typeof b=="string",e=0,f=a.length;if(d&&!j.test(b)){b=b.toLowerCase();for(;e<f;e++){c=a[e];if(c){var g=c.parentNode;a[e]=g.nodeName.toLowerCase()===b?g:!1}}}else{for(;e<f;e++)c=a[e],c&&(a[e]=d?c.parentNode:c.parentNode===b);d&&k.filter(b,a,!0)}},"":function(a,b,c){var e,f=d++,g=u;typeof b=="string"&&!j.test(b)&&(b=b.toLowerCase(),e=b,g=t),g("parentNode",b,f,a,e,c)},"~":function(a,b,c){var e,f=d++,g=u;typeof b=="string"&&!j.test(b)&&(b=b.toLowerCase(),e=b,g=t),g("previousSibling",b,f,a,e,c)}},find:{ID:function(a,b,c){if(typeof b.getElementById!="undefined"&&!c){var d=b.getElementById(a[1]);return d&&d.parentNode?[d]:[]}},NAME:function(a,b){if(typeof b.getElementsByName!="undefined"){var c=[],d=b.getElementsByName(a[1]);for(var e=0,f=d.length;e<f;e++)d[e].getAttribute("name")===a[1]&&c.push(d[e]);return c.length===0?null:c}},TAG:function(a,b){if(typeof b.getElementsByTagName!="undefined")return b.getElementsByTagName(a[1])}},preFilter:{CLASS:function(a,b,c,d,e,f){a=" "+a[1].replace(i,"")+" ";if(f)return a;for(var g=0,h;(h=b[g])!=null;g++)h&&(e^(h.className&&(" "+h.className+" ").replace(/[\t\n\r]/g," ").indexOf(a)>=0)?c||d.push(h):c&&(b[g]=!1));return!1},ID:function(a){return a[1].replace(i,"")},TAG:function(a,b){return a[1].replace(i,"").toLowerCase()},CHILD:function(a){if(a[1]==="nth"){a[2]||k.error(a[0]),a[2]=a[2].replace(/^\+|\s*/g,"");var b=/(-?)(\d*)(?:n([+\-]?\d*))?/.exec(a[2]==="even"&&"2n"||a[2]==="odd"&&"2n+1"||!/\D/.test(a[2])&&"0n+"+a[2]||a[2]);a[2]=b[1]+(b[2]||1)-0,a[3]=b[3]-0}else a[2]&&k.error(a[0]);a[0]=d++;return a},ATTR:function(a,b,c,d,e,f){var g=a[1]=a[1].replace(i,"");!f&&l.attrMap[g]&&(a[1]=l.attrMap[g]),a[4]=(a[4]||a[5]||"").replace(i,""),a[2]==="~="&&(a[4]=" "+a[4]+" ");return a},PSEUDO:function(b,c,d,e,f){if(b[1]==="not")if((a.exec(b[3])||"").length>1||/^\w/.test(b[3]))b[3]=k(b[3],null,null,c);else{var g=k.filter(b[3],c,d,!0^f);d||e.push.apply(e,g);return!1}else if(l.match.POS.test(b[0])||l.match.CHILD.test(b[0]))return!0;return b},POS:function(a){a.unshift(!0);return a}},filters:{enabled:function(a){return a.disabled===!1&&a.type!=="hidden"},disabled:function(a){return a.disabled===!0},checked:function(a){return a.checked===!0},selected:function(a){a.parentNode&&a.parentNode.selectedIndex;return a.selected===!0},parent:function(a){return!!a.firstChild},empty:function(a){return!a.firstChild},has:function(a,b,c){return!!k(c[3],a).length},header:function(a){return/h\d/i.test(a.nodeName)},text:function(a){var b=a.getAttribute("type"),c=a.type;return a.nodeName.toLowerCase()==="input"&&"text"===c&&(b===c||b===null)},radio:function(a){return a.nodeName.toLowerCase()==="input"&&"radio"===a.type},checkbox:function(a){return a.nodeName.toLowerCase()==="input"&&"checkbox"===a.type},file:function(a){return a.nodeName.toLowerCase()==="input"&&"file"===a.type},password:function(a){return a.nodeName.toLowerCase()==="input"&&"password"===a.type},submit:function(a){var b=a.nodeName.toLowerCase();return(b==="input"||b==="button")&&"submit"===a.type},image:function(a){return a.nodeName.toLowerCase()==="input"&&"image"===a.type},reset:function(a){var b=a.nodeName.toLowerCase();return(b==="input"||b==="button")&&"reset"===a.type},button:function(a){var b=a.nodeName.toLowerCase();return b==="input"&&"button"===a.type||b==="button"},input:function(a){return/input|select|textarea|button/i.test(a.nodeName)},focus:function(a){return a===a.ownerDocument.activeElement}},setFilters:{first:function(a,b){return b===0},last:function(a,b,c,d){return b===d.length-1},even:function(a,b){return b%2===0},odd:function(a,b){return b%2===1},lt:function(a,b,c){return b<c[3]-0},gt:function(a,b,c){return b>c[3]-0},nth:function(a,b,c){return c[3]-0===b},eq:function(a,b,c){return c[3]-0===b}},filter:{PSEUDO:function(a,b,c,d){var e=b[1],f=l.filters[e];if(f)return f(a,c,b,d);if(e==="contains")return(a.textContent||a.innerText||k.getText([a])||"").indexOf(b[3])>=0;if(e==="not"){var g=b[3];for(var h=0,i=g.length;h<i;h++)if(g[h]===a)return!1;return!0}k.error(e)},CHILD:function(a,b){var c=b[1],d=a;switch(c){case"only":case"first":while(d=d.previousSibling)if(d.nodeType===1)return!1;if(c==="first")return!0;d=a;case"last":while(d=d.nextSibling)if(d.nodeType===1)return!1;return!0;case"nth":var e=b[2],f=b[3];if(e===1&&f===0)return!0;var g=b[0],h=a.parentNode;if(h&&(h.sizcache!==g||!a.nodeIndex)){var i=0;for(d=h.firstChild;d;d=d.nextSibling)d.nodeType===1&&(d.nodeIndex=++i);h.sizcache=g}var j=a.nodeIndex-f;return e===0?j===0:j%e===0&&j/e>=0}},ID:function(a,b){return a.nodeType===1&&a.getAttribute("id")===b},TAG:function(a,b){return b==="*"&&a.nodeType===1||a.nodeName.toLowerCase()===b},CLASS:function(a,b){return(" "+(a.className||a.getAttribute("class"))+" ").indexOf(b)>-1},ATTR:function(a,b){var c=b[1],d=l.attrHandle[c]?l.attrHandle[c](a):a[c]!=null?a[c]:a.getAttribute(c),e=d+"",f=b[2],g=b[4];return d==null?f==="!=":f==="="?e===g:f==="*="?e.indexOf(g)>=0:f==="~="?(" "+e+" ").indexOf(g)>=0:g?f==="!="?e!==g:f==="^="?e.indexOf(g)===0:f==="$="?e.substr(e.length-g.length)===g:f==="|="?e===g||e.substr(0,g.length+1)===g+"-":!1:e&&d!==!1},POS:function(a,b,c,d){var e=b[2],f=l.setFilters[e];if(f)return f(a,c,b,d)}}},m=l.match.POS,n=function(a,b){return"\\"+(b-0+1)};for(var o in l.match)l.match[o]=new RegExp(l.match[o].source+/(?![^\[]*\])(?![^\(]*\))/.source),l.leftMatch[o]=new RegExp(/(^(?:.|\r|\n)*?)/.source+l.match[o].source.replace(/\\(\d+)/g,n));var p=function(a,b){a=Array.prototype.slice.call(a,0);if(b){b.push.apply(b,a);return b}return a};try{Array.prototype.slice.call(c.documentElement.childNodes,0)[0].nodeType}catch(q){p=function(a,b){var c=0,d=b||[];if(e.call(a)==="[object Array]")Array.prototype.push.apply(d,a);else if(typeof a.length=="number")for(var f=a.length;c<f;c++)d.push(a[c]);else for(;a[c];c++)d.push(a[c]);return d}}var r,s;c.documentElement.compareDocumentPosition?r=function(a,b){if(a===b){g=!0;return 0}if(!a.compareDocumentPosition||!b.compareDocumentPosition)return a.compareDocumentPosition?-1:1;return a.compareDocumentPosition(b)&4?-1:1}:(r=function(a,b){if(a===b){g=!0;return 0}if(a.sourceIndex&&b.sourceIndex)return a.sourceIndex-b.sourceIndex;var c,d,e=[],f=[],h=a.parentNode,i=b.parentNode,j=h;if(h===i)return s(a,b);if(!h)return-1;if(!i)return 1;while(j)e.unshift(j),j=j.parentNode;j=i;while(j)f.unshift(j),j=j.parentNode;c=e.length,d=f.length;for(var k=0;k<c&&k<d;k++)if(e[k]!==f[k])return s(e[k],f[k]);return k===c?s(a,f[k],-1):s(e[k],b,1)},s=function(a,b,c){if(a===b)return c;var d=a.nextSibling;while(d){if(d===b)return-1;d=d.nextSibling}return 1}),k.getText=function(a){var b="",c;for(var d=0;a[d];d++)c=a[d],c.nodeType===3||c.nodeType===4?b+=c.nodeValue:c.nodeType!==8&&(b+=k.getText(c.childNodes));return b},function(){var a=c.createElement("div"),d="script"+(new Date).getTime(),e=c.documentElement;a.innerHTML="<a name='"+d+"'/>",e.insertBefore(a,e.firstChild),c.getElementById(d)&&(l.find.ID=function(a,c,d){if(typeof c.getElementById!="undefined"&&!d){var e=c.getElementById(a[1]);return e?e.id===a[1]||typeof e.getAttributeNode!="undefined"&&e.getAttributeNode("id").nodeValue===a[1]?[e]:b:[]}},l.filter.ID=function(a,b){var c=typeof a.getAttributeNode!="undefined"&&a.getAttributeNode("id");return a.nodeType===1&&c&&c.nodeValue===b}),e.removeChild(a),e=a=null}(),function(){var a=c.createElement("div");a.appendChild(c.createComment("")),a.getElementsByTagName("*").length>0&&(l.find.TAG=function(a,b){var c=b.getElementsByTagName(a[1]);if(a[1]==="*"){var d=[];for(var e=0;c[e];e++)c[e].nodeType===1&&d.push(c[e]);c=d}return c}),a.innerHTML="<a href='#'></a>",a.firstChild&&typeof a.firstChild.getAttribute!="undefined"&&a.firstChild.getAttribute("href")!=="#"&&(l.attrHandle.href=function(a){return a.getAttribute("href",2)}),a=null}(),c.querySelectorAll&&function(){var a=k,b=c.createElement("div"),d="__sizzle__";b.innerHTML="<p class='TEST'></p>";if(!b.querySelectorAll||b.querySelectorAll(".TEST").length!==0){k=function(b,e,f,g){e=e||c;if(!g&&!k.isXML(e)){var h=/^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec(b);if(h&&(e.nodeType===1||e.nodeType===9)){if(h[1])return p(e.getElementsByTagName(b),f);if(h[2]&&l.find.CLASS&&e.getElementsByClassName)return p(e.getElementsByClassName(h[2]),f)}if(e.nodeType===9){if(b==="body"&&e.body)return p([e.body],f);if(h&&h[3]){var i=e.getElementById(h[3]);if(!i||!i.parentNode)return p([],f);if(i.id===h[3])return p([i],f)}try{return p(e.querySelectorAll(b),f)}catch(j){}}else if(e.nodeType===1&&e.nodeName.toLowerCase()!=="object"){var m=e,n=e.getAttribute("id"),o=n||d,q=e.parentNode,r=/^\s*[+~]/.test(b);n?o=o.replace(/'/g,"\\$&"):e.setAttribute("id",o),r&&q&&(e=e.parentNode);try{if(!r||q)return p(e.querySelectorAll("[id='"+o+"'] "+b),f)}catch(s){}finally{n||m.removeAttribute("id")}}}return a(b,e,f,g)};for(var e in a)k[e]=a[e];b=null}}(),function(){var a=c.documentElement,b=a.matchesSelector||a.mozMatchesSelector||a.webkitMatchesSelector||a.msMatchesSelector;if(b){var d=!b.call(c.createElement("div"),"div"),e=!1;try{b.call(c.documentElement,"[test!='']:sizzle")}catch(f){e=!0}k.matchesSelector=function(a,c){c=c.replace(/\=\s*([^'"\]]*)\s*\]/g,"='$1']");if(!k.isXML(a))try{if(e||!l.match.PSEUDO.test(c)&&!/!=/.test(c)){var f=b.call(a,c);if(f||!d||a.document&&a.document.nodeType!==11)return f}}catch(g){}return k(c,null,null,[a]).length>0}}}(),function(){var a=c.createElement("div");a.innerHTML="<div class='test e'></div><div class='test'></div>";if(!!a.getElementsByClassName&&a.getElementsByClassName("e").length!==0){a.lastChild.className="e";if(a.getElementsByClassName("e").length===1)return;l.order.splice(1,0,"CLASS"),l.find.CLASS=function(a,b,c){if(typeof b.getElementsByClassName!="undefined"&&!c)return b.getElementsByClassName(a[1])},a=null}}(),c.documentElement.contains?k.contains=function(a,b){return a!==b&&(a.contains?a.contains(b):!0)}:c.documentElement.compareDocumentPosition?k.contains=function(a,b){return!!(a.compareDocumentPosition(b)&16)}:k.contains=function(){return!1},k.isXML=function(a){var b=(a?a.ownerDocument||a:0).documentElement;return b?b.nodeName!=="HTML":!1};var v=function(a,b){var c,d=[],e="",f=b.nodeType?[b]:b;while(c=l.match.PSEUDO.exec(a))e+=c[0],a=a.replace(l.match.PSEUDO,"");a=l.relative[a]?a+"*":a;for(var g=0,h=f.length;g<h;g++)k(a,f[g],d);return k.filter(e,d)};f.find=k,f.expr=k.selectors,f.expr[":"]=f.expr.filters,f.unique=k.uniqueSort,f.text=k.getText,f.isXMLDoc=k.isXML,f.contains=k.contains}();var P=/Until$/,Q=/^(?:parents|prevUntil|prevAll)/,R=/,/,S=/^.[^:#\[\.,]*$/,T=Array.prototype.slice,U=f.expr.match.POS,V={children:!0,contents:!0,next:!0,prev:!0};f.fn.extend({find:function(a){var b=this,c,d;if(typeof a!="string")return f(a).filter(function(){for(c=0,d=b.length;c<d;c++)if(f.contains(b[c],this))return!0});var e=this.pushStack("","find",a),g,h,i;for(c=0,d=this.length;c<d;c++){g=e.length,f.find(a,this[c],e);if(c>0)for(h=g;h<e.length;h++)for(i=0;i<g;i++)if(e[i]===e[h]){e.splice(h--,1);break}}return e},has:function(a){var b=f(a);return this.filter(function(){for(var a=0,c=b.length;a<c;a++)if(f.contains(this,b[a]))return!0})},not:function(a){return this.pushStack(X(this,a,!1),"not",a)},filter:function(a){return this.pushStack(X(this,a,!0),"filter",a)},is:function(a){return!!a&&(typeof a=="string"?f.filter(a,this).length>0:this.filter(a).length>0)},closest:function(a,b){var c=[],d,e,g=this[0];if(f.isArray(a)){var h,i,j={},k=1;if(g&&a.length){for(d=0,e=a.length;d<e;d++)i=a[d],j[i]||(j[i]=U.test(i)?f(i,b||this.context):i);while(g&&g.ownerDocument&&g!==b){for(i in j)h=j[i],(h.jquery?h.index(g)>-1:f(g).is(h))&&c.push({selector:i,elem:g,level:k});g=g.parentNode,k++}}return c}var l=U.test(a)||typeof a!="string"?f(a,b||this.context):0;for(d=0,e=this.length;d<e;d++){g=this[d];while(g){if(l?l.index(g)>-1:f.find.matchesSelector(g,a)){c.push(g);break}g=g.parentNode;if(!g||!g.ownerDocument||g===b||g.nodeType===11)break}}c=c.length>1?f.unique(c):c;return this.pushStack(c,"closest",a)},index:function(a){if(!a||typeof a=="string")return f.inArray(this[0],a?f(a):this.parent().children());return f.inArray(a.jquery?a[0]:a,this)},add:function(a,b){var c=typeof a=="string"?f(a,b):f.makeArray(a&&a.nodeType?[a]:a),d=f.merge(this.get(),c);return this.pushStack(W(c[0])||W(d[0])?d:f.unique(d))},andSelf:function(){return this.add(this.prevObject)}}),f.each({parent:function(a){var b=a.parentNode;return b&&b.nodeType!==11?b:null},parents:function(a){return f.dir(a,"parentNode")},parentsUntil:function(a,b,c){return f.dir(a,"parentNode",c)},next:function(a){return f.nth(a,2,"nextSibling")},prev:function(a){return f.nth(a,2,"previousSibling")},nextAll:function(a){return f.dir(a,"nextSibling")},prevAll:function(a){return f.dir(a,"previousSibling")},nextUntil:function(a,b,c){return f.dir(a,"nextSibling",c)},prevUntil:function(a,b,c){return f.dir(a,"previousSibling",c)},siblings:function(a){return f.sibling(a.parentNode.firstChild,a)},children:function(a){return f.sibling(a.firstChild)},contents:function(a){return f.nodeName(a,"iframe")?a.contentDocument||a.contentWindow.document:f.makeArray(a.childNodes)}},function(a,b){f.fn[a]=function(c,d){var e=f.map(this,b,c),g=T.call(arguments);P.test(a)||(d=c),d&&typeof d=="string"&&(e=f.filter(d,e)),e=this.length>1&&!V[a]?f.unique(e):e,(this.length>1||R.test(d))&&Q.test(a)&&(e=e.reverse());return this.pushStack(e,a,g.join(","))}}),f.extend({filter:function(a,b,c){c&&(a=":not("+a+")");return b.length===1?f.find.matchesSelector(b[0],a)?[b[0]]:[]:f.find.matches(a,b)},dir:function(a,c,d){var e=[],g=a[c];while(g&&g.nodeType!==9&&(d===b||g.nodeType!==1||!f(g).is(d)))g.nodeType===1&&e.push(g),g=g[c];return e},nth:function(a,b,c,d){b=b||1;var e=0;for(;a;a=a[c])if(a.nodeType===1&&++e===b)break;return a},sibling:function(a,b){var c=[];for(;a;a=a.nextSibling)a.nodeType===1&&a!==b&&c.push(a);return c}});var Y=/ jQuery\d+="(?:\d+|null)"/g,Z=/^\s+/,$=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig,_=/<([\w:]+)/,ba=/<tbody/i,bb=/<|&#?\w+;/,bc=/<(?:script|object|embed|option|style)/i,bd=/checked\s*(?:[^=]|=\s*.checked.)/i,be=/\/(java|ecma)script/i,bf=/^\s*<!(?:\[CDATA\[|\-\-)/,bg={option:[1,"<select multiple='multiple'>","</select>"],legend:[1,"<fieldset>","</fieldset>"],thead:[1,"<table>","</table>"],tr:[2,"<table><tbody>","</tbody></table>"],td:[3,"<table><tbody><tr>","</tr></tbody></table>"],col:[2,"<table><tbody></tbody><colgroup>","</colgroup></table>"],area:[1,"<map>","</map>"],_default:[0,"",""]};bg.optgroup=bg.option,bg.tbody=bg.tfoot=bg.colgroup=bg.caption=bg.thead,bg.th=bg.td,f.support.htmlSerialize||(bg._default=[1,"div<div>","</div>"]),f.fn.extend({text:function(a){if(f.isFunction(a))return this.each(function(b){var c=f(this);c.text(a.call(this,b,c.text()))});if(typeof a!="object"&&a!==b)return this.empty().append((this[0]&&this[0].ownerDocument||c).createTextNode(a));return f.text(this)},wrapAll:function(a){if(f.isFunction(a))return this.each(function(b){f(this).wrapAll(a.call(this,b))});if(this[0]){var b=f(a,this[0].ownerDocument).eq(0).clone(!0);this[0].parentNode&&b.insertBefore(this[0]),b.map(function(){var a=this;while(a.firstChild&&a.firstChild.nodeType===1)a=a.firstChild;return a}).append(this)}return this},wrapInner:function(a){if(f.isFunction(a))return this.each(function(b){f(this).wrapInner(a.call(this,b))});return this.each(function(){var b=f(this),c=b.contents();c.length?c.wrapAll(a):b.append(a)})},wrap:function(a){return this.each(function(){f(this).wrapAll(a)})},unwrap:function(){return this.parent().each(function(){f.nodeName(this,"body")||f(this).replaceWith(this.childNodes)}).end()},append:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.appendChild(a)})},prepend:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.insertBefore(a,this.firstChild)})},before:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this)});if(arguments.length){var a=f(arguments[0]);a.push.apply(a,this.toArray());return this.pushStack(a,"before",arguments)}},after:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this.nextSibling)});if(arguments.length){var a=this.pushStack(this,"after",arguments);a.push.apply(a,f(arguments[0]).toArray());return a}},remove:function(a,b){for(var c=0,d;(d=this[c])!=null;c++)if(!a||f.filter(a,[d]).length)!b&&d.nodeType===1&&(f.cleanData(d.getElementsByTagName("*")),f.cleanData([d])),d.parentNode&&d.parentNode.removeChild(d);return this},empty:function(){for(var a=0,b;(b=this[a])!=null;a++){b.nodeType===1&&f.cleanData(b.getElementsByTagName("*"));while(b.firstChild)b.removeChild(b.firstChild)}return this},clone:function(a,b){a=a==null?!1:a,b=b==null?a:b;return this.map(function(){return f.clone(this,a,b)})},html:function(a){if(a===b)return this[0]&&this[0].nodeType===1?this[0].innerHTML.replace(Y,""):null;if(typeof a=="string"&&!bc.test(a)&&(f.support.leadingWhitespace||!Z.test(a))&&!bg[(_.exec(a)||["",""])[1].toLowerCase()]){a=a.replace($,"<$1></$2>");try{for(var c=0,d=this.length;c<d;c++)this[c].nodeType===1&&(f.cleanData(this[c].getElementsByTagName("*")),this[c].innerHTML=a)}catch(e){this.empty().append(a)}}else f.isFunction(a)?this.each(function(b){var c=f(this);c.html(a.call(this,b,c.html()))}):this.empty().append(a);return this},replaceWith:function(a){if(this[0]&&this[0].parentNode){if(f.isFunction(a))return this.each(function(b){var c=f(this),d=c.html();c.replaceWith(a.call(this,b,d))});typeof a!="string"&&(a=f(a).detach());return this.each(function(){var b=this.nextSibling,c=this.parentNode;f(this).remove(),b?f(b).before(a):f(c).append(a)})}return this.length?this.pushStack(f(f.isFunction(a)?a():a),"replaceWith",a):this},detach:function(a){return this.remove(a,!0)},domManip:function(a,c,d){var e,g,h,i,j=a[0],k=[];if(!f.support.checkClone&&arguments.length===3&&typeof j=="string"&&bd.test(j))return this.each(function(){f(this).domManip(a,c,d,!0)});if(f.isFunction(j))return this.each(function(e){var g=f(this);a[0]=j.call(this,e,c?g.html():b),g.domManip(a,c,d)});if(this[0]){i=j&&j.parentNode,f.support.parentNode&&i&&i.nodeType===11&&i.childNodes.length===this.length?e={fragment:i}:e=f.buildFragment(a,this,k),h=e.fragment,h.childNodes.length===1?g=h=h.firstChild:g=h.firstChild;if(g){c=c&&f.nodeName(g,"tr");for(var l=0,m=this.length,n=m-1;l<m;l++)d.call(c?bh(this[l],g):this[l],e.cacheable||m>1&&l<n?f.clone(h,!0,!0):h)}k.length&&f.each(k,bn)}return this}}),f.buildFragment=function(a,b,d){var e,g,h,i=b&&b[0]?b[0].ownerDocument||b[0]:c;a.length===1&&typeof a[0]=="string"&&a[0].length<512&&i===c&&a[0].charAt(0)==="<"&&!bc.test(a[0])&&(f.support.checkClone||!bd.test(a[0]))&&(g=!0,h=f.fragments[a[0]],h&&h!==1&&(e=h)),e||(e=i.createDocumentFragment(),f.clean(a,i,e,d)),g&&(f.fragments[a[0]]=h?e:1);return{fragment:e,cacheable:g}},f.fragments={},f.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(a,b){f.fn[a]=function(c){var d=[],e=f(c),g=this.length===1&&this[0].parentNode;if(g&&g.nodeType===11&&g.childNodes.length===1&&e.length===1){e[b](this[0]);return this}for(var h=0,i=e.length;h<i;h++){var j=(h>0?this.clone(!0):this).get();f(e[h])[b](j),d=d.concat(j)}return this.pushStack(d,a,e.selector)}}),f.extend({clone:function(a,b,c){var d=a.cloneNode(!0),e,g,h;if((!f.support.noCloneEvent||!f.support.noCloneChecked)&&(a.nodeType===1||a.nodeType===11)&&!f.isXMLDoc(a)){bj(a,d),e=bk(a),g=bk(d);for(h=0;e[h];++h)bj(e[h],g[h])}if(b){bi(a,d);if(c){e=bk(a),g=bk(d);for(h=0;e[h];++h)bi(e[h],g[h])}}return d},clean:function(a,b,d,e){var g;b=b||c,typeof b.createElement=="undefined"&&(b=b.ownerDocument||
-b[0]&&b[0].ownerDocument||c);var h=[],i;for(var j=0,k;(k=a[j])!=null;j++){typeof k=="number"&&(k+="");if(!k)continue;if(typeof k=="string")if(!bb.test(k))k=b.createTextNode(k);else{k=k.replace($,"<$1></$2>");var l=(_.exec(k)||["",""])[1].toLowerCase(),m=bg[l]||bg._default,n=m[0],o=b.createElement("div");o.innerHTML=m[1]+k+m[2];while(n--)o=o.lastChild;if(!f.support.tbody){var p=ba.test(k),q=l==="table"&&!p?o.firstChild&&o.firstChild.childNodes:m[1]==="<table>"&&!p?o.childNodes:[];for(i=q.length-1;i>=0;--i)f.nodeName(q[i],"tbody")&&!q[i].childNodes.length&&q[i].parentNode.removeChild(q[i])}!f.support.leadingWhitespace&&Z.test(k)&&o.insertBefore(b.createTextNode(Z.exec(k)[0]),o.firstChild),k=o.childNodes}var r;if(!f.support.appendChecked)if(k[0]&&typeof (r=k.length)=="number")for(i=0;i<r;i++)bm(k[i]);else bm(k);k.nodeType?h.push(k):h=f.merge(h,k)}if(d){g=function(a){return!a.type||be.test(a.type)};for(j=0;h[j];j++)if(e&&f.nodeName(h[j],"script")&&(!h[j].type||h[j].type.toLowerCase()==="text/javascript"))e.push(h[j].parentNode?h[j].parentNode.removeChild(h[j]):h[j]);else{if(h[j].nodeType===1){var s=f.grep(h[j].getElementsByTagName("script"),g);h.splice.apply(h,[j+1,0].concat(s))}d.appendChild(h[j])}}return h},cleanData:function(a){var b,c,d=f.cache,e=f.expando,g=f.event.special,h=f.support.deleteExpando;for(var i=0,j;(j=a[i])!=null;i++){if(j.nodeName&&f.noData[j.nodeName.toLowerCase()])continue;c=j[f.expando];if(c){b=d[c]&&d[c][e];if(b&&b.events){for(var k in b.events)g[k]?f.event.remove(j,k):f.removeEvent(j,k,b.handle);b.handle&&(b.handle.elem=null)}h?delete j[f.expando]:j.removeAttribute&&j.removeAttribute(f.expando),delete d[c]}}}});var bo=/alpha\([^)]*\)/i,bp=/opacity=([^)]*)/,bq=/-([a-z])/ig,br=/([A-Z]|^ms)/g,bs=/^-?\d+(?:px)?$/i,bt=/^-?\d/,bu=/^[+\-]=/,bv=/[^+\-\.\de]+/g,bw={position:"absolute",visibility:"hidden",display:"block"},bx=["Left","Right"],by=["Top","Bottom"],bz,bA,bB,bC=function(a,b){return b.toUpperCase()};f.fn.css=function(a,c){if(arguments.length===2&&c===b)return this;return f.access(this,a,c,!0,function(a,c,d){return d!==b?f.style(a,c,d):f.css(a,c)})},f.extend({cssHooks:{opacity:{get:function(a,b){if(b){var c=bz(a,"opacity","opacity");return c===""?"1":c}return a.style.opacity}}},cssNumber:{zIndex:!0,fontWeight:!0,opacity:!0,zoom:!0,lineHeight:!0,widows:!0,orphans:!0},cssProps:{"float":f.support.cssFloat?"cssFloat":"styleFloat"},style:function(a,c,d,e){if(!!a&&a.nodeType!==3&&a.nodeType!==8&&!!a.style){var g,h,i=f.camelCase(c),j=a.style,k=f.cssHooks[i];c=f.cssProps[i]||i;if(d===b){if(k&&"get"in k&&(g=k.get(a,!1,e))!==b)return g;return j[c]}h=typeof d;if(h==="number"&&isNaN(d)||d==null)return;h==="string"&&bu.test(d)&&(d=+d.replace(bv,"")+parseFloat(f.css(a,c))),h==="number"&&!f.cssNumber[i]&&(d+="px");if(!k||!("set"in k)||(d=k.set(a,d))!==b)try{j[c]=d}catch(l){}}},css:function(a,c,d){var e,g;c=f.camelCase(c),g=f.cssHooks[c],c=f.cssProps[c]||c,c==="cssFloat"&&(c="float");if(g&&"get"in g&&(e=g.get(a,!0,d))!==b)return e;if(bz)return bz(a,c)},swap:function(a,b,c){var d={};for(var e in b)d[e]=a.style[e],a.style[e]=b[e];c.call(a);for(e in b)a.style[e]=d[e]},camelCase:function(a){return a.replace(bq,bC)}}),f.curCSS=f.css,f.each(["height","width"],function(a,b){f.cssHooks[b]={get:function(a,c,d){var e;if(c){a.offsetWidth!==0?e=bD(a,b,d):f.swap(a,bw,function(){e=bD(a,b,d)});if(e<=0){e=bz(a,b,b),e==="0px"&&bB&&(e=bB(a,b,b));if(e!=null)return e===""||e==="auto"?"0px":e}if(e<0||e==null){e=a.style[b];return e===""||e==="auto"?"0px":e}return typeof e=="string"?e:e+"px"}},set:function(a,b){if(!bs.test(b))return b;b=parseFloat(b);if(b>=0)return b+"px"}}}),f.support.opacity||(f.cssHooks.opacity={get:function(a,b){return bp.test((b&&a.currentStyle?a.currentStyle.filter:a.style.filter)||"")?parseFloat(RegExp.$1)/100+"":b?"1":""},set:function(a,b){var c=a.style,d=a.currentStyle;c.zoom=1;var e=f.isNaN(b)?"":"alpha(opacity="+b*100+")",g=d&&d.filter||c.filter||"";c.filter=bo.test(g)?g.replace(bo,e):g+" "+e}}),f(function(){f.support.reliableMarginRight||(f.cssHooks.marginRight={get:function(a,b){var c;f.swap(a,{display:"inline-block"},function(){b?c=bz(a,"margin-right","marginRight"):c=a.style.marginRight});return c}})}),c.defaultView&&c.defaultView.getComputedStyle&&(bA=function(a,c){var d,e,g;c=c.replace(br,"-$1").toLowerCase();if(!(e=a.ownerDocument.defaultView))return b;if(g=e.getComputedStyle(a,null))d=g.getPropertyValue(c),d===""&&!f.contains(a.ownerDocument.documentElement,a)&&(d=f.style(a,c));return d}),c.documentElement.currentStyle&&(bB=function(a,b){var c,d=a.currentStyle&&a.currentStyle[b],e=a.runtimeStyle&&a.runtimeStyle[b],f=a.style;!bs.test(d)&&bt.test(d)&&(c=f.left,e&&(a.runtimeStyle.left=a.currentStyle.left),f.left=b==="fontSize"?"1em":d||0,d=f.pixelLeft+"px",f.left=c,e&&(a.runtimeStyle.left=e));return d===""?"auto":d}),bz=bA||bB,f.expr&&f.expr.filters&&(f.expr.filters.hidden=function(a){var b=a.offsetWidth,c=a.offsetHeight;return b===0&&c===0||!f.support.reliableHiddenOffsets&&(a.style.display||f.css(a,"display"))==="none"},f.expr.filters.visible=function(a){return!f.expr.filters.hidden(a)});var bE=/%20/g,bF=/\[\]$/,bG=/\r?\n/g,bH=/#.*$/,bI=/^(.*?):[ \t]*([^\r\n]*)\r?$/mg,bJ=/^(?:color|date|datetime|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i,bK=/^(?:about|app|app\-storage|.+\-extension|file|widget):$/,bL=/^(?:GET|HEAD)$/,bM=/^\/\//,bN=/\?/,bO=/<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi,bP=/^(?:select|textarea)/i,bQ=/\s+/,bR=/([?&])_=[^&]*/,bS=/^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+))?)?/,bT=f.fn.load,bU={},bV={},bW,bX;try{bW=e.href}catch(bY){bW=c.createElement("a"),bW.href="",bW=bW.href}bX=bS.exec(bW.toLowerCase())||[],f.fn.extend({load:function(a,c,d){if(typeof a!="string"&&bT)return bT.apply(this,arguments);if(!this.length)return this;var e=a.indexOf(" ");if(e>=0){var g=a.slice(e,a.length);a=a.slice(0,e)}var h="GET";c&&(f.isFunction(c)?(d=c,c=b):typeof c=="object"&&(c=f.param(c,f.ajaxSettings.traditional),h="POST"));var i=this;f.ajax({url:a,type:h,dataType:"html",data:c,complete:function(a,b,c){c=a.responseText,a.isResolved()&&(a.done(function(a){c=a}),i.html(g?f("<div>").append(c.replace(bO,"")).find(g):c)),d&&i.each(d,[c,b,a])}});return this},serialize:function(){return f.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?f.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||bP.test(this.nodeName)||bJ.test(this.type))}).map(function(a,b){var c=f(this).val();return c==null?null:f.isArray(c)?f.map(c,function(a,c){return{name:b.name,value:a.replace(bG,"\r\n")}}):{name:b.name,value:c.replace(bG,"\r\n")}}).get()}}),f.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),function(a,b){f.fn[b]=function(a){return this.bind(b,a)}}),f.each(["get","post"],function(a,c){f[c]=function(a,d,e,g){f.isFunction(d)&&(g=g||e,e=d,d=b);return f.ajax({type:c,url:a,data:d,success:e,dataType:g})}}),f.extend({getScript:function(a,c){return f.get(a,b,c,"script")},getJSON:function(a,b,c){return f.get(a,b,c,"json")},ajaxSetup:function(a,b){b?f.extend(!0,a,f.ajaxSettings,b):(b=a,a=f.extend(!0,f.ajaxSettings,b));for(var c in{context:1,url:1})c in b?a[c]=b[c]:c in f.ajaxSettings&&(a[c]=f.ajaxSettings[c]);return a},ajaxSettings:{url:bW,isLocal:bK.test(bX[1]),global:!0,type:"GET",contentType:"application/x-www-form-urlencoded",processData:!0,async:!0,accepts:{xml:"application/xml, text/xml",html:"text/html",text:"text/plain",json:"application/json, text/javascript","*":"*/*"},contents:{xml:/xml/,html:/html/,json:/json/},responseFields:{xml:"responseXML",text:"responseText"},converters:{"* text":a.String,"text html":!0,"text json":f.parseJSON,"text xml":f.parseXML}},ajaxPrefilter:bZ(bU),ajaxTransport:bZ(bV),ajax:function(a,c){function w(a,c,l,m){if(s!==2){s=2,q&&clearTimeout(q),p=b,n=m||"",v.readyState=a?4:0;var o,r,u,w=l?ca(d,v,l):b,x,y;if(a>=200&&a<300||a===304){if(d.ifModified){if(x=v.getResponseHeader("Last-Modified"))f.lastModified[k]=x;if(y=v.getResponseHeader("Etag"))f.etag[k]=y}if(a===304)c="notmodified",o=!0;else try{r=cb(d,w),c="success",o=!0}catch(z){c="parsererror",u=z}}else{u=c;if(!c||a)c="error",a<0&&(a=0)}v.status=a,v.statusText=c,o?h.resolveWith(e,[r,c,v]):h.rejectWith(e,[v,c,u]),v.statusCode(j),j=b,t&&g.trigger("ajax"+(o?"Success":"Error"),[v,d,o?r:u]),i.resolveWith(e,[v,c]),t&&(g.trigger("ajaxComplete",[v,d]),--f.active||f.event.trigger("ajaxStop"))}}typeof a=="object"&&(c=a,a=b),c=c||{};var d=f.ajaxSetup({},c),e=d.context||d,g=e!==d&&(e.nodeType||e instanceof f)?f(e):f.event,h=f.Deferred(),i=f._Deferred(),j=d.statusCode||{},k,l={},m={},n,o,p,q,r,s=0,t,u,v={readyState:0,setRequestHeader:function(a,b){if(!s){var c=a.toLowerCase();a=m[c]=m[c]||a,l[a]=b}return this},getAllResponseHeaders:function(){return s===2?n:null},getResponseHeader:function(a){var c;if(s===2){if(!o){o={};while(c=bI.exec(n))o[c[1].toLowerCase()]=c[2]}c=o[a.toLowerCase()]}return c===b?null:c},overrideMimeType:function(a){s||(d.mimeType=a);return this},abort:function(a){a=a||"abort",p&&p.abort(a),w(0,a);return this}};h.promise(v),v.success=v.done,v.error=v.fail,v.complete=i.done,v.statusCode=function(a){if(a){var b;if(s<2)for(b in a)j[b]=[j[b],a[b]];else b=a[v.status],v.then(b,b)}return this},d.url=((a||d.url)+"").replace(bH,"").replace(bM,bX[1]+"//"),d.dataTypes=f.trim(d.dataType||"*").toLowerCase().split(bQ),d.crossDomain==null&&(r=bS.exec(d.url.toLowerCase()),d.crossDomain=!(!r||r[1]==bX[1]&&r[2]==bX[2]&&(r[3]||(r[1]==="http:"?80:443))==(bX[3]||(bX[1]==="http:"?80:443)))),d.data&&d.processData&&typeof d.data!="string"&&(d.data=f.param(d.data,d.traditional)),b$(bU,d,c,v);if(s===2)return!1;t=d.global,d.type=d.type.toUpperCase(),d.hasContent=!bL.test(d.type),t&&f.active++===0&&f.event.trigger("ajaxStart");if(!d.hasContent){d.data&&(d.url+=(bN.test(d.url)?"&":"?")+d.data),k=d.url;if(d.cache===!1){var x=f.now(),y=d.url.replace(bR,"$1_="+x);d.url=y+(y===d.url?(bN.test(d.url)?"&":"?")+"_="+x:"")}}(d.data&&d.hasContent&&d.contentType!==!1||c.contentType)&&v.setRequestHeader("Content-Type",d.contentType),d.ifModified&&(k=k||d.url,f.lastModified[k]&&v.setRequestHeader("If-Modified-Since",f.lastModified[k]),f.etag[k]&&v.setRequestHeader("If-None-Match",f.etag[k])),v.setRequestHeader("Accept",d.dataTypes[0]&&d.accepts[d.dataTypes[0]]?d.accepts[d.dataTypes[0]]+(d.dataTypes[0]!=="*"?", */*; q=0.01":""):d.accepts["*"]);for(u in d.headers)v.setRequestHeader(u,d.headers[u]);if(d.beforeSend&&(d.beforeSend.call(e,v,d)===!1||s===2)){v.abort();return!1}for(u in{success:1,error:1,complete:1})v[u](d[u]);p=b$(bV,d,c,v);if(!p)w(-1,"No Transport");else{v.readyState=1,t&&g.trigger("ajaxSend",[v,d]),d.async&&d.timeout>0&&(q=setTimeout(function(){v.abort("timeout")},d.timeout));try{s=1,p.send(l,w)}catch(z){status<2?w(-1,z):f.error(z)}}return v},param:function(a,c){var d=[],e=function(a,b){b=f.isFunction(b)?b():b,d[d.length]=encodeURIComponent(a)+"="+encodeURIComponent(b)};c===b&&(c=f.ajaxSettings.traditional);if(f.isArray(a)||a.jquery&&!f.isPlainObject(a))f.each(a,function(){e(this.name,this.value)});else for(var g in a)b_(g,a[g],c,e);return d.join("&").replace(bE,"+")}}),f.extend({active:0,lastModified:{},etag:{}});var cc=f.now(),cd=/(\=)\?(&|$)|\?\?/i;f.ajaxSetup({jsonp:"callback",jsonpCallback:function(){return f.expando+"_"+cc++}}),f.ajaxPrefilter("json jsonp",function(b,c,d){var e=b.contentType==="application/x-www-form-urlencoded"&&typeof b.data=="string";if(b.dataTypes[0]==="jsonp"||b.jsonp!==!1&&(cd.test(b.url)||e&&cd.test(b.data))){var g,h=b.jsonpCallback=f.isFunction(b.jsonpCallback)?b.jsonpCallback():b.jsonpCallback,i=a[h],j=b.url,k=b.data,l="$1"+h+"$2";b.jsonp!==!1&&(j=j.replace(cd,l),b.url===j&&(e&&(k=k.replace(cd,l)),b.data===k&&(j+=(/\?/.test(j)?"&":"?")+b.jsonp+"="+h))),b.url=j,b.data=k,a[h]=function(a){g=[a]},d.always(function(){a[h]=i,g&&f.isFunction(i)&&a[h](g[0])}),b.converters["script json"]=function(){g||f.error(h+" was not called");return g[0]},b.dataTypes[0]="json";return"script"}}),f.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/javascript|ecmascript/},converters:{"text script":function(a){f.globalEval(a);return a}}}),f.ajaxPrefilter("script",function(a){a.cache===b&&(a.cache=!1),a.crossDomain&&(a.type="GET",a.global=!1)}),f.ajaxTransport("script",function(a){if(a.crossDomain){var d,e=c.head||c.getElementsByTagName("head")[0]||c.documentElement;return{send:function(f,g){d=c.createElement("script"),d.async="async",a.scriptCharset&&(d.charset=a.scriptCharset),d.src=a.url,d.onload=d.onreadystatechange=function(a,c){if(c||!d.readyState||/loaded|complete/.test(d.readyState))d.onload=d.onreadystatechange=null,e&&d.parentNode&&e.removeChild(d),d=b,c||g(200,"success")},e.insertBefore(d,e.firstChild)},abort:function(){d&&d.onload(0,1)}}}});var ce=a.ActiveXObject?function(){for(var a in cg)cg[a](0,1)}:!1,cf=0,cg;f.ajaxSettings.xhr=a.ActiveXObject?function(){return!this.isLocal&&ch()||ci()}:ch,function(a){f.extend(f.support,{ajax:!!a,cors:!!a&&"withCredentials"in a})}(f.ajaxSettings.xhr()),f.support.ajax&&f.ajaxTransport(function(c){if(!c.crossDomain||f.support.cors){var d;return{send:function(e,g){var h=c.xhr(),i,j;c.username?h.open(c.type,c.url,c.async,c.username,c.password):h.open(c.type,c.url,c.async);if(c.xhrFields)for(j in c.xhrFields)h[j]=c.xhrFields[j];c.mimeType&&h.overrideMimeType&&h.overrideMimeType(c.mimeType),!c.crossDomain&&!e["X-Requested-With"]&&(e["X-Requested-With"]="XMLHttpRequest");try{for(j in e)h.setRequestHeader(j,e[j])}catch(k){}h.send(c.hasContent&&c.data||null),d=function(a,e){var j,k,l,m,n;try{if(d&&(e||h.readyState===4)){d=b,i&&(h.onreadystatechange=f.noop,ce&&delete cg[i]);if(e)h.readyState!==4&&h.abort();else{j=h.status,l=h.getAllResponseHeaders(),m={},n=h.responseXML,n&&n.documentElement&&(m.xml=n),m.text=h.responseText;try{k=h.statusText}catch(o){k=""}!j&&c.isLocal&&!c.crossDomain?j=m.text?200:404:j===1223&&(j=204)}}}catch(p){e||g(-1,p)}m&&g(j,k,m,l)},!c.async||h.readyState===4?d():(i=++cf,ce&&(cg||(cg={},f(a).unload(ce)),cg[i]=d),h.onreadystatechange=d)},abort:function(){d&&d(0,1)}}}});var cj={},ck,cl,cm=/^(?:toggle|show|hide)$/,cn=/^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i,co,cp=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]],cq,cr=a.webkitRequestAnimationFrame||a.mozRequestAnimationFrame||a.oRequestAnimationFrame;f.fn.extend({show:function(a,b,c){var d,e;if(a||a===0)return this.animate(cu("show",3),a,b,c);for(var g=0,h=this.length;g<h;g++)d=this[g],d.style&&(e=d.style.display,!f._data(d,"olddisplay")&&e==="none"&&(e=d.style.display=""),e===""&&f.css(d,"display")==="none"&&f._data(d,"olddisplay",cv(d.nodeName)));for(g=0;g<h;g++){d=this[g];if(d.style){e=d.style.display;if(e===""||e==="none")d.style.display=f._data(d,"olddisplay")||""}}return this},hide:function(a,b,c){if(a||a===0)return this.animate(cu("hide",3),a,b,c);for(var d=0,e=this.length;d<e;d++)if(this[d].style){var g=f.css(this[d],"display");g!=="none"&&!f._data(this[d],"olddisplay")&&f._data(this[d],"olddisplay",g)}for(d=0;d<e;d++)this[d].style&&(this[d].style.display="none");return this},_toggle:f.fn.toggle,toggle:function(a,b,c){var d=typeof a=="boolean";f.isFunction(a)&&f.isFunction(b)?this._toggle.apply(this,arguments):a==null||d?this.each(function(){var b=d?a:f(this).is(":hidden");f(this)[b?"show":"hide"]()}):this.animate(cu("toggle",3),a,b,c);return this},fadeTo:function(a,b,c,d){return this.filter(":hidden").css("opacity",0).show().end().animate({opacity:b},a,c,d)},animate:function(a,b,c,d){var e=f.speed(b,c,d);if(f.isEmptyObject(a))return this.each(e.complete,[!1]);a=f.extend({},a);return this[e.queue===!1?"each":"queue"](function(){e.queue===!1&&f._mark(this);var b=f.extend({},e),c=this.nodeType===1,d=c&&f(this).is(":hidden"),g,h,i,j,k,l,m,n,o;b.animatedProperties={};for(i in a){g=f.camelCase(i),i!==g&&(a[g]=a[i],delete a[i]),h=a[g],f.isArray(h)?(b.animatedProperties[g]=h[1],h=a[g]=h[0]):b.animatedProperties[g]=b.specialEasing&&b.specialEasing[g]||b.easing||"swing";if(h==="hide"&&d||h==="show"&&!d)return b.complete.call(this);c&&(g==="height"||g==="width")&&(b.overflow=[this.style.overflow,this.style.overflowX,this.style.overflowY],f.css(this,"display")==="inline"&&f.css(this,"float")==="none"&&(f.support.inlineBlockNeedsLayout?(j=cv(this.nodeName),j==="inline"?this.style.display="inline-block":(this.style.display="inline",this.style.zoom=1)):this.style.display="inline-block"))}b.overflow!=null&&(this.style.overflow="hidden");for(i in a)k=new f.fx(this,b,i),h=a[i],cm.test(h)?k[h==="toggle"?d?"show":"hide":h]():(l=cn.exec(h),m=k.cur(),l?(n=parseFloat(l[2]),o=l[3]||(f.cssNumber[i]?"":"px"),o!=="px"&&(f.style(this,i,(n||1)+o),m=(n||1)/k.cur()*m,f.style(this,i,m+o)),l[1]&&(n=(l[1]==="-="?-1:1)*n+m),k.custom(m,n,o)):k.custom(m,h,""));return!0})},stop:function(a,b){a&&this.queue([]),this.each(function(){var a=f.timers,c=a.length;b||f._unmark(!0,this);while(c--)a[c].elem===this&&(b&&a[c](!0),a.splice(c,1))}),b||this.dequeue();return this}}),f.each({slideDown:cu("show",1),slideUp:cu("hide",1),slideToggle:cu("toggle",1),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"},fadeToggle:{opacity:"toggle"}},function(a,b){f.fn[a]=function(a,c,d){return this.animate(b,a,c,d)}}),f.extend({speed:function(a,b,c){var d=a&&typeof a=="object"?f.extend({},a):{complete:c||!c&&b||f.isFunction(a)&&a,duration:a,easing:c&&b||b&&!f.isFunction(b)&&b};d.duration=f.fx.off?0:typeof d.duration=="number"?d.duration:d.duration in f.fx.speeds?f.fx.speeds[d.duration]:f.fx.speeds._default,d.old=d.complete,d.complete=function(a){d.queue!==!1?f.dequeue(this):a!==!1&&f._unmark(this),f.isFunction(d.old)&&d.old.call(this)};return d},easing:{linear:function(a,b,c,d){return c+d*a},swing:function(a,b,c,d){return(-Math.cos(a*Math.PI)/2+.5)*d+c}},timers:[],fx:function(a,b,c){this.options=b,this.elem=a,this.prop=c,b.orig=b.orig||{}}}),f.fx.prototype={update:function(){this.options.step&&this.options.step.call(this.elem,this.now,this),(f.fx.step[this.prop]||f.fx.step._default)(this)},cur:function(){if(this.elem[this.prop]!=null&&(!this.elem.style||this.elem.style[this.prop]==null))return this.elem[this.prop];var a,b=f.css(this.elem,this.prop);return isNaN(a=parseFloat(b))?!b||b==="auto"?0:b:a},custom:function(a,b,c){function h(a){return d.step(a)}var d=this,e=f.fx,g;this.startTime=cq||cs(),this.start=a,this.end=b,this.unit=c||this.unit||(f.cssNumber[this.prop]?"":"px"),this.now=this.start,this.pos=this.state=0,h.elem=this.elem,h()&&f.timers.push(h)&&!co&&(cr?(co=1,g=function(){co&&(cr(g),e.tick())},cr(g)):co=setInterval(e.tick,e.interval))},show:function(){this.options.orig[this.prop]=f.style(this.elem,this.prop),this.options.show=!0,this.custom(this.prop==="width"||this.prop==="height"?1:0,this.cur()),f(this.elem).show()},hide:function(){this.options.orig[this.prop]=f.style(this.elem,this.prop),this.options.hide=!0,this.custom(this.cur(),0)},step:function(a){var b=cq||cs(),c=!0,d=this.elem,e=this.options,g,h;if(a||b>=e.duration+this.startTime){this.now=this.end,this.pos=this.state=1,this.update(),e.animatedProperties[this.prop]=!0;for(g in e.animatedProperties)e.animatedProperties[g]!==!0&&(c=!1);if(c){e.overflow!=null&&!f.support.shrinkWrapBlocks&&f.each(["","X","Y"],function(a,b){d.style["overflow"+b]=e.overflow[a]}),e.hide&&f(d).hide();if(e.hide||e.show)for(var i in e.animatedProperties)f.style(d,i,e.orig[i]);e.complete.call(d)}return!1}e.duration==Infinity?this.now=b:(h=b-this.startTime,this.state=h/e.duration,this.pos=f.easing[e.animatedProperties[this.prop]](this.state,h,0,1,e.duration),this.now=this.start+(this.end-this.start)*this.pos),this.update();return!0}},f.extend(f.fx,{tick:function(){for(var a=f.timers,b=0;b<a.length;++b)a[b]()||a.splice(b--,1);a.length||f.fx.stop()},interval:13,stop:function(){clearInterval(co),co=null},speeds:{slow:600,fast:200,_default:400},step:{opacity:function(a){f.style(a.elem,"opacity",a.now)},_default:function(a){a.elem.style&&a.elem.style[a.prop]!=null?a.elem.style[a.prop]=(a.prop==="width"||a.prop==="height"?Math.max(0,a.now):a.now)+a.unit:a.elem[a.prop]=a.now}}}),f.expr&&f.expr.filters&&(f.expr.filters.animated=function(a){return f.grep(f.timers,function(b){return a===b.elem}).length});var cw=/^t(?:able|d|h)$/i,cx=/^(?:body|html)$/i;"getBoundingClientRect"in c.documentElement?f.fn.offset=function(a){var b=this[0],c;if(a)return this.each(function(b){f.offset.setOffset(this,a,b)});if(!b||!b.ownerDocument)return null;if(b===b.ownerDocument.body)return f.offset.bodyOffset(b);try{c=b.getBoundingClientRect()}catch(d){}var e=b.ownerDocument,g=e.documentElement;if(!c||!f.contains(g,b))return c?{top:c.top,left:c.left}:{top:0,left:0};var h=e.body,i=cy(e),j=g.clientTop||h.clientTop||0,k=g.clientLeft||h.clientLeft||0,l=i.pageYOffset||f.support.boxModel&&g.scrollTop||h.scrollTop,m=i.pageXOffset||f.support.boxModel&&g.scrollLeft||h.scrollLeft,n=c.top+l-j,o=c.left+m-k;return{top:n,left:o}}:f.fn.offset=function(a){var b=this[0];if(a)return this.each(function(b){f.offset.setOffset(this,a,b)});if(!b||!b.ownerDocument)return null;if(b===b.ownerDocument.body)return f.offset.bodyOffset(b);f.offset.initialize();var c,d=b.offsetParent,e=b,g=b.ownerDocument,h=g.documentElement,i=g.body,j=g.defaultView,k=j?j.getComputedStyle(b,null):b.currentStyle,l=b.offsetTop,m=b.offsetLeft;while((b=b.parentNode)&&b!==i&&b!==h){if(f.offset.supportsFixedPosition&&k.position==="fixed")break;c=j?j.getComputedStyle(b,null):b.currentStyle,l-=b.scrollTop,m-=b.scrollLeft,b===d&&(l+=b.offsetTop,m+=b.offsetLeft,f.offset.doesNotAddBorder&&(!f.offset.doesAddBorderForTableAndCells||!cw.test(b.nodeName))&&(l+=parseFloat(c.borderTopWidth)||0,m+=parseFloat(c.borderLeftWidth)||0),e=d,d=b.offsetParent),f.offset.subtractsBorderForOverflowNotVisible&&c.overflow!=="visible"&&(l+=parseFloat(c.borderTopWidth)||0,m+=parseFloat(c.borderLeftWidth)||0),k=c}if(k.position==="relative"||k.position==="static")l+=i.offsetTop,m+=i.offsetLeft;f.offset.supportsFixedPosition&&k.position==="fixed"&&(l+=Math.max(h.scrollTop,i.scrollTop),m+=Math.max(h.scrollLeft,i.scrollLeft));return{top:l,left:m}},f.offset={initialize:function(){var a=c.body,b=c.createElement("div"),d,e,g,h,i=parseFloat(f.css(a,"marginTop"))||0,j="<div style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;'><div></div></div><table style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;' cellpadding='0' cellspacing='0'><tr><td></td></tr></table>";f.extend(b.style,{position:"absolute",top:0,left:0,margin:0,border:0,width:"1px",height:"1px",visibility:"hidden"}),b.innerHTML=j,a.insertBefore(b,a.firstChild),d=b.firstChild,e=d.firstChild,h=d.nextSibling.firstChild.firstChild,this.doesNotAddBorder=e.offsetTop!==5,this.doesAddBorderForTableAndCells=h.offsetTop===5,e.style.position="fixed",e.style.top="20px",this.supportsFixedPosition=e.offsetTop===20||e.offsetTop===15,e.style.position=e.style.top="",d.style.overflow="hidden",d.style.position="relative",this.subtractsBorderForOverflowNotVisible=e.offsetTop===-5,this.doesNotIncludeMarginInBodyOffset=a.offsetTop!==i,a.removeChild(b),f.offset.initialize=f.noop},bodyOffset:function(a){var b=a.offsetTop,c=a.offsetLeft;f.offset.initialize(),f.offset.doesNotIncludeMarginInBodyOffset&&(b+=parseFloat(f.css(a,"marginTop"))||0,c+=parseFloat(f.css(a,"marginLeft"))||0);return{top:b,left:c}},setOffset:function(a,b,c){var d=f.css(a,"position");d==="static"&&(a.style.position="relative");var e=f(a),g=e.offset(),h=f.css(a,"top"),i=f.css(a,"left"),j=(d==="absolute"||d==="fixed")&&f.inArray("auto",[h,i])>-1,k={},l={},m,n;j?(l=e.position(),m=l.top,n=l.left):(m=parseFloat(h)||0,n=parseFloat(i)||0),f.isFunction(b)&&(b=b.call(a,c,g)),b.top!=null&&(k.top=b.top-g.top+m),b.left!=null&&(k.left=b.left-g.left+n),"using"in b?b.using.call(a,k):e.css(k)}},f.fn.extend({position:function(){if(!this[0])return null;var a=this[0],b=this.offsetParent(),c=this.offset(),d=cx.test(b[0].nodeName)?{top:0,left:0}:b.offset();c.top-=parseFloat(f.css(a,"marginTop"))||0,c.left-=parseFloat(f.css(a,"marginLeft"))||0,d.top+=parseFloat(f.css(b[0],"borderTopWidth"))||0,d.left+=parseFloat(f.css(b[0],"borderLeftWidth"))||0;return{top:c.top-d.top,left:c.left-d.left}},offsetParent:function(){return this.map(function(){var a=this.offsetParent||c.body;while(a&&!cx.test(a.nodeName)&&f.css(a,"position")==="static")a=a.offsetParent;return a})}}),f.each(["Left","Top"],function(a,c){var d="scroll"+c;f.fn[d]=function(c){var e,g;if(c===b){e=this[0];if(!e)return null;g=cy(e);return g?"pageXOffset"in g?g[a?"pageYOffset":"pageXOffset"]:f.support.boxModel&&g.document.documentElement[d]||g.document.body[d]:e[d]}return this.each(function(){g=cy(this),g?g.scrollTo(a?f(g).scrollLeft():c,a?c:f(g).scrollTop()):this[d]=c})}}),f.each(["Height","Width"],function(a,c){var d=c.toLowerCase();f.fn["inner"+c]=function(){return this[0]?parseFloat(f.css(this[0],d,"padding")):null},f.fn["outer"+c]=function(a){return this[0]?parseFloat(f.css(this[0],d,a?"margin":"border")):null},f.fn[d]=function(a){var e=this[0];if(!e)return a==null?null:this;if(f.isFunction(a))return this.each(function(b){var c=f(this);c[d](a.call(this,b,c[d]()))});if(f.isWindow(e)){var g=e.document.documentElement["client"+c];return e.document.compatMode==="CSS1Compat"&&g||e.document.body["client"+c]||g}if(e.nodeType===9)return Math.max(e.documentElement["client"+c],e.body["scroll"+c],e.documentElement["scroll"+c],e.body["offset"+c],e.documentElement["offset"+c]);if(a===b){var h=f.css(e,d),i=parseFloat(h);return f.isNaN(i)?h:i}return this.css(d,typeof a=="string"?a:a+"px")}}),a.jQuery=a.$=f})(window);
+

--- /dev/null
+++ b/js/jquery-1.6.2.min.js
@@ -1,1 +1,18 @@
-
+/*!
+ * jQuery JavaScript Library v1.6.2
+ * http://jquery.com/
+ *
+ * Copyright 2011, John Resig
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * Includes Sizzle.js
+ * http://sizzlejs.com/
+ * Copyright 2011, The Dojo Foundation
+ * Released under the MIT, BSD, and GPL Licenses.
+ *
+ * Date: Thu Jun 30 14:16:56 2011 -0400
+ */
+(function(a,b){function cv(a){return f.isWindow(a)?a:a.nodeType===9?a.defaultView||a.parentWindow:!1}function cs(a){if(!cg[a]){var b=c.body,d=f("<"+a+">").appendTo(b),e=d.css("display");d.remove();if(e==="none"||e===""){ch||(ch=c.createElement("iframe"),ch.frameBorder=ch.width=ch.height=0),b.appendChild(ch);if(!ci||!ch.createElement)ci=(ch.contentWindow||ch.contentDocument).document,ci.write((c.compatMode==="CSS1Compat"?"<!doctype html>":"")+"<html><body>"),ci.close();d=ci.createElement(a),ci.body.appendChild(d),e=f.css(d,"display"),b.removeChild(ch)}cg[a]=e}return cg[a]}function cr(a,b){var c={};f.each(cm.concat.apply([],cm.slice(0,b)),function(){c[this]=a});return c}function cq(){cn=b}function cp(){setTimeout(cq,0);return cn=f.now()}function cf(){try{return new a.ActiveXObject("Microsoft.XMLHTTP")}catch(b){}}function ce(){try{return new a.XMLHttpRequest}catch(b){}}function b$(a,c){a.dataFilter&&(c=a.dataFilter(c,a.dataType));var d=a.dataTypes,e={},g,h,i=d.length,j,k=d[0],l,m,n,o,p;for(g=1;g<i;g++){if(g===1)for(h in a.converters)typeof h=="string"&&(e[h.toLowerCase()]=a.converters[h]);l=k,k=d[g];if(k==="*")k=l;else if(l!=="*"&&l!==k){m=l+" "+k,n=e[m]||e["* "+k];if(!n){p=b;for(o in e){j=o.split(" ");if(j[0]===l||j[0]==="*"){p=e[j[1]+" "+k];if(p){o=e[o],o===!0?n=p:p===!0&&(n=o);break}}}}!n&&!p&&f.error("No conversion from "+m.replace(" "," to ")),n!==!0&&(c=n?n(c):p(o(c)))}}return c}function bZ(a,c,d){var e=a.contents,f=a.dataTypes,g=a.responseFields,h,i,j,k;for(i in g)i in d&&(c[g[i]]=d[i]);while(f[0]==="*")f.shift(),h===b&&(h=a.mimeType||c.getResponseHeader("content-type"));if(h)for(i in e)if(e[i]&&e[i].test(h)){f.unshift(i);break}if(f[0]in d)j=f[0];else{for(i in d){if(!f[0]||a.converters[i+" "+f[0]]){j=i;break}k||(k=i)}j=j||k}if(j){j!==f[0]&&f.unshift(j);return d[j]}}function bY(a,b,c,d){if(f.isArray(b))f.each(b,function(b,e){c||bC.test(a)?d(a,e):bY(a+"["+(typeof e=="object"||f.isArray(e)?b:"")+"]",e,c,d)});else if(!c&&b!=null&&typeof b=="object")for(var e in b)bY(a+"["+e+"]",b[e],c,d);else d(a,b)}function bX(a,c,d,e,f,g){f=f||c.dataTypes[0],g=g||{},g[f]=!0;var h=a[f],i=0,j=h?h.length:0,k=a===bR,l;for(;i<j&&(k||!l);i++)l=h[i](c,d,e),typeof l=="string"&&(!k||g[l]?l=b:(c.dataTypes.unshift(l),l=bX(a,c,d,e,l,g)));(k||!l)&&!g["*"]&&(l=bX(a,c,d,e,"*",g));return l}function bW(a){return function(b,c){typeof b!="string"&&(c=b,b="*");if(f.isFunction(c)){var d=b.toLowerCase().split(bN),e=0,g=d.length,h,i,j;for(;e<g;e++)h=d[e],j=/^\+/.test(h),j&&(h=h.substr(1)||"*"),i=a[h]=a[h]||[],i[j?"unshift":"push"](c)}}}function bA(a,b,c){var d=b==="width"?a.offsetWidth:a.offsetHeight,e=b==="width"?bv:bw;if(d>0){c!=="border"&&f.each(e,function(){c||(d-=parseFloat(f.css(a,"padding"+this))||0),c==="margin"?d+=parseFloat(f.css(a,c+this))||0:d-=parseFloat(f.css(a,"border"+this+"Width"))||0});return d+"px"}d=bx(a,b,b);if(d<0||d==null)d=a.style[b]||0;d=parseFloat(d)||0,c&&f.each(e,function(){d+=parseFloat(f.css(a,"padding"+this))||0,c!=="padding"&&(d+=parseFloat(f.css(a,"border"+this+"Width"))||0),c==="margin"&&(d+=parseFloat(f.css(a,c+this))||0)});return d+"px"}function bm(a,b){b.src?f.ajax({url:b.src,async:!1,dataType:"script"}):f.globalEval((b.text||b.textContent||b.innerHTML||"").replace(be,"/*$0*/")),b.parentNode&&b.parentNode.removeChild(b)}function bl(a){f.nodeName(a,"input")?bk(a):"getElementsByTagName"in a&&f.grep(a.getElementsByTagName("input"),bk)}function bk(a){if(a.type==="checkbox"||a.type==="radio")a.defaultChecked=a.checked}function bj(a){return"getElementsByTagName"in a?a.getElementsByTagName("*"):"querySelectorAll"in a?a.querySelectorAll("*"):[]}function bi(a,b){var c;if(b.nodeType===1){b.clearAttributes&&b.clearAttributes(),b.mergeAttributes&&b.mergeAttributes(a),c=b.nodeName.toLowerCase();if(c==="object")b.outerHTML=a.outerHTML;else if(c!=="input"||a.type!=="checkbox"&&a.type!=="radio"){if(c==="option")b.selected=a.defaultSelected;else if(c==="input"||c==="textarea")b.defaultValue=a.defaultValue}else a.checked&&(b.defaultChecked=b.checked=a.checked),b.value!==a.value&&(b.value=a.value);b.removeAttribute(f.expando)}}function bh(a,b){if(b.nodeType===1&&!!f.hasData(a)){var c=f.expando,d=f.data(a),e=f.data(b,d);if(d=d[c]){var g=d.events;e=e[c]=f.extend({},d);if(g){delete e.handle,e.events={};for(var h in g)for(var i=0,j=g[h].length;i<j;i++)f.event.add(b,h+(g[h][i].namespace?".":"")+g[h][i].namespace,g[h][i],g[h][i].data)}}}}function bg(a,b){return f.nodeName(a,"table")?a.getElementsByTagName("tbody")[0]||a.appendChild(a.ownerDocument.createElement("tbody")):a}function W(a,b,c){b=b||0;if(f.isFunction(b))return f.grep(a,function(a,d){var e=!!b.call(a,d,a);return e===c});if(b.nodeType)return f.grep(a,function(a,d){return a===b===c});if(typeof b=="string"){var d=f.grep(a,function(a){return a.nodeType===1});if(R.test(b))return f.filter(b,d,!c);b=f.filter(b,d)}return f.grep(a,function(a,d){return f.inArray(a,b)>=0===c})}function V(a){return!a||!a.parentNode||a.parentNode.nodeType===11}function N(a,b){return(a&&a!=="*"?a+".":"")+b.replace(z,"`").replace(A,"&")}function M(a){var b,c,d,e,g,h,i,j,k,l,m,n,o,p=[],q=[],r=f._data(this,"events");if(!(a.liveFired===this||!r||!r.live||a.target.disabled||a.button&&a.type==="click")){a.namespace&&(n=new RegExp("(^|\\.)"+a.namespace.split(".").join("\\.(?:.*\\.)?")+"(\\.|$)")),a.liveFired=this;var s=r.live.slice(0);for(i=0;i<s.length;i++)g=s[i],g.origType.replace(x,"")===a.type?q.push(g.selector):s.splice(i--,1);e=f(a.target).closest(q,a.currentTarget);for(j=0,k=e.length;j<k;j++){m=e[j];for(i=0;i<s.length;i++){g=s[i];if(m.selector===g.selector&&(!n||n.test(g.namespace))&&!m.elem.disabled){h=m.elem,d=null;if(g.preType==="mouseenter"||g.preType==="mouseleave")a.type=g.preType,d=f(a.relatedTarget).closest(g.selector)[0],d&&f.contains(h,d)&&(d=h);(!d||d!==h)&&p.push({elem:h,handleObj:g,level:m.level})}}}for(j=0,k=p.length;j<k;j++){e=p[j];if(c&&e.level>c)break;a.currentTarget=e.elem,a.data=e.handleObj.data,a.handleObj=e.handleObj,o=e.handleObj.origHandler.apply(e.elem,arguments);if(o===!1||a.isPropagationStopped()){c=e.level,o===!1&&(b=!1);if(a.isImmediatePropagationStopped())break}}return b}}function K(a,c,d){var e=f.extend({},d[0]);e.type=a,e.originalEvent={},e.liveFired=b,f.event.handle.call(c,e),e.isDefaultPrevented()&&d[0].preventDefault()}function E(){return!0}function D(){return!1}function m(a,c,d){var e=c+"defer",g=c+"queue",h=c+"mark",i=f.data(a,e,b,!0);i&&(d==="queue"||!f.data(a,g,b,!0))&&(d==="mark"||!f.data(a,h,b,!0))&&setTimeout(function(){!f.data(a,g,b,!0)&&!f.data(a,h,b,!0)&&(f.removeData(a,e,!0),i.resolve())},0)}function l(a){for(var b in a)if(b!=="toJSON")return!1;return!0}function k(a,c,d){if(d===b&&a.nodeType===1){var e="data-"+c.replace(j,"$1-$2").toLowerCase();d=a.getAttribute(e);if(typeof d=="string"){try{d=d==="true"?!0:d==="false"?!1:d==="null"?null:f.isNaN(d)?i.test(d)?f.parseJSON(d):d:parseFloat(d)}catch(g){}f.data(a,c,d)}else d=b}return d}var c=a.document,d=a.navigator,e=a.location,f=function(){function J(){if(!e.isReady){try{c.documentElement.doScroll("left")}catch(a){setTimeout(J,1);return}e.ready()}}var e=function(a,b){return new e.fn.init(a,b,h)},f=a.jQuery,g=a.$,h,i=/^(?:[^<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/,j=/\S/,k=/^\s+/,l=/\s+$/,m=/\d/,n=/^<(\w+)\s*\/?>(?:<\/\1>)?$/,o=/^[\],:{}\s]*$/,p=/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,q=/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,r=/(?:^|:|,)(?:\s*\[)+/g,s=/(webkit)[ \/]([\w.]+)/,t=/(opera)(?:.*version)?[ \/]([\w.]+)/,u=/(msie) ([\w.]+)/,v=/(mozilla)(?:.*? rv:([\w.]+))?/,w=/-([a-z])/ig,x=function(a,b){return b.toUpperCase()},y=d.userAgent,z,A,B,C=Object.prototype.toString,D=Object.prototype.hasOwnProperty,E=Array.prototype.push,F=Array.prototype.slice,G=String.prototype.trim,H=Array.prototype.indexOf,I={};e.fn=e.prototype={constructor:e,init:function(a,d,f){var g,h,j,k;if(!a)return this;if(a.nodeType){this.context=this[0]=a,this.length=1;return this}if(a==="body"&&!d&&c.body){this.context=c,this[0]=c.body,this.selector=a,this.length=1;return this}if(typeof a=="string"){a.charAt(0)!=="<"||a.charAt(a.length-1)!==">"||a.length<3?g=i.exec(a):g=[null,a,null];if(g&&(g[1]||!d)){if(g[1]){d=d instanceof e?d[0]:d,k=d?d.ownerDocument||d:c,j=n.exec(a),j?e.isPlainObject(d)?(a=[c.createElement(j[1])],e.fn.attr.call(a,d,!0)):a=[k.createElement(j[1])]:(j=e.buildFragment([g[1]],[k]),a=(j.cacheable?e.clone(j.fragment):j.fragment).childNodes);return e.merge(this,a)}h=c.getElementById(g[2]);if(h&&h.parentNode){if(h.id!==g[2])return f.find(a);this.length=1,this[0]=h}this.context=c,this.selector=a;return this}return!d||d.jquery?(d||f).find(a):this.constructor(d).find(a)}if(e.isFunction(a))return f.ready(a);a.selector!==b&&(this.selector=a.selector,this.context=a.context);return e.makeArray(a,this)},selector:"",jquery:"1.6.2",length:0,size:function(){return this.length},toArray:function(){return F.call(this,0)},get:function(a){return a==null?this.toArray():a<0?this[this.length+a]:this[a]},pushStack:function(a,b,c){var d=this.constructor();e.isArray(a)?E.apply(d,a):e.merge(d,a),d.prevObject=this,d.context=this.context,b==="find"?d.selector=this.selector+(this.selector?" ":"")+c:b&&(d.selector=this.selector+"."+b+"("+c+")");return d},each:function(a,b){return e.each(this,a,b)},ready:function(a){e.bindReady(),A.done(a);return this},eq:function(a){return a===-1?this.slice(a):this.slice(a,+a+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(F.apply(this,arguments),"slice",F.call(arguments).join(","))},map:function(a){return this.pushStack(e.map(this,function(b,c){return a.call(b,c,b)}))},end:function(){return this.prevObject||this.constructor(null)},push:E,sort:[].sort,splice:[].splice},e.fn.init.prototype=e.fn,e.extend=e.fn.extend=function(){var a,c,d,f,g,h,i=arguments[0]||{},j=1,k=arguments.length,l=!1;typeof i=="boolean"&&(l=i,i=arguments[1]||{},j=2),typeof i!="object"&&!e.isFunction(i)&&(i={}),k===j&&(i=this,--j);for(;j<k;j++)if((a=arguments[j])!=null)for(c in a){d=i[c],f=a[c];if(i===f)continue;l&&f&&(e.isPlainObject(f)||(g=e.isArray(f)))?(g?(g=!1,h=d&&e.isArray(d)?d:[]):h=d&&e.isPlainObject(d)?d:{},i[c]=e.extend(l,h,f)):f!==b&&(i[c]=f)}return i},e.extend({noConflict:function(b){a.$===e&&(a.$=g),b&&a.jQuery===e&&(a.jQuery=f);return e},isReady:!1,readyWait:1,holdReady:function(a){a?e.readyWait++:e.ready(!0)},ready:function(a){if(a===!0&&!--e.readyWait||a!==!0&&!e.isReady){if(!c.body)return setTimeout(e.ready,1);e.isReady=!0;if(a!==!0&&--e.readyWait>0)return;A.resolveWith(c,[e]),e.fn.trigger&&e(c).trigger("ready").unbind("ready")}},bindReady:function(){if(!A){A=e._Deferred();if(c.readyState==="complete")return setTimeout(e.ready,1);if(c.addEventListener)c.addEventListener("DOMContentLoaded",B,!1),a.addEventListener("load",e.ready,!1);else if(c.attachEvent){c.attachEvent("onreadystatechange",B),a.attachEvent("onload",e.ready);var b=!1;try{b=a.frameElement==null}catch(d){}c.documentElement.doScroll&&b&&J()}}},isFunction:function(a){return e.type(a)==="function"},isArray:Array.isArray||function(a){return e.type(a)==="array"},isWindow:function(a){return a&&typeof a=="object"&&"setInterval"in a},isNaN:function(a){return a==null||!m.test(a)||isNaN(a)},type:function(a){return a==null?String(a):I[C.call(a)]||"object"},isPlainObject:function(a){if(!a||e.type(a)!=="object"||a.nodeType||e.isWindow(a))return!1;if(a.constructor&&!D.call(a,"constructor")&&!D.call(a.constructor.prototype,"isPrototypeOf"))return!1;var c;for(c in a);return c===b||D.call(a,c)},isEmptyObject:function(a){for(var b in a)return!1;return!0},error:function(a){throw a},parseJSON:function(b){if(typeof b!="string"||!b)return null;b=e.trim(b);if(a.JSON&&a.JSON.parse)return a.JSON.parse(b);if(o.test(b.replace(p,"@").replace(q,"]").replace(r,"")))return(new Function("return "+b))();e.error("Invalid JSON: "+b)},parseXML:function(b,c,d){a.DOMParser?(d=new DOMParser,c=d.parseFromString(b,"text/xml")):(c=new ActiveXObject("Microsoft.XMLDOM"),c.async="false",c.loadXML(b)),d=c.documentElement,(!d||!d.nodeName||d.nodeName==="parsererror")&&e.error("Invalid XML: "+b);return c},noop:function(){},globalEval:function(b){b&&j.test(b)&&(a.execScript||function(b){a.eval.call(a,b)})(b)},camelCase:function(a){return a.replace(w,x)},nodeName:function(a,b){return a.nodeName&&a.nodeName.toUpperCase()===b.toUpperCase()},each:function(a,c,d){var f,g=0,h=a.length,i=h===b||e.isFunction(a);if(d){if(i){for(f in a)if(c.apply(a[f],d)===!1)break}else for(;g<h;)if(c.apply(a[g++],d)===!1)break}else if(i){for(f in a)if(c.call(a[f],f,a[f])===!1)break}else for(;g<h;)if(c.call(a[g],g,a[g++])===!1)break;return a},trim:G?function(a){return a==null?"":G.call(a)}:function(a){return a==null?"":(a+"").replace(k,"").replace(l,"")},makeArray:function(a,b){var c=b||[];if(a!=null){var d=e.type(a);a.length==null||d==="string"||d==="function"||d==="regexp"||e.isWindow(a)?E.call(c,a):e.merge(c,a)}return c},inArray:function(a,b){if(H)return H.call(b,a);for(var c=0,d=b.length;c<d;c++)if(b[c]===a)return c;return-1},merge:function(a,c){var d=a.length,e=0;if(typeof c.length=="number")for(var f=c.length;e<f;e++)a[d++]=c[e];else while(c[e]!==b)a[d++]=c[e++];a.length=d;return a},grep:function(a,b,c){var d=[],e;c=!!c;for(var f=0,g=a.length;f<g;f++)e=!!b(a[f],f),c!==e&&d.push(a[f]);return d},map:function(a,c,d){var f,g,h=[],i=0,j=a.length,k=a instanceof e||j!==b&&typeof j=="number"&&(j>0&&a[0]&&a[j-1]||j===0||e.isArray(a));if(k)for(;i<j;i++)f=c(a[i],i,d),f!=null&&(h[h.length]=f);else for(g in a)f=c(a[g],g,d),f!=null&&(h[h.length]=f);return h.concat.apply([],h)},guid:1,proxy:function(a,c){if(typeof c=="string"){var d=a[c];c=a,a=d}if(!e.isFunction(a))return b;var f=F.call(arguments,2),g=function(){return a.apply(c,f.concat(F.call(arguments)))};g.guid=a.guid=a.guid||g.guid||e.guid++;return g},access:function(a,c,d,f,g,h){var i=a.length;if(typeof c=="object"){for(var j in c)e.access(a,j,c[j],f,g,d);return a}if(d!==b){f=!h&&f&&e.isFunction(d);for(var k=0;k<i;k++)g(a[k],c,f?d.call(a[k],k,g(a[k],c)):d,h);return a}return i?g(a[0],c):b},now:function(){return(new Date).getTime()},uaMatch:function(a){a=a.toLowerCase();var b=s.exec(a)||t.exec(a)||u.exec(a)||a.indexOf("compatible")<0&&v.exec(a)||[];return{browser:b[1]||"",version:b[2]||"0"}},sub:function(){function a(b,c){return new a.fn.init(b,c)}e.extend(!0,a,this),a.superclass=this,a.fn=a.prototype=this(),a.fn.constructor=a,a.sub=this.sub,a.fn.init=function(d,f){f&&f instanceof e&&!(f instanceof a)&&(f=a(f));return e.fn.init.call(this,d,f,b)},a.fn.init.prototype=a.fn;var b=a(c);return a},browser:{}}),e.each("Boolean Number String Function Array Date RegExp Object".split(" "),function(a,b){I["[object "+b+"]"]=b.toLowerCase()}),z=e.uaMatch(y),z.browser&&(e.browser[z.browser]=!0,e.browser.version=z.version),e.browser.webkit&&(e.browser.safari=!0),j.test(" ")&&(k=/^[\s\xA0]+/,l=/[\s\xA0]+$/),h=e(c),c.addEventListener?B=function(){c.removeEventListener("DOMContentLoaded",B,!1),e.ready()}:c.attachEvent&&(B=function(){c.readyState==="complete"&&(c.detachEvent("onreadystatechange",B),e.ready())});return e}(),g="done fail isResolved isRejected promise then always pipe".split(" "),h=[].slice;f.extend({_Deferred:function(){var a=[],b,c,d,e={done:function(){if(!d){var c=arguments,g,h,i,j,k;b&&(k=b,b=0);for(g=0,h=c.length;g<h;g++)i=c[g],j=f.type(i),j==="array"?e.done.apply(e,i):j==="function"&&a.push(i);k&&e.resolveWith(k[0],k[1])}return this},resolveWith:function(e,f){if(!d&&!b&&!c){f=f||[],c=1;try{while(a[0])a.shift().apply(e,f)}finally{b=[e,f],c=0}}return this},resolve:function(){e.resolveWith(this,arguments);return this},isResolved:function(){return!!c||!!b},cancel:function(){d=1,a=[];return this}};return e},Deferred:function(a){var b=f._Deferred(),c=f._Deferred(),d;f.extend(b,{then:function(a,c){b.done(a).fail(c);return this},always:function(){return b.done.apply(b,arguments).fail.apply(this,arguments)},fail:c.done,rejectWith:c.resolveWith,reject:c.resolve,isRejected:c.isResolved,pipe:function(a,c){return f.Deferred(function(d){f.each({done:[a,"resolve"],fail:[c,"reject"]},function(a,c){var e=c[0],g=c[1],h;f.isFunction(e)?b[a](function(){h=e.apply(this,arguments),h&&f.isFunction(h.promise)?h.promise().then(d.resolve,d.reject):d[g](h)}):b[a](d[g])})}).promise()},promise:function(a){if(a==null){if(d)return d;d=a={}}var c=g.length;while(c--)a[g[c]]=b[g[c]];return a}}),b.done(c.cancel).fail(b.cancel),delete b.cancel,a&&a.call(b,b);return b},when:function(a){function i(a){return function(c){b[a]=arguments.length>1?h.call(arguments,0):c,--e||g.resolveWith(g,h.call(b,0))}}var b=arguments,c=0,d=b.length,e=d,g=d<=1&&a&&f.isFunction(a.promise)?a:f.Deferred();if(d>1){for(;c<d;c++)b[c]&&f.isFunction(b[c].promise)?b[c].promise().then(i(c),g.reject):--e;e||g.resolveWith(g,b)}else g!==a&&g.resolveWith(g,d?[a]:[]);return g.promise()}}),f.support=function(){var a=c.createElement("div"),b=c.documentElement,d,e,g,h,i,j,k,l,m,n,o,p,q,r,s,t,u;a.setAttribute("className","t"),a.innerHTML="   <link/><table></table><a href='/a' style='top:1px;float:left;opacity:.55;'>a</a><input type='checkbox'/>",d=a.getElementsByTagName("*"),e=a.getElementsByTagName("a")[0];if(!d||!d.length||!e)return{};g=c.createElement("select"),h=g.appendChild(c.createElement("option")),i=a.getElementsByTagName("input")[0],k={leadingWhitespace:a.firstChild.nodeType===3,tbody:!a.getElementsByTagName("tbody").length,htmlSerialize:!!a.getElementsByTagName("link").length,style:/top/.test(e.getAttribute("style")),hrefNormalized:e.getAttribute("href")==="/a",opacity:/^0.55$/.test(e.style.opacity),cssFloat:!!e.style.cssFloat,checkOn:i.value==="on",optSelected:h.selected,getSetAttribute:a.className!=="t",submitBubbles:!0,changeBubbles:!0,focusinBubbles:!1,deleteExpando:!0,noCloneEvent:!0,inlineBlockNeedsLayout:!1,shrinkWrapBlocks:!1,reliableMarginRight:!0},i.checked=!0,k.noCloneChecked=i.cloneNode(!0).checked,g.disabled=!0,k.optDisabled=!h.disabled;try{delete a.test}catch(v){k.deleteExpando=!1}!a.addEventListener&&a.attachEvent&&a.fireEvent&&(a.attachEvent("onclick",function(){k.noCloneEvent=!1}),a.cloneNode(!0).fireEvent("onclick")),i=c.createElement("input"),i.value="t",i.setAttribute("type","radio"),k.radioValue=i.value==="t",i.setAttribute("checked","checked"),a.appendChild(i),l=c.createDocumentFragment(),l.appendChild(a.firstChild),k.checkClone=l.cloneNode(!0).cloneNode(!0).lastChild.checked,a.innerHTML="",a.style.width=a.style.paddingLeft="1px",m=c.getElementsByTagName("body")[0],o=c.createElement(m?"div":"body"),p={visibility:"hidden",width:0,height:0,border:0,margin:0},m&&f.extend(p,{position:"absolute",left:-1e3,top:-1e3});for(t in p)o.style[t]=p[t];o.appendChild(a),n=m||b,n.insertBefore(o,n.firstChild),k.appendChecked=i.checked,k.boxModel=a.offsetWidth===2,"zoom"in a.style&&(a.style.display="inline",a.style.zoom=1,k.inlineBlockNeedsLayout=a.offsetWidth===2,a.style.display="",a.innerHTML="<div style='width:4px;'></div>",k.shrinkWrapBlocks=a.offsetWidth!==2),a.innerHTML="<table><tr><td style='padding:0;border:0;display:none'></td><td>t</td></tr></table>",q=a.getElementsByTagName("td"),u=q[0].offsetHeight===0,q[0].style.display="",q[1].style.display="none",k.reliableHiddenOffsets=u&&q[0].offsetHeight===0,a.innerHTML="",c.defaultView&&c.defaultView.getComputedStyle&&(j=c.createElement("div"),j.style.width="0",j.style.marginRight="0",a.appendChild(j),k.reliableMarginRight=(parseInt((c.defaultView.getComputedStyle(j,null)||{marginRight:0}).marginRight,10)||0)===0),o.innerHTML="",n.removeChild(o);if(a.attachEvent)for(t in{submit:1,change:1,focusin:1})s="on"+t,u=s in a,u||(a.setAttribute(s,"return;"),u=typeof a[s]=="function"),k[t+"Bubbles"]=u;o=l=g=h=m=j=a=i=null;return k}(),f.boxModel=f.support.boxModel;var i=/^(?:\{.*\}|\[.*\])$/,j=/([a-z])([A-Z])/g;f.extend({cache:{},uuid:0,expando:"jQuery"+(f.fn.jquery+Math.random()).replace(/\D/g,""),noData:{embed:!0,object:"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",applet:!0},hasData:function(a){a=a.nodeType?f.cache[a[f.expando]]:a[f.expando];return!!a&&!l(a)},data:function(a,c,d,e){if(!!f.acceptData(a)){var g=f.expando,h=typeof c=="string",i,j=a.nodeType,k=j?f.cache:a,l=j?a[f.expando]:a[f.expando]&&f.expando;if((!l||e&&l&&!k[l][g])&&h&&d===b)return;l||(j?a[f.expando]=l=++f.uuid:l=f.expando),k[l]||(k[l]={},j||(k[l].toJSON=f.noop));if(typeof c=="object"||typeof c=="function")e?k[l][g]=f.extend(k[l][g],c):k[l]=f.extend(k[l],c);i=k[l],e&&(i[g]||(i[g]={}),i=i[g]),d!==b&&(i[f.camelCase(c)]=d);if(c==="events"&&!i[c])return i[g]&&i[g].events;return h?i[f.camelCase(c)]||i[c]:i}},removeData:function(b,c,d){if(!!f.acceptData(b)){var e=f.expando,g=b.nodeType,h=g?f.cache:b,i=g?b[f.expando]:f.expando;if(!h[i])return;if(c){var j=d?h[i][e]:h[i];if(j){delete j[c];if(!l(j))return}}if(d){delete h[i][e];if(!l(h[i]))return}var k=h[i][e];f.support.deleteExpando||h!=a?delete h[i]:h[i]=null,k?(h[i]={},g||(h[i].toJSON=f.noop),h[i][e]=k):g&&(f.support.deleteExpando?delete b[f.expando]:b.removeAttribute?b.removeAttribute(f.expando):b[f.expando]=null)}},_data:function(a,b,c){return f.data(a,b,c,!0)},acceptData:function(a){if(a.nodeName){var b=f.noData[a.nodeName.toLowerCase()];if(b)return b!==!0&&a.getAttribute("classid")===b}return!0}}),f.fn.extend({data:function(a,c){var d=null;if(typeof a=="undefined"){if(this.length){d=f.data(this[0]);if(this[0].nodeType===1){var e=this[0].attributes,g;for(var h=0,i=e.length;h<i;h++)g=e[h].name,g.indexOf("data-")===0&&(g=f.camelCase(g.substring(5)),k(this[0],g,d[g]))}}return d}if(typeof a=="object")return this.each(function(){f.data(this,a)});var j=a.split(".");j[1]=j[1]?"."+j[1]:"";if(c===b){d=this.triggerHandler("getData"+j[1]+"!",[j[0]]),d===b&&this.length&&(d=f.data(this[0],a),d=k(this[0],a,d));return d===b&&j[1]?this.data(j[0]):d}return this.each(function(){var b=f(this),d=[j[0],c];b.triggerHandler("setData"+j[1]+"!",d),f.data(this,a,c),b.triggerHandler("changeData"+j[1]+"!",d)})},removeData:function(a){return this.each(function(){f.removeData(this,a)})}}),f.extend({_mark:function(a,c){a&&(c=(c||"fx")+"mark",f.data(a,c,(f.data(a,c,b,!0)||0)+1,!0))},_unmark:function(a,c,d){a!==!0&&(d=c,c=a,a=!1);if(c){d=d||"fx";var e=d+"mark",g=a?0:(f.data(c,e,b,!0)||1)-1;g?f.data(c,e,g,!0):(f.removeData(c,e,!0),m(c,d,"mark"))}},queue:function(a,c,d){if(a){c=(c||"fx")+"queue";var e=f.data(a,c,b,!0);d&&(!e||f.isArray(d)?e=f.data(a,c,f.makeArray(d),!0):e.push(d));return e||[]}},dequeue:function(a,b){b=b||"fx";var c=f.queue(a,b),d=c.shift(),e;d==="inprogress"&&(d=c.shift()),d&&(b==="fx"&&c.unshift("inprogress"),d.call(a,function(){f.dequeue(a,b)})),c.length||(f.removeData(a,b+"queue",!0),m(a,b,"queue"))}}),f.fn.extend({queue:function(a,c){typeof a!="string"&&(c=a,a="fx");if(c===b)return f.queue(this[0],a);return this.each(function(){var b=f.queue(this,a,c);a==="fx"&&b[0]!=="inprogress"&&f.dequeue(this,a)})},dequeue:function(a){return this.each(function(){f.dequeue(this,a)})},delay:function(a,b){a=f.fx?f.fx.speeds[a]||a:a,b=b||"fx";return this.queue(b,function(){var c=this;setTimeout(function(){f.dequeue(c,b)},a)})},clearQueue:function(a){return this.queue(a||"fx",[])},promise:function(a,c){function m(){--h||d.resolveWith(e,[e])}typeof a!="string"&&(c=a,a=b),a=a||"fx";var d=f.Deferred(),e=this,g=e.length,h=1,i=a+"defer",j=a+"queue",k=a+"mark",l;while(g--)if(l=f.data(e[g],i,b,!0)||(f.data(e[g],j,b,!0)||f.data(e[g],k,b,!0))&&f.data(e[g],i,f._Deferred(),!0))h++,l.done(m);m();return d.promise()}});var n=/[\n\t\r]/g,o=/\s+/,p=/\r/g,q=/^(?:button|input)$/i,r=/^(?:button|input|object|select|textarea)$/i,s=/^a(?:rea)?$/i,t=/^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i,u=/\:|^on/,v,w;f.fn.extend({attr:function(a,b){return f.access(this,a,b,!0,f.attr)},removeAttr:function(a){return this.each(function(){f.removeAttr(this,a)})},prop:function(a,b){return f.access(this,a,b,!0,f.prop)},removeProp:function(a){a=f.propFix[a]||a;return this.each(function(){try{this[a]=b,delete this[a]}catch(c){}})},addClass:function(a){var b,c,d,e,g,h,i;if(f.isFunction(a))return this.each(function(b){f(this).addClass(a.call(this,b,this.className))});if(a&&typeof a=="string"){b=a.split(o);for(c=0,d=this.length;c<d;c++){e=this[c];if(e.nodeType===1)if(!e.className&&b.length===1)e.className=a;else{g=" "+e.className+" ";for(h=0,i=b.length;h<i;h++)~g.indexOf(" "+b[h]+" ")||(g+=b[h]+" ");e.className=f.trim(g)}}}return this},removeClass:function(a){var c,d,e,g,h,i,j;if(f.isFunction(a))return this.each(function(b){f(this).removeClass(a.call(this,b,this.className))});if(a&&typeof a=="string"||a===b){c=(a||"").split(o);for(d=0,e=this.length;d<e;d++){g=this[d];if(g.nodeType===1&&g.className)if(a){h=(" "+g.className+" ").replace(n," ");for(i=0,j=c.length;i<j;i++)h=h.replace(" "+c[i]+" "," ");g.className=f.trim(h)}else g.className=""}}return this},toggleClass:function(a,b){var c=typeof a,d=typeof b=="boolean";if(f.isFunction(a))return this.each(function(c){f(this).toggleClass(a.call(this,c,this.className,b),b)});return this.each(function(){if(c==="string"){var e,g=0,h=f(this),i=b,j=a.split(o);while(e=j[g++])i=d?i:!h.hasClass(e),h[i?"addClass":"removeClass"](e)}else if(c==="undefined"||c==="boolean")this.className&&f._data(this,"__className__",this.className),this.className=this.className||a===!1?"":f._data(this,"__className__")||""})},hasClass:function(a){var b=" "+a+" ";for(var c=0,d=this.length;c<d;c++)if((" "+this[c].className+" ").replace(n," ").indexOf(b)>-1)return!0;return!1},val:function(a){var c,d,e=this[0];if(!arguments.length){if(e){c=f.valHooks[e.nodeName.toLowerCase()]||f.valHooks[e.type];if(c&&"get"in c&&(d=c.get(e,"value"))!==b)return d;d=e.value;return typeof d=="string"?d.replace(p,""):d==null?"":d}return b}var g=f.isFunction(a);return this.each(function(d){var e=f(this),h;if(this.nodeType===1){g?h=a.call(this,d,e.val()):h=a,h==null?h="":typeof h=="number"?h+="":f.isArray(h)&&(h=f.map(h,function(a){return a==null?"":a+""})),c=f.valHooks[this.nodeName.toLowerCase()]||f.valHooks[this.type];if(!c||!("set"in c)||c.set(this,h,"value")===b)this.value=h}})}}),f.extend({valHooks:{option:{get:function(a){var b=a.attributes.value;return!b||b.specified?a.value:a.text}},select:{get:function(a){var b,c=a.selectedIndex,d=[],e=a.options,g=a.type==="select-one";if(c<0)return null;for(var h=g?c:0,i=g?c+1:e.length;h<i;h++){var j=e[h];if(j.selected&&(f.support.optDisabled?!j.disabled:j.getAttribute("disabled")===null)&&(!j.parentNode.disabled||!f.nodeName(j.parentNode,"optgroup"))){b=f(j).val();if(g)return b;d.push(b)}}if(g&&!d.length&&e.length)return f(e[c]).val();return d},set:function(a,b){var c=f.makeArray(b);f(a).find("option").each(function(){this.selected=f.inArray(f(this).val(),c)>=0}),c.length||(a.selectedIndex=-1);return c}}},attrFn:{val:!0,css:!0,html:!0,text:!0,data:!0,width:!0,height:!0,offset:!0},attrFix:{tabindex:"tabIndex"},attr:function(a,c,d,e){var g=a.nodeType;if(!a||g===3||g===8||g===2)return b;if(e&&c in f.attrFn)return f(a)[c](d);if(!("getAttribute"in a))return f.prop(a,c,d);var h,i,j=g!==1||!f.isXMLDoc(a);j&&(c=f.attrFix[c]||c,i=f.attrHooks[c],i||(t.test(c)?i=w:v&&c!=="className"&&(f.nodeName(a,"form")||u.test(c))&&(i=v)));if(d!==b){if(d===null){f.removeAttr(a,c);return b}if(i&&"set"in i&&j&&(h=i.set(a,d,c))!==b)return h;a.setAttribute(c,""+d);return d}if(i&&"get"in i&&j&&(h=i.get(a,c))!==null)return h;h=a.getAttribute(c);return h===null?b:h},removeAttr:function(a,b){var c;a.nodeType===1&&(b=f.attrFix[b]||b,f.support.getSetAttribute?a.removeAttribute(b):(f.attr(a,b,""),a.removeAttributeNode(a.getAttributeNode(b))),t.test(b)&&(c=f.propFix[b]||b)in a&&(a[c]=!1))},attrHooks:{type:{set:function(a,b){if(q.test(a.nodeName)&&a.parentNode)f.error("type property can't be changed");else if(!f.support.radioValue&&b==="radio"&&f.nodeName(a,"input")){var c=a.value;a.setAttribute("type",b),c&&(a.value=c);return b}}},tabIndex:{get:function(a){var c=a.getAttributeNode("tabIndex");return c&&c.specified?parseInt(c.value,10):r.test(a.nodeName)||s.test(a.nodeName)&&a.href?0:b}},value:{get:function(a,b){if(v&&f.nodeName(a,"button"))return v.get(a,b);return b in a?a.value:null},set:function(a,b,c){if(v&&f.nodeName(a,"button"))return v.set(a,b,c);a.value=b}}},propFix:{tabindex:"tabIndex",readonly:"readOnly","for":"htmlFor","class":"className",maxlength:"maxLength",cellspacing:"cellSpacing",cellpadding:"cellPadding",rowspan:"rowSpan",colspan:"colSpan",usemap:"useMap",frameborder:"frameBorder",contenteditable:"contentEditable"},prop:function(a,c,d){var e=a.nodeType;if(!a||e===3||e===8||e===2)return b;var g,h,i=e!==1||!f.isXMLDoc(a);i&&(c=f.propFix[c]||c,h=f.propHooks[c]);return d!==b?h&&"set"in h&&(g=h.set(a,d,c))!==b?g:a[c]=d:h&&"get"in h&&(g=h.get(a,c))!==b?g:a[c]},propHooks:{}}),w={get:function(a,c){return f.prop(a,c)?c.toLowerCase():b},set:function(a,b,c){var d;b===!1?f.removeAttr(a,c):(d=f.propFix[c]||c,d in a&&(a[d]=!0),a.setAttribute(c,c.toLowerCase()));return c}},f.support.getSetAttribute||(f.attrFix=f.propFix,v=f.attrHooks.name=f.attrHooks.title=f.valHooks.button={get:function(a,c){var d;d=a.getAttributeNode(c);return d&&d.nodeValue!==""?d.nodeValue:b},set:function(a,b,c){var d=a.getAttributeNode(c);if(d){d.nodeValue=b;return b}}},f.each(["width","height"],function(a,b){f.attrHooks[b]=f.extend(f.attrHooks[b],{set:function(a,c){if(c===""){a.setAttribute(b,"auto");return c}}})})),f.support.hrefNormalized||f.each(["href","src","width","height"],function(a,c){f.attrHooks[c]=f.extend(f.attrHooks[c],{get:function(a){var d=a.getAttribute(c,2);return d===null?b:d}})}),f.support.style||(f.attrHooks.style={get:function(a){return a.style.cssText.toLowerCase()||b},set:function(a,b){return a.style.cssText=""+b}}),f.support.optSelected||(f.propHooks.selected=f.extend(f.propHooks.selected,{get:function(a){var b=a.parentNode;b&&(b.selectedIndex,b.parentNode&&b.parentNode.selectedIndex)}})),f.support.checkOn||f.each(["radio","checkbox"],function(){f.valHooks[this]={get:function(a){return a.getAttribute("value")===null?"on":a.value}}}),f.each(["radio","checkbox"],function(){f.valHooks[this]=f.extend(f.valHooks[this],{set:function(a,b){if(f.isArray(b))return a.checked=f.inArray(f(a).val(),b)>=0}})});var x=/\.(.*)$/,y=/^(?:textarea|input|select)$/i,z=/\./g,A=/ /g,B=/[^\w\s.|`]/g,C=function(a){return a.replace(B,"\\$&")};f.event={add:function(a,c,d,e){if(a.nodeType!==3&&a.nodeType!==8){if(d===!1)d=D;else if(!d)return;var g,h;d.handler&&(g=d,d=g.handler),d.guid||(d.guid=f.guid++);var i=f._data(a);if(!i)return;var j=i.events,k=i.handle;j||(i.events=j={}),k||(i.handle=k=function(a){return typeof f!="undefined"&&(!a||f.event.triggered!==a.type)?f.event.handle.apply(k.elem,arguments):b}),k.elem=a,c=c.split(" ");var l,m=0,n;while(l=c[m++]){h=g?f.extend({},g):{handler:d,data:e},l.indexOf(".")>-1?(n=l.split("."),l=n.shift(),h.namespace=n.slice(0).sort().join(".")):(n=[],h.namespace=""),h.type=l,h.guid||(h.guid=d.guid);var o=j[l],p=f.event.special[l]||{};if(!o){o=j[l]=[];if(!p.setup||p.setup.call(a,e,n,k)===!1)a.addEventListener?a.addEventListener(l,k,!1):a.attachEvent&&a.attachEvent("on"+l,k)}p.add&&(p.add.call(a,h),h.handler.guid||(h.handler.guid=d.guid)),o.push(h),f.event.global[l]=!0}a=null}},global:{},remove:function(a,c,d,e){if(a.nodeType!==3&&a.nodeType!==8){d===!1&&(d=D);var g,h,i,j,k=0,l,m,n,o,p,q,r,s=f.hasData(a)&&f._data(a),t=s&&s.events;if(!s||!t)return;c&&c.type&&(d=c.handler,c=c.type);if(!c||typeof c=="string"&&c.charAt(0)==="."){c=c||"";for(h in t)f.event.remove(a,h+c);return}c=c.split(" ");while(h=c[k++]){r=h,q=null,l=h.indexOf(".")<0,m=[],l||(m=h.split("."),h=m.shift(),n=new RegExp("(^|\\.)"+f.map(m.slice(0).sort(),C).join("\\.(?:.*\\.)?")+"(\\.|$)")),p=t[h];if(!p)continue;if(!d){for(j=0;j<p.length;j++){q=p[j];if(l||n.test(q.namespace))f.event.remove(a,r,q.handler,j),p.splice(j--,1)}continue}o=f.event.special[h]||{};for(j=e||0;j<p.length;j++){q=p[j];if(d.guid===q.guid){if(l||n.test(q.namespace))e==null&&p.splice(j--,1),o.remove&&o.remove.call(a,q);if(e!=null)break}}if(p.length===0||e!=null&&p.length===1)(!o.teardown||o.teardown.call(a,m)===!1)&&f.removeEvent(a,h,s.handle),g=null,delete t[h]}if(f.isEmptyObject(t)){var u=s.handle;u&&(u.elem=null),delete s.events,delete s.handle,f.isEmptyObject(s)&&f.removeData(a,b,!0)}}},customEvent:{getData:!0,setData:!0,changeData:!0},trigger:function(c,d,e,g){var h=c.type||c,i=[],j;h.indexOf("!")>=0&&(h=h.slice(0,-1),j=!0),h.indexOf(".")>=0&&(i=h.split("."),h=i.
+shift(),i.sort());if(!!e&&!f.event.customEvent[h]||!!f.event.global[h]){c=typeof c=="object"?c[f.expando]?c:new f.Event(h,c):new f.Event(h),c.type=h,c.exclusive=j,c.namespace=i.join("."),c.namespace_re=new RegExp("(^|\\.)"+i.join("\\.(?:.*\\.)?")+"(\\.|$)");if(g||!e)c.preventDefault(),c.stopPropagation();if(!e){f.each(f.cache,function(){var a=f.expando,b=this[a];b&&b.events&&b.events[h]&&f.event.trigger(c,d,b.handle.elem)});return}if(e.nodeType===3||e.nodeType===8)return;c.result=b,c.target=e,d=d!=null?f.makeArray(d):[],d.unshift(c);var k=e,l=h.indexOf(":")<0?"on"+h:"";do{var m=f._data(k,"handle");c.currentTarget=k,m&&m.apply(k,d),l&&f.acceptData(k)&&k[l]&&k[l].apply(k,d)===!1&&(c.result=!1,c.preventDefault()),k=k.parentNode||k.ownerDocument||k===c.target.ownerDocument&&a}while(k&&!c.isPropagationStopped());if(!c.isDefaultPrevented()){var n,o=f.event.special[h]||{};if((!o._default||o._default.call(e.ownerDocument,c)===!1)&&(h!=="click"||!f.nodeName(e,"a"))&&f.acceptData(e)){try{l&&e[h]&&(n=e[l],n&&(e[l]=null),f.event.triggered=h,e[h]())}catch(p){}n&&(e[l]=n),f.event.triggered=b}}return c.result}},handle:function(c){c=f.event.fix(c||a.event);var d=((f._data(this,"events")||{})[c.type]||[]).slice(0),e=!c.exclusive&&!c.namespace,g=Array.prototype.slice.call(arguments,0);g[0]=c,c.currentTarget=this;for(var h=0,i=d.length;h<i;h++){var j=d[h];if(e||c.namespace_re.test(j.namespace)){c.handler=j.handler,c.data=j.data,c.handleObj=j;var k=j.handler.apply(this,g);k!==b&&(c.result=k,k===!1&&(c.preventDefault(),c.stopPropagation()));if(c.isImmediatePropagationStopped())break}}return c.result},props:"altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode layerX layerY metaKey newValue offsetX offsetY pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "),fix:function(a){if(a[f.expando])return a;var d=a;a=f.Event(d);for(var e=this.props.length,g;e;)g=this.props[--e],a[g]=d[g];a.target||(a.target=a.srcElement||c),a.target.nodeType===3&&(a.target=a.target.parentNode),!a.relatedTarget&&a.fromElement&&(a.relatedTarget=a.fromElement===a.target?a.toElement:a.fromElement);if(a.pageX==null&&a.clientX!=null){var h=a.target.ownerDocument||c,i=h.documentElement,j=h.body;a.pageX=a.clientX+(i&&i.scrollLeft||j&&j.scrollLeft||0)-(i&&i.clientLeft||j&&j.clientLeft||0),a.pageY=a.clientY+(i&&i.scrollTop||j&&j.scrollTop||0)-(i&&i.clientTop||j&&j.clientTop||0)}a.which==null&&(a.charCode!=null||a.keyCode!=null)&&(a.which=a.charCode!=null?a.charCode:a.keyCode),!a.metaKey&&a.ctrlKey&&(a.metaKey=a.ctrlKey),!a.which&&a.button!==b&&(a.which=a.button&1?1:a.button&2?3:a.button&4?2:0);return a},guid:1e8,proxy:f.proxy,special:{ready:{setup:f.bindReady,teardown:f.noop},live:{add:function(a){f.event.add(this,N(a.origType,a.selector),f.extend({},a,{handler:M,guid:a.handler.guid}))},remove:function(a){f.event.remove(this,N(a.origType,a.selector),a)}},beforeunload:{setup:function(a,b,c){f.isWindow(this)&&(this.onbeforeunload=c)},teardown:function(a,b){this.onbeforeunload===b&&(this.onbeforeunload=null)}}}},f.removeEvent=c.removeEventListener?function(a,b,c){a.removeEventListener&&a.removeEventListener(b,c,!1)}:function(a,b,c){a.detachEvent&&a.detachEvent("on"+b,c)},f.Event=function(a,b){if(!this.preventDefault)return new f.Event(a,b);a&&a.type?(this.originalEvent=a,this.type=a.type,this.isDefaultPrevented=a.defaultPrevented||a.returnValue===!1||a.getPreventDefault&&a.getPreventDefault()?E:D):this.type=a,b&&f.extend(this,b),this.timeStamp=f.now(),this[f.expando]=!0},f.Event.prototype={preventDefault:function(){this.isDefaultPrevented=E;var a=this.originalEvent;!a||(a.preventDefault?a.preventDefault():a.returnValue=!1)},stopPropagation:function(){this.isPropagationStopped=E;var a=this.originalEvent;!a||(a.stopPropagation&&a.stopPropagation(),a.cancelBubble=!0)},stopImmediatePropagation:function(){this.isImmediatePropagationStopped=E,this.stopPropagation()},isDefaultPrevented:D,isPropagationStopped:D,isImmediatePropagationStopped:D};var F=function(a){var b=a.relatedTarget,c=!1,d=a.type;a.type=a.data,b!==this&&(b&&(c=f.contains(this,b)),c||(f.event.handle.apply(this,arguments),a.type=d))},G=function(a){a.type=a.data,f.event.handle.apply(this,arguments)};f.each({mouseenter:"mouseover",mouseleave:"mouseout"},function(a,b){f.event.special[a]={setup:function(c){f.event.add(this,b,c&&c.selector?G:F,a)},teardown:function(a){f.event.remove(this,b,a&&a.selector?G:F)}}}),f.support.submitBubbles||(f.event.special.submit={setup:function(a,b){if(!f.nodeName(this,"form"))f.event.add(this,"click.specialSubmit",function(a){var b=a.target,c=b.type;(c==="submit"||c==="image")&&f(b).closest("form").length&&K("submit",this,arguments)}),f.event.add(this,"keypress.specialSubmit",function(a){var b=a.target,c=b.type;(c==="text"||c==="password")&&f(b).closest("form").length&&a.keyCode===13&&K("submit",this,arguments)});else return!1},teardown:function(a){f.event.remove(this,".specialSubmit")}});if(!f.support.changeBubbles){var H,I=function(a){var b=a.type,c=a.value;b==="radio"||b==="checkbox"?c=a.checked:b==="select-multiple"?c=a.selectedIndex>-1?f.map(a.options,function(a){return a.selected}).join("-"):"":f.nodeName(a,"select")&&(c=a.selectedIndex);return c},J=function(c){var d=c.target,e,g;if(!!y.test(d.nodeName)&&!d.readOnly){e=f._data(d,"_change_data"),g=I(d),(c.type!=="focusout"||d.type!=="radio")&&f._data(d,"_change_data",g);if(e===b||g===e)return;if(e!=null||g)c.type="change",c.liveFired=b,f.event.trigger(c,arguments[1],d)}};f.event.special.change={filters:{focusout:J,beforedeactivate:J,click:function(a){var b=a.target,c=f.nodeName(b,"input")?b.type:"";(c==="radio"||c==="checkbox"||f.nodeName(b,"select"))&&J.call(this,a)},keydown:function(a){var b=a.target,c=f.nodeName(b,"input")?b.type:"";(a.keyCode===13&&!f.nodeName(b,"textarea")||a.keyCode===32&&(c==="checkbox"||c==="radio")||c==="select-multiple")&&J.call(this,a)},beforeactivate:function(a){var b=a.target;f._data(b,"_change_data",I(b))}},setup:function(a,b){if(this.type==="file")return!1;for(var c in H)f.event.add(this,c+".specialChange",H[c]);return y.test(this.nodeName)},teardown:function(a){f.event.remove(this,".specialChange");return y.test(this.nodeName)}},H=f.event.special.change.filters,H.focus=H.beforeactivate}f.support.focusinBubbles||f.each({focus:"focusin",blur:"focusout"},function(a,b){function e(a){var c=f.event.fix(a);c.type=b,c.originalEvent={},f.event.trigger(c,null,c.target),c.isDefaultPrevented()&&a.preventDefault()}var d=0;f.event.special[b]={setup:function(){d++===0&&c.addEventListener(a,e,!0)},teardown:function(){--d===0&&c.removeEventListener(a,e,!0)}}}),f.each(["bind","one"],function(a,c){f.fn[c]=function(a,d,e){var g;if(typeof a=="object"){for(var h in a)this[c](h,d,a[h],e);return this}if(arguments.length===2||d===!1)e=d,d=b;c==="one"?(g=function(a){f(this).unbind(a,g);return e.apply(this,arguments)},g.guid=e.guid||f.guid++):g=e;if(a==="unload"&&c!=="one")this.one(a,d,e);else for(var i=0,j=this.length;i<j;i++)f.event.add(this[i],a,g,d);return this}}),f.fn.extend({unbind:function(a,b){if(typeof a=="object"&&!a.preventDefault)for(var c in a)this.unbind(c,a[c]);else for(var d=0,e=this.length;d<e;d++)f.event.remove(this[d],a,b);return this},delegate:function(a,b,c,d){return this.live(b,c,d,a)},undelegate:function(a,b,c){return arguments.length===0?this.unbind("live"):this.die(b,null,c,a)},trigger:function(a,b){return this.each(function(){f.event.trigger(a,b,this)})},triggerHandler:function(a,b){if(this[0])return f.event.trigger(a,b,this[0],!0)},toggle:function(a){var b=arguments,c=a.guid||f.guid++,d=0,e=function(c){var e=(f.data(this,"lastToggle"+a.guid)||0)%d;f.data(this,"lastToggle"+a.guid,e+1),c.preventDefault();return b[e].apply(this,arguments)||!1};e.guid=c;while(d<b.length)b[d++].guid=c;return this.click(e)},hover:function(a,b){return this.mouseenter(a).mouseleave(b||a)}});var L={focus:"focusin",blur:"focusout",mouseenter:"mouseover",mouseleave:"mouseout"};f.each(["live","die"],function(a,c){f.fn[c]=function(a,d,e,g){var h,i=0,j,k,l,m=g||this.selector,n=g?this:f(this.context);if(typeof a=="object"&&!a.preventDefault){for(var o in a)n[c](o,d,a[o],m);return this}if(c==="die"&&!a&&g&&g.charAt(0)==="."){n.unbind(g);return this}if(d===!1||f.isFunction(d))e=d||D,d=b;a=(a||"").split(" ");while((h=a[i++])!=null){j=x.exec(h),k="",j&&(k=j[0],h=h.replace(x,""));if(h==="hover"){a.push("mouseenter"+k,"mouseleave"+k);continue}l=h,L[h]?(a.push(L[h]+k),h=h+k):h=(L[h]||h)+k;if(c==="live")for(var p=0,q=n.length;p<q;p++)f.event.add(n[p],"live."+N(h,m),{data:d,selector:m,handler:e,origType:h,origHandler:e,preType:l});else n.unbind("live."+N(h,m),e)}return this}}),f.each("blur focus focusin focusout load resize scroll unload click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup error".split(" "),function(a,b){f.fn[b]=function(a,c){c==null&&(c=a,a=null);return arguments.length>0?this.bind(b,a,c):this.trigger(b)},f.attrFn&&(f.attrFn[b]=!0)}),function(){function u(a,b,c,d,e,f){for(var g=0,h=d.length;g<h;g++){var i=d[g];if(i){var j=!1;i=i[a];while(i){if(i.sizcache===c){j=d[i.sizset];break}if(i.nodeType===1){f||(i.sizcache=c,i.sizset=g);if(typeof b!="string"){if(i===b){j=!0;break}}else if(k.filter(b,[i]).length>0){j=i;break}}i=i[a]}d[g]=j}}}function t(a,b,c,d,e,f){for(var g=0,h=d.length;g<h;g++){var i=d[g];if(i){var j=!1;i=i[a];while(i){if(i.sizcache===c){j=d[i.sizset];break}i.nodeType===1&&!f&&(i.sizcache=c,i.sizset=g);if(i.nodeName.toLowerCase()===b){j=i;break}i=i[a]}d[g]=j}}}var a=/((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,d=0,e=Object.prototype.toString,g=!1,h=!0,i=/\\/g,j=/\W/;[0,0].sort(function(){h=!1;return 0});var k=function(b,d,f,g){f=f||[],d=d||c;var h=d;if(d.nodeType!==1&&d.nodeType!==9)return[];if(!b||typeof b!="string")return f;var i,j,n,o,q,r,s,t,u=!0,w=k.isXML(d),x=[],y=b;do{a.exec(""),i=a.exec(y);if(i){y=i[3],x.push(i[1]);if(i[2]){o=i[3];break}}}while(i);if(x.length>1&&m.exec(b))if(x.length===2&&l.relative[x[0]])j=v(x[0]+x[1],d);else{j=l.relative[x[0]]?[d]:k(x.shift(),d);while(x.length)b=x.shift(),l.relative[b]&&(b+=x.shift()),j=v(b,j)}else{!g&&x.length>1&&d.nodeType===9&&!w&&l.match.ID.test(x[0])&&!l.match.ID.test(x[x.length-1])&&(q=k.find(x.shift(),d,w),d=q.expr?k.filter(q.expr,q.set)[0]:q.set[0]);if(d){q=g?{expr:x.pop(),set:p(g)}:k.find(x.pop(),x.length===1&&(x[0]==="~"||x[0]==="+")&&d.parentNode?d.parentNode:d,w),j=q.expr?k.filter(q.expr,q.set):q.set,x.length>0?n=p(j):u=!1;while(x.length)r=x.pop(),s=r,l.relative[r]?s=x.pop():r="",s==null&&(s=d),l.relative[r](n,s,w)}else n=x=[]}n||(n=j),n||k.error(r||b);if(e.call(n)==="[object Array]")if(!u)f.push.apply(f,n);else if(d&&d.nodeType===1)for(t=0;n[t]!=null;t++)n[t]&&(n[t]===!0||n[t].nodeType===1&&k.contains(d,n[t]))&&f.push(j[t]);else for(t=0;n[t]!=null;t++)n[t]&&n[t].nodeType===1&&f.push(j[t]);else p(n,f);o&&(k(o,h,f,g),k.uniqueSort(f));return f};k.uniqueSort=function(a){if(r){g=h,a.sort(r);if(g)for(var b=1;b<a.length;b++)a[b]===a[b-1]&&a.splice(b--,1)}return a},k.matches=function(a,b){return k(a,null,null,b)},k.matchesSelector=function(a,b){return k(b,null,null,[a]).length>0},k.find=function(a,b,c){var d;if(!a)return[];for(var e=0,f=l.order.length;e<f;e++){var g,h=l.order[e];if(g=l.leftMatch[h].exec(a)){var j=g[1];g.splice(1,1);if(j.substr(j.length-1)!=="\\"){g[1]=(g[1]||"").replace(i,""),d=l.find[h](g,b,c);if(d!=null){a=a.replace(l.match[h],"");break}}}}d||(d=typeof b.getElementsByTagName!="undefined"?b.getElementsByTagName("*"):[]);return{set:d,expr:a}},k.filter=function(a,c,d,e){var f,g,h=a,i=[],j=c,m=c&&c[0]&&k.isXML(c[0]);while(a&&c.length){for(var n in l.filter)if((f=l.leftMatch[n].exec(a))!=null&&f[2]){var o,p,q=l.filter[n],r=f[1];g=!1,f.splice(1,1);if(r.substr(r.length-1)==="\\")continue;j===i&&(i=[]);if(l.preFilter[n]){f=l.preFilter[n](f,j,d,i,e,m);if(!f)g=o=!0;else if(f===!0)continue}if(f)for(var s=0;(p=j[s])!=null;s++)if(p){o=q(p,f,s,j);var t=e^!!o;d&&o!=null?t?g=!0:j[s]=!1:t&&(i.push(p),g=!0)}if(o!==b){d||(j=i),a=a.replace(l.match[n],"");if(!g)return[];break}}if(a===h)if(g==null)k.error(a);else break;h=a}return j},k.error=function(a){throw"Syntax error, unrecognized expression: "+a};var l=k.selectors={order:["ID","NAME","TAG"],match:{ID:/#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,CLASS:/\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,NAME:/\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/,ATTR:/\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(?:(['"])(.*?)\3|(#?(?:[\w\u00c0-\uFFFF\-]|\\.)*)|)|)\s*\]/,TAG:/^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/,CHILD:/:(only|nth|last|first)-child(?:\(\s*(even|odd|(?:[+\-]?\d+|(?:[+\-]?\d*)?n\s*(?:[+\-]\s*\d+)?))\s*\))?/,POS:/:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/,PSEUDO:/:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/},leftMatch:{},attrMap:{"class":"className","for":"htmlFor"},attrHandle:{href:function(a){return a.getAttribute("href")},type:function(a){return a.getAttribute("type")}},relative:{"+":function(a,b){var c=typeof b=="string",d=c&&!j.test(b),e=c&&!d;d&&(b=b.toLowerCase());for(var f=0,g=a.length,h;f<g;f++)if(h=a[f]){while((h=h.previousSibling)&&h.nodeType!==1);a[f]=e||h&&h.nodeName.toLowerCase()===b?h||!1:h===b}e&&k.filter(b,a,!0)},">":function(a,b){var c,d=typeof b=="string",e=0,f=a.length;if(d&&!j.test(b)){b=b.toLowerCase();for(;e<f;e++){c=a[e];if(c){var g=c.parentNode;a[e]=g.nodeName.toLowerCase()===b?g:!1}}}else{for(;e<f;e++)c=a[e],c&&(a[e]=d?c.parentNode:c.parentNode===b);d&&k.filter(b,a,!0)}},"":function(a,b,c){var e,f=d++,g=u;typeof b=="string"&&!j.test(b)&&(b=b.toLowerCase(),e=b,g=t),g("parentNode",b,f,a,e,c)},"~":function(a,b,c){var e,f=d++,g=u;typeof b=="string"&&!j.test(b)&&(b=b.toLowerCase(),e=b,g=t),g("previousSibling",b,f,a,e,c)}},find:{ID:function(a,b,c){if(typeof b.getElementById!="undefined"&&!c){var d=b.getElementById(a[1]);return d&&d.parentNode?[d]:[]}},NAME:function(a,b){if(typeof b.getElementsByName!="undefined"){var c=[],d=b.getElementsByName(a[1]);for(var e=0,f=d.length;e<f;e++)d[e].getAttribute("name")===a[1]&&c.push(d[e]);return c.length===0?null:c}},TAG:function(a,b){if(typeof b.getElementsByTagName!="undefined")return b.getElementsByTagName(a[1])}},preFilter:{CLASS:function(a,b,c,d,e,f){a=" "+a[1].replace(i,"")+" ";if(f)return a;for(var g=0,h;(h=b[g])!=null;g++)h&&(e^(h.className&&(" "+h.className+" ").replace(/[\t\n\r]/g," ").indexOf(a)>=0)?c||d.push(h):c&&(b[g]=!1));return!1},ID:function(a){return a[1].replace(i,"")},TAG:function(a,b){return a[1].replace(i,"").toLowerCase()},CHILD:function(a){if(a[1]==="nth"){a[2]||k.error(a[0]),a[2]=a[2].replace(/^\+|\s*/g,"");var b=/(-?)(\d*)(?:n([+\-]?\d*))?/.exec(a[2]==="even"&&"2n"||a[2]==="odd"&&"2n+1"||!/\D/.test(a[2])&&"0n+"+a[2]||a[2]);a[2]=b[1]+(b[2]||1)-0,a[3]=b[3]-0}else a[2]&&k.error(a[0]);a[0]=d++;return a},ATTR:function(a,b,c,d,e,f){var g=a[1]=a[1].replace(i,"");!f&&l.attrMap[g]&&(a[1]=l.attrMap[g]),a[4]=(a[4]||a[5]||"").replace(i,""),a[2]==="~="&&(a[4]=" "+a[4]+" ");return a},PSEUDO:function(b,c,d,e,f){if(b[1]==="not")if((a.exec(b[3])||"").length>1||/^\w/.test(b[3]))b[3]=k(b[3],null,null,c);else{var g=k.filter(b[3],c,d,!0^f);d||e.push.apply(e,g);return!1}else if(l.match.POS.test(b[0])||l.match.CHILD.test(b[0]))return!0;return b},POS:function(a){a.unshift(!0);return a}},filters:{enabled:function(a){return a.disabled===!1&&a.type!=="hidden"},disabled:function(a){return a.disabled===!0},checked:function(a){return a.checked===!0},selected:function(a){a.parentNode&&a.parentNode.selectedIndex;return a.selected===!0},parent:function(a){return!!a.firstChild},empty:function(a){return!a.firstChild},has:function(a,b,c){return!!k(c[3],a).length},header:function(a){return/h\d/i.test(a.nodeName)},text:function(a){var b=a.getAttribute("type"),c=a.type;return a.nodeName.toLowerCase()==="input"&&"text"===c&&(b===c||b===null)},radio:function(a){return a.nodeName.toLowerCase()==="input"&&"radio"===a.type},checkbox:function(a){return a.nodeName.toLowerCase()==="input"&&"checkbox"===a.type},file:function(a){return a.nodeName.toLowerCase()==="input"&&"file"===a.type},password:function(a){return a.nodeName.toLowerCase()==="input"&&"password"===a.type},submit:function(a){var b=a.nodeName.toLowerCase();return(b==="input"||b==="button")&&"submit"===a.type},image:function(a){return a.nodeName.toLowerCase()==="input"&&"image"===a.type},reset:function(a){var b=a.nodeName.toLowerCase();return(b==="input"||b==="button")&&"reset"===a.type},button:function(a){var b=a.nodeName.toLowerCase();return b==="input"&&"button"===a.type||b==="button"},input:function(a){return/input|select|textarea|button/i.test(a.nodeName)},focus:function(a){return a===a.ownerDocument.activeElement}},setFilters:{first:function(a,b){return b===0},last:function(a,b,c,d){return b===d.length-1},even:function(a,b){return b%2===0},odd:function(a,b){return b%2===1},lt:function(a,b,c){return b<c[3]-0},gt:function(a,b,c){return b>c[3]-0},nth:function(a,b,c){return c[3]-0===b},eq:function(a,b,c){return c[3]-0===b}},filter:{PSEUDO:function(a,b,c,d){var e=b[1],f=l.filters[e];if(f)return f(a,c,b,d);if(e==="contains")return(a.textContent||a.innerText||k.getText([a])||"").indexOf(b[3])>=0;if(e==="not"){var g=b[3];for(var h=0,i=g.length;h<i;h++)if(g[h]===a)return!1;return!0}k.error(e)},CHILD:function(a,b){var c=b[1],d=a;switch(c){case"only":case"first":while(d=d.previousSibling)if(d.nodeType===1)return!1;if(c==="first")return!0;d=a;case"last":while(d=d.nextSibling)if(d.nodeType===1)return!1;return!0;case"nth":var e=b[2],f=b[3];if(e===1&&f===0)return!0;var g=b[0],h=a.parentNode;if(h&&(h.sizcache!==g||!a.nodeIndex)){var i=0;for(d=h.firstChild;d;d=d.nextSibling)d.nodeType===1&&(d.nodeIndex=++i);h.sizcache=g}var j=a.nodeIndex-f;return e===0?j===0:j%e===0&&j/e>=0}},ID:function(a,b){return a.nodeType===1&&a.getAttribute("id")===b},TAG:function(a,b){return b==="*"&&a.nodeType===1||a.nodeName.toLowerCase()===b},CLASS:function(a,b){return(" "+(a.className||a.getAttribute("class"))+" ").indexOf(b)>-1},ATTR:function(a,b){var c=b[1],d=l.attrHandle[c]?l.attrHandle[c](a):a[c]!=null?a[c]:a.getAttribute(c),e=d+"",f=b[2],g=b[4];return d==null?f==="!=":f==="="?e===g:f==="*="?e.indexOf(g)>=0:f==="~="?(" "+e+" ").indexOf(g)>=0:g?f==="!="?e!==g:f==="^="?e.indexOf(g)===0:f==="$="?e.substr(e.length-g.length)===g:f==="|="?e===g||e.substr(0,g.length+1)===g+"-":!1:e&&d!==!1},POS:function(a,b,c,d){var e=b[2],f=l.setFilters[e];if(f)return f(a,c,b,d)}}},m=l.match.POS,n=function(a,b){return"\\"+(b-0+1)};for(var o in l.match)l.match[o]=new RegExp(l.match[o].source+/(?![^\[]*\])(?![^\(]*\))/.source),l.leftMatch[o]=new RegExp(/(^(?:.|\r|\n)*?)/.source+l.match[o].source.replace(/\\(\d+)/g,n));var p=function(a,b){a=Array.prototype.slice.call(a,0);if(b){b.push.apply(b,a);return b}return a};try{Array.prototype.slice.call(c.documentElement.childNodes,0)[0].nodeType}catch(q){p=function(a,b){var c=0,d=b||[];if(e.call(a)==="[object Array]")Array.prototype.push.apply(d,a);else if(typeof a.length=="number")for(var f=a.length;c<f;c++)d.push(a[c]);else for(;a[c];c++)d.push(a[c]);return d}}var r,s;c.documentElement.compareDocumentPosition?r=function(a,b){if(a===b){g=!0;return 0}if(!a.compareDocumentPosition||!b.compareDocumentPosition)return a.compareDocumentPosition?-1:1;return a.compareDocumentPosition(b)&4?-1:1}:(r=function(a,b){if(a===b){g=!0;return 0}if(a.sourceIndex&&b.sourceIndex)return a.sourceIndex-b.sourceIndex;var c,d,e=[],f=[],h=a.parentNode,i=b.parentNode,j=h;if(h===i)return s(a,b);if(!h)return-1;if(!i)return 1;while(j)e.unshift(j),j=j.parentNode;j=i;while(j)f.unshift(j),j=j.parentNode;c=e.length,d=f.length;for(var k=0;k<c&&k<d;k++)if(e[k]!==f[k])return s(e[k],f[k]);return k===c?s(a,f[k],-1):s(e[k],b,1)},s=function(a,b,c){if(a===b)return c;var d=a.nextSibling;while(d){if(d===b)return-1;d=d.nextSibling}return 1}),k.getText=function(a){var b="",c;for(var d=0;a[d];d++)c=a[d],c.nodeType===3||c.nodeType===4?b+=c.nodeValue:c.nodeType!==8&&(b+=k.getText(c.childNodes));return b},function(){var a=c.createElement("div"),d="script"+(new Date).getTime(),e=c.documentElement;a.innerHTML="<a name='"+d+"'/>",e.insertBefore(a,e.firstChild),c.getElementById(d)&&(l.find.ID=function(a,c,d){if(typeof c.getElementById!="undefined"&&!d){var e=c.getElementById(a[1]);return e?e.id===a[1]||typeof e.getAttributeNode!="undefined"&&e.getAttributeNode("id").nodeValue===a[1]?[e]:b:[]}},l.filter.ID=function(a,b){var c=typeof a.getAttributeNode!="undefined"&&a.getAttributeNode("id");return a.nodeType===1&&c&&c.nodeValue===b}),e.removeChild(a),e=a=null}(),function(){var a=c.createElement("div");a.appendChild(c.createComment("")),a.getElementsByTagName("*").length>0&&(l.find.TAG=function(a,b){var c=b.getElementsByTagName(a[1]);if(a[1]==="*"){var d=[];for(var e=0;c[e];e++)c[e].nodeType===1&&d.push(c[e]);c=d}return c}),a.innerHTML="<a href='#'></a>",a.firstChild&&typeof a.firstChild.getAttribute!="undefined"&&a.firstChild.getAttribute("href")!=="#"&&(l.attrHandle.href=function(a){return a.getAttribute("href",2)}),a=null}(),c.querySelectorAll&&function(){var a=k,b=c.createElement("div"),d="__sizzle__";b.innerHTML="<p class='TEST'></p>";if(!b.querySelectorAll||b.querySelectorAll(".TEST").length!==0){k=function(b,e,f,g){e=e||c;if(!g&&!k.isXML(e)){var h=/^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec(b);if(h&&(e.nodeType===1||e.nodeType===9)){if(h[1])return p(e.getElementsByTagName(b),f);if(h[2]&&l.find.CLASS&&e.getElementsByClassName)return p(e.getElementsByClassName(h[2]),f)}if(e.nodeType===9){if(b==="body"&&e.body)return p([e.body],f);if(h&&h[3]){var i=e.getElementById(h[3]);if(!i||!i.parentNode)return p([],f);if(i.id===h[3])return p([i],f)}try{return p(e.querySelectorAll(b),f)}catch(j){}}else if(e.nodeType===1&&e.nodeName.toLowerCase()!=="object"){var m=e,n=e.getAttribute("id"),o=n||d,q=e.parentNode,r=/^\s*[+~]/.test(b);n?o=o.replace(/'/g,"\\$&"):e.setAttribute("id",o),r&&q&&(e=e.parentNode);try{if(!r||q)return p(e.querySelectorAll("[id='"+o+"'] "+b),f)}catch(s){}finally{n||m.removeAttribute("id")}}}return a(b,e,f,g)};for(var e in a)k[e]=a[e];b=null}}(),function(){var a=c.documentElement,b=a.matchesSelector||a.mozMatchesSelector||a.webkitMatchesSelector||a.msMatchesSelector;if(b){var d=!b.call(c.createElement("div"),"div"),e=!1;try{b.call(c.documentElement,"[test!='']:sizzle")}catch(f){e=!0}k.matchesSelector=function(a,c){c=c.replace(/\=\s*([^'"\]]*)\s*\]/g,"='$1']");if(!k.isXML(a))try{if(e||!l.match.PSEUDO.test(c)&&!/!=/.test(c)){var f=b.call(a,c);if(f||!d||a.document&&a.document.nodeType!==11)return f}}catch(g){}return k(c,null,null,[a]).length>0}}}(),function(){var a=c.createElement("div");a.innerHTML="<div class='test e'></div><div class='test'></div>";if(!!a.getElementsByClassName&&a.getElementsByClassName("e").length!==0){a.lastChild.className="e";if(a.getElementsByClassName("e").length===1)return;l.order.splice(1,0,"CLASS"),l.find.CLASS=function(a,b,c){if(typeof b.getElementsByClassName!="undefined"&&!c)return b.getElementsByClassName(a[1])},a=null}}(),c.documentElement.contains?k.contains=function(a,b){return a!==b&&(a.contains?a.contains(b):!0)}:c.documentElement.compareDocumentPosition?k.contains=function(a,b){return!!(a.compareDocumentPosition(b)&16)}:k.contains=function(){return!1},k.isXML=function(a){var b=(a?a.ownerDocument||a:0).documentElement;return b?b.nodeName!=="HTML":!1};var v=function(a,b){var c,d=[],e="",f=b.nodeType?[b]:b;while(c=l.match.PSEUDO.exec(a))e+=c[0],a=a.replace(l.match.PSEUDO,"");a=l.relative[a]?a+"*":a;for(var g=0,h=f.length;g<h;g++)k(a,f[g],d);return k.filter(e,d)};f.find=k,f.expr=k.selectors,f.expr[":"]=f.expr.filters,f.unique=k.uniqueSort,f.text=k.getText,f.isXMLDoc=k.isXML,f.contains=k.contains}();var O=/Until$/,P=/^(?:parents|prevUntil|prevAll)/,Q=/,/,R=/^.[^:#\[\.,]*$/,S=Array.prototype.slice,T=f.expr.match.POS,U={children:!0,contents:!0,next:!0,prev:!0};f.fn.extend({find:function(a){var b=this,c,d;if(typeof a!="string")return f(a).filter(function(){for(c=0,d=b.length;c<d;c++)if(f.contains(b[c],this))return!0});var e=this.pushStack("","find",a),g,h,i;for(c=0,d=this.length;c<d;c++){g=e.length,f.find(a,this[c],e);if(c>0)for(h=g;h<e.length;h++)for(i=0;i<g;i++)if(e[i]===e[h]){e.splice(h--,1);break}}return e},has:function(a){var b=f(a);return this.filter(function(){for(var a=0,c=b.length;a<c;a++)if(f.contains(this,b[a]))return!0})},not:function(a){return this.pushStack(W(this,a,!1),"not",a)},filter:function(a){return this.pushStack(W(this,a,!0),"filter",a)},is:function(a){return!!a&&(typeof a=="string"?f.filter(a,this).length>0:this.filter(a).length>0)},closest:function(a,b){var c=[],d,e,g=this[0];if(f.isArray(a)){var h,i,j={},k=1;if(g&&a.length){for(d=0,e=a.length;d<e;d++)i=a[d],j[i]||(j[i]=T.test(i)?f(i,b||this.context):i);while(g&&g.ownerDocument&&g!==b){for(i in j)h=j[i],(h.jquery?h.index(g)>-1:f(g).is(h))&&c.push({selector:i,elem:g,level:k});g=g.parentNode,k++}}return c}var l=T.test(a)||typeof a!="string"?f(a,b||this.context):0;for(d=0,e=this.length;d<e;d++){g=this[d];while(g){if(l?l.index(g)>-1:f.find.matchesSelector(g,a)){c.push(g);break}g=g.parentNode;if(!g||!g.ownerDocument||g===b||g.nodeType===11)break}}c=c.length>1?f.unique(c):c;return this.pushStack(c,"closest",a)},index:function(a){if(!a||typeof a=="string")return f.inArray(this[0],a?f(a):this.parent().children());return f.inArray(a.jquery?a[0]:a,this)},add:function(a,b){var c=typeof a=="string"?f(a,b):f.makeArray(a&&a.nodeType?[a]:a),d=f.merge(this.get(),c);return this.pushStack(V(c[0])||V(d[0])?d:f.unique(d))},andSelf:function(){return this.add(this.prevObject)}}),f.each({parent:function(a){var b=a.parentNode;return b&&b.nodeType!==11?b:null},parents:function(a){return f.dir(a,"parentNode")},parentsUntil:function(a,b,c){return f.dir(a,"parentNode",c)},next:function(a){return f.nth(a,2,"nextSibling")},prev:function(a){return f.nth(a,2,"previousSibling")},nextAll:function(a){return f.dir(a,"nextSibling")},prevAll:function(a){return f.dir(a,"previousSibling")},nextUntil:function(a,b,c){return f.dir(a,"nextSibling",c)},prevUntil:function(a,b,c){return f.dir(a,"previousSibling",c)},siblings:function(a){return f.sibling(a.parentNode.firstChild,a)},children:function(a){return f.sibling(a.firstChild)},contents:function(a){return f.nodeName(a,"iframe")?a.contentDocument||a.contentWindow.document:f.makeArray(a.childNodes)}},function(a,b){f.fn[a]=function(c,d){var e=f.map(this,b,c),g=S.call(arguments);O.test(a)||(d=c),d&&typeof d=="string"&&(e=f.filter(d,e)),e=this.length>1&&!U[a]?f.unique(e):e,(this.length>1||Q.test(d))&&P.test(a)&&(e=e.reverse());return this.pushStack(e,a,g.join(","))}}),f.extend({filter:function(a,b,c){c&&(a=":not("+a+")");return b.length===1?f.find.matchesSelector(b[0],a)?[b[0]]:[]:f.find.matches(a,b)},dir:function(a,c,d){var e=[],g=a[c];while(g&&g.nodeType!==9&&(d===b||g.nodeType!==1||!f(g).is(d)))g.nodeType===1&&e.push(g),g=g[c];return e},nth:function(a,b,c,d){b=b||1;var e=0;for(;a;a=a[c])if(a.nodeType===1&&++e===b)break;return a},sibling:function(a,b){var c=[];for(;a;a=a.nextSibling)a.nodeType===1&&a!==b&&c.push(a);return c}});var X=/ jQuery\d+="(?:\d+|null)"/g,Y=/^\s+/,Z=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig,$=/<([\w:]+)/,_=/<tbody/i,ba=/<|&#?\w+;/,bb=/<(?:script|object|embed|option|style)/i,bc=/checked\s*(?:[^=]|=\s*.checked.)/i,bd=/\/(java|ecma)script/i,be=/^\s*<!(?:\[CDATA\[|\-\-)/,bf={option:[1,"<select multiple='multiple'>","</select>"],legend:[1,"<fieldset>","</fieldset>"],thead:[1,"<table>","</table>"],tr:[2,"<table><tbody>","</tbody></table>"],td:[3,"<table><tbody><tr>","</tr></tbody></table>"],col:[2,"<table><tbody></tbody><colgroup>","</colgroup></table>"],area:[1,"<map>","</map>"],_default:[0,"",""]};bf.optgroup=bf.option,bf.tbody=bf.tfoot=bf.colgroup=bf.caption=bf.thead,bf.th=bf.td,f.support.htmlSerialize||(bf._default=[1,"div<div>","</div>"]),f.fn.extend({text:function(a){if(f.isFunction(a))return this.each(function(b){var c=f(this);c.text(a.call(this,b,c.text()))});if(typeof a!="object"&&a!==b)return this.empty().append((this[0]&&this[0].ownerDocument||c).createTextNode(a));return f.text(this)},wrapAll:function(a){if(f.isFunction(a))return this.each(function(b){f(this).wrapAll(a.call(this,b))});if(this[0]){var b=f(a,this[0].ownerDocument).eq(0).clone(!0);this[0].parentNode&&b.insertBefore(this[0]),b.map(function(){var a=this;while(a.firstChild&&a.firstChild.nodeType===1)a=a.firstChild;return a}).append(this)}return this},wrapInner:function(a){if(f.isFunction(a))return this.each(function(b){f(this).wrapInner(a.call(this,b))});return this.each(function(){var b=f(this),c=b.contents();c.length?c.wrapAll(a):b.append(a)})},wrap:function(a){return this.each(function(){f(this).wrapAll(a)})},unwrap:function(){return this.parent().each(function(){f.nodeName(this,"body")||f(this).replaceWith(this.childNodes)}).end()},append:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.appendChild(a)})},prepend:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.insertBefore(a,this.firstChild)})},before:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this)});if(arguments.length){var a=f(arguments[0]);a.push.apply(a,this.toArray());return this.pushStack(a,"before",arguments)}},after:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this.nextSibling)});if(arguments.length){var a=this.pushStack(this,"after",arguments);a.push.apply(a,f(arguments[0]).toArray());return a}},remove:function(a,b){for(var c=0,d;(d=this[c])!=null;c++)if(!a||f.filter(a,[d]).length)!b&&d.nodeType===1&&(f.cleanData(d.getElementsByTagName("*")),f.cleanData([d])),d.parentNode&&d.parentNode.removeChild(d);return this},empty:function(){for(var a=0,b;(b=this[a])!=null;a++){b.nodeType===1&&f.cleanData(b.getElementsByTagName("*"));while(b.firstChild)b.removeChild(b.firstChild)}return this},clone:function(a,b){a=a==null?!1:a,b=b==null?a:b;return this.map(function(){return f.clone(this,a,b)})},html:function(a){if(a===b)return this[0]&&this[0].nodeType===1?this[0].innerHTML.replace(X,""):null;if(typeof a=="string"&&!bb.test(a)&&(f.support.leadingWhitespace||!Y.test(a))&&!bf[($.exec(a)||["",""])[1].toLowerCase()]){a=a.replace(Z,"<$1></$2>");try{for(var c=0,d=this.length;c<d;c++)this[c].nodeType===1&&(f.cleanData(this[c].getElementsByTagName("*")),this[c].innerHTML=a)}catch(e){this.empty().append(a)}}else f.isFunction(a)?this.each(function(b){var c=f(this);c.html(a.call(this,b,c.html()))}):this.empty().append(a);return this},replaceWith:function(a){if(this[0]&&this[0].parentNode){if(f.isFunction(a))return this.each(function(b){var c=f(this),d=c.html();c.replaceWith(a.call(this,b,d))});typeof a!="string"&&(a=f(a).detach());return this.each(function(){var b=this.nextSibling,c=this.parentNode;f(this).remove(),b?f(b).before(a):f(c).append(a)})}return this.length?this.pushStack(f(f.isFunction(a)?a():a),"replaceWith",a):this},detach:function(a){return this.remove(a,!0)},domManip:function(a,c,d){var e,g,h,i,j=a[0],k=[];if(!f.support.checkClone&&arguments.length===3&&typeof j=="string"&&bc.test(j))return this.each(function(){f(this).domManip(a,c,d,!0)});if(f.isFunction(j))return this.each(function(e){var g=f(this);a[0]=j.call(this,e,c?g.html():b),g.domManip(a,c,d)});if(this[0]){i=j&&j.parentNode,f.support.parentNode&&i&&i.nodeType===11&&i.childNodes.length===this.length?e={fragment:i}:e=f.buildFragment(a,this,k),h=e.fragment,h.childNodes.length===1?g=h=h.firstChild:g=h.firstChild;if(g){c=c&&f.nodeName(g,"tr");for(var l=0,m=this.length,n=m-1;l<m;l++)d.call(c?bg(this[l],g):this[l],e.cacheable||m>1&&l<n?f.clone(h,!0,!0):h)}k.length&&f.each(k,bm)}return this}}),f.buildFragment=function(a,b,d){var e,g,h,i;b&&b[0]&&(i=b[0].ownerDocument||b[0]),i.createDocumentFragment||(i=c),a.length===1&&typeof a[0]=="string"&&a[0].length<512&&i===c&&a[0].charAt(0)==="<"&&!bb.test(a[0])&&(f.support.checkClone||!bc.test(a[0]))&&(g=!0,h=f.fragments[a[0]],h&&h!==1&&(e=h)),e||(e=i.createDocumentFragment(),f.clean(a,i,e,d)),g&&(f.fragments[a[0]]=h?e:1);return{fragment:e,cacheable:g}},f.fragments={},f.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(a,b){f.fn[a]=function(c){var d=[],e=f(c),g=this.length===1&&this[0].parentNode;if(g&&g.nodeType===11&&g.childNodes.length===1&&e.length===1){e[b](this[0]);return this}for(var h=0,i=e.length;h<i;h++){var j=(h>0?this.clone(!0):this).get();f(e[h])[b](j),d=d.concat(j
+)}return this.pushStack(d,a,e.selector)}}),f.extend({clone:function(a,b,c){var d=a.cloneNode(!0),e,g,h;if((!f.support.noCloneEvent||!f.support.noCloneChecked)&&(a.nodeType===1||a.nodeType===11)&&!f.isXMLDoc(a)){bi(a,d),e=bj(a),g=bj(d);for(h=0;e[h];++h)bi(e[h],g[h])}if(b){bh(a,d);if(c){e=bj(a),g=bj(d);for(h=0;e[h];++h)bh(e[h],g[h])}}e=g=null;return d},clean:function(a,b,d,e){var g;b=b||c,typeof b.createElement=="undefined"&&(b=b.ownerDocument||b[0]&&b[0].ownerDocument||c);var h=[],i;for(var j=0,k;(k=a[j])!=null;j++){typeof k=="number"&&(k+="");if(!k)continue;if(typeof k=="string")if(!ba.test(k))k=b.createTextNode(k);else{k=k.replace(Z,"<$1></$2>");var l=($.exec(k)||["",""])[1].toLowerCase(),m=bf[l]||bf._default,n=m[0],o=b.createElement("div");o.innerHTML=m[1]+k+m[2];while(n--)o=o.lastChild;if(!f.support.tbody){var p=_.test(k),q=l==="table"&&!p?o.firstChild&&o.firstChild.childNodes:m[1]==="<table>"&&!p?o.childNodes:[];for(i=q.length-1;i>=0;--i)f.nodeName(q[i],"tbody")&&!q[i].childNodes.length&&q[i].parentNode.removeChild(q[i])}!f.support.leadingWhitespace&&Y.test(k)&&o.insertBefore(b.createTextNode(Y.exec(k)[0]),o.firstChild),k=o.childNodes}var r;if(!f.support.appendChecked)if(k[0]&&typeof (r=k.length)=="number")for(i=0;i<r;i++)bl(k[i]);else bl(k);k.nodeType?h.push(k):h=f.merge(h,k)}if(d){g=function(a){return!a.type||bd.test(a.type)};for(j=0;h[j];j++)if(e&&f.nodeName(h[j],"script")&&(!h[j].type||h[j].type.toLowerCase()==="text/javascript"))e.push(h[j].parentNode?h[j].parentNode.removeChild(h[j]):h[j]);else{if(h[j].nodeType===1){var s=f.grep(h[j].getElementsByTagName("script"),g);h.splice.apply(h,[j+1,0].concat(s))}d.appendChild(h[j])}}return h},cleanData:function(a){var b,c,d=f.cache,e=f.expando,g=f.event.special,h=f.support.deleteExpando;for(var i=0,j;(j=a[i])!=null;i++){if(j.nodeName&&f.noData[j.nodeName.toLowerCase()])continue;c=j[f.expando];if(c){b=d[c]&&d[c][e];if(b&&b.events){for(var k in b.events)g[k]?f.event.remove(j,k):f.removeEvent(j,k,b.handle);b.handle&&(b.handle.elem=null)}h?delete j[f.expando]:j.removeAttribute&&j.removeAttribute(f.expando),delete d[c]}}}});var bn=/alpha\([^)]*\)/i,bo=/opacity=([^)]*)/,bp=/([A-Z]|^ms)/g,bq=/^-?\d+(?:px)?$/i,br=/^-?\d/,bs=/^[+\-]=/,bt=/[^+\-\.\de]+/g,bu={position:"absolute",visibility:"hidden",display:"block"},bv=["Left","Right"],bw=["Top","Bottom"],bx,by,bz;f.fn.css=function(a,c){if(arguments.length===2&&c===b)return this;return f.access(this,a,c,!0,function(a,c,d){return d!==b?f.style(a,c,d):f.css(a,c)})},f.extend({cssHooks:{opacity:{get:function(a,b){if(b){var c=bx(a,"opacity","opacity");return c===""?"1":c}return a.style.opacity}}},cssNumber:{fillOpacity:!0,fontWeight:!0,lineHeight:!0,opacity:!0,orphans:!0,widows:!0,zIndex:!0,zoom:!0},cssProps:{"float":f.support.cssFloat?"cssFloat":"styleFloat"},style:function(a,c,d,e){if(!!a&&a.nodeType!==3&&a.nodeType!==8&&!!a.style){var g,h,i=f.camelCase(c),j=a.style,k=f.cssHooks[i];c=f.cssProps[i]||i;if(d===b){if(k&&"get"in k&&(g=k.get(a,!1,e))!==b)return g;return j[c]}h=typeof d;if(h==="number"&&isNaN(d)||d==null)return;h==="string"&&bs.test(d)&&(d=+d.replace(bt,"")+parseFloat(f.css(a,c)),h="number"),h==="number"&&!f.cssNumber[i]&&(d+="px");if(!k||!("set"in k)||(d=k.set(a,d))!==b)try{j[c]=d}catch(l){}}},css:function(a,c,d){var e,g;c=f.camelCase(c),g=f.cssHooks[c],c=f.cssProps[c]||c,c==="cssFloat"&&(c="float");if(g&&"get"in g&&(e=g.get(a,!0,d))!==b)return e;if(bx)return bx(a,c)},swap:function(a,b,c){var d={};for(var e in b)d[e]=a.style[e],a.style[e]=b[e];c.call(a);for(e in b)a.style[e]=d[e]}}),f.curCSS=f.css,f.each(["height","width"],function(a,b){f.cssHooks[b]={get:function(a,c,d){var e;if(c){if(a.offsetWidth!==0)return bA(a,b,d);f.swap(a,bu,function(){e=bA(a,b,d)});return e}},set:function(a,b){if(!bq.test(b))return b;b=parseFloat(b);if(b>=0)return b+"px"}}}),f.support.opacity||(f.cssHooks.opacity={get:function(a,b){return bo.test((b&&a.currentStyle?a.currentStyle.filter:a.style.filter)||"")?parseFloat(RegExp.$1)/100+"":b?"1":""},set:function(a,b){var c=a.style,d=a.currentStyle;c.zoom=1;var e=f.isNaN(b)?"":"alpha(opacity="+b*100+")",g=d&&d.filter||c.filter||"";c.filter=bn.test(g)?g.replace(bn,e):g+" "+e}}),f(function(){f.support.reliableMarginRight||(f.cssHooks.marginRight={get:function(a,b){var c;f.swap(a,{display:"inline-block"},function(){b?c=bx(a,"margin-right","marginRight"):c=a.style.marginRight});return c}})}),c.defaultView&&c.defaultView.getComputedStyle&&(by=function(a,c){var d,e,g;c=c.replace(bp,"-$1").toLowerCase();if(!(e=a.ownerDocument.defaultView))return b;if(g=e.getComputedStyle(a,null))d=g.getPropertyValue(c),d===""&&!f.contains(a.ownerDocument.documentElement,a)&&(d=f.style(a,c));return d}),c.documentElement.currentStyle&&(bz=function(a,b){var c,d=a.currentStyle&&a.currentStyle[b],e=a.runtimeStyle&&a.runtimeStyle[b],f=a.style;!bq.test(d)&&br.test(d)&&(c=f.left,e&&(a.runtimeStyle.left=a.currentStyle.left),f.left=b==="fontSize"?"1em":d||0,d=f.pixelLeft+"px",f.left=c,e&&(a.runtimeStyle.left=e));return d===""?"auto":d}),bx=by||bz,f.expr&&f.expr.filters&&(f.expr.filters.hidden=function(a){var b=a.offsetWidth,c=a.offsetHeight;return b===0&&c===0||!f.support.reliableHiddenOffsets&&(a.style.display||f.css(a,"display"))==="none"},f.expr.filters.visible=function(a){return!f.expr.filters.hidden(a)});var bB=/%20/g,bC=/\[\]$/,bD=/\r?\n/g,bE=/#.*$/,bF=/^(.*?):[ \t]*([^\r\n]*)\r?$/mg,bG=/^(?:color|date|datetime|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i,bH=/^(?:about|app|app\-storage|.+\-extension|file|widget):$/,bI=/^(?:GET|HEAD)$/,bJ=/^\/\//,bK=/\?/,bL=/<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi,bM=/^(?:select|textarea)/i,bN=/\s+/,bO=/([?&])_=[^&]*/,bP=/^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+))?)?/,bQ=f.fn.load,bR={},bS={},bT,bU;try{bT=e.href}catch(bV){bT=c.createElement("a"),bT.href="",bT=bT.href}bU=bP.exec(bT.toLowerCase())||[],f.fn.extend({load:function(a,c,d){if(typeof a!="string"&&bQ)return bQ.apply(this,arguments);if(!this.length)return this;var e=a.indexOf(" ");if(e>=0){var g=a.slice(e,a.length);a=a.slice(0,e)}var h="GET";c&&(f.isFunction(c)?(d=c,c=b):typeof c=="object"&&(c=f.param(c,f.ajaxSettings.traditional),h="POST"));var i=this;f.ajax({url:a,type:h,dataType:"html",data:c,complete:function(a,b,c){c=a.responseText,a.isResolved()&&(a.done(function(a){c=a}),i.html(g?f("<div>").append(c.replace(bL,"")).find(g):c)),d&&i.each(d,[c,b,a])}});return this},serialize:function(){return f.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?f.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||bM.test(this.nodeName)||bG.test(this.type))}).map(function(a,b){var c=f(this).val();return c==null?null:f.isArray(c)?f.map(c,function(a,c){return{name:b.name,value:a.replace(bD,"\r\n")}}):{name:b.name,value:c.replace(bD,"\r\n")}}).get()}}),f.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),function(a,b){f.fn[b]=function(a){return this.bind(b,a)}}),f.each(["get","post"],function(a,c){f[c]=function(a,d,e,g){f.isFunction(d)&&(g=g||e,e=d,d=b);return f.ajax({type:c,url:a,data:d,success:e,dataType:g})}}),f.extend({getScript:function(a,c){return f.get(a,b,c,"script")},getJSON:function(a,b,c){return f.get(a,b,c,"json")},ajaxSetup:function(a,b){b?f.extend(!0,a,f.ajaxSettings,b):(b=a,a=f.extend(!0,f.ajaxSettings,b));for(var c in{context:1,url:1})c in b?a[c]=b[c]:c in f.ajaxSettings&&(a[c]=f.ajaxSettings[c]);return a},ajaxSettings:{url:bT,isLocal:bH.test(bU[1]),global:!0,type:"GET",contentType:"application/x-www-form-urlencoded",processData:!0,async:!0,accepts:{xml:"application/xml, text/xml",html:"text/html",text:"text/plain",json:"application/json, text/javascript","*":"*/*"},contents:{xml:/xml/,html:/html/,json:/json/},responseFields:{xml:"responseXML",text:"responseText"},converters:{"* text":a.String,"text html":!0,"text json":f.parseJSON,"text xml":f.parseXML}},ajaxPrefilter:bW(bR),ajaxTransport:bW(bS),ajax:function(a,c){function w(a,c,l,m){if(s!==2){s=2,q&&clearTimeout(q),p=b,n=m||"",v.readyState=a?4:0;var o,r,u,w=l?bZ(d,v,l):b,x,y;if(a>=200&&a<300||a===304){if(d.ifModified){if(x=v.getResponseHeader("Last-Modified"))f.lastModified[k]=x;if(y=v.getResponseHeader("Etag"))f.etag[k]=y}if(a===304)c="notmodified",o=!0;else try{r=b$(d,w),c="success",o=!0}catch(z){c="parsererror",u=z}}else{u=c;if(!c||a)c="error",a<0&&(a=0)}v.status=a,v.statusText=c,o?h.resolveWith(e,[r,c,v]):h.rejectWith(e,[v,c,u]),v.statusCode(j),j=b,t&&g.trigger("ajax"+(o?"Success":"Error"),[v,d,o?r:u]),i.resolveWith(e,[v,c]),t&&(g.trigger("ajaxComplete",[v,d]),--f.active||f.event.trigger("ajaxStop"))}}typeof a=="object"&&(c=a,a=b),c=c||{};var d=f.ajaxSetup({},c),e=d.context||d,g=e!==d&&(e.nodeType||e instanceof f)?f(e):f.event,h=f.Deferred(),i=f._Deferred(),j=d.statusCode||{},k,l={},m={},n,o,p,q,r,s=0,t,u,v={readyState:0,setRequestHeader:function(a,b){if(!s){var c=a.toLowerCase();a=m[c]=m[c]||a,l[a]=b}return this},getAllResponseHeaders:function(){return s===2?n:null},getResponseHeader:function(a){var c;if(s===2){if(!o){o={};while(c=bF.exec(n))o[c[1].toLowerCase()]=c[2]}c=o[a.toLowerCase()]}return c===b?null:c},overrideMimeType:function(a){s||(d.mimeType=a);return this},abort:function(a){a=a||"abort",p&&p.abort(a),w(0,a);return this}};h.promise(v),v.success=v.done,v.error=v.fail,v.complete=i.done,v.statusCode=function(a){if(a){var b;if(s<2)for(b in a)j[b]=[j[b],a[b]];else b=a[v.status],v.then(b,b)}return this},d.url=((a||d.url)+"").replace(bE,"").replace(bJ,bU[1]+"//"),d.dataTypes=f.trim(d.dataType||"*").toLowerCase().split(bN),d.crossDomain==null&&(r=bP.exec(d.url.toLowerCase()),d.crossDomain=!(!r||r[1]==bU[1]&&r[2]==bU[2]&&(r[3]||(r[1]==="http:"?80:443))==(bU[3]||(bU[1]==="http:"?80:443)))),d.data&&d.processData&&typeof d.data!="string"&&(d.data=f.param(d.data,d.traditional)),bX(bR,d,c,v);if(s===2)return!1;t=d.global,d.type=d.type.toUpperCase(),d.hasContent=!bI.test(d.type),t&&f.active++===0&&f.event.trigger("ajaxStart");if(!d.hasContent){d.data&&(d.url+=(bK.test(d.url)?"&":"?")+d.data),k=d.url;if(d.cache===!1){var x=f.now(),y=d.url.replace(bO,"$1_="+x);d.url=y+(y===d.url?(bK.test(d.url)?"&":"?")+"_="+x:"")}}(d.data&&d.hasContent&&d.contentType!==!1||c.contentType)&&v.setRequestHeader("Content-Type",d.contentType),d.ifModified&&(k=k||d.url,f.lastModified[k]&&v.setRequestHeader("If-Modified-Since",f.lastModified[k]),f.etag[k]&&v.setRequestHeader("If-None-Match",f.etag[k])),v.setRequestHeader("Accept",d.dataTypes[0]&&d.accepts[d.dataTypes[0]]?d.accepts[d.dataTypes[0]]+(d.dataTypes[0]!=="*"?", */*; q=0.01":""):d.accepts["*"]);for(u in d.headers)v.setRequestHeader(u,d.headers[u]);if(d.beforeSend&&(d.beforeSend.call(e,v,d)===!1||s===2)){v.abort();return!1}for(u in{success:1,error:1,complete:1})v[u](d[u]);p=bX(bS,d,c,v);if(!p)w(-1,"No Transport");else{v.readyState=1,t&&g.trigger("ajaxSend",[v,d]),d.async&&d.timeout>0&&(q=setTimeout(function(){v.abort("timeout")},d.timeout));try{s=1,p.send(l,w)}catch(z){status<2?w(-1,z):f.error(z)}}return v},param:function(a,c){var d=[],e=function(a,b){b=f.isFunction(b)?b():b,d[d.length]=encodeURIComponent(a)+"="+encodeURIComponent(b)};c===b&&(c=f.ajaxSettings.traditional);if(f.isArray(a)||a.jquery&&!f.isPlainObject(a))f.each(a,function(){e(this.name,this.value)});else for(var g in a)bY(g,a[g],c,e);return d.join("&").replace(bB,"+")}}),f.extend({active:0,lastModified:{},etag:{}});var b_=f.now(),ca=/(\=)\?(&|$)|\?\?/i;f.ajaxSetup({jsonp:"callback",jsonpCallback:function(){return f.expando+"_"+b_++}}),f.ajaxPrefilter("json jsonp",function(b,c,d){var e=b.contentType==="application/x-www-form-urlencoded"&&typeof b.data=="string";if(b.dataTypes[0]==="jsonp"||b.jsonp!==!1&&(ca.test(b.url)||e&&ca.test(b.data))){var g,h=b.jsonpCallback=f.isFunction(b.jsonpCallback)?b.jsonpCallback():b.jsonpCallback,i=a[h],j=b.url,k=b.data,l="$1"+h+"$2";b.jsonp!==!1&&(j=j.replace(ca,l),b.url===j&&(e&&(k=k.replace(ca,l)),b.data===k&&(j+=(/\?/.test(j)?"&":"?")+b.jsonp+"="+h))),b.url=j,b.data=k,a[h]=function(a){g=[a]},d.always(function(){a[h]=i,g&&f.isFunction(i)&&a[h](g[0])}),b.converters["script json"]=function(){g||f.error(h+" was not called");return g[0]},b.dataTypes[0]="json";return"script"}}),f.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/javascript|ecmascript/},converters:{"text script":function(a){f.globalEval(a);return a}}}),f.ajaxPrefilter("script",function(a){a.cache===b&&(a.cache=!1),a.crossDomain&&(a.type="GET",a.global=!1)}),f.ajaxTransport("script",function(a){if(a.crossDomain){var d,e=c.head||c.getElementsByTagName("head")[0]||c.documentElement;return{send:function(f,g){d=c.createElement("script"),d.async="async",a.scriptCharset&&(d.charset=a.scriptCharset),d.src=a.url,d.onload=d.onreadystatechange=function(a,c){if(c||!d.readyState||/loaded|complete/.test(d.readyState))d.onload=d.onreadystatechange=null,e&&d.parentNode&&e.removeChild(d),d=b,c||g(200,"success")},e.insertBefore(d,e.firstChild)},abort:function(){d&&d.onload(0,1)}}}});var cb=a.ActiveXObject?function(){for(var a in cd)cd[a](0,1)}:!1,cc=0,cd;f.ajaxSettings.xhr=a.ActiveXObject?function(){return!this.isLocal&&ce()||cf()}:ce,function(a){f.extend(f.support,{ajax:!!a,cors:!!a&&"withCredentials"in a})}(f.ajaxSettings.xhr()),f.support.ajax&&f.ajaxTransport(function(c){if(!c.crossDomain||f.support.cors){var d;return{send:function(e,g){var h=c.xhr(),i,j;c.username?h.open(c.type,c.url,c.async,c.username,c.password):h.open(c.type,c.url,c.async);if(c.xhrFields)for(j in c.xhrFields)h[j]=c.xhrFields[j];c.mimeType&&h.overrideMimeType&&h.overrideMimeType(c.mimeType),!c.crossDomain&&!e["X-Requested-With"]&&(e["X-Requested-With"]="XMLHttpRequest");try{for(j in e)h.setRequestHeader(j,e[j])}catch(k){}h.send(c.hasContent&&c.data||null),d=function(a,e){var j,k,l,m,n;try{if(d&&(e||h.readyState===4)){d=b,i&&(h.onreadystatechange=f.noop,cb&&delete cd[i]);if(e)h.readyState!==4&&h.abort();else{j=h.status,l=h.getAllResponseHeaders(),m={},n=h.responseXML,n&&n.documentElement&&(m.xml=n),m.text=h.responseText;try{k=h.statusText}catch(o){k=""}!j&&c.isLocal&&!c.crossDomain?j=m.text?200:404:j===1223&&(j=204)}}}catch(p){e||g(-1,p)}m&&g(j,k,m,l)},!c.async||h.readyState===4?d():(i=++cc,cb&&(cd||(cd={},f(a).unload(cb)),cd[i]=d),h.onreadystatechange=d)},abort:function(){d&&d(0,1)}}}});var cg={},ch,ci,cj=/^(?:toggle|show|hide)$/,ck=/^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i,cl,cm=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]],cn,co=a.webkitRequestAnimationFrame||a.mozRequestAnimationFrame||a.oRequestAnimationFrame;f.fn.extend({show:function(a,b,c){var d,e;if(a||a===0)return this.animate(cr("show",3),a,b,c);for(var g=0,h=this.length;g<h;g++)d=this[g],d.style&&(e=d.style.display,!f._data(d,"olddisplay")&&e==="none"&&(e=d.style.display=""),e===""&&f.css(d,"display")==="none"&&f._data(d,"olddisplay",cs(d.nodeName)));for(g=0;g<h;g++){d=this[g];if(d.style){e=d.style.display;if(e===""||e==="none")d.style.display=f._data(d,"olddisplay")||""}}return this},hide:function(a,b,c){if(a||a===0)return this.animate(cr("hide",3),a,b,c);for(var d=0,e=this.length;d<e;d++)if(this[d].style){var g=f.css(this[d],"display");g!=="none"&&!f._data(this[d],"olddisplay")&&f._data(this[d],"olddisplay",g)}for(d=0;d<e;d++)this[d].style&&(this[d].style.display="none");return this},_toggle:f.fn.toggle,toggle:function(a,b,c){var d=typeof a=="boolean";f.isFunction(a)&&f.isFunction(b)?this._toggle.apply(this,arguments):a==null||d?this.each(function(){var b=d?a:f(this).is(":hidden");f(this)[b?"show":"hide"]()}):this.animate(cr("toggle",3),a,b,c);return this},fadeTo:function(a,b,c,d){return this.filter(":hidden").css("opacity",0).show().end().animate({opacity:b},a,c,d)},animate:function(a,b,c,d){var e=f.speed(b,c,d);if(f.isEmptyObject(a))return this.each(e.complete,[!1]);a=f.extend({},a);return this[e.queue===!1?"each":"queue"](function(){e.queue===!1&&f._mark(this);var b=f.extend({},e),c=this.nodeType===1,d=c&&f(this).is(":hidden"),g,h,i,j,k,l,m,n,o;b.animatedProperties={};for(i in a){g=f.camelCase(i),i!==g&&(a[g]=a[i],delete a[i]),h=a[g],f.isArray(h)?(b.animatedProperties[g]=h[1],h=a[g]=h[0]):b.animatedProperties[g]=b.specialEasing&&b.specialEasing[g]||b.easing||"swing";if(h==="hide"&&d||h==="show"&&!d)return b.complete.call(this);c&&(g==="height"||g==="width")&&(b.overflow=[this.style.overflow,this.style.overflowX,this.style.overflowY],f.css(this,"display")==="inline"&&f.css(this,"float")==="none"&&(f.support.inlineBlockNeedsLayout?(j=cs(this.nodeName),j==="inline"?this.style.display="inline-block":(this.style.display="inline",this.style.zoom=1)):this.style.display="inline-block"))}b.overflow!=null&&(this.style.overflow="hidden");for(i in a)k=new f.fx(this,b,i),h=a[i],cj.test(h)?k[h==="toggle"?d?"show":"hide":h]():(l=ck.exec(h),m=k.cur(),l?(n=parseFloat(l[2]),o=l[3]||(f.cssNumber[i]?"":"px"),o!=="px"&&(f.style(this,i,(n||1)+o),m=(n||1)/k.cur()*m,f.style(this,i,m+o)),l[1]&&(n=(l[1]==="-="?-1:1)*n+m),k.custom(m,n,o)):k.custom(m,h,""));return!0})},stop:function(a,b){a&&this.queue([]),this.each(function(){var a=f.timers,c=a.length;b||f._unmark(!0,this);while(c--)a[c].elem===this&&(b&&a[c](!0),a.splice(c,1))}),b||this.dequeue();return this}}),f.each({slideDown:cr("show",1),slideUp:cr("hide",1),slideToggle:cr("toggle",1),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"},fadeToggle:{opacity:"toggle"}},function(a,b){f.fn[a]=function(a,c,d){return this.animate(b,a,c,d)}}),f.extend({speed:function(a,b,c){var d=a&&typeof a=="object"?f.extend({},a):{complete:c||!c&&b||f.isFunction(a)&&a,duration:a,easing:c&&b||b&&!f.isFunction(b)&&b};d.duration=f.fx.off?0:typeof d.duration=="number"?d.duration:d.duration in f.fx.speeds?f.fx.speeds[d.duration]:f.fx.speeds._default,d.old=d.complete,d.complete=function(a){f.isFunction(d.old)&&d.old.call(this),d.queue!==!1?f.dequeue(this):a!==!1&&f._unmark(this)};return d},easing:{linear:function(a,b,c,d){return c+d*a},swing:function(a,b,c,d){return(-Math.cos(a*Math.PI)/2+.5)*d+c}},timers:[],fx:function(a,b,c){this.options=b,this.elem=a,this.prop=c,b.orig=b.orig||{}}}),f.fx.prototype={update:function(){this.options.step&&this.options.step.call(this.elem,this.now,this),(f.fx.step[this.prop]||f.fx.step._default)(this)},cur:function(){if(this.elem[this.prop]!=null&&(!this.elem.style||this.elem.style[this.prop]==null))return this.elem[this.prop];var a,b=f.css(this.elem,this.prop);return isNaN(a=parseFloat(b))?!b||b==="auto"?0:b:a},custom:function(a,b,c){function h(a){return d.step(a)}var d=this,e=f.fx,g;this.startTime=cn||cp(),this.start=a,this.end=b,this.unit=c||this.unit||(f.cssNumber[this.prop]?"":"px"),this.now=this.start,this.pos=this.state=0,h.elem=this.elem,h()&&f.timers.push(h)&&!cl&&(co?(cl=!0,g=function(){cl&&(co(g),e.tick())},co(g)):cl=setInterval(e.tick,e.interval))},show:function(){this.options.orig[this.prop]=f.style(this.elem,this.prop),this.options.show=!0,this.custom(this.prop==="width"||this.prop==="height"?1:0,this.cur()),f(this.elem).show()},hide:function(){this.options.orig[this.prop]=f.style(this.elem,this.prop),this.options.hide=!0,this.custom(this.cur(),0)},step:function(a){var b=cn||cp(),c=!0,d=this.elem,e=this.options,g,h;if(a||b>=e.duration+this.startTime){this.now=this.end,this.pos=this.state=1,this.update(),e.animatedProperties[this.prop]=!0;for(g in e.animatedProperties)e.animatedProperties[g]!==!0&&(c=!1);if(c){e.overflow!=null&&!f.support.shrinkWrapBlocks&&f.each(["","X","Y"],function(a,b){d.style["overflow"+b]=e.overflow[a]}),e.hide&&f(d).hide();if(e.hide||e.show)for(var i in e.animatedProperties)f.style(d,i,e.orig[i]);e.complete.call(d)}return!1}e.duration==Infinity?this.now=b:(h=b-this.startTime,this.state=h/e.duration,this.pos=f.easing[e.animatedProperties[this.prop]](this.state,h,0,1,e.duration),this.now=this.start+(this.end-this.start)*this.pos),this.update();return!0}},f.extend(f.fx,{tick:function(){for(var a=f.timers,b=0;b<a.length;++b)a[b]()||a.splice(b--,1);a.length||f.fx.stop()},interval:13,stop:function(){clearInterval(cl),cl=null},speeds:{slow:600,fast:200,_default:400},step:{opacity:function(a){f.style(a.elem,"opacity",a.now)},_default:function(a){a.elem.style&&a.elem.style[a.prop]!=null?a.elem.style[a.prop]=(a.prop==="width"||a.prop==="height"?Math.max(0,a.now):a.now)+a.unit:a.elem[a.prop]=a.now}}}),f.expr&&f.expr.filters&&(f.expr.filters.animated=function(a){return f.grep(f.timers,function(b){return a===b.elem}).length});var ct=/^t(?:able|d|h)$/i,cu=/^(?:body|html)$/i;"getBoundingClientRect"in c.documentElement?f.fn.offset=function(a){var b=this[0],c;if(a)return this.each(function(b){f.offset.setOffset(this,a,b)});if(!b||!b.ownerDocument)return null;if(b===b.ownerDocument.body)return f.offset.bodyOffset(b);try{c=b.getBoundingClientRect()}catch(d){}var e=b.ownerDocument,g=e.documentElement;if(!c||!f.contains(g,b))return c?{top:c.top,left:c.left}:{top:0,left:0};var h=e.body,i=cv(e),j=g.clientTop||h.clientTop||0,k=g.clientLeft||h.clientLeft||0,l=i.pageYOffset||f.support.boxModel&&g.scrollTop||h.scrollTop,m=i.pageXOffset||f.support.boxModel&&g.scrollLeft||h.scrollLeft,n=c.top+l-j,o=c.left+m-k;return{top:n,left:o}}:f.fn.offset=function(a){var b=this[0];if(a)return this.each(function(b){f.offset.setOffset(this,a,b)});if(!b||!b.ownerDocument)return null;if(b===b.ownerDocument.body)return f.offset.bodyOffset(b);f.offset.initialize();var c,d=b.offsetParent,e=b,g=b.ownerDocument,h=g.documentElement,i=g.body,j=g.defaultView,k=j?j.getComputedStyle(b,null):b.currentStyle,l=b.offsetTop,m=b.offsetLeft;while((b=b.parentNode)&&b!==i&&b!==h){if(f.offset.supportsFixedPosition&&k.position==="fixed")break;c=j?j.getComputedStyle(b,null):b.currentStyle,l-=b.scrollTop,m-=b.scrollLeft,b===d&&(l+=b.offsetTop,m+=b.offsetLeft,f.offset.doesNotAddBorder&&(!f.offset.doesAddBorderForTableAndCells||!ct.test(b.nodeName))&&(l+=parseFloat(c.borderTopWidth)||0,m+=parseFloat(c.borderLeftWidth)||0),e=d,d=b.offsetParent),f.offset.subtractsBorderForOverflowNotVisible&&c.overflow!=="visible"&&(l+=parseFloat(c.borderTopWidth)||0,m+=parseFloat(c.borderLeftWidth)||0),k=c}if(k.position==="relative"||k.position==="static")l+=i.offsetTop,m+=i.offsetLeft;f.offset.supportsFixedPosition&&k.position==="fixed"&&(l+=Math.max(h.scrollTop,i.scrollTop),m+=Math.max(h.scrollLeft,i.scrollLeft));return{top:l,left:m}},f.offset={initialize:function(){var a=c.body,b=c.createElement("div"),d,e,g,h,i=parseFloat(f.css(a,"marginTop"))||0,j="<div style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;'><div></div></div><table style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;' cellpadding='0' cellspacing='0'><tr><td></td></tr></table>";f.extend(b.style,{position:"absolute",top:0,left:0,margin:0,border:0,width:"1px",height:"1px",visibility:"hidden"}),b.innerHTML=j,a.insertBefore(b,a.firstChild),d=b.firstChild,e=d.firstChild,h=d.nextSibling.firstChild.firstChild,this.doesNotAddBorder=e.offsetTop!==5,this.doesAddBorderForTableAndCells=h.offsetTop===5,e.style.position="fixed",e.style.top="20px",this.supportsFixedPosition=e.offsetTop===20||e.offsetTop===15,e.style.position=e.style.top="",d.style.overflow="hidden",d.style.position="relative",this.subtractsBorderForOverflowNotVisible=e.offsetTop===-5,this.doesNotIncludeMarginInBodyOffset=a.offsetTop!==i,a.removeChild(b),f.offset.initialize=f.noop},bodyOffset:function(a){var b=a.offsetTop,c=a.offsetLeft;f.offset.initialize(),f.offset.doesNotIncludeMarginInBodyOffset&&(b+=parseFloat(f.css(a,"marginTop"))||0,c+=parseFloat(f.css(a,"marginLeft"))||0);return{top:b,left:c}},setOffset:function(a,b,c){var d=f.css(a,"position");d==="static"&&(a.style.position="relative");var e=f(a),g=e.offset(),h=f.css(a,"top"),i=f.css(a,"left"),j=(d==="absolute"||d==="fixed")&&f.inArray("auto",[h,i])>-1,k={},l={},m,n;j?(l=e.position(),m=l.top,n=l.left):(m=parseFloat(h)||0,n=parseFloat(i)||0),f.isFunction(b)&&(b=b.call(a,c,g)),b.top!=null&&(k.top=b.top-g.top+m),b.left!=null&&(k.left=b.left-g.left+n),"using"in b?b.using.call(a,k):e.css(k)}},f.fn.extend({position:function(){if(!this[0])return null;var a=this[0],b=this.offsetParent(),c=this.offset(),d=cu.test(b[0].nodeName)?{top:0,left:0}:b.offset();c.top-=parseFloat(f.css(a,"marginTop"))||0,c.left-=parseFloat(f.css(a,"marginLeft"))||0,d.top+=parseFloat(f.css(b[0],"borderTopWidth"))||0,d.left+=parseFloat(f.css(b[0],"borderLeftWidth"))||0;return{top:c.top-d.top,left:c.left-d.left}},offsetParent:function(){return this.map(function(){var a=this.offsetParent||c.body;while(a&&!cu.test(a.nodeName)&&f.css(a,"position")==="static")a=a.offsetParent;return a})}}),f.each(["Left","Top"],function(a,c){var d="scroll"+c;f.fn[d]=function(c){var e,g;if(c===b){e=this[0];if(!e)return null;g=cv(e);return g?"pageXOffset"in g?g[a?"pageYOffset":"pageXOffset"]:f.support.boxModel&&g.document.documentElement[d]||g.document.body[d]:e[d]}return this.each(function(){g=cv(this),g?g.scrollTo(a?f(g).scrollLeft():c,a?c:f(g).scrollTop()):this[d]=c})}}),f.each(["Height","Width"],function(a,c){var d=c.toLowerCase();f.fn["inner"+c]=function(){var a=this[0];return a&&a.style?parseFloat(f.css(a,d,"padding")):null},f.fn["outer"+c]=function(a){var b=this[0];return b&&b.style?parseFloat(f.css(b,d,a?"margin":"border")):null},f.fn[d]=function(a){var e=this[0];if(!e)return a==null?null:this;if(f.isFunction(a))return this.each(function(b){var c=f(this);c[d](a.call(this,b,c[d]()))});if(f.isWindow(e)){var g=e.document.documentElement["client"+c];return e.document.compatMode==="CSS1Compat"&&g||e.document.body["client"+c]||g}if(e.nodeType===9)return Math.max(e.documentElement["client"+c],e.body["scroll"+c],e.documentElement["scroll"+c],e.body["offset"+c],e.documentElement["offset"+c]);if(a===b){var h=f.css(e,d),i=parseFloat(h);return f.isNaN(i)?h:i}return this.css(d,typeof a=="string"?a:a+"px")}}),a.jQuery=a.$=f})(window);

--- a/js/jquery.mobile-1.0b1.js
+++ /dev/null
@@ -1,5627 +1,1 @@
-/*!
- * jQuery Mobile v1.0b1
- * http://jquerymobile.com/
- *
- * Copyright 2010, jQuery Project
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- */
-/*!
- * jQuery UI Widget @VERSION
- *
- * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Widget
- */
-(function( $, undefined ) {
 
-// jQuery 1.4+
-if ( $.cleanData ) {
-	var _cleanData = $.cleanData;
-	$.cleanData = function( elems ) {
-		for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) {
-			$( elem ).triggerHandler( "remove" );
-		}
-		_cleanData( elems );
-	};
-} else {
-	var _remove = $.fn.remove;
-	$.fn.remove = function( selector, keepData ) {
-		return this.each(function() {
-			if ( !keepData ) {
-				if ( !selector || $.filter( selector, [ this ] ).length ) {
-					$( "*", this ).add( [ this ] ).each(function() {
-						$( this ).triggerHandler( "remove" );
-					});
-				}
-			}
-			return _remove.call( $(this), selector, keepData );
-		});
-	};
-}
-
-$.widget = function( name, base, prototype ) {
-	var namespace = name.split( "." )[ 0 ],
-		fullName;
-	name = name.split( "." )[ 1 ];
-	fullName = namespace + "-" + name;
-
-	if ( !prototype ) {
-		prototype = base;
-		base = $.Widget;
-	}
-
-	// create selector for plugin
-	$.expr[ ":" ][ fullName ] = function( elem ) {
-		return !!$.data( elem, name );
-	};
-
-	$[ namespace ] = $[ namespace ] || {};
-	$[ namespace ][ name ] = function( options, element ) {
-		// allow instantiation without initializing for simple inheritance
-		if ( arguments.length ) {
-			this._createWidget( options, element );
-		}
-	};
-
-	var basePrototype = new base();
-	// we need to make the options hash a property directly on the new instance
-	// otherwise we'll modify the options hash on the prototype that we're
-	// inheriting from
-//	$.each( basePrototype, function( key, val ) {
-//		if ( $.isPlainObject(val) ) {
-//			basePrototype[ key ] = $.extend( {}, val );
-//		}
-//	});
-	basePrototype.options = $.extend( true, {}, basePrototype.options );
-	$[ namespace ][ name ].prototype = $.extend( true, basePrototype, {
-		namespace: namespace,
-		widgetName: name,
-		widgetEventPrefix: $[ namespace ][ name ].prototype.widgetEventPrefix || name,
-		widgetBaseClass: fullName
-	}, prototype );
-
-	$.widget.bridge( name, $[ namespace ][ name ] );
-};
-
-$.widget.bridge = function( name, object ) {
-	$.fn[ name ] = function( options ) {
-		var isMethodCall = typeof options === "string",
-			args = Array.prototype.slice.call( arguments, 1 ),
-			returnValue = this;
-
-		// allow multiple hashes to be passed on init
-		options = !isMethodCall && args.length ?
-			$.extend.apply( null, [ true, options ].concat(args) ) :
-			options;
-
-		// prevent calls to internal methods
-		if ( isMethodCall && options.charAt( 0 ) === "_" ) {
-			return returnValue;
-		}
-
-		if ( isMethodCall ) {
-			this.each(function() {
-				var instance = $.data( this, name );
-				if ( !instance ) {
-					throw "cannot call methods on " + name + " prior to initialization; " +
-						"attempted to call method '" + options + "'";
-				}
-				if ( !$.isFunction( instance[options] ) ) {
-					throw "no such method '" + options + "' for " + name + " widget instance";
-				}
-				var methodValue = instance[ options ].apply( instance, args );
-				if ( methodValue !== instance && methodValue !== undefined ) {
-					returnValue = methodValue;
-					return false;
-				}
-			});
-		} else {
-			this.each(function() {
-				var instance = $.data( this, name );
-				if ( instance ) {
-					instance.option( options || {} )._init();
-				} else {
-					$.data( this, name, new object( options, this ) );
-				}
-			});
-		}
-
-		return returnValue;
-	};
-};
-
-$.Widget = function( options, element ) {
-	// allow instantiation without initializing for simple inheritance
-	if ( arguments.length ) {
-		this._createWidget( options, element );
-	}
-};
-
-$.Widget.prototype = {
-	widgetName: "widget",
-	widgetEventPrefix: "",
-	options: {
-		disabled: false
-	},
-	_createWidget: function( options, element ) {
-		// $.widget.bridge stores the plugin instance, but we do it anyway
-		// so that it's stored even before the _create function runs
-		$.data( element, this.widgetName, this );
-		this.element = $( element );
-		this.options = $.extend( true, {},
-			this.options,
-			this._getCreateOptions(),
-			options );
-
-		var self = this;
-		this.element.bind( "remove." + this.widgetName, function() {
-			self.destroy();
-		});
-
-		this._create();
-		this._trigger( "create" );
-		this._init();
-	},
-	_getCreateOptions: function() {
-		var options = {};
-		if ( $.metadata ) {
-			options = $.metadata.get( element )[ this.widgetName ];
-		}
-		return options;
-	},
-	_create: function() {},
-	_init: function() {},
-
-	destroy: function() {
-		this.element
-			.unbind( "." + this.widgetName )
-			.removeData( this.widgetName );
-		this.widget()
-			.unbind( "." + this.widgetName )
-			.removeAttr( "aria-disabled" )
-			.removeClass(
-				this.widgetBaseClass + "-disabled " +
-				"ui-state-disabled" );
-	},
-
-	widget: function() {
-		return this.element;
-	},
-
-	option: function( key, value ) {
-		var options = key;
-
-		if ( arguments.length === 0 ) {
-			// don't return a reference to the internal hash
-			return $.extend( {}, this.options );
-		}
-
-		if  (typeof key === "string" ) {
-			if ( value === undefined ) {
-				return this.options[ key ];
-			}
-			options = {};
-			options[ key ] = value;
-		}
-
-		this._setOptions( options );
-
-		return this;
-	},
-	_setOptions: function( options ) {
-		var self = this;
-		$.each( options, function( key, value ) {
-			self._setOption( key, value );
-		});
-
-		return this;
-	},
-	_setOption: function( key, value ) {
-		this.options[ key ] = value;
-
-		if ( key === "disabled" ) {
-			this.widget()
-				[ value ? "addClass" : "removeClass"](
-					this.widgetBaseClass + "-disabled" + " " +
-					"ui-state-disabled" )
-				.attr( "aria-disabled", value );
-		}
-
-		return this;
-	},
-
-	enable: function() {
-		return this._setOption( "disabled", false );
-	},
-	disable: function() {
-		return this._setOption( "disabled", true );
-	},
-
-	_trigger: function( type, event, data ) {
-		var callback = this.options[ type ];
-
-		event = $.Event( event );
-		event.type = ( type === this.widgetEventPrefix ?
-			type :
-			this.widgetEventPrefix + type ).toLowerCase();
-		data = data || {};
-
-		// copy original event properties over to the new event
-		// this would happen if we could call $.event.fix instead of $.Event
-		// but we don't have a way to force an event to be fixed multiple times
-		if ( event.originalEvent ) {
-			for ( var i = $.event.props.length, prop; i; ) {
-				prop = $.event.props[ --i ];
-				event[ prop ] = event.originalEvent[ prop ];
-			}
-		}
-
-		this.element.trigger( event, data );
-
-		return !( $.isFunction(callback) &&
-			callback.call( this.element[0], event, data ) === false ||
-			event.isDefaultPrevented() );
-	}
-};
-
-})( jQuery );
-/*
-* jQuery Mobile Framework : widget factory extentions for mobile
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT or GPL Version 2 licenses.
-* http://jquery.org/license
-*/
-(function($, undefined ) {
-
-$.widget( "mobile.widget", {
-	_getCreateOptions: function() {
-		var elem = this.element,
-			options = {};
-		$.each( this.options, function( option ) {
-			var value = elem.jqmData( option.replace( /[A-Z]/g, function( c ) {
-				return "-" + c.toLowerCase();
-			} ) );
-			if ( value !== undefined ) {
-				options[ option ] = value;
-			}
-		});
-		return options;
-	}
-});
-
-})( jQuery );
-/*
-* jQuery Mobile Framework : resolution and CSS media query related helpers and behavior
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT or GPL Version 2 licenses.
-* http://jquery.org/license
-*/
-(function($, undefined ) {
-
-var $window = $(window),
-	$html = $( "html" ),
-
-	//media-query-like width breakpoints, which are translated to classes on the html element
-	resolutionBreakpoints = [320,480,768,1024];
-
-
-/* $.mobile.media method: pass a CSS media type or query and get a bool return
-	note: this feature relies on actual media query support for media queries, though types will work most anywhere
-	examples:
-		$.mobile.media('screen') //>> tests for screen media type
-		$.mobile.media('screen and (min-width: 480px)') //>> tests for screen media type with window width > 480px
-		$.mobile.media('@media screen and (-webkit-min-device-pixel-ratio: 2)') //>> tests for webkit 2x pixel ratio (iPhone 4)
-*/
-$.mobile.media = (function() {
-	// TODO: use window.matchMedia once at least one UA implements it
-	var cache = {},
-		testDiv = $( "<div id='jquery-mediatest'>" ),
-		fakeBody = $( "<body>" ).append( testDiv );
-
-	return function( query ) {
-		if ( !( query in cache ) ) {
-			var styleBlock = document.createElement('style'),
-        		cssrule = "@media " + query + " { #jquery-mediatest { position:absolute; } }";
-	        //must set type for IE!	
-	        styleBlock.type = "text/css";
-	        if (styleBlock.styleSheet){ 
-	          styleBlock.styleSheet.cssText = cssrule;
-	        } 
-	        else {
-	          styleBlock.appendChild(document.createTextNode(cssrule));
-	        } 
-				
-			$html.prepend( fakeBody ).prepend( styleBlock );
-			cache[ query ] = testDiv.css( "position" ) === "absolute";
-			fakeBody.add( styleBlock ).remove();
-		}
-		return cache[ query ];
-	};
-})();
-
-/*
-	private function for adding/removing breakpoint classes to HTML element for faux media-query support
-	It does not require media query support, instead using JS to detect screen width > cross-browser support
-	This function is called on orientationchange, resize, and mobileinit, and is bound via the 'htmlclass' event namespace
-*/
-function detectResolutionBreakpoints(){
-	var currWidth = $window.width(),
-		minPrefix = "min-width-",
-		maxPrefix = "max-width-",
-		minBreakpoints = [],
-		maxBreakpoints = [],
-		unit = "px",
-		breakpointClasses;
-
-	$html.removeClass( minPrefix + resolutionBreakpoints.join(unit + " " + minPrefix) + unit + " " +
-		maxPrefix + resolutionBreakpoints.join( unit + " " + maxPrefix) + unit );
-
-	$.each(resolutionBreakpoints,function( i, breakPoint ){
-		if( currWidth >= breakPoint ){
-			minBreakpoints.push( minPrefix + breakPoint + unit );
-		}
-		if( currWidth <= breakPoint ){
-			maxBreakpoints.push( maxPrefix + breakPoint + unit );
-		}
-	});
-
-	if( minBreakpoints.length ){ breakpointClasses = minBreakpoints.join(" "); }
-	if( maxBreakpoints.length ){ breakpointClasses += " " +  maxBreakpoints.join(" "); }
-
-	$html.addClass( breakpointClasses );
-};
-
-/* $.mobile.addResolutionBreakpoints method:
-	pass either a number or an array of numbers and they'll be added to the min/max breakpoint classes
-	Examples:
-		$.mobile.addResolutionBreakpoints( 500 );
-		$.mobile.addResolutionBreakpoints( [500, 1200] );
-*/
-$.mobile.addResolutionBreakpoints = function( newbps ){
-	if( $.type( newbps ) === "array" ){
-		resolutionBreakpoints = resolutionBreakpoints.concat( newbps );
-	}
-	else {
-		resolutionBreakpoints.push( newbps );
-	}
-	resolutionBreakpoints.sort(function(a,b){ return a-b; });
-	detectResolutionBreakpoints();
-};
-
-/* 	on mobileinit, add classes to HTML element
-	and set handlers to update those on orientationchange and resize*/
-$(document).bind("mobileinit.htmlclass", function(){
-	/* bind to orientationchange and resize
-	to add classes to HTML element for min/max breakpoints and orientation */
-	var ev = $.support.orientation;
-	$window.bind("orientationchange.htmlclass throttledResize.htmlclass", function(event){
-		//add orientation class to HTML element on flip/resize.
-		if(event.orientation){
-			$html.removeClass( "portrait landscape" ).addClass( event.orientation );
-		}
-		//add classes to HTML element for min/max breakpoints
-		detectResolutionBreakpoints();
-	});
-});
-
-/* Manually trigger an orientationchange event when the dom ready event fires.
-   This will ensure that any viewport meta tag that may have been injected
-   has taken effect already, allowing us to properly calculate the width of the
-   document.
-*/
-$(function(){
-	//trigger event manually
-	$window.trigger( "orientationchange.htmlclass" );
-});
-
-})(jQuery);/*
-* jQuery Mobile Framework : support tests
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.
-* Note: Code is in draft form and is subject to change 
-*/
-( function( $, undefined  ) {
-
-var fakeBody = $( "<body>"  ).prependTo( "html" ),
-	fbCSS = fakeBody[ 0 ].style,
-	vendors = [ "webkit", "moz", "o" ],
-	webos = "palmGetResource" in window, //only used to rule out scrollTop 
-	bb = window.blackberry; //only used to rule out box shadow, as it's filled opaque on BB
-
-// thx Modernizr
-function propExists( prop  ){
-	var uc_prop = prop.charAt( 0 ).toUpperCase() + prop.substr( 1 ),
-		props   = ( prop + " " + vendors.join( uc_prop + " " ) + uc_prop ).split( " " );
-	for( var v in props ){
-		if( fbCSS[ v ] !== undefined  ){
-			return true;
-		}
-	}
-}
-
-// test for dynamic-updating base tag support ( allows us to avoid href,src attr rewriting )
-function baseTagTest(){
-	var fauxBase = location.protocol + "//" + location.host + location.pathname + "ui-dir/",
-		base = $( "head base" ),
-		fauxEle = null,
-		href = "";
-	if ( !base.length ) {
-		base = fauxEle = $( "<base>", { "href": fauxBase} ).appendTo( "head" );
-	}
-	else {
-		href = base.attr( "href" );
-	}
-	var link = $( "<a href='testurl'></a>"  ).prependTo( fakeBody  ),
-		rebase = link[ 0 ].href;
-	base[ 0 ].href = href ? href : location.pathname;
-	if ( fauxEle ) {
-		fauxEle.remove();
-	}
-	return rebase.indexOf( fauxBase ) === 0;
-}
-
-
-// non-UA-based IE version check by James Padolsey, modified by jdalton - from http://gist.github.com/527683
-// allows for inclusion of IE 6+, including Windows Mobile 7
-$.mobile.browser = {};
-$.mobile.browser.ie = ( function() {
-    var v = 3, 
-	div = document.createElement( "div" ), 
-	a = div.all || [];
-    while ( div.innerHTML = "<!--[if gt IE " + ( ++v ) + "]><br><![endif]-->", a[ 0 ] ); 
-    return v > 4 ? v : !v;
-}() );
-
-
-$.extend( $.support, {
-	orientation: "orientation" in window,
-	touch: "ontouchend" in document,
-	cssTransitions: "WebKitTransitionEvent" in window,
-	pushState: !!history.pushState,
-	mediaquery: $.mobile.media( "only all" ),
-	cssPseudoElement: !!propExists( "content" ),
-	boxShadow: !!propExists( "boxShadow" ) && !bb,
-	scrollTop: ( "pageXOffset" in window || "scrollTop" in document.documentElement || "scrollTop" in fakeBody[ 0 ] ) && !webos,
-	dynamicBaseTag: baseTagTest(),
-	eventCapture: ( "addEventListener" in document ) // This is a weak test. We may want to beef this up later.
-} );
-
-fakeBody.remove();
-
-// for ruling out shadows via css
-if( !$.support.boxShadow  ){ $( "html" ).addClass( "ui-mobile-nosupport-boxshadow" ); }
-
-} )( jQuery  );/*
-* jQuery Mobile Framework : "mouse" plugin
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT or GPL Version 2 licenses.
-* http://jquery.org/license
-*/
-
-// This plugin is an experiment for abstracting away the touch and mouse
-// events so that developers don't have to worry about which method of input
-// the device their document is loaded on supports.
-//
-// The idea here is to allow the developer to register listeners for the
-// basic mouse events, such as mousedown, mousemove, mouseup, and click,
-// and the plugin will take care of registering the correct listeners
-// behind the scenes to invoke the listener at the fastest possible time
-// for that device, while still retaining the order of event firing in
-// the traditional mouse environment, should multiple handlers be registered
-// on the same element for different events.
-//
-// The current version exposes the following virtual events to jQuery bind methods:
-// "vmouseover vmousedown vmousemove vmouseup vclick vmouseout vmousecancel"
-
-(function($, window, document, undefined) {
-
-var dataPropertyName = "virtualMouseBindings",
-	touchTargetPropertyName = "virtualTouchID",
-	virtualEventNames = "vmouseover vmousedown vmousemove vmouseup vclick vmouseout vmousecancel".split(" "),
-	touchEventProps = "clientX clientY pageX pageY screenX screenY".split(" "),
-	activeDocHandlers = {},
-	resetTimerID = 0,
-	startX = 0,
-	startY = 0,
-	didScroll = false,
-	clickBlockList = [],
-	blockMouseTriggers = false,
-	blockTouchTriggers = false,
-	eventCaptureSupported = $.support.eventCapture,
-	$document = $(document),
-	nextTouchID = 1,
-	lastTouchID = 0;
-
-$.vmouse = {
-	moveDistanceThreshold: 10,
-	clickDistanceThreshold: 10,
-	resetTimerDuration: 1500
-};
-
-function getNativeEvent(event)
-{
-	while (event && typeof event.originalEvent !== "undefined") {
-		event = event.originalEvent;
-	}
-	return event;
-}
-
-function createVirtualEvent(event, eventType)
-{
-	var t = event.type;
-	event = $.Event(event);
-	event.type = eventType;
-	
-	var oe = event.originalEvent;
-	var props = $.event.props;
-	
-	// copy original event properties over to the new event
-	// this would happen if we could call $.event.fix instead of $.Event
-	// but we don't have a way to force an event to be fixed multiple times
-	if (oe) {
-		for ( var i = props.length, prop; i; ) {
-			prop = props[ --i ];
-			event[prop] = oe[prop];
-		}
-	}
-	
-	if (t.search(/^touch/) !== -1){
-		var ne = getNativeEvent(oe),
-			t = ne.touches,
-			ct = ne.changedTouches,
-			touch = (t && t.length) ? t[0] : ((ct && ct.length) ? ct[0] : undefined);
-		if (touch){
-			for (var i = 0, len = touchEventProps.length; i < len; i++){
-				var prop = touchEventProps[i];
-				event[prop] = touch[prop];
-			}
-		}
-	}
-
-	return event;
-}
-
-function getVirtualBindingFlags(element)
-{
-	var flags = {};
-	while (element){
-		var b = $.data(element, dataPropertyName);
-		for (var k in b) {
-			if (b[k]){
-				flags[k] = flags.hasVirtualBinding = true;
-			}
-		}
-		element = element.parentNode;
-	}
-	return flags;
-}
-
-function getClosestElementWithVirtualBinding(element, eventType)
-{
-	while (element){
-		var b = $.data(element, dataPropertyName);
-		if (b && (!eventType || b[eventType])) {
-			return element;
-		}
-		element = element.parentNode;
-	}
-	return null;
-}
-
-function enableTouchBindings()
-{
-	blockTouchTriggers = false;
-}
-
-function disableTouchBindings()
-{
-	blockTouchTriggers = true;
-}
-
-function enableMouseBindings()
-{
-	lastTouchID = 0;
-	clickBlockList.length = 0;
-	blockMouseTriggers = false;
-
-	// When mouse bindings are enabled, our
-	// touch bindings are disabled.
-	disableTouchBindings();
-}
-
-function disableMouseBindings()
-{
-	// When mouse bindings are disabled, our
-	// touch bindings are enabled.
-	enableTouchBindings();
-}
-
-function startResetTimer()
-{
-	clearResetTimer();
-	resetTimerID = setTimeout(function(){
-		resetTimerID = 0;
-		enableMouseBindings();
-	}, $.vmouse.resetTimerDuration);
-}
-
-function clearResetTimer()
-{
-	if (resetTimerID){
-		clearTimeout(resetTimerID);
-		resetTimerID = 0;
-	}
-}
-
-function triggerVirtualEvent(eventType, event, flags)
-{
-	var defaultPrevented = false;
-
-	if ((flags && flags[eventType]) || (!flags && getClosestElementWithVirtualBinding(event.target, eventType))) {
-		var ve = createVirtualEvent(event, eventType);
-		$(event.target).trigger(ve);
-		defaultPrevented = ve.isDefaultPrevented();
-	}
-
-	return defaultPrevented;
-}
-
-function mouseEventCallback(event)
-{
-	var touchID = $.data(event.target, touchTargetPropertyName);
-	if (!blockMouseTriggers && (!lastTouchID || lastTouchID !== touchID)){
-		triggerVirtualEvent("v" + event.type, event);
-	}
-}
-
-function handleTouchStart(event)
-{
-	var touches = getNativeEvent(event).touches;
-	if (touches && touches.length === 1){
-		var target = event.target,
-			flags = getVirtualBindingFlags(target);
-	
-		if (flags.hasVirtualBinding){
-			lastTouchID = nextTouchID++;
-			$.data(target, touchTargetPropertyName, lastTouchID);
-	
-			clearResetTimer();
-			
-			disableMouseBindings();
-			didScroll = false;
-			
-			var t = getNativeEvent(event).touches[0];
-			startX = t.pageX;
-			startY = t.pageY;
-		
-			triggerVirtualEvent("vmouseover", event, flags);
-			triggerVirtualEvent("vmousedown", event, flags);
-		}
-	}
-}
-
-function handleScroll(event)
-{
-	if (blockTouchTriggers){
-		return;
-	}
-
-	if (!didScroll){
-		triggerVirtualEvent("vmousecancel", event, getVirtualBindingFlags(event.target));
-	}
-
-	didScroll = true;
-	startResetTimer();
-}
-
-function handleTouchMove(event)
-{
-	if (blockTouchTriggers){
-		return;
-	}
-
-	var t = getNativeEvent(event).touches[0];
-
-	var didCancel = didScroll,
-		moveThreshold = $.vmouse.moveDistanceThreshold;
-	didScroll = didScroll
-		|| (Math.abs(t.pageX - startX) > moveThreshold || Math.abs(t.pageY - startY) > moveThreshold);
-
-	var flags = getVirtualBindingFlags(event.target);
-	if (didScroll && !didCancel){
-		triggerVirtualEvent("vmousecancel", event, flags);
-	}
-	triggerVirtualEvent("vmousemove", event, flags);
-	startResetTimer();
-}
-
-function handleTouchEnd(event)
-{
-	if (blockTouchTriggers){
-		return;
-	}
-
-	disableTouchBindings();
-
-	var flags = getVirtualBindingFlags(event.target);
-	triggerVirtualEvent("vmouseup", event, flags);
-	if (!didScroll){
-		if (triggerVirtualEvent("vclick", event, flags)){
-			// The target of the mouse events that follow the touchend
-			// event don't necessarily match the target used during the
-			// touch. This means we need to rely on coordinates for blocking
-			// any click that is generated.
-			var t = getNativeEvent(event).changedTouches[0];
-			clickBlockList.push({ touchID: lastTouchID, x: t.clientX, y: t.clientY });
-
-			// Prevent any mouse events that follow from triggering
-			// virtual event notifications.
-			blockMouseTriggers = true;
-		}
-	}
-	triggerVirtualEvent("vmouseout", event, flags);
-	didScroll = false;
-	
-	startResetTimer();
-}
-
-function hasVirtualBindings(ele)
-{
-	var bindings = $.data(ele, dataPropertyName), k;
-	if (bindings){
-		for (k in bindings){
-			if (bindings[k]){
-				return true;
-			}
-		}
-	}
-	return false;
-}
-
-function dummyMouseHandler(){}
-
-function getSpecialEventObject(eventType)
-{
-	var realType = eventType.substr(1);
-	return {
-		setup: function(data, namespace) {
-			// If this is the first virtual mouse binding for this element,
-			// add a bindings object to its data.
-
-			if (!hasVirtualBindings(this)){
-				$.data(this, dataPropertyName, {});
-			}
-
-			// If setup is called, we know it is the first binding for this
-			// eventType, so initialize the count for the eventType to zero.
-
-			var bindings = $.data(this, dataPropertyName);
-			bindings[eventType] = true;
-
-			// If this is the first virtual mouse event for this type,
-			// register a global handler on the document.
-
-			activeDocHandlers[eventType] = (activeDocHandlers[eventType] || 0) + 1;
-			if (activeDocHandlers[eventType] === 1){
-				$document.bind(realType, mouseEventCallback);
-			}
-
-			// Some browsers, like Opera Mini, won't dispatch mouse/click events
-			// for elements unless they actually have handlers registered on them.
-			// To get around this, we register dummy handlers on the elements.
-
-			$(this).bind(realType, dummyMouseHandler);
-
-			// For now, if event capture is not supported, we rely on mouse handlers.
-			if (eventCaptureSupported){
-				// If this is the first virtual mouse binding for the document,
-				// register our touchstart handler on the document.
-	
-				activeDocHandlers["touchstart"] = (activeDocHandlers["touchstart"] || 0) + 1;
-				if (activeDocHandlers["touchstart"] === 1) {
-					$document.bind("touchstart", handleTouchStart)
-
-						.bind("touchend", handleTouchEnd)
-					
-						// On touch platforms, touching the screen and then dragging your finger
-						// causes the window content to scroll after some distance threshold is
-						// exceeded. On these platforms, a scroll prevents a click event from being
-						// dispatched, and on some platforms, even the touchend is suppressed. To
-						// mimic the suppression of the click event, we need to watch for a scroll
-						// event. Unfortunately, some platforms like iOS don't dispatch scroll
-						// events until *AFTER* the user lifts their finger (touchend). This means
-						// we need to watch both scroll and touchmove events to figure out whether
-						// or not a scroll happenens before the touchend event is fired.
-					
-						.bind("touchmove", handleTouchMove)
-						.bind("scroll", handleScroll);			
-				}
-			}
-		},
-
-		teardown: function(data, namespace) {
-			// If this is the last virtual binding for this eventType,
-			// remove its global handler from the document.
-
-			--activeDocHandlers[eventType];
-			if (!activeDocHandlers[eventType]){
-				$document.unbind(realType, mouseEventCallback);
-			}
-
-			if (eventCaptureSupported){
-				// If this is the last virtual mouse binding in existence,
-				// remove our document touchstart listener.
-	
-				--activeDocHandlers["touchstart"];
-				if (!activeDocHandlers["touchstart"]) {
-					$document.unbind("touchstart", handleTouchStart)
-						.unbind("touchmove", handleTouchMove)
-						.unbind("touchend", handleTouchEnd)
-						.unbind("scroll", handleScroll);
-				}
-			}
-
-			var $this = $(this),
-				bindings = $.data(this, dataPropertyName);
-
-			// teardown may be called when an element was
-			// removed from the DOM. If this is the case,
-			// jQuery core may have already stripped the element
-			// of any data bindings so we need to check it before
-			// using it.
-			if (bindings){
-				bindings[eventType] = false;
-			}
-
-			// Unregister the dummy event handler.
-
-			$this.unbind(realType, dummyMouseHandler);
-
-			// If this is the last virtual mouse binding on the
-			// element, remove the binding data from the element.
-
-			if (!hasVirtualBindings(this)){
-				$this.removeData(dataPropertyName);
-			}
-		}
-	};
-}
-
-// Expose our custom events to the jQuery bind/unbind mechanism.
-
-for (var i = 0; i < virtualEventNames.length; i++){
-	$.event.special[virtualEventNames[i]] = getSpecialEventObject(virtualEventNames[i]);
-}
-
-// Add a capture click handler to block clicks.
-// Note that we require event capture support for this so if the device
-// doesn't support it, we punt for now and rely solely on mouse events.
-if (eventCaptureSupported){
-	document.addEventListener("click", function(e){
-		var cnt = clickBlockList.length;
-		var target = e.target;
-		if (cnt) {
-			var x = e.clientX,
-				y = e.clientY,
-				threshold = $.vmouse.clickDistanceThreshold;
-
-			// The idea here is to run through the clickBlockList to see if
-			// the current click event is in the proximity of one of our
-			// vclick events that had preventDefault() called on it. If we find
-			// one, then we block the click.
-			//
-			// Why do we have to rely on proximity?
-			//
-			// Because the target of the touch event that triggered the vclick
-			// can be different from the target of the click event synthesized
-			// by the browser. The target of a mouse/click event that is syntehsized
-			// from a touch event seems to be implementation specific. For example,
-			// some browsers will fire mouse/click events for a link that is near
-			// a touch event, even though the target of the touchstart/touchend event
-			// says the user touched outside the link. Also, it seems that with most
-			// browsers, the target of the mouse/click event is not calculated until the
-			// time it is dispatched, so if you replace an element that you touched
-			// with another element, the target of the mouse/click will be the new
-			// element underneath that point.
-			//
-			// Aside from proximity, we also check to see if the target and any
-			// of its ancestors were the ones that blocked a click. This is necessary
-			// because of the strange mouse/click target calculation done in the
-			// Android 2.1 browser, where if you click on an element, and there is a
-			// mouse/click handler on one of its ancestors, the target will be the
-			// innermost child of the touched element, even if that child is no where
-			// near the point of touch.
-			
-			var ele = target;
-			while (ele) {
-				for (var i = 0; i < cnt; i++) {
-					var o = clickBlockList[i],
-						touchID = 0;
-					if ((ele === target && Math.abs(o.x - x) < threshold && Math.abs(o.y - y) < threshold) || $.data(ele, touchTargetPropertyName) === o.touchID){
-						// XXX: We may want to consider removing matches from the block list
-						//      instead of waiting for the reset timer to fire.
-						e.preventDefault();
-						e.stopPropagation();
-						return;
-					}
-				}
-				ele = ele.parentNode;
-			}
-		}
-	}, true);
-}
-})(jQuery, window, document);
-/*
-* jQuery Mobile Framework : events
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT or GPL Version 2 licenses.
-* http://jquery.org/license
-*/
-(function($, undefined ) {
-
-// add new event shortcuts
-$.each( "touchstart touchmove touchend orientationchange throttledresize tap taphold swipe swipeleft swiperight scrollstart scrollstop".split( " " ), function( i, name ) {
-	$.fn[ name ] = function( fn ) {
-		return fn ? this.bind( name, fn ) : this.trigger( name );
-	};
-	$.attrFn[ name ] = true;
-});
-
-var supportTouch = $.support.touch,
-	scrollEvent = "touchmove scroll",
-	touchStartEvent = supportTouch ? "touchstart" : "mousedown",
-	touchStopEvent = supportTouch ? "touchend" : "mouseup",
-	touchMoveEvent = supportTouch ? "touchmove" : "mousemove";
-
-function triggerCustomEvent(obj, eventType, event)
-{
-	var originalType = event.type;
-	event.type = eventType;
-	$.event.handle.call( obj, event );
-	event.type = originalType;
-}
-
-// also handles scrollstop
-$.event.special.scrollstart = {
-	enabled: true,
-	
-	setup: function() {
-		var thisObject = this,
-			$this = $( thisObject ),
-			scrolling,
-			timer;
-		
-		function trigger( event, state ) {
-			scrolling = state;
-			triggerCustomEvent( thisObject, scrolling ? "scrollstart" : "scrollstop", event );
-		}
-		
-		// iPhone triggers scroll after a small delay; use touchmove instead
-		$this.bind( scrollEvent, function( event ) {
-			if ( !$.event.special.scrollstart.enabled ) {
-				return;
-			}
-			
-			if ( !scrolling ) {
-				trigger( event, true );
-			}
-			
-			clearTimeout( timer );
-			timer = setTimeout(function() {
-				trigger( event, false );
-			}, 50 );
-		});
-	}
-};
-
-// also handles taphold
-$.event.special.tap = {
-	setup: function() {
-		var thisObject = this,
-			$this = $( thisObject );
-		
-		$this
-			.bind("vmousedown", function( event ) {
-				if ( event.which && event.which !== 1 ) {
-					return false;
-				}
-				
-				var touching = true,
-					origTarget = event.target,
-					origEvent = event.originalEvent,
-					timer;
-					
-				function clearTapHandlers() {
-					touching = false;
-					clearTimeout(timer);
-					$this.unbind("vclick", clickHandler).unbind("vmousecancel", clearTapHandlers);
-				}
-				
-				function clickHandler(event) {
-					clearTapHandlers();
-
-					/* ONLY trigger a 'tap' event if the start target is
-					 * the same as the stop target.
-					 */
-					if ( origTarget == event.target ) {
-						triggerCustomEvent( thisObject, "tap", event );
-					}
-				}
-
-				$this.bind("vmousecancel", clearTapHandlers).bind("vclick", clickHandler);
-
-				timer = setTimeout(function() {
-					if ( touching ) {
-						triggerCustomEvent( thisObject, "taphold", event );
-					}
-				}, 750 );
-			});
-	}
-};
-
-// also handles swipeleft, swiperight
-$.event.special.swipe = {
-	setup: function() {
-		var thisObject = this,
-			$this = $( thisObject );
-		
-		$this
-			.bind( touchStartEvent, function( event ) {
-				var data = event.originalEvent.touches ?
-						event.originalEvent.touches[ 0 ] :
-						event,
-					start = {
-						time: (new Date).getTime(),
-						coords: [ data.pageX, data.pageY ],
-						origin: $( event.target )
-					},
-					stop;
-				
-				function moveHandler( event ) {
-					if ( !start ) {
-						return;
-					}
-					
-					var data = event.originalEvent.touches ?
-							event.originalEvent.touches[ 0 ] :
-							event;
-					stop = {
-							time: (new Date).getTime(),
-							coords: [ data.pageX, data.pageY ]
-					};
-					
-					// prevent scrolling
-					if ( Math.abs( start.coords[0] - stop.coords[0] ) > 10 ) {
-						event.preventDefault();
-					}
-				}
-				
-				$this
-					.bind( touchMoveEvent, moveHandler )
-					.one( touchStopEvent, function( event ) {
-						$this.unbind( touchMoveEvent, moveHandler );
-						if ( start && stop ) {
-							if ( stop.time - start.time < 1000 && 
-									Math.abs( start.coords[0] - stop.coords[0]) > 30 &&
-									Math.abs( start.coords[1] - stop.coords[1]) < 75 ) {
-								start.origin
-								.trigger( "swipe" )
-
-								.trigger( start.coords[0] > stop.coords[0] ? "swipeleft" : "swiperight" );
-							}
-						}
-						start = stop = undefined;
-					});
-			});
-	}
-};
-
-(function($){
-	// "Cowboy" Ben Alman
-	
-	var win = $(window),
-		special_event,
-		get_orientation,
-		last_orientation;
-	
-	$.event.special.orientationchange = special_event = {
-		setup: function(){
-			// If the event is supported natively, return false so that jQuery
-			// will bind to the event using DOM methods.
-			if ( $.support.orientation ) { return false; }
-			
-			// Get the current orientation to avoid initial double-triggering.
-			last_orientation = get_orientation();
-			
-			// Because the orientationchange event doesn't exist, simulate the
-			// event by testing window dimensions on resize.
-			win.bind( "throttledresize", handler );
-		},
-		teardown: function(){
-			// If the event is not supported natively, return false so that
-			// jQuery will unbind the event using DOM methods.
-			if ( $.support.orientation ) { return false; }
-			
-			// Because the orientationchange event doesn't exist, unbind the
-			// resize event handler.
-			win.unbind( "throttledresize", handler );
-		},
-		add: function( handleObj ) {
-			// Save a reference to the bound event handler.
-			var old_handler = handleObj.handler;
-			
-			handleObj.handler = function( event ) {
-				// Modify event object, adding the .orientation property.
-				event.orientation = get_orientation();
-				
-				// Call the originally-bound event handler and return its result.
-				return old_handler.apply( this, arguments );
-			};
-		}
-	};
-	
-	// If the event is not supported natively, this handler will be bound to
-	// the window resize event to simulate the orientationchange event.
-	function handler() {
-		// Get the current orientation.
-		var orientation = get_orientation();
-		
-		if ( orientation !== last_orientation ) {
-			// The orientation has changed, so trigger the orientationchange event.
-			last_orientation = orientation;
-			win.trigger( "orientationchange" );
-		}
-	};
-	
-	// Get the current page orientation. This method is exposed publicly, should it
-	// be needed, as jQuery.event.special.orientationchange.orientation()
-	$.event.special.orientationchange.orientation = get_orientation = function() {
-		var elem = document.documentElement;
-		return elem && elem.clientWidth / elem.clientHeight < 1.1 ? "portrait" : "landscape";
-	};
-	
-})(jQuery);
-
-
-// throttled resize event
-(function(){
-	$.event.special.throttledresize = {
-		setup: function() {
-			$( this ).bind( "resize", handler );	
-		},
-		teardown: function(){
-			$( this ).unbind( "resize", handler );
-		}
-	};
-
-	var throttle = 250,
-		handler = function(){
-			curr = ( new Date() ).getTime();
-			diff = curr - lastCall;
-			if( diff >= throttle ){
-				lastCall = curr;
-				$( this ).trigger( "throttledresize" );
-			}
-			else{
-				if( heldCall ){
-					clearTimeout( heldCall );
-				}
-				//promise a held call will still execute
-				heldCall = setTimeout( handler, throttle - diff );
-			}
-		},
-		lastCall = 0,
-		heldCall,
-		curr,
-		diff;
-})();
-
-
-$.each({
-	scrollstop: "scrollstart",
-	taphold: "tap",
-	swipeleft: "swipe",
-	swiperight: "swipe"
-}, function( event, sourceEvent ) {
-	$.event.special[ event ] = {
-		setup: function() {
-			$( this ).bind( sourceEvent, $.noop );
-		}
-	};
-});
-
-})( jQuery );
-/*!
- * jQuery hashchange event - v1.3 - 7/21/2010
- * http://benalman.com/projects/jquery-hashchange-plugin/
- * 
- * Copyright (c) 2010 "Cowboy" Ben Alman
- * Dual licensed under the MIT and GPL licenses.
- * http://benalman.com/about/license/
- */
-
-// Script: jQuery hashchange event
-//
-// *Version: 1.3, Last updated: 7/21/2010*
-// 
-// Project Home - http://benalman.com/projects/jquery-hashchange-plugin/
-// GitHub       - http://github.com/cowboy/jquery-hashchange/
-// Source       - http://github.com/cowboy/jquery-hashchange/raw/master/jquery.ba-hashchange.js
-// (Minified)   - http://github.com/cowboy/jquery-hashchange/raw/master/jquery.ba-hashchange.min.js (0.8kb gzipped)
-// 
-// About: License
-// 
-// Copyright (c) 2010 "Cowboy" Ben Alman,
-// Dual licensed under the MIT and GPL licenses.
-// http://benalman.com/about/license/
-// 
-// About: Examples
-// 
-// These working examples, complete with fully commented code, illustrate a few
-// ways in which this plugin can be used.
-// 
-// hashchange event - http://benalman.com/code/projects/jquery-hashchange/examples/hashchange/
-// document.domain - http://benalman.com/code/projects/jquery-hashchange/examples/document_domain/
-// 
-// About: Support and Testing
-// 
-// Information about what version or versions of jQuery this plugin has been
-// tested with, what browsers it has been tested in, and where the unit tests
-// reside (so you can test it yourself).
-// 
-// jQuery Versions - 1.2.6, 1.3.2, 1.4.1, 1.4.2
-// Browsers Tested - Internet Explorer 6-8, Firefox 2-4, Chrome 5-6, Safari 3.2-5,
-//                   Opera 9.6-10.60, iPhone 3.1, Android 1.6-2.2, BlackBerry 4.6-5.
-// Unit Tests      - http://benalman.com/code/projects/jquery-hashchange/unit/
-// 
-// About: Known issues
-// 
-// While this jQuery hashchange event implementation is quite stable and
-// robust, there are a few unfortunate browser bugs surrounding expected
-// hashchange event-based behaviors, independent of any JavaScript
-// window.onhashchange abstraction. See the following examples for more
-// information:
-// 
-// Chrome: Back Button - http://benalman.com/code/projects/jquery-hashchange/examples/bug-chrome-back-button/
-// Firefox: Remote XMLHttpRequest - http://benalman.com/code/projects/jquery-hashchange/examples/bug-firefox-remote-xhr/
-// WebKit: Back Button in an Iframe - http://benalman.com/code/projects/jquery-hashchange/examples/bug-webkit-hash-iframe/
-// Safari: Back Button from a different domain - http://benalman.com/code/projects/jquery-hashchange/examples/bug-safari-back-from-diff-domain/
-// 
-// Also note that should a browser natively support the window.onhashchange 
-// event, but not report that it does, the fallback polling loop will be used.
-// 
-// About: Release History
-// 
-// 1.3   - (7/21/2010) Reorganized IE6/7 Iframe code to make it more
-//         "removable" for mobile-only development. Added IE6/7 document.title
-//         support. Attempted to make Iframe as hidden as possible by using
-//         techniques from http://www.paciellogroup.com/blog/?p=604. Added 
-//         support for the "shortcut" format $(window).hashchange( fn ) and
-//         $(window).hashchange() like jQuery provides for built-in events.
-//         Renamed jQuery.hashchangeDelay to <jQuery.fn.hashchange.delay> and
-//         lowered its default value to 50. Added <jQuery.fn.hashchange.domain>
-//         and <jQuery.fn.hashchange.src> properties plus document-domain.html
-//         file to address access denied issues when setting document.domain in
-//         IE6/7.
-// 1.2   - (2/11/2010) Fixed a bug where coming back to a page using this plugin
-//         from a page on another domain would cause an error in Safari 4. Also,
-//         IE6/7 Iframe is now inserted after the body (this actually works),
-//         which prevents the page from scrolling when the event is first bound.
-//         Event can also now be bound before DOM ready, but it won't be usable
-//         before then in IE6/7.
-// 1.1   - (1/21/2010) Incorporated document.documentMode test to fix IE8 bug
-//         where browser version is incorrectly reported as 8.0, despite
-//         inclusion of the X-UA-Compatible IE=EmulateIE7 meta tag.
-// 1.0   - (1/9/2010) Initial Release. Broke out the jQuery BBQ event.special
-//         window.onhashchange functionality into a separate plugin for users
-//         who want just the basic event & back button support, without all the
-//         extra awesomeness that BBQ provides. This plugin will be included as
-//         part of jQuery BBQ, but also be available separately.
-
-(function($,window,undefined){
-  '$:nomunge'; // Used by YUI compressor.
-  
-  // Reused string.
-  var str_hashchange = 'hashchange',
-    
-    // Method / object references.
-    doc = document,
-    fake_onhashchange,
-    special = $.event.special,
-    
-    // Does the browser support window.onhashchange? Note that IE8 running in
-    // IE7 compatibility mode reports true for 'onhashchange' in window, even
-    // though the event isn't supported, so also test document.documentMode.
-    doc_mode = doc.documentMode,
-    supports_onhashchange = 'on' + str_hashchange in window && ( doc_mode === undefined || doc_mode > 7 );
-  
-  // Get location.hash (or what you'd expect location.hash to be) sans any
-  // leading #. Thanks for making this necessary, Firefox!
-  function get_fragment( url ) {
-    url = url || location.href;
-    return '#' + url.replace( /^[^#]*#?(.*)$/, '$1' );
-  };
-  
-  // Method: jQuery.fn.hashchange
-  // 
-  // Bind a handler to the window.onhashchange event or trigger all bound
-  // window.onhashchange event handlers. This behavior is consistent with
-  // jQuery's built-in event handlers.
-  // 
-  // Usage:
-  // 
-  // > jQuery(window).hashchange( [ handler ] );
-  // 
-  // Arguments:
-  // 
-  //  handler - (Function) Optional handler to be bound to the hashchange
-  //    event. This is a "shortcut" for the more verbose form:
-  //    jQuery(window).bind( 'hashchange', handler ). If handler is omitted,
-  //    all bound window.onhashchange event handlers will be triggered. This
-  //    is a shortcut for the more verbose
-  //    jQuery(window).trigger( 'hashchange' ). These forms are described in
-  //    the <hashchange event> section.
-  // 
-  // Returns:
-  // 
-  //  (jQuery) The initial jQuery collection of elements.
-  
-  // Allow the "shortcut" format $(elem).hashchange( fn ) for binding and
-  // $(elem).hashchange() for triggering, like jQuery does for built-in events.
-  $.fn[ str_hashchange ] = function( fn ) {
-    return fn ? this.bind( str_hashchange, fn ) : this.trigger( str_hashchange );
-  };
-  
-  // Property: jQuery.fn.hashchange.delay
-  // 
-  // The numeric interval (in milliseconds) at which the <hashchange event>
-  // polling loop executes. Defaults to 50.
-  
-  // Property: jQuery.fn.hashchange.domain
-  // 
-  // If you're setting document.domain in your JavaScript, and you want hash
-  // history to work in IE6/7, not only must this property be set, but you must
-  // also set document.domain BEFORE jQuery is loaded into the page. This
-  // property is only applicable if you are supporting IE6/7 (or IE8 operating
-  // in "IE7 compatibility" mode).
-  // 
-  // In addition, the <jQuery.fn.hashchange.src> property must be set to the
-  // path of the included "document-domain.html" file, which can be renamed or
-  // modified if necessary (note that the document.domain specified must be the
-  // same in both your main JavaScript as well as in this file).
-  // 
-  // Usage:
-  // 
-  // jQuery.fn.hashchange.domain = document.domain;
-  
-  // Property: jQuery.fn.hashchange.src
-  // 
-  // If, for some reason, you need to specify an Iframe src file (for example,
-  // when setting document.domain as in <jQuery.fn.hashchange.domain>), you can
-  // do so using this property. Note that when using this property, history
-  // won't be recorded in IE6/7 until the Iframe src file loads. This property
-  // is only applicable if you are supporting IE6/7 (or IE8 operating in "IE7
-  // compatibility" mode).
-  // 
-  // Usage:
-  // 
-  // jQuery.fn.hashchange.src = 'path/to/file.html';
-  
-  $.fn[ str_hashchange ].delay = 50;
-  /*
-  $.fn[ str_hashchange ].domain = null;
-  $.fn[ str_hashchange ].src = null;
-  */
-  
-  // Event: hashchange event
-  // 
-  // Fired when location.hash changes. In browsers that support it, the native
-  // HTML5 window.onhashchange event is used, otherwise a polling loop is
-  // initialized, running every <jQuery.fn.hashchange.delay> milliseconds to
-  // see if the hash has changed. In IE6/7 (and IE8 operating in "IE7
-  // compatibility" mode), a hidden Iframe is created to allow the back button
-  // and hash-based history to work.
-  // 
-  // Usage as described in <jQuery.fn.hashchange>:
-  // 
-  // > // Bind an event handler.
-  // > jQuery(window).hashchange( function(e) {
-  // >   var hash = location.hash;
-  // >   ...
-  // > });
-  // > 
-  // > // Manually trigger the event handler.
-  // > jQuery(window).hashchange();
-  // 
-  // A more verbose usage that allows for event namespacing:
-  // 
-  // > // Bind an event handler.
-  // > jQuery(window).bind( 'hashchange', function(e) {
-  // >   var hash = location.hash;
-  // >   ...
-  // > });
-  // > 
-  // > // Manually trigger the event handler.
-  // > jQuery(window).trigger( 'hashchange' );
-  // 
-  // Additional Notes:
-  // 
-  // * The polling loop and Iframe are not created until at least one handler
-  //   is actually bound to the 'hashchange' event.
-  // * If you need the bound handler(s) to execute immediately, in cases where
-  //   a location.hash exists on page load, via bookmark or page refresh for
-  //   example, use jQuery(window).hashchange() or the more verbose 
-  //   jQuery(window).trigger( 'hashchange' ).
-  // * The event can be bound before DOM ready, but since it won't be usable
-  //   before then in IE6/7 (due to the necessary Iframe), recommended usage is
-  //   to bind it inside a DOM ready handler.
-  
-  // Override existing $.event.special.hashchange methods (allowing this plugin
-  // to be defined after jQuery BBQ in BBQ's source code).
-  special[ str_hashchange ] = $.extend( special[ str_hashchange ], {
-    
-    // Called only when the first 'hashchange' event is bound to window.
-    setup: function() {
-      // If window.onhashchange is supported natively, there's nothing to do..
-      if ( supports_onhashchange ) { return false; }
-      
-      // Otherwise, we need to create our own. And we don't want to call this
-      // until the user binds to the event, just in case they never do, since it
-      // will create a polling loop and possibly even a hidden Iframe.
-      $( fake_onhashchange.start );
-    },
-    
-    // Called only when the last 'hashchange' event is unbound from window.
-    teardown: function() {
-      // If window.onhashchange is supported natively, there's nothing to do..
-      if ( supports_onhashchange ) { return false; }
-      
-      // Otherwise, we need to stop ours (if possible).
-      $( fake_onhashchange.stop );
-    }
-    
-  });
-  
-  // fake_onhashchange does all the work of triggering the window.onhashchange
-  // event for browsers that don't natively support it, including creating a
-  // polling loop to watch for hash changes and in IE 6/7 creating a hidden
-  // Iframe to enable back and forward.
-  fake_onhashchange = (function(){
-    var self = {},
-      timeout_id,
-      
-      // Remember the initial hash so it doesn't get triggered immediately.
-      last_hash = get_fragment(),
-      
-      fn_retval = function(val){ return val; },
-      history_set = fn_retval,
-      history_get = fn_retval;
-    
-    // Start the polling loop.
-    self.start = function() {
-      timeout_id || poll();
-    };
-    
-    // Stop the polling loop.
-    self.stop = function() {
-      timeout_id && clearTimeout( timeout_id );
-      timeout_id = undefined;
-    };
-    
-    // This polling loop checks every $.fn.hashchange.delay milliseconds to see
-    // if location.hash has changed, and triggers the 'hashchange' event on
-    // window when necessary.
-    function poll() {
-      var hash = get_fragment(),
-        history_hash = history_get( last_hash );
-      
-      if ( hash !== last_hash ) {
-        history_set( last_hash = hash, history_hash );
-        
-        $(window).trigger( str_hashchange );
-        
-      } else if ( history_hash !== last_hash ) {
-        location.href = location.href.replace( /#.*/, '' ) + history_hash;
-      }
-      
-      timeout_id = setTimeout( poll, $.fn[ str_hashchange ].delay );
-    };
-    
-    // vvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvv
-    // vvvvvvvvvvvvvvvvvvv REMOVE IF NOT SUPPORTING IE6/7/8 vvvvvvvvvvvvvvvvvvv
-    // vvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvv
-    $.browser.msie && !supports_onhashchange && (function(){
-      // Not only do IE6/7 need the "magical" Iframe treatment, but so does IE8
-      // when running in "IE7 compatibility" mode.
-      
-      var iframe,
-        iframe_src;
-      
-      // When the event is bound and polling starts in IE 6/7, create a hidden
-      // Iframe for history handling.
-      self.start = function(){
-        if ( !iframe ) {
-          iframe_src = $.fn[ str_hashchange ].src;
-          iframe_src = iframe_src && iframe_src + get_fragment();
-          
-          // Create hidden Iframe. Attempt to make Iframe as hidden as possible
-          // by using techniques from http://www.paciellogroup.com/blog/?p=604.
-          iframe = $('<iframe tabindex="-1" title="empty"/>').hide()
-            
-            // When Iframe has completely loaded, initialize the history and
-            // start polling.
-            .one( 'load', function(){
-              iframe_src || history_set( get_fragment() );
-              poll();
-            })
-            
-            // Load Iframe src if specified, otherwise nothing.
-            .attr( 'src', iframe_src || 'javascript:0' )
-            
-            // Append Iframe after the end of the body to prevent unnecessary
-            // initial page scrolling (yes, this works).
-            .insertAfter( 'body' )[0].contentWindow;
-          
-          // Whenever `document.title` changes, update the Iframe's title to
-          // prettify the back/next history menu entries. Since IE sometimes
-          // errors with "Unspecified error" the very first time this is set
-          // (yes, very useful) wrap this with a try/catch block.
-          doc.onpropertychange = function(){
-            try {
-              if ( event.propertyName === 'title' ) {
-                iframe.document.title = doc.title;
-              }
-            } catch(e) {}
-          };
-          
-        }
-      };
-      
-      // Override the "stop" method since an IE6/7 Iframe was created. Even
-      // if there are no longer any bound event handlers, the polling loop
-      // is still necessary for back/next to work at all!
-      self.stop = fn_retval;
-      
-      // Get history by looking at the hidden Iframe's location.hash.
-      history_get = function() {
-        return get_fragment( iframe.location.href );
-      };
-      
-      // Set a new history item by opening and then closing the Iframe
-      // document, *then* setting its location.hash. If document.domain has
-      // been set, update that as well.
-      history_set = function( hash, history_hash ) {
-        var iframe_doc = iframe.document,
-          domain = $.fn[ str_hashchange ].domain;
-        
-        if ( hash !== history_hash ) {
-          // Update Iframe with any initial `document.title` that might be set.
-          iframe_doc.title = doc.title;
-          
-          // Opening the Iframe's document after it has been closed is what
-          // actually adds a history entry.
-          iframe_doc.open();
-          
-          // Set document.domain for the Iframe document as well, if necessary.
-          domain && iframe_doc.write( '<script>document.domain="' + domain + '"</script>' );
-          
-          iframe_doc.close();
-          
-          // Update the Iframe's hash, for great justice.
-          iframe.location.hash = hash;
-        }
-      };
-      
-    })();
-    // ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^
-    // ^^^^^^^^^^^^^^^^^^^ REMOVE IF NOT SUPPORTING IE6/7/8 ^^^^^^^^^^^^^^^^^^^
-    // ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^
-    
-    return self;
-  })();
-  
-})(jQuery,this);
-/*
-* jQuery Mobile Framework : "page" plugin
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT or GPL Version 2 licenses.
-* http://jquery.org/license
-*/
-(function($, undefined ) {
-
-$.widget( "mobile.page", $.mobile.widget, {
-	options: {
-		backBtnText: "Back",
-		addBackBtn: false,
-		backBtnTheme: null,
-		degradeInputs: {
-			color: false,
-			date: false,
-			datetime: false,
-			"datetime-local": false,
-			email: false,
-			month: false,
-			number: false,
-			range: "number",
-			search: true,
-			tel: false,
-			time: false,
-			url: false,
-			week: false
-		},
-		keepNative: null
-	},
-
-	_create: function() {
-		var $elem = this.element,
-			o = this.options;
-
-		this.keepNative = ":jqmData(role='none'), :jqmData(role='nojs')" + (o.keepNative ? ", " + o.keepNative : "");
-
-		if ( this._trigger( "beforeCreate" ) === false ) {
-			return;
-		}
-
-		//some of the form elements currently rely on the presence of ui-page and ui-content
-		// classes so we'll handle page and content roles outside of the main role processing
-		// loop below.
-		$elem.find( ":jqmData(role='page'), :jqmData(role='content')" ).andSelf().each(function() {
-			$(this).addClass( "ui-" + $(this).jqmData( "role" ) );
-		});
-
-		$elem.find( ":jqmData(role='nojs')" ).addClass( "ui-nojs" );
-
-		// pre-find data els
-		var $dataEls = $elem.find( ":jqmData(role)" ).andSelf().each(function() {
-			var $this = $( this ),
-				role = $this.jqmData( "role" ),
-				theme = $this.jqmData( "theme" );
-
-			//apply theming and markup modifications to page,header,content,footer
-			if ( role === "header" || role === "footer" ) {
-				$this.addClass( "ui-bar-" + (theme || $this.parent( ":jqmData(role='page')" ).jqmData( "theme" ) || "a") );
-
-				// add ARIA role
-				$this.attr( "role", role === "header" ? "banner" : "contentinfo" );
-
-				//right,left buttons
-				var $headeranchors = $this.children( "a" ),
-					leftbtn = $headeranchors.hasClass( "ui-btn-left" ),
-					rightbtn = $headeranchors.hasClass( "ui-btn-right" );
-
-				if ( !leftbtn ) {
-					leftbtn = $headeranchors.eq( 0 ).not( ".ui-btn-right" ).addClass( "ui-btn-left" ).length;
-				}
-
-				if ( !rightbtn ) {
-					rightbtn = $headeranchors.eq( 1 ).addClass( "ui-btn-right" ).length;
-				}
-
-				// auto-add back btn on pages beyond first view
-				if ( o.addBackBtn && role === "header" &&
-						$( ".ui-page" ).length > 1 &&
-						$elem.jqmData( "url" ) !== $.mobile.path.stripHash( location.hash ) &&
-						!leftbtn && $this.jqmData( "backbtn" ) !== false ) {
-
-					var backBtn = $( "<a href='#' class='ui-btn-left' data-"+ $.mobile.ns +"rel='back' data-"+ $.mobile.ns +"icon='arrow-l'>"+ o.backBtnText +"</a>" ).prependTo( $this );
-					
-					//if theme is provided, override default inheritance
-					if( o.backBtnTheme ){
-						backBtn.attr( "data-"+ $.mobile.ns +"theme", o.backBtnTheme );
-					}
-				}
-
-				//page title
-				$this.children( "h1, h2, h3, h4, h5, h6" )
-					.addClass( "ui-title" )
-					//regardless of h element number in src, it becomes h1 for the enhanced page
-					.attr({ "tabindex": "0", "role": "heading", "aria-level": "1" });
-
-			} else if ( role === "content" ) {
-				if ( theme ) {
-					$this.addClass( "ui-body-" + theme );
-				}
-
-				// add ARIA role
-				$this.attr( "role", "main" );
-
-			} else if ( role === "page" ) {
-				$this.addClass( "ui-body-" + (theme || "c") );
-			}
-
-			switch(role) {
-				case "header":
-				case "footer":
-				case "page":
-				case "content":
-					$this.addClass( "ui-" + role );
-					break;
-				case "collapsible":
-				case "fieldcontain":
-				case "navbar":
-				case "listview":
-				case "dialog":
-					$this[ role ]();
-					break;
-			}
-		});
-
-		//enhance form controls
-  	this._enhanceControls();
-
-		//links in bars, or those with  data-role become buttons
-		$elem.find( ":jqmData(role='button'), .ui-bar > a, .ui-header > a, .ui-footer > a" )
-			.not( ".ui-btn" )
-			.not(this.keepNative)
-			.buttonMarkup();
-
-		$elem
-			.find(":jqmData(role='controlgroup')")
-			.controlgroup();
-
-		//links within content areas
-		$elem.find( "a:not(.ui-btn):not(.ui-link-inherit)" )
-			.not(this.keepNative)
-			.addClass( "ui-link" );
-
-		//fix toolbars
-		$elem.fixHeaderFooter();
-	},
-
-	_typeAttributeRegex: /\s+type=["']?\w+['"]?/,
-
-	_enhanceControls: function() {
-		var o = this.options, self = this;
-
-		// degrade inputs to avoid poorly implemented native functionality
-		this.element.find( "input" ).not(this.keepNative).each(function() {
-			var type = this.getAttribute( "type" ),
-				optType = o.degradeInputs[ type ] || "text";
-
-			if ( o.degradeInputs[ type ] ) {
-				$( this ).replaceWith(
-					$( "<div>" ).html( $(this).clone() ).html()
-						.replace( self._typeAttributeRegex, " type=\""+ optType +"\" data-" + $.mobile.ns + "type=\""+type+"\" " ) );
-			}
-		});
-
-		// We re-find form elements since the degredation code above
-		// may have injected new elements. We cache the non-native control
-		// query to reduce the number of times we search through the entire page.
-
-		var allControls = this.element.find("input, textarea, select, button"),
-			nonNativeControls = allControls.not(this.keepNative);
-
-		// XXX: Temporary workaround for issue 785. Turn off autocorrect and
-		//      autocomplete since the popup they use can't be dismissed by
-		//      the user. Note that we test for the presence of the feature
-		//      by looking for the autocorrect property on the input element.
-
-		var textInputs = allControls.filter( "input[type=text]" );
-		if (textInputs.length && typeof textInputs[0].autocorrect !== "undefined") {
-			textInputs.each(function(){
-				// Set the attribute instead of the property just in case there
-				// is code that attempts to make modifications via HTML.
-				this.setAttribute("autocorrect", "off");
-				this.setAttribute("autocomplete", "off");
-			});
-		}
-
-		// enchance form controls
-		nonNativeControls
-			.filter( "[type='radio'], [type='checkbox']" )
-			.checkboxradio();
-
-		nonNativeControls
-			.filter( "button, [type='button'], [type='submit'], [type='reset'], [type='image']" )
-			.button();
-
-		nonNativeControls
-			.filter( "input, textarea" )
-			.not( "[type='radio'], [type='checkbox'], [type='button'], [type='submit'], [type='reset'], [type='image'], [type='hidden']" )
-			.textinput();
-
-		nonNativeControls
-			.filter( "input, select" )
-			.filter( ":jqmData(role='slider'), :jqmData(type='range')" )
-			.slider();
-
-		nonNativeControls
-			.filter( "select:not(:jqmData(role='slider'))" )
-			.selectmenu();
-	}
-});
-
-})( jQuery );
-/*!
- * jQuery Mobile v@VERSION
- * http://jquerymobile.com/
- *
- * Copyright 2010, jQuery Project
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- */
-
-(function( $, window, undefined ) {
-
-	//jQuery.mobile configurable options
-	$.extend( $.mobile, {
-
-		//namespace used framework-wide for data-attrs. Default is no namespace
-		ns: "",
-
-		//define the url parameter used for referencing widget-generated sub-pages.
-		//Translates to to example.html&ui-page=subpageIdentifier
-		//hash segment before &ui-page= is used to make Ajax request
-		subPageUrlKey: "ui-page",
-
-		//anchor links with a data-rel, or pages with a	 data-role, that match these selectors will be untrackable in history
-		//(no change in URL, not bookmarkable)
-		nonHistorySelectors: "dialog",
-
-		//class assigned to page currently in view, and during transitions
-		activePageClass: "ui-page-active",
-
-		//class used for "active" button state, from CSS framework
-		activeBtnClass: "ui-btn-active",
-
-		//automatically handle clicks and form submissions through Ajax, when same-domain
-		ajaxEnabled: true,
-		
-		//When enabled, clicks and taps that result in Ajax page changes will happen slightly sooner on touch devices.
-		//Also, it will prevent the address bar from appearing on platforms like iOS during page transitions.
-		//This option has no effect on non-touch devices, but enabling it may interfere with jQuery plugins that bind to click events
-		useFastClick: true,
-
-		//automatically load and show pages based on location.hash
-		hashListeningEnabled: true,
-
-		//set default page transition - 'none' for no transitions
-		defaultPageTransition: "slide",
-		
-		//minimum scroll distance that will be remembered when returning to a page
-		minScrollBack: screen.height / 2,
-
-		//set default dialog transition - 'none' for no transitions
-		defaultDialogTransition: "pop",
-
-		//show loading message during Ajax requests
-		//if false, message will not appear, but loading classes will still be toggled on html el
-		loadingMessage: "loading",
-
-		//error response message - appears when an Ajax page request fails
-		pageLoadErrorMessage: "Error Loading Page",
-
-		//support conditions that must be met in order to proceed
-		//default enhanced qualifications are media query support OR IE 7+
-		gradeA: function(){
-			return $.support.mediaquery || $.mobile.browser.ie && $.mobile.browser.ie >= 7;
-		},
-
-		//TODO might be useful upstream in jquery itself ?
-		keyCode: {
-			ALT: 18,
-			BACKSPACE: 8,
-			CAPS_LOCK: 20,
-			COMMA: 188,
-			COMMAND: 91,
-			COMMAND_LEFT: 91, // COMMAND
-			COMMAND_RIGHT: 93,
-			CONTROL: 17,
-			DELETE: 46,
-			DOWN: 40,
-			END: 35,
-			ENTER: 13,
-			ESCAPE: 27,
-			HOME: 36,
-			INSERT: 45,
-			LEFT: 37,
-			MENU: 93, // COMMAND_RIGHT
-			NUMPAD_ADD: 107,
-			NUMPAD_DECIMAL: 110,
-			NUMPAD_DIVIDE: 111,
-			NUMPAD_ENTER: 108,
-			NUMPAD_MULTIPLY: 106,
-			NUMPAD_SUBTRACT: 109,
-			PAGE_DOWN: 34,
-			PAGE_UP: 33,
-			PERIOD: 190,
-			RIGHT: 39,
-			SHIFT: 16,
-			SPACE: 32,
-			TAB: 9,
-			UP: 38,
-			WINDOWS: 91 // COMMAND
-		},
-
-		//scroll page vertically: scroll to 0 to hide iOS address bar, or pass a Y value
-		silentScroll: function( ypos ) {
-			if( $.type( ypos ) !== "number" ){
-				ypos = $.mobile.defaultHomeScroll;
-			}
-
-			// prevent scrollstart and scrollstop events
-			$.event.special.scrollstart.enabled = false;
-
-			setTimeout(function() {
-				window.scrollTo( 0, ypos );
-				$(document).trigger( "silentscroll", { x: 0, y: ypos });
-			},20);
-
-			setTimeout(function() {
-				$.event.special.scrollstart.enabled = true;
-			}, 150 );
-		},
-
-		// compile the namespace normalization regex once
-		normalizeRegex: /-([a-z])/g,
-
-		// take a data attribute property, prepend the namespace
-		// and then camel case the attribute string
-		nsNormalize: function(prop){
-			if(!prop) return;
-
-			return $.camelCase( $.mobile.ns + prop );
-		}
-	});
-
-	//mobile version of data and removeData and hasData methods
-	//ensures all data is set and retrieved using jQuery Mobile's data namespace
-	$.fn.jqmData = function( prop, value ){
-		return this.data( prop ? $.mobile.nsNormalize(prop) : prop, value );
-	};
-
-	$.jqmData = function( elem, prop, value ){
-		return $.data( elem, $.mobile.nsNormalize(prop), value );
-	};
-
-	$.fn.jqmRemoveData = function( prop ){
-		return this.removeData( $.mobile.nsNormalize(prop) );
-	};
-
-	$.jqmRemoveData = function( elem, prop ){
-		return $.removeData( elem, $.mobile.nsNormalize(prop) );
-	};
-
-	$.jqmHasData = function( elem, prop ){
-		return $.hasData( elem, $.mobile.nsNormalize(prop) );
-	};
-
-	// Monkey-patching Sizzle to filter the :jqmData selector
-	var oldFind = $.find;
-
-	$.find = function( selector, context, ret, extra ) {
-		selector = selector.replace(/:jqmData\(([^)]*)\)/g, "[data-" + ($.mobile.ns || "") + "$1]");
-
-		return oldFind.call( this, selector, context, ret, extra );
-	};
-
-	$.extend( $.find, oldFind );
-
-	$.find.matches = function( expr, set ) {
-		return $.find( expr, null, null, set );
-	};
-
-	$.find.matchesSelector = function( node, expr ) {
-		return $.find( expr, null, null, [node] ).length > 0;
-	};
-})( jQuery, this );
-/*
-* jQuery Mobile Framework : core utilities for auto ajax navigation, base tag mgmt,
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT or GPL Version 2 licenses.
-* http://jquery.org/license
-*/
-( function( $, undefined ) {
-
-	//define vars for interal use
-	var $window = $( window ),
-		$html = $( 'html' ),
-		$head = $( 'head' ),
-
-		//url path helpers for use in relative url management
-		path = {
-
-			// This scary looking regular expression parses an absolute URL or its relative
-			// variants (protocol, site, document, query, and hash), into the various
-			// components (protocol, host, path, query, fragment, etc that make up the
-			// URL as well as some other commonly used sub-parts. When used with RegExp.exec()
-			// or String.match, it parses the URL into a results array that looks like this:
-			//
-			//     [0]: http://jblas:password@mycompany.com:8080/mail/inbox?msg=1234&type=unread#msg-content
-			//     [1]: http://jblas:password@mycompany.com:8080/mail/inbox?msg=1234&type=unread
-			//     [2]: http://jblas:password@mycompany.com:8080/mail/inbox
-			//     [3]: http://jblas:password@mycompany.com:8080
-			//     [4]: http:
-			//     [5]: jblas:password@mycompany.com:8080
-			//     [6]: jblas:password
-			//     [7]: jblas
-			//     [8]: password
-			//     [9]: mycompany.com:8080
-			//    [10]: mycompany.com
-			//    [11]: 8080
-			//    [12]: /mail/inbox
-			//    [13]: /mail/
-			//    [14]: inbox
-			//    [15]: ?msg=1234&type=unread
-			//    [16]: #msg-content
-			//
-			urlParseRE: /^(((([^:\/#\?]+:)?(?:\/\/((?:(([^:@\/#\?]+)(?:\:([^:@\/#\?]+))?)@)?(([^:\/#\?]+)(?:\:([0-9]+))?))?)?)?((\/?(?:[^\/\?#]+\/+)*)([^\?#]*)))?(\?[^#]+)?)(#.*)?/,
-
-			//Parse a URL into a structure that allows easy access to
-			//all of the URL components by name.
-			parseUrl: function( url ) {
-				// If we're passed an object, we'll assume that it is
-				// a parsed url object and just return it back to the caller.
-				if ( typeof url === "object" ) {
-					return url;
-				}
-
-				var u = url || "",
-					matches = path.urlParseRE.exec( url ),
-					results;
-				if ( matches ) {
-					// Create an object that allows the caller to access the sub-matches
-					// by name. Note that IE returns an empty string instead of undefined,
-					// like all other browsers do, so we normalize everything so its consistent
-					// no matter what browser we're running on.
-					results = {
-						href:         matches[0] || "",
-						hrefNoHash:   matches[1] || "",
-						hrefNoSearch: matches[2] || "",
-						domain:       matches[3] || "",
-						protocol:     matches[4] || "",
-						authority:    matches[5] || "",
-						username:     matches[7] || "",
-						password:     matches[8] || "",
-						host:         matches[9] || "",
-						hostname:     matches[10] || "",
-						port:         matches[11] || "",
-						pathname:     matches[12] || "",
-						directory:    matches[13] || "",
-						filename:     matches[14] || "",
-						search:       matches[15] || "",
-						hash:         matches[16] || ""
-					};
-				}
-				return results || {};
-			},
-
-			//Turn relPath into an asbolute path. absPath is
-			//an optional absolute path which describes what
-			//relPath is relative to.
-			makePathAbsolute: function( relPath, absPath ) {
-				if ( relPath && relPath.charAt( 0 ) === "/" ) {
-					return relPath;
-				}
-		
-				relPath = relPath || "";
-				absPath = absPath ? absPath.replace( /^\/|\/?[^\/]*$/g, "" ) : "";
-		
-				var absStack = absPath ? absPath.split( "/" ) : [],
-					relStack = relPath.split( "/" );
-				for ( var i = 0; i < relStack.length; i++ ) {
-					var d = relStack[ i ];
-					switch ( d ) {
-						case ".":
-							break;
-						case "..":
-							if ( absStack.length ) {
-								absStack.pop();
-							}
-							break;
-						default:
-							absStack.push( d );
-							break;
-					}
-				}
-				return "/" + absStack.join( "/" );
-			},
-
-			//Returns true if both urls have the same domain.
-			isSameDomain: function( absUrl1, absUrl2 ) {
-				return path.parseUrl( absUrl1 ).domain === path.parseUrl( absUrl2 ).domain;
-			},
-
-			//Returns true for any relative variant.
-			isRelativeUrl: function( url ) {
-				// All relative Url variants have one thing in common, no protocol.
-				return path.parseUrl( url ).protocol === "";
-			},
-
-			//Returns true for an absolute url.
-			isAbsoluteUrl: function( url ) {
-				return path.parseUrl( url ).protocol !== "";
-			},
-
-			//Turn the specified realtive URL into an absolute one. This function
-			//can handle all relative variants (protocol, site, document, query, fragment).
-			makeUrlAbsolute: function( relUrl, absUrl ) {
-				if ( !path.isRelativeUrl( relUrl ) ) {
-					return relUrl;
-				}
-		
-				var relObj = path.parseUrl( relUrl ),
-					absObj = path.parseUrl( absUrl ),
-					protocol = relObj.protocol || absObj.protocol,
-					authority = relObj.authority || absObj.authority,
-					hasPath = relObj.pathname !== "",
-					pathname = path.makePathAbsolute( relObj.pathname || absObj.filename, absObj.pathname ),
-					search = relObj.search || ( !hasPath && absObj.search ) || "",
-					hash = relObj.hash;
-		
-				return protocol + "//" + authority + pathname + search + hash;
-			},
-
-			//Add search (aka query) params to the specified url.
-			addSearchParams: function( url, params ) {
-				var u = path.parseUrl( url ),
-					p = ( typeof params === "object" ) ? $.param( params ) : params,
-					s = u.search || "?";
-				return u.hrefNoSearch + s + ( s.charAt( s.length - 1 ) !== "?" ? "&" : "" ) + p + ( u.hash || "" );
-			},
-
-			convertUrlToDataUrl: function( absUrl ) {
-				var u = path.parseUrl( absUrl );
-				if ( path.isEmbeddedPage( u ) ) {
-					return u.hash.replace( /^#/, "" );
-				} else if ( path.isSameDomain( u, documentBase ) ) {
-					return u.hrefNoHash.replace( documentBase.domain, "" );
-				}
-				return absUrl;
-			},
-
-			//get path from current hash, or from a file path
-			get: function( newPath ) {
-				if( newPath === undefined ) {
-					newPath = location.hash;
-				}
-				return path.stripHash( newPath ).replace( /[^\/]*\.[^\/*]+$/, '' );
-			},
-
-			//return the substring of a filepath before the sub-page key, for making a server request
-			getFilePath: function( path ) {
-				var splitkey = '&' + $.mobile.subPageUrlKey;
-				return path && path.split( splitkey )[0].split( dialogHashKey )[0];
-			},
-
-			//set location hash to path
-			set: function( path ) {
-				location.hash = path;
-			},
-
-			//test if a given url (string) is a path
-			//NOTE might be exceptionally naive
-			isPath: function( url ) {
-				return ( /\// ).test( url );
-			},
-
-			//return a url path with the window's location protocol/hostname/pathname removed
-			clean: function( url ) {
-				return url.replace( documentBase.domain, "" );
-			},
-
-			//just return the url without an initial #
-			stripHash: function( url ) {
-				return url.replace( /^#/, "" );
-			},
-
-			//remove the preceding hash, any query params, and dialog notations
-			cleanHash: function( hash ) {
-				return path.stripHash( hash.replace( /\?.*$/, "" ).replace( dialogHashKey, "" ) );
-			},
-
-			//check whether a url is referencing the same domain, or an external domain or different protocol
-			//could be mailto, etc
-			isExternal: function( url ) {
-				var u = path.parseUrl( url );
-				return u.protocol && u.domain !== documentUrl.domain ? true : false;
-			},
-
-			hasProtocol: function( url ) {
-				return ( /^(:?\w+:)/ ).test( url );
-			},
-
-			isEmbeddedPage: function( url ) {
-				var u = path.parseUrl( url );
-
-				//if the path is absolute, then we need to compare the url against
-				//both the documentUrl and the documentBase. The main reason for this
-				//is that links embedded within external documents will refer to the
-				//application document, whereas links embedded within the application
-				//document will be resolved against the document base.
-				if ( u.protocol !== "" ) {
-					return ( u.hash && ( u.hrefNoHash === documentUrl.hrefNoHash || ( documentBaseDiffers && u.hrefNoHash === documentBase.hrefNoHash ) ) );
-				}
-				return (/^#/).test( u.href );
-			}
-		},
-
-		//will be defined when a link is clicked and given an active class
-		$activeClickedLink = null,
-
-		//urlHistory is purely here to make guesses at whether the back or forward button was clicked
-		//and provide an appropriate transition
-		urlHistory = {
-			//array of pages that are visited during a single page load. each has a url and optional transition
-			stack: [],
-
-			//maintain an index number for the active page in the stack
-			activeIndex: 0,
-
-			//get active
-			getActive: function() {
-				return urlHistory.stack[ urlHistory.activeIndex ];
-			},
-
-			getPrev: function() {
-				return urlHistory.stack[ urlHistory.activeIndex - 1 ];
-			},
-
-			getNext: function() {
-				return urlHistory.stack[ urlHistory.activeIndex + 1 ];
-			},
-
-			// addNew is used whenever a new page is added
-			addNew: function( url, transition, title, storedTo ) {
-				//if there's forward history, wipe it
-				if( urlHistory.getNext() ) {
-					urlHistory.clearForward();
-				}
-
-				urlHistory.stack.push( {url : url, transition: transition, title: title, page: storedTo } );
-
-				urlHistory.activeIndex = urlHistory.stack.length - 1;
-			},
-
-			//wipe urls ahead of active index
-			clearForward: function() {
-				urlHistory.stack = urlHistory.stack.slice( 0, urlHistory.activeIndex + 1 );
-			},
-
-			directHashChange: function( opts ) {
-				var back , forward, newActiveIndex;
-
-				// check if url isp in history and if it's ahead or behind current page
-				$.each( urlHistory.stack, function( i, historyEntry ) {
-
-					//if the url is in the stack, it's a forward or a back
-					if( opts.currentUrl === historyEntry.url ) {
-						//define back and forward by whether url is older or newer than current page
-						back = i < urlHistory.activeIndex;
-						forward = !back;
-						newActiveIndex = i;
-					}
-				});
-
-				// save new page index, null check to prevent falsey 0 result
-				this.activeIndex = newActiveIndex !== undefined ? newActiveIndex : this.activeIndex;
-
-				if( back ) {
-					opts.isBack();
-				} else if( forward ) {
-					opts.isForward();
-				}
-			},
-
-			//disable hashchange event listener internally to ignore one change
-			//toggled internally when location.hash is updated to match the url of a successful page load
-			ignoreNextHashChange: false
-		},
-
-		//define first selector to receive focus when a page is shown
-		focusable = "[tabindex],a,button:visible,select:visible,input",
-
-		//queue to hold simultanious page transitions
-		pageTransitionQueue = [],
-
-		//indicates whether or not page is in process of transitioning
-		isPageTransitioning = false,
-
-		//nonsense hash change key for dialogs, so they create a history entry
-		dialogHashKey = "&ui-state=dialog",
-
-		//existing base tag?
-		$base = $head.children( "base" ),
-
-		//tuck away the original document URL minus any fragment.
-		documentUrl = path.parseUrl( location.href ),
-
-		//if the document has an embedded base tag, documentBase is set to its
-		//initial value. If a base tag does not exist, then we default to the documentUrl.
-		documentBase = $base.length ? path.parseUrl( path.makeUrlAbsolute( $base.attr( "href" ), documentUrl.href ) ) : documentUrl,
-
-		//cache the comparison once.
-		documentBaseDiffers = ( documentUrl.hrefNoHash !== documentBase.hrefNoHash );
-
-		//base element management, defined depending on dynamic base tag support
-		var base = $.support.dynamicBaseTag ? {
-
-			//define base element, for use in routing asset urls that are referenced in Ajax-requested markup
-			element: ( $base.length ? $base : $( "<base>", { href: documentBase.hrefNoHash } ).prependTo( $head ) ),
-
-			//set the generated BASE element's href attribute to a new page's base path
-			set: function( href ) {
-				base.element.attr( "href", path.makeUrlAbsolute( href, documentBase ) );
-			},
-
-			//set the generated BASE element's href attribute to a new page's base path
-			reset: function() {
-				base.element.attr( "href", documentBase.hrefNoHash );
-			}
-
-		} : undefined;
-
-/*
-	internal utility functions
---------------------------------------*/
-
-
-	//direct focus to the page title, or otherwise first focusable element
-	function reFocus( page ) {
-		var lastClicked = page.jqmData( "lastClicked" );
-
-		if( lastClicked && lastClicked.length ) {
-			lastClicked.focus();
-		}
-		else {
-			var pageTitle = page.find( ".ui-title:eq(0)" );
-
-			if( pageTitle.length ) {
-				pageTitle.focus();
-			}
-			else{
-				page.find( focusable ).eq( 0 ).focus();
-			}
-		}
-	}
-
-	//remove active classes after page transition or error
-	function removeActiveLinkClass( forceRemoval ) {
-		if( !!$activeClickedLink && ( !$activeClickedLink.closest( '.ui-page-active' ).length || forceRemoval ) ) {
-			$activeClickedLink.removeClass( $.mobile.activeBtnClass );
-		}
-		$activeClickedLink = null;
-	}
-
-	function releasePageTransitionLock() {
-		isPageTransitioning = false;
-		if( pageTransitionQueue.length > 0 ) {
-			$.mobile.changePage.apply( null, pageTransitionQueue.pop() );
-		}
-	}
-
-	//function for transitioning between two existing pages
-	function transitionPages( toPage, fromPage, transition, reverse ) {
-		
-		//get current scroll distance
-		var currScroll = $.support.scrollTop ? $window.scrollTop() : true,
-			toScroll	= toPage.data( "lastScroll" ) || $.mobile.defaultHomeScroll,
-			screenHeight = getScreenHeight();
-		
-		//if scrolled down, scroll to top
-		if( currScroll ){
-			window.scrollTo( 0, $.mobile.defaultHomeScroll );
-		}
-		
-		//if the Y location we're scrolling to is less than 10px, let it go for sake of smoothness
-		if( toScroll < $.mobile.minScrollBack ){
-			toScroll = 0;
-		}
-		
-		if( fromPage ) {
-			//set as data for returning to that spot
-			fromPage
-				.height( screenHeight + currScroll )
-				.jqmData( "lastScroll", currScroll )
-				.jqmData( "lastClicked", $activeClickedLink );
-				
-			//trigger before show/hide events
-			fromPage.data( "page" )._trigger( "beforehide", null, { nextPage: toPage } );
-		}
-		toPage
-			.height( screenHeight + toScroll )
-			.data( "page" )._trigger( "beforeshow", null, { prevPage: fromPage || $( "" ) } );
-
-		//clear page loader
-		$.mobile.hidePageLoadingMsg();
-
-		//find the transition handler for the specified transition. If there
-		//isn't one in our transitionHandlers dictionary, use the default one.
-		//call the handler immediately to kick-off the transition.
-		var th = $.mobile.transitionHandlers[transition || "none"] || $.mobile.defaultTransitionHandler,
-			promise = th( transition, reverse, toPage, fromPage );
-
-		promise.done(function() {
-			//reset toPage height bac
-			toPage.height( "" );
-			
-			//jump to top or prev scroll, sometimes on iOS the page has not rendered yet.
-			if( toScroll ){
-				$.mobile.silentScroll( toScroll );
-				$( document ).one( "silentscroll", function() { reFocus( toPage ); } );
-			}
-			else{
-				reFocus( toPage ); 
-			}
-
-			//trigger show/hide events
-			if( fromPage ) {
-				fromPage.height("").data( "page" )._trigger( "hide", null, { nextPage: toPage } );
-			}
-			
-			//trigger pageshow, define prevPage as either fromPage or empty jQuery obj
-			toPage.data( "page" )._trigger( "show", null, { prevPage: fromPage || $( "" ) } );
-		});
-
-		return promise;
-	}
-	
-	//simply set the active page's minimum height to screen height, depending on orientation
-	function getScreenHeight(){
-		var orientation 	= jQuery.event.special.orientationchange.orientation(),
-			port			= orientation === "portrait",
-			winMin			= port ? 480 : 320,
-			screenHeight	= port ? screen.availHeight : screen.availWidth,
-			winHeight		= Math.max( winMin, $( window ).height() ),
-			pageMin			= Math.min( screenHeight, winHeight );
-
-		return pageMin;
-	}
-	
-	//simply set the active page's minimum height to screen height, depending on orientation
-	function resetActivePageHeight(){
-		$( "." + $.mobile.activePageClass ).css( "min-height", getScreenHeight() );
-	}
-
-	//shared page enhancements
-	function enhancePage( $page, role ) {
-		// If a role was specified, make sure the data-role attribute
-		// on the page element is in sync.
-		if( role ) {
-			$page.attr( "data-" + $.mobile.ns + "role", role );
-		}
-
-		//run page plugin
-		$page.page();
-	}
-
-/* exposed $.mobile methods	 */
-
-	//animation complete callback
-	$.fn.animationComplete = function( callback ) {
-		if( $.support.cssTransitions ) {
-			return $( this ).one( 'webkitAnimationEnd', callback );
-		}
-		else{
-			// defer execution for consistency between webkit/non webkit
-			setTimeout( callback, 0 );
-			return $( this );
-		}
-	};
-
-	//update location.hash, with or without triggering hashchange event
-	//TODO - deprecate this one at 1.0
-	$.mobile.updateHash = path.set;
-
-	//expose path object on $.mobile
-	$.mobile.path = path;
-
-	//expose base object on $.mobile
-	$.mobile.base = base;
-
-	//url stack, useful when plugins need to be aware of previous pages viewed
-	//TODO: deprecate this one at 1.0
-	$.mobile.urlstack = urlHistory.stack;
-
-	//history stack
-	$.mobile.urlHistory = urlHistory;
-
-	//default non-animation transition handler
-	$.mobile.noneTransitionHandler = function( name, reverse, $toPage, $fromPage ) {
-		if ( $fromPage ) {
-			$fromPage.removeClass( $.mobile.activePageClass );
-		}
-		$toPage.addClass( $.mobile.activePageClass );
-
-		return $.Deferred().resolve( name, reverse, $toPage, $fromPage ).promise();
-	};
-
-	//default handler for unknown transitions
-	$.mobile.defaultTransitionHandler = $.mobile.noneTransitionHandler;
-
-	//transition handler dictionary for 3rd party transitions
-	$.mobile.transitionHandlers = {
-		none: $.mobile.defaultTransitionHandler
-	};
-
-	//enable cross-domain page support
-	$.mobile.allowCrossDomainPages = false;
-
-	//return the original document url
-	$.mobile.getDocumentUrl = function(asParsedObject) {
-		return asParsedObject ? $.extend( {}, documentUrl ) : documentUrl.href;
-	};
-
-	//return the original document base url
-	$.mobile.getDocumentBase = function(asParsedObject) {
-		return asParsedObject ? $.extend( {}, documentBase ) : documentBase.href;
-	};
-
-	// Load a page into the DOM.
-	$.mobile.loadPage = function( url, options ) {
-		// This function uses deferred notifications to let callers
-		// know when the page is done loading, or if an error has occurred.
-		var deferred = $.Deferred(),
-
-			// The default loadPage options with overrides specified by
-			// the caller.
-			settings = $.extend( {}, $.mobile.loadPage.defaults, options ),
-
-			// The DOM element for the page after it has been loaded.
-			page = null,
-
-			// If the reloadPage option is true, and the page is already
-			// in the DOM, dupCachedPage will be set to the page element
-			// so that it can be removed after the new version of the
-			// page is loaded off the network.
-			dupCachedPage = null,
-
-			// The absolute version of the URL passed into the function. This
-			// version of the URL may contain dialog/subpage params in it.
-			absUrl = path.makeUrlAbsolute( url, documentBase.hrefNoHash );
-
-
-		// If the caller provided data, and we're using "get" request,
-		// append the data to the URL.
-		if ( settings.data && settings.type === "get" ) {
-			absUrl = path.addSearchParams( absUrl, settings.data );
-			settings.data = undefined;
-		}
-
-			// The absolute version of the URL minus any dialog/subpage params.
-			// In otherwords the real URL of the page to be loaded.
-		var fileUrl = path.getFilePath( absUrl ),
-
-			// The version of the Url actually stored in the data-url attribute of
-			// the page. For embedded pages, it is just the id of the page. For pages
-			// within the same domain as the document base, it is the site relative
-			// path. For cross-domain pages (Phone Gap only) the entire absolute Url
-			// used to load the page.
-			dataUrl = path.convertUrlToDataUrl( absUrl );
-
-		// Make sure we have a pageContainer to work with.
-		settings.pageContainer = settings.pageContainer || $.mobile.pageContainer;
-
-		// Check to see if the page already exists in the DOM.
-		page = settings.pageContainer.children( ":jqmData(url='" + dataUrl + "')" );
-
-		// Reset base to the default document base.
-		if ( base ) {
-			base.reset();
-		}
-
-		// If the page we are interested in is already in the DOM,
-		// and the caller did not indicate that we should force a
-		// reload of the file, we are done. Otherwise, track the
-		// existing page as a duplicated.
-		if ( page.length ) {
-			if ( !settings.reloadPage ) {
-				enhancePage( page, settings.role );
-				deferred.resolve( absUrl, options, page );
-				return deferred.promise();
-			}
-			dupCachedPage = page;
-		}
-
-		if ( settings.showLoadMsg ) {
-			$.mobile.showPageLoadingMsg();
-		}
-
-		// Load the new page.
-		$.ajax({
-			url: fileUrl,
-			type: settings.type,
-			data: settings.data,
-			dataType: "html",
-			success: function( html ) {
-				//pre-parse html to check for a data-url,
-				//use it as the new fileUrl, base path, etc
-				var all = $( "<div></div>" ),
-
-						//page title regexp
-						newPageTitle = html.match( /<title[^>]*>([^<]*)/ ) && RegExp.$1,
-
-						// TODO handle dialogs again
-						pageElemRegex = new RegExp( ".*(<[^>]+\\bdata-" + $.mobile.ns + "role=[\"']?page[\"']?[^>]*>).*" ),
-						dataUrlRegex = new RegExp( "\\bdata-" + $.mobile.ns + "url=[\"']?([^\"'>]*)[\"']?" );
-
-
-				// data-url must be provided for the base tag so resource requests can be directed to the
-				// correct url. loading into a temprorary element makes these requests immediately
-				if( pageElemRegex.test( html )
-						&& RegExp.$1
-						&& dataUrlRegex.test( RegExp.$1 )
-						&& RegExp.$1 ) {
-					url = fileUrl = path.getFilePath( RegExp.$1 );
-				}
-
-				if ( base ) {
-					base.set( fileUrl );
-				}
-
-				//workaround to allow scripts to execute when included in page divs
-				all.get( 0 ).innerHTML = html;
-				page = all.find( ":jqmData(role='page'), :jqmData(role='dialog')" ).first();
-
-				if ( newPageTitle && !page.jqmData( "title" ) ) {
-					page.jqmData( "title", newPageTitle );
-				}
-
-				//rewrite src and href attrs to use a base url
-				if( !$.support.dynamicBaseTag ) {
-					var newPath = path.get( fileUrl );
-					page.find( "[src], link[href], a[rel='external'], :jqmData(ajax='false'), a[target]" ).each(function() {
-						var thisAttr = $( this ).is( '[href]' ) ? 'href' :
-								$(this).is('[src]') ? 'src' : 'action',
-							thisUrl = $( this ).attr( thisAttr );
-
-						// XXX_jblas: We need to fix this so that it removes the document
-						//            base URL, and then prepends with the new page URL.
-						//if full path exists and is same, chop it - helps IE out
-						thisUrl = thisUrl.replace( location.protocol + '//' + location.host + location.pathname, '' );
-
-						if( !/^(\w+:|#|\/)/.test( thisUrl ) ) {
-							$( this ).attr( thisAttr, newPath + thisUrl );
-						}
-					});
-				}
-
-				//append to page and enhance
-				page
-					.attr( "data-" + $.mobile.ns + "url", path.convertUrlToDataUrl( fileUrl ) )
-					.appendTo( settings.pageContainer );
-
-				enhancePage( page, settings.role );
-
-				// Enhancing the page may result in new dialogs/sub pages being inserted
-				// into the DOM. If the original absUrl refers to a sub-page, that is the
-				// real page we are interested in.
-				if ( absUrl.indexOf( "&" + $.mobile.subPageUrlKey ) > -1 ) {
-					page = settings.pageContainer.children( ":jqmData(url='" + dataUrl + "')" );
-				}
-
-				// Remove loading message.
-				if ( settings.showLoadMsg ) {
-					$.mobile.hidePageLoadingMsg();
-				}
-
-				deferred.resolve( absUrl, options, page, dupCachedPage );
-			},
-			error: function() {
-				//set base back to current path
-				if( base ) {
-					base.set( path.get() );
-				}
-
-				// Remove loading message.
-				if ( settings.showLoadMsg ) {
-					$.mobile.hidePageLoadingMsg();
-
-					//show error message
-					$( "<div class='ui-loader ui-overlay-shadow ui-body-e ui-corner-all'><h1>"+ $.mobile.pageLoadErrorMessage +"</h1></div>" )
-						.css({ "display": "block", "opacity": 0.96, "top": $window.scrollTop() + 100 })
-						.appendTo( settings.pageContainer )
-						.delay( 800 )
-						.fadeOut( 400, function() {
-							$( this ).remove();
-						});
-				}
-
-				deferred.reject( absUrl, options );
-			}
-		});
-
-		return deferred.promise();
-	};
-
-	$.mobile.loadPage.defaults = {
-		type: "get",
-		data: undefined,
-		reloadPage: false,
-		role: undefined, // By default we rely on the role defined by the @data-role attribute.
-		showLoadMsg: true,
-		pageContainer: undefined
-	};
-
-	// Show a specific page in the page container.
-	$.mobile.changePage = function( toPage, options ) {
-		// XXX: REMOVE_BEFORE_SHIPPING_1.0
-		// This is temporary code that makes changePage() compatible with previous alpha versions.
-		if ( typeof options !== "object" ) {
-			var opts = null;
-
-			// Map old-style call signature for form submit to the new options object format.
-			if ( typeof toPage === "object" && toPage.url && toPage.type ) {
-				opts = {
-					type: toPage.type,
-					data: toPage.data,
-					forcePageLoad: true
-				};
-				toPage = toPage.url;
-			}
-
-			// The arguments passed into the function need to be re-mapped
-			// to the new options object format.
-			var len = arguments.length;
-			if ( len > 1 ) {
-				var argNames = [ "transition", "reverse", "changeHash", "fromHashChange" ], i;
-				for ( i = 1; i < len; i++ ) {
-					var a = arguments[ i ];
-					if ( typeof a !== "undefined" ) {
-						opts = opts || {};
-						opts[ argNames[ i - 1 ] ] = a;
-					}
-				}
-			}
-
-			// If an options object was created, then we know changePage() was called
-			// with an old signature.
-			if ( opts ) {
-				return $.mobile.changePage( toPage, opts );
-			}
-		}
-		// XXX: REMOVE_BEFORE_SHIPPING_1.0
-
-		// If we are in the midst of a transition, queue the current request.
-		// We'll call changePage() once we're done with the current transition to
-		// service the request.
-		if( isPageTransitioning ) {
-			pageTransitionQueue.unshift( arguments );
-			return;
-		}
-
-		// Set the isPageTransitioning flag to prevent any requests from
-		// entering this method while we are in the midst of loading a page
-		// or transitioning.
-
-		isPageTransitioning = true;
-
-		var settings = $.extend( {}, $.mobile.changePage.defaults, options );
-
-		// Make sure we have a pageContainer to work with.
-		settings.pageContainer = settings.pageContainer || $.mobile.pageContainer;
-
-		// If the caller passed us a url, call loadPage()
-		// to make sure it is loaded into the DOM. We'll listen
-		// to the promise object it returns so we know when
-		// it is done loading or if an error ocurred.
-		if ( typeof toPage == "string" ) {
-			$.mobile.loadPage( toPage, settings )
-				.done(function( url, options, newPage, dupCachedPage ) {
-					isPageTransitioning = false;
-					options.duplicateCachedPage = dupCachedPage;
-					$.mobile.changePage( newPage, options );
-				})
-				.fail(function( url, options ) {
-					// XXX_jblas: Fire off changepagefailed notificaiton.
-					isPageTransitioning = false;
-
-					//clear out the active button state
-					removeActiveLinkClass( true );
-
-					//release transition lock so navigation is free again
-					releasePageTransitionLock();
-					settings.pageContainer.trigger("changepagefailed");
-				});
-			return;
-		}
-
-		// The caller passed us a real page DOM element. Update our
-		// internal state and then trigger a transition to the page.
-		var mpc = settings.pageContainer,
-			fromPage = $.mobile.activePage,
-			url = toPage.jqmData( "url" ),
-			fileUrl = path.getFilePath( url ),
-			active = urlHistory.getActive(),
-			activeIsInitialPage = urlHistory.activeIndex === 0,
-			historyDir = 0,
-			pageTitle = document.title,
-			isDialog = settings.role === "dialog" || toPage.jqmData( "role" ) === "dialog";
-
-		// Let listeners know we're about to change the current page.
-		mpc.trigger( "beforechangepage" );
-
-		// If we are trying to transition to the same page that we are currently on ignore the request.
-		// an illegal same page request is defined by the current page being the same as the url, as long as there's history
-		// and toPage is not an array or object (those are allowed to be "same")
-		//
-		// XXX_jblas: We need to remove this at some point when we allow for transitions
-		//            to the same page.
-		if( fromPage && fromPage[0] === toPage[0] ) {
-			isPageTransitioning = false;
-			mpc.trigger( "changepage" );
-			return;
-		}
-
-		// We need to make sure the page we are given has already been enhanced.
-		enhancePage( toPage, settings.role );
-
-		// If the changePage request was sent from a hashChange event, check to see if the
-		// page is already within the urlHistory stack. If so, we'll assume the user hit
-		// the forward/back button and will try to match the transition accordingly.
-		if( settings.fromHashChange ) {
-			urlHistory.directHashChange({
-				currentUrl:	url,
-				isBack:		function() { historyDir = -1; },
-				isForward:	function() { historyDir = 1; }
-			});
-		}
-
-		// Kill the keyboard.
-		// XXX_jblas: We need to stop crawling the entire document to kill focus. Instead,
-		//            we should be tracking focus with a live() handler so we already have
-		//            the element in hand at this point.
-		$( document.activeElement || "" ).add( "input:focus, textarea:focus, select:focus" ).blur();
-
-		// If we're displaying the page as a dialog, we don't want the url
-		// for the dialog content to be used in the hash. Instead, we want
-		// to append the dialogHashKey to the url of the current page.
-		if ( isDialog && active ) {
-			url = active.url + dialogHashKey;
-		}
-
-		// Set the location hash.
-		if( settings.changeHash !== false && url ) {
-			//disable hash listening temporarily
-			urlHistory.ignoreNextHashChange = true;
-			//update hash and history
-			path.set( url );
-		}
-
-		//if title element wasn't found, try the page div data attr too
-		var newPageTitle = toPage.jqmData( "title" ) || toPage.children(":jqmData(role='header')").find(".ui-title" ).text();
-		if( !!newPageTitle && pageTitle == document.title ) {
-			pageTitle = newPageTitle;
-		}
-
-		//add page to history stack if it's not back or forward
-		if( !historyDir ) {
-			urlHistory.addNew( url, settings.transition, pageTitle, toPage );
-		}
-
-		//set page title
-		document.title = urlHistory.getActive().title;
-
-		//set "toPage" as activePage
-		$.mobile.activePage = toPage;
-
-		// Make sure we have a transition defined.
-		settings.transition = settings.transition
-			|| ( ( historyDir && !activeIsInitialPage ) ? active.transition : undefined )
-			|| ( settings.role === "dialog" ? $.mobile.defaultDialogTransition : $.mobile.defaultPageTransition );
-
-		// If we're navigating back in the URL history, set reverse accordingly.
-		settings.reverse = settings.reverse || historyDir < 0;
-
-		transitionPages( toPage, fromPage, settings.transition, settings.reverse )
-			.done(function() {
-				removeActiveLinkClass();
-	
-				//if there's a duplicateCachedPage, remove it from the DOM now that it's hidden
-				if ( settings.duplicateCachedPage ) {
-					settings.duplicateCachedPage.remove();
-				}
-	
-				//remove initial build class (only present on first pageshow)
-				$html.removeClass( "ui-mobile-rendering" );
-	
-				releasePageTransitionLock();
-	
-				// Let listeners know we're all done changing the current page.
-				mpc.trigger( "changepage" );
-			});
-	};
-
-	$.mobile.changePage.defaults = {
-		transition: undefined,
-		reverse: false,
-		changeHash: true,
-		fromHashChange: false,
-		role: undefined, // By default we rely on the role defined by the @data-role attribute.
-		duplicateCachedPage: undefined,
-		pageContainer: undefined
-	};
-
-/* Event Bindings - hashchange, submit, and click */
-
-	//bind to form submit events, handle with Ajax
-	$( "form" ).live('submit', function( event ) {
-		var $this = $( this );
-		if( !$.mobile.ajaxEnabled ||
-			$this.is( ":jqmData(ajax='false')" ) ) {
-				return;
-			}
-
-		var type = $this.attr( "method" ),
-			url = path.makeUrlAbsolute( $this.attr( "action" ), getClosestBaseUrl($this) ),
-			target = $this.attr( "target" );
-
-		//external submits use regular HTTP
-		if( path.isExternal( url ) || target ) {
-			return;
-		}
-
-		$.mobile.changePage(
-			url,
-			{
-				type:		type.length && type.toLowerCase() || "get",
-				data:		$this.serialize(),
-				transition:	$this.jqmData( "transition" ),
-				direction:	$this.jqmData( "direction" ),
-				reloadPage:	true
-			}
-		);
-		event.preventDefault();
-	});
-
-	function findClosestLink( ele )
-	{
-		while ( ele ) {
-			if ( ele.nodeName.toLowerCase() == "a" ) {
-				break;
-			}
-			ele = ele.parentNode;
-		}
-		return ele;
-	}
-
-	// The base URL for any given element depends on the page it resides in.
-	function getClosestBaseUrl( ele )
-	{
-		// Find the closest page and extract out its url.
-		var url = $( ele ).closest( ".ui-page" ).jqmData( "url" ),
-			base = documentBase.hrefNoHash;
-
-		if ( !url || !path.isPath( url ) ) {
-			url = base;
-		}
-
-		return path.makeUrlAbsolute( url, base);
-	}
-
-	//add active state on vclick
-	$( document ).bind( "vclick", function( event ) {
-		var link = findClosestLink( event.target );
-		if ( link ) {
-			if ( path.parseUrl( link.getAttribute( "href" ) || "#" ).hash !== "#" ) {
-				$( link ).closest( ".ui-btn" ).not( ".ui-disabled" ).addClass( $.mobile.activeBtnClass );
-				$( "." + $.mobile.activePageClass + " .ui-btn" ).not( link ).blur();
-			}
-		}
-	});
-
-	// click routing - direct to HTTP or Ajax, accordingly
-	// TODO: most of the time, vclick will be all we need for fastClick bulletproofing.
-	// However, it seems that in Android 2.1, a click event
-	// will occasionally arrive independently of the bound vclick
-	// binding to click as well seems to help in this edge case
-	// we'll dig into this further in the next release cycle
-	$( document ).bind( $.mobile.useFastClick ? "vclick click" : "click", function( event ) {
-		var link = findClosestLink( event.target );
-		if ( !link ) {
-			return;
-		}
-
-		var $link = $( link ),
-			//remove active link class if external (then it won't be there if you come back)
-			httpCleanup = function(){
-				window.setTimeout( function() { removeActiveLinkClass( true ); }, 200 );
-			};
-
-		//if there's a data-rel=back attr, go back in history
-		if( $link.is( ":jqmData(rel='back')" ) ) {
-			window.history.back();
-			return false;
-		}
-		
-		//if ajax is disabled, exit early
-		if( !$.mobile.ajaxEnabled ){
-			httpCleanup();
-			//use default click handling
-			return;
-		}
-		
-		var baseUrl = getClosestBaseUrl( $link ),
-
-			//get href, if defined, otherwise default to empty hash
-			href = path.makeUrlAbsolute( $link.attr( "href" ) || "#", baseUrl );
-
-		// XXX_jblas: Ideally links to application pages should be specified as
-		//            an url to the application document with a hash that is either
-		//            the site relative path or id to the page. But some of the
-		//            internal code that dynamically generates sub-pages for nested
-		//            lists and select dialogs, just write a hash in the link they
-		//            create. This means the actual URL path is based on whatever
-		//            the current value of the base tag is at the time this code
-		//            is called. For now we are just assuming that any url with a
-		//            hash in it is an application page reference.
-		if ( href.search( "#" ) != -1 ) {
-			href = href.replace( /[^#]*#/, "" );
-			if ( !href ) {
-				//link was an empty hash meant purely
-				//for interaction, so we ignore it.
-				event.preventDefault();
-				return;
-			} else if ( path.isPath( href ) ) {
-				//we have apath so make it the href we want to load.
-				href = path.makeUrlAbsolute( href, baseUrl );
-			} else {
-				//we have a simple id so use the documentUrl as its base.
-				href = path.makeUrlAbsolute( "#" + href, documentUrl.hrefNoHash );
-			}
-		}
-
-			// Should we handle this link, or let the browser deal with it?
-		var useDefaultUrlHandling = $link.is( "[rel='external']" ) || $link.is( ":jqmData(ajax='false')" ) || $link.is( "[target]" ),
-
-			// Some embedded browsers, like the web view in Phone Gap, allow cross-domain XHR
-			// requests if the document doing the request was loaded via the file:// protocol.
-			// This is usually to allow the application to "phone home" and fetch app specific
-			// data. We normally let the browser handle external/cross-domain urls, but if the
-			// allowCrossDomainPages option is true, we will allow cross-domain http/https
-			// requests to go through our page loading logic.
-			isCrossDomainPageLoad = ( $.mobile.allowCrossDomainPages && documentUrl.protocol === "file:" && href.search( /^https?:/ ) != -1 ),
-
-			//check for protocol or rel and its not an embedded page
-			//TODO overlap in logic from isExternal, rel=external check should be
-			//     moved into more comprehensive isExternalLink
-			isExternal = useDefaultUrlHandling || ( path.isExternal( href ) && !isCrossDomainPageLoad );
-
-		$activeClickedLink = $link.closest( ".ui-btn" );
-
-		if( isExternal ) {
-			httpCleanup();
-			//use default click handling
-			return;
-		}
-
-		//use ajax
-		var transition = $link.jqmData( "transition" ),
-			direction = $link.jqmData( "direction" ),
-			reverse = ( direction && direction === "reverse" ) ||
-						// deprecated - remove by 1.0
-						$link.jqmData( "back" ),
-
-			//this may need to be more specific as we use data-rel more
-			role = $link.attr( "data-" + $.mobile.ns + "rel" ) || undefined;
-
-		$.mobile.changePage( href, { transition: transition, reverse: reverse, role: role } );
-		event.preventDefault();
-	});
-
-	//hashchange event handler
-	$window.bind( "hashchange", function( e, triggered ) {
-		//find first page via hash
-		var to = path.stripHash( location.hash ),
-			//transition is false if it's the first page, undefined otherwise (and may be overridden by default)
-			transition = $.mobile.urlHistory.stack.length === 0 ? "none" : undefined;
-
-		//if listening is disabled (either globally or temporarily), or it's a dialog hash
-		if( !$.mobile.hashListeningEnabled || urlHistory.ignoreNextHashChange ) {
-			urlHistory.ignoreNextHashChange = false;
-			return;
-		}
-
-		// special case for dialogs
-		if( urlHistory.stack.length > 1 &&
-				to.indexOf( dialogHashKey ) > -1 ) {
-
-			// If current active page is not a dialog skip the dialog and continue
-			// in the same direction
-			if(!$.mobile.activePage.is( ".ui-dialog" )) {
-				//determine if we're heading forward or backward and continue accordingly past
-				//the current dialog
-				urlHistory.directHashChange({
-					currentUrl: to,
-					isBack: function() { window.history.back(); },
-					isForward: function() { window.history.forward(); }
-				});
-
-				// prevent changepage
-				return;
-			} else {
-				var setTo = function() { to = $.mobile.urlHistory.getActive().page; };
-				// if the current active page is a dialog and we're navigating
-				// to a dialog use the dialog objected saved in the stack
-				urlHistory.directHashChange({	currentUrl: to, isBack: setTo, isForward: setTo	});
-			}
-		}
-
-		//if to is defined, load it
-		if ( to ) {
-			to = ( typeof to === "string" && !path.isPath( to ) ) ? ( '#' + to ) : to;
-			$.mobile.changePage( to, { transition: transition, changeHash: false, fromHashChange: true } );
-		}
-		//there's no hash, go to the first page in the dom
-		else {
-			$.mobile.changePage( $.mobile.firstPage, { transition: transition, changeHash: false, fromHashChange: true } );
-		}
-	});
-	
-	//set page min-heights to be device specific
-	$( document ).bind( "pageshow", resetActivePageHeight );
-	$( window ).bind( "throttledresize", resetActivePageHeight );
-
-})( jQuery );
-/*!
- * jQuery Mobile v@VERSION
- * http://jquerymobile.com/
- *
- * Copyright 2010, jQuery Project
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- */
-
-( function( $, window, undefined ) {
-
-function css3TransitionHandler( name, reverse, $to, $from )
-{
-	var deferred = new $.Deferred(),
-		reverseClass = reverse ? " reverse" : "",
-		viewportClass = "ui-mobile-viewport-transitioning viewport-" + name,
-		doneFunc = function() {
-			$to.add( $from ).removeClass( "out in reverse " + name );
-			if ( $from ) {
-				$from.removeClass( $.mobile.activePageClass );
-			}
-			$to.parent().removeClass( viewportClass );
-	
-			deferred.resolve( name, reverse, $to, $from );
-		};
-	
-	$to.animationComplete( doneFunc );
-	
-	$to.parent().addClass( viewportClass );
-	if ( $from ) {
-		$from.addClass( name + " out" + reverseClass );
-	}
-	$to.addClass( $.mobile.activePageClass + " " + name + " in" + reverseClass );
-
-	return deferred.promise();
-}
-
-// Make our transition handler public.
-$.mobile.css3TransitionHandler = css3TransitionHandler;
-
-// If the default transition handler is the 'none' handler, replace it with our handler.
-if ( $.mobile.defaultTransitionHandler === $.mobile.noneTransitionHandler ) {
-	$.mobile.defaultTransitionHandler = css3TransitionHandler;
-}
-
-})( jQuery, this );
-/*
-* jQuery Mobile Framework : "fixHeaderFooter" plugin - on-demand positioning for headers,footers
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT or GPL Version 2 licenses.
-* http://jquery.org/license
-*/
-(function($, undefined ) {
-$.fn.fixHeaderFooter = function(options){
-	if( !$.support.scrollTop ){ return this; }
-	
-	return this.each(function(){
-		var $this = $(this);
-		
-		if( $this.jqmData('fullscreen') ){ $this.addClass('ui-page-fullscreen'); }
-		$this.find( ".ui-header:jqmData(position='fixed')" ).addClass('ui-header-fixed ui-fixed-inline fade'); //should be slidedown
-		$this.find( ".ui-footer:jqmData(position='fixed')" ).addClass('ui-footer-fixed ui-fixed-inline fade'); //should be slideup		
-	});
-};
-
-//single controller for all showing,hiding,toggling		
-$.fixedToolbars = (function(){
-	if( !$.support.scrollTop ){ return; }
-	var currentstate = 'inline',
-		autoHideMode = false,
-		showDelay = 100,
-		delayTimer,
-		ignoreTargets = 'a,input,textarea,select,button,label,.ui-header-fixed,.ui-footer-fixed',
-		toolbarSelector = '.ui-header-fixed:first, .ui-footer-fixed:not(.ui-footer-duplicate):last',
-		stickyFooter, //for storing quick references to duplicate footers
-		supportTouch = $.support.touch,
-		touchStartEvent = supportTouch ? "touchstart" : "mousedown",
-		touchStopEvent = supportTouch ? "touchend" : "mouseup",
-		stateBefore = null,
-		scrollTriggered = false,
-        touchToggleEnabled = true;
-
-	function showEventCallback(event)
-	{
-		// An event that affects the dimensions of the visual viewport has
-		// been triggered. If the header and/or footer for the current page are in overlay
-		// mode, we want to hide them, and then fire off a timer to show them at a later
-		// point. Events like a resize can be triggered continuously during a scroll, on
-		// some platforms, so the timer is used to delay the actual positioning until the
-		// flood of events have subsided.
-		//
-		// If we are in autoHideMode, we don't do anything because we know the scroll
-		// callbacks for the plugin will fire off a show when the scrolling has stopped.
-		if (!autoHideMode && currentstate == 'overlay') {
-			if (!delayTimer)
-				$.fixedToolbars.hide(true);
-			$.fixedToolbars.startShowTimer();
-		}
-	}
-
-	$(function() {
-		$(document)
-			.bind( "vmousedown",function(event){
-				if( touchToggleEnabled ) {
-					stateBefore = currentstate;
-				}
-			})
-			.bind( "vclick",function(event){
-				if( touchToggleEnabled ) {
-					if( $(event.target).closest(ignoreTargets).length ){ return; }
-					if( !scrollTriggered ){
-						$.fixedToolbars.toggle(stateBefore);
-						stateBefore = null;
-					}
-				}
-			})
-			.bind('silentscroll', showEventCallback);
-
-/*		
-		The below checks first for a $(document).scrollTop() value, and if zero, binds scroll events to $(window) instead. If the scrollTop value is actually zero, both will return zero anyway.
-
-		Works with $(document), not $(window) : Opera Mobile (WinMO phone; kinda broken anyway)
-		Works with $(window), not $(document) : IE 7/8
-		Works with either $(window) or $(document) : Chrome, FF 3.6/4, Android 1.6/2.1, iOS
-		Needs work either way : BB5, Opera Mobile (iOS)
-
-*/
-
-		(( $(document).scrollTop() == 0 ) ? $(window) : $(document))
-			.bind('scrollstart',function(event){
-				scrollTriggered = true;
-				if(stateBefore == null){ stateBefore = currentstate; }
-
-				// We only enter autoHideMode if the headers/footers are in
-				// an overlay state or the show timer was started. If the
-				// show timer is set, clear it so the headers/footers don't
-				// show up until after we're done scrolling.
-				var isOverlayState = stateBefore == 'overlay';
-				autoHideMode = isOverlayState || !!delayTimer;
-				if (autoHideMode){
-					$.fixedToolbars.clearShowTimer();
-					if (isOverlayState) {
-						$.fixedToolbars.hide(true);
-					}
-				}
-			})
-			.bind('scrollstop',function(event){
-				if( $(event.target).closest(ignoreTargets).length ){ return; }
-				scrollTriggered = false;
-				if (autoHideMode) {
-					autoHideMode = false;
-					$.fixedToolbars.startShowTimer();
-				}
-				stateBefore = null;
-			});
-
-			$(window).bind('resize', showEventCallback);
-	});
-		
-	//before page is shown, check for duplicate footer
-	$('.ui-page').live('pagebeforeshow', function(event, ui){
-		var page = $(event.target),
-			footer = page.find( ":jqmData(role='footer')" ),
-			id = footer.data('id'),
-			prevPage = ui.prevPage,
-			prevFooter = prevPage && prevPage.find( ":jqmData(role='footer')" ),
-			prevFooterMatches = prevFooter.length && prevFooter.jqmData( "id" ) === id;
-		
-		if( id && prevFooterMatches ){
-			stickyFooter = footer;
-			setTop( stickyFooter.removeClass( "fade in out" ).appendTo( $.mobile.pageContainer ) );
-		}
-	});
-
-	//after page is shown, append footer to new page
-	$('.ui-page').live('pageshow', function(event, ui){
-		var $this = $(this);
-		
-		if( stickyFooter && stickyFooter.length ){	
-			
-			setTimeout(function(){
-				setTop( stickyFooter.appendTo( $this ).addClass("fade") );
-				stickyFooter = null;
-			}, 500);	
-		}
-		
-		$.fixedToolbars.show(true, this);	
-	});
-    
-    //When a collapsiable is hidden or shown we need to trigger the fixed toolbar to reposition itself (#1635)
-	$( ".ui-collapsible-contain" ).live( "collapse expand", showEventCallback );
-
-	// element.getBoundingClientRect() is broken in iOS 3.2.1 on the iPad. The
-	// coordinates inside of the rect it returns don't have the page scroll position
-	// factored out of it like the other platforms do. To get around this,
-	// we'll just calculate the top offset the old fashioned way until core has
-	// a chance to figure out how to handle this situation.
-	//
-	// TODO: We'll need to get rid of getOffsetTop() once a fix gets folded into core.
-
-	function getOffsetTop(ele)
-	{
-		var top = 0;
-		if (ele)
-		{
-			var op = ele.offsetParent, body = document.body;
-			top = ele.offsetTop;
-			while (ele && ele != body)
-			{
-				top += ele.scrollTop || 0;
-				if (ele == op)
-				{
-					top += op.offsetTop;
-					op = ele.offsetParent;
-				}
-				ele = ele.parentNode;
-			}
-		}
-		return top;
-	}
-
-	function setTop(el){
-		var fromTop = $(window).scrollTop(),
-			thisTop = getOffsetTop(el[0]), // el.offset().top returns the wrong value on iPad iOS 3.2.1, call our workaround instead.
-			thisCSStop = el.css('top') == 'auto' ? 0 : parseFloat(el.css('top')),
-			screenHeight = window.innerHeight,
-			thisHeight = el.outerHeight(),
-			useRelative = el.parents('.ui-page:not(.ui-page-fullscreen)').length,
-			relval;
-		if( el.is('.ui-header-fixed') ){
-			relval = fromTop - thisTop + thisCSStop;
-			if( relval < thisTop){ relval = 0; }
-			return el.css('top', ( useRelative ) ? relval : fromTop);
-		}
-		else{
-			//relval = -1 * (thisTop - (fromTop + screenHeight) + thisCSStop + thisHeight);
-			//if( relval > thisTop ){ relval = 0; }
-			relval = fromTop + screenHeight - thisHeight - (thisTop - thisCSStop);
-			return el.css('top', ( useRelative ) ? relval : fromTop + screenHeight - thisHeight );
-		}
-	}
-
-	//exposed methods
-	return {
-		show: function(immediately, page){
-			$.fixedToolbars.clearShowTimer();
-			currentstate = 'overlay';
-			var $ap = page ? $(page) : ($.mobile.activePage ? $.mobile.activePage : $(".ui-page-active"));
-			return $ap.children( toolbarSelector ).each(function(){
-				var el = $(this),
-					fromTop = $(window).scrollTop(),
-					thisTop = getOffsetTop(el[0]), // el.offset().top returns the wrong value on iPad iOS 3.2.1, call our workaround instead.
-					screenHeight = window.innerHeight,
-					thisHeight = el.outerHeight(),
-					alreadyVisible = (el.is('.ui-header-fixed') && fromTop <= thisTop + thisHeight) || (el.is('.ui-footer-fixed') && thisTop <= fromTop + screenHeight);	
-				
-				//add state class
-				el.addClass('ui-fixed-overlay').removeClass('ui-fixed-inline');	
-					
-				if( !alreadyVisible && !immediately ){
-					el.animationComplete(function(){
-						el.removeClass('in');
-					}).addClass('in');
-				}
-				setTop(el);
-			});	
-		},
-		hide: function(immediately){
-			currentstate = 'inline';
-			var $ap = $.mobile.activePage ? $.mobile.activePage : $(".ui-page-active");
-			return $ap.children( toolbarSelector ).each(function(){
-				var el = $(this);
-
-				var thisCSStop = el.css('top'); thisCSStop = thisCSStop == 'auto' ? 0 : parseFloat(thisCSStop);
-				
-				//add state class
-				el.addClass('ui-fixed-inline').removeClass('ui-fixed-overlay');
-				
-				if (thisCSStop < 0 || (el.is('.ui-header-fixed') && thisCSStop != 0))
-				{
-					if(immediately){
-						el.css('top',0);
-					}
-					else{
-						if( el.css('top') !== 'auto' && parseFloat(el.css('top')) !== 0 ){
-							var classes = 'out reverse';
-							el.animationComplete(function(){
-								el.removeClass(classes);
-								el.css('top',0);
-							}).addClass(classes);	
-						}
-					}
-				}
-			});
-		},
-		startShowTimer: function(){
-			$.fixedToolbars.clearShowTimer();
-			var args = $.makeArray(arguments);
-			delayTimer = setTimeout(function(){
-				delayTimer = undefined;
-				$.fixedToolbars.show.apply(null, args);
-			}, showDelay);
-		},
-		clearShowTimer: function() {
-			if (delayTimer) {
-				clearTimeout(delayTimer);
-			}
-			delayTimer = undefined;
-		},
-		toggle: function(from){
-			if(from){ currentstate = from; }
-			return (currentstate == 'overlay') ? $.fixedToolbars.hide() : $.fixedToolbars.show();
-		},
-        setTouchToggleEnabled: function(enabled) {
-            touchToggleEnabled = enabled;
-        }
-	};
-})();
-
-})(jQuery);
-/*
-* jQuery Mobile Framework : "checkboxradio" plugin
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT or GPL Version 2 licenses.
-* http://jquery.org/license
-*/
-(function($, undefined ) {
-$.widget( "mobile.checkboxradio", $.mobile.widget, {
-	options: {
-		theme: null
-	},
-	_create: function(){
-		var self = this,
-			input = this.element,
-			//NOTE: Windows Phone could not find the label through a selector
-			//filter works though.
-			label = input.closest("form,fieldset,:jqmData(role='page')").find("label").filter('[for="' + input[0].id + '"]'),
-			inputtype = input.attr( "type" ),
-			checkedicon = "ui-icon-" + inputtype + "-on",
-			uncheckedicon = "ui-icon-" + inputtype + "-off";
-
-		if ( inputtype != "checkbox" && inputtype != "radio" ) { return; }
-
-		//expose for other methods
-		$.extend( this,{
-			label			: label,
-			inputtype		: inputtype,
-			checkedicon		: checkedicon,
-			uncheckedicon	: uncheckedicon
-		});
-
-		// If there's no selected theme...
-		if( !this.options.theme ) {
-			this.options.theme = this.element.jqmData( "theme" );
-		}
-
-		label
-			.buttonMarkup({
-				theme: this.options.theme,
-				icon: this.element.parents( ":jqmData(type='horizontal')" ).length ? undefined : uncheckedicon,
-				shadow: false
-			});
-
-		// wrap the input + label in a div
-		input
-			.add( label )
-			.wrapAll( "<div class='ui-" + inputtype +"'></div>" );
-
-		label.bind({
-			vmouseover: function() {
-				if( $(this).parent().is('.ui-disabled') ){ return false; }
-			},
-
-			vclick: function( event ){
-				if ( input.is( ":disabled" ) ){
-					event.preventDefault();
-					return;
-				}
-
-				self._cacheVals();
-        
-				input.prop( "checked", inputtype === "radio" && true || !(input.prop("checked")) );
-
-				// input set for common radio buttons will contain all the radio
-				// buttons, but will not for checkboxes. clearing the checked status
-				// of other radios ensures the active button state is applied properly
-				self._getInputSet().not(input).prop('checked', false);
-
-				self._updateAll();
-				return false;
-			}
-
-		});
-
-		input
-			.bind({
-				vmousedown: function(){
-					this._cacheVals();
-				},
-
-				vclick: function(){
-          // adds checked attribute to checked input when keyboard is used
-          if ($(this).is(":checked")) { 
-             $(this).prop( "checked", true);   
-             self._getInputSet().not($(this)).prop('checked', false);
-          } else {
-             $(this).prop("checked", false);
-          }
-					self._updateAll();
-				},
-
-				focus: function() {
-					label.addClass( "ui-focus" );
-				},
-
-				blur: function() {
-					label.removeClass( "ui-focus" );
-				}
-			});
-
-		this.refresh();
-
-	},
-
-	_cacheVals: function(){
-		this._getInputSet().each(function(){
-			$(this).jqmData("cacheVal", $(this).is(":checked") );
-		});
-	},
-
-	//returns either a set of radios with the same name attribute, or a single checkbox
-	_getInputSet: function(){
-		return this.element.closest( "form,fieldset,:jqmData(role='page')" )
-				.find( "input[name='"+ this.element.attr( "name" ) +"'][type='"+ this.inputtype +"']" );
-	},
-
-	_updateAll: function(){
-		var self = this;
-
-		this._getInputSet().each(function(){
-			if( $(this).is(":checked") || self.inputtype === "checkbox" ){
-				$(this).trigger("change");
-			}
-		})
-		.checkboxradio( "refresh" );
-	},
-
-	refresh: function( ){
-		var input = this.element,
-			label = this.label,
-			icon = label.find( ".ui-icon" );
-
-		// input[0].checked expando doesn't always report the proper value
-		// for checked='checked'
-		if ( $(input[0]).prop('checked') ) {
-			label.addClass( $.mobile.activeBtnClass );
-			icon.addClass( this.checkedicon ).removeClass( this.uncheckedicon );
-
-		} else {
-			label.removeClass( $.mobile.activeBtnClass );
-			icon.removeClass( this.checkedicon ).addClass( this.uncheckedicon );
-		}
-
-		if( input.is( ":disabled" ) ){
-			this.disable();
-		}
-		else {
-			this.enable();
-		}
-	},
-
-	disable: function(){
-		this.element.prop("disabled",true).parent().addClass("ui-disabled");
-	},
-
-	enable: function(){
-		this.element.prop("disabled",false).parent().removeClass("ui-disabled");
-	}
-});
-})( jQuery );
-/*
-* jQuery Mobile Framework : "textinput" plugin for text inputs, textareas
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT or GPL Version 2 licenses.
-* http://jquery.org/license
-*/
-(function($, undefined ) {
-$.widget( "mobile.textinput", $.mobile.widget, {
-	options: {
-		theme: null
-	},
-	_create: function(){
-		var input = this.element,
-			o = this.options,
-			theme = o.theme,
-			themeclass;
-			
-		if ( !theme ) {
-			var themedParent = this.element.closest("[class*='ui-bar-'],[class*='ui-body-']"),
-				themeLetter = themedParent.length && /ui-(bar|body)-([a-z])/.exec( themedParent.attr("class") ),
-				theme = themeLetter && themeLetter[2] || "c";
-		}	
-		
-		themeclass = " ui-body-" + theme;
-		
-		$('label[for="'+input.attr('id')+'"]').addClass('ui-input-text');
-		
-		input.addClass('ui-input-text ui-body-'+ o.theme);
-		
-		var focusedEl = input;
-		
-		//"search" input widget
-		if( input.is( "[type='search'],:jqmData(type='search')" ) ){
-			focusedEl = input.wrap('<div class="ui-input-search ui-shadow-inset ui-btn-corner-all ui-btn-shadow ui-icon-searchfield'+ themeclass +'"></div>').parent();
-			var clearbtn = $('<a href="#" class="ui-input-clear" title="clear text">clear text</a>')
-				.tap(function( e ){
-					input.val('').focus();
-					input.trigger('change'); 
-					clearbtn.addClass('ui-input-clear-hidden');
-					e.preventDefault();
-				})
-				.appendTo(focusedEl)
-				.buttonMarkup({icon: 'delete', iconpos: 'notext', corners:true, shadow:true});
-			
-			function toggleClear(){
-				if(input.val() == ''){
-					clearbtn.addClass('ui-input-clear-hidden');
-				}
-				else{
-					clearbtn.removeClass('ui-input-clear-hidden');
-				}
-			}
-			
-			toggleClear();
-			input.keyup(toggleClear);
-	                input.focus(toggleClear);   
-		}
-		else{
-			input.addClass('ui-corner-all ui-shadow-inset' + themeclass);
-		}
-				
-		input
-			.focus(function(){
-				focusedEl.addClass('ui-focus');
-			})
-			.blur(function(){
-				focusedEl.removeClass('ui-focus');
-			});	
-			
-		//autogrow
-		if ( input.is('textarea') ) {
-			var extraLineHeight = 15,
-				keyupTimeoutBuffer = 100,
-				keyup = function() {
-					var scrollHeight = input[0].scrollHeight,
-						clientHeight = input[0].clientHeight;
-					if ( clientHeight < scrollHeight ) {
-						input.css({ height: (scrollHeight + extraLineHeight) });
-					}
-				},
-				keyupTimeout;
-			input.keyup(function() {
-				clearTimeout( keyupTimeout );
-				keyupTimeout = setTimeout( keyup, keyupTimeoutBuffer );
-			});
-		}
-	},
-	
-	disable: function(){
-		( this.element.attr("disabled",true).is( "[type='search'],:jqmData(type='search')" ) ? this.element.parent() : this.element ).addClass("ui-disabled");
-	},
-	
-	enable: function(){
-		( this.element.attr("disabled", false).is( "[type='search'],:jqmData(type='search')" ) ? this.element.parent() : this.element ).removeClass("ui-disabled");
-	}
-});
-})( jQuery );
-/*
-* jQuery Mobile Framework : "selectmenu" plugin
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT or GPL Version 2 licenses.
-* http://jquery.org/license
-*/
-(function($, undefined ) {
-$.widget( "mobile.selectmenu", $.mobile.widget, {
-	options: {
-		theme: null,
-		disabled: false,
-		icon: 'arrow-d',
-		iconpos: 'right',
-		inline: null,
-		corners: true,
-		shadow: true,
-		iconshadow: true,
-		menuPageTheme: 'b',
-		overlayTheme: 'a',
-		hidePlaceholderMenuItems: true,
-		closeText: 'Close',
-		nativeMenu: true
-	},
-	_create: function(){
-
-		var self = this,
-
-			o = this.options,
-
-			select = this.element
-						.wrap( "<div class='ui-select'>" ),
-
-			selectID = select.attr( "id" ),
-
-			label = $( 'label[for="'+ selectID +'"]' ).addClass( "ui-select" ),
-
-			//IE throws an exception at options.item() function when
-			//there is no selected item
-			//select first in this case
-			selectedIndex = select[0].selectedIndex == -1 ? 0 : select[0].selectedIndex,
-
-			button = ( self.options.nativeMenu ? $( "<div/>" ) : $( "<a>", {
-					"href": "#",
-					"role": "button",
-					"id": buttonId,
-					"aria-haspopup": "true",
-					"aria-owns": menuId
-				}) )
-				.text( $( select[0].options.item( selectedIndex ) ).text() )
-				.insertBefore( select )
-				.buttonMarkup({
-					theme: o.theme,
-					icon: o.icon,
-					iconpos: o.iconpos,
-					inline: o.inline,
-					corners: o.corners,
-					shadow: o.shadow,
-					iconshadow: o.iconshadow
-				}),
-
-			//multi select or not
-			isMultiple = self.isMultiple = select[0].multiple;
-
-		//Opera does not properly support opacity on select elements
-		//In Mini, it hides the element, but not its text
-		//On the desktop,it seems to do the opposite
-		//for these reasons, using the nativeMenu option results in a full native select in Opera
-		if( o.nativeMenu && window.opera && window.opera.version ){
-			select.addClass( "ui-select-nativeonly" );
-		}
-
-		//vars for non-native menus
-		if( !o.nativeMenu ){
-			var options = select.find("option"),
-
-				buttonId = selectID + "-button",
-
-				menuId = selectID + "-menu",
-
-				thisPage = select.closest( ".ui-page" ),
-
-				//button theme
-				theme = /ui-btn-up-([a-z])/.exec( button.attr("class") )[1],
-
-				menuPage = $( "<div data-" + $.mobile.ns + "role='dialog' data-" +$.mobile.ns + "theme='"+ o.menuPageTheme +"'>" +
-							"<div data-" + $.mobile.ns + "role='header'>" +
-								"<div class='ui-title'>" + label.text() + "</div>"+
-							"</div>"+
-							"<div data-" + $.mobile.ns + "role='content'></div>"+
-						"</div>" )
-						.appendTo( $.mobile.pageContainer )
-						.page(),
-
-				menuPageContent = menuPage.find( ".ui-content" ),
-
-				menuPageClose = menuPage.find( ".ui-header a" ),
-
-				screen = $( "<div>", {"class": "ui-selectmenu-screen ui-screen-hidden"})
-							.appendTo( thisPage ),
-
-				listbox = $( "<div>", { "class": "ui-selectmenu ui-selectmenu-hidden ui-overlay-shadow ui-corner-all pop ui-body-" + o.overlayTheme } )
-						.insertAfter(screen),
-
-				list = $( "<ul>", {
-						"class": "ui-selectmenu-list",
-						"id": menuId,
-						"role": "listbox",
-						"aria-labelledby": buttonId
-					})
-					.attr( "data-" + $.mobile.ns + "theme", theme )
-					.appendTo( listbox ),
-
-				header = $( "<div>", {
-						"class": "ui-header ui-bar-" + theme
-					})
-					.prependTo( listbox ),
-
-				headerTitle = $( "<h1>", {
-						"class": "ui-title"
-					})
-					.appendTo( header ),
-
-				headerClose = $( "<a>", {
-						"text": o.closeText,
-						"href": "#",
-						"class": "ui-btn-left"
-					})
-					.attr( "data-" + $.mobile.ns + "iconpos", "notext" )
-					.attr( "data-" + $.mobile.ns + "icon", "delete" )
-					.appendTo( header )
-					.buttonMarkup(),
-
-				menuType;
-		} //end non native vars
-
-		// add counter for multi selects
-		if( isMultiple ){
-			self.buttonCount = $('<span>')
-				.addClass( 'ui-li-count ui-btn-up-c ui-btn-corner-all' )
-				.hide()
-				.appendTo( button );
-		}
-
-		//disable if specified
-		if( o.disabled ){ this.disable(); }
-
-		//events on native select
-		select
-			.change(function(){
-				self.refresh();
-			});
-
-		//expose to other methods
-		$.extend(self, {
-			select: select,
-			optionElems: options,
-			selectID: selectID,
-			label: label,
-			buttonId:buttonId,
-			menuId:menuId,
-			thisPage:thisPage,
-			button:button,
-			menuPage:menuPage,
-			menuPageContent:menuPageContent,
-			screen:screen,
-			listbox:listbox,
-			list:list,
-			menuType:menuType,
-			header:header,
-			headerClose:headerClose,
-			headerTitle:headerTitle,
-			placeholder: ''
-		});
-
-		//support for using the native select menu with a custom button
-		if( o.nativeMenu ){
-
-			select
-				.appendTo(button)
-				.bind( "vmousedown", function( e ){
-					//add active class to button
-					button.addClass( $.mobile.activeBtnClass );
-				})
-				.bind( "focus vmouseover", function(){
-					button.trigger( "vmouseover" );
-				})
-				.bind( "vmousemove", function(){
-					//remove active class on scroll/touchmove
-					button.removeClass( $.mobile.activeBtnClass );
-				})
-				.bind( "change blur vmouseout", function(){
-					button
-						.trigger( "vmouseout" )
-						.removeClass( $.mobile.activeBtnClass );
-				});
-
-
-		} else {
-
-			//create list from select, update state
-			self.refresh();
-
-			select
-				.attr( "tabindex", "-1" )
-				.focus(function(){
-					$(this).blur();
-					button.focus();
-				});
-
-			//button events
-			button
-				.bind( "vclick keydown" , function( event ){
-					if( event.type == "vclick" ||
-						event.keyCode && ( event.keyCode === $.mobile.keyCode.ENTER || event.keyCode === $.mobile.keyCode.SPACE ) ){
-						self.open();
-						event.preventDefault();
-					}
-				});
-
-			//events for list items
-			list
-			.attr( "role", "listbox" )
-			.delegate( ".ui-li>a", "focusin", function() {
-				$( this ).attr( "tabindex", "0" );
-			})
-			.delegate( ".ui-li>a", "focusout", function() {
-				$( this ).attr( "tabindex", "-1" );
-			})
-			.delegate("li:not(.ui-disabled, .ui-li-divider)", "vclick", function(event){
-
-				// index of option tag to be selected
-				var oldIndex = select[0].selectedIndex,
-					newIndex = list.find( "li:not(.ui-li-divider)" ).index( this ),
-					option = self.optionElems.eq( newIndex )[0];
-
-				// toggle selected status on the tag for multi selects
-				option.selected = isMultiple ? !option.selected : true;
-
-				// toggle checkbox class for multiple selects
-				if( isMultiple ){
-					$(this)
-						.find('.ui-icon')
-						.toggleClass('ui-icon-checkbox-on', option.selected)
-						.toggleClass('ui-icon-checkbox-off', !option.selected);
-				}
-
-				// trigger change if value changed
-				if( isMultiple || oldIndex !== newIndex ){
-					select.trigger( "change" );
-				}
-
-				//hide custom select for single selects only
-				if( !isMultiple ){
-					self.close();
-				}
-
-				event.preventDefault();
-			})
-			//keyboard events for menu items
-			.keydown(function( e ) {
-				var target = $( e.target ),
-					li = target.closest( "li" );
-
-				// switch logic based on which key was pressed
-				switch ( e.keyCode ) {
-					// up or left arrow keys
-					case 38:
-						var prev = li.prev();
-
-						// if there's a previous option, focus it
-						if ( prev.length ) {
-							target
-								.blur()
-								.attr( "tabindex", "-1" );
-
-							prev.find( "a" ).first().focus();
-						}
-
-						return false;
-					break;
-
-					// down or right arrow keys
-					case 40:
-						var next = li.next();
-
-						// if there's a next option, focus it
-						if ( next.length ) {
-							target
-								.blur()
-								.attr( "tabindex", "-1" );
-
-							next.find( "a" ).first().focus();
-						}
-
-						return false;
-					break;
-
-					// if enter or space is pressed, trigger click
-					case 13:
-					case 32:
-						 target.trigger( "vclick" );
-
-						 return false;
-					break;
-				}
-			});
-
-			//events on "screen" overlay
-			screen.bind("vclick", function( event ){
-				self.close();
-			});
-
-			//close button on small overlays
-			self.headerClose.click(function(){
-				if( self.menuType == "overlay" ){
-					self.close();
-					return false;
-				}
-			})
-		}
-	},
-
-	_buildList: function(){
-		var self = this,
-			o = this.options,
-			placeholder = this.placeholder,
-			optgroups = [],
-			lis = [],
-			dataIcon = self.isMultiple ? "checkbox-off" : "false";
-
-		self.list.empty().filter('.ui-listview').listview('destroy');
-
-		//populate menu with options from select element
-		self.select.find( "option" ).each(function( i ){
-			var $this = $(this),
-				$parent = $this.parent(),
-				text = $this.text(),
-				anchor = "<a href='#'>"+ text +"</a>",
-				classes = [],
-				extraAttrs = [];
-
-			// are we inside an optgroup?
-			if( $parent.is("optgroup") ){
-				var optLabel = $parent.attr("label");
-
-				// has this optgroup already been built yet?
-				if( $.inArray(optLabel, optgroups) === -1 ){
-					lis.push( "<li data-" + $.mobile.ns + "role='list-divider'>"+ optLabel +"</li>" );
-					optgroups.push( optLabel );
-				}
-			}
-
-			//find placeholder text
-			if( !this.getAttribute('value') || text.length == 0 || $this.jqmData('placeholder') ){
-				if( o.hidePlaceholderMenuItems ){
-					classes.push( "ui-selectmenu-placeholder" );
-				}
-				placeholder = self.placeholder = text;
-			}
-
-			// support disabled option tags
-			if( this.disabled ){
-				classes.push( "ui-disabled" );
-				extraAttrs.push( "aria-disabled='true'" );
-			}
-
-			lis.push( "<li data-" + $.mobile.ns + "icon='"+ dataIcon +"' class='"+ classes.join(" ") + "' " + extraAttrs.join(" ") +">"+ anchor +"</li>" )
-		});
-
-		self.list.html( lis.join(" ") );
-
-		self.list.find( "li" )
-			.attr({ "role": "option", "tabindex": "-1" })
-			.first().attr( "tabindex", "0" );
-
-		// hide header close link for single selects
-		if( !this.isMultiple ){
-			this.headerClose.hide();
-		}
-
-		// hide header if it's not a multiselect and there's no placeholder
-		if( !this.isMultiple && !placeholder.length ){
-			this.header.hide();
-		} else {
-			this.headerTitle.text( this.placeholder );
-		}
-
-		//now populated, create listview
-		self.list.listview();
-	},
-
-	refresh: function( forceRebuild ){
-		var self = this,
-			select = this.element,
-			isMultiple = this.isMultiple,
-			options = this.optionElems = select.find("option"),
-			selected = options.filter(":selected"),
-
-			// return an array of all selected index's
-			indicies = selected.map(function(){
-				return options.index( this );
-			}).get();
-
-		if( !self.options.nativeMenu && ( forceRebuild || select[0].options.length != self.list.find('li').length )){
-			self._buildList();
-		}
-
-		self.button
-			.find( ".ui-btn-text" )
-			.text(function(){
-				if( !isMultiple ){
-					return selected.text();
-				}
-
-				return selected.length ?
-					selected.map(function(){ return $(this).text(); }).get().join(', ') :
-					self.placeholder;
-			});
-
-		// multiple count inside button
-		if( isMultiple ){
-			self.buttonCount[ selected.length > 1 ? 'show' : 'hide' ]().text( selected.length );
-		}
-
-		if( !self.options.nativeMenu ){
-			self.list
-				.find( 'li:not(.ui-li-divider)' )
-				.removeClass( $.mobile.activeBtnClass )
-				.attr( 'aria-selected', false )
-				.each(function( i ){
-					if( $.inArray(i, indicies) > -1 ){
-						var item = $(this).addClass( $.mobile.activeBtnClass );
-
-						// aria selected attr
-						item.find( 'a' ).attr( 'aria-selected', true );
-
-						// multiple selects: add the "on" checkbox state to the icon
-						if( isMultiple ){
-							item.find('.ui-icon').removeClass('ui-icon-checkbox-off').addClass('ui-icon-checkbox-on');
-						}
-					}
-				});
-		}
-	},
-
-	open: function(){
-		if( this.options.disabled || this.options.nativeMenu ){ return; }
-
-		var self = this,
-			menuHeight = self.list.parent().outerHeight(),
-			menuWidth = self.list.parent().outerWidth(),
-			scrollTop = $(window).scrollTop(),
-			btnOffset = self.button.offset().top,
-			screenHeight = window.innerHeight,
-			screenWidth = window.innerWidth;
-
-		//add active class to button
-		self.button.addClass( $.mobile.activeBtnClass );
-
-		//remove after delay
-		setTimeout(function(){
-			self.button.removeClass( $.mobile.activeBtnClass );
-		}, 300);
-
-		function focusMenuItem(){
-			self.list.find( ".ui-btn-active" ).focus();
-		}
-
-		if( menuHeight > screenHeight - 80 || !$.support.scrollTop ){
-
-			//for webos (set lastscroll using button offset)
-			if( scrollTop == 0 && btnOffset > screenHeight ){
-				self.thisPage.one('pagehide',function(){
-					$(this).jqmData('lastScroll', btnOffset);
-				});
-			}
-
-			self.menuPage.one('pageshow', function() {
-				// silentScroll() is called whenever a page is shown to restore
-				// any previous scroll position the page may have had. We need to
-				// wait for the "silentscroll" event before setting focus to avoid
-				// the browser's "feature" which offsets rendering to make sure
-				// whatever has focus is in view.
-				$(window).one("silentscroll", function(){ focusMenuItem(); });
-			});
-
-			self.menuType = "page";
-			self.menuPageContent.append( self.list );
-			$.mobile.changePage( self.menuPage, { transition: 'pop' } );
-		}
-		else {
-			self.menuType = "overlay";
-
-			self.screen
-				.height( $(document).height() )
-				.removeClass('ui-screen-hidden');
-
-			//try and center the overlay over the button
-			var roomtop = btnOffset - scrollTop,
-				roombot = scrollTop + screenHeight - btnOffset,
-				halfheight = menuHeight / 2,
-				maxwidth = parseFloat(self.list.parent().css('max-width')),
-				newtop, newleft;
-
-			if( roomtop > menuHeight / 2 && roombot > menuHeight / 2 ){
-				newtop = btnOffset + ( self.button.outerHeight() / 2 ) - halfheight;
-			}
-			else{
-				//30px tolerance off the edges
-				newtop = roomtop > roombot ? scrollTop + screenHeight - menuHeight - 30 : scrollTop + 30;
-			}
-
-			// if the menuwidth is smaller than the screen center is
-			if (menuWidth < maxwidth) {
-				newleft = (screenWidth - menuWidth) / 2;
-			} else { //otherwise insure a >= 30px offset from the left
-				newleft = self.button.offset().left + self.button.outerWidth() / 2 - menuWidth / 2;
-				// 30px tolerance off the edges
-				if (newleft < 30) {
-					newleft = 30;
-				} else if ((newleft + menuWidth) > screenWidth) {
-					newleft = screenWidth - menuWidth - 30;
-				}
-			}
-
-			self.listbox
-				.append( self.list )
-				.removeClass( "ui-selectmenu-hidden" )
-				.css({
-					top: newtop,
-					left: newleft
-				})
-				.addClass("in");
-
-			focusMenuItem();
-		}
-
-		// wait before the dialog can be closed
-		setTimeout(function(){
-		 	self.isOpen = true;
-		}, 400);
-	},
-
-	close: function(){
-		if( this.options.disabled || !this.isOpen || this.options.nativeMenu ){ return; }
-		var self = this;
-
-		function focusButton(){
-			setTimeout(function(){
-				self.button.focus();
-			}, 40);
-
-			self.listbox.removeAttr('style').append( self.list );
-		}
-
-		if(self.menuType == "page"){
-			// button refocus ensures proper height calculation
-			// by removing the inline style and ensuring page inclusion
-			self.menuPage.one("pagehide", focusButton);
-
-			// doesn't solve the possible issue with calling change page
-			// where the objects don't define data urls which prevents dialog key
-			// stripping - changePage has incoming refactor
-			window.history.back();
-		}
-		else{
-			self.screen.addClass( "ui-screen-hidden" );
-			self.listbox.addClass( "ui-selectmenu-hidden" ).removeAttr( "style" ).removeClass("in");
-			focusButton();
-		}
-
-		// allow the dialog to be closed again
-		this.isOpen = false;
-	},
-
-	disable: function(){
-		this.element.attr("disabled",true);
-		this.button.addClass('ui-disabled').attr("aria-disabled", true);
-		return this._setOption( "disabled", true );
-	},
-
-	enable: function(){
-		this.element.attr("disabled",false);
-		this.button.removeClass('ui-disabled').attr("aria-disabled", false);
-		return this._setOption( "disabled", false );
-	}
-});
-})( jQuery );
-
-/*
-* jQuery Mobile Framework : plugin for making button-like links
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT or GPL Version 2 licenses.
-* http://jquery.org/license
-*/
-( function( $, undefined ) {
-
-$.fn.buttonMarkup = function( options ) {
-	return this.each( function() {
-		var el = $( this ),
-		    o = $.extend( {}, $.fn.buttonMarkup.defaults, el.jqmData(), options ),
-
-			// Classes Defined
-			buttonClass,
-			innerClass = "ui-btn-inner",
-			iconClass;
-
-		if ( attachEvents ) {
-			attachEvents();
-		}
-
-		// if not, try to find closest theme container
-		if ( !o.theme ) {
-			var themedParent = el.closest( "[class*='ui-bar-'],[class*='ui-body-']" );
-			o.theme = themedParent.length ?
-				/ui-(bar|body)-([a-z])/.exec( themedParent.attr( "class" ) )[2] :
-				"c";
-		}
-
-		buttonClass = "ui-btn ui-btn-up-" + o.theme;
-
-		if ( o.inline ) {
-			buttonClass += " ui-btn-inline";
-		}
-
-		if ( o.icon ) {
-			o.icon = "ui-icon-" + o.icon;
-			o.iconpos = o.iconpos || "left";
-
-			iconClass = "ui-icon " + o.icon;
-
-			if ( o.shadow ) {
-				iconClass += " ui-icon-shadow";
-			}
-		}
-
-		if ( o.iconpos ) {
-			buttonClass += " ui-btn-icon-" + o.iconpos;
-
-			if ( o.iconpos == "notext" && !el.attr( "title" ) ) {
-				el.attr( "title", el.text() );
-			}
-		}
-
-		if ( o.corners ) {
-			buttonClass += " ui-btn-corner-all";
-			innerClass += " ui-btn-corner-all";
-		}
-
-		if ( o.shadow ) {
-			buttonClass += " ui-shadow";
-		}
-
-		el
-			.attr( "data-" + $.mobile.ns + "theme", o.theme )
-			.addClass( buttonClass );
-
-		var wrap = ( "<D class='" + innerClass + "'><D class='ui-btn-text'></D>" +
-			( o.icon ? "<span class='" + iconClass + "'></span>" : "" ) +
-			"</D>" ).replace( /D/g, o.wrapperEls );
-
-		el.wrapInner( wrap );
-	});
-};
-
-$.fn.buttonMarkup.defaults = {
-	corners: true,
-	shadow: true,
-	iconshadow: true,
-	wrapperEls: "span"
-};
-
-function closestEnabledButton( element )
-{
-	while ( element ) {
-		var $ele = $( element );
-		if ( $ele.hasClass( "ui-btn" ) && !$ele.hasClass( "ui-disabled" ) ) {
-			break;
-		}
-		element = element.parentNode;
-	}
-	return element;
-}
-
-var attachEvents = function() {
-	$( document ).bind( {
-		"vmousedown": function( event ) {
-			var btn = closestEnabledButton( event.target );
-			if ( btn ) {
-				var $btn = $( btn ),
-					theme = $btn.attr( "data-" + $.mobile.ns + "theme" );
-				$btn.removeClass( "ui-btn-up-" + theme ).addClass( "ui-btn-down-" + theme );
-			}
-		},
-		"vmousecancel vmouseup": function( event ) {
-			var btn = closestEnabledButton( event.target );
-			if ( btn ) {
-				var $btn = $( btn ),
-					theme = $btn.attr( "data-" + $.mobile.ns + "theme" );
-				$btn.removeClass( "ui-btn-down-" + theme ).addClass( "ui-btn-up-" + theme );
-			}
-		},
-		"vmouseover focus": function( event ) {
-			var btn = closestEnabledButton( event.target );
-			if ( btn ) {
-				var $btn = $( btn ),
-					theme = $btn.attr( "data-" + $.mobile.ns + "theme" );
-				$btn.removeClass( "ui-btn-up-" + theme ).addClass( "ui-btn-hover-" + theme );
-			}
-		},
-		"vmouseout blur": function( event ) {
-			var btn = closestEnabledButton( event.target );
-			if ( btn ) {
-				var $btn = $( btn ),
-					theme = $btn.attr( "data-" + $.mobile.ns + "theme" );
-				$btn.removeClass( "ui-btn-hover-" + theme ).addClass( "ui-btn-up-" + theme );
-			}
-		}
-	});
-
-	attachEvents = null;
-};
-
-})( jQuery );
-/*
-* jQuery Mobile Framework : "button" plugin - links that proxy to native input/buttons
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT or GPL Version 2 licenses.
-* http://jquery.org/license
-*/ 
-(function($, undefined ) {
-$.widget( "mobile.button", $.mobile.widget, {
-	options: {
-		theme: null, 
-		icon: null,
-		iconpos: null,
-		inline: null,
-		corners: true,
-		shadow: true,
-		iconshadow: true
-	},
-	_create: function(){
-		var $el = this.element,
-			o = this.options;
-		
-		//add ARIA role
-		this.button = $( "<div></div>" )
-			.text( $el.text() || $el.val() )
-			.buttonMarkup({
-				theme: o.theme, 
-				icon: o.icon,
-				iconpos: o.iconpos,
-				inline: o.inline,
-				corners: o.corners,
-				shadow: o.shadow,
-				iconshadow: o.iconshadow
-			})
-			.insertBefore( $el )
-			.append( $el.addClass('ui-btn-hidden') );
-		
-		//add hidden input during submit
-		var type = $el.attr('type');
-		if( type !== 'button' && type !== 'reset' ){
-			$el.bind("vclick", function(){
-				var $buttonPlaceholder = $("<input>", 
-						{type: "hidden", name: $el.attr("name"), value: $el.attr("value")})
-						.insertBefore($el);
-						
-				//bind to doc to remove after submit handling	
-				$(document).submit(function(){
-					 $buttonPlaceholder.remove();
-				});
-			});
-		}
-		this.refresh();
-			
-	},
-
-	enable: function(){
-		this.element.attr("disabled", false);
-		this.button.removeClass("ui-disabled").attr("aria-disabled", false);
-		return this._setOption("disabled", false);
-	},
-
-	disable: function(){
-		this.element.attr("disabled", true);
-		this.button.addClass("ui-disabled").attr("aria-disabled", true);
-		return this._setOption("disabled", true);
-	},
-
-	refresh: function(){
-		if( this.element.attr('disabled') ){
-			this.disable();
-		}
-		else{
-			this.enable();
-		}
-	}
-});
-})( jQuery );/*
-* jQuery Mobile Framework : "slider" plugin
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT or GPL Version 2 licenses.
-* http://jquery.org/license
-*/
-(function($, undefined ) {
-$.widget( "mobile.slider", $.mobile.widget, {
-	options: {
-		theme: null,
-		trackTheme: null,
-		disabled: false
-	},
-	_create: function(){
-		var self = this,
-
-			control = this.element,
-
-			parentTheme = control.parents('[class*=ui-bar-],[class*=ui-body-]').eq(0),
-
-			parentTheme = parentTheme.length ? parentTheme.attr('class').match(/ui-(bar|body)-([a-z])/)[2] : 'c',
-
-			theme = this.options.theme ? this.options.theme : parentTheme,
-
-			trackTheme = this.options.trackTheme ? this.options.trackTheme : parentTheme,
-
-			cType = control[0].nodeName.toLowerCase(),
-			selectClass = (cType == 'select') ? 'ui-slider-switch' : '',
-			controlID = control.attr('id'),
-			labelID = controlID + '-label',
-			label = $('[for="'+ controlID +'"]').attr('id',labelID),
-			val = function(){
-				return (cType == 'input') ? parseFloat(control.val()) : control[0].selectedIndex;
-			},
-			min = (cType == 'input') ? parseFloat(control.attr('min')) : 0,
-			max = (cType == 'input') ? parseFloat(control.attr('max')) : control.find('option').length-1,
-			step = window.parseFloat(control.attr('step') || 1),
-			slider = $('<div class="ui-slider '+ selectClass +' ui-btn-down-'+ trackTheme+' ui-btn-corner-all" role="application"></div>'),
-			handle = $('<a href="#" class="ui-slider-handle"></a>')
-				.appendTo(slider)
-				.buttonMarkup({corners: true, theme: theme, shadow: true})
-				.attr({
-					'role': 'slider',
-					'aria-valuemin': min,
-					'aria-valuemax': max,
-					'aria-valuenow': val(),
-					'aria-valuetext': val(),
-					'title': val(),
-					'aria-labelledby': labelID
-				});
-
-		$.extend(this, {
-			slider: slider,
-			handle: handle,
-			dragging: false,
-			beforeStart: null
-		});
-
-		if(cType == 'select'){
-			slider.wrapInner('<div class="ui-slider-inneroffset"></div>');
-			var options = control.find('option');
-
-			control.find('option').each(function(i){
-				var side = (i==0) ?'b':'a',
-					corners = (i==0) ? 'right' :'left',
-					theme = (i==0) ? ' ui-btn-down-' + trackTheme :' ui-btn-active';
-				$('<div class="ui-slider-labelbg ui-slider-labelbg-'+ side + theme +' ui-btn-corner-'+ corners+'"></div>').prependTo(slider);
-				$('<span class="ui-slider-label ui-slider-label-'+ side + theme +' ui-btn-corner-'+ corners+'" role="img">'+$(this).text()+'</span>').prependTo(handle);
-			});
-
-		}
-
-		label.addClass('ui-slider');
-
-		// monitor the input for updated values
-		control
-			.addClass((cType == 'input') ? 'ui-slider-input' : 'ui-slider-switch')
-			.change(function(){
-				self.refresh( val(), true );
-			})
-			.keyup(function(){ // necessary?
-				self.refresh( val(), true, true );
-			})
-			.blur(function(){
-				self.refresh( val(), true );
-			});
-
-		// prevent screen drag when slider activated
-		$(document).bind( "vmousemove", function(event){
-			if ( self.dragging ) {
-				self.refresh( event );
-				return false;
-			}
-		});
-
-		slider
-			.bind( "vmousedown", function(event){
-				self.dragging = true;
-				if ( cType === "select" ) {
-					self.beforeStart = control[0].selectedIndex;
-				}
-				self.refresh( event );
-				return false;
-			});
-
-		slider
-			.add(document)
-			.bind( "vmouseup", function(){
-				if ( self.dragging ) {
-					self.dragging = false;
-					if ( cType === "select" ) {
-						if ( self.beforeStart === control[0].selectedIndex ) {
-							//tap occurred, but value didn't change. flip it!
-							self.refresh( self.beforeStart === 0 ? 1 : 0 );
-						}
-						var curval = val();
-						var snapped = Math.round( curval / (max - min) * 100 );
-						handle
-							.addClass("ui-slider-handle-snapping")
-							.css("left", snapped + "%")
-							.animationComplete(function(){
-								handle.removeClass("ui-slider-handle-snapping");
-							});
-					}
-					return false;
-				}
-			});
-
-		slider.insertAfter(control);
-
-		// NOTE force focus on handle
-		this.handle
-			.bind( "vmousedown", function(){
-				$(this).focus();
-			})
-			.bind( "vclick", false );
-
-		this.handle
-			.bind( "keydown", function( event ) {
-				var index = val();
-
-				if ( self.options.disabled ) {
-					return;
-				}
-
-				// In all cases prevent the default and mark the handle as active
-				switch ( event.keyCode ) {
-				 case $.mobile.keyCode.HOME:
-				 case $.mobile.keyCode.END:
-				 case $.mobile.keyCode.PAGE_UP:
-				 case $.mobile.keyCode.PAGE_DOWN:
-				 case $.mobile.keyCode.UP:
-				 case $.mobile.keyCode.RIGHT:
-				 case $.mobile.keyCode.DOWN:
-				 case $.mobile.keyCode.LEFT:
-					event.preventDefault();
-
-					if ( !self._keySliding ) {
-						self._keySliding = true;
-						$( this ).addClass( "ui-state-active" );
-					}
-					break;
-				}
-
-				// move the slider according to the keypress
-				switch ( event.keyCode ) {
-				 case $.mobile.keyCode.HOME:
-					self.refresh(min);
-					break;
-				 case $.mobile.keyCode.END:
-					self.refresh(max);
-					break;
-				 case $.mobile.keyCode.PAGE_UP:
-				 case $.mobile.keyCode.UP:
-				 case $.mobile.keyCode.RIGHT:
-					self.refresh(index + step);
-					break;
-				 case $.mobile.keyCode.PAGE_DOWN:
-				 case $.mobile.keyCode.DOWN:
-				 case $.mobile.keyCode.LEFT:
-					self.refresh(index - step);
-					break;
-				}
-			}) // remove active mark
-			.keyup(function( event ) {
-				if ( self._keySliding ) {
-					self._keySliding = false;
-					$( this ).removeClass( "ui-state-active" );
-				}
-			});
-
-		this.refresh();
-	},
-
-	refresh: function(val, isfromControl, preventInputUpdate){
-		if ( this.options.disabled ) { return; }
-
-		var control = this.element, percent,
-			cType = control[0].nodeName.toLowerCase(),
-			min = (cType === "input") ? parseFloat(control.attr("min")) : 0,
-			max = (cType === "input") ? parseFloat(control.attr("max")) : control.find("option").length - 1;
-
-		if ( typeof val === "object" ) {
-			var data = val,
-				// a slight tolerance helped get to the ends of the slider
-				tol = 8;
-			if ( !this.dragging
-					|| data.pageX < this.slider.offset().left - tol
-					|| data.pageX > this.slider.offset().left + this.slider.width() + tol ) {
-				return;
-			}
-			percent = Math.round( ((data.pageX - this.slider.offset().left) / this.slider.width() ) * 100 );
-		} else {
-			if ( val == null ) {
-				val = (cType === "input") ? parseFloat(control.val()) : control[0].selectedIndex;
-			}
-			percent = (parseFloat(val) - min) / (max - min) * 100;
-		}
-
-		if ( isNaN(percent) ) { return; }
-		if ( percent < 0 ) { percent = 0; }
-		if ( percent > 100 ) { percent = 100; }
-
-		var newval = Math.round( (percent / 100) * (max - min) ) + min;
-		if ( newval < min ) { newval = min; }
-		if ( newval > max ) { newval = max; }
-
-		//flip the stack of the bg colors
-		if ( percent > 60 && cType === "select" ) {
-
-		}
-		this.handle.css("left", percent + "%");
-		this.handle.attr({
-				"aria-valuenow": (cType === "input") ? newval : control.find("option").eq(newval).attr("value"),
-				"aria-valuetext": (cType === "input") ? newval : control.find("option").eq(newval).text(),
-				title: newval
-			});
-
-		// add/remove classes for flip toggle switch
-		if ( cType === "select" ) {
-			if ( newval === 0 ) {
-				this.slider.addClass("ui-slider-switch-a")
-					.removeClass("ui-slider-switch-b");
-			} else {
-				this.slider.addClass("ui-slider-switch-b")
-					.removeClass("ui-slider-switch-a");
-			}
-		}
-
-		if(!preventInputUpdate){
-			// update control's value
-			if ( cType === "input" ) {
-				control.val(newval);
-			} else {
-				control[ 0 ].selectedIndex = newval;
-			}
-			if (!isfromControl) { control.trigger("change"); }
-		}
-	},
-
-	enable: function(){
-		this.element.attr("disabled", false);
-		this.slider.removeClass("ui-disabled").attr("aria-disabled", false);
-		return this._setOption("disabled", false);
-	},
-
-	disable: function(){
-		this.element.attr("disabled", true);
-		this.slider.addClass("ui-disabled").attr("aria-disabled", true);
-		return this._setOption("disabled", true);
-	}
-
-});
-})( jQuery );
-
-/*
-* jQuery Mobile Framework : "collapsible" plugin
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT or GPL Version 2 licenses.
-* http://jquery.org/license
-*/
-( function( $, undefined ) {
-$.widget( "mobile.collapsible", $.mobile.widget, {
-	options: {
-		expandCueText: " click to expand contents",
-		collapseCueText: " click to collapse contents",
-		collapsed: false,
-		heading: ">:header,>legend",
-		theme: null,
-		iconTheme: "d"
-	},
-	_create: function() {
-
-		var $el = this.element,
-			o = this.options,
-			collapsibleContain = $el.addClass( "ui-collapsible-contain" ),
-			collapsibleHeading = $el.find( o.heading ).eq( 0 ),
-			collapsibleContent = collapsibleContain.wrapInner( '<div class="ui-collapsible-content"></div>' ).find( ".ui-collapsible-content" ),
-			collapsibleParent = $el.closest( ":jqmData(role='collapsible-set')" ).addClass( "ui-collapsible-set" );
-
-		//replace collapsibleHeading if it's a legend
-		if ( collapsibleHeading.is( "legend" ) ) {
-			collapsibleHeading = $( '<div role="heading">'+ collapsibleHeading.html() +"</div>" ).insertBefore( collapsibleHeading );
-			collapsibleHeading.next().remove();
-		}
-
-		collapsibleHeading
-			//drop heading in before content
-			.insertBefore( collapsibleContent )
-			//modify markup & attributes
-			.addClass( "ui-collapsible-heading" )
-			.append( '<span class="ui-collapsible-heading-status"></span>' )
-			.wrapInner( '<a href="#" class="ui-collapsible-heading-toggle"></a>' )
-			.find( "a:eq(0)" )
-				.buttonMarkup( {
-					shadow: !collapsibleParent.length,
-					corners: false,
-					iconPos: "left",
-					icon: "plus",
-					theme: o.theme
-				} )
-				.find( ".ui-icon" )
-					.removeAttr( "class" )
-					.buttonMarkup( {
-						shadow: true,
-						corners: true,
-						iconPos: "notext",
-						icon: "plus",
-						theme: o.iconTheme
-					} );
-
-			if ( ! collapsibleParent.length ) {
-				collapsibleHeading
-					.find( "a:eq(0)" )
-						.addClass( "ui-corner-all" )
-						.find( ".ui-btn-inner" )
-							.addClass( "ui-corner-all" );
-			}
-			else {
-				if ( collapsibleContain.jqmData( "collapsible-last" ) ) {
-					collapsibleHeading
-						.find( "a:eq(0), .ui-btn-inner" )
-							.addClass( "ui-corner-bottom" );
-				}
-			}
-
-		//events
-		collapsibleContain
-			.bind( "collapse", function( event ) {
-				if ( ! event.isDefaultPrevented() && $( event.target ).closest( ".ui-collapsible-contain" ).is( collapsibleContain ) ) {
-					event.preventDefault();
-					collapsibleHeading
-						.addClass( "ui-collapsible-heading-collapsed" )
-						.find( ".ui-collapsible-heading-status" )
-							.text( o.expandCueText )
-						.end()
-						.find( ".ui-icon" )
-							.removeClass( "ui-icon-minus" )
-							.addClass( "ui-icon-plus" );
-					collapsibleContent.addClass( "ui-collapsible-content-collapsed" ).attr( "aria-hidden", true );
-
-					if ( collapsibleContain.jqmData( "collapsible-last" ) ) {
-						collapsibleHeading
-							.find( "a:eq(0), .ui-btn-inner" )
-							.addClass( "ui-corner-bottom" );
-					}
-				}
-
-			} )
-			.bind( "expand", function( event ) {	
-				if ( ! event.isDefaultPrevented() ) {
-					event.preventDefault();
-					collapsibleHeading
-						.removeClass( "ui-collapsible-heading-collapsed" )
-						.find( ".ui-collapsible-heading-status" ).text( o.collapseCueText );
-
-					collapsibleHeading.find( ".ui-icon" ).removeClass( "ui-icon-plus" ).addClass( "ui-icon-minus" );
-					collapsibleContent.removeClass( "ui-collapsible-content-collapsed" ).attr( "aria-hidden", false );
-
-					if ( collapsibleContain.jqmData( "collapsible-last" ) ) {
-						collapsibleHeading
-							.find( "a:eq(0), .ui-btn-inner" )
-							.removeClass( "ui-corner-bottom" );
-					}
-				}
-			} )
-			.trigger( o.collapsed ? "collapse" : "expand" );
-
-
-		//close others in a set
-		if ( collapsibleParent.length && !collapsibleParent.jqmData( "collapsiblebound" ) ) {
-			collapsibleParent
-				.jqmData( "collapsiblebound", true )
-				.bind( "expand", function( event ){
-					
-					$( event.target )
-						.closest( ".ui-collapsible-contain" )
-						.siblings( ".ui-collapsible-contain" )
-						.trigger( "collapse" );
-					
-				} );
-
-
-			var set = collapsibleParent.find( ":jqmData(role='collapsible'):first" );
-
-			set.first()
-				.find( "a:eq(0)" )
-					.addClass( "ui-corner-top" )
-						.find( ".ui-btn-inner" )
-							.addClass( "ui-corner-top" );
-
-			set.last().jqmData( "collapsible-last", true );
-		}
-
-		collapsibleHeading
-			.bind( "vclick", function( e ) {
-				if ( collapsibleHeading.is( ".ui-collapsible-heading-collapsed" ) ) {
-					collapsibleContain.trigger( "expand" );
-				}
-				else {
-					collapsibleContain.trigger( "collapse" );
-				}
-				e.preventDefault();
-			} );
-	}
-} );
-} )( jQuery );
-/*
-* jQuery Mobile Framework: "controlgroup" plugin - corner-rounding for groups of buttons, checks, radios, etc
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT or GPL Version 2 licenses.
-* http://jquery.org/license
-*/
-(function($, undefined ) {
-$.fn.controlgroup = function(options){
-		
-	return this.each(function(){
-		var o = $.extend({
-			direction: $( this ).jqmData( "type" ) || "vertical",
-			shadow: false
-		},options);
-		var groupheading = $(this).find('>legend'),
-			flCorners = o.direction == 'horizontal' ? ['ui-corner-left', 'ui-corner-right'] : ['ui-corner-top', 'ui-corner-bottom'],
-			type = $(this).find('input:eq(0)').attr('type');
-		
-		//replace legend with more stylable replacement div	
-		if( groupheading.length ){
-			$(this).wrapInner('<div class="ui-controlgroup-controls"></div>');	
-			$('<div role="heading" class="ui-controlgroup-label">'+ groupheading.html() +'</div>').insertBefore( $(this).children(0) );	
-			groupheading.remove();	
-		}
-
-		$(this).addClass('ui-corner-all ui-controlgroup ui-controlgroup-'+o.direction);
-		
-		function flipClasses(els){
-			els
-				.removeClass('ui-btn-corner-all ui-shadow')
-				.eq(0).addClass(flCorners[0])
-				.end()
-				.filter(':last').addClass(flCorners[1]).addClass('ui-controlgroup-last');
-		}
-		flipClasses($(this).find('.ui-btn'));
-		flipClasses($(this).find('.ui-btn-inner'));
-		if(o.shadow){
-			$(this).addClass('ui-shadow');
-		}
-	});	
-};
-})(jQuery);/*
-* jQuery Mobile Framework : "fieldcontain" plugin - simple class additions to make form row separators
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT or GPL Version 2 licenses.
-* http://jquery.org/license
-*/
-(function($, undefined ) {
-$.fn.fieldcontain = function(options){
-	return this.addClass('ui-field-contain ui-body ui-br');
-};
-})(jQuery);/*
-* jQuery Mobile Framework : "listview" plugin
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT or GPL Version 2 licenses.
-* http://jquery.org/license
-*/
-(function($, undefined ) {
-//Keeps track of the number of lists per page UID
-//This allows support for multiple nested list in the same page
-//https://github.com/jquery/jquery-mobile/issues/1617
-var listCountPerPage = {};
-
-$.widget( "mobile.listview", $.mobile.widget, {
-	options: {
-		theme: "c",
-		countTheme: "c",
-		headerTheme: "b",
-		dividerTheme: "b",
-		splitIcon: "arrow-r",
-		splitTheme: "b",
-		inset: false
-	},
-	
-	_create: function() {
-		var t = this;
-
-		// create listview markup 
-		t.element.addClass(function( i, orig ) {
-			return orig + " ui-listview " + ( t.options.inset ? " ui-listview-inset ui-corner-all ui-shadow " : "" );
-		});
-
-		t.refresh();
-	},
-
-	_itemApply: function( $list, item ) {
-		// TODO class has to be defined in markup
-		item.find( ".ui-li-count" )
-			.addClass( "ui-btn-up-" + ($list.jqmData( "counttheme" ) || this.options.countTheme) + " ui-btn-corner-all" ).end()
-		.find( "h1, h2, h3, h4, h5, h6" ).addClass( "ui-li-heading" ).end()
-		.find( "p, dl" ).addClass( "ui-li-desc" ).end()
-		.find( ">img:eq(0), .ui-link-inherit>img:eq(0)" ).addClass( "ui-li-thumb" ).each(function() {
-			item.addClass( $(this).is( ".ui-li-icon" ) ? "ui-li-has-icon" : "ui-li-has-thumb" );
-		}).end()
-		.find( ".ui-li-aside" ).each(function() {
-			var $this = $(this);
-			$this.prependTo( $this.parent() ); //shift aside to front for css float
-		});
-	},
-	
-	_removeCorners: function( li ) {
-		li
-			.add( li.find(".ui-btn-inner, .ui-li-link-alt, .ui-li-thumb") )
-			.removeClass( "ui-corner-top ui-corner-bottom ui-corner-br ui-corner-bl ui-corner-tr ui-corner-tl" );
-	},
-	
-	refresh: function( create ) {
-		this._createSubPages();
-		
-		var o = this.options,
-			$list = this.element,
-			self = this,
-			dividertheme = $list.jqmData( "dividertheme" ) || o.dividerTheme,
-			listsplittheme = $list.jqmData( "splittheme" ),
-			listspliticon = $list.jqmData( "spliticon" ),
-			li = $list.children( "li" ),
-			counter = $.support.cssPseudoElement || !$.nodeName( $list[0], "ol" ) ? 0 : 1;
-
-		if ( counter ) {
-			$list.find( ".ui-li-dec" ).remove();
-		}
-
-		for (var pos = 0, numli = li.length; pos < numli; pos++) {
-			var item = li.eq(pos),
-				itemClass = "ui-li";
-
-			// If we're creating the element, we update it regardless
-			if ( create || !item.hasClass( "ui-li" ) ) {
-                var itemTheme = item.jqmData("theme") || o.theme,
-                    a = item.children( "a" );
-
-                if ( a.length ) {
-                    var icon = item.jqmData("icon");
-
-                    item
-                        .buttonMarkup({
-                            wrapperEls: "div",
-                            shadow: false,
-                            corners: false,
-                            iconpos: "right",
-                            icon: a.length > 1 || icon === false ? false : icon || "arrow-r",
-                            theme: itemTheme
-                        });
-
-                    a.first().addClass( "ui-link-inherit" );
-
-                    if ( a.length > 1 ) {
-                        itemClass += " ui-li-has-alt";
-
-                        var last = a.last(),
-                            splittheme = listsplittheme || last.jqmData( "theme" ) || o.splitTheme;
-
-                        last
-                            .appendTo(item)
-                            .attr( "title", last.text() )
-                            .addClass( "ui-li-link-alt" )
-                            .empty()
-                            .buttonMarkup({
-                                shadow: false,
-                                corners: false,
-                                theme: itemTheme,
-                                icon: false,
-                                iconpos: false
-                            })
-                            .find( ".ui-btn-inner" )
-                                .append( $( "<span />" ).buttonMarkup({
-                                    shadow: true,
-                                    corners: true,
-                                    theme: splittheme,
-                                    iconpos: "notext",
-                                    icon: listspliticon || last.jqmData( "icon" ) ||  o.splitIcon
-                                } ) );
-                    }
-
-                } else if ( item.jqmData( "role" ) === "list-divider" ) {
-                    itemClass += " ui-li-divider ui-btn ui-bar-" + dividertheme;
-                    item.attr( "role", "heading" );
-
-                    //reset counter when a divider heading is encountered
-                    if ( counter ) {
-                        counter = 1;
-                    }
-
-                } else {
-                    itemClass += " ui-li-static ui-body-" + itemTheme;
-                }
-            }
-			
-			
-			if( o.inset ){	
-				if ( pos === 0 ) {
-						itemClass += " ui-corner-top";
-	
-						item
-							.add( item.find( ".ui-btn-inner" ) )
-							.find( ".ui-li-link-alt" )
-								.addClass( "ui-corner-tr" )
-							.end()
-							.find( ".ui-li-thumb" )
-								.addClass( "ui-corner-tl" );
-						if(item.next().next().length){
-							self._removeCorners( item.next() );		
-						}
-	
-				}
-				if ( pos === li.length - 1 ) {
-						itemClass += " ui-corner-bottom";
-	
-						item
-							.add( item.find( ".ui-btn-inner" ) )
-							.find( ".ui-li-link-alt" )
-								.addClass( "ui-corner-br" )
-							.end()
-							.find( ".ui-li-thumb" )
-								.addClass( "ui-corner-bl" );
-						
-						if(item.prev().prev().length){
-							self._removeCorners( item.prev() );		
-						}	
-				}
-			}
-
-
-			if ( counter && itemClass.indexOf( "ui-li-divider" ) < 0 ) {
-			
-				var countParent = item.is(".ui-li-static:first") ? item : item.find( ".ui-link-inherit" );
-				
-				countParent
-					.addClass( "ui-li-jsnumbering" )
-					.prepend( "<span class='ui-li-dec'>" + (counter++) + ". </span>" );
-			}
-
-			item.add( item.children( ".ui-btn-inner" ) ).addClass( itemClass );
-
-			if ( !create ) {
-				self._itemApply( $list, item );
-			}
-		}
-	},
-	
-	//create a string for ID/subpage url creation
-	_idStringEscape: function( str ){
-		return str.replace(/[^a-zA-Z0-9]/g, '-');
-	},
-
-	_createSubPages: function() {
-		var parentList = this.element,
-			parentPage = parentList.closest( ".ui-page" ),
-			parentUrl = parentPage.jqmData( "url" ),
-			parentId  = parentUrl || parentPage[ 0 ][ $.expando ],
-			parentListId = parentList.attr( "id" ),
-			o = this.options,
-			dns = "data-" + $.mobile.ns,
-			self = this,
-			persistentFooterID = parentPage.find( ":jqmData(role='footer')" ).jqmData( "id" );
-
-		if ( typeof( listCountPerPage[ parentId ] ) === 'undefined' ) {
-			listCountPerPage[ parentId ] = -1;
-		}
-		parentListId = parentListId || ++listCountPerPage[ parentId ];
-
-		$( parentList.find( "li>ul, li>ol" ).toArray().reverse() ).each(function( i ) {
-			var list = $( this ),
-				listId = list.attr( "id" ) || parentListId + "-" + i,
-				parent = list.parent(),
-				nodeEls = $( list.prevAll().toArray().reverse() ),
-				nodeEls = nodeEls.length ? nodeEls : $( "<span>" + $.trim(parent.contents()[ 0 ].nodeValue) + "</span>" ),
-				title = nodeEls.first().text(),//url limits to first 30 chars of text
-				id = ( parentUrl || "" ) + "&" + $.mobile.subPageUrlKey + "=" + listId;
-				theme = list.jqmData( "theme" ) || o.theme,
-				countTheme = list.jqmData( "counttheme" ) || parentList.jqmData( "counttheme" ) || o.countTheme,
-				newPage = list.detach()
-							.wrap( "<div " + dns + "role='page' " +  dns + "url='" + id + "' " + dns + "theme='" + theme + "' " + dns + "count-theme='" + countTheme + "'><div " + dns + "role='content'></div></div>" )
-							.parent()
-								.before( "<div " + dns + "role='header' " + dns + "theme='" + o.headerTheme + "'><div class='ui-title'>" + title + "</div></div>" )
-								.after( persistentFooterID ? $( "<div " + dns + "role='footer' " + dns + "id='"+ persistentFooterID +"'>") : "" )
-								.parent()
-									.appendTo( $.mobile.pageContainer );
-
-				newPage.page();		
-			var anchor = parent.find('a:first');
-			if ( !anchor.length ) {
-				anchor = $("<a />").html( nodeEls || title ).prependTo( parent.empty() );
-			}
-			anchor.attr('href','#' + id);
-		}).listview();
-	}
-});
-
-})( jQuery );
-/*
-* jQuery Mobile Framework : "listview" filter extension
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT or GPL Version 2 licenses.
-* http://jquery.org/license
-*/
-(function($, undefined ) {
-
-$.mobile.listview.prototype.options.filter = false;
-$.mobile.listview.prototype.options.filterPlaceholder = "Filter items...";
-$.mobile.listview.prototype.options.filterTheme = "c";
-
-$( ":jqmData(role='listview')" ).live( "listviewcreate", function() {
-	var list = $( this ),
-		listview = list.data( "listview" );
-
-	if ( !listview.options.filter ) {
-		return;
-	}
-
-	var wrapper = $( "<form>", { "class": "ui-listview-filter ui-bar-" + listview.options.filterTheme, "role": "search" } ),
-
-		search = $( "<input>", {
-				placeholder: listview.options.filterPlaceholder
-			})
-			.attr( "data-" + $.mobile.ns + "type", "search" )
-			.jqmData( 'lastval', "" )
-			.bind( "keyup change", function() {
-
-				var val = this.value.toLowerCase(),
-					listItems=null,
-					lastval = $( this ).jqmData('lastval')+"";
-
-				//change val as lastval for next execution  
-				$(this).jqmData( 'lastval' , val );
-
-				change = val.replace( new RegExp( "^" + lastval ) , "" );
-
-				if( val.length < lastval.length || change.length != ( val.length - lastval.length ) ){
-
-					//removed chars or pasted something totaly different, check all items
-					listItems = list.children();
-				} else {
-
-					//only chars added, not removed, only use visible subset
-					listItems = list.children( ':not(.ui-screen-hidden)' );
-				}
-
-				if ( val ) {
-
-					// This handles hiding regular rows without the text we search for
-					// and any list dividers without regular rows shown under it
-					var item, 
-						childItems = false,                        
-						itemtext="";
-
-					for ( var i = listItems.length - 1; i >= 0; i-- ) {
-						item = $( listItems[i] );
-						itemtext = item.jqmData( 'filtertext' ) || item.text();
-
-						if ( item.is( "li:jqmData(role=list-divider)" ) ) {
-
-							item.toggleClass( 'ui-filter-hidequeue' , !childItems );
-
-							// New bucket!
-							childItems = false;
-
-						} else if ( itemtext.toLowerCase().indexOf( val ) === -1) {
-
-							//mark to be hidden
-							item.toggleClass( 'ui-filter-hidequeue' , true );
-						} else {
-
-							// There's a shown item in the bucket
-							childItems = true;
-						}
-					}
-
-					// show items, not marked to be hidden
-					listItems
-						.filter( ':not(.ui-filter-hidequeue)' )
-						.toggleClass('ui-screen-hidden',false);
-
-					// hide items, marked to be hidden
-					listItems
-						.filter( '.ui-filter-hidequeue' )
-						.toggleClass('ui-screen-hidden',true)
-						.toggleClass( 'ui-filter-hidequeue' , false );
-
-				}else{
-
-					//filtervalue is empty => show all
-					listItems.toggleClass('ui-screen-hidden',false);
-				}
-			})
-			.appendTo( wrapper )
-			.textinput();
-
-	if ($( this ).jqmData( "inset" ) ) {
-		wrapper.addClass( "ui-listview-filter-inset" );
-	}
-
-	wrapper.insertBefore( list );
-});
-
-})( jQuery );/*
-* jQuery Mobile Framework : "dialog" plugin.
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.
-* Note: Code is in draft form and is subject to change
-*/
-( function( $, undefined ) {
-$.widget( "mobile.dialog", $.mobile.widget, {
-	options: {
-		closeBtnText: "Close"
-	},
-	_create: function() {
-		var $el = this.element;
-		
-		/* class the markup for dialog styling */	
-		$el
-			//add ARIA role
-			.attr( "role", "dialog" )
-			.addClass( "ui-page ui-dialog ui-body-a" )
-			.find( ":jqmData(role=header)" )
-			.addClass( "ui-corner-top ui-overlay-shadow" )
-				.prepend( "<a href='#' data-" + $.mobile.ns + "icon='delete' data-" + $.mobile.ns + "rel='back' data-" + $.mobile.ns + "iconpos='notext'>"+ this.options.closeBtnText +"</a>" )
-			.end()
-			.find( '.ui-content:not([class*="ui-body-"])' )
-				.addClass( 'ui-body-c' )
-			.end()
-			.find( ".ui-content,:jqmData(role='footer')" )
-				.last()
-				.addClass( "ui-corner-bottom ui-overlay-shadow" );
-		
-		/* bind events 
-			- clicks and submits should use the closing transition that the dialog opened with
-			  unless a data-transition is specified on the link/form
-			- if the click was on the close button, or the link has a data-rel="back" it'll go back in history naturally
-		*/
-		$el
-			.bind( "vclick submit", function( e ) {
-				var $target = $( e.target ).closest( e.type === "vclick" ? "a" : "form" );
-				
-				if( $target.length && ! $target.jqmData( "transition" ) ) {
-					var active = $.mobile.urlHistory.getActive() || {};
-					$target
-						.attr( "data-" + $.mobile.ns + "transition", ( active.transition || $.mobile.defaultDialogTransition ) )
-						.attr( "data-" + $.mobile.ns + "direction", "reverse" );
-				}
-			})
-			.bind( "pagehide", function() {
-				$( this ).find( "." + $.mobile.activeBtnClass ).removeClass( $.mobile.activeBtnClass );
-			});
-	},
-	
-	//close method goes back in history
-	close: function() {
-		window.history.back();
-	}
-});
-})( jQuery );
-/*
-* jQuery Mobile Framework : "navbar" plugin
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT or GPL Version 2 licenses.
-* http://jquery.org/license
-*/
-(function($, undefined ) {
-$.widget( "mobile.navbar", $.mobile.widget, {
-	options: {
-		iconpos: 'top',
-		grid: null
-	},
-	_create: function(){
-		var $navbar = this.element,
-			$navbtns = $navbar.find("a"),
-			iconpos = $navbtns.filter( ":jqmData(icon)").length ? this.options.iconpos : undefined;
-		
-		$navbar
-			.addClass('ui-navbar')
-			.attr("role","navigation")
-			.find("ul")
-				.grid({grid: this.options.grid });		
-		
-		if( !iconpos ){ 
-			$navbar.addClass("ui-navbar-noicons");
-		}
-		
-		$navbtns
-			.buttonMarkup({
-				corners:	false, 
-				shadow:		false, 
-				iconpos:	iconpos
-			});
-		
-		$navbar.delegate("a", "vclick",function(event){
-			$navbtns.not( ".ui-state-persist" ).removeClass( $.mobile.activeBtnClass );
-			$( this ).addClass( $.mobile.activeBtnClass );
-		});	
-	}
-});
-})( jQuery );
-/*
-* jQuery Mobile Framework : plugin for creating CSS grids
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT or GPL Version 2 licenses.
-* http://jquery.org/license
-*/ 
-(function($, undefined ) {
-$.fn.grid = function(options){
-	return this.each(function(){
-		var o = $.extend({
-			grid: null
-		},options);
-	
-			
-		var $kids = $(this).children(),
-			gridCols = {solo:1, a:2, b:3, c:4, d:5},
-			grid = o.grid,
-			iterator;
-			
-			if( !grid ){
-				if( $kids.length <= 5 ){
-					for(var letter in gridCols){
-						if(gridCols[letter] == $kids.length){ grid = letter; }
-					}
-				}
-				else{
-					grid = 'a';
-				}
-			}
-			iterator = gridCols[grid];
-			
-		$(this).addClass('ui-grid-' + grid);
-	
-		$kids.filter(':nth-child(' + iterator + 'n+1)').addClass('ui-block-a');
-		if(iterator > 1){	
-			$kids.filter(':nth-child(' + iterator + 'n+2)').addClass('ui-block-b');
-		}	
-		if(iterator > 2){	
-			$kids.filter(':nth-child(3n+3)').addClass('ui-block-c');
-		}	
-		if(iterator > 3){	
-			$kids.filter(':nth-child(4n+4)').addClass('ui-block-d');
-		}	
-		if(iterator > 4){	
-			$kids.filter(':nth-child(5n+5)').addClass('ui-block-e');
-		}
-				
-	});	
-};
-})(jQuery);/*!
- * jQuery Mobile v@VERSION
- * http://jquerymobile.com/
- *
- * Copyright 2010, jQuery Project
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- */
-
-(function( $, window, undefined ) {
-	var	$html = $( "html" ),
-			$head = $( "head" ),
-			$window = $( window );
-
- 	//trigger mobileinit event - useful hook for configuring $.mobile settings before they're used
-	$( window.document ).trigger( "mobileinit" );
-
-	//support conditions
-	//if device support condition(s) aren't met, leave things as they are -> a basic, usable experience,
-	//otherwise, proceed with the enhancements
-	if ( !$.mobile.gradeA() ) {
-		return;
-	}
-	
-	// override ajaxEnabled on platforms that have known conflicts with hash history updates 
-	// or generally work better browsing in regular http for full page refreshes (BB5, Opera Mini)
-	if( window.blackberry && !window.WebKitPoint || window.operamini && Object.prototype.toString.call( window.operamini ) === "[object OperaMini]" ){
-		$.mobile.ajaxEnabled = false;
-	}
-
-	//add mobile, initial load "rendering" classes to docEl
-	$html.addClass( "ui-mobile ui-mobile-rendering" );
-
-	//loading div which appears during Ajax requests
-	//will not appear if $.mobile.loadingMessage is false
-	var $loader = $.mobile.loadingMessage ?		$( "<div class='ui-loader ui-body-a ui-corner-all'>" + "<span class='ui-icon ui-icon-loading spin'></span>" + "<h1>" + $.mobile.loadingMessage + "</h1>" + "</div>" )	: undefined;
-
-	$.extend($.mobile, {
-		// turn on/off page loading message.
-		showPageLoadingMsg: function() {
-			if( $.mobile.loadingMessage ){
-				var activeBtn = $( "." + $.mobile.activeBtnClass ).first();
-			
-				$loader
-					.appendTo( $.mobile.pageContainer )
-					//position at y center (if scrollTop supported), above the activeBtn (if defined), or just 100px from top
-					.css( {
-						top: $.support.scrollTop && $(window).scrollTop() + $(window).height() / 2 ||
-						activeBtn.length && activeBtn.offset().top || 100
-					} );
-			}
-			
-			$html.addClass( "ui-loading" );
-		},
-
-		hidePageLoadingMsg: function() {
-			$html.removeClass( "ui-loading" );
-		},
-
-		// XXX: deprecate for 1.0
-		pageLoading: function ( done ) {
-			if ( done ) {
-				$.mobile.hidePageLoadingMsg();
-			} else {
-				$.mobile.showPageLoadingMsg();
-			}
-		},
-
-		// find and enhance the pages in the dom and transition to the first page.
-		initializePage: function(){
-			//find present pages
-			var $pages = $( ":jqmData(role='page')" );
-
-			//add dialogs, set data-url attrs
-			$pages.add( ":jqmData(role='dialog')" ).each(function(){
-				var $this = $(this);
-
-				// unless the data url is already set set it to the id
-				if( !$this.jqmData('url') ){
-					$this.attr( "data-" + $.mobile.ns + "url", $this.attr( "id" ) );
-				}
-			});
-
-			//define first page in dom case one backs out to the directory root (not always the first page visited, but defined as fallback)
-			$.mobile.firstPage = $pages.first();
-
-			//define page container
-			$.mobile.pageContainer = $pages.first().parent().addClass( "ui-mobile-viewport" );
-
-			//cue page loading message
-			$.mobile.showPageLoadingMsg();
-
-			// if hashchange listening is disabled or there's no hash deeplink, change to the first page in the DOM
-			if( !$.mobile.hashListeningEnabled || !$.mobile.path.stripHash( location.hash ) ){
-				$.mobile.changePage( $.mobile.firstPage, { transition: "none", reverse: true, changeHash: false, fromHashChange: true } );
-			}
-			// otherwise, trigger a hashchange to load a deeplink
-			else {
-				$window.trigger( "hashchange", [ true ] );
-			}
-		}
-	});
-	
-	//check which scrollTop value should be used by scrolling to 1 immediately at domready
-	//then check what the scroll top is. Android will report 0... others 1
-	//note that this initial scroll won't hide the address bar. It's just for the check.
-	$(function(){
-		window.scrollTo( 0, 1 );
-	
-		//if defaultHomeScroll hasn't been set yet, see if scrollTop is 1
-		//it should be 1 in most browsers, but android treats 1 as 0 (for hiding addr bar)
-		//so if it's 1, use 0 from now on
-		$.mobile.defaultHomeScroll = ( !$.support.scrollTop || $(window).scrollTop() === 1 ) ? 0 : 1;
-	
-		//dom-ready inits
-		$( $.mobile.initializePage );
-	
-		//window load event
-		//hide iOS browser chrome on load
-		$window.load( $.mobile.silentScroll );
-	});
-})( jQuery, this );
-

--- /dev/null
+++ b/js/jquery.mobile-1.0b2.js
@@ -1,1 +1,6260 @@
-
+/*!
+ * jQuery Mobile v1.0b2
+ * http://jquerymobile.com/
+ *
+ * Copyright 2010, jQuery Project
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ */
+/*!
+ * jQuery UI Widget @VERSION
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Widget
+ */
+(function( $, undefined ) {
+
+// jQuery 1.4+
+if ( $.cleanData ) {
+	var _cleanData = $.cleanData;
+	$.cleanData = function( elems ) {
+		for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) {
+			$( elem ).triggerHandler( "remove" );
+		}
+		_cleanData( elems );
+	};
+} else {
+	var _remove = $.fn.remove;
+	$.fn.remove = function( selector, keepData ) {
+		return this.each(function() {
+			if ( !keepData ) {
+				if ( !selector || $.filter( selector, [ this ] ).length ) {
+					$( "*", this ).add( [ this ] ).each(function() {
+						$( this ).triggerHandler( "remove" );
+					});
+				}
+			}
+			return _remove.call( $(this), selector, keepData );
+		});
+	};
+}
+
+$.widget = function( name, base, prototype ) {
+	var namespace = name.split( "." )[ 0 ],
+		fullName;
+	name = name.split( "." )[ 1 ];
+	fullName = namespace + "-" + name;
+
+	if ( !prototype ) {
+		prototype = base;
+		base = $.Widget;
+	}
+
+	// create selector for plugin
+	$.expr[ ":" ][ fullName ] = function( elem ) {
+		return !!$.data( elem, name );
+	};
+
+	$[ namespace ] = $[ namespace ] || {};
+	$[ namespace ][ name ] = function( options, element ) {
+		// allow instantiation without initializing for simple inheritance
+		if ( arguments.length ) {
+			this._createWidget( options, element );
+		}
+	};
+
+	var basePrototype = new base();
+	// we need to make the options hash a property directly on the new instance
+	// otherwise we'll modify the options hash on the prototype that we're
+	// inheriting from
+//	$.each( basePrototype, function( key, val ) {
+//		if ( $.isPlainObject(val) ) {
+//			basePrototype[ key ] = $.extend( {}, val );
+//		}
+//	});
+	basePrototype.options = $.extend( true, {}, basePrototype.options );
+	$[ namespace ][ name ].prototype = $.extend( true, basePrototype, {
+		namespace: namespace,
+		widgetName: name,
+		widgetEventPrefix: $[ namespace ][ name ].prototype.widgetEventPrefix || name,
+		widgetBaseClass: fullName
+	}, prototype );
+
+	$.widget.bridge( name, $[ namespace ][ name ] );
+};
+
+$.widget.bridge = function( name, object ) {
+	$.fn[ name ] = function( options ) {
+		var isMethodCall = typeof options === "string",
+			args = Array.prototype.slice.call( arguments, 1 ),
+			returnValue = this;
+
+		// allow multiple hashes to be passed on init
+		options = !isMethodCall && args.length ?
+			$.extend.apply( null, [ true, options ].concat(args) ) :
+			options;
+
+		// prevent calls to internal methods
+		if ( isMethodCall && options.charAt( 0 ) === "_" ) {
+			return returnValue;
+		}
+
+		if ( isMethodCall ) {
+			this.each(function() {
+				var instance = $.data( this, name );
+				if ( !instance ) {
+					throw "cannot call methods on " + name + " prior to initialization; " +
+						"attempted to call method '" + options + "'";
+				}
+				if ( !$.isFunction( instance[options] ) ) {
+					throw "no such method '" + options + "' for " + name + " widget instance";
+				}
+				var methodValue = instance[ options ].apply( instance, args );
+				if ( methodValue !== instance && methodValue !== undefined ) {
+					returnValue = methodValue;
+					return false;
+				}
+			});
+		} else {
+			this.each(function() {
+				var instance = $.data( this, name );
+				if ( instance ) {
+					instance.option( options || {} )._init();
+				} else {
+					$.data( this, name, new object( options, this ) );
+				}
+			});
+		}
+
+		return returnValue;
+	};
+};
+
+$.Widget = function( options, element ) {
+	// allow instantiation without initializing for simple inheritance
+	if ( arguments.length ) {
+		this._createWidget( options, element );
+	}
+};
+
+$.Widget.prototype = {
+	widgetName: "widget",
+	widgetEventPrefix: "",
+	options: {
+		disabled: false
+	},
+	_createWidget: function( options, element ) {
+		// $.widget.bridge stores the plugin instance, but we do it anyway
+		// so that it's stored even before the _create function runs
+		$.data( element, this.widgetName, this );
+		this.element = $( element );
+		this.options = $.extend( true, {},
+			this.options,
+			this._getCreateOptions(),
+			options );
+
+		var self = this;
+		this.element.bind( "remove." + this.widgetName, function() {
+			self.destroy();
+		});
+
+		this._create();
+		this._trigger( "create" );
+		this._init();
+	},
+	_getCreateOptions: function() {
+		var options = {};
+		if ( $.metadata ) {
+			options = $.metadata.get( element )[ this.widgetName ];
+		}
+		return options;
+	},
+	_create: function() {},
+	_init: function() {},
+
+	destroy: function() {
+		this.element
+			.unbind( "." + this.widgetName )
+			.removeData( this.widgetName );
+		this.widget()
+			.unbind( "." + this.widgetName )
+			.removeAttr( "aria-disabled" )
+			.removeClass(
+				this.widgetBaseClass + "-disabled " +
+				"ui-state-disabled" );
+	},
+
+	widget: function() {
+		return this.element;
+	},
+
+	option: function( key, value ) {
+		var options = key;
+
+		if ( arguments.length === 0 ) {
+			// don't return a reference to the internal hash
+			return $.extend( {}, this.options );
+		}
+
+		if  (typeof key === "string" ) {
+			if ( value === undefined ) {
+				return this.options[ key ];
+			}
+			options = {};
+			options[ key ] = value;
+		}
+
+		this._setOptions( options );
+
+		return this;
+	},
+	_setOptions: function( options ) {
+		var self = this;
+		$.each( options, function( key, value ) {
+			self._setOption( key, value );
+		});
+
+		return this;
+	},
+	_setOption: function( key, value ) {
+		this.options[ key ] = value;
+
+		if ( key === "disabled" ) {
+			this.widget()
+				[ value ? "addClass" : "removeClass"](
+					this.widgetBaseClass + "-disabled" + " " +
+					"ui-state-disabled" )
+				.attr( "aria-disabled", value );
+		}
+
+		return this;
+	},
+
+	enable: function() {
+		return this._setOption( "disabled", false );
+	},
+	disable: function() {
+		return this._setOption( "disabled", true );
+	},
+
+	_trigger: function( type, event, data ) {
+		var callback = this.options[ type ];
+
+		event = $.Event( event );
+		event.type = ( type === this.widgetEventPrefix ?
+			type :
+			this.widgetEventPrefix + type ).toLowerCase();
+		data = data || {};
+
+		// copy original event properties over to the new event
+		// this would happen if we could call $.event.fix instead of $.Event
+		// but we don't have a way to force an event to be fixed multiple times
+		if ( event.originalEvent ) {
+			for ( var i = $.event.props.length, prop; i; ) {
+				prop = $.event.props[ --i ];
+				event[ prop ] = event.originalEvent[ prop ];
+			}
+		}
+
+		this.element.trigger( event, data );
+
+		return !( $.isFunction(callback) &&
+			callback.call( this.element[0], event, data ) === false ||
+			event.isDefaultPrevented() );
+	}
+};
+
+})( jQuery );
+/*
+* jQuery Mobile Framework : widget factory extentions for mobile
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT or GPL Version 2 licenses.
+* http://jquery.org/license
+*/
+
+(function( $, undefined ) {
+
+$.widget( "mobile.widget", {
+	_getCreateOptions: function() {
+
+		var elem = this.element,
+			options = {};
+
+		$.each( this.options, function( option ) {
+
+			var value = elem.jqmData( option.replace( /[A-Z]/g, function( c ) {
+							return "-" + c.toLowerCase();
+						})
+					);
+
+			if ( value !== undefined ) {
+				options[ option ] = value;
+			}
+		});
+
+		return options;
+	}
+});
+
+})( jQuery );
+/*
+* jQuery Mobile Framework : resolution and CSS media query related helpers and behavior
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT or GPL Version 2 licenses.
+* http://jquery.org/license
+*/
+(function( $, undefined ) {
+
+var $window = $( window ),
+	$html = $( "html" );
+
+/* $.mobile.media method: pass a CSS media type or query and get a bool return
+	note: this feature relies on actual media query support for media queries, though types will work most anywhere
+	examples:
+		$.mobile.media('screen') //>> tests for screen media type
+		$.mobile.media('screen and (min-width: 480px)') //>> tests for screen media type with window width > 480px
+		$.mobile.media('@media screen and (-webkit-min-device-pixel-ratio: 2)') //>> tests for webkit 2x pixel ratio (iPhone 4)
+*/
+$.mobile.media = (function() {
+	// TODO: use window.matchMedia once at least one UA implements it
+	var cache = {},
+		testDiv = $( "<div id='jquery-mediatest'>" ),
+		fakeBody = $( "<body>" ).append( testDiv );
+
+	return function( query ) {
+		if ( !( query in cache ) ) {
+			var styleBlock = document.createElement( "style" ),
+				cssrule = "@media " + query + " { #jquery-mediatest { position:absolute; } }";
+
+			//must set type for IE!
+			styleBlock.type = "text/css";
+
+			if ( styleBlock.styleSheet  ){
+				styleBlock.styleSheet.cssText = cssrule;
+			} else {
+				styleBlock.appendChild( document.createTextNode(cssrule) );
+			}
+
+			$html.prepend( fakeBody ).prepend( styleBlock );
+			cache[ query ] = testDiv.css( "position" ) === "absolute";
+			fakeBody.add( styleBlock ).remove();
+		}
+		return cache[ query ];
+	};
+})();
+
+})(jQuery);/*
+* jQuery Mobile Framework : support tests
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.
+*/
+
+(function( $, undefined ) {
+
+var fakeBody = $( "<body>" ).prependTo( "html" ),
+	fbCSS = fakeBody[ 0 ].style,
+	vendors = [ "webkit", "moz", "o" ],
+	webos = "palmGetResource" in window, //only used to rule out scrollTop
+	bb = window.blackberry; //only used to rule out box shadow, as it's filled opaque on BB
+
+// thx Modernizr
+function propExists( prop ) {
+	var uc_prop = prop.charAt( 0 ).toUpperCase() + prop.substr( 1 ),
+		props = ( prop + " " + vendors.join( uc_prop + " " ) + uc_prop ).split( " " );
+
+	for ( var v in props ){
+		if ( fbCSS[ v ] !== undefined ) {
+			return true;
+		}
+	}
+}
+
+// Test for dynamic-updating base tag support ( allows us to avoid href,src attr rewriting )
+function baseTagTest() {
+	var fauxBase = location.protocol + "//" + location.host + location.pathname + "ui-dir/",
+		base = $( "head base" ),
+		fauxEle = null,
+		href = "",
+		link, rebase;
+
+	if ( !base.length ) {
+		base = fauxEle = $( "<base>", { "href": fauxBase }).appendTo( "head" );
+	} else {
+		href = base.attr( "href" );
+	}
+
+	link = $( "<a href='testurl'></a>" ).prependTo( fakeBody );
+	rebase = link[ 0 ].href;
+	base[ 0 ].href = href ? href : location.pathname;
+
+	if ( fauxEle ) {
+		fauxEle.remove();
+	}
+	return rebase.indexOf( fauxBase ) === 0;
+}
+
+
+// non-UA-based IE version check by James Padolsey, modified by jdalton - from http://gist.github.com/527683
+// allows for inclusion of IE 6+, including Windows Mobile 7
+$.mobile.browser = {};
+$.mobile.browser.ie = (function() {
+	var v = 3,
+	div = document.createElement( "div" ),
+	a = div.all || [];
+
+	while ( div.innerHTML = "<!--[if gt IE " + ( ++v ) + "]><br><![endif]-->", a[ 0 ] );
+
+	return v > 4 ? v : !v;
+})();
+
+
+$.extend( $.support, {
+	orientation: "orientation" in window,
+	touch: "ontouchend" in document,
+	cssTransitions: "WebKitTransitionEvent" in window,
+	pushState: !!history.pushState,
+	mediaquery: $.mobile.media( "only all" ),
+	cssPseudoElement: !!propExists( "content" ),
+	boxShadow: !!propExists( "boxShadow" ) && !bb,
+	scrollTop: ( "pageXOffset" in window || "scrollTop" in document.documentElement || "scrollTop" in fakeBody[ 0 ] ) && !webos,
+	dynamicBaseTag: baseTagTest(),
+	// TODO: This is a weak test. We may want to beef this up later.
+	eventCapture: "addEventListener" in document
+});
+
+fakeBody.remove();
+
+
+// $.mobile.ajaxBlacklist is used to override ajaxEnabled on platforms that have known conflicts with hash history updates (BB5, Symbian)
+// or that generally work better browsing in regular http for full page refreshes (Opera Mini)
+// Note: This detection below is used as a last resort.
+// We recommend only using these detection methods when all other more reliable/forward-looking approaches are not possible
+var nokiaLTE7_3 = (function(){
+
+	var ua = window.navigator.userAgent;
+
+	//The following is an attempt to match Nokia browsers that are running Symbian/s60, with webkit, version 7.3 or older
+	return ua.indexOf( "Nokia" ) > -1 &&
+			( ua.indexOf( "Symbian/3" ) > -1 || ua.indexOf( "Series60/5" ) > -1 ) &&
+			ua.indexOf( "AppleWebKit" ) > -1 &&
+			ua.match( /(BrowserNG|NokiaBrowser)\/7\.[0-3]/ );
+})();
+
+$.mobile.ajaxBlacklist =
+			// BlackBerry browsers, pre-webkit
+			window.blackberry && !window.WebKitPoint ||
+			// Opera Mini
+			window.operamini && Object.prototype.toString.call( window.operamini ) === "[object OperaMini]" ||
+			// Symbian webkits pre 7.3
+			nokiaLTE7_3;
+
+// Lastly, this workaround is the only way we've found so far to get pre 7.3 Symbian webkit devices
+// to render the stylesheets when they're referenced before this script, as we'd recommend doing.
+// This simply reappends the CSS in place, which for some reason makes it apply
+if ( nokiaLTE7_3 ) {
+	$(function() {
+		$( "head link[rel=stylesheet]" ).attr( "rel", "alternate stylesheet" ).attr( "rel", "stylesheet" );
+	});
+}
+
+// For ruling out shadows via css
+if ( !$.support.boxShadow ) {
+	$( "html" ).addClass( "ui-mobile-nosupport-boxshadow" );
+}
+
+})( jQuery );/*
+* jQuery Mobile Framework : "mouse" plugin
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT or GPL Version 2 licenses.
+* http://jquery.org/license
+*/
+
+// This plugin is an experiment for abstracting away the touch and mouse
+// events so that developers don't have to worry about which method of input
+// the device their document is loaded on supports.
+//
+// The idea here is to allow the developer to register listeners for the
+// basic mouse events, such as mousedown, mousemove, mouseup, and click,
+// and the plugin will take care of registering the correct listeners
+// behind the scenes to invoke the listener at the fastest possible time
+// for that device, while still retaining the order of event firing in
+// the traditional mouse environment, should multiple handlers be registered
+// on the same element for different events.
+//
+// The current version exposes the following virtual events to jQuery bind methods:
+// "vmouseover vmousedown vmousemove vmouseup vclick vmouseout vmousecancel"
+
+(function( $, window, document, undefined ) {
+
+var dataPropertyName = "virtualMouseBindings",
+	touchTargetPropertyName = "virtualTouchID",
+	virtualEventNames = "vmouseover vmousedown vmousemove vmouseup vclick vmouseout vmousecancel".split( " " ),
+	touchEventProps = "clientX clientY pageX pageY screenX screenY".split( " " ),
+	activeDocHandlers = {},
+	resetTimerID = 0,
+	startX = 0,
+	startY = 0,
+	didScroll = false,
+	clickBlockList = [],
+	blockMouseTriggers = false,
+	blockTouchTriggers = false,
+	eventCaptureSupported = $.support.eventCapture,
+	$document = $( document ),
+	nextTouchID = 1,
+	lastTouchID = 0;
+
+$.vmouse = {
+	moveDistanceThreshold: 10,
+	clickDistanceThreshold: 10,
+	resetTimerDuration: 1500
+};
+
+function getNativeEvent( event ) {
+
+	while ( event && typeof event.originalEvent !== "undefined" ) {
+		event = event.originalEvent;
+	}
+	return event;
+}
+
+function createVirtualEvent( event, eventType ) {
+
+	var t = event.type,
+		oe, props, ne, prop, ct, touch, i, j;
+
+	event = $.Event(event);
+	event.type = eventType;
+
+	oe = event.originalEvent;
+	props = $.event.props;
+
+	// copy original event properties over to the new event
+	// this would happen if we could call $.event.fix instead of $.Event
+	// but we don't have a way to force an event to be fixed multiple times
+	if ( oe ) {
+		for ( i = props.length, prop; i; ) {
+			prop = props[ --i ];
+			event[ prop ] = oe[ prop ];
+		}
+	}
+
+	if ( t.search(/^touch/) !== -1 ) {
+		ne = getNativeEvent( oe );
+		t = ne.touches;
+		ct = ne.changedTouches;
+		touch = ( t && t.length ) ? t[0] : ( (ct && ct.length) ? ct[ 0 ] : undefined );
+
+		if ( touch ) {
+			for ( j = 0, len = touchEventProps.length; j < len; j++){
+				prop = touchEventProps[ j ];
+				event[ prop ] = touch[ prop ];
+			}
+		}
+	}
+
+	return event;
+}
+
+function getVirtualBindingFlags( element ) {
+
+	var flags = {},
+		b, k;
+
+	while ( element ) {
+
+		b = $.data( element, dataPropertyName );
+
+		for (  k in b ) {
+			if ( b[ k ] ) {
+				flags[ k ] = flags.hasVirtualBinding = true;
+			}
+		}
+		element = element.parentNode;
+	}
+	return flags;
+}
+
+function getClosestElementWithVirtualBinding( element, eventType ) {
+	var b;
+	while ( element ) {
+
+		b = $.data( element, dataPropertyName );
+
+		if ( b && ( !eventType || b[ eventType ] ) ) {
+			return element;
+		}
+		element = element.parentNode;
+	}
+	return null;
+}
+
+function enableTouchBindings() {
+	blockTouchTriggers = false;
+}
+
+function disableTouchBindings() {
+	blockTouchTriggers = true;
+}
+
+function enableMouseBindings() {
+	lastTouchID = 0;
+	clickBlockList.length = 0;
+	blockMouseTriggers = false;
+
+	// When mouse bindings are enabled, our
+	// touch bindings are disabled.
+	disableTouchBindings();
+}
+
+function disableMouseBindings() {
+	// When mouse bindings are disabled, our
+	// touch bindings are enabled.
+	enableTouchBindings();
+}
+
+function startResetTimer() {
+	clearResetTimer();
+	resetTimerID = setTimeout(function(){
+		resetTimerID = 0;
+		enableMouseBindings();
+	}, $.vmouse.resetTimerDuration );
+}
+
+function clearResetTimer() {
+	if ( resetTimerID ){
+		clearTimeout( resetTimerID );
+		resetTimerID = 0;
+	}
+}
+
+function triggerVirtualEvent( eventType, event, flags ) {
+	var defaultPrevented = false,
+		ve;
+
+	if ( ( flags && flags[ eventType ] ) ||
+				( !flags && getClosestElementWithVirtualBinding( event.target, eventType ) ) ) {
+
+		ve = createVirtualEvent( event, eventType );
+
+		$( event.target).trigger( ve );
+
+		defaultPrevented = ve.isDefaultPrevented();
+	}
+
+	return defaultPrevented;
+}
+
+function mouseEventCallback( event ) {
+	var touchID = $.data(event.target, touchTargetPropertyName);
+
+	if ( !blockMouseTriggers && ( !lastTouchID || lastTouchID !== touchID ) ){
+		triggerVirtualEvent( "v" + event.type, event );
+	}
+}
+
+function handleTouchStart( event ) {
+
+	var touches = getNativeEvent( event ).touches,
+		target, flags;
+
+	if ( touches && touches.length === 1 ) {
+
+		target = event.target;
+		flags = getVirtualBindingFlags( target );
+
+		if ( flags.hasVirtualBinding ) {
+
+			lastTouchID = nextTouchID++;
+			$.data( target, touchTargetPropertyName, lastTouchID );
+
+			clearResetTimer();
+
+			disableMouseBindings();
+			didScroll = false;
+
+			var t = getNativeEvent( event ).touches[ 0 ];
+			startX = t.pageX;
+			startY = t.pageY;
+
+			triggerVirtualEvent( "vmouseover", event, flags );
+			triggerVirtualEvent( "vmousedown", event, flags );
+		}
+	}
+}
+
+function handleScroll( event ) {
+	if ( blockTouchTriggers ) {
+		return;
+	}
+
+	if ( !didScroll ) {
+		triggerVirtualEvent( "vmousecancel", event, getVirtualBindingFlags( event.target ) );
+	}
+
+	didScroll = true;
+	startResetTimer();
+}
+
+function handleTouchMove( event ) {
+	if ( blockTouchTriggers ) {
+		return;
+	}
+
+	var t = getNativeEvent( event ).touches[ 0 ],
+		didCancel = didScroll,
+		moveThreshold = $.vmouse.moveDistanceThreshold;
+		didScroll = didScroll ||
+			( Math.abs(t.pageX - startX) > moveThreshold ||
+				Math.abs(t.pageY - startY) > moveThreshold ),
+		flags = getVirtualBindingFlags( event.target );
+
+	if ( didScroll && !didCancel ) {
+		triggerVirtualEvent( "vmousecancel", event, flags );
+	}
+
+	triggerVirtualEvent( "vmousemove", event, flags );
+	startResetTimer();
+}
+
+function handleTouchEnd( event ) {
+	if ( blockTouchTriggers ) {
+		return;
+	}
+
+	disableTouchBindings();
+
+	var flags = getVirtualBindingFlags( event.target ),
+		t;
+	triggerVirtualEvent( "vmouseup", event, flags );
+
+	if ( !didScroll ) {
+		if ( triggerVirtualEvent( "vclick", event, flags ) ) {
+			// The target of the mouse events that follow the touchend
+			// event don't necessarily match the target used during the
+			// touch. This means we need to rely on coordinates for blocking
+			// any click that is generated.
+			t = getNativeEvent( event ).changedTouches[ 0 ];
+			clickBlockList.push({
+				touchID: lastTouchID,
+				x: t.clientX,
+				y: t.clientY
+			});
+
+			// Prevent any mouse events that follow from triggering
+			// virtual event notifications.
+			blockMouseTriggers = true;
+		}
+	}
+	triggerVirtualEvent( "vmouseout", event, flags);
+	didScroll = false;
+
+	startResetTimer();
+}
+
+function hasVirtualBindings( ele ) {
+	var bindings = $.data( ele, dataPropertyName ),
+		k;
+
+	if ( bindings ) {
+		for ( k in bindings ) {
+			if ( bindings[ k ] ) {
+				return true;
+			}
+		}
+	}
+	return false;
+}
+
+function dummyMouseHandler(){}
+
+function getSpecialEventObject( eventType ) {
+	var realType = eventType.substr( 1 );
+
+	return {
+		setup: function( data, namespace ) {
+			// If this is the first virtual mouse binding for this element,
+			// add a bindings object to its data.
+
+			if ( !hasVirtualBindings( this ) ) {
+				$.data( this, dataPropertyName, {});
+			}
+
+			// If setup is called, we know it is the first binding for this
+			// eventType, so initialize the count for the eventType to zero.
+			var bindings = $.data( this, dataPropertyName );
+			bindings[ eventType ] = true;
+
+			// If this is the first virtual mouse event for this type,
+			// register a global handler on the document.
+
+			activeDocHandlers[ eventType ] = ( activeDocHandlers[ eventType ] || 0 ) + 1;
+
+			if ( activeDocHandlers[ eventType ] === 1 ) {
+				$document.bind( realType, mouseEventCallback );
+			}
+
+			// Some browsers, like Opera Mini, won't dispatch mouse/click events
+			// for elements unless they actually have handlers registered on them.
+			// To get around this, we register dummy handlers on the elements.
+
+			$( this ).bind( realType, dummyMouseHandler );
+
+			// For now, if event capture is not supported, we rely on mouse handlers.
+			if ( eventCaptureSupported ) {
+				// If this is the first virtual mouse binding for the document,
+				// register our touchstart handler on the document.
+
+				activeDocHandlers[ "touchstart" ] = ( activeDocHandlers[ "touchstart" ] || 0) + 1;
+
+				if (activeDocHandlers[ "touchstart" ] === 1) {
+					$document.bind( "touchstart", handleTouchStart )
+						.bind( "touchend", handleTouchEnd )
+
+						// On touch platforms, touching the screen and then dragging your finger
+						// causes the window content to scroll after some distance threshold is
+						// exceeded. On these platforms, a scroll prevents a click event from being
+						// dispatched, and on some platforms, even the touchend is suppressed. To
+						// mimic the suppression of the click event, we need to watch for a scroll
+						// event. Unfortunately, some platforms like iOS don't dispatch scroll
+						// events until *AFTER* the user lifts their finger (touchend). This means
+						// we need to watch both scroll and touchmove events to figure out whether
+						// or not a scroll happenens before the touchend event is fired.
+
+						.bind( "touchmove", handleTouchMove )
+						.bind( "scroll", handleScroll );
+				}
+			}
+		},
+
+		teardown: function( data, namespace ) {
+			// If this is the last virtual binding for this eventType,
+			// remove its global handler from the document.
+
+			--activeDocHandlers[ eventType ];
+
+			if ( !activeDocHandlers[ eventType ] ) {
+				$document.unbind( realType, mouseEventCallback );
+			}
+
+			if ( eventCaptureSupported ) {
+				// If this is the last virtual mouse binding in existence,
+				// remove our document touchstart listener.
+
+				--activeDocHandlers[ "touchstart" ];
+
+				if ( !activeDocHandlers[ "touchstart" ] ) {
+					$document.unbind( "touchstart", handleTouchStart )
+						.unbind( "touchmove", handleTouchMove )
+						.unbind( "touchend", handleTouchEnd )
+						.unbind( "scroll", handleScroll );
+				}
+			}
+
+			var $this = $( this ),
+				bindings = $.data( this, dataPropertyName );
+
+			// teardown may be called when an element was
+			// removed from the DOM. If this is the case,
+			// jQuery core may have already stripped the element
+			// of any data bindings so we need to check it before
+			// using it.
+			if ( bindings ) {
+				bindings[ eventType ] = false;
+			}
+
+			// Unregister the dummy event handler.
+
+			$this.unbind( realType, dummyMouseHandler );
+
+			// If this is the last virtual mouse binding on the
+			// element, remove the binding data from the element.
+
+			if ( !hasVirtualBindings( this ) ) {
+				$this.removeData( dataPropertyName );
+			}
+		}
+	};
+}
+
+// Expose our custom events to the jQuery bind/unbind mechanism.
+
+for ( var i = 0; i < virtualEventNames.length; i++ ){
+	$.event.special[ virtualEventNames[ i ] ] = getSpecialEventObject( virtualEventNames[ i ] );
+}
+
+// Add a capture click handler to block clicks.
+// Note that we require event capture support for this so if the device
+// doesn't support it, we punt for now and rely solely on mouse events.
+if ( eventCaptureSupported ) {
+	document.addEventListener( "click", function( e ){
+		var cnt = clickBlockList.length,
+			target = e.target,
+			x, y, ele, i, o, touchID;
+
+		if ( cnt ) {
+			x = e.clientX;
+			y = e.clientY;
+			threshold = $.vmouse.clickDistanceThreshold;
+
+			// The idea here is to run through the clickBlockList to see if
+			// the current click event is in the proximity of one of our
+			// vclick events that had preventDefault() called on it. If we find
+			// one, then we block the click.
+			//
+			// Why do we have to rely on proximity?
+			//
+			// Because the target of the touch event that triggered the vclick
+			// can be different from the target of the click event synthesized
+			// by the browser. The target of a mouse/click event that is syntehsized
+			// from a touch event seems to be implementation specific. For example,
+			// some browsers will fire mouse/click events for a link that is near
+			// a touch event, even though the target of the touchstart/touchend event
+			// says the user touched outside the link. Also, it seems that with most
+			// browsers, the target of the mouse/click event is not calculated until the
+			// time it is dispatched, so if you replace an element that you touched
+			// with another element, the target of the mouse/click will be the new
+			// element underneath that point.
+			//
+			// Aside from proximity, we also check to see if the target and any
+			// of its ancestors were the ones that blocked a click. This is necessary
+			// because of the strange mouse/click target calculation done in the
+			// Android 2.1 browser, where if you click on an element, and there is a
+			// mouse/click handler on one of its ancestors, the target will be the
+			// innermost child of the touched element, even if that child is no where
+			// near the point of touch.
+
+			ele = target;
+
+			while ( ele ) {
+				for ( i = 0; i < cnt; i++ ) {
+					o = clickBlockList[ i ];
+					touchID = 0;
+
+					if ( ( ele === target && Math.abs( o.x - x ) < threshold && Math.abs( o.y - y ) < threshold ) ||
+								$.data( ele, touchTargetPropertyName ) === o.touchID ) {
+						// XXX: We may want to consider removing matches from the block list
+						//      instead of waiting for the reset timer to fire.
+						e.preventDefault();
+						e.stopPropagation();
+						return;
+					}
+				}
+				ele = ele.parentNode;
+			}
+		}
+	}, true);
+}
+})( jQuery, window, document );
+/*
+* jQuery Mobile Framework : events
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT or GPL Version 2 licenses.
+* http://jquery.org/license
+*/
+(function( $, window, undefined ) {
+
+// add new event shortcuts
+$.each( ( "touchstart touchmove touchend orientationchange throttledresize " +
+					"tap taphold swipe swipeleft swiperight scrollstart scrollstop" ).split( " " ), function( i, name ) {
+
+	$.fn[ name ] = function( fn ) {
+		return fn ? this.bind( name, fn ) : this.trigger( name );
+	};
+
+	$.attrFn[ name ] = true;
+});
+
+var supportTouch = $.support.touch,
+	scrollEvent = "touchmove scroll",
+	touchStartEvent = supportTouch ? "touchstart" : "mousedown",
+	touchStopEvent = supportTouch ? "touchend" : "mouseup",
+	touchMoveEvent = supportTouch ? "touchmove" : "mousemove";
+
+function triggerCustomEvent( obj, eventType, event ) {
+	var originalType = event.type;
+	event.type = eventType;
+	$.event.handle.call( obj, event );
+	event.type = originalType;
+}
+
+// also handles scrollstop
+$.event.special.scrollstart = {
+
+	enabled: true,
+
+	setup: function() {
+
+		var thisObject = this,
+			$this = $( thisObject ),
+			scrolling,
+			timer;
+
+		function trigger( event, state ) {
+			scrolling = state;
+			triggerCustomEvent( thisObject, scrolling ? "scrollstart" : "scrollstop", event );
+		}
+
+		// iPhone triggers scroll after a small delay; use touchmove instead
+		$this.bind( scrollEvent, function( event ) {
+
+			if ( !$.event.special.scrollstart.enabled ) {
+				return;
+			}
+
+			if ( !scrolling ) {
+				trigger( event, true );
+			}
+
+			clearTimeout( timer );
+			timer = setTimeout(function() {
+				trigger( event, false );
+			}, 50 );
+		});
+	}
+};
+
+// also handles taphold
+$.event.special.tap = {
+	setup: function() {
+		var thisObject = this,
+			$this = $( thisObject );
+
+		$this.bind( "vmousedown", function( event ) {
+
+			if ( event.which && event.which !== 1 ) {
+				return false;
+			}
+
+			var touching = true,
+				origTarget = event.target,
+				origEvent = event.originalEvent,
+				timer;
+
+			function clearTapHandlers() {
+				touching = false;
+				clearTimeout(timer);
+
+				$this.unbind( "vclick", clickHandler )
+					.unbind( "vmousecancel", clearTapHandlers );
+			}
+
+			function clickHandler(event) {
+				clearTapHandlers();
+
+				// ONLY trigger a 'tap' event if the start target is
+				// the same as the stop target.
+				if ( origTarget == event.target ) {
+					triggerCustomEvent( thisObject, "tap", event );
+				}
+			}
+
+			$this.bind( "vmousecancel", clearTapHandlers )
+				.bind( "vclick", clickHandler );
+
+			timer = setTimeout(function() {
+				if ( touching ) {
+					triggerCustomEvent( thisObject, "taphold", event );
+				}
+			}, 750 );
+		});
+	}
+};
+
+// also handles swipeleft, swiperight
+$.event.special.swipe = {
+	scrollSupressionThreshold: 10, // More than this horizontal displacement, and we will suppress scrolling.
+	
+	durationThreshold: 1000, // More time than this, and it isn't a swipe.
+	
+	horizontalDistanceThreshold: 30,  // Swipe horizontal displacement must be more than this.
+	
+	verticalDistanceThreshold: 75,  // Swipe vertical displacement must be less than this.
+
+	setup: function() {
+		var thisObject = this,
+			$this = $( thisObject );
+
+		$this.bind( touchStartEvent, function( event ) {
+			var data = event.originalEvent.touches ?
+								event.originalEvent.touches[ 0 ] : event,
+				start = {
+					time: ( new Date() ).getTime(),
+					coords: [ data.pageX, data.pageY ],
+					origin: $( event.target )
+				},
+				stop;
+
+			function moveHandler( event ) {
+
+				if ( !start ) {
+					return;
+				}
+
+				var data = event.originalEvent.touches ?
+						event.originalEvent.touches[ 0 ] : event;
+
+				stop = {
+					time: ( new Date() ).getTime(),
+					coords: [ data.pageX, data.pageY ]
+				};
+
+				// prevent scrolling
+				if ( Math.abs( start.coords[ 0 ] - stop.coords[ 0 ] ) > $.event.special.swipe.scrollSupressionThreshold ) {
+					event.preventDefault();
+				}
+			}
+
+			$this.bind( touchMoveEvent, moveHandler )
+				.one( touchStopEvent, function( event ) {
+					$this.unbind( touchMoveEvent, moveHandler );
+
+					if ( start && stop ) {
+						if ( stop.time - start.time < $.event.special.swipe.durationThreshold &&
+								Math.abs( start.coords[ 0 ] - stop.coords[ 0 ] ) > $.event.special.swipe.horizontalDistanceThreshold &&
+								Math.abs( start.coords[ 1 ] - stop.coords[ 1 ] ) < $.event.special.swipe.verticalDistanceThreshold ) {
+
+							start.origin.trigger( "swipe" )
+								.trigger( start.coords[0] > stop.coords[ 0 ] ? "swipeleft" : "swiperight" );
+						}
+					}
+					start = stop = undefined;
+				});
+		});
+	}
+};
+
+(function( $, window ) {
+	// "Cowboy" Ben Alman
+
+	var win = $( window ),
+		special_event,
+		get_orientation,
+		last_orientation;
+
+	$.event.special.orientationchange = special_event = {
+		setup: function() {
+			// If the event is supported natively, return false so that jQuery
+			// will bind to the event using DOM methods.
+			if ( $.support.orientation ) {
+				return false;
+			}
+
+			// Get the current orientation to avoid initial double-triggering.
+			last_orientation = get_orientation();
+
+			// Because the orientationchange event doesn't exist, simulate the
+			// event by testing window dimensions on resize.
+			win.bind( "throttledresize", handler );
+		},
+		teardown: function(){
+			// If the event is not supported natively, return false so that
+			// jQuery will unbind the event using DOM methods.
+			if ( $.support.orientation ) {
+				return false;
+			}
+
+			// Because the orientationchange event doesn't exist, unbind the
+			// resize event handler.
+			win.unbind( "throttledresize", handler );
+		},
+		add: function( handleObj ) {
+			// Save a reference to the bound event handler.
+			var old_handler = handleObj.handler;
+
+			handleObj.handler = function( event ) {
+				// Modify event object, adding the .orientation property.
+				event.orientation = get_orientation();
+
+				// Call the originally-bound event handler and return its result.
+				return old_handler.apply( this, arguments );
+			};
+		}
+	};
+
+	// If the event is not supported natively, this handler will be bound to
+	// the window resize event to simulate the orientationchange event.
+	function handler() {
+		// Get the current orientation.
+		var orientation = get_orientation();
+
+		if ( orientation !== last_orientation ) {
+			// The orientation has changed, so trigger the orientationchange event.
+			last_orientation = orientation;
+			win.trigger( "orientationchange" );
+		}
+	};
+
+	// Get the current page orientation. This method is exposed publicly, should it
+	// be needed, as jQuery.event.special.orientationchange.orientation()
+	$.event.special.orientationchange.orientation = get_orientation = function() {
+		var elem = document.documentElement;
+		return elem && elem.clientWidth / elem.clientHeight < 1.1 ? "portrait" : "landscape";
+	};
+
+})( jQuery, window );
+
+
+// throttled resize event
+(function() {
+
+	$.event.special.throttledresize = {
+		setup: function() {
+			$( this ).bind( "resize", handler );
+		},
+		teardown: function(){
+			$( this ).unbind( "resize", handler );
+		}
+	};
+
+	var throttle = 250,
+		handler = function() {
+			curr = ( new Date() ).getTime();
+			diff = curr - lastCall;
+
+			if ( diff >= throttle ) {
+
+				lastCall = curr;
+				$( this ).trigger( "throttledresize" );
+
+			} else {
+
+				if ( heldCall ) {
+					clearTimeout( heldCall );
+				}
+
+				// Promise a held call will still execute
+				heldCall = setTimeout( handler, throttle - diff );
+			}
+		},
+		lastCall = 0,
+		heldCall,
+		curr,
+		diff;
+})();
+
+
+$.each({
+	scrollstop: "scrollstart",
+	taphold: "tap",
+	swipeleft: "swipe",
+	swiperight: "swipe"
+}, function( event, sourceEvent ) {
+
+	$.event.special[ event ] = {
+		setup: function() {
+			$( this ).bind( sourceEvent, $.noop );
+		}
+	};
+});
+
+})( jQuery, this );
+/*!
+ * jQuery hashchange event - v1.3 - 7/21/2010
+ * http://benalman.com/projects/jquery-hashchange-plugin/
+ * 
+ * Copyright (c) 2010 "Cowboy" Ben Alman
+ * Dual licensed under the MIT and GPL licenses.
+ * http://benalman.com/about/license/
+ */
+
+// Script: jQuery hashchange event
+//
+// *Version: 1.3, Last updated: 7/21/2010*
+// 
+// Project Home - http://benalman.com/projects/jquery-hashchange-plugin/
+// GitHub       - http://github.com/cowboy/jquery-hashchange/
+// Source       - http://github.com/cowboy/jquery-hashchange/raw/master/jquery.ba-hashchange.js
+// (Minified)   - http://github.com/cowboy/jquery-hashchange/raw/master/jquery.ba-hashchange.min.js (0.8kb gzipped)
+// 
+// About: License
+// 
+// Copyright (c) 2010 "Cowboy" Ben Alman,
+// Dual licensed under the MIT and GPL licenses.
+// http://benalman.com/about/license/
+// 
+// About: Examples
+// 
+// These working examples, complete with fully commented code, illustrate a few
+// ways in which this plugin can be used.
+// 
+// hashchange event - http://benalman.com/code/projects/jquery-hashchange/examples/hashchange/
+// document.domain - http://benalman.com/code/projects/jquery-hashchange/examples/document_domain/
+// 
+// About: Support and Testing
+// 
+// Information about what version or versions of jQuery this plugin has been
+// tested with, what browsers it has been tested in, and where the unit tests
+// reside (so you can test it yourself).
+// 
+// jQuery Versions - 1.2.6, 1.3.2, 1.4.1, 1.4.2
+// Browsers Tested - Internet Explorer 6-8, Firefox 2-4, Chrome 5-6, Safari 3.2-5,
+//                   Opera 9.6-10.60, iPhone 3.1, Android 1.6-2.2, BlackBerry 4.6-5.
+// Unit Tests      - http://benalman.com/code/projects/jquery-hashchange/unit/
+// 
+// About: Known issues
+// 
+// While this jQuery hashchange event implementation is quite stable and
+// robust, there are a few unfortunate browser bugs surrounding expected
+// hashchange event-based behaviors, independent of any JavaScript
+// window.onhashchange abstraction. See the following examples for more
+// information:
+// 
+// Chrome: Back Button - http://benalman.com/code/projects/jquery-hashchange/examples/bug-chrome-back-button/
+// Firefox: Remote XMLHttpRequest - http://benalman.com/code/projects/jquery-hashchange/examples/bug-firefox-remote-xhr/
+// WebKit: Back Button in an Iframe - http://benalman.com/code/projects/jquery-hashchange/examples/bug-webkit-hash-iframe/
+// Safari: Back Button from a different domain - http://benalman.com/code/projects/jquery-hashchange/examples/bug-safari-back-from-diff-domain/
+// 
+// Also note that should a browser natively support the window.onhashchange 
+// event, but not report that it does, the fallback polling loop will be used.
+// 
+// About: Release History
+// 
+// 1.3   - (7/21/2010) Reorganized IE6/7 Iframe code to make it more
+//         "removable" for mobile-only development. Added IE6/7 document.title
+//         support. Attempted to make Iframe as hidden as possible by using
+//         techniques from http://www.paciellogroup.com/blog/?p=604. Added 
+//         support for the "shortcut" format $(window).hashchange( fn ) and
+//         $(window).hashchange() like jQuery provides for built-in events.
+//         Renamed jQuery.hashchangeDelay to <jQuery.fn.hashchange.delay> and
+//         lowered its default value to 50. Added <jQuery.fn.hashchange.domain>
+//         and <jQuery.fn.hashchange.src> properties plus document-domain.html
+//         file to address access denied issues when setting document.domain in
+//         IE6/7.
+// 1.2   - (2/11/2010) Fixed a bug where coming back to a page using this plugin
+//         from a page on another domain would cause an error in Safari 4. Also,
+//         IE6/7 Iframe is now inserted after the body (this actually works),
+//         which prevents the page from scrolling when the event is first bound.
+//         Event can also now be bound before DOM ready, but it won't be usable
+//         before then in IE6/7.
+// 1.1   - (1/21/2010) Incorporated document.documentMode test to fix IE8 bug
+//         where browser version is incorrectly reported as 8.0, despite
+//         inclusion of the X-UA-Compatible IE=EmulateIE7 meta tag.
+// 1.0   - (1/9/2010) Initial Release. Broke out the jQuery BBQ event.special
+//         window.onhashchange functionality into a separate plugin for users
+//         who want just the basic event & back button support, without all the
+//         extra awesomeness that BBQ provides. This plugin will be included as
+//         part of jQuery BBQ, but also be available separately.
+
+(function($,window,undefined){
+  '$:nomunge'; // Used by YUI compressor.
+  
+  // Reused string.
+  var str_hashchange = 'hashchange',
+    
+    // Method / object references.
+    doc = document,
+    fake_onhashchange,
+    special = $.event.special,
+    
+    // Does the browser support window.onhashchange? Note that IE8 running in
+    // IE7 compatibility mode reports true for 'onhashchange' in window, even
+    // though the event isn't supported, so also test document.documentMode.
+    doc_mode = doc.documentMode,
+    supports_onhashchange = 'on' + str_hashchange in window && ( doc_mode === undefined || doc_mode > 7 );
+  
+  // Get location.hash (or what you'd expect location.hash to be) sans any
+  // leading #. Thanks for making this necessary, Firefox!
+  function get_fragment( url ) {
+    url = url || location.href;
+    return '#' + url.replace( /^[^#]*#?(.*)$/, '$1' );
+  };
+  
+  // Method: jQuery.fn.hashchange
+  // 
+  // Bind a handler to the window.onhashchange event or trigger all bound
+  // window.onhashchange event handlers. This behavior is consistent with
+  // jQuery's built-in event handlers.
+  // 
+  // Usage:
+  // 
+  // > jQuery(window).hashchange( [ handler ] );
+  // 
+  // Arguments:
+  // 
+  //  handler - (Function) Optional handler to be bound to the hashchange
+  //    event. This is a "shortcut" for the more verbose form:
+  //    jQuery(window).bind( 'hashchange', handler ). If handler is omitted,
+  //    all bound window.onhashchange event handlers will be triggered. This
+  //    is a shortcut for the more verbose
+  //    jQuery(window).trigger( 'hashchange' ). These forms are described in
+  //    the <hashchange event> section.
+  // 
+  // Returns:
+  // 
+  //  (jQuery) The initial jQuery collection of elements.
+  
+  // Allow the "shortcut" format $(elem).hashchange( fn ) for binding and
+  // $(elem).hashchange() for triggering, like jQuery does for built-in events.
+  $.fn[ str_hashchange ] = function( fn ) {
+    return fn ? this.bind( str_hashchange, fn ) : this.trigger( str_hashchange );
+  };
+  
+  // Property: jQuery.fn.hashchange.delay
+  // 
+  // The numeric interval (in milliseconds) at which the <hashchange event>
+  // polling loop executes. Defaults to 50.
+  
+  // Property: jQuery.fn.hashchange.domain
+  // 
+  // If you're setting document.domain in your JavaScript, and you want hash
+  // history to work in IE6/7, not only must this property be set, but you must
+  // also set document.domain BEFORE jQuery is loaded into the page. This
+  // property is only applicable if you are supporting IE6/7 (or IE8 operating
+  // in "IE7 compatibility" mode).
+  // 
+  // In addition, the <jQuery.fn.hashchange.src> property must be set to the
+  // path of the included "document-domain.html" file, which can be renamed or
+  // modified if necessary (note that the document.domain specified must be the
+  // same in both your main JavaScript as well as in this file).
+  // 
+  // Usage:
+  // 
+  // jQuery.fn.hashchange.domain = document.domain;
+  
+  // Property: jQuery.fn.hashchange.src
+  // 
+  // If, for some reason, you need to specify an Iframe src file (for example,
+  // when setting document.domain as in <jQuery.fn.hashchange.domain>), you can
+  // do so using this property. Note that when using this property, history
+  // won't be recorded in IE6/7 until the Iframe src file loads. This property
+  // is only applicable if you are supporting IE6/7 (or IE8 operating in "IE7
+  // compatibility" mode).
+  // 
+  // Usage:
+  // 
+  // jQuery.fn.hashchange.src = 'path/to/file.html';
+  
+  $.fn[ str_hashchange ].delay = 50;
+  /*
+  $.fn[ str_hashchange ].domain = null;
+  $.fn[ str_hashchange ].src = null;
+  */
+  
+  // Event: hashchange event
+  // 
+  // Fired when location.hash changes. In browsers that support it, the native
+  // HTML5 window.onhashchange event is used, otherwise a polling loop is
+  // initialized, running every <jQuery.fn.hashchange.delay> milliseconds to
+  // see if the hash has changed. In IE6/7 (and IE8 operating in "IE7
+  // compatibility" mode), a hidden Iframe is created to allow the back button
+  // and hash-based history to work.
+  // 
+  // Usage as described in <jQuery.fn.hashchange>:
+  // 
+  // > // Bind an event handler.
+  // > jQuery(window).hashchange( function(e) {
+  // >   var hash = location.hash;
+  // >   ...
+  // > });
+  // > 
+  // > // Manually trigger the event handler.
+  // > jQuery(window).hashchange();
+  // 
+  // A more verbose usage that allows for event namespacing:
+  // 
+  // > // Bind an event handler.
+  // > jQuery(window).bind( 'hashchange', function(e) {
+  // >   var hash = location.hash;
+  // >   ...
+  // > });
+  // > 
+  // > // Manually trigger the event handler.
+  // > jQuery(window).trigger( 'hashchange' );
+  // 
+  // Additional Notes:
+  // 
+  // * The polling loop and Iframe are not created until at least one handler
+  //   is actually bound to the 'hashchange' event.
+  // * If you need the bound handler(s) to execute immediately, in cases where
+  //   a location.hash exists on page load, via bookmark or page refresh for
+  //   example, use jQuery(window).hashchange() or the more verbose 
+  //   jQuery(window).trigger( 'hashchange' ).
+  // * The event can be bound before DOM ready, but since it won't be usable
+  //   before then in IE6/7 (due to the necessary Iframe), recommended usage is
+  //   to bind it inside a DOM ready handler.
+  
+  // Override existing $.event.special.hashchange methods (allowing this plugin
+  // to be defined after jQuery BBQ in BBQ's source code).
+  special[ str_hashchange ] = $.extend( special[ str_hashchange ], {
+    
+    // Called only when the first 'hashchange' event is bound to window.
+    setup: function() {
+      // If window.onhashchange is supported natively, there's nothing to do..
+      if ( supports_onhashchange ) { return false; }
+      
+      // Otherwise, we need to create our own. And we don't want to call this
+      // until the user binds to the event, just in case they never do, since it
+      // will create a polling loop and possibly even a hidden Iframe.
+      $( fake_onhashchange.start );
+    },
+    
+    // Called only when the last 'hashchange' event is unbound from window.
+    teardown: function() {
+      // If window.onhashchange is supported natively, there's nothing to do..
+      if ( supports_onhashchange ) { return false; }
+      
+      // Otherwise, we need to stop ours (if possible).
+      $( fake_onhashchange.stop );
+    }
+    
+  });
+  
+  // fake_onhashchange does all the work of triggering the window.onhashchange
+  // event for browsers that don't natively support it, including creating a
+  // polling loop to watch for hash changes and in IE 6/7 creating a hidden
+  // Iframe to enable back and forward.
+  fake_onhashchange = (function(){
+    var self = {},
+      timeout_id,
+      
+      // Remember the initial hash so it doesn't get triggered immediately.
+      last_hash = get_fragment(),
+      
+      fn_retval = function(val){ return val; },
+      history_set = fn_retval,
+      history_get = fn_retval;
+    
+    // Start the polling loop.
+    self.start = function() {
+      timeout_id || poll();
+    };
+    
+    // Stop the polling loop.
+    self.stop = function() {
+      timeout_id && clearTimeout( timeout_id );
+      timeout_id = undefined;
+    };
+    
+    // This polling loop checks every $.fn.hashchange.delay milliseconds to see
+    // if location.hash has changed, and triggers the 'hashchange' event on
+    // window when necessary.
+    function poll() {
+      var hash = get_fragment(),
+        history_hash = history_get( last_hash );
+      
+      if ( hash !== last_hash ) {
+        history_set( last_hash = hash, history_hash );
+        
+        $(window).trigger( str_hashchange );
+        
+      } else if ( history_hash !== last_hash ) {
+        location.href = location.href.replace( /#.*/, '' ) + history_hash;
+      }
+      
+      timeout_id = setTimeout( poll, $.fn[ str_hashchange ].delay );
+    };
+    
+    // vvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvv
+    // vvvvvvvvvvvvvvvvvvv REMOVE IF NOT SUPPORTING IE6/7/8 vvvvvvvvvvvvvvvvvvv
+    // vvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvvv
+    $.browser.msie && !supports_onhashchange && (function(){
+      // Not only do IE6/7 need the "magical" Iframe treatment, but so does IE8
+      // when running in "IE7 compatibility" mode.
+      
+      var iframe,
+        iframe_src;
+      
+      // When the event is bound and polling starts in IE 6/7, create a hidden
+      // Iframe for history handling.
+      self.start = function(){
+        if ( !iframe ) {
+          iframe_src = $.fn[ str_hashchange ].src;
+          iframe_src = iframe_src && iframe_src + get_fragment();
+          
+          // Create hidden Iframe. Attempt to make Iframe as hidden as possible
+          // by using techniques from http://www.paciellogroup.com/blog/?p=604.
+          iframe = $('<iframe tabindex="-1" title="empty"/>').hide()
+            
+            // When Iframe has completely loaded, initialize the history and
+            // start polling.
+            .one( 'load', function(){
+              iframe_src || history_set( get_fragment() );
+              poll();
+            })
+            
+            // Load Iframe src if specified, otherwise nothing.
+            .attr( 'src', iframe_src || 'javascript:0' )
+            
+            // Append Iframe after the end of the body to prevent unnecessary
+            // initial page scrolling (yes, this works).
+            .insertAfter( 'body' )[0].contentWindow;
+          
+          // Whenever `document.title` changes, update the Iframe's title to
+          // prettify the back/next history menu entries. Since IE sometimes
+          // errors with "Unspecified error" the very first time this is set
+          // (yes, very useful) wrap this with a try/catch block.
+          doc.onpropertychange = function(){
+            try {
+              if ( event.propertyName === 'title' ) {
+                iframe.document.title = doc.title;
+              }
+            } catch(e) {}
+          };
+          
+        }
+      };
+      
+      // Override the "stop" method since an IE6/7 Iframe was created. Even
+      // if there are no longer any bound event handlers, the polling loop
+      // is still necessary for back/next to work at all!
+      self.stop = fn_retval;
+      
+      // Get history by looking at the hidden Iframe's location.hash.
+      history_get = function() {
+        return get_fragment( iframe.location.href );
+      };
+      
+      // Set a new history item by opening and then closing the Iframe
+      // document, *then* setting its location.hash. If document.domain has
+      // been set, update that as well.
+      history_set = function( hash, history_hash ) {
+        var iframe_doc = iframe.document,
+          domain = $.fn[ str_hashchange ].domain;
+        
+        if ( hash !== history_hash ) {
+          // Update Iframe with any initial `document.title` that might be set.
+          iframe_doc.title = doc.title;
+          
+          // Opening the Iframe's document after it has been closed is what
+          // actually adds a history entry.
+          iframe_doc.open();
+          
+          // Set document.domain for the Iframe document as well, if necessary.
+          domain && iframe_doc.write( '<script>document.domain="' + domain + '"</script>' );
+          
+          iframe_doc.close();
+          
+          // Update the Iframe's hash, for great justice.
+          iframe.location.hash = hash;
+        }
+      };
+      
+    })();
+    // ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^
+    // ^^^^^^^^^^^^^^^^^^^ REMOVE IF NOT SUPPORTING IE6/7/8 ^^^^^^^^^^^^^^^^^^^
+    // ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^
+    
+    return self;
+  })();
+  
+})(jQuery,this);
+/*
+* jQuery Mobile Framework : "page" plugin
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT or GPL Version 2 licenses.
+* http://jquery.org/license
+*/
+
+(function( $, undefined ) {
+
+$.widget( "mobile.page", $.mobile.widget, {
+	options: {
+		theme: "c",
+		domCache: false
+	},
+
+	_create: function() {
+		var $elem = this.element,
+			o = this.options;
+
+		if ( this._trigger( "beforeCreate" ) === false ) {
+			return;
+		}
+
+		$elem.addClass( "ui-page ui-body-" + o.theme );
+	}
+});
+
+})( jQuery );
+/*!
+ * jQuery Mobile v@VERSION
+ * http://jquerymobile.com/
+ *
+ * Copyright 2010, jQuery Project
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ */
+
+(function( $, window, undefined ) {
+
+	// jQuery.mobile configurable options
+	$.extend( $.mobile, {
+
+		// Namespace used framework-wide for data-attrs. Default is no namespace
+		ns: "",
+
+		// Define the url parameter used for referencing widget-generated sub-pages.
+		// Translates to to example.html&ui-page=subpageIdentifier
+		// hash segment before &ui-page= is used to make Ajax request
+		subPageUrlKey: "ui-page",
+
+		// Class assigned to page currently in view, and during transitions
+		activePageClass: "ui-page-active",
+
+		// Class used for "active" button state, from CSS framework
+		activeBtnClass: "ui-btn-active",
+
+		// Automatically handle clicks and form submissions through Ajax, when same-domain
+		ajaxEnabled: true,
+
+		// Automatically load and show pages based on location.hash
+		hashListeningEnabled: true,
+
+		// Set default page transition - 'none' for no transitions
+		defaultPageTransition: "slide",
+
+		// Minimum scroll distance that will be remembered when returning to a page
+		minScrollBack: screen.height / 2,
+
+		// Set default dialog transition - 'none' for no transitions
+		defaultDialogTransition: "pop",
+
+		// Show loading message during Ajax requests
+		// if false, message will not appear, but loading classes will still be toggled on html el
+		loadingMessage: "loading",
+
+		// Error response message - appears when an Ajax page request fails
+		pageLoadErrorMessage: "Error Loading Page",
+		
+		//automatically initialize the DOM when it's ready
+		autoInitializePage: true,
+
+		// Support conditions that must be met in order to proceed
+		// default enhanced qualifications are media query support OR IE 7+
+		gradeA: function(){
+			return $.support.mediaquery || $.mobile.browser.ie && $.mobile.browser.ie >= 7;
+		},
+
+		// TODO might be useful upstream in jquery itself ?
+		keyCode: {
+			ALT: 18,
+			BACKSPACE: 8,
+			CAPS_LOCK: 20,
+			COMMA: 188,
+			COMMAND: 91,
+			COMMAND_LEFT: 91, // COMMAND
+			COMMAND_RIGHT: 93,
+			CONTROL: 17,
+			DELETE: 46,
+			DOWN: 40,
+			END: 35,
+			ENTER: 13,
+			ESCAPE: 27,
+			HOME: 36,
+			INSERT: 45,
+			LEFT: 37,
+			MENU: 93, // COMMAND_RIGHT
+			NUMPAD_ADD: 107,
+			NUMPAD_DECIMAL: 110,
+			NUMPAD_DIVIDE: 111,
+			NUMPAD_ENTER: 108,
+			NUMPAD_MULTIPLY: 106,
+			NUMPAD_SUBTRACT: 109,
+			PAGE_DOWN: 34,
+			PAGE_UP: 33,
+			PERIOD: 190,
+			RIGHT: 39,
+			SHIFT: 16,
+			SPACE: 32,
+			TAB: 9,
+			UP: 38,
+			WINDOWS: 91 // COMMAND
+		},
+
+		// Scroll page vertically: scroll to 0 to hide iOS address bar, or pass a Y value
+		silentScroll: function( ypos ) {
+			if ( $.type( ypos ) !== "number" ) {
+				ypos = $.mobile.defaultHomeScroll;
+			}
+
+			// prevent scrollstart and scrollstop events
+			$.event.special.scrollstart.enabled = false;
+
+			setTimeout(function() {
+				window.scrollTo( 0, ypos );
+				$( document ).trigger( "silentscroll", { x: 0, y: ypos });
+			}, 20 );
+
+			setTimeout(function() {
+				$.event.special.scrollstart.enabled = true;
+			}, 150 );
+		},
+
+		// Take a data attribute property, prepend the namespace
+		// and then camel case the attribute string
+		nsNormalize: function( prop ) {
+			if ( !prop ) {
+				return;
+			}
+
+			return $.camelCase( $.mobile.ns + prop );
+		}
+	});
+
+	// Mobile version of data and removeData and hasData methods
+	// ensures all data is set and retrieved using jQuery Mobile's data namespace
+	$.fn.jqmData = function( prop, value ) {
+		return this.data( prop ? $.mobile.nsNormalize( prop ) : prop, value );
+	};
+
+	$.jqmData = function( elem, prop, value ) {
+		return $.data( elem, $.mobile.nsNormalize( prop ), value );
+	};
+
+	$.fn.jqmRemoveData = function( prop ) {
+		return this.removeData( $.mobile.nsNormalize( prop ) );
+	};
+
+	$.jqmRemoveData = function( elem, prop ) {
+		return $.removeData( elem, $.mobile.nsNormalize( prop ) );
+	};
+
+	$.jqmHasData = function( elem, prop ) {
+		return $.hasData( elem, $.mobile.nsNormalize( prop ) );
+	};
+
+	// Monkey-patching Sizzle to filter the :jqmData selector
+	var oldFind = $.find;
+
+	$.find = function( selector, context, ret, extra ) {
+		selector = selector.replace(/:jqmData\(([^)]*)\)/g, "[data-" + ( $.mobile.ns || "" ) + "$1]");
+
+		return oldFind.call( this, selector, context, ret, extra );
+	};
+
+	$.extend( $.find, oldFind );
+
+	$.find.matches = function( expr, set ) {
+		return $.find( expr, null, null, set );
+	};
+
+	$.find.matchesSelector = function( node, expr ) {
+		return $.find( expr, null, null, [ node ] ).length > 0;
+	};
+})( jQuery, this );
+/*
+* jQuery Mobile Framework : core utilities for auto ajax navigation, base tag mgmt,
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT or GPL Version 2 licenses.
+* http://jquery.org/license
+*/
+( function( $, undefined ) {
+
+	//define vars for interal use
+	var $window = $( window ),
+		$html = $( 'html' ),
+		$head = $( 'head' ),
+
+		//url path helpers for use in relative url management
+		path = {
+
+			// This scary looking regular expression parses an absolute URL or its relative
+			// variants (protocol, site, document, query, and hash), into the various
+			// components (protocol, host, path, query, fragment, etc that make up the
+			// URL as well as some other commonly used sub-parts. When used with RegExp.exec()
+			// or String.match, it parses the URL into a results array that looks like this:
+			//
+			//     [0]: http://jblas:password@mycompany.com:8080/mail/inbox?msg=1234&type=unread#msg-content
+			//     [1]: http://jblas:password@mycompany.com:8080/mail/inbox?msg=1234&type=unread
+			//     [2]: http://jblas:password@mycompany.com:8080/mail/inbox
+			//     [3]: http://jblas:password@mycompany.com:8080
+			//     [4]: http:
+			//     [5]: jblas:password@mycompany.com:8080
+			//     [6]: jblas:password
+			//     [7]: jblas
+			//     [8]: password
+			//     [9]: mycompany.com:8080
+			//    [10]: mycompany.com
+			//    [11]: 8080
+			//    [12]: /mail/inbox
+			//    [13]: /mail/
+			//    [14]: inbox
+			//    [15]: ?msg=1234&type=unread
+			//    [16]: #msg-content
+			//
+			urlParseRE: /^(((([^:\/#\?]+:)?(?:\/\/((?:(([^:@\/#\?]+)(?:\:([^:@\/#\?]+))?)@)?(([^:\/#\?]+)(?:\:([0-9]+))?))?)?)?((\/?(?:[^\/\?#]+\/+)*)([^\?#]*)))?(\?[^#]+)?)(#.*)?/,
+
+			//Parse a URL into a structure that allows easy access to
+			//all of the URL components by name.
+			parseUrl: function( url ) {
+				// If we're passed an object, we'll assume that it is
+				// a parsed url object and just return it back to the caller.
+				if ( $.type( url ) === "object" ) {
+					return url;
+				}
+
+				var u = url || "",
+					matches = path.urlParseRE.exec( url ),
+					results;
+				if ( matches ) {
+					// Create an object that allows the caller to access the sub-matches
+					// by name. Note that IE returns an empty string instead of undefined,
+					// like all other browsers do, so we normalize everything so its consistent
+					// no matter what browser we're running on.
+					results = {
+						href:         matches[0] || "",
+						hrefNoHash:   matches[1] || "",
+						hrefNoSearch: matches[2] || "",
+						domain:       matches[3] || "",
+						protocol:     matches[4] || "",
+						authority:    matches[5] || "",
+						username:     matches[7] || "",
+						password:     matches[8] || "",
+						host:         matches[9] || "",
+						hostname:     matches[10] || "",
+						port:         matches[11] || "",
+						pathname:     matches[12] || "",
+						directory:    matches[13] || "",
+						filename:     matches[14] || "",
+						search:       matches[15] || "",
+						hash:         matches[16] || ""
+					};
+				}
+				return results || {};
+			},
+
+			//Turn relPath into an asbolute path. absPath is
+			//an optional absolute path which describes what
+			//relPath is relative to.
+			makePathAbsolute: function( relPath, absPath ) {
+				if ( relPath && relPath.charAt( 0 ) === "/" ) {
+					return relPath;
+				}
+
+				relPath = relPath || "";
+				absPath = absPath ? absPath.replace( /^\/|(\/[^\/]*|[^\/]+)$/g, "" ) : "";
+
+				var absStack = absPath ? absPath.split( "/" ) : [],
+					relStack = relPath.split( "/" );
+				for ( var i = 0; i < relStack.length; i++ ) {
+					var d = relStack[ i ];
+					switch ( d ) {
+						case ".":
+							break;
+						case "..":
+							if ( absStack.length ) {
+								absStack.pop();
+							}
+							break;
+						default:
+							absStack.push( d );
+							break;
+					}
+				}
+				return "/" + absStack.join( "/" );
+			},
+
+			//Returns true if both urls have the same domain.
+			isSameDomain: function( absUrl1, absUrl2 ) {
+				return path.parseUrl( absUrl1 ).domain === path.parseUrl( absUrl2 ).domain;
+			},
+
+			//Returns true for any relative variant.
+			isRelativeUrl: function( url ) {
+				// All relative Url variants have one thing in common, no protocol.
+				return path.parseUrl( url ).protocol === "";
+			},
+
+			//Returns true for an absolute url.
+			isAbsoluteUrl: function( url ) {
+				return path.parseUrl( url ).protocol !== "";
+			},
+
+			//Turn the specified realtive URL into an absolute one. This function
+			//can handle all relative variants (protocol, site, document, query, fragment).
+			makeUrlAbsolute: function( relUrl, absUrl ) {
+				if ( !path.isRelativeUrl( relUrl ) ) {
+					return relUrl;
+				}
+
+				var relObj = path.parseUrl( relUrl ),
+					absObj = path.parseUrl( absUrl ),
+					protocol = relObj.protocol || absObj.protocol,
+					authority = relObj.authority || absObj.authority,
+					hasPath = relObj.pathname !== "",
+					pathname = path.makePathAbsolute( relObj.pathname || absObj.filename, absObj.pathname ),
+					search = relObj.search || ( !hasPath && absObj.search ) || "",
+					hash = relObj.hash;
+
+				return protocol + "//" + authority + pathname + search + hash;
+			},
+
+			//Add search (aka query) params to the specified url.
+			addSearchParams: function( url, params ) {
+				var u = path.parseUrl( url ),
+					p = ( typeof params === "object" ) ? $.param( params ) : params,
+					s = u.search || "?";
+				return u.hrefNoSearch + s + ( s.charAt( s.length - 1 ) !== "?" ? "&" : "" ) + p + ( u.hash || "" );
+			},
+
+			convertUrlToDataUrl: function( absUrl ) {
+				var u = path.parseUrl( absUrl );
+				if ( path.isEmbeddedPage( u ) ) {
+				    // For embedded pages, remove the dialog hash key as in getFilePath(),
+				    // otherwise the Data Url won't match the id of the embedded Page.
+					return u.hash.split( dialogHashKey )[0].replace( /^#/, "" );
+				} else if ( path.isSameDomain( u, documentBase ) ) {
+					return u.hrefNoHash.replace( documentBase.domain, "" );
+				}
+				return absUrl;
+			},
+
+			//get path from current hash, or from a file path
+			get: function( newPath ) {
+				if( newPath === undefined ) {
+					newPath = location.hash;
+				}
+				return path.stripHash( newPath ).replace( /[^\/]*\.[^\/*]+$/, '' );
+			},
+
+			//return the substring of a filepath before the sub-page key, for making a server request
+			getFilePath: function( path ) {
+				var splitkey = '&' + $.mobile.subPageUrlKey;
+				return path && path.split( splitkey )[0].split( dialogHashKey )[0];
+			},
+
+			//set location hash to path
+			set: function( path ) {
+				location.hash = path;
+			},
+
+			//test if a given url (string) is a path
+			//NOTE might be exceptionally naive
+			isPath: function( url ) {
+				return ( /\// ).test( url );
+			},
+
+			//return a url path with the window's location protocol/hostname/pathname removed
+			clean: function( url ) {
+				return url.replace( documentBase.domain, "" );
+			},
+
+			//just return the url without an initial #
+			stripHash: function( url ) {
+				return url.replace( /^#/, "" );
+			},
+
+			//remove the preceding hash, any query params, and dialog notations
+			cleanHash: function( hash ) {
+				return path.stripHash( hash.replace( /\?.*$/, "" ).replace( dialogHashKey, "" ) );
+			},
+
+			//check whether a url is referencing the same domain, or an external domain or different protocol
+			//could be mailto, etc
+			isExternal: function( url ) {
+				var u = path.parseUrl( url );
+				return u.protocol && u.domain !== documentUrl.domain ? true : false;
+			},
+
+			hasProtocol: function( url ) {
+				return ( /^(:?\w+:)/ ).test( url );
+			},
+
+			isEmbeddedPage: function( url ) {
+				var u = path.parseUrl( url );
+
+				//if the path is absolute, then we need to compare the url against
+				//both the documentUrl and the documentBase. The main reason for this
+				//is that links embedded within external documents will refer to the
+				//application document, whereas links embedded within the application
+				//document will be resolved against the document base.
+				if ( u.protocol !== "" ) {
+					return ( u.hash && ( u.hrefNoHash === documentUrl.hrefNoHash || ( documentBaseDiffers && u.hrefNoHash === documentBase.hrefNoHash ) ) );
+				}
+				return (/^#/).test( u.href );
+			}
+		},
+
+		//will be defined when a link is clicked and given an active class
+		$activeClickedLink = null,
+
+		//urlHistory is purely here to make guesses at whether the back or forward button was clicked
+		//and provide an appropriate transition
+		urlHistory = {
+			// Array of pages that are visited during a single page load. 
+			// Each has a url and optional transition, title, and pageUrl (which represents the file path, in cases where URL is obscured, such as dialogs)
+			stack: [],
+
+			//maintain an index number for the active page in the stack
+			activeIndex: 0,
+
+			//get active
+			getActive: function() {
+				return urlHistory.stack[ urlHistory.activeIndex ];
+			},
+
+			getPrev: function() {
+				return urlHistory.stack[ urlHistory.activeIndex - 1 ];
+			},
+
+			getNext: function() {
+				return urlHistory.stack[ urlHistory.activeIndex + 1 ];
+			},
+
+			// addNew is used whenever a new page is added
+			addNew: function( url, transition, title, pageUrl ) {
+				//if there's forward history, wipe it
+				if( urlHistory.getNext() ) {
+					urlHistory.clearForward();
+				}
+
+				urlHistory.stack.push( {url : url, transition: transition, title: title, pageUrl: pageUrl } );
+
+				urlHistory.activeIndex = urlHistory.stack.length - 1;
+			},
+
+			//wipe urls ahead of active index
+			clearForward: function() {
+				urlHistory.stack = urlHistory.stack.slice( 0, urlHistory.activeIndex + 1 );
+			},
+
+			directHashChange: function( opts ) {
+				var back , forward, newActiveIndex;
+
+				// check if url isp in history and if it's ahead or behind current page
+				$.each( urlHistory.stack, function( i, historyEntry ) {
+
+					//if the url is in the stack, it's a forward or a back
+					if( opts.currentUrl === historyEntry.url ) {
+						//define back and forward by whether url is older or newer than current page
+						back = i < urlHistory.activeIndex;
+						forward = !back;
+						newActiveIndex = i;
+					}
+				});
+
+				// save new page index, null check to prevent falsey 0 result
+				this.activeIndex = newActiveIndex !== undefined ? newActiveIndex : this.activeIndex;
+
+				if( back ) {
+					opts.isBack();
+				} else if( forward ) {
+					opts.isForward();
+				}
+			},
+
+			//disable hashchange event listener internally to ignore one change
+			//toggled internally when location.hash is updated to match the url of a successful page load
+			ignoreNextHashChange: false
+		},
+
+		//define first selector to receive focus when a page is shown
+		focusable = "[tabindex],a,button:visible,select:visible,input",
+
+		//queue to hold simultanious page transitions
+		pageTransitionQueue = [],
+
+		//indicates whether or not page is in process of transitioning
+		isPageTransitioning = false,
+
+		//nonsense hash change key for dialogs, so they create a history entry
+		dialogHashKey = "&ui-state=dialog",
+
+		//existing base tag?
+		$base = $head.children( "base" ),
+
+		//tuck away the original document URL minus any fragment.
+		documentUrl = path.parseUrl( location.href ),
+
+		//if the document has an embedded base tag, documentBase is set to its
+		//initial value. If a base tag does not exist, then we default to the documentUrl.
+		documentBase = $base.length ? path.parseUrl( path.makeUrlAbsolute( $base.attr( "href" ), documentUrl.href ) ) : documentUrl,
+
+		//cache the comparison once.
+		documentBaseDiffers = ( documentUrl.hrefNoHash !== documentBase.hrefNoHash );
+
+		//base element management, defined depending on dynamic base tag support
+		var base = $.support.dynamicBaseTag ? {
+
+			//define base element, for use in routing asset urls that are referenced in Ajax-requested markup
+			element: ( $base.length ? $base : $( "<base>", { href: documentBase.hrefNoHash } ).prependTo( $head ) ),
+
+			//set the generated BASE element's href attribute to a new page's base path
+			set: function( href ) {
+				base.element.attr( "href", path.makeUrlAbsolute( href, documentBase ) );
+			},
+
+			//set the generated BASE element's href attribute to a new page's base path
+			reset: function() {
+				base.element.attr( "href", documentBase.hrefNoHash );
+			}
+
+		} : undefined;
+
+/*
+	internal utility functions
+--------------------------------------*/
+
+
+	//direct focus to the page title, or otherwise first focusable element
+	function reFocus( page ) {
+		var lastClicked = page.jqmData( "lastClicked" );
+
+		if( lastClicked && lastClicked.length ) {
+			lastClicked.focus();
+		}
+		else {
+			var pageTitle = page.find( ".ui-title:eq(0)" );
+
+			if( pageTitle.length ) {
+				pageTitle.focus();
+			}
+			else{
+				page.find( focusable ).eq( 0 ).focus();
+			}
+		}
+	}
+
+	//remove active classes after page transition or error
+	function removeActiveLinkClass( forceRemoval ) {
+		if( !!$activeClickedLink && ( !$activeClickedLink.closest( '.ui-page-active' ).length || forceRemoval ) ) {
+			$activeClickedLink.removeClass( $.mobile.activeBtnClass );
+		}
+		$activeClickedLink = null;
+	}
+
+	function releasePageTransitionLock() {
+		isPageTransitioning = false;
+		if( pageTransitionQueue.length > 0 ) {
+			$.mobile.changePage.apply( null, pageTransitionQueue.pop() );
+		}
+	}
+
+	//function for transitioning between two existing pages
+	function transitionPages( toPage, fromPage, transition, reverse ) {
+
+		//get current scroll distance
+		var currScroll = $.support.scrollTop ? $window.scrollTop() : true,
+			toScroll	= toPage.data( "lastScroll" ) || $.mobile.defaultHomeScroll,
+			screenHeight = getScreenHeight();
+
+		//if scrolled down, scroll to top
+		if( currScroll ){
+			window.scrollTo( 0, $.mobile.defaultHomeScroll );
+		}
+
+		//if the Y location we're scrolling to is less than 10px, let it go for sake of smoothness
+		if( toScroll < $.mobile.minScrollBack ){
+			toScroll = 0;
+		}
+
+		if( fromPage ) {
+			//set as data for returning to that spot
+			fromPage
+				.height( screenHeight + currScroll )
+				.jqmData( "lastScroll", currScroll )
+				.jqmData( "lastClicked", $activeClickedLink );
+
+			//trigger before show/hide events
+			fromPage.data( "page" )._trigger( "beforehide", null, { nextPage: toPage } );
+		}
+		toPage
+			.height( screenHeight + toScroll )
+			.data( "page" )._trigger( "beforeshow", null, { prevPage: fromPage || $( "" ) } );
+
+		//clear page loader
+		$.mobile.hidePageLoadingMsg();
+
+		//find the transition handler for the specified transition. If there
+		//isn't one in our transitionHandlers dictionary, use the default one.
+		//call the handler immediately to kick-off the transition.
+		var th = $.mobile.transitionHandlers[transition || "none"] || $.mobile.defaultTransitionHandler,
+			promise = th( transition, reverse, toPage, fromPage );
+
+		promise.done(function() {
+			//reset toPage height bac
+			toPage.height( "" );
+
+			//jump to top or prev scroll, sometimes on iOS the page has not rendered yet.
+			if( toScroll ){
+				$.mobile.silentScroll( toScroll );
+				$( document ).one( "silentscroll", function() { reFocus( toPage ); } );
+			}
+			else{
+				reFocus( toPage );
+			}
+
+			//trigger show/hide events
+			if( fromPage ) {
+				fromPage.height("").data( "page" )._trigger( "hide", null, { nextPage: toPage } );
+			}
+
+			//trigger pageshow, define prevPage as either fromPage or empty jQuery obj
+			toPage.data( "page" )._trigger( "show", null, { prevPage: fromPage || $( "" ) } );
+		});
+
+		return promise;
+	}
+
+	//simply set the active page's minimum height to screen height, depending on orientation
+	function getScreenHeight(){
+		var orientation 	= jQuery.event.special.orientationchange.orientation(),
+			port			= orientation === "portrait",
+			winMin			= port ? 480 : 320,
+			screenHeight	= port ? screen.availHeight : screen.availWidth,
+			winHeight		= Math.max( winMin, $( window ).height() ),
+			pageMin			= Math.min( screenHeight, winHeight );
+
+		return pageMin;
+	}
+
+	//simply set the active page's minimum height to screen height, depending on orientation
+	function resetActivePageHeight(){
+		$( "." + $.mobile.activePageClass ).css( "min-height", getScreenHeight() );
+	}
+
+	//shared page enhancements
+	function enhancePage( $page, role ) {
+		// If a role was specified, make sure the data-role attribute
+		// on the page element is in sync.
+		if( role ) {
+			$page.attr( "data-" + $.mobile.ns + "role", role );
+		}
+
+		//run page plugin
+		$page.page();
+	}
+
+/* exposed $.mobile methods	 */
+
+	//animation complete callback
+	$.fn.animationComplete = function( callback ) {
+		if( $.support.cssTransitions ) {
+			return $( this ).one( 'webkitAnimationEnd', callback );
+		}
+		else{
+			// defer execution for consistency between webkit/non webkit
+			setTimeout( callback, 0 );
+			return $( this );
+		}
+	};
+
+	//update location.hash, with or without triggering hashchange event
+	//TODO - deprecate this one at 1.0
+	$.mobile.updateHash = path.set;
+
+	//expose path object on $.mobile
+	$.mobile.path = path;
+
+	//expose base object on $.mobile
+	$.mobile.base = base;
+
+	//url stack, useful when plugins need to be aware of previous pages viewed
+	//TODO: deprecate this one at 1.0
+	$.mobile.urlstack = urlHistory.stack;
+
+	//history stack
+	$.mobile.urlHistory = urlHistory;
+
+	//default non-animation transition handler
+	$.mobile.noneTransitionHandler = function( name, reverse, $toPage, $fromPage ) {
+		if ( $fromPage ) {
+			$fromPage.removeClass( $.mobile.activePageClass );
+		}
+		$toPage.addClass( $.mobile.activePageClass );
+
+		return $.Deferred().resolve( name, reverse, $toPage, $fromPage ).promise();
+	};
+
+	//default handler for unknown transitions
+	$.mobile.defaultTransitionHandler = $.mobile.noneTransitionHandler;
+
+	//transition handler dictionary for 3rd party transitions
+	$.mobile.transitionHandlers = {
+		none: $.mobile.defaultTransitionHandler
+	};
+
+	//enable cross-domain page support
+	$.mobile.allowCrossDomainPages = false;
+
+	//return the original document url
+	$.mobile.getDocumentUrl = function(asParsedObject) {
+		return asParsedObject ? $.extend( {}, documentUrl ) : documentUrl.href;
+	};
+
+	//return the original document base url
+	$.mobile.getDocumentBase = function(asParsedObject) {
+		return asParsedObject ? $.extend( {}, documentBase ) : documentBase.href;
+	};
+
+	// Load a page into the DOM.
+	$.mobile.loadPage = function( url, options ) {
+		// This function uses deferred notifications to let callers
+		// know when the page is done loading, or if an error has occurred.
+		var deferred = $.Deferred(),
+
+			// The default loadPage options with overrides specified by
+			// the caller.
+			settings = $.extend( {}, $.mobile.loadPage.defaults, options ),
+
+			// The DOM element for the page after it has been loaded.
+			page = null,
+
+			// If the reloadPage option is true, and the page is already
+			// in the DOM, dupCachedPage will be set to the page element
+			// so that it can be removed after the new version of the
+			// page is loaded off the network.
+			dupCachedPage = null,
+
+			// determine the current base url
+			findBaseWithDefault = function(){
+				var closestBase = ( $.mobile.activePage && getClosestBaseUrl( $.mobile.activePage ) );
+				return closestBase || documentBase.hrefNoHash;
+			},
+
+			// The absolute version of the URL passed into the function. This
+			// version of the URL may contain dialog/subpage params in it.
+			absUrl = path.makeUrlAbsolute( url, findBaseWithDefault() );
+
+
+		// If the caller provided data, and we're using "get" request,
+		// append the data to the URL.
+		if ( settings.data && settings.type === "get" ) {
+			absUrl = path.addSearchParams( absUrl, settings.data );
+			settings.data = undefined;
+		}
+
+			// The absolute version of the URL minus any dialog/subpage params.
+			// In otherwords the real URL of the page to be loaded.
+		var fileUrl = path.getFilePath( absUrl ),
+
+			// The version of the Url actually stored in the data-url attribute of
+			// the page. For embedded pages, it is just the id of the page. For pages
+			// within the same domain as the document base, it is the site relative
+			// path. For cross-domain pages (Phone Gap only) the entire absolute Url
+			// used to load the page.
+			dataUrl = path.convertUrlToDataUrl( absUrl );
+
+		// Make sure we have a pageContainer to work with.
+		settings.pageContainer = settings.pageContainer || $.mobile.pageContainer;
+
+		// Check to see if the page already exists in the DOM.
+		page = settings.pageContainer.children( ":jqmData(url='" + dataUrl + "')" );
+
+		// Reset base to the default document base.
+		if ( base ) {
+			base.reset();
+		}
+
+		// If the page we are interested in is already in the DOM,
+		// and the caller did not indicate that we should force a
+		// reload of the file, we are done. Otherwise, track the
+		// existing page as a duplicated.
+		if ( page.length ) {
+			if ( !settings.reloadPage ) {
+				enhancePage( page, settings.role );
+				deferred.resolve( absUrl, options, page );
+				return deferred.promise();
+			}
+			dupCachedPage = page;
+		}
+
+		if ( settings.showLoadMsg ) {
+			
+			// This configurable timeout allows cached pages a brief delay to load without showing a message
+			var loadMsgDelay = setTimeout(function(){
+					$.mobile.showPageLoadingMsg();
+				}, settings.loadMsgDelay ),
+				
+				// Shared logic for clearing timeout and removing message.
+				hideMsg = function(){
+					
+					// Stop message show timer
+					clearTimeout( loadMsgDelay );
+					
+					// Hide loading message
+					$.mobile.hidePageLoadingMsg();
+				};
+		}
+
+		if ( !( $.mobile.allowCrossDomainPages || path.isSameDomain( documentUrl, absUrl ) ) ) {
+			deferred.reject( absUrl, options );
+		} else {
+			// Load the new page.
+			$.ajax({
+				url: fileUrl,
+				type: settings.type,
+				data: settings.data,
+				dataType: "html",
+				success: function( html ) {
+					//pre-parse html to check for a data-url,
+					//use it as the new fileUrl, base path, etc
+					var all = $( "<div></div>" ),
+
+						//page title regexp
+						newPageTitle = html.match( /<title[^>]*>([^<]*)/ ) && RegExp.$1,
+
+						// TODO handle dialogs again
+						pageElemRegex = new RegExp( ".*(<[^>]+\\bdata-" + $.mobile.ns + "role=[\"']?page[\"']?[^>]*>).*" ),
+						dataUrlRegex = new RegExp( "\\bdata-" + $.mobile.ns + "url=[\"']?([^\"'>]*)[\"']?" );
+
+
+					// data-url must be provided for the base tag so resource requests can be directed to the
+					// correct url. loading into a temprorary element makes these requests immediately
+					if( pageElemRegex.test( html )
+							&& RegExp.$1
+							&& dataUrlRegex.test( RegExp.$1 )
+							&& RegExp.$1 ) {
+						url = fileUrl = path.getFilePath( RegExp.$1 );
+					}
+					else{
+
+					}
+
+					if ( base ) {
+						base.set( fileUrl );
+					}
+
+					//workaround to allow scripts to execute when included in page divs
+					all.get( 0 ).innerHTML = html;
+					page = all.find( ":jqmData(role='page'), :jqmData(role='dialog')" ).first();
+
+					//if page elem couldn't be found, create one and insert the body element's contents
+					if( !page.length ){
+						page = $( "<div data-" + $.mobile.ns + "role='page'>" + html.split( /<\/?body[^>]*>/gmi )[1] + "</div>" );
+					}
+
+					if ( newPageTitle && !page.jqmData( "title" ) ) {
+						page.jqmData( "title", newPageTitle );
+					}
+
+					//rewrite src and href attrs to use a base url
+					if( !$.support.dynamicBaseTag ) {
+						var newPath = path.get( fileUrl );
+						page.find( "[src], link[href], a[rel='external'], :jqmData(ajax='false'), a[target]" ).each(function() {
+							var thisAttr = $( this ).is( '[href]' ) ? 'href' :
+									$(this).is('[src]') ? 'src' : 'action',
+								thisUrl = $( this ).attr( thisAttr );
+
+							// XXX_jblas: We need to fix this so that it removes the document
+							//            base URL, and then prepends with the new page URL.
+							//if full path exists and is same, chop it - helps IE out
+							thisUrl = thisUrl.replace( location.protocol + '//' + location.host + location.pathname, '' );
+
+							if( !/^(\w+:|#|\/)/.test( thisUrl ) ) {
+								$( this ).attr( thisAttr, newPath + thisUrl );
+							}
+						});
+					}
+
+					//append to page and enhance
+					page
+						.attr( "data-" + $.mobile.ns + "url", path.convertUrlToDataUrl( fileUrl ) )
+						.appendTo( settings.pageContainer );
+
+					// wait for page creation to leverage options defined on widget
+					page.one('pagecreate', function(){
+
+						// when dom caching is not enabled bind to remove the page on hide
+						if( !page.data("page").options.domCache ){
+							page.bind( "pagehide.remove", function(){
+								$(this).remove();
+							});
+						}
+					});
+
+					enhancePage( page, settings.role );
+
+					// Enhancing the page may result in new dialogs/sub pages being inserted
+					// into the DOM. If the original absUrl refers to a sub-page, that is the
+					// real page we are interested in.
+					if ( absUrl.indexOf( "&" + $.mobile.subPageUrlKey ) > -1 ) {
+						page = settings.pageContainer.children( ":jqmData(url='" + dataUrl + "')" );
+					}
+
+					//bind pageHide to removePage after it's hidden, if the page options specify to do so
+
+					// Remove loading message.
+					if ( settings.showLoadMsg ) {
+						hideMsg();
+					}
+
+					deferred.resolve( absUrl, options, page, dupCachedPage );
+				},
+				error: function() {
+					//set base back to current path
+					if( base ) {
+						base.set( path.get() );
+					}
+
+					// Remove loading message.
+					if ( settings.showLoadMsg ) {
+						
+						// Remove loading message.
+						hideMsg();
+
+						//show error message
+						$( "<div class='ui-loader ui-overlay-shadow ui-body-e ui-corner-all'><h1>"+ $.mobile.pageLoadErrorMessage +"</h1></div>" )
+							.css({ "display": "block", "opacity": 0.96, "top": $window.scrollTop() + 100 })
+							.appendTo( settings.pageContainer )
+							.delay( 800 )
+							.fadeOut( 400, function() {
+								$( this ).remove();
+							});
+					}
+
+					deferred.reject( absUrl, options );
+				}
+			});
+		}
+
+		return deferred.promise();
+	};
+
+	$.mobile.loadPage.defaults = {
+		type: "get",
+		data: undefined,
+		reloadPage: false,
+		role: undefined, // By default we rely on the role defined by the @data-role attribute.
+		showLoadMsg: false,
+		pageContainer: undefined,
+		loadMsgDelay: 50 // This delay allows loads that pull from browser cache to occur without showing the loading message.
+	};
+
+	// Show a specific page in the page container.
+	$.mobile.changePage = function( toPage, options ) {
+		// XXX: REMOVE_BEFORE_SHIPPING_1.0
+		// This is temporary code that makes changePage() compatible with previous alpha versions.
+		if ( typeof options !== "object" ) {
+			var opts = null;
+
+			// Map old-style call signature for form submit to the new options object format.
+			if ( typeof toPage === "object" && toPage.url && toPage.type ) {
+				opts = {
+					type: toPage.type,
+					data: toPage.data,
+					forcePageLoad: true
+				};
+				toPage = toPage.url;
+			}
+
+			// The arguments passed into the function need to be re-mapped
+			// to the new options object format.
+			var len = arguments.length;
+			if ( len > 1 ) {
+				var argNames = [ "transition", "reverse", "changeHash", "fromHashChange" ], i;
+				for ( i = 1; i < len; i++ ) {
+					var a = arguments[ i ];
+					if ( typeof a !== "undefined" ) {
+						opts = opts || {};
+						opts[ argNames[ i - 1 ] ] = a;
+					}
+				}
+			}
+
+			// If an options object was created, then we know changePage() was called
+			// with an old signature.
+			if ( opts ) {
+				return $.mobile.changePage( toPage, opts );
+			}
+		}
+		// XXX: REMOVE_BEFORE_SHIPPING_1.0
+
+		// If we are in the midst of a transition, queue the current request.
+		// We'll call changePage() once we're done with the current transition to
+		// service the request.
+		if( isPageTransitioning ) {
+			pageTransitionQueue.unshift( arguments );
+			return;
+		}
+
+		// Set the isPageTransitioning flag to prevent any requests from
+		// entering this method while we are in the midst of loading a page
+		// or transitioning.
+
+		isPageTransitioning = true;
+
+		var settings = $.extend( {}, $.mobile.changePage.defaults, options );
+
+		// Make sure we have a pageContainer to work with.
+		settings.pageContainer = settings.pageContainer || $.mobile.pageContainer;
+
+		// If the caller passed us a url, call loadPage()
+		// to make sure it is loaded into the DOM. We'll listen
+		// to the promise object it returns so we know when
+		// it is done loading or if an error ocurred.
+		if ( typeof toPage == "string" ) {
+			$.mobile.loadPage( toPage, settings )
+				.done(function( url, options, newPage, dupCachedPage ) {
+					isPageTransitioning = false;
+					options.duplicateCachedPage = dupCachedPage;
+					$.mobile.changePage( newPage, options );
+				})
+				.fail(function( url, options ) {
+					// XXX_jblas: Fire off changepagefailed notificaiton.
+					isPageTransitioning = false;
+
+					//clear out the active button state
+					removeActiveLinkClass( true );
+
+					//release transition lock so navigation is free again
+					releasePageTransitionLock();
+					settings.pageContainer.trigger("changepagefailed");
+				});
+			return;
+		}
+
+		// The caller passed us a real page DOM element. Update our
+		// internal state and then trigger a transition to the page.
+		var mpc = settings.pageContainer,
+			fromPage = $.mobile.activePage,
+			url = toPage.jqmData( "url" ),
+			// The pageUrl var is usually the same as url, except when url is obscured as a dialog url. pageUrl always contains the file path
+			pageUrl = url,
+			fileUrl = path.getFilePath( url ),
+			active = urlHistory.getActive(),
+			activeIsInitialPage = urlHistory.activeIndex === 0,
+			historyDir = 0,
+			pageTitle = document.title,
+			isDialog = settings.role === "dialog" || toPage.jqmData( "role" ) === "dialog";
+
+		// Let listeners know we're about to change the current page.
+		mpc.trigger( "beforechangepage" );
+
+		// If we are trying to transition to the same page that we are currently on ignore the request.
+		// an illegal same page request is defined by the current page being the same as the url, as long as there's history
+		// and toPage is not an array or object (those are allowed to be "same")
+		//
+		// XXX_jblas: We need to remove this at some point when we allow for transitions
+		//            to the same page.
+		if( fromPage && fromPage[0] === toPage[0] ) {
+			isPageTransitioning = false;
+			mpc.trigger( "changepage" );
+			return;
+		}
+
+		// We need to make sure the page we are given has already been enhanced.
+		enhancePage( toPage, settings.role );
+
+		// If the changePage request was sent from a hashChange event, check to see if the
+		// page is already within the urlHistory stack. If so, we'll assume the user hit
+		// the forward/back button and will try to match the transition accordingly.
+		if( settings.fromHashChange ) {
+			urlHistory.directHashChange({
+				currentUrl:	url,
+				isBack:		function() { historyDir = -1; },
+				isForward:	function() { historyDir = 1; }
+			});
+		}
+
+		// Kill the keyboard.
+		// XXX_jblas: We need to stop crawling the entire document to kill focus. Instead,
+		//            we should be tracking focus with a live() handler so we already have
+		//            the element in hand at this point.
+		// Wrap this in a try/catch block since IE9 throw "Unspecified error" if document.activeElement
+		// is undefined when we are in an IFrame.
+		try {
+			$( document.activeElement || "" ).add( "input:focus, textarea:focus, select:focus" ).blur();
+		} catch(e) {}
+
+		// If we're displaying the page as a dialog, we don't want the url
+		// for the dialog content to be used in the hash. Instead, we want
+		// to append the dialogHashKey to the url of the current page.
+		if ( isDialog && active ) {
+			url = active.url + dialogHashKey;
+		}
+
+		// Set the location hash.
+		if( settings.changeHash !== false && url ) {
+			//disable hash listening temporarily
+			urlHistory.ignoreNextHashChange = true;
+			//update hash and history
+			path.set( url );
+		}
+
+		//if title element wasn't found, try the page div data attr too
+		var newPageTitle = toPage.jqmData( "title" ) || toPage.children(":jqmData(role='header')").find(".ui-title" ).text();
+		if( !!newPageTitle && pageTitle == document.title ) {
+			pageTitle = newPageTitle;
+		}
+
+		//add page to history stack if it's not back or forward
+		if( !historyDir ) {
+			urlHistory.addNew( url, settings.transition, pageTitle, pageUrl );
+		}
+
+		//set page title
+		document.title = urlHistory.getActive().title;
+
+		//set "toPage" as activePage
+		$.mobile.activePage = toPage;
+
+		// Make sure we have a transition defined.
+		settings.transition = settings.transition
+			|| ( ( historyDir && !activeIsInitialPage ) ? active.transition : undefined )
+			|| ( isDialog ? $.mobile.defaultDialogTransition : $.mobile.defaultPageTransition );
+
+		// If we're navigating back in the URL history, set reverse accordingly.
+		settings.reverse = settings.reverse || historyDir < 0;
+
+		transitionPages( toPage, fromPage, settings.transition, settings.reverse )
+			.done(function() {
+				removeActiveLinkClass();
+
+				//if there's a duplicateCachedPage, remove it from the DOM now that it's hidden
+				if ( settings.duplicateCachedPage ) {
+					settings.duplicateCachedPage.remove();
+				}
+
+				//remove initial build class (only present on first pageshow)
+				$html.removeClass( "ui-mobile-rendering" );
+
+				releasePageTransitionLock();
+
+				// Let listeners know we're all done changing the current page.
+				mpc.trigger( "changepage" );
+			});
+	};
+
+	$.mobile.changePage.defaults = {
+		transition: undefined,
+		reverse: false,
+		changeHash: true,
+		fromHashChange: false,
+		role: undefined, // By default we rely on the role defined by the @data-role attribute.
+		duplicateCachedPage: undefined,
+		pageContainer: undefined,
+		showLoadMsg: true //loading message shows by default when pages are being fetched during changePage
+	};
+
+/* Event Bindings - hashchange, submit, and click */
+	function findClosestLink( ele )
+	{
+		while ( ele ) {
+			if ( ele.nodeName.toLowerCase() == "a" ) {
+				break;
+			}
+			ele = ele.parentNode;
+		}
+		return ele;
+	}
+
+	// The base URL for any given element depends on the page it resides in.
+	function getClosestBaseUrl( ele )
+	{
+		// Find the closest page and extract out its url.
+		var url = $( ele ).closest( ".ui-page" ).jqmData( "url" ),
+			base = documentBase.hrefNoHash;
+
+		if ( !url || !path.isPath( url ) ) {
+			url = base;
+		}
+
+		return path.makeUrlAbsolute( url, base);
+	}
+
+
+	//The following event bindings should be bound after mobileinit has been triggered
+	//the following function is called in the init file
+	$.mobile._registerInternalEvents = function(){
+
+		//bind to form submit events, handle with Ajax
+		$( "form" ).live('submit', function( event ) {
+			var $this = $( this );
+			if( !$.mobile.ajaxEnabled ||
+				$this.is( ":jqmData(ajax='false')" ) ) {
+					return;
+				}
+
+			var type = $this.attr( "method" ),
+				target = $this.attr( "target" ),
+				url = $this.attr( "action" );
+
+			// If no action is specified, browsers default to using the
+			// URL of the document containing the form. Since we dynamically
+			// pull in pages from external documents, the form should submit
+			// to the URL for the source document of the page containing
+			// the form.
+			if ( !url ) {
+				// Get the @data-url for the page containing the form.
+				url = getClosestBaseUrl( $this );
+				if ( url === documentBase.hrefNoHash ) {
+					// The url we got back matches the document base,
+					// which means the page must be an internal/embedded page,
+					// so default to using the actual document url as a browser
+					// would.
+					url = documentUrl.hrefNoSearch;
+				}
+			}
+
+			url = path.makeUrlAbsolute(  url, getClosestBaseUrl($this) );
+
+			//external submits use regular HTTP
+			if( path.isExternal( url ) || target ) {
+				return;
+			}
+
+			$.mobile.changePage(
+				url,
+				{
+					type:		type && type.length && type.toLowerCase() || "get",
+					data:		$this.serialize(),
+					transition:	$this.jqmData( "transition" ),
+					direction:	$this.jqmData( "direction" ),
+					reloadPage:	true
+				}
+			);
+			event.preventDefault();
+		});
+
+		//add active state on vclick
+		$( document ).bind( "vclick", function( event ) {
+			var link = findClosestLink( event.target );
+			if ( link ) {
+				if ( path.parseUrl( link.getAttribute( "href" ) || "#" ).hash !== "#" ) {
+					$( link ).closest( ".ui-btn" ).not( ".ui-disabled" ).addClass( $.mobile.activeBtnClass );
+					$( "." + $.mobile.activePageClass + " .ui-btn" ).not( link ).blur();
+				}
+			}
+		});
+
+		// click routing - direct to HTTP or Ajax, accordingly
+		$( document ).bind( "click", function( event ) {
+			var link = findClosestLink( event.target );
+			if ( !link ) {
+				return;
+			}
+
+			var $link = $( link ),
+				//remove active link class if external (then it won't be there if you come back)
+				httpCleanup = function(){
+					window.setTimeout( function() { removeActiveLinkClass( true ); }, 200 );
+				};
+
+			//if there's a data-rel=back attr, go back in history
+			if( $link.is( ":jqmData(rel='back')" ) ) {
+				window.history.back();
+				return false;
+			}
+
+			//if ajax is disabled, exit early
+			if( !$.mobile.ajaxEnabled ){
+				httpCleanup();
+				//use default click handling
+				return;
+			}
+
+			var baseUrl = getClosestBaseUrl( $link ),
+
+				//get href, if defined, otherwise default to empty hash
+				href = path.makeUrlAbsolute( $link.attr( "href" ) || "#", baseUrl );
+
+			// XXX_jblas: Ideally links to application pages should be specified as
+			//            an url to the application document with a hash that is either
+			//            the site relative path or id to the page. But some of the
+			//            internal code that dynamically generates sub-pages for nested
+			//            lists and select dialogs, just write a hash in the link they
+			//            create. This means the actual URL path is based on whatever
+			//            the current value of the base tag is at the time this code
+			//            is called. For now we are just assuming that any url with a
+			//            hash in it is an application page reference.
+			if ( href.search( "#" ) != -1 ) {
+				href = href.replace( /[^#]*#/, "" );
+				if ( !href ) {
+					//link was an empty hash meant purely
+					//for interaction, so we ignore it.
+					event.preventDefault();
+					return;
+				} else if ( path.isPath( href ) ) {
+					//we have apath so make it the href we want to load.
+					href = path.makeUrlAbsolute( href, baseUrl );
+				} else {
+					//we have a simple id so use the documentUrl as its base.
+					href = path.makeUrlAbsolute( "#" + href, documentUrl.hrefNoHash );
+				}
+			}
+
+				// Should we handle this link, or let the browser deal with it?
+			var useDefaultUrlHandling = $link.is( "[rel='external']" ) || $link.is( ":jqmData(ajax='false')" ) || $link.is( "[target]" ),
+
+				// Some embedded browsers, like the web view in Phone Gap, allow cross-domain XHR
+				// requests if the document doing the request was loaded via the file:// protocol.
+				// This is usually to allow the application to "phone home" and fetch app specific
+				// data. We normally let the browser handle external/cross-domain urls, but if the
+				// allowCrossDomainPages option is true, we will allow cross-domain http/https
+				// requests to go through our page loading logic.
+				isCrossDomainPageLoad = ( $.mobile.allowCrossDomainPages && documentUrl.protocol === "file:" && href.search( /^https?:/ ) != -1 ),
+
+				//check for protocol or rel and its not an embedded page
+				//TODO overlap in logic from isExternal, rel=external check should be
+				//     moved into more comprehensive isExternalLink
+				isExternal = useDefaultUrlHandling || ( path.isExternal( href ) && !isCrossDomainPageLoad );
+
+			$activeClickedLink = $link.closest( ".ui-btn" );
+
+			if( isExternal ) {
+				httpCleanup();
+				//use default click handling
+				return;
+			}
+
+			//use ajax
+			var transition = $link.jqmData( "transition" ),
+				direction = $link.jqmData( "direction" ),
+				reverse = ( direction && direction === "reverse" ) ||
+							// deprecated - remove by 1.0
+							$link.jqmData( "back" ),
+
+				//this may need to be more specific as we use data-rel more
+				role = $link.attr( "data-" + $.mobile.ns + "rel" ) || undefined;
+
+			$.mobile.changePage( href, { transition: transition, reverse: reverse, role: role } );
+			event.preventDefault();
+		});
+
+		//prefetch pages when anchors with data-prefetch are encountered
+		$( ".ui-page" ).live( "pageshow.prefetch", function(){
+			var urls = [];
+			$( this ).find( "a:jqmData(prefetch)" ).each(function(){
+				var url = $( this ).attr( "href" );
+				if ( url && $.inArray( url, urls ) === -1 ) {
+					urls.push( url );
+					$.mobile.loadPage( url );
+				}
+			});
+		} );
+
+		//hashchange event handler
+		$window.bind( "hashchange", function( e, triggered ) {
+			//find first page via hash
+			var to = path.stripHash( location.hash ),
+				//transition is false if it's the first page, undefined otherwise (and may be overridden by default)
+				transition = $.mobile.urlHistory.stack.length === 0 ? "none" : undefined;
+
+			//if listening is disabled (either globally or temporarily), or it's a dialog hash
+			if( !$.mobile.hashListeningEnabled || urlHistory.ignoreNextHashChange ) {
+				urlHistory.ignoreNextHashChange = false;
+				return;
+			}
+
+			// special case for dialogs
+			if( urlHistory.stack.length > 1 &&
+					to.indexOf( dialogHashKey ) > -1 ) {
+
+				// If current active page is not a dialog skip the dialog and continue
+				// in the same direction
+				if(!$.mobile.activePage.is( ".ui-dialog" )) {
+					//determine if we're heading forward or backward and continue accordingly past
+					//the current dialog
+					urlHistory.directHashChange({
+						currentUrl: to,
+						isBack: function() { window.history.back(); },
+						isForward: function() { window.history.forward(); }
+					});
+
+					// prevent changepage
+					return;
+				} else {
+					var setTo = function() { to = $.mobile.urlHistory.getActive().pageUrl; };
+					// if the current active page is a dialog and we're navigating
+					// to a dialog use the dialog objected saved in the stack
+					urlHistory.directHashChange({	currentUrl: to, isBack: setTo, isForward: setTo	});
+				}
+			}
+			
+			//if to is defined, load it
+			if ( to ) {
+				to = ( typeof to === "string" && !path.isPath( to ) ) ? ( '#' + to ) : to;
+				$.mobile.changePage( to, { transition: transition, changeHash: false, fromHashChange: true } );
+			}
+			//there's no hash, go to the first page in the dom
+			else {
+				$.mobile.changePage( $.mobile.firstPage, { transition: transition, changeHash: false, fromHashChange: true } );
+			}
+		});
+
+		//set page min-heights to be device specific
+		$( document ).bind( "pageshow", resetActivePageHeight );
+		$( window ).bind( "throttledresize", resetActivePageHeight );
+
+	};//_registerInternalEvents callback
+
+})( jQuery );
+/*!
+ * jQuery Mobile v@VERSION
+ * http://jquerymobile.com/
+ *
+ * Copyright 2010, jQuery Project
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ */
+
+(function( $, window, undefined ) {
+
+function css3TransitionHandler( name, reverse, $to, $from ) {
+
+	var deferred = new $.Deferred(),
+		reverseClass = reverse ? " reverse" : "",
+		viewportClass = "ui-mobile-viewport-transitioning viewport-" + name,
+		doneFunc = function() {
+
+			$to.add( $from ).removeClass( "out in reverse " + name );
+
+			if ( $from ) {
+				$from.removeClass( $.mobile.activePageClass );
+			}
+
+			$to.parent().removeClass( viewportClass );
+
+			deferred.resolve( name, reverse, $to, $from );
+		};
+
+	$to.animationComplete( doneFunc );
+
+	$to.parent().addClass( viewportClass );
+
+	if ( $from ) {
+		$from.addClass( name + " out" + reverseClass );
+	}
+	$to.addClass( $.mobile.activePageClass + " " + name + " in" + reverseClass );
+
+	return deferred.promise();
+}
+
+// Make our transition handler public.
+$.mobile.css3TransitionHandler = css3TransitionHandler;
+
+// If the default transition handler is the 'none' handler, replace it with our handler.
+if ( $.mobile.defaultTransitionHandler === $.mobile.noneTransitionHandler ) {
+	$.mobile.defaultTransitionHandler = css3TransitionHandler;
+}
+
+})( jQuery, this );
+/*
+* jQuery Mobile Framework : "degradeInputs" plugin - degrades inputs to another type after custom enhancements are made.
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT or GPL Version 2 licenses.
+* http://jquery.org/license
+*/
+
+(function( $, undefined ) {
+
+$.mobile.page.prototype.options.degradeInputs = {
+	color: false,
+	date: false,
+	datetime: false,
+	"datetime-local": false,
+	email: false,
+	month: false,
+	number: false,
+	range: "number",
+	search: true,
+	tel: false,
+	time: false,
+	url: false,
+	week: false
+};
+
+$.mobile.page.prototype.options.keepNative = ":jqmData(role='none'), :jqmData(role='nojs')";
+
+
+//auto self-init widgets
+$( document ).bind( "pagecreate enhance", function( e ){
+	
+	var page = $( e.target ).data( "page" ),
+		o = page.options;
+	
+	// degrade inputs to avoid poorly implemented native functionality
+	$( e.target ).find( "input" ).not( o.keepNative ).each(function() {
+		var $this = $( this ),
+			type = this.getAttribute( "type" ),
+			optType = o.degradeInputs[ type ] || "text";
+
+		if ( o.degradeInputs[ type ] ) {
+			$this.replaceWith(
+				$( "<div>" ).html( $this.clone() ).html()
+					.replace( /\s+type=["']?\w+['"]?/, " type=\"" + optType + "\" data-" + $.mobile.ns + "type=\"" + type + "\" " )
+			);
+		}
+	});
+	
+});
+
+})( jQuery );/*
+* jQuery Mobile Framework : "dialog" plugin.
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.
+*/
+
+(function( $, window, undefined ) {
+
+$.widget( "mobile.dialog", $.mobile.widget, {
+	options: {
+		closeBtnText 	: "Close",
+		theme			: "a",
+		initSelector	: ":jqmData(role='dialog')"
+	},
+	_create: function() {
+		var $el = this.element,
+			pageTheme = $el.attr( "class" ).match( /ui-body-[a-z]/ );
+			
+		if( pageTheme.length ){
+			$el.removeClass( pageTheme[ 0 ] );
+		}	
+		
+		$el.addClass( "ui-body-" + this.options.theme );
+		
+		// Class the markup for dialog styling
+		// Set aria role
+		$el.attr( "role", "dialog" )
+			.addClass( "ui-dialog" )
+			.find( ":jqmData(role='header')" )
+			.addClass( "ui-corner-top ui-overlay-shadow" )
+				.prepend( "<a href='#' data-" + $.mobile.ns + "icon='delete' data-" + $.mobile.ns + "rel='back' data-" + $.mobile.ns + "iconpos='notext'>"+ this.options.closeBtnText + "</a>" )
+			.end()
+			.find( ":jqmData(role='content'),:jqmData(role='footer')" )
+				.last()
+				.addClass( "ui-corner-bottom ui-overlay-shadow" );
+
+		/* bind events
+			- clicks and submits should use the closing transition that the dialog opened with
+			  unless a data-transition is specified on the link/form
+			- if the click was on the close button, or the link has a data-rel="back" it'll go back in history naturally
+		*/
+		$el.bind( "vclick submit", function( event ) {
+			var $target = $( event.target ).closest( event.type === "vclick" ? "a" : "form" ),
+				active;
+
+			if ( $target.length && !$target.jqmData( "transition" ) ) {
+
+				active = $.mobile.urlHistory.getActive() || {};
+
+				$target.attr( "data-" + $.mobile.ns + "transition", ( active.transition || $.mobile.defaultDialogTransition ) )
+					.attr( "data-" + $.mobile.ns + "direction", "reverse" );
+			}
+		})
+		.bind( "pagehide", function() {
+			$( this ).find( "." + $.mobile.activeBtnClass ).removeClass( $.mobile.activeBtnClass );
+		});
+	},
+
+	// Close method goes back in history
+	close: function() {
+		window.history.back();
+	}
+});
+
+//auto self-init widgets
+$( $.mobile.dialog.prototype.options.initSelector ).live( "pagecreate", function(){
+	$( this ).dialog();
+});
+
+})( jQuery, this );
+/*
+* jQuery Mobile Framework : This plugin handles theming and layout of headers, footers, and content areas
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT or GPL Version 2 licenses.
+* http://jquery.org/license
+*/
+
+(function( $, undefined ) {
+
+$.mobile.page.prototype.options.backBtnText		= "Back";
+$.mobile.page.prototype.options.addBackBtn		= false;
+$.mobile.page.prototype.options.backBtnTheme	= null;
+$.mobile.page.prototype.options.headerTheme		= "a";
+$.mobile.page.prototype.options.footerTheme		= "a";
+$.mobile.page.prototype.options.contentTheme	= null;
+
+$( ":jqmData(role='page'), :jqmData(role='dialog')" ).live( "pagecreate", function( e ) {
+	
+	var $page		= $( this ),
+		o			= $page.data( "page" ).options,
+		pageTheme	= o.theme;
+	
+	$( ":jqmData(role='header'), :jqmData(role='footer'), :jqmData(role='content')", this ).each(function() {
+		var $this	= $( this ),
+			role	= $this.jqmData( "role" ),
+			theme	= $this.jqmData( "theme" ),
+			$headeranchors,
+			leftbtn,
+			rightbtn,
+			backBtn;
+			
+		$this.addClass( "ui-" + role );	
+
+		//apply theming and markup modifications to page,header,content,footer
+		if ( role === "header" || role === "footer" ) {
+			
+			var thisTheme = theme || ( role === "header" ? o.headerTheme : o.footerTheme ) || pageTheme;
+
+			//add theme class
+			$this.addClass( "ui-bar-" + thisTheme );
+
+			// Add ARIA role
+			$this.attr( "role", role === "header" ? "banner" : "contentinfo" );
+
+			// Right,left buttons
+			$headeranchors	= $this.children( "a" );
+			leftbtn			= $headeranchors.hasClass( "ui-btn-left" );
+			rightbtn		= $headeranchors.hasClass( "ui-btn-right" );
+
+			if ( !leftbtn ) {
+				leftbtn = $headeranchors.eq( 0 ).not( ".ui-btn-right" ).addClass( "ui-btn-left" ).length;
+			}
+
+			if ( !rightbtn ) {
+				rightbtn = $headeranchors.eq( 1 ).addClass( "ui-btn-right" ).length;
+			}
+
+			// Auto-add back btn on pages beyond first view
+			if ( o.addBackBtn && role === "header" &&
+					$( ".ui-page" ).length > 1 &&
+					$this.jqmData( "url" ) !== $.mobile.path.stripHash( location.hash ) &&
+					!leftbtn ) {
+
+				backBtn = $( "<a href='#' class='ui-btn-left' data-"+ $.mobile.ns +"rel='back' data-"+ $.mobile.ns +"icon='arrow-l'>"+ o.backBtnText +"</a>" ).prependTo( $this );
+
+				// If theme is provided, override default inheritance
+				backBtn.attr( "data-"+ $.mobile.ns +"theme", o.backBtnTheme || thisTheme );
+			}
+
+			// Page title
+			$this.children( "h1, h2, h3, h4, h5, h6" )
+				.addClass( "ui-title" )
+				// Regardless of h element number in src, it becomes h1 for the enhanced page
+				.attr({
+					"tabindex": "0",
+					"role": "heading",
+					"aria-level": "1"
+				});
+
+		} else if ( role === "content" ) {
+
+			$this.addClass( "ui-body-" + ( theme || pageTheme || o.contentTheme ) );
+
+			// Add ARIA role
+			$this.attr( "role", "main" );
+
+		}
+	});
+});
+
+})( jQuery );/*
+* jQuery Mobile Framework : "collapsible" plugin
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT or GPL Version 2 licenses.
+* http://jquery.org/license
+*/
+(function( $, undefined ) {
+
+$.widget( "mobile.collapsible", $.mobile.widget, {
+	options: {
+		expandCueText: " click to expand contents",
+		collapseCueText: " click to collapse contents",
+		collapsed: false,
+		heading: ">:header,>legend",
+		theme: null,
+		iconTheme: "d",
+		initSelector: ":jqmData(role='collapsible')"
+	},
+	_create: function() {
+
+		var $el = this.element,
+			o = this.options,
+			collapsibleContain = $el.addClass( "ui-collapsible-contain" ),
+			collapsibleHeading = $el.find( o.heading ).eq( 0 ),
+			collapsibleContent = collapsibleContain.wrapInner( "<div class='ui-collapsible-content'></div>" ).find( ".ui-collapsible-content" ),
+			collapsibleParent = $el.closest( ":jqmData(role='collapsible-set')" ).addClass( "ui-collapsible-set" );
+
+		// Replace collapsibleHeading if it's a legend
+		if ( collapsibleHeading.is( "legend" ) ) {
+			collapsibleHeading = $( "<div role='heading'>"+ collapsibleHeading.html() +"</div>" ).insertBefore( collapsibleHeading );
+			collapsibleHeading.next().remove();
+		}
+
+		collapsibleHeading
+			//drop heading in before content
+			.insertBefore( collapsibleContent )
+			//modify markup & attributes
+			.addClass( "ui-collapsible-heading" )
+			.append( "<span class='ui-collapsible-heading-status'></span>" )
+			.wrapInner( "<a href='#' class='ui-collapsible-heading-toggle'></a>" )
+			.find( "a:eq(0)" )
+				.buttonMarkup({
+					shadow: !collapsibleParent.length,
+					corners: false,
+					iconPos: "left",
+					icon: "plus",
+					theme: o.theme
+				})
+				.find( ".ui-icon" )
+					.removeAttr( "class" )
+					.buttonMarkup({
+						shadow: true,
+						corners: true,
+						iconPos: "notext",
+						icon: "plus",
+						theme: o.iconTheme
+					});
+
+			if ( !collapsibleParent.length ) {
+				collapsibleHeading
+					.find( "a:eq(0)" )
+						.addClass( "ui-corner-all" )
+						.find( ".ui-btn-inner" )
+							.addClass( "ui-corner-all" );
+			} else {
+				if ( collapsibleContain.jqmData( "collapsible-last" ) ) {
+					collapsibleHeading
+						.find( "a:eq(0), .ui-btn-inner" )
+							.addClass( "ui-corner-bottom" );
+				}
+			}
+
+		//events
+		collapsibleContain
+			.bind( "collapse", function( event ) {
+				if ( ! event.isDefaultPrevented() &&
+							$( event.target ).closest( ".ui-collapsible-contain" ).is( collapsibleContain ) ) {
+
+					event.preventDefault();
+
+					collapsibleHeading
+						.addClass( "ui-collapsible-heading-collapsed" )
+						.find( ".ui-collapsible-heading-status" )
+							.text( o.expandCueText )
+						.end()
+						.find( ".ui-icon" )
+							.removeClass( "ui-icon-minus" )
+							.addClass( "ui-icon-plus" );
+
+					collapsibleContent.addClass( "ui-collapsible-content-collapsed" ).attr( "aria-hidden", true );
+
+					if ( collapsibleContain.jqmData( "collapsible-last" ) ) {
+						collapsibleHeading
+							.find( "a:eq(0), .ui-btn-inner" )
+							.addClass( "ui-corner-bottom" );
+					}
+				}
+			})
+			.bind( "expand", function( event ) {
+				if ( !event.isDefaultPrevented() ) {
+
+					event.preventDefault();
+
+					collapsibleHeading
+						.removeClass( "ui-collapsible-heading-collapsed" )
+						.find( ".ui-collapsible-heading-status" ).text( o.collapseCueText );
+
+					collapsibleHeading.find( ".ui-icon" ).removeClass( "ui-icon-plus" ).addClass( "ui-icon-minus" );
+
+					collapsibleContent.removeClass( "ui-collapsible-content-collapsed" ).attr( "aria-hidden", false );
+
+					if ( collapsibleContain.jqmData( "collapsible-last" ) ) {
+
+						collapsibleHeading
+							.find( "a:eq(0), .ui-btn-inner" )
+							.removeClass( "ui-corner-bottom" );
+					}
+				}
+			})
+			.trigger( o.collapsed ? "collapse" : "expand" );
+
+		// Close others in a set
+		if ( collapsibleParent.length && !collapsibleParent.jqmData( "collapsiblebound" ) ) {
+
+			collapsibleParent
+				.jqmData( "collapsiblebound", true )
+				.bind( "expand", function( event ) {
+
+					$( event.target )
+						.closest( ".ui-collapsible-contain" )
+						.siblings( ".ui-collapsible-contain" )
+						.trigger( "collapse" );
+
+				});
+
+			var set = collapsibleParent.children( ":jqmData(role='collapsible')" );
+
+			set.first()
+				.find( "a:eq(0)" )
+					.addClass( "ui-corner-top" )
+						.find( ".ui-btn-inner" )
+							.addClass( "ui-corner-top" );
+
+			set.last().jqmData( "collapsible-last", true );
+		}
+
+		collapsibleHeading
+			.bind( "vclick", function( event ) {
+
+				var type = collapsibleHeading.is( ".ui-collapsible-heading-collapsed" ) ?
+										"expand" : "collapse";
+
+				collapsibleContain.trigger( type );
+
+				event.preventDefault();
+			});
+	}
+});
+
+//auto self-init widgets
+$( document ).bind( "pagecreate create", function( e ){
+	$( $.mobile.collapsible.prototype.options.initSelector, e.target ).collapsible();
+});
+
+})( jQuery );
+/*
+* jQuery Mobile Framework : "fieldcontain" plugin - simple class additions to make form row separators
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT or GPL Version 2 licenses.
+* http://jquery.org/license
+*/
+
+(function( $, undefined ) {
+
+$.fn.fieldcontain = function( options ) {
+	return this.addClass( "ui-field-contain ui-body ui-br" );
+};
+
+//auto self-init widgets
+$( document ).bind( "pagecreate create", function( e ){
+	$( ":jqmData(role='fieldcontain')", e.target ).fieldcontain();
+});
+
+})( jQuery );/*
+* jQuery Mobile Framework : plugin for creating CSS grids
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT or GPL Version 2 licenses.
+* http://jquery.org/license
+*/
+
+(function( $, undefined ) {
+
+$.fn.grid = function( options ) {
+	return this.each(function() {
+
+		var $this = $( this ),
+			o = $.extend({
+				grid: null
+			},options),
+			$kids = $this.children(),
+			gridCols = {solo:1, a:2, b:3, c:4, d:5},
+			grid = o.grid,
+			iterator;
+
+			if ( !grid ) {
+				if ( $kids.length <= 5 ) {
+					for ( var letter in gridCols ) {
+						if ( gridCols[ letter ] === $kids.length ) {
+							grid = letter;
+						}
+					}
+				} else {
+					grid = "a";
+				}
+			}
+			iterator = gridCols[grid];
+
+		$this.addClass( "ui-grid-" + grid );
+
+		$kids.filter( ":nth-child(" + iterator + "n+1)" ).addClass( "ui-block-a" );
+
+		if ( iterator > 1 ) {
+			$kids.filter( ":nth-child(" + iterator + "n+2)" ).addClass( "ui-block-b" );
+		}
+		if ( iterator > 2 ) {
+			$kids.filter( ":nth-child(3n+3)" ).addClass( "ui-block-c" );
+		}
+		if ( iterator > 3 ) {
+			$kids.filter( ":nth-child(4n+4)" ).addClass( "ui-block-d" );
+		}
+		if ( iterator > 4 ) {
+			$kids.filter( ":nth-child(5n+5)" ).addClass( "ui-block-e" );
+		}
+	});
+};
+})( jQuery );/*
+* jQuery Mobile Framework : "navbar" plugin
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT or GPL Version 2 licenses.
+* http://jquery.org/license
+*/
+
+(function( $, undefined ) {
+
+$.widget( "mobile.navbar", $.mobile.widget, {
+	options: {
+		iconpos: "top",
+		grid: null,
+		initSelector: ":jqmData(role='navbar')"
+	},
+
+	_create: function(){
+
+		var $navbar = this.element,
+			$navbtns = $navbar.find( "a" ),
+			iconpos = $navbtns.filter( ":jqmData(icon)" ).length ?
+									this.options.iconpos : undefined;
+
+		$navbar.addClass( "ui-navbar" )
+			.attr( "role","navigation" )
+			.find( "ul" )
+				.grid({ grid: this.options.grid });
+
+		if ( !iconpos ) {
+			$navbar.addClass( "ui-navbar-noicons" );
+		}
+
+		$navbtns.buttonMarkup({
+			corners:	false,
+			shadow:		false,
+			iconpos:	iconpos
+		});
+
+		$navbar.delegate( "a", "vclick", function( event ) {
+			$navbtns.not( ".ui-state-persist" ).removeClass( $.mobile.activeBtnClass );
+			$( this ).addClass( $.mobile.activeBtnClass );
+		});
+	}
+});
+
+//auto self-init widgets
+$( document ).bind( "pagecreate create", function( e ){
+	$( $.mobile.navbar.prototype.options.initSelector, e.target ).navbar();
+});
+
+})( jQuery );
+/*
+* jQuery Mobile Framework : "listview" plugin
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT or GPL Version 2 licenses.
+* http://jquery.org/license
+*/
+
+(function( $, undefined ) {
+
+//Keeps track of the number of lists per page UID
+//This allows support for multiple nested list in the same page
+//https://github.com/jquery/jquery-mobile/issues/1617
+var listCountPerPage = {};
+
+$.widget( "mobile.listview", $.mobile.widget, {
+	options: {
+		theme: "c",
+		countTheme: "c",
+		headerTheme: "b",
+		dividerTheme: "b",
+		splitIcon: "arrow-r",
+		splitTheme: "b",
+		inset: false,
+		initSelector: ":jqmData(role='listview')"
+	},
+
+	_create: function() {
+		var t = this;
+
+		// create listview markup
+		t.element.addClass(function( i, orig ) {
+			return orig + " ui-listview " + ( t.options.inset ? " ui-listview-inset ui-corner-all ui-shadow " : "" );
+		});
+
+		t.refresh();
+	},
+
+	_itemApply: function( $list, item ) {
+		// TODO class has to be defined in markup
+		item.find( ".ui-li-count" )
+			.addClass( "ui-btn-up-" + ( $list.jqmData( "counttheme" ) || this.options.countTheme ) + " ui-btn-corner-all" ).end()
+		.find( "h1, h2, h3, h4, h5, h6" ).addClass( "ui-li-heading" ).end()
+		.find( "p, dl" ).addClass( "ui-li-desc" ).end()
+		.find( ">img:eq(0), .ui-link-inherit>img:eq(0)" ).addClass( "ui-li-thumb" ).each(function() {
+			item.addClass( $(this).is( ".ui-li-icon" ) ? "ui-li-has-icon" : "ui-li-has-thumb" );
+		}).end()
+		.find( ".ui-li-aside" ).each(function() {
+			var $this = $(this);
+			$this.prependTo( $this.parent() ); //shift aside to front for css float
+		});
+	},
+
+	_removeCorners: function( li, which ) {
+		var top = "ui-corner-top ui-corner-tr ui-corner-tl",
+			bot = "ui-corner-bottom ui-corner-br ui-corner-bl";
+
+		li = li.add( li.find( ".ui-btn-inner, .ui-li-link-alt, .ui-li-thumb" ) );
+
+		if ( which === "top" ) {
+			li.removeClass( top );
+		} else if ( which === "bottom" ) {
+			li.removeClass( bot );
+		} else {
+			li.removeClass( top + " " + bot );
+		}
+	},
+
+	refresh: function( create ) {
+		this.parentPage = this.element.closest( ".ui-page" );
+		this._createSubPages();
+
+		var o = this.options,
+			$list = this.element,
+			self = this,
+			dividertheme = $list.jqmData( "dividertheme" ) || o.dividerTheme,
+			listsplittheme = $list.jqmData( "splittheme" ),
+			listspliticon = $list.jqmData( "spliticon" ),
+			li = $list.children( "li" ),
+			counter = $.support.cssPseudoElement || !$.nodeName( $list[ 0 ], "ol" ) ? 0 : 1,
+			item, itemClass, itemTheme,
+			a, last, splittheme, countParent, icon;
+
+		if ( counter ) {
+			$list.find( ".ui-li-dec" ).remove();
+		}
+
+		for ( var pos = 0, numli = li.length; pos < numli; pos++ ) {
+			item = li.eq( pos );
+			itemClass = "ui-li";
+
+			// If we're creating the element, we update it regardless
+			if ( create || !item.hasClass( "ui-li" ) ) {
+				itemTheme = item.jqmData("theme") || o.theme;
+				a = item.children( "a" );
+
+				if ( a.length ) {
+					icon = item.jqmData("icon");
+
+					item.buttonMarkup({
+						wrapperEls: "div",
+						shadow: false,
+						corners: false,
+						iconpos: "right",
+						icon: a.length > 1 || icon === false ? false : icon || "arrow-r",
+						theme: itemTheme
+					});
+
+					a.first().addClass( "ui-link-inherit" );
+
+					if ( a.length > 1 ) {
+						itemClass += " ui-li-has-alt";
+
+						last = a.last();
+						splittheme = listsplittheme || last.jqmData( "theme" ) || o.splitTheme;
+
+						last.appendTo(item)
+							.attr( "title", last.text() )
+							.addClass( "ui-li-link-alt" )
+							.empty()
+							.buttonMarkup({
+								shadow: false,
+								corners: false,
+								theme: itemTheme,
+								icon: false,
+								iconpos: false
+							})
+							.find( ".ui-btn-inner" )
+								.append(
+									$( "<span />" ).buttonMarkup({
+										shadow: true,
+										corners: true,
+										theme: splittheme,
+										iconpos: "notext",
+										icon: listspliticon || last.jqmData( "icon" ) || o.splitIcon
+									})
+								);
+					}
+				} else if ( item.jqmData( "role" ) === "list-divider" ) {
+
+					itemClass += " ui-li-divider ui-btn ui-bar-" + dividertheme;
+					item.attr( "role", "heading" );
+
+					//reset counter when a divider heading is encountered
+					if ( counter ) {
+						counter = 1;
+					}
+
+				} else {
+					itemClass += " ui-li-static ui-body-" + itemTheme;
+				}
+			}
+
+			if ( o.inset ) {
+				if ( pos === 0 ) {
+					itemClass += " ui-corner-top";
+
+					item.add( item.find( ".ui-btn-inner" ) )
+						.find( ".ui-li-link-alt" )
+							.addClass( "ui-corner-tr" )
+						.end()
+						.find( ".ui-li-thumb" )
+							.addClass( "ui-corner-tl" );
+
+					if ( item.next().next().length ) {
+						self._removeCorners( item.next() );
+					}
+				}
+
+				if ( pos === li.length - 1 ) {
+					itemClass += " ui-corner-bottom";
+
+					item.add( item.find( ".ui-btn-inner" ) )
+						.find( ".ui-li-link-alt" )
+							.addClass( "ui-corner-br" )
+						.end()
+						.find( ".ui-li-thumb" )
+							.addClass( "ui-corner-bl" );
+
+					if ( item.prev().prev().length ) {
+						self._removeCorners( item.prev() );
+					} else if ( item.prev().length ) {
+						self._removeCorners( item.prev(), "bottom" );
+					}
+				}
+			}
+
+			if ( counter && itemClass.indexOf( "ui-li-divider" ) < 0 ) {
+				countParent = item.is( ".ui-li-static:first" ) ? item : item.find( ".ui-link-inherit" );
+
+				countParent.addClass( "ui-li-jsnumbering" )
+					.prepend( "<span class='ui-li-dec'>" + (counter++) + ". </span>" );
+			}
+
+			item.add( item.children( ".ui-btn-inner" ) ).addClass( itemClass );
+
+			if ( !create ) {
+				self._itemApply( $list, item );
+			}
+		}
+	},
+
+	//create a string for ID/subpage url creation
+	_idStringEscape: function( str ) {
+		return str.replace(/[^a-zA-Z0-9]/g, '-');
+	},
+
+	_createSubPages: function() {
+		var parentList = this.element,
+			parentPage = parentList.closest( ".ui-page" ),
+			parentUrl = parentPage.jqmData( "url" ),
+			parentId = parentUrl || parentPage[ 0 ][ $.expando ],
+			parentListId = parentList.attr( "id" ),
+			o = this.options,
+			dns = "data-" + $.mobile.ns,
+			self = this,
+			persistentFooterID = parentPage.find( ":jqmData(role='footer')" ).jqmData( "id" ),
+			hasSubPages;
+
+		if ( typeof listCountPerPage[ parentId ] === "undefined" ) {
+			listCountPerPage[ parentId ] = -1;
+		}
+
+		parentListId = parentListId || ++listCountPerPage[ parentId ];
+
+		$( parentList.find( "li>ul, li>ol" ).toArray().reverse() ).each(function( i ) {
+			var self = this,
+				list = $( this ),
+				listId = list.attr( "id" ) || parentListId + "-" + i,
+				parent = list.parent(),
+				nodeEls = $( list.prevAll().toArray().reverse() ),
+				nodeEls = nodeEls.length ? nodeEls : $( "<span>" + $.trim(parent.contents()[ 0 ].nodeValue) + "</span>" ),
+				title = nodeEls.first().text(),//url limits to first 30 chars of text
+				id = ( parentUrl || "" ) + "&" + $.mobile.subPageUrlKey + "=" + listId,
+				theme = list.jqmData( "theme" ) || o.theme,
+				countTheme = list.jqmData( "counttheme" ) || parentList.jqmData( "counttheme" ) || o.countTheme,
+				newPage, anchor;
+
+			//define hasSubPages for use in later removal
+			hasSubPages = true;
+
+			newPage = list.detach()
+						.wrap( "<div " + dns + "role='page' " +	dns + "url='" + id + "' " + dns + "theme='" + theme + "' " + dns + "count-theme='" + countTheme + "'><div " + dns + "role='content'></div></div>" )
+						.parent()
+							.before( "<div " + dns + "role='header' " + dns + "theme='" + o.headerTheme + "'><div class='ui-title'>" + title + "</div></div>" )
+							.after( persistentFooterID ? $( "<div " + dns + "role='footer' " + dns + "id='"+ persistentFooterID +"'>") : "" )
+							.parent()
+								.appendTo( $.mobile.pageContainer );
+
+			newPage.page();
+
+			anchor = parent.find('a:first');
+
+			if ( !anchor.length ) {
+				anchor = $( "<a/>" ).html( nodeEls || title ).prependTo( parent.empty() );
+			}
+
+			anchor.attr( "href", "#" + id );
+
+		}).listview();
+
+		//on pagehide, remove any nested pages along with the parent page, as long as they aren't active
+		if( hasSubPages && parentPage.data("page").options.domCache === false ){
+			var newRemove = function( e, ui ){
+				var nextPage = ui.nextPage, npURL;
+
+				if( ui.nextPage ){
+					npURL = nextPage.jqmData( "url" );
+					if( npURL.indexOf( parentUrl + "&" + $.mobile.subPageUrlKey ) !== 0 ){
+						self.childPages().remove();
+						parentPage.remove();
+					}
+				}
+			};
+
+			// unbind the original page remove and replace with our specialized version
+			parentPage
+				.unbind( "pagehide.remove" )
+				.bind( "pagehide.remove", newRemove);
+		}
+	},
+
+	// TODO sort out a better way to track sub pages of the listview this is brittle
+	childPages: function(){
+		var parentUrl = this.parentPage.jqmData( "url" );
+
+		return $( ":jqmData(url^='"+  parentUrl + "&" + $.mobile.subPageUrlKey +"')");
+	}
+});
+
+//auto self-init widgets
+$( document ).bind( "pagecreate create", function( e ){
+	$( $.mobile.listview.prototype.options.initSelector, e.target ).listview();
+});
+
+})( jQuery );
+/*
+* jQuery Mobile Framework : "listview" filter extension
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT or GPL Version 2 licenses.
+* http://jquery.org/license
+*/
+
+(function( $, undefined ) {
+
+$.mobile.listview.prototype.options.filter = false;
+$.mobile.listview.prototype.options.filterPlaceholder = "Filter items...";
+$.mobile.listview.prototype.options.filterTheme = "c";
+
+$( ":jqmData(role='listview')" ).live( "listviewcreate", function() {
+
+	var list = $( this ),
+		listview = list.data( "listview" );
+
+	if ( !listview.options.filter ) {
+		return;
+	}
+
+	var wrapper = $( "<form>", {
+			"class": "ui-listview-filter ui-bar-" + listview.options.filterTheme,
+			"role": "search"
+		}),
+		search = $( "<input>", {
+			placeholder: listview.options.filterPlaceholder
+		})
+		.attr( "data-" + $.mobile.ns + "type", "search" )
+		.jqmData( "lastval", "" )
+		.bind( "keyup change", function() {
+
+			var $this = $(this),
+				val = this.value.toLowerCase(),
+				listItems = null,
+				lastval = $this.jqmData( "lastval" ) + "",
+				childItems = false,
+				itemtext = "",
+				item;
+
+			// Change val as lastval for next execution
+			$this.jqmData( "lastval" , val );
+
+			change = val.replace( new RegExp( "^" + lastval ) , "" );
+
+			if ( val.length < lastval.length || change.length != ( val.length - lastval.length ) ) {
+
+				// Removed chars or pasted something totaly different, check all items
+				listItems = list.children();
+			} else {
+
+				// Only chars added, not removed, only use visible subset
+				listItems = list.children( ":not(.ui-screen-hidden)" );
+			}
+
+			if ( val ) {
+
+				// This handles hiding regular rows without the text we search for
+				// and any list dividers without regular rows shown under it
+
+				for ( var i = listItems.length - 1; i >= 0; i-- ) {
+					item = $( listItems[ i ] );
+					itemtext = item.jqmData( "filtertext" ) || item.text();
+
+					if ( item.is( "li:jqmData(role=list-divider)" ) ) {
+
+						item.toggleClass( "ui-filter-hidequeue" , !childItems );
+
+						// New bucket!
+						childItems = false;
+
+					} else if ( itemtext.toLowerCase().indexOf( val ) === -1 ) {
+
+						//mark to be hidden
+						item.toggleClass( "ui-filter-hidequeue" , true );
+					} else {
+
+						// There"s a shown item in the bucket
+						childItems = true;
+					}
+				}
+
+				// Show items, not marked to be hidden
+				listItems
+					.filter( ":not(.ui-filter-hidequeue)" )
+					.toggleClass( "ui-screen-hidden", false );
+
+				// Hide items, marked to be hidden
+				listItems
+					.filter( ".ui-filter-hidequeue" )
+					.toggleClass( "ui-screen-hidden", true )
+					.toggleClass( "ui-filter-hidequeue", false );
+
+			} else {
+
+				//filtervalue is empty => show all
+				listItems.toggleClass( "ui-screen-hidden", false );
+			}
+		})
+		.appendTo( wrapper )
+		.textinput();
+
+	if ( $( this ).jqmData( "inset" ) ) {
+		wrapper.addClass( "ui-listview-filter-inset" );
+	}
+
+	wrapper.bind( "submit", function() {
+		return false;
+	})
+	.insertBefore( list );
+});
+
+})( jQuery );/*
+* jQuery Mobile Framework : "fieldcontain" plugin - simple class additions to make form row separators
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT or GPL Version 2 licenses.
+* http://jquery.org/license
+*/
+
+(function( $, undefined ) {
+
+$( document ).bind( "pagecreate create", function( e ){
+	$( ":jqmData(role='nojs')", e.target ).addClass( "ui-nojs" );
+	
+});
+
+})( jQuery );/*
+* jQuery Mobile Framework : "checkboxradio" plugin
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT or GPL Version 2 licenses.
+* http://jquery.org/license
+*/
+
+(function( $, undefined ) {
+
+$.widget( "mobile.checkboxradio", $.mobile.widget, {
+	options: {
+		theme: null,
+		initSelector: "input[type='checkbox'],input[type='radio']"
+	},
+	_create: function() {
+		var self = this,
+			input = this.element,
+			// NOTE: Windows Phone could not find the label through a selector
+			// filter works though.
+			label = input.closest( "form,fieldset,:jqmData(role='page')" ).find( "label" ).filter( "[for='" + input[ 0 ].id + "']"),
+			inputtype = input.attr( "type" ),
+			checkedState = inputtype + "-on",
+			uncheckedState = inputtype + "-off",
+			icon = input.parents( ":jqmData(type='horizontal')" ).length ? undefined : uncheckedState,
+			activeBtn = icon ? "" : " " + $.mobile.activeBtnClass,
+			checkedClass = "ui-" + checkedState + activeBtn,
+			uncheckedClass = "ui-" + uncheckedState,
+			checkedicon = "ui-icon-" + checkedState,
+			uncheckedicon = "ui-icon-" + uncheckedState;
+
+		if ( inputtype !== "checkbox" && inputtype !== "radio" ) {
+			return;
+		}
+
+		// Expose for other methods
+		$.extend( this, {
+			label: label,
+			inputtype: inputtype,
+			checkedClass: checkedClass,
+			uncheckedClass: uncheckedClass,
+			checkedicon: checkedicon,
+			uncheckedicon: uncheckedicon
+		});
+
+		// If there's no selected theme...
+		if( !this.options.theme ) {
+			this.options.theme = this.element.jqmData( "theme" );
+		}
+
+		label.buttonMarkup({
+			theme: this.options.theme,
+			icon: icon,
+			shadow: false
+		});
+
+		// Wrap the input + label in a div
+		input.add( label )
+			.wrapAll( "<div class='ui-" + inputtype + "'></div>" );
+
+		label.bind({
+			vmouseover: function() {
+				if ( $( this ).parent().is( ".ui-disabled" ) ) {
+					return false;
+				}
+			},
+
+			vclick: function( event ) {
+				if ( input.is( ":disabled" ) ) {
+					event.preventDefault();
+					return;
+				}
+
+				self._cacheVals();
+
+				input.prop( "checked", inputtype === "radio" && true || !input.prop( "checked" ) );
+
+				// Input set for common radio buttons will contain all the radio
+				// buttons, but will not for checkboxes. clearing the checked status
+				// of other radios ensures the active button state is applied properly
+				self._getInputSet().not( input ).prop( "checked", false );
+
+				self._updateAll();
+				return false;
+			}
+
+		});
+
+		input
+			.bind({
+				vmousedown: function() {
+					this._cacheVals();
+				},
+
+				vclick: function() {
+
+					var $this = $(this);
+
+					// Adds checked attribute to checked input when keyboard is used
+					if ( $this.is( ":checked" ) ) {
+
+						$this.prop( "checked", true);
+						self._getInputSet().not($this).prop( "checked", false );
+					} else {
+
+						$this.prop( "checked", false );
+					}
+
+					self._updateAll();
+				},
+
+				focus: function() {
+					label.addClass( "ui-focus" );
+				},
+
+				blur: function() {
+					label.removeClass( "ui-focus" );
+				}
+			});
+
+		this.refresh();
+	},
+
+	_cacheVals: function() {
+		this._getInputSet().each(function() {
+			var $this = $(this);
+
+			$this.jqmData( "cacheVal", $this.is( ":checked" ) );
+		});
+	},
+
+	//returns either a set of radios with the same name attribute, or a single checkbox
+	_getInputSet: function(){
+        if(this.inputtype == "checkbox") {
+            return this.element;
+        }
+        return this.element.closest( "form,fieldset,:jqmData(role='page')" )
+				.find( "input[name='"+ this.element.attr( "name" ) +"'][type='"+ this.inputtype +"']" );
+	},
+
+	_updateAll: function() {
+		var self = this;
+
+		this._getInputSet().each(function() {
+			var $this = $(this);
+
+			if ( $this.is( ":checked" ) || self.inputtype === "checkbox" ) {
+				$this.trigger( "change" );
+			}
+		})
+		.checkboxradio( "refresh" );
+	},
+
+	refresh: function() {
+		var input = this.element,
+			label = this.label,
+			icon = label.find( ".ui-icon" );
+
+		// input[0].checked expando doesn't always report the proper value
+		// for checked='checked'
+		if ( $( input[ 0 ] ).prop( "checked" ) ) {
+
+			label.addClass( this.checkedClass ).removeClass( this.uncheckedClass );
+			icon.addClass( this.checkedicon ).removeClass( this.uncheckedicon );
+
+		} else {
+
+			label.removeClass( this.checkedClass ).addClass( this.uncheckedClass );
+			icon.removeClass( this.checkedicon ).addClass( this.uncheckedicon );
+		}
+
+		if ( input.is( ":disabled" ) ) {
+			this.disable();
+		} else {
+			this.enable();
+		}
+	},
+
+	disable: function() {
+		this.element.prop( "disabled", true ).parent().addClass( "ui-disabled" );
+	},
+
+	enable: function() {
+		this.element.prop( "disabled", false ).parent().removeClass( "ui-disabled" );
+	}
+});
+
+//auto self-init widgets
+$( document ).bind( "pagecreate create", function( e ){
+	$( $.mobile.checkboxradio.prototype.options.initSelector, e.target )
+		.not( ":jqmData(role='none'), :jqmData(role='nojs')" )
+		.checkboxradio();
+});
+
+})( jQuery );
+/*
+* jQuery Mobile Framework : "button" plugin - links that proxy to native input/buttons
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT or GPL Version 2 licenses.
+* http://jquery.org/license
+*/
+
+(function( $, undefined ) {
+
+$.widget( "mobile.button", $.mobile.widget, {
+	options: {
+		theme: null,
+		icon: null,
+		iconpos: null,
+		inline: null,
+		corners: true,
+		shadow: true,
+		iconshadow: true,
+		initSelector: "button, [type='button'], [type='submit'], [type='reset'], [type='image']"
+	},
+	_create: function() {
+		var $el = this.element,
+			o = this.options,
+			type;
+
+		// Add ARIA role
+		this.button = $( "<div></div>" )
+			.text( $el.text() || $el.val() )
+			.buttonMarkup({
+				theme: o.theme,
+				icon: o.icon,
+				iconpos: o.iconpos,
+				inline: o.inline,
+				corners: o.corners,
+				shadow: o.shadow,
+				iconshadow: o.iconshadow
+			})
+			.insertBefore( $el )
+			.append( $el.addClass( "ui-btn-hidden" ) );
+
+		// Add hidden input during submit
+		type = $el.attr( "type" );
+
+		if ( type !== "button" && type !== "reset" ) {
+
+			$el.bind( "vclick", function() {
+
+				var $buttonPlaceholder = $( "<input>", {
+							type: "hidden",
+							name: $el.attr( "name" ),
+							value: $el.attr( "value" )
+						})
+						.insertBefore( $el );
+
+				// Bind to doc to remove after submit handling
+				$( document ).submit(function(){
+					 $buttonPlaceholder.remove();
+				});
+			});
+		}
+
+		this.refresh();
+	},
+
+	enable: function() {
+		this.element.attr( "disabled", false );
+		this.button.removeClass( "ui-disabled" ).attr( "aria-disabled", false );
+		return this._setOption( "disabled", false );
+	},
+
+	disable: function() {
+		this.element.attr( "disabled", true );
+		this.button.addClass( "ui-disabled" ).attr( "aria-disabled", true );
+		return this._setOption( "disabled", true );
+	},
+
+	refresh: function() {
+		if ( this.element.attr( "disabled" ) ) {
+			this.disable();
+		} else {
+			this.enable();
+		}
+	}
+});
+
+//auto self-init widgets
+$( document ).bind( "pagecreate create", function( e ){
+	$( $.mobile.button.prototype.options.initSelector, e.target )
+		.not( ":jqmData(role='none'), :jqmData(role='nojs')" )
+		.button();
+});
+
+})( jQuery );/*
+* jQuery Mobile Framework : "slider" plugin
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT or GPL Version 2 licenses.
+* http://jquery.org/license
+*/
+
+( function( $, undefined ) {
+
+$.widget( "mobile.slider", $.mobile.widget, {
+	options: {
+		theme: null,
+		trackTheme: null,
+		disabled: false,
+		initSelector: "input[type='range'], :jqmData(type='range'), :jqmData(role='slider')"
+	},
+
+	_create: function() {
+
+		// TODO: Each of these should have comments explain what they're for
+		var self = this,
+
+			control = this.element,
+
+			parentTheme = control.parents( "[class*='ui-bar-'],[class*='ui-body-']" ).eq( 0 ),
+
+			parentTheme = parentTheme.length ? parentTheme.attr( "class" ).match( /ui-(bar|body)-([a-z])/ )[ 2 ] : "c",
+
+			theme = this.options.theme ? this.options.theme : parentTheme,
+
+			trackTheme = this.options.trackTheme ? this.options.trackTheme : parentTheme,
+
+			cType = control[ 0 ].nodeName.toLowerCase(),
+
+			selectClass = ( cType == "select" ) ? "ui-slider-switch" : "",
+
+			controlID = control.attr( "id" ),
+
+			labelID = controlID + "-label",
+
+			label = $( "[for='"+ controlID +"']" ).attr( "id", labelID ),
+
+			val = function() {
+				return  cType == "input"  ? parseFloat( control.val() ) : control[0].selectedIndex;
+			},
+
+			min =  cType == "input" ? parseFloat( control.attr( "min" ) ) : 0,
+
+			max =  cType == "input" ? parseFloat( control.attr( "max" ) ) : control.find( "option" ).length-1,
+
+			step = window.parseFloat( control.attr( "step" ) || 1 ),
+
+			slider = $( "<div class='ui-slider " + selectClass + " ui-btn-down-" + trackTheme +
+									" ui-btn-corner-all' role='application'></div>" ),
+
+			handle = $( "<a href='#' class='ui-slider-handle'></a>" )
+				.appendTo( slider )
+				.buttonMarkup({ corners: true, theme: theme, shadow: true })
+				.attr({
+					"role": "slider",
+					"aria-valuemin": min,
+					"aria-valuemax": max,
+					"aria-valuenow": val(),
+					"aria-valuetext": val(),
+					"title": val(),
+					"aria-labelledby": labelID
+				}),
+			options;
+
+		$.extend( this, {
+			slider: slider,
+			handle: handle,
+			dragging: false,
+			beforeStart: null
+		});
+
+		if ( cType == "select" ) {
+
+			slider.wrapInner( "<div class='ui-slider-inneroffset'></div>" );
+
+			options = control.find( "option" );
+
+			control.find( "option" ).each(function( i ) {
+
+				var side = !i ? "b":"a",
+					corners = !i ? "right" :"left",
+					theme = !i ? " ui-btn-down-" + trackTheme :" ui-btn-active";
+
+				$( "<div class='ui-slider-labelbg ui-slider-labelbg-" + side + theme + " ui-btn-corner-" + corners + "'></div>" )
+					.prependTo( slider );
+
+				$( "<span class='ui-slider-label ui-slider-label-" + side + theme + " ui-btn-corner-" + corners + "' role='img'>" + $( this ).text() + "</span>" )
+					.prependTo( handle );
+			});
+
+		}
+
+		label.addClass( "ui-slider" );
+
+		// monitor the input for updated values
+		control.addClass( cType === "input" ? "ui-slider-input" : "ui-slider-switch" )
+			.change( function() {
+				self.refresh( val(), true );
+			})
+			.keyup( function() { // necessary?
+				self.refresh( val(), true, true );
+			})
+			.blur( function() {
+				self.refresh( val(), true );
+			});
+
+		// prevent screen drag when slider activated
+		$( document ).bind( "vmousemove", function( event ) {
+			if ( self.dragging ) {
+				self.refresh( event );
+				return false;
+			}
+		});
+
+		slider.bind( "vmousedown", function( event ) {
+			self.dragging = true;
+
+			if ( cType === "select" ) {
+				self.beforeStart = control[0].selectedIndex;
+			}
+			self.refresh( event );
+			return false;
+		});
+
+		slider.add( document )
+			.bind( "vmouseup", function() {
+				if ( self.dragging ) {
+
+					self.dragging = false;
+
+					if ( cType === "select" ) {
+
+						if ( self.beforeStart === control[ 0 ].selectedIndex ) {
+							//tap occurred, but value didn't change. flip it!
+							self.refresh( !self.beforeStart ? 1 : 0 );
+						}
+						var curval = val();
+						var snapped = Math.round( curval / ( max - min ) * 100 );
+						handle
+							.addClass( "ui-slider-handle-snapping" )
+							.css( "left", snapped + "%" )
+							.animationComplete( function() {
+								handle.removeClass( "ui-slider-handle-snapping" );
+							});
+					}
+					return false;
+				}
+			});
+
+		slider.insertAfter( control );
+
+		// NOTE force focus on handle
+		this.handle
+			.bind( "vmousedown", function() {
+				$( this ).focus();
+			})
+			.bind( "vclick", false );
+
+		this.handle
+			.bind( "keydown", function( event ) {
+				var index = val();
+
+				if ( self.options.disabled ) {
+					return;
+				}
+
+				// In all cases prevent the default and mark the handle as active
+				switch ( event.keyCode ) {
+				 case $.mobile.keyCode.HOME:
+				 case $.mobile.keyCode.END:
+				 case $.mobile.keyCode.PAGE_UP:
+				 case $.mobile.keyCode.PAGE_DOWN:
+				 case $.mobile.keyCode.UP:
+				 case $.mobile.keyCode.RIGHT:
+				 case $.mobile.keyCode.DOWN:
+				 case $.mobile.keyCode.LEFT:
+					event.preventDefault();
+
+					if ( !self._keySliding ) {
+						self._keySliding = true;
+						$( this ).addClass( "ui-state-active" );
+					}
+					break;
+				}
+
+				// move the slider according to the keypress
+				switch ( event.keyCode ) {
+				 case $.mobile.keyCode.HOME:
+					self.refresh( min );
+					break;
+				 case $.mobile.keyCode.END:
+					self.refresh( max );
+					break;
+				 case $.mobile.keyCode.PAGE_UP:
+				 case $.mobile.keyCode.UP:
+				 case $.mobile.keyCode.RIGHT:
+					self.refresh( index + step );
+					break;
+				 case $.mobile.keyCode.PAGE_DOWN:
+				 case $.mobile.keyCode.DOWN:
+				 case $.mobile.keyCode.LEFT:
+					self.refresh( index - step );
+					break;
+				}
+			}) // remove active mark
+			.keyup( function( event ) {
+				if ( self._keySliding ) {
+					self._keySliding = false;
+					$( this ).removeClass( "ui-state-active" );
+				}
+			});
+
+		this.refresh(undefined, undefined, true);
+	},
+
+	refresh: function( val, isfromControl, preventInputUpdate ) {
+		if ( this.options.disabled ) { return; }
+
+		var control = this.element, percent,
+			cType = control[0].nodeName.toLowerCase(),
+			min = cType === "input" ? parseFloat( control.attr( "min" ) ) : 0,
+			max = cType === "input" ? parseFloat( control.attr( "max" ) ) : control.find( "option" ).length - 1;
+
+		if ( typeof val === "object" ) {
+			var data = val,
+				// a slight tolerance helped get to the ends of the slider
+				tol = 8;
+			if ( !this.dragging ||
+					data.pageX < this.slider.offset().left - tol ||
+					data.pageX > this.slider.offset().left + this.slider.width() + tol ) {
+				return;
+			}
+			percent = Math.round( ( ( data.pageX - this.slider.offset().left ) / this.slider.width() ) * 100 );
+		} else {
+			if ( val == null ) {
+				val = cType === "input" ? parseFloat( control.val() ) : control[0].selectedIndex;
+			}
+			percent = ( parseFloat( val ) - min ) / ( max - min ) * 100;
+		}
+
+		if ( isNaN( percent ) ) {
+			return;
+		}
+
+		if ( percent < 0 ) {
+			percent = 0;
+		}
+
+		if ( percent > 100 ) {
+			percent = 100;
+		}
+
+		var newval = Math.round( ( percent / 100 ) * ( max - min ) ) + min;
+
+		if ( newval < min ) {
+			newval = min;
+		}
+
+		if ( newval > max ) {
+			newval = max;
+		}
+
+		// Flip the stack of the bg colors
+		if ( percent > 60 && cType === "select" ) {
+			// TODO: Dead path?
+		}
+		this.handle.css( "left", percent + "%" );
+		this.handle.attr( {
+				"aria-valuenow": cType === "input" ? newval : control.find( "option" ).eq( newval ).attr( "value" ),
+				"aria-valuetext": cType === "input" ? newval : control.find( "option" ).eq( newval ).text(),
+				title: newval
+			});
+
+		// add/remove classes for flip toggle switch
+		if ( cType === "select" ) {
+			if ( newval === 0 ) {
+				this.slider.addClass( "ui-slider-switch-a" )
+					.removeClass( "ui-slider-switch-b" );
+			} else {
+				this.slider.addClass( "ui-slider-switch-b" )
+					.removeClass( "ui-slider-switch-a" );
+			}
+		}
+
+		if ( !preventInputUpdate ) {
+			// update control"s value
+			if ( cType === "input" ) {
+				control.val( newval );
+			} else {
+				control[ 0 ].selectedIndex = newval;
+			}
+			if ( !isfromControl ) {
+				control.trigger( "change" );
+			}
+		}
+	},
+
+	enable: function() {
+		this.element.attr( "disabled", false );
+		this.slider.removeClass( "ui-disabled" ).attr( "aria-disabled", false );
+		return this._setOption( "disabled", false );
+	},
+
+	disable: function() {
+		this.element.attr( "disabled", true );
+		this.slider.addClass( "ui-disabled" ).attr( "aria-disabled", true );
+		return this._setOption( "disabled", true );
+	}
+
+});
+
+//auto self-init widgets
+$( document ).bind( "pagecreate create", function( e ){
+
+	$( $.mobile.slider.prototype.options.initSelector, e.target )
+		.not( ":jqmData(role='none'), :jqmData(role='nojs')" )
+		.slider();
+
+});
+
+})( jQuery );/*
+* jQuery Mobile Framework : "textinput" plugin for text inputs, textareas
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT or GPL Version 2 licenses.
+* http://jquery.org/license
+*/
+
+(function( $, undefined ) {
+
+$.widget( "mobile.textinput", $.mobile.widget, {
+	options: {
+		theme: null,
+		initSelector: "input[type='text'], input[type='search'], :jqmData(type='search'), input[type='number'], :jqmData(type='number'), input[type='password'], input[type='email'], input[type='url'], input[type='tel'], textarea"
+	},
+
+	_create: function() {
+
+		var input = this.element,
+			o = this.options,
+			theme = o.theme,
+			themedParent, themeclass, themeLetter, focusedEl, clearbtn;
+
+		if ( !theme ) {
+			themedParent = this.element.closest( "[class*='ui-bar-'],[class*='ui-body-']" );
+			themeLetter = themedParent.length && /ui-(bar|body)-([a-z])/.exec( themedParent.attr( "class" ) );
+			theme = themeLetter && themeLetter[2] || "c";
+		}
+
+		themeclass = " ui-body-" + theme;
+
+		$( "label[for='" + input.attr( "id" ) + "']" ).addClass( "ui-input-text" );
+
+		input.addClass("ui-input-text ui-body-"+ o.theme );
+
+		focusedEl = input;
+		
+		// XXX: Temporary workaround for issue 785. Turn off autocorrect and
+		//      autocomplete since the popup they use can't be dismissed by
+		//      the user. Note that we test for the presence of the feature
+		//      by looking for the autocorrect property on the input element.
+		if ( typeof input[0].autocorrect !== "undefined" ) {
+			// Set the attribute instead of the property just in case there
+			// is code that attempts to make modifications via HTML.
+			input[0].setAttribute( "autocorrect", "off" );
+			input[0].setAttribute( "autocomplete", "off" );
+		}
+		
+
+		//"search" input widget
+		if ( input.is( "[type='search'],:jqmData(type='search')" ) ) {
+
+			focusedEl = input.wrap( "<div class='ui-input-search ui-shadow-inset ui-btn-corner-all ui-btn-shadow ui-icon-searchfield" + themeclass + "'></div>" ).parent();
+			clearbtn = $( "<a href='#' class='ui-input-clear' title='clear text'>clear text</a>" )
+				.tap(function( event ) {
+					input.val( "" ).focus();
+					input.trigger( "change" );
+					clearbtn.addClass( "ui-input-clear-hidden" );
+					event.preventDefault();
+				})
+				.appendTo( focusedEl )
+				.buttonMarkup({
+					icon: "delete",
+					iconpos: "notext",
+					corners: true,
+					shadow: true
+				});
+
+			function toggleClear() {
+				if ( !input.val() ) {
+					clearbtn.addClass( "ui-input-clear-hidden" );
+				} else {
+					clearbtn.removeClass( "ui-input-clear-hidden" );
+				}
+			}
+
+			toggleClear();
+
+			input.keyup( toggleClear )
+				.focus( toggleClear );
+
+		} else {
+			input.addClass( "ui-corner-all ui-shadow-inset" + themeclass );
+		}
+
+		input.focus(function() {
+				focusedEl.addClass( "ui-focus" );
+			})
+			.blur(function(){
+				focusedEl.removeClass( "ui-focus" );
+			});
+
+		// Autogrow
+		if ( input.is( "textarea" ) ) {
+			var extraLineHeight = 15,
+				keyupTimeoutBuffer = 100,
+				keyup = function() {
+					var scrollHeight = input[ 0 ].scrollHeight,
+						clientHeight = input[ 0 ].clientHeight;
+
+					if ( clientHeight < scrollHeight ) {
+						input.css({
+							height: (scrollHeight + extraLineHeight)
+						});
+					}
+				},
+				keyupTimeout;
+
+			input.keyup(function() {
+				clearTimeout( keyupTimeout );
+				keyupTimeout = setTimeout( keyup, keyupTimeoutBuffer );
+			});
+		}
+	},
+
+	disable: function(){
+		( this.element.attr( "disabled", true ).is( "[type='search'],:jqmData(type='search')" ) ?
+			this.element.parent() : this.element ).addClass( "ui-disabled" );
+	},
+
+	enable: function(){
+		( this.element.attr( "disabled", false).is( "[type='search'],:jqmData(type='search')" ) ?
+			this.element.parent() : this.element ).removeClass( "ui-disabled" );
+	}
+});
+
+//auto self-init widgets
+$( document ).bind( "pagecreate create", function( e ){
+	
+	$( $.mobile.textinput.prototype.options.initSelector, e.target )
+		.not( ":jqmData(role='none'), :jqmData(role='nojs')" )
+		.textinput();
+		
+});
+
+})( jQuery );
+/*
+* jQuery Mobile Framework : "selectmenu" plugin
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT or GPL Version 2 licenses.
+* http://jquery.org/license
+*/
+
+(function( $, undefined ) {
+
+$.widget( "mobile.selectmenu", $.mobile.widget, {
+	options: {
+		theme: null,
+		disabled: false,
+		icon: "arrow-d",
+		iconpos: "right",
+		inline: null,
+		corners: true,
+		shadow: true,
+		iconshadow: true,
+		menuPageTheme: "b",
+		overlayTheme: "a",
+		hidePlaceholderMenuItems: true,
+		closeText: "Close",
+		nativeMenu: true,
+		initSelector: "select:not(:jqmData(role='slider'))"
+	},
+	_create: function() {
+
+		var self = this,
+
+			o = this.options,
+
+			select = this.element
+						.wrap( "<div class='ui-select'>" ),
+
+			selectID = select.attr( "id" ),
+
+			label = $( "label[for='"+ selectID +"']" ).addClass( "ui-select" ),
+
+			// IE throws an exception at options.item() function when
+			// there is no selected item
+			// select first in this case
+			selectedIndex = select[ 0 ].selectedIndex == -1 ? 0 : select[ 0 ].selectedIndex,
+
+			button = ( self.options.nativeMenu ? $( "<div/>" ) : $( "<a>", {
+					"href": "#",
+					"role": "button",
+					"id": buttonId,
+					"aria-haspopup": "true",
+					"aria-owns": menuId
+				}) )
+				.text( $( select[ 0 ].options.item( selectedIndex ) ).text() )
+				.insertBefore( select )
+				.buttonMarkup({
+					theme: o.theme,
+					icon: o.icon,
+					iconpos: o.iconpos,
+					inline: o.inline,
+					corners: o.corners,
+					shadow: o.shadow,
+					iconshadow: o.iconshadow
+				}),
+
+			// Multi select or not
+			isMultiple = self.isMultiple = select[ 0 ].multiple;
+
+		// Opera does not properly support opacity on select elements
+		// In Mini, it hides the element, but not its text
+		// On the desktop,it seems to do the opposite
+		// for these reasons, using the nativeMenu option results in a full native select in Opera
+		if ( o.nativeMenu && window.opera && window.opera.version ) {
+			select.addClass( "ui-select-nativeonly" );
+		}
+
+		//vars for non-native menus
+		if ( !o.nativeMenu ) {
+			var options = select.find("option"),
+
+				buttonId = selectID + "-button",
+
+				menuId = selectID + "-menu",
+
+				thisPage = select.closest( ".ui-page" ),
+
+				//button theme
+				theme = /ui-btn-up-([a-z])/.exec( button.attr( "class" ) )[1],
+
+				menuPage = $( "<div data-" + $.mobile.ns + "role='dialog' data-" +$.mobile.ns + "theme='"+ o.menuPageTheme +"'>" +
+							"<div data-" + $.mobile.ns + "role='header'>" +
+								"<div class='ui-title'>" + label.text() + "</div>"+
+							"</div>"+
+							"<div data-" + $.mobile.ns + "role='content'></div>"+
+						"</div>" )
+						.appendTo( $.mobile.pageContainer )
+						.page(),
+
+				menuPageContent = menuPage.find( ".ui-content" ),
+
+				menuPageClose = menuPage.find( ".ui-header a" ),
+
+				screen = $( "<div>", {"class": "ui-selectmenu-screen ui-screen-hidden"})
+							.appendTo( thisPage ),
+
+				listbox = $("<div>", { "class": "ui-selectmenu ui-selectmenu-hidden ui-overlay-shadow ui-corner-all ui-body-" + o.overlayTheme + " " + $.mobile.defaultDialogTransition })
+						.insertAfter(screen),
+
+				list = $( "<ul>", {
+						"class": "ui-selectmenu-list",
+						"id": menuId,
+						"role": "listbox",
+						"aria-labelledby": buttonId
+					})
+					.attr( "data-" + $.mobile.ns + "theme", theme )
+					.appendTo( listbox ),
+
+				header = $( "<div>", {
+						"class": "ui-header ui-bar-" + theme
+					})
+					.prependTo( listbox ),
+
+				headerTitle = $( "<h1>", {
+						"class": "ui-title"
+					})
+					.appendTo( header ),
+
+				headerClose = $( "<a>", {
+						"text": o.closeText,
+						"href": "#",
+						"class": "ui-btn-left"
+					})
+					.attr( "data-" + $.mobile.ns + "iconpos", "notext" )
+					.attr( "data-" + $.mobile.ns + "icon", "delete" )
+					.appendTo( header )
+					.buttonMarkup(),
+
+				menuType;
+		} // End non native vars
+
+		// Add counter for multi selects
+		if ( isMultiple ) {
+			self.buttonCount = $( "<span>" )
+				.addClass( "ui-li-count ui-btn-up-c ui-btn-corner-all" )
+				.hide()
+				.appendTo( button );
+		}
+
+		// Disable if specified
+		if ( o.disabled ) {
+			this.disable();
+		}
+
+		// Events on native select
+		select.change(function() {
+			self.refresh();
+		});
+
+		// Expose to other methods
+		$.extend( self, {
+			select: select,
+			optionElems: options,
+			selectID: selectID,
+			label: label,
+			buttonId: buttonId,
+			menuId: menuId,
+			thisPage: thisPage,
+			button: button,
+			menuPage: menuPage,
+			menuPageContent: menuPageContent,
+			screen: screen,
+			listbox: listbox,
+			list: list,
+			menuType: menuType,
+			header: header,
+			headerClose: headerClose,
+			headerTitle: headerTitle,
+			placeholder: ""
+		});
+
+		// Support for using the native select menu with a custom button
+		if ( o.nativeMenu ) {
+
+			select.appendTo( button )
+				.bind( "vmousedown", function() {
+					// Add active class to button
+					button.addClass( $.mobile.activeBtnClass );
+				})
+				.bind( "focus vmouseover", function() {
+					button.trigger( "vmouseover" );
+				})
+				.bind( "vmousemove", function() {
+					// Remove active class on scroll/touchmove
+					button.removeClass( $.mobile.activeBtnClass );
+				})
+				.bind( "change blur vmouseout", function() {
+
+					button.trigger( "vmouseout" )
+						.removeClass( $.mobile.activeBtnClass );
+				});
+
+
+		} else {
+
+			// Create list from select, update state
+			self.refresh();
+
+			select.attr( "tabindex", "-1" )
+				.focus(function() {
+					$(this).blur();
+					button.focus();
+				});
+
+			// Button events
+			button.bind( "vclick keydown" , function( event ) {
+				if ( event.type == "vclick" ||
+							event.keyCode && ( event.keyCode === $.mobile.keyCode.ENTER ||
+																		event.keyCode === $.mobile.keyCode.SPACE ) ) {
+
+					self.open();
+					event.preventDefault();
+				}
+			});
+
+			// Events for list items
+			list.attr( "role", "listbox" )
+				.delegate( ".ui-li>a", "focusin", function() {
+					$( this ).attr( "tabindex", "0" );
+				})
+				.delegate( ".ui-li>a", "focusout", function() {
+					$( this ).attr( "tabindex", "-1" );
+				})
+				.delegate( "li:not(.ui-disabled, .ui-li-divider)", "vclick", function( event ) {
+
+					var $this = $( this ),
+						// index of option tag to be selected
+						oldIndex = select[ 0 ].selectedIndex,
+						newIndex = $this.jqmData( "option-index" ),
+						option = self.optionElems[ newIndex ];
+
+					// toggle selected status on the tag for multi selects
+					option.selected = isMultiple ? !option.selected : true;
+
+					// toggle checkbox class for multiple selects
+					if ( isMultiple ) {
+						$this.find( ".ui-icon" )
+							.toggleClass( "ui-icon-checkbox-on", option.selected )
+							.toggleClass( "ui-icon-checkbox-off", !option.selected );
+					}
+
+					// trigger change if value changed
+					if ( isMultiple || oldIndex !== newIndex ) {
+						select.trigger( "change" );
+					}
+
+					//hide custom select for single selects only
+					if ( !isMultiple ) {
+						self.close();
+					}
+
+					event.preventDefault();
+			})
+			//keyboard events for menu items
+			.keydown(function( event ) {
+				var target = $( event.target ),
+					li = target.closest( "li" ),
+					prev, next;
+
+				// switch logic based on which key was pressed
+				switch ( event.keyCode ) {
+					// up or left arrow keys
+					case 38:
+						prev = li.prev();
+
+						// if there's a previous option, focus it
+						if ( prev.length ) {
+							target
+								.blur()
+								.attr( "tabindex", "-1" );
+
+							prev.find( "a" ).first().focus();
+						}
+
+						return false;
+					break;
+
+					// down or right arrow keys
+					case 40:
+						next = li.next();
+
+						// if there's a next option, focus it
+						if ( next.length ) {
+							target
+								.blur()
+								.attr( "tabindex", "-1" );
+
+							next.find( "a" ).first().focus();
+						}
+
+						return false;
+					break;
+
+					// If enter or space is pressed, trigger click
+					case 13:
+					case 32:
+						 target.trigger( "vclick" );
+
+						 return false;
+					break;
+				}
+			});
+
+			// button refocus ensures proper height calculation
+			// by removing the inline style and ensuring page inclusion
+			self.menuPage.bind( "pagehide", function(){
+				self.list.appendTo( self.listbox );
+				self._focusButton();
+			});
+
+			// Events on "screen" overlay
+			screen.bind( "vclick", function( event ) {
+				self.close();
+			});
+
+			// Close button on small overlays
+			self.headerClose.click(function() {
+				if ( self.menuType == "overlay" ) {
+					self.close();
+					return false;
+				}
+			});
+		}
+	},
+
+	_buildList: function() {
+		var self = this,
+			o = this.options,
+			placeholder = this.placeholder,
+			optgroups = [],
+			lis = [],
+			dataIcon = self.isMultiple ? "checkbox-off" : "false";
+
+		self.list.empty().filter( ".ui-listview" ).listview( "destroy" );
+
+		// Populate menu with options from select element
+		self.select.find( "option" ).each(function( i ) {
+			var $this = $( this ),
+				$parent = $this.parent(),
+				text = $this.text(),
+				anchor = "<a href='#'>"+ text +"</a>",
+				classes = [],
+				extraAttrs = [];
+
+			// Are we inside an optgroup?
+			if ( $parent.is( "optgroup" ) ) {
+				var optLabel = $parent.attr( "label" );
+
+				// has this optgroup already been built yet?
+				if ( $.inArray( optLabel, optgroups ) === -1 ) {
+					lis.push( "<li data-" + $.mobile.ns + "role='list-divider'>"+ optLabel +"</li>" );
+					optgroups.push( optLabel );
+				}
+			}
+
+			// Find placeholder text
+			// TODO: Are you sure you want to use getAttribute? ^RW
+			if ( !this.getAttribute( "value" ) || text.length == 0 || $this.jqmData( "placeholder" ) ) {
+				if ( o.hidePlaceholderMenuItems ) {
+					classes.push( "ui-selectmenu-placeholder" );
+				}
+				placeholder = self.placeholder = text;
+			}
+
+			// support disabled option tags
+			if ( this.disabled ) {
+				classes.push( "ui-disabled" );
+				extraAttrs.push( "aria-disabled='true'" );
+			}
+
+			lis.push( "<li data-" + $.mobile.ns + "option-index='" + i + "' data-" + $.mobile.ns + "icon='"+ dataIcon +"' class='"+ classes.join(" ") + "' " + extraAttrs.join(" ") +">"+ anchor +"</li>" )
+		});
+
+		self.list.html( lis.join(" ") );
+
+		self.list.find( "li" )
+			.attr({ "role": "option", "tabindex": "-1" })
+			.first().attr( "tabindex", "0" );
+
+		// Hide header close link for single selects
+		if ( !this.isMultiple ) {
+			this.headerClose.hide();
+		}
+
+		// Hide header if it's not a multiselect and there's no placeholder
+		if ( !this.isMultiple && !placeholder.length ) {
+			this.header.hide();
+		} else {
+			this.headerTitle.text( this.placeholder );
+		}
+
+		// Now populated, create listview
+		self.list.listview();
+	},
+
+	refresh: function( forceRebuild ) {
+		var self = this,
+			select = this.element,
+			isMultiple = this.isMultiple,
+			options = this.optionElems = select.find( "option" ),
+			selected = options.filter( ":selected" ),
+
+			// return an array of all selected index's
+			indicies = selected.map(function() {
+				return options.index( this );
+			}).get();
+
+		if ( !self.options.nativeMenu &&
+					( forceRebuild || select[0].options.length != self.list.find( "li" ).length ) ) {
+
+			self._buildList();
+		}
+
+		self.button.find( ".ui-btn-text" )
+			.text(function() {
+
+				if ( !isMultiple ) {
+					return selected.text();
+				}
+
+				return selected.length ? selected.map(function() {
+								return $( this ).text();
+							}).get().join( ", " ) : self.placeholder;
+			});
+
+		// multiple count inside button
+		if ( isMultiple ) {
+			self.buttonCount[ selected.length > 1 ? "show" : "hide" ]().text( selected.length );
+		}
+
+		if ( !self.options.nativeMenu ) {
+
+			self.list.find( "li:not(.ui-li-divider)" )
+				.removeClass( $.mobile.activeBtnClass )
+				.attr( "aria-selected", false )
+				.each(function( i ) {
+
+					if ( $.inArray( i, indicies ) > -1 ) {
+						var item = $( this ).addClass( $.mobile.activeBtnClass );
+
+						// Aria selected attr
+						item.find( "a" ).attr( "aria-selected", true );
+
+						// Multiple selects: add the "on" checkbox state to the icon
+						if ( isMultiple ) {
+							item.find( ".ui-icon" ).removeClass( "ui-icon-checkbox-off" ).addClass( "ui-icon-checkbox-on" );
+						}
+					}
+				});
+		}
+	},
+
+	open: function() {
+		if ( this.options.disabled || this.options.nativeMenu ) {
+			return;
+		}
+
+		var self = this,
+			menuHeight = self.list.parent().outerHeight(),
+			menuWidth = self.list.parent().outerWidth(),
+			scrollTop = $( window ).scrollTop(),
+			btnOffset = self.button.offset().top,
+			screenHeight = window.innerHeight,
+			screenWidth = window.innerWidth;
+
+		//add active class to button
+		self.button.addClass( $.mobile.activeBtnClass );
+
+		//remove after delay
+		setTimeout(function() {
+			self.button.removeClass( $.mobile.activeBtnClass );
+		}, 300);
+
+		function focusMenuItem() {
+			self.list.find( ".ui-btn-active" ).focus();
+		}
+
+		if ( menuHeight > screenHeight - 80 || !$.support.scrollTop ) {
+			// prevent the parent page from being removed from the DOM,
+			// otherwise the results of selecting a list item in the dialog
+			// fall into a black hole
+			self.thisPage.unbind( "pagehide.remove" );
+
+			//for webos (set lastscroll using button offset)
+			if ( scrollTop == 0 && btnOffset > screenHeight ) {
+				self.thisPage.one( "pagehide", function() {
+					$( this ).jqmData( "lastScroll", btnOffset );
+				});
+			}
+
+			self.menuPage.one( "pageshow", function() {
+				// silentScroll() is called whenever a page is shown to restore
+				// any previous scroll position the page may have had. We need to
+				// wait for the "silentscroll" event before setting focus to avoid
+				// the browser"s "feature" which offsets rendering to make sure
+				// whatever has focus is in view.
+				$( window ).one( "silentscroll", function() {
+					focusMenuItem();
+				});
+
+				self.isOpen = true;
+			});
+
+			self.menuType = "page";
+			self.menuPageContent.append( self.list );
+			$.mobile.changePage( self.menuPage, {
+			   transition: $.mobile.defaultDialogTransition
+			});
+		} else {
+
+			self.menuType = "overlay";
+
+			self.screen.height( $(document).height() )
+				.removeClass( "ui-screen-hidden" );
+
+			// Try and center the overlay over the button
+			var roomtop = btnOffset - scrollTop,
+				roombot = scrollTop + screenHeight - btnOffset,
+				halfheight = menuHeight / 2,
+				maxwidth = parseFloat( self.list.parent().css( "max-width" ) ),
+				newtop, newleft;
+
+			if ( roomtop > menuHeight / 2 && roombot > menuHeight / 2 ) {
+				newtop = btnOffset + ( self.button.outerHeight() / 2 ) - halfheight;
+			} else {
+				// 30px tolerance off the edges
+				newtop = roomtop > roombot ? scrollTop + screenHeight - menuHeight - 30 : scrollTop + 30;
+			}
+
+			// If the menuwidth is smaller than the screen center is
+			if ( menuWidth < maxwidth ) {
+				newleft = ( screenWidth - menuWidth ) / 2;
+			} else {
+
+				//otherwise insure a >= 30px offset from the left
+				newleft = self.button.offset().left + self.button.outerWidth() / 2 - menuWidth / 2;
+
+				// 30px tolerance off the edges
+				if ( newleft < 30 ) {
+					newleft = 30;
+				} else if ( ( newleft + menuWidth ) > screenWidth ) {
+					newleft = screenWidth - menuWidth - 30;
+				}
+			}
+
+			self.listbox.append( self.list )
+				.removeClass( "ui-selectmenu-hidden" )
+				.css({
+					top: newtop,
+					left: newleft
+				})
+				.addClass( "in" );
+
+			focusMenuItem();
+
+			// duplicate with value set in page show for dialog sized selects
+			self.isOpen = true;
+		}
+	},
+
+	_focusButton : function(){
+		var self = this;
+		setTimeout(function() {
+			self.button.focus();
+		}, 40);
+	},
+
+	close: function() {
+		if ( this.options.disabled || !this.isOpen || this.options.nativeMenu ) {
+			return;
+		}
+
+		var self = this;
+
+		if ( self.menuType == "page" ) {
+			// rebind the page remove that was unbound in the open function
+			// to allow for the parent page removal from actions other than the use
+			// of a dialog sized custom select
+			self.thisPage.bind( "pagehide.remove", function(){
+				$(this).remove();
+			});
+
+			// doesn't solve the possible issue with calling change page
+			// where the objects don't define data urls which prevents dialog key
+			// stripping - changePage has incoming refactor
+			window.history.back();
+		} else{
+			self.screen.addClass( "ui-screen-hidden" );
+			self.listbox.addClass( "ui-selectmenu-hidden" ).removeAttr( "style" ).removeClass( "in" );
+			self.list.appendTo( self.listbox );
+			self._focusButton();
+		}
+
+		// allow the dialog to be closed again
+		this.isOpen = false;
+	},
+
+	disable: function() {
+		this.element.attr( "disabled", true );
+		this.button.addClass( "ui-disabled" ).attr( "aria-disabled", true );
+		return this._setOption( "disabled", true );
+	},
+
+	enable: function() {
+		this.element.attr( "disabled", false );
+		this.button.removeClass( "ui-disabled" ).attr( "aria-disabled", false );
+		return this._setOption( "disabled", false );
+	}
+});
+
+//auto self-init widgets
+$( document ).bind( "pagecreate create", function( e ){
+	$( $.mobile.selectmenu.prototype.options.initSelector, e.target )
+		.not( ":jqmData(role='none'), :jqmData(role='nojs')" )
+		.selectmenu();
+});
+
+})( jQuery );
+
+/*
+* jQuery Mobile Framework : plugin for making button-like links
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT or GPL Version 2 licenses.
+* http://jquery.org/license
+*/
+( function( $, undefined ) {
+
+$.fn.buttonMarkup = function( options ) {
+	return this.each( function() {
+		var el = $( this ),
+			o = $.extend( {}, $.fn.buttonMarkup.defaults, el.jqmData(), options ),
+
+			// Classes Defined
+			innerClass = "ui-btn-inner",
+			buttonClass, iconClass,
+			themedParent, wrap;
+
+		if ( attachEvents ) {
+			attachEvents();
+		}
+
+		// if not, try to find closest theme container
+		if ( !o.theme ) {
+			themedParent = el.closest( "[class*='ui-bar-'],[class*='ui-body-']" );
+			o.theme = themedParent.length ?
+				/ui-(bar|body)-([a-z])/.exec( themedParent.attr( "class" ) )[2] :
+				"c";
+		}
+
+		buttonClass = "ui-btn ui-btn-up-" + o.theme;
+
+		if ( o.inline ) {
+			buttonClass += " ui-btn-inline";
+		}
+
+		if ( o.icon ) {
+			o.icon = "ui-icon-" + o.icon;
+			o.iconpos = o.iconpos || "left";
+
+			iconClass = "ui-icon " + o.icon;
+
+			if ( o.iconshadow ) {
+				iconClass += " ui-icon-shadow";
+			}
+		}
+
+		if ( o.iconpos ) {
+			buttonClass += " ui-btn-icon-" + o.iconpos;
+
+			if ( o.iconpos == "notext" && !el.attr( "title" ) ) {
+				el.attr( "title", el.text() );
+			}
+		}
+
+		if ( o.corners ) {
+			buttonClass += " ui-btn-corner-all";
+			innerClass += " ui-btn-corner-all";
+		}
+
+		if ( o.shadow ) {
+			buttonClass += " ui-shadow";
+		}
+
+		el.attr( "data-" + $.mobile.ns + "theme", o.theme )
+			.addClass( buttonClass );
+
+		wrap = ( "<D class='" + innerClass + "'><D class='ui-btn-text'></D>" +
+			( o.icon ? "<span class='" + iconClass + "'></span>" : "" ) +
+			"</D>" ).replace( /D/g, o.wrapperEls );
+
+		el.wrapInner( wrap );
+	});
+};
+
+$.fn.buttonMarkup.defaults = {
+	corners: true,
+	shadow: true,
+	iconshadow: true,
+	wrapperEls: "span"
+};
+
+function closestEnabledButton( element ) {
+	while ( element ) {
+		var $ele = $( element );
+		if ( $ele.hasClass( "ui-btn" ) && !$ele.hasClass( "ui-disabled" ) ) {
+			break;
+		}
+		element = element.parentNode;
+	}
+	return element;
+}
+
+var attachEvents = function() {
+	$( document ).bind( {
+		"vmousedown": function( event ) {
+			var btn = closestEnabledButton( event.target ),
+				$btn, theme;
+
+			if ( btn ) {
+				$btn = $( btn );
+				theme = $btn.attr( "data-" + $.mobile.ns + "theme" );
+				$btn.removeClass( "ui-btn-up-" + theme ).addClass( "ui-btn-down-" + theme );
+			}
+		},
+		"vmousecancel vmouseup": function( event ) {
+			var btn = closestEnabledButton( event.target ),
+				$btn, theme;
+
+			if ( btn ) {
+				$btn = $( btn );
+				theme = $btn.attr( "data-" + $.mobile.ns + "theme" );
+				$btn.removeClass( "ui-btn-down-" + theme ).addClass( "ui-btn-up-" + theme );
+			}
+		},
+		"vmouseover focus": function( event ) {
+			var btn = closestEnabledButton( event.target ),
+				$btn, theme;
+
+			if ( btn ) {
+				$btn = $( btn );
+				theme = $btn.attr( "data-" + $.mobile.ns + "theme" );
+				$btn.removeClass( "ui-btn-up-" + theme ).addClass( "ui-btn-hover-" + theme );
+			}
+		},
+		"vmouseout blur": function( event ) {
+			var btn = closestEnabledButton( event.target ),
+				$btn, theme;
+
+			if ( btn ) {
+				$btn = $( btn );
+				theme = $btn.attr( "data-" + $.mobile.ns + "theme" );
+				$btn.removeClass( "ui-btn-hover-" + theme ).addClass( "ui-btn-up-" + theme );
+			}
+		}
+	});
+
+	attachEvents = null;
+};
+
+//links in bars, or those with  data-role become buttons
+//auto self-init widgets
+$( document ).bind( "pagecreate create", function( e ){
+
+	$( ":jqmData(role='button'), .ui-bar > a, .ui-header > a, .ui-footer > a, .ui-bar > :jqmData(role='controlgroup') > a", e.target )
+		.not( ".ui-btn, :jqmData(role='none'), :jqmData(role='nojs')" )
+		.buttonMarkup();
+});
+
+})( jQuery );
+/*
+* jQuery Mobile Framework: "controlgroup" plugin - corner-rounding for groups of buttons, checks, radios, etc
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT or GPL Version 2 licenses.
+* http://jquery.org/license
+*/
+(function( $, undefined ) {
+
+$.fn.controlgroup = function( options ) {
+
+	return this.each(function() {
+
+		var $el = $( this ),
+			o = $.extend({
+						direction: $el.jqmData( "type" ) || "vertical",
+						shadow: false,
+						excludeInvisible: true
+					}, options ),
+			groupheading = $el.find( ">legend" ),
+			flCorners = o.direction == "horizontal" ? [ "ui-corner-left", "ui-corner-right" ] : [ "ui-corner-top", "ui-corner-bottom" ],
+			type = $el.find( "input:eq(0)" ).attr( "type" );
+
+		// Replace legend with more stylable replacement div
+		if ( groupheading.length ) {
+			$el.wrapInner( "<div class='ui-controlgroup-controls'></div>" );
+			$( "<div role='heading' class='ui-controlgroup-label'>" + groupheading.html() + "</div>" ).insertBefore( $el.children(0) );
+			groupheading.remove();
+		}
+
+		$el.addClass( "ui-corner-all ui-controlgroup ui-controlgroup-" + o.direction );
+
+		// TODO: This should be moved out to the closure
+		// otherwise it is redefined each time controlgroup() is called
+		function flipClasses( els ) {
+			els.removeClass( "ui-btn-corner-all ui-shadow" )
+				.eq( 0 ).addClass( flCorners[ 0 ] )
+				.end()
+				.filter( ":last" ).addClass( flCorners[ 1 ] ).addClass( "ui-controlgroup-last" );
+		}
+
+		flipClasses( $el.find( ".ui-btn" + ( o.excludeInvisible ? ":visible" : "" ) ) );
+		flipClasses( $el.find( ".ui-btn-inner" ) );
+
+		if ( o.shadow ) {
+			$el.addClass( "ui-shadow" );
+		}
+	});
+};
+
+//auto self-init widgets
+$( document ).bind( "pagecreate create", function( e ){
+	$( ":jqmData(role='controlgroup')", e.target ).controlgroup({ excludeInvisible: false });
+});
+
+})(jQuery);/*
+* jQuery Mobile Framework : "fieldcontain" plugin - simple class additions to make form row separators
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT or GPL Version 2 licenses.
+* http://jquery.org/license
+*/
+
+(function( $, undefined ) {
+
+$( document ).bind( "pagecreate create", function( e ){
+	
+	//links within content areas
+	$( e.target )
+		.find( "a" )
+		.not( ".ui-btn, .ui-link-inherit, :jqmData(role='none'), :jqmData(role='nojs')" )
+		.addClass( "ui-link" );
+
+});
+
+})( jQuery );/*
+* jQuery Mobile Framework : "fixHeaderFooter" plugin - on-demand positioning for headers,footers
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT or GPL Version 2 licenses.
+* http://jquery.org/license
+*/
+
+(function( $, undefined ) {
+
+var slideDownClass = "ui-header-fixed ui-fixed-inline fade",
+	slideUpClass = "ui-footer-fixed ui-fixed-inline fade",
+
+	slideDownSelector = ".ui-header:jqmData(position='fixed')",
+	slideUpSelector = ".ui-footer:jqmData(position='fixed')";
+
+$.fn.fixHeaderFooter = function( options ) {
+
+	if ( !$.support.scrollTop ) {
+		return this;
+	}
+
+	return this.each(function() {
+		var $this = $( this );
+
+		if ( $this.jqmData( "fullscreen" ) ) {
+			$this.addClass( "ui-page-fullscreen" );
+		}
+
+		// Should be slidedown
+		$this.find( slideDownSelector ).addClass( slideDownClass );
+
+		// Should be slideup
+		$this.find( slideUpSelector ).addClass( slideUpClass );
+	});
+};
+
+// single controller for all showing,hiding,toggling
+$.mobile.fixedToolbars = (function() {
+
+	if ( !$.support.scrollTop ) {
+		return;
+	}
+
+	var stickyFooter, delayTimer,
+		currentstate = "inline",
+		autoHideMode = false,
+		showDelay = 100,
+		ignoreTargets = "a,input,textarea,select,button,label,.ui-header-fixed,.ui-footer-fixed",
+		toolbarSelector = ".ui-header-fixed:first, .ui-footer-fixed:not(.ui-footer-duplicate):last",
+		// for storing quick references to duplicate footers
+		supportTouch = $.support.touch,
+		touchStartEvent = supportTouch ? "touchstart" : "mousedown",
+		touchStopEvent = supportTouch ? "touchend" : "mouseup",
+		stateBefore = null,
+		scrollTriggered = false,
+		touchToggleEnabled = true;
+
+	function showEventCallback( event ) {
+		// An event that affects the dimensions of the visual viewport has
+		// been triggered. If the header and/or footer for the current page are in overlay
+		// mode, we want to hide them, and then fire off a timer to show them at a later
+		// point. Events like a resize can be triggered continuously during a scroll, on
+		// some platforms, so the timer is used to delay the actual positioning until the
+		// flood of events have subsided.
+		//
+		// If we are in autoHideMode, we don't do anything because we know the scroll
+		// callbacks for the plugin will fire off a show when the scrolling has stopped.
+		if ( !autoHideMode && currentstate === "overlay" ) {
+			if ( !delayTimer ) {
+				$.mobile.fixedToolbars.hide( true );
+			}
+
+			$.mobile.fixedToolbars.startShowTimer();
+		}
+	}
+
+	$(function() {
+		var $document = $( document ),
+			$window = $( window );
+
+		$document
+			.bind( "vmousedown", function( event ) {
+				if ( touchToggleEnabled ) {
+					stateBefore = currentstate;
+				}
+			})
+			.bind( "vclick", function( event ) {
+				if ( touchToggleEnabled ) {
+
+					if ( $(event.target).closest( ignoreTargets ).length ) {
+						return;
+					}
+
+					if ( !scrollTriggered ) {
+						$.mobile.fixedToolbars.toggle( stateBefore );
+						stateBefore = null;
+					}
+				}
+			})
+			.bind( "silentscroll", showEventCallback );
+
+
+		// The below checks first for a $(document).scrollTop() value, and if zero, binds scroll events to $(window) instead.
+		// If the scrollTop value is actually zero, both will return zero anyway.
+		//
+		// Works with $(document), not $(window) : Opera Mobile (WinMO phone; kinda broken anyway)
+		// Works with $(window), not $(document) : IE 7/8
+		// Works with either $(window) or $(document) : Chrome, FF 3.6/4, Android 1.6/2.1, iOS
+		// Needs work either way : BB5, Opera Mobile (iOS)
+
+		( ( $document.scrollTop() === 0 ) ? $window : $document )
+			.bind( "scrollstart", function( event ) {
+
+				scrollTriggered = true;
+
+				if ( stateBefore === null ) {
+					stateBefore = currentstate;
+				}
+
+				// We only enter autoHideMode if the headers/footers are in
+				// an overlay state or the show timer was started. If the
+				// show timer is set, clear it so the headers/footers don't
+				// show up until after we're done scrolling.
+				var isOverlayState = stateBefore == "overlay";
+
+				autoHideMode = isOverlayState || !!delayTimer;
+
+				if ( autoHideMode ) {
+					$.mobile.fixedToolbars.clearShowTimer();
+
+					if ( isOverlayState ) {
+						$.mobile.fixedToolbars.hide( true );
+					}
+				}
+			})
+			.bind( "scrollstop", function( event ) {
+
+				if ( $( event.target ).closest( ignoreTargets ).length ) {
+					return;
+				}
+
+				scrollTriggered = false;
+
+				if ( autoHideMode ) {
+					$.mobile.fixedToolbars.startShowTimer();
+					autoHideMode = false;
+				}
+				stateBefore = null;
+			});
+
+			$window.bind( "resize", showEventCallback );
+	});
+
+	// 1. Before page is shown, check for duplicate footer
+	// 2. After page is shown, append footer to new page
+	$( ".ui-page" )
+		.live( "pagebeforeshow", function( event, ui ) {
+
+			var page = $( event.target ),
+				footer = page.find( ":jqmData(role='footer')" ),
+				id = footer.data( "id" ),
+				prevPage = ui.prevPage,
+				prevFooter = prevPage && prevPage.find( ":jqmData(role='footer')" ),
+				prevFooterMatches = prevFooter.length && prevFooter.jqmData( "id" ) === id;
+
+			if ( id && prevFooterMatches ) {
+				stickyFooter = footer;
+				setTop( stickyFooter.removeClass( "fade in out" ).appendTo( $.mobile.pageContainer ) );
+			}
+		})
+		.live( "pageshow", function( event, ui ) {
+
+			var $this = $( this );
+
+			if ( stickyFooter && stickyFooter.length ) {
+
+				setTimeout(function() {
+					setTop( stickyFooter.appendTo( $this ).addClass( "fade" ) );
+					stickyFooter = null;
+				}, 500);
+			}
+
+			$.mobile.fixedToolbars.show( true, this );
+		});
+
+	// When a collapsiable is hidden or shown we need to trigger the fixed toolbar to reposition itself (#1635)
+	$( ".ui-collapsible-contain" ).live( "collapse expand", showEventCallback );
+
+	// element.getBoundingClientRect() is broken in iOS 3.2.1 on the iPad. The
+	// coordinates inside of the rect it returns don't have the page scroll position
+	// factored out of it like the other platforms do. To get around this,
+	// we'll just calculate the top offset the old fashioned way until core has
+	// a chance to figure out how to handle this situation.
+	//
+	// TODO: We'll need to get rid of getOffsetTop() once a fix gets folded into core.
+
+	function getOffsetTop( ele ) {
+		var top = 0,
+			op, body;
+
+		if ( ele ) {
+			body = document.body;
+			op = ele.offsetParent;
+			top = ele.offsetTop;
+
+			while ( ele && ele != body ) {
+				top += ele.scrollTop || 0;
+
+				if ( ele == op ) {
+					top += op.offsetTop;
+					op = ele.offsetParent;
+				}
+
+				ele = ele.parentNode;
+			}
+		}
+		return top;
+	}
+
+	function setTop( el ) {
+		var fromTop = $(window).scrollTop(),
+			thisTop = getOffsetTop( el[ 0 ] ), // el.offset().top returns the wrong value on iPad iOS 3.2.1, call our workaround instead.
+			thisCSStop = el.css( "top" ) == "auto" ? 0 : parseFloat(el.css( "top" )),
+			screenHeight = window.innerHeight,
+			thisHeight = el.outerHeight(),
+			useRelative = el.parents( ".ui-page:not(.ui-page-fullscreen)" ).length,
+			relval;
+
+		if ( el.is( ".ui-header-fixed" ) ) {
+
+			relval = fromTop - thisTop + thisCSStop;
+
+			if ( relval < thisTop ) {
+				relval = 0;
+			}
+
+			return el.css( "top", useRelative ? relval : fromTop );
+		} else {
+			// relval = -1 * (thisTop - (fromTop + screenHeight) + thisCSStop + thisHeight);
+			// if ( relval > thisTop ) { relval = 0; }
+			relval = fromTop + screenHeight - thisHeight - (thisTop - thisCSStop );
+
+			return el.css( "top", useRelative ? relval : fromTop + screenHeight - thisHeight );
+		}
+	}
+
+	// Exposed methods
+	return {
+
+		show: function( immediately, page ) {
+
+			$.mobile.fixedToolbars.clearShowTimer();
+
+			currentstate = "overlay";
+
+			var $ap = page ? $( page ) :
+					( $.mobile.activePage ? $.mobile.activePage :
+						$( ".ui-page-active" ) );
+
+			return $ap.children( toolbarSelector ).each(function() {
+
+				var el = $( this ),
+					fromTop = $( window ).scrollTop(),
+					// el.offset().top returns the wrong value on iPad iOS 3.2.1, call our workaround instead.
+					thisTop = getOffsetTop( el[ 0 ] ),
+					screenHeight = window.innerHeight,
+					thisHeight = el.outerHeight(),
+					alreadyVisible = ( el.is( ".ui-header-fixed" ) && fromTop <= thisTop + thisHeight ) ||
+														( el.is( ".ui-footer-fixed" ) && thisTop <= fromTop + screenHeight );
+
+				// Add state class
+				el.addClass( "ui-fixed-overlay" ).removeClass( "ui-fixed-inline" );
+
+				if ( !alreadyVisible && !immediately ) {
+					el.animationComplete(function() {
+						el.removeClass( "in" );
+					}).addClass( "in" );
+				}
+				setTop(el);
+			});
+		},
+
+		hide: function( immediately ) {
+
+			currentstate = "inline";
+
+			var $ap = $.mobile.activePage ? $.mobile.activePage :
+									$( ".ui-page-active" );
+
+			return $ap.children( toolbarSelector ).each(function() {
+
+				var el = $(this),
+					thisCSStop = el.css( "top" ),
+					classes;
+
+				thisCSStop = thisCSStop == "auto" ? 0 :
+											parseFloat(thisCSStop);
+
+				// Add state class
+				el.addClass( "ui-fixed-inline" ).removeClass( "ui-fixed-overlay" );
+
+				if ( thisCSStop < 0 || ( el.is( ".ui-header-fixed" ) && thisCSStop !== 0 ) ) {
+
+					if ( immediately ) {
+						el.css( "top", 0);
+					} else {
+
+						if ( el.css( "top" ) !== "auto" && parseFloat( el.css( "top" ) ) !== 0 ) {
+
+							classes = "out reverse";
+
+							el.animationComplete(function() {
+								el.removeClass( classes ).css( "top", 0 );
+							}).addClass( classes );
+						}
+					}
+				}
+			});
+		},
+
+		startShowTimer: function() {
+
+			$.mobile.fixedToolbars.clearShowTimer();
+
+			var args = [].slice.call( arguments );
+
+			delayTimer = setTimeout(function() {
+				delayTimer = undefined;
+				$.mobile.fixedToolbars.show.apply( null, args );
+			}, showDelay);
+		},
+
+		clearShowTimer: function() {
+			if ( delayTimer ) {
+				clearTimeout( delayTimer );
+			}
+			delayTimer = undefined;
+		},
+
+		toggle: function( from ) {
+			if ( from ) {
+				currentstate = from;
+			}
+			return ( currentstate === "overlay" ) ? $.mobile.fixedToolbars.hide() :
+								$.mobile.fixedToolbars.show();
+		},
+
+		setTouchToggleEnabled: function( enabled ) {
+			touchToggleEnabled = enabled;
+		}
+	};
+})();
+
+// TODO - Deprecated namepace on $. Remove in a later release
+$.fixedToolbars = $.mobile.fixedToolbars;
+
+//auto self-init widgets
+$( document ).bind( "pagecreate create", function( event ) {
+
+	if ( $( ":jqmData(position='fixed')", event.target ).length ) {
+
+		$( event.target ).each(function() {
+
+			if ( !$.support.scrollTop ) {
+				return this;
+			}
+
+			var $this = $( this );
+
+			if ( $this.jqmData( "fullscreen" ) ) {
+				$this.addClass( "ui-page-fullscreen" );
+			}
+
+			// Should be slidedown
+			$this.find( slideDownSelector ).addClass( slideDownClass );
+
+			// Should be slideup
+			$this.find( slideUpSelector ).addClass( slideUpClass );
+
+		})
+
+	}
+});
+
+})( jQuery );
+/*
+* jQuery Mobile Framework : resolution and CSS media query related helpers and behavior
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT or GPL Version 2 licenses.
+* http://jquery.org/license
+*/
+(function( $, undefined ) {
+
+var $window = $( window ),
+	$html = $( "html" ),
+
+	//media-query-like width breakpoints, which are translated to classes on the html element
+	resolutionBreakpoints = [ 320, 480, 768, 1024 ];
+
+/*
+	private function for adding/removing breakpoint classes to HTML element for faux media-query support
+	It does not require media query support, instead using JS to detect screen width > cross-browser support
+	This function is called on orientationchange, resize, and mobileinit, and is bound via the 'htmlclass' event namespace
+*/
+function detectResolutionBreakpoints() {
+	var currWidth = $window.width(),
+		minPrefix = "min-width-",
+		maxPrefix = "max-width-",
+		minBreakpoints = [],
+		maxBreakpoints = [],
+		unit = "px",
+		breakpointClasses;
+
+	$html.removeClass( minPrefix + resolutionBreakpoints.join(unit + " " + minPrefix) + unit + " " +
+		maxPrefix + resolutionBreakpoints.join( unit + " " + maxPrefix) + unit );
+
+	$.each( resolutionBreakpoints, function( i, breakPoint ) {
+		if( currWidth >= breakPoint ) {
+			minBreakpoints.push( minPrefix + breakPoint + unit );
+		}
+		if( currWidth <= breakPoint ) {
+			maxBreakpoints.push( maxPrefix + breakPoint + unit );
+		}
+	});
+
+	if ( minBreakpoints.length ) {
+		breakpointClasses = minBreakpoints.join(" ");
+	}
+	if ( maxBreakpoints.length ) {
+		breakpointClasses += " " +  maxBreakpoints.join(" ");
+	}
+
+	$html.addClass( breakpointClasses );
+};
+
+/* $.mobile.addResolutionBreakpoints method:
+	pass either a number or an array of numbers and they'll be added to the min/max breakpoint classes
+	Examples:
+		$.mobile.addResolutionBreakpoints( 500 );
+		$.mobile.addResolutionBreakpoints( [500, 1200] );
+*/
+$.mobile.addResolutionBreakpoints = function( newbps ) {
+	if( $.type( newbps ) === "array" ){
+		resolutionBreakpoints = resolutionBreakpoints.concat( newbps );
+	} else {
+		resolutionBreakpoints.push( newbps );
+	}
+
+	resolutionBreakpoints.sort(function( a, b ) {
+		return a - b;
+	});
+
+	detectResolutionBreakpoints();
+};
+
+/* on mobileinit, add classes to HTML element
+	and set handlers to update those on orientationchange and resize
+*/
+$( document ).bind( "mobileinit.htmlclass", function() {
+	// bind to orientationchange and resize
+	// to add classes to HTML element for min/max breakpoints and orientation
+
+	var ev = $.support.orientation;
+
+	$window.bind( "orientationchange.htmlclass throttledResize.htmlclass", function( event ) {
+
+		// add orientation class to HTML element on flip/resize.
+		if ( event.orientation ) {
+			$html.removeClass( "portrait landscape" ).addClass( event.orientation );
+		}
+
+		// add classes to HTML element for min/max breakpoints
+		detectResolutionBreakpoints();
+	});
+});
+
+/* Manually trigger an orientationchange event when the dom ready event fires.
+	This will ensure that any viewport meta tag that may have been injected
+	has taken effect already, allowing us to properly calculate the width of the
+	document.
+*/
+$(function() {
+	//trigger event manually
+	$window.trigger( "orientationchange.htmlclass" );
+});
+
+})(jQuery);/*!
+ * jQuery Mobile v@VERSION
+ * http://jquerymobile.com/
+ *
+ * Copyright 2010, jQuery Project
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ */
+
+(function( $, window, undefined ) {
+	var	$html = $( "html" ),
+			$head = $( "head" ),
+			$window = $( window );
+
+ 	//trigger mobileinit event - useful hook for configuring $.mobile settings before they're used
+	$( window.document ).trigger( "mobileinit" );
+
+	//support conditions
+	//if device support condition(s) aren't met, leave things as they are -> a basic, usable experience,
+	//otherwise, proceed with the enhancements
+	if ( !$.mobile.gradeA() ) {
+		return;
+	}
+	
+	// override ajaxEnabled on platforms that have known conflicts with hash history updates 
+	// or generally work better browsing in regular http for full page refreshes (BB5, Opera Mini)
+	if( $.mobile.ajaxBlacklist ){
+		$.mobile.ajaxEnabled = false;
+	}
+
+	//add mobile, initial load "rendering" classes to docEl
+	$html.addClass( "ui-mobile ui-mobile-rendering" );
+
+	//loading div which appears during Ajax requests
+	//will not appear if $.mobile.loadingMessage is false
+	var $loader = $( "<div class='ui-loader ui-body-a ui-corner-all'><span class='ui-icon ui-icon-loading spin'></span><h1></h1></div>" );
+
+	$.extend($.mobile, {
+		// turn on/off page loading message.
+		showPageLoadingMsg: function() {
+			if( $.mobile.loadingMessage ){
+				var activeBtn = $( "." + $.mobile.activeBtnClass ).first();
+			
+				$loader
+					.find( "h1" )
+						.text( $.mobile.loadingMessage )
+						.end()
+					.appendTo( $.mobile.pageContainer )
+					//position at y center (if scrollTop supported), above the activeBtn (if defined), or just 100px from top
+					.css( {
+						top: $.support.scrollTop && $(window).scrollTop() + $(window).height() / 2 ||
+						activeBtn.length && activeBtn.offset().top || 100
+					} );
+			}
+			
+			$html.addClass( "ui-loading" );
+		},
+
+		hidePageLoadingMsg: function() {
+			$html.removeClass( "ui-loading" );
+		},
+
+		// XXX: deprecate for 1.0
+		pageLoading: function ( done ) {
+			if ( done ) {
+				$.mobile.hidePageLoadingMsg();
+			} else {
+				$.mobile.showPageLoadingMsg();
+			}
+		},
+
+		// find and enhance the pages in the dom and transition to the first page.
+		initializePage: function(){
+			//find present pages
+			var $pages = $( ":jqmData(role='page')" );
+			
+			//if no pages are found, create one with body's inner html
+			if( !$pages.length ){
+				$pages = $( "body" ).wrapInner( "<div data-" + $.mobile.ns + "role='page'></div>" ).children( 0 );
+			}
+
+			//add dialogs, set data-url attrs
+			$pages.add( ":jqmData(role='dialog')" ).each(function(){
+				var $this = $(this);
+
+				// unless the data url is already set set it to the id
+				if( !$this.jqmData('url') ){
+					$this.attr( "data-" + $.mobile.ns + "url", $this.attr( "id" ) );
+				}
+			});
+
+			//define first page in dom case one backs out to the directory root (not always the first page visited, but defined as fallback)
+			$.mobile.firstPage = $pages.first();
+
+			//define page container
+			$.mobile.pageContainer = $pages.first().parent().addClass( "ui-mobile-viewport" );
+
+			//cue page loading message
+			$.mobile.showPageLoadingMsg();
+
+			// if hashchange listening is disabled or there's no hash deeplink, change to the first page in the DOM
+			if( !$.mobile.hashListeningEnabled || !$.mobile.path.stripHash( location.hash ) ){
+				$.mobile.changePage( $.mobile.firstPage, { transition: "none", reverse: true, changeHash: false, fromHashChange: true } );
+			}
+			// otherwise, trigger a hashchange to load a deeplink
+			else {
+				$window.trigger( "hashchange", [ true ] );
+			}
+		}
+	});
+	
+	//initialize events now, after mobileinit has occurred
+	$.mobile._registerInternalEvents();
+	
+	//check which scrollTop value should be used by scrolling to 1 immediately at domready
+	//then check what the scroll top is. Android will report 0... others 1
+	//note that this initial scroll won't hide the address bar. It's just for the check.
+	$(function(){
+		window.scrollTo( 0, 1 );
+
+		//if defaultHomeScroll hasn't been set yet, see if scrollTop is 1
+		//it should be 1 in most browsers, but android treats 1 as 0 (for hiding addr bar)
+		//so if it's 1, use 0 from now on
+		$.mobile.defaultHomeScroll = ( !$.support.scrollTop || $(window).scrollTop() === 1 ) ? 0 : 1;
+	
+		//dom-ready inits
+		if( $.mobile.autoInitializePage ){
+			$( $.mobile.initializePage );
+		}
+		
+		//window load event
+		//hide iOS browser chrome on load
+		$window.load( $.mobile.silentScroll );
+	});
+})( jQuery, this );
+

--- a/labs/busstopdensity.tile.php
+++ b/labs/busstopdensity.tile.php
@@ -15,8 +15,8 @@
 	set_time_limit(120);//2mn
 	ini_set('memory_limit', '256M');
 error_reporting(E_ALL ^ E_DEPRECATED);
-	require_once ('lib/GoogleMapUtility.php');
-	require_once ('lib/HeatMap.php');
+	require_once ($labsPath . 'lib/GoogleMapUtility.php');
+	require_once ($labsPath . 'lib/HeatMap.php');
 
 	//Root folder to store generated tiles
 	define('TILE_DIR', 'tiles/');
@@ -103,13 +103,14 @@
             global $conn;
 		$nbPOIInsideTile = 0;
 
-	$result = pg_query($conn, $query);
         $spots = Array();
-	if (!$result) {
-		databaseError(pg_result_error($result));
+	$query = $conn->prepare($query);
+	$query->execute();
+	if (!$query) {
+		databaseError($conn->errorInfo());
 		return Array();
 	}
-	foreach( pg_fetch_all($result) as $row){
+	foreach( $query->fetchAll() as $row){
 				$point = GoogleMapUtility::getOffsetPixelCoords($row['stop_lat'], $row['stop_lon'], $zoom, $X, $Y);
 				//Count result only in the tile
 				if( ($point->x > -$offset) && ($point->x < (GoogleMapUtility::TILE_SIZE+$offset)) && ($point->y > -$offset) && ($point->y < (GoogleMapUtility::TILE_SIZE+$offset))){

--- a/labs/index.php
+++ b/labs/index.php
@@ -1,18 +1,39 @@
 <?php
 include ('../include/common.inc.php');
-include_header("Busness R&amp;D", "index")
+
+include_header("Busness R&amp;D", "index");
+ if ($_SESSION['authed'] == true) {
+ 	echo '<ul data-role="listview" data-theme="e" data-groupingtheme="e">
+		<li data-role="list-divider" > Admin Features </li>
+		<li><a href="myway_timeliness_calculate.php"><h3>myway_timeliness_calculate</h3>
+		<p>myway_timeliness_calculate</p></a></li>
+		<li><a href="myway_timeliness_reconcile.php"><h3>myway_timeliness_reconcile</h3>
+		<p>myway_timeliness_reconcile</p></a></li>
+		<li><a href="servicealert_editor.php"><h3>servicealert_editor</h3>
+		<p>servicealert_editor</p></a></li>
+            </ul>';
+ }
 ?>
 	    <ul data-role="listview" data-theme="e" data-groupingtheme="e">
 		<li data-role="list-divider" > Experimental Features </li>
 		<li><a href="mywaybalance.php"><h3>MyWay Balance for mobile</h3>
 		<p>Mobile viewer for MyWay balance. Warning! No HTTPS security.</p></a></li>
-		<li><a href="networkstats.php"><h3>Route Statistics</h3>
-		<p>Analysis of route timing points</p></a></li>
 		<li><a href="busstopdensity.php"><h3>Bus Stop Density Map</h3>
 		<p>Analysis of bus stop coverage</p></a></li>
 		<li><a href="stopBrowser.php"><h3>Bus Stop Browser Map</h3>
 		<p>Bus stop location/route browser</p></a></li>
-		<li>More coming soon!</li>
+            </ul>
+   <ul data-role="listview" data-theme="e" data-groupingtheme="e">
+
+		<li data-role="list-divider" > MyWay Timeliness Graphs </li>
+		<li><a href="myway_timeliness.php"><h3>Timeliness over Day</h3>
+		<p>Displays the deviation from the timetable over the day</p></a></li>
+		<li><a href="myway_timeliness_freqdist.php"><h3>Frequency Distribution of Time Deviation</h3>
+		<p>Displays spread of time deviations</p></a></li>
+		<li><a href="myway_timeliness_route.php"><h3>Timeliness over Route</h3>
+		<p>Displays the deviation from timetable as a specific route progresses</p></a></li>
+		<li><a href="myway_timeliness_stop.php"><h3>Timeliness at Stop</h3>
+		<p>Displays the deviation from the timetable at a specific stop</p></a></li>
             </ul>
 	    </div>
 <?php

--- a/labs/myway_api.json.php
+++ b/labs/myway_api.json.php
@@ -126,7 +126,7 @@
 if (sizeof($return) == 0) {
 $return['error'][] = "No data extracted from MyWay website - API may be out of date";
 }
-
+if (basename(__FILE__) == "myway_api.json.php") {
 header('Content-Type: text/javascript; charset=utf8');
 // header('Access-Control-Allow-Origin: http://bus.lambdacomplex.org/');
 header('Access-Control-Max-Age: 3628800');
@@ -137,5 +137,6 @@
 	
 }
 else echo json_encode($return);
+}
 ?>
 

--- a/labs/myway_timeliness.php
+++ b/labs/myway_timeliness.php
@@ -6,57 +6,51 @@
     <!--[if lte IE 8]><script language="javascript" type="text/javascript" src="../js/flot/excanvas.min.js"></script><![endif]--> 
  
     <script language="javascript" type="text/javascript" src="../js/flot/jquery.flot.js"></script> 
-  <div id="placeholder" style="width:800px;height:600px"></div> 
+  <center><div id="placeholder" style="width:900px;height:550px"></div></center>
 <script type="text/javascript"> 
 $(function () {
     var d = new Date();
-						d.setUTCMinutes(0);
-						d.setUTCHours(0);
+    d.setUTCMinutes(0);
+    d.setUTCHours(0);
     var midnight = d.getTime();
-    var d1 = [];
+
 <?php
-//$query = "select * from myway_timingdeltas order by time";
-$query = "select * from myway_timingdeltas where abs(timing_delta) < 2*(select stddev(timing_delta) from myway_timingdeltas)  order by time;";
-$query = $conn->prepare($query);
-$query->execute();
+$query = "select * from myway_timingdeltas where abs(timing_delta) < 2*(select stddev(timing_delta) from myway_timingdeltas)  order by route_full_name;";
+$query = $conn -> prepare($query);
+$query -> execute();
 if (!$query) {
-	databaseError($conn->errorInfo());
-	return Array();
-}
+    databaseError($conn -> errorInfo());
+     return Array();
+    } 
 $i = 0;
-foreach ($query->fetchAll() as $delta) {
-	echo "d1.push([ midnight+ (1000*" . midnight_seconds(strtotime($delta['time'])) . "), {$delta['timing_delta']}]); \n";
-	$i++;
-};
+$labels = Array();
+$lastRoute = "";
+foreach ($query -> fetchAll() as $delta) {
+    $routeName = $delta['route_full_name'];
+     if (strstr($routeName, " 3")) $routeName = "312-319";
+     else $routeName = preg_replace('/\D/', '', $routeName);
+     if ($routeName != $lastRoute) {
+        $i++;
+         echo "    var d$i = [];";
+         $lastRoute = $routeName;
+         $labels[$i] = $routeName;
+         } 
+    echo "d$i.push([ midnight+ (1000*" . midnight_seconds(strtotime($delta['time'])) . "), " . intval($delta['timing_delta']) . "]); \n";
+    } ;
 ?>
 
-    var d2 = [];
-<?php
-//$query = "select * from myway_timingdeltas order by route_full_name";
-$query = "select * from myway_timingdeltas where abs(timing_delta) < 2*(select stddev(timing_delta) from myway_timingdeltas) order by route_full_name";
-$query = $conn->prepare($query);
-$query->execute();
-if (!$query) {
-	databaseError($conn->errorInfo());
-	return Array();
-}
-$i = 0;
-foreach ($query->fetchAll() as $delta) {
-	//  echo "d2.push([$i, {$delta['timing_delta']}]); \n";
-	$i++;
-};
-?>
        var placeholder = $("#placeholder");
 
     var plot = $.plot(placeholder, [
-        {
-            data: d1,
-            points: { show: true }
-        },
-        {
-            data: d2,
-            points: { show: true }
-        },
+<?php
+foreach ($labels as $key => $label) {
+    echo "        {
+            data: d$key,
+            points: { show: true },
+            label: '$label'
+        },";
+    } 
+?>
     ],
         {
             xaxis: {
@@ -67,17 +61,18 @@
             yaxis: {
                 tickFormatter: yformatter
             },
-            grid: { hoverable: true, clickable: true },
+            grid: { hoverable: true, clickable: true, labelMargin: 32   },
     });
         var o;
     o = plot.pointOffset({ x: midnight+ (9*60*60*1000), y: -1.2});
     placeholder.append('<div style="position:absolute;left:' + (o.left + 4) + 'px;top:' + o.top + 'px;color:#666;font-size:smaller">9am</div>');
-  o = plot.pointOffset({ x: midnight+ (16*60*60*1000), y: -1.2});
+    o = plot.pointOffset({ x: midnight+ (16*60*60*1000), y: -1.2});
     placeholder.append('<div style="position:absolute;left:' + (o.left + 4) + 'px;top:' + o.top + 'px;color:#666;font-size:smaller">4pm</div>');
 
  });
 function yformatter(v) {
-    return Math.floor(v/60) + " minutes " + (v == 0 ? "" : (v >0 ? "early":"late"))
+    if (Math.floor(v/60) < -9) return "";
+    return Math.abs(Math.floor(v/60)) + " min " + (v == 0 ? "" : (v >0 ? "early":"late"))
 }
   function showTooltip(x, y, contents) {
         $('<div id="tooltip">' + contents + '</div>').css( {
@@ -111,7 +106,7 @@
 
                     
                     showTooltip(item.pageX, item.pageY,
-                                item.series.label + " of " + x + " "+ time +" = " + y +" ( "+ y/60+" minutes )");
+                                item.series.label + " at "+ time +" = " + Math.abs(new Number(y/60).toFixed(2))+" minutes "+(y >0 ? "early":"late"));
                 }
             }
             else {

--- a/labs/myway_timeliness_calculate.php
+++ b/labs/myway_timeliness_calculate.php
@@ -1,6 +1,8 @@
 <?php
 include ('../include/common.inc.php');
 include_header("MyWay Delta Calculate", "mywayDeltaCalc");
+flush();
+ob_flush();
 function abssort($a, $b)
 {
 	if ($a['timeDiff'] == $b['timeDiff']) {
@@ -40,8 +42,10 @@
 		echo "error, route '{$obsv['myway_route']}' unknown";
 		continue;
 	}
-	//		:convert timestamp into time of day and date
+	// convert timestamp into time of day and date
+// timezones from http://www.postgresql.org/docs/8.0/static/datetime-keywords.html
 	$time = date("H:i:s", strtotime($obsv['time']));
+    $time_tz = date("H:i:s", strtotime($obsv['time']))." AESST";
         $search_time = date("H:i:s", strtotime($obsv['time'])-(30*60)); // 30 minutes margin
 	$date = date("c", strtotime($obsv['time']));
 	$timing_period = service_period(strtotime($date));
@@ -87,7 +91,8 @@
 						//work out time delta, put into array with index of delta
 						$timeDeltas[] = Array(
 							"timeDiff" => $timeDiff,
-							"stop_code" => $potentialStop['stop_code']
+							"stop_code" => $potentialStop['stop_code'],
+                                                        "stop_sequence" => $timedTrip['stop_sequence']
 						);
 						echo "Found trip {$trip['trip_id']} at stop {$potentialStop['stop_code']} (#{$potentialStop['stop_id']}, sequence #{$trip['stop_sequence']})<br>";
                                                 echo "Arriving at {$timedTrip['arrival_time']}, difference of " . round($timeDiff / 60, 2) . " minutes<br>";
@@ -101,6 +106,8 @@
 			//print out that stops/does not stop
 			echo "No matching routes found at {$potentialStop['stop_code']}<br>";
                         var_dump($stopRoutes);
+                        			flush();
+
 		}
 	}
 	//   lowest delta is recorded delta
@@ -110,24 +117,25 @@
 		echo "Lowest difference of " . round($lowestDelta / 60, 2) . " minutes will be recorded for this observation<br>";
 		$observation_id = $obsv['observation_id'];
 		$route_full_name = $obsv['route_full_name'];
-		$myway_route = $obsv['myway_stop'];
 		$stop_code = $timeDeltas[0]["stop_code"];
-		$stmt = $conn->prepare("insert into myway_timingdeltas (observation_id, route_full_name, myway_route, stop_code, timing_delta, time, date, timing_period)
-				      values (:observation_id, :route_full_name, :myway_route, :stop_code, :timing_delta, :time, :date, :timing_period)");
+		$stop_sequence = $timeDeltas[0]["stop_sequence"];
+		$stmt = $conn->prepare("insert into myway_timingdeltas (observation_id, route_full_name, stop_code, timing_delta, time, date, timing_period, stop_sequence)
+				      values (:observation_id, :route_full_name, :stop_code, :timing_delta, :time, :date, :timing_period, :stop_sequence)");
 		$stmt->bindParam(':observation_id', $observation_id);
 		$stmt->bindParam(':route_full_name', $route_full_name);
-		$stmt->bindParam(':myway_route', $myway_route);
 		$stmt->bindParam(':stop_code', $stop_code);
 		$stmt->bindParam(':timing_delta', $lowestDelta);
-		$stmt->bindParam(':time', $time);
+		$stmt->bindParam(':time', $time_tz);
 		$stmt->bindParam(':date', $date);
 		$stmt->bindParam(':timing_period', $timing_period);
+                $stmt->bindParam(':stop_sequence', $stop_sequence);
 		// insert a record
 		$stmt->execute();
 		if ($stmt->rowCount() > 0) {
 			echo "Recorded.<br>";
 		}
 		var_dump($conn->errorInfo());
+			flush();
 	}
 	flush();
 }

--- /dev/null
+++ b/labs/myway_timeliness_freqdist.php
@@ -1,1 +1,45 @@
+<?php
+include ('../include/common.inc.php');
+include_header("MyWay Deltas", "mywayDelta");
+?>
 
+    <!--[if lte IE 8]><script language="javascript" type="text/javascript" src="../js/flot/excanvas.min.js"></script><![endif]--> 
+ 
+    <script language="javascript" type="text/javascript" src="../js/flot/jquery.flot.js"></script> 
+  <center><div id="placeholder" style="width:900px;height:550px"></div></center>
+<script type="text/javascript"> 
+$(function () {
+
+ var d1 = [];
+<?php
+$query = "select td, count(*) from (select (timing_delta - MOD(timing_delta,10)) as td from myway_timingdeltas where abs(timing_delta) < 2*(select stddev(timing_delta) from myway_timingdeltas)) as a  group by td order by td";
+$query = $conn->prepare($query);
+$query->execute();
+if (!$query) {
+	databaseError($conn->errorInfo());
+	return Array();
+}
+
+foreach ($query->fetchAll() as $delta) {
+
+	echo "d1.push([ ".intval($delta['td']).", ".intval($delta['count'])."]); \n";
+};
+?>
+
+       var placeholder = $("#placeholder");
+
+    var plot = $.plot(placeholder, [
+       {
+            data: d1,
+            bars: { show: true }
+        },
+    ],
+        {
+
+            grid: { hoverable: true, clickable: true, labelMargin: 17  },
+    });
+
+ });
+
+ 
+</script> 

--- /dev/null
+++ b/labs/myway_timeliness_overview.php
@@ -1,1 +1,97 @@
+<?php
+include ('../include/common.inc.php');
+include_header("MyWay Deltas", "mywayDelta");
+?>
+<table>
+    <tr><td></td><td>Mean</td><td>Standard<br>Deviation</td><td>Sample Size</td></tr>
+<th> Overall </th>
+<?php
+$query = "select '', avg(timing_delta), stddev(timing_delta), count(*)  from myway_timingdeltas ";
+$query = $conn->prepare($query);
+$query->execute();
+if (!$query) {
+	databaseError($conn->errorInfo());
+	return Array();
+}
+foreach ($query->fetchAll() as $row) {
+	echo "<tr><td>{$row[0]}</td><td>" . floor($row[1]) . "</td><td>" . floor($row[2]) . "</td><td>{$row[3]}</td></tr>";
+};
+?>
 
+
+<th> Hour of Day </th>
+<?php
+$query = "select extract(hour from time), avg(timing_delta), stddev(timing_delta), count(*) from myway_timingdeltas group by extract(hour from time) order by extract(hour from time)";
+$query = $conn->prepare($query);
+$query->execute();
+if (!$query) {
+	databaseError($conn->errorInfo());
+	return Array();
+}
+foreach ($query->fetchAll() as $row) {
+	echo "<tr><td>{$row[0]}</td><td>" . floor($row[1]) . "</td><td>" . floor($row[2]) . "</td><td>{$row[3]}</td></tr>";
+};
+?>
+
+<th> Day of Week </th>
+<?php
+$query = "select to_char(date, 'Day'), avg(timing_delta), stddev(timing_delta), count(*) from myway_timingdeltas group by to_char(date, 'Day') order by to_char(date, 'Day')";
+$query = $conn->prepare($query);
+$query->execute();
+if (!$query) {
+	databaseError($conn->errorInfo());
+	return Array();
+}
+foreach ($query->fetchAll() as $row) {
+	echo "<tr><td>{$row[0]}</td><td>" . floor($row[1]) . "</td><td>" . floor($row[2]) . "</td><td>{$row[3]}</td></tr>";
+};
+?>
+<th>Month </th>
+<?php
+$query = "select to_char(date, 'Month'), avg(timing_delta), stddev(timing_delta), count(*) from myway_timingdeltas group by to_char(date, 'Month') order by to_char(date, 'Month')";
+$query = $conn->prepare($query);
+$query->execute();
+if (!$query) {
+	databaseError($conn->errorInfo());
+	return Array();
+}
+foreach ($query->fetchAll() as $row) {
+	echo "<tr><td>{$row[0]}</td><td>" . floor($row[1]) . "</td><td>" . floor($row[2]) . "</td><td>{$row[3]}</td></tr>";
+};
+?>
+
+<th>Stop </th>
+<?php
+$query = "select myway_stop, avg(timing_delta), stddev(timing_delta), count(*)  from myway_timingdeltas INNER JOIN myway_observations
+ON myway_observations.observation_id=myway_timingdeltas.observation_id group by myway_stop having  count(*) > 1 order by myway_stop";
+$query = $conn->prepare($query);
+$query->execute();
+if (!$query) {
+	databaseError($conn->errorInfo());
+	return Array();
+}
+foreach ($query->fetchAll() as $row) {
+	echo "<tr><td>{$row[0]}</td><td>" . floor($row[1]) . "</td><td>" . floor($row[2]) . "</td><td>{$row[3]}</td></tr>";
+};
+?>
+<th>Route </th>
+<?php
+$query = "select route_full_name, avg(timing_delta), stddev(timing_delta), count(*) from myway_timingdeltas  group by route_full_name having  count(*) > 1 order by route_full_name";
+$query = $conn->prepare($query);
+$query->execute();
+if (!$query) {
+	databaseError($conn->errorInfo());
+	return Array();
+}
+foreach ($query->fetchAll() as $row) {
+	echo "<tr><td>{$row[0]}</td><td>" . floor($row[1]) . "</td><td>" . floor($row[2]) . "</td><td>{$row[3]}</td></tr>";
+};
+?>
+
+
+</table>
+
+<?php
+include_footer();
+?>
+

--- a/labs/myway_timeliness_reconcile.php
+++ b/labs/myway_timeliness_reconcile.php
@@ -1,5 +1,6 @@
 <?php
 include ('../include/common.inc.php');
+auth();
 foreach ($_REQUEST as $key => $value) {
 	if (strstr($key, "route") && !strstr($value, "Select")) {
 		$myway_route = str_replace("route", "", $key);
@@ -7,8 +8,8 @@
 		$query = "update myway_routes set route_full_name = :route_full_name where myway_route = :myway_route";
 		debug($query, "database");
 		$query = $conn->prepare($query);
-		$query->bindParam(":myway_route", $myway_route);
-		$query->bindParam(":route_full_name", $route_full_name);
+		$query->bindParam(":myway_route", $myway_route,PDO::PARAM_STR, 5);
+		$query->bindParam(":route_full_name", $route_full_name,PDO::PARAM_STR, 42);
 		$query->execute();
 		die(print_r($conn->errorInfo() , true));
 	}
@@ -19,8 +20,8 @@
 		$query = "update myway_stops set stop_code = :stop_code, stop_street = :stop_street where myway_stop = :myway_stop";
 		debug($query, "database");
 		$query = $conn->prepare($query);
-		$query->bindParam(":myway_stop", $myway_stop);
-		$query->bindParam(":stop_code", $stop_code);
+		$query->bindParam(":myway_stop", $myway_stop, PDO::PARAM_STR, 25);
+		$query->bindParam(":stop_code", $stop_code, PDO::PARAM_STR, 32);
                 		$query->bindParam(":stop_street", $stop_street);
 		$query->execute();
 		die(print_r($conn->errorInfo() , true));

--- /dev/null
+++ b/labs/myway_timeliness_route.json.php
@@ -1,1 +1,25 @@
-
+<?php
+include ('../include/common.inc.php');
+header('Content-Type: text/javascript; charset=utf8');
+// header('Access-Control-Allow-Origin: http://bus.lambdacomplex.org/');
+header('Access-Control-Max-Age: 3628800');
+header('Access-Control-Allow-Methods: GET, POST, PUT, DELETE');
+?>
+{
+    "label": "<?php echo $_REQUEST['routeid']; ?>",
+    "data": <?php
+   $query = "select * from myway_timingdeltas where route_full_name = :route_full_name AND abs(timing_delta) < 2*(select stddev(timing_delta) from myway_timingdeltas)  order by stop_sequence;";
+$query = $conn->prepare($query);
+$query->bindParam(':route_full_name', $_REQUEST['routeid'],PDO::PARAM_STR, 42);
+		
+$query->execute();
+if (!$query) {
+	databaseError($conn->errorInfo());
+	return Array();
+}
+foreach ($query->fetchAll() as $delta) {
+	$points[] = "[{$delta['stop_sequence']}, {$delta['timing_delta']}]";
+};
+echo "[".implode(",",$points)."]";
+?>
+}

--- /dev/null
+++ b/labs/myway_timeliness_route.php
@@ -1,1 +1,125 @@
+<?php
+include ('../include/common.inc.php');
+include_header("MyWay Deltas", "mywayDelta");
+?>
 
+    <!--[if lte IE 8]><script language="javascript" type="text/javascript" src="../js/flot/excanvas.min.js"></script><![endif]--> 
+ 
+    <script language="javascript" type="text/javascript" src="../js/flot/jquery.flot.js"></script> 
+  <form method="get" action="">
+    <select id="routeid" name="routeid">
+<?php
+$query = "select distinct route_full_name from myway_routes where myway_route != '' order by route_full_name";
+$query = $conn->prepare($query);
+$query->execute();
+if (!$query) {
+	databaseError($conn->errorInfo());
+	return Array();
+}
+foreach ($query->fetchAll() as $route) {
+           echo "<option value=\"{$route['route_full_name']}\">{$route['route_full_name']}</option>";
+  
+};
+?>    </select>
+  <center><div id="placeholder" style="width:900px;height:550px"></div></center>
+<script type="text/javascript"> 
+$(function () {
+
+       var placeholder = $("#placeholder");
+ var data = [];
+    var options = {
+            xaxis: {
+            },
+            yaxis: {
+                tickFormatter: yformatter
+            },
+            grid: { hoverable: true, clickable: true, labelMargin: 32   },
+series: {
+      lines: { show: false },
+      points: { show: true }
+    }
+    };
+    
+    var plot = $.plot(placeholder, data, options);
+ 
+// fetch one series, adding to what we got
+    var alreadyFetched = {};
+    
+   $("#routeid").change(function () {
+   var select = $(this);
+        
+        // find the URL in the link right next to us 
+    //    var dataurl = button.siblings('a').attr('href');
+ var dataurl = "myway_timeliness_route.json.php?routeid=" + select.val();
+        // then fetch the data with jQuery
+        function onDataReceived(series) {
+            // extract the first coordinate pair so you can see that
+            // data is now an ordinary Javascript object
+            var firstcoordinate = '(' + series.data[0][0] + ', ' + series.data[0][1] + ')';
+ 
+      
+            // let's add it to our current data
+            if (!alreadyFetched[series.label]) {
+                alreadyFetched[series.label] = true;
+                data.push(series);
+            }
+            
+            // and plot all we got
+            $.plot(placeholder, data, options);
+         }
+        
+        $.ajax({
+            url: dataurl,
+            method: 'GET',
+            dataType: 'json',
+            success: onDataReceived
+        });
+    });
+ 
+
+ });
+
+
+
+function yformatter(v) {
+    if (Math.floor(v/60) < -9) return "";
+    return Math.abs(Math.floor(v/60)) + " min " + (v == 0 ? "" : (v >0 ? "early":"late"))
+}
+  function showTooltip(x, y, contents) {
+        $('<div id="tooltip">' + contents + '</div>').css( {
+            position: 'absolute',
+            display: 'none',
+            top: y + 5,
+            left: x + 5,
+            border: '1px solid #fdd',
+            padding: '2px',
+            'background-color': '#fee',
+            opacity: 0.80
+        }).appendTo("body").fadeIn(200);
+    }
+ 
+    var previousPoint = null;
+    $("#placeholder").bind("plothover", function (event, pos, item) {
+        $("#x").text(pos.x.toFixed(2));
+        $("#y").text(pos.y.toFixed(2));
+ 
+            if (item) {
+                if (previousPoint != item.dataIndex) {
+                    previousPoint = item.dataIndex;
+                    
+                    $("#tooltip").remove();
+                    var x = item.datapoint[0],
+                        y = item.datapoint[1].toFixed(2);
+                    
+                    showTooltip(item.pageX, item.pageY,
+                                item.series.label + " at stop_sequence "+ x +" = " + Math.abs(new Number(y/60).toFixed(2))+" minutes "+(y >0 ? "early":"late"));
+                }
+            }
+            else {
+                $("#tooltip").remove();
+                previousPoint = null;            
+            }
+    });
+
+</script> 
+

--- /dev/null
+++ b/labs/myway_timeliness_stop.json.php
@@ -1,1 +1,32 @@
+<?php
+include ('../include/common.inc.php');
+header('Content-Type: text/javascript; charset=utf8');
+// header('Access-Control-Allow-Origin: http://bus.lambdacomplex.org/');
+header('Access-Control-Max-Age: 3628800');
+header('Access-Control-Allow-Methods: GET, POST, PUT, DELETE');
+?>
+{
+    "label": "<?php echo $_REQUEST['stopid']; ?>",
+    "data": <?php
+   $query = "select * from myway_timingdeltas INNER JOIN myway_observations
+ON myway_observations.observation_id=myway_timingdeltas.observation_id
+   where myway_stop = :myway_stop
+   AND abs(timing_delta) < 2*(select stddev(timing_delta) from myway_timingdeltas)
+   order by myway_timingdeltas.time;";
+$query = $conn->prepare($query);
+$query->bindParam(':myway_stop', $_REQUEST['stopid'],PDO::PARAM_STR, 42);
+		
+$query->execute();
+if (!$query) {
+	databaseError($conn->errorInfo());
+	return Array();
+}
+foreach ($query->fetchAll() as $delta) {
+	$points[] = "[".((strtotime("00:00Z") + midnight_seconds(strtotime($delta['time'])))*1000).", {$delta['timing_delta']}]";
+};
+if (count($points) == 0) {
+    echo "[]"; }
+    else echo "[".implode(",",$points)."]";
+?>
+}
 

--- /dev/null
+++ b/labs/myway_timeliness_stop.php
@@ -1,1 +1,136 @@
+<?php
+include ('../include/common.inc.php');
+include_header("MyWay Deltas", "mywayDelta");
+?>
 
+    <!--[if lte IE 8]><script language="javascript" type="text/javascript" src="../js/flot/excanvas.min.js"></script><![endif]--> 
+ 
+    <script language="javascript" type="text/javascript" src="../js/flot/jquery.flot.js"></script> 
+   <form method="get" action="">
+    <select id="stopid" name="stopid">
+<?php
+$query = "select distinct myway_stop from myway_stops where myway_stop != '' order by myway_stop";
+$query = $conn->prepare($query);
+$query->execute();
+if (!$query) {
+	databaseError($conn->errorInfo());
+	return Array();
+}
+foreach ($query->fetchAll() as $stop) {
+           echo "<option value=\"{$stop['myway_stop']}\">{$stop['myway_stop']}</option>";
+  
+};
+?>    </select> <center><div id="placeholder" style="width:900px;height:550px"></div></center>
+<script type="text/javascript"> 
+$(function () {
+    var d = new Date();
+						d.setUTCMinutes(0);
+						d.setUTCHours(0);
+    var midnight = d.getTime();
+
+       var placeholder = $("#placeholder");
+ var data = [];
+    var options = {
+            xaxis: {
+                mode: "time",
+                min: midnight + (1000*60*60*8),
+                max: midnight + (1000*60*60*23.5)
+            },
+            yaxis: {
+                tickFormatter: yformatter
+            },
+            grid: { hoverable: true, clickable: true, labelMargin: 32   },
+ series: {
+      lines: { show: false },
+      points: { show: true }
+    }
+    };
+
+    var plot = $.plot(placeholder, data, options);
+        var o;
+    o = plot.pointOffset({ x: midnight+ (9*60*60*1000), y: -1.2});
+    placeholder.append('<div style="position:absolute;left:' + (o.left + 4) + 'px;top:' + o.top + 'px;color:#666;font-size:smaller">9am</div>');
+    o = plot.pointOffset({ x: midnight+ (16*60*60*1000), y: -1.2});
+    placeholder.append('<div style="position:absolute;left:' + (o.left + 4) + 'px;top:' + o.top + 'px;color:#666;font-size:smaller">4pm</div>');
+// fetch one series, adding to what we got
+    var alreadyFetched = {};
+    
+   $("#stopid").change(function () {
+   var select = $(this);
+        
+        // find the URL in the link right next to us 
+    //    var dataurl = button.siblings('a').attr('href');
+ var dataurl = "myway_timeliness_stop.json.php?stopid=" + select.val();
+        // then fetch the data with jQuery
+        function onDataReceived(series) {
+            // extract the first coordinate pair so you can see that
+            // data is now an ordinary Javascript object
+            var firstcoordinate = '(' + series.data[0][0] + ', ' + series.data[0][1] + ')';
+ 
+      
+            // let's add it to our current data
+            if (!alreadyFetched[series.label]) {
+                alreadyFetched[series.label] = true;
+                data.push(series);
+            }
+            
+            // and plot all we got
+            $.plot(placeholder, data, options);
+         }
+        
+        $.ajax({
+            url: dataurl,
+            method: 'GET',
+            dataType: 'json',
+            success: onDataReceived
+        });
+    });
+
+ });
+function yformatter(v) {
+    if (Math.floor(v/60) < -9) return "";
+    return Math.abs(Math.floor(v/60)) + " min " + (v == 0 ? "" : (v >0 ? "early":"late"))
+}
+  function showTooltip(x, y, contents) {
+        $('<div id="tooltip">' + contents + '</div>').css( {
+            position: 'absolute',
+            display: 'none',
+            top: y + 5,
+            left: x + 5,
+            border: '1px solid #fdd',
+            padding: '2px',
+            'background-color': '#fee',
+            opacity: 0.80
+        }).appendTo("body").fadeIn(200);
+    }
+ 
+    var previousPoint = null;
+    $("#placeholder").bind("plothover", function (event, pos, item) {
+        $("#x").text(pos.x.toFixed(2));
+        $("#y").text(pos.y.toFixed(2));
+ 
+            if (item) {
+                if (previousPoint != item.dataIndex) {
+                    previousPoint = item.dataIndex;
+                    
+                    $("#tooltip").remove();
+                    var x = item.datapoint[0].toFixed(2),
+                        y = item.datapoint[1].toFixed(2);
+                    
+                    var d = new Date();
+d.setTime(x);
+var time = d.getUTCHours() +':'+ (d.getUTCMinutes().toString().length == 1 ? '0'+ d.getMinutes():  d.getUTCMinutes())
+
+                    
+                    showTooltip(item.pageX, item.pageY,
+                                item.series.label + " at "+ time +" = " + Math.abs(new Number(y/60).toFixed(2))+" minutes "+(y >0 ? "early":"late"));
+                }
+            }
+            else {
+                $("#tooltip").remove();
+                previousPoint = null;            
+            }
+    });
+
+</script> 
+

--- a/labs/mywaybalance.php
+++ b/labs/mywaybalance.php
@@ -111,7 +111,11 @@
     </div>
     <div data-role="fieldcontain">
         <label for="contribute_myway">Contribute MyWay records to timeliness study? </label>
-        <input type="checkbox" name="contribute_myway" id="contribute_myway" checked="no"  />
+        <input type="checkbox" name="contribute_myway" id="contribute_myway" defaultChecked="no"  />
+    </div>
+    <div data-role="fieldcontain">
+        <label for="accept_warning">I accept that Transport for Canberra <a href="http://transport.act.gov.au/myway/protect.html">advise against the use of third party MyWay applications</a> </label>
+        <input type="checkbox" name="accept_warning" id="accept_warning" defaultChecked="no"  />
     </div>
         <input type="submit" value="Go!"></form>';
 }

file:a/labs/networkstats.php (deleted)
--- a/labs/networkstats.php
+++ /dev/null
@@ -1,147 +1,1 @@
-<?php
-include ('../include/common.inc.php');
-include_header("Route Statistics", "networkstats")
-?>
-<script type="text/javascript" src="../js/flotr/lib/prototype-1.6.0.2.js"></script>
 
-		<!--[if IE]>
-
-			<script type="text/javascript" src="../js/flotr/lib/excanvas.js"></script>
-
-			<script type="text/javascript" src="../js/flotr/lib/base64.js"></script>
-
-		<![endif]-->
-
-		<script type="text/javascript" src="../js/flotr/lib/canvas2image.js"></script>
-
-		<script type="text/javascript" src="../js/flotr/lib/canvastext.js"></script>
-
-		<script type="text/javascript" src="../js/flotr/flotr.debug-0.2.0-alpha_radar1.js"></script>
-		<form method="get" action="networkstats.php">
-			<select id="routeid" name="routeid">
-				<?php
-				foreach (getRoutes() as $route) {
-				echo "<option value=\"{$route['route_id']}\">{$route['route_short_name']} {$route['route_long_name']}</option>";
-				}
-				?>
-			</select>
-			<input type="submit" value="View"/>
-		</form>
-
-<?php
-// middle of graph = 6am
-$adjustFactor = 0;
-$route = getRoute($routeid);
-echo "<h1>{$route['route_short_name']} {$route['route_long_name']}</h1>";
-foreach (getRouteTrips($routeid) as $key => $trip) {
-	$dLabel[$key] = $trip['arrival_time'];
-	if ($key == 0) {
-		$time = strtotime($trip['arrival_time']);
-		$adjustFactor = (date("G", $time) * 3600);
-	}
-	$tripStops = viaPoints($trip['trip_id']);
-	foreach ($tripStops as $i => $stop) {
-		if ($key == 0) {
-			$dTicks[$i] = $stop['stop_name'];
-		}
-		$time = strtotime($stop['arrival_time']);
-		$d[$key][$i] = 	(date("G", $time) * 3600) + (date("i", $time) * 60) + date("s", $time) - $adjustFactor;
-
-	}
-}
-
-?>
-<div id="container" style="width:100%;height:900px;"></div>
-<script type="text/javascript">
-
-			/**
-
-			 * Wait till dom's finished loading.
-
-			 */
-
-			document.observe('dom:loaded', function(){
-
-				/**
-
-				 * Fill series d1 and d2.
-
-				 */
-<?php
-foreach ($d as $key => $dataseries) {
-	
-	echo "var d$key =[";
-	foreach ($dataseries as $i => $datapoint) {
-		echo "[$i, $datapoint],";
-	}
-	echo "];\n";
-}
-
-?>
-
-			    
-
-			    var f = Flotr.draw($('container'), 
-
-					[
-						<?php
-foreach ($d as $key => $dataseries) {
-	
-	echo '{data:d'.$key.", label:'{$dLabel[$key]}'".', radar:{fill:false}},'."\n";
-	
-}
-
-?>
-					 ],
-
-					{defaultType: 'radar',
-
-					 radarChartMode: true,
-
-					 HtmlText: false,
-
-					 fontSize: 9,
-
-					 xaxis:{
-
-						ticks: [
-							<?php
-foreach ($dTicks as $key => $tickName) {
-		echo '['.$key.', "'.$tickName.'"],';
-}
-
-?>
-							
-							]},
-
-					 mouse:{ // Setup point tracking
-
-						track: true,
-
-						lineColor: 'black',
-
-						relative: true,
-
-						sensibility: 70,
-
-						trackFormatter: function(obj){
-						var d = new Date();
-						d.setMinutes(0);
-						d.setHours(0);
-d.setTime(d.getTime() + Math.floor(obj.radarData*1000) + <?php echo $adjustFactor*1000 ?>);
-return d.getHours() +':'+ (d.getMinutes().toString().length == 1 ? '0'+ d.getMinutes():  d.getMinutes());
-}}});
-
-			});
-
-		</script>
-
-	    </div>
-	    
-
-
-<?php
-include_footer()
-?>
-        
-

--- /dev/null
+++ b/labs/servicealert_editor.php
@@ -1,1 +1,190 @@
+<?php
+include ('../include/common.inc.php');
+auth();
+include_header("Service Alert Editor", "serviceAlertEditor");
+/**
+ * Currently support:
+ * network inform
+ * stop remove: trip patch, route inform
+ * - stop search
+ * street inform: route inform, trip inform, stop inform
+ * - street search
+ * trip remove: route patch, stop inform 
+ * - trip search by route
+ */
+if (isset($_REQUEST['saveedit'])) {
+    
+    if ($_REQUEST['saveedit'] != "") updateServiceAlert($_REQUEST['saveedit'], $_REQUEST['startdate'], $_REQUEST['enddate'], $_REQUEST['description'], $_REQUEST['url']);
+    else addServiceAlert($_REQUEST['startdate'], $_REQUEST['enddate'], $_REQUEST['description'], $_REQUEST['url']);
+     echo "Saved " . $_REQUEST['saveedit'];
+     die();
+     } 
+if ($_REQUEST['delete']) {
+    $deleteParts = explode(";", $_REQUEST['delete']);
+     deleteInformedAlert($deleteParts[0], $deleteParts[1], $deleteParts[2]);
+     echo "Deleted network inform for {$deleteParts[0]} ({$deleteParts[1]},{$deleteParts[2]})<br>\n";
+     die();
+     } 
+if ($_REQUEST['networkinform']) {
+    addInformedAlert($_REQUEST['networkinform'], "network", "network", "inform");
+     echo "Added network inform for" . $_REQUEST['networkinform'];
+     die();
+     } 
+if ($_REQUEST['stopsearch']) {
+    addInformedAlert($_REQUEST['stopsearch'], "stop", $_REQUEST['stopid'], "remove");
+     echo "Added stop remove for" . $_REQUEST['stopsearch'] . ", stop" . $_REQUEST['stopid'] . "<br>\n";
+    
+     foreach ($service_periods as $sp) {
+        echo "Patching $sp trips<br>\n";
+         foreach (getStopTrips($_REQUEST['stopid'], $sp) as $trip) {
+            addInformedAlert($_REQUEST['stopsearch'], "trip", $trip['trip_id'], "patch");
+             echo "Added trip patch for" . $_REQUEST['stopsearch'] . ", trip" . $trip['trip_id'] . "<br>\n";
+            
+             } 
+        echo "Informing $sp routes<br>\n";
+         foreach (getStopRoutes($_REQUEST['stopid'], $sp) as $route) {
+            addInformedAlert($_REQUEST['stopsearch'], "route", $route['route_id'], "inform");
+             echo "Added route inform for" . $_REQUEST['stopsearch'] . ", route" . $route['route_id'] . "<br>\n";
+             } 
+        } 
+    die();
+     } 
+if ($_REQUEST['routesearch']) {
+    echo "Informing route<br>\n";
+     $stops = Array();
+     echo "Informing trips<br>\n";
+     foreach(getRouteTrips() as $trip) {
+        addInformedAlert($_REQUEST['stopsearch'], "trip", $trip['trip_id'], "patch");
+         echo "Added trip patch for" . $_REQUEST['stopsearch'] . ", trip" . $trip['trip_id'] . "<br>\n";
+         viaPoints($tripID, "", false);
+         } 
+    
+    echo "Informing stops<br>\n";
+     foreach($stops as $stop) {
+        addInformedAlert($_REQUEST['stopsearch'], "stop", $_REQUEST['stopid'], "remove");
+         echo "Added stop remove for" . $_REQUEST['stopsearch'] . ", stop" . $_REQUEST['stopid'] . "<br>\n";
+         } 
+    die();
+     } 
+if ($_REQUEST['streetsearch']) {
+    
+    echo "Informing stops<br>\n";
+     foreach(getStopByName() as $stop) {
+        addInformedAlert($_REQUEST['stopsearch'], "stop", $_REQUEST['stopid'], "remove");
+         echo "Added stop inform for" . $_REQUEST['stopsearch'] . ", stop" . $_REQUEST['stopid'] . "<br>\n";
+        
+         foreach ($service_periods as $sp) {
+            echo "Patching $sp trips<br>\n";
+             foreach (getStopTrips($_REQUEST['stopid'], $sp) as $trip) {
+                addInformedAlert($_REQUEST['stopsearch'], "trip", $trip['trip_id'], "patch");
+                 echo "Added trip inform for" . $_REQUEST['stopsearch'] . ", trip" . $trip['trip_id'] . "<br>\n";
+                
+                 } 
+            echo "Informing $sp routes<br>\n";
+             foreach (getStopRoutes($_REQUEST['stopid'], $sp) as $route) {
+                addInformedAlert($_REQUEST['stopsearch'], "route", $route['route_id'], "inform");
+                 echo "Added route inform for" . $_REQUEST['stopsearch'] . ", route" . $route['route_id'] . "<br>\n";
+                
+                
+                 } 
+            } 
+        die();
+         } 
+    } 
+?>
+Active and Future Alerts:
+<table>
+<?php
+foreach(getFutureAlerts() as $alert) {
+    echo "<tr><td>{$alert['start']}</td><td>{$alert['end']}</td><td>" . substr($alert['description'], 0, 999) . '</td><td><a href="?edit=' . $alert['id'] . '">edit</a></td></tr>';
+     } 
 
+?>
+</table>
+<?php
+$alert = getServiceAlert($_REQUEST['edit']);
+
+?>
+<form action="<?php echo basename(__FILE__) ;
+?>" method="get">
+
+    <div data-role="fieldcontain">
+        <label for="startdate"> Start Date</label>
+        <input type="text" name="startdate" id="startdate" value="<?php
+ if ($alert['start']) echo $alert['start'];
+ else echo date("c", strtotime("0:00"));
+ ?>"  />
+    </div>
+        <div data-role="fieldcontain">
+        <label for="enddate"> End Date </label>
+        <input type="text" name="enddate" id="enddate" value="<?php
+ if ($alert['end']) echo $alert['end'];
+ else echo date("c", strtotime("23:59"));
+?>"  />
+    </div>
+        <div data-role="fieldcontain">
+        <label for="description">Description</label>
+        <textarea name="description">
+<?php echo $alert['description'];
+?></textarea>
+    </div>
+        <div data-role="fieldcontain">
+        <label for="url">URL</label>
+        <input type="text" name="url" id="url" value="<?php echo $alert['url'];
+?>"  />
+    </div>
+        <input type="hidden" name="saveedit" value="<?php echo $_REQUEST['edit'];
+?>"/>
+        <input type="submit" value="Save"/>
+                </div></form>
+
+<?php
+if ($_REQUEST['edit']) {
+    echo "Informed Entities for ID {$_REQUEST['edit']}:";
+     echo '<table>';
+     foreach(getInformedAlerts($_REQUEST['edit'], "", "") as $informed) {
+        echo "<tr><td>{$informed['informed_class']}</td><td>{$informed['informed_id']}</td><td>{$informed['informed_action']}" . '</td><td><a href="?delete=' . $_REQUEST['edit'] . ';' . $informed['informed_class'] . ';' . $informed['informed_id'] . '">delete</a></td></tr>';
+         } 
+    echo '</table>';
+     ?>
+<form action="<?php echo basename(__FILE__) ;
+     ?>" method="get">
+        <input type="hidden" name="networkinform" value="<?php echo $_REQUEST['edit'];
+     ?>"/>
+        <input type="submit" value="Add Network Inform"/>
+                </form>
+                <form action="<?php echo basename(__FILE__) ;
+     ?>" method="get">
+                <div data-role="fieldcontain">
+        <label for="stopid">StopID</label>
+        <input type="text" name="stopid" />
+    </div>
+        <input type="hidden" name="stopsearch" value="<?php echo $_REQUEST['edit'];
+     ?>"/>
+        <input type="submit" value="Stop Search"/>
+                </form>
+<form action="<?php echo basename(__FILE__) ;
+     ?>" method="get">
+<div data-role="fieldcontain">
+        <label for="street">Street</label>
+        <input type="text" name="street" />
+    </div>
+        <input type="hidden" name="streetsearch" value="<?php echo $_REQUEST['edit'];
+     ?>"/>
+        <input type="submit" value="Street Search"/>
+                </form>
+                <form action="<?php echo basename(__FILE__) ;
+     ?>" method="get">
+                <div data-role="fieldcontain">
+        <label for="routeid">routeID</label>
+        <input type="text" name="routeid" />
+    </div>
+        <input type="hidden" name="routesearch" value="<?php echo $_REQUEST['edit'];
+     ?>"/>
+        <input type="submit" value="Route Search"/>
+                </form>
+<?php
+    
+     } 
+include_footer();
+?>

--- /dev/null
+++ b/labs/travelAllRoutes.php
@@ -1,1 +1,23 @@
+<?php
+include ('../include/common.inc.php');
+	$query = "Select route_short_name,max(route_id) as route_id from routes where route_short_name NOT LIKE '7__'  AND route_short_name != '170' AND route_short_name NOT LIKE '9__' group by route_short_name order by route_short_name ;";
+	debug($query, "database");
+	$query = $conn->prepare($query);
+	$query->execute();
+echo "<table><tr><th>Route Number</th><th>First Trip Start</th><th>First Trip End</th><th>Length</th>";
+$total = 0;
+$count = 0;
+foreach($query->fetchAll() as $r) {
+        $trips = getRouteTrips($r['route_id']);
+    $startTime = $trips[0]['arrival_time'];
+    $endTime = getTripEndTime($trips[0]['trip_id']);
+    $timeDiff = strtotime($endTime) - strtotime($startTime);
+    $total += $timeDiff;
+    $count ++;
+    echo "<tr><td>{$r['route_short_name']}</td><td>$startTime</td><td>$endTime</td><td>$timeDiff seconds ie. ". ($timeDiff/60). " minutes</td></tr>";
 
+}
+echo "</table>";
+echo "Total time: $total seconds ie. " .($total/60/60). " hours<br>";
+echo "$count Routes";
+?>

--- /dev/null
+++ b/lib/openid-php/Auth/OpenID.php
@@ -1,1 +1,564 @@
-
+<?php
+
+/**
+ * This is the PHP OpenID library by JanRain, Inc.
+ *
+ * This module contains core utility functionality used by the
+ * library.  See Consumer.php and Server.php for the consumer and
+ * server implementations.
+ *
+ * PHP versions 4 and 5
+ *
+ * LICENSE: See the COPYING file included in this distribution.
+ *
+ * @package OpenID
+ * @author JanRain, Inc. <openid@janrain.com>
+ * @copyright 2005-2008 Janrain, Inc.
+ * @license http://www.apache.org/licenses/LICENSE-2.0 Apache
+ */
+
+/**
+ * The library version string
+ */
+define('Auth_OpenID_VERSION', '2.2.2');
+
+/**
+ * Require the fetcher code.
+ */
+require_once "Auth/Yadis/PlainHTTPFetcher.php";
+require_once "Auth/Yadis/ParanoidHTTPFetcher.php";
+require_once "Auth/OpenID/BigMath.php";
+require_once "Auth/OpenID/URINorm.php";
+
+/**
+ * Status code returned by the server when the only option is to show
+ * an error page, since we do not have enough information to redirect
+ * back to the consumer. The associated value is an error message that
+ * should be displayed on an HTML error page.
+ *
+ * @see Auth_OpenID_Server
+ */
+define('Auth_OpenID_LOCAL_ERROR', 'local_error');
+
+/**
+ * Status code returned when there is an error to return in key-value
+ * form to the consumer. The caller should return a 400 Bad Request
+ * response with content-type text/plain and the value as the body.
+ *
+ * @see Auth_OpenID_Server
+ */
+define('Auth_OpenID_REMOTE_ERROR', 'remote_error');
+
+/**
+ * Status code returned when there is a key-value form OK response to
+ * the consumer. The value associated with this code is the
+ * response. The caller should return a 200 OK response with
+ * content-type text/plain and the value as the body.
+ *
+ * @see Auth_OpenID_Server
+ */
+define('Auth_OpenID_REMOTE_OK', 'remote_ok');
+
+/**
+ * Status code returned when there is a redirect back to the
+ * consumer. The value is the URL to redirect back to. The caller
+ * should return a 302 Found redirect with a Location: header
+ * containing the URL.
+ *
+ * @see Auth_OpenID_Server
+ */
+define('Auth_OpenID_REDIRECT', 'redirect');
+
+/**
+ * Status code returned when the caller needs to authenticate the
+ * user. The associated value is a {@link Auth_OpenID_ServerRequest}
+ * object that can be used to complete the authentication. If the user
+ * has taken some authentication action, use the retry() method of the
+ * {@link Auth_OpenID_ServerRequest} object to complete the request.
+ *
+ * @see Auth_OpenID_Server
+ */
+define('Auth_OpenID_DO_AUTH', 'do_auth');
+
+/**
+ * Status code returned when there were no OpenID arguments
+ * passed. This code indicates that the caller should return a 200 OK
+ * response and display an HTML page that says that this is an OpenID
+ * server endpoint.
+ *
+ * @see Auth_OpenID_Server
+ */
+define('Auth_OpenID_DO_ABOUT', 'do_about');
+
+/**
+ * Defines for regexes and format checking.
+ */
+define('Auth_OpenID_letters',
+       "abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ");
+
+define('Auth_OpenID_digits',
+       "0123456789");
+
+define('Auth_OpenID_punct',
+       "!\"#$%&'()*+,-./:;<=>?@[\\]^_`{|}~");
+
+Auth_OpenID_include_init();
+
+/**
+ * The OpenID utility function class.
+ *
+ * @package OpenID
+ * @access private
+ */
+class Auth_OpenID {
+
+    /**
+     * Return true if $thing is an Auth_OpenID_FailureResponse object;
+     * false if not.
+     *
+     * @access private
+     */
+    static function isFailure($thing)
+    {
+        return is_a($thing, 'Auth_OpenID_FailureResponse');
+    }
+
+    /**
+     * Gets the query data from the server environment based on the
+     * request method used.  If GET was used, this looks at
+     * $_SERVER['QUERY_STRING'] directly.  If POST was used, this
+     * fetches data from the special php://input file stream.
+     *
+     * Returns an associative array of the query arguments.
+     *
+     * Skips invalid key/value pairs (i.e. keys with no '=value'
+     * portion).
+     *
+     * Returns an empty array if neither GET nor POST was used, or if
+     * POST was used but php://input cannot be opened.
+     *
+     * See background:
+     * http://lists.openidenabled.com/pipermail/dev/2007-March/000395.html
+     *
+     * @access private
+     */
+    static function getQuery($query_str=null)
+    {
+        $data = array();
+
+        if ($query_str !== null) {
+            $data = Auth_OpenID::params_from_string($query_str);
+        } else if (!array_key_exists('REQUEST_METHOD', $_SERVER)) {
+            // Do nothing.
+        } else {
+          // XXX HACK FIXME HORRIBLE.
+          //
+          // POSTing to a URL with query parameters is acceptable, but
+          // we don't have a clean way to distinguish those parameters
+          // when we need to do things like return_to verification
+          // which only want to look at one kind of parameter.  We're
+          // going to emulate the behavior of some other environments
+          // by defaulting to GET and overwriting with POST if POST
+          // data is available.
+          $data = Auth_OpenID::params_from_string($_SERVER['QUERY_STRING']);
+
+          if ($_SERVER['REQUEST_METHOD'] == 'POST') {
+            $str = file_get_contents('php://input');
+
+            if ($str === false) {
+              $post = array();
+            } else {
+              $post = Auth_OpenID::params_from_string($str);
+            }
+
+            $data = array_merge($data, $post);
+          }
+        }
+
+        return $data;
+    }
+
+    static function params_from_string($str)
+    {
+        $chunks = explode("&", $str);
+
+        $data = array();
+        foreach ($chunks as $chunk) {
+            $parts = explode("=", $chunk, 2);
+
+            if (count($parts) != 2) {
+                continue;
+            }
+
+            list($k, $v) = $parts;
+            $data[urldecode($k)] = urldecode($v);
+        }
+
+        return $data;
+    }
+
+    /**
+     * Create dir_name as a directory if it does not exist. If it
+     * exists, make sure that it is, in fact, a directory.  Returns
+     * true if the operation succeeded; false if not.
+     *
+     * @access private
+     */
+    static function ensureDir($dir_name)
+    {
+        if (is_dir($dir_name) || @mkdir($dir_name)) {
+            return true;
+        } else {
+            $parent_dir = dirname($dir_name);
+
+            // Terminal case; there is no parent directory to create.
+            if ($parent_dir == $dir_name) {
+                return true;
+            }
+
+            return (Auth_OpenID::ensureDir($parent_dir) && @mkdir($dir_name));
+        }
+    }
+
+    /**
+     * Adds a string prefix to all values of an array.  Returns a new
+     * array containing the prefixed values.
+     *
+     * @access private
+     */
+    static function addPrefix($values, $prefix)
+    {
+        $new_values = array();
+        foreach ($values as $s) {
+            $new_values[] = $prefix . $s;
+        }
+        return $new_values;
+    }
+
+    /**
+     * Convenience function for getting array values.  Given an array
+     * $arr and a key $key, get the corresponding value from the array
+     * or return $default if the key is absent.
+     *
+     * @access private
+     */
+    static function arrayGet($arr, $key, $fallback = null)
+    {
+        if (is_array($arr)) {
+            if (array_key_exists($key, $arr)) {
+                return $arr[$key];
+            } else {
+                return $fallback;
+            }
+        } else {
+            trigger_error("Auth_OpenID::arrayGet (key = ".$key.") expected " .
+                          "array as first parameter, got " .
+                          gettype($arr), E_USER_WARNING);
+
+            return false;
+        }
+    }
+
+    /**
+     * Replacement for PHP's broken parse_str.
+     */
+    static function parse_str($query)
+    {
+        if ($query === null) {
+            return null;
+        }
+
+        $parts = explode('&', $query);
+
+        $new_parts = array();
+        for ($i = 0; $i < count($parts); $i++) {
+            $pair = explode('=', $parts[$i]);
+
+            if (count($pair) != 2) {
+                continue;
+            }
+
+            list($key, $value) = $pair;
+            $new_parts[urldecode($key)] = urldecode($value);
+        }
+
+        return $new_parts;
+    }
+
+    /**
+     * Implements the PHP 5 'http_build_query' functionality.
+     *
+     * @access private
+     * @param array $data Either an array key/value pairs or an array
+     * of arrays, each of which holding two values: a key and a value,
+     * sequentially.
+     * @return string $result The result of url-encoding the key/value
+     * pairs from $data into a URL query string
+     * (e.g. "username=bob&id=56").
+     */
+    static function httpBuildQuery($data)
+    {
+        $pairs = array();
+        foreach ($data as $key => $value) {
+            if (is_array($value)) {
+                $pairs[] = urlencode($value[0])."=".urlencode($value[1]);
+            } else {
+                $pairs[] = urlencode($key)."=".urlencode($value);
+            }
+        }
+        return implode("&", $pairs);
+    }
+
+    /**
+     * "Appends" query arguments onto a URL.  The URL may or may not
+     * already have arguments (following a question mark).
+     *
+     * @access private
+     * @param string $url A URL, which may or may not already have
+     * arguments.
+     * @param array $args Either an array key/value pairs or an array of
+     * arrays, each of which holding two values: a key and a value,
+     * sequentially.  If $args is an ordinary key/value array, the
+     * parameters will be added to the URL in sorted alphabetical order;
+     * if $args is an array of arrays, their order will be preserved.
+     * @return string $url The original URL with the new parameters added.
+     *
+     */
+    static function appendArgs($url, $args)
+    {
+        if (count($args) == 0) {
+            return $url;
+        }
+
+        // Non-empty array; if it is an array of arrays, use
+        // multisort; otherwise use sort.
+        if (array_key_exists(0, $args) &&
+            is_array($args[0])) {
+            // Do nothing here.
+        } else {
+            $keys = array_keys($args);
+            sort($keys);
+            $new_args = array();
+            foreach ($keys as $key) {
+                $new_args[] = array($key, $args[$key]);
+            }
+            $args = $new_args;
+        }
+
+        $sep = '?';
+        if (strpos($url, '?') !== false) {
+            $sep = '&';
+        }
+
+        return $url . $sep . Auth_OpenID::httpBuildQuery($args);
+    }
+
+    /**
+     * Implements python's urlunparse, which is not available in PHP.
+     * Given the specified components of a URL, this function rebuilds
+     * and returns the URL.
+     *
+     * @access private
+     * @param string $scheme The scheme (e.g. 'http').  Defaults to 'http'.
+     * @param string $host The host.  Required.
+     * @param string $port The port.
+     * @param string $path The path.
+     * @param string $query The query.
+     * @param string $fragment The fragment.
+     * @return string $url The URL resulting from assembling the
+     * specified components.
+     */
+    static function urlunparse($scheme, $host, $port = null, $path = '/',
+                        $query = '', $fragment = '')
+    {
+
+        if (!$scheme) {
+            $scheme = 'http';
+        }
+
+        if (!$host) {
+            return false;
+        }
+
+        if (!$path) {
+            $path = '';
+        }
+
+        $result = $scheme . "://" . $host;
+
+        if ($port) {
+            $result .= ":" . $port;
+        }
+
+        $result .= $path;
+
+        if ($query) {
+            $result .= "?" . $query;
+        }
+
+        if ($fragment) {
+            $result .= "#" . $fragment;
+        }
+
+        return $result;
+    }
+
+    /**
+     * Given a URL, this "normalizes" it by adding a trailing slash
+     * and / or a leading http:// scheme where necessary.  Returns
+     * null if the original URL is malformed and cannot be normalized.
+     *
+     * @access private
+     * @param string $url The URL to be normalized.
+     * @return mixed $new_url The URL after normalization, or null if
+     * $url was malformed.
+     */
+    static function normalizeUrl($url)
+    {
+        @$parsed = parse_url($url);
+
+        if (!$parsed) {
+            return null;
+        }
+
+        if (isset($parsed['scheme']) &&
+            isset($parsed['host'])) {
+            $scheme = strtolower($parsed['scheme']);
+            if (!in_array($scheme, array('http', 'https'))) {
+                return null;
+            }
+        } else {
+            $url = 'http://' . $url;
+        }
+
+        $normalized = Auth_OpenID_urinorm($url);
+        if ($normalized === null) {
+            return null;
+        }
+        list($defragged, $frag) = Auth_OpenID::urldefrag($normalized);
+        return $defragged;
+    }
+
+    /**
+     * Replacement (wrapper) for PHP's intval() because it's broken.
+     *
+     * @access private
+     */
+    static function intval($value)
+    {
+        $re = "/^\\d+$/";
+
+        if (!preg_match($re, $value)) {
+            return false;
+        }
+
+        return intval($value);
+    }
+
+    /**
+     * Count the number of bytes in a string independently of
+     * multibyte support conditions.
+     *
+     * @param string $str The string of bytes to count.
+     * @return int The number of bytes in $str.
+     */
+    static function bytes($str)
+    {
+        return strlen(bin2hex($str)) / 2;
+    }
+
+    /**
+     * Get the bytes in a string independently of multibyte support
+     * conditions.
+     */
+    static function toBytes($str)
+    {
+        $hex = bin2hex($str);
+
+        if (!$hex) {
+            return array();
+        }
+
+        $b = array();
+        for ($i = 0; $i < strlen($hex); $i += 2) {
+            $b[] = chr(base_convert(substr($hex, $i, 2), 16, 10));
+        }
+
+        return $b;
+    }
+
+    static function urldefrag($url)
+    {
+        $parts = explode("#", $url, 2);
+
+        if (count($parts) == 1) {
+            return array($parts[0], "");
+        } else {
+            return $parts;
+        }
+    }
+
+    static function filter($callback, &$sequence)
+    {
+        $result = array();
+
+        foreach ($sequence as $item) {
+            if (call_user_func_array($callback, array($item))) {
+                $result[] = $item;
+            }
+        }
+
+        return $result;
+    }
+
+    static function update(&$dest, &$src)
+    {
+        foreach ($src as $k => $v) {
+            $dest[$k] = $v;
+        }
+    }
+
+    /**
+     * Wrap PHP's standard error_log functionality.  Use this to
+     * perform all logging. It will interpolate any additional
+     * arguments into the format string before logging.
+     *
+     * @param string $format_string The sprintf format for the message
+     */
+    static function log($format_string)
+    {
+        $args = func_get_args();
+        $message = call_user_func_array('sprintf', $args);
+        error_log($message);
+    }
+
+    static function autoSubmitHTML($form, $title="OpenId transaction in progress")
+    {
+        return("<html>".
+               "<head><title>".
+               $title .
+               "</title></head>".
+               "<body onload='document.forms[0].submit();'>".
+               $form .
+               "<script>".
+               "var elements = document.forms[0].elements;".
+               "for (var i = 0; i < elements.length; i++) {".
+               "  elements[i].style.display = \"none\";".
+               "}".
+               "</script>".
+               "</body>".
+               "</html>");
+    }
+}
+
+/*
+ * Function to run when this file is included.
+ * Abstracted to a function to make life easier
+ * for some PHP optimizers.
+ */
+function Auth_OpenID_include_init() {
+  if (Auth_OpenID_getMathLib() === null) {
+    Auth_OpenID_setNoMathSupport();
+  }
+}
+

--- /dev/null
+++ b/lib/openid-php/Auth/OpenID/AX.php
@@ -1,1 +1,1023 @@
-
+<?php
+
+/**
+ * Implements the OpenID attribute exchange specification, version 1.0
+ * as of svn revision 370 from openid.net svn.
+ *
+ * @package OpenID
+ */
+
+/**
+ * Require utility classes and functions for the consumer.
+ */
+require_once "Auth/OpenID/Extension.php";
+require_once "Auth/OpenID/Message.php";
+require_once "Auth/OpenID/TrustRoot.php";
+
+define('Auth_OpenID_AX_NS_URI',
+       'http://openid.net/srv/ax/1.0');
+
+// Use this as the 'count' value for an attribute in a FetchRequest to
+// ask for as many values as the OP can provide.
+define('Auth_OpenID_AX_UNLIMITED_VALUES', 'unlimited');
+
+// Minimum supported alias length in characters.  Here for
+// completeness.
+define('Auth_OpenID_AX_MINIMUM_SUPPORTED_ALIAS_LENGTH', 32);
+
+/**
+ * AX utility class.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_AX {
+    /**
+     * @param mixed $thing Any object which may be an
+     * Auth_OpenID_AX_Error object.
+     *
+     * @return bool true if $thing is an Auth_OpenID_AX_Error; false
+     * if not.
+     */
+    static function isError($thing)
+    {
+        return is_a($thing, 'Auth_OpenID_AX_Error');
+    }
+}
+
+/**
+ * Check an alias for invalid characters; raise AXError if any are
+ * found.  Return None if the alias is valid.
+ */
+function Auth_OpenID_AX_checkAlias($alias)
+{
+  if (strpos($alias, ',') !== false) {
+      return new Auth_OpenID_AX_Error(sprintf(
+                   "Alias %s must not contain comma", $alias));
+  }
+  if (strpos($alias, '.') !== false) {
+      return new Auth_OpenID_AX_Error(sprintf(
+                   "Alias %s must not contain period", $alias));
+  }
+
+  return true;
+}
+
+/**
+ * Results from data that does not meet the attribute exchange 1.0
+ * specification
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_AX_Error {
+    function Auth_OpenID_AX_Error($message=null)
+    {
+        $this->message = $message;
+    }
+}
+
+/**
+ * Abstract class containing common code for attribute exchange
+ * messages.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_AX_Message extends Auth_OpenID_Extension {
+    /**
+     * ns_alias: The preferred namespace alias for attribute exchange
+     * messages
+     */
+    var $ns_alias = 'ax';
+
+    /**
+     * mode: The type of this attribute exchange message. This must be
+     * overridden in subclasses.
+     */
+    var $mode = null;
+
+    var $ns_uri = Auth_OpenID_AX_NS_URI;
+
+    /**
+     * Return Auth_OpenID_AX_Error if the mode in the attribute
+     * exchange arguments does not match what is expected for this
+     * class; true otherwise.
+     *
+     * @access private
+     */
+    function _checkMode($ax_args)
+    {
+        $mode = Auth_OpenID::arrayGet($ax_args, 'mode');
+        if ($mode != $this->mode) {
+            return new Auth_OpenID_AX_Error(
+                            sprintf(
+                                    "Expected mode '%s'; got '%s'",
+                                    $this->mode, $mode));
+        }
+
+        return true;
+    }
+
+    /**
+     * Return a set of attribute exchange arguments containing the
+     * basic information that must be in every attribute exchange
+     * message.
+     *
+     * @access private
+     */
+    function _newArgs()
+    {
+        return array('mode' => $this->mode);
+    }
+}
+
+/**
+ * Represents a single attribute in an attribute exchange
+ * request. This should be added to an AXRequest object in order to
+ * request the attribute.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_AX_AttrInfo {
+    /**
+     * Construct an attribute information object.  Do not call this
+     * directly; call make(...) instead.
+     *
+     * @param string $type_uri The type URI for this attribute.
+     *
+     * @param int $count The number of values of this type to request.
+     *
+     * @param bool $required Whether the attribute will be marked as
+     * required in the request.
+     *
+     * @param string $alias The name that should be given to this
+     * attribute in the request.
+     */
+    function Auth_OpenID_AX_AttrInfo($type_uri, $count, $required,
+                                     $alias)
+    {
+        /**
+         * required: Whether the attribute will be marked as required
+         * when presented to the subject of the attribute exchange
+         * request.
+         */
+        $this->required = $required;
+
+        /**
+         * count: How many values of this type to request from the
+         * subject. Defaults to one.
+         */
+        $this->count = $count;
+
+        /**
+         * type_uri: The identifier that determines what the attribute
+         * represents and how it is serialized. For example, one type
+         * URI representing dates could represent a Unix timestamp in
+         * base 10 and another could represent a human-readable
+         * string.
+         */
+        $this->type_uri = $type_uri;
+
+        /**
+         * alias: The name that should be given to this attribute in
+         * the request. If it is not supplied, a generic name will be
+         * assigned. For example, if you want to call a Unix timestamp
+         * value 'tstamp', set its alias to that value. If two
+         * attributes in the same message request to use the same
+         * alias, the request will fail to be generated.
+         */
+        $this->alias = $alias;
+    }
+
+    /**
+     * Construct an attribute information object.  For parameter
+     * details, see the constructor.
+     */
+    static function make($type_uri, $count=1, $required=false,
+                  $alias=null)
+    {
+        if ($alias !== null) {
+            $result = Auth_OpenID_AX_checkAlias($alias);
+
+            if (Auth_OpenID_AX::isError($result)) {
+                return $result;
+            }
+        }
+
+        return new Auth_OpenID_AX_AttrInfo($type_uri, $count, $required,
+                                           $alias);
+    }
+
+    /**
+     * When processing a request for this attribute, the OP should
+     * call this method to determine whether all available attribute
+     * values were requested.  If self.count == UNLIMITED_VALUES, this
+     * returns True.  Otherwise this returns False, in which case
+     * self.count is an integer.
+    */
+    function wantsUnlimitedValues()
+    {
+        return $this->count === Auth_OpenID_AX_UNLIMITED_VALUES;
+    }
+}
+
+/**
+ * Given a namespace mapping and a string containing a comma-separated
+ * list of namespace aliases, return a list of type URIs that
+ * correspond to those aliases.
+ *
+ * @param $namespace_map The mapping from namespace URI to alias
+ * @param $alias_list_s The string containing the comma-separated
+ * list of aliases. May also be None for convenience.
+ *
+ * @return $seq The list of namespace URIs that corresponds to the
+ * supplied list of aliases. If the string was zero-length or None, an
+ * empty list will be returned.
+ *
+ * return null If an alias is present in the list of aliases but
+ * is not present in the namespace map.
+ */
+function Auth_OpenID_AX_toTypeURIs($namespace_map, $alias_list_s)
+{
+    $uris = array();
+
+    if ($alias_list_s) {
+        foreach (explode(',', $alias_list_s) as $alias) {
+            $type_uri = $namespace_map->getNamespaceURI($alias);
+            if ($type_uri === null) {
+                // raise KeyError(
+                // 'No type is defined for attribute name %r' % (alias,))
+                return new Auth_OpenID_AX_Error(
+                  sprintf('No type is defined for attribute name %s',
+                          $alias)
+                  );
+            } else {
+                $uris[] = $type_uri;
+            }
+        }
+    }
+
+    return $uris;
+}
+
+/**
+ * An attribute exchange 'fetch_request' message. This message is sent
+ * by a relying party when it wishes to obtain attributes about the
+ * subject of an OpenID authentication request.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_AX_FetchRequest extends Auth_OpenID_AX_Message {
+
+    var $mode = 'fetch_request';
+
+    function Auth_OpenID_AX_FetchRequest($update_url=null)
+    {
+        /**
+         * requested_attributes: The attributes that have been
+         * requested thus far, indexed by the type URI.
+         */
+        $this->requested_attributes = array();
+
+        /**
+         * update_url: A URL that will accept responses for this
+         * attribute exchange request, even in the absence of the user
+         * who made this request.
+        */
+        $this->update_url = $update_url;
+    }
+
+    /**
+     * Add an attribute to this attribute exchange request.
+     *
+     * @param attribute: The attribute that is being requested
+     * @return true on success, false when the requested attribute is
+     * already present in this fetch request.
+     */
+    function add($attribute)
+    {
+        if ($this->contains($attribute->type_uri)) {
+            return new Auth_OpenID_AX_Error(
+              sprintf("The attribute %s has already been requested",
+                      $attribute->type_uri));
+        }
+
+        $this->requested_attributes[$attribute->type_uri] = $attribute;
+
+        return true;
+    }
+
+    /**
+     * Get the serialized form of this attribute fetch request.
+     *
+     * @returns Auth_OpenID_AX_FetchRequest The fetch request message parameters
+     */
+    function getExtensionArgs()
+    {
+        $aliases = new Auth_OpenID_NamespaceMap();
+
+        $required = array();
+        $if_available = array();
+
+        $ax_args = $this->_newArgs();
+
+        foreach ($this->requested_attributes as $type_uri => $attribute) {
+            if ($attribute->alias === null) {
+                $alias = $aliases->add($type_uri);
+            } else {
+                $alias = $aliases->addAlias($type_uri, $attribute->alias);
+
+                if ($alias === null) {
+                    return new Auth_OpenID_AX_Error(
+                      sprintf("Could not add alias %s for URI %s",
+                              $attribute->alias, $type_uri
+                      ));
+                }
+            }
+
+            if ($attribute->required) {
+                $required[] = $alias;
+            } else {
+                $if_available[] = $alias;
+            }
+
+            if ($attribute->count != 1) {
+                $ax_args['count.' . $alias] = strval($attribute->count);
+            }
+
+            $ax_args['type.' . $alias] = $type_uri;
+        }
+
+        if ($required) {
+            $ax_args['required'] = implode(',', $required);
+        }
+
+        if ($if_available) {
+            $ax_args['if_available'] = implode(',', $if_available);
+        }
+
+        return $ax_args;
+    }
+
+    /**
+     * Get the type URIs for all attributes that have been marked as
+     * required.
+     *
+     * @return A list of the type URIs for attributes that have been
+     * marked as required.
+     */
+    function getRequiredAttrs()
+    {
+        $required = array();
+        foreach ($this->requested_attributes as $type_uri => $attribute) {
+            if ($attribute->required) {
+                $required[] = $type_uri;
+            }
+        }
+
+        return $required;
+    }
+
+    /**
+     * Extract a FetchRequest from an OpenID message
+     *
+     * @param request: The OpenID request containing the attribute
+     * fetch request
+     *
+     * @returns mixed An Auth_OpenID_AX_Error or the
+     * Auth_OpenID_AX_FetchRequest extracted from the request message if
+     * successful
+     */
+    static function fromOpenIDRequest($request)
+    {
+        $m = $request->message;
+        $obj = new Auth_OpenID_AX_FetchRequest();
+        $ax_args = $m->getArgs($obj->ns_uri);
+
+        $result = $obj->parseExtensionArgs($ax_args);
+
+        if (Auth_OpenID_AX::isError($result)) {
+            return $result;
+        }
+
+        if ($obj->update_url) {
+            // Update URL must match the openid.realm of the
+            // underlying OpenID 2 message.
+            $realm = $m->getArg(Auth_OpenID_OPENID_NS, 'realm',
+                        $m->getArg(
+                                  Auth_OpenID_OPENID_NS,
+                                  'return_to'));
+
+            if (!$realm) {
+                $obj = new Auth_OpenID_AX_Error(
+                  sprintf("Cannot validate update_url %s " .
+                          "against absent realm", $obj->update_url));
+            } else if (!Auth_OpenID_TrustRoot::match($realm,
+                                                     $obj->update_url)) {
+                $obj = new Auth_OpenID_AX_Error(
+                  sprintf("Update URL %s failed validation against realm %s",
+                          $obj->update_url, $realm));
+            }
+        }
+
+        return $obj;
+    }
+
+    /**
+     * Given attribute exchange arguments, populate this FetchRequest.
+     *
+     * @return $result Auth_OpenID_AX_Error if the data to be parsed
+     * does not follow the attribute exchange specification. At least
+     * when 'if_available' or 'required' is not specified for a
+     * particular attribute type.  Returns true otherwise.
+    */
+    function parseExtensionArgs($ax_args)
+    {
+        $result = $this->_checkMode($ax_args);
+        if (Auth_OpenID_AX::isError($result)) {
+            return $result;
+        }
+
+        $aliases = new Auth_OpenID_NamespaceMap();
+
+        foreach ($ax_args as $key => $value) {
+            if (strpos($key, 'type.') === 0) {
+                $alias = substr($key, 5);
+                $type_uri = $value;
+
+                $alias = $aliases->addAlias($type_uri, $alias);
+
+                if ($alias === null) {
+                    return new Auth_OpenID_AX_Error(
+                      sprintf("Could not add alias %s for URI %s",
+                              $alias, $type_uri)
+                      );
+                }
+
+                $count_s = Auth_OpenID::arrayGet($ax_args, 'count.' . $alias);
+                if ($count_s) {
+                    $count = Auth_OpenID::intval($count_s);
+                    if (($count === false) &&
+                        ($count_s === Auth_OpenID_AX_UNLIMITED_VALUES)) {
+                        $count = $count_s;
+                    }
+                } else {
+                    $count = 1;
+                }
+
+                if ($count === false) {
+                    return new Auth_OpenID_AX_Error(
+                      sprintf("Integer value expected for %s, got %s",
+                              'count.' . $alias, $count_s));
+                }
+
+                $attrinfo = Auth_OpenID_AX_AttrInfo::make($type_uri, $count,
+                                                          false, $alias);
+
+                if (Auth_OpenID_AX::isError($attrinfo)) {
+                    return $attrinfo;
+                }
+
+                $this->add($attrinfo);
+            }
+        }
+
+        $required = Auth_OpenID_AX_toTypeURIs($aliases,
+                         Auth_OpenID::arrayGet($ax_args, 'required'));
+
+        foreach ($required as $type_uri) {
+            $attrib = $this->requested_attributes[$type_uri];
+            $attrib->required = true;
+        }
+
+        $if_available = Auth_OpenID_AX_toTypeURIs($aliases,
+                             Auth_OpenID::arrayGet($ax_args, 'if_available'));
+
+        $all_type_uris = array_merge($required, $if_available);
+
+        foreach ($aliases->iterNamespaceURIs() as $type_uri) {
+            if (!in_array($type_uri, $all_type_uris)) {
+                return new Auth_OpenID_AX_Error(
+                  sprintf('Type URI %s was in the request but not ' .
+                          'present in "required" or "if_available"',
+                          $type_uri));
+
+            }
+        }
+
+        $this->update_url = Auth_OpenID::arrayGet($ax_args, 'update_url');
+
+        return true;
+    }
+
+    /**
+     * Iterate over the AttrInfo objects that are contained in this
+     * fetch_request.
+     */
+    function iterAttrs()
+    {
+        return array_values($this->requested_attributes);
+    }
+
+    function iterTypes()
+    {
+        return array_keys($this->requested_attributes);
+    }
+
+    /**
+     * Is the given type URI present in this fetch_request?
+     */
+    function contains($type_uri)
+    {
+        return in_array($type_uri, $this->iterTypes());
+    }
+}
+
+/**
+ * An abstract class that implements a message that has attribute keys
+ * and values. It contains the common code between fetch_response and
+ * store_request.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_AX_KeyValueMessage extends Auth_OpenID_AX_Message {
+
+    function Auth_OpenID_AX_KeyValueMessage()
+    {
+        $this->data = array();
+    }
+
+    /**
+     * Add a single value for the given attribute type to the
+     * message. If there are already values specified for this type,
+     * this value will be sent in addition to the values already
+     * specified.
+     *
+     * @param type_uri: The URI for the attribute
+     * @param value: The value to add to the response to the relying
+     * party for this attribute
+     * @return null
+     */
+    function addValue($type_uri, $value)
+    {
+        if (!array_key_exists($type_uri, $this->data)) {
+            $this->data[$type_uri] = array();
+        }
+
+        $values =& $this->data[$type_uri];
+        $values[] = $value;
+    }
+
+    /**
+     * Set the values for the given attribute type. This replaces any
+     * values that have already been set for this attribute.
+     *
+     * @param type_uri: The URI for the attribute
+     * @param values: A list of values to send for this attribute.
+     */
+    function setValues($type_uri, &$values)
+    {
+        $this->data[$type_uri] =& $values;
+    }
+
+    /**
+     * Get the extension arguments for the key/value pairs contained
+     * in this message.
+     *
+     * @param aliases: An alias mapping. Set to None if you don't care
+     * about the aliases for this request.
+     *
+     * @access private
+     */
+    function _getExtensionKVArgs($aliases)
+    {
+        if ($aliases === null) {
+            $aliases = new Auth_OpenID_NamespaceMap();
+        }
+
+        $ax_args = array();
+
+        foreach ($this->data as $type_uri => $values) {
+            $alias = $aliases->add($type_uri);
+
+            $ax_args['type.' . $alias] = $type_uri;
+            $ax_args['count.' . $alias] = strval(count($values));
+
+            foreach ($values as $i => $value) {
+              $key = sprintf('value.%s.%d', $alias, $i + 1);
+              $ax_args[$key] = $value;
+            }
+        }
+
+        return $ax_args;
+    }
+
+    /**
+     * Parse attribute exchange key/value arguments into this object.
+     *
+     * @param ax_args: The attribute exchange fetch_response
+     * arguments, with namespacing removed.
+     *
+     * @return Auth_OpenID_AX_Error or true
+     */
+    function parseExtensionArgs($ax_args)
+    {
+        $result = $this->_checkMode($ax_args);
+        if (Auth_OpenID_AX::isError($result)) {
+            return $result;
+        }
+
+        $aliases = new Auth_OpenID_NamespaceMap();
+
+        foreach ($ax_args as $key => $value) {
+            if (strpos($key, 'type.') === 0) {
+                $type_uri = $value;
+                $alias = substr($key, 5);
+
+                $result = Auth_OpenID_AX_checkAlias($alias);
+
+                if (Auth_OpenID_AX::isError($result)) {
+                    return $result;
+                }
+
+                $alias = $aliases->addAlias($type_uri, $alias);
+
+                if ($alias === null) {
+                    return new Auth_OpenID_AX_Error(
+                      sprintf("Could not add alias %s for URI %s",
+                              $alias, $type_uri)
+                      );
+                }
+            }
+        }
+
+        foreach ($aliases->iteritems() as $pair) {
+            list($type_uri, $alias) = $pair;
+
+            if (array_key_exists('count.' . $alias, $ax_args) && ($ax_args['count.' . $alias] !== Auth_OpenID_AX_UNLIMITED_VALUES)) {
+
+                $count_key = 'count.' . $alias;
+                $count_s = $ax_args[$count_key];
+
+                $count = Auth_OpenID::intval($count_s);
+
+                if ($count === false) {
+                    return new Auth_OpenID_AX_Error(
+                      sprintf("Integer value expected for %s, got %s",
+                              'count. %s' . $alias, $count_s,
+                              Auth_OpenID_AX_UNLIMITED_VALUES)
+                                                    );
+                }
+
+                $values = array();
+                for ($i = 1; $i < $count + 1; $i++) {
+                    $value_key = sprintf('value.%s.%d', $alias, $i);
+
+                    if (!array_key_exists($value_key, $ax_args)) {
+                      return new Auth_OpenID_AX_Error(
+                        sprintf(
+                                "No value found for key %s",
+                                $value_key));
+                    }
+
+                    $value = $ax_args[$value_key];
+                    $values[] = $value;
+                }
+            } else {
+                $key = 'value.' . $alias;
+
+                if (!array_key_exists($key, $ax_args)) {
+                  return new Auth_OpenID_AX_Error(
+                    sprintf(
+                            "No value found for key %s",
+                            $key));
+                }
+
+                $value = $ax_args['value.' . $alias];
+
+                if ($value == '') {
+                    $values = array();
+                } else {
+                    $values = array($value);
+                }
+            }
+
+            $this->data[$type_uri] = $values;
+        }
+
+        return true;
+    }
+
+    /**
+     * Get a single value for an attribute. If no value was sent for
+     * this attribute, use the supplied default. If there is more than
+     * one value for this attribute, this method will fail.
+     *
+     * @param type_uri: The URI for the attribute
+     * @param default: The value to return if the attribute was not
+     * sent in the fetch_response.
+     *
+     * @return $value Auth_OpenID_AX_Error on failure or the value of
+     * the attribute in the fetch_response message, or the default
+     * supplied
+     */
+    function getSingle($type_uri, $default=null)
+    {
+        $values = Auth_OpenID::arrayGet($this->data, $type_uri);
+        if (!$values) {
+            return $default;
+        } else if (count($values) == 1) {
+            return $values[0];
+        } else {
+            return new Auth_OpenID_AX_Error(
+              sprintf('More than one value present for %s',
+                      $type_uri)
+              );
+        }
+    }
+
+    /**
+     * Get the list of values for this attribute in the
+     * fetch_response.
+     *
+     * XXX: what to do if the values are not present? default
+     * parameter? this is funny because it's always supposed to return
+     * a list, so the default may break that, though it's provided by
+     * the user's code, so it might be okay. If no default is
+     * supplied, should the return be None or []?
+     *
+     * @param type_uri: The URI of the attribute
+     *
+     * @return $values The list of values for this attribute in the
+     * response. May be an empty list.  If the attribute was not sent
+     * in the response, returns Auth_OpenID_AX_Error.
+     */
+    function get($type_uri)
+    {
+        if (array_key_exists($type_uri, $this->data)) {
+            return $this->data[$type_uri];
+        } else {
+            return new Auth_OpenID_AX_Error(
+              sprintf("Type URI %s not found in response",
+                      $type_uri)
+              );
+        }
+    }
+
+    /**
+     * Get the number of responses for a particular attribute in this
+     * fetch_response message.
+     *
+     * @param type_uri: The URI of the attribute
+     *
+     * @returns int The number of values sent for this attribute.  If
+     * the attribute was not sent in the response, returns
+     * Auth_OpenID_AX_Error.
+     */
+    function count($type_uri)
+    {
+        if (array_key_exists($type_uri, $this->data)) {
+            return count($this->get($type_uri));
+        } else {
+            return new Auth_OpenID_AX_Error(
+              sprintf("Type URI %s not found in response",
+                      $type_uri)
+              );
+        }
+    }
+}
+
+/**
+ * A fetch_response attribute exchange message.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_AX_FetchResponse extends Auth_OpenID_AX_KeyValueMessage {
+    var $mode = 'fetch_response';
+
+    function Auth_OpenID_AX_FetchResponse($update_url=null)
+    {
+        $this->Auth_OpenID_AX_KeyValueMessage();
+        $this->update_url = $update_url;
+    }
+
+    /**
+     * Serialize this object into arguments in the attribute exchange
+     * namespace
+     *
+     * @return $args The dictionary of unqualified attribute exchange
+     * arguments that represent this fetch_response, or
+     * Auth_OpenID_AX_Error on error.
+     */
+    function getExtensionArgs($request=null)
+    {
+        $aliases = new Auth_OpenID_NamespaceMap();
+
+        $zero_value_types = array();
+
+        if ($request !== null) {
+            // Validate the data in the context of the request (the
+            // same attributes should be present in each, and the
+            // counts in the response must be no more than the counts
+            // in the request)
+
+            foreach ($this->data as $type_uri => $unused) {
+                if (!$request->contains($type_uri)) {
+                    return new Auth_OpenID_AX_Error(
+                      sprintf("Response attribute not present in request: %s",
+                              $type_uri)
+                      );
+                }
+            }
+
+            foreach ($request->iterAttrs() as $attr_info) {
+                // Copy the aliases from the request so that reading
+                // the response in light of the request is easier
+                if ($attr_info->alias === null) {
+                    $aliases->add($attr_info->type_uri);
+                } else {
+                    $alias = $aliases->addAlias($attr_info->type_uri,
+                                                $attr_info->alias);
+
+                    if ($alias === null) {
+                        return new Auth_OpenID_AX_Error(
+                          sprintf("Could not add alias %s for URI %s",
+                                  $attr_info->alias, $attr_info->type_uri)
+                          );
+                    }
+                }
+
+                if (array_key_exists($attr_info->type_uri, $this->data)) {
+                    $values = $this->data[$attr_info->type_uri];
+                } else {
+                    $values = array();
+                    $zero_value_types[] = $attr_info;
+                }
+
+                if (($attr_info->count != Auth_OpenID_AX_UNLIMITED_VALUES) &&
+                    ($attr_info->count < count($values))) {
+                    return new Auth_OpenID_AX_Error(
+                      sprintf("More than the number of requested values " .
+                              "were specified for %s",
+                              $attr_info->type_uri)
+                      );
+                }
+            }
+        }
+
+        $kv_args = $this->_getExtensionKVArgs($aliases);
+
+        // Add the KV args into the response with the args that are
+        // unique to the fetch_response
+        $ax_args = $this->_newArgs();
+
+        // For each requested attribute, put its type/alias and count
+        // into the response even if no data were returned.
+        foreach ($zero_value_types as $attr_info) {
+            $alias = $aliases->getAlias($attr_info->type_uri);
+            $kv_args['type.' . $alias] = $attr_info->type_uri;
+            $kv_args['count.' . $alias] = '0';
+        }
+
+        $update_url = null;
+        if ($request) {
+            $update_url = $request->update_url;
+        } else {
+            $update_url = $this->update_url;
+        }
+
+        if ($update_url) {
+            $ax_args['update_url'] = $update_url;
+        }
+
+        Auth_OpenID::update($ax_args, $kv_args);
+
+        return $ax_args;
+    }
+
+    /**
+     * @return $result Auth_OpenID_AX_Error on failure or true on
+     * success.
+     */
+    function parseExtensionArgs($ax_args)
+    {
+        $result = parent::parseExtensionArgs($ax_args);
+
+        if (Auth_OpenID_AX::isError($result)) {
+            return $result;
+        }
+
+        $this->update_url = Auth_OpenID::arrayGet($ax_args, 'update_url');
+
+        return true;
+    }
+
+    /**
+     * Construct a FetchResponse object from an OpenID library
+     * SuccessResponse object.
+     *
+     * @param success_response: A successful id_res response object
+     *
+     * @param signed: Whether non-signed args should be processsed. If
+     * True (the default), only signed arguments will be processsed.
+     *
+     * @return $response A FetchResponse containing the data from the
+     * OpenID message
+     */
+    static function fromSuccessResponse($success_response, $signed=true)
+    {
+        $obj = new Auth_OpenID_AX_FetchResponse();
+        if ($signed) {
+            $ax_args = $success_response->getSignedNS($obj->ns_uri);
+        } else {
+            $ax_args = $success_response->message->getArgs($obj->ns_uri);
+        }
+        if ($ax_args === null || Auth_OpenID::isFailure($ax_args) ||
+              sizeof($ax_args) == 0) {
+            return null;
+        }
+
+        $result = $obj->parseExtensionArgs($ax_args);
+        if (Auth_OpenID_AX::isError($result)) {
+            #XXX log me
+            return null;
+        }
+        return $obj;
+    }
+}
+
+/**
+ * A store request attribute exchange message representation.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_AX_StoreRequest extends Auth_OpenID_AX_KeyValueMessage {
+    var $mode = 'store_request';
+
+    /**
+     * @param array $aliases The namespace aliases to use when making
+     * this store response. Leave as None to use defaults.
+     */
+    function getExtensionArgs($aliases=null)
+    {
+        $ax_args = $this->_newArgs();
+        $kv_args = $this->_getExtensionKVArgs($aliases);
+        Auth_OpenID::update($ax_args, $kv_args);
+        return $ax_args;
+    }
+}
+
+/**
+ * An indication that the store request was processed along with this
+ * OpenID transaction.  Use make(), NOT the constructor, to create
+ * response objects.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_AX_StoreResponse extends Auth_OpenID_AX_Message {
+    var $SUCCESS_MODE = 'store_response_success';
+    var $FAILURE_MODE = 'store_response_failure';
+
+    /**
+     * Returns Auth_OpenID_AX_Error on error or an
+     * Auth_OpenID_AX_StoreResponse object on success.
+     */
+    function make($succeeded=true, $error_message=null)
+    {
+        if (($succeeded) && ($error_message !== null)) {
+            return new Auth_OpenID_AX_Error('An error message may only be '.
+                                    'included in a failing fetch response');
+        }
+
+        return new Auth_OpenID_AX_StoreResponse($succeeded, $error_message);
+    }
+
+    function Auth_OpenID_AX_StoreResponse($succeeded=true, $error_message=null)
+    {
+        if ($succeeded) {
+            $this->mode = $this->SUCCESS_MODE;
+        } else {
+            $this->mode = $this->FAILURE_MODE;
+        }
+
+        $this->error_message = $error_message;
+    }
+
+    /**
+     * Was this response a success response?
+     */
+    function succeeded()
+    {
+        return $this->mode == $this->SUCCESS_MODE;
+    }
+
+    function getExtensionArgs()
+    {
+        $ax_args = $this->_newArgs();
+        if ((!$this->succeeded()) && $this->error_message) {
+            $ax_args['error'] = $this->error_message;
+        }
+
+        return $ax_args;
+    }
+}
+
+

--- /dev/null
+++ b/lib/openid-php/Auth/OpenID/Association.php
@@ -1,1 +1,611 @@
-
+<?php
+
+/**
+ * This module contains code for dealing with associations between
+ * consumers and servers.
+ *
+ * PHP versions 4 and 5
+ *
+ * LICENSE: See the COPYING file included in this distribution.
+ *
+ * @package OpenID
+ * @author JanRain, Inc. <openid@janrain.com>
+ * @copyright 2005-2008 Janrain, Inc.
+ * @license http://www.apache.org/licenses/LICENSE-2.0 Apache
+ */
+
+/**
+ * @access private
+ */
+require_once 'Auth/OpenID/CryptUtil.php';
+
+/**
+ * @access private
+ */
+require_once 'Auth/OpenID/KVForm.php';
+
+/**
+ * @access private
+ */
+require_once 'Auth/OpenID/HMAC.php';
+
+/**
+ * This class represents an association between a server and a
+ * consumer.  In general, users of this library will never see
+ * instances of this object.  The only exception is if you implement a
+ * custom {@link Auth_OpenID_OpenIDStore}.
+ *
+ * If you do implement such a store, it will need to store the values
+ * of the handle, secret, issued, lifetime, and assoc_type instance
+ * variables.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_Association {
+
+    /**
+     * This is a HMAC-SHA1 specific value.
+     *
+     * @access private
+     */
+    var $SIG_LENGTH = 20;
+
+    /**
+     * The ordering and name of keys as stored by serialize.
+     *
+     * @access private
+     */
+    var $assoc_keys = array(
+                            'version',
+                            'handle',
+                            'secret',
+                            'issued',
+                            'lifetime',
+                            'assoc_type'
+                            );
+
+    var $_macs = array(
+                       'HMAC-SHA1' => 'Auth_OpenID_HMACSHA1',
+                       'HMAC-SHA256' => 'Auth_OpenID_HMACSHA256'
+                       );
+
+    /**
+     * This is an alternate constructor (factory method) used by the
+     * OpenID consumer library to create associations.  OpenID store
+     * implementations shouldn't use this constructor.
+     *
+     * @access private
+     *
+     * @param integer $expires_in This is the amount of time this
+     * association is good for, measured in seconds since the
+     * association was issued.
+     *
+     * @param string $handle This is the handle the server gave this
+     * association.
+     *
+     * @param string secret This is the shared secret the server
+     * generated for this association.
+     *
+     * @param assoc_type This is the type of association this
+     * instance represents.  The only valid values of this field at
+     * this time is 'HMAC-SHA1' and 'HMAC-SHA256', but new types may
+     * be defined in the future.
+     *
+     * @return association An {@link Auth_OpenID_Association}
+     * instance.
+     */
+    static function fromExpiresIn($expires_in, $handle, $secret, $assoc_type)
+    {
+        $issued = time();
+        $lifetime = $expires_in;
+        return new Auth_OpenID_Association($handle, $secret,
+                                           $issued, $lifetime, $assoc_type);
+    }
+
+    /**
+     * This is the standard constructor for creating an association.
+     * The library should create all of the necessary associations, so
+     * this constructor is not part of the external API.
+     *
+     * @access private
+     *
+     * @param string $handle This is the handle the server gave this
+     * association.
+     *
+     * @param string $secret This is the shared secret the server
+     * generated for this association.
+     *
+     * @param integer $issued This is the time this association was
+     * issued, in seconds since 00:00 GMT, January 1, 1970.  (ie, a
+     * unix timestamp)
+     *
+     * @param integer $lifetime This is the amount of time this
+     * association is good for, measured in seconds since the
+     * association was issued.
+     *
+     * @param string $assoc_type This is the type of association this
+     * instance represents.  The only valid values of this field at
+     * this time is 'HMAC-SHA1' and 'HMAC-SHA256', but new types may
+     * be defined in the future.
+     */
+    function Auth_OpenID_Association(
+        $handle, $secret, $issued, $lifetime, $assoc_type)
+    {
+        if (!in_array($assoc_type,
+                      Auth_OpenID_getSupportedAssociationTypes(), true)) {
+            $fmt = 'Unsupported association type (%s)';
+            trigger_error(sprintf($fmt, $assoc_type), E_USER_ERROR);
+        }
+
+        $this->handle = $handle;
+        $this->secret = $secret;
+        $this->issued = $issued;
+        $this->lifetime = $lifetime;
+        $this->assoc_type = $assoc_type;
+    }
+
+    /**
+     * This returns the number of seconds this association is still
+     * valid for, or 0 if the association is no longer valid.
+     *
+     * @return integer $seconds The number of seconds this association
+     * is still valid for, or 0 if the association is no longer valid.
+     */
+    function getExpiresIn($now = null)
+    {
+        if ($now == null) {
+            $now = time();
+        }
+
+        return max(0, $this->issued + $this->lifetime - $now);
+    }
+
+    /**
+     * This checks to see if two {@link Auth_OpenID_Association}
+     * instances represent the same association.
+     *
+     * @return bool $result true if the two instances represent the
+     * same association, false otherwise.
+     */
+    function equal($other)
+    {
+        return ((gettype($this) == gettype($other))
+                && ($this->handle == $other->handle)
+                && ($this->secret == $other->secret)
+                && ($this->issued == $other->issued)
+                && ($this->lifetime == $other->lifetime)
+                && ($this->assoc_type == $other->assoc_type));
+    }
+
+    /**
+     * Convert an association to KV form.
+     *
+     * @return string $result String in KV form suitable for
+     * deserialization by deserialize.
+     */
+    function serialize()
+    {
+        $data = array(
+                     'version' => '2',
+                     'handle' => $this->handle,
+                     'secret' => base64_encode($this->secret),
+                     'issued' => strval(intval($this->issued)),
+                     'lifetime' => strval(intval($this->lifetime)),
+                     'assoc_type' => $this->assoc_type
+                     );
+
+        assert(array_keys($data) == $this->assoc_keys);
+
+        return Auth_OpenID_KVForm::fromArray($data, $strict = true);
+    }
+
+    /**
+     * Parse an association as stored by serialize().  This is the
+     * inverse of serialize.
+     *
+     * @param string $assoc_s Association as serialized by serialize()
+     * @return Auth_OpenID_Association $result instance of this class
+     */
+    static function deserialize($class_name, $assoc_s)
+    {
+        $pairs = Auth_OpenID_KVForm::toArray($assoc_s, $strict = true);
+        $keys = array();
+        $values = array();
+        foreach ($pairs as $key => $value) {
+            if (is_array($value)) {
+                list($key, $value) = $value;
+            }
+            $keys[] = $key;
+            $values[] = $value;
+        }
+
+        $class_vars = get_class_vars($class_name);
+        $class_assoc_keys = $class_vars['assoc_keys'];
+
+        sort($keys);
+        sort($class_assoc_keys);
+
+        if ($keys != $class_assoc_keys) {
+            trigger_error('Unexpected key values: ' . var_export($keys, true),
+                          E_USER_WARNING);
+            return null;
+        }
+
+        $version = $pairs['version'];
+        $handle = $pairs['handle'];
+        $secret = $pairs['secret'];
+        $issued = $pairs['issued'];
+        $lifetime = $pairs['lifetime'];
+        $assoc_type = $pairs['assoc_type'];
+
+        if ($version != '2') {
+            trigger_error('Unknown version: ' . $version, E_USER_WARNING);
+            return null;
+        }
+
+        $issued = intval($issued);
+        $lifetime = intval($lifetime);
+        $secret = base64_decode($secret);
+
+        return new $class_name(
+            $handle, $secret, $issued, $lifetime, $assoc_type);
+    }
+
+    /**
+     * Generate a signature for a sequence of (key, value) pairs
+     *
+     * @access private
+     * @param array $pairs The pairs to sign, in order.  This is an
+     * array of two-tuples.
+     * @return string $signature The binary signature of this sequence
+     * of pairs
+     */
+    function sign($pairs)
+    {
+        $kv = Auth_OpenID_KVForm::fromArray($pairs);
+
+        /* Invalid association types should be caught at constructor */
+        $callback = $this->_macs[$this->assoc_type];
+
+        return call_user_func_array($callback, array($this->secret, $kv));
+    }
+
+    /**
+     * Generate a signature for some fields in a dictionary
+     *
+     * @access private
+     * @param array $fields The fields to sign, in order; this is an
+     * array of strings.
+     * @param array $data Dictionary of values to sign (an array of
+     * string => string pairs).
+     * @return string $signature The signature, base64 encoded
+     */
+    function signMessage($message)
+    {
+        if ($message->hasKey(Auth_OpenID_OPENID_NS, 'sig') ||
+            $message->hasKey(Auth_OpenID_OPENID_NS, 'signed')) {
+            // Already has a sig
+            return null;
+        }
+
+        $extant_handle = $message->getArg(Auth_OpenID_OPENID_NS,
+                                          'assoc_handle');
+
+        if ($extant_handle && ($extant_handle != $this->handle)) {
+            // raise ValueError("Message has a different association handle")
+            return null;
+        }
+
+        $signed_message = $message;
+        $signed_message->setArg(Auth_OpenID_OPENID_NS, 'assoc_handle',
+                                $this->handle);
+
+        $message_keys = array_keys($signed_message->toPostArgs());
+        $signed_list = array();
+        $signed_prefix = 'openid.';
+
+        foreach ($message_keys as $k) {
+            if (strpos($k, $signed_prefix) === 0) {
+                $signed_list[] = substr($k, strlen($signed_prefix));
+            }
+        }
+
+        $signed_list[] = 'signed';
+        sort($signed_list);
+
+        $signed_message->setArg(Auth_OpenID_OPENID_NS, 'signed',
+                                implode(',', $signed_list));
+        $sig = $this->getMessageSignature($signed_message);
+        $signed_message->setArg(Auth_OpenID_OPENID_NS, 'sig', $sig);
+        return $signed_message;
+    }
+
+    /**
+     * Given a {@link Auth_OpenID_Message}, return the key/value pairs
+     * to be signed according to the signed list in the message.  If
+     * the message lacks a signed list, return null.
+     *
+     * @access private
+     */
+    function _makePairs($message)
+    {
+        $signed = $message->getArg(Auth_OpenID_OPENID_NS, 'signed');
+        if (!$signed || Auth_OpenID::isFailure($signed)) {
+            // raise ValueError('Message has no signed list: %s' % (message,))
+            return null;
+        }
+
+        $signed_list = explode(',', $signed);
+        $pairs = array();
+        $data = $message->toPostArgs();
+        foreach ($signed_list as $field) {
+            $pairs[] = array($field, Auth_OpenID::arrayGet($data,
+                                                           'openid.' .
+                                                           $field, ''));
+        }
+        return $pairs;
+    }
+
+    /**
+     * Given an {@link Auth_OpenID_Message}, return the signature for
+     * the signed list in the message.
+     *
+     * @access private
+     */
+    function getMessageSignature($message)
+    {
+        $pairs = $this->_makePairs($message);
+        return base64_encode($this->sign($pairs));
+    }
+
+    /**
+     * Confirm that the signature of these fields matches the
+     * signature contained in the data.
+     *
+     * @access private
+     */
+    function checkMessageSignature($message)
+    {
+        $sig = $message->getArg(Auth_OpenID_OPENID_NS,
+                                'sig');
+
+        if (!$sig || Auth_OpenID::isFailure($sig)) {
+            return false;
+        }
+
+        $calculated_sig = $this->getMessageSignature($message);
+        return Auth_OpenID_CryptUtil::constEq($calculated_sig, $sig);
+    }
+}
+
+function Auth_OpenID_getSecretSize($assoc_type)
+{
+    if ($assoc_type == 'HMAC-SHA1') {
+        return 20;
+    } else if ($assoc_type == 'HMAC-SHA256') {
+        return 32;
+    } else {
+        return null;
+    }
+}
+
+function Auth_OpenID_getAllAssociationTypes()
+{
+    return array('HMAC-SHA1', 'HMAC-SHA256');
+}
+
+function Auth_OpenID_getSupportedAssociationTypes()
+{
+    $a = array('HMAC-SHA1');
+
+    if (Auth_OpenID_HMACSHA256_SUPPORTED) {
+        $a[] = 'HMAC-SHA256';
+    }
+
+    return $a;
+}
+
+function Auth_OpenID_getSessionTypes($assoc_type)
+{
+    $assoc_to_session = array(
+       'HMAC-SHA1' => array('DH-SHA1', 'no-encryption'));
+
+    if (Auth_OpenID_HMACSHA256_SUPPORTED) {
+        $assoc_to_session['HMAC-SHA256'] =
+            array('DH-SHA256', 'no-encryption');
+    }
+
+    return Auth_OpenID::arrayGet($assoc_to_session, $assoc_type, array());
+}
+
+function Auth_OpenID_checkSessionType($assoc_type, $session_type)
+{
+    if (!in_array($session_type,
+                  Auth_OpenID_getSessionTypes($assoc_type))) {
+        return false;
+    }
+
+    return true;
+}
+
+function Auth_OpenID_getDefaultAssociationOrder()
+{
+    $order = array();
+
+    if (!Auth_OpenID_noMathSupport()) {
+        $order[] = array('HMAC-SHA1', 'DH-SHA1');
+
+        if (Auth_OpenID_HMACSHA256_SUPPORTED) {
+            $order[] = array('HMAC-SHA256', 'DH-SHA256');
+        }
+    }
+
+    $order[] = array('HMAC-SHA1', 'no-encryption');
+
+    if (Auth_OpenID_HMACSHA256_SUPPORTED) {
+        $order[] = array('HMAC-SHA256', 'no-encryption');
+    }
+
+    return $order;
+}
+
+function Auth_OpenID_getOnlyEncryptedOrder()
+{
+    $result = array();
+
+    foreach (Auth_OpenID_getDefaultAssociationOrder() as $pair) {
+        list($assoc, $session) = $pair;
+
+        if ($session != 'no-encryption') {
+            if (Auth_OpenID_HMACSHA256_SUPPORTED &&
+                ($assoc == 'HMAC-SHA256')) {
+                $result[] = $pair;
+            } else if ($assoc != 'HMAC-SHA256') {
+                $result[] = $pair;
+            }
+        }
+    }
+
+    return $result;
+}
+
+function Auth_OpenID_getDefaultNegotiator()
+{
+    return new Auth_OpenID_SessionNegotiator(
+                 Auth_OpenID_getDefaultAssociationOrder());
+}
+
+function Auth_OpenID_getEncryptedNegotiator()
+{
+    return new Auth_OpenID_SessionNegotiator(
+                 Auth_OpenID_getOnlyEncryptedOrder());
+}
+
+/**
+ * A session negotiator controls the allowed and preferred association
+ * types and association session types. Both the {@link
+ * Auth_OpenID_Consumer} and {@link Auth_OpenID_Server} use
+ * negotiators when creating associations.
+ *
+ * You can create and use negotiators if you:
+
+ * - Do not want to do Diffie-Hellman key exchange because you use
+ * transport-layer encryption (e.g. SSL)
+ *
+ * - Want to use only SHA-256 associations
+ *
+ * - Do not want to support plain-text associations over a non-secure
+ * channel
+ *
+ * It is up to you to set a policy for what kinds of associations to
+ * accept. By default, the library will make any kind of association
+ * that is allowed in the OpenID 2.0 specification.
+ *
+ * Use of negotiators in the library
+ * =================================
+ *
+ * When a consumer makes an association request, it calls {@link
+ * getAllowedType} to get the preferred association type and
+ * association session type.
+ *
+ * The server gets a request for a particular association/session type
+ * and calls {@link isAllowed} to determine if it should create an
+ * association. If it is supported, negotiation is complete. If it is
+ * not, the server calls {@link getAllowedType} to get an allowed
+ * association type to return to the consumer.
+ *
+ * If the consumer gets an error response indicating that the
+ * requested association/session type is not supported by the server
+ * that contains an assocation/session type to try, it calls {@link
+ * isAllowed} to determine if it should try again with the given
+ * combination of association/session type.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_SessionNegotiator {
+    function Auth_OpenID_SessionNegotiator($allowed_types)
+    {
+        $this->allowed_types = array();
+        $this->setAllowedTypes($allowed_types);
+    }
+
+    /**
+     * Set the allowed association types, checking to make sure each
+     * combination is valid.
+     *
+     * @access private
+     */
+    function setAllowedTypes($allowed_types)
+    {
+        foreach ($allowed_types as $pair) {
+            list($assoc_type, $session_type) = $pair;
+            if (!Auth_OpenID_checkSessionType($assoc_type, $session_type)) {
+                return false;
+            }
+        }
+
+        $this->allowed_types = $allowed_types;
+        return true;
+    }
+
+    /**
+     * Add an association type and session type to the allowed types
+     * list. The assocation/session pairs are tried in the order that
+     * they are added.
+     *
+     * @access private
+     */
+    function addAllowedType($assoc_type, $session_type = null)
+    {
+        if ($this->allowed_types === null) {
+            $this->allowed_types = array();
+        }
+
+        if ($session_type === null) {
+            $available = Auth_OpenID_getSessionTypes($assoc_type);
+
+            if (!$available) {
+                return false;
+            }
+
+            foreach ($available as $session_type) {
+                $this->addAllowedType($assoc_type, $session_type);
+            }
+        } else {
+            if (Auth_OpenID_checkSessionType($assoc_type, $session_type)) {
+                $this->allowed_types[] = array($assoc_type, $session_type);
+            } else {
+                return false;
+            }
+        }
+
+        return true;
+    }
+
+    // Is this combination of association type and session type allowed?
+    function isAllowed($assoc_type, $session_type)
+    {
+        $assoc_good = in_array(array($assoc_type, $session_type),
+                               $this->allowed_types);
+
+        $matches = in_array($session_type,
+                            Auth_OpenID_getSessionTypes($assoc_type));
+
+        return ($assoc_good && $matches);
+    }
+
+    /**
+     * Get a pair of assocation type and session type that are
+     * supported.
+     */
+    function getAllowedType()
+    {
+        if (!$this->allowed_types) {
+            return array(null, null);
+        }
+
+        return $this->allowed_types[0];
+    }
+}
+
+

--- /dev/null
+++ b/lib/openid-php/Auth/OpenID/BigMath.php
@@ -1,1 +1,452 @@
-
+<?php
+
+/**
+ * BigMath: A math library wrapper that abstracts out the underlying
+ * long integer library.
+ *
+ * PHP versions 4 and 5
+ *
+ * LICENSE: See the COPYING file included in this distribution.
+ *
+ * @access private
+ * @package OpenID
+ * @author JanRain, Inc. <openid@janrain.com>
+ * @copyright 2005-2008 Janrain, Inc.
+ * @license http://www.apache.org/licenses/LICENSE-2.0 Apache
+ */
+
+/**
+ * Needed for random number generation
+ */
+require_once 'Auth/OpenID/CryptUtil.php';
+
+/**
+ * Need Auth_OpenID::bytes().
+ */
+require_once 'Auth/OpenID.php';
+
+/**
+ * The superclass of all big-integer math implementations
+ * @access private
+ * @package OpenID
+ */
+class Auth_OpenID_MathLibrary {
+    /**
+     * Given a long integer, returns the number converted to a binary
+     * string.  This function accepts long integer values of arbitrary
+     * magnitude and uses the local large-number math library when
+     * available.
+     *
+     * @param integer $long The long number (can be a normal PHP
+     * integer or a number created by one of the available long number
+     * libraries)
+     * @return string $binary The binary version of $long
+     */
+    function longToBinary($long)
+    {
+        $cmp = $this->cmp($long, 0);
+        if ($cmp < 0) {
+            $msg = __FUNCTION__ . " takes only positive integers.";
+            trigger_error($msg, E_USER_ERROR);
+            return null;
+        }
+
+        if ($cmp == 0) {
+            return "\x00";
+        }
+
+        $bytes = array();
+
+        while ($this->cmp($long, 0) > 0) {
+            array_unshift($bytes, $this->mod($long, 256));
+            $long = $this->div($long, pow(2, 8));
+        }
+
+        if ($bytes && ($bytes[0] > 127)) {
+            array_unshift($bytes, 0);
+        }
+
+        $string = '';
+        foreach ($bytes as $byte) {
+            $string .= pack('C', $byte);
+        }
+
+        return $string;
+    }
+
+    /**
+     * Given a binary string, returns the binary string converted to a
+     * long number.
+     *
+     * @param string $binary The binary version of a long number,
+     * probably as a result of calling longToBinary
+     * @return integer $long The long number equivalent of the binary
+     * string $str
+     */
+    function binaryToLong($str)
+    {
+        if ($str === null) {
+            return null;
+        }
+
+        // Use array_merge to return a zero-indexed array instead of a
+        // one-indexed array.
+        $bytes = array_merge(unpack('C*', $str));
+
+        $n = $this->init(0);
+
+        if ($bytes && ($bytes[0] > 127)) {
+            trigger_error("bytesToNum works only for positive integers.",
+                          E_USER_WARNING);
+            return null;
+        }
+
+        foreach ($bytes as $byte) {
+            $n = $this->mul($n, pow(2, 8));
+            $n = $this->add($n, $byte);
+        }
+
+        return $n;
+    }
+
+    function base64ToLong($str)
+    {
+        $b64 = base64_decode($str);
+
+        if ($b64 === false) {
+            return false;
+        }
+
+        return $this->binaryToLong($b64);
+    }
+
+    function longToBase64($str)
+    {
+        return base64_encode($this->longToBinary($str));
+    }
+
+    /**
+     * Returns a random number in the specified range.  This function
+     * accepts $start, $stop, and $step values of arbitrary magnitude
+     * and will utilize the local large-number math library when
+     * available.
+     *
+     * @param integer $start The start of the range, or the minimum
+     * random number to return
+     * @param integer $stop The end of the range, or the maximum
+     * random number to return
+     * @param integer $step The step size, such that $result - ($step
+     * * N) = $start for some N
+     * @return integer $result The resulting randomly-generated number
+     */
+    function rand($stop)
+    {
+        static $duplicate_cache = array();
+
+        // Used as the key for the duplicate cache
+        $rbytes = $this->longToBinary($stop);
+
+        if (array_key_exists($rbytes, $duplicate_cache)) {
+            list($duplicate, $nbytes) = $duplicate_cache[$rbytes];
+        } else {
+            if ($rbytes[0] == "\x00") {
+                $nbytes = Auth_OpenID::bytes($rbytes) - 1;
+            } else {
+                $nbytes = Auth_OpenID::bytes($rbytes);
+            }
+
+            $mxrand = $this->pow(256, $nbytes);
+
+            // If we get a number less than this, then it is in the
+            // duplicated range.
+            $duplicate = $this->mod($mxrand, $stop);
+
+            if (count($duplicate_cache) > 10) {
+                $duplicate_cache = array();
+            }
+
+            $duplicate_cache[$rbytes] = array($duplicate, $nbytes);
+        }
+
+        do {
+            $bytes = "\x00" . Auth_OpenID_CryptUtil::getBytes($nbytes);
+            $n = $this->binaryToLong($bytes);
+            // Keep looping if this value is in the low duplicated range
+        } while ($this->cmp($n, $duplicate) < 0);
+
+        return $this->mod($n, $stop);
+    }
+}
+
+/**
+ * Exposes BCmath math library functionality.
+ *
+ * {@link Auth_OpenID_BcMathWrapper} wraps the functionality provided
+ * by the BCMath extension.
+ *
+ * @access private
+ * @package OpenID
+ */
+class Auth_OpenID_BcMathWrapper extends Auth_OpenID_MathLibrary{
+    var $type = 'bcmath';
+
+    function add($x, $y)
+    {
+        return bcadd($x, $y);
+    }
+
+    function sub($x, $y)
+    {
+        return bcsub($x, $y);
+    }
+
+    function pow($base, $exponent)
+    {
+        return bcpow($base, $exponent);
+    }
+
+    function cmp($x, $y)
+    {
+        return bccomp($x, $y);
+    }
+
+    function init($number, $base = 10)
+    {
+        return $number;
+    }
+
+    function mod($base, $modulus)
+    {
+        return bcmod($base, $modulus);
+    }
+
+    function mul($x, $y)
+    {
+        return bcmul($x, $y);
+    }
+
+    function div($x, $y)
+    {
+        return bcdiv($x, $y);
+    }
+
+    /**
+     * Same as bcpowmod when bcpowmod is missing
+     *
+     * @access private
+     */
+    function _powmod($base, $exponent, $modulus)
+    {
+        $square = $this->mod($base, $modulus);
+        $result = 1;
+        while($this->cmp($exponent, 0) > 0) {
+            if ($this->mod($exponent, 2)) {
+                $result = $this->mod($this->mul($result, $square), $modulus);
+            }
+            $square = $this->mod($this->mul($square, $square), $modulus);
+            $exponent = $this->div($exponent, 2);
+        }
+        return $result;
+    }
+
+    function powmod($base, $exponent, $modulus)
+    {
+        if (function_exists('bcpowmod')) {
+            return bcpowmod($base, $exponent, $modulus);
+        } else {
+            return $this->_powmod($base, $exponent, $modulus);
+        }
+    }
+
+    function toString($num)
+    {
+        return $num;
+    }
+}
+
+/**
+ * Exposes GMP math library functionality.
+ *
+ * {@link Auth_OpenID_GmpMathWrapper} wraps the functionality provided
+ * by the GMP extension.
+ *
+ * @access private
+ * @package OpenID
+ */
+class Auth_OpenID_GmpMathWrapper extends Auth_OpenID_MathLibrary{
+    var $type = 'gmp';
+
+    function add($x, $y)
+    {
+        return gmp_add($x, $y);
+    }
+
+    function sub($x, $y)
+    {
+        return gmp_sub($x, $y);
+    }
+
+    function pow($base, $exponent)
+    {
+        return gmp_pow($base, $exponent);
+    }
+
+    function cmp($x, $y)
+    {
+        return gmp_cmp($x, $y);
+    }
+
+    function init($number, $base = 10)
+    {
+        return gmp_init($number, $base);
+    }
+
+    function mod($base, $modulus)
+    {
+        return gmp_mod($base, $modulus);
+    }
+
+    function mul($x, $y)
+    {
+        return gmp_mul($x, $y);
+    }
+
+    function div($x, $y)
+    {
+        return gmp_div_q($x, $y);
+    }
+
+    function powmod($base, $exponent, $modulus)
+    {
+        return gmp_powm($base, $exponent, $modulus);
+    }
+
+    function toString($num)
+    {
+        return gmp_strval($num);
+    }
+}
+
+/**
+ * Define the supported extensions.  An extension array has keys
+ * 'modules', 'extension', and 'class'.  'modules' is an array of PHP
+ * module names which the loading code will attempt to load.  These
+ * values will be suffixed with a library file extension (e.g. ".so").
+ * 'extension' is the name of a PHP extension which will be tested
+ * before 'modules' are loaded.  'class' is the string name of a
+ * {@link Auth_OpenID_MathWrapper} subclass which should be
+ * instantiated if a given extension is present.
+ *
+ * You can define new math library implementations and add them to
+ * this array.
+ */
+function Auth_OpenID_math_extensions()
+{
+    $result = array();
+
+    if (!defined('Auth_OpenID_BUGGY_GMP')) {
+        $result[] =
+            array('modules' => array('gmp', 'php_gmp'),
+                  'extension' => 'gmp',
+                  'class' => 'Auth_OpenID_GmpMathWrapper');
+    }
+
+    $result[] = array('modules' => array('bcmath', 'php_bcmath'),
+                      'extension' => 'bcmath',
+                      'class' => 'Auth_OpenID_BcMathWrapper');
+
+    return $result;
+}
+
+/**
+ * Detect which (if any) math library is available
+ */
+function Auth_OpenID_detectMathLibrary($exts)
+{
+    $loaded = false;
+
+    foreach ($exts as $extension) {
+        if (extension_loaded($extension['extension'])) {
+            return $extension;
+        }
+    }
+
+    return false;
+}
+
+/**
+ * {@link Auth_OpenID_getMathLib} checks for the presence of long
+ * number extension modules and returns an instance of
+ * {@link Auth_OpenID_MathWrapper} which exposes the module's
+ * functionality.
+ *
+ * Checks for the existence of an extension module described by the
+ * result of {@link Auth_OpenID_math_extensions()} and returns an
+ * instance of a wrapper for that extension module.  If no extension
+ * module is found, an instance of {@link Auth_OpenID_MathWrapper} is
+ * returned, which wraps the native PHP integer implementation.  The
+ * proper calling convention for this method is $lib =
+ * Auth_OpenID_getMathLib().
+ *
+ * This function checks for the existence of specific long number
+ * implementations in the following order: GMP followed by BCmath.
+ *
+ * @return Auth_OpenID_MathWrapper $instance An instance of
+ * {@link Auth_OpenID_MathWrapper} or one of its subclasses
+ *
+ * @package OpenID
+ */
+function Auth_OpenID_getMathLib()
+{
+    // The instance of Auth_OpenID_MathWrapper that we choose to
+    // supply will be stored here, so that subseqent calls to this
+    // method will return a reference to the same object.
+    static $lib = null;
+
+    if (isset($lib)) {
+        return $lib;
+    }
+
+    if (Auth_OpenID_noMathSupport()) {
+        $null = null;
+        return $null;
+    }
+
+    // If this method has not been called before, look at
+    // Auth_OpenID_math_extensions and try to find an extension that
+    // works.
+    $ext = Auth_OpenID_detectMathLibrary(Auth_OpenID_math_extensions());
+    if ($ext === false) {
+        $tried = array();
+        foreach (Auth_OpenID_math_extensions() as $extinfo) {
+            $tried[] = $extinfo['extension'];
+        }
+        $triedstr = implode(", ", $tried);
+
+        Auth_OpenID_setNoMathSupport();
+
+        $result = null;
+        return $result;
+    }
+
+    // Instantiate a new wrapper
+    $class = $ext['class'];
+    $lib = new $class();
+
+    return $lib;
+}
+
+function Auth_OpenID_setNoMathSupport()
+{
+    if (!defined('Auth_OpenID_NO_MATH_SUPPORT')) {
+        define('Auth_OpenID_NO_MATH_SUPPORT', true);
+    }
+}
+
+function Auth_OpenID_noMathSupport()
+{
+    return defined('Auth_OpenID_NO_MATH_SUPPORT');
+}
+
+
+

--- /dev/null
+++ b/lib/openid-php/Auth/OpenID/Consumer.php
@@ -1,1 +1,2235 @@
-
+<?php
+
+/**
+ * This module documents the main interface with the OpenID consumer
+ * library.  The only part of the library which has to be used and
+ * isn't documented in full here is the store required to create an
+ * Auth_OpenID_Consumer instance.  More on the abstract store type and
+ * concrete implementations of it that are provided in the
+ * documentation for the Auth_OpenID_Consumer constructor.
+ *
+ * OVERVIEW
+ *
+ * The OpenID identity verification process most commonly uses the
+ * following steps, as visible to the user of this library:
+ *
+ *   1. The user enters their OpenID into a field on the consumer's
+ *      site, and hits a login button.
+ *   2. The consumer site discovers the user's OpenID server using the
+ *      YADIS protocol.
+ *   3. The consumer site sends the browser a redirect to the identity
+ *      server.  This is the authentication request as described in
+ *      the OpenID specification.
+ *   4. The identity server's site sends the browser a redirect back
+ *      to the consumer site.  This redirect contains the server's
+ *      response to the authentication request.
+ *
+ * The most important part of the flow to note is the consumer's site
+ * must handle two separate HTTP requests in order to perform the full
+ * identity check.
+ *
+ * LIBRARY DESIGN
+ * 
+ * This consumer library is designed with that flow in mind.  The goal
+ * is to make it as easy as possible to perform the above steps
+ * securely.
+ *
+ * At a high level, there are two important parts in the consumer
+ * library.  The first important part is this module, which contains
+ * the interface to actually use this library.  The second is the
+ * Auth_OpenID_Interface class, which describes the interface to use
+ * if you need to create a custom method for storing the state this
+ * library needs to maintain between requests.
+ *
+ * In general, the second part is less important for users of the
+ * library to know about, as several implementations are provided
+ * which cover a wide variety of situations in which consumers may use
+ * the library.
+ *
+ * This module contains a class, Auth_OpenID_Consumer, with methods
+ * corresponding to the actions necessary in each of steps 2, 3, and 4
+ * described in the overview.  Use of this library should be as easy
+ * as creating an Auth_OpenID_Consumer instance and calling the
+ * methods appropriate for the action the site wants to take.
+ *
+ * STORES AND DUMB MODE
+ *
+ * OpenID is a protocol that works best when the consumer site is able
+ * to store some state.  This is the normal mode of operation for the
+ * protocol, and is sometimes referred to as smart mode.  There is
+ * also a fallback mode, known as dumb mode, which is available when
+ * the consumer site is not able to store state.  This mode should be
+ * avoided when possible, as it leaves the implementation more
+ * vulnerable to replay attacks.
+ *
+ * The mode the library works in for normal operation is determined by
+ * the store that it is given.  The store is an abstraction that
+ * handles the data that the consumer needs to manage between http
+ * requests in order to operate efficiently and securely.
+ *
+ * Several store implementation are provided, and the interface is
+ * fully documented so that custom stores can be used as well.  See
+ * the documentation for the Auth_OpenID_Consumer class for more
+ * information on the interface for stores.  The implementations that
+ * are provided allow the consumer site to store the necessary data in
+ * several different ways, including several SQL databases and normal
+ * files on disk.
+ *
+ * There is an additional concrete store provided that puts the system
+ * in dumb mode.  This is not recommended, as it removes the library's
+ * ability to stop replay attacks reliably.  It still uses time-based
+ * checking to make replay attacks only possible within a small
+ * window, but they remain possible within that window.  This store
+ * should only be used if the consumer site has no way to retain data
+ * between requests at all.
+ *
+ * IMMEDIATE MODE
+ *
+ * In the flow described above, the user may need to confirm to the
+ * lidentity server that it's ok to authorize his or her identity.
+ * The server may draw pages asking for information from the user
+ * before it redirects the browser back to the consumer's site.  This
+ * is generally transparent to the consumer site, so it is typically
+ * ignored as an implementation detail.
+ *
+ * There can be times, however, where the consumer site wants to get a
+ * response immediately.  When this is the case, the consumer can put
+ * the library in immediate mode.  In immediate mode, there is an
+ * extra response possible from the server, which is essentially the
+ * server reporting that it doesn't have enough information to answer
+ * the question yet.
+ *
+ * USING THIS LIBRARY
+ *
+ * Integrating this library into an application is usually a
+ * relatively straightforward process.  The process should basically
+ * follow this plan:
+ *
+ * Add an OpenID login field somewhere on your site.  When an OpenID
+ * is entered in that field and the form is submitted, it should make
+ * a request to the your site which includes that OpenID URL.
+ *
+ * First, the application should instantiate the Auth_OpenID_Consumer
+ * class using the store of choice (Auth_OpenID_FileStore or one of
+ * the SQL-based stores).  If the application has a custom
+ * session-management implementation, an object implementing the
+ * {@link Auth_Yadis_PHPSession} interface should be passed as the
+ * second parameter.  Otherwise, the default uses $_SESSION.
+ *
+ * Next, the application should call the Auth_OpenID_Consumer object's
+ * 'begin' method.  This method takes the OpenID URL.  The 'begin'
+ * method returns an Auth_OpenID_AuthRequest object.
+ *
+ * Next, the application should call the 'redirectURL' method of the
+ * Auth_OpenID_AuthRequest object.  The 'return_to' URL parameter is
+ * the URL that the OpenID server will send the user back to after
+ * attempting to verify his or her identity.  The 'trust_root' is the
+ * URL (or URL pattern) that identifies your web site to the user when
+ * he or she is authorizing it.  Send a redirect to the resulting URL
+ * to the user's browser.
+ *
+ * That's the first half of the authentication process.  The second
+ * half of the process is done after the user's ID server sends the
+ * user's browser a redirect back to your site to complete their
+ * login.
+ *
+ * When that happens, the user will contact your site at the URL given
+ * as the 'return_to' URL to the Auth_OpenID_AuthRequest::redirectURL
+ * call made above.  The request will have several query parameters
+ * added to the URL by the identity server as the information
+ * necessary to finish the request.
+ *
+ * Lastly, instantiate an Auth_OpenID_Consumer instance as above and
+ * call its 'complete' method, passing in all the received query
+ * arguments.
+ *
+ * There are multiple possible return types possible from that
+ * method. These indicate the whether or not the login was successful,
+ * and include any additional information appropriate for their type.
+ *
+ * PHP versions 4 and 5
+ *
+ * LICENSE: See the COPYING file included in this distribution.
+ *
+ * @package OpenID
+ * @author JanRain, Inc. <openid@janrain.com>
+ * @copyright 2005-2008 Janrain, Inc.
+ * @license http://www.apache.org/licenses/LICENSE-2.0 Apache
+ */
+
+/**
+ * Require utility classes and functions for the consumer.
+ */
+require_once "Auth/OpenID.php";
+require_once "Auth/OpenID/Message.php";
+require_once "Auth/OpenID/HMAC.php";
+require_once "Auth/OpenID/Association.php";
+require_once "Auth/OpenID/CryptUtil.php";
+require_once "Auth/OpenID/DiffieHellman.php";
+require_once "Auth/OpenID/KVForm.php";
+require_once "Auth/OpenID/Nonce.php";
+require_once "Auth/OpenID/Discover.php";
+require_once "Auth/OpenID/URINorm.php";
+require_once "Auth/Yadis/Manager.php";
+require_once "Auth/Yadis/XRI.php";
+
+/**
+ * This is the status code returned when the complete method returns
+ * successfully.
+ */
+define('Auth_OpenID_SUCCESS', 'success');
+
+/**
+ * Status to indicate cancellation of OpenID authentication.
+ */
+define('Auth_OpenID_CANCEL', 'cancel');
+
+/**
+ * This is the status code completeAuth returns when the value it
+ * received indicated an invalid login.
+ */
+define('Auth_OpenID_FAILURE', 'failure');
+
+/**
+ * This is the status code completeAuth returns when the
+ * {@link Auth_OpenID_Consumer} instance is in immediate mode, and the
+ * identity server sends back a URL to send the user to to complete his
+ * or her login.
+ */
+define('Auth_OpenID_SETUP_NEEDED', 'setup needed');
+
+/**
+ * This is the status code beginAuth returns when the page fetched
+ * from the entered OpenID URL doesn't contain the necessary link tags
+ * to function as an identity page.
+ */
+define('Auth_OpenID_PARSE_ERROR', 'parse error');
+
+/**
+ * An OpenID consumer implementation that performs discovery and does
+ * session management.  See the Consumer.php file documentation for
+ * more information.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_Consumer {
+
+    /**
+     * @access private
+     */
+    var $discoverMethod = 'Auth_OpenID_discover';
+
+    /**
+     * @access private
+     */
+    var $session_key_prefix = "_openid_consumer_";
+
+    /**
+     * @access private
+     */
+    var $_token_suffix = "last_token";
+
+    /**
+     * Initialize a Consumer instance.
+     *
+     * You should create a new instance of the Consumer object with
+     * every HTTP request that handles OpenID transactions.
+     *
+     * @param Auth_OpenID_OpenIDStore $store This must be an object
+     * that implements the interface in {@link
+     * Auth_OpenID_OpenIDStore}.  Several concrete implementations are
+     * provided, to cover most common use cases.  For stores backed by
+     * MySQL, PostgreSQL, or SQLite, see the {@link
+     * Auth_OpenID_SQLStore} class and its sublcasses.  For a
+     * filesystem-backed store, see the {@link Auth_OpenID_FileStore}
+     * module.  As a last resort, if it isn't possible for the server
+     * to store state at all, an instance of {@link
+     * Auth_OpenID_DumbStore} can be used.
+     *
+     * @param mixed $session An object which implements the interface
+     * of the {@link Auth_Yadis_PHPSession} class.  Particularly, this
+     * object is expected to have these methods: get($key), set($key),
+     * $value), and del($key).  This defaults to a session object
+     * which wraps PHP's native session machinery.  You should only
+     * need to pass something here if you have your own sessioning
+     * implementation.
+     *
+     * @param str $consumer_cls The name of the class to instantiate
+     * when creating the internal consumer object.  This is used for
+     * testing.
+     */
+    function Auth_OpenID_Consumer($store, $session = null,
+                                  $consumer_cls = null)
+    {
+        if ($session === null) {
+            $session = new Auth_Yadis_PHPSession();
+        }
+
+        $this->session = $session;
+
+        if ($consumer_cls !== null) {
+            $this->consumer = new $consumer_cls($store);
+        } else {
+            $this->consumer = new Auth_OpenID_GenericConsumer($store);
+        }
+
+        $this->_token_key = $this->session_key_prefix . $this->_token_suffix;
+    }
+
+    /**
+     * Used in testing to define the discovery mechanism.
+     *
+     * @access private
+     */
+    function getDiscoveryObject($session, $openid_url,
+                                $session_key_prefix)
+    {
+        return new Auth_Yadis_Discovery($session, $openid_url,
+                                        $session_key_prefix);
+    }
+
+    /**
+     * Start the OpenID authentication process. See steps 1-2 in the
+     * overview at the top of this file.
+     *
+     * @param string $user_url Identity URL given by the user. This
+     * method performs a textual transformation of the URL to try and
+     * make sure it is normalized. For example, a user_url of
+     * example.com will be normalized to http://example.com/
+     * normalizing and resolving any redirects the server might issue.
+     *
+     * @param bool $anonymous True if the OpenID request is to be sent
+     * to the server without any identifier information.  Use this
+     * when you want to transport data but don't want to do OpenID
+     * authentication with identifiers.
+     *
+     * @return Auth_OpenID_AuthRequest $auth_request An object
+     * containing the discovered information will be returned, with a
+     * method for building a redirect URL to the server, as described
+     * in step 3 of the overview. This object may also be used to add
+     * extension arguments to the request, using its 'addExtensionArg'
+     * method.
+     */
+    function begin($user_url, $anonymous=false)
+    {
+        $openid_url = $user_url;
+
+        $disco = $this->getDiscoveryObject($this->session,
+                                           $openid_url,
+                                           $this->session_key_prefix);
+
+        // Set the 'stale' attribute of the manager.  If discovery
+        // fails in a fatal way, the stale flag will cause the manager
+        // to be cleaned up next time discovery is attempted.
+
+        $m = $disco->getManager();
+        $loader = new Auth_Yadis_ManagerLoader();
+
+        if ($m) {
+            if ($m->stale) {
+                $disco->destroyManager();
+            } else {
+                $m->stale = true;
+                $disco->session->set($disco->session_key,
+                                     serialize($loader->toSession($m)));
+            }
+        }
+
+        $endpoint = $disco->getNextService($this->discoverMethod,
+                                           $this->consumer->fetcher);
+
+        // Reset the 'stale' attribute of the manager.
+        $m = $disco->getManager();
+        if ($m) {
+            $m->stale = false;
+            $disco->session->set($disco->session_key,
+                                 serialize($loader->toSession($m)));
+        }
+
+        if ($endpoint === null) {
+            return null;
+        } else {
+            return $this->beginWithoutDiscovery($endpoint,
+                                                $anonymous);
+        }
+    }
+
+    /**
+     * Start OpenID verification without doing OpenID server
+     * discovery. This method is used internally by Consumer.begin
+     * after discovery is performed, and exists to provide an
+     * interface for library users needing to perform their own
+     * discovery.
+     *
+     * @param Auth_OpenID_ServiceEndpoint $endpoint an OpenID service
+     * endpoint descriptor.
+     *
+     * @param bool anonymous Set to true if you want to perform OpenID
+     * without identifiers.
+     *
+     * @return Auth_OpenID_AuthRequest $auth_request An OpenID
+     * authentication request object.
+     */
+    function beginWithoutDiscovery($endpoint, $anonymous=false)
+    {
+        $loader = new Auth_OpenID_ServiceEndpointLoader();
+        $auth_req = $this->consumer->begin($endpoint);
+        $this->session->set($this->_token_key,
+              $loader->toSession($auth_req->endpoint));
+        if (!$auth_req->setAnonymous($anonymous)) {
+            return new Auth_OpenID_FailureResponse(null,
+              "OpenID 1 requests MUST include the identifier " .
+              "in the request.");
+        }
+        return $auth_req;
+    }
+
+    /**
+     * Called to interpret the server's response to an OpenID
+     * request. It is called in step 4 of the flow described in the
+     * consumer overview.
+     *
+     * @param string $current_url The URL used to invoke the application.
+     * Extract the URL from your application's web
+     * request framework and specify it here to have it checked
+     * against the openid.current_url value in the response.  If
+     * the current_url URL check fails, the status of the
+     * completion will be FAILURE.
+     *
+     * @param array $query An array of the query parameters (key =>
+     * value pairs) for this HTTP request.  Defaults to null.  If
+     * null, the GET or POST data are automatically gotten from the
+     * PHP environment.  It is only useful to override $query for
+     * testing.
+     *
+     * @return Auth_OpenID_ConsumerResponse $response A instance of an
+     * Auth_OpenID_ConsumerResponse subclass. The type of response is
+     * indicated by the status attribute, which will be one of
+     * SUCCESS, CANCEL, FAILURE, or SETUP_NEEDED.
+     */
+    function complete($current_url, $query=null)
+    {
+        if ($current_url && !is_string($current_url)) {
+            // This is ugly, but we need to complain loudly when
+            // someone uses the API incorrectly.
+            trigger_error("current_url must be a string; see NEWS file " .
+                          "for upgrading notes.",
+                          E_USER_ERROR);
+        }
+
+        if ($query === null) {
+            $query = Auth_OpenID::getQuery();
+        }
+
+        $loader = new Auth_OpenID_ServiceEndpointLoader();
+        $endpoint_data = $this->session->get($this->_token_key);
+        $endpoint =
+            $loader->fromSession($endpoint_data);
+
+        $message = Auth_OpenID_Message::fromPostArgs($query);
+        $response = $this->consumer->complete($message, $endpoint, 
+                                              $current_url);
+        $this->session->del($this->_token_key);
+
+        if (in_array($response->status, array(Auth_OpenID_SUCCESS,
+                                              Auth_OpenID_CANCEL))) {
+            if ($response->identity_url !== null) {
+                $disco = $this->getDiscoveryObject($this->session,
+                                                   $response->identity_url,
+                                                   $this->session_key_prefix);
+                $disco->cleanup(true);
+            }
+        }
+
+        return $response;
+    }
+}
+
+/**
+ * A class implementing HMAC/DH-SHA1 consumer sessions.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_DiffieHellmanSHA1ConsumerSession {
+    var $session_type = 'DH-SHA1';
+    var $hash_func = 'Auth_OpenID_SHA1';
+    var $secret_size = 20;
+    var $allowed_assoc_types = array('HMAC-SHA1');
+
+    function Auth_OpenID_DiffieHellmanSHA1ConsumerSession($dh = null)
+    {
+        if ($dh === null) {
+            $dh = new Auth_OpenID_DiffieHellman();
+        }
+
+        $this->dh = $dh;
+    }
+
+    function getRequest()
+    {
+        $math = Auth_OpenID_getMathLib();
+
+        $cpub = $math->longToBase64($this->dh->public);
+
+        $args = array('dh_consumer_public' => $cpub);
+
+        if (!$this->dh->usingDefaultValues()) {
+            $args = array_merge($args, array(
+                'dh_modulus' =>
+                     $math->longToBase64($this->dh->mod),
+                'dh_gen' =>
+                     $math->longToBase64($this->dh->gen)));
+        }
+
+        return $args;
+    }
+
+    function extractSecret($response)
+    {
+        if (!$response->hasKey(Auth_OpenID_OPENID_NS,
+                               'dh_server_public')) {
+            return null;
+        }
+
+        if (!$response->hasKey(Auth_OpenID_OPENID_NS,
+                               'enc_mac_key')) {
+            return null;
+        }
+
+        $math = Auth_OpenID_getMathLib();
+
+        $spub = $math->base64ToLong($response->getArg(Auth_OpenID_OPENID_NS,
+                                                      'dh_server_public'));
+        $enc_mac_key = base64_decode($response->getArg(Auth_OpenID_OPENID_NS,
+                                                       'enc_mac_key'));
+
+        return $this->dh->xorSecret($spub, $enc_mac_key, $this->hash_func);
+    }
+}
+
+/**
+ * A class implementing HMAC/DH-SHA256 consumer sessions.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_DiffieHellmanSHA256ConsumerSession extends
+      Auth_OpenID_DiffieHellmanSHA1ConsumerSession {
+    var $session_type = 'DH-SHA256';
+    var $hash_func = 'Auth_OpenID_SHA256';
+    var $secret_size = 32;
+    var $allowed_assoc_types = array('HMAC-SHA256');
+}
+
+/**
+ * A class implementing plaintext consumer sessions.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_PlainTextConsumerSession {
+    var $session_type = 'no-encryption';
+    var $allowed_assoc_types =  array('HMAC-SHA1', 'HMAC-SHA256');
+
+    function getRequest()
+    {
+        return array();
+    }
+
+    function extractSecret($response)
+    {
+        if (!$response->hasKey(Auth_OpenID_OPENID_NS, 'mac_key')) {
+            return null;
+        }
+
+        return base64_decode($response->getArg(Auth_OpenID_OPENID_NS,
+                                               'mac_key'));
+    }
+}
+
+/**
+ * Returns available session types.
+ */
+function Auth_OpenID_getAvailableSessionTypes()
+{
+    $types = array(
+      'no-encryption' => 'Auth_OpenID_PlainTextConsumerSession',
+      'DH-SHA1' => 'Auth_OpenID_DiffieHellmanSHA1ConsumerSession',
+      'DH-SHA256' => 'Auth_OpenID_DiffieHellmanSHA256ConsumerSession');
+
+    return $types;
+}
+
+/**
+ * This class is the interface to the OpenID consumer logic.
+ * Instances of it maintain no per-request state, so they can be
+ * reused (or even used by multiple threads concurrently) as needed.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_GenericConsumer {
+    /**
+     * @access private
+     */
+    var $discoverMethod = 'Auth_OpenID_discover';
+
+    /**
+     * This consumer's store object.
+     */
+    var $store;
+
+    /**
+     * @access private
+     */
+    var $_use_assocs;
+
+    /**
+     * @access private
+     */
+    var $openid1_nonce_query_arg_name = 'janrain_nonce';
+
+    /**
+     * Another query parameter that gets added to the return_to for
+     * OpenID 1; if the user's session state is lost, use this claimed
+     * identifier to do discovery when verifying the response.
+     */
+    var $openid1_return_to_identifier_name = 'openid1_claimed_id';
+
+    /**
+     * This method initializes a new {@link Auth_OpenID_Consumer}
+     * instance to access the library.
+     *
+     * @param Auth_OpenID_OpenIDStore $store This must be an object
+     * that implements the interface in {@link Auth_OpenID_OpenIDStore}.
+     * Several concrete implementations are provided, to cover most common use
+     * cases.  For stores backed by MySQL, PostgreSQL, or SQLite, see
+     * the {@link Auth_OpenID_SQLStore} class and its sublcasses.  For a
+     * filesystem-backed store, see the {@link Auth_OpenID_FileStore} module.
+     * As a last resort, if it isn't possible for the server to store
+     * state at all, an instance of {@link Auth_OpenID_DumbStore} can be used.
+     *
+     * @param bool $immediate This is an optional boolean value.  It
+     * controls whether the library uses immediate mode, as explained
+     * in the module description.  The default value is False, which
+     * disables immediate mode.
+     */
+    function Auth_OpenID_GenericConsumer($store)
+    {
+        $this->store = $store;
+        $this->negotiator = Auth_OpenID_getDefaultNegotiator();
+        $this->_use_assocs = (is_null($this->store) ? false : true);
+
+        $this->fetcher = Auth_Yadis_Yadis::getHTTPFetcher();
+
+        $this->session_types = Auth_OpenID_getAvailableSessionTypes();
+    }
+
+    /**
+     * Called to begin OpenID authentication using the specified
+     * {@link Auth_OpenID_ServiceEndpoint}.
+     *
+     * @access private
+     */
+    function begin($service_endpoint)
+    {
+        $assoc = $this->_getAssociation($service_endpoint);
+        $r = new Auth_OpenID_AuthRequest($service_endpoint, $assoc);
+        $r->return_to_args[$this->openid1_nonce_query_arg_name] =
+            Auth_OpenID_mkNonce();
+
+        if ($r->message->isOpenID1()) {
+            $r->return_to_args[$this->openid1_return_to_identifier_name] =
+                $r->endpoint->claimed_id;
+        }
+
+        return $r;
+    }
+
+    /**
+     * Given an {@link Auth_OpenID_Message}, {@link
+     * Auth_OpenID_ServiceEndpoint} and optional return_to URL,
+     * complete OpenID authentication.
+     *
+     * @access private
+     */
+    function complete($message, $endpoint, $return_to)
+    {
+        $mode = $message->getArg(Auth_OpenID_OPENID_NS, 'mode',
+                                 '<no mode set>');
+
+        $mode_methods = array(
+                              'cancel' => '_complete_cancel',
+                              'error' => '_complete_error',
+                              'setup_needed' => '_complete_setup_needed',
+                              'id_res' => '_complete_id_res',
+                              );
+
+        $method = Auth_OpenID::arrayGet($mode_methods, $mode,
+                                        '_completeInvalid');
+
+        return call_user_func_array(array($this, $method),
+                                    array($message, &$endpoint, $return_to));
+    }
+
+    /**
+     * @access private
+     */
+    function _completeInvalid($message, $endpoint, $unused)
+    {
+        $mode = $message->getArg(Auth_OpenID_OPENID_NS, 'mode',
+                                 '<No mode set>');
+
+        return new Auth_OpenID_FailureResponse($endpoint,
+                    sprintf("Invalid openid.mode '%s'", $mode));
+    }
+
+    /**
+     * @access private
+     */
+    function _complete_cancel($message, $endpoint, $unused)
+    {
+        return new Auth_OpenID_CancelResponse($endpoint);
+    }
+
+    /**
+     * @access private
+     */
+    function _complete_error($message, $endpoint, $unused)
+    {
+        $error = $message->getArg(Auth_OpenID_OPENID_NS, 'error');
+        $contact = $message->getArg(Auth_OpenID_OPENID_NS, 'contact');
+        $reference = $message->getArg(Auth_OpenID_OPENID_NS, 'reference');
+
+        return new Auth_OpenID_FailureResponse($endpoint, $error,
+                                               $contact, $reference);
+    }
+
+    /**
+     * @access private
+     */
+    function _complete_setup_needed($message, $endpoint, $unused)
+    {
+        if (!$message->isOpenID2()) {
+            return $this->_completeInvalid($message, $endpoint);
+        }
+
+        $user_setup_url = $message->getArg(Auth_OpenID_OPENID2_NS,
+                                           'user_setup_url');
+        return new Auth_OpenID_SetupNeededResponse($endpoint, $user_setup_url);
+    }
+
+    /**
+     * @access private
+     */
+    function _complete_id_res($message, $endpoint, $return_to)
+    {
+        $user_setup_url = $message->getArg(Auth_OpenID_OPENID1_NS,
+                                           'user_setup_url');
+
+        if ($this->_checkSetupNeeded($message)) {
+            return new Auth_OpenID_SetupNeededResponse(
+                $endpoint, $user_setup_url);
+        } else {
+            return $this->_doIdRes($message, $endpoint, $return_to);
+        }
+    }
+
+    /**
+     * @access private
+     */
+    function _checkSetupNeeded($message)
+    {
+        // In OpenID 1, we check to see if this is a cancel from
+        // immediate mode by the presence of the user_setup_url
+        // parameter.
+        if ($message->isOpenID1()) {
+            $user_setup_url = $message->getArg(Auth_OpenID_OPENID1_NS,
+                                               'user_setup_url');
+            if ($user_setup_url !== null) {
+                return true;
+            }
+        }
+
+        return false;
+    }
+
+    /**
+     * @access private
+     */
+    function _doIdRes($message, $endpoint, $return_to)
+    {
+        // Checks for presence of appropriate fields (and checks
+        // signed list fields)
+        $result = $this->_idResCheckForFields($message);
+
+        if (Auth_OpenID::isFailure($result)) {
+            return $result;
+        }
+
+        if (!$this->_checkReturnTo($message, $return_to)) {
+            return new Auth_OpenID_FailureResponse(null,
+            sprintf("return_to does not match return URL. Expected %s, got %s",
+                    $return_to,
+                    $message->getArg(Auth_OpenID_OPENID_NS, 'return_to')));
+        }
+
+        // Verify discovery information:
+        $result = $this->_verifyDiscoveryResults($message, $endpoint);
+
+        if (Auth_OpenID::isFailure($result)) {
+            return $result;
+        }
+
+        $endpoint = $result;
+
+        $result = $this->_idResCheckSignature($message,
+                                              $endpoint->server_url);
+
+        if (Auth_OpenID::isFailure($result)) {
+            return $result;
+        }
+
+        $result = $this->_idResCheckNonce($message, $endpoint);
+
+        if (Auth_OpenID::isFailure($result)) {
+            return $result;
+        }
+
+        $signed_list_str = $message->getArg(Auth_OpenID_OPENID_NS, 'signed',
+                                            Auth_OpenID_NO_DEFAULT);
+        if (Auth_OpenID::isFailure($signed_list_str)) {
+            return $signed_list_str;
+        }
+        $signed_list = explode(',', $signed_list_str);
+
+        $signed_fields = Auth_OpenID::addPrefix($signed_list, "openid.");
+
+        return new Auth_OpenID_SuccessResponse($endpoint, $message,
+                                               $signed_fields);
+
+    }
+
+    /**
+     * @access private
+     */
+    function _checkReturnTo($message, $return_to)
+    {
+        // Check an OpenID message and its openid.return_to value
+        // against a return_to URL from an application.  Return True
+        // on success, False on failure.
+
+        // Check the openid.return_to args against args in the
+        // original message.
+        $result = Auth_OpenID_GenericConsumer::_verifyReturnToArgs(
+                                           $message->toPostArgs());
+        if (Auth_OpenID::isFailure($result)) {
+            return false;
+        }
+
+        // Check the return_to base URL against the one in the
+        // message.
+        $msg_return_to = $message->getArg(Auth_OpenID_OPENID_NS,
+                                          'return_to');
+        if (Auth_OpenID::isFailure($return_to)) {
+            // XXX log me
+            return false;
+        }
+
+        $return_to_parts = parse_url(Auth_OpenID_urinorm($return_to));
+        $msg_return_to_parts = parse_url(Auth_OpenID_urinorm($msg_return_to));
+
+        // If port is absent from both, add it so it's equal in the
+        // check below.
+        if ((!array_key_exists('port', $return_to_parts)) &&
+            (!array_key_exists('port', $msg_return_to_parts))) {
+            $return_to_parts['port'] = null;
+            $msg_return_to_parts['port'] = null;
+        }
+
+        // If path is absent from both, add it so it's equal in the
+        // check below.
+        if ((!array_key_exists('path', $return_to_parts)) &&
+            (!array_key_exists('path', $msg_return_to_parts))) {
+            $return_to_parts['path'] = null;
+            $msg_return_to_parts['path'] = null;
+        }
+
+        // The URL scheme, authority, and path MUST be the same
+        // between the two URLs.
+        foreach (array('scheme', 'host', 'port', 'path') as $component) {
+            // If the url component is absent in either URL, fail.
+            // There should always be a scheme, host, port, and path.
+            if (!array_key_exists($component, $return_to_parts)) {
+                return false;
+            }
+
+            if (!array_key_exists($component, $msg_return_to_parts)) {
+                return false;
+            }
+
+            if (Auth_OpenID::arrayGet($return_to_parts, $component) !==
+                Auth_OpenID::arrayGet($msg_return_to_parts, $component)) {
+                return false;
+            }
+        }
+
+        return true;
+    }
+
+    /**
+     * @access private
+     */
+    function _verifyReturnToArgs($query)
+    {
+        // Verify that the arguments in the return_to URL are present in this
+        // response.
+
+        $message = Auth_OpenID_Message::fromPostArgs($query);
+        $return_to = $message->getArg(Auth_OpenID_OPENID_NS, 'return_to');
+
+        if (Auth_OpenID::isFailure($return_to)) {
+            return $return_to;
+        }
+        // XXX: this should be checked by _idResCheckForFields
+        if (!$return_to) {
+            return new Auth_OpenID_FailureResponse(null,
+                           "Response has no return_to");
+        }
+
+        $parsed_url = parse_url($return_to);
+
+        $q = array();
+        if (array_key_exists('query', $parsed_url)) {
+            $rt_query = $parsed_url['query'];
+            $q = Auth_OpenID::parse_str($rt_query);
+        }
+
+        foreach ($q as $rt_key => $rt_value) {
+            if (!array_key_exists($rt_key, $query)) {
+                return new Auth_OpenID_FailureResponse(null,
+                  sprintf("return_to parameter %s absent from query", $rt_key));
+            } else {
+                $value = $query[$rt_key];
+                if ($rt_value != $value) {
+                    return new Auth_OpenID_FailureResponse(null,
+                      sprintf("parameter %s value %s does not match " .
+                              "return_to value %s", $rt_key,
+                              $value, $rt_value));
+                }
+            }
+        }
+
+        // Make sure all non-OpenID arguments in the response are also
+        // in the signed return_to.
+        $bare_args = $message->getArgs(Auth_OpenID_BARE_NS);
+        foreach ($bare_args as $key => $value) {
+            if (Auth_OpenID::arrayGet($q, $key) != $value) {
+                return new Auth_OpenID_FailureResponse(null,
+                  sprintf("Parameter %s = %s not in return_to URL",
+                          $key, $value));
+            }
+        }
+
+        return true;
+    }
+
+    /**
+     * @access private
+     */
+    function _idResCheckSignature($message, $server_url)
+    {
+        $assoc_handle = $message->getArg(Auth_OpenID_OPENID_NS,
+                                         'assoc_handle');
+        if (Auth_OpenID::isFailure($assoc_handle)) {
+            return $assoc_handle;
+        }
+
+        $assoc = $this->store->getAssociation($server_url, $assoc_handle);
+
+        if ($assoc) {
+            if ($assoc->getExpiresIn() <= 0) {
+                // XXX: It might be a good idea sometimes to re-start
+                // the authentication with a new association. Doing it
+                // automatically opens the possibility for
+                // denial-of-service by a server that just returns
+                // expired associations (or really short-lived
+                // associations)
+                return new Auth_OpenID_FailureResponse(null,
+                             'Association with ' . $server_url . ' expired');
+            }
+
+            if (!$assoc->checkMessageSignature($message)) {
+                // If we get a "bad signature" here, it means that the association
+                // is unrecoverabley corrupted in some way. Any futher attempts
+                // to login with this association is likely to fail. Drop it.
+                $this->store->removeAssociation($server_url, $assoc_handle);
+                return new Auth_OpenID_FailureResponse(null,
+                                                       "Bad signature");
+            }
+        } else {
+            // It's not an association we know about.  Stateless mode
+            // is our only possible path for recovery.  XXX - async
+            // framework will not want to block on this call to
+            // _checkAuth.
+            if (!$this->_checkAuth($message, $server_url)) {
+                return new Auth_OpenID_FailureResponse(null,
+                             "Server denied check_authentication");
+            }
+        }
+
+        return null;
+    }
+
+    /**
+     * @access private
+     */
+    function _verifyDiscoveryResults($message, $endpoint=null)
+    {
+        if ($message->getOpenIDNamespace() == Auth_OpenID_OPENID2_NS) {
+            return $this->_verifyDiscoveryResultsOpenID2($message,
+                                                         $endpoint);
+        } else {
+            return $this->_verifyDiscoveryResultsOpenID1($message,
+                                                         $endpoint);
+        }
+    }
+
+    /**
+     * @access private
+     */
+    function _verifyDiscoveryResultsOpenID1($message, $endpoint)
+    {
+        $claimed_id = $message->getArg(Auth_OpenID_BARE_NS,
+                                $this->openid1_return_to_identifier_name);
+
+        if (($endpoint === null) && ($claimed_id === null)) {
+            return new Auth_OpenID_FailureResponse($endpoint,
+              'When using OpenID 1, the claimed ID must be supplied, ' .
+              'either by passing it through as a return_to parameter ' .
+              'or by using a session, and supplied to the GenericConsumer ' .
+              'as the argument to complete()');
+        } else if (($endpoint !== null) && ($claimed_id === null)) {
+            $claimed_id = $endpoint->claimed_id;
+        }
+
+        $to_match = new Auth_OpenID_ServiceEndpoint();
+        $to_match->type_uris = array(Auth_OpenID_TYPE_1_1);
+        $to_match->local_id = $message->getArg(Auth_OpenID_OPENID1_NS,
+                                               'identity');
+
+        // Restore delegate information from the initiation phase
+        $to_match->claimed_id = $claimed_id;
+
+        if ($to_match->local_id === null) {
+            return new Auth_OpenID_FailureResponse($endpoint,
+                         "Missing required field openid.identity");
+        }
+
+        $to_match_1_0 = $to_match->copy();
+        $to_match_1_0->type_uris = array(Auth_OpenID_TYPE_1_0);
+
+        if ($endpoint !== null) {
+            $result = $this->_verifyDiscoverySingle($endpoint, $to_match);
+
+            if (is_a($result, 'Auth_OpenID_TypeURIMismatch')) {
+                $result = $this->_verifyDiscoverySingle($endpoint,
+                                                        $to_match_1_0);
+            }
+
+            if (Auth_OpenID::isFailure($result)) {
+                // oidutil.log("Error attempting to use stored
+                //             discovery information: " + str(e))
+                //             oidutil.log("Attempting discovery to
+                //             verify endpoint")
+            } else {
+                return $endpoint;
+            }
+        }
+
+        // Endpoint is either bad (failed verification) or None
+        return $this->_discoverAndVerify($to_match->claimed_id,
+                                         array($to_match, $to_match_1_0));
+    }
+
+    /**
+     * @access private
+     */
+    function _verifyDiscoverySingle($endpoint, $to_match)
+    {
+        // Every type URI that's in the to_match endpoint has to be
+        // present in the discovered endpoint.
+        foreach ($to_match->type_uris as $type_uri) {
+            if (!$endpoint->usesExtension($type_uri)) {
+                return new Auth_OpenID_TypeURIMismatch($endpoint,
+                             "Required type ".$type_uri." not present");
+            }
+        }
+
+        // Fragments do not influence discovery, so we can't compare a
+        // claimed identifier with a fragment to discovered
+        // information.
+        list($defragged_claimed_id, $_) =
+            Auth_OpenID::urldefrag($to_match->claimed_id);
+
+        if ($defragged_claimed_id != $endpoint->claimed_id) {
+            return new Auth_OpenID_FailureResponse($endpoint,
+              sprintf('Claimed ID does not match (different subjects!), ' .
+                      'Expected %s, got %s', $defragged_claimed_id,
+                      $endpoint->claimed_id));
+        }
+
+        if ($to_match->getLocalID() != $endpoint->getLocalID()) {
+            return new Auth_OpenID_FailureResponse($endpoint,
+              sprintf('local_id mismatch. Expected %s, got %s',
+                      $to_match->getLocalID(), $endpoint->getLocalID()));
+        }
+
+        // If the server URL is None, this must be an OpenID 1
+        // response, because op_endpoint is a required parameter in
+        // OpenID 2. In that case, we don't actually care what the
+        // discovered server_url is, because signature checking or
+        // check_auth should take care of that check for us.
+        if ($to_match->server_url === null) {
+            if ($to_match->preferredNamespace() != Auth_OpenID_OPENID1_NS) {
+                return new Auth_OpenID_FailureResponse($endpoint,
+                             "Preferred namespace mismatch (bug)");
+            }
+        } else if ($to_match->server_url != $endpoint->server_url) {
+            return new Auth_OpenID_FailureResponse($endpoint,
+              sprintf('OP Endpoint mismatch. Expected %s, got %s',
+                      $to_match->server_url, $endpoint->server_url));
+        }
+
+        return null;
+    }
+
+    /**
+     * @access private
+     */
+    function _verifyDiscoveryResultsOpenID2($message, $endpoint)
+    {
+        $to_match = new Auth_OpenID_ServiceEndpoint();
+        $to_match->type_uris = array(Auth_OpenID_TYPE_2_0);
+        $to_match->claimed_id = $message->getArg(Auth_OpenID_OPENID2_NS,
+                                                 'claimed_id');
+
+        $to_match->local_id = $message->getArg(Auth_OpenID_OPENID2_NS,
+                                                'identity');
+
+        $to_match->server_url = $message->getArg(Auth_OpenID_OPENID2_NS,
+                                                 'op_endpoint');
+
+        if ($to_match->server_url === null) {
+            return new Auth_OpenID_FailureResponse($endpoint,
+                         "OP Endpoint URL missing");
+        }
+
+        // claimed_id and identifier must both be present or both be
+        // absent
+        if (($to_match->claimed_id === null) &&
+            ($to_match->local_id !== null)) {
+            return new Auth_OpenID_FailureResponse($endpoint,
+              'openid.identity is present without openid.claimed_id');
+        }
+
+        if (($to_match->claimed_id !== null) &&
+            ($to_match->local_id === null)) {
+            return new Auth_OpenID_FailureResponse($endpoint,
+              'openid.claimed_id is present without openid.identity');
+        }
+
+        if ($to_match->claimed_id === null) {
+            // This is a response without identifiers, so there's
+            // really no checking that we can do, so return an
+            // endpoint that's for the specified `openid.op_endpoint'
+            return Auth_OpenID_ServiceEndpoint::fromOPEndpointURL(
+                                                $to_match->server_url);
+        }
+
+        if (!$endpoint) {
+            // The claimed ID doesn't match, so we have to do
+            // discovery again. This covers not using sessions, OP
+            // identifier endpoints and responses that didn't match
+            // the original request.
+            // oidutil.log('No pre-discovered information supplied.')
+            return $this->_discoverAndVerify($to_match->claimed_id,
+                                             array($to_match));
+        } else {
+
+            // The claimed ID matches, so we use the endpoint that we
+            // discovered in initiation. This should be the most
+            // common case.
+            $result = $this->_verifyDiscoverySingle($endpoint, $to_match);
+
+            if (Auth_OpenID::isFailure($result)) {
+                $endpoint = $this->_discoverAndVerify($to_match->claimed_id,
+                                                      array($to_match));
+                if (Auth_OpenID::isFailure($endpoint)) {
+                    return $endpoint;
+                }
+            }
+        }
+
+        // The endpoint we return should have the claimed ID from the
+        // message we just verified, fragment and all.
+        if ($endpoint->claimed_id != $to_match->claimed_id) {
+            $endpoint->claimed_id = $to_match->claimed_id;
+        }
+
+        return $endpoint;
+    }
+
+    /**
+     * @access private
+     */
+    function _discoverAndVerify($claimed_id, $to_match_endpoints)
+    {
+        // oidutil.log('Performing discovery on %s' % (claimed_id,))
+        list($unused, $services) = call_user_func($this->discoverMethod,
+                                                  $claimed_id,
+                                                  &$this->fetcher);
+
+        if (!$services) {
+            return new Auth_OpenID_FailureResponse(null,
+              sprintf("No OpenID information found at %s",
+                      $claimed_id));
+        }
+
+        return $this->_verifyDiscoveryServices($claimed_id, $services,
+                                               $to_match_endpoints);
+    }
+
+    /**
+     * @access private
+     */
+    function _verifyDiscoveryServices($claimed_id, 
+                                      $services, $to_match_endpoints)
+    {
+        // Search the services resulting from discovery to find one
+        // that matches the information from the assertion
+
+        foreach ($services as $endpoint) {
+            foreach ($to_match_endpoints as $to_match_endpoint) {
+                $result = $this->_verifyDiscoverySingle($endpoint, 
+                                                        $to_match_endpoint);
+
+                if (!Auth_OpenID::isFailure($result)) {
+                    // It matches, so discover verification has
+                    // succeeded. Return this endpoint.
+                    return $endpoint;
+                }
+            }
+        }
+
+        return new Auth_OpenID_FailureResponse(null,
+          sprintf('No matching endpoint found after discovering %s: %s',
+                  $claimed_id, $result->message));
+    }
+
+    /**
+     * Extract the nonce from an OpenID 1 response.  Return the nonce
+     * from the BARE_NS since we independently check the return_to
+     * arguments are the same as those in the response message.
+     *
+     * See the openid1_nonce_query_arg_name class variable
+     *
+     * @returns $nonce The nonce as a string or null
+     *
+     * @access private
+     */
+    function _idResGetNonceOpenID1($message, $endpoint)
+    {
+        return $message->getArg(Auth_OpenID_BARE_NS,
+                                $this->openid1_nonce_query_arg_name);
+    }
+
+    /**
+     * @access private
+     */
+    function _idResCheckNonce($message, $endpoint)
+    {
+        if ($message->isOpenID1()) {
+            // This indicates that the nonce was generated by the consumer
+            $nonce = $this->_idResGetNonceOpenID1($message, $endpoint);
+            $server_url = '';
+        } else {
+            $nonce = $message->getArg(Auth_OpenID_OPENID2_NS,
+                                      'response_nonce');
+
+            $server_url = $endpoint->server_url;
+        }
+
+        if ($nonce === null) {
+            return new Auth_OpenID_FailureResponse($endpoint,
+                                     "Nonce missing from response");
+        }
+
+        $parts = Auth_OpenID_splitNonce($nonce);
+
+        if ($parts === null) {
+            return new Auth_OpenID_FailureResponse($endpoint,
+                                     "Malformed nonce in response");
+        }
+
+        list($timestamp, $salt) = $parts;
+
+        if (!$this->store->useNonce($server_url, $timestamp, $salt)) {
+            return new Auth_OpenID_FailureResponse($endpoint,
+                         "Nonce already used or out of range");
+        }
+
+        return null;
+    }
+
+    /**
+     * @access private
+     */
+    function _idResCheckForFields($message)
+    {
+        $basic_fields = array('return_to', 'assoc_handle', 'sig', 'signed');
+        $basic_sig_fields = array('return_to', 'identity');
+
+        $require_fields = array(
+            Auth_OpenID_OPENID2_NS => array_merge($basic_fields,
+                                                  array('op_endpoint')),
+
+            Auth_OpenID_OPENID1_NS => array_merge($basic_fields,
+                                                  array('identity'))
+            );
+
+        $require_sigs = array(
+            Auth_OpenID_OPENID2_NS => array_merge($basic_sig_fields,
+                                                  array('response_nonce',
+                                                        'claimed_id',
+                                                        'assoc_handle',
+                                                        'op_endpoint')),
+            Auth_OpenID_OPENID1_NS => array_merge($basic_sig_fields,
+                                                  array('nonce'))
+            );
+
+        foreach ($require_fields[$message->getOpenIDNamespace()] as $field) {
+            if (!$message->hasKey(Auth_OpenID_OPENID_NS, $field)) {
+                return new Auth_OpenID_FailureResponse(null,
+                             "Missing required field '".$field."'");
+            }
+        }
+
+        $signed_list_str = $message->getArg(Auth_OpenID_OPENID_NS,
+                                            'signed',
+                                            Auth_OpenID_NO_DEFAULT);
+        if (Auth_OpenID::isFailure($signed_list_str)) {
+            return $signed_list_str;
+        }
+        $signed_list = explode(',', $signed_list_str);
+
+        foreach ($require_sigs[$message->getOpenIDNamespace()] as $field) {
+            // Field is present and not in signed list
+            if ($message->hasKey(Auth_OpenID_OPENID_NS, $field) &&
+                (!in_array($field, $signed_list))) {
+                return new Auth_OpenID_FailureResponse(null,
+                             "'".$field."' not signed");
+            }
+        }
+
+        return null;
+    }
+
+    /**
+     * @access private
+     */
+    function _checkAuth($message, $server_url)
+    {
+        $request = $this->_createCheckAuthRequest($message);
+        if ($request === null) {
+            return false;
+        }
+
+        $resp_message = $this->_makeKVPost($request, $server_url);
+        if (($resp_message === null) ||
+            (is_a($resp_message, 'Auth_OpenID_ServerErrorContainer'))) {
+            return false;
+        }
+
+        return $this->_processCheckAuthResponse($resp_message, $server_url);
+    }
+
+    /**
+     * @access private
+     */
+    function _createCheckAuthRequest($message)
+    {
+        $signed = $message->getArg(Auth_OpenID_OPENID_NS, 'signed');
+        if ($signed) {
+            foreach (explode(',', $signed) as $k) {
+                $value = $message->getAliasedArg($k);
+                if ($value === null) {
+                    return null;
+                }
+            }
+        }
+        $ca_message = $message->copy();
+        $ca_message->setArg(Auth_OpenID_OPENID_NS, 'mode', 
+                            'check_authentication');
+        return $ca_message;
+    }
+
+    /**
+     * @access private
+     */
+    function _processCheckAuthResponse($response, $server_url)
+    {
+        $is_valid = $response->getArg(Auth_OpenID_OPENID_NS, 'is_valid',
+                                      'false');
+
+        $invalidate_handle = $response->getArg(Auth_OpenID_OPENID_NS,
+                                               'invalidate_handle');
+
+        if ($invalidate_handle !== null) {
+            $this->store->removeAssociation($server_url,
+                                            $invalidate_handle);
+        }
+
+        if ($is_valid == 'true') {
+            return true;
+        }
+
+        return false;
+    }
+
+    /**
+     * Adapt a POST response to a Message.
+     *
+     * @param $response Result of a POST to an OpenID endpoint.
+     *
+     * @access private
+     */
+    static function _httpResponseToMessage($response, $server_url)
+    {
+        // Should this function be named Message.fromHTTPResponse instead?
+        $response_message = Auth_OpenID_Message::fromKVForm($response->body);
+
+        if ($response->status == 400) {
+            return Auth_OpenID_ServerErrorContainer::fromMessage(
+                        $response_message);
+        } else if ($response->status != 200 and $response->status != 206) {
+            return null;
+        }
+
+        return $response_message;
+    }
+
+    /**
+     * @access private
+     */
+    function _makeKVPost($message, $server_url)
+    {
+        $body = $message->toURLEncoded();
+        $resp = $this->fetcher->post($server_url, $body);
+
+        if ($resp === null) {
+            return null;
+        }
+
+        return $this->_httpResponseToMessage($resp, $server_url);
+    }
+
+    /**
+     * @access private
+     */
+    function _getAssociation($endpoint)
+    {
+        if (!$this->_use_assocs) {
+            return null;
+        }
+
+        $assoc = $this->store->getAssociation($endpoint->server_url);
+
+        if (($assoc === null) ||
+            ($assoc->getExpiresIn() <= 0)) {
+
+            $assoc = $this->_negotiateAssociation($endpoint);
+
+            if ($assoc !== null) {
+                $this->store->storeAssociation($endpoint->server_url,
+                                               $assoc);
+            }
+        }
+
+        return $assoc;
+    }
+
+    /**
+     * Handle ServerErrors resulting from association requests.
+     *
+     * @return $result If server replied with an C{unsupported-type}
+     * error, return a tuple of supported C{association_type},
+     * C{session_type}.  Otherwise logs the error and returns null.
+     *
+     * @access private
+     */
+    function _extractSupportedAssociationType($server_error, $endpoint,
+                                              $assoc_type)
+    {
+        // Any error message whose code is not 'unsupported-type'
+        // should be considered a total failure.
+        if (($server_error->error_code != 'unsupported-type') ||
+            ($server_error->message->isOpenID1())) {
+            return null;
+        }
+
+        // The server didn't like the association/session type that we
+        // sent, and it sent us back a message that might tell us how
+        // to handle it.
+
+        // Extract the session_type and assoc_type from the error
+        // message
+        $assoc_type = $server_error->message->getArg(Auth_OpenID_OPENID_NS,
+                                                     'assoc_type');
+
+        $session_type = $server_error->message->getArg(Auth_OpenID_OPENID_NS,
+                                                       'session_type');
+
+        if (($assoc_type === null) || ($session_type === null)) {
+            return null;
+        } else if (!$this->negotiator->isAllowed($assoc_type,
+                                                 $session_type)) {
+            return null;
+        } else {
+          return array($assoc_type, $session_type);
+        }
+    }
+
+    /**
+     * @access private
+     */
+    function _negotiateAssociation($endpoint)
+    {
+        // Get our preferred session/association type from the negotiatior.
+        list($assoc_type, $session_type) = $this->negotiator->getAllowedType();
+
+        $assoc = $this->_requestAssociation(
+                           $endpoint, $assoc_type, $session_type);
+
+        if (Auth_OpenID::isFailure($assoc)) {
+            return null;
+        }
+
+        if (is_a($assoc, 'Auth_OpenID_ServerErrorContainer')) {
+            $why = $assoc;
+
+            $supportedTypes = $this->_extractSupportedAssociationType(
+                                     $why, $endpoint, $assoc_type);
+
+            if ($supportedTypes !== null) {
+                list($assoc_type, $session_type) = $supportedTypes;
+
+                // Attempt to create an association from the assoc_type
+                // and session_type that the server told us it
+                // supported.
+                $assoc = $this->_requestAssociation(
+                                   $endpoint, $assoc_type, $session_type);
+
+                if (is_a($assoc, 'Auth_OpenID_ServerErrorContainer')) {
+                    // Do not keep trying, since it rejected the
+                    // association type that it told us to use.
+                    // oidutil.log('Server %s refused its suggested association
+                    //             'type: session_type=%s, assoc_type=%s'
+                    //             % (endpoint.server_url, session_type,
+                    //                assoc_type))
+                    return null;
+                } else {
+                    return $assoc;
+                }
+            } else {
+                return null;
+            }
+        } else {
+            return $assoc;
+        }
+    }
+
+    /**
+     * @access private
+     */
+    function _requestAssociation($endpoint, $assoc_type, $session_type)
+    {
+        list($assoc_session, $args) = $this->_createAssociateRequest(
+                                      $endpoint, $assoc_type, $session_type);
+
+        $response_message = $this->_makeKVPost($args, $endpoint->server_url);
+
+        if ($response_message === null) {
+            // oidutil.log('openid.associate request failed: %s' % (why[0],))
+            return null;
+        } else if (is_a($response_message,
+                        'Auth_OpenID_ServerErrorContainer')) {
+            return $response_message;
+        }
+
+        return $this->_extractAssociation($response_message, $assoc_session);
+    }
+
+    /**
+     * @access private
+     */
+    function _extractAssociation($assoc_response, $assoc_session)
+    {
+        // Extract the common fields from the response, raising an
+        // exception if they are not found
+        $assoc_type = $assoc_response->getArg(
+                         Auth_OpenID_OPENID_NS, 'assoc_type',
+                         Auth_OpenID_NO_DEFAULT);
+
+        if (Auth_OpenID::isFailure($assoc_type)) {
+            return $assoc_type;
+        }
+
+        $assoc_handle = $assoc_response->getArg(
+                           Auth_OpenID_OPENID_NS, 'assoc_handle',
+                           Auth_OpenID_NO_DEFAULT);
+
+        if (Auth_OpenID::isFailure($assoc_handle)) {
+            return $assoc_handle;
+        }
+
+        // expires_in is a base-10 string. The Python parsing will
+        // accept literals that have whitespace around them and will
+        // accept negative values. Neither of these are really in-spec,
+        // but we think it's OK to accept them.
+        $expires_in_str = $assoc_response->getArg(
+                             Auth_OpenID_OPENID_NS, 'expires_in',
+                             Auth_OpenID_NO_DEFAULT);
+
+        if (Auth_OpenID::isFailure($expires_in_str)) {
+            return $expires_in_str;
+        }
+
+        $expires_in = Auth_OpenID::intval($expires_in_str);
+        if ($expires_in === false) {
+            
+            $err = sprintf("Could not parse expires_in from association ".
+                           "response %s", print_r($assoc_response, true));
+            return new Auth_OpenID_FailureResponse(null, $err);
+        }
+
+        // OpenID 1 has funny association session behaviour.
+        if ($assoc_response->isOpenID1()) {
+            $session_type = $this->_getOpenID1SessionType($assoc_response);
+        } else {
+            $session_type = $assoc_response->getArg(
+                               Auth_OpenID_OPENID2_NS, 'session_type',
+                               Auth_OpenID_NO_DEFAULT);
+
+            if (Auth_OpenID::isFailure($session_type)) {
+                return $session_type;
+            }
+        }
+
+        // Session type mismatch
+        if ($assoc_session->session_type != $session_type) {
+            if ($assoc_response->isOpenID1() &&
+                ($session_type == 'no-encryption')) {
+                // In OpenID 1, any association request can result in
+                // a 'no-encryption' association response. Setting
+                // assoc_session to a new no-encryption session should
+                // make the rest of this function work properly for
+                // that case.
+                $assoc_session = new Auth_OpenID_PlainTextConsumerSession();
+            } else {
+                // Any other mismatch, regardless of protocol version
+                // results in the failure of the association session
+                // altogether.
+                return null;
+            }
+        }
+
+        // Make sure assoc_type is valid for session_type
+        if (!in_array($assoc_type, $assoc_session->allowed_assoc_types)) {
+            return null;
+        }
+
+        // Delegate to the association session to extract the secret
+        // from the response, however is appropriate for that session
+        // type.
+        $secret = $assoc_session->extractSecret($assoc_response);
+
+        if ($secret === null) {
+            return null;
+        }
+
+        return Auth_OpenID_Association::fromExpiresIn(
+                 $expires_in, $assoc_handle, $secret, $assoc_type);
+    }
+
+    /**
+     * @access private
+     */
+    function _createAssociateRequest($endpoint, $assoc_type, $session_type)
+    {
+        if (array_key_exists($session_type, $this->session_types)) {
+            $session_type_class = $this->session_types[$session_type];
+
+            if (is_callable($session_type_class)) {
+                $assoc_session = $session_type_class();
+            } else {
+                $assoc_session = new $session_type_class();
+            }
+        } else {
+            return null;
+        }
+
+        $args = array(
+            'mode' => 'associate',
+            'assoc_type' => $assoc_type);
+
+        if (!$endpoint->compatibilityMode()) {
+            $args['ns'] = Auth_OpenID_OPENID2_NS;
+        }
+
+        // Leave out the session type if we're in compatibility mode
+        // *and* it's no-encryption.
+        if ((!$endpoint->compatibilityMode()) ||
+            ($assoc_session->session_type != 'no-encryption')) {
+            $args['session_type'] = $assoc_session->session_type;
+        }
+
+        $args = array_merge($args, $assoc_session->getRequest());
+        $message = Auth_OpenID_Message::fromOpenIDArgs($args);
+        return array($assoc_session, $message);
+    }
+
+    /**
+     * Given an association response message, extract the OpenID 1.X
+     * session type.
+     *
+     * This function mostly takes care of the 'no-encryption' default
+     * behavior in OpenID 1.
+     *
+     * If the association type is plain-text, this function will
+     * return 'no-encryption'
+     *
+     * @access private
+     * @return $typ The association type for this message
+     */
+    function _getOpenID1SessionType($assoc_response)
+    {
+        // If it's an OpenID 1 message, allow session_type to default
+        // to None (which signifies "no-encryption")
+        $session_type = $assoc_response->getArg(Auth_OpenID_OPENID1_NS,
+                                                'session_type');
+
+        // Handle the differences between no-encryption association
+        // respones in OpenID 1 and 2:
+
+        // no-encryption is not really a valid session type for OpenID
+        // 1, but we'll accept it anyway, while issuing a warning.
+        if ($session_type == 'no-encryption') {
+            // oidutil.log('WARNING: OpenID server sent "no-encryption"'
+            //             'for OpenID 1.X')
+        } else if (($session_type == '') || ($session_type === null)) {
+            // Missing or empty session type is the way to flag a
+            // 'no-encryption' response. Change the session type to
+            // 'no-encryption' so that it can be handled in the same
+            // way as OpenID 2 'no-encryption' respones.
+            $session_type = 'no-encryption';
+        }
+
+        return $session_type;
+    }
+}
+
+/**
+ * This class represents an authentication request from a consumer to
+ * an OpenID server.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_AuthRequest {
+
+    /**
+     * Initialize an authentication request with the specified token,
+     * association, and endpoint.
+     *
+     * Users of this library should not create instances of this
+     * class.  Instances of this class are created by the library when
+     * needed.
+     */
+    function Auth_OpenID_AuthRequest($endpoint, $assoc)
+    {
+        $this->assoc = $assoc;
+        $this->endpoint = $endpoint;
+        $this->return_to_args = array();
+        $this->message = new Auth_OpenID_Message(
+            $endpoint->preferredNamespace());
+        $this->_anonymous = false;
+    }
+
+    /**
+     * Add an extension to this checkid request.
+     *
+     * $extension_request: An object that implements the extension
+     * request interface for adding arguments to an OpenID message.
+     */
+    function addExtension($extension_request)
+    {
+        $extension_request->toMessage($this->message);
+    }
+
+    /**
+     * Add an extension argument to this OpenID authentication
+     * request.
+     *
+     * Use caution when adding arguments, because they will be
+     * URL-escaped and appended to the redirect URL, which can easily
+     * get quite long.
+     *
+     * @param string $namespace The namespace for the extension. For
+     * example, the simple registration extension uses the namespace
+     * 'sreg'.
+     *
+     * @param string $key The key within the extension namespace. For
+     * example, the nickname field in the simple registration
+     * extension's key is 'nickname'.
+     *
+     * @param string $value The value to provide to the server for
+     * this argument.
+     */
+    function addExtensionArg($namespace, $key, $value)
+    {
+        return $this->message->setArg($namespace, $key, $value);
+    }
+
+    /**
+     * Set whether this request should be made anonymously. If a
+     * request is anonymous, the identifier will not be sent in the
+     * request. This is only useful if you are making another kind of
+     * request with an extension in this request.
+     *
+     * Anonymous requests are not allowed when the request is made
+     * with OpenID 1.
+     */
+    function setAnonymous($is_anonymous)
+    {
+        if ($is_anonymous && $this->message->isOpenID1()) {
+            return false;
+        } else {
+            $this->_anonymous = $is_anonymous;
+            return true;
+        }
+    }
+
+    /**
+     * Produce a {@link Auth_OpenID_Message} representing this
+     * request.
+     *
+     * @param string $realm The URL (or URL pattern) that identifies
+     * your web site to the user when she is authorizing it.
+     *
+     * @param string $return_to The URL that the OpenID provider will
+     * send the user back to after attempting to verify her identity.
+     *
+     * Not specifying a return_to URL means that the user will not be
+     * returned to the site issuing the request upon its completion.
+     *
+     * @param bool $immediate If true, the OpenID provider is to send
+     * back a response immediately, useful for behind-the-scenes
+     * authentication attempts.  Otherwise the OpenID provider may
+     * engage the user before providing a response.  This is the
+     * default case, as the user may need to provide credentials or
+     * approve the request before a positive response can be sent.
+     */
+    function getMessage($realm, $return_to=null, $immediate=false)
+    {
+        if ($return_to) {
+            $return_to = Auth_OpenID::appendArgs($return_to,
+                                                 $this->return_to_args);
+        } else if ($immediate) {
+            // raise ValueError(
+            //     '"return_to" is mandatory when
+            //using "checkid_immediate"')
+            return new Auth_OpenID_FailureResponse(null,
+              "'return_to' is mandatory when using checkid_immediate");
+        } else if ($this->message->isOpenID1()) {
+            // raise ValueError('"return_to" is
+            // mandatory for OpenID 1 requests')
+            return new Auth_OpenID_FailureResponse(null,
+              "'return_to' is mandatory for OpenID 1 requests");
+        } else if ($this->return_to_args) {
+            // raise ValueError('extra "return_to" arguments
+            // were specified, but no return_to was specified')
+            return new Auth_OpenID_FailureResponse(null,
+              "extra 'return_to' arguments where specified, " .
+              "but no return_to was specified");
+        }
+
+        if ($immediate) {
+            $mode = 'checkid_immediate';
+        } else {
+            $mode = 'checkid_setup';
+        }
+
+        $message = $this->message->copy();
+        if ($message->isOpenID1()) {
+            $realm_key = 'trust_root';
+        } else {
+            $realm_key = 'realm';
+        }
+
+        $message->updateArgs(Auth_OpenID_OPENID_NS,
+                             array(
+                                   $realm_key => $realm,
+                                   'mode' => $mode,
+                                   'return_to' => $return_to));
+
+        if (!$this->_anonymous) {
+            if ($this->endpoint->isOPIdentifier()) {
+                // This will never happen when we're in compatibility
+                // mode, as long as isOPIdentifier() returns False
+                // whenever preferredNamespace() returns OPENID1_NS.
+                $claimed_id = $request_identity =
+                    Auth_OpenID_IDENTIFIER_SELECT;
+            } else {
+                $request_identity = $this->endpoint->getLocalID();
+                $claimed_id = $this->endpoint->claimed_id;
+            }
+
+            // This is true for both OpenID 1 and 2
+            $message->setArg(Auth_OpenID_OPENID_NS, 'identity',
+                             $request_identity);
+
+            if ($message->isOpenID2()) {
+                $message->setArg(Auth_OpenID_OPENID2_NS, 'claimed_id',
+                                 $claimed_id);
+            }
+        }
+
+        if ($this->assoc) {
+            $message->setArg(Auth_OpenID_OPENID_NS, 'assoc_handle',
+                             $this->assoc->handle);
+        }
+
+        return $message;
+    }
+
+    function redirectURL($realm, $return_to = null,
+                         $immediate = false)
+    {
+        $message = $this->getMessage($realm, $return_to, $immediate);
+
+        if (Auth_OpenID::isFailure($message)) {
+            return $message;
+        }
+
+        return $message->toURL($this->endpoint->server_url);
+    }
+
+    /**
+     * Get html for a form to submit this request to the IDP.
+     *
+     * form_tag_attrs: An array of attributes to be added to the form
+     * tag. 'accept-charset' and 'enctype' have defaults that can be
+     * overridden. If a value is supplied for 'action' or 'method', it
+     * will be replaced.
+     */
+    function formMarkup($realm, $return_to=null, $immediate=false,
+                        $form_tag_attrs=null)
+    {
+        $message = $this->getMessage($realm, $return_to, $immediate);
+
+        if (Auth_OpenID::isFailure($message)) {
+            return $message;
+        }
+
+        return $message->toFormMarkup($this->endpoint->server_url,
+                                      $form_tag_attrs);
+    }
+
+    /**
+     * Get a complete html document that will autosubmit the request
+     * to the IDP.
+     *
+     * Wraps formMarkup.  See the documentation for that function.
+     */
+    function htmlMarkup($realm, $return_to=null, $immediate=false,
+                        $form_tag_attrs=null)
+    {
+        $form = $this->formMarkup($realm, $return_to, $immediate, 
+                                  $form_tag_attrs);
+
+        if (Auth_OpenID::isFailure($form)) {
+            return $form;
+        }
+        return Auth_OpenID::autoSubmitHTML($form);
+    }
+
+    function shouldSendRedirect()
+    {
+        return $this->endpoint->compatibilityMode();
+    }
+}
+
+/**
+ * The base class for responses from the Auth_OpenID_Consumer.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_ConsumerResponse {
+    var $status = null;
+
+    function setEndpoint($endpoint)
+    {
+        $this->endpoint = $endpoint;
+        if ($endpoint === null) {
+            $this->identity_url = null;
+        } else {
+            $this->identity_url = $endpoint->claimed_id;
+        }
+    }
+
+    /**
+     * Return the display identifier for this response.
+     *
+     * The display identifier is related to the Claimed Identifier, but the
+     * two are not always identical.  The display identifier is something the
+     * user should recognize as what they entered, whereas the response's
+     * claimed identifier (in the identity_url attribute) may have extra
+     * information for better persistence.
+     *
+     * URLs will be stripped of their fragments for display.  XRIs will
+     * display the human-readable identifier (i-name) instead of the
+     * persistent identifier (i-number).
+     *
+     * Use the display identifier in your user interface.  Use
+     * identity_url for querying your database or authorization server.
+     *
+     */
+    function getDisplayIdentifier()
+    {
+        if ($this->endpoint !== null) {
+            return $this->endpoint->getDisplayIdentifier();
+        }
+        return null;
+    }
+}
+
+/**
+ * A response with a status of Auth_OpenID_SUCCESS. Indicates that
+ * this request is a successful acknowledgement from the OpenID server
+ * that the supplied URL is, indeed controlled by the requesting
+ * agent.  This has three relevant attributes:
+ *
+ * claimed_id - The identity URL that has been authenticated
+ *
+ * signed_args - The arguments in the server's response that were
+ * signed and verified.
+ *
+ * status - Auth_OpenID_SUCCESS.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_SuccessResponse extends Auth_OpenID_ConsumerResponse {
+    var $status = Auth_OpenID_SUCCESS;
+
+    /**
+     * @access private
+     */
+    function Auth_OpenID_SuccessResponse($endpoint, $message, $signed_args=null)
+    {
+        $this->endpoint = $endpoint;
+        $this->identity_url = $endpoint->claimed_id;
+        $this->signed_args = $signed_args;
+        $this->message = $message;
+
+        if ($this->signed_args === null) {
+            $this->signed_args = array();
+        }
+    }
+
+    /**
+     * Extract signed extension data from the server's response.
+     *
+     * @param string $prefix The extension namespace from which to
+     * extract the extension data.
+     */
+    function extensionResponse($namespace_uri, $require_signed)
+    {
+        if ($require_signed) {
+            return $this->getSignedNS($namespace_uri);
+        } else {
+            return $this->message->getArgs($namespace_uri);
+        }
+    }
+
+    function isOpenID1()
+    {
+        return $this->message->isOpenID1();
+    }
+
+    function isSigned($ns_uri, $ns_key)
+    {
+        // Return whether a particular key is signed, regardless of
+        // its namespace alias
+        return in_array($this->message->getKey($ns_uri, $ns_key),
+                        $this->signed_args);
+    }
+
+    function getSigned($ns_uri, $ns_key, $default = null)
+    {
+        // Return the specified signed field if available, otherwise
+        // return default
+        if ($this->isSigned($ns_uri, $ns_key)) {
+            return $this->message->getArg($ns_uri, $ns_key, $default);
+        } else {
+            return $default;
+        }
+    }
+
+    function getSignedNS($ns_uri)
+    {
+        $args = array();
+
+        $msg_args = $this->message->getArgs($ns_uri);
+        if (Auth_OpenID::isFailure($msg_args)) {
+            return null;
+        }
+
+        foreach ($msg_args as $key => $value) {
+            if (!$this->isSigned($ns_uri, $key)) {
+                unset($msg_args[$key]);
+            }
+        }
+
+        return $msg_args;
+    }
+
+    /**
+     * Get the openid.return_to argument from this response.
+     *
+     * This is useful for verifying that this request was initiated by
+     * this consumer.
+     *
+     * @return string $return_to The return_to URL supplied to the
+     * server on the initial request, or null if the response did not
+     * contain an 'openid.return_to' argument.
+    */
+    function getReturnTo()
+    {
+        return $this->getSigned(Auth_OpenID_OPENID_NS, 'return_to');
+    }
+}
+
+/**
+ * A response with a status of Auth_OpenID_FAILURE. Indicates that the
+ * OpenID protocol has failed. This could be locally or remotely
+ * triggered.  This has three relevant attributes:
+ *
+ * claimed_id - The identity URL for which authentication was
+ * attempted, if it can be determined.  Otherwise, null.
+ *
+ * message - A message indicating why the request failed, if one is
+ * supplied.  Otherwise, null.
+ *
+ * status - Auth_OpenID_FAILURE.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_FailureResponse extends Auth_OpenID_ConsumerResponse {
+    var $status = Auth_OpenID_FAILURE;
+
+    function Auth_OpenID_FailureResponse($endpoint, $message = null,
+                                         $contact = null, $reference = null)
+    {
+        $this->setEndpoint($endpoint);
+        $this->message = $message;
+        $this->contact = $contact;
+        $this->reference = $reference;
+    }
+}
+
+/**
+ * A specific, internal failure used to detect type URI mismatch.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_TypeURIMismatch extends Auth_OpenID_FailureResponse {
+}
+
+/**
+ * Exception that is raised when the server returns a 400 response
+ * code to a direct request.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_ServerErrorContainer {
+    function Auth_OpenID_ServerErrorContainer($error_text,
+                                              $error_code,
+                                              $message)
+    {
+        $this->error_text = $error_text;
+        $this->error_code = $error_code;
+        $this->message = $message;
+    }
+
+    /**
+     * @access private
+     */
+    static function fromMessage($message)
+    {
+        $error_text = $message->getArg(
+           Auth_OpenID_OPENID_NS, 'error', '<no error message supplied>');
+        $error_code = $message->getArg(Auth_OpenID_OPENID_NS, 'error_code');
+        return new Auth_OpenID_ServerErrorContainer($error_text,
+                                                    $error_code,
+                                                    $message);
+    }
+}
+
+/**
+ * A response with a status of Auth_OpenID_CANCEL. Indicates that the
+ * user cancelled the OpenID authentication request.  This has two
+ * relevant attributes:
+ *
+ * claimed_id - The identity URL for which authentication was
+ * attempted, if it can be determined.  Otherwise, null.
+ *
+ * status - Auth_OpenID_SUCCESS.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_CancelResponse extends Auth_OpenID_ConsumerResponse {
+    var $status = Auth_OpenID_CANCEL;
+
+    function Auth_OpenID_CancelResponse($endpoint)
+    {
+        $this->setEndpoint($endpoint);
+    }
+}
+
+/**
+ * A response with a status of Auth_OpenID_SETUP_NEEDED. Indicates
+ * that the request was in immediate mode, and the server is unable to
+ * authenticate the user without further interaction.
+ *
+ * claimed_id - The identity URL for which authentication was
+ * attempted.
+ *
+ * setup_url - A URL that can be used to send the user to the server
+ * to set up for authentication. The user should be redirected in to
+ * the setup_url, either in the current window or in a new browser
+ * window.  Null in OpenID 2.
+ *
+ * status - Auth_OpenID_SETUP_NEEDED.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_SetupNeededResponse extends Auth_OpenID_ConsumerResponse {
+    var $status = Auth_OpenID_SETUP_NEEDED;
+
+    function Auth_OpenID_SetupNeededResponse($endpoint,
+                                             $setup_url = null)
+    {
+        $this->setEndpoint($endpoint);
+        $this->setup_url = $setup_url;
+    }
+}
+
+
+

--- /dev/null
+++ b/lib/openid-php/Auth/OpenID/CryptUtil.php
@@ -1,1 +1,123 @@
+<?php
 
+/**
+ * CryptUtil: A suite of wrapper utility functions for the OpenID
+ * library.
+ *
+ * PHP versions 4 and 5
+ *
+ * LICENSE: See the COPYING file included in this distribution.
+ *
+ * @access private
+ * @package OpenID
+ * @author JanRain, Inc. <openid@janrain.com>
+ * @copyright 2005-2008 Janrain, Inc.
+ * @license http://www.apache.org/licenses/LICENSE-2.0 Apache
+ */
+
+if (!defined('Auth_OpenID_RAND_SOURCE')) {
+    /**
+     * The filename for a source of random bytes. Define this yourself
+     * if you have a different source of randomness.
+     */
+    define('Auth_OpenID_RAND_SOURCE', '/dev/urandom');
+}
+
+class Auth_OpenID_CryptUtil {
+    /**
+     * Get the specified number of random bytes.
+     *
+     * Attempts to use a cryptographically secure (not predictable)
+     * source of randomness if available. If there is no high-entropy
+     * randomness source available, it will fail. As a last resort,
+     * for non-critical systems, define
+     * <code>Auth_OpenID_RAND_SOURCE</code> as <code>null</code>, and
+     * the code will fall back on a pseudo-random number generator.
+     *
+     * @param int $num_bytes The length of the return value
+     * @return string $bytes random bytes
+     */
+    static function getBytes($num_bytes)
+    {
+        static $f = null;
+        $bytes = '';
+        if ($f === null) {
+            if (Auth_OpenID_RAND_SOURCE === null) {
+                $f = false;
+            } else {
+                $f = @fopen(Auth_OpenID_RAND_SOURCE, "r");
+                /*if ($f === false) {
+                    $msg = 'Define Auth_OpenID_RAND_SOURCE as null to ' .
+                        ' continue with an insecure random number generator.';
+                    trigger_error($msg, E_USER_ERROR);
+                }*/
+            }
+        }
+        if ($f === false) {
+            // pseudorandom used
+            $bytes = '';
+            for ($i = 0; $i < $num_bytes; $i += 4) {
+                $bytes .= pack('L', mt_rand());
+            }
+            $bytes = substr($bytes, 0, $num_bytes);
+        } else {
+            $bytes = fread($f, $num_bytes);
+        }
+        return $bytes;
+    }
+
+    /**
+     * Produce a string of length random bytes, chosen from chrs.  If
+     * $chrs is null, the resulting string may contain any characters.
+     *
+     * @param integer $length The length of the resulting
+     * randomly-generated string
+     * @param string $chrs A string of characters from which to choose
+     * to build the new string
+     * @return string $result A string of randomly-chosen characters
+     * from $chrs
+     */
+    static function randomString($length, $population = null)
+    {
+        if ($population === null) {
+            return Auth_OpenID_CryptUtil::getBytes($length);
+        }
+
+        $popsize = strlen($population);
+
+        if ($popsize > 256) {
+            $msg = 'More than 256 characters supplied to ' . __FUNCTION__;
+            trigger_error($msg, E_USER_ERROR);
+        }
+
+        $duplicate = 256 % $popsize;
+
+        $str = "";
+        for ($i = 0; $i < $length; $i++) {
+            do {
+                $n = ord(Auth_OpenID_CryptUtil::getBytes(1));
+            } while ($n < $duplicate);
+
+            $n %= $popsize;
+            $str .= $population[$n];
+        }
+
+        return $str;
+    }
+
+    static function constEq($s1, $s2)
+    {
+        if (strlen($s1) != strlen($s2)) {
+            return false;
+        }
+
+        $result = true;
+        $length = strlen($s1);
+        for ($i = 0; $i < $length; $i++) {
+            $result &= ($s1[$i] == $s2[$i]);
+        }
+        return $result;
+    }
+}
+
+

--- /dev/null
+++ b/lib/openid-php/Auth/OpenID/DatabaseConnection.php
@@ -1,1 +1,131 @@
+<?php
 
+/**
+ * The Auth_OpenID_DatabaseConnection class, which is used to emulate
+ * a PEAR database connection.
+ *
+ * @package OpenID
+ * @author JanRain, Inc. <openid@janrain.com>
+ * @copyright 2005-2008 Janrain, Inc.
+ * @license http://www.apache.org/licenses/LICENSE-2.0 Apache
+ */
+
+/**
+ * An empty base class intended to emulate PEAR connection
+ * functionality in applications that supply their own database
+ * abstraction mechanisms.  See {@link Auth_OpenID_SQLStore} for more
+ * information.  You should subclass this class if you need to create
+ * an SQL store that needs to access its database using an
+ * application's database abstraction layer instead of a PEAR database
+ * connection.  Any subclass of Auth_OpenID_DatabaseConnection MUST
+ * adhere to the interface specified here.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_DatabaseConnection {
+    /**
+     * Sets auto-commit mode on this database connection.
+     *
+     * @param bool $mode True if auto-commit is to be used; false if
+     * not.
+     */
+    function autoCommit($mode)
+    {
+    }
+
+    /**
+     * Run an SQL query with the specified parameters, if any.
+     *
+     * @param string $sql An SQL string with placeholders.  The
+     * placeholders are assumed to be specific to the database engine
+     * for this connection.
+     *
+     * @param array $params An array of parameters to insert into the
+     * SQL string using this connection's escaping mechanism.
+     *
+     * @return mixed $result The result of calling this connection's
+     * internal query function.  The type of result depends on the
+     * underlying database engine.  This method is usually used when
+     * the result of a query is not important, like a DDL query.
+     */
+    function query($sql, $params = array())
+    {
+    }
+
+    /**
+     * Starts a transaction on this connection, if supported.
+     */
+    function begin()
+    {
+    }
+
+    /**
+     * Commits a transaction on this connection, if supported.
+     */
+    function commit()
+    {
+    }
+
+    /**
+     * Performs a rollback on this connection, if supported.
+     */
+    function rollback()
+    {
+    }
+
+    /**
+     * Run an SQL query and return the first column of the first row
+     * of the result set, if any.
+     *
+     * @param string $sql An SQL string with placeholders.  The
+     * placeholders are assumed to be specific to the database engine
+     * for this connection.
+     *
+     * @param array $params An array of parameters to insert into the
+     * SQL string using this connection's escaping mechanism.
+     *
+     * @return mixed $result The value of the first column of the
+     * first row of the result set.  False if no such result was
+     * found.
+     */
+    function getOne($sql, $params = array())
+    {
+    }
+
+    /**
+     * Run an SQL query and return the first row of the result set, if
+     * any.
+     *
+     * @param string $sql An SQL string with placeholders.  The
+     * placeholders are assumed to be specific to the database engine
+     * for this connection.
+     *
+     * @param array $params An array of parameters to insert into the
+     * SQL string using this connection's escaping mechanism.
+     *
+     * @return array $result The first row of the result set, if any,
+     * keyed on column name.  False if no such result was found.
+     */
+    function getRow($sql, $params = array())
+    {
+    }
+
+    /**
+     * Run an SQL query with the specified parameters, if any.
+     *
+     * @param string $sql An SQL string with placeholders.  The
+     * placeholders are assumed to be specific to the database engine
+     * for this connection.
+     *
+     * @param array $params An array of parameters to insert into the
+     * SQL string using this connection's escaping mechanism.
+     *
+     * @return array $result An array of arrays representing the
+     * result of the query; each array is keyed on column name.
+     */
+    function getAll($sql, $params = array())
+    {
+    }
+}
+
+

--- /dev/null
+++ b/lib/openid-php/Auth/OpenID/DiffieHellman.php
@@ -1,1 +1,114 @@
+<?php
 
+/**
+ * The OpenID library's Diffie-Hellman implementation.
+ *
+ * PHP versions 4 and 5
+ *
+ * LICENSE: See the COPYING file included in this distribution.
+ *
+ * @access private
+ * @package OpenID
+ * @author JanRain, Inc. <openid@janrain.com>
+ * @copyright 2005-2008 Janrain, Inc.
+ * @license http://www.apache.org/licenses/LICENSE-2.0 Apache
+ */
+
+require_once 'Auth/OpenID.php';
+require_once 'Auth/OpenID/BigMath.php';
+
+function Auth_OpenID_getDefaultMod()
+{
+    return '155172898181473697471232257763715539915724801'.
+        '966915404479707795314057629378541917580651227423'.
+        '698188993727816152646631438561595825688188889951'.
+        '272158842675419950341258706556549803580104870537'.
+        '681476726513255747040765857479291291572334510643'.
+        '245094715007229621094194349783925984760375594985'.
+        '848253359305585439638443';
+}
+
+function Auth_OpenID_getDefaultGen()
+{
+    return '2';
+}
+
+/**
+ * The Diffie-Hellman key exchange class.  This class relies on
+ * {@link Auth_OpenID_MathLibrary} to perform large number operations.
+ *
+ * @access private
+ * @package OpenID
+ */
+class Auth_OpenID_DiffieHellman {
+
+    var $mod;
+    var $gen;
+    var $private;
+    var $lib = null;
+
+    function Auth_OpenID_DiffieHellman($mod = null, $gen = null,
+                                       $private = null, $lib = null)
+    {
+        if ($lib === null) {
+            $this->lib = Auth_OpenID_getMathLib();
+        } else {
+            $this->lib = $lib;
+        }
+
+        if ($mod === null) {
+            $this->mod = $this->lib->init(Auth_OpenID_getDefaultMod());
+        } else {
+            $this->mod = $mod;
+        }
+
+        if ($gen === null) {
+            $this->gen = $this->lib->init(Auth_OpenID_getDefaultGen());
+        } else {
+            $this->gen = $gen;
+        }
+
+        if ($private === null) {
+            $r = $this->lib->rand($this->mod);
+            $this->private = $this->lib->add($r, 1);
+        } else {
+            $this->private = $private;
+        }
+
+        $this->public = $this->lib->powmod($this->gen, $this->private,
+                                           $this->mod);
+    }
+
+    function getSharedSecret($composite)
+    {
+        return $this->lib->powmod($composite, $this->private, $this->mod);
+    }
+
+    function getPublicKey()
+    {
+        return $this->public;
+    }
+
+    function usingDefaultValues()
+    {
+        return ($this->mod == Auth_OpenID_getDefaultMod() &&
+                $this->gen == Auth_OpenID_getDefaultGen());
+    }
+
+    function xorSecret($composite, $secret, $hash_func)
+    {
+        $dh_shared = $this->getSharedSecret($composite);
+        $dh_shared_str = $this->lib->longToBinary($dh_shared);
+        $hash_dh_shared = $hash_func($dh_shared_str);
+
+        $xsecret = "";
+        for ($i = 0; $i < Auth_OpenID::bytes($secret); $i++) {
+            $xsecret .= chr(ord($secret[$i]) ^ ord($hash_dh_shared[$i]));
+        }
+
+        return $xsecret;
+    }
+}
+
+
+

--- /dev/null
+++ b/lib/openid-php/Auth/OpenID/Discover.php
@@ -1,1 +1,607 @@
-
+<?php
+
+/**
+ * The OpenID and Yadis discovery implementation for OpenID 1.2.
+ */
+
+require_once "Auth/OpenID.php";
+require_once "Auth/OpenID/Parse.php";
+require_once "Auth/OpenID/Message.php";
+require_once "Auth/Yadis/XRIRes.php";
+require_once "Auth/Yadis/Yadis.php";
+
+// XML namespace value
+define('Auth_OpenID_XMLNS_1_0', 'http://openid.net/xmlns/1.0');
+
+// Yadis service types
+define('Auth_OpenID_TYPE_1_2', 'http://openid.net/signon/1.2');
+define('Auth_OpenID_TYPE_1_1', 'http://openid.net/signon/1.1');
+define('Auth_OpenID_TYPE_1_0', 'http://openid.net/signon/1.0');
+define('Auth_OpenID_TYPE_2_0_IDP', 'http://specs.openid.net/auth/2.0/server');
+define('Auth_OpenID_TYPE_2_0', 'http://specs.openid.net/auth/2.0/signon');
+define('Auth_OpenID_RP_RETURN_TO_URL_TYPE',
+       'http://specs.openid.net/auth/2.0/return_to');
+
+function Auth_OpenID_getOpenIDTypeURIs()
+{
+    return array(Auth_OpenID_TYPE_2_0_IDP,
+                 Auth_OpenID_TYPE_2_0,
+                 Auth_OpenID_TYPE_1_2,
+                 Auth_OpenID_TYPE_1_1,
+                 Auth_OpenID_TYPE_1_0);
+}
+
+function Auth_OpenID_getOpenIDConsumerTypeURIs()
+{
+    return array(Auth_OpenID_RP_RETURN_TO_URL_TYPE);
+}
+
+
+/*
+ * Provides a user-readable interpretation of a type uri.
+ * Useful for error messages.
+ */
+function Auth_OpenID_getOpenIDTypeName($type_uri) {
+    switch ($type_uri) {
+    case Auth_OpenID_TYPE_2_0_IDP:
+      return 'OpenID 2.0 IDP';
+    case Auth_OpenID_TYPE_2_0:
+      return 'OpenID 2.0';
+    case Auth_OpenID_TYPE_1_2:
+      return 'OpenID 1.2';
+    case Auth_OpenID_TYPE_1_1:
+      return 'OpenID 1.1';
+    case Auth_OpenID_TYPE_1_0:
+      return 'OpenID 1.0';
+    case Auth_OpenID_RP_RETURN_TO_URL_TYPE:
+      return 'OpenID relying party';
+    }
+}
+
+/**
+ * Object representing an OpenID service endpoint.
+ */
+class Auth_OpenID_ServiceEndpoint {
+    function Auth_OpenID_ServiceEndpoint()
+    {
+        $this->claimed_id = null;
+        $this->server_url = null;
+        $this->type_uris = array();
+        $this->local_id = null;
+        $this->canonicalID = null;
+        $this->used_yadis = false; // whether this came from an XRDS
+        $this->display_identifier = null;
+    }
+
+    function getDisplayIdentifier()
+    {
+        if ($this->display_identifier) {
+            return $this->display_identifier;
+        }
+        if (! $this->claimed_id) {
+          return $this->claimed_id;
+        }
+        $parsed = parse_url($this->claimed_id);
+        $scheme = $parsed['scheme'];
+        $host = $parsed['host'];
+        $path = $parsed['path'];
+        if (array_key_exists('query', $parsed)) {
+            $query = $parsed['query'];
+            $no_frag = "$scheme://$host$path?$query";
+        } else {
+            $no_frag = "$scheme://$host$path";
+        }
+        return $no_frag;
+    }
+
+    function usesExtension($extension_uri)
+    {
+        return in_array($extension_uri, $this->type_uris);
+    }
+
+    function preferredNamespace()
+    {
+        if (in_array(Auth_OpenID_TYPE_2_0_IDP, $this->type_uris) ||
+            in_array(Auth_OpenID_TYPE_2_0, $this->type_uris)) {
+            return Auth_OpenID_OPENID2_NS;
+        } else {
+            return Auth_OpenID_OPENID1_NS;
+        }
+    }
+
+    /*
+     * Query this endpoint to see if it has any of the given type
+     * URIs. This is useful for implementing other endpoint classes
+     * that e.g. need to check for the presence of multiple versions
+     * of a single protocol.
+     *
+     * @param $type_uris The URIs that you wish to check
+     *
+     * @return all types that are in both in type_uris and
+     * $this->type_uris
+     */
+    function matchTypes($type_uris)
+    {
+        $result = array();
+        foreach ($type_uris as $test_uri) {
+            if ($this->supportsType($test_uri)) {
+                $result[] = $test_uri;
+            }
+        }
+
+        return $result;
+    }
+
+    function supportsType($type_uri)
+    {
+        // Does this endpoint support this type?
+        return ((in_array($type_uri, $this->type_uris)) ||
+                (($type_uri == Auth_OpenID_TYPE_2_0) &&
+                 $this->isOPIdentifier()));
+    }
+
+    function compatibilityMode()
+    {
+        return $this->preferredNamespace() != Auth_OpenID_OPENID2_NS;
+    }
+
+    function isOPIdentifier()
+    {
+        return in_array(Auth_OpenID_TYPE_2_0_IDP, $this->type_uris);
+    }
+
+    static function fromOPEndpointURL($op_endpoint_url)
+    {
+        // Construct an OP-Identifier OpenIDServiceEndpoint object for
+        // a given OP Endpoint URL
+        $obj = new Auth_OpenID_ServiceEndpoint();
+        $obj->server_url = $op_endpoint_url;
+        $obj->type_uris = array(Auth_OpenID_TYPE_2_0_IDP);
+        return $obj;
+    }
+
+    function parseService($yadis_url, $uri, $type_uris, $service_element)
+    {
+        // Set the state of this object based on the contents of the
+        // service element.  Return true if successful, false if not
+        // (if findOPLocalIdentifier returns false).
+        $this->type_uris = $type_uris;
+        $this->server_url = $uri;
+        $this->used_yadis = true;
+
+        if (!$this->isOPIdentifier()) {
+            $this->claimed_id = $yadis_url;
+            $this->local_id = Auth_OpenID_findOPLocalIdentifier(
+                                                    $service_element,
+                                                    $this->type_uris);
+            if ($this->local_id === false) {
+                return false;
+            }
+        }
+
+        return true;
+    }
+
+    function getLocalID()
+    {
+        // Return the identifier that should be sent as the
+        // openid.identity_url parameter to the server.
+        if ($this->local_id === null && $this->canonicalID === null) {
+            return $this->claimed_id;
+        } else {
+            if ($this->local_id) {
+                return $this->local_id;
+            } else {
+                return $this->canonicalID;
+            }
+        }
+    }
+
+    /*
+     * Parse the given document as XRDS looking for OpenID consumer services.
+     *
+     * @return array of Auth_OpenID_ServiceEndpoint or null if the
+     * document cannot be parsed.
+     */
+    function consumerFromXRDS($uri, $xrds_text)
+    {
+        $xrds =& Auth_Yadis_XRDS::parseXRDS($xrds_text);
+
+        if ($xrds) {
+            $yadis_services =
+              $xrds->services(array('filter_MatchesAnyOpenIDConsumerType'));
+            return Auth_OpenID_makeOpenIDEndpoints($uri, $yadis_services);
+        }
+
+        return null;
+    }
+
+    /*
+     * Parse the given document as XRDS looking for OpenID services.
+     *
+     * @return array of Auth_OpenID_ServiceEndpoint or null if the
+     * document cannot be parsed.
+     */
+    static function fromXRDS($uri, $xrds_text)
+    {
+        $xrds = Auth_Yadis_XRDS::parseXRDS($xrds_text);
+
+        if ($xrds) {
+            $yadis_services =
+              $xrds->services(array('filter_MatchesAnyOpenIDType'));
+            return Auth_OpenID_makeOpenIDEndpoints($uri, $yadis_services);
+        }
+
+        return null;
+    }
+
+    /*
+     * Create endpoints from a DiscoveryResult.
+     *
+     * @param discoveryResult Auth_Yadis_DiscoveryResult
+     * @return array of Auth_OpenID_ServiceEndpoint or null if
+     * endpoints cannot be created.
+     */
+    static function fromDiscoveryResult($discoveryResult)
+    {
+        if ($discoveryResult->isXRDS()) {
+            return Auth_OpenID_ServiceEndpoint::fromXRDS(
+                                     $discoveryResult->normalized_uri,
+                                     $discoveryResult->response_text);
+        } else {
+            return Auth_OpenID_ServiceEndpoint::fromHTML(
+                                     $discoveryResult->normalized_uri,
+                                     $discoveryResult->response_text);
+        }
+    }
+
+    static function fromHTML($uri, $html)
+    {
+        $discovery_types = array(
+                                 array(Auth_OpenID_TYPE_2_0,
+                                       'openid2.provider', 'openid2.local_id'),
+                                 array(Auth_OpenID_TYPE_1_1,
+                                       'openid.server', 'openid.delegate')
+                                 );
+
+        $services = array();
+
+        foreach ($discovery_types as $triple) {
+            list($type_uri, $server_rel, $delegate_rel) = $triple;
+
+            $urls = Auth_OpenID_legacy_discover($html, $server_rel,
+                                                $delegate_rel);
+
+            if ($urls === false) {
+                continue;
+            }
+
+            list($delegate_url, $server_url) = $urls;
+
+            $service = new Auth_OpenID_ServiceEndpoint();
+            $service->claimed_id = $uri;
+            $service->local_id = $delegate_url;
+            $service->server_url = $server_url;
+            $service->type_uris = array($type_uri);
+
+            $services[] = $service;
+        }
+
+        return $services;
+    }
+
+    function copy()
+    {
+        $x = new Auth_OpenID_ServiceEndpoint();
+
+        $x->claimed_id = $this->claimed_id;
+        $x->server_url = $this->server_url;
+        $x->type_uris = $this->type_uris;
+        $x->local_id = $this->local_id;
+        $x->canonicalID = $this->canonicalID;
+        $x->used_yadis = $this->used_yadis;
+
+        return $x;
+    }
+}
+
+function Auth_OpenID_findOPLocalIdentifier($service, $type_uris)
+{
+    // Extract a openid:Delegate value from a Yadis Service element.
+    // If no delegate is found, returns null.  Returns false on
+    // discovery failure (when multiple delegate/localID tags have
+    // different values).
+
+    $service->parser->registerNamespace('openid',
+                                        Auth_OpenID_XMLNS_1_0);
+
+    $service->parser->registerNamespace('xrd',
+                                        Auth_Yadis_XMLNS_XRD_2_0);
+
+    $parser = $service->parser;
+
+    $permitted_tags = array();
+
+    if (in_array(Auth_OpenID_TYPE_1_1, $type_uris) ||
+        in_array(Auth_OpenID_TYPE_1_0, $type_uris)) {
+        $permitted_tags[] = 'openid:Delegate';
+    }
+
+    if (in_array(Auth_OpenID_TYPE_2_0, $type_uris)) {
+        $permitted_tags[] = 'xrd:LocalID';
+    }
+
+    $local_id = null;
+
+    foreach ($permitted_tags as $tag_name) {
+        $tags = $service->getElements($tag_name);
+
+        foreach ($tags as $tag) {
+            $content = $parser->content($tag);
+
+            if ($local_id === null) {
+                $local_id = $content;
+            } else if ($local_id != $content) {
+                return false;
+            }
+        }
+    }
+
+    return $local_id;
+}
+
+function filter_MatchesAnyOpenIDType($service)
+{
+    $uris = $service->getTypes();
+
+    foreach ($uris as $uri) {
+        if (in_array($uri, Auth_OpenID_getOpenIDTypeURIs())) {
+            return true;
+        }
+    }
+
+    return false;
+}
+
+function filter_MatchesAnyOpenIDConsumerType(&$service)
+{
+    $uris = $service->getTypes();
+
+    foreach ($uris as $uri) {
+        if (in_array($uri, Auth_OpenID_getOpenIDConsumerTypeURIs())) {
+            return true;
+        }
+    }
+
+    return false;
+}
+
+function Auth_OpenID_bestMatchingService($service, $preferred_types)
+{
+    // Return the index of the first matching type, or something
+    // higher if no type matches.
+    //
+    // This provides an ordering in which service elements that
+    // contain a type that comes earlier in the preferred types list
+    // come before service elements that come later. If a service
+    // element has more than one type, the most preferred one wins.
+
+    foreach ($preferred_types as $index => $typ) {
+        if (in_array($typ, $service->type_uris)) {
+            return $index;
+        }
+    }
+
+    return count($preferred_types);
+}
+
+function Auth_OpenID_arrangeByType($service_list, $preferred_types)
+{
+    // Rearrange service_list in a new list so services are ordered by
+    // types listed in preferred_types.  Return the new list.
+
+    // Build a list with the service elements in tuples whose
+    // comparison will prefer the one with the best matching service
+    $prio_services = array();
+    foreach ($service_list as $index => $service) {
+        $prio_services[] = array(Auth_OpenID_bestMatchingService($service,
+                                                        $preferred_types),
+                                 $index, $service);
+    }
+
+    sort($prio_services);
+
+    // Now that the services are sorted by priority, remove the sort
+    // keys from the list.
+    foreach ($prio_services as $index => $s) {
+        $prio_services[$index] = $prio_services[$index][2];
+    }
+
+    return $prio_services;
+}
+
+// Extract OP Identifier services.  If none found, return the rest,
+// sorted with most preferred first according to
+// OpenIDServiceEndpoint.openid_type_uris.
+//
+// openid_services is a list of OpenIDServiceEndpoint objects.
+//
+// Returns a list of OpenIDServiceEndpoint objects."""
+function Auth_OpenID_getOPOrUserServices($openid_services)
+{
+    $op_services = Auth_OpenID_arrangeByType($openid_services,
+                                     array(Auth_OpenID_TYPE_2_0_IDP));
+
+    $openid_services = Auth_OpenID_arrangeByType($openid_services,
+                                     Auth_OpenID_getOpenIDTypeURIs());
+
+    if ($op_services) {
+        return $op_services;
+    } else {
+        return $openid_services;
+    }
+}
+
+function Auth_OpenID_makeOpenIDEndpoints($uri, $yadis_services)
+{
+    $s = array();
+
+    if (!$yadis_services) {
+        return $s;
+    }
+
+    foreach ($yadis_services as $service) {
+        $type_uris = $service->getTypes();
+        $uris = $service->getURIs();
+
+        // If any Type URIs match and there is an endpoint URI
+        // specified, then this is an OpenID endpoint
+        if ($type_uris &&
+            $uris) {
+            foreach ($uris as $service_uri) {
+                $openid_endpoint = new Auth_OpenID_ServiceEndpoint();
+                if ($openid_endpoint->parseService($uri,
+                                                   $service_uri,
+                                                   $type_uris,
+                                                   $service)) {
+                    $s[] = $openid_endpoint;
+                }
+            }
+        }
+    }
+
+    return $s;
+}
+
+function Auth_OpenID_discoverWithYadis($uri, $fetcher,
+              $endpoint_filter='Auth_OpenID_getOPOrUserServices',
+              $discover_function=null)
+{
+    // Discover OpenID services for a URI. Tries Yadis and falls back
+    // on old-style <link rel='...'> discovery if Yadis fails.
+
+    // Might raise a yadis.discover.DiscoveryFailure if no document
+    // came back for that URI at all.  I don't think falling back to
+    // OpenID 1.0 discovery on the same URL will help, so don't bother
+    // to catch it.
+    if ($discover_function === null) {
+        $discover_function = array('Auth_Yadis_Yadis', 'discover');
+    }
+
+    $openid_services = array();
+
+    $response = call_user_func_array($discover_function,
+                                     array($uri, $fetcher));
+
+    $yadis_url = $response->normalized_uri;
+    $yadis_services = array();
+
+    if ($response->isFailure() && !$response->isXRDS()) {
+        return array($uri, array());
+    }
+
+    $openid_services = Auth_OpenID_ServiceEndpoint::fromXRDS(
+                                         $yadis_url,
+                                         $response->response_text);
+
+    if (!$openid_services) {
+        if ($response->isXRDS()) {
+            return Auth_OpenID_discoverWithoutYadis($uri,
+                                                    $fetcher);
+        }
+
+        // Try to parse the response as HTML to get OpenID 1.0/1.1
+        // <link rel="...">
+        $openid_services = Auth_OpenID_ServiceEndpoint::fromHTML(
+                                        $yadis_url,
+                                        $response->response_text);
+    }
+
+    $openid_services = call_user_func_array($endpoint_filter,
+                                            array($openid_services));
+
+    return array($yadis_url, $openid_services);
+}
+
+function Auth_OpenID_discoverURI($uri, $fetcher)
+{
+    $uri = Auth_OpenID::normalizeUrl($uri);
+    return Auth_OpenID_discoverWithYadis($uri, $fetcher);
+}
+
+function Auth_OpenID_discoverWithoutYadis($uri, $fetcher)
+{
+    $http_resp = @$fetcher->get($uri);
+
+    if ($http_resp->status != 200 and $http_resp->status != 206) {
+        return array($uri, array());
+    }
+
+    $identity_url = $http_resp->final_url;
+
+    // Try to parse the response as HTML to get OpenID 1.0/1.1 <link
+    // rel="...">
+    $openid_services = Auth_OpenID_ServiceEndpoint::fromHTML(
+                                           $identity_url,
+                                           $http_resp->body);
+
+    return array($identity_url, $openid_services);
+}
+
+function Auth_OpenID_discoverXRI($iname, $fetcher)
+{
+    $resolver = new Auth_Yadis_ProxyResolver($fetcher);
+    list($canonicalID, $yadis_services) =
+        $resolver->query($iname,
+                         Auth_OpenID_getOpenIDTypeURIs(),
+                         array('filter_MatchesAnyOpenIDType'));
+
+    $openid_services = Auth_OpenID_makeOpenIDEndpoints($iname,
+                                                       $yadis_services);
+
+    $openid_services = Auth_OpenID_getOPOrUserServices($openid_services);
+
+    for ($i = 0; $i < count($openid_services); $i++) {
+        $openid_services[$i]->canonicalID = $canonicalID;
+        $openid_services[$i]->claimed_id = $canonicalID;
+        $openid_services[$i]->display_identifier = $iname;
+    }
+
+    // FIXME: returned xri should probably be in some normal form
+    return array($iname, $openid_services);
+}
+
+function Auth_OpenID_discover($uri, $fetcher)
+{
+    // If the fetcher (i.e., PHP) doesn't support SSL, we can't do
+    // discovery on an HTTPS URL.
+    if ($fetcher->isHTTPS($uri) && !$fetcher->supportsSSL()) {
+        return array($uri, array());
+    }
+
+    if (Auth_Yadis_identifierScheme($uri) == 'XRI') {
+        $result = Auth_OpenID_discoverXRI($uri, $fetcher);
+    } else {
+        $result = Auth_OpenID_discoverURI($uri, $fetcher);
+    }
+
+    // If the fetcher doesn't support SSL, we can't interact with
+    // HTTPS server URLs; remove those endpoints from the list.
+    if (!$fetcher->supportsSSL()) {
+        $http_endpoints = array();
+        list($new_uri, $endpoints) = $result;
+
+        foreach ($endpoints as $e) {
+            if (!$fetcher->isHTTPS($e->server_url)) {
+                $http_endpoints[] = $e;
+            }
+        }
+
+        $result = array($new_uri, $http_endpoints);
+    }
+
+    return $result;
+}
+
+
+

--- /dev/null
+++ b/lib/openid-php/Auth/OpenID/DumbStore.php
@@ -1,1 +1,100 @@
+<?php
 
+/**
+ * This file supplies a dumb store backend for OpenID servers and
+ * consumers.
+ *
+ * PHP versions 4 and 5
+ *
+ * LICENSE: See the COPYING file included in this distribution.
+ *
+ * @package OpenID
+ * @author JanRain, Inc. <openid@janrain.com>
+ * @copyright 2005-2008 Janrain, Inc.
+ * @license http://www.apache.org/licenses/LICENSE-2.0 Apache
+ */
+
+/**
+ * Import the interface for creating a new store class.
+ */
+require_once 'Auth/OpenID/Interface.php';
+require_once 'Auth/OpenID/HMAC.php';
+
+/**
+ * This is a store for use in the worst case, when you have no way of
+ * saving state on the consumer site. Using this store makes the
+ * consumer vulnerable to replay attacks, as it's unable to use
+ * nonces. Avoid using this store if it is at all possible.
+ *
+ * Most of the methods of this class are implementation details.
+ * Users of this class need to worry only about the constructor.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_DumbStore extends Auth_OpenID_OpenIDStore {
+
+    /**
+     * Creates a new {@link Auth_OpenID_DumbStore} instance. For the security
+     * of the tokens generated by the library, this class attempts to
+     * at least have a secure implementation of getAuthKey.
+     *
+     * When you create an instance of this class, pass in a secret
+     * phrase. The phrase is hashed with sha1 to make it the correct
+     * length and form for an auth key. That allows you to use a long
+     * string as the secret phrase, which means you can make it very
+     * difficult to guess.
+     *
+     * Each {@link Auth_OpenID_DumbStore} instance that is created for use by
+     * your consumer site needs to use the same $secret_phrase.
+     *
+     * @param string secret_phrase The phrase used to create the auth
+     * key returned by getAuthKey
+     */
+    function Auth_OpenID_DumbStore($secret_phrase)
+    {
+        $this->auth_key = Auth_OpenID_SHA1($secret_phrase);
+    }
+
+    /**
+     * This implementation does nothing.
+     */
+    function storeAssociation($server_url, $association)
+    {
+    }
+
+    /**
+     * This implementation always returns null.
+     */
+    function getAssociation($server_url, $handle = null)
+    {
+        return null;
+    }
+
+    /**
+     * This implementation always returns false.
+     */
+    function removeAssociation($server_url, $handle)
+    {
+        return false;
+    }
+
+    /**
+     * In a system truly limited to dumb mode, nonces must all be
+     * accepted. This therefore always returns true, which makes
+     * replay attacks feasible.
+     */
+    function useNonce($server_url, $timestamp, $salt)
+    {
+        return true;
+    }
+
+    /**
+     * This method returns the auth key generated by the constructor.
+     */
+    function getAuthKey()
+    {
+        return $this->auth_key;
+    }
+}
+
+

--- /dev/null
+++ b/lib/openid-php/Auth/OpenID/Extension.php
@@ -1,1 +1,62 @@
+<?php
 
+/**
+ * An interface for OpenID extensions.
+ *
+ * @package OpenID
+ */
+
+/**
+ * Require the Message implementation.
+ */
+require_once 'Auth/OpenID/Message.php';
+
+/**
+ * A base class for accessing extension request and response data for
+ * the OpenID 2 protocol.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_Extension {
+    /**
+     * ns_uri: The namespace to which to add the arguments for this
+     * extension
+     */
+    var $ns_uri = null;
+    var $ns_alias = null;
+
+    /**
+     * Get the string arguments that should be added to an OpenID
+     * message for this extension.
+     */
+    function getExtensionArgs()
+    {
+        return null;
+    }
+
+    /**
+     * Add the arguments from this extension to the provided message.
+     *
+     * Returns the message with the extension arguments added.
+     */
+    function toMessage($message)
+    {
+        $implicit = $message->isOpenID1();
+        $added = $message->namespaces->addAlias($this->ns_uri,
+                                                $this->ns_alias,
+                                                $implicit);
+
+        if ($added === null) {
+            if ($message->namespaces->getAlias($this->ns_uri) !=
+                $this->ns_alias) {
+                return null;
+            }
+        }
+
+        $message->updateArgs($this->ns_uri,
+                             $this->getExtensionArgs());
+        return $message;
+    }
+}
+
+

--- /dev/null
+++ b/lib/openid-php/Auth/OpenID/FileStore.php
@@ -1,1 +1,619 @@
-
+<?php
+
+/**
+ * This file supplies a Memcached store backend for OpenID servers and
+ * consumers.
+ *
+ * PHP versions 4 and 5
+ *
+ * LICENSE: See the COPYING file included in this distribution.
+ *
+ * @package OpenID
+ * @author JanRain, Inc. <openid@janrain.com>
+ * @copyright 2005-2008 Janrain, Inc.
+ * @license http://www.apache.org/licenses/LICENSE-2.0 Apache
+ */
+
+/**
+ * Require base class for creating a new interface.
+ */
+require_once 'Auth/OpenID.php';
+require_once 'Auth/OpenID/Interface.php';
+require_once 'Auth/OpenID/HMAC.php';
+require_once 'Auth/OpenID/Nonce.php';
+
+/**
+ * This is a filesystem-based store for OpenID associations and
+ * nonces.  This store should be safe for use in concurrent systems on
+ * both windows and unix (excluding NFS filesystems).  There are a
+ * couple race conditions in the system, but those failure cases have
+ * been set up in such a way that the worst-case behavior is someone
+ * having to try to log in a second time.
+ *
+ * Most of the methods of this class are implementation details.
+ * People wishing to just use this store need only pay attention to
+ * the constructor.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_FileStore extends Auth_OpenID_OpenIDStore {
+
+    /**
+     * Initializes a new {@link Auth_OpenID_FileStore}.  This
+     * initializes the nonce and association directories, which are
+     * subdirectories of the directory passed in.
+     *
+     * @param string $directory This is the directory to put the store
+     * directories in.
+     */
+    function Auth_OpenID_FileStore($directory)
+    {
+        if (!Auth_OpenID::ensureDir($directory)) {
+            trigger_error('Not a directory and failed to create: '
+                          . $directory, E_USER_ERROR);
+        }
+        $directory = realpath($directory);
+
+        $this->directory = $directory;
+        $this->active = true;
+
+        $this->nonce_dir = $directory . DIRECTORY_SEPARATOR . 'nonces';
+
+        $this->association_dir = $directory . DIRECTORY_SEPARATOR .
+            'associations';
+
+        // Temp dir must be on the same filesystem as the assciations
+        // $directory.
+        $this->temp_dir = $directory . DIRECTORY_SEPARATOR . 'temp';
+
+        $this->max_nonce_age = 6 * 60 * 60; // Six hours, in seconds
+
+        if (!$this->_setup()) {
+            trigger_error('Failed to initialize OpenID file store in ' .
+                          $directory, E_USER_ERROR);
+        }
+    }
+
+    function destroy()
+    {
+        Auth_OpenID_FileStore::_rmtree($this->directory);
+        $this->active = false;
+    }
+
+    /**
+     * Make sure that the directories in which we store our data
+     * exist.
+     *
+     * @access private
+     */
+    function _setup()
+    {
+        return (Auth_OpenID::ensureDir($this->nonce_dir) &&
+                Auth_OpenID::ensureDir($this->association_dir) &&
+                Auth_OpenID::ensureDir($this->temp_dir));
+    }
+
+    /**
+     * Create a temporary file on the same filesystem as
+     * $this->association_dir.
+     *
+     * The temporary directory should not be cleaned if there are any
+     * processes using the store. If there is no active process using
+     * the store, it is safe to remove all of the files in the
+     * temporary directory.
+     *
+     * @return array ($fd, $filename)
+     * @access private
+     */
+    function _mktemp()
+    {
+        $name = Auth_OpenID_FileStore::_mkstemp($dir = $this->temp_dir);
+        $file_obj = @fopen($name, 'wb');
+        if ($file_obj !== false) {
+            return array($file_obj, $name);
+        } else {
+            Auth_OpenID_FileStore::_removeIfPresent($name);
+        }
+    }
+
+    function cleanupNonces()
+    {
+        global $Auth_OpenID_SKEW;
+
+        $nonces = Auth_OpenID_FileStore::_listdir($this->nonce_dir);
+        $now = time();
+
+        $removed = 0;
+        // Check all nonces for expiry
+        foreach ($nonces as $nonce_fname) {
+            $base = basename($nonce_fname);
+            $parts = explode('-', $base, 2);
+            $timestamp = $parts[0];
+            $timestamp = intval($timestamp, 16);
+            if (abs($timestamp - $now) > $Auth_OpenID_SKEW) {
+                Auth_OpenID_FileStore::_removeIfPresent($nonce_fname);
+                $removed += 1;
+            }
+        }
+        return $removed;
+    }
+
+    /**
+     * Create a unique filename for a given server url and
+     * handle. This implementation does not assume anything about the
+     * format of the handle. The filename that is returned will
+     * contain the domain name from the server URL for ease of human
+     * inspection of the data directory.
+     *
+     * @return string $filename
+     */
+    function getAssociationFilename($server_url, $handle)
+    {
+        if (!$this->active) {
+            trigger_error("FileStore no longer active", E_USER_ERROR);
+            return null;
+        }
+
+        if (strpos($server_url, '://') === false) {
+            trigger_error(sprintf("Bad server URL: %s", $server_url),
+                          E_USER_WARNING);
+            return null;
+        }
+
+        list($proto, $rest) = explode('://', $server_url, 2);
+        $parts = explode('/', $rest);
+        $domain = Auth_OpenID_FileStore::_filenameEscape($parts[0]);
+        $url_hash = Auth_OpenID_FileStore::_safe64($server_url);
+        if ($handle) {
+            $handle_hash = Auth_OpenID_FileStore::_safe64($handle);
+        } else {
+            $handle_hash = '';
+        }
+
+        $filename = sprintf('%s-%s-%s-%s', $proto, $domain, $url_hash,
+                            $handle_hash);
+
+        return $this->association_dir. DIRECTORY_SEPARATOR . $filename;
+    }
+
+    /**
+     * Store an association in the association directory.
+     */
+    function storeAssociation($server_url, $association)
+    {
+        if (!$this->active) {
+            trigger_error("FileStore no longer active", E_USER_ERROR);
+            return false;
+        }
+
+        $association_s = $association->serialize();
+        $filename = $this->getAssociationFilename($server_url,
+                                                  $association->handle);
+        list($tmp_file, $tmp) = $this->_mktemp();
+
+        if (!$tmp_file) {
+            trigger_error("_mktemp didn't return a valid file descriptor",
+                          E_USER_WARNING);
+            return false;
+        }
+
+        fwrite($tmp_file, $association_s);
+
+        fflush($tmp_file);
+
+        fclose($tmp_file);
+
+        if (@rename($tmp, $filename)) {
+            return true;
+        } else {
+            // In case we are running on Windows, try unlinking the
+            // file in case it exists.
+            @unlink($filename);
+
+            // Now the target should not exist. Try renaming again,
+            // giving up if it fails.
+            if (@rename($tmp, $filename)) {
+                return true;
+            }
+        }
+
+        // If there was an error, don't leave the temporary file
+        // around.
+        Auth_OpenID_FileStore::_removeIfPresent($tmp);
+        return false;
+    }
+
+    /**
+     * Retrieve an association. If no handle is specified, return the
+     * association with the most recent issue time.
+     *
+     * @return mixed $association
+     */
+    function getAssociation($server_url, $handle = null)
+    {
+        if (!$this->active) {
+            trigger_error("FileStore no longer active", E_USER_ERROR);
+            return null;
+        }
+
+        if ($handle === null) {
+            $handle = '';
+        }
+
+        // The filename with the empty handle is a prefix of all other
+        // associations for the given server URL.
+        $filename = $this->getAssociationFilename($server_url, $handle);
+
+        if ($handle) {
+            return $this->_getAssociation($filename);
+        } else {
+            $association_files =
+                Auth_OpenID_FileStore::_listdir($this->association_dir);
+            $matching_files = array();
+
+            // strip off the path to do the comparison
+            $name = basename($filename);
+            foreach ($association_files as $association_file) {
+                $base = basename($association_file);
+                if (strpos($base, $name) === 0) {
+                    $matching_files[] = $association_file;
+                }
+            }
+
+            $matching_associations = array();
+            // read the matching files and sort by time issued
+            foreach ($matching_files as $full_name) {
+                $association = $this->_getAssociation($full_name);
+                if ($association !== null) {
+                    $matching_associations[] = array($association->issued,
+                                                     $association);
+                }
+            }
+
+            $issued = array();
+            $assocs = array();
+            foreach ($matching_associations as $key => $assoc) {
+                $issued[$key] = $assoc[0];
+                $assocs[$key] = $assoc[1];
+            }
+
+            array_multisort($issued, SORT_DESC, $assocs, SORT_DESC,
+                            $matching_associations);
+
+            // return the most recently issued one.
+            if ($matching_associations) {
+                list($issued, $assoc) = $matching_associations[0];
+                return $assoc;
+            } else {
+                return null;
+            }
+        }
+    }
+
+    /**
+     * @access private
+     */
+    function _getAssociation($filename)
+    {
+        if (!$this->active) {
+            trigger_error("FileStore no longer active", E_USER_ERROR);
+            return null;
+        }
+
+        $assoc_file = @fopen($filename, 'rb');
+
+        if ($assoc_file === false) {
+            return null;
+        }
+
+        $assoc_s = fread($assoc_file, filesize($filename));
+        fclose($assoc_file);
+
+        if (!$assoc_s) {
+            return null;
+        }
+
+        $association =
+            Auth_OpenID_Association::deserialize('Auth_OpenID_Association',
+                                                $assoc_s);
+
+        if (!$association) {
+            Auth_OpenID_FileStore::_removeIfPresent($filename);
+            return null;
+        }
+
+        if ($association->getExpiresIn() == 0) {
+            Auth_OpenID_FileStore::_removeIfPresent($filename);
+            return null;
+        } else {
+            return $association;
+        }
+    }
+
+    /**
+     * Remove an association if it exists. Do nothing if it does not.
+     *
+     * @return bool $success
+     */
+    function removeAssociation($server_url, $handle)
+    {
+        if (!$this->active) {
+            trigger_error("FileStore no longer active", E_USER_ERROR);
+            return null;
+        }
+
+        $assoc = $this->getAssociation($server_url, $handle);
+        if ($assoc === null) {
+            return false;
+        } else {
+            $filename = $this->getAssociationFilename($server_url, $handle);
+            return Auth_OpenID_FileStore::_removeIfPresent($filename);
+        }
+    }
+
+    /**
+     * Return whether this nonce is present. As a side effect, mark it
+     * as no longer present.
+     *
+     * @return bool $present
+     */
+    function useNonce($server_url, $timestamp, $salt)
+    {
+        global $Auth_OpenID_SKEW;
+
+        if (!$this->active) {
+            trigger_error("FileStore no longer active", E_USER_ERROR);
+            return null;
+        }
+
+        if ( abs($timestamp - time()) > $Auth_OpenID_SKEW ) {
+            return false;
+        }
+
+        if ($server_url) {
+            list($proto, $rest) = explode('://', $server_url, 2);
+        } else {
+            $proto = '';
+            $rest = '';
+        }
+
+        $parts = explode('/', $rest, 2);
+        $domain = $this->_filenameEscape($parts[0]);
+        $url_hash = $this->_safe64($server_url);
+        $salt_hash = $this->_safe64($salt);
+
+        $filename = sprintf('%08x-%s-%s-%s-%s', $timestamp, $proto,
+                            $domain, $url_hash, $salt_hash);
+        $filename = $this->nonce_dir . DIRECTORY_SEPARATOR . $filename;
+
+        $result = @fopen($filename, 'x');
+
+        if ($result === false) {
+            return false;
+        } else {
+            fclose($result);
+            return true;
+        }
+    }
+
+    /**
+     * Remove expired entries from the database. This is potentially
+     * expensive, so only run when it is acceptable to take time.
+     *
+     * @access private
+     */
+    function _allAssocs()
+    {
+        $all_associations = array();
+
+        $association_filenames =
+            Auth_OpenID_FileStore::_listdir($this->association_dir);
+
+        foreach ($association_filenames as $association_filename) {
+            $association_file = fopen($association_filename, 'rb');
+
+            if ($association_file !== false) {
+                $assoc_s = fread($association_file,
+                                 filesize($association_filename));
+                fclose($association_file);
+
+                // Remove expired or corrupted associations
+                $association =
+                  Auth_OpenID_Association::deserialize(
+                         'Auth_OpenID_Association', $assoc_s);
+
+                if ($association === null) {
+                    Auth_OpenID_FileStore::_removeIfPresent(
+                                                 $association_filename);
+                } else {
+                    if ($association->getExpiresIn() == 0) {
+                        $all_associations[] = array($association_filename,
+                                                    $association);
+                    }
+                }
+            }
+        }
+
+        return $all_associations;
+    }
+
+    function clean()
+    {
+        if (!$this->active) {
+            trigger_error("FileStore no longer active", E_USER_ERROR);
+            return null;
+        }
+
+        $nonces = Auth_OpenID_FileStore::_listdir($this->nonce_dir);
+        $now = time();
+
+        // Check all nonces for expiry
+        foreach ($nonces as $nonce) {
+            if (!Auth_OpenID_checkTimestamp($nonce, $now)) {
+                $filename = $this->nonce_dir . DIRECTORY_SEPARATOR . $nonce;
+                Auth_OpenID_FileStore::_removeIfPresent($filename);
+            }
+        }
+
+        foreach ($this->_allAssocs() as $pair) {
+            list($assoc_filename, $assoc) = $pair;
+            if ($assoc->getExpiresIn() == 0) {
+                Auth_OpenID_FileStore::_removeIfPresent($assoc_filename);
+            }
+        }
+    }
+
+    /**
+     * @access private
+     */
+    function _rmtree($dir)
+    {
+        if ($dir[strlen($dir) - 1] != DIRECTORY_SEPARATOR) {
+            $dir .= DIRECTORY_SEPARATOR;
+        }
+
+        if ($handle = opendir($dir)) {
+            while ($item = readdir($handle)) {
+                if (!in_array($item, array('.', '..'))) {
+                    if (is_dir($dir . $item)) {
+
+                        if (!Auth_OpenID_FileStore::_rmtree($dir . $item)) {
+                            return false;
+                        }
+                    } else if (is_file($dir . $item)) {
+                        if (!unlink($dir . $item)) {
+                            return false;
+                        }
+                    }
+                }
+            }
+
+            closedir($handle);
+
+            if (!@rmdir($dir)) {
+                return false;
+            }
+
+            return true;
+        } else {
+            // Couldn't open directory.
+            return false;
+        }
+    }
+
+    /**
+     * @access private
+     */
+    function _mkstemp($dir)
+    {
+        foreach (range(0, 4) as $i) {
+            $name = tempnam($dir, "php_openid_filestore_");
+
+            if ($name !== false) {
+                return $name;
+            }
+        }
+        return false;
+    }
+
+    /**
+     * @access private
+     */
+    static function _mkdtemp($dir)
+    {
+        foreach (range(0, 4) as $i) {
+            $name = $dir . strval(DIRECTORY_SEPARATOR) . strval(getmypid()) .
+                "-" . strval(rand(1, time()));
+            if (!mkdir($name, 0700)) {
+                return false;
+            } else {
+                return $name;
+            }
+        }
+        return false;
+    }
+
+    /**
+     * @access private
+     */
+    function _listdir($dir)
+    {
+        $handle = opendir($dir);
+        $files = array();
+        while (false !== ($filename = readdir($handle))) {
+            if (!in_array($filename, array('.', '..'))) {
+                $files[] = $dir . DIRECTORY_SEPARATOR . $filename;
+            }
+        }
+        return $files;
+    }
+
+    /**
+     * @access private
+     */
+    function _isFilenameSafe($char)
+    {
+        $_Auth_OpenID_filename_allowed = Auth_OpenID_letters .
+            Auth_OpenID_digits . ".";
+        return (strpos($_Auth_OpenID_filename_allowed, $char) !== false);
+    }
+
+    /**
+     * @access private
+     */
+    function _safe64($str)
+    {
+        $h64 = base64_encode(Auth_OpenID_SHA1($str));
+        $h64 = str_replace('+', '_', $h64);
+        $h64 = str_replace('/', '.', $h64);
+        $h64 = str_replace('=', '', $h64);
+        return $h64;
+    }
+
+    /**
+     * @access private
+     */
+    function _filenameEscape($str)
+    {
+        $filename = "";
+        $b = Auth_OpenID::toBytes($str);
+
+        for ($i = 0; $i < count($b); $i++) {
+            $c = $b[$i];
+            if (Auth_OpenID_FileStore::_isFilenameSafe($c)) {
+                $filename .= $c;
+            } else {
+                $filename .= sprintf("_%02X", ord($c));
+            }
+        }
+        return $filename;
+    }
+
+    /**
+     * Attempt to remove a file, returning whether the file existed at
+     * the time of the call.
+     *
+     * @access private
+     * @return bool $result True if the file was present, false if not.
+     */
+    function _removeIfPresent($filename)
+    {
+        return @unlink($filename);
+    }
+
+    function cleanupAssociations()
+    {
+        $removed = 0;
+        foreach ($this->_allAssocs() as $pair) {
+            list($assoc_filename, $assoc) = $pair;
+            if ($assoc->getExpiresIn() == 0) {
+                $this->_removeIfPresent($assoc_filename);
+                $removed += 1;
+            }
+        }
+        return $removed;
+    }
+}
+
+
+

--- /dev/null
+++ b/lib/openid-php/Auth/OpenID/HMAC.php
@@ -1,1 +1,106 @@
+<?php
 
+/**
+ * This is the HMACSHA1 implementation for the OpenID library.
+ *
+ * PHP versions 4 and 5
+ *
+ * LICENSE: See the COPYING file included in this distribution.
+ *
+ * @access private
+ * @package OpenID
+ * @author JanRain, Inc. <openid@janrain.com>
+ * @copyright 2005-2008 Janrain, Inc.
+ * @license http://www.apache.org/licenses/LICENSE-2.0 Apache
+ */
+
+require_once 'Auth/OpenID.php';
+
+/**
+ * SHA1_BLOCKSIZE is this module's SHA1 blocksize used by the fallback
+ * implementation.
+ */
+define('Auth_OpenID_SHA1_BLOCKSIZE', 64);
+
+function Auth_OpenID_SHA1($text)
+{
+    if (function_exists('hash') &&
+        function_exists('hash_algos') &&
+        (in_array('sha1', hash_algos()))) {
+        // PHP 5 case (sometimes): 'hash' available and 'sha1' algo
+        // supported.
+        return hash('sha1', $text, true);
+    } else if (function_exists('sha1')) {
+        // PHP 4 case: 'sha1' available.
+        $hex = sha1($text);
+        $raw = '';
+        for ($i = 0; $i < 40; $i += 2) {
+            $hexcode = substr($hex, $i, 2);
+            $charcode = (int)base_convert($hexcode, 16, 10);
+            $raw .= chr($charcode);
+        }
+        return $raw;
+    } else {
+        // Explode.
+        trigger_error('No SHA1 function found', E_USER_ERROR);
+    }
+}
+
+/**
+ * Compute an HMAC/SHA1 hash.
+ *
+ * @access private
+ * @param string $key The HMAC key
+ * @param string $text The message text to hash
+ * @return string $mac The MAC
+ */
+function Auth_OpenID_HMACSHA1($key, $text)
+{
+    if (Auth_OpenID::bytes($key) > Auth_OpenID_SHA1_BLOCKSIZE) {
+        $key = Auth_OpenID_SHA1($key, true);
+    }
+
+    if (function_exists('hash_hmac') &&
+        function_exists('hash_algos') &&
+        (in_array('sha1', hash_algos()))) {
+        return hash_hmac('sha1', $text, $key, true);
+    }
+    // Home-made solution
+
+    $key = str_pad($key, Auth_OpenID_SHA1_BLOCKSIZE, chr(0x00));
+    $ipad = str_repeat(chr(0x36), Auth_OpenID_SHA1_BLOCKSIZE);
+    $opad = str_repeat(chr(0x5c), Auth_OpenID_SHA1_BLOCKSIZE);
+    $hash1 = Auth_OpenID_SHA1(($key ^ $ipad) . $text, true);
+    $hmac = Auth_OpenID_SHA1(($key ^ $opad) . $hash1, true);
+    return $hmac;
+}
+
+if (function_exists('hash') &&
+    function_exists('hash_algos') &&
+    (in_array('sha256', hash_algos()))) {
+    function Auth_OpenID_SHA256($text)
+    {
+        // PHP 5 case: 'hash' available and 'sha256' algo supported.
+        return hash('sha256', $text, true);
+    }
+    define('Auth_OpenID_SHA256_SUPPORTED', true);
+} else {
+    define('Auth_OpenID_SHA256_SUPPORTED', false);
+}
+
+if (function_exists('hash_hmac') &&
+    function_exists('hash_algos') &&
+    (in_array('sha256', hash_algos()))) {
+
+    function Auth_OpenID_HMACSHA256($key, $text)
+    {
+        // Return raw MAC (not hex string).
+        return hash_hmac('sha256', $text, $key, true);
+    }
+
+    define('Auth_OpenID_HMACSHA256_SUPPORTED', true);
+} else {
+    define('Auth_OpenID_HMACSHA256_SUPPORTED', false);
+}
+
+

--- /dev/null
+++ b/lib/openid-php/Auth/OpenID/Interface.php
@@ -1,1 +1,197 @@
+<?php
 
+/**
+ * This file specifies the interface for PHP OpenID store implementations.
+ *
+ * PHP versions 4 and 5
+ *
+ * LICENSE: See the COPYING file included in this distribution.
+ *
+ * @package OpenID
+ * @author JanRain, Inc. <openid@janrain.com>
+ * @copyright 2005-2008 Janrain, Inc.
+ * @license http://www.apache.org/licenses/LICENSE-2.0 Apache
+ */
+
+/**
+ * This is the interface for the store objects the OpenID library
+ * uses. It is a single class that provides all of the persistence
+ * mechanisms that the OpenID library needs, for both servers and
+ * consumers.  If you want to create an SQL-driven store, please see
+ * then {@link Auth_OpenID_SQLStore} class.
+ *
+ * Change: Version 2.0 removed the storeNonce, getAuthKey, and isDumb
+ * methods, and changed the behavior of the useNonce method to support
+ * one-way nonces.
+ *
+ * @package OpenID
+ * @author JanRain, Inc. <openid@janrain.com>
+ */
+class Auth_OpenID_OpenIDStore {
+    /**
+     * This method puts an Association object into storage,
+     * retrievable by server URL and handle.
+     *
+     * @param string $server_url The URL of the identity server that
+     * this association is with. Because of the way the server portion
+     * of the library uses this interface, don't assume there are any
+     * limitations on the character set of the input string. In
+     * particular, expect to see unescaped non-url-safe characters in
+     * the server_url field.
+     *
+     * @param Association $association The Association to store.
+     */
+    function storeAssociation($server_url, $association)
+    {
+        trigger_error("Auth_OpenID_OpenIDStore::storeAssociation ".
+                      "not implemented", E_USER_ERROR);
+    }
+
+    /*
+     * Remove expired nonces from the store.
+     *
+     * Discards any nonce from storage that is old enough that its
+     * timestamp would not pass useNonce().
+     *
+     * This method is not called in the normal operation of the
+     * library.  It provides a way for store admins to keep their
+     * storage from filling up with expired data.
+     *
+     * @return the number of nonces expired
+     */
+    function cleanupNonces()
+    {
+        trigger_error("Auth_OpenID_OpenIDStore::cleanupNonces ".
+                      "not implemented", E_USER_ERROR);
+    }
+
+    /*
+     * Remove expired associations from the store.
+     *
+     * This method is not called in the normal operation of the
+     * library.  It provides a way for store admins to keep their
+     * storage from filling up with expired data.
+     *
+     * @return the number of associations expired.
+     */
+    function cleanupAssociations()
+    {
+        trigger_error("Auth_OpenID_OpenIDStore::cleanupAssociations ".
+                      "not implemented", E_USER_ERROR);
+    }
+
+    /*
+     * Shortcut for cleanupNonces(), cleanupAssociations().
+     *
+     * This method is not called in the normal operation of the
+     * library.  It provides a way for store admins to keep their
+     * storage from filling up with expired data.
+     */
+    function cleanup()
+    {
+        return array($this->cleanupNonces(),
+                     $this->cleanupAssociations());
+    }
+
+    /**
+     * Report whether this storage supports cleanup
+     */
+    function supportsCleanup()
+    {
+        return true;
+    }
+
+    /**
+     * This method returns an Association object from storage that
+     * matches the server URL and, if specified, handle. It returns
+     * null if no such association is found or if the matching
+     * association is expired.
+     *
+     * If no handle is specified, the store may return any association
+     * which matches the server URL. If multiple associations are
+     * valid, the recommended return value for this method is the one
+     * most recently issued.
+     *
+     * This method is allowed (and encouraged) to garbage collect
+     * expired associations when found. This method must not return
+     * expired associations.
+     *
+     * @param string $server_url The URL of the identity server to get
+     * the association for. Because of the way the server portion of
+     * the library uses this interface, don't assume there are any
+     * limitations on the character set of the input string.  In
+     * particular, expect to see unescaped non-url-safe characters in
+     * the server_url field.
+     *
+     * @param mixed $handle This optional parameter is the handle of
+     * the specific association to get. If no specific handle is
+     * provided, any valid association matching the server URL is
+     * returned.
+     *
+     * @return Association The Association for the given identity
+     * server.
+     */
+    function getAssociation($server_url, $handle = null)
+    {
+        trigger_error("Auth_OpenID_OpenIDStore::getAssociation ".
+                      "not implemented", E_USER_ERROR);
+    }
+
+    /**
+     * This method removes the matching association if it's found, and
+     * returns whether the association was removed or not.
+     *
+     * @param string $server_url The URL of the identity server the
+     * association to remove belongs to. Because of the way the server
+     * portion of the library uses this interface, don't assume there
+     * are any limitations on the character set of the input
+     * string. In particular, expect to see unescaped non-url-safe
+     * characters in the server_url field.
+     *
+     * @param string $handle This is the handle of the association to
+     * remove. If there isn't an association found that matches both
+     * the given URL and handle, then there was no matching handle
+     * found.
+     *
+     * @return mixed Returns whether or not the given association existed.
+     */
+    function removeAssociation($server_url, $handle)
+    {
+        trigger_error("Auth_OpenID_OpenIDStore::removeAssociation ".
+                      "not implemented", E_USER_ERROR);
+    }
+
+    /**
+     * Called when using a nonce.
+     *
+     * This method should return C{True} if the nonce has not been
+     * used before, and store it for a while to make sure nobody
+     * tries to use the same value again.  If the nonce has already
+     * been used, return C{False}.
+     *
+     * Change: In earlier versions, round-trip nonces were used and a
+     * nonce was only valid if it had been previously stored with
+     * storeNonce.  Version 2.0 uses one-way nonces, requiring a
+     * different implementation here that does not depend on a
+     * storeNonce call.  (storeNonce is no longer part of the
+     * interface.
+     *
+     * @param string $nonce The nonce to use.
+     *
+     * @return bool Whether or not the nonce was valid.
+     */
+    function useNonce($server_url, $timestamp, $salt)
+    {
+        trigger_error("Auth_OpenID_OpenIDStore::useNonce ".
+                      "not implemented", E_USER_ERROR);
+    }
+
+    /**
+     * Removes all entries from the store; implementation is optional.
+     */
+    function reset()
+    {
+    }
+
+}
+

--- /dev/null
+++ b/lib/openid-php/Auth/OpenID/KVForm.php
@@ -1,1 +1,112 @@
+<?php
 
+/**
+ * OpenID protocol key-value/comma-newline format parsing and
+ * serialization
+ *
+ * PHP versions 4 and 5
+ *
+ * LICENSE: See the COPYING file included in this distribution.
+ *
+ * @access private
+ * @package OpenID
+ * @author JanRain, Inc. <openid@janrain.com>
+ * @copyright 2005-2008 Janrain, Inc.
+ * @license http://www.apache.org/licenses/LICENSE-2.0 Apache
+ */
+
+/**
+ * Container for key-value/comma-newline OpenID format and parsing
+ */
+class Auth_OpenID_KVForm {
+    /**
+     * Convert an OpenID colon/newline separated string into an
+     * associative array
+     *
+     * @static
+     * @access private
+     */
+    static function toArray($kvs, $strict=false)
+    {
+        $lines = explode("\n", $kvs);
+
+        $last = array_pop($lines);
+        if ($last !== '') {
+            array_push($lines, $last);
+            if ($strict) {
+                return false;
+            }
+        }
+
+        $values = array();
+
+        for ($lineno = 0; $lineno < count($lines); $lineno++) {
+            $line = $lines[$lineno];
+            $kv = explode(':', $line, 2);
+            if (count($kv) != 2) {
+                if ($strict) {
+                    return false;
+                }
+                continue;
+            }
+
+            $key = $kv[0];
+            $tkey = trim($key);
+            if ($tkey != $key) {
+                if ($strict) {
+                    return false;
+                }
+            }
+
+            $value = $kv[1];
+            $tval = trim($value);
+            if ($tval != $value) {
+                if ($strict) {
+                    return false;
+                }
+            }
+
+            $values[$tkey] = $tval;
+        }
+
+        return $values;
+    }
+
+    /**
+     * Convert an array into an OpenID colon/newline separated string
+     *
+     * @static
+     * @access private
+     */
+    static function fromArray($values)
+    {
+        if ($values === null) {
+            return null;
+        }
+
+        ksort($values);
+
+        $serialized = '';
+        foreach ($values as $key => $value) {
+            if (is_array($value)) {
+                list($key, $value) = array($value[0], $value[1]);
+            }
+
+            if (strpos($key, ':') !== false) {
+                return null;
+            }
+
+            if (strpos($key, "\n") !== false) {
+                return null;
+            }
+
+            if (strpos($value, "\n") !== false) {
+                return null;
+            }
+            $serialized .= "$key:$value\n";
+        }
+        return $serialized;
+    }
+}
+
+

--- /dev/null
+++ b/lib/openid-php/Auth/OpenID/MDB2Store.php
@@ -1,1 +1,414 @@
-
+<?php
+
+/**
+ * SQL-backed OpenID stores for use with PEAR::MDB2.
+ *
+ * PHP versions 4 and 5
+ *
+ * LICENSE: See the COPYING file included in this distribution.
+ *
+ * @package OpenID
+ * @author JanRain, Inc. <openid@janrain.com>
+ * @copyright 2005 Janrain, Inc.
+ * @license http://www.gnu.org/copyleft/lesser.html LGPL
+ */
+
+require_once 'MDB2.php';
+
+/**
+ * @access private
+ */
+require_once 'Auth/OpenID/Interface.php';
+
+/**
+ * @access private
+ */
+require_once 'Auth/OpenID.php';
+
+/**
+ * @access private
+ */
+require_once 'Auth/OpenID/Nonce.php';
+
+/**
+ * This store uses a PEAR::MDB2 connection to store persistence
+ * information.
+ *
+ * The table names used are determined by the class variables
+ * associations_table_name and nonces_table_name.  To change the name
+ * of the tables used, pass new table names into the constructor.
+ *
+ * To create the tables with the proper schema, see the createTables
+ * method.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_MDB2Store extends Auth_OpenID_OpenIDStore {
+    /**
+     * This creates a new MDB2Store instance.  It requires an
+     * established database connection be given to it, and it allows
+     * overriding the default table names.
+     *
+     * @param connection $connection This must be an established
+     * connection to a database of the correct type for the SQLStore
+     * subclass you're using.  This must be a PEAR::MDB2 connection
+     * handle.
+     *
+     * @param associations_table: This is an optional parameter to
+     * specify the name of the table used for storing associations.
+     * The default value is 'oid_associations'.
+     *
+     * @param nonces_table: This is an optional parameter to specify
+     * the name of the table used for storing nonces.  The default
+     * value is 'oid_nonces'.
+     */
+    function Auth_OpenID_MDB2Store($connection,
+                                  $associations_table = null,
+                                  $nonces_table = null)
+    {
+        $this->associations_table_name = "oid_associations";
+        $this->nonces_table_name = "oid_nonces";
+
+        // Check the connection object type to be sure it's a PEAR
+        // database connection.
+        if (!is_object($connection) ||
+            !is_subclass_of($connection, 'mdb2_driver_common')) {
+            trigger_error("Auth_OpenID_MDB2Store expected PEAR connection " .
+                          "object (got ".get_class($connection).")",
+                          E_USER_ERROR);
+            return;
+        }
+
+        $this->connection = $connection;
+
+        // Be sure to set the fetch mode so the results are keyed on
+        // column name instead of column index.
+        $this->connection->setFetchMode(MDB2_FETCHMODE_ASSOC);
+        
+        if (PEAR::isError($this->connection->loadModule('Extended'))) {
+            trigger_error("Unable to load MDB2_Extended module", E_USER_ERROR);
+            return;
+        }
+
+        if ($associations_table) {
+            $this->associations_table_name = $associations_table;
+        }
+
+        if ($nonces_table) {
+            $this->nonces_table_name = $nonces_table;
+        }
+
+        $this->max_nonce_age = 6 * 60 * 60;
+    }
+
+    function tableExists($table_name)
+    {
+        return !PEAR::isError($this->connection->query(
+                                  sprintf("SELECT * FROM %s LIMIT 0",
+                                          $table_name)));
+    }
+
+    function createTables()
+    {
+        $n = $this->create_nonce_table();
+        $a = $this->create_assoc_table();
+
+        if (!$n || !$a) {
+            return false;
+        }
+        return true;
+    }
+
+    function create_nonce_table()
+    {
+        if (!$this->tableExists($this->nonces_table_name)) {
+            switch ($this->connection->phptype) {
+                case "mysql":
+                case "mysqli":
+                    // Custom SQL for MySQL to use InnoDB and variable-
+                    // length keys
+                    $r = $this->connection->exec(
+                        sprintf("CREATE TABLE %s (\n".
+                                "  server_url VARCHAR(2047) NOT NULL DEFAULT '',\n".
+                                "  timestamp INTEGER NOT NULL,\n".
+                                "  salt CHAR(40) NOT NULL,\n".
+                                "  UNIQUE (server_url(255), timestamp, salt)\n".
+                                ") TYPE=InnoDB",
+                                $this->nonces_table_name));
+                    if (PEAR::isError($r)) {
+                        return false;
+                    }
+                    break;
+                default:
+                    if (PEAR::isError(
+                        $this->connection->loadModule('Manager'))) {
+                        return false;
+                    }
+                    $fields = array(
+                        "server_url" => array(
+                            "type" => "text",
+                            "length" => 2047,
+                            "notnull" => true
+                        ),
+                        "timestamp" => array(
+                            "type" => "integer",
+                            "notnull" => true
+                        ),
+                        "salt" => array(
+                            "type" => "text",
+                            "length" => 40,
+                            "fixed" => true,
+                            "notnull" => true
+                        )
+                    );
+                    $constraint = array(
+                        "unique" => 1,
+                        "fields" => array(
+                            "server_url" => true,
+                            "timestamp" => true,
+                            "salt" => true
+                        )
+                    );
+                    
+                    $r = $this->connection->createTable($this->nonces_table_name,
+                                                        $fields);
+                    if (PEAR::isError($r)) {
+                        return false;
+                    }
+                    
+                    $r = $this->connection->createConstraint(
+                        $this->nonces_table_name,
+                        $this->nonces_table_name . "_constraint",
+                        $constraint);
+                    if (PEAR::isError($r)) {
+                        return false;
+                    }
+                    break;
+            }
+        }
+        return true;
+    }
+
+    function create_assoc_table()
+    {
+        if (!$this->tableExists($this->associations_table_name)) {
+            switch ($this->connection->phptype) {
+                case "mysql":
+                case "mysqli":
+                    // Custom SQL for MySQL to use InnoDB and variable-
+                    // length keys
+                    $r = $this->connection->exec(
+                        sprintf("CREATE TABLE %s(\n".
+                                "  server_url VARCHAR(2047) NOT NULL DEFAULT '',\n".
+                                "  handle VARCHAR(255) NOT NULL,\n".
+                                "  secret BLOB NOT NULL,\n".
+                                "  issued INTEGER NOT NULL,\n".
+                                "  lifetime INTEGER NOT NULL,\n".
+                                "  assoc_type VARCHAR(64) NOT NULL,\n".
+                                "  PRIMARY KEY (server_url(255), handle)\n".
+                                ") TYPE=InnoDB",
+                            $this->associations_table_name));
+                    if (PEAR::isError($r)) {
+                        return false;
+                    }
+                    break;
+                default:
+                    if (PEAR::isError(
+                        $this->connection->loadModule('Manager'))) {
+                        return false;
+                    }
+                    $fields = array(
+                        "server_url" => array(
+                            "type" => "text",
+                            "length" => 2047,
+                            "notnull" => true
+                        ),
+                        "handle" => array(
+                            "type" => "text",
+                            "length" => 255,
+                            "notnull" => true
+                        ),
+                        "secret" => array(
+                            "type" => "blob",
+                            "length" => "255",
+                            "notnull" => true
+                        ),
+                        "issued" => array(
+                            "type" => "integer",
+                            "notnull" => true
+                        ),
+                        "lifetime" => array(
+                            "type" => "integer",
+                            "notnull" => true
+                        ),
+                        "assoc_type" => array(
+                            "type" => "text",
+                            "length" => 64,
+                            "notnull" => true
+                        )
+                    );
+                    $options = array(
+                        "primary" => array(
+                            "server_url" => true,
+                            "handle" => true
+                        )
+                    );
+                    
+                    $r = $this->connection->createTable(
+                        $this->associations_table_name,
+                        $fields,
+                        $options);
+                    if (PEAR::isError($r)) {
+                        return false;
+                    }
+                    break;
+            }
+        }
+        return true;
+    }
+
+    function storeAssociation($server_url, $association)
+    {
+        $fields = array(
+            "server_url" => array(
+                "value" => $server_url,
+                "key" => true
+            ),
+            "handle" => array(
+                "value" => $association->handle,
+                "key" => true
+            ),
+            "secret" => array(
+                "value" => $association->secret,
+                "type" => "blob"
+            ),
+            "issued" => array(
+                "value" => $association->issued
+            ),
+            "lifetime" => array(
+                "value" => $association->lifetime
+            ),
+            "assoc_type" => array(
+                "value" => $association->assoc_type
+            )
+        );
+        
+        return !PEAR::isError($this->connection->replace(
+                                  $this->associations_table_name,
+                                  $fields));
+    }
+
+    function cleanupNonces()
+    {
+        global $Auth_OpenID_SKEW;
+        $v = time() - $Auth_OpenID_SKEW;
+
+        return $this->connection->exec(
+            sprintf("DELETE FROM %s WHERE timestamp < %d",
+                    $this->nonces_table_name, $v));
+    }
+
+    function cleanupAssociations()
+    {
+        return $this->connection->exec(
+            sprintf("DELETE FROM %s WHERE issued + lifetime < %d",
+                    $this->associations_table_name, time()));
+    }
+
+    function getAssociation($server_url, $handle = null)
+    {
+        $sql = "";
+        $params = null;
+        $types = array(
+                       "text",
+                       "blob",
+                       "integer",
+                       "integer",
+                       "text"
+                       );
+        if ($handle !== null) {
+            $sql = sprintf("SELECT handle, secret, issued, lifetime, assoc_type " .
+                           "FROM %s WHERE server_url = ? AND handle = ?",
+                           $this->associations_table_name);
+            $params = array($server_url, $handle);
+        } else {
+            $sql = sprintf("SELECT handle, secret, issued, lifetime, assoc_type " .
+                           "FROM %s WHERE server_url = ? ORDER BY issued DESC",
+                           $this->associations_table_name);
+            $params = array($server_url);
+        }
+        
+        $assoc = $this->connection->getRow($sql, $types, $params);
+
+        if (!$assoc || PEAR::isError($assoc)) {
+            return null;
+        } else {
+            $association = new Auth_OpenID_Association($assoc['handle'],
+                                                       stream_get_contents(
+                                                           $assoc['secret']),
+                                                       $assoc['issued'],
+                                                       $assoc['lifetime'],
+                                                       $assoc['assoc_type']);
+            fclose($assoc['secret']);
+            return $association;
+        }
+    }
+
+    function removeAssociation($server_url, $handle)
+    {
+        $r = $this->connection->execParam(
+            sprintf("DELETE FROM %s WHERE server_url = ? AND handle = ?",
+                    $this->associations_table_name),
+            array($server_url, $handle));
+        
+        if (PEAR::isError($r) || $r == 0) {
+            return false;
+        }
+        return true;
+    }
+
+    function useNonce($server_url, $timestamp, $salt)
+    {
+        global $Auth_OpenID_SKEW;
+
+        if (abs($timestamp - time()) > $Auth_OpenID_SKEW ) {
+            return false;
+        }
+        
+        $fields = array(
+                        "timestamp" => $timestamp,
+                        "salt" => $salt
+                        );
+        
+        if (!empty($server_url)) {
+            $fields["server_url"] = $server_url;
+        }
+        
+        $r = $this->connection->autoExecute(
+            $this->nonces_table_name,
+            $fields,
+            MDB2_AUTOQUERY_INSERT);
+        
+        if (PEAR::isError($r)) {
+            return false;
+        }
+        return true;
+    }
+
+    /**
+     * Resets the store by removing all records from the store's
+     * tables.
+     */
+    function reset()
+    {
+        $this->connection->query(sprintf("DELETE FROM %s",
+                                         $this->associations_table_name));
+
+        $this->connection->query(sprintf("DELETE FROM %s",
+                                         $this->nonces_table_name));
+    }
+
+}
+
+?>
+

--- /dev/null
+++ b/lib/openid-php/Auth/OpenID/MemcachedStore.php
@@ -1,1 +1,208 @@
-
+<?php
+
+/**
+ * This file supplies a memcached store backend for OpenID servers and
+ * consumers.
+ *
+ * PHP versions 4 and 5
+ *
+ * LICENSE: See the COPYING file included in this distribution.
+ *
+ * @package OpenID
+ * @author Artemy Tregubenko <me@arty.name>
+ * @copyright 2008 JanRain, Inc.
+ * @license http://www.apache.org/licenses/LICENSE-2.0 Apache
+ * Contributed by Open Web Technologies <http://openwebtech.ru/>
+ */
+
+/**
+ * Import the interface for creating a new store class.
+ */
+require_once 'Auth/OpenID/Interface.php';
+
+/**
+ * This is a memcached-based store for OpenID associations and
+ * nonces. 
+ * 
+ * As memcache has limit of 250 chars for key length, 
+ * server_url, handle and salt are hashed with sha1(). 
+ *
+ * Most of the methods of this class are implementation details.
+ * People wishing to just use this store need only pay attention to
+ * the constructor.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_MemcachedStore extends Auth_OpenID_OpenIDStore {
+
+    /**
+     * Initializes a new {@link Auth_OpenID_MemcachedStore} instance.
+     * Just saves memcached object as property.
+     *
+     * @param resource connection Memcache connection resourse
+     */
+    function Auth_OpenID_MemcachedStore($connection, $compress = false)
+    {
+        $this->connection = $connection;
+        $this->compress = $compress ? MEMCACHE_COMPRESSED : 0;
+    }
+
+    /**
+     * Store association until its expiration time in memcached. 
+     * Overwrites any existing association with same server_url and 
+     * handle. Handles list of associations for every server. 
+     */
+    function storeAssociation($server_url, $association)
+    {
+        // create memcached keys for association itself 
+        // and list of associations for this server
+        $associationKey = $this->associationKey($server_url, 
+            $association->handle);
+        $serverKey = $this->associationServerKey($server_url);
+        
+        // get list of associations 
+        $serverAssociations = $this->connection->get($serverKey);
+        
+        // if no such list, initialize it with empty array
+        if (!$serverAssociations) {
+            $serverAssociations = array();
+        }
+        // and store given association key in it
+        $serverAssociations[$association->issued] = $associationKey;
+        
+        // save associations' keys list 
+        $this->connection->set(
+            $serverKey,
+            $serverAssociations,
+            $this->compress
+        );
+        // save association itself
+        $this->connection->set(
+            $associationKey,
+            $association, 
+            $this->compress, 
+            $association->issued + $association->lifetime);
+    }
+
+    /**
+     * Read association from memcached. If no handle given 
+     * and multiple associations found, returns latest issued
+     */
+    function getAssociation($server_url, $handle = null)
+    {
+        // simple case: handle given
+        if ($handle !== null) {
+            // get association, return null if failed
+            $association = $this->connection->get(
+                $this->associationKey($server_url, $handle));
+            return $association ? $association : null;
+        }
+        
+        // no handle given, working with list
+        // create key for list of associations
+        $serverKey = $this->associationServerKey($server_url);
+        
+        // get list of associations
+        $serverAssociations = $this->connection->get($serverKey);
+        // return null if failed or got empty list
+        if (!$serverAssociations) {
+            return null;
+        }
+        
+        // get key of most recently issued association
+        $keys = array_keys($serverAssociations);
+        sort($keys);
+        $lastKey = $serverAssociations[array_pop($keys)];
+        
+        // get association, return null if failed
+        $association = $this->connection->get($lastKey);
+        return $association ? $association : null;
+    }
+
+    /**
+     * Immediately delete association from memcache.
+     */
+    function removeAssociation($server_url, $handle)
+    {
+        // create memcached keys for association itself 
+        // and list of associations for this server
+        $serverKey = $this->associationServerKey($server_url);
+        $associationKey = $this->associationKey($server_url, 
+            $handle);
+        
+        // get list of associations
+        $serverAssociations = $this->connection->get($serverKey);
+        // return null if failed or got empty list
+        if (!$serverAssociations) {
+            return false;
+        }
+        
+        // ensure that given association key exists in list
+        $serverAssociations = array_flip($serverAssociations);
+        if (!array_key_exists($associationKey, $serverAssociations)) {
+            return false;
+        }
+        
+        // remove given association key from list
+        unset($serverAssociations[$associationKey]);
+        $serverAssociations = array_flip($serverAssociations);
+        
+        // save updated list
+        $this->connection->set(
+            $serverKey,
+            $serverAssociations,
+            $this->compress
+        );
+
+        // delete association 
+        return $this->connection->delete($associationKey);
+    }
+
+    /**
+     * Create nonce for server and salt, expiring after 
+     * $Auth_OpenID_SKEW seconds.
+     */
+    function useNonce($server_url, $timestamp, $salt)
+    {
+        global $Auth_OpenID_SKEW;
+        
+        // save one request to memcache when nonce obviously expired 
+        if (abs($timestamp - time()) > $Auth_OpenID_SKEW) {
+            return false;
+        }
+        
+        // returns false when nonce already exists
+        // otherwise adds nonce
+        return $this->connection->add(
+            'openid_nonce_' . sha1($server_url) . '_' . sha1($salt), 
+            1, // any value here 
+            $this->compress, 
+            $Auth_OpenID_SKEW);
+    }
+    
+    /**
+     * Memcache key is prefixed with 'openid_association_' string. 
+     */
+    function associationKey($server_url, $handle = null) 
+    {
+        return 'openid_association_' . sha1($server_url) . '_' . sha1($handle);
+    }
+    
+    /**
+     * Memcache key is prefixed with 'openid_association_' string. 
+     */
+    function associationServerKey($server_url) 
+    {
+        return 'openid_association_server_' . sha1($server_url);
+    }
+    
+    /**
+     * Report that this storage doesn't support cleanup
+     */
+    function supportsCleanup()
+    {
+        return false;
+    }
+}
+
+

--- /dev/null
+++ b/lib/openid-php/Auth/OpenID/Message.php
@@ -1,1 +1,921 @@
-
+<?php
+
+/**
+ * Extension argument processing code
+ *
+ * @package OpenID
+ */
+
+/**
+ * Import tools needed to deal with messages.
+ */
+require_once 'Auth/OpenID.php';
+require_once 'Auth/OpenID/KVForm.php';
+require_once 'Auth/Yadis/XML.php';
+require_once 'Auth/OpenID/Consumer.php'; // For Auth_OpenID_FailureResponse
+
+// This doesn't REALLY belong here, but where is better?
+define('Auth_OpenID_IDENTIFIER_SELECT',
+       "http://specs.openid.net/auth/2.0/identifier_select");
+
+// URI for Simple Registration extension, the only commonly deployed
+// OpenID 1.x extension, and so a special case
+define('Auth_OpenID_SREG_URI', 'http://openid.net/sreg/1.0');
+
+// The OpenID 1.X namespace URI
+define('Auth_OpenID_OPENID1_NS', 'http://openid.net/signon/1.0');
+define('Auth_OpenID_THE_OTHER_OPENID1_NS', 'http://openid.net/signon/1.1');
+
+function Auth_OpenID_isOpenID1($ns)
+{
+    return ($ns == Auth_OpenID_THE_OTHER_OPENID1_NS) ||
+        ($ns == Auth_OpenID_OPENID1_NS);
+}
+
+// The OpenID 2.0 namespace URI
+define('Auth_OpenID_OPENID2_NS', 'http://specs.openid.net/auth/2.0');
+
+// The namespace consisting of pairs with keys that are prefixed with
+// "openid."  but not in another namespace.
+define('Auth_OpenID_NULL_NAMESPACE', 'Null namespace');
+
+// The null namespace, when it is an allowed OpenID namespace
+define('Auth_OpenID_OPENID_NS', 'OpenID namespace');
+
+// The top-level namespace, excluding all pairs with keys that start
+// with "openid."
+define('Auth_OpenID_BARE_NS', 'Bare namespace');
+
+// Sentinel for Message implementation to indicate that getArg should
+// return null instead of returning a default.
+define('Auth_OpenID_NO_DEFAULT', 'NO DEFAULT ALLOWED');
+
+// Limit, in bytes, of identity provider and return_to URLs, including
+// response payload.  See OpenID 1.1 specification, Appendix D.
+define('Auth_OpenID_OPENID1_URL_LIMIT', 2047);
+
+// All OpenID protocol fields.  Used to check namespace aliases.
+global $Auth_OpenID_OPENID_PROTOCOL_FIELDS;
+$Auth_OpenID_OPENID_PROTOCOL_FIELDS = array(
+    'ns', 'mode', 'error', 'return_to', 'contact', 'reference',
+    'signed', 'assoc_type', 'session_type', 'dh_modulus', 'dh_gen',
+    'dh_consumer_public', 'claimed_id', 'identity', 'realm',
+    'invalidate_handle', 'op_endpoint', 'response_nonce', 'sig',
+    'assoc_handle', 'trust_root', 'openid');
+
+// Global namespace / alias registration map.  See
+// Auth_OpenID_registerNamespaceAlias.
+global $Auth_OpenID_registered_aliases;
+$Auth_OpenID_registered_aliases = array();
+
+/**
+ * Registers a (namespace URI, alias) mapping in a global namespace
+ * alias map.  Raises NamespaceAliasRegistrationError if either the
+ * namespace URI or alias has already been registered with a different
+ * value.  This function is required if you want to use a namespace
+ * with an OpenID 1 message.
+ */
+function Auth_OpenID_registerNamespaceAlias($namespace_uri, $alias)
+{
+    global $Auth_OpenID_registered_aliases;
+
+    if (Auth_OpenID::arrayGet($Auth_OpenID_registered_aliases,
+                              $alias) == $namespace_uri) {
+        return true;
+    }
+
+    if (in_array($namespace_uri,
+                 array_values($Auth_OpenID_registered_aliases))) {
+        return false;
+    }
+
+    if (in_array($alias, array_keys($Auth_OpenID_registered_aliases))) {
+        return false;
+    }
+
+    $Auth_OpenID_registered_aliases[$alias] = $namespace_uri;
+    return true;
+}
+
+/**
+ * Removes a (namespace_uri, alias) registration from the global
+ * namespace alias map.  Returns true if the removal succeeded; false
+ * if not (if the mapping did not exist).
+ */
+function Auth_OpenID_removeNamespaceAlias($namespace_uri, $alias)
+{
+    global $Auth_OpenID_registered_aliases;
+
+    if (Auth_OpenID::arrayGet($Auth_OpenID_registered_aliases,
+                              $alias) === $namespace_uri) {
+        unset($Auth_OpenID_registered_aliases[$alias]);
+        return true;
+    }
+
+    return false;
+}
+
+/**
+ * An Auth_OpenID_Mapping maintains a mapping from arbitrary keys to
+ * arbitrary values.  (This is unlike an ordinary PHP array, whose
+ * keys may be only simple scalars.)
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_Mapping {
+    /**
+     * Initialize a mapping.  If $classic_array is specified, its keys
+     * and values are used to populate the mapping.
+     */
+    function Auth_OpenID_Mapping($classic_array = null)
+    {
+        $this->keys = array();
+        $this->values = array();
+
+        if (is_array($classic_array)) {
+            foreach ($classic_array as $key => $value) {
+                $this->set($key, $value);
+            }
+        }
+    }
+
+    /**
+     * Returns true if $thing is an Auth_OpenID_Mapping object; false
+     * if not.
+     */
+    static function isA($thing)
+    {
+        return (is_object($thing) &&
+                strtolower(get_class($thing)) == 'auth_openid_mapping');
+    }
+
+    /**
+     * Returns an array of the keys in the mapping.
+     */
+    function keys()
+    {
+        return $this->keys;
+    }
+
+    /**
+     * Returns an array of values in the mapping.
+     */
+    function values()
+    {
+        return $this->values;
+    }
+
+    /**
+     * Returns an array of (key, value) pairs in the mapping.
+     */
+    function items()
+    {
+        $temp = array();
+
+        for ($i = 0; $i < count($this->keys); $i++) {
+            $temp[] = array($this->keys[$i],
+                            $this->values[$i]);
+        }
+        return $temp;
+    }
+
+    /**
+     * Returns the "length" of the mapping, or the number of keys.
+     */
+    function len()
+    {
+        return count($this->keys);
+    }
+
+    /**
+     * Sets a key-value pair in the mapping.  If the key already
+     * exists, its value is replaced with the new value.
+     */
+    function set($key, $value)
+    {
+        $index = array_search($key, $this->keys);
+
+        if ($index !== false) {
+            $this->values[$index] = $value;
+        } else {
+            $this->keys[] = $key;
+            $this->values[] = $value;
+        }
+    }
+
+    /**
+     * Gets a specified value from the mapping, associated with the
+     * specified key.  If the key does not exist in the mapping,
+     * $default is returned instead.
+     */
+    function get($key, $default = null)
+    {
+        $index = array_search($key, $this->keys);
+
+        if ($index !== false) {
+            return $this->values[$index];
+        } else {
+            return $default;
+        }
+    }
+
+    /**
+     * @access private
+     */
+    function _reflow()
+    {
+        // PHP is broken yet again.  Sort the arrays to remove the
+        // hole in the numeric indexes that make up the array.
+        $old_keys = $this->keys;
+        $old_values = $this->values;
+
+        $this->keys = array();
+        $this->values = array();
+
+        foreach ($old_keys as $k) {
+            $this->keys[] = $k;
+        }
+
+        foreach ($old_values as $v) {
+            $this->values[] = $v;
+        }
+    }
+
+    /**
+     * Deletes a key-value pair from the mapping with the specified
+     * key.
+     */
+    function del($key)
+    {
+        $index = array_search($key, $this->keys);
+
+        if ($index !== false) {
+            unset($this->keys[$index]);
+            unset($this->values[$index]);
+            $this->_reflow();
+            return true;
+        }
+        return false;
+    }
+
+    /**
+     * Returns true if the specified value has a key in the mapping;
+     * false if not.
+     */
+    function contains($value)
+    {
+        return (array_search($value, $this->keys) !== false);
+    }
+}
+
+/**
+ * Maintains a bijective map between namespace uris and aliases.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_NamespaceMap {
+    function Auth_OpenID_NamespaceMap()
+    {
+        $this->alias_to_namespace = new Auth_OpenID_Mapping();
+        $this->namespace_to_alias = new Auth_OpenID_Mapping();
+        $this->implicit_namespaces = array();
+    }
+
+    function getAlias($namespace_uri)
+    {
+        return $this->namespace_to_alias->get($namespace_uri);
+    }
+
+    function getNamespaceURI($alias)
+    {
+        return $this->alias_to_namespace->get($alias);
+    }
+
+    function iterNamespaceURIs()
+    {
+        // Return an iterator over the namespace URIs
+        return $this->namespace_to_alias->keys();
+    }
+
+    function iterAliases()
+    {
+        // Return an iterator over the aliases"""
+        return $this->alias_to_namespace->keys();
+    }
+
+    function iteritems()
+    {
+        return $this->namespace_to_alias->items();
+    }
+
+    function isImplicit($namespace_uri)
+    {
+        return in_array($namespace_uri, $this->implicit_namespaces);
+    }
+
+    function addAlias($namespace_uri, $desired_alias, $implicit=false)
+    {
+        // Add an alias from this namespace URI to the desired alias
+        global $Auth_OpenID_OPENID_PROTOCOL_FIELDS;
+
+        // Check that desired_alias is not an openid protocol field as
+        // per the spec.
+        if (in_array($desired_alias, $Auth_OpenID_OPENID_PROTOCOL_FIELDS)) {
+            Auth_OpenID::log("\"%s\" is not an allowed namespace alias",
+                            $desired_alias);
+            return null;
+        }
+
+        // Check that desired_alias does not contain a period as per
+        // the spec.
+        if (strpos($desired_alias, '.') !== false) {
+            Auth_OpenID::log('"%s" must not contain a dot', $desired_alias);
+            return null;
+        }
+
+        // Check that there is not a namespace already defined for the
+        // desired alias
+        $current_namespace_uri =
+            $this->alias_to_namespace->get($desired_alias);
+
+        if (($current_namespace_uri !== null) &&
+            ($current_namespace_uri != $namespace_uri)) {
+            Auth_OpenID::log('Cannot map "%s" because previous mapping exists',
+                            $namespace_uri);
+            return null;
+        }
+
+        // Check that there is not already a (different) alias for
+        // this namespace URI
+        $alias = $this->namespace_to_alias->get($namespace_uri);
+
+        if (($alias !== null) && ($alias != $desired_alias)) {
+            Auth_OpenID::log('Cannot map %s to alias %s. ' .
+                            'It is already mapped to alias %s',
+                            $namespace_uri, $desired_alias, $alias);
+            return null;
+        }
+
+        assert((Auth_OpenID_NULL_NAMESPACE === $desired_alias) ||
+               is_string($desired_alias));
+
+        $this->alias_to_namespace->set($desired_alias, $namespace_uri);
+        $this->namespace_to_alias->set($namespace_uri, $desired_alias);
+        if ($implicit) {
+            array_push($this->implicit_namespaces, $namespace_uri);
+        }
+
+        return $desired_alias;
+    }
+
+    function add($namespace_uri)
+    {
+        // Add this namespace URI to the mapping, without caring what
+        // alias it ends up with
+
+        // See if this namespace is already mapped to an alias
+        $alias = $this->namespace_to_alias->get($namespace_uri);
+
+        if ($alias !== null) {
+            return $alias;
+        }
+
+        // Fall back to generating a numerical alias
+        $i = 0;
+        while (1) {
+            $alias = 'ext' . strval($i);
+            if ($this->addAlias($namespace_uri, $alias) === null) {
+                $i += 1;
+            } else {
+                return $alias;
+            }
+        }
+
+        // Should NEVER be reached!
+        return null;
+    }
+
+    function contains($namespace_uri)
+    {
+        return $this->isDefined($namespace_uri);
+    }
+
+    function isDefined($namespace_uri)
+    {
+        return $this->namespace_to_alias->contains($namespace_uri);
+    }
+}
+
+/**
+ * In the implementation of this object, null represents the global
+ * namespace as well as a namespace with no key.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_Message {
+
+    function Auth_OpenID_Message($openid_namespace = null)
+    {
+        // Create an empty Message
+        $this->allowed_openid_namespaces = array(
+                               Auth_OpenID_OPENID1_NS,
+                               Auth_OpenID_THE_OTHER_OPENID1_NS,
+                               Auth_OpenID_OPENID2_NS);
+
+        $this->args = new Auth_OpenID_Mapping();
+        $this->namespaces = new Auth_OpenID_NamespaceMap();
+        if ($openid_namespace === null) {
+            $this->_openid_ns_uri = null;
+        } else {
+            $implicit = Auth_OpenID_isOpenID1($openid_namespace);
+            $this->setOpenIDNamespace($openid_namespace, $implicit);
+        }
+    }
+
+    function isOpenID1()
+    {
+        return Auth_OpenID_isOpenID1($this->getOpenIDNamespace());
+    }
+
+    function isOpenID2()
+    {
+        return $this->getOpenIDNamespace() == Auth_OpenID_OPENID2_NS;
+    }
+
+    static function fromPostArgs($args)
+    {
+        // Construct a Message containing a set of POST arguments
+        $obj = new Auth_OpenID_Message();
+
+        // Partition into "openid." args and bare args
+        $openid_args = array();
+        foreach ($args as $key => $value) {
+
+            if (is_array($value)) {
+                return null;
+            }
+
+            $parts = explode('.', $key, 2);
+
+            if (count($parts) == 2) {
+                list($prefix, $rest) = $parts;
+            } else {
+                $prefix = null;
+            }
+
+            if ($prefix != 'openid') {
+                $obj->args->set(array(Auth_OpenID_BARE_NS, $key), $value);
+            } else {
+                $openid_args[$rest] = $value;
+            }
+        }
+
+        if ($obj->_fromOpenIDArgs($openid_args)) {
+            return $obj;
+        } else {
+            return null;
+        }
+    }
+
+    static function fromOpenIDArgs($openid_args)
+    {
+        // Takes an array.
+
+        // Construct a Message from a parsed KVForm message
+        $obj = new Auth_OpenID_Message();
+        if ($obj->_fromOpenIDArgs($openid_args)) {
+            return $obj;
+        } else {
+            return null;
+        }
+    }
+
+    /**
+     * @access private
+     */
+    function _fromOpenIDArgs($openid_args)
+    {
+        global $Auth_OpenID_registered_aliases;
+
+        // Takes an Auth_OpenID_Mapping instance OR an array.
+
+        if (!Auth_OpenID_Mapping::isA($openid_args)) {
+            $openid_args = new Auth_OpenID_Mapping($openid_args);
+        }
+
+        $ns_args = array();
+
+        // Resolve namespaces
+        foreach ($openid_args->items() as $pair) {
+            list($rest, $value) = $pair;
+
+            $parts = explode('.', $rest, 2);
+
+            if (count($parts) == 2) {
+                list($ns_alias, $ns_key) = $parts;
+            } else {
+                $ns_alias = Auth_OpenID_NULL_NAMESPACE;
+                $ns_key = $rest;
+            }
+
+            if ($ns_alias == 'ns') {
+                if ($this->namespaces->addAlias($value, $ns_key) === null) {
+                    return false;
+                }
+            } else if (($ns_alias == Auth_OpenID_NULL_NAMESPACE) &&
+                       ($ns_key == 'ns')) {
+                // null namespace
+                if ($this->setOpenIDNamespace($value, false) === false) {
+                    return false;
+                }
+            } else {
+                $ns_args[] = array($ns_alias, $ns_key, $value);
+            }
+        }
+
+        if (!$this->getOpenIDNamespace()) {
+            if ($this->setOpenIDNamespace(Auth_OpenID_OPENID1_NS, true) ===
+                false) {
+                return false;
+            }
+        }
+
+        // Actually put the pairs into the appropriate namespaces
+        foreach ($ns_args as $triple) {
+            list($ns_alias, $ns_key, $value) = $triple;
+            $ns_uri = $this->namespaces->getNamespaceURI($ns_alias);
+            if ($ns_uri === null) {
+                $ns_uri = $this->_getDefaultNamespace($ns_alias);
+                if ($ns_uri === null) {
+
+                    $ns_uri = Auth_OpenID_OPENID_NS;
+                    $ns_key = sprintf('%s.%s', $ns_alias, $ns_key);
+                } else {
+                    $this->namespaces->addAlias($ns_uri, $ns_alias, true);
+                }
+            }
+
+            $this->setArg($ns_uri, $ns_key, $value);
+        }
+
+        return true;
+    }
+
+    function _getDefaultNamespace($mystery_alias)
+    {
+        global $Auth_OpenID_registered_aliases;
+        if ($this->isOpenID1()) {
+            return @$Auth_OpenID_registered_aliases[$mystery_alias];
+        }
+        return null;
+    }
+
+    function setOpenIDNamespace($openid_ns_uri, $implicit)
+    {
+        if (!in_array($openid_ns_uri, $this->allowed_openid_namespaces)) {
+            Auth_OpenID::log('Invalid null namespace: "%s"', $openid_ns_uri);
+            return false;
+        }
+
+        $succeeded = $this->namespaces->addAlias($openid_ns_uri,
+                                                 Auth_OpenID_NULL_NAMESPACE,
+                                                 $implicit);
+        if ($succeeded === false) {
+            return false;
+        }
+
+        $this->_openid_ns_uri = $openid_ns_uri;
+
+        return true;
+    }
+
+    function getOpenIDNamespace()
+    {
+        return $this->_openid_ns_uri;
+    }
+
+    static function fromKVForm($kvform_string)
+    {
+        // Create a Message from a KVForm string
+        return Auth_OpenID_Message::fromOpenIDArgs(
+                     Auth_OpenID_KVForm::toArray($kvform_string));
+    }
+
+    function copy()
+    {
+        return $this;
+    }
+
+    function toPostArgs()
+    {
+        // Return all arguments with openid. in front of namespaced
+        // arguments.
+
+        $args = array();
+
+        // Add namespace definitions to the output
+        foreach ($this->namespaces->iteritems() as $pair) {
+            list($ns_uri, $alias) = $pair;
+            if ($this->namespaces->isImplicit($ns_uri)) {
+                continue;
+            }
+            if ($alias == Auth_OpenID_NULL_NAMESPACE) {
+                $ns_key = 'openid.ns';
+            } else {
+                $ns_key = 'openid.ns.' . $alias;
+            }
+            $args[$ns_key] = $ns_uri;
+        }
+
+        foreach ($this->args->items() as $pair) {
+            list($ns_parts, $value) = $pair;
+            list($ns_uri, $ns_key) = $ns_parts;
+            $key = $this->getKey($ns_uri, $ns_key);
+            $args[$key] = $value;
+        }
+
+        return $args;
+    }
+
+    function toArgs()
+    {
+        // Return all namespaced arguments, failing if any
+        // non-namespaced arguments exist.
+        $post_args = $this->toPostArgs();
+        $kvargs = array();
+        foreach ($post_args as $k => $v) {
+            if (strpos($k, 'openid.') !== 0) {
+                // raise ValueError(
+                //   'This message can only be encoded as a POST, because it '
+                //   'contains arguments that are not prefixed with "openid."')
+                return null;
+            } else {
+                $kvargs[substr($k, 7)] = $v;
+            }
+        }
+
+        return $kvargs;
+    }
+
+    function toFormMarkup($action_url, $form_tag_attrs = null,
+                          $submit_text = "Continue")
+    {
+        $form = "<form accept-charset=\"UTF-8\" ".
+            "enctype=\"application/x-www-form-urlencoded\"";
+
+        if (!$form_tag_attrs) {
+            $form_tag_attrs = array();
+        }
+
+        $form_tag_attrs['action'] = $action_url;
+        $form_tag_attrs['method'] = 'post';
+
+        unset($form_tag_attrs['enctype']);
+        unset($form_tag_attrs['accept-charset']);
+
+        if ($form_tag_attrs) {
+            foreach ($form_tag_attrs as $name => $attr) {
+                $form .= sprintf(" %s=\"%s\"", $name, $attr);
+            }
+        }
+
+        $form .= ">\n";
+
+        foreach ($this->toPostArgs() as $name => $value) {
+            $form .= sprintf(
+                        "<input type=\"hidden\" name=\"%s\" value=\"%s\" />\n",
+                        $name, urldecode($value));
+        }
+
+        $form .= sprintf("<input type=\"submit\" value=\"%s\" />\n",
+                         $submit_text);
+
+        $form .= "</form>\n";
+
+        return $form;
+    }
+
+    function toURL($base_url)
+    {
+        // Generate a GET URL with the parameters in this message
+        // attached as query parameters.
+        return Auth_OpenID::appendArgs($base_url, $this->toPostArgs());
+    }
+
+    function toKVForm()
+    {
+        // Generate a KVForm string that contains the parameters in
+        // this message. This will fail if the message contains
+        // arguments outside of the 'openid.' prefix.
+        return Auth_OpenID_KVForm::fromArray($this->toArgs());
+    }
+
+    function toURLEncoded()
+    {
+        // Generate an x-www-urlencoded string
+        $args = array();
+
+        foreach ($this->toPostArgs() as $k => $v) {
+            $args[] = array($k, $v);
+        }
+
+        sort($args);
+        return Auth_OpenID::httpBuildQuery($args);
+    }
+
+    /**
+     * @access private
+     */
+    function _fixNS($namespace)
+    {
+        // Convert an input value into the internally used values of
+        // this object
+
+        if ($namespace == Auth_OpenID_OPENID_NS) {
+            if ($this->_openid_ns_uri === null) {
+                return new Auth_OpenID_FailureResponse(null,
+                    'OpenID namespace not set');
+            } else {
+                $namespace = $this->_openid_ns_uri;
+            }
+        }
+
+        if (($namespace != Auth_OpenID_BARE_NS) &&
+              (!is_string($namespace))) {
+            //TypeError
+            $err_msg = sprintf("Namespace must be Auth_OpenID_BARE_NS, ".
+                              "Auth_OpenID_OPENID_NS or a string. got %s",
+                              print_r($namespace, true));
+            return new Auth_OpenID_FailureResponse(null, $err_msg);
+        }
+
+        if (($namespace != Auth_OpenID_BARE_NS) &&
+            (strpos($namespace, ':') === false)) {
+            // fmt = 'OpenID 2.0 namespace identifiers SHOULD be URIs. Got %r'
+            // warnings.warn(fmt % (namespace,), DeprecationWarning)
+
+            if ($namespace == 'sreg') {
+                // fmt = 'Using %r instead of "sreg" as namespace'
+                // warnings.warn(fmt % (SREG_URI,), DeprecationWarning,)
+                return Auth_OpenID_SREG_URI;
+            }
+        }
+
+        return $namespace;
+    }
+
+    function hasKey($namespace, $ns_key)
+    {
+        $namespace = $this->_fixNS($namespace);
+        if (Auth_OpenID::isFailure($namespace)) {
+            // XXX log me
+            return false;
+        } else {
+            return $this->args->contains(array($namespace, $ns_key));
+        }
+    }
+
+    function getKey($namespace, $ns_key)
+    {
+        // Get the key for a particular namespaced argument
+        $namespace = $this->_fixNS($namespace);
+        if (Auth_OpenID::isFailure($namespace)) {
+            return $namespace;
+        }
+        if ($namespace == Auth_OpenID_BARE_NS) {
+            return $ns_key;
+        }
+
+        $ns_alias = $this->namespaces->getAlias($namespace);
+
+        // No alias is defined, so no key can exist
+        if ($ns_alias === null) {
+            return null;
+        }
+
+        if ($ns_alias == Auth_OpenID_NULL_NAMESPACE) {
+            $tail = $ns_key;
+        } else {
+            $tail = sprintf('%s.%s', $ns_alias, $ns_key);
+        }
+
+        return 'openid.' . $tail;
+    }
+
+    function getArg($namespace, $key, $default = null)
+    {
+        // Get a value for a namespaced key.
+        $namespace = $this->_fixNS($namespace);
+
+        if (Auth_OpenID::isFailure($namespace)) {
+            return $namespace;
+        } else {
+            if ((!$this->args->contains(array($namespace, $key))) &&
+              ($default == Auth_OpenID_NO_DEFAULT)) {
+                $err_msg = sprintf("Namespace %s missing required field %s",
+                                   $namespace, $key);
+                return new Auth_OpenID_FailureResponse(null, $err_msg);
+            } else {
+                return $this->args->get(array($namespace, $key), $default);
+            }
+        }
+    }
+
+    function getArgs($namespace)
+    {
+        // Get the arguments that are defined for this namespace URI
+
+        $namespace = $this->_fixNS($namespace);
+        if (Auth_OpenID::isFailure($namespace)) {
+            return $namespace;
+        } else {
+            $stuff = array();
+            foreach ($this->args->items() as $pair) {
+                list($key, $value) = $pair;
+                list($pair_ns, $ns_key) = $key;
+                if ($pair_ns == $namespace) {
+                    $stuff[$ns_key] = $value;
+                }
+            }
+
+            return $stuff;
+        }
+    }
+
+    function updateArgs($namespace, $updates)
+    {
+        // Set multiple key/value pairs in one call
+
+        $namespace = $this->_fixNS($namespace);
+
+        if (Auth_OpenID::isFailure($namespace)) {
+            return $namespace;
+        } else {
+            foreach ($updates as $k => $v) {
+                $this->setArg($namespace, $k, $v);
+            }
+            return true;
+        }
+    }
+
+    function setArg($namespace, $key, $value)
+    {
+        // Set a single argument in this namespace
+        $namespace = $this->_fixNS($namespace);
+
+        if (Auth_OpenID::isFailure($namespace)) {
+            return $namespace;
+        } else {
+            $this->args->set(array($namespace, $key), $value);
+            if ($namespace !== Auth_OpenID_BARE_NS) {
+                $this->namespaces->add($namespace);
+            }
+            return true;
+        }
+    }
+
+    function delArg($namespace, $key)
+    {
+        $namespace = $this->_fixNS($namespace);
+
+        if (Auth_OpenID::isFailure($namespace)) {
+            return $namespace;
+        } else {
+            return $this->args->del(array($namespace, $key));
+        }
+    }
+
+    function getAliasedArg($aliased_key, $default = null)
+    {
+        if ($aliased_key == 'ns') {
+            // Return the namespace URI for the OpenID namespace
+            return $this->getOpenIDNamespace();
+        }
+
+        $parts = explode('.', $aliased_key, 2);
+
+        if (count($parts) != 2) {
+            $ns = null;
+        } else {
+            list($alias, $key) = $parts;
+
+            if ($alias == 'ns') {
+              // Return the namespace URI for a namespace alias
+              // parameter.
+              return $this->namespaces->getNamespaceURI($key);
+            } else {
+              $ns = $this->namespaces->getNamespaceURI($alias);
+            }
+        }
+
+        if ($ns === null) {
+            $key = $aliased_key;
+            $ns = $this->getOpenIDNamespace();
+        }
+
+        return $this->getArg($ns, $key, $default);
+    }
+}
+
+
+

--- /dev/null
+++ b/lib/openid-php/Auth/OpenID/MySQLStore.php
@@ -1,1 +1,78 @@
+<?php
 
+/**
+ * A MySQL store.
+ *
+ * @package OpenID
+ */
+
+/**
+ * Require the base class file.
+ */
+require_once "Auth/OpenID/SQLStore.php";
+
+/**
+ * An SQL store that uses MySQL as its backend.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_MySQLStore extends Auth_OpenID_SQLStore {
+    /**
+     * @access private
+     */
+    function setSQL()
+    {
+        $this->sql['nonce_table'] =
+            "CREATE TABLE %s (\n".
+            "  server_url VARCHAR(2047) NOT NULL,\n".
+            "  timestamp INTEGER NOT NULL,\n".
+            "  salt CHAR(40) NOT NULL,\n".
+            "  UNIQUE (server_url(255), timestamp, salt)\n".
+            ") ENGINE=InnoDB";
+
+        $this->sql['assoc_table'] =
+            "CREATE TABLE %s (\n".
+            "  server_url BLOB NOT NULL,\n".
+            "  handle VARCHAR(255) NOT NULL,\n".
+            "  secret BLOB NOT NULL,\n".
+            "  issued INTEGER NOT NULL,\n".
+            "  lifetime INTEGER NOT NULL,\n".
+            "  assoc_type VARCHAR(64) NOT NULL,\n".
+            "  PRIMARY KEY (server_url(255), handle)\n".
+            ") ENGINE=InnoDB";
+
+        $this->sql['set_assoc'] =
+            "REPLACE INTO %s (server_url, handle, secret, issued,\n".
+            "  lifetime, assoc_type) VALUES (?, ?, !, ?, ?, ?)";
+
+        $this->sql['get_assocs'] =
+            "SELECT handle, secret, issued, lifetime, assoc_type FROM %s ".
+            "WHERE server_url = ?";
+
+        $this->sql['get_assoc'] =
+            "SELECT handle, secret, issued, lifetime, assoc_type FROM %s ".
+            "WHERE server_url = ? AND handle = ?";
+
+        $this->sql['remove_assoc'] =
+            "DELETE FROM %s WHERE server_url = ? AND handle = ?";
+
+        $this->sql['add_nonce'] =
+            "INSERT INTO %s (server_url, timestamp, salt) VALUES (?, ?, ?)";
+
+        $this->sql['clean_nonce'] =
+            "DELETE FROM %s WHERE timestamp < ?";
+
+        $this->sql['clean_assoc'] =
+            "DELETE FROM %s WHERE issued + lifetime < ?";
+    }
+
+    /**
+     * @access private
+     */
+    function blobEncode($blob)
+    {
+        return "0x" . bin2hex($blob);
+    }
+}
+
+

--- /dev/null
+++ b/lib/openid-php/Auth/OpenID/Nonce.php
@@ -1,1 +1,109 @@
+<?php
 
+/**
+ * Nonce-related functionality.
+ *
+ * @package OpenID
+ */
+
+/**
+ * Need CryptUtil to generate random strings.
+ */
+require_once 'Auth/OpenID/CryptUtil.php';
+
+/**
+ * This is the characters that the nonces are made from.
+ */
+define('Auth_OpenID_Nonce_CHRS',"abcdefghijklmnopqrstuvwxyz" .
+       "ABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789");
+
+// Keep nonces for five hours (allow five hours for the combination of
+// request time and clock skew). This is probably way more than is
+// necessary, but there is not much overhead in storing nonces.
+global $Auth_OpenID_SKEW;
+$Auth_OpenID_SKEW = 60 * 60 * 5;
+
+define('Auth_OpenID_Nonce_REGEX',
+       '/(\d{4})-(\d\d)-(\d\d)T(\d\d):(\d\d):(\d\d)Z(.*)/');
+
+define('Auth_OpenID_Nonce_TIME_FMT',
+       '%Y-%m-%dT%H:%M:%SZ');
+
+function Auth_OpenID_splitNonce($nonce_string)
+{
+    // Extract a timestamp from the given nonce string
+    $result = preg_match(Auth_OpenID_Nonce_REGEX, $nonce_string, $matches);
+    if ($result != 1 || count($matches) != 8) {
+        return null;
+    }
+
+    list($unused,
+         $tm_year,
+         $tm_mon,
+         $tm_mday,
+         $tm_hour,
+         $tm_min,
+         $tm_sec,
+         $uniquifier) = $matches;
+
+    $timestamp =
+        @gmmktime($tm_hour, $tm_min, $tm_sec, $tm_mon, $tm_mday, $tm_year);
+
+    if ($timestamp === false || $timestamp < 0) {
+        return null;
+    }
+
+    return array($timestamp, $uniquifier);
+}
+
+function Auth_OpenID_checkTimestamp($nonce_string,
+                                    $allowed_skew = null,
+                                    $now = null)
+{
+    // Is the timestamp that is part of the specified nonce string
+    // within the allowed clock-skew of the current time?
+    global $Auth_OpenID_SKEW;
+
+    if ($allowed_skew === null) {
+        $allowed_skew = $Auth_OpenID_SKEW;
+    }
+
+    $parts = Auth_OpenID_splitNonce($nonce_string);
+    if ($parts == null) {
+        return false;
+    }
+
+    if ($now === null) {
+        $now = time();
+    }
+
+    $stamp = $parts[0];
+
+    // Time after which we should not use the nonce
+    $past = $now - $allowed_skew;
+
+    // Time that is too far in the future for us to allow
+    $future = $now + $allowed_skew;
+
+    // the stamp is not too far in the future and is not too far
+    // in the past
+    return (($past <= $stamp) && ($stamp <= $future));
+}
+
+function Auth_OpenID_mkNonce($when = null)
+{
+    // Generate a nonce with the current timestamp
+    $salt = Auth_OpenID_CryptUtil::randomString(
+        6, Auth_OpenID_Nonce_CHRS);
+    if ($when === null) {
+        // It's safe to call time() with no arguments; it returns a
+        // GMT unix timestamp on PHP 4 and PHP 5.  gmmktime() with no
+        // args returns a local unix timestamp on PHP 4, so don't use
+        // that.
+        $when = time();
+    }
+    $time_str = gmstrftime(Auth_OpenID_Nonce_TIME_FMT, $when);
+    return $time_str . $salt;
+}
+
+

--- /dev/null
+++ b/lib/openid-php/Auth/OpenID/PAPE.php
@@ -1,1 +1,301 @@
-
+<?php
+
+/**
+ * An implementation of the OpenID Provider Authentication Policy
+ *  Extension 1.0
+ *
+ * See:
+ * http://openid.net/developers/specs/
+ */
+
+require_once "Auth/OpenID/Extension.php";
+
+define('Auth_OpenID_PAPE_NS_URI',
+       "http://specs.openid.net/extensions/pape/1.0");
+
+define('PAPE_AUTH_MULTI_FACTOR_PHYSICAL',
+       'http://schemas.openid.net/pape/policies/2007/06/multi-factor-physical');
+define('PAPE_AUTH_MULTI_FACTOR',
+       'http://schemas.openid.net/pape/policies/2007/06/multi-factor');
+define('PAPE_AUTH_PHISHING_RESISTANT',
+       'http://schemas.openid.net/pape/policies/2007/06/phishing-resistant');
+
+define('PAPE_TIME_VALIDATOR',
+      '/^[0-9]{4,4}-[0-9][0-9]-[0-9][0-9]T[0-9][0-9]:[0-9][0-9]:[0-9][0-9]Z$/');
+/**
+ * A Provider Authentication Policy request, sent from a relying party
+ * to a provider
+ *
+ * preferred_auth_policies: The authentication policies that
+ * the relying party prefers
+ *
+ * max_auth_age: The maximum time, in seconds, that the relying party
+ * wants to allow to have elapsed before the user must re-authenticate
+ */
+class Auth_OpenID_PAPE_Request extends Auth_OpenID_Extension {
+
+    var $ns_alias = 'pape';
+    var $ns_uri = Auth_OpenID_PAPE_NS_URI;
+
+    function Auth_OpenID_PAPE_Request($preferred_auth_policies=null,
+                                      $max_auth_age=null)
+    {
+        if ($preferred_auth_policies === null) {
+            $preferred_auth_policies = array();
+        }
+
+        $this->preferred_auth_policies = $preferred_auth_policies;
+        $this->max_auth_age = $max_auth_age;
+    }
+
+    /**
+     * Add an acceptable authentication policy URI to this request
+     *
+     * This method is intended to be used by the relying party to add
+     * acceptable authentication types to the request.
+     *
+     * policy_uri: The identifier for the preferred type of
+     * authentication.
+     */
+    function addPolicyURI($policy_uri)
+    {
+        if (!in_array($policy_uri, $this->preferred_auth_policies)) {
+            $this->preferred_auth_policies[] = $policy_uri;
+        }
+    }
+
+    function getExtensionArgs()
+    {
+        $ns_args = array(
+                         'preferred_auth_policies' =>
+                           implode(' ', $this->preferred_auth_policies)
+                         );
+
+        if ($this->max_auth_age !== null) {
+            $ns_args['max_auth_age'] = strval($this->max_auth_age);
+        }
+
+        return $ns_args;
+    }
+
+    /**
+     * Instantiate a Request object from the arguments in a checkid_*
+     * OpenID message
+     */
+    static function fromOpenIDRequest($request)
+    {
+        $obj = new Auth_OpenID_PAPE_Request();
+        $args = $request->message->getArgs(Auth_OpenID_PAPE_NS_URI);
+
+        if ($args === null || $args === array()) {
+            return null;
+        }
+
+        $obj->parseExtensionArgs($args);
+        return $obj;
+    }
+
+    /**
+     * Set the state of this request to be that expressed in these
+     * PAPE arguments
+     *
+     * @param args: The PAPE arguments without a namespace
+     */
+    function parseExtensionArgs($args)
+    {
+        // preferred_auth_policies is a space-separated list of policy
+        // URIs
+        $this->preferred_auth_policies = array();
+
+        $policies_str = Auth_OpenID::arrayGet($args, 'preferred_auth_policies');
+        if ($policies_str) {
+            foreach (explode(' ', $policies_str) as $uri) {
+                if (!in_array($uri, $this->preferred_auth_policies)) {
+                    $this->preferred_auth_policies[] = $uri;
+                }
+            }
+        }
+
+        // max_auth_age is base-10 integer number of seconds
+        $max_auth_age_str = Auth_OpenID::arrayGet($args, 'max_auth_age');
+        if ($max_auth_age_str) {
+            $this->max_auth_age = Auth_OpenID::intval($max_auth_age_str);
+        } else {
+            $this->max_auth_age = null;
+        }
+    }
+
+    /**
+     * Given a list of authentication policy URIs that a provider
+     * supports, this method returns the subsequence of those types
+     * that are preferred by the relying party.
+     *
+     * @param supported_types: A sequence of authentication policy
+     * type URIs that are supported by a provider
+     *
+     * @return array The sub-sequence of the supported types that are
+     * preferred by the relying party. This list will be ordered in
+     * the order that the types appear in the supported_types
+     * sequence, and may be empty if the provider does not prefer any
+     * of the supported authentication types.
+     */
+    function preferredTypes($supported_types)
+    {
+        $result = array();
+
+        foreach ($supported_types as $st) {
+            if (in_array($st, $this->preferred_auth_policies)) {
+                $result[] = $st;
+            }
+        }
+        return $result;
+    }
+}
+
+/**
+ * A Provider Authentication Policy response, sent from a provider to
+ * a relying party
+ */
+class Auth_OpenID_PAPE_Response extends Auth_OpenID_Extension {
+
+    var $ns_alias = 'pape';
+    var $ns_uri = Auth_OpenID_PAPE_NS_URI;
+
+    function Auth_OpenID_PAPE_Response($auth_policies=null, $auth_time=null,
+                                       $nist_auth_level=null)
+    {
+        if ($auth_policies) {
+            $this->auth_policies = $auth_policies;
+        } else {
+            $this->auth_policies = array();
+        }
+
+        $this->auth_time = $auth_time;
+        $this->nist_auth_level = $nist_auth_level;
+    }
+
+    /**
+     * Add a authentication policy to this response
+     *
+     * This method is intended to be used by the provider to add a
+     * policy that the provider conformed to when authenticating the
+     * user.
+     *
+     * @param policy_uri: The identifier for the preferred type of
+     * authentication.
+     */
+    function addPolicyURI($policy_uri)
+    {
+        if (!in_array($policy_uri, $this->auth_policies)) {
+            $this->auth_policies[] = $policy_uri;
+        }
+    }
+
+    /**
+     * Create an Auth_OpenID_PAPE_Response object from a successful
+     * OpenID library response.
+     *
+     * @param success_response $success_response A SuccessResponse
+     * from Auth_OpenID_Consumer::complete()
+     *
+     * @returns: A provider authentication policy response from the
+     * data that was supplied with the id_res response.
+     */
+    static function fromSuccessResponse($success_response)
+    {
+        $obj = new Auth_OpenID_PAPE_Response();
+
+        // PAPE requires that the args be signed.
+        $args = $success_response->getSignedNS(Auth_OpenID_PAPE_NS_URI);
+
+        if ($args === null || $args === array()) {
+            return null;
+        }
+
+        $result = $obj->parseExtensionArgs($args);
+
+        if ($result === false) {
+            return null;
+        } else {
+            return $obj;
+        }
+    }
+
+    /**
+     * Parse the provider authentication policy arguments into the
+     *  internal state of this object
+     *
+     * @param args: unqualified provider authentication policy
+     * arguments
+     *
+     * @param strict: Whether to return false when bad data is
+     * encountered
+     *
+     * @return null The data is parsed into the internal fields of
+     * this object.
+    */
+    function parseExtensionArgs($args, $strict=false)
+    {
+        $policies_str = Auth_OpenID::arrayGet($args, 'auth_policies');
+        if ($policies_str && $policies_str != "none") {
+            $this->auth_policies = explode(" ", $policies_str);
+        }
+
+        $nist_level_str = Auth_OpenID::arrayGet($args, 'nist_auth_level');
+        if ($nist_level_str !== null) {
+            $nist_level = Auth_OpenID::intval($nist_level_str);
+
+            if ($nist_level === false) {
+                if ($strict) {
+                    return false;
+                } else {
+                    $nist_level = null;
+                }
+            }
+
+            if (0 <= $nist_level && $nist_level < 5) {
+                $this->nist_auth_level = $nist_level;
+            } else if ($strict) {
+                return false;
+            }
+        }
+
+        $auth_time = Auth_OpenID::arrayGet($args, 'auth_time');
+        if ($auth_time !== null) {
+            if (preg_match(PAPE_TIME_VALIDATOR, $auth_time)) {
+                $this->auth_time = $auth_time;
+            } else if ($strict) {
+                return false;
+            }
+        }
+    }
+
+    function getExtensionArgs()
+    {
+        $ns_args = array();
+        if (count($this->auth_policies) > 0) {
+            $ns_args['auth_policies'] = implode(' ', $this->auth_policies);
+        } else {
+            $ns_args['auth_policies'] = 'none';
+        }
+
+        if ($this->nist_auth_level !== null) {
+            if (!in_array($this->nist_auth_level, range(0, 4), true)) {
+                return false;
+            }
+            $ns_args['nist_auth_level'] = strval($this->nist_auth_level);
+        }
+
+        if ($this->auth_time !== null) {
+            if (!preg_match(PAPE_TIME_VALIDATOR, $this->auth_time)) {
+                return false;
+            }
+
+            $ns_args['auth_time'] = $this->auth_time;
+        }
+
+        return $ns_args;
+    }
+}
+
+

--- /dev/null
+++ b/lib/openid-php/Auth/OpenID/Parse.php
@@ -1,1 +1,378 @@
-
+<?php
+
+/**
+ * This module implements a VERY limited parser that finds <link> tags
+ * in the head of HTML or XHTML documents and parses out their
+ * attributes according to the OpenID spec. It is a liberal parser,
+ * but it requires these things from the data in order to work:
+ *
+ * - There must be an open <html> tag
+ *
+ * - There must be an open <head> tag inside of the <html> tag
+ *
+ * - Only <link>s that are found inside of the <head> tag are parsed
+ *   (this is by design)
+ *
+ * - The parser follows the OpenID specification in resolving the
+ *   attributes of the link tags. This means that the attributes DO
+ *   NOT get resolved as they would by an XML or HTML parser. In
+ *   particular, only certain entities get replaced, and href
+ *   attributes do not get resolved relative to a base URL.
+ *
+ * From http://openid.net/specs.bml:
+ *
+ * - The openid.server URL MUST be an absolute URL. OpenID consumers
+ *   MUST NOT attempt to resolve relative URLs.
+ *
+ * - The openid.server URL MUST NOT include entities other than &amp;,
+ *   &lt;, &gt;, and &quot;.
+ *
+ * The parser ignores SGML comments and <![CDATA[blocks]]>. Both kinds
+ * of quoting are allowed for attributes.
+ *
+ * The parser deals with invalid markup in these ways:
+ *
+ * - Tag names are not case-sensitive
+ *
+ * - The <html> tag is accepted even when it is not at the top level
+ *
+ * - The <head> tag is accepted even when it is not a direct child of
+ *   the <html> tag, but a <html> tag must be an ancestor of the
+ *   <head> tag
+ *
+ * - <link> tags are accepted even when they are not direct children
+ *   of the <head> tag, but a <head> tag must be an ancestor of the
+ *   <link> tag
+ *
+ * - If there is no closing tag for an open <html> or <head> tag, the
+ *   remainder of the document is viewed as being inside of the
+ *   tag. If there is no closing tag for a <link> tag, the link tag is
+ *   treated as a short tag. Exceptions to this rule are that <html>
+ *   closes <html> and <body> or <head> closes <head>
+ *
+ * - Attributes of the <link> tag are not required to be quoted.
+ *
+ * - In the case of duplicated attribute names, the attribute coming
+ *   last in the tag will be the value returned.
+ *
+ * - Any text that does not parse as an attribute within a link tag
+ *   will be ignored. (e.g. <link pumpkin rel='openid.server' /> will
+ *   ignore pumpkin)
+ *
+ * - If there are more than one <html> or <head> tag, the parser only
+ *   looks inside of the first one.
+ *
+ * - The contents of <script> tags are ignored entirely, except
+ *   unclosed <script> tags. Unclosed <script> tags are ignored.
+ *
+ * - Any other invalid markup is ignored, including unclosed SGML
+ *   comments and unclosed <![CDATA[blocks.
+ *
+ * PHP versions 4 and 5
+ *
+ * LICENSE: See the COPYING file included in this distribution.
+ *
+ * @access private
+ * @package OpenID
+ * @author JanRain, Inc. <openid@janrain.com>
+ * @copyright 2005-2008 Janrain, Inc.
+ * @license http://www.apache.org/licenses/LICENSE-2.0 Apache
+ */
+
+/**
+ * Require Auth_OpenID::arrayGet().
+ */
+require_once "Auth/OpenID.php";
+
+class Auth_OpenID_Parse {
+
+    /**
+     * Specify some flags for use with regex matching.
+     */
+    var $_re_flags = "si";
+
+    /**
+     * Stuff to remove before we start looking for tags
+     */
+    var $_removed_re =
+           "<!--.*?-->|<!\[CDATA\[.*?\]\]>|<script\b(?!:)[^>]*>.*?<\/script>";
+
+    /**
+     * Starts with the tag name at a word boundary, where the tag name
+     * is not a namespace
+     */
+    var $_tag_expr = "<%s\b(?!:)([^>]*?)(?:\/>|>(.*)(?:<\/?%s\s*>|\Z))";
+
+    var $_attr_find = '\b(\w+)=("[^"]*"|\'[^\']*\'|[^\'"\s\/<>]+)';
+
+    var $_open_tag_expr = "<%s\b";
+    var $_close_tag_expr = "<((\/%s\b)|(%s[^>\/]*\/))>";
+
+    function Auth_OpenID_Parse()
+    {
+        $this->_link_find = sprintf("/<link\b(?!:)([^>]*)(?!<)>/%s",
+                                    $this->_re_flags);
+
+        $this->_entity_replacements = array(
+                                            'amp' => '&',
+                                            'lt' => '<',
+                                            'gt' => '>',
+                                            'quot' => '"'
+                                            );
+
+        $this->_attr_find = sprintf("/%s/%s",
+                                    $this->_attr_find,
+                                    $this->_re_flags);
+
+        $this->_removed_re = sprintf("/%s/%s",
+                                     $this->_removed_re,
+                                     $this->_re_flags);
+
+        $this->_ent_replace =
+            sprintf("&(%s);", implode("|",
+                                      $this->_entity_replacements));
+    }
+
+    /**
+     * Returns a regular expression that will match a given tag in an
+     * SGML string.
+     */
+    function tagMatcher($tag_name, $close_tags = null)
+    {
+        $expr = $this->_tag_expr;
+
+        if ($close_tags) {
+            $options = implode("|", array_merge(array($tag_name), $close_tags));
+            $closer = sprintf("(?:%s)", $options);
+        } else {
+            $closer = $tag_name;
+        }
+
+        $expr = sprintf($expr, $tag_name, $closer);
+        return sprintf("/%s/%s", $expr, $this->_re_flags);
+    }
+
+    function openTag($tag_name)
+    {
+        $expr = sprintf($this->_open_tag_expr, $tag_name);
+        return sprintf("/%s/%s", $expr, $this->_re_flags);
+    }
+
+    function closeTag($tag_name)
+    {
+        $expr = sprintf($this->_close_tag_expr, $tag_name, $tag_name);
+        return sprintf("/%s/%s", $expr, $this->_re_flags);
+    }
+
+    function htmlBegin($s)
+    {
+        $matches = array();
+        $result = preg_match($this->openTag('html'), $s,
+                             $matches, PREG_OFFSET_CAPTURE);
+        if ($result === false || !$matches) {
+            return false;
+        }
+        // Return the offset of the first match.
+        return $matches[0][1];
+    }
+
+    function htmlEnd($s)
+    {
+        $matches = array();
+        $result = preg_match($this->closeTag('html'), $s,
+                             $matches, PREG_OFFSET_CAPTURE);
+        if ($result === false || !$matches) {
+            return false;
+        }
+        // Return the offset of the first match.
+        return $matches[count($matches) - 1][1];
+    }
+
+    function headFind()
+    {
+        return $this->tagMatcher('head', array('body', 'html'));
+    }
+
+    function replaceEntities($str)
+    {
+        foreach ($this->_entity_replacements as $old => $new) {
+            $str = preg_replace(sprintf("/&%s;/", $old), $new, $str);
+        }
+        return $str;
+    }
+
+    function removeQuotes($str)
+    {
+        $matches = array();
+        $double = '/^"(.*)"$/';
+        $single = "/^\'(.*)\'$/";
+
+        if (preg_match($double, $str, $matches)) {
+            return $matches[1];
+        } else if (preg_match($single, $str, $matches)) {
+            return $matches[1];
+        } else {
+            return $str;
+        }
+    }
+    
+    function match($regexp, $text, &$match)
+    {
+        if (!is_callable('mb_ereg_search_init')) {
+            return preg_match($regexp, $text, $match);
+        }
+
+        $regexp = substr($regexp, 1, strlen($regexp) - 2 - strlen($this->_re_flags));
+        mb_ereg_search_init($text);
+        if (!mb_ereg_search($regexp)) {
+            return false;
+        }
+        $match = mb_ereg_search_getregs();
+        return true;
+    }
+
+    /**
+     * Find all link tags in a string representing a HTML document and
+     * return a list of their attributes.
+     *
+     * @todo This is quite ineffective and may fail with the default
+     *       pcre.backtrack_limit of 100000 in PHP 5.2, if $html is big.
+     *       It should rather use stripos (in PHP5) or strpos()+strtoupper()
+     *       in PHP4 to manage this.
+     *
+     * @param string $html The text to parse
+     * @return array $list An array of arrays of attributes, one for each
+     * link tag
+     */
+    function parseLinkAttrs($html)
+    {
+        $stripped = preg_replace($this->_removed_re,
+                                 "",
+                                 $html);
+
+        $html_begin = $this->htmlBegin($stripped);
+        $html_end = $this->htmlEnd($stripped);
+
+        if ($html_begin === false) {
+            return array();
+        }
+
+        if ($html_end === false) {
+            $html_end = strlen($stripped);
+        }
+
+        $stripped = substr($stripped, $html_begin,
+                           $html_end - $html_begin);
+
+        // Workaround to prevent PREG_BACKTRACK_LIMIT_ERROR:
+        $old_btlimit = ini_set( 'pcre.backtrack_limit', -1 );
+
+        // Try to find the <HEAD> tag.
+        $head_re = $this->headFind();
+        $head_match = array();
+        if (!$this->match($head_re, $stripped, $head_match)) {
+                     ini_set( 'pcre.backtrack_limit', $old_btlimit );
+                     return array();
+        }
+
+        $link_data = array();
+        $link_matches = array();
+
+        if (!preg_match_all($this->_link_find, $head_match[0],
+                            $link_matches)) {
+            ini_set( 'pcre.backtrack_limit', $old_btlimit );
+            return array();
+        }
+
+        foreach ($link_matches[0] as $link) {
+            $attr_matches = array();
+            preg_match_all($this->_attr_find, $link, $attr_matches);
+            $link_attrs = array();
+            foreach ($attr_matches[0] as $index => $full_match) {
+                $name = $attr_matches[1][$index];
+                $value = $this->replaceEntities(
+                              $this->removeQuotes($attr_matches[2][$index]));
+
+                $link_attrs[strtolower($name)] = $value;
+            }
+            $link_data[] = $link_attrs;
+        }
+
+        ini_set( 'pcre.backtrack_limit', $old_btlimit );
+        return $link_data;
+    }
+
+    function relMatches($rel_attr, $target_rel)
+    {
+        // Does this target_rel appear in the rel_str?
+        // XXX: TESTME
+        $rels = preg_split("/\s+/", trim($rel_attr));
+        foreach ($rels as $rel) {
+            $rel = strtolower($rel);
+            if ($rel == $target_rel) {
+                return 1;
+            }
+        }
+
+        return 0;
+    }
+
+    function linkHasRel($link_attrs, $target_rel)
+    {
+        // Does this link have target_rel as a relationship?
+        // XXX: TESTME
+        $rel_attr = Auth_OpeniD::arrayGet($link_attrs, 'rel', null);
+        return ($rel_attr && $this->relMatches($rel_attr,
+                                               $target_rel));
+    }
+
+    function findLinksRel($link_attrs_list, $target_rel)
+    {
+        // Filter the list of link attributes on whether it has
+        // target_rel as a relationship.
+        // XXX: TESTME
+        $result = array();
+        foreach ($link_attrs_list as $attr) {
+            if ($this->linkHasRel($attr, $target_rel)) {
+                $result[] = $attr;
+            }
+        }
+
+        return $result;
+    }
+
+    function findFirstHref($link_attrs_list, $target_rel)
+    {
+        // Return the value of the href attribute for the first link
+        // tag in the list that has target_rel as a relationship.
+        // XXX: TESTME
+        $matches = $this->findLinksRel($link_attrs_list,
+                                       $target_rel);
+        if (!$matches) {
+            return null;
+        }
+        $first = $matches[0];
+        return Auth_OpenID::arrayGet($first, 'href', null);
+    }
+}
+
+function Auth_OpenID_legacy_discover($html_text, $server_rel,
+                                     $delegate_rel)
+{
+    $p = new Auth_OpenID_Parse();
+
+    $link_attrs = $p->parseLinkAttrs($html_text);
+
+    $server_url = $p->findFirstHref($link_attrs,
+                                    $server_rel);
+
+    if ($server_url === null) {
+        return false;
+    } else {
+        $delegate_url = $p->findFirstHref($link_attrs,
+                                          $delegate_rel);
+        return array($delegate_url, $server_url);
+    }
+}
+
+

--- /dev/null
+++ b/lib/openid-php/Auth/OpenID/PostgreSQLStore.php
@@ -1,1 +1,113 @@
+<?php
 
+/**
+ * A PostgreSQL store.
+ *
+ * @package OpenID
+ */
+
+/**
+ * Require the base class file.
+ */
+require_once "Auth/OpenID/SQLStore.php";
+
+/**
+ * An SQL store that uses PostgreSQL as its backend.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_PostgreSQLStore extends Auth_OpenID_SQLStore {
+    /**
+     * @access private
+     */
+    function setSQL()
+    {
+        $this->sql['nonce_table'] =
+            "CREATE TABLE %s (server_url VARCHAR(2047) NOT NULL, ".
+                             "timestamp INTEGER NOT NULL, ".
+                             "salt CHAR(40) NOT NULL, ".
+                "UNIQUE (server_url, timestamp, salt))";
+
+        $this->sql['assoc_table'] =
+            "CREATE TABLE %s (server_url VARCHAR(2047) NOT NULL, ". 
+                             "handle VARCHAR(255) NOT NULL, ".
+                             "secret BYTEA NOT NULL, ".
+                             "issued INTEGER NOT NULL, ".
+                             "lifetime INTEGER NOT NULL, ".
+                             "assoc_type VARCHAR(64) NOT NULL, ".
+            "PRIMARY KEY (server_url, handle), ".
+            "CONSTRAINT secret_length_constraint CHECK ".
+            "(LENGTH(secret) <= 128))";
+
+        $this->sql['set_assoc'] =
+            array(
+                  'insert_assoc' => "INSERT INTO %s (server_url, handle, ".
+                  "secret, issued, lifetime, assoc_type) VALUES ".
+                  "(?, ?, '!', ?, ?, ?)",
+                  'update_assoc' => "UPDATE %s SET secret = '!', issued = ?, ".
+                  "lifetime = ?, assoc_type = ? WHERE server_url = ? AND ".
+                  "handle = ?"
+                  );
+
+        $this->sql['get_assocs'] =
+            "SELECT handle, secret, issued, lifetime, assoc_type FROM %s ".
+            "WHERE server_url = ?";
+
+        $this->sql['get_assoc'] =
+            "SELECT handle, secret, issued, lifetime, assoc_type FROM %s ".
+            "WHERE server_url = ? AND handle = ?";
+
+        $this->sql['remove_assoc'] =
+            "DELETE FROM %s WHERE server_url = ? AND handle = ?";
+
+        $this->sql['add_nonce'] =
+                  "INSERT INTO %s (server_url, timestamp, salt) VALUES ".
+                  "(?, ?, ?)"
+                  ;
+
+        $this->sql['clean_nonce'] =
+            "DELETE FROM %s WHERE timestamp < ?";
+
+        $this->sql['clean_assoc'] =
+            "DELETE FROM %s WHERE issued + lifetime < ?";
+    }
+
+    /**
+     * @access private
+     */
+    function _set_assoc($server_url, $handle, $secret, $issued, $lifetime,
+                        $assoc_type)
+    {
+        $result = $this->_get_assoc($server_url, $handle);
+        if ($result) {
+            // Update the table since this associations already exists.
+            $this->connection->query($this->sql['set_assoc']['update_assoc'],
+                                     array($secret, $issued, $lifetime,
+                                           $assoc_type, $server_url, $handle));
+        } else {
+            // Insert a new record because this association wasn't
+            // found.
+            $this->connection->query($this->sql['set_assoc']['insert_assoc'],
+                                     array($server_url, $handle, $secret,
+                                           $issued, $lifetime, $assoc_type));
+        }
+    }
+
+    /**
+     * @access private
+     */
+    function blobEncode($blob)
+    {
+        return $this->_octify($blob);
+    }
+
+    /**
+     * @access private
+     */
+    function blobDecode($blob)
+    {
+        return $this->_unoctify($blob);
+    }
+}
+
+

--- /dev/null
+++ b/lib/openid-php/Auth/OpenID/SQLStore.php
@@ -1,1 +1,558 @@
-
+<?php
+
+/**
+ * SQL-backed OpenID stores.
+ *
+ * PHP versions 4 and 5
+ *
+ * LICENSE: See the COPYING file included in this distribution.
+ *
+ * @package OpenID
+ * @author JanRain, Inc. <openid@janrain.com>
+ * @copyright 2005-2008 Janrain, Inc.
+ * @license http://www.apache.org/licenses/LICENSE-2.0 Apache
+ */
+
+/**
+ * @access private
+ */
+require_once 'Auth/OpenID/Interface.php';
+require_once 'Auth/OpenID/Nonce.php';
+
+/**
+ * @access private
+ */
+require_once 'Auth/OpenID.php';
+
+/**
+ * @access private
+ */
+require_once 'Auth/OpenID/Nonce.php';
+
+/**
+ * This is the parent class for the SQL stores, which contains the
+ * logic common to all of the SQL stores.
+ *
+ * The table names used are determined by the class variables
+ * associations_table_name and nonces_table_name.  To change the name
+ * of the tables used, pass new table names into the constructor.
+ *
+ * To create the tables with the proper schema, see the createTables
+ * method.
+ *
+ * This class shouldn't be used directly.  Use one of its subclasses
+ * instead, as those contain the code necessary to use a specific
+ * database.  If you're an OpenID integrator and you'd like to create
+ * an SQL-driven store that wraps an application's database
+ * abstraction, be sure to create a subclass of
+ * {@link Auth_OpenID_DatabaseConnection} that calls the application's
+ * database abstraction calls.  Then, pass an instance of your new
+ * database connection class to your SQLStore subclass constructor.
+ *
+ * All methods other than the constructor and createTables should be
+ * considered implementation details.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_SQLStore extends Auth_OpenID_OpenIDStore {
+
+    /**
+     * This creates a new SQLStore instance.  It requires an
+     * established database connection be given to it, and it allows
+     * overriding the default table names.
+     *
+     * @param connection $connection This must be an established
+     * connection to a database of the correct type for the SQLStore
+     * subclass you're using.  This must either be an PEAR DB
+     * connection handle or an instance of a subclass of
+     * Auth_OpenID_DatabaseConnection.
+     *
+     * @param associations_table: This is an optional parameter to
+     * specify the name of the table used for storing associations.
+     * The default value is 'oid_associations'.
+     *
+     * @param nonces_table: This is an optional parameter to specify
+     * the name of the table used for storing nonces.  The default
+     * value is 'oid_nonces'.
+     */
+    function Auth_OpenID_SQLStore($connection,
+                                  $associations_table = null,
+                                  $nonces_table = null)
+    {
+        $this->associations_table_name = "oid_associations";
+        $this->nonces_table_name = "oid_nonces";
+
+        // Check the connection object type to be sure it's a PEAR
+        // database connection.
+        if (!(is_object($connection) &&
+              (is_subclass_of($connection, 'db_common') ||
+               is_subclass_of($connection,
+                              'auth_openid_databaseconnection')))) {
+            trigger_error("Auth_OpenID_SQLStore expected PEAR connection " .
+                          "object (got ".get_class($connection).")",
+                          E_USER_ERROR);
+            return;
+        }
+
+        $this->connection = $connection;
+
+        // Be sure to set the fetch mode so the results are keyed on
+        // column name instead of column index.  This is a PEAR
+        // constant, so only try to use it if PEAR is present.  Note
+        // that Auth_Openid_Databaseconnection instances need not
+        // implement ::setFetchMode for this reason.
+        if (is_subclass_of($this->connection, 'db_common')) {
+            $this->connection->setFetchMode(DB_FETCHMODE_ASSOC);
+        }
+
+        if ($associations_table) {
+            $this->associations_table_name = $associations_table;
+        }
+
+        if ($nonces_table) {
+            $this->nonces_table_name = $nonces_table;
+        }
+
+        $this->max_nonce_age = 6 * 60 * 60;
+
+        // Be sure to run the database queries with auto-commit mode
+        // turned OFF, because we want every function to run in a
+        // transaction, implicitly.  As a rule, methods named with a
+        // leading underscore will NOT control transaction behavior.
+        // Callers of these methods will worry about transactions.
+        $this->connection->autoCommit(false);
+
+        // Create an empty SQL strings array.
+        $this->sql = array();
+
+        // Call this method (which should be overridden by subclasses)
+        // to populate the $this->sql array with SQL strings.
+        $this->setSQL();
+
+        // Verify that all required SQL statements have been set, and
+        // raise an error if any expected SQL strings were either
+        // absent or empty.
+        list($missing, $empty) = $this->_verifySQL();
+
+        if ($missing) {
+            trigger_error("Expected keys in SQL query list: " .
+                          implode(", ", $missing),
+                          E_USER_ERROR);
+            return;
+        }
+
+        if ($empty) {
+            trigger_error("SQL list keys have no SQL strings: " .
+                          implode(", ", $empty),
+                          E_USER_ERROR);
+            return;
+        }
+
+        // Add table names to queries.
+        $this->_fixSQL();
+    }
+
+    function tableExists($table_name)
+    {
+        return !$this->isError(
+                      $this->connection->query(
+                          sprintf("SELECT * FROM %s LIMIT 0",
+                                  $table_name)));
+    }
+
+    /**
+     * Returns true if $value constitutes a database error; returns
+     * false otherwise.
+     */
+    function isError($value)
+    {
+        return PEAR::isError($value);
+    }
+
+    /**
+     * Converts a query result to a boolean.  If the result is a
+     * database error according to $this->isError(), this returns
+     * false; otherwise, this returns true.
+     */
+    function resultToBool($obj)
+    {
+        if ($this->isError($obj)) {
+            return false;
+        } else {
+            return true;
+        }
+    }
+
+    /**
+     * This method should be overridden by subclasses.  This method is
+     * called by the constructor to set values in $this->sql, which is
+     * an array keyed on sql name.
+     */
+    function setSQL()
+    {
+    }
+
+    /**
+     * Resets the store by removing all records from the store's
+     * tables.
+     */
+    function reset()
+    {
+        $this->connection->query(sprintf("DELETE FROM %s",
+                                         $this->associations_table_name));
+
+        $this->connection->query(sprintf("DELETE FROM %s",
+                                         $this->nonces_table_name));
+    }
+
+    /**
+     * @access private
+     */
+    function _verifySQL()
+    {
+        $missing = array();
+        $empty = array();
+
+        $required_sql_keys = array(
+                                   'nonce_table',
+                                   'assoc_table',
+                                   'set_assoc',
+                                   'get_assoc',
+                                   'get_assocs',
+                                   'remove_assoc'
+                                   );
+
+        foreach ($required_sql_keys as $key) {
+            if (!array_key_exists($key, $this->sql)) {
+                $missing[] = $key;
+            } else if (!$this->sql[$key]) {
+                $empty[] = $key;
+            }
+        }
+
+        return array($missing, $empty);
+    }
+
+    /**
+     * @access private
+     */
+    function _fixSQL()
+    {
+        $replacements = array(
+                              array(
+                                    'value' => $this->nonces_table_name,
+                                    'keys' => array('nonce_table',
+                                                    'add_nonce',
+                                                    'clean_nonce')
+                                    ),
+                              array(
+                                    'value' => $this->associations_table_name,
+                                    'keys' => array('assoc_table',
+                                                    'set_assoc',
+                                                    'get_assoc',
+                                                    'get_assocs',
+                                                    'remove_assoc',
+                                                    'clean_assoc')
+                                    )
+                              );
+
+        foreach ($replacements as $item) {
+            $value = $item['value'];
+            $keys = $item['keys'];
+
+            foreach ($keys as $k) {
+                if (is_array($this->sql[$k])) {
+                    foreach ($this->sql[$k] as $part_key => $part_value) {
+                        $this->sql[$k][$part_key] = sprintf($part_value,
+                                                            $value);
+                    }
+                } else {
+                    $this->sql[$k] = sprintf($this->sql[$k], $value);
+                }
+            }
+        }
+    }
+
+    function blobDecode($blob)
+    {
+        return $blob;
+    }
+
+    function blobEncode($str)
+    {
+        return $str;
+    }
+
+    function createTables()
+    {
+        $this->connection->autoCommit(true);
+        $n = $this->create_nonce_table();
+        $a = $this->create_assoc_table();
+        $this->connection->autoCommit(false);
+
+        if ($n && $a) {
+            return true;
+        } else {
+            return false;
+        }
+    }
+
+    function create_nonce_table()
+    {
+        if (!$this->tableExists($this->nonces_table_name)) {
+            $r = $this->connection->query($this->sql['nonce_table']);
+            return $this->resultToBool($r);
+        }
+        return true;
+    }
+
+    function create_assoc_table()
+    {
+        if (!$this->tableExists($this->associations_table_name)) {
+            $r = $this->connection->query($this->sql['assoc_table']);
+            return $this->resultToBool($r);
+        }
+        return true;
+    }
+
+    /**
+     * @access private
+     */
+    function _set_assoc($server_url, $handle, $secret, $issued,
+                        $lifetime, $assoc_type)
+    {
+        return $this->connection->query($this->sql['set_assoc'],
+                                        array(
+                                              $server_url,
+                                              $handle,
+                                              $secret,
+                                              $issued,
+                                              $lifetime,
+                                              $assoc_type));
+    }
+
+    function storeAssociation($server_url, $association)
+    {
+        if ($this->resultToBool($this->_set_assoc(
+                                            $server_url,
+                                            $association->handle,
+                                            $this->blobEncode(
+                                                  $association->secret),
+                                            $association->issued,
+                                            $association->lifetime,
+                                            $association->assoc_type
+                                            ))) {
+            $this->connection->commit();
+        } else {
+            $this->connection->rollback();
+        }
+    }
+
+    /**
+     * @access private
+     */
+    function _get_assoc($server_url, $handle)
+    {
+        $result = $this->connection->getRow($this->sql['get_assoc'],
+                                            array($server_url, $handle));
+        if ($this->isError($result)) {
+            return null;
+        } else {
+            return $result;
+        }
+    }
+
+    /**
+     * @access private
+     */
+    function _get_assocs($server_url)
+    {
+        $result = $this->connection->getAll($this->sql['get_assocs'],
+                                            array($server_url));
+
+        if ($this->isError($result)) {
+            return array();
+        } else {
+            return $result;
+        }
+    }
+
+    function removeAssociation($server_url, $handle)
+    {
+        if ($this->_get_assoc($server_url, $handle) == null) {
+            return false;
+        }
+
+        if ($this->resultToBool($this->connection->query(
+                              $this->sql['remove_assoc'],
+                              array($server_url, $handle)))) {
+            $this->connection->commit();
+        } else {
+            $this->connection->rollback();
+        }
+
+        return true;
+    }
+
+    function getAssociation($server_url, $handle = null)
+    {
+        if ($handle !== null) {
+            $assoc = $this->_get_assoc($server_url, $handle);
+
+            $assocs = array();
+            if ($assoc) {
+                $assocs[] = $assoc;
+            }
+        } else {
+            $assocs = $this->_get_assocs($server_url);
+        }
+
+        if (!$assocs || (count($assocs) == 0)) {
+            return null;
+        } else {
+            $associations = array();
+
+            foreach ($assocs as $assoc_row) {
+                $assoc = new Auth_OpenID_Association($assoc_row['handle'],
+                                                     $assoc_row['secret'],
+                                                     $assoc_row['issued'],
+                                                     $assoc_row['lifetime'],
+                                                     $assoc_row['assoc_type']);
+
+                $assoc->secret = $this->blobDecode($assoc->secret);
+
+                if ($assoc->getExpiresIn() == 0) {
+                    $this->removeAssociation($server_url, $assoc->handle);
+                } else {
+                    $associations[] = array($assoc->issued, $assoc);
+                }
+            }
+
+            if ($associations) {
+                $issued = array();
+                $assocs = array();
+                foreach ($associations as $key => $assoc) {
+                    $issued[$key] = $assoc[0];
+                    $assocs[$key] = $assoc[1];
+                }
+
+                array_multisort($issued, SORT_DESC, $assocs, SORT_DESC,
+                                $associations);
+
+                // return the most recently issued one.
+                list($issued, $assoc) = $associations[0];
+                return $assoc;
+            } else {
+                return null;
+            }
+        }
+    }
+
+    /**
+     * @access private
+     */
+    function _add_nonce($server_url, $timestamp, $salt)
+    {
+        $sql = $this->sql['add_nonce'];
+        $result = $this->connection->query($sql, array($server_url,
+                                                       $timestamp,
+                                                       $salt));
+        if ($this->isError($result)) {
+            $this->connection->rollback();
+        } else {
+            $this->connection->commit();
+        }
+        return $this->resultToBool($result);
+    }
+
+    function useNonce($server_url, $timestamp, $salt)
+    {
+        global $Auth_OpenID_SKEW;
+
+        if ( abs($timestamp - time()) > $Auth_OpenID_SKEW ) {
+            return false;
+        }
+
+        return $this->_add_nonce($server_url, $timestamp, $salt);
+    }
+
+    /**
+     * "Octifies" a binary string by returning a string with escaped
+     * octal bytes.  This is used for preparing binary data for
+     * PostgreSQL BYTEA fields.
+     *
+     * @access private
+     */
+    function _octify($str)
+    {
+        $result = "";
+        for ($i = 0; $i < Auth_OpenID::bytes($str); $i++) {
+            $ch = substr($str, $i, 1);
+            if ($ch == "\\") {
+                $result .= "\\\\\\\\";
+            } else if (ord($ch) == 0) {
+                $result .= "\\\\000";
+            } else {
+                $result .= "\\" . strval(decoct(ord($ch)));
+            }
+        }
+        return $result;
+    }
+
+    /**
+     * "Unoctifies" octal-escaped data from PostgreSQL and returns the
+     * resulting ASCII (possibly binary) string.
+     *
+     * @access private
+     */
+    function _unoctify($str)
+    {
+        $result = "";
+        $i = 0;
+        while ($i < strlen($str)) {
+            $char = $str[$i];
+            if ($char == "\\") {
+                // Look to see if the next char is a backslash and
+                // append it.
+                if ($str[$i + 1] != "\\") {
+                    $octal_digits = substr($str, $i + 1, 3);
+                    $dec = octdec($octal_digits);
+                    $char = chr($dec);
+                    $i += 4;
+                } else {
+                    $char = "\\";
+                    $i += 2;
+                }
+            } else {
+                $i += 1;
+            }
+
+            $result .= $char;
+        }
+
+        return $result;
+    }
+
+    function cleanupNonces()
+    {
+        global $Auth_OpenID_SKEW;
+        $v = time() - $Auth_OpenID_SKEW;
+
+        $this->connection->query($this->sql['clean_nonce'], array($v));
+        $num = $this->connection->affectedRows();
+        $this->connection->commit();
+        return $num;
+    }
+
+    function cleanupAssociations()
+    {
+        $this->connection->query($this->sql['clean_assoc'],
+                                 array(time()));
+        $num = $this->connection->affectedRows();
+        $this->connection->commit();
+        return $num;
+    }
+}
+
+
+

--- /dev/null
+++ b/lib/openid-php/Auth/OpenID/SQLiteStore.php
@@ -1,1 +1,71 @@
+<?php
 
+/**
+ * An SQLite store.
+ *
+ * @package OpenID
+ */
+
+/**
+ * Require the base class file.
+ */
+require_once "Auth/OpenID/SQLStore.php";
+
+/**
+ * An SQL store that uses SQLite as its backend.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_SQLiteStore extends Auth_OpenID_SQLStore {
+    function setSQL()
+    {
+        $this->sql['nonce_table'] =
+            "CREATE TABLE %s (server_url VARCHAR(2047), timestamp INTEGER, ".
+            "salt CHAR(40), UNIQUE (server_url, timestamp, salt))";
+
+        $this->sql['assoc_table'] =
+            "CREATE TABLE %s (server_url VARCHAR(2047), handle VARCHAR(255), ".
+            "secret BLOB(128), issued INTEGER, lifetime INTEGER, ".
+            "assoc_type VARCHAR(64), PRIMARY KEY (server_url, handle))";
+
+        $this->sql['set_assoc'] =
+            "INSERT OR REPLACE INTO %s VALUES (?, ?, ?, ?, ?, ?)";
+
+        $this->sql['get_assocs'] =
+            "SELECT handle, secret, issued, lifetime, assoc_type FROM %s ".
+            "WHERE server_url = ?";
+
+        $this->sql['get_assoc'] =
+            "SELECT handle, secret, issued, lifetime, assoc_type FROM %s ".
+            "WHERE server_url = ? AND handle = ?";
+
+        $this->sql['remove_assoc'] =
+            "DELETE FROM %s WHERE server_url = ? AND handle = ?";
+
+        $this->sql['add_nonce'] =
+            "INSERT INTO %s (server_url, timestamp, salt) VALUES (?, ?, ?)";
+
+        $this->sql['clean_nonce'] =
+            "DELETE FROM %s WHERE timestamp < ?";
+
+        $this->sql['clean_assoc'] =
+            "DELETE FROM %s WHERE issued + lifetime < ?";
+    }
+
+    /**
+     * @access private
+     */
+    function _add_nonce($server_url, $timestamp, $salt)
+    {
+        // PECL SQLite extensions 1.0.3 and older (1.0.3 is the
+        // current release at the time of this writing) have a broken
+        // sqlite_escape_string function that breaks when passed the
+        // empty string. Prefixing all strings with one character
+        // keeps them unique and avoids this bug. The nonce table is
+        // write-only, so we don't have to worry about updating other
+        // functions with this same bad hack.
+        return parent::_add_nonce('x' . $server_url, $timestamp, $salt);
+    }
+}
+
+

--- /dev/null
+++ b/lib/openid-php/Auth/OpenID/SReg.php
@@ -1,1 +1,522 @@
-
+<?php
+
+/**
+ * Simple registration request and response parsing and object
+ * representation.
+ *
+ * This module contains objects representing simple registration
+ * requests and responses that can be used with both OpenID relying
+ * parties and OpenID providers.
+ *
+ * 1. The relying party creates a request object and adds it to the
+ * {@link Auth_OpenID_AuthRequest} object before making the
+ * checkid request to the OpenID provider:
+ *
+ *   $sreg_req = Auth_OpenID_SRegRequest::build(array('email'));
+ *   $auth_request->addExtension($sreg_req);
+ *
+ * 2. The OpenID provider extracts the simple registration request
+ * from the OpenID request using {@link
+ * Auth_OpenID_SRegRequest::fromOpenIDRequest}, gets the user's
+ * approval and data, creates an {@link Auth_OpenID_SRegResponse}
+ * object and adds it to the id_res response:
+ *
+ *   $sreg_req = Auth_OpenID_SRegRequest::fromOpenIDRequest(
+ *                                  $checkid_request);
+ *   // [ get the user's approval and data, informing the user that
+ *   //   the fields in sreg_response were requested ]
+ *   $sreg_resp = Auth_OpenID_SRegResponse::extractResponse(
+ *                                  $sreg_req, $user_data);
+ *   $sreg_resp->toMessage($openid_response->fields);
+ *
+ * 3. The relying party uses {@link
+ * Auth_OpenID_SRegResponse::fromSuccessResponse} to extract the data
+ * from the OpenID response:
+ *
+ *   $sreg_resp = Auth_OpenID_SRegResponse::fromSuccessResponse(
+ *                                  $success_response);
+ *
+ * @package OpenID
+ */
+
+/**
+ * Import message and extension internals.
+ */
+require_once 'Auth/OpenID/Message.php';
+require_once 'Auth/OpenID/Extension.php';
+
+// The data fields that are listed in the sreg spec
+global $Auth_OpenID_sreg_data_fields;
+$Auth_OpenID_sreg_data_fields = array(
+                                      'fullname' => 'Full Name',
+                                      'nickname' => 'Nickname',
+                                      'dob' => 'Date of Birth',
+                                      'email' => 'E-mail Address',
+                                      'gender' => 'Gender',
+                                      'postcode' => 'Postal Code',
+                                      'country' => 'Country',
+                                      'language' => 'Language',
+                                      'timezone' => 'Time Zone');
+
+/**
+ * Check to see that the given value is a valid simple registration
+ * data field name.  Return true if so, false if not.
+ */
+function Auth_OpenID_checkFieldName($field_name)
+{
+    global $Auth_OpenID_sreg_data_fields;
+
+    if (!in_array($field_name, array_keys($Auth_OpenID_sreg_data_fields))) {
+        return false;
+    }
+    return true;
+}
+
+// URI used in the wild for Yadis documents advertising simple
+// registration support
+define('Auth_OpenID_SREG_NS_URI_1_0', 'http://openid.net/sreg/1.0');
+
+// URI in the draft specification for simple registration 1.1
+// <http://openid.net/specs/openid-simple-registration-extension-1_1-01.html>
+define('Auth_OpenID_SREG_NS_URI_1_1', 'http://openid.net/extensions/sreg/1.1');
+
+// This attribute will always hold the preferred URI to use when
+// adding sreg support to an XRDS file or in an OpenID namespace
+// declaration.
+define('Auth_OpenID_SREG_NS_URI', Auth_OpenID_SREG_NS_URI_1_1);
+
+Auth_OpenID_registerNamespaceAlias(Auth_OpenID_SREG_NS_URI_1_1, 'sreg');
+
+/**
+ * Does the given endpoint advertise support for simple
+ * registration?
+ *
+ * $endpoint: The endpoint object as returned by OpenID discovery.
+ * returns whether an sreg type was advertised by the endpoint
+ */
+function Auth_OpenID_supportsSReg($endpoint)
+{
+    return ($endpoint->usesExtension(Auth_OpenID_SREG_NS_URI_1_1) ||
+            $endpoint->usesExtension(Auth_OpenID_SREG_NS_URI_1_0));
+}
+
+/**
+ * A base class for classes dealing with Simple Registration protocol
+ * messages.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_SRegBase extends Auth_OpenID_Extension {
+    /**
+     * Extract the simple registration namespace URI from the given
+     * OpenID message. Handles OpenID 1 and 2, as well as both sreg
+     * namespace URIs found in the wild, as well as missing namespace
+     * definitions (for OpenID 1)
+     *
+     * $message: The OpenID message from which to parse simple
+     * registration fields. This may be a request or response message.
+     *
+     * Returns the sreg namespace URI for the supplied message. The
+     * message may be modified to define a simple registration
+     * namespace.
+     *
+     * @access private
+     */
+    static function _getSRegNS($message)
+    {
+        $alias = null;
+        $found_ns_uri = null;
+
+        // See if there exists an alias for one of the two defined
+        // simple registration types.
+        foreach (array(Auth_OpenID_SREG_NS_URI_1_1,
+                       Auth_OpenID_SREG_NS_URI_1_0) as $sreg_ns_uri) {
+            $alias = $message->namespaces->getAlias($sreg_ns_uri);
+            if ($alias !== null) {
+                $found_ns_uri = $sreg_ns_uri;
+                break;
+            }
+        }
+
+        if ($alias === null) {
+            // There is no alias for either of the types, so try to
+            // add one. We default to using the modern value (1.1)
+            $found_ns_uri = Auth_OpenID_SREG_NS_URI_1_1;
+            if ($message->namespaces->addAlias(Auth_OpenID_SREG_NS_URI_1_1,
+                                               'sreg') === null) {
+                // An alias for the string 'sreg' already exists, but
+                // it's defined for something other than simple
+                // registration
+                return null;
+            }
+        }
+
+        return $found_ns_uri;
+    }
+}
+
+/**
+ * An object to hold the state of a simple registration request.
+ *
+ * required: A list of the required fields in this simple registration
+ * request
+ *
+ * optional: A list of the optional fields in this simple registration
+ * request
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_SRegRequest extends Auth_OpenID_SRegBase {
+
+    var $ns_alias = 'sreg';
+
+    /**
+     * Initialize an empty simple registration request.
+     */
+    static function build($required=null, $optional=null,
+                   $policy_url=null,
+                   $sreg_ns_uri=Auth_OpenID_SREG_NS_URI,
+                   $cls='Auth_OpenID_SRegRequest')
+    {
+        $obj = new $cls();
+
+        $obj->required = array();
+        $obj->optional = array();
+        $obj->policy_url = $policy_url;
+        $obj->ns_uri = $sreg_ns_uri;
+
+        if ($required) {
+            if (!$obj->requestFields($required, true, true)) {
+                return null;
+            }
+        }
+
+        if ($optional) {
+            if (!$obj->requestFields($optional, false, true)) {
+                return null;
+            }
+        }
+
+        return $obj;
+    }
+
+    /**
+     * Create a simple registration request that contains the fields
+     * that were requested in the OpenID request with the given
+     * arguments
+     *
+     * $request: The OpenID authentication request from which to
+     * extract an sreg request.
+     *
+     * $cls: name of class to use when creating sreg request object.
+     * Used for testing.
+     *
+     * Returns the newly created simple registration request
+     */
+    static function fromOpenIDRequest($request, $cls='Auth_OpenID_SRegRequest')
+    {
+
+        $obj = call_user_func_array(array($cls, 'build'),
+                 array(null, null, null, Auth_OpenID_SREG_NS_URI, $cls));
+
+        // Since we're going to mess with namespace URI mapping, don't
+        // mutate the object that was passed in.
+        $m = $request->message;
+
+        $obj->ns_uri = $obj->_getSRegNS($m);
+        $args = $m->getArgs($obj->ns_uri);
+
+        if ($args === null || Auth_OpenID::isFailure($args)) {
+            return null;
+        }
+
+        $obj->parseExtensionArgs($args);
+
+        return $obj;
+    }
+
+    /**
+     * Parse the unqualified simple registration request parameters
+     * and add them to this object.
+     *
+     * This method is essentially the inverse of
+     * getExtensionArgs. This method restores the serialized simple
+     * registration request fields.
+     *
+     * If you are extracting arguments from a standard OpenID
+     * checkid_* request, you probably want to use fromOpenIDRequest,
+     * which will extract the sreg namespace and arguments from the
+     * OpenID request. This method is intended for cases where the
+     * OpenID server needs more control over how the arguments are
+     * parsed than that method provides.
+     *
+     * $args == $message->getArgs($ns_uri);
+     * $request->parseExtensionArgs($args);
+     *
+     * $args: The unqualified simple registration arguments
+     *
+     * strict: Whether requests with fields that are not defined in
+     * the simple registration specification should be tolerated (and
+     * ignored)
+     */
+    function parseExtensionArgs($args, $strict=false)
+    {
+        foreach (array('required', 'optional') as $list_name) {
+            $required = ($list_name == 'required');
+            $items = Auth_OpenID::arrayGet($args, $list_name);
+            if ($items) {
+                foreach (explode(',', $items) as $field_name) {
+                    if (!$this->requestField($field_name, $required, $strict)) {
+                        if ($strict) {
+                            return false;
+                        }
+                    }
+                }
+            }
+        }
+
+        $this->policy_url = Auth_OpenID::arrayGet($args, 'policy_url');
+
+        return true;
+    }
+
+    /**
+     * A list of all of the simple registration fields that were
+     * requested, whether they were required or optional.
+     */
+    function allRequestedFields()
+    {
+        return array_merge($this->required, $this->optional);
+    }
+
+    /**
+     * Have any simple registration fields been requested?
+     */
+    function wereFieldsRequested()
+    {
+        return count($this->allRequestedFields());
+    }
+
+    /**
+     * Was this field in the request?
+     */
+    function contains($field_name)
+    {
+        return (in_array($field_name, $this->required) ||
+                in_array($field_name, $this->optional));
+    }
+
+    /**
+     * Request the specified field from the OpenID user
+     *
+     * $field_name: the unqualified simple registration field name
+     *
+     * required: whether the given field should be presented to the
+     * user as being a required to successfully complete the request
+     *
+     * strict: whether to raise an exception when a field is added to
+     * a request more than once
+     */
+    function requestField($field_name,
+                          $required=false, $strict=false)
+    {
+        if (!Auth_OpenID_checkFieldName($field_name)) {
+            return false;
+        }
+
+        if ($strict) {
+            if ($this->contains($field_name)) {
+                return false;
+            }
+        } else {
+            if (in_array($field_name, $this->required)) {
+                return true;
+            }
+
+            if (in_array($field_name, $this->optional)) {
+                if ($required) {
+                    unset($this->optional[array_search($field_name,
+                                                       $this->optional)]);
+                } else {
+                    return true;
+                }
+            }
+        }
+
+        if ($required) {
+            $this->required[] = $field_name;
+        } else {
+            $this->optional[] = $field_name;
+        }
+
+        return true;
+    }
+
+    /**
+     * Add the given list of fields to the request
+     *
+     * field_names: The simple registration data fields to request
+     *
+     * required: Whether these values should be presented to the user
+     * as required
+     *
+     * strict: whether to raise an exception when a field is added to
+     * a request more than once
+     */
+    function requestFields($field_names, $required=false, $strict=false)
+    {
+        if (!is_array($field_names)) {
+            return false;
+        }
+
+        foreach ($field_names as $field_name) {
+            if (!$this->requestField($field_name, $required, $strict=$strict)) {
+                return false;
+            }
+        }
+
+        return true;
+    }
+
+    /**
+     * Get a dictionary of unqualified simple registration arguments
+     * representing this request.
+     *
+     * This method is essentially the inverse of
+     * C{L{parseExtensionArgs}}. This method serializes the simple
+     * registration request fields.
+     */
+    function getExtensionArgs()
+    {
+        $args = array();
+
+        if ($this->required) {
+            $args['required'] = implode(',', $this->required);
+        }
+
+        if ($this->optional) {
+            $args['optional'] = implode(',', $this->optional);
+        }
+
+        if ($this->policy_url) {
+            $args['policy_url'] = $this->policy_url;
+        }
+
+        return $args;
+    }
+}
+
+/**
+ * Represents the data returned in a simple registration response
+ * inside of an OpenID C{id_res} response. This object will be created
+ * by the OpenID server, added to the C{id_res} response object, and
+ * then extracted from the C{id_res} message by the Consumer.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_SRegResponse extends Auth_OpenID_SRegBase {
+
+    var $ns_alias = 'sreg';
+
+    function Auth_OpenID_SRegResponse($data=null,
+                                      $sreg_ns_uri=Auth_OpenID_SREG_NS_URI)
+    {
+        if ($data === null) {
+            $this->data = array();
+        } else {
+            $this->data = $data;
+        }
+
+        $this->ns_uri = $sreg_ns_uri;
+    }
+
+    /**
+     * Take a C{L{SRegRequest}} and a dictionary of simple
+     * registration values and create a C{L{SRegResponse}} object
+     * containing that data.
+     *
+     * request: The simple registration request object
+     *
+     * data: The simple registration data for this response, as a
+     * dictionary from unqualified simple registration field name to
+     * string (unicode) value. For instance, the nickname should be
+     * stored under the key 'nickname'.
+     */
+    static function extractResponse($request, $data)
+    {
+        $obj = new Auth_OpenID_SRegResponse();
+        $obj->ns_uri = $request->ns_uri;
+
+        foreach ($request->allRequestedFields() as $field) {
+            $value = Auth_OpenID::arrayGet($data, $field);
+            if ($value !== null) {
+                $obj->data[$field] = $value;
+            }
+        }
+
+        return $obj;
+    }
+
+    /**
+     * Create a C{L{SRegResponse}} object from a successful OpenID
+     * library response
+     * (C{L{openid.consumer.consumer.SuccessResponse}}) response
+     * message
+     *
+     * success_response: A SuccessResponse from consumer.complete()
+     *
+     * signed_only: Whether to process only data that was
+     * signed in the id_res message from the server.
+     *
+     * Returns a simple registration response containing the data that
+     * was supplied with the C{id_res} response.
+     */
+    static function fromSuccessResponse($success_response, $signed_only=true)
+    {
+        global $Auth_OpenID_sreg_data_fields;
+
+        $obj = new Auth_OpenID_SRegResponse();
+        $obj->ns_uri = $obj->_getSRegNS($success_response->message);
+
+        if ($signed_only) {
+            $args = $success_response->getSignedNS($obj->ns_uri);
+        } else {
+            $args = $success_response->message->getArgs($obj->ns_uri);
+        }
+
+        if ($args === null || Auth_OpenID::isFailure($args)) {
+            return null;
+        }
+
+        foreach ($Auth_OpenID_sreg_data_fields as $field_name => $desc) {
+            if (in_array($field_name, array_keys($args))) {
+                $obj->data[$field_name] = $args[$field_name];
+            }
+        }
+
+        return $obj;
+    }
+
+    function getExtensionArgs()
+    {
+        return $this->data;
+    }
+
+    // Read-only dictionary interface
+    function get($field_name, $default=null)
+    {
+        if (!Auth_OpenID_checkFieldName($field_name)) {
+            return null;
+        }
+
+        return Auth_OpenID::arrayGet($this->data, $field_name, $default);
+    }
+
+    function contents()
+    {
+        return $this->data;
+    }
+}
+
+
+

--- /dev/null
+++ b/lib/openid-php/Auth/OpenID/Server.php
@@ -1,1 +1,1766 @@
-
+<?php
+
+/**
+ * OpenID server protocol and logic.
+ * 
+ * Overview
+ *
+ * An OpenID server must perform three tasks:
+ *
+ *  1. Examine the incoming request to determine its nature and validity.
+ *  2. Make a decision about how to respond to this request.
+ *  3. Format the response according to the protocol.
+ * 
+ * The first and last of these tasks may performed by the {@link
+ * Auth_OpenID_Server::decodeRequest()} and {@link
+ * Auth_OpenID_Server::encodeResponse} methods.  Who gets to do the
+ * intermediate task -- deciding how to respond to the request -- will
+ * depend on what type of request it is.
+ *
+ * If it's a request to authenticate a user (a 'checkid_setup' or
+ * 'checkid_immediate' request), you need to decide if you will assert
+ * that this user may claim the identity in question.  Exactly how you
+ * do that is a matter of application policy, but it generally
+ * involves making sure the user has an account with your system and
+ * is logged in, checking to see if that identity is hers to claim,
+ * and verifying with the user that she does consent to releasing that
+ * information to the party making the request.
+ *
+ * Examine the properties of the {@link Auth_OpenID_CheckIDRequest}
+ * object, and if and when you've come to a decision, form a response
+ * by calling {@link Auth_OpenID_CheckIDRequest::answer()}.
+ *
+ * Other types of requests relate to establishing associations between
+ * client and server and verifing the authenticity of previous
+ * communications.  {@link Auth_OpenID_Server} contains all the logic
+ * and data necessary to respond to such requests; just pass it to
+ * {@link Auth_OpenID_Server::handleRequest()}.
+ *
+ * OpenID Extensions
+ * 
+ * Do you want to provide other information for your users in addition
+ * to authentication?  Version 1.2 of the OpenID protocol allows
+ * consumers to add extensions to their requests.  For example, with
+ * sites using the Simple Registration
+ * Extension
+ * (http://openid.net/specs/openid-simple-registration-extension-1_0.html),
+ * a user can agree to have their nickname and e-mail address sent to
+ * a site when they sign up.
+ *
+ * Since extensions do not change the way OpenID authentication works,
+ * code to handle extension requests may be completely separate from
+ * the {@link Auth_OpenID_Request} class here.  But you'll likely want
+ * data sent back by your extension to be signed.  {@link
+ * Auth_OpenID_ServerResponse} provides methods with which you can add
+ * data to it which can be signed with the other data in the OpenID
+ * signature.
+ *
+ * For example:
+ *
+ * <pre>  // when request is a checkid_* request
+ *  $response = $request->answer(true);
+ *  // this will a signed 'openid.sreg.timezone' parameter to the response
+ *  response.addField('sreg', 'timezone', 'America/Los_Angeles')</pre>
+ *
+ * Stores
+ *
+ * The OpenID server needs to maintain state between requests in order
+ * to function.  Its mechanism for doing this is called a store.  The
+ * store interface is defined in Interface.php.  Additionally, several
+ * concrete store implementations are provided, so that most sites
+ * won't need to implement a custom store.  For a store backed by flat
+ * files on disk, see {@link Auth_OpenID_FileStore}.  For stores based
+ * on MySQL, SQLite, or PostgreSQL, see the {@link
+ * Auth_OpenID_SQLStore} subclasses.
+ *
+ * Upgrading
+ *
+ * The keys by which a server looks up associations in its store have
+ * changed in version 1.2 of this library.  If your store has entries
+ * created from version 1.0 code, you should empty it.
+ *
+ * PHP versions 4 and 5
+ *
+ * LICENSE: See the COPYING file included in this distribution.
+ *
+ * @package OpenID
+ * @author JanRain, Inc. <openid@janrain.com>
+ * @copyright 2005-2008 Janrain, Inc.
+ * @license http://www.apache.org/licenses/LICENSE-2.0 Apache
+ */
+
+/**
+ * Required imports
+ */
+require_once "Auth/OpenID.php";
+require_once "Auth/OpenID/Association.php";
+require_once "Auth/OpenID/CryptUtil.php";
+require_once "Auth/OpenID/BigMath.php";
+require_once "Auth/OpenID/DiffieHellman.php";
+require_once "Auth/OpenID/KVForm.php";
+require_once "Auth/OpenID/TrustRoot.php";
+require_once "Auth/OpenID/ServerRequest.php";
+require_once "Auth/OpenID/Message.php";
+require_once "Auth/OpenID/Nonce.php";
+
+define('AUTH_OPENID_HTTP_OK', 200);
+define('AUTH_OPENID_HTTP_REDIRECT', 302);
+define('AUTH_OPENID_HTTP_ERROR', 400);
+
+/**
+ * @access private
+ */
+global $_Auth_OpenID_Request_Modes;
+$_Auth_OpenID_Request_Modes = array('checkid_setup',
+                                    'checkid_immediate');
+
+/**
+ * @access private
+ */
+define('Auth_OpenID_ENCODE_KVFORM', 'kfvorm');
+
+/**
+ * @access private
+ */
+define('Auth_OpenID_ENCODE_URL', 'URL/redirect');
+
+/**
+ * @access private
+ */
+define('Auth_OpenID_ENCODE_HTML_FORM', 'HTML form');
+
+/**
+ * @access private
+ */
+function Auth_OpenID_isError($obj, $cls = 'Auth_OpenID_ServerError')
+{
+    return is_a($obj, $cls);
+}
+
+/**
+ * An error class which gets instantiated and returned whenever an
+ * OpenID protocol error occurs.  Be prepared to use this in place of
+ * an ordinary server response.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_ServerError {
+    /**
+     * @access private
+     */
+    function Auth_OpenID_ServerError($message = null, $text = null,
+                                     $reference = null, $contact = null)
+    {
+        $this->message = $message;
+        $this->text = $text;
+        $this->contact = $contact;
+        $this->reference = $reference;
+    }
+
+    function getReturnTo()
+    {
+        if ($this->message &&
+            $this->message->hasKey(Auth_OpenID_OPENID_NS, 'return_to')) {
+            return $this->message->getArg(Auth_OpenID_OPENID_NS,
+                                          'return_to');
+        } else {
+            return null;
+        }
+    }
+
+    /**
+     * Returns the return_to URL for the request which caused this
+     * error.
+     */
+    function hasReturnTo()
+    {
+        return $this->getReturnTo() !== null;
+    }
+
+    /**
+     * Encodes this error's response as a URL suitable for
+     * redirection.  If the response has no return_to, another
+     * Auth_OpenID_ServerError is returned.
+     */
+    function encodeToURL()
+    {
+        if (!$this->message) {
+            return null;
+        }
+
+        $msg = $this->toMessage();
+        return $msg->toURL($this->getReturnTo());
+    }
+
+    /**
+     * Encodes the response to key-value form.  This is a
+     * machine-readable format used to respond to messages which came
+     * directly from the consumer and not through the user-agent.  See
+     * the OpenID specification.
+     */
+    function encodeToKVForm()
+    {
+        return Auth_OpenID_KVForm::fromArray(
+                                      array('mode' => 'error',
+                                            'error' => $this->toString()));
+    }
+
+    function toFormMarkup($form_tag_attrs=null)
+    {
+        $msg = $this->toMessage();
+        return $msg->toFormMarkup($this->getReturnTo(), $form_tag_attrs);
+    }
+
+    function toHTML($form_tag_attrs=null)
+    {
+        return Auth_OpenID::autoSubmitHTML(
+                      $this->toFormMarkup($form_tag_attrs));
+    }
+
+    function toMessage()
+    {
+        // Generate a Message object for sending to the relying party,
+        // after encoding.
+        $namespace = $this->message->getOpenIDNamespace();
+        $reply = new Auth_OpenID_Message($namespace);
+        $reply->setArg(Auth_OpenID_OPENID_NS, 'mode', 'error');
+        $reply->setArg(Auth_OpenID_OPENID_NS, 'error', $this->toString());
+
+        if ($this->contact !== null) {
+            $reply->setArg(Auth_OpenID_OPENID_NS, 'contact', $this->contact);
+        }
+
+        if ($this->reference !== null) {
+            $reply->setArg(Auth_OpenID_OPENID_NS, 'reference',
+                           $this->reference);
+        }
+
+        return $reply;
+    }
+
+    /**
+     * Returns one of Auth_OpenID_ENCODE_URL,
+     * Auth_OpenID_ENCODE_KVFORM, or null, depending on the type of
+     * encoding expected for this error's payload.
+     */
+    function whichEncoding()
+    {
+        global $_Auth_OpenID_Request_Modes;
+
+        if ($this->hasReturnTo()) {
+            if ($this->message->isOpenID2() &&
+                (strlen($this->encodeToURL()) >
+                   Auth_OpenID_OPENID1_URL_LIMIT)) {
+                return Auth_OpenID_ENCODE_HTML_FORM;
+            } else {
+                return Auth_OpenID_ENCODE_URL;
+            }
+        }
+
+        if (!$this->message) {
+            return null;
+        }
+
+        $mode = $this->message->getArg(Auth_OpenID_OPENID_NS,
+                                       'mode');
+
+        if ($mode) {
+            if (!in_array($mode, $_Auth_OpenID_Request_Modes)) {
+                return Auth_OpenID_ENCODE_KVFORM;
+            }
+        }
+        return null;
+    }
+
+    /**
+     * Returns this error message.
+     */
+    function toString()
+    {
+        if ($this->text) {
+            return $this->text;
+        } else {
+            return get_class($this) . " error";
+        }
+    }
+}
+
+/**
+ * Error returned by the server code when a return_to is absent from a
+ * request.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_NoReturnToError extends Auth_OpenID_ServerError {
+    function Auth_OpenID_NoReturnToError($message = null,
+                                         $text = "No return_to URL available")
+    {
+        parent::Auth_OpenID_ServerError($message, $text);
+    }
+
+    function toString()
+    {
+        return "No return_to available";
+    }
+}
+
+/**
+ * An error indicating that the return_to URL is malformed.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_MalformedReturnURL extends Auth_OpenID_ServerError {
+    function Auth_OpenID_MalformedReturnURL($message, $return_to)
+    {
+        $this->return_to = $return_to;
+        parent::Auth_OpenID_ServerError($message, "malformed return_to URL");
+    }
+}
+
+/**
+ * This error is returned when the trust_root value is malformed.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_MalformedTrustRoot extends Auth_OpenID_ServerError {
+    function Auth_OpenID_MalformedTrustRoot($message = null,
+                                            $text = "Malformed trust root")
+    {
+        parent::Auth_OpenID_ServerError($message, $text);
+    }
+
+    function toString()
+    {
+        return "Malformed trust root";
+    }
+}
+
+/**
+ * The base class for all server request classes.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_Request {
+    var $mode = null;
+}
+
+/**
+ * A request to verify the validity of a previous response.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_CheckAuthRequest extends Auth_OpenID_Request {
+    var $mode = "check_authentication";
+    var $invalidate_handle = null;
+
+    function Auth_OpenID_CheckAuthRequest($assoc_handle, $signed,
+                                          $invalidate_handle = null)
+    {
+        $this->assoc_handle = $assoc_handle;
+        $this->signed = $signed;
+        if ($invalidate_handle !== null) {
+            $this->invalidate_handle = $invalidate_handle;
+        }
+        $this->namespace = Auth_OpenID_OPENID2_NS;
+        $this->message = null;
+    }
+
+    static function fromMessage($message, $server=null)
+    {
+        $required_keys = array('assoc_handle', 'sig', 'signed');
+
+        foreach ($required_keys as $k) {
+            if (!$message->getArg(Auth_OpenID_OPENID_NS, $k)) {
+                return new Auth_OpenID_ServerError($message,
+                    sprintf("%s request missing required parameter %s from \
+                            query", "check_authentication", $k));
+            }
+        }
+
+        $assoc_handle = $message->getArg(Auth_OpenID_OPENID_NS, 'assoc_handle');
+        $sig = $message->getArg(Auth_OpenID_OPENID_NS, 'sig');
+
+        $signed_list = $message->getArg(Auth_OpenID_OPENID_NS, 'signed');
+        $signed_list = explode(",", $signed_list);
+
+        $signed = $message;
+        if ($signed->hasKey(Auth_OpenID_OPENID_NS, 'mode')) {
+            $signed->setArg(Auth_OpenID_OPENID_NS, 'mode', 'id_res');
+        }
+
+        $result = new Auth_OpenID_CheckAuthRequest($assoc_handle, $signed);
+        $result->message = $message;
+        $result->sig = $sig;
+        $result->invalidate_handle = $message->getArg(Auth_OpenID_OPENID_NS,
+                                                      'invalidate_handle');
+        return $result;
+    }
+
+    function answer($signatory)
+    {
+        $is_valid = $signatory->verify($this->assoc_handle, $this->signed);
+
+        // Now invalidate that assoc_handle so it this checkAuth
+        // message cannot be replayed.
+        $signatory->invalidate($this->assoc_handle, true);
+        $response = new Auth_OpenID_ServerResponse($this);
+
+        $response->fields->setArg(Auth_OpenID_OPENID_NS,
+                                  'is_valid',
+                                  ($is_valid ? "true" : "false"));
+
+        if ($this->invalidate_handle) {
+            $assoc = $signatory->getAssociation($this->invalidate_handle,
+                                                false);
+            if (!$assoc) {
+                $response->fields->setArg(Auth_OpenID_OPENID_NS,
+                                          'invalidate_handle',
+                                          $this->invalidate_handle);
+            }
+        }
+        return $response;
+    }
+}
+
+/**
+ * A class implementing plaintext server sessions.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_PlainTextServerSession {
+    /**
+     * An object that knows how to handle association requests with no
+     * session type.
+     */
+    var $session_type = 'no-encryption';
+    var $needs_math = false;
+    var $allowed_assoc_types = array('HMAC-SHA1', 'HMAC-SHA256');
+
+    static function fromMessage($unused_request)
+    {
+        return new Auth_OpenID_PlainTextServerSession();
+    }
+
+    function answer($secret)
+    {
+        return array('mac_key' => base64_encode($secret));
+    }
+}
+
+/**
+ * A class implementing DH-SHA1 server sessions.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_DiffieHellmanSHA1ServerSession {
+    /**
+     * An object that knows how to handle association requests with
+     * the Diffie-Hellman session type.
+     */
+
+    var $session_type = 'DH-SHA1';
+    var $needs_math = true;
+    var $allowed_assoc_types = array('HMAC-SHA1');
+    var $hash_func = 'Auth_OpenID_SHA1';
+
+    function Auth_OpenID_DiffieHellmanSHA1ServerSession($dh, $consumer_pubkey)
+    {
+        $this->dh = $dh;
+        $this->consumer_pubkey = $consumer_pubkey;
+    }
+
+    static function getDH($message)
+    {
+        $dh_modulus = $message->getArg(Auth_OpenID_OPENID_NS, 'dh_modulus');
+        $dh_gen = $message->getArg(Auth_OpenID_OPENID_NS, 'dh_gen');
+
+        if ((($dh_modulus === null) && ($dh_gen !== null)) ||
+            (($dh_gen === null) && ($dh_modulus !== null))) {
+
+            if ($dh_modulus === null) {
+                $missing = 'modulus';
+            } else {
+                $missing = 'generator';
+            }
+
+            return new Auth_OpenID_ServerError($message,
+                                'If non-default modulus or generator is '.
+                                'supplied, both must be supplied.  Missing '.
+                                $missing);
+        }
+
+        $lib = Auth_OpenID_getMathLib();
+
+        if ($dh_modulus || $dh_gen) {
+            $dh_modulus = $lib->base64ToLong($dh_modulus);
+            $dh_gen = $lib->base64ToLong($dh_gen);
+            if ($lib->cmp($dh_modulus, 0) == 0 ||
+                $lib->cmp($dh_gen, 0) == 0) {
+                return new Auth_OpenID_ServerError(
+                  $message, "Failed to parse dh_mod or dh_gen");
+            }
+            $dh = new Auth_OpenID_DiffieHellman($dh_modulus, $dh_gen);
+        } else {
+            $dh = new Auth_OpenID_DiffieHellman();
+        }
+
+        $consumer_pubkey = $message->getArg(Auth_OpenID_OPENID_NS,
+                                            'dh_consumer_public');
+        if ($consumer_pubkey === null) {
+            return new Auth_OpenID_ServerError($message,
+                                  'Public key for DH-SHA1 session '.
+                                  'not found in query');
+        }
+
+        $consumer_pubkey =
+            $lib->base64ToLong($consumer_pubkey);
+
+        if ($consumer_pubkey === false) {
+            return new Auth_OpenID_ServerError($message,
+                                       "dh_consumer_public is not base64");
+        }
+
+        return array($dh, $consumer_pubkey);
+    }
+
+    static function fromMessage($message)
+    {
+        $result = Auth_OpenID_DiffieHellmanSHA1ServerSession::getDH($message);
+
+        if (is_a($result, 'Auth_OpenID_ServerError')) {
+            return $result;
+        } else {
+            list($dh, $consumer_pubkey) = $result;
+            return new Auth_OpenID_DiffieHellmanSHA1ServerSession($dh,
+                                                    $consumer_pubkey);
+        }
+    }
+
+    function answer($secret)
+    {
+        $lib = Auth_OpenID_getMathLib();
+        $mac_key = $this->dh->xorSecret($this->consumer_pubkey, $secret,
+                                        $this->hash_func);
+        return array(
+           'dh_server_public' =>
+                $lib->longToBase64($this->dh->public),
+           'enc_mac_key' => base64_encode($mac_key));
+    }
+}
+
+/**
+ * A class implementing DH-SHA256 server sessions.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_DiffieHellmanSHA256ServerSession
+      extends Auth_OpenID_DiffieHellmanSHA1ServerSession {
+
+    var $session_type = 'DH-SHA256';
+    var $hash_func = 'Auth_OpenID_SHA256';
+    var $allowed_assoc_types = array('HMAC-SHA256');
+
+    static function fromMessage($message)
+    {
+        $result = Auth_OpenID_DiffieHellmanSHA1ServerSession::getDH($message);
+
+        if (is_a($result, 'Auth_OpenID_ServerError')) {
+            return $result;
+        } else {
+            list($dh, $consumer_pubkey) = $result;
+            return new Auth_OpenID_DiffieHellmanSHA256ServerSession($dh,
+                                                      $consumer_pubkey);
+        }
+    }
+}
+
+/**
+ * A request to associate with the server.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_AssociateRequest extends Auth_OpenID_Request {
+    var $mode = "associate";
+
+    static function getSessionClasses()
+    {
+        return array(
+          'no-encryption' => 'Auth_OpenID_PlainTextServerSession',
+          'DH-SHA1' => 'Auth_OpenID_DiffieHellmanSHA1ServerSession',
+          'DH-SHA256' => 'Auth_OpenID_DiffieHellmanSHA256ServerSession');
+    }
+
+    function Auth_OpenID_AssociateRequest($session, $assoc_type)
+    {
+        $this->session = $session;
+        $this->namespace = Auth_OpenID_OPENID2_NS;
+        $this->assoc_type = $assoc_type;
+    }
+
+    static function fromMessage($message, $server=null)
+    {
+        if ($message->isOpenID1()) {
+            $session_type = $message->getArg(Auth_OpenID_OPENID_NS,
+                                             'session_type');
+
+            if ($session_type == 'no-encryption') {
+                // oidutil.log('Received OpenID 1 request with a no-encryption '
+                //             'assocaition session type. Continuing anyway.')
+            } else if (!$session_type) {
+                $session_type = 'no-encryption';
+            }
+        } else {
+            $session_type = $message->getArg(Auth_OpenID_OPENID_NS,
+                                             'session_type');
+            if ($session_type === null) {
+                return new Auth_OpenID_ServerError($message,
+                  "session_type missing from request");
+            }
+        }
+
+        $session_class = Auth_OpenID::arrayGet(
+           Auth_OpenID_AssociateRequest::getSessionClasses(),
+           $session_type);
+
+        if ($session_class === null) {
+            return new Auth_OpenID_ServerError($message,
+                                               "Unknown session type " .
+                                               $session_type);
+        }
+
+        $session = call_user_func(array($session_class, 'fromMessage'),
+                                  $message);
+        if (is_a($session, 'Auth_OpenID_ServerError')) {
+            return $session;
+        }
+
+        $assoc_type = $message->getArg(Auth_OpenID_OPENID_NS,
+                                       'assoc_type', 'HMAC-SHA1');
+
+        if (!in_array($assoc_type, $session->allowed_assoc_types)) {
+            $fmt = "Session type %s does not support association type %s";
+            return new Auth_OpenID_ServerError($message,
+              sprintf($fmt, $session_type, $assoc_type));
+        }
+
+        $obj = new Auth_OpenID_AssociateRequest($session, $assoc_type);
+        $obj->message = $message;
+        $obj->namespace = $message->getOpenIDNamespace();
+        return $obj;
+    }
+
+    function answer($assoc)
+    {
+        $response = new Auth_OpenID_ServerResponse($this);
+        $response->fields->updateArgs(Auth_OpenID_OPENID_NS,
+           array(
+                 'expires_in' => sprintf('%d', $assoc->getExpiresIn()),
+                 'assoc_type' => $this->assoc_type,
+                 'assoc_handle' => $assoc->handle));
+
+        $response->fields->updateArgs(Auth_OpenID_OPENID_NS,
+           $this->session->answer($assoc->secret));
+
+        if (! ($this->session->session_type == 'no-encryption' 
+               && $this->message->isOpenID1())) {
+            $response->fields->setArg(Auth_OpenID_OPENID_NS,
+                                      'session_type',
+                                      $this->session->session_type);
+        }
+
+        return $response;
+    }
+
+    function answerUnsupported($text_message,
+                               $preferred_association_type=null,
+                               $preferred_session_type=null)
+    {
+        if ($this->message->isOpenID1()) {
+            return new Auth_OpenID_ServerError($this->message);
+        }
+
+        $response = new Auth_OpenID_ServerResponse($this);
+        $response->fields->setArg(Auth_OpenID_OPENID_NS,
+                                  'error_code', 'unsupported-type');
+        $response->fields->setArg(Auth_OpenID_OPENID_NS,
+                                  'error', $text_message);
+
+        if ($preferred_association_type) {
+            $response->fields->setArg(Auth_OpenID_OPENID_NS,
+                                      'assoc_type',
+                                      $preferred_association_type);
+        }
+
+        if ($preferred_session_type) {
+            $response->fields->setArg(Auth_OpenID_OPENID_NS,
+                                      'session_type',
+                                      $preferred_session_type);
+        }
+        $response->code = AUTH_OPENID_HTTP_ERROR;
+        return $response;
+    }
+}
+
+/**
+ * A request to confirm the identity of a user.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_CheckIDRequest extends Auth_OpenID_Request {
+    /**
+     * Return-to verification callback.  Default is
+     * Auth_OpenID_verifyReturnTo from TrustRoot.php.
+     */
+    var $verifyReturnTo = 'Auth_OpenID_verifyReturnTo';
+
+    /**
+     * The mode of this request.
+     */
+    var $mode = "checkid_setup"; // or "checkid_immediate"
+
+    /**
+     * Whether this request is for immediate mode.
+     */
+    var $immediate = false;
+
+    /**
+     * The trust_root value for this request.
+     */
+    var $trust_root = null;
+
+    /**
+     * The OpenID namespace for this request.
+     * deprecated since version 2.0.2
+     */
+    var $namespace;
+    
+    static function make($message, $identity, $return_to, $trust_root = null,
+                  $immediate = false, $assoc_handle = null, $server = null)
+    {
+        if ($server === null) {
+            return new Auth_OpenID_ServerError($message,
+                                               "server must not be null");
+        }
+
+        if ($return_to &&
+            !Auth_OpenID_TrustRoot::_parse($return_to)) {
+            return new Auth_OpenID_MalformedReturnURL($message, $return_to);
+        }
+
+        $r = new Auth_OpenID_CheckIDRequest($identity, $return_to,
+                                            $trust_root, $immediate,
+                                            $assoc_handle, $server);
+
+        $r->namespace = $message->getOpenIDNamespace();
+        $r->message = $message;
+
+        if (!$r->trustRootValid()) {
+            return new Auth_OpenID_UntrustedReturnURL($message,
+                                                      $return_to,
+                                                      $trust_root);
+        } else {
+            return $r;
+        }
+    }
+
+    function Auth_OpenID_CheckIDRequest($identity, $return_to,
+                                        $trust_root = null, $immediate = false,
+                                        $assoc_handle = null, $server = null,
+                                        $claimed_id = null)
+    {
+        $this->namespace = Auth_OpenID_OPENID2_NS;
+        $this->assoc_handle = $assoc_handle;
+        $this->identity = $identity;
+        if ($claimed_id === null) {
+            $this->claimed_id = $identity;
+        } else {
+            $this->claimed_id = $claimed_id;
+        }
+        $this->return_to = $return_to;
+        $this->trust_root = $trust_root;
+        $this->server = $server;
+
+        if ($immediate) {
+            $this->immediate = true;
+            $this->mode = "checkid_immediate";
+        } else {
+            $this->immediate = false;
+            $this->mode = "checkid_setup";
+        }
+    }
+
+    function equals($other)
+    {
+        return (
+                (is_a($other, 'Auth_OpenID_CheckIDRequest')) &&
+                ($this->namespace == $other->namespace) &&
+                ($this->assoc_handle == $other->assoc_handle) &&
+                ($this->identity == $other->identity) &&
+                ($this->claimed_id == $other->claimed_id) &&
+                ($this->return_to == $other->return_to) &&
+                ($this->trust_root == $other->trust_root));
+    }
+
+    /*
+     * Does the relying party publish the return_to URL for this
+     * response under the realm? It is up to the provider to set a
+     * policy for what kinds of realms should be allowed. This
+     * return_to URL verification reduces vulnerability to data-theft
+     * attacks based on open proxies, corss-site-scripting, or open
+     * redirectors.
+     *
+     * This check should only be performed after making sure that the
+     * return_to URL matches the realm.
+     *
+     * @return true if the realm publishes a document with the
+     * return_to URL listed, false if not or if discovery fails
+     */
+    function returnToVerified()
+    {
+        $fetcher = Auth_Yadis_Yadis::getHTTPFetcher();
+        return call_user_func_array($this->verifyReturnTo,
+                                    array($this->trust_root, $this->return_to, $fetcher));
+    }
+
+    static function fromMessage($message, $server)
+    {
+        $mode = $message->getArg(Auth_OpenID_OPENID_NS, 'mode');
+        $immediate = null;
+
+        if ($mode == "checkid_immediate") {
+            $immediate = true;
+            $mode = "checkid_immediate";
+        } else {
+            $immediate = false;
+            $mode = "checkid_setup";
+        }
+
+        $return_to = $message->getArg(Auth_OpenID_OPENID_NS,
+                                      'return_to');
+
+        if (($message->isOpenID1()) &&
+            (!$return_to)) {
+            $fmt = "Missing required field 'return_to' from checkid request";
+            return new Auth_OpenID_ServerError($message, $fmt);
+        }
+
+        $identity = $message->getArg(Auth_OpenID_OPENID_NS,
+                                     'identity');
+        $claimed_id = $message->getArg(Auth_OpenID_OPENID_NS, 'claimed_id');
+        if ($message->isOpenID1()) {
+            if ($identity === null) {
+                $s = "OpenID 1 message did not contain openid.identity";
+                return new Auth_OpenID_ServerError($message, $s);
+            }
+        } else {
+            if ($identity && !$claimed_id) {
+                $s = "OpenID 2.0 message contained openid.identity but not " .
+                  "claimed_id";
+                return new Auth_OpenID_ServerError($message, $s);
+            } else if ($claimed_id && !$identity) {
+                $s = "OpenID 2.0 message contained openid.claimed_id " .
+                  "but not identity";
+                return new Auth_OpenID_ServerError($message, $s);
+            }
+        }
+
+        // There's a case for making self.trust_root be a TrustRoot
+        // here.  But if TrustRoot isn't currently part of the
+        // "public" API, I'm not sure it's worth doing.
+        if ($message->isOpenID1()) {
+            $trust_root_param = 'trust_root';
+        } else {
+            $trust_root_param = 'realm';
+        }
+        $trust_root = $message->getArg(Auth_OpenID_OPENID_NS, 
+                                       $trust_root_param);
+        if (! $trust_root) {
+            $trust_root = $return_to;
+        }
+
+        if (! $message->isOpenID1() && 
+            ($return_to === null) &&
+            ($trust_root === null)) {
+            return new Auth_OpenID_ServerError($message,
+              "openid.realm required when openid.return_to absent");
+        }
+
+        $assoc_handle = $message->getArg(Auth_OpenID_OPENID_NS,
+                                         'assoc_handle');
+
+        $obj = Auth_OpenID_CheckIDRequest::make($message,
+                                                $identity,
+                                                $return_to,
+                                                $trust_root,
+                                                $immediate,
+                                                $assoc_handle,
+                                                $server);
+
+        if (is_a($obj, 'Auth_OpenID_ServerError')) {
+            return $obj;
+        }
+
+        $obj->claimed_id = $claimed_id;
+
+        return $obj;
+    }
+
+    function idSelect()
+    {
+        // Is the identifier to be selected by the IDP?
+        // So IDPs don't have to import the constant
+        return $this->identity == Auth_OpenID_IDENTIFIER_SELECT;
+    }
+
+    function trustRootValid()
+    {
+        if (!$this->trust_root) {
+            return true;
+        }
+
+        $tr = Auth_OpenID_TrustRoot::_parse($this->trust_root);
+        if ($tr === false) {
+            return new Auth_OpenID_MalformedTrustRoot($this->message,
+                                                      $this->trust_root);
+        }
+
+        if ($this->return_to !== null) {
+            return Auth_OpenID_TrustRoot::match($this->trust_root,
+                                                $this->return_to);
+        } else {
+            return true;
+        }
+    }
+
+    /**
+     * Respond to this request.  Return either an
+     * {@link Auth_OpenID_ServerResponse} or
+     * {@link Auth_OpenID_ServerError}.
+     *
+     * @param bool $allow Allow this user to claim this identity, and
+     * allow the consumer to have this information?
+     *
+     * @param string $server_url DEPRECATED.  Passing $op_endpoint to
+     * the {@link Auth_OpenID_Server} constructor makes this optional.
+     *
+     * When an OpenID 1.x immediate mode request does not succeed, it
+     * gets back a URL where the request may be carried out in a
+     * not-so-immediate fashion.  Pass my URL in here (the fully
+     * qualified address of this server's endpoint, i.e.
+     * http://example.com/server), and I will use it as a base for the
+     * URL for a new request.
+     *
+     * Optional for requests where {@link $immediate} is false or
+     * $allow is true.
+     *
+     * @param string $identity The OP-local identifier to answer with.
+     * Only for use when the relying party requested identifier
+     * selection.
+     *
+     * @param string $claimed_id The claimed identifier to answer
+     * with, for use with identifier selection in the case where the
+     * claimed identifier and the OP-local identifier differ,
+     * i.e. when the claimed_id uses delegation.
+     *
+     * If $identity is provided but this is not, $claimed_id will
+     * default to the value of $identity.  When answering requests
+     * that did not ask for identifier selection, the response
+     * $claimed_id will default to that of the request.
+     *
+     * This parameter is new in OpenID 2.0.
+     *
+     * @return mixed
+     */
+    function answer($allow, $server_url = null, $identity = null,
+                    $claimed_id = null)
+    {
+        if (!$this->return_to) {
+            return new Auth_OpenID_NoReturnToError();
+        }
+
+        if (!$server_url) {
+            if ((!$this->message->isOpenID1()) &&
+                (!$this->server->op_endpoint)) {
+                return new Auth_OpenID_ServerError(null,
+                  "server should be constructed with op_endpoint to " .
+                  "respond to OpenID 2.0 messages.");
+            }
+
+            $server_url = $this->server->op_endpoint;
+        }
+
+        if ($allow) {
+            $mode = 'id_res';
+        } else if ($this->message->isOpenID1()) {
+            if ($this->immediate) {
+                $mode = 'id_res';
+            } else {
+                $mode = 'cancel';
+            }
+        } else {
+            if ($this->immediate) {
+                $mode = 'setup_needed';
+            } else {
+                $mode = 'cancel';
+            }
+        }
+
+        if (!$this->trustRootValid()) {
+            return new Auth_OpenID_UntrustedReturnURL(null,
+                                                      $this->return_to,
+                                                      $this->trust_root);
+        }
+
+        $response = new Auth_OpenID_ServerResponse($this);
+
+        if ($claimed_id &&
+            ($this->message->isOpenID1())) {
+            return new Auth_OpenID_ServerError(null,
+              "claimed_id is new in OpenID 2.0 and not " .
+              "available for ".$this->namespace);
+        }
+
+        if ($identity && !$claimed_id) {
+            $claimed_id = $identity;
+        }
+
+        if ($allow) {
+
+            if ($this->identity == Auth_OpenID_IDENTIFIER_SELECT) {
+                if (!$identity) {
+                    return new Auth_OpenID_ServerError(null,
+                      "This request uses IdP-driven identifier selection.  " .
+                      "You must supply an identifier in the response.");
+                }
+
+                $response_identity = $identity;
+                $response_claimed_id = $claimed_id;
+
+            } else if ($this->identity) {
+                if ($identity &&
+                    ($this->identity != $identity)) {
+                    $fmt = "Request was for %s, cannot reply with identity %s";
+                    return new Auth_OpenID_ServerError(null,
+                      sprintf($fmt, $this->identity, $identity));
+                }
+
+                $response_identity = $this->identity;
+                $response_claimed_id = $this->claimed_id;
+            } else {
+                if ($identity) {
+                    return new Auth_OpenID_ServerError(null,
+                      "This request specified no identity and " .
+                      "you supplied ".$identity);
+                }
+
+                $response_identity = null;
+            }
+
+            if (($this->message->isOpenID1()) &&
+                ($response_identity === null)) {
+                return new Auth_OpenID_ServerError(null,
+                  "Request was an OpenID 1 request, so response must " .
+                  "include an identifier.");
+            }
+
+            $response->fields->updateArgs(Auth_OpenID_OPENID_NS,
+                   array('mode' => $mode,
+                         'return_to' => $this->return_to,
+                         'response_nonce' => Auth_OpenID_mkNonce()));
+
+            if (!$this->message->isOpenID1()) {
+                $response->fields->setArg(Auth_OpenID_OPENID_NS,
+                                          'op_endpoint', $server_url);
+            }
+
+            if ($response_identity !== null) {
+                $response->fields->setArg(
+                                          Auth_OpenID_OPENID_NS,
+                                          'identity',
+                                          $response_identity);
+                if ($this->message->isOpenID2()) {
+                    $response->fields->setArg(
+                                              Auth_OpenID_OPENID_NS,
+                                              'claimed_id',
+                                              $response_claimed_id);
+                }
+            }
+
+        } else {
+            $response->fields->setArg(Auth_OpenID_OPENID_NS,
+                                      'mode', $mode);
+
+            if ($this->immediate) {
+                if (($this->message->isOpenID1()) &&
+                    (!$server_url)) {
+                    return new Auth_OpenID_ServerError(null,
+                                 'setup_url is required for $allow=false \
+                                  in OpenID 1.x immediate mode.');
+                }
+
+                $setup_request = new Auth_OpenID_CheckIDRequest(
+                                                $this->identity,
+                                                $this->return_to,
+                                                $this->trust_root,
+                                                false,
+                                                $this->assoc_handle,
+                                                $this->server,
+                                                $this->claimed_id);
+                $setup_request->message = $this->message;
+
+                $setup_url = $setup_request->encodeToURL($server_url);
+
+                if ($setup_url === null) {
+                    return new Auth_OpenID_NoReturnToError();
+                }
+
+                $response->fields->setArg(Auth_OpenID_OPENID_NS,
+                                          'user_setup_url',
+                                          $setup_url);
+            }
+        }
+
+        return $response;
+    }
+
+    function encodeToURL($server_url)
+    {
+        if (!$this->return_to) {
+            return new Auth_OpenID_NoReturnToError();
+        }
+
+        // Imported from the alternate reality where these classes are
+        // used in both the client and server code, so Requests are
+        // Encodable too.  That's right, code imported from alternate
+        // realities all for the love of you, id_res/user_setup_url.
+
+        $q = array('mode' => $this->mode,
+                   'identity' => $this->identity,
+                   'claimed_id' => $this->claimed_id,
+                   'return_to' => $this->return_to);
+
+        if ($this->trust_root) {
+            if ($this->message->isOpenID1()) {
+                $q['trust_root'] = $this->trust_root;
+            } else {
+                $q['realm'] = $this->trust_root;
+            }
+        }
+
+        if ($this->assoc_handle) {
+            $q['assoc_handle'] = $this->assoc_handle;
+        }
+
+        $response = new Auth_OpenID_Message(
+            $this->message->getOpenIDNamespace());
+        $response->updateArgs(Auth_OpenID_OPENID_NS, $q);
+        return $response->toURL($server_url);
+    }
+
+    function getCancelURL()
+    {
+        if (!$this->return_to) {
+            return new Auth_OpenID_NoReturnToError();
+        }
+
+        if ($this->immediate) {
+            return new Auth_OpenID_ServerError(null,
+                                               "Cancel is not an appropriate \
+                                               response to immediate mode \
+                                               requests.");
+        }
+
+        $response = new Auth_OpenID_Message(
+            $this->message->getOpenIDNamespace());
+        $response->setArg(Auth_OpenID_OPENID_NS, 'mode', 'cancel');
+        return $response->toURL($this->return_to);
+    }
+}
+
+/**
+ * This class encapsulates the response to an OpenID server request.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_ServerResponse {
+
+    function Auth_OpenID_ServerResponse($request)
+    {
+        $this->request = $request;
+        $this->fields = new Auth_OpenID_Message($this->request->namespace);
+    }
+
+    function whichEncoding()
+    {
+      global $_Auth_OpenID_Request_Modes;
+
+        if (in_array($this->request->mode, $_Auth_OpenID_Request_Modes)) {
+            if ($this->fields->isOpenID2() &&
+                (strlen($this->encodeToURL()) >
+                   Auth_OpenID_OPENID1_URL_LIMIT)) {
+                return Auth_OpenID_ENCODE_HTML_FORM;
+            } else {
+                return Auth_OpenID_ENCODE_URL;
+            }
+        } else {
+            return Auth_OpenID_ENCODE_KVFORM;
+        }
+    }
+
+    /*
+     * Returns the form markup for this response.
+     *
+     * @return str
+     */
+    function toFormMarkup($form_tag_attrs=null)
+    {
+        return $this->fields->toFormMarkup($this->request->return_to,
+                                           $form_tag_attrs);
+    }
+
+    /*
+     * Returns an HTML document containing the form markup for this
+     * response that autosubmits with javascript.
+     */
+    function toHTML()
+    {
+        return Auth_OpenID::autoSubmitHTML($this->toFormMarkup());
+    }
+
+    /*
+     * Returns True if this response's encoding is ENCODE_HTML_FORM.
+     * Convenience method for server authors.
+     *
+     * @return bool
+     */
+    function renderAsForm()
+    {
+        return $this->whichEncoding() == Auth_OpenID_ENCODE_HTML_FORM;
+    }
+
+
+    function encodeToURL()
+    {
+        return $this->fields->toURL($this->request->return_to);
+    }
+
+    function addExtension($extension_response)
+    {
+        $extension_response->toMessage($this->fields);
+    }
+
+    function needsSigning()
+    {
+        return $this->fields->getArg(Auth_OpenID_OPENID_NS,
+                                     'mode') == 'id_res';
+    }
+
+    function encodeToKVForm()
+    {
+        return $this->fields->toKVForm();
+    }
+}
+
+/**
+ * A web-capable response object which you can use to generate a
+ * user-agent response.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_WebResponse {
+    var $code = AUTH_OPENID_HTTP_OK;
+    var $body = "";
+
+    function Auth_OpenID_WebResponse($code = null, $headers = null,
+                                     $body = null)
+    {
+        if ($code) {
+            $this->code = $code;
+        }
+
+        if ($headers !== null) {
+            $this->headers = $headers;
+        } else {
+            $this->headers = array();
+        }
+
+        if ($body !== null) {
+            $this->body = $body;
+        }
+    }
+}
+
+/**
+ * Responsible for the signature of query data and the verification of
+ * OpenID signature values.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_Signatory {
+
+    // = 14 * 24 * 60 * 60; # 14 days, in seconds
+    var $SECRET_LIFETIME = 1209600;
+
+    // keys have a bogus server URL in them because the filestore
+    // really does expect that key to be a URL.  This seems a little
+    // silly for the server store, since I expect there to be only one
+    // server URL.
+    var $normal_key = 'http://localhost/|normal';
+    var $dumb_key = 'http://localhost/|dumb';
+
+    /**
+     * Create a new signatory using a given store.
+     */
+    function Auth_OpenID_Signatory($store)
+    {
+        // assert store is not None
+        $this->store = $store;
+    }
+
+    /**
+     * Verify, using a given association handle, a signature with
+     * signed key-value pairs from an HTTP request.
+     */
+    function verify($assoc_handle, $message)
+    {
+        $assoc = $this->getAssociation($assoc_handle, true);
+        if (!$assoc) {
+            // oidutil.log("failed to get assoc with handle %r to verify sig %r"
+            //             % (assoc_handle, sig))
+            return false;
+        }
+
+        return $assoc->checkMessageSignature($message);
+    }
+
+    /**
+     * Given a response, sign the fields in the response's 'signed'
+     * list, and insert the signature into the response.
+     */
+    function sign($response)
+    {
+        $signed_response = $response;
+        $assoc_handle = $response->request->assoc_handle;
+
+        if ($assoc_handle) {
+            // normal mode
+            $assoc = $this->getAssociation($assoc_handle, false, false);
+            if (!$assoc || ($assoc->getExpiresIn() <= 0)) {
+                // fall back to dumb mode
+                $signed_response->fields->setArg(Auth_OpenID_OPENID_NS,
+                             'invalidate_handle', $assoc_handle);
+                $assoc_type = ($assoc ? $assoc->assoc_type : 'HMAC-SHA1');
+
+                if ($assoc && ($assoc->getExpiresIn() <= 0)) {
+                    $this->invalidate($assoc_handle, false);
+                }
+
+                $assoc = $this->createAssociation(true, $assoc_type);
+            }
+        } else {
+            // dumb mode.
+            $assoc = $this->createAssociation(true);
+        }
+
+        $signed_response->fields = $assoc->signMessage(
+                                      $signed_response->fields);
+        return $signed_response;
+    }
+
+    /**
+     * Make a new association.
+     */
+    function createAssociation($dumb = true, $assoc_type = 'HMAC-SHA1')
+    {
+        $secret = Auth_OpenID_CryptUtil::getBytes(
+                    Auth_OpenID_getSecretSize($assoc_type));
+
+        $uniq = base64_encode(Auth_OpenID_CryptUtil::getBytes(4));
+        $handle = sprintf('{%s}{%x}{%s}', $assoc_type, intval(time()), $uniq);
+
+        $assoc = Auth_OpenID_Association::fromExpiresIn(
+                      $this->SECRET_LIFETIME, $handle, $secret, $assoc_type);
+
+        if ($dumb) {
+            $key = $this->dumb_key;
+        } else {
+            $key = $this->normal_key;
+        }
+
+        $this->store->storeAssociation($key, $assoc);
+        return $assoc;
+    }
+
+    /**
+     * Given an association handle, get the association from the
+     * store, or return a ServerError or null if something goes wrong.
+     */
+    function getAssociation($assoc_handle, $dumb, $check_expiration=true)
+    {
+        if ($assoc_handle === null) {
+            return new Auth_OpenID_ServerError(null,
+                                     "assoc_handle must not be null");
+        }
+
+        if ($dumb) {
+            $key = $this->dumb_key;
+        } else {
+            $key = $this->normal_key;
+        }
+
+        $assoc = $this->store->getAssociation($key, $assoc_handle);
+
+        if (($assoc !== null) && ($assoc->getExpiresIn() <= 0)) {
+            if ($check_expiration) {
+                $this->store->removeAssociation($key, $assoc_handle);
+                $assoc = null;
+            }
+        }
+
+        return $assoc;
+    }
+
+    /**
+     * Invalidate a given association handle.
+     */
+    function invalidate($assoc_handle, $dumb)
+    {
+        if ($dumb) {
+            $key = $this->dumb_key;
+        } else {
+            $key = $this->normal_key;
+        }
+        $this->store->removeAssociation($key, $assoc_handle);
+    }
+}
+
+/**
+ * Encode an {@link Auth_OpenID_ServerResponse} to an
+ * {@link Auth_OpenID_WebResponse}.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_Encoder {
+
+    var $responseFactory = 'Auth_OpenID_WebResponse';
+
+    /**
+     * Encode an {@link Auth_OpenID_ServerResponse} and return an
+     * {@link Auth_OpenID_WebResponse}.
+     */
+    function encode($response)
+    {
+        $cls = $this->responseFactory;
+
+        $encode_as = $response->whichEncoding();
+        if ($encode_as == Auth_OpenID_ENCODE_KVFORM) {
+            $wr = new $cls(null, null, $response->encodeToKVForm());
+            if (is_a($response, 'Auth_OpenID_ServerError')) {
+                $wr->code = AUTH_OPENID_HTTP_ERROR;
+            }
+        } else if ($encode_as == Auth_OpenID_ENCODE_URL) {
+            $location = $response->encodeToURL();
+            $wr = new $cls(AUTH_OPENID_HTTP_REDIRECT,
+                           array('location' => $location));
+        } else if ($encode_as == Auth_OpenID_ENCODE_HTML_FORM) {
+          $wr = new $cls(AUTH_OPENID_HTTP_OK, array(),
+                         $response->toHTML());
+        } else {
+            return new Auth_OpenID_EncodingError($response);
+        }
+        /* Allow the response to carry a custom error code (ex: for Association errors) */
+        if(isset($response->code)) {
+            $wr->code = $response->code;
+        }
+        return $wr;
+    }
+}
+
+/**
+ * An encoder which also takes care of signing fields when required.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_SigningEncoder extends Auth_OpenID_Encoder {
+
+    function Auth_OpenID_SigningEncoder($signatory)
+    {
+        $this->signatory = $signatory;
+    }
+
+    /**
+     * Sign an {@link Auth_OpenID_ServerResponse} and return an
+     * {@link Auth_OpenID_WebResponse}.
+     */
+    function encode($response)
+    {
+        // the isinstance is a bit of a kludge... it means there isn't
+        // really an adapter to make the interfaces quite match.
+        if (!is_a($response, 'Auth_OpenID_ServerError') &&
+            $response->needsSigning()) {
+
+            if (!$this->signatory) {
+                return new Auth_OpenID_ServerError(null,
+                                       "Must have a store to sign request");
+            }
+
+            if ($response->fields->hasKey(Auth_OpenID_OPENID_NS, 'sig')) {
+                return new Auth_OpenID_AlreadySigned($response);
+            }
+            $response = $this->signatory->sign($response);
+        }
+
+        return parent::encode($response);
+    }
+}
+
+/**
+ * Decode an incoming query into an Auth_OpenID_Request.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_Decoder {
+
+    function Auth_OpenID_Decoder($server)
+    {
+        $this->server = $server;
+
+        $this->handlers = array(
+            'checkid_setup' => 'Auth_OpenID_CheckIDRequest',
+            'checkid_immediate' => 'Auth_OpenID_CheckIDRequest',
+            'check_authentication' => 'Auth_OpenID_CheckAuthRequest',
+            'associate' => 'Auth_OpenID_AssociateRequest'
+            );
+    }
+
+    /**
+     * Given an HTTP query in an array (key-value pairs), decode it
+     * into an Auth_OpenID_Request object.
+     */
+    function decode($query)
+    {
+        if (!$query) {
+            return null;
+        }
+
+        $message = Auth_OpenID_Message::fromPostArgs($query);
+
+        if ($message === null) {
+            /*
+             * It's useful to have a Message attached to a
+             * ProtocolError, so we override the bad ns value to build
+             * a Message out of it.  Kinda kludgy, since it's made of
+             * lies, but the parts that aren't lies are more useful
+             * than a 'None'.
+             */
+            $old_ns = $query['openid.ns'];
+
+            $query['openid.ns'] = Auth_OpenID_OPENID2_NS;
+            $message = Auth_OpenID_Message::fromPostArgs($query);
+            return new Auth_OpenID_ServerError(
+                  $message,
+                  sprintf("Invalid OpenID namespace URI: %s", $old_ns));
+        }
+
+        $mode = $message->getArg(Auth_OpenID_OPENID_NS, 'mode');
+        if (!$mode) {
+            return new Auth_OpenID_ServerError($message,
+                                               "No mode value in message");
+        }
+
+        if (Auth_OpenID::isFailure($mode)) {
+            return new Auth_OpenID_ServerError($message,
+                                               $mode->message);
+        }
+
+        $handlerCls = Auth_OpenID::arrayGet($this->handlers, $mode,
+                                            $this->defaultDecoder($message));
+
+        if (!is_a($handlerCls, 'Auth_OpenID_ServerError')) {
+            return call_user_func_array(array($handlerCls, 'fromMessage'),
+                                        array($message, $this->server));
+        } else {
+            return $handlerCls;
+        }
+    }
+
+    function defaultDecoder($message)
+    {
+        $mode = $message->getArg(Auth_OpenID_OPENID_NS, 'mode');
+
+        if (Auth_OpenID::isFailure($mode)) {
+            return new Auth_OpenID_ServerError($message,
+                                               $mode->message);
+        }
+
+        return new Auth_OpenID_ServerError($message,
+                       sprintf("Unrecognized OpenID mode %s", $mode));
+    }
+}
+
+/**
+ * An error that indicates an encoding problem occurred.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_EncodingError {
+    function Auth_OpenID_EncodingError($response)
+    {
+        $this->response = $response;
+    }
+}
+
+/**
+ * An error that indicates that a response was already signed.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_AlreadySigned extends Auth_OpenID_EncodingError {
+    // This response is already signed.
+}
+
+/**
+ * An error that indicates that the given return_to is not under the
+ * given trust_root.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_UntrustedReturnURL extends Auth_OpenID_ServerError {
+    function Auth_OpenID_UntrustedReturnURL($message, $return_to,
+                                            $trust_root)
+    {
+        parent::Auth_OpenID_ServerError($message, "Untrusted return_to URL");
+        $this->return_to = $return_to;
+        $this->trust_root = $trust_root;
+    }
+
+    function toString()
+    {
+        return sprintf("return_to %s not under trust_root %s",
+                       $this->return_to, $this->trust_root);
+    }
+}
+
+/**
+ * I handle requests for an OpenID server.
+ *
+ * Some types of requests (those which are not checkid requests) may
+ * be handed to my {@link handleRequest} method, and I will take care
+ * of it and return a response.
+ *
+ * For your convenience, I also provide an interface to {@link
+ * Auth_OpenID_Decoder::decode()} and {@link
+ * Auth_OpenID_SigningEncoder::encode()} through my methods {@link
+ * decodeRequest} and {@link encodeResponse}.
+ *
+ * All my state is encapsulated in an {@link Auth_OpenID_OpenIDStore}.
+ *
+ * Example:
+ *
+ * <pre> $oserver = new Auth_OpenID_Server(Auth_OpenID_FileStore($data_path),
+ *                                   "http://example.com/op");
+ * $request = $oserver->decodeRequest();
+ * if (in_array($request->mode, array('checkid_immediate',
+ *                                    'checkid_setup'))) {
+ *     if ($app->isAuthorized($request->identity, $request->trust_root)) {
+ *         $response = $request->answer(true);
+ *     } else if ($request->immediate) {
+ *         $response = $request->answer(false);
+ *     } else {
+ *         $app->showDecidePage($request);
+ *         return;
+ *     }
+ * } else {
+ *     $response = $oserver->handleRequest($request);
+ * }
+ *
+ * $webresponse = $oserver->encode($response);</pre>
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_Server {
+    function Auth_OpenID_Server($store, $op_endpoint=null)
+    {
+        $this->store = $store;
+        $this->signatory = new Auth_OpenID_Signatory($this->store);
+        $this->encoder = new Auth_OpenID_SigningEncoder($this->signatory);
+        $this->decoder = new Auth_OpenID_Decoder($this);
+        $this->op_endpoint = $op_endpoint;
+        $this->negotiator = Auth_OpenID_getDefaultNegotiator();
+    }
+
+    /**
+     * Handle a request.  Given an {@link Auth_OpenID_Request} object,
+     * call the appropriate {@link Auth_OpenID_Server} method to
+     * process the request and generate a response.
+     *
+     * @param Auth_OpenID_Request $request An {@link Auth_OpenID_Request}
+     * returned by {@link Auth_OpenID_Server::decodeRequest()}.
+     *
+     * @return Auth_OpenID_ServerResponse $response A response object
+     * capable of generating a user-agent reply.
+     */
+    function handleRequest($request)
+    {
+        if (method_exists($this, "openid_" . $request->mode)) {
+            $handler = array($this, "openid_" . $request->mode);
+            return call_user_func($handler, &$request);
+        }
+        return null;
+    }
+
+    /**
+     * The callback for 'check_authentication' messages.
+     */
+    function openid_check_authentication($request)
+    {
+        return $request->answer($this->signatory);
+    }
+
+    /**
+     * The callback for 'associate' messages.
+     */
+    function openid_associate($request)
+    {
+        $assoc_type = $request->assoc_type;
+        $session_type = $request->session->session_type;
+        if ($this->negotiator->isAllowed($assoc_type, $session_type)) {
+            $assoc = $this->signatory->createAssociation(false,
+                                                         $assoc_type);
+            return $request->answer($assoc);
+        } else {
+            $message = sprintf('Association type %s is not supported with '.
+                               'session type %s', $assoc_type, $session_type);
+            list($preferred_assoc_type, $preferred_session_type) =
+                $this->negotiator->getAllowedType();
+            return $request->answerUnsupported($message,
+                                               $preferred_assoc_type,
+                                               $preferred_session_type);
+        }
+    }
+
+    /**
+     * Encodes as response in the appropriate format suitable for
+     * sending to the user agent.
+     */
+    function encodeResponse($response)
+    {
+        return $this->encoder->encode($response);
+    }
+
+    /**
+     * Decodes a query args array into the appropriate
+     * {@link Auth_OpenID_Request} object.
+     */
+    function decodeRequest($query=null)
+    {
+        if ($query === null) {
+            $query = Auth_OpenID::getQuery();
+        }
+
+        return $this->decoder->decode($query);
+    }
+}
+
+
+

--- /dev/null
+++ b/lib/openid-php/Auth/OpenID/ServerRequest.php
@@ -1,1 +1,37 @@
+<?php
+/**
+ * OpenID Server Request
+ *
+ * @see Auth_OpenID_Server
+ *
+ * PHP versions 4 and 5
+ *
+ * LICENSE: See the COPYING file included in this distribution.
+ *
+ * @package OpenID
+ * @author JanRain, Inc. <openid@janrain.com>
+ * @copyright 2005-2008 Janrain, Inc.
+ * @license http://www.apache.org/licenses/LICENSE-2.0 Apache
+ */
 
+/**
+ * Imports
+ */
+require_once "Auth/OpenID.php";
+
+/**
+ * Object that holds the state of a request to the OpenID server
+ *
+ * With accessor functions to get at the internal request data.
+ *
+ * @see Auth_OpenID_Server
+ * @package OpenID
+ */
+class Auth_OpenID_ServerRequest {
+    function Auth_OpenID_ServerRequest()
+    {
+        $this->mode = null;
+    }
+}
+
+

--- /dev/null
+++ b/lib/openid-php/Auth/OpenID/TrustRoot.php
@@ -1,1 +1,462 @@
-
+<?php
+/**
+ * Functions for dealing with OpenID trust roots
+ *
+ * PHP versions 4 and 5
+ *
+ * LICENSE: See the COPYING file included in this distribution.
+ *
+ * @package OpenID
+ * @author JanRain, Inc. <openid@janrain.com>
+ * @copyright 2005-2008 Janrain, Inc.
+ * @license http://www.apache.org/licenses/LICENSE-2.0 Apache
+ */
+
+require_once 'Auth/OpenID/Discover.php';
+
+/**
+ * A regular expression that matches a domain ending in a top-level domains.
+ * Used in checking trust roots for sanity.
+ *
+ * @access private
+ */
+define('Auth_OpenID___TLDs',
+       '/\.(ac|ad|ae|aero|af|ag|ai|al|am|an|ao|aq|ar|arpa|as|asia' .
+       '|at|au|aw|ax|az|ba|bb|bd|be|bf|bg|bh|bi|biz|bj|bm|bn|bo|br' .
+       '|bs|bt|bv|bw|by|bz|ca|cat|cc|cd|cf|cg|ch|ci|ck|cl|cm|cn|co' .
+       '|com|coop|cr|cu|cv|cx|cy|cz|de|dj|dk|dm|do|dz|ec|edu|ee|eg' .
+       '|er|es|et|eu|fi|fj|fk|fm|fo|fr|ga|gb|gd|ge|gf|gg|gh|gi|gl' .
+       '|gm|gn|gov|gp|gq|gr|gs|gt|gu|gw|gy|hk|hm|hn|hr|ht|hu|id|ie' .
+       '|il|im|in|info|int|io|iq|ir|is|it|je|jm|jo|jobs|jp|ke|kg|kh' .
+       '|ki|km|kn|kp|kr|kw|ky|kz|la|lb|lc|li|lk|lr|ls|lt|lu|lv|ly' .
+       '|ma|mc|md|me|mg|mh|mil|mk|ml|mm|mn|mo|mobi|mp|mq|mr|ms|mt' .
+       '|mu|museum|mv|mw|mx|my|mz|na|name|nc|ne|net|nf|ng|ni|nl|no' .
+       '|np|nr|nu|nz|om|org|pa|pe|pf|pg|ph|pk|pl|pm|pn|pr|pro|ps|pt' .
+       '|pw|py|qa|re|ro|rs|ru|rw|sa|sb|sc|sd|se|sg|sh|si|sj|sk|sl' .
+       '|sm|sn|so|sr|st|su|sv|sy|sz|tc|td|tel|tf|tg|th|tj|tk|tl|tm' .
+       '|tn|to|tp|tr|travel|tt|tv|tw|tz|ua|ug|uk|us|uy|uz|va|vc|ve' .
+       '|vg|vi|vn|vu|wf|ws|xn--0zwm56d|xn--11b5bs3a9aj6g' .
+       '|xn--80akhbyknj4f|xn--9t4b11yi5a|xn--deba0ad|xn--g6w251d' .
+       '|xn--hgbk6aj7f53bba|xn--hlcj6aya9esc7a|xn--jxalpdlp' .
+       '|xn--kgbechtv|xn--zckzah|ye|yt|yu|za|zm|zw)\.?$/');
+
+define('Auth_OpenID___HostSegmentRe',
+       "/^(?:[-a-zA-Z0-9!$&'\\(\\)\\*+,;=._~]|%[a-zA-Z0-9]{2})*$/");
+
+/**
+ * A wrapper for trust-root related functions
+ */
+class Auth_OpenID_TrustRoot {
+    /*
+     * Return a discovery URL for this realm.
+     *
+     * Return null if the realm could not be parsed or was not valid.
+     *
+     * @param return_to The relying party return URL of the OpenID
+     * authentication request
+     *
+     * @return The URL upon which relying party discovery should be
+     * run in order to verify the return_to URL
+     */
+    static function buildDiscoveryURL($realm)
+    {
+        $parsed = Auth_OpenID_TrustRoot::_parse($realm);
+
+        if ($parsed === false) {
+            return false;
+        }
+
+        if ($parsed['wildcard']) {
+            // Use "www." in place of the star
+            if ($parsed['host'][0] != '.') {
+                return false;
+            }
+
+            $www_domain = 'www' . $parsed['host'];
+
+            return sprintf('%s://%s%s', $parsed['scheme'],
+                           $www_domain, $parsed['path']);
+        } else {
+            return $parsed['unparsed'];
+        }
+    }
+
+    /**
+     * Parse a URL into its trust_root parts.
+     *
+     * @static
+     *
+     * @access private
+     *
+     * @param string $trust_root The url to parse
+     *
+     * @return mixed $parsed Either an associative array of trust root
+     * parts or false if parsing failed.
+     */
+    static function _parse($trust_root)
+    {
+        $trust_root = Auth_OpenID_urinorm($trust_root);
+        if ($trust_root === null) {
+            return false;
+        }
+
+        if (preg_match("/:\/\/[^:]+(:\d+){2,}(\/|$)/", $trust_root)) {
+            return false;
+        }
+
+        $parts = @parse_url($trust_root);
+        if ($parts === false) {
+            return false;
+        }
+
+        $required_parts = array('scheme', 'host');
+        $forbidden_parts = array('user', 'pass', 'fragment');
+        $keys = array_keys($parts);
+        if (array_intersect($keys, $required_parts) != $required_parts) {
+            return false;
+        }
+
+        if (array_intersect($keys, $forbidden_parts) != array()) {
+            return false;
+        }
+
+        if (!preg_match(Auth_OpenID___HostSegmentRe, $parts['host'])) {
+            return false;
+        }
+
+        $scheme = strtolower($parts['scheme']);
+        $allowed_schemes = array('http', 'https');
+        if (!in_array($scheme, $allowed_schemes)) {
+            return false;
+        }
+        $parts['scheme'] = $scheme;
+
+        $host = strtolower($parts['host']);
+        $hostparts = explode('*', $host);
+        switch (count($hostparts)) {
+        case 1:
+            $parts['wildcard'] = false;
+            break;
+        case 2:
+            if ($hostparts[0] ||
+                ($hostparts[1] && substr($hostparts[1], 0, 1) != '.')) {
+                return false;
+            }
+            $host = $hostparts[1];
+            $parts['wildcard'] = true;
+            break;
+        default:
+            return false;
+        }
+        if (strpos($host, ':') !== false) {
+            return false;
+        }
+
+        $parts['host'] = $host;
+
+        if (isset($parts['path'])) {
+            $path = strtolower($parts['path']);
+            if (substr($path, 0, 1) != '/') {
+                return false;
+            }
+        } else {
+            $path = '/';
+        }
+
+        $parts['path'] = $path;
+        if (!isset($parts['port'])) {
+            $parts['port'] = false;
+        }
+
+
+        $parts['unparsed'] = $trust_root;
+
+        return $parts;
+    }
+
+    /**
+     * Is this trust root sane?
+     *
+     * A trust root is sane if it is syntactically valid and it has a
+     * reasonable domain name. Specifically, the domain name must be
+     * more than one level below a standard TLD or more than two
+     * levels below a two-letter tld.
+     *
+     * For example, '*.com' is not a sane trust root, but '*.foo.com'
+     * is.  '*.co.uk' is not sane, but '*.bbc.co.uk' is.
+     *
+     * This check is not always correct, but it attempts to err on the
+     * side of marking sane trust roots insane instead of marking
+     * insane trust roots sane. For example, 'kink.fm' is marked as
+     * insane even though it "should" (for some meaning of should) be
+     * marked sane.
+     *
+     * This function should be used when creating OpenID servers to
+     * alert the users of the server when a consumer attempts to get
+     * the user to accept a suspicious trust root.
+     *
+     * @static
+     * @param string $trust_root The trust root to check
+     * @return bool $sanity Whether the trust root looks OK
+     */
+    static function isSane($trust_root)
+    {
+        $parts = Auth_OpenID_TrustRoot::_parse($trust_root);
+        if ($parts === false) {
+            return false;
+        }
+
+        // Localhost is a special case
+        if ($parts['host'] == 'localhost') {
+            return true;
+        }
+        
+        $host_parts = explode('.', $parts['host']);
+        if ($parts['wildcard']) {
+            // Remove the empty string from the beginning of the array
+            array_shift($host_parts);
+        }
+
+        if ($host_parts && !$host_parts[count($host_parts) - 1]) {
+            array_pop($host_parts);
+        }
+
+        if (!$host_parts) {
+            return false;
+        }
+
+        // Don't allow adjacent dots
+        if (in_array('', $host_parts, true)) {
+            return false;
+        }
+
+        // Get the top-level domain of the host. If it is not a valid TLD,
+        // it's not sane.
+        preg_match(Auth_OpenID___TLDs, $parts['host'], $matches);
+        if (!$matches) {
+            return false;
+        }
+        $tld = $matches[1];
+
+        if (count($host_parts) == 1) {
+            return false;
+        }
+
+        if ($parts['wildcard']) {
+            // It's a 2-letter tld with a short second to last segment
+            // so there needs to be more than two segments specified
+            // (e.g. *.co.uk is insane)
+            $second_level = $host_parts[count($host_parts) - 2];
+            if (strlen($tld) == 2 && strlen($second_level) <= 3) {
+                return count($host_parts) > 2;
+            }
+        }
+
+        return true;
+    }
+
+    /**
+     * Does this URL match the given trust root?
+     *
+     * Return whether the URL falls under the given trust root. This
+     * does not check whether the trust root is sane. If the URL or
+     * trust root do not parse, this function will return false.
+     *
+     * @param string $trust_root The trust root to match against
+     *
+     * @param string $url The URL to check
+     *
+     * @return bool $matches Whether the URL matches against the
+     * trust root
+     */
+    static function match($trust_root, $url)
+    {
+        $trust_root_parsed = Auth_OpenID_TrustRoot::_parse($trust_root);
+        $url_parsed = Auth_OpenID_TrustRoot::_parse($url);
+        if (!$trust_root_parsed || !$url_parsed) {
+            return false;
+        }
+
+        // Check hosts matching
+        if ($url_parsed['wildcard']) {
+            return false;
+        }
+        if ($trust_root_parsed['wildcard']) {
+            $host_tail = $trust_root_parsed['host'];
+            $host = $url_parsed['host'];
+            if ($host_tail &&
+                substr($host, -(strlen($host_tail))) != $host_tail &&
+                substr($host_tail, 1) != $host) {
+                return false;
+            }
+        } else {
+            if ($trust_root_parsed['host'] != $url_parsed['host']) {
+                return false;
+            }
+        }
+
+        // Check path and query matching
+        $base_path = $trust_root_parsed['path'];
+        $path = $url_parsed['path'];
+        if (!isset($trust_root_parsed['query'])) {
+            if ($base_path != $path) {
+                if (substr($path, 0, strlen($base_path)) != $base_path) {
+                    return false;
+                }
+                if (substr($base_path, strlen($base_path) - 1, 1) != '/' &&
+                    substr($path, strlen($base_path), 1) != '/') {
+                    return false;
+                }
+            }
+        } else {
+            $base_query = $trust_root_parsed['query'];
+            $query = @$url_parsed['query'];
+            $qplus = substr($query, 0, strlen($base_query) + 1);
+            $bqplus = $base_query . '&';
+            if ($base_path != $path ||
+                ($base_query != $query && $qplus != $bqplus)) {
+                return false;
+            }
+        }
+
+        // The port and scheme need to match exactly
+        return ($trust_root_parsed['scheme'] == $url_parsed['scheme'] &&
+                $url_parsed['port'] === $trust_root_parsed['port']);
+    }
+}
+
+/*
+ * If the endpoint is a relying party OpenID return_to endpoint,
+ * return the endpoint URL. Otherwise, return None.
+ *
+ * This function is intended to be used as a filter for the Yadis
+ * filtering interface.
+ *
+ * @see: C{L{openid.yadis.services}}
+ * @see: C{L{openid.yadis.filters}}
+ *
+ * @param endpoint: An XRDS BasicServiceEndpoint, as returned by
+ * performing Yadis dicovery.
+ *
+ * @returns: The endpoint URL or None if the endpoint is not a
+ * relying party endpoint.
+ */
+function filter_extractReturnURL($endpoint)
+{
+    if ($endpoint->matchTypes(array(Auth_OpenID_RP_RETURN_TO_URL_TYPE))) {
+        return $endpoint;
+    } else {
+        return null;
+    }
+}
+
+function &Auth_OpenID_extractReturnURL(&$endpoint_list)
+{
+    $result = array();
+
+    foreach ($endpoint_list as $endpoint) {
+        if (filter_extractReturnURL($endpoint)) {
+            $result[] = $endpoint;
+        }
+    }
+
+    return $result;
+}
+
+/*
+ * Is the return_to URL under one of the supplied allowed return_to
+ * URLs?
+ */
+function Auth_OpenID_returnToMatches($allowed_return_to_urls, $return_to)
+{
+    foreach ($allowed_return_to_urls as $allowed_return_to) {
+        // A return_to pattern works the same as a realm, except that
+        // it's not allowed to use a wildcard. We'll model this by
+        // parsing it as a realm, and not trying to match it if it has
+        // a wildcard.
+
+        $return_realm = Auth_OpenID_TrustRoot::_parse($allowed_return_to);
+        if (// Parses as a trust root
+            ($return_realm !== false) &&
+            // Does not have a wildcard
+            (!$return_realm['wildcard']) &&
+            // Matches the return_to that we passed in with it
+            (Auth_OpenID_TrustRoot::match($allowed_return_to, $return_to))) {
+            return true;
+        }
+    }
+
+    // No URL in the list matched
+    return false;
+}
+
+/*
+ * Given a relying party discovery URL return a list of return_to
+ * URLs.
+ */
+function Auth_OpenID_getAllowedReturnURLs($relying_party_url, $fetcher,
+              $discover_function=null)
+{
+    if ($discover_function === null) {
+        $discover_function = array('Auth_Yadis_Yadis', 'discover');
+    }
+
+    $xrds_parse_cb = array('Auth_OpenID_ServiceEndpoint', 'consumerFromXRDS');
+
+    list($rp_url_after_redirects, $endpoints) =
+        Auth_Yadis_getServiceEndpoints($relying_party_url, $xrds_parse_cb,
+                                       $discover_function, $fetcher);
+
+    if ($rp_url_after_redirects != $relying_party_url) {
+        // Verification caused a redirect
+        return false;
+    }
+
+    call_user_func_array($discover_function,
+                         array($relying_party_url, &$fetcher));
+
+    $return_to_urls = array();
+    $matching_endpoints = Auth_OpenID_extractReturnURL($endpoints);
+
+    foreach ($matching_endpoints as $e) {
+        $return_to_urls[] = $e->server_url;
+    }
+
+    return $return_to_urls;
+}
+
+/*
+ * Verify that a return_to URL is valid for the given realm.
+ *
+ * This function builds a discovery URL, performs Yadis discovery on
+ * it, makes sure that the URL does not redirect, parses out the
+ * return_to URLs, and finally checks to see if the current return_to
+ * URL matches the return_to.
+ *
+ * @return true if the return_to URL is valid for the realm
+ */
+function Auth_OpenID_verifyReturnTo($realm_str, $return_to, $fetcher,
+              $_vrfy='Auth_OpenID_getAllowedReturnURLs')
+{
+    $disco_url = Auth_OpenID_TrustRoot::buildDiscoveryURL($realm_str);
+
+    if ($disco_url === false) {
+        return false;
+    }
+
+    $allowable_urls = call_user_func_array($_vrfy,
+                           array($disco_url, $fetcher));
+
+    // The realm_str could not be parsed.
+    if ($allowable_urls === false) {
+        return false;
+    }
+
+    if (Auth_OpenID_returnToMatches($allowable_urls, $return_to)) {
+        return true;
+    } else {
+        return false;
+    }
+}
+
+

--- /dev/null
+++ b/lib/openid-php/Auth/OpenID/URINorm.php
@@ -1,1 +1,250 @@
-
+<?php
+
+/**
+ * URI normalization routines.
+ *
+ * @package OpenID
+ * @author JanRain, Inc. <openid@janrain.com>
+ * @copyright 2005-2008 Janrain, Inc.
+ * @license http://www.apache.org/licenses/LICENSE-2.0 Apache
+ */
+
+require_once 'Auth/Yadis/Misc.php';
+
+// from appendix B of rfc 3986 (http://www.ietf.org/rfc/rfc3986.txt)
+function Auth_OpenID_getURIPattern()
+{
+    return '&^(([^:/?#]+):)?(//([^/?#]*))?([^?#]*)(\?([^#]*))?(#(.*))?&';
+}
+
+function Auth_OpenID_getAuthorityPattern()
+{
+    return '/^([^@]*@)?([^:]*)(:.*)?/';
+}
+
+function Auth_OpenID_getEncodedPattern()
+{
+    return '/%([0-9A-Fa-f]{2})/';
+}
+
+# gen-delims  = ":" / "/" / "?" / "#" / "[" / "]" / "@"
+#
+# sub-delims  = "!" / "$" / "&" / "'" / "(" / ")"
+#                  / "*" / "+" / "," / ";" / "="
+#
+# unreserved  = ALPHA / DIGIT / "-" / "." / "_" / "~"
+function Auth_OpenID_getURLIllegalCharRE()
+{
+    return "/([^-A-Za-z0-9:\/\?#\[\]@\!\$&'\(\)\*\+,;=\._~\%])/";
+}
+
+function Auth_OpenID_getUnreserved()
+{
+    $_unreserved = array();
+    for ($i = 0; $i < 256; $i++) {
+        $_unreserved[$i] = false;
+    }
+
+    for ($i = ord('A'); $i <= ord('Z'); $i++) {
+        $_unreserved[$i] = true;
+    }
+
+    for ($i = ord('0'); $i <= ord('9'); $i++) {
+        $_unreserved[$i] = true;
+    }
+
+    for ($i = ord('a'); $i <= ord('z'); $i++) {
+        $_unreserved[$i] = true;
+    }
+
+    $_unreserved[ord('-')] = true;
+    $_unreserved[ord('.')] = true;
+    $_unreserved[ord('_')] = true;
+    $_unreserved[ord('~')] = true;
+
+    return $_unreserved;
+}
+
+function Auth_OpenID_getEscapeRE()
+{
+    $parts = array();
+    foreach (array_merge(Auth_Yadis_getUCSChars(),
+                         Auth_Yadis_getIPrivateChars()) as $pair) {
+        list($m, $n) = $pair;
+        $parts[] = sprintf("%s-%s", chr($m), chr($n));
+    }
+
+    return sprintf('[%s]', implode('', $parts));
+}
+
+function Auth_OpenID_pct_encoded_replace_unreserved($mo)
+{
+    $_unreserved = Auth_OpenID_getUnreserved();
+
+    $i = intval($mo[1], 16);
+    if ($_unreserved[$i]) {
+        return chr($i);
+    } else {
+        return strtoupper($mo[0]);
+    }
+
+    return $mo[0];
+}
+
+function Auth_OpenID_pct_encoded_replace($mo)
+{
+    return chr(intval($mo[1], 16));
+}
+
+function Auth_OpenID_remove_dot_segments($path)
+{
+    $result_segments = array();
+
+    while ($path) {
+        if (Auth_Yadis_startswith($path, '../')) {
+            $path = substr($path, 3);
+        } else if (Auth_Yadis_startswith($path, './')) {
+            $path = substr($path, 2);
+        } else if (Auth_Yadis_startswith($path, '/./')) {
+            $path = substr($path, 2);
+        } else if ($path == '/.') {
+            $path = '/';
+        } else if (Auth_Yadis_startswith($path, '/../')) {
+            $path = substr($path, 3);
+            if ($result_segments) {
+                array_pop($result_segments);
+            }
+        } else if ($path == '/..') {
+            $path = '/';
+            if ($result_segments) {
+                array_pop($result_segments);
+            }
+        } else if (($path == '..') ||
+                   ($path == '.')) {
+            $path = '';
+        } else {
+            $i = 0;
+            if ($path[0] == '/') {
+                $i = 1;
+            }
+            $i = strpos($path, '/', $i);
+            if ($i === false) {
+                $i = strlen($path);
+            }
+            $result_segments[] = substr($path, 0, $i);
+            $path = substr($path, $i);
+        }
+    }
+
+    return implode('', $result_segments);
+}
+
+function Auth_OpenID_urinorm($uri)
+{
+    $uri_matches = array();
+    preg_match(Auth_OpenID_getURIPattern(), $uri, $uri_matches);
+
+    if (count($uri_matches) < 9) {
+        for ($i = count($uri_matches); $i <= 9; $i++) {
+            $uri_matches[] = '';
+        }
+    }
+
+    $illegal_matches = array();
+    preg_match(Auth_OpenID_getURLIllegalCharRE(),
+               $uri, $illegal_matches);
+    if ($illegal_matches) {
+        return null;
+    }
+
+    $scheme = $uri_matches[2];
+    if ($scheme) {
+        $scheme = strtolower($scheme);
+    }
+
+    $scheme = $uri_matches[2];
+    if ($scheme === '') {
+        // No scheme specified
+        return null;
+    }
+
+    $scheme = strtolower($scheme);
+    if (!in_array($scheme, array('http', 'https'))) {
+        // Not an absolute HTTP or HTTPS URI
+        return null;
+    }
+
+    $authority = $uri_matches[4];
+    if ($authority === '') {
+        // Not an absolute URI
+        return null;
+    }
+
+    $authority_matches = array();
+    preg_match(Auth_OpenID_getAuthorityPattern(),
+               $authority, $authority_matches);
+    if (count($authority_matches) === 0) {
+        // URI does not have a valid authority
+        return null;
+    }
+
+    if (count($authority_matches) < 4) {
+        for ($i = count($authority_matches); $i <= 4; $i++) {
+            $authority_matches[] = '';
+        }
+    }
+
+    list($_whole, $userinfo, $host, $port) = $authority_matches;
+
+    if ($userinfo === null) {
+        $userinfo = '';
+    }
+
+    if (strpos($host, '%') !== -1) {
+        $host = strtolower($host);
+        $host = preg_replace_callback(
+                  Auth_OpenID_getEncodedPattern(),
+                  'Auth_OpenID_pct_encoded_replace', $host);
+        // NO IDNA.
+        // $host = unicode($host, 'utf-8').encode('idna');
+    } else {
+        $host = strtolower($host);
+    }
+
+    if ($port) {
+        if (($port == ':') ||
+            ($scheme == 'http' && $port == ':80') ||
+            ($scheme == 'https' && $port == ':443')) {
+            $port = '';
+        }
+    } else {
+        $port = '';
+    }
+
+    $authority = $userinfo . $host . $port;
+
+    $path = $uri_matches[5];
+    $path = preg_replace_callback(
+               Auth_OpenID_getEncodedPattern(),
+               'Auth_OpenID_pct_encoded_replace_unreserved', $path);
+
+    $path = Auth_OpenID_remove_dot_segments($path);
+    if (!$path) {
+        $path = '/';
+    }
+
+    $query = $uri_matches[6];
+    if ($query === null) {
+        $query = '';
+    }
+
+    $fragment = $uri_matches[8];
+    if ($fragment === null) {
+        $fragment = '';
+    }
+
+    return $scheme . '://' . $authority . $path . $query . $fragment;
+}
+
+
+

--- /dev/null
+++ b/lib/openid-php/Auth/Yadis/HTTPFetcher.php
@@ -1,1 +1,175 @@
+<?php
 
+/**
+ * This module contains the HTTP fetcher interface
+ *
+ * PHP versions 4 and 5
+ *
+ * LICENSE: See the COPYING file included in this distribution.
+ *
+ * @package OpenID
+ * @author JanRain, Inc. <openid@janrain.com>
+ * @copyright 2005-2008 Janrain, Inc.
+ * @license http://www.apache.org/licenses/LICENSE-2.0 Apache
+ */
+
+/**
+ * Require logging functionality
+ */
+require_once "Auth/OpenID.php";
+
+define('Auth_OpenID_FETCHER_MAX_RESPONSE_KB', 1024);
+define('Auth_OpenID_USER_AGENT', 
+       'php-openid/'.Auth_OpenID_VERSION.' (php/'.phpversion().')');
+
+class Auth_Yadis_HTTPResponse {
+    function Auth_Yadis_HTTPResponse($final_url = null, $status = null,
+                                         $headers = null, $body = null)
+    {
+        $this->final_url = $final_url;
+        $this->status = $status;
+        $this->headers = $headers;
+        $this->body = $body;
+    }
+}
+
+/**
+ * This class is the interface for HTTP fetchers the Yadis library
+ * uses.  This interface is only important if you need to write a new
+ * fetcher for some reason.
+ *
+ * @access private
+ * @package OpenID
+ */
+class Auth_Yadis_HTTPFetcher {
+
+    var $timeout = 20; // timeout in seconds.
+
+    /**
+     * Return whether a URL can be fetched.  Returns false if the URL
+     * scheme is not allowed or is not supported by this fetcher
+     * implementation; returns true otherwise.
+     *
+     * @return bool
+     */
+    function canFetchURL($url)
+    {
+        if ($this->isHTTPS($url) && !$this->supportsSSL()) {
+            Auth_OpenID::log("HTTPS URL unsupported fetching %s",
+                             $url);
+            return false;
+        }
+
+        if (!$this->allowedURL($url)) {
+            Auth_OpenID::log("URL fetching not allowed for '%s'",
+                             $url);
+            return false;
+        }
+
+        return true;
+    }
+
+    /**
+     * Return whether a URL should be allowed. Override this method to
+     * conform to your local policy.
+     *
+     * By default, will attempt to fetch any http or https URL.
+     */
+    function allowedURL($url)
+    {
+        return $this->URLHasAllowedScheme($url);
+    }
+
+    /**
+     * Does this fetcher implementation (and runtime) support fetching
+     * HTTPS URLs?  May inspect the runtime environment.
+     *
+     * @return bool $support True if this fetcher supports HTTPS
+     * fetching; false if not.
+     */
+    function supportsSSL()
+    {
+        trigger_error("not implemented", E_USER_ERROR);
+    }
+
+    /**
+     * Is this an https URL?
+     *
+     * @access private
+     */
+    function isHTTPS($url)
+    {
+        return (bool)preg_match('/^https:\/\//i', $url);
+    }
+
+    /**
+     * Is this an http or https URL?
+     *
+     * @access private
+     */
+    function URLHasAllowedScheme($url)
+    {
+        return (bool)preg_match('/^https?:\/\//i', $url);
+    }
+
+    /**
+     * @access private
+     */
+    function _findRedirect($headers, $url)
+    {
+        foreach ($headers as $line) {
+            if (strpos(strtolower($line), "location: ") === 0) {
+                $parts = explode(" ", $line, 2);
+                $loc = $parts[1];
+                $ppos = strpos($loc, "://");
+                if ($ppos === false || $ppos > strpos($loc, "/")) {
+                  /* no host; add it */
+                  $hpos = strpos($url, "://");
+                  $prt = substr($url, 0, $hpos+3);
+                  $url = substr($url, $hpos+3);
+                  if (substr($loc, 0, 1) == "/") {
+                    /* absolute path */
+                    $fspos = strpos($url, "/");
+                    if ($fspos) $loc = $prt.substr($url, 0, $fspos).$loc;
+                    else $loc = $prt.$url.$loc;
+                  } else {
+                    /* relative path */
+                    $pp = $prt;
+                    while (1) {
+                      $xpos = strpos($url, "/");
+                      if ($xpos === false) break;
+                      $apos = strpos($url, "?");
+                      if ($apos !== false && $apos < $xpos) break;
+                      $apos = strpos($url, "&");
+                      if ($apos !== false && $apos < $xpos) break;
+                      $pp .= substr($url, 0, $xpos+1);
+                      $url = substr($url, $xpos+1);
+                    }
+                    $loc = $pp.$loc;
+                  }
+                }
+                return $loc;
+            }
+        }
+        return null;
+    }
+
+    /**
+     * Fetches the specified URL using optional extra headers and
+     * returns the server's response.
+     *
+     * @param string $url The URL to be fetched.
+     * @param array $extra_headers An array of header strings
+     * (e.g. "Accept: text/html").
+     * @return mixed $result An array of ($code, $url, $headers,
+     * $body) if the URL could be fetched; null if the URL does not
+     * pass the URLHasAllowedScheme check or if the server's response
+     * is malformed.
+     */
+    function get($url, $headers = null)
+    {
+        trigger_error("not implemented", E_USER_ERROR);
+    }
+}
+
+

--- /dev/null
+++ b/lib/openid-php/Auth/Yadis/Manager.php
@@ -1,1 +1,522 @@
-
+<?php
+
+/**
+ * Yadis service manager to be used during yadis-driven authentication
+ * attempts.
+ *
+ * @package OpenID
+ */
+
+/**
+ * The base session class used by the Auth_Yadis_Manager.  This
+ * class wraps the default PHP session machinery and should be
+ * subclassed if your application doesn't use PHP sessioning.
+ *
+ * @package OpenID
+ */
+class Auth_Yadis_PHPSession {
+    /**
+     * Set a session key/value pair.
+     *
+     * @param string $name The name of the session key to add.
+     * @param string $value The value to add to the session.
+     */
+    function set($name, $value)
+    {
+        $_SESSION[$name] = $value;
+    }
+
+    /**
+     * Get a key's value from the session.
+     *
+     * @param string $name The name of the key to retrieve.
+     * @param string $default The optional value to return if the key
+     * is not found in the session.
+     * @return string $result The key's value in the session or
+     * $default if it isn't found.
+     */
+    function get($name, $default=null)
+    {
+        if (array_key_exists($name, $_SESSION)) {
+            return $_SESSION[$name];
+        } else {
+            return $default;
+        }
+    }
+
+    /**
+     * Remove a key/value pair from the session.
+     *
+     * @param string $name The name of the key to remove.
+     */
+    function del($name)
+    {
+        unset($_SESSION[$name]);
+    }
+
+    /**
+     * Return the contents of the session in array form.
+     */
+    function contents()
+    {
+        return $_SESSION;
+    }
+}
+
+/**
+ * A session helper class designed to translate between arrays and
+ * objects.  Note that the class used must have a constructor that
+ * takes no parameters.  This is not a general solution, but it works
+ * for dumb objects that just need to have attributes set.  The idea
+ * is that you'll subclass this and override $this->check($data) ->
+ * bool to implement your own session data validation.
+ *
+ * @package OpenID
+ */
+class Auth_Yadis_SessionLoader {
+    /**
+     * Override this.
+     *
+     * @access private
+     */
+    function check($data)
+    {
+        return true;
+    }
+
+    /**
+     * Given a session data value (an array), this creates an object
+     * (returned by $this->newObject()) whose attributes and values
+     * are those in $data.  Returns null if $data lacks keys found in
+     * $this->requiredKeys().  Returns null if $this->check($data)
+     * evaluates to false.  Returns null if $this->newObject()
+     * evaluates to false.
+     *
+     * @access private
+     */
+    function fromSession($data)
+    {
+        if (!$data) {
+            return null;
+        }
+
+        $required = $this->requiredKeys();
+
+        foreach ($required as $k) {
+            if (!array_key_exists($k, $data)) {
+                return null;
+            }
+        }
+
+        if (!$this->check($data)) {
+            return null;
+        }
+
+        $data = array_merge($data, $this->prepareForLoad($data));
+        $obj = $this->newObject($data);
+
+        if (!$obj) {
+            return null;
+        }
+
+        foreach ($required as $k) {
+            $obj->$k = $data[$k];
+        }
+
+        return $obj;
+    }
+
+    /**
+     * Prepares the data array by making any necessary changes.
+     * Returns an array whose keys and values will be used to update
+     * the original data array before calling $this->newObject($data).
+     *
+     * @access private
+     */
+    function prepareForLoad($data)
+    {
+        return array();
+    }
+
+    /**
+     * Returns a new instance of this loader's class, using the
+     * session data to construct it if necessary.  The object need
+     * only be created; $this->fromSession() will take care of setting
+     * the object's attributes.
+     *
+     * @access private
+     */
+    function newObject($data)
+    {
+        return null;
+    }
+
+    /**
+     * Returns an array of keys and values built from the attributes
+     * of $obj.  If $this->prepareForSave($obj) returns an array, its keys
+     * and values are used to update the $data array of attributes
+     * from $obj.
+     *
+     * @access private
+     */
+    function toSession($obj)
+    {
+        $data = array();
+        foreach ($obj as $k => $v) {
+            $data[$k] = $v;
+        }
+
+        $extra = $this->prepareForSave($obj);
+
+        if ($extra && is_array($extra)) {
+            foreach ($extra as $k => $v) {
+                $data[$k] = $v;
+            }
+        }
+
+        return $data;
+    }
+
+    /**
+     * Override this.
+     *
+     * @access private
+     */
+    function prepareForSave($obj)
+    {
+        return array();
+    }
+}
+
+/**
+ * A concrete loader implementation for Auth_OpenID_ServiceEndpoints.
+ *
+ * @package OpenID
+ */
+class Auth_OpenID_ServiceEndpointLoader extends Auth_Yadis_SessionLoader {
+    function newObject($data)
+    {
+        return new Auth_OpenID_ServiceEndpoint();
+    }
+
+    function requiredKeys()
+    {
+        $obj = new Auth_OpenID_ServiceEndpoint();
+        $data = array();
+        foreach ($obj as $k => $v) {
+            $data[] = $k;
+        }
+        return $data;
+    }
+
+    function check($data)
+    {
+        return is_array($data['type_uris']);
+    }
+}
+
+/**
+ * A concrete loader implementation for Auth_Yadis_Managers.
+ *
+ * @package OpenID
+ */
+class Auth_Yadis_ManagerLoader extends Auth_Yadis_SessionLoader {
+    function requiredKeys()
+    {
+        return array('starting_url',
+                     'yadis_url',
+                     'services',
+                     'session_key',
+                     '_current',
+                     'stale');
+    }
+
+    function newObject($data)
+    {
+        return new Auth_Yadis_Manager($data['starting_url'],
+                                          $data['yadis_url'],
+                                          $data['services'],
+                                          $data['session_key']);
+    }
+
+    function check($data)
+    {
+        return is_array($data['services']);
+    }
+
+    function prepareForLoad($data)
+    {
+        $loader = new Auth_OpenID_ServiceEndpointLoader();
+        $services = array();
+        foreach ($data['services'] as $s) {
+            $services[] = $loader->fromSession($s);
+        }
+        return array('services' => $services);
+    }
+
+    function prepareForSave($obj)
+    {
+        $loader = new Auth_OpenID_ServiceEndpointLoader();
+        $services = array();
+        foreach ($obj->services as $s) {
+            $services[] = $loader->toSession($s);
+        }
+        return array('services' => $services);
+    }
+}
+
+/**
+ * The Yadis service manager which stores state in a session and
+ * iterates over <Service> elements in a Yadis XRDS document and lets
+ * a caller attempt to use each one.  This is used by the Yadis
+ * library internally.
+ *
+ * @package OpenID
+ */
+class Auth_Yadis_Manager {
+
+    /**
+     * Intialize a new yadis service manager.
+     *
+     * @access private
+     */
+    function Auth_Yadis_Manager($starting_url, $yadis_url,
+                                    $services, $session_key)
+    {
+        // The URL that was used to initiate the Yadis protocol
+        $this->starting_url = $starting_url;
+
+        // The URL after following redirects (the identifier)
+        $this->yadis_url = $yadis_url;
+
+        // List of service elements
+        $this->services = $services;
+
+        $this->session_key = $session_key;
+
+        // Reference to the current service object
+        $this->_current = null;
+
+        // Stale flag for cleanup if PHP lib has trouble.
+        $this->stale = false;
+    }
+
+    /**
+     * @access private
+     */
+    function length()
+    {
+        // How many untried services remain?
+        return count($this->services);
+    }
+
+    /**
+     * Return the next service
+     *
+     * $this->current() will continue to return that service until the
+     * next call to this method.
+     */
+    function nextService()
+    {
+
+        if ($this->services) {
+            $this->_current = array_shift($this->services);
+        } else {
+            $this->_current = null;
+        }
+
+        return $this->_current;
+    }
+
+    /**
+     * @access private
+     */
+    function current()
+    {
+        // Return the current service.
+        // Returns None if there are no services left.
+        return $this->_current;
+    }
+
+    /**
+     * @access private
+     */
+    function forURL($url)
+    {
+        return in_array($url, array($this->starting_url, $this->yadis_url));
+    }
+
+    /**
+     * @access private
+     */
+    function started()
+    {
+        // Has the first service been returned?
+        return $this->_current !== null;
+    }
+}
+
+/**
+ * State management for discovery.
+ *
+ * High-level usage pattern is to call .getNextService(discover) in
+ * order to find the next available service for this user for this
+ * session. Once a request completes, call .cleanup() to clean up the
+ * session state.
+ *
+ * @package OpenID
+ */
+class Auth_Yadis_Discovery {
+
+    /**
+     * @access private
+     */
+    var $DEFAULT_SUFFIX = 'auth';
+
+    /**
+     * @access private
+     */
+    var $PREFIX = '_yadis_services_';
+
+    /**
+     * Initialize a discovery object.
+     *
+     * @param Auth_Yadis_PHPSession $session An object which
+     * implements the Auth_Yadis_PHPSession API.
+     * @param string $url The URL on which to attempt discovery.
+     * @param string $session_key_suffix The optional session key
+     * suffix override.
+     */
+    function Auth_Yadis_Discovery($session, $url,
+                                      $session_key_suffix = null)
+    {
+        /// Initialize a discovery object
+        $this->session = $session;
+        $this->url = $url;
+        if ($session_key_suffix === null) {
+            $session_key_suffix = $this->DEFAULT_SUFFIX;
+        }
+
+        $this->session_key_suffix = $session_key_suffix;
+        $this->session_key = $this->PREFIX . $this->session_key_suffix;
+    }
+
+    /**
+     * Return the next authentication service for the pair of
+     * user_input and session. This function handles fallback.
+     */
+    function getNextService($discover_cb, $fetcher)
+    {
+        $manager = $this->getManager();
+        if (!$manager || (!$manager->services)) {
+            $this->destroyManager();
+
+            list($yadis_url, $services) = call_user_func($discover_cb,
+                                                         $this->url,
+                                                         &$fetcher);
+
+            $manager = $this->createManager($services, $yadis_url);
+        }
+
+        if ($manager) {
+            $loader = new Auth_Yadis_ManagerLoader();
+            $service = $manager->nextService();
+            $this->session->set($this->session_key,
+                                serialize($loader->toSession($manager)));
+        } else {
+            $service = null;
+        }
+
+        return $service;
+    }
+
+    /**
+     * Clean up Yadis-related services in the session and return the
+     * most-recently-attempted service from the manager, if one
+     * exists.
+     *
+     * @param $force True if the manager should be deleted regardless
+     * of whether it's a manager for $this->url.
+     */
+    function cleanup($force=false)
+    {
+        $manager = $this->getManager($force);
+        if ($manager) {
+            $service = $manager->current();
+            $this->destroyManager($force);
+        } else {
+            $service = null;
+        }
+
+        return $service;
+    }
+
+    /**
+     * @access private
+     */
+    function getSessionKey()
+    {
+        // Get the session key for this starting URL and suffix
+        return $this->PREFIX . $this->session_key_suffix;
+    }
+
+    /**
+     * @access private
+     *
+     * @param $force True if the manager should be returned regardless
+     * of whether it's a manager for $this->url.
+     */
+    function getManager($force=false)
+    {
+        // Extract the YadisServiceManager for this object's URL and
+        // suffix from the session.
+
+        $manager_str = $this->session->get($this->getSessionKey());
+        $manager = null;
+
+        if ($manager_str !== null) {
+            $loader = new Auth_Yadis_ManagerLoader();
+            $manager = $loader->fromSession(unserialize($manager_str));
+        }
+
+        if ($manager && ($manager->forURL($this->url) || $force)) {
+            return $manager;
+        }
+    }
+
+    /**
+     * @access private
+     */
+    function createManager($services, $yadis_url = null)
+    {
+        $key = $this->getSessionKey();
+        if ($this->getManager()) {
+            return $this->getManager();
+        }
+
+        if ($services) {
+            $loader = new Auth_Yadis_ManagerLoader();
+            $manager = new Auth_Yadis_Manager($this->url, $yadis_url,
+                                              $services, $key);
+            $this->session->set($this->session_key,
+                                serialize($loader->toSession($manager)));
+            return $manager;
+        }
+    }
+
+    /**
+     * @access private
+     *
+     * @param $force True if the manager should be deleted regardless
+     * of whether it's a manager for $this->url.
+     */
+    function destroyManager($force=false)
+    {
+        if ($this->getManager($force) !== null) {
+            $key = $this->getSessionKey();
+            $this->session->del($key);
+        }
+    }
+}
+
+

--- /dev/null
+++ b/lib/openid-php/Auth/Yadis/Misc.php
@@ -1,1 +1,59 @@
+<?php
 
+/**
+ * Miscellaneous utility values and functions for OpenID and Yadis.
+ *
+ * @package OpenID
+ * @author JanRain, Inc. <openid@janrain.com>
+ * @copyright 2005-2008 Janrain, Inc.
+ * @license http://www.apache.org/licenses/LICENSE-2.0 Apache
+ */
+
+function Auth_Yadis_getUCSChars()
+{
+    return array(
+                 array(0xA0, 0xD7FF),
+                 array(0xF900, 0xFDCF),
+                 array(0xFDF0, 0xFFEF),
+                 array(0x10000, 0x1FFFD),
+                 array(0x20000, 0x2FFFD),
+                 array(0x30000, 0x3FFFD),
+                 array(0x40000, 0x4FFFD),
+                 array(0x50000, 0x5FFFD),
+                 array(0x60000, 0x6FFFD),
+                 array(0x70000, 0x7FFFD),
+                 array(0x80000, 0x8FFFD),
+                 array(0x90000, 0x9FFFD),
+                 array(0xA0000, 0xAFFFD),
+                 array(0xB0000, 0xBFFFD),
+                 array(0xC0000, 0xCFFFD),
+                 array(0xD0000, 0xDFFFD),
+                 array(0xE1000, 0xEFFFD)
+                 );
+}
+
+function Auth_Yadis_getIPrivateChars()
+{
+    return array(
+                 array(0xE000, 0xF8FF),
+                 array(0xF0000, 0xFFFFD),
+                 array(0x100000, 0x10FFFD)
+                 );
+}
+
+function Auth_Yadis_pct_escape_unicode($char_match)
+{
+    $c = $char_match[0];
+    $result = "";
+    for ($i = 0; $i < strlen($c); $i++) {
+        $result .= "%".sprintf("%X", ord($c[$i]));
+    }
+    return $result;
+}
+
+function Auth_Yadis_startswith($s, $stuff)
+{
+    return strpos($s, $stuff) === 0;
+}
+
+

--- /dev/null
+++ b/lib/openid-php/Auth/Yadis/ParanoidHTTPFetcher.php
@@ -1,1 +1,246 @@
-
+<?php
+
+/**
+ * This module contains the CURL-based HTTP fetcher implementation.
+ *
+ * PHP versions 4 and 5
+ *
+ * LICENSE: See the COPYING file included in this distribution.
+ *
+ * @package OpenID
+ * @author JanRain, Inc. <openid@janrain.com>
+ * @copyright 2005-2008 Janrain, Inc.
+ * @license http://www.apache.org/licenses/LICENSE-2.0 Apache
+ */
+
+/**
+ * Interface import
+ */
+require_once "Auth/Yadis/HTTPFetcher.php";
+
+require_once "Auth/OpenID.php";
+
+/**
+ * A paranoid {@link Auth_Yadis_HTTPFetcher} class which uses CURL
+ * for fetching.
+ *
+ * @package OpenID
+ */
+class Auth_Yadis_ParanoidHTTPFetcher extends Auth_Yadis_HTTPFetcher {
+    function Auth_Yadis_ParanoidHTTPFetcher()
+    {
+        $this->reset();
+    }
+
+    function reset()
+    {
+        $this->headers = array();
+        $this->data = "";
+    }
+
+    /**
+     * @access private
+     */
+    function _writeHeader($ch, $header)
+    {
+        array_push($this->headers, rtrim($header));
+        return strlen($header);
+    }
+
+    /**
+     * @access private
+     */
+    function _writeData($ch, $data)
+    {
+        if (strlen($this->data) > 1024*Auth_OpenID_FETCHER_MAX_RESPONSE_KB) {
+            return 0;
+        } else {
+            $this->data .= $data;
+            return strlen($data);
+        }
+    }
+
+    /**
+     * Does this fetcher support SSL URLs?
+     */
+    function supportsSSL()
+    {
+        $v = curl_version();
+        if(is_array($v)) {
+            return in_array('https', $v['protocols']);
+        } elseif (is_string($v)) {
+            return preg_match('/OpenSSL/i', $v);
+        } else {
+            return 0;
+        }
+    }
+
+    function get($url, $extra_headers = null)
+    {
+        if (!$this->canFetchURL($url)) {
+            return null;
+        }
+
+        $stop = time() + $this->timeout;
+        $off = $this->timeout;
+
+        $redir = true;
+
+        while ($redir && ($off > 0)) {
+            $this->reset();
+
+            $c = curl_init();
+
+            if ($c === false) {
+                Auth_OpenID::log(
+                    "curl_init returned false; could not " .
+                    "initialize for URL '%s'", $url);
+                return null;
+            }
+
+            if (defined('CURLOPT_NOSIGNAL')) {
+                curl_setopt($c, CURLOPT_NOSIGNAL, true);
+            }
+
+            if (!$this->allowedURL($url)) {
+                Auth_OpenID::log("Fetching URL not allowed: %s",
+                                 $url);
+                return null;
+            }
+
+            curl_setopt($c, CURLOPT_WRITEFUNCTION,
+                        array($this, "_writeData"));
+            curl_setopt($c, CURLOPT_HEADERFUNCTION,
+                        array($this, "_writeHeader"));
+
+            if ($extra_headers) {
+                curl_setopt($c, CURLOPT_HTTPHEADER, $extra_headers);
+            }
+
+            $cv = curl_version();
+            if(is_array($cv)) {
+              $curl_user_agent = 'curl/'.$cv['version'];
+            } else {
+              $curl_user_agent = $cv;
+            }
+            curl_setopt($c, CURLOPT_USERAGENT,
+                        Auth_OpenID_USER_AGENT.' '.$curl_user_agent);
+            curl_setopt($c, CURLOPT_TIMEOUT, $off);
+            curl_setopt($c, CURLOPT_URL, $url);
+
+            if (defined('Auth_OpenID_VERIFY_HOST')) {
+                curl_setopt($c, CURLOPT_SSL_VERIFYPEER, true);
+                curl_setopt($c, CURLOPT_SSL_VERIFYHOST, 2);
+            }
+            curl_exec($c);
+
+            $code = curl_getinfo($c, CURLINFO_HTTP_CODE);
+            $body = $this->data;
+            $headers = $this->headers;
+
+            if (!$code) {
+                Auth_OpenID::log("Got no response code when fetching %s", $url);
+                Auth_OpenID::log("CURL error (%s): %s",
+                                 curl_errno($c), curl_error($c));
+                return null;
+            }
+
+            if (in_array($code, array(301, 302, 303, 307))) {
+                $url = $this->_findRedirect($headers, $url);
+                $redir = true;
+            } else {
+                $redir = false;
+                curl_close($c);
+
+                if (defined('Auth_OpenID_VERIFY_HOST') &&
+                    $this->isHTTPS($url)) {
+                    Auth_OpenID::log('OpenID: Verified SSL host %s using '.
+                                     'curl/get', $url);
+                }
+                $new_headers = array();
+
+                foreach ($headers as $header) {
+                    if (strpos($header, ': ')) {
+                        list($name, $value) = explode(': ', $header, 2);
+                        $new_headers[$name] = $value;
+                    }
+                }
+
+                Auth_OpenID::log(
+                    "Successfully fetched '%s': GET response code %s",
+                    $url, $code);
+
+                return new Auth_Yadis_HTTPResponse($url, $code,
+                                                    $new_headers, $body);
+            }
+
+            $off = $stop - time();
+        }
+
+        return null;
+    }
+
+    function post($url, $body, $extra_headers = null)
+    {
+        if (!$this->canFetchURL($url)) {
+            return null;
+        }
+
+        $this->reset();
+
+        $c = curl_init();
+
+        if (defined('CURLOPT_NOSIGNAL')) {
+            curl_setopt($c, CURLOPT_NOSIGNAL, true);
+        }
+
+        curl_setopt($c, CURLOPT_POST, true);
+        curl_setopt($c, CURLOPT_POSTFIELDS, $body);
+        curl_setopt($c, CURLOPT_TIMEOUT, $this->timeout);
+        curl_setopt($c, CURLOPT_URL, $url);
+        curl_setopt($c, CURLOPT_WRITEFUNCTION,
+                    array($this, "_writeData"));
+
+        if (defined('Auth_OpenID_VERIFY_HOST')) {
+            curl_setopt($c, CURLOPT_SSL_VERIFYPEER, true);
+            curl_setopt($c, CURLOPT_SSL_VERIFYHOST, 2);
+        }
+
+        curl_exec($c);
+
+        $code = curl_getinfo($c, CURLINFO_HTTP_CODE);
+
+        if (!$code) {
+            Auth_OpenID::log("Got no response code when fetching %s", $url);
+            Auth_OpenID::log("CURL error (%s): %s",
+                             curl_errno($c), curl_error($c));
+            return null;
+        }
+
+        if (defined('Auth_OpenID_VERIFY_HOST') && $this->isHTTPS($url)) {
+            Auth_OpenID::log('OpenID: Verified SSL host %s using '.
+                             'curl/post', $url);
+        }
+        $body = $this->data;
+
+        curl_close($c);
+
+        $new_headers = $extra_headers;
+
+        foreach ($this->headers as $header) {
+            if (strpos($header, ': ')) {
+                list($name, $value) = explode(': ', $header, 2);
+                $new_headers[$name] = $value;
+            }
+
+        }
+
+        Auth_OpenID::log("Successfully fetched '%s': POST response code %s",
+                         $url, $code);
+
+        return new Auth_Yadis_HTTPResponse($url, $code,
+                                           $new_headers, $body);
+    }
+}
+
+

--- /dev/null
+++ b/lib/openid-php/Auth/Yadis/ParseHTML.php
@@ -1,1 +1,259 @@
-
+<?php
+
+/**
+ * This is the HTML pseudo-parser for the Yadis library.
+ *
+ * PHP versions 4 and 5
+ *
+ * LICENSE: See the COPYING file included in this distribution.
+ *
+ * @package OpenID
+ * @author JanRain, Inc. <openid@janrain.com>
+ * @copyright 2005-2008 Janrain, Inc.
+ * @license http://www.apache.org/licenses/LICENSE-2.0 Apache
+ */
+
+/**
+ * This class is responsible for scanning an HTML string to find META
+ * tags and their attributes.  This is used by the Yadis discovery
+ * process.  This class must be instantiated to be used.
+ *
+ * @package OpenID
+ */
+class Auth_Yadis_ParseHTML {
+
+    /**
+     * @access private
+     */
+    var $_re_flags = "si";
+
+    /**
+     * @access private
+     */
+    var $_removed_re =
+           "<!--.*?-->|<!\[CDATA\[.*?\]\]>|<script\b(?!:)[^>]*>.*?<\/script>";
+
+    /**
+     * @access private
+     */
+    var $_tag_expr = "<%s%s(?:\s.*?)?%s>";
+
+    /**
+     * @access private
+     */
+    var $_attr_find = '\b([-\w]+)=(".*?"|\'.*?\'|.+?)[\/\s>]';
+
+    function Auth_Yadis_ParseHTML()
+    {
+        $this->_attr_find = sprintf("/%s/%s",
+                                    $this->_attr_find,
+                                    $this->_re_flags);
+
+        $this->_removed_re = sprintf("/%s/%s",
+                                     $this->_removed_re,
+                                     $this->_re_flags);
+
+        $this->_entity_replacements = array(
+                                            'amp' => '&',
+                                            'lt' => '<',
+                                            'gt' => '>',
+                                            'quot' => '"'
+                                            );
+
+        $this->_ent_replace =
+            sprintf("&(%s);", implode("|",
+                                      $this->_entity_replacements));
+    }
+
+    /**
+     * Replace HTML entities (amp, lt, gt, and quot) as well as
+     * numeric entities (e.g. #x9f;) with their actual values and
+     * return the new string.
+     *
+     * @access private
+     * @param string $str The string in which to look for entities
+     * @return string $new_str The new string entities decoded
+     */
+    function replaceEntities($str)
+    {
+        foreach ($this->_entity_replacements as $old => $new) {
+            $str = preg_replace(sprintf("/&%s;/", $old), $new, $str);
+        }
+
+        // Replace numeric entities because html_entity_decode doesn't
+        // do it for us.
+        $str = preg_replace('~&#x([0-9a-f]+);~ei', 'chr(hexdec("\\1"))', $str);
+        $str = preg_replace('~&#([0-9]+);~e', 'chr(\\1)', $str);
+
+        return $str;
+    }
+
+    /**
+     * Strip single and double quotes off of a string, if they are
+     * present.
+     *
+     * @access private
+     * @param string $str The original string
+     * @return string $new_str The new string with leading and
+     * trailing quotes removed
+     */
+    function removeQuotes($str)
+    {
+        $matches = array();
+        $double = '/^"(.*)"$/';
+        $single = "/^\'(.*)\'$/";
+
+        if (preg_match($double, $str, $matches)) {
+            return $matches[1];
+        } else if (preg_match($single, $str, $matches)) {
+            return $matches[1];
+        } else {
+            return $str;
+        }
+    }
+
+    /**
+     * Create a regular expression that will match an opening 
+     * or closing tag from a set of names.
+     *
+     * @access private
+     * @param mixed $tag_names Tag names to match
+     * @param mixed $close false/0 = no, true/1 = yes, other = maybe
+     * @param mixed $self_close false/0 = no, true/1 = yes, other = maybe
+     * @return string $regex A regular expression string to be used
+     * in, say, preg_match.
+     */
+    function tagPattern($tag_names, $close, $self_close)
+    {
+        if (is_array($tag_names)) {
+            $tag_names = '(?:'.implode('|',$tag_names).')';
+        }
+        if ($close) {
+            $close = '\/' . (($close == 1)? '' : '?');
+        } else {
+            $close = '';
+        }
+        if ($self_close) {
+            $self_close = '(?:\/\s*)' . (($self_close == 1)? '' : '?');
+        } else {
+            $self_close = '';
+        }
+        $expr = sprintf($this->_tag_expr, $close, $tag_names, $self_close);
+
+        return sprintf("/%s/%s", $expr, $this->_re_flags);
+    }
+
+    /**
+     * Given an HTML document string, this finds all the META tags in
+     * the document, provided they are found in the
+     * <HTML><HEAD>...</HEAD> section of the document.  The <HTML> tag
+     * may be missing.
+     *
+     * @access private
+     * @param string $html_string An HTMl document string
+     * @return array $tag_list Array of tags; each tag is an array of
+     * attribute -> value.
+     */
+    function getMetaTags($html_string)
+    {
+        $html_string = preg_replace($this->_removed_re,
+                                    "",
+                                    $html_string);
+
+        $key_tags = array($this->tagPattern('html', false, false),
+                          $this->tagPattern('head', false, false),
+                          $this->tagPattern('head', true, false),
+                          $this->tagPattern('html', true, false),
+                          $this->tagPattern(array(
+                          'body', 'frameset', 'frame', 'p', 'div',
+                          'table','span','a'), 'maybe', 'maybe'));
+        $key_tags_pos = array();
+        foreach ($key_tags as $pat) {
+            $matches = array();
+            preg_match($pat, $html_string, $matches, PREG_OFFSET_CAPTURE);
+            if($matches) {
+                $key_tags_pos[] = $matches[0][1];
+            } else {
+                $key_tags_pos[] = null;
+            }
+        }
+        // no opening head tag
+        if (is_null($key_tags_pos[1])) {
+            return array();
+        }
+        // the effective </head> is the min of the following
+        if (is_null($key_tags_pos[2])) {
+            $key_tags_pos[2] = strlen($html_string);
+        }
+        foreach (array($key_tags_pos[3], $key_tags_pos[4]) as $pos) {
+            if (!is_null($pos) && $pos < $key_tags_pos[2]) {
+                $key_tags_pos[2] = $pos;
+            }
+        }
+        // closing head tag comes before opening head tag
+        if ($key_tags_pos[1] > $key_tags_pos[2]) {
+            return array();
+        }
+        // if there is an opening html tag, make sure the opening head tag
+        // comes after it
+        if (!is_null($key_tags_pos[0]) && $key_tags_pos[1] < $key_tags_pos[0]) {
+            return array();
+        }
+        $html_string = substr($html_string, $key_tags_pos[1],
+                              ($key_tags_pos[2]-$key_tags_pos[1]));
+
+        $link_data = array();
+        $link_matches = array();
+        
+        if (!preg_match_all($this->tagPattern('meta', false, 'maybe'),
+                            $html_string, $link_matches)) {
+            return array();
+        }
+
+        foreach ($link_matches[0] as $link) {
+            $attr_matches = array();
+            preg_match_all($this->_attr_find, $link, $attr_matches);
+            $link_attrs = array();
+            foreach ($attr_matches[0] as $index => $full_match) {
+                $name = $attr_matches[1][$index];
+                $value = $this->replaceEntities(
+                              $this->removeQuotes($attr_matches[2][$index]));
+
+                $link_attrs[strtolower($name)] = $value;
+            }
+            $link_data[] = $link_attrs;
+        }
+
+        return $link_data;
+    }
+
+    /**
+     * Looks for a META tag with an "http-equiv" attribute whose value
+     * is one of ("x-xrds-location", "x-yadis-location"), ignoring
+     * case.  If such a META tag is found, its "content" attribute
+     * value is returned.
+     *
+     * @param string $html_string An HTML document in string format
+     * @return mixed $content The "content" attribute value of the
+     * META tag, if found, or null if no such tag was found.
+     */
+    function getHTTPEquiv($html_string)
+    {
+        $meta_tags = $this->getMetaTags($html_string);
+
+        if ($meta_tags) {
+            foreach ($meta_tags as $tag) {
+                if (array_key_exists('http-equiv', $tag) &&
+                    (in_array(strtolower($tag['http-equiv']),
+                              array('x-xrds-location', 'x-yadis-location'))) &&
+                    array_key_exists('content', $tag)) {
+                    return $tag['content'];
+                }
+            }
+        }
+
+        return null;
+    }
+}
+
+

--- /dev/null
+++ b/lib/openid-php/Auth/Yadis/PlainHTTPFetcher.php
@@ -1,1 +1,249 @@
-
+<?php
+
+/**
+ * This module contains the plain non-curl HTTP fetcher
+ * implementation.
+ *
+ * PHP versions 4 and 5
+ *
+ * LICENSE: See the COPYING file included in this distribution.
+ *
+ * @package OpenID
+ * @author JanRain, Inc. <openid@janrain.com>
+ * @copyright 2005-2008 Janrain, Inc.
+ * @license http://www.apache.org/licenses/LICENSE-2.0 Apache
+ */
+
+/**
+ * Interface import
+ */
+require_once "Auth/Yadis/HTTPFetcher.php";
+
+/**
+ * This class implements a plain, hand-built socket-based fetcher
+ * which will be used in the event that CURL is unavailable.
+ *
+ * @package OpenID
+ */
+class Auth_Yadis_PlainHTTPFetcher extends Auth_Yadis_HTTPFetcher {
+    /**
+     * Does this fetcher support SSL URLs?
+     */
+    function supportsSSL()
+    {
+        return function_exists('openssl_open');
+    }
+
+    function get($url, $extra_headers = null)
+    {
+        if (!$this->canFetchURL($url)) {
+            return null;
+        }
+
+        $redir = true;
+
+        $stop = time() + $this->timeout;
+        $off = $this->timeout;
+
+        while ($redir && ($off > 0)) {
+
+            $parts = parse_url($url);
+
+            $specify_port = true;
+
+            // Set a default port.
+            if (!array_key_exists('port', $parts)) {
+                $specify_port = false;
+                if ($parts['scheme'] == 'http') {
+                    $parts['port'] = 80;
+                } elseif ($parts['scheme'] == 'https') {
+                    $parts['port'] = 443;
+                } else {
+                    return null;
+                }
+            }
+
+            if (!array_key_exists('path', $parts)) {
+                $parts['path'] = '/';
+            }
+
+            $host = $parts['host'];
+
+            if ($parts['scheme'] == 'https') {
+                $host = 'ssl://' . $host;
+            }
+
+            $user_agent = Auth_OpenID_USER_AGENT;
+
+            $headers = array(
+                             "GET ".$parts['path'].
+                             (array_key_exists('query', $parts) ?
+                              "?".$parts['query'] : "").
+                                 " HTTP/1.0",
+                             "User-Agent: $user_agent",
+                             "Host: ".$parts['host'].
+                                ($specify_port ? ":".$parts['port'] : ""),
+                             "Port: ".$parts['port']);
+
+            $errno = 0;
+            $errstr = '';
+
+            if ($extra_headers) {
+                foreach ($extra_headers as $h) {
+                    $headers[] = $h;
+                }
+            }
+
+            @$sock = fsockopen($host, $parts['port'], $errno, $errstr,
+                               $this->timeout);
+            if ($sock === false) {
+                return false;
+            }
+
+            stream_set_timeout($sock, $this->timeout);
+
+            fputs($sock, implode("\r\n", $headers) . "\r\n\r\n");
+
+            $data = "";
+            $kilobytes = 0;
+            while (!feof($sock) &&
+                   $kilobytes < Auth_OpenID_FETCHER_MAX_RESPONSE_KB ) {
+                $data .= fgets($sock, 1024);
+                $kilobytes += 1;
+            }
+
+            fclose($sock);
+
+            // Split response into header and body sections
+            list($headers, $body) = explode("\r\n\r\n", $data, 2);
+            $headers = explode("\r\n", $headers);
+
+            $http_code = explode(" ", $headers[0]);
+            $code = $http_code[1];
+
+            if (in_array($code, array('301', '302'))) {
+                $url = $this->_findRedirect($headers, $url);
+                $redir = true;
+            } else {
+                $redir = false;
+            }
+
+            $off = $stop - time();
+        }
+
+        $new_headers = array();
+
+        foreach ($headers as $header) {
+            if (preg_match("/:/", $header)) {
+                $parts = explode(": ", $header, 2);
+
+                if (count($parts) == 2) {
+                    list($name, $value) = $parts;
+                    $new_headers[$name] = $value;
+                }
+            }
+
+        }
+
+        return new Auth_Yadis_HTTPResponse($url, $code, $new_headers, $body);
+    }
+
+    function post($url, $body, $extra_headers = null)
+    {
+        if (!$this->canFetchURL($url)) {
+            return null;
+        }
+
+        $parts = parse_url($url);
+
+        $headers = array();
+
+        $post_path = $parts['path'];
+        if (isset($parts['query'])) {
+            $post_path .= '?' . $parts['query'];
+        }
+
+        $headers[] = "POST ".$post_path." HTTP/1.0";
+        $headers[] = "Host: " . $parts['host'];
+        $headers[] = "Content-type: application/x-www-form-urlencoded";
+        $headers[] = "Content-length: " . strval(strlen($body));
+
+        if ($extra_headers &&
+            is_array($extra_headers)) {
+            $headers = array_merge($headers, $extra_headers);
+        }
+
+        // Join all headers together.
+        $all_headers = implode("\r\n", $headers);
+
+        // Add headers, two newlines, and request body.
+        $request = $all_headers . "\r\n\r\n" . $body;
+
+        // Set a default port.
+        if (!array_key_exists('port', $parts)) {
+            if ($parts['scheme'] == 'http') {
+                $parts['port'] = 80;
+            } elseif ($parts['scheme'] == 'https') {
+                $parts['port'] = 443;
+            } else {
+                return null;
+            }
+        }
+
+        if ($parts['scheme'] == 'https') {
+            $parts['host'] = sprintf("ssl://%s", $parts['host']);
+        }
+
+        // Connect to the remote server.
+        $errno = 0;
+        $errstr = '';
+
+        $sock = fsockopen($parts['host'], $parts['port'], $errno, $errstr,
+                          $this->timeout);
+
+        if ($sock === false) {
+            return null;
+        }
+
+        stream_set_timeout($sock, $this->timeout);
+
+        // Write the POST request.
+        fputs($sock, $request);
+
+        // Get the response from the server.
+        $response = "";
+        while (!feof($sock)) {
+            if ($data = fgets($sock, 128)) {
+                $response .= $data;
+            } else {
+                break;
+            }
+        }
+
+        // Split the request into headers and body.
+        list($headers, $response_body) = explode("\r\n\r\n", $response, 2);
+
+        $headers = explode("\r\n", $headers);
+
+        // Expect the first line of the headers data to be something
+        // like HTTP/1.1 200 OK.  Split the line on spaces and take
+        // the second token, which should be the return code.
+        $http_code = explode(" ", $headers[0]);
+        $code = $http_code[1];
+
+        $new_headers = array();
+
+        foreach ($headers as $header) {
+            if (preg_match("/:/", $header)) {
+                list($name, $value) = explode(": ", $header, 2);
+                $new_headers[$name] = $value;
+            }
+
+        }
+
+        return new Auth_Yadis_HTTPResponse($url, $code,
+                                           $new_headers, $response_body);
+    }
+}
+
+

--- /dev/null
+++ b/lib/openid-php/Auth/Yadis/XML.php
@@ -1,1 +1,353 @@
-
+<?php
+
+/**
+ * XML-parsing classes to wrap the domxml and DOM extensions for PHP 4
+ * and 5, respectively.
+ *
+ * @package OpenID
+ */
+
+/**
+ * The base class for wrappers for available PHP XML-parsing
+ * extensions.  To work with this Yadis library, subclasses of this
+ * class MUST implement the API as defined in the remarks for this
+ * class.  Subclasses of Auth_Yadis_XMLParser are used to wrap
+ * particular PHP XML extensions such as 'domxml'.  These are used
+ * internally by the library depending on the availability of
+ * supported PHP XML extensions.
+ *
+ * @package OpenID
+ */
+class Auth_Yadis_XMLParser {
+    /**
+     * Initialize an instance of Auth_Yadis_XMLParser with some
+     * XML and namespaces.  This SHOULD NOT be overridden by
+     * subclasses.
+     *
+     * @param string $xml_string A string of XML to be parsed.
+     * @param array $namespace_map An array of ($ns_name => $ns_uri)
+     * to be registered with the XML parser.  May be empty.
+     * @return boolean $result True if the initialization and
+     * namespace registration(s) succeeded; false otherwise.
+     */
+    function init($xml_string, $namespace_map)
+    {
+        if (!$this->setXML($xml_string)) {
+            return false;
+        }
+
+        foreach ($namespace_map as $prefix => $uri) {
+            if (!$this->registerNamespace($prefix, $uri)) {
+                return false;
+            }
+        }
+
+        return true;
+    }
+
+    /**
+     * Register a namespace with the XML parser.  This should be
+     * overridden by subclasses.
+     *
+     * @param string $prefix The namespace prefix to appear in XML tag
+     * names.
+     *
+     * @param string $uri The namespace URI to be used to identify the
+     * namespace in the XML.
+     *
+     * @return boolean $result True if the registration succeeded;
+     * false otherwise.
+     */
+    function registerNamespace($prefix, $uri)
+    {
+        // Not implemented.
+    }
+
+    /**
+     * Set this parser object's XML payload.  This should be
+     * overridden by subclasses.
+     *
+     * @param string $xml_string The XML string to pass to this
+     * object's XML parser.
+     *
+     * @return boolean $result True if the initialization succeeded;
+     * false otherwise.
+     */
+    function setXML($xml_string)
+    {
+        // Not implemented.
+    }
+
+    /**
+     * Evaluate an XPath expression and return the resulting node
+     * list.  This should be overridden by subclasses.
+     *
+     * @param string $xpath The XPath expression to be evaluated.
+     *
+     * @param mixed $node A node object resulting from a previous
+     * evalXPath call.  This node, if specified, provides the context
+     * for the evaluation of this xpath expression.
+     *
+     * @return array $node_list An array of matching opaque node
+     * objects to be used with other methods of this parser class.
+     */
+    function &evalXPath($xpath, $node = null)
+    {
+        // Not implemented.
+    }
+
+    /**
+     * Return the textual content of a specified node.
+     *
+     * @param mixed $node A node object from a previous call to
+     * $this->evalXPath().
+     *
+     * @return string $content The content of this node.
+     */
+    function content($node)
+    {
+        // Not implemented.
+    }
+
+    /**
+     * Return the attributes of a specified node.
+     *
+     * @param mixed $node A node object from a previous call to
+     * $this->evalXPath().
+     *
+     * @return array $attrs An array mapping attribute names to
+     * values.
+     */
+    function attributes($node)
+    {
+        // Not implemented.
+    }
+}
+
+/**
+ * This concrete implementation of Auth_Yadis_XMLParser implements
+ * the appropriate API for the 'domxml' extension which is typically
+ * packaged with PHP 4.  This class will be used whenever the 'domxml'
+ * extension is detected.  See the Auth_Yadis_XMLParser class for
+ * details on this class's methods.
+ *
+ * @package OpenID
+ */
+class Auth_Yadis_domxml extends Auth_Yadis_XMLParser {
+    function Auth_Yadis_domxml()
+    {
+        $this->xml = null;
+        $this->doc = null;
+        $this->xpath = null;
+        $this->errors = array();
+    }
+
+    function setXML($xml_string)
+    {
+        $this->xml = $xml_string;
+        $this->doc = @domxml_open_mem($xml_string, DOMXML_LOAD_PARSING,
+                                      $this->errors);
+
+        if (!$this->doc) {
+            return false;
+        }
+
+        $this->xpath = $this->doc->xpath_new_context();
+
+        return true;
+    }
+
+    function registerNamespace($prefix, $uri)
+    {
+        return xpath_register_ns($this->xpath, $prefix, $uri);
+    }
+
+    function &evalXPath($xpath, $node = null)
+    {
+        if ($node) {
+            $result = @$this->xpath->xpath_eval($xpath, $node);
+        } else {
+            $result = @$this->xpath->xpath_eval($xpath);
+        }
+
+        if (!$result) {
+            $n = array();
+            return $n;
+        }
+
+        if (!$result->nodeset) {
+            $n = array();
+            return $n;
+        }
+
+        return $result->nodeset;
+    }
+
+    function content($node)
+    {
+        if ($node) {
+            return $node->get_content();
+        }
+    }
+
+    function attributes($node)
+    {
+        if ($node) {
+            $arr = $node->attributes();
+            $result = array();
+
+            if ($arr) {
+                foreach ($arr as $attrnode) {
+                    $result[$attrnode->name] = $attrnode->value;
+                }
+            }
+
+            return $result;
+        }
+    }
+}
+
+/**
+ * This concrete implementation of Auth_Yadis_XMLParser implements
+ * the appropriate API for the 'dom' extension which is typically
+ * packaged with PHP 5.  This class will be used whenever the 'dom'
+ * extension is detected.  See the Auth_Yadis_XMLParser class for
+ * details on this class's methods.
+ *
+ * @package OpenID
+ */
+class Auth_Yadis_dom extends Auth_Yadis_XMLParser {
+    function Auth_Yadis_dom()
+    {
+        $this->xml = null;
+        $this->doc = null;
+        $this->xpath = null;
+        $this->errors = array();
+    }
+
+    function setXML($xml_string)
+    {
+        $this->xml = $xml_string;
+        $this->doc = new DOMDocument;
+
+        if (!$this->doc) {
+            return false;
+        }
+
+        if (!@$this->doc->loadXML($xml_string)) {
+            return false;
+        }
+
+        $this->xpath = new DOMXPath($this->doc);
+
+        if ($this->xpath) {
+            return true;
+        } else {
+            return false;
+        }
+    }
+
+    function registerNamespace($prefix, $uri)
+    {
+        return $this->xpath->registerNamespace($prefix, $uri);
+    }
+
+    function &evalXPath($xpath, $node = null)
+    {
+        if ($node) {
+            $result = @$this->xpath->query($xpath, $node);
+        } else {
+            $result = @$this->xpath->query($xpath);
+        }
+
+        $n = array();
+
+        if (!$result) {
+            return $n;
+        }
+
+        for ($i = 0; $i < $result->length; $i++) {
+            $n[] = $result->item($i);
+        }
+
+        return $n;
+    }
+
+    function content($node)
+    {
+        if ($node) {
+            return $node->textContent;
+        }
+    }
+
+    function attributes($node)
+    {
+        if ($node) {
+            $arr = $node->attributes;
+            $result = array();
+
+            if ($arr) {
+                for ($i = 0; $i < $arr->length; $i++) {
+                    $node = $arr->item($i);
+                    $result[$node->nodeName] = $node->nodeValue;
+                }
+            }
+
+            return $result;
+        }
+    }
+}
+
+global $__Auth_Yadis_defaultParser;
+$__Auth_Yadis_defaultParser = null;
+
+/**
+ * Set a default parser to override the extension-driven selection of
+ * available parser classes.  This is helpful in a test environment or
+ * one in which multiple parsers can be used but one is more
+ * desirable.
+ *
+ * @param Auth_Yadis_XMLParser $parser An instance of a
+ * Auth_Yadis_XMLParser subclass.
+ */
+function Auth_Yadis_setDefaultParser($parser)
+{
+    global $__Auth_Yadis_defaultParser;
+    $__Auth_Yadis_defaultParser = $parser;
+}
+
+function Auth_Yadis_getSupportedExtensions()
+{
+    return array('dom'    => 'Auth_Yadis_dom',
+                 'domxml' => 'Auth_Yadis_domxml');
+}
+
+/**
+ * Returns an instance of a Auth_Yadis_XMLParser subclass based on
+ * the availability of PHP extensions for XML parsing.  If
+ * Auth_Yadis_setDefaultParser has been called, the parser used in
+ * that call will be returned instead.
+ */
+function Auth_Yadis_getXMLParser()
+{
+    global $__Auth_Yadis_defaultParser;
+    
+    if (isset($__Auth_Yadis_defaultParser)) {
+        return $__Auth_Yadis_defaultParser;
+    }
+    
+    foreach(Auth_Yadis_getSupportedExtensions() as $extension => $classname)
+    {
+      if (extension_loaded($extension))
+      {
+        $p = new $classname();
+        Auth_Yadis_setDefaultParser($p);
+        return $p;
+      }
+    }
+    
+    return false;
+}
+
+
+

--- /dev/null
+++ b/lib/openid-php/Auth/Yadis/XRDS.php
@@ -1,1 +1,479 @@
-
+<?php
+
+/**
+ * This module contains the XRDS parsing code.
+ *
+ * PHP versions 4 and 5
+ *
+ * LICENSE: See the COPYING file included in this distribution.
+ *
+ * @package OpenID
+ * @author JanRain, Inc. <openid@janrain.com>
+ * @copyright 2005-2008 Janrain, Inc.
+ * @license http://www.apache.org/licenses/LICENSE-2.0 Apache
+ */
+
+/**
+ * Require the XPath implementation.
+ */
+require_once 'Auth/Yadis/XML.php';
+
+/**
+ * This match mode means a given service must match ALL filters passed
+ * to the Auth_Yadis_XRDS::services() call.
+ */
+define('SERVICES_YADIS_MATCH_ALL', 101);
+
+/**
+ * This match mode means a given service must match ANY filters (at
+ * least one) passed to the Auth_Yadis_XRDS::services() call.
+ */
+define('SERVICES_YADIS_MATCH_ANY', 102);
+
+/**
+ * The priority value used for service elements with no priority
+ * specified.
+ */
+define('SERVICES_YADIS_MAX_PRIORITY', pow(2, 30));
+
+/**
+ * XRD XML namespace
+ */
+define('Auth_Yadis_XMLNS_XRD_2_0', 'xri://$xrd*($v*2.0)');
+
+/**
+ * XRDS XML namespace
+ */
+define('Auth_Yadis_XMLNS_XRDS', 'xri://$xrds');
+
+function Auth_Yadis_getNSMap()
+{
+    return array('xrds' => Auth_Yadis_XMLNS_XRDS,
+                 'xrd' => Auth_Yadis_XMLNS_XRD_2_0);
+}
+
+/**
+ * @access private
+ */
+function Auth_Yadis_array_scramble($arr)
+{
+    $result = array();
+
+    while (count($arr)) {
+        $index = array_rand($arr, 1);
+        $result[] = $arr[$index];
+        unset($arr[$index]);
+    }
+
+    return $result;
+}
+
+/**
+ * This class represents a <Service> element in an XRDS document.
+ * Objects of this type are returned by
+ * Auth_Yadis_XRDS::services() and
+ * Auth_Yadis_Yadis::services().  Each object corresponds directly
+ * to a <Service> element in the XRDS and supplies a
+ * getElements($name) method which you should use to inspect the
+ * element's contents.  See {@link Auth_Yadis_Yadis} for more
+ * information on the role this class plays in Yadis discovery.
+ *
+ * @package OpenID
+ */
+class Auth_Yadis_Service {
+
+    /**
+     * Creates an empty service object.
+     */
+    function Auth_Yadis_Service()
+    {
+        $this->element = null;
+        $this->parser = null;
+    }
+
+    /**
+     * Return the URIs in the "Type" elements, if any, of this Service
+     * element.
+     *
+     * @return array $type_uris An array of Type URI strings.
+     */
+    function getTypes()
+    {
+        $t = array();
+        foreach ($this->getElements('xrd:Type') as $elem) {
+            $c = $this->parser->content($elem);
+            if ($c) {
+                $t[] = $c;
+            }
+        }
+        return $t;
+    }
+
+    function matchTypes($type_uris)
+    {
+        $result = array();
+
+        foreach ($this->getTypes() as $typ) {
+            if (in_array($typ, $type_uris)) {
+                $result[] = $typ;
+            }
+        }
+
+        return $result;
+    }
+
+    /**
+     * Return the URIs in the "URI" elements, if any, of this Service
+     * element.  The URIs are returned sorted in priority order.
+     *
+     * @return array $uris An array of URI strings.
+     */
+    function getURIs()
+    {
+        $uris = array();
+        $last = array();
+
+        foreach ($this->getElements('xrd:URI') as $elem) {
+            $uri_string = $this->parser->content($elem);
+            $attrs = $this->parser->attributes($elem);
+            if ($attrs &&
+                array_key_exists('priority', $attrs)) {
+                $priority = intval($attrs['priority']);
+                if (!array_key_exists($priority, $uris)) {
+                    $uris[$priority] = array();
+                }
+
+                $uris[$priority][] = $uri_string;
+            } else {
+                $last[] = $uri_string;
+            }
+        }
+
+        $keys = array_keys($uris);
+        sort($keys);
+
+        // Rebuild array of URIs.
+        $result = array();
+        foreach ($keys as $k) {
+            $new_uris = Auth_Yadis_array_scramble($uris[$k]);
+            $result = array_merge($result, $new_uris);
+        }
+
+        $result = array_merge($result,
+                              Auth_Yadis_array_scramble($last));
+
+        return $result;
+    }
+
+    /**
+     * Returns the "priority" attribute value of this <Service>
+     * element, if the attribute is present.  Returns null if not.
+     *
+     * @return mixed $result Null or integer, depending on whether
+     * this Service element has a 'priority' attribute.
+     */
+    function getPriority()
+    {
+        $attributes = $this->parser->attributes($this->element);
+
+        if (array_key_exists('priority', $attributes)) {
+            return intval($attributes['priority']);
+        }
+
+        return null;
+    }
+
+    /**
+     * Used to get XML elements from this object's <Service> element.
+     *
+     * This is what you should use to get all custom information out
+     * of this element. This is used by service filter functions to
+     * determine whether a service element contains specific tags,
+     * etc.  NOTE: this only considers elements which are direct
+     * children of the <Service> element for this object.
+     *
+     * @param string $name The name of the element to look for
+     * @return array $list An array of elements with the specified
+     * name which are direct children of the <Service> element.  The
+     * nodes returned by this function can be passed to $this->parser
+     * methods (see {@link Auth_Yadis_XMLParser}).
+     */
+    function getElements($name)
+    {
+        return $this->parser->evalXPath($name, $this->element);
+    }
+}
+
+/*
+ * Return the expiration date of this XRD element, or None if no
+ * expiration was specified.
+ *
+ * @param $default The value to use as the expiration if no expiration
+ * was specified in the XRD.
+ */
+function Auth_Yadis_getXRDExpiration($xrd_element, $default=null)
+{
+    $expires_element = $xrd_element->$parser->evalXPath('/xrd:Expires');
+    if ($expires_element === null) {
+        return $default;
+    } else {
+        $expires_string = $expires_element->text;
+
+        // Will raise ValueError if the string is not the expected
+        // format
+        $t = strptime($expires_string, "%Y-%m-%dT%H:%M:%SZ");
+
+        if ($t === false) {
+            return false;
+        }
+
+        // [int $hour [, int $minute [, int $second [,
+        //  int $month [, int $day [, int $year ]]]]]]
+        return mktime($t['tm_hour'], $t['tm_min'], $t['tm_sec'],
+                      $t['tm_mon'], $t['tm_day'], $t['tm_year']);
+    }
+}
+
+/**
+ * This class performs parsing of XRDS documents.
+ *
+ * You should not instantiate this class directly; rather, call
+ * parseXRDS statically:
+ *
+ * <pre>  $xrds = Auth_Yadis_XRDS::parseXRDS($xml_string);</pre>
+ *
+ * If the XRDS can be parsed and is valid, an instance of
+ * Auth_Yadis_XRDS will be returned.  Otherwise, null will be
+ * returned.  This class is used by the Auth_Yadis_Yadis::discover
+ * method.
+ *
+ * @package OpenID
+ */
+class Auth_Yadis_XRDS {
+
+    /**
+     * Instantiate a Auth_Yadis_XRDS object.  Requires an XPath
+     * instance which has been used to parse a valid XRDS document.
+     */
+    function Auth_Yadis_XRDS($xmlParser, $xrdNodes)
+    {
+        $this->parser = $xmlParser;
+        $this->xrdNode = $xrdNodes[count($xrdNodes) - 1];
+        $this->allXrdNodes = $xrdNodes;
+        $this->serviceList = array();
+        $this->_parse();
+    }
+
+    /**
+     * Parse an XML string (XRDS document) and return either a
+     * Auth_Yadis_XRDS object or null, depending on whether the
+     * XRDS XML is valid.
+     *
+     * @param string $xml_string An XRDS XML string.
+     * @return mixed $xrds An instance of Auth_Yadis_XRDS or null,
+     * depending on the validity of $xml_string
+     */
+    static function parseXRDS($xml_string, $extra_ns_map = null)
+    {
+        $_null = null;
+
+        if (!$xml_string) {
+            return $_null;
+        }
+
+        $parser = Auth_Yadis_getXMLParser();
+
+        $ns_map = Auth_Yadis_getNSMap();
+
+        if ($extra_ns_map && is_array($extra_ns_map)) {
+            $ns_map = array_merge($ns_map, $extra_ns_map);
+        }
+
+        if (!($parser && $parser->init($xml_string, $ns_map))) {
+            return $_null;
+        }
+
+        // Try to get root element.
+        $root = $parser->evalXPath('/xrds:XRDS[1]');
+        if (!$root) {
+            return $_null;
+        }
+
+        if (is_array($root)) {
+            $root = $root[0];
+        }
+
+        $attrs = $parser->attributes($root);
+
+        if (array_key_exists('xmlns:xrd', $attrs) &&
+            $attrs['xmlns:xrd'] != Auth_Yadis_XMLNS_XRDS) {
+            return $_null;
+        } else if (array_key_exists('xmlns', $attrs) &&
+                   preg_match('/xri/', $attrs['xmlns']) &&
+                   $attrs['xmlns'] != Auth_Yadis_XMLNS_XRD_2_0) {
+            return $_null;
+        }
+
+        // Get the last XRD node.
+        $xrd_nodes = $parser->evalXPath('/xrds:XRDS[1]/xrd:XRD');
+
+        if (!$xrd_nodes) {
+            return $_null;
+        }
+
+        $xrds = new Auth_Yadis_XRDS($parser, $xrd_nodes);
+        return $xrds;
+    }
+
+    /**
+     * @access private
+     */
+    function _addService($priority, $service)
+    {
+        $priority = intval($priority);
+
+        if (!array_key_exists($priority, $this->serviceList)) {
+            $this->serviceList[$priority] = array();
+        }
+
+        $this->serviceList[$priority][] = $service;
+    }
+
+    /**
+     * Creates the service list using nodes from the XRDS XML
+     * document.
+     *
+     * @access private
+     */
+    function _parse()
+    {
+        $this->serviceList = array();
+
+        $services = $this->parser->evalXPath('xrd:Service', $this->xrdNode);
+
+        foreach ($services as $node) {
+            $s = new Auth_Yadis_Service();
+            $s->element = $node;
+            $s->parser = $this->parser;
+
+            $priority = $s->getPriority();
+
+            if ($priority === null) {
+                $priority = SERVICES_YADIS_MAX_PRIORITY;
+            }
+
+            $this->_addService($priority, $s);
+        }
+    }
+
+    /**
+     * Returns a list of service objects which correspond to <Service>
+     * elements in the XRDS XML document for this object.
+     *
+     * Optionally, an array of filter callbacks may be given to limit
+     * the list of returned service objects.  Furthermore, the default
+     * mode is to return all service objects which match ANY of the
+     * specified filters, but $filter_mode may be
+     * SERVICES_YADIS_MATCH_ALL if you want to be sure that the
+     * returned services match all the given filters.  See {@link
+     * Auth_Yadis_Yadis} for detailed usage information on filter
+     * functions.
+     *
+     * @param mixed $filters An array of callbacks to filter the
+     * returned services, or null if all services are to be returned.
+     * @param integer $filter_mode SERVICES_YADIS_MATCH_ALL or
+     * SERVICES_YADIS_MATCH_ANY, depending on whether the returned
+     * services should match ALL or ANY of the specified filters,
+     * respectively.
+     * @return mixed $services An array of {@link
+     * Auth_Yadis_Service} objects if $filter_mode is a valid
+     * mode; null if $filter_mode is an invalid mode (i.e., not
+     * SERVICES_YADIS_MATCH_ANY or SERVICES_YADIS_MATCH_ALL).
+     */
+    function services($filters = null,
+                      $filter_mode = SERVICES_YADIS_MATCH_ANY)
+    {
+
+        $pri_keys = array_keys($this->serviceList);
+        sort($pri_keys, SORT_NUMERIC);
+
+        // If no filters are specified, return the entire service
+        // list, ordered by priority.
+        if (!$filters ||
+            (!is_array($filters))) {
+
+            $result = array();
+            foreach ($pri_keys as $pri) {
+                $result = array_merge($result, $this->serviceList[$pri]);
+            }
+
+            return $result;
+        }
+
+        // If a bad filter mode is specified, return null.
+        if (!in_array($filter_mode, array(SERVICES_YADIS_MATCH_ANY,
+                                          SERVICES_YADIS_MATCH_ALL))) {
+            return null;
+        }
+
+        // Otherwise, use the callbacks in the filter list to
+        // determine which services are returned.
+        $filtered = array();
+
+        foreach ($pri_keys as $priority_value) {
+            $service_obj_list = $this->serviceList[$priority_value];
+
+            foreach ($service_obj_list as $service) {
+
+                $matches = 0;
+
+                foreach ($filters as $filter) {
+
+                    if (call_user_func_array($filter, array(&$service))) {
+                        $matches++;
+
+                        if ($filter_mode == SERVICES_YADIS_MATCH_ANY) {
+                            $pri = $service->getPriority();
+                            if ($pri === null) {
+                                $pri = SERVICES_YADIS_MAX_PRIORITY;
+                            }
+
+                            if (!array_key_exists($pri, $filtered)) {
+                                $filtered[$pri] = array();
+                            }
+
+                            $filtered[$pri][] = $service;
+                            break;
+                        }
+                    }
+                }
+
+                if (($filter_mode == SERVICES_YADIS_MATCH_ALL) &&
+                    ($matches == count($filters))) {
+
+                    $pri = $service->getPriority();
+                    if ($pri === null) {
+                        $pri = SERVICES_YADIS_MAX_PRIORITY;
+                    }
+
+                    if (!array_key_exists($pri, $filtered)) {
+                        $filtered[$pri] = array();
+                    }
+                    $filtered[$pri][] = $service;
+                }
+            }
+        }
+
+        $pri_keys = array_keys($filtered);
+        sort($pri_keys, SORT_NUMERIC);
+
+        $result = array();
+        foreach ($pri_keys as $pri) {
+            $result = array_merge($result, $filtered[$pri]);
+        }
+
+        return $result;
+    }
+}
+
+

--- /dev/null
+++ b/lib/openid-php/Auth/Yadis/XRI.php
@@ -1,1 +1,235 @@
-
+<?php
+
+/**
+ * Routines for XRI resolution.
+ *
+ * @package OpenID
+ * @author JanRain, Inc. <openid@janrain.com>
+ * @copyright 2005-2008 Janrain, Inc.
+ * @license http://www.apache.org/licenses/LICENSE-2.0 Apache
+ */
+
+require_once 'Auth/Yadis/Misc.php';
+require_once 'Auth/Yadis/Yadis.php';
+require_once 'Auth/OpenID.php';
+
+function Auth_Yadis_getDefaultProxy()
+{
+    return 'http://xri.net/';
+}
+
+function Auth_Yadis_getXRIAuthorities()
+{
+    return array('!', '=', '@', '+', '$', '(');
+}
+
+function Auth_Yadis_getEscapeRE()
+{
+    $parts = array();
+    foreach (array_merge(Auth_Yadis_getUCSChars(),
+                         Auth_Yadis_getIPrivateChars()) as $pair) {
+        list($m, $n) = $pair;
+        $parts[] = sprintf("%s-%s", chr($m), chr($n));
+    }
+
+    return sprintf('/[%s]/', implode('', $parts));
+}
+
+function Auth_Yadis_getXrefRE()
+{
+    return '/\((.*?)\)/';
+}
+
+function Auth_Yadis_identifierScheme($identifier)
+{
+    if (Auth_Yadis_startswith($identifier, 'xri://') ||
+        ($identifier &&
+          in_array($identifier[0], Auth_Yadis_getXRIAuthorities()))) {
+        return "XRI";
+    } else {
+        return "URI";
+    }
+}
+
+function Auth_Yadis_toIRINormal($xri)
+{
+    if (!Auth_Yadis_startswith($xri, 'xri://')) {
+        $xri = 'xri://' . $xri;
+    }
+
+    return Auth_Yadis_escapeForIRI($xri);
+}
+
+function _escape_xref($xref_match)
+{
+    $xref = $xref_match[0];
+    $xref = str_replace('/', '%2F', $xref);
+    $xref = str_replace('?', '%3F', $xref);
+    $xref = str_replace('#', '%23', $xref);
+    return $xref;
+}
+
+function Auth_Yadis_escapeForIRI($xri)
+{
+    $xri = str_replace('%', '%25', $xri);
+    $xri = preg_replace_callback(Auth_Yadis_getXrefRE(),
+                                 '_escape_xref', $xri);
+    return $xri;
+}
+
+function Auth_Yadis_toURINormal($xri)
+{
+    return Auth_Yadis_iriToURI(Auth_Yadis_toIRINormal($xri));
+}
+
+function Auth_Yadis_iriToURI($iri)
+{
+    if (1) {
+        return $iri;
+    } else {
+        // According to RFC 3987, section 3.1, "Mapping of IRIs to URIs"
+        return preg_replace_callback(Auth_Yadis_getEscapeRE(),
+                                     'Auth_Yadis_pct_escape_unicode', $iri);
+    }
+}
+
+
+function Auth_Yadis_XRIAppendArgs($url, $args)
+{
+    // Append some arguments to an HTTP query.  Yes, this is just like
+    // OpenID's appendArgs, but with special seasoning for XRI
+    // queries.
+
+    if (count($args) == 0) {
+        return $url;
+    }
+
+    // Non-empty array; if it is an array of arrays, use multisort;
+    // otherwise use sort.
+    if (array_key_exists(0, $args) &&
+        is_array($args[0])) {
+        // Do nothing here.
+    } else {
+        $keys = array_keys($args);
+        sort($keys);
+        $new_args = array();
+        foreach ($keys as $key) {
+            $new_args[] = array($key, $args[$key]);
+        }
+        $args = $new_args;
+    }
+
+    // According to XRI Resolution section "QXRI query parameters":
+    //
+    // "If the original QXRI had a null query component (only a
+    //  leading question mark), or a query component consisting of
+    //  only question marks, one additional leading question mark MUST
+    //  be added when adding any XRI resolution parameters."
+    if (strpos(rtrim($url, '?'), '?') !== false) {
+        $sep = '&';
+    } else {
+        $sep = '?';
+    }
+
+    return $url . $sep . Auth_OpenID::httpBuildQuery($args);
+}
+
+function Auth_Yadis_providerIsAuthoritative($providerID, $canonicalID)
+{
+    $lastbang = strrpos($canonicalID, '!');
+    $p = substr($canonicalID, 0, $lastbang);
+    return $p == $providerID;
+}
+
+function Auth_Yadis_rootAuthority($xri)
+{
+    // Return the root authority for an XRI.
+
+    $root = null;
+
+    if (Auth_Yadis_startswith($xri, 'xri://')) {
+        $xri = substr($xri, 6);
+    }
+
+    $authority = explode('/', $xri, 2);
+    $authority = $authority[0];
+    if ($authority[0] == '(') {
+        // Cross-reference.
+        // XXX: This is incorrect if someone nests cross-references so
+        //   there is another close-paren in there.  Hopefully nobody
+        //   does that before we have a real xriparse function.
+        //   Hopefully nobody does that *ever*.
+        $root = substr($authority, 0, strpos($authority, ')') + 1);
+    } else if (in_array($authority[0], Auth_Yadis_getXRIAuthorities())) {
+        // Other XRI reference.
+        $root = $authority[0];
+    } else {
+        // IRI reference.
+        $_segments = explode("!", $authority);
+        $segments = array();
+        foreach ($_segments as $s) {
+            $segments = array_merge($segments, explode("*", $s));
+        }
+        $root = $segments[0];
+    }
+
+    return Auth_Yadis_XRI($root);
+}
+
+function Auth_Yadis_XRI($xri)
+{
+    if (!Auth_Yadis_startswith($xri, 'xri://')) {
+        $xri = 'xri://' . $xri;
+    }
+    return $xri;
+}
+
+function Auth_Yadis_getCanonicalID($iname, $xrds)
+{
+    // Returns false or a canonical ID value.
+
+    // Now nodes are in reverse order.
+    $xrd_list = array_reverse($xrds->allXrdNodes);
+    $parser = $xrds->parser;
+    $node = $xrd_list[0];
+
+    $canonicalID_nodes = $parser->evalXPath('xrd:CanonicalID', $node);
+
+    if (!$canonicalID_nodes) {
+        return false;
+    }
+
+    $canonicalID = $canonicalID_nodes[0];
+    $canonicalID = Auth_Yadis_XRI($parser->content($canonicalID));
+
+    $childID = $canonicalID;
+
+    for ($i = 1; $i < count($xrd_list); $i++) {
+        $xrd = $xrd_list[$i];
+
+        $parent_sought = substr($childID, 0, strrpos($childID, '!'));
+        $parentCID = $parser->evalXPath('xrd:CanonicalID', $xrd);
+        if (!$parentCID) {
+            return false;
+        }
+        $parentCID = Auth_Yadis_XRI($parser->content($parentCID[0]));
+
+        if (strcasecmp($parent_sought, $parentCID)) {
+            // raise XRDSFraud.
+            return false;
+        }
+
+        $childID = $parent_sought;
+    }
+
+    $root = Auth_Yadis_rootAuthority($iname);
+    if (!Auth_Yadis_providerIsAuthoritative($root, $childID)) {
+        // raise XRDSFraud.
+        return false;
+    }
+
+    return $canonicalID;
+}
+
+
+

--- /dev/null
+++ b/lib/openid-php/Auth/Yadis/XRIRes.php
@@ -1,1 +1,73 @@
+<?php
 
+/**
+ * Code for using a proxy XRI resolver.
+ */
+
+require_once 'Auth/Yadis/XRDS.php';
+require_once 'Auth/Yadis/XRI.php';
+
+class Auth_Yadis_ProxyResolver {
+    function Auth_Yadis_ProxyResolver($fetcher, $proxy_url = null)
+    {
+        $this->fetcher = $fetcher;
+        $this->proxy_url = $proxy_url;
+        if (!$this->proxy_url) {
+            $this->proxy_url = Auth_Yadis_getDefaultProxy();
+        }
+    }
+
+    function queryURL($xri, $service_type = null)
+    {
+        // trim off the xri:// prefix
+        $qxri = substr(Auth_Yadis_toURINormal($xri), 6);
+        $hxri = $this->proxy_url . $qxri;
+        $args = array(
+                      '_xrd_r' => 'application/xrds+xml'
+                      );
+
+        if ($service_type) {
+            $args['_xrd_t'] = $service_type;
+        } else {
+            // Don't perform service endpoint selection.
+            $args['_xrd_r'] .= ';sep=false';
+        }
+
+        $query = Auth_Yadis_XRIAppendArgs($hxri, $args);
+        return $query;
+    }
+
+    function query($xri, $service_types, $filters = array())
+    {
+        $services = array();
+        $canonicalID = null;
+        foreach ($service_types as $service_type) {
+            $url = $this->queryURL($xri, $service_type);
+            $response = $this->fetcher->get($url);
+            if ($response->status != 200 and $response->status != 206) {
+                continue;
+            }
+            $xrds = Auth_Yadis_XRDS::parseXRDS($response->body);
+            if (!$xrds) {
+                continue;
+            }
+            $canonicalID = Auth_Yadis_getCanonicalID($xri,
+                                                         $xrds);
+
+            if ($canonicalID === false) {
+                return null;
+            }
+
+            $some_services = $xrds->services($filters);
+            $services = array_merge($services, $some_services);
+            // TODO:
+            //  * If we do get hits for multiple service_types, we're
+            //    almost certainly going to have duplicated service
+            //    entries and broken priority ordering.
+        }
+        return array($canonicalID, $services);
+    }
+}
+
+
+

--- /dev/null
+++ b/lib/openid-php/Auth/Yadis/Yadis.php
@@ -1,1 +1,383 @@
-
+<?php
+
+/**
+ * The core PHP Yadis implementation.
+ *
+ * PHP versions 4 and 5
+ *
+ * LICENSE: See the COPYING file included in this distribution.
+ *
+ * @package OpenID
+ * @author JanRain, Inc. <openid@janrain.com>
+ * @copyright 2005-2008 Janrain, Inc.
+ * @license http://www.apache.org/licenses/LICENSE-2.0 Apache
+ */
+
+/**
+ * Need both fetcher types so we can use the right one based on the
+ * presence or absence of CURL.
+ */
+require_once "Auth/Yadis/PlainHTTPFetcher.php";
+require_once "Auth/Yadis/ParanoidHTTPFetcher.php";
+
+/**
+ * Need this for parsing HTML (looking for META tags).
+ */
+require_once "Auth/Yadis/ParseHTML.php";
+
+/**
+ * Need this to parse the XRDS document during Yadis discovery.
+ */
+require_once "Auth/Yadis/XRDS.php";
+
+/**
+ * XRDS (yadis) content type
+ */
+define('Auth_Yadis_CONTENT_TYPE', 'application/xrds+xml');
+
+/**
+ * Yadis header
+ */
+define('Auth_Yadis_HEADER_NAME', 'X-XRDS-Location');
+
+/**
+ * Contains the result of performing Yadis discovery on a URI.
+ *
+ * @package OpenID
+ */
+class Auth_Yadis_DiscoveryResult {
+
+    // The URI that was passed to the fetcher
+    var $request_uri = null;
+
+    // The result of following redirects from the request_uri
+    var $normalized_uri = null;
+
+    // The URI from which the response text was returned (set to
+    // None if there was no XRDS document found)
+    var $xrds_uri = null;
+
+    var $xrds = null;
+
+    // The content-type returned with the response_text
+    var $content_type = null;
+
+    // The document returned from the xrds_uri
+    var $response_text = null;
+
+    // Did the discovery fail miserably?
+    var $failed = false;
+
+    function Auth_Yadis_DiscoveryResult($request_uri)
+    {
+        // Initialize the state of the object
+        // sets all attributes to None except the request_uri
+        $this->request_uri = $request_uri;
+    }
+
+    function fail()
+    {
+        $this->failed = true;
+    }
+
+    function isFailure()
+    {
+        return $this->failed;
+    }
+
+    /**
+     * Returns the list of service objects as described by the XRDS
+     * document, if this yadis object represents a successful Yadis
+     * discovery.
+     *
+     * @return array $services An array of {@link Auth_Yadis_Service}
+     * objects
+     */
+    function services()
+    {
+        if ($this->xrds) {
+            return $this->xrds->services();
+        }
+
+        return null;
+    }
+
+    function usedYadisLocation()
+    {
+        // Was the Yadis protocol's indirection used?
+        return ($this->xrds_uri && $this->normalized_uri != $this->xrds_uri);
+    }
+
+    function isXRDS()
+    {
+        // Is the response text supposed to be an XRDS document?
+        return ($this->usedYadisLocation() ||
+                $this->content_type == Auth_Yadis_CONTENT_TYPE);
+    }
+}
+
+/**
+ *
+ * Perform the Yadis protocol on the input URL and return an iterable
+ * of resulting endpoint objects.
+ *
+ * input_url: The URL on which to perform the Yadis protocol
+ *
+ * @return: The normalized identity URL and an iterable of endpoint
+ * objects generated by the filter function.
+ *
+ * xrds_parse_func: a callback which will take (uri, xrds_text) and
+ * return an array of service endpoint objects or null.  Usually
+ * array('Auth_OpenID_ServiceEndpoint', 'fromXRDS').
+ *
+ * discover_func: if not null, a callback which should take (uri) and
+ * return an Auth_Yadis_Yadis object or null.
+ */
+function Auth_Yadis_getServiceEndpoints($input_url, $xrds_parse_func,
+                                        $discover_func=null, $fetcher=null)
+{
+    if ($discover_func === null) {
+        $discover_function = array('Auth_Yadis_Yadis', 'discover');
+    }
+
+    $yadis_result = call_user_func_array($discover_func,
+                                         array($input_url, &$fetcher));
+
+    if ($yadis_result === null) {
+        return array($input_url, array());
+    }
+
+    $endpoints = call_user_func_array($xrds_parse_func,
+                      array($yadis_result->normalized_uri,
+                            $yadis_result->response_text));
+
+    if ($endpoints === null) {
+        $endpoints = array();
+    }
+
+    return array($yadis_result->normalized_uri, $endpoints);
+}
+
+/**
+ * This is the core of the PHP Yadis library.  This is the only class
+ * a user needs to use to perform Yadis discovery.  This class
+ * performs the discovery AND stores the result of the discovery.
+ *
+ * First, require this library into your program source:
+ *
+ * <pre>  require_once "Auth/Yadis/Yadis.php";</pre>
+ *
+ * To perform Yadis discovery, first call the "discover" method
+ * statically with a URI parameter:
+ *
+ * <pre>  $http_response = array();
+ *  $fetcher = Auth_Yadis_Yadis::getHTTPFetcher();
+ *  $yadis_object = Auth_Yadis_Yadis::discover($uri,
+ *                                    $http_response, $fetcher);</pre>
+ *
+ * If the discovery succeeds, $yadis_object will be an instance of
+ * {@link Auth_Yadis_Yadis}.  If not, it will be null.  The XRDS
+ * document found during discovery should have service descriptions,
+ * which can be accessed by calling
+ *
+ * <pre>  $service_list = $yadis_object->services();</pre>
+ *
+ * which returns an array of objects which describe each service.
+ * These objects are instances of Auth_Yadis_Service.  Each object
+ * describes exactly one whole Service element, complete with all of
+ * its Types and URIs (no expansion is performed).  The common use
+ * case for using the service objects returned by services() is to
+ * write one or more filter functions and pass those to services():
+ *
+ * <pre>  $service_list = $yadis_object->services(
+ *                               array("filterByURI",
+ *                                     "filterByExtension"));</pre>
+ *
+ * The filter functions (whose names appear in the array passed to
+ * services()) take the following form:
+ *
+ * <pre>  function myFilter($service) {
+ *       // Query $service object here.  Return true if the service
+ *       // matches your query; false if not.
+ *  }</pre>
+ *
+ * This is an example of a filter which uses a regular expression to
+ * match the content of URI tags (note that the Auth_Yadis_Service
+ * class provides a getURIs() method which you should use instead of
+ * this contrived example):
+ *
+ * <pre>
+ *  function URIMatcher($service) {
+ *      foreach ($service->getElements('xrd:URI') as $uri) {
+ *          if (preg_match("/some_pattern/",
+ *                         $service->parser->content($uri))) {
+ *              return true;
+ *          }
+ *      }
+ *      return false;
+ *  }</pre>
+ *
+ * The filter functions you pass will be called for each service
+ * object to determine which ones match the criteria your filters
+ * specify.  The default behavior is that if a given service object
+ * matches ANY of the filters specified in the services() call, it
+ * will be returned.  You can specify that a given service object will
+ * be returned ONLY if it matches ALL specified filters by changing
+ * the match mode of services():
+ *
+ * <pre>  $yadis_object->services(array("filter1", "filter2"),
+ *                          SERVICES_YADIS_MATCH_ALL);</pre>
+ *
+ * See {@link SERVICES_YADIS_MATCH_ALL} and {@link
+ * SERVICES_YADIS_MATCH_ANY}.
+ *
+ * Services described in an XRDS should have a library which you'll
+ * probably be using.  Those libraries are responsible for defining
+ * filters that can be used with the "services()" call.  If you need
+ * to write your own filter, see the documentation for {@link
+ * Auth_Yadis_Service}.
+ *
+ * @package OpenID
+ */
+class Auth_Yadis_Yadis {
+
+    /**
+     * Returns an HTTP fetcher object.  If the CURL extension is
+     * present, an instance of {@link Auth_Yadis_ParanoidHTTPFetcher}
+     * is returned.  If not, an instance of
+     * {@link Auth_Yadis_PlainHTTPFetcher} is returned.
+     *
+     * If Auth_Yadis_CURL_OVERRIDE is defined, this method will always
+     * return a {@link Auth_Yadis_PlainHTTPFetcher}.
+     */
+    static function getHTTPFetcher($timeout = 20)
+    {
+        if (Auth_Yadis_Yadis::curlPresent() &&
+            (!defined('Auth_Yadis_CURL_OVERRIDE'))) {
+            $fetcher = new Auth_Yadis_ParanoidHTTPFetcher($timeout);
+        } else {
+            $fetcher = new Auth_Yadis_PlainHTTPFetcher($timeout);
+        }
+        return $fetcher;
+    }
+
+    static function curlPresent()
+    {
+        return function_exists('curl_init');
+    }
+
+    /**
+     * @access private
+     */
+   static function _getHeader($header_list, $names)
+    {
+        foreach ($header_list as $name => $value) {
+            foreach ($names as $n) {
+                if (strtolower($name) == strtolower($n)) {
+                    return $value;
+                }
+            }
+        }
+
+        return null;
+    }
+
+    /**
+     * @access private
+     */
+    static function _getContentType($content_type_header)
+    {
+        if ($content_type_header) {
+            $parts = explode(";", $content_type_header);
+            return strtolower($parts[0]);
+        }
+    }
+
+    /**
+     * This should be called statically and will build a Yadis
+     * instance if the discovery process succeeds.  This implements
+     * Yadis discovery as specified in the Yadis specification.
+     *
+     * @param string $uri The URI on which to perform Yadis discovery.
+     *
+     * @param array $http_response An array reference where the HTTP
+     * response object will be stored (see {@link
+     * Auth_Yadis_HTTPResponse}.
+     *
+     * @param Auth_Yadis_HTTPFetcher $fetcher An instance of a
+     * Auth_Yadis_HTTPFetcher subclass.
+     *
+     * @param array $extra_ns_map An array which maps namespace names
+     * to namespace URIs to be used when parsing the Yadis XRDS
+     * document.
+     *
+     * @param integer $timeout An optional fetcher timeout, in seconds.
+     *
+     * @return mixed $obj Either null or an instance of
+     * Auth_Yadis_Yadis, depending on whether the discovery
+     * succeeded.
+     */
+    static function discover($uri, $fetcher,
+                      $extra_ns_map = null, $timeout = 20)
+    {
+        $result = new Auth_Yadis_DiscoveryResult($uri);
+
+        $request_uri = $uri;
+        $headers = array("Accept: " . Auth_Yadis_CONTENT_TYPE .
+                         ', text/html; q=0.3, application/xhtml+xml; q=0.5');
+
+        if ($fetcher === null) {
+            $fetcher = Auth_Yadis_Yadis::getHTTPFetcher($timeout);
+        }
+
+        $response = $fetcher->get($uri, $headers);
+
+        if (!$response || ($response->status != 200 and
+                           $response->status != 206)) {
+            $result->fail();
+            return $result;
+        }
+
+        $result->normalized_uri = $response->final_url;
+        $result->content_type = Auth_Yadis_Yadis::_getHeader(
+                                       $response->headers,
+                                       array('content-type'));
+
+        if ($result->content_type &&
+            (Auth_Yadis_Yadis::_getContentType($result->content_type) ==
+             Auth_Yadis_CONTENT_TYPE)) {
+            $result->xrds_uri = $result->normalized_uri;
+        } else {
+            $yadis_location = Auth_Yadis_Yadis::_getHeader(
+                                                 $response->headers,
+                                                 array(Auth_Yadis_HEADER_NAME));
+
+            if (!$yadis_location) {
+                $parser = new Auth_Yadis_ParseHTML();
+                $yadis_location = $parser->getHTTPEquiv($response->body);
+            }
+
+            if ($yadis_location) {
+                $result->xrds_uri = $yadis_location;
+
+                $response = $fetcher->get($yadis_location);
+
+                if ((!$response) || ($response->status != 200 and
+                                     $response->status != 206)) {
+                    $result->fail();
+                    return $result;
+                }
+
+                $result->content_type = Auth_Yadis_Yadis::_getHeader(
+                                                         $response->headers,
+                                                         array('content-type'));
+            }
+        }
+
+        $result->response_text = $response->body;
+        return $result;
+    }
+}
+
+
+

--- a/routeList.php
+++ b/routeList.php
@@ -44,7 +44,7 @@
 		include_header("Routes Nearby", "routeList", true, true);
 		trackEvent("Route Lists", "Routes Nearby", $_SESSION['lat'] . "," . $_SESSION['lon']);
 		navbar();
-		timePlaceSettings(true);
+		placeSettings();
 		if (!isset($_SESSION['lat']) || !isset($_SESSION['lat']) || $_SESSION['lat'] == "" || $_SESSION['lon'] == "") {
 			include_footer();
 			die();

--- a/servicealerts_api.php
+++ b/servicealerts_api.php
@@ -1,42 +1,9 @@
 <?php
 include ('include/common.inc.php');
-/*
-  also need last modified epoch of client gtfs
-  
-         - add,remove,patch
-            - stop
-            - trip
-            - network
-          - patterns (WHERE=)
-            - route (short_name or route_id)
-            - street
-            - stop
-            - trip */
-$return = Array();
-$return['header']['gtrtfs_version'] = "1";
-$return['header']['timestamp'] = time();
-$return['entities'] = Array();
-foreach(getCurrentAlerts() as $alert) {
-	$informedEntities = getInformedAlerts($alert['id'],$filter_class,$filter_id);
-	if (sizeof($informedEntities) >0) {
-		$entity = Array();
-		$entity['id'] = $alert['id'];
-		$entity['alert']['active_period']['start'] = $alert['start'];
-		$entity['alert']['active_period']['start'] = $alert['end'];
-		$entity['alert']['url']['translation'] = $alert['url'];
-		$entity['alert']['description']['translation'] = $alert['description'];
-		
-		foreach ($informedEntities as $informedEntity) {
-			$informed = Array();
-			$informed[$informedEntity['informed_class']."_id"] = $informedEntity['informed_id'];
-			if ($informedEntity['informed_action'] != "") $informed["x-action"] = $informedEntity['informed_action'];
-			//$informed[$informedEntity['class']."_type"] = $informedEntity['type'];
-			$entity['informed'][] = $informed; 
-		}
-		$return['entities'][] = $entity;
-	}
-}
-//header('Content-Type: text/javascript; charset=utf8');
+
+if (basename(__FILE__) == "servicealerts_api.php") {
+	$return = getServiceAlerts($_REQUEST['filter_class'],$_REQUEST['filter_id']);
+header('Content-Type: text/javascript; charset=utf8');
 // header('Access-Control-Allow-Origin: http://bus.lambdacomplex.org/');
 header('Access-Control-Max-Age: 3628800');
 header('Access-Control-Allow-Methods: GET, POST, PUT, DELETE');
@@ -45,5 +12,6 @@
 	//print_r($_GET['callback'] . $json); //callback is prepended for json-p
 }
 else echo json_encode($return);
+}
             ?>
 

--- a/sitemap.xml.php
+++ b/sitemap.xml.php
@@ -3,10 +3,13 @@
 $last_updated = date('Y-m-d',@filemtime('cbrfeed.zip'));
 header("Content-Type: text/xml");
 echo "<?xml version='1.0' encoding='UTF-8'?>";
-  echo '<urlset xmlns="http://www.sitemaps.org/schemas/sitemap/0.9">' . "\n";
+  echo '<urlset xmlns="http://www.sitemaps.org/schemas/sitemap/0.9" xmlns:geo="http://www.google.com/geo/schemas/sitemap/1.0">' . "\n";
       echo " <url><loc>".curPageURL()."index.php</loc><priority>1.0</priority></url>\n";
 foreach (scandir("./") as $file) {
       if (strpos($file,".php") !== false && $file != "index.php" && $file != "sitemap.xml.php") echo " <url><loc>".curPageURL()."$file</loc><priority>0.3</priority></url>\n";
+}
+foreach (scandir("./labs") as $file) {
+      if (strpos($file,".php") !== false) echo " <url><loc>".curPageURL()."/labs/$file</loc><priority>0.3</priority></url>\n";
 }
 foreach (getStops() as $stop) {
       echo " <url><loc>".curPageURL()."stop.php?stopid=".htmlspecialchars ($stop["stop_id"])."</loc>";

file:a/stop.php -> file:b/stop.php
--- a/stop.php
+++ b/stop.php
@@ -12,6 +12,7 @@
 	// expand out to all platforms
 	
 }*/
+
 $stops = Array();
 $stopPositions = Array();
 $stopNames = Array();
@@ -60,8 +61,14 @@
 	}
 }
 include_header($stop['stop_name'], "stop");
+
+/*$serviceAlerts = json_decode(getPage(curPageURL() . "/servicealerts_api.php?filter_class=stop&filter_id=".$stopid) , true);
+
+foreach($serviceAlerts['entities'] as $serviceAlert) {
+    echo '<div id="servicewarning">'.$serviceAlert['alert']['description']['translation'].'</div>';
+}*/
+
 echo '<span class="content-secondary">';
-timePlaceSettings();
 echo $stopLinks;
 if (sizeof($stops) > 0) {
 	trackEvent("View Stops", "View Combined Stops", $stop["stop_name"], $stop["stop_id"]);
@@ -76,6 +83,31 @@
 		)
 	)) ;
 }
+
+// time settings
+echo '<div id="settings" data-role="collapsible" data-collapsed="true">
+<h3>Change Time (' . (isset($_SESSION['time']) ? $_SESSION['time'] : "Current Time,") . ' ' . ucwords(service_period()) . ')...</h3>
+        <form action="' . basename($_SERVER['PHP_SELF']) . "?" . $_SERVER['QUERY_STRING'] . '" method="post">
+        <div class="ui-body"> 
+    		<div data-role="fieldcontain">
+		        <label for="time"> Time: </label>
+		    	<input type="time" name="time" id="time" value="' . (isset($_SESSION['time']) ? $_SESSION['time'] : date("H:i")) . '"/>
+			<a href="#" name="currentTime" id="currentTime" onClick="var d = new Date();' . "$('#time').val(d.getHours() +':'+ (d.getMinutes().toString().length == 1 ? '0'+ d.getMinutes():  d.getMinutes()));" . '">Current Time?</a>
+	        </div>
+		<div data-role="fieldcontain">
+		    <label for="service_period"> Service Period:  </label>
+			<select name="service_period" id="service_period">';
+	foreach ($service_periods as $service_period) {
+		echo "<option value=\"$service_period\"" . (service_period() === $service_period ? " SELECTED" : "") . '>' . ucwords($service_period) . '</option>';
+	}
+	echo '</select>
+			<a href="#" style="display:none" name="currentPeriod" id="currentPeriod">Current Period?</a>
+		</div>
+		
+		<input type="submit" value="Update"/>
+                </div></form>
+            </div>';
+
 echo '</span><span class="content-primary">';
 echo '  <ul data-role="listview"  data-inset="true">';
 if (sizeof($allStopsTrips) > 0) {

--- a/stopList.php
+++ b/stopList.php
@@ -40,7 +40,6 @@
 		$stops = getStops();
 		include_header("All Stops", "stopList");
 		navbar();
-		timePlaceSettings();
 	}
 	else if (isset($nearby)) {
 		$listType = 'nearby=yes';
@@ -48,7 +47,7 @@
 		trackEvent("Stop Lists", "Stops Nearby", $_SESSION['lat'] . "," . $_SESSION['lon']);
 		navbar();
 		if (!isset($_SESSION['lat']) || !isset($_SESSION['lat']) || $_SESSION['lat'] == "" || $_SESSION['lon'] == "") {
-			timePlaceSettings(true);
+			placeSettings();
 			include_footer();
 			die();
 		}
@@ -65,7 +64,7 @@
 			);
 		}
 		echo staticmap($stopPositions, 0, "iconb", true, true);
-		timePlaceSettings(true);
+		placeSettings();
 		echo '</span><span class="content-primary">';
 	}
 	else if (isset($suburb)) {
@@ -78,7 +77,6 @@
 		$stops = getStops(true, $firstLetter);
 		include_header("Timing Points / Major Stops", "stopList");
 		navbar();
-		timePlaceSettings();
 	}
 	echo '  <ul data-role="listview" data-filter="true" data-inset="true" >';
 	if (!isset($firstLetter) && !isset($suburb) && !isset($nearby)) {

--- a/updatedb.php
+++ b/updatedb.php
@@ -1,6 +1,19 @@
 <?php
+if ( php_sapi_name() == "cli") {
 include ('include/common.inc.php');
 $conn = pg_connect("dbname=transitdata user=postgres password=snmc host=localhost") or die('connection failed');
+$pdconn = new PDO("pgsql:dbname=transitdata;user=postgres;password=snmc;host=localhost");
+
+/*
+	delete from agency;
+	delete from calendar;
+	delete from calendar_dates;
+	delete from routes;
+	delete from shapes;
+	delete from stop_times;
+	delete from stops;
+	delete from trips;
+*/
 // Unzip cbrfeed.zip, import all csv files to database
 $unzip = true;
 $zip = zip_open(dirname(__FILE__) . "/cbrfeed.zip");
@@ -30,8 +43,20 @@
 		echo "Opening $file \n";
 		$line = 0;
 		$handle = fopen($tmpdir . $file, "r");
+		 if ($tablename =="stop_times") {
+			 $stmt = $pdconn->prepare("insert into stop_times (trip_id,stop_id,stop_sequence,arrival_time,departure_time) values(:trip_id, :stop_id, :stop_sequence,:arrival_time,:departure_time);");
+		$stmt->bindParam(':trip_id',$trip_id);
+				$stmt->bindParam(':stop_id',$stop_id);
+						$stmt->bindParam(':stop_sequence',$stop_sequence);
+						$stmt->bindParam(':arrival_time',$time);
+							$stmt->bindParam(':departure_time',$time);
+	}
+
+
 		while (($data = fgetcsv($handle, 1000, ",")) !== FALSE) {
-			if ($line > 0) {
+			if ($line == 0) {
+			
+			} else { 
 				$query = "insert into $tablename values(";
                                 $valueCount = 0;
                                 foreach ($data as $value) {
@@ -43,19 +68,29 @@
 				} else {
                                   $query.= "');";
                                 }
-                                if ($tablename =="stop_times" && $data[1] == "") {
-                                  $query = "insert into $tablename (trip_id,stop_id,stop_sequence) values('{$data[0]}','{$data[3]}','{$data[4]}');";
-                                }
+               if ($tablename =="stop_times") {
+                //                  $query = "insert into $tablename (trip_id,stop_id,stop_sequence) values('{$data[0]}','{$data[3]}','{$data[4]}');";
+                $trip_id=$data[0];
+                $stop_id=$data[3];
+                $stop_sequence=$data[4];
+                $time=($data[1] == "" ? null : $data[1]);
+               }
                                  
 			}
-                        $result = pg_query($conn, $query);
+              if ($tablename =="stop_times") {
+	              $stmt->execute();
+	          }
+              else {
+	              $result = pg_query($conn, $query);
+	          }
 			$line++;
-                        if ($line % 10000 == 0) echo "$line records... \n";
+                        if ($line % 10000 == 0) echo "$line records... ".date('c')."\n";
 		}
 		fclose($handle);
 		echo "Found a total of $line records in $file.\n";
 
 	}
 }
+}
 ?>