Upgrade to jquery.mobile-1.0rc1
--- /dev/null
+++ b/.box
@@ -1,1 +1,5 @@
+shared_writable_dirs:
+ - /labs/tiles
+ - /lib/staticmaplite/cache
+php_extensions: [pgsql, pdo, pdo_pgsql, curl]
--- /dev/null
+++ b/.gitignore
@@ -1,1 +1,9 @@
+/labs/tiles/12
+/labs/tiles/13
+/labs/tiles/14
+/labs/tiles/15
+/labs/tiles/16
+/labs/tiles/17
+/labs/tiles/19
+/nbproject/private/
--- a/about.php
+++ b/about.php
@@ -1,31 +1,53 @@
<?php
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
include ('include/common.inc.php');
include_header("About", "about")
?>
<p>
-Busness Time - An ACT bus timetable webapp<br />
-Based on the maxious-canberra-transit-feed (<a
-href="http://s3-ap-southeast-1.amazonaws.com/busresources/cbrfeed.zip">download</a>,
-last updated <?php
-echo date("F d Y.", @filemtime('cbrfeed.zip')); ?>)<br />
-Source code for the <a
-href="https://github.com/maxious/ACTBus-data">transit
-feed</a> and <a href="https://github.com/maxious/ACTBus-ui">this
-site</a> available from github.<br />
-Uses jQuery Mobile, PHP, PostgreSQL, OpenTripPlanner, OpenLayers, OpenStreetMap, Cloudmade Geocoder and Tile Service<br />
-<br />
-Feedback encouraged; contact maxious@lambdacomplex.org<br />
+ Busness Time - An ACT bus timetable webapp<br />
+ Based on the maxious-canberra-transit-feed (<a
+ href="http://s3-ap-southeast-1.amazonaws.com/busresources/cbrfeed.zip">download</a>,
+ last updated <?php echo date("F d Y.", @filemtime('cbrfeed.zip')); ?>)<br />
+ Source code for the <a
+ href="https://github.com/maxious/ACTBus-data">transit
+ feed</a> and <a href="https://github.com/maxious/ACTBus-ui">this
+ site</a> available from github.<br />
+ Uses jQuery Mobile, PHP, PostgreSQL, OpenTripPlanner, OpenLayers, OpenStreetMap, Cloudmade Geocoder and Tile Service<br />
<br />
-Some icons by Joseph Wain / glyphish.com<br />
-<br />
-<small>Disclaimer: The content of this website is of a general and informative nature. Please check with printed timetables or those available on http://action.act.gov.au before your trip.
-Whilst every effort has been made to ensure the high quality and accuracy of the Site, the Author makes no warranty,
-express or implied concerning the topicality, correctness, completeness or quality of the information, which is provided
-"as is". The Author expressly disclaims all warranties, including but not limited to warranties of fitness for a particular purpose and warranties of merchantability.
-All offers are not binding and without obligation. The Author expressly reserves the right, in his discretion, to suspend,
-change, modify, add or remove portions of the Site and to restrict or terminate the use and accessibility of the Site
-without prior notice. </small>
-<?php
-include_footer();
-?>
+ Feedback encouraged; contact maxious@lambdacomplex.org<br />
+ <br />
+ Some icons by Joseph Wain / glyphish.com<br />
+ Native clients also available for iPhone(<a href="http://itunes.apple.com/au/app/cbrtimetable/id444287349?mt=8">cbrTimetable by Sandor Kolotenko</a>
+ , <a href="http://itunes.apple.com/au/app/act-buses/id376634797?mt=8">ACT Buses by David Sullivan</a>)
+ and Android (<a href="https://market.android.com/details?id=com.action">MyBus 2.0 by Imagine Team</a>)
+ <br />
+ GTFS-realtime API;
+ Alerts and Trip Updates (but only Cancelled or Stop Skipped)
+ Default format binary but can get JSON by adding ?ascii=yes
+ <br />
+ <br />
+ <small>Disclaimer: The content of this website is of a general and informative nature. Please check with printed timetables or those available on http://action.act.gov.au before your trip.
+ Whilst every effort has been made to ensure the high quality and accuracy of the Site, the Author makes no warranty,
+ express or implied concerning the topicality, correctness, completeness or quality of the information, which is provided
+ "as is". The Author expressly disclaims all warranties, including but not limited to warranties of fitness for a particular purpose and warranties of merchantability.
+ All offers are not binding and without obligation. The Author expressly reserves the right, in his discretion, to suspend,
+ change, modify, add or remove portions of the Site and to restrict or terminate the use and accessibility of the Site
+ without prior notice. </small>
+ <?php
+ include_footer();
+ ?>
--- a/aws/awsStartup.sh
+++ b/aws/awsStartup.sh
@@ -5,35 +5,9 @@
#postgres postgres-server php-pg
#http://www.how2forge.org/installing-lighttpd-with-php5-and-mysql-support-on-fedora-12
-cp /root/aws.php /tmp/
-mkdir /var/www/lib/staticmaplite/cache
-chcon -h system_u:object_r:httpd_sys_content_t /var/www
-chcon -R -h root:object_r:httpd_sys_content_t /var/www/*
-chcon -R -t httpd_sys_content_rw_t /var/www/lib/staticmaplite/cache
-chmod -R 777 /var/www/lib/staticmaplite/cache
-chcon -R -t httpd_sys_content_rw_t /var/www/labs/tiles
-chmod -R 777 /var/www/labs/tiles
-wget http://s3-ap-southeast-1.amazonaws.com/busresources/cbrfeed.zip \
--O /var/www/cbrfeed.zip
+sh busuiphp.sh
+sh busuidb.sh
+sh busuiotp.sh
-createdb transitdata
-createlang -d transitdata plpgsql
-psql -d transitdata -f /var/www/lib/postgis.sql
-# curl https://github.com/maxious/ACTBus-ui/raw/master/transitdata.cbrfeed.sql.gz -o transitdata.cbrfeed.sql.gz
-#made with pg_dump transitdata | gzip -c > transitdata.cbrfeed.sql.gz
-gunzip /var/www/transitdata.cbrfeed.sql.gz
-psql -d transitdata -f /var/www/transitdata.cbrfeed.sql
-#createuser transitdata -SDRP
-#password transitdata
-#psql -d transitdata -c \"GRANT SELECT ON TABLE agency,calendar,calendar_dates,routes,stop_times,stops,trips TO transitdata;\"
-php /var/www/updatedb.php
-wget http://s3-ap-southeast-1.amazonaws.com/busresources/Graph.obj \
--O /tmp/Graph.obj
-rm -rfv /usr/share/tomcat6/webapps/opentripplanner*
-wget http://s3-ap-southeast-1.amazonaws.com/busresources/opentripplanner-webapp.war \
--O /usr/share/tomcat6/webapps/opentripplanner-webapp.war
-wget http://s3-ap-southeast-1.amazonaws.com/busresources/opentripplanner-api-webapp.war \
--O /usr/share/tomcat6/webapps/opentripplanner-api-webapp.war
-/etc/init.d/tomcat6 restart
--- /dev/null
+++ b/aws/busuidb.sh
@@ -1,1 +1,14 @@
-
+createdb transitdata
+createlang -d transitdata plpgsql
+psql -d transitdata -f /var/www/lib/postgis.sql
+# curl https://github.com/maxious/ACTBus-ui/raw/master/transitdata.cbrfeed.sql.gz -o transitdata.cbrfeed.sql.gz
+#made with pg_dump transitdata | gzip -c > transitdata.cbrfeed.sql.gz
+gunzip /var/www/transitdata.cbrfeed.sql.gz
+psql -d transitdata -f /var/www/transitdata.cbrfeed.sql
+#createuser transitdata -SDRP
+#password transitdata
+#psql -d transitdata -c "GRANT SELECT ON TABLE agency,calendar,calendar_dates,routes,stop_times,stops,trips TO transitdata;"
+#psql -d transitdata -c "GRANT SELECT,INSERT ON TABLE myway_observations,myway_routes,myway_stops,myway_timingdeltas TO transitdata;"
+#psql -d transitdata -c "GRANT SELECT,INSERT,UPDATE ON TABLE myway_routes,myway_stops TO transitdata;"
+##psql -d transitdata -c "GRANT SELECT ON ALL TABLES IN SCHEMA public TO transitdata;"
+php /var/www/updatedb.php
--- /dev/null
+++ b/aws/busuiotp.sh
@@ -1,1 +1,10 @@
+wget http://s3-ap-southeast-1.amazonaws.com/busresources/Graph.obj \
+-O /tmp/Graph.obj
+/etc/init.d/tomcat6 stop
+rm -rfv /usr/share/tomcat6/webapps/opentripplanner*
+wget http://s3-ap-southeast-1.amazonaws.com/busresources/opentripplanner-webapp.war \
+-O /usr/share/tomcat6/webapps/opentripplanner-webapp.war
+wget http://s3-ap-southeast-1.amazonaws.com/busresources/opentripplanner-api-webapp.war \
+-O /usr/share/tomcat6/webapps/opentripplanner-api-webapp.war
+/etc/init.d/tomcat6 restart
--- /dev/null
+++ b/aws/busuiotp.testing.sh
@@ -1,1 +1,10 @@
+wget http://s3-ap-southeast-1.amazonaws.com/busresources/testing/Graph.obj \
+-O /tmp/Graph.obj
+/etc/init.d/tomcat6 stop
+rm -rfv /usr/share/tomcat6/webapps/opentripplanner*
+wget http://s3-ap-southeast-1.amazonaws.com/busresources/testing/opentripplanner-webapp.war \
+-O /usr/share/tomcat6/webapps/opentripplanner-webapp.war
+wget http://s3-ap-southeast-1.amazonaws.com/busresources/testing/opentripplanner-api-webapp.war \
+-O /usr/share/tomcat6/webapps/opentripplanner-api-webapp.war
+/etc/init.d/tomcat6 restart
--- /dev/null
+++ b/aws/busuiphp.sh
@@ -1,1 +1,12 @@
+cp /root/aws.php /tmp/
+chmod 777 /var/cache/lighttpd/compress/
+chcon -h system_u:object_r:httpd_sys_content_t /var/www
+chcon -R -h root:object_r:httpd_sys_content_t /var/www/*
+
+chcon -R -t httpd_sys_content_rw_t /var/www/labs/tiles
+chmod -R 777 /var/www/labs/tiles
+
+wget http://s3-ap-southeast-1.amazonaws.com/busresources/cbrfeed.zip \
+-O /var/www/cbrfeed.zip
+
--- /dev/null
+++ b/aws/data-sources.xml
@@ -1,1 +1,13 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<beans xmlns="http://www.springframework.org/schema/beans" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance"
+ xsi:schemaLocation="http://www.springframework.org/schema/beans http://www.springframework.org/schema/beans/spring-beans-2.5.xsd">
+ <!-- Single graph -->
+ <import resource="classpath:org/opentripplanner/api/application-context.xml" />
+
+ <bean id="graphBundle" class="org.opentripplanner.model.GraphBundle">
+ <property name="path" value="/tmp/" />
+ </bean>
+
+</beans>
+
Binary files /dev/null and b/css/images/warning.png differ
--- a/css/jquery.mobile-1.0a4.css
+++ /dev/null
@@ -1,1661 +1,1 @@
-/*!
- * jQuery Mobile v1.0a4
- * http://jquerymobile.com/
- *
- * Copyright 2010, jQuery Project
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- */
-/*
-* jQuery Mobile Framework
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.
-* Note: Code is in draft form and is subject to change
-*/
-
-/* A
------------------------------------------------------------------------------------------------------------*/
-
-.ui-bar-a {
- border: 1px solid #2A2A2A;
- background: #111111;
- color: #ffffff;
- font-weight: bold;
- text-shadow: 0 -1px 1px #000000;
- background-image: -moz-linear-gradient(top,
- #3c3c3c,
- #111111);
- background-image: -webkit-gradient(linear,left top,left bottom,
- color-stop(0, #3c3c3c),
- color-stop(1, #111111));
- -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#3c3c3c', EndColorStr='#111111')";
-}
-.ui-bar-a,
-.ui-bar-a input,
-.ui-bar-a select,
-.ui-bar-a textarea,
-.ui-bar-a button {
- font-family: Helvetica, Arial, sans-serif;
-}
-.ui-bar-a .ui-link-inherit {
- color: #fff;
-}
-.ui-bar-a .ui-link {
- color: #7cc4e7;
- font-weight: bold;
-}
-.ui-body-a {
- border: 1px solid #2A2A2A;
- background: #222222;
- color: #fff;
- text-shadow: 0 1px 0 #000;
- font-weight: normal;
- background-image: -moz-linear-gradient(top,
- #666666,
- #222222);
- background-image: -webkit-gradient(linear,left top,left bottom,
- color-stop(0, #666666),
- color-stop(1, #222222));
- -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#666666', EndColorStr='#222222)')";
-}
-.ui-body-a,
-.ui-body-a input,
-.ui-body-a select,
-.ui-body-a textarea,
-.ui-body-a button {
- font-family: Helvetica, Arial, sans-serif;
-}
-.ui-body-a .ui-link-inherit {
- color: #fff;
-}
-.ui-body-a .ui-link {
- color: #2489CE;
- font-weight: bold;
-}
-.ui-br {
- border-bottom: rgb(130,130,130);
- border-bottom: rgba(130,130,130,.3);
- border-bottom-width: 1px;
- border-bottom-style: solid;
-}
-.ui-btn-up-a {
- border: 1px solid #222;
- background: #333333;
- font-weight: bold;
- color: #fff;
- text-shadow: 0 -1px 1px #000;
- background-image: -moz-linear-gradient(top,
- #555555,
- #333333);
- background-image: -webkit-gradient(linear,left top,left bottom,
- color-stop(0, #555555),
- color-stop(1, #333333));
- -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#555555', EndColorStr='#333333')";
-}
-.ui-btn-up-a a.ui-link-inherit {
- color: #fff;
-}
-.ui-btn-hover-a {
- border: 1px solid #000;
- background: #444444;
- font-weight: bold;
- color: #fff;
- text-shadow: 0 -1px 1px #000;
- background-image: -moz-linear-gradient(top,
- #666666,
- #444444);
- background-image: -webkit-gradient(linear,left top,left bottom,
- color-stop(0, #666666),
- color-stop(1, #444444));
- -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#666666', EndColorStr='#444444')";
-}
-.ui-btn-hover-a a.ui-link-inherit {
- color: #fff;
-}
-.ui-btn-down-a {
- border: 1px solid #000;
- background: #3d3d3d;
- font-weight: bold;
- color: #fff;
- text-shadow: 0 -1px 1px #000;
- background-image: -moz-linear-gradient(top,
- #333333,
- #5a5a5a);
- background-image: -webkit-gradient(linear,left top,left bottom,
- color-stop(0, #333333),
- color-stop(1, #5a5a5a));
- -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#333333', EndColorStr='#5a5a5a')";
-}
-.ui-btn-down-a a.ui-link-inherit {
- color: #fff;
-}
-.ui-btn-up-a,
-.ui-btn-hover-a,
-.ui-btn-down-a {
- font-family: Helvetica, Arial, sans-serif;
- text-decoration: none;
-}
-
-
-/* B
------------------------------------------------------------------------------------------------------------*/
-
-.ui-bar-b {
- border: 1px solid #456f9a;
- background: #5e87b0;
- color: #fff;
- font-weight: bold;
- text-shadow: 0 -1px 1px #254f7a;
- background-image: -moz-linear-gradient(top,
- #81a8ce,
- #5e87b0);
- background-image: -webkit-gradient(linear,left top,left bottom,
- color-stop(0, #81a8ce),
- color-stop(1, #5e87b0));
- -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#81a8ce', EndColorStr='#5e87b0')";
-}
-.ui-bar-b,
-.ui-bar-b input,
-.ui-bar-b select,
-.ui-bar-b textarea,
-.ui-bar-b button {
- font-family: Helvetica, Arial, sans-serif;
-}
-.ui-bar-b .ui-link-inherit {
- color: #fff;
-}
-.ui-bar-b .ui-link {
- color: #7cc4e7;
- font-weight: bold;
-}
-
-.ui-body-b {
- border: 1px solid #C6C6C6;
- background: #cccccc;
- color: #333333;
- text-shadow: 0 1px 0 #fff;
- font-weight: normal;
- background-image: -moz-linear-gradient(top,
- #e6e6e6,
- #cccccc);
- background-image: -webkit-gradient(linear,left top,left bottom,
- color-stop(0, #e6e6e6),
- color-stop(1, #cccccc));
- -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#e6e6e6', EndColorStr='#cccccc')";
-}
-.ui-body-b,
-.ui-body-b input,
-.ui-body-b select,
-.ui-body-b textarea,
-.ui-body-b button {
- font-family: Helvetica, Arial, sans-serif;
-}
-.ui-body-b .ui-link-inherit {
- color: #333333;
-}
-.ui-body-b .ui-link {
- color: #2489CE;
- font-weight: bold;
-}
-.ui-btn-up-b {
- border: 1px solid #145072;
- background: #2567ab;
- font-weight: bold;
- color: #fff;
- text-shadow: 0 -1px 1px #145072;
- background-image: -moz-linear-gradient(top,
- #4e89c5,
- #2567ab);
- background-image: -webkit-gradient(linear,left top,left bottom,
- color-stop(0, #5f9cc5),
- color-stop(1, #396b9e));
- -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#4e89c5', EndColorStr='#2567ab')";
-}
-.ui-btn-up-b a.ui-link-inherit {
- color: #fff;
-}
-.ui-btn-hover-b {
- border: 1px solid #00516e;
- background: #4b88b6;
- font-weight: bold;
- color: #fff;
- text-shadow: 0 -1px 1px #014D68;
- background-image: -moz-linear-gradient(top,
- #72b0d4,
- #4b88b6);
- background-image: -webkit-gradient(linear,left top,left bottom,
- color-stop(0, #72b0d4),
- color-stop(1, #4b88b6));
- -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#72b0d4', EndColorStr='#4b88b6')";
-}
-.ui-btn-hover-b a.ui-link-inherit {
- color: #fff;
-}
-.ui-btn-down-b {
- border: 1px solid #225377;
- background: #4e89c5;
- font-weight: bold;
- color: #fff;
- text-shadow: 0 -1px 1px #225377;
- background-image: -moz-linear-gradient(top,
- #396b9e,
- #4e89c5);
- background-image: -webkit-gradient(linear,left top,left bottom,
- color-stop(0, #396b9e),
- color-stop(1, #4e89c5));
- -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#396b9e', EndColorStr='#4e89c5')";
-}
-.ui-btn-down-b a.ui-link-inherit {
- color: #fff;
-}
-.ui-btn-up-b,
-.ui-btn-hover-b,
-.ui-btn-down-b {
- font-family: Helvetica, Arial, sans-serif;
- text-decoration: none;
-}
-
-
-/* C
------------------------------------------------------------------------------------------------------------*/
-
-.ui-bar-c {
- border: 1px solid #B3B3B3;
- background: #e9eaeb;
- color: #3E3E3E;
- font-weight: bold;
- text-shadow: 0 1px 1px #fff;
- background-image: -moz-linear-gradient(top,
- #f0f0f0,
- #e9eaeb);
- background-image: -webkit-gradient(linear,left top,left bottom,
- color-stop(0, #f0f0f0),
- color-stop(1, #e9eaeb));
- -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#f0f0f0', EndColorStr='#e9eaeb')";
-}
-.ui-bar-c,
-.ui-bar-c input,
-.ui-bar-c select,
-.ui-bar-c textarea,
-.ui-bar-c button {
- font-family: Helvetica, Arial, sans-serif;
-}
-.ui-body-c {
- border: 1px solid #B3B3B3;
- color: #333333;
- text-shadow: 0 1px 0 #fff;
- background: #f0f0f0;
- background-image: -moz-linear-gradient(top,
- #eeeeee,
- #dddddd);
- background-image: -webkit-gradient(linear,left top,left bottom,
- color-stop(0, #eeeeee),
- color-stop(1, #dddddd));
- -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#eeeeee', EndColorStr='#dddddd')";
-}
-.ui-body-c,
-.ui-body-c input,
-.ui-body-c select,
-.ui-body-c textarea,
-.ui-body-c button {
- font-family: Helvetica, Arial, sans-serif;
-}
-.ui-body-c .ui-link-inherit {
- color: #333333;
-}
-.ui-body-c .ui-link {
- color: #2489CE;
- font-weight: bold;
-}
-
-.ui-btn-up-c {
- border: 1px solid #ccc;
- background: #eee;
- font-weight: bold;
- color: #444;
- text-shadow: 0 1px 1px #f6f6f6;
- background-image: -moz-linear-gradient(top,
- #fefefe,
- #eeeeee);
- background-image: -webkit-gradient(linear,left top,left bottom,
- color-stop(0, #fdfdfd),
- color-stop(1, #eeeeee));
- -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#fdfdfd', EndColorStr='#eeeeee')";
-}
-.ui-btn-up-c a.ui-link-inherit {
- color: #2F3E46;
-}
-
-.ui-btn-hover-c {
- border: 1px solid #bbb;
- background: #dadada;
- font-weight: bold;
- color: #101010;
- text-shadow: 0 1px 1px #fff;
- background-image: -moz-linear-gradient(top,
- #ededed,
- #dadada);
- background-image: -webkit-gradient(linear,left top,left bottom,
- color-stop(0, #ededed),
- color-stop(1, #dadada));
- -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#ededed', EndColorStr='#dadada')";
-}
-.ui-btn-hover-c a.ui-link-inherit {
- color: #2F3E46;
-}
-.ui-btn-down-c {
- border: 1px solid #808080;
- background: #fdfdfd;
- font-weight: bold;
- color: #111111;
- text-shadow: 0 1px 1px #ffffff;
- background-image: -moz-linear-gradient(top,
- #eeeeee,
- #fdfdfd);
- background-image: -webkit-gradient(linear,left top,left bottom,
- color-stop(0, #eeeeee),
- color-stop(1, #fdfdfd));
- -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#eeeeee', EndColorStr='#fdfdfd')";
-}
-.ui-btn-down-c a.ui-link-inherit {
- color: #2F3E46;
-}
-.ui-btn-up-c,
-.ui-btn-hover-c,
-.ui-btn-down-c {
- font-family: Helvetica, Arial, sans-serif;
- text-decoration: none;
-}
-
-
-/* D
------------------------------------------------------------------------------------------------------------*/
-
-.ui-bar-d {
- border: 1px solid #ccc;
- background: #bbb;
- color: #333;
- text-shadow: 0 1px 0 #eee;
- background-image: -moz-linear-gradient(top,
- #ddd,
- #bbb);
- background-image: -webkit-gradient(linear,left top,left bottom,
- color-stop(0, #ddd),
- color-stop(1, #bbb));
- -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#dddddd', EndColorStr='#bbbbbb')";
-}
-.ui-bar-d,
-.ui-bar-d input,
-.ui-bar-d select,
-.ui-bar-d textarea,
-.ui-bar-d button {
- font-family: Helvetica, Arial, sans-serif;
-}
-.ui-bar-d .ui-link-inherit {
- color: #333;
-}
-.ui-bar-d .ui-link {
- color: #2489CE;
- font-weight: bold;
-}
-.ui-body-d {
- border: 1px solid #ccc;
- color: #333333;
- text-shadow: 0 1px 0 #fff;
- background: #ffffff;
-}
-.ui-body-d,
-.ui-body-d input,
-.ui-body-d select,
-.ui-body-d textarea,
-.ui-body-d button {
- font-family: Helvetica, Arial, sans-serif;
-}
-.ui-body-d .ui-link-inherit {
- color: #333333;
-}
-.ui-body-d .ui-link {
- color: #2489CE;
- font-weight: bold;
-}
-.ui-btn-up-d {
- border: 1px solid #ccc;
- background: #fff;
- font-weight: bold;
- color: #444;
- text-shadow: 0 1px 1px #fff;
-}
-.ui-btn-up-d a.ui-link-inherit {
- color: #333;
-}
-.ui-btn-hover-d {
- border: 1px solid #aaa;
- background: #eeeeee;
- font-weight: bold;
- color: #222;
- cursor: pointer;
- text-shadow: 0 1px 1px #fff;
- background-image: -moz-linear-gradient(top,
- #fdfdfd,
- #eeeeee);
- background-image: -webkit-gradient(linear,left top,left bottom,
- color-stop(0, #fdfdfd),
- color-stop(1, #eeeeee));
- -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#fdfdfd', EndColorStr='#eeeeee')";
-}
-.ui-btn-hover-d a.ui-link-inherit {
- color: #222;
-}
-.ui-btn-down-d {
- border: 1px solid #aaaaaa;
- background: #ffffff;
- font-weight: bold;
- color: #111;
- text-shadow: 0 1px 1px #ffffff;
- background-image: -moz-linear-gradient(top,
- #eeeeee,
- #ffffff);
- background-image: -webkit-gradient(linear,left top,left bottom,
- color-stop(0, #eeeeee),
- color-stop(1, #ffffff));
- -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#eeeeee', EndColorStr='#ffffff')";
-}
-.ui-btn-down-d a.ui-link-inherit {
- border: 1px solid #808080;
- background: #ced0d2;
- font-weight: bold;
- color: #111;
- text-shadow: none;
- background-image: -moz-linear-gradient(top,
- #cccccc,
- #eeeeee);
- background-image: -webkit-gradient(linear,left top,left bottom,
- color-stop(0, #cccccc),
- color-stop(1, #eeeeee));
- -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#cccccc', EndColorStr='#eeeeee')";
-}
-.ui-btn-up-d,
-.ui-btn-hover-d,
-.ui-btn-down-d {
- font-family: Helvetica, Arial, sans-serif;
- text-decoration: none;
-}
-
-
-/* E
------------------------------------------------------------------------------------------------------------*/
-
-.ui-bar-e {
- border: 1px solid #F7C942;
- background: #fadb4e;
- color: #333;
- text-shadow: 0 1px 0 #fff;
- background-image: -moz-linear-gradient(top,
- #fceda7,
- #fadb4e);
- background-image: -webkit-gradient(linear,left top,left bottom,
- color-stop(0, #fceda7),
- color-stop(1, #fadb4e));
- -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#fceda7', EndColorStr='#fadb4e')";
-}
-.ui-bar-e,
-.ui-bar-e input,
-.ui-bar-e select,
-.ui-bar-e textarea,
-.ui-bar-d button {
- font-family: Helvetica, Arial, sans-serif;
-}
-.ui-bar-e .ui-link-inherit {
- color: #333;
-}
-.ui-bar-e .ui-link {
- color: #2489CE;
- font-weight: bold;
-}
-.ui-body-e {
- border: 1px solid #F7C942;
- color: #333333;
- text-shadow: 0 1px 0 #fff;
- background: #faeb9e;
- background-image: -moz-linear-gradient(top,
- #fff,
- #faeb9e);
- background-image: -webkit-gradient(linear,left top,left bottom,
- color-stop(0, #fff),
- color-stop(1, #faeb9e));
- -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#ffffff', EndColorStr='#faeb9e')";
-}
-.ui-body-e,
-.ui-body-e input,
-.ui-body-e select,
-.ui-body-e textarea,
-.ui-body-e button {
- font-family: Helvetica, Arial, sans-serif;
-}
-.ui-body-e .ui-link-inherit {
- color: #333333;
-}
-.ui-body-e .ui-link {
- color: #2489CE;
- font-weight: bold;
-}
-.ui-btn-up-e {
- border: 1px solid #F7C942;
- background: #fadb4e;
- font-weight: bold;
- color: #333;
- text-shadow: 0 1px 1px #fe3;
- text-shadow: 0 1px 0 #fff;
- background-image: -moz-linear-gradient(top,
- #fceda7,
- #fadb4e);
- background-image: -webkit-gradient(linear,left top,left bottom,
- color-stop(0, #fceda7),
- color-stop(1, #fadb4e));
- -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#fceda7', EndColorStr='#fadb4e')";
-}
-.ui-btn-up-e a.ui-link-inherit {
- color: #333;
-}
-.ui-btn-hover-e {
- border: 1px solid #e79952;
- background: #fbe26f;
- font-weight: bold;
- color: #111;
- text-shadow: 0 1px 1px #fff;
- background-image: -moz-linear-gradient(top,
- #fcf0b5,
- #fbe26f);
- background-image: -webkit-gradient(linear,left top,left bottom,
- color-stop(0, #fcf0b5),
- color-stop(1, #fbe26f));
- -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#fcf0b5', EndColorStr='#fbe26f')";
-}
-
-.ui-btn-hover-e a.ui-link-inherit {
- color: #333;
-}
-.ui-btn-down-e {
- border: 1px solid #F7C942;
- background: #fceda7;
- font-weight: bold;
- color: #111;
- text-shadow: 0 1px 1px #ffffff;
- background-image: -moz-linear-gradient(top,
- #fadb4e,
- #fceda7);
- background-image: -webkit-gradient(linear,left top,left bottom,
- color-stop(0, #fadb4e),
- color-stop(1, #fceda7));
- -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#fadb4e', EndColorStr='#fceda7')";
-}
-.ui-btn-down-e a.ui-link-inherit {
- color: #333;
-}
-.ui-btn-up-e,
-.ui-btn-hover-e,
-.ui-btn-down-e {
- font-family: Helvetica, Arial, sans-serif;
- text-decoration: none;
-}
-
-
-/* links within "buttons"
------------------------------------------------------------------------------------------------------------*/
-
-a.ui-link-inherit {
- text-decoration: none !important;
-}
-
-
-/* Active class used as the "on" state across all themes
------------------------------------------------------------------------------------------------------------*/
-
-.ui-btn-active {
- border: 1px solid #155678;
- background: #4596ce;
- font-weight: bold;
- color: #fff;
- cursor: pointer;
- text-shadow: 0 -1px 1px #145072;
- text-decoration: none;
- background-image: -moz-linear-gradient(top,
- #85bae4,
- #5393c5);
- background-image: -webkit-gradient(linear,left top,left bottom,
- color-stop(0, #85bae4),
- color-stop(1, #5393c5));
- -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorStr='#85bae4', EndColorStr='#5393c5')";
- outline: none;
-}
-.ui-btn-active a.ui-link-inherit {
- color: #fff;
-}
-
-
-/* button inner top highlight
------------------------------------------------------------------------------------------------------------*/
-
-.ui-btn-inner {
- border-top: 1px solid #fff;
- border-color: rgba(255,255,255,.3);
-}
-
-
-/* corner rounding classes
------------------------------------------------------------------------------------------------------------*/
-
-.ui-corner-tl {
- -moz-border-radius-topleft: .6em;
- -webkit-border-top-left-radius: .6em;
- border-top-left-radius: .6em;
-}
-.ui-corner-tr {
- -moz-border-radius-topright: .6em;
- -webkit-border-top-right-radius: .6em;
- border-top-right-radius: .6em;
-}
-.ui-corner-bl {
- -moz-border-radius-bottomleft: .6em;
- -webkit-border-bottom-left-radius: .6em;
- border-bottom-left-radius: .6em;
-}
-.ui-corner-br {
- -moz-border-radius-bottomright: .6em;
- -webkit-border-bottom-right-radius: .6em;
- border-bottom-right-radius: .6em;
-}
-.ui-corner-top {
- -moz-border-radius-topleft: .6em;
- -webkit-border-top-left-radius: .6em;
- border-top-left-radius: .6em;
- -moz-border-radius-topright: .6em;
- -webkit-border-top-right-radius: .6em;
- border-top-right-radius: .6em;
-}
-.ui-corner-bottom {
- -moz-border-radius-bottomleft: .6em;
- -webkit-border-bottom-left-radius: .6em;
- border-bottom-left-radius: .6em;
- -moz-border-radius-bottomright: .6em;
- -webkit-border-bottom-right-radius: .6em;
- border-bottom-right-radius: .6em;
- }
-.ui-corner-right {
- -moz-border-radius-topright: .6em;
- -webkit-border-top-right-radius: .6em;
- border-top-right-radius: .6em;
- -moz-border-radius-bottomright: .6em;
- -webkit-border-bottom-right-radius: .6em;
- border-bottom-right-radius: .6em;
-}
-.ui-corner-left {
- -moz-border-radius-topleft: .6em;
- -webkit-border-top-left-radius: .6em;
- border-top-left-radius: .6em;
- -moz-border-radius-bottomleft: .6em;
- -webkit-border-bottom-left-radius: .6em;
- border-bottom-left-radius: .6em;
-}
-.ui-corner-all {
- -moz-border-radius: .6em;
- -webkit-border-radius: .6em;
- border-radius: .6em;
-}
-
-
-
-/* Interaction cues
------------------------------------------------------------------------------------------------------------*/
-.ui-disabled {
- opacity: .3;
-}
-.ui-disabled,
-.ui-disabled a {
- cursor: default !important;
-}
-
-/* Icons
------------------------------------------------------------------------------------------------------------*/
-
-.ui-icon {
- background: #666;
- background: rgba(0,0,0,.4);
- background-image: url(images/icons-18-white.png);
- background-repeat: no-repeat;
- -moz-border-radius: 9px;
- -webkit-border-radius: 9px;
- border-radius: 9px;
-}
-
-
-/* Alt icon color
------------------------------------------------------------------------------------------------------------*/
-
-.ui-icon-alt {
- background: #fff;
- background: rgba(255,255,255,.3);
- background-image: url(images/icons-18-black.png);
- background-repeat: no-repeat;
-}
-
-/* HD/"retina" sprite
------------------------------------------------------------------------------------------------------------*/
-
-@media only screen and (-webkit-min-device-pixel-ratio: 1.5),
- only screen and (min--moz-device-pixel-ratio: 1.5),
- only screen and (min-resolution: 240dpi) {
-
- .ui-icon-plus, .ui-icon-minus, .ui-icon-delete, .ui-icon-arrow-r,
- .ui-icon-arrow-l, .ui-icon-arrow-u, .ui-icon-arrow-d, .ui-icon-check,
- .ui-icon-gear, .ui-icon-refresh, .ui-icon-forward, .ui-icon-back,
- .ui-icon-grid, .ui-icon-star, .ui-icon-alert, .ui-icon-info, .ui-icon-home, .ui-icon-search,
- .ui-icon-checkbox-off, .ui-icon-checkbox-on, .ui-icon-radio-off, .ui-icon-radio-on {
- background-image: url(images/icons-36-white.png);
- -moz-background-size: 776px 18px;
- -o-background-size: 776px 18px;
- -webkit-background-size: 776px 18px;
- background-size: 776px 18px;
- }
- .ui-icon-alt {
- background-image: url(images/icons-36-black.png);
- }
-}
-
-/* plus minus */
-.ui-icon-plus {
- background-position: -0 50%;
-}
-.ui-icon-minus {
- background-position: -36px 50%;
-}
-
-/* delete/close */
-.ui-icon-delete {
- background-position: -72px 50%;
-}
-
-/* arrows */
-.ui-icon-arrow-r {
- background-position: -108px 50%;
-}
-.ui-icon-arrow-l {
- background-position: -144px 50%;
-}
-.ui-icon-arrow-u {
- background-position: -180px 50%;
-}
-.ui-icon-arrow-d {
- background-position: -216px 50%;
-}
-
-/* misc */
-.ui-icon-check {
- background-position: -252px 50%;
-}
-.ui-icon-gear {
- background-position: -288px 50%;
-}
-.ui-icon-refresh {
- background-position: -324px 50%;
-}
-.ui-icon-forward {
- background-position: -360px 50%;
-}
-.ui-icon-back {
- background-position: -396px 50%;
-}
-.ui-icon-grid {
- background-position: -432px 50%;
-}
-.ui-icon-star {
- background-position: -468px 50%;
-}
-.ui-icon-alert {
- background-position: -504px 50%;
-}
-.ui-icon-info {
- background-position: -540px 50%;
-}
-.ui-icon-home {
- background-position: -576px 50%;
-}
-.ui-icon-search {
- background-position: -612px 50%;
-}
-.ui-icon-checkbox-off {
- background-position: -684px 50%;
-}
-.ui-icon-checkbox-on {
- background-position: -648px 50%;
-}
-.ui-icon-radio-off {
- background-position: -756px 50%;
-}
-.ui-icon-radio-on {
- background-position: -720px 50%;
-}
-
-
-/* checks,radios */
-.ui-icon-checkbox-off,
-.ui-icon-checkbox-on,
-.ui-icon-radio-off,
-.ui-icon-radio-on {
- background-color: transparent;
- -moz-border-radius: 0;
- -webkit-border-radius: 0;
- border-radius: 0;
-}
-.ui-icon-searchfield {
- background-image: url(images/icon-search-black.png);
- background-size: 16px 16px;
-}
-
-/* loading icon */
-.ui-icon-loading {
- background-image: url(images/ajax-loader.png);
- width: 40px;
- height: 40px;
- -moz-border-radius: 20px;
- -webkit-border-radius: 20px;
- border-radius: 20px;
- background-size: 35px 35px;
-}
-
-
-/* Button corner classes
------------------------------------------------------------------------------------------------------------*/
-
-.ui-btn-corner-tl {
- -moz-border-radius-topleft: 1em;
- -webkit-border-top-left-radius: 1em;
- border-top-left-radius: 1em;
-}
-.ui-btn-corner-tr {
- -moz-border-radius-topright: 1em;
- -webkit-border-top-right-radius: 1em;
- border-top-right-radius: 1em;
-}
-.ui-btn-corner-bl {
- -moz-border-radius-bottomleft: 1em;
- -webkit-border-bottom-left-radius: 1em;
- border-bottom-left-radius: 1em;
-}
-.ui-btn-corner-br {
- -moz-border-radius-bottomright: 1em;
- -webkit-border-bottom-right-radius: 1em;
- border-bottom-right-radius: 1em;
-}
-.ui-btn-corner-top {
- -moz-border-radius-topleft: 1em;
- -webkit-border-top-left-radius: 1em;
- border-top-left-radius: 1em;
- -moz-border-radius-topright: 1em;
- -webkit-border-top-right-radius: 1em;
- border-top-right-radius: 1em;
-}
-.ui-btn-corner-bottom {
- -moz-border-radius-bottomleft: 1em;
- -webkit-border-bottom-left-radius: 1em;
- border-bottom-left-radius: 1em;
- -moz-border-radius-bottomright: 1em;
- -webkit-border-bottom-right-radius: 1em;
- border-bottom-right-radius: 1em;
-}
-.ui-btn-corner-right {
- -moz-border-radius-topright: 1em;
- -webkit-border-top-right-radius: 1em;
- border-top-right-radius: 1em;
- -moz-border-radius-bottomright: 1em;
- -webkit-border-bottom-right-radius: 1em;
- border-bottom-right-radius: 1em;
-}
-.ui-btn-corner-left {
- -moz-border-radius-topleft: 1em;
- -webkit-border-top-left-radius: 1em;
- border-top-left-radius: 1em;
- -moz-border-radius-bottomleft: 1em;
- -webkit-border-bottom-left-radius: 1em;
- border-bottom-left-radius: 1em;
-}
-.ui-btn-corner-all {
- -moz-border-radius: 1em;
- -webkit-border-radius: 1em;
- border-radius: 1em;
-}
-
-/* radius clip workaround for cleaning up corner trapping */
-.ui-corner-tl,
-.ui-corner-tr,
-.ui-corner-bl,
-.ui-corner-br,
-.ui-corner-top,
-.ui-corner-bottom,
-.ui-corner-right,
-.ui-corner-left,
-.ui-corner-all,
-.ui-btn-corner-tl,
-.ui-btn-corner-tr,
-.ui-btn-corner-bl,
-.ui-btn-corner-br,
-.ui-btn-corner-top,
-.ui-btn-corner-bottom,
-.ui-btn-corner-right,
-.ui-btn-corner-left,
-.ui-btn-corner-all {
- -webkit-background-clip: padding-box;
- -moz-background-clip: padding-box;
- background-clip: padding-box;
-}
-
-/* Overlay / modal
------------------------------------------------------------------------------------------------------------*/
-
-.ui-overlay {
- background: #666;
- opacity: .5;
- filter: Alpha(Opacity=50);
- position: absolute;
- width: 100%;
- height: 100%;
-}
-.ui-overlay-shadow {
- -moz-box-shadow: 0px 0px 12px rgba(0,0,0,.6);
- -webkit-box-shadow: 0px 0px 12px rgba(0,0,0,.6);
- box-shadow: 0px 0px 12px rgba(0,0,0,.6);
-}
-.ui-shadow {
- -moz-box-shadow: 0px 1px 4px rgba(0,0,0,.3);
- -webkit-box-shadow: 0px 1px 4px rgba(0,0,0,.3);
- box-shadow: 0px 1px 4px rgba(0,0,0,.3);
-}
-.ui-bar-a .ui-shadow,
-.ui-bar-b .ui-shadow ,
-.ui-bar-c .ui-shadow {
- -moz-box-shadow: 0px 1px 0 rgba(255,255,255,.3);
- -webkit-box-shadow: 0px 1px 0 rgba(255,255,255,.3);
- box-shadow: 0px 1px 0 rgba(255,255,255,.3);
-}
-.ui-shadow-inset {
- -moz-box-shadow: inset 0px 1px 4px rgba(0,0,0,.2);
- -webkit-box-shadow: inset 0px 1px 4px rgba(0,0,0,.2);
- box-shadow: inset 0px 1px 4px rgba(0,0,0,.2);
-}
-.ui-icon-shadow {
- -moz-box-shadow: 0px 1px 0 rgba(255,255,255,.4);
- -webkit-box-shadow: 0px 1px 0 rgba(255,255,255,.4);
- box-shadow: 0px 1px 0 rgba(255,255,255,.4);
-}
-
-
-/* Focus state - set here for specificity
------------------------------------------------------------------------------------------------------------*/
-
-.ui-focus {
- -moz-box-shadow: 0px 0px 12px #387bbe;
- -webkit-box-shadow: 0px 0px 12px #387bbe;
- box-shadow: 0px 0px 12px #387bbe;
-}
-
-/* unset box shadow in browsers that don't do it right
------------------------------------------------------------------------------------------------------------*/
-
-.ui-mobile-nosupport-boxshadow * {
- -moz-box-shadow: none !important;
- -webkit-box-shadow: none !important;
- box-shadow: none !important;
-}
-
-/* ...and bring back focus */
-.ui-mobile-nosupport-boxshadow .ui-focus {
- outline-width: 2px;
-}/*
-* jQuery Mobile Framework
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.
-* Note: Code is in draft form and is subject to change
-*/
-
-/* some unsets - more probably needed */
-.ui-mobile, .ui-mobile body { height: 100%; }
-.ui-mobile fieldset, .ui-page { padding: 0; margin: 0; }
-.ui-mobile a img, .ui-mobile fieldset { border: 0; }
-
-/* responsive page widths */
-.ui-mobile-viewport { margin: 0; overflow-x: hidden; -webkit-text-size-adjust: none; -ms-text-size-adjust:none; -webkit-tap-highlight-color: rgba(0, 0, 0, 0); }
-
-/* "page" containers - full-screen views, one should always be in view post-pageload */
-.ui-mobile [data-role=page], .ui-mobile [data-role=dialog], .ui-page { top: 0; left: 0; width: 100%; min-height: 100%; position: absolute; display: none; border: 0; }
-.ui-mobile .ui-page-active { display: block; overflow: visible; }
-
-/*orientations from js are available */
-.portrait,
-.portrait .ui-page { min-height: 100%; }
-.landscape,
-.landscape .ui-page { min-height: 100%; }
-
-/* loading screen */
-.ui-loading .ui-mobile-viewport { overflow: hidden !important; }
-.ui-loading .ui-loader { display: block; }
-.ui-loading .ui-page { overflow: hidden; }
-.ui-loader { display: none; position: absolute; opacity: .85; z-index: 10; left: 50%; width: 200px; margin-left: -130px; margin-top: -35px; padding: 10px 30px; }
-.ui-loader h1 { font-size: 15px; text-align: center; }
-.ui-loader .ui-icon { position: static; display: block; opacity: .9; margin: 0 auto; width: 35px; height: 35px; background-color: transparent; }
-
-/*fouc*/
-.ui-mobile-rendering > * { visibility: hidden; }
-
-/*headers, content panels*/
-.ui-bar, .ui-body { position: relative; padding: .4em 15px; overflow: hidden; display: block; clear:both; }
-.ui-bar { font-size: 16px; margin: 0; }
-.ui-bar h1, .ui-bar h2, .ui-bar h3, .ui-bar h4, .ui-bar h5, .ui-bar h6 { margin: 0; padding: 0; font-size: 16px; display: inline-block; }
-
-.ui-header, .ui-footer { display: block; }
-.ui-page .ui-header, .ui-page .ui-footer { position: relative; }
-.ui-header .ui-btn-left { position: absolute; left: 10px; top: .4em; }
-.ui-header .ui-btn-right { position: absolute; right: 10px; top: .4em; }
-.ui-header .ui-title, .ui-footer .ui-title { text-align: center; font-size: 16px; display: block; margin: .6em 90px .8em; padding: 0; text-overflow: ellipsis; overflow: hidden; white-space: nowrap; outline: 0 !important; }
-
-/*content area*/
-.ui-content { border-width: 0; overflow: visible; overflow-x: hidden; padding: 15px; }
-.ui-page-fullscreen .ui-content { padding:0; }
-
-/* icons sizing */
-.ui-icon { width: 18px; height: 18px; }
-
-/* fullscreen class on ui-content div */
-.ui-fullscreen { }
-.ui-fullscreen img { max-width: 100%; }
-
-/* non-js content hiding */
-.ui-nojs { position: absolute; left: -9999px; }
-/*
-* jQuery Mobile Framework
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
-*/
-.spin {
- -webkit-transform: rotate(360deg);
- -webkit-animation-name: spin;
- -webkit-animation-duration: 1s;
- -webkit-animation-iteration-count: infinite;
-}
-@-webkit-keyframes spin {
- from {-webkit-transform: rotate(0deg);}
- to {-webkit-transform: rotate(360deg);}
-}
-
-/* Transitions from jQtouch (with small modifications): http://www.jqtouch.com/
-Built by David Kaneda and maintained by Jonathan Stark.
-*/
-.in, .out {
- -webkit-animation-timing-function: ease-in-out;
- -webkit-animation-duration: 350ms;
-}
-
-.slide.in {
- -webkit-transform: translateX(0);
- -webkit-animation-name: slideinfromright;
-}
-
-.slide.out {
- -webkit-transform: translateX(-100%);
- -webkit-animation-name: slideouttoleft;
-}
-
-.slide.in.reverse {
- -webkit-transform: translateX(0);
- -webkit-animation-name: slideinfromleft;
-}
-
-.slide.out.reverse {
- -webkit-transform: translateX(100%);
- -webkit-animation-name: slideouttoright;
-}
-
-.slideup.in {
- -webkit-transform: translateY(0);
- -webkit-animation-name: slideinfrombottom;
- z-index: 10;
-}
-
-.slideup.out {
- -webkit-animation-name: dontmove;
- z-index: 0;
-}
-
-.slideup.out.reverse {
- -webkit-transform: translateY(100%);
- z-index: 10;
- -webkit-animation-name: slideouttobottom;
-}
-
-.slideup.in.reverse {
- z-index: 0;
- -webkit-animation-name: dontmove;
-}
-.slidedown.in {
- -webkit-transform: translateY(0);
- -webkit-animation-name: slideinfromtop;
- z-index: 10;
-}
-
-.slidedown.out {
- -webkit-animation-name: dontmove;
- z-index: 0;
-}
-
-.slidedown.out.reverse {
- -webkit-transform: translateY(-100%);
- z-index: 10;
- -webkit-animation-name: slideouttotop;
-}
-
-.slidedown.in.reverse {
- z-index: 0;
- -webkit-animation-name: dontmove;
-}
-
-@-webkit-keyframes slideinfromright {
- from { -webkit-transform: translateX(100%); }
- to { -webkit-transform: translateX(0); }
-}
-
-@-webkit-keyframes slideinfromleft {
- from { -webkit-transform: translateX(-100%); }
- to { -webkit-transform: translateX(0); }
-}
-
-@-webkit-keyframes slideouttoleft {
- from { -webkit-transform: translateX(0); }
- to { -webkit-transform: translateX(-100%); }
-}
-
-@-webkit-keyframes slideouttoright {
- from { -webkit-transform: translateX(0); }
- to { -webkit-transform: translateX(100%); }
-}
-
-
-@-webkit-keyframes slideinfromtop {
- from { -webkit-transform: translateY(-100%); }
- to { -webkit-transform: translateY(0); }
-}
-
-@-webkit-keyframes slideinfrombottom {
- from { -webkit-transform: translateY(100%); }
- to { -webkit-transform: translateY(0); }
-}
-
-@-webkit-keyframes slideouttobottom {
- from { -webkit-transform: translateY(0); }
- to { -webkit-transform: translateY(100%); }
-}
-
-@-webkit-keyframes slideouttotop {
- from { -webkit-transform: translateY(0); }
- to { -webkit-transform: translateY(-100%); }
-}
-@-webkit-keyframes fadein {
- from { opacity: 0; }
- to { opacity: 1; }
-}
-
-@-webkit-keyframes fadeout {
- from { opacity: 1; }
- to { opacity: 0; }
-}
-
-.fade.in {
- opacity: 1;
- z-index: 10;
- -webkit-animation-name: fadein;
-}
-.fade.out {
- z-index: 0;
- -webkit-animation-name: fadeout;
-}
-
-/* The properties in this body rule are only necessary for the 'flip' transition.
- * We need specify the perspective to create a projection matrix. This will add
- * some depth as the element flips. The depth number represents the distance of
- * the viewer from the z-plane. According to the CSS3 spec, 1000 is a moderate
- * value.
- */
-.ui-mobile-viewport-perspective {
- -webkit-perspective: 1000;
- position: absolute;
-}
-
-.ui-mobile-viewport-transitioning,
-.ui-mobile-viewport-transitioning .ui-page {
- width: 100%;
- height: 100%;
- overflow: hidden;
-}
-
-.flip {
- -webkit-animation-duration: .65s;
- -webkit-backface-visibility:hidden;
- -webkit-transform:translateX(0); /* Needed to work around an iOS 3.1 bug that causes listview thumbs to disappear when -webkit-visibility:hidden is used. */
-}
-
-.flip.in {
- -webkit-transform: rotateY(0) scale(1);
- -webkit-animation-name: flipinfromleft;
-}
-
-.flip.out {
- -webkit-transform: rotateY(-180deg) scale(.8);
- -webkit-animation-name: flipouttoleft;
-}
-
-/* Shake it all about */
-
-.flip.in.reverse {
- -webkit-transform: rotateY(0) scale(1);
- -webkit-animation-name: flipinfromright;
-}
-
-.flip.out.reverse {
- -webkit-transform: rotateY(180deg) scale(.8);
- -webkit-animation-name: flipouttoright;
-}
-
-@-webkit-keyframes flipinfromright {
- from { -webkit-transform: rotateY(-180deg) scale(.8); }
- to { -webkit-transform: rotateY(0) scale(1); }
-}
-
-@-webkit-keyframes flipinfromleft {
- from { -webkit-transform: rotateY(180deg) scale(.8); }
- to { -webkit-transform: rotateY(0) scale(1); }
-}
-
-@-webkit-keyframes flipouttoleft {
- from { -webkit-transform: rotateY(0) scale(1); }
- to { -webkit-transform: rotateY(-180deg) scale(.8); }
-}
-
-@-webkit-keyframes flipouttoright {
- from { -webkit-transform: rotateY(0) scale(1); }
- to { -webkit-transform: rotateY(180deg) scale(.8); }
-}
-
-
-/* Hackish, but reliable. */
-
-@-webkit-keyframes dontmove {
- from { opacity: 1; }
- to { opacity: 1; }
-}
-
-.pop {
- -webkit-transform-origin: 50% 50%;
-}
-
-.pop.in {
- -webkit-transform: scale(1);
- opacity: 1;
- -webkit-animation-name: popin;
- z-index: 10;
-}
-
-.pop.out.reverse {
- -webkit-transform: scale(.2);
- opacity: 0;
- -webkit-animation-name: popout;
- z-index: 10;
-}
-
-.pop.in.reverse {
- z-index: 0;
- -webkit-animation-name: dontmove;
-}
-
-@-webkit-keyframes popin {
- from {
- -webkit-transform: scale(.2);
- opacity: 0;
- }
- to {
- -webkit-transform: scale(1);
- opacity: 1;
- }
-}
-
-@-webkit-keyframes popout {
- from {
- -webkit-transform: scale(1);
- opacity: 1;
- }
- to {
- -webkit-transform: scale(.2);
- opacity: 0;
- }
-}/*
-* jQuery Mobile Framework
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
-*/
-
-/* content configurations. */
-.ui-grid-a, .ui-grid-b, .ui-grid-c, .ui-grid-d { overflow: hidden; }
-.ui-block-a, .ui-block-b, .ui-block-c, .ui-block-d, .ui-block-e { margin: 0; padding: 0; border: 0; float: left; min-height:1px;}
-
-/* grid solo: 100 - single item fallback */
-.ui-grid-solo .ui-block-a { width: 100%; float: none; }
-
-/* grid a: 50/50 */
-.ui-grid-a .ui-block-a, .ui-grid-a .ui-block-b { width: 50%; }
-.ui-grid-a .ui-block-a { clear: left; }
-
-/* grid b: 33/33/33 */
-.ui-grid-b .ui-block-a, .ui-grid-b .ui-block-b, .ui-grid-b .ui-block-c { width: 33.333%; }
-.ui-grid-b .ui-block-a { clear: left; }
-
-/* grid c: 25/25/25/25 */
-.ui-grid-c .ui-block-a, .ui-grid-c .ui-block-b, .ui-grid-c .ui-block-c, .ui-grid-c .ui-block-d { width: 25%; }
-.ui-grid-c .ui-block-a { clear: left; }
-
-/* grid d: 20/20/20/20/20 */
-.ui-grid-d .ui-block-a, .ui-grid-d .ui-block-b, .ui-grid-d .ui-block-c, .ui-grid-d .ui-block-d, .ui-grid-d .ui-block-e { width: 20%; }
-.ui-grid-d .ui-block-a { clear: left; }
-/*
-* jQuery Mobile Framework
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
-*/
-/* fixed page header & footer configuration */
-.ui-header, .ui-footer, .ui-page-fullscreen .ui-header, .ui-page-fullscreen .ui-footer { position: absolute; overflow: hidden; width: 100%; border-left-width: 0; border-right-width: 0; }
-.ui-header-fixed, .ui-footer-fixed {
- z-index: 1000;
- -webkit-transform: translateZ(0); /* Force header/footer rendering to go through the same rendering pipeline as native page scrolling. */
-}
-.ui-footer-duplicate, .ui-page-fullscreen .ui-fixed-inline { display: none; }
-.ui-page-fullscreen .ui-header, .ui-page-fullscreen .ui-footer { opacity: .9; }
-/*
-* jQuery Mobile Framework
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
-*/
-.ui-navbar { overflow: hidden; }
-.ui-navbar ul, .ui-navbar-expanded ul { list-style:none; padding: 0; margin: 0; position: relative; display: block; border: 0;}
-.ui-navbar-collapsed ul { float: left; width: 75%; margin-right: -2px; }
-.ui-navbar-collapsed .ui-navbar-toggle { float: left; width: 25%; }
-.ui-navbar li.ui-navbar-truncate { position: absolute; left: -9999px; top: -9999px; }
-.ui-navbar li .ui-btn, .ui-navbar .ui-navbar-toggle .ui-btn { display: block; font-size: 12px; text-align: center; margin: 0; border-right-width: 0; }
-.ui-navbar li .ui-btn { margin-right: -1px; }
-.ui-navbar li .ui-btn:last-child { margin-right: 0; }
-.ui-header .ui-navbar li .ui-btn, .ui-header .ui-navbar .ui-navbar-toggle .ui-btn,
-.ui-footer .ui-navbar li .ui-btn, .ui-footer .ui-navbar .ui-navbar-toggle .ui-btn { border-top-width: 0; border-bottom-width: 0; }
-.ui-navbar .ui-btn-inner { padding-left: 2px; padding-right: 2px; }
-.ui-navbar-noicons li .ui-btn .ui-btn-inner, .ui-navbar-noicons .ui-navbar-toggle .ui-btn-inner { padding-top: .8em; padding-bottom: .9em; }
-/*expanded page styles*/
-.ui-navbar-expanded .ui-btn { margin: 0; font-size: 14px; }
-.ui-navbar-expanded .ui-btn-inner { padding-left: 5px; padding-right: 5px; }
-.ui-navbar-expanded .ui-btn-icon-top .ui-btn-inner { padding: 45px 5px 15px; text-align: center; }
-.ui-navbar-expanded .ui-btn-icon-top .ui-icon { top: 15px; }
-.ui-navbar-expanded .ui-btn-icon-bottom .ui-btn-inner { padding: 15px 5px 45px; text-align: center; }
-.ui-navbar-expanded .ui-btn-icon-bottom .ui-icon { bottom: 15px; }
-.ui-navbar-expanded li .ui-btn .ui-btn-inner { min-height: 2.5em; }
-.ui-navbar-expanded .ui-navbar-noicons .ui-btn .ui-btn-inner { padding-top: 1.8em; padding-bottom: 1.9em; }
-/*
-* jQuery Mobile Framework
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
-*/
-.ui-btn { display: block; text-align: center; cursor:pointer; position: relative; margin: .5em 5px; padding: 0; }
-.ui-btn:focus, .ui-btn:active { outline: none; }
-.ui-header .ui-btn, .ui-footer .ui-btn, .ui-bar .ui-btn { display: inline-block; font-size: 13px; margin: 0; }
-.ui-btn-inline { display: inline-block; }
-.ui-btn-inner { padding: .6em 25px; display: block; height: 100%; text-overflow: ellipsis; overflow: hidden; white-space: nowrap; position: relative; }
-.ui-header .ui-btn-inner, .ui-footer .ui-btn-inner, .ui-bar .ui-btn-inner { padding: .4em 8px .5em; }
-.ui-btn-icon-notext { display: inline-block; width: 20px; height: 20px; padding: 2px 1px 2px 3px; text-indent: -9999px; }
-.ui-btn-icon-notext .ui-btn-inner { padding: 0; }
-.ui-btn-icon-notext .ui-btn-text { position: absolute; left: -999px; }
-.ui-btn-icon-left .ui-btn-inner { padding-left: 33px; }
-.ui-header .ui-btn-icon-left .ui-btn-inner,
-.ui-footer .ui-btn-icon-left .ui-btn-inner,
-.ui-bar .ui-btn-icon-left .ui-btn-inner { padding-left: 27px; }
-.ui-btn-icon-right .ui-btn-inner { padding-right: 33px; }
-.ui-header .ui-btn-icon-right .ui-btn-inner,
-.ui-footer .ui-btn-icon-right .ui-btn-inner,
-.ui-bar .ui-btn-icon-right .ui-btn-inner { padding-right: 27px; }
-.ui-btn-icon-top .ui-btn-inner { padding-top: 33px; }
-.ui-header .ui-btn-icon-top .ui-btn-inner,
-.ui-footer .ui-btn-icon-top .ui-btn-inner,
-.ui-bar .ui-btn-icon-top .ui-btn-inner { padding-top: 27px; }
-.ui-btn-icon-bottom .ui-btn-inner { padding-bottom: 33px; }
-.ui-header .ui-btn-icon-bottom .ui-btn-inner,
-.ui-footer .ui-btn-icon-bottom .ui-btn-inner,
-.ui-bar .ui-btn-icon-bottom .ui-btn-inner { padding-bottom: 27px; }
-
-/*btn icon positioning*/
-.ui-btn-icon-notext .ui-icon { display: block; }
-.ui-btn-icon-left .ui-icon, .ui-btn-icon-right .ui-icon { position: absolute; top: 50%; margin-top: -9px; }
-.ui-btn-icon-top .ui-icon, .ui-btn-icon-bottom .ui-icon { position: absolute; left: 50%; margin-left: -9px; }
-.ui-btn-icon-left .ui-icon { left: 10px; }
-.ui-btn-icon-right .ui-icon {right: 10px; }
-.ui-header .ui-btn-icon-left .ui-icon,
-.ui-footer .ui-btn-icon-left .ui-icon,
-.ui-bar .ui-btn-icon-left .ui-icon { left: 4px; }
-.ui-header .ui-btn-icon-right .ui-icon,
-.ui-footer .ui-btn-icon-right .ui-icon,
-.ui-bar .ui-btn-icon-right .ui-icon { right: 4px; }
-.ui-header .ui-btn-icon-top .ui-icon,
-.ui-footer .ui-btn-icon-top .ui-icon,
-.ui-bar .ui-btn-icon-top .ui-icon { top: 4px; }
-.ui-header .ui-btn-icon-bottom .ui-icon,
-.ui-footer .ui-btn-icon-bottom .ui-icon,
-.ui-bar .ui-btn-icon-bottom .ui-icon { bottom: 4px; }
-.ui-btn-icon-top .ui-icon { top: 5px; }
-.ui-btn-icon-bottom .ui-icon { bottom: 5px; }
-/*hiding native button,inputs */
-.ui-btn-hidden { position: absolute; top: 0; left: 0; width: 100%; height: 100%; -webkit-appearance: button; opacity: 0; cursor: pointer; -ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=0)"; filter: alpha(opacity=0); }
-/*
-* jQuery Mobile Framework
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
-*/
-.ui-collapsible-contain { margin: .5em 0; }
-.ui-collapsible-heading { font-size: 16px; display: block; margin: 0 -8px; padding: 0; border-width: 0 0 1px 0; position: relative; }
-.ui-collapsible-heading a { text-align: left; margin: 0; }
-.ui-collapsible-heading a .ui-btn-inner { padding-left: 40px; }
-.ui-collapsible-heading a span.ui-btn { position: absolute; left: 6px; top: 50%; margin: -12px 0 0 0; width: 20px; height: 20px; padding: 1px 0px 1px 2px; text-indent: -9999px; }
-.ui-collapsible-heading a span.ui-btn .ui-btn-inner { padding: 0; }
-.ui-collapsible-heading a span.ui-btn .ui-icon { left: 0; margin-top: -10px; }
-.ui-collapsible-heading-status { position:absolute; left:-9999px; }
-.ui-collapsible-content { display: block; padding: 10px 0 10px 8px; }
-.ui-collapsible-content-collapsed { display: none; }
-
-.ui-collapsible-set { margin: .5em 0; }
-.ui-collapsible-set .ui-collapsible-contain { margin: -1px 0 0; }
-/*
-* jQuery Mobile Framework
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
-*/
-.ui-controlgroup, fieldset.ui-controlgroup { padding: 0; margin: .5em 0 1em; }
-.ui-bar .ui-controlgroup { margin: 0 .3em; }
-.ui-controlgroup-label { font-size: 16px; line-height: 1.4; font-weight: normal; margin: 0 0 .3em; }
-.ui-controlgroup-controls { display: block; width: 95%;}
-.ui-controlgroup li { list-style: none; }
-.ui-controlgroup-vertical .ui-btn,
-.ui-controlgroup-vertical .ui-checkbox, .ui-controlgroup-vertical .ui-radio { margin: 0; border-bottom-width: 0; }
-.ui-controlgroup-vertical .ui-controlgroup-last { border-bottom-width: 1px; }
-.ui-controlgroup-horizontal { padding: 0; }
-.ui-controlgroup-horizontal .ui-btn,
-.ui-controlgroup-horizontal .ui-checkbox, .ui-controlgroup-horizontal .ui-radio { display: inline-block; margin: 0 -5px 0 0; }
-.ui-controlgroup-horizontal .ui-checkbox, .ui-controlgroup-horizontal .ui-radio { display: inline; }
-.ui-controlgroup-horizontal .ui-checkbox .ui-btn, .ui-controlgroup-horizontal .ui-radio .ui-btn,
-.ui-controlgroup-horizontal .ui-checkbox:last-child, .ui-controlgroup-horizontal .ui-radio:last-child { margin-right: 0; }
-.ui-controlgroup-horizontal .ui-controlgroup-last { margin-right: 0; }
-.ui-controlgroup .ui-checkbox label, .ui-controlgroup .ui-radio label { font-size: 16px; }
-/* conflicts with listview..
-.ui-controlgroup .ui-btn-icon-notext { width: 30px; height: 30px; text-indent: -9999px; }
-.ui-controlgroup .ui-btn-icon-notext .ui-btn-inner { padding: 5px 6px 5px 5px; }
-*/
-
-.min-width-480px .ui-controlgroup-label { vertical-align: top; display: inline-block; width: 20%; margin: 0 2% 0 0; }
-.min-width-480px .ui-controlgroup-controls { width: 60%; display: inline-block; } /*
-* jQuery Mobile Framework
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
-*/
-.ui-dialog { min-height: 480px; }
-.ui-dialog .ui-header, .ui-dialog .ui-content, .ui-dialog .ui-footer { margin: 15px; position: relative; }
-.ui-dialog .ui-header, .ui-dialog .ui-footer { z-index: 10; width: auto; }
-.ui-dialog .ui-content, .ui-dialog .ui-footer { margin-top: -15px; }/*
-* jQuery Mobile Framework
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
-*/
-.ui-checkbox, .ui-radio { position:relative; margin: .2em 0 .5em; z-index: 1; }
-.ui-checkbox .ui-btn, .ui-radio .ui-btn { margin: 0; text-align: left; z-index: 2; }
-.ui-checkbox .ui-btn-icon-left .ui-btn-inner,.ui-radio .ui-btn-icon-left .ui-btn-inner { padding-left: 45px; }
-.ui-checkbox .ui-btn-icon-right .ui-btn-inner, .ui-radio .ui-btn-icon-right .ui-btn-inner { padding-right: 45px; }
-.ui-checkbox .ui-btn-icon-left .ui-icon, .ui-radio .ui-btn-icon-left .ui-icon {left: 15px; }
-.ui-checkbox .ui-btn-icon-right .ui-icon, .ui-radio .ui-btn-icon-right .ui-icon {right: 15px; }
-/* input, label positioning */
-.ui-checkbox input,.ui-radio input { position:absolute; left:20px; top:50%; width: 10px; height: 10px; margin:-5px 0 0 0; outline: 0 !important; z-index: 1; }/*
-* jQuery Mobile Framework
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
-*/
-.ui-field-contain { background: none; padding: 1.5em 0; margin: 0; border-bottom-width: 1px; overflow: visible; }
-.ui-field-contain:first-child { border-top-width: 0; }
-.min-width-480px .ui-field-contain { border-width: 0; padding: 0; margin: 1em 0; }/*
-* jQuery Mobile Framework
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
-*/
-.ui-select { display: block; position: relative; }
-.ui-select select { position: absolute; left: -9999px; top: -9999px; }
-.ui-select .ui-btn { overflow: hidden; }
-.ui-select .ui-btn select { cursor: pointer; -webkit-appearance: button; left: 0; top:0; width: 100%; height: 100%; opacity: 0; -ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=0)"; filter: alpha(opacity=0); }
-.ui-select .ui-btn select.ui-select-nativeonly { opacity: 1; }
-
-.ui-select .ui-btn-icon-right .ui-btn-inner { padding-right: 45px; }
-.ui-select .ui-btn-icon-right .ui-icon { right: 15px; }
-
-/* labels */
-label.ui-select { font-size: 16px; line-height: 1.4; font-weight: normal; margin: 0 0 .3em; display: block; }
-
-/*listbox*/
-.ui-select .ui-btn-text, .ui-selectmenu .ui-btn-text { display: inline-block; min-height: 1em; }
-.ui-select .ui-btn-text { text-overflow: ellipsis; overflow: hidden; display: block;}
-
-.ui-selectmenu { position: absolute; padding: 0; z-index: 100 !important; width: 80%; max-width: 350px; padding: 6px; }
-.ui-selectmenu .ui-listview { margin: 0; }
-.ui-selectmenu .ui-btn.ui-li-divider { cursor: default; }
-.ui-selectmenu-hidden { top: -9999px; left: -9999px; }
-.ui-selectmenu-screen { position: absolute; top: 0; left: 0; width: 100%; height: 100%; z-index: 99; }
-.ui-screen-hidden, .ui-selectmenu-list .ui-li .ui-icon { display: none; }
-.ui-selectmenu-list .ui-li .ui-icon { display: block; }
-.ui-li.ui-selectmenu-placeholder { display: none; }
-.ui-selectmenu .ui-header .ui-title { margin: 0.6em 46px 0.8em; }
-
-.min-width-480px label.ui-select { display: inline-block; width: 20%; margin: 0 2% 0 0; }
-.min-width-480px .ui-select { width: 60%; display: inline-block; }
-
-/* when no placeholder is defined in a multiple select, the header height doesn't even extend past the close button. this shim's content in there */
-.ui-selectmenu .ui-header h1:after { content: '.'; visibility: hidden; }/*
-* jQuery Mobile Framework
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
-*/
-label.ui-input-text { font-size: 16px; line-height: 1.4; display: block; font-weight: normal; margin: 0 0 .3em; }
-input.ui-input-text, textarea.ui-input-text { background-image: none; padding: .4em; line-height: 1.4; font-size: 16px; display: block; width: 95%; }
-input.ui-input-text { -webkit-appearance: none; }
-textarea.ui-input-text { height: 50px; -webkit-transition: height 200ms linear; -moz-transition: height 200ms linear; -o-transition: height 200ms linear; transition: height 200ms linear; }
-.ui-input-search { padding: 0 30px; width: 77%; background-position: 8px 50%; background-repeat: no-repeat; position: relative; }
-.ui-input-search input.ui-input-text { border: none; width: 98%; padding: .4em 0; margin: 0; display: block; background: transparent none; outline: 0 !important; }
-.ui-input-search .ui-input-clear { position: absolute; right: 0; top: 50%; margin-top: -14px; }
-.ui-input-search .ui-input-clear-hidden { display: none; }
-
-/* orientation adjustments - incomplete!*/
-.min-width-480px label.ui-input-text { vertical-align: top; }
-.min-width-480px label.ui-input-text { display: inline-block; width: 20%; margin: 0 2% 0 0; }
-.min-width-480px input.ui-input-text,
-.min-width-480px textarea.ui-input-text,
-.min-width-480px .ui-input-search { width: 60%; display: inline-block; }
-.min-width-480px .ui-input-search { width: 50%; }
-.min-width-480px .ui-input-search input.ui-input-text { width: 98%; /*echos rule from above*/ }
-/*
-* jQuery Mobile Framework
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
-*/
-.ui-listview { margin: 0; counter-reset: listnumbering; }
-.ui-content .ui-listview { margin: -15px; }
-.ui-content .ui-listview-inset { margin: 1em 0; }
-.ui-listview, .ui-li { list-style:none; padding:0; }
-.ui-li, .ui-li.ui-field-contain { display: block; margin:0; position: relative; overflow: visible; text-align: left; border-width: 0; border-top-width: 1px; }
-.ui-li .ui-btn-text a.ui-link-inherit { text-overflow: ellipsis; overflow: hidden; white-space: nowrap; }
-.ui-li-divider, .ui-li-static { padding: .5em 15px; font-size: 14px; font-weight: bold; }
-.ui-li-divider { counter-reset: listnumbering; }
-ol.ui-listview .ui-link-inherit:before, ol.ui-listview .ui-li-static:before, .ui-li-dec { font-size: .8em; display: inline-block; padding-right: .3em; font-weight: normal;counter-increment: listnumbering; content: counter(listnumbering) ". "; }
-ol.ui-listview .ui-li-jsnumbering:before { content: "" !important; } /* to avoid chance of duplication */
-.ui-listview-inset .ui-li { border-right-width: 1px; border-left-width: 1px; }
-.ui-li:last-child, .ui-li.ui-field-contain:last-child { border-bottom-width: 1px; }
-.ui-li>.ui-btn-inner { display: block; position: relative; padding: 0; }
-.ui-li .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li { padding: .7em 75px .7em 15px; display: block; }
-.ui-li-has-thumb .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li-has-thumb { min-height: 60px; padding-left: 100px; }
-.ui-li-has-icon .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li-has-icon { min-height: 20px; padding-left: 40px; }
-.ui-li-heading { font-size: 16px; font-weight: bold; display: block; margin: .6em 0; text-overflow: ellipsis; overflow: hidden; white-space: nowrap; }
-.ui-li-desc { font-size: 12px; font-weight: normal; display: block; margin: -.5em 0 .6em; text-overflow: ellipsis; overflow: hidden; white-space: nowrap; }
-.ui-li-thumb, .ui-li-icon { position: absolute; left: 1px; top: 0; max-height: 80px; max-width: 80px; }
-.ui-li-icon { max-height: 40px; max-width: 40px; left: 10px; top: .9em; }
-.ui-li-thumb, .ui-li-icon, .ui-li-content { float: left; margin-right: 10px; }
-
-.ui-li-aside { float: right; width: 50%; text-align: right; margin: .3em 0; }
-.min-width-480px .ui-li-aside { width: 45%; }
-.ui-li-divider { cursor: default; }
-.ui-li-has-alt .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li-has-alt { padding-right: 95px; }
-.ui-li-count { position: absolute; font-size: 11px; font-weight: bold; padding: .2em .5em; top: 50%; margin-top: -.9em; right: 38px; }
-.ui-li-divider .ui-li-count, .ui-li-static .ui-li-count { right: 10px; }
-.ui-li-has-alt .ui-li-count { right: 55px; }
-.ui-li-link-alt { position: absolute; width: 40px; height: 100%; border-width: 0; border-left-width: 1px; top: 0; right: 0; margin: 0; padding: 0; }
-.ui-li-link-alt .ui-btn { overflow: hidden; position: absolute; right: 8px; top: 50%; margin: -11px 0 0 0; border-bottom-width: 1px; }
-.ui-li-link-alt .ui-btn-inner { padding: 0; position: static; }
-.ui-li-link-alt .ui-btn .ui-icon { right: 50%; margin-right: -9px; }
-
-.ui-listview-filter { border-width: 0; overflow: hidden; margin: -15px -15px 15px -15px }
-.ui-listview-filter .ui-input-search { margin: 5px; width: auto; display: block; }
-
-.ui-listview-filter-inset { margin: -15px -5px -15px -5px; background: transparent; }
-
-/* Odd iPad positioning issue. */
-@media only screen and (min-device-width: 768px) and (max-device-width: 1024px) {
- .ui-li .ui-btn-text { overflow: visible; }
-}/*
-* jQuery Mobile Framework
-* Copyright (c) jQuery Project
-* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
-*/
-label.ui-slider { display: block; }
-input.ui-slider-input, .min-width-480px input.ui-slider-input { display: inline-block; width: 50px; }
-select.ui-slider-switch { display: none; }
-div.ui-slider { position: relative; display: inline-block; overflow: visible; height: 15px; padding: 0; margin: 0 2% 0 20px; top: 4px; width: 66%; }
-a.ui-slider-handle { position: absolute; z-index: 10; top: 50%; width: 28px; height: 28px; margin-top: -15px; margin-left: -15px; }
-a.ui-slider-handle .ui-btn-inner { padding-left: 0; padding-right: 0; }
-.min-width-480px label.ui-slider { display: inline-block; width: 20%; margin: 0 2% 0 0; }
-.min-width-480px div.ui-slider { width: 45%; }
-
-div.ui-slider-switch { height: 32px; overflow: hidden; margin-left: 0; }
-div.ui-slider-inneroffset { margin-left: 50%; position: absolute; top: 1px; height: 100%; width: 50%; }
-div.ui-slider-handle-snapping { -webkit-transition: left 100ms linear; }
-div.ui-slider-labelbg { position: absolute; top:0; margin: 0; border-width: 0; }
-div.ui-slider-switch div.ui-slider-labelbg-a { width: 60%; height: 100%; left: 0; }
-div.ui-slider-switch div.ui-slider-labelbg-b { width: 60%; height: 100%; right: 0; }
-.ui-slider-switch-a div.ui-slider-labelbg-a, .ui-slider-switch-b div.ui-slider-labelbg-b { z-index: -1; }
-.ui-slider-switch-a div.ui-slider-labelbg-b, .ui-slider-switch-b div.ui-slider-labelbg-a { z-index: 0; }
-
-div.ui-slider-switch a.ui-slider-handle { z-index: 20; width: 101%; height: 32px; margin-top: -18px; margin-left: -101%; }
-span.ui-slider-label { width: 100%; position: absolute;height: 32px; font-size: 16px; text-align: center; line-height: 2; background: none; border-color: transparent; }
-span.ui-slider-label-a { left: -100%; margin-right: -1px }
-span.ui-slider-label-b { right: -100%; margin-left: -1px }
-
--- /dev/null
+++ b/css/jquery.mobile-1.0rc1.css
@@ -1,1 +1,1750 @@
-
+/*!
+ * jQuery Mobile v1.0rc1
+ * http://jquerymobile.com/
+ *
+ * Copyright 2010, jQuery Project
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ */
+/*!
+* jQuery Mobile Framework
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.
+*/
+
+/* Swatches */
+
+/* A
+-----------------------------------------------------------------------------------------------------------*/
+
+.ui-bar-a {
+ border: 1px solid #2A2A2A /*{a-bar-border}*/;
+ background: #111111 /*{a-bar-background-color}*/;
+ color: #ffffff /*{a-bar-color}*/;
+ font-weight: bold;
+ text-shadow: 0 /*{a-bar-shadow-x}*/ -1px /*{a-bar-shadow-y}*/ 1px /*{a-bar-shadow-radius}*/ #000000 /*{a-bar-shadow-color}*/;
+ background-image: -webkit-gradient(linear, left top, left bottom, from(#3c3c3c /*{a-bar-background-start}*/), to(#111 /*{a-bar-background-end}*/)); /* Saf4+, Chrome */
+ background-image: -webkit-linear-gradient(top, #3c3c3c /*{a-bar-background-start}*/, #111 /*{a-bar-background-end}*/); /* Chrome 10+, Saf5.1+ */
+ background-image: -moz-linear-gradient(top, #3c3c3c /*{a-bar-background-start}*/, #111 /*{a-bar-background-end}*/); /* FF3.6 */
+ background-image: -ms-linear-gradient(top, #3c3c3c /*{a-bar-background-start}*/, #111 /*{a-bar-background-end}*/); /* IE10 */
+ background-image: -o-linear-gradient(top, #3c3c3c /*{a-bar-background-start}*/, #111 /*{a-bar-background-end}*/); /* Opera 11.10+ */
+ background-image: linear-gradient(top, #3c3c3c /*{a-bar-background-start}*/, #111 /*{a-bar-background-end}*/);
+}
+.ui-bar-a,
+.ui-bar-a input,
+.ui-bar-a select,
+.ui-bar-a textarea,
+.ui-bar-a button {
+ font-family: Helvetica, Arial, sans-serif /*{a-bar-font}*/;
+}
+.ui-bar-a .ui-link-inherit {
+ color: #fff /*{a-bar-color}*/;
+}
+.ui-bar-a .ui-link {
+ color: #7cc4e7 /*{global-link-color}*/;
+ font-weight: bold;
+}
+.ui-body-a {
+ border: 1px solid #2A2A2A /*{a-body-border}*/;
+ background: #222222 /*{a-body-background-color}*/;
+ color: #fff /*{a-body-color}*/;
+ text-shadow: 0 /*{a-body-shadow-x}*/ 1px /*{a-body-shadow-y}*/ 0 /*{a-body-shadow-radius}*/ #000 /*{a-body-shadow-color}*/;
+ font-weight: normal;
+ background-image: -webkit-gradient(linear, left top, left bottom, from(#666 /*{a-body-background-start}*/), to(#222 /*{a-body-background-end}*/)); /* Saf4+, Chrome */
+ background-image: -webkit-linear-gradient(top, #666 /*{a-body-background-start}*/, #222 /*{a-body-background-end}*/); /* Chrome 10+, Saf5.1+ */
+ background-image: -moz-linear-gradient(top, #666 /*{a-body-background-start}*/, #222 /*{a-body-background-end}*/); /* FF3.6 */
+ background-image: -ms-linear-gradient(top, #666 /*{a-body-background-start}*/, #222 /*{a-body-background-end}*/); /* IE10 */
+ background-image: -o-linear-gradient(top, #666 /*{a-body-background-start}*/, #222 /*{a-body-background-end}*/); /* Opera 11.10+ */
+ background-image: linear-gradient(top, #666 /*{a-body-background-start}*/, #222 /*{a-body-background-end}*/);
+}
+.ui-body-a,
+.ui-body-a input,
+.ui-body-a select,
+.ui-body-a textarea,
+.ui-body-a button {
+ font-family: Helvetica, Arial, sans-serif /*{a-body-font}*/;
+}
+.ui-body-a .ui-link-inherit {
+ color: #fff /*{a-body-color}*/;
+}
+.ui-body-a .ui-link {
+ color: #2489CE /*{global-link-color}*/;
+ font-weight: bold;
+}
+.ui-br {
+ border-bottom: rgb(130,130,130);
+ border-bottom: rgba(130,130,130,.3);
+ border-bottom-width: 1px;
+ border-bottom-style: solid;
+}
+.ui-btn-up-a {
+ border: 1px solid #222 /*{a-bup-border}*/;
+ background: #333333 /*{a-bup-background-color}*/;
+ font-weight: bold;
+ color: #fff /*{a-bup-color}*/;
+ text-shadow: 0 /*{a-bup-shadow-x}*/ -1px /*{a-bup-shadow-y}*/ 1px /*{a-bup-shadow-radius}*/ #000 /*{a-bup-shadow-color}*/;
+ background-image: -webkit-gradient(linear, left top, left bottom, from(#555 /*{a-bup-background-start}*/), to(#333 /*{a-bup-background-end}*/)); /* Saf4+, Chrome */
+ background-image: -webkit-linear-gradient(top, #555 /*{a-bup-background-start}*/, #333 /*{a-bup-background-end}*/); /* Chrome 10+, Saf5.1+ */
+ background-image: -moz-linear-gradient(top, #555 /*{a-bup-background-start}*/, #333 /*{a-bup-background-end}*/); /* FF3.6 */
+ background-image: -ms-linear-gradient(top, #555 /*{a-bup-background-start}*/, #333 /*{a-bup-background-end}*/); /* IE10 */
+ background-image: -o-linear-gradient(top, #555 /*{a-bup-background-start}*/, #333 /*{a-bup-background-end}*/); /* Opera 11.10+ */
+ background-image: linear-gradient(top, #555 /*{a-bup-background-start}*/, #333 /*{a-bup-background-end}*/);
+}
+.ui-btn-up-a a.ui-link-inherit {
+ color: #fff /*{a-bup-color}*/;
+}
+.ui-btn-hover-a {
+ border: 1px solid #000 /*{a-bhover-border}*/;
+ background: #444444 /*{a-bhover-background-color}*/;
+ font-weight: bold;
+ color: #fff /*{a-bhover-color}*/;
+ text-shadow: 0 /*{a-bhover-shadow-x}*/ -1px /*{a-bhover-shadow-y}*/ 1px /*{a-bhover-shadow-radius}*/ #000 /*{a-bhover-shadow-color}*/;
+ background-image: -webkit-gradient(linear, left top, left bottom, from(#666 /*{a-bhover-background-start}*/), to(#444 /*{a-bhover-background-end}*/)); /* Saf4+, Chrome */
+ background-image: -webkit-linear-gradient(top, #666 /*{a-bhover-background-start}*/, #444 /*{a-bhover-background-end}*/); /* Chrome 10+, Saf5.1+ */
+ background-image: -moz-linear-gradient(top, #666 /*{a-bhover-background-start}*/, #444 /*{a-bhover-background-end}*/); /* FF3.6 */
+ background-image: -ms-linear-gradient(top, #666 /*{a-bhover-background-start}*/, #444 /*{a-bhover-background-end}*/); /* IE10 */
+ background-image: -o-linear-gradient(top, #666 /*{a-bhover-background-start}*/, #444 /*{a-bhover-background-end}*/); /* Opera 11.10+ */
+ background-image: linear-gradient(top, #666 /*{a-bhover-background-start}*/, #444 /*{a-bhover-background-end}*/);
+}
+.ui-btn-hover-a a.ui-link-inherit {
+ color: #fff /*{a-bhover-color}*/;
+}
+.ui-btn-down-a {
+ border: 1px solid #000 /*{a-bdown-border}*/;
+ background: #3d3d3d /*{a-bdown-background-color}*/;
+ font-weight: bold;
+ color: #fff /*{a-bdown-color}*/;
+ text-shadow: 0 /*{a-bdown-shadow-x}*/ -1px /*{a-bdown-shadow-y}*/ 1px /*{a-bdown-shadow-radius}*/ #000 /*{a-bdown-shadow-color}*/;
+ background-image: -webkit-gradient(linear, left top, left bottom, from(#333 /*{a-bdown-background-start}*/), to(#5a5a5a /*{a-bdown-background-end}*/)); /* Saf4+, Chrome */
+ background-image: -webkit-linear-gradient(top, #333 /*{a-bdown-background-start}*/, #5a5a5a /*{a-bdown-background-end}*/); /* Chrome 10+, Saf5.1+ */
+ background-image: -moz-linear-gradient(top, #333 /*{a-bdown-background-start}*/, #5a5a5a /*{a-bdown-background-end}*/); /* FF3.6 */
+ background-image: -ms-linear-gradient(top, #333 /*{a-bdown-background-start}*/, #5a5a5a /*{a-bdown-background-end}*/); /* IE10 */
+ background-image: -o-linear-gradient(top, #333 /*{a-bdown-background-start}*/, #5a5a5a /*{a-bdown-background-end}*/); /* Opera 11.10+ */
+ background-image: linear-gradient(top, #333 /*{a-bdown-background-start}*/, #5a5a5a /*{a-bdown-background-end}*/);
+}
+.ui-btn-down-a a.ui-link-inherit {
+ color: #fff /*{a-bdown-color}*/;
+}
+.ui-btn-up-a,
+.ui-btn-hover-a,
+.ui-btn-down-a {
+ font-family: Helvetica, Arial, sans-serif /*{a-button-font}*/;
+ text-decoration: none;
+}
+
+
+/* B
+-----------------------------------------------------------------------------------------------------------*/
+
+.ui-bar-b {
+ border: 1px solid #456f9a /*{b-bar-border}*/;
+ background: #5e87b0 /*{b-bar-background-color}*/;
+ color: #fff /*{b-bar-color}*/;
+ font-weight: bold;
+ text-shadow: 0 /*{b-bar-shadow-x}*/ -1px /*{b-bar-shadow-y}*/ 1px /*{b-bar-shadow-radius}*/ #254f7a /*{b-bar-shadow-color}*/;
+ background-image: -webkit-gradient(linear, left top, left bottom, from(#81a8ce /*{b-bar-background-start}*/), to(#5e87b0 /*{b-bar-background-end}*/)); /* Saf4+, Chrome */
+ background-image: -webkit-linear-gradient(top, #81a8ce /*{b-bar-background-start}*/, #5e87b0 /*{b-bar-background-end}*/); /* Chrome 10+, Saf5.1+ */
+ background-image: -moz-linear-gradient(top, #81a8ce /*{b-bar-background-start}*/, #5e87b0 /*{b-bar-background-end}*/); /* FF3.6 */
+ background-image: -ms-linear-gradient(top, #81a8ce /*{b-bar-background-start}*/, #5e87b0 /*{b-bar-background-end}*/); /* IE10 */
+ background-image: -o-linear-gradient(top, #81a8ce /*{b-bar-background-start}*/, #5e87b0 /*{b-bar-background-end}*/); /* Opera 11.10+ */
+ background-image: linear-gradient(top, #81a8ce /*{b-bar-background-start}*/, #5e87b0 /*{b-bar-background-end}*/);
+}
+.ui-bar-b,
+.ui-bar-b input,
+.ui-bar-b select,
+.ui-bar-b textarea,
+.ui-bar-b button {
+ font-family: Helvetica, Arial, sans-serif /*{b-bar-font}*/;
+}
+.ui-bar-b .ui-link-inherit {
+ color: #fff /*{b-bar-color}*/;
+}
+.ui-bar-b .ui-link {
+ color: #7cc4e7 /*{global-link-color}*/;
+ font-weight: bold;
+}
+
+.ui-body-b {
+ border: 1px solid #C6C6C6 /*{b-body-border}*/;
+ background: #cccccc /*{b-body-background-color}*/;
+ color: #333333 /*{b-body-color}*/;
+ text-shadow: 0 /*{b-body-shadow-x}*/ 1px /*{b-body-shadow-y}*/ 0 /*{b-body-shadow-radius}*/ #fff /*{b-body-shadow-color}*/;
+ font-weight: normal;
+ background-image: -webkit-gradient(linear, left top, left bottom, from(#e6e6e6 /*{b-body-background-start}*/), to(#ccc /*{b-body-background-end}*/)); /* Saf4+, Chrome */
+ background-image: -webkit-linear-gradient(top, #e6e6e6 /*{b-body-background-start}*/, #ccc /*{b-body-background-end}*/); /* Chrome 10+, Saf5.1+ */
+ background-image: -moz-linear-gradient(top, #e6e6e6 /*{b-body-background-start}*/, #ccc /*{b-body-background-end}*/); /* FF3.6 */
+ background-image: -ms-linear-gradient(top, #e6e6e6 /*{b-body-background-start}*/, #ccc /*{b-body-background-end}*/); /* IE10 */
+ background-image: -o-linear-gradient(top, #e6e6e6 /*{b-body-background-start}*/, #ccc /*{b-body-background-end}*/); /* Opera 11.10+ */
+ background-image: linear-gradient(top, #e6e6e6 /*{b-body-background-start}*/, #ccc /*{b-body-background-end}*/);
+}
+.ui-body-b,
+.ui-body-b input,
+.ui-body-b select,
+.ui-body-b textarea,
+.ui-body-b button {
+ font-family: Helvetica, Arial, sans-serif /*{b-body-font}*/;
+}
+.ui-body-b .ui-link-inherit {
+ color: #333333 /*{b-body-color}*/;
+}
+.ui-body-b .ui-link {
+ color: #2489CE /*{global-link-color}*/;
+ font-weight: bold;
+}
+.ui-btn-up-b {
+ border: 1px solid #145072 /*{b-bup-border}*/;
+ background: #2567ab /*{b-bup-background-color}*/;
+ font-weight: bold;
+ color: #fff /*{b-bup-color}*/;
+ text-shadow: 0 /*{b-bup-shadow-x}*/ -1px /*{b-bup-shadow-y}*/ 1px /*{b-bup-shadow-radius}*/ #145072 /*{b-bup-shadow-color}*/;
+ background-image: -webkit-gradient(linear, left top, left bottom, from(#5f9cc5 /*{b-bup-background-start}*/), to(#396b9e /*{b-bup-background-end}*/)); /* Saf4+, Chrome */
+ background-image: -webkit-linear-gradient(top, #5f9cc5 /*{b-bup-background-start}*/, #396b9e /*{b-bup-background-end}*/); /* Chrome 10+, Saf5.1+ */
+ background-image: -moz-linear-gradient(top, #5f9cc5 /*{b-bup-background-start}*/, #396b9e /*{b-bup-background-end}*/); /* FF3.6 */
+ background-image: -ms-linear-gradient(top, #5f9cc5 /*{b-bup-background-start}*/, #396b9e /*{b-bup-background-end}*/); /* IE10 */
+ background-image: -o-linear-gradient(top, #5f9cc5 /*{b-bup-background-start}*/, #396b9e /*{b-bup-background-end}*/); /* Opera 11.10+ */
+ background-image: linear-gradient(top, #5f9cc5 /*{b-bup-background-start}*/, #396b9e /*{b-bup-background-end}*/);
+}
+.ui-btn-up-b a.ui-link-inherit {
+ color: #fff /*{b-bup-color}*/;
+}
+.ui-btn-hover-b {
+ border: 1px solid #00516e /*{b-bhover-border}*/;
+ background: #4b88b6 /*{b-bhover-background-color}*/;
+ font-weight: bold;
+ color: #fff /*{b-bhover-color}*/;
+ text-shadow: 0 /*{b-bhover-shadow-x}*/ -1px /*{b-bhover-shadow-y}*/ 1px /*{b-bhover-shadow-radius}*/ #014D68 /*{b-bhover-shadow-color}*/;
+ background-image: -webkit-gradient(linear, left top, left bottom, from(#72b0d4 /*{b-bhover-background-start}*/), to(#4b88b6 /*{b-bhover-background-end}*/)); /* Saf4+, Chrome */
+ background-image: -webkit-linear-gradient(top, #72b0d4 /*{b-bhover-background-start}*/, #4b88b6 /*{b-bhover-background-end}*/); /* Chrome 10+, Saf5.1+ */
+ background-image: -moz-linear-gradient(top, #72b0d4 /*{b-bhover-background-start}*/, #4b88b6 /*{b-bhover-background-end}*/); /* FF3.6 */
+ background-image: -ms-linear-gradient(top, #72b0d4 /*{b-bhover-background-start}*/, #4b88b6 /*{b-bhover-background-end}*/); /* IE10 */
+ background-image: -o-linear-gradient(top, #72b0d4 /*{b-bhover-background-start}*/, #4b88b6 /*{b-bhover-background-end}*/); /* Opera 11.10+ */
+ background-image: linear-gradient(top, #72b0d4 /*{b-bhover-background-start}*/, #4b88b6 /*{b-bhover-background-end}*/);
+}
+.ui-btn-hover-b a.ui-link-inherit {
+ color: #fff /*{b-bhover-color}*/;
+}
+.ui-btn-down-b {
+ border: 1px solid #225377 /*{b-bdown-border}*/;
+ background: #4e89c5 /*{b-bdown-background-color}*/;
+ font-weight: bold;
+ color: #fff /*{b-bdown-color}*/;
+ text-shadow: 0 /*{b-bdown-shadow-x}*/ -1px /*{b-bdown-shadow-y}*/ 1px /*{b-bdown-shadow-radius}*/ #225377 /*{b-bdown-shadow-color}*/;
+ background-image: -webkit-gradient(linear, left top, left bottom, from(#396b9e /*{b-bdown-background-start}*/), to(#4e89c5 /*{b-bdown-background-end}*/)); /* Saf4+, Chrome */
+ background-image: -webkit-linear-gradient(top, #396b9e /*{b-bdown-background-start}*/, #4e89c5 /*{b-bdown-background-end}*/); /* Chrome 10+, Saf5.1+ */
+ background-image: -moz-linear-gradient(top, #396b9e /*{b-bdown-background-start}*/, #4e89c5 /*{b-bdown-background-end}*/); /* FF3.6 */
+ background-image: -ms-linear-gradient(top, #396b9e /*{b-bdown-background-start}*/, #4e89c5 /*{b-bdown-background-end}*/); /* IE10 */
+ background-image: -o-linear-gradient(top, #396b9e /*{b-bdown-background-start}*/, #4e89c5 /*{b-bdown-background-end}*/); /* Opera 11.10+ */
+ background-image: linear-gradient(top, #396b9e /*{b-bdown-background-start}*/, #4e89c5 /*{b-bdown-background-end}*/);
+}
+.ui-btn-down-b a.ui-link-inherit {
+ color: #fff /*{b-bdown-color}*/;
+}
+.ui-btn-up-b,
+.ui-btn-hover-b,
+.ui-btn-down-b {
+ font-family: Helvetica, Arial, sans-serif /*{b-button-font}*/;
+ text-decoration: none;
+}
+
+
+/* C
+-----------------------------------------------------------------------------------------------------------*/
+
+.ui-bar-c {
+ border: 1px solid #B3B3B3 /*{c-bar-border}*/;
+ background: #e9eaeb /*{c-bar-background-color}*/;
+ color: #3E3E3E /*{c-bar-color}*/;
+ font-weight: bold;
+ text-shadow: 0 /*{c-bar-shadow-x}*/ 1px /*{c-bar-shadow-y}*/ 1px /*{c-bar-shadow-radius}*/ #fff /*{c-bar-shadow-color}*/;
+ background-image: -webkit-gradient(linear, left top, left bottom, from(#f0f0f0 /*{c-bar-background-start}*/), to(#e9eaeb /*{c-bar-background-end}*/)); /* Saf4+, Chrome */
+ background-image: -webkit-linear-gradient(top, #f0f0f0 /*{c-bar-background-start}*/, #e9eaeb /*{c-bar-background-end}*/); /* Chrome 10+, Saf5.1+ */
+ background-image: -moz-linear-gradient(top, #f0f0f0 /*{c-bar-background-start}*/, #e9eaeb /*{c-bar-background-end}*/); /* FF3.6 */
+ background-image: -ms-linear-gradient(top, #f0f0f0 /*{c-bar-background-start}*/, #e9eaeb /*{c-bar-background-end}*/); /* IE10 */
+ background-image: -o-linear-gradient(top, #f0f0f0 /*{c-bar-background-start}*/, #e9eaeb /*{c-bar-background-end}*/); /* Opera 11.10+ */
+ background-image: linear-gradient(top, #f0f0f0 /*{c-bar-background-start}*/, #e9eaeb /*{c-bar-background-end}*/);
+}
+
+.ui-bar-c .ui-link {
+ color: #2489CE /*{global-link-color}*/;
+ font-weight: bold;
+}
+
+.ui-bar-c,
+.ui-bar-c input,
+.ui-bar-c select,
+.ui-bar-c textarea,
+.ui-bar-c button {
+ font-family: Helvetica, Arial, sans-serif /*{c-bar-font}*/;
+}
+.ui-body-c {
+ border: 1px solid #B3B3B3 /*{c-body-border}*/;
+ color: #333333 /*{c-body-color}*/;
+ text-shadow: 0 /*{c-body-shadow-x}*/ 1px /*{c-body-shadow-y}*/ 0 /*{c-body-shadow-radius}*/ #fff /*{c-body-shadow-color}*/;
+ background: #f0f0f0 /*{c-body-background-color}*/;
+ background-image: -webkit-gradient(linear, left top, left bottom, from(#eee /*{c-body-background-start}*/), to(#ddd /*{c-body-background-end}*/)); /* Saf4+, Chrome */
+ background-image: -webkit-linear-gradient(top, #eee /*{c-body-background-start}*/, #ddd /*{c-body-background-end}*/); /* Chrome 10+, Saf5.1+ */
+ background-image: -moz-linear-gradient(top, #eee /*{c-body-background-start}*/, #ddd /*{c-body-background-end}*/); /* FF3.6 */
+ background-image: -ms-linear-gradient(top, #eee /*{c-body-background-start}*/, #ddd /*{c-body-background-end}*/); /* IE10 */
+ background-image: -o-linear-gradient(top, #eee /*{c-body-background-start}*/, #ddd /*{c-body-background-end}*/); /* Opera 11.10+ */
+ background-image: linear-gradient(top, #eee /*{c-body-background-start}*/, #ddd /*{c-body-background-end}*/);
+}
+.ui-body-c,
+.ui-body-c input,
+.ui-body-c select,
+.ui-body-c textarea,
+.ui-body-c button {
+ font-family: Helvetica, Arial, sans-serif /*{c-body-font}*/;
+}
+.ui-body-c .ui-link-inherit {
+ color: #333333 /*{c-body-color}*/;
+}
+.ui-body-c .ui-link {
+ color: #2489CE /*{global-link-color}*/;
+ font-weight: bold;
+}
+
+.ui-btn-up-c {
+ border: 1px solid #ccc /*{c-bup-border}*/;
+ background: #eee /*{c-bup-background-color}*/;
+ font-weight: bold;
+ color: #444 /*{c-bup-color}*/;
+ text-shadow: 0 /*{c-bup-shadow-x}*/ 1px /*{c-bup-shadow-y}*/ 1px /*{c-bup-shadow-radius}*/ #f6f6f6 /*{c-bup-shadow-color}*/;
+ background-image: -webkit-gradient(linear, left top, left bottom, from(#fdfdfd /*{c-bup-background-start}*/), to(#eee /*{c-bup-background-end}*/)); /* Saf4+, Chrome */
+ background-image: -webkit-linear-gradient(top, #fdfdfd /*{c-bup-background-start}*/, #eee /*{c-bup-background-end}*/); /* Chrome 10+, Saf5.1+ */
+ background-image: -moz-linear-gradient(top, #fdfdfd /*{c-bup-background-start}*/, #eee /*{c-bup-background-end}*/); /* FF3.6 */
+ background-image: -ms-linear-gradient(top, #fdfdfd /*{c-bup-background-start}*/, #eee /*{c-bup-background-end}*/); /* IE10 */
+ background-image: -o-linear-gradient(top, #fdfdfd /*{c-bup-background-start}*/, #eee /*{c-bup-background-end}*/); /* Opera 11.10+ */
+ background-image: linear-gradient(top, #fdfdfd /*{c-bup-background-start}*/, #eee /*{c-bup-background-end}*/);
+}
+.ui-btn-up-c a.ui-link-inherit {
+ color: #2F3E46 /*{c-bup-color}*/;
+}
+
+.ui-btn-hover-c {
+ border: 1px solid #bbb /*{c-bhover-border}*/;
+ background: #dadada /*{c-bhover-background-color}*/;
+ font-weight: bold;
+ color: #101010 /*{c-bhover-color}*/;
+ text-shadow: 0 /*{c-bhover-shadow-x}*/ 1px /*{c-bhover-shadow-y}*/ 1px /*{c-bhover-shadow-radius}*/ #fff /*{c-bhover-shadow-color}*/;
+ background-image: -webkit-gradient(linear, left top, left bottom, from(#ededed /*{c-bhover-background-start}*/), to(#dadada /*{c-bhover-background-end}*/)); /* Saf4+, Chrome */
+ background-image: -webkit-linear-gradient(top, #ededed /*{c-bhover-background-start}*/, #dadada /*{c-bhover-background-end}*/); /* Chrome 10+, Saf5.1+ */
+ background-image: -moz-linear-gradient(top, #ededed /*{c-bhover-background-start}*/, #dadada /*{c-bhover-background-end}*/); /* FF3.6 */
+ background-image: -ms-linear-gradient(top, #ededed /*{c-bhover-background-start}*/, #dadada /*{c-bhover-background-end}*/); /* IE10 */
+ background-image: -o-linear-gradient(top, #ededed /*{c-bhover-background-start}*/, #dadada /*{c-bhover-background-end}*/); /* Opera 11.10+ */
+ background-image: linear-gradient(top, #ededed /*{c-bhover-background-start}*/, #dadada /*{c-bhover-background-end}*/);
+}
+.ui-btn-hover-c a.ui-link-inherit {
+ color: #2F3E46 /*{c-bhover-color}*/;
+}
+.ui-btn-down-c {
+ border: 1px solid #808080 /*{c-bdown-border}*/;
+ background: #fdfdfd /*{c-bdown-background-color}*/;
+ font-weight: bold;
+ color: #111111 /*{c-bdown-color}*/;
+ text-shadow: 0 /*{c-bdown-shadow-x}*/ 1px /*{c-bdown-shadow-y}*/ 1px /*{c-bdown-shadow-radius}*/ #ffffff /*{c-bdown-shadow-color}*/;
+ background-image: -webkit-gradient(linear, left top, left bottom, from(#eee /*{c-bdown-background-start}*/), to(#fdfdfd /*{c-bdown-background-end}*/)); /* Saf4+, Chrome */
+ background-image: -webkit-linear-gradient(top, #eee /*{c-bdown-background-start}*/, #fdfdfd /*{c-bdown-background-end}*/); /* Chrome 10+, Saf5.1+ */
+ background-image: -moz-linear-gradient(top, #eee /*{c-bdown-background-start}*/, #fdfdfd /*{c-bdown-background-end}*/); /* FF3.6 */
+ background-image: -ms-linear-gradient(top, #eee /*{c-bdown-background-start}*/, #fdfdfd /*{c-bdown-background-end}*/); /* IE10 */
+ background-image: -o-linear-gradient(top, #eee /*{c-bdown-background-start}*/, #fdfdfd /*{c-bdown-background-end}*/); /* Opera 11.10+ */
+ background-image: linear-gradient(top, #eee /*{c-bdown-background-start}*/, #fdfdfd /*{c-bdown-background-end}*/);
+}
+.ui-btn-down-c a.ui-link-inherit {
+ color: #2F3E46 /*{c-bdown-color}*/;
+}
+.ui-btn-up-c,
+.ui-btn-hover-c,
+.ui-btn-down-c {
+ font-family: Helvetica, Arial, sans-serif /*{c-button-font}*/;
+ text-decoration: none;
+}
+
+
+/* D
+-----------------------------------------------------------------------------------------------------------*/
+
+.ui-bar-d {
+ border: 1px solid #ccc /*{d-bar-border}*/;
+ background: #bbb /*{d-bar-background-color}*/;
+ color: #333 /*{d-bar-color}*/;
+ text-shadow: 0 /*{d-bar-shadow-x}*/ 1px /*{d-bar-shadow-y}*/ 0 /*{d-bar-shadow-radius}*/ #eee /*{d-bar-shadow-color}*/;
+ background-image: -webkit-gradient(linear, left top, left bottom, from(#ddd /*{d-bar-background-start}*/), to(#bbb /*{d-bar-background-end}*/)); /* Saf4+, Chrome */
+ background-image: -webkit-linear-gradient(top, #ddd /*{d-bar-background-start}*/, #bbb /*{d-bar-background-end}*/); /* Chrome 10+, Saf5.1+ */
+ background-image: -moz-linear-gradient(top, #ddd /*{d-bar-background-start}*/, #bbb /*{d-bar-background-end}*/); /* FF3.6 */
+ background-image: -ms-linear-gradient(top, #ddd /*{d-bar-background-start}*/, #bbb /*{d-bar-background-end}*/); /* IE10 */
+ background-image: -o-linear-gradient(top, #ddd /*{d-bar-background-start}*/, #bbb /*{d-bar-background-end}*/); /* Opera 11.10+ */
+ background-image: linear-gradient(top, #ddd /*{d-bar-background-start}*/, #bbb /*{d-bar-background-end}*/);
+}
+.ui-bar-d,
+.ui-bar-d input,
+.ui-bar-d select,
+.ui-bar-d textarea,
+.ui-bar-d button {
+ font-family: Helvetica, Arial, sans-serif /*{d-bar-font}*/;
+}
+.ui-bar-d .ui-link-inherit {
+ color: #333 /*{d-bar-color}*/;
+}
+.ui-bar-d .ui-link {
+ color: #2489CE /*{global-link-color}*/;
+ font-weight: bold;
+}
+.ui-body-d {
+ border: 1px solid #ccc /*{d-body-border}*/;
+ color: #333333 /*{d-body-color}*/;
+ text-shadow: 0 /*{d-body-shadow-x}*/ 1px /*{d-body-shadow-y}*/ 0 /*{d-body-shadow-radius}*/ #fff /*{d-body-shadow-color}*/;
+ background: #ffffff /*{d-body-background-color}*/;
+ background-image: -webkit-gradient(linear, left top, left bottom, from(#fff), to(#fff /*{d-body-background-end}*/)); /* Saf4+, Chrome */
+ background-image: -webkit-linear-gradient(top, #fff /*{d-body-background-start}*/, #fff /*{d-body-background-end}*/); /* Chrome 10+, Saf5.1+ */
+ background-image: -moz-linear-gradient(top, #fff /*{d-body-background-start}*/, #fff /*{d-body-background-end}*/); /* FF3.6 */
+ background-image: -ms-linear-gradient(top, #fff /*{d-body-background-start}*/, #fff /*{d-body-background-end}*/); /* IE10 */
+ background-image: -o-linear-gradient(top, #fff /*{d-body-background-start}*/, #fff /*{d-body-background-end}*/); /* Opera 11.10+ */
+ background-image: linear-gradient(top, #fff /*{d-body-background-start}*/, #fff /*{d-body-background-end}*/);
+}
+.ui-body-d,
+.ui-body-d input,
+.ui-body-d select,
+.ui-body-d textarea,
+.ui-body-d button {
+ font-family: Helvetica, Arial, sans-serif /*{d-body-font}*/;
+}
+.ui-body-d .ui-link-inherit {
+ color: #333333 /*{d-body-color}*/;
+}
+.ui-body-d .ui-link {
+ color: #2489CE /*{global-link-color}*/;
+ font-weight: bold;
+}
+.ui-btn-up-d {
+ border: 1px solid #ccc /*{d-bup-border}*/;
+ background: #fff /*{d-bup-background-color}*/;
+ font-weight: bold;
+ color: #444 /*{d-bup-color}*/;
+ text-shadow: 0 /*{d-bup-shadow-x}*/ 1px /*{d-bup-shadow-y}*/ 1px /*{d-bup-shadow-radius}*/ #fff /*{d-bup-shadow-color}*/;
+ background-image: -webkit-gradient(linear, left top, left bottom, from(#fff), to(#fff /*{d-bup-background-end}*/)); /* Saf4+, Chrome */
+ background-image: -webkit-linear-gradient(top, #fff /*{d-bup-background-start}*/, #fff /*{d-bup-background-end}*/); /* Chrome 10+, Saf5.1+ */
+ background-image: -moz-linear-gradient(top, #fff /*{d-bup-background-start}*/, #fff /*{d-bup-background-end}*/); /* FF3.6 */
+ background-image: -ms-linear-gradient(top, #fff /*{d-bup-background-start}*/, #fff /*{d-bup-background-end}*/); /* IE10 */
+ background-image: -o-linear-gradient(top, #fff /*{d-bup-background-start}*/, #fff /*{d-bup-background-end}*/); /* Opera 11.10+ */
+ background-image: linear-gradient(top, #fff /*{d-bup-background-start}*/, #fff /*{d-bup-background-end}*/);
+}
+.ui-btn-up-d a.ui-link-inherit {
+ color: #333 /*{d-bup-color}*/;
+}
+.ui-btn-hover-d {
+ border: 1px solid #aaa /*{d-bhover-border}*/;
+ background: #eeeeee /*{d-bhover-background-color}*/;
+ font-weight: bold;
+ color: #222 /*{d-bhover-color}*/;
+ cursor: pointer;
+ text-shadow: 0 /*{d-bhover-shadow-x}*/ 1px /*{d-bhover-shadow-y}*/ 1px /*{d-bhover-shadow-radius}*/ #fff /*{d-bhover-shadow-color}*/;
+ background-image: -webkit-gradient(linear, left top, left bottom, from(#fdfdfd), to(#eee /*{d-bhover-background-end}*/)); /* Saf4+, Chrome */
+ background-image: -webkit-linear-gradient(top, #fdfdfd /*{d-bhover-background-start}*/, #eee /*{d-bhover-background-end}*/); /* Chrome 10+, Saf5.1+ */
+ background-image: -moz-linear-gradient(top, #fdfdfd /*{d-bhover-background-start}*/, #eee /*{d-bhover-background-end}*/); /* FF3.6 */
+ background-image: -ms-linear-gradient(top, #fdfdfd /*{d-bhover-background-start}*/, #eee /*{d-bhover-background-end}*/); /* IE10 */
+ background-image: -o-linear-gradient(top, #fdfdfd /*{d-bhover-background-start}*/, #eee /*{d-bhover-background-end}*/); /* Opera 11.10+ */
+ background-image: linear-gradient(top, #fdfdfd /*{d-bhover-background-start}*/, #eee /*{d-bhover-background-end}*/);
+}
+.ui-btn-hover-d a.ui-link-inherit {
+ color: #222 /*{d-bhover-color}*/;
+}
+.ui-btn-down-d {
+ border: 1px solid #aaaaaa /*{d-bdown-border}*/;
+ background: #ffffff /*{d-bdown-background-color}*/;
+ font-weight: bold;
+ color: #111 /*{d-bdown-color}*/;
+ text-shadow: 0 /*{d-bdown-shadow-x}*/ 1px /*{d-bdown-shadow-y}*/ 1px /*{d-bdown-shadow-radius}*/ #ffffff /*{d-bdown-shadow-color}*/;
+ background-image: -webkit-gradient(linear, left top, left bottom, from(#eee /*{d-bdown-background-start}*/), to(#fff /*{d-bdown-background-end}*/)); /* Saf4+, Chrome */
+ background-image: -webkit-linear-gradient(top, #eee /*{d-bdown-background-start}*/, #fff /*{d-bdown-background-end}*/); /* Chrome 10+, Saf5.1+ */
+ background-image: -moz-linear-gradient(top, #eee /*{d-bdown-background-start}*/, #fff /*{d-bdown-background-end}*/); /* FF3.6 */
+ background-image: -ms-linear-gradient(top, #eee /*{d-bdown-background-start}*/, #fff /*{d-bdown-background-end}*/); /* IE10 */
+ background-image: -o-linear-gradient(top, #eee /*{d-bdown-background-start}*/, #fff /*{d-bdown-background-end}*/); /* Opera 11.10+ */
+ background-image: linear-gradient(top, #eee /*{d-bdown-background-start}*/, #fff /*{d-bdown-background-end}*/);
+}
+.ui-btn-down-d a.ui-link-inherit {
+ color: #111 /*{d-bdown-color}*/;
+}
+.ui-btn-up-d,
+.ui-btn-hover-d,
+.ui-btn-down-d {
+ font-family: Helvetica, Arial, sans-serif /*{d-button-font}*/;
+ text-decoration: none;
+}
+
+
+/* E
+-----------------------------------------------------------------------------------------------------------*/
+
+.ui-bar-e {
+ border: 1px solid #F7C942 /*{e-bar-border}*/;
+ background: #fadb4e /*{e-bar-background-color}*/;
+ color: #333 /*{e-bar-color}*/;
+ text-shadow: 0 /*{e-bar-shadow-x}*/ 1px /*{e-bar-shadow-y}*/ 0 /*{e-bar-shadow-radius}*/ #fff /*{e-bar-shadow-color}*/;
+ background-image: -webkit-gradient(linear, left top, left bottom, from(#fceda7 /*{e-bar-background-start}*/), to(#fadb4e /*{e-bar-background-end}*/)); /* Saf4+, Chrome */
+ background-image: -webkit-linear-gradient(top, #fceda7 /*{e-bar-background-start}*/, #fadb4e /*{e-bar-background-end}*/); /* Chrome 10+, Saf5.1+ */
+ background-image: -moz-linear-gradient(top, #fceda7 /*{e-bar-background-start}*/, #fadb4e /*{e-bar-background-end}*/); /* FF3.6 */
+ background-image: -ms-linear-gradient(top, #fceda7 /*{e-bar-background-start}*/, #fadb4e /*{e-bar-background-end}*/); /* IE10 */
+ background-image: -o-linear-gradient(top, #fceda7 /*{e-bar-background-start}*/, #fadb4e /*{e-bar-background-end}*/); /* Opera 11.10+ */
+ background-image: linear-gradient(top, #fceda7 /*{e-bar-background-start}*/, #fadb4e /*{e-bar-background-end}*/);
+}
+.ui-bar-e,
+.ui-bar-e input,
+.ui-bar-e select,
+.ui-bar-e textarea,
+.ui-bar-e button {
+ font-family: Helvetica, Arial, sans-serif /*{e-bar-font}*/;
+}
+.ui-bar-e .ui-link-inherit {
+ color: #333 /*{e-bar-color}*/;
+}
+.ui-bar-e .ui-link {
+ color: #2489CE /*{global-link-color}*/;
+ font-weight: bold;
+}
+.ui-body-e {
+ border: 1px solid #F7C942 /*{e-body-border}*/;
+ color: #333333 /*{e-body-color}*/;
+ text-shadow: 0 /*{e-body-shadow-x}*/ 1px /*{e-body-shadow-y}*/ 0 /*{e-body-shadow-radius}*/ #fff /*{e-body-shadow-color}*/;
+ background: #faeb9e /*{e-body-background-color}*/;
+ background-image: -webkit-gradient(linear, left top, left bottom, from(#fff /*{e-body-background-start}*/), to(#faeb9e /*{e-body-background-end}*/)); /* Saf4+, Chrome */
+ background-image: -webkit-linear-gradient(top, #fff /*{e-body-background-start}*/, #faeb9e /*{e-body-background-end}*/); /* Chrome 10+, Saf5.1+ */
+ background-image: -moz-linear-gradient(top, #fff /*{e-body-background-start}*/, #faeb9e /*{e-body-background-end}*/); /* FF3.6 */
+ background-image: -ms-linear-gradient(top, #fff /*{e-body-background-start}*/, #faeb9e /*{e-body-background-end}*/); /* IE10 */
+ background-image: -o-linear-gradient(top, #fff /*{e-body-background-start}*/, #faeb9e /*{e-body-background-end}*/); /* Opera 11.10+ */
+ background-image: linear-gradient(top, #fff /*{e-body-background-start}*/, #faeb9e /*{e-body-background-end}*/);
+}
+.ui-body-e,
+.ui-body-e input,
+.ui-body-e select,
+.ui-body-e textarea,
+.ui-body-e button {
+ font-family: Helvetica, Arial, sans-serif /*{e-body-font}*/;
+}
+.ui-body-e .ui-link-inherit {
+ color: #333333 /*{e-body-color}*/;
+}
+.ui-body-e .ui-link {
+ color: #2489CE /*{global-link-color}*/;
+ font-weight: bold;
+}
+.ui-btn-up-e {
+ border: 1px solid #F7C942 /*{e-bup-border}*/;
+ background: #fadb4e /*{e-bup-background-color}*/;
+ font-weight: bold;
+ color: #333 /*{e-bup-color}*/;
+ text-shadow: 0 /*{e-bup-shadow-x}*/ 1px /*{e-bup-shadow-y}*/ 0 /*{e-bup-shadow-radius}*/ #fff /*{e-bup-shadow-color}*/;
+ background-image: -webkit-gradient(linear, left top, left bottom, from(#fceda7 /*{e-bup-background-start}*/), to(#fadb4e /*{e-bup-background-end}*/)); /* Saf4+, Chrome */
+ background-image: -webkit-linear-gradient(top, #fceda7 /*{e-bup-background-start}*/, #fadb4e /*{e-bup-background-end}*/); /* Chrome 10+, Saf5.1+ */
+ background-image: -moz-linear-gradient(top, #fceda7 /*{e-bup-background-start}*/, #fadb4e /*{e-bup-background-end}*/); /* FF3.6 */
+ background-image: -ms-linear-gradient(top, #fceda7 /*{e-bup-background-start}*/, #fadb4e /*{e-bup-background-end}*/); /* IE10 */
+ background-image: -o-linear-gradient(top, #fceda7 /*{e-bup-background-start}*/, #fadb4e /*{e-bup-background-end}*/); /* Opera 11.10+ */
+ background-image: linear-gradient(top, #fceda7 /*{e-bup-background-start}*/, #fadb4e /*{e-bup-background-end}*/);
+}
+.ui-btn-up-e a.ui-link-inherit {
+ color: #333 /*{e-bup-color}*/;
+}
+.ui-btn-hover-e {
+ border: 1px solid #e79952 /*{e-bhover-border}*/;
+ background: #fbe26f /*{e-bhover-background-color}*/;
+ font-weight: bold;
+ color: #111 /*{e-bhover-color}*/;
+ text-shadow: 0 /*{e-bhover-shadow-x}*/ 1px /*{e-bhover-shadow-y}*/ 1px /*{e-bhover-shadow-radius}*/ #fff /*{e-bhover-shadow-color}*/;
+ background-image: -webkit-gradient(linear, left top, left bottom, from(#fcf0b5 /*{e-bhover-background-start}*/), to(#fbe26f /*{e-bhover-background-end}*/)); /* Saf4+, Chrome */
+ background-image: -webkit-linear-gradient(top, #fcf0b5 /*{e-bhover-background-start}*/, #fbe26f /*{e-bhover-background-end}*/); /* Chrome 10+, Saf5.1+ */
+ background-image: -moz-linear-gradient(top, #fcf0b5 /*{e-bhover-background-start}*/, #fbe26f /*{e-bhover-background-end}*/); /* FF3.6 */
+ background-image: -ms-linear-gradient(top, #fcf0b5 /*{e-bhover-background-start}*/, #fbe26f /*{e-bhover-background-end}*/); /* IE10 */
+ background-image: -o-linear-gradient(top, #fcf0b5 /*{e-bhover-background-start}*/, #fbe26f /*{e-bhover-background-end}*/); /* Opera 11.10+ */
+ background-image: linear-gradient(top, #fcf0b5 /*{e-bhover-background-start}*/, #fbe26f /*{e-bhover-background-end}*/);
+}
+
+.ui-btn-hover-e a.ui-link-inherit {
+ color: #333 /*{e-bhover-color}*/;
+}
+.ui-btn-down-e {
+ border: 1px solid #F7C942 /*{e-bdown-border}*/;
+ background: #fceda7 /*{e-bdown-background-color}*/;
+ font-weight: bold;
+ color: #111 /*{e-bdown-color}*/;
+ text-shadow: 0 /*{e-bdown-shadow-x}*/ 1px /*{e-bdown-shadow-y}*/ 1px /*{e-bdown-shadow-radius}*/ #ffffff /*{e-bdown-shadow-color}*/;
+ background-image: -webkit-gradient(linear, left top, left bottom, from(#fadb4e /*{e-bdown-background-start}*/), to(#fceda7 /*{e-bdown-background-end}*/)); /* Saf4+, Chrome */
+ background-image: -webkit-linear-gradient(top, #fadb4e /*{e-bdown-background-start}*/, #fceda7 /*{e-bdown-background-end}*/); /* Chrome 10+, Saf5.1+ */
+ background-image: -moz-linear-gradient(top, #fadb4e /*{e-bdown-background-start}*/, #fceda7 /*{e-bdown-background-end}*/); /* FF3.6 */
+ background-image: -ms-linear-gradient(top, #fadb4e /*{e-bdown-background-start}*/, #fceda7 /*{e-bdown-background-end}*/); /* IE10 */
+ background-image: -o-linear-gradient(top, #fadb4e /*{e-bdown-background-start}*/, #fceda7 /*{e-bdown-background-end}*/); /* Opera 11.10+ */
+ background-image: linear-gradient(top, #fadb4e /*{e-bdown-background-start}*/, #fceda7 /*{e-bdown-background-end}*/);
+}
+.ui-btn-down-e a.ui-link-inherit {
+ color: #333 /*{e-bdown-color}*/;
+}
+.ui-btn-up-e,
+.ui-btn-hover-e,
+.ui-btn-down-e {
+ font-family: Helvetica, Arial, sans-serif /*{e-button-font}*/;
+ text-decoration: none;
+}
+
+/* Structure */
+
+/* links within "buttons"
+-----------------------------------------------------------------------------------------------------------*/
+
+a.ui-link-inherit {
+ text-decoration: none !important;
+}
+
+/* links and their different states
+-----------------------------------------------------------------------------------------------------------*/
+
+.ui-link{
+ color: #2489CE /*{global-link-color}*/
+}
+
+.ui-link:hover{
+ color: #2489CE /*{global-link-hover}*/
+}
+
+.ui-link:active{
+ color: #2489CE /*{global-link-active}*/
+}
+
+.ui-link:visited{
+ color: #2489CE /*{global-link-visited}*/
+}
+
+/* Active class used as the "on" state across all themes
+-----------------------------------------------------------------------------------------------------------*/
+
+.ui-btn-active {
+ border: 1px solid #155678 /*{global-active-border}*/;
+ background: #4596ce /*{global-active-background-color}*/;
+ font-weight: bold;
+ color: #fff /*{global-active-color}*/;
+ cursor: pointer;
+ text-shadow: 0 /*{global-active-shadow-x}*/ -1px /*{global-active-shadow-y}*/ 1px /*{global-active-shadow-radius}*/ #145072 /*{global-active-shadow-color}*/;
+ text-decoration: none;
+ background-image: -webkit-gradient(linear, left top, left bottom, from(#85bae4 /*{global-active-background-start}*/), to(#5393c5 /*{global-active-background-end}*/)); /* Saf4+, Chrome */
+ background-image: -webkit-linear-gradient(top, #85bae4 /*{global-active-background-start}*/, #5393c5 /*{global-active-background-end}*/); /* Chrome 10+, Saf5.1+ */
+ background-image: -moz-linear-gradient(top, #85bae4 /*{global-active-background-start}*/, #5393c5 /*{global-active-background-end}*/); /* FF3.6 */
+ background-image: -ms-linear-gradient(top, #85bae4 /*{global-active-background-start}*/, #5393c5 /*{global-active-background-end}*/); /* IE10 */
+ background-image: -o-linear-gradient(top, #85bae4 /*{global-active-background-start}*/, #5393c5 /*{global-active-background-end}*/); /* Opera 11.10+ */
+ background-image: linear-gradient(top, #85bae4 /*{global-active-background-start}*/, #5393c5 /*{global-active-background-end}*/);
+ outline: none;
+ font-family: Helvetica, Arial, sans-serif /*{global-active-font}*/;
+}
+.ui-btn-active a.ui-link-inherit {
+ color: #fff /*{global-active-color}*/;
+}
+
+
+/* button inner top highlight
+-----------------------------------------------------------------------------------------------------------*/
+
+.ui-btn-inner {
+ border-top: 1px solid #fff;
+ border-color: rgba(255,255,255,.3);
+}
+
+
+/* corner rounding classes
+-----------------------------------------------------------------------------------------------------------*/
+
+.ui-corner-tl {
+ -moz-border-radius-topleft: .6em /*{global-radii-blocks}*/;
+ -webkit-border-top-left-radius: .6em /*{global-radii-blocks}*/;
+ border-top-left-radius: .6em /*{global-radii-blocks}*/;
+}
+.ui-corner-tr {
+ -moz-border-radius-topright: .6em /*{global-radii-blocks}*/;
+ -webkit-border-top-right-radius: .6em /*{global-radii-blocks}*/;
+ border-top-right-radius: .6em /*{global-radii-blocks}*/;
+}
+.ui-corner-bl {
+ -moz-border-radius-bottomleft: .6em /*{global-radii-blocks}*/;
+ -webkit-border-bottom-left-radius: .6em /*{global-radii-blocks}*/;
+ border-bottom-left-radius: .6em /*{global-radii-blocks}*/;
+}
+.ui-corner-br {
+ -moz-border-radius-bottomright: .6em /*{global-radii-blocks}*/;
+ -webkit-border-bottom-right-radius: .6em /*{global-radii-blocks}*/;
+ border-bottom-right-radius: .6em /*{global-radii-blocks}*/;
+}
+.ui-corner-top {
+ -moz-border-radius-topleft: .6em /*{global-radii-blocks}*/;
+ -webkit-border-top-left-radius: .6em /*{global-radii-blocks}*/;
+ border-top-left-radius: .6em /*{global-radii-blocks}*/;
+ -moz-border-radius-topright: .6em /*{global-radii-blocks}*/;
+ -webkit-border-top-right-radius: .6em /*{global-radii-blocks}*/;
+ border-top-right-radius: .6em /*{global-radii-blocks}*/;
+}
+.ui-corner-bottom {
+ -moz-border-radius-bottomleft: .6em /*{global-radii-blocks}*/;
+ -webkit-border-bottom-left-radius: .6em /*{global-radii-blocks}*/;
+ border-bottom-left-radius: .6em /*{global-radii-blocks}*/;
+ -moz-border-radius-bottomright: .6em /*{global-radii-blocks}*/;
+ -webkit-border-bottom-right-radius: .6em /*{global-radii-blocks}*/;
+ border-bottom-right-radius: .6em /*{global-radii-blocks}*/;
+ }
+.ui-corner-right {
+ -moz-border-radius-topright: .6em /*{global-radii-blocks}*/;
+ -webkit-border-top-right-radius: .6em /*{global-radii-blocks}*/;
+ border-top-right-radius: .6em /*{global-radii-blocks}*/;
+ -moz-border-radius-bottomright: .6em /*{global-radii-blocks}*/;
+ -webkit-border-bottom-right-radius: .6em /*{global-radii-blocks}*/;
+ border-bottom-right-radius: .6em /*{global-radii-blocks}*/;
+}
+.ui-corner-left {
+ -moz-border-radius-topleft: .6em /*{global-radii-blocks}*/;
+ -webkit-border-top-left-radius: .6em /*{global-radii-blocks}*/;
+ border-top-left-radius: .6em /*{global-radii-blocks}*/;
+ -moz-border-radius-bottomleft: .6em /*{global-radii-blocks}*/;
+ -webkit-border-bottom-left-radius: .6em /*{global-radii-blocks}*/;
+ border-bottom-left-radius: .6em /*{global-radii-blocks}*/;
+}
+.ui-corner-all {
+ -moz-border-radius: .6em /*{global-radii-blocks}*/;
+ -webkit-border-radius: .6em /*{global-radii-blocks}*/;
+ border-radius: .6em /*{global-radii-blocks}*/;
+}
+.ui-corner-none {
+ -moz-border-radius: 0;
+ -webkit-border-radius: 0;
+ border-radius: 0;
+}
+
+/* Interaction cues
+-----------------------------------------------------------------------------------------------------------*/
+.ui-disabled {
+ opacity: .3;
+}
+.ui-disabled,
+.ui-disabled a {
+ cursor: default;
+}
+
+/* Icons
+-----------------------------------------------------------------------------------------------------------*/
+
+.ui-icon,
+.ui-icon-searchfield:after {
+ background: #666 /*{global-icon-color}*/;
+ background: rgba(0,0,0,.4) /*{global-icon-disc}*/;
+ background-image: url(images/icons-18-white.png) /*{global-icon-set}*/;
+ background-repeat: no-repeat;
+ -moz-border-radius: 9px;
+ -webkit-border-radius: 9px;
+ border-radius: 9px;
+}
+
+
+/* Alt icon color
+-----------------------------------------------------------------------------------------------------------*/
+
+.ui-icon-alt {
+ background: #fff;
+ background: rgba(255,255,255,.3);
+ background-image: url(images/icons-18-black.png);
+ background-repeat: no-repeat;
+}
+
+/* HD/"retina" sprite
+-----------------------------------------------------------------------------------------------------------*/
+
+@media only screen and (-webkit-min-device-pixel-ratio: 1.5),
+ only screen and (min--moz-device-pixel-ratio: 1.5),
+ only screen and (min-resolution: 240dpi) {
+
+ .ui-icon-plus, .ui-icon-minus, .ui-icon-delete, .ui-icon-arrow-r,
+ .ui-icon-arrow-l, .ui-icon-arrow-u, .ui-icon-arrow-d, .ui-icon-check,
+ .ui-icon-gear, .ui-icon-refresh, .ui-icon-forward, .ui-icon-back,
+ .ui-icon-grid, .ui-icon-star, .ui-icon-alert, .ui-icon-info, .ui-icon-home, .ui-icon-search, .ui-icon-searchfield:after,
+ .ui-icon-checkbox-off, .ui-icon-checkbox-on, .ui-icon-radio-off, .ui-icon-radio-on {
+ background-image: url(images/icons-36-white.png);
+ -moz-background-size: 776px 18px;
+ -o-background-size: 776px 18px;
+ -webkit-background-size: 776px 18px;
+ background-size: 776px 18px;
+ }
+ .ui-icon-alt {
+ background-image: url(images/icons-36-black.png);
+ }
+}
+
+/* plus minus */
+.ui-icon-plus {
+ background-position: -0 50%;
+}
+.ui-icon-minus {
+ background-position: -36px 50%;
+}
+
+/* delete/close */
+.ui-icon-delete {
+ background-position: -72px 50%;
+}
+
+/* arrows */
+.ui-icon-arrow-r {
+ background-position: -108px 50%;
+}
+.ui-icon-arrow-l {
+ background-position: -144px 50%;
+}
+.ui-icon-arrow-u {
+ background-position: -180px 50%;
+}
+.ui-icon-arrow-d {
+ background-position: -216px 50%;
+}
+
+/* misc */
+.ui-icon-check {
+ background-position: -252px 50%;
+}
+.ui-icon-gear {
+ background-position: -288px 50%;
+}
+.ui-icon-refresh {
+ background-position: -324px 50%;
+}
+.ui-icon-forward {
+ background-position: -360px 50%;
+}
+.ui-icon-back {
+ background-position: -396px 50%;
+}
+.ui-icon-grid {
+ background-position: -432px 50%;
+}
+.ui-icon-star {
+ background-position: -468px 50%;
+}
+.ui-icon-alert {
+ background-position: -504px 50%;
+}
+.ui-icon-info {
+ background-position: -540px 50%;
+}
+.ui-icon-home {
+ background-position: -576px 50%;
+}
+.ui-icon-search,
+.ui-icon-searchfield:after {
+ background-position: -612px 50%;
+}
+.ui-icon-checkbox-off {
+ background-position: -684px 50%;
+}
+.ui-icon-checkbox-on {
+ background-position: -648px 50%;
+}
+.ui-icon-radio-off {
+ background-position: -756px 50%;
+}
+.ui-icon-radio-on {
+ background-position: -720px 50%;
+}
+
+
+/* checks,radios */
+.ui-checkbox .ui-icon {
+ -moz-border-radius: 3px;
+ -webkit-border-radius: 3px;
+ border-radius: 3px;
+}
+.ui-icon-checkbox-off,
+.ui-icon-radio-off {
+ background-color: transparent;
+}
+.ui-checkbox-on .ui-icon,
+.ui-radio-on .ui-icon {
+ background-color: #4596ce /*{global-active-background-color}*/; /* NOTE: this hex should match the active state color. It's repeated here for cascade */
+}
+
+/* loading icon */
+.ui-icon-loading {
+ background-image: url(images/ajax-loader.png);
+ width: 40px;
+ height: 40px;
+ -moz-border-radius: 20px;
+ -webkit-border-radius: 20px;
+ border-radius: 20px;
+ background-size: 35px 35px;
+}
+
+
+/* Button corner classes
+-----------------------------------------------------------------------------------------------------------*/
+
+.ui-btn-corner-tl {
+ -moz-border-radius-topleft: 1em /*{global-radii-buttons}*/;
+ -webkit-border-top-left-radius: 1em /*{global-radii-buttons}*/;
+ border-top-left-radius: 1em /*{global-radii-buttons}*/;
+}
+.ui-btn-corner-tr {
+ -moz-border-radius-topright: 1em /*{global-radii-buttons}*/;
+ -webkit-border-top-right-radius: 1em /*{global-radii-buttons}*/;
+ border-top-right-radius: 1em /*{global-radii-buttons}*/;
+}
+.ui-btn-corner-bl {
+ -moz-border-radius-bottomleft: 1em /*{global-radii-buttons}*/;
+ -webkit-border-bottom-left-radius: 1em /*{global-radii-buttons}*/;
+ border-bottom-left-radius: 1em /*{global-radii-buttons}*/;
+}
+.ui-btn-corner-br {
+ -moz-border-radius-bottomright: 1em /*{global-radii-buttons}*/;
+ -webkit-border-bottom-right-radius: 1em /*{global-radii-buttons}*/;
+ border-bottom-right-radius: 1em /*{global-radii-buttons}*/;
+}
+.ui-btn-corner-top {
+ -moz-border-radius-topleft: 1em /*{global-radii-buttons}*/;
+ -webkit-border-top-left-radius: 1em /*{global-radii-buttons}*/;
+ border-top-left-radius: 1em /*{global-radii-buttons}*/;
+ -moz-border-radius-topright: 1em /*{global-radii-buttons}*/;
+ -webkit-border-top-right-radius: 1em /*{global-radii-buttons}*/;
+ border-top-right-radius: 1em /*{global-radii-buttons}*/;
+}
+.ui-btn-corner-bottom {
+ -moz-border-radius-bottomleft: 1em /*{global-radii-buttons}*/;
+ -webkit-border-bottom-left-radius: 1em /*{global-radii-buttons}*/;
+ border-bottom-left-radius: 1em /*{global-radii-buttons}*/;
+ -moz-border-radius-bottomright: 1em /*{global-radii-buttons}*/;
+ -webkit-border-bottom-right-radius: 1em /*{global-radii-buttons}*/;
+ border-bottom-right-radius: 1em /*{global-radii-buttons}*/;
+}
+.ui-btn-corner-right {
+ -moz-border-radius-topright: 1em /*{global-radii-buttons}*/;
+ -webkit-border-top-right-radius: 1em /*{global-radii-buttons}*/;
+ border-top-right-radius: 1em /*{global-radii-buttons}*/;
+ -moz-border-radius-bottomright: 1em /*{global-radii-buttons}*/;
+ -webkit-border-bottom-right-radius: 1em /*{global-radii-buttons}*/;
+ border-bottom-right-radius: 1em /*{global-radii-buttons}*/;
+}
+.ui-btn-corner-left {
+ -moz-border-radius-topleft: 1em /*{global-radii-buttons}*/;
+ -webkit-border-top-left-radius: 1em /*{global-radii-buttons}*/;
+ border-top-left-radius: 1em /*{global-radii-buttons}*/;
+ -moz-border-radius-bottomleft: 1em /*{global-radii-buttons}*/;
+ -webkit-border-bottom-left-radius: 1em /*{global-radii-buttons}*/;
+ border-bottom-left-radius: 1em /*{global-radii-buttons}*/;
+}
+.ui-btn-corner-all {
+ -moz-border-radius: 1em /*{global-radii-buttons}*/;
+ -webkit-border-radius: 1em /*{global-radii-buttons}*/;
+ border-radius: 1em /*{global-radii-buttons}*/;
+}
+
+/* radius clip workaround for cleaning up corner trapping */
+.ui-corner-tl,
+.ui-corner-tr,
+.ui-corner-bl,
+.ui-corner-br,
+.ui-corner-top,
+.ui-corner-bottom,
+.ui-corner-right,
+.ui-corner-left,
+.ui-corner-all,
+.ui-btn-corner-tl,
+.ui-btn-corner-tr,
+.ui-btn-corner-bl,
+.ui-btn-corner-br,
+.ui-btn-corner-top,
+.ui-btn-corner-bottom,
+.ui-btn-corner-right,
+.ui-btn-corner-left,
+.ui-btn-corner-all {
+ -webkit-background-clip: padding-box;
+ -moz-background-clip: padding;
+ background-clip: padding-box;
+}
+
+/* Overlay / modal
+-----------------------------------------------------------------------------------------------------------*/
+
+.ui-overlay {
+ background: #666;
+ opacity: .5;
+ filter: Alpha(Opacity=50);
+ position: absolute;
+ width: 100%;
+ height: 100%;
+}
+.ui-overlay-shadow {
+ -moz-box-shadow: 0px 0px 12px rgba(0,0,0,.6);
+ -webkit-box-shadow: 0px 0px 12px rgba(0,0,0,.6);
+ box-shadow: 0px 0px 12px rgba(0,0,0,.6);
+}
+.ui-shadow {
+ -moz-box-shadow: 0px 1px 4px /*{global-box-shadow-size}*/ rgba(0,0,0,.3) /*{global-box-shadow-color}*/;
+ -webkit-box-shadow: 0px 1px 4px /*{global-box-shadow-size}*/ rgba(0,0,0,.3) /*{global-box-shadow-color}*/;
+ box-shadow: 0px 1px 4px /*{global-box-shadow-size}*/ rgba(0,0,0,.3) /*{global-box-shadow-color}*/;
+}
+.ui-bar-a .ui-shadow,
+.ui-bar-b .ui-shadow ,
+.ui-bar-c .ui-shadow {
+ -moz-box-shadow: 0px 1px 0 rgba(255,255,255,.3);
+ -webkit-box-shadow: 0px 1px 0 rgba(255,255,255,.3);
+ box-shadow: 0px 1px 0 rgba(255,255,255,.3);
+}
+.ui-shadow-inset {
+ -moz-box-shadow: inset 0px 1px 4px rgba(0,0,0,.2);
+ -webkit-box-shadow: inset 0px 1px 4px rgba(0,0,0,.2);
+ box-shadow: inset 0px 1px 4px rgba(0,0,0,.2);
+}
+.ui-icon-shadow {
+ -moz-box-shadow: 0px 1px 0 rgba(255,255,255,.4);
+ -webkit-box-shadow: 0px 1px 0 rgba(255,255,255,.4);
+ box-shadow: 0px 1px 0 rgba(255,255,255,.4);
+}
+
+/* Focus state - set here for specificity
+-----------------------------------------------------------------------------------------------------------*/
+
+.ui-focus {
+ -moz-box-shadow: 0px 0px 12px #387bbe /*{global-active-background-color}*/;
+ -webkit-box-shadow: 0px 0px 12px #387bbe /*{global-active-background-color}*/;
+ box-shadow: 0px 0px 12px #387bbe /*{global-active-background-color}*/;
+}
+
+/* unset box shadow in browsers that don't do it right
+-----------------------------------------------------------------------------------------------------------*/
+
+.ui-mobile-nosupport-boxshadow * {
+ -moz-box-shadow: none !important;
+ -webkit-box-shadow: none !important;
+ box-shadow: none !important;
+}
+
+/* ...and bring back focus */
+.ui-mobile-nosupport-boxshadow .ui-focus {
+ outline-width: 2px;
+}/*
+* jQuery Mobile Framework
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.
+*/
+
+/* some unsets - more probably needed */
+.ui-mobile, .ui-mobile body { height: 100%; }
+.ui-mobile fieldset, .ui-page { padding: 0; margin: 0; }
+.ui-mobile a img, .ui-mobile fieldset { border: 0; }
+
+/* responsive page widths */
+.ui-mobile-viewport { margin: 0; overflow-x: hidden; -webkit-text-size-adjust: none; -ms-text-size-adjust:none; -webkit-tap-highlight-color: rgba(0, 0, 0, 0); }
+
+/* "page" containers - full-screen views, one should always be in view post-pageload */
+.ui-mobile [data-role=page], .ui-mobile [data-role=dialog], .ui-page { top: 0; left: 0; width: 100%; min-height: 100%; position: absolute; display: none; border: 0; }
+.ui-mobile .ui-page-active { display: block; overflow: visible; }
+
+/* on ios4, setting focus on the page element causes flashing during transitions when there is an outline, so we turn off outlines */
+.ui-page { outline: none; }
+
+/* native overflow scrolling */
+.ui-page.ui-mobile-touch-overflow,
+.ui-mobile-touch-overflow.ui-native-fixed .ui-content {
+ overflow: auto;
+ height: 100%;
+ -webkit-overflow-scrolling: touch;
+ -moz-overflow-scrolling: touch;
+ -o-overflow-scrolling: touch;
+ -ms-overflow-scrolling: touch;
+ overflow-scrolling: touch;
+}
+.ui-page.ui-mobile-touch-overflow,
+.ui-page.ui-mobile-touch-overflow * {
+ /* some level of transform keeps elements from blinking out of visibility on iOS */
+ -webkit-transform: rotateY(0);
+}
+.ui-page.ui-mobile-pre-transition {
+ display: block;
+}
+
+/* loading screen */
+.ui-loading .ui-mobile-viewport { overflow: hidden !important; }
+.ui-loading .ui-loader { display: block; }
+.ui-loading .ui-page { overflow: hidden; }
+.ui-loader { display: none; position: absolute; opacity: .85; z-index: 100; left: 50%; width: 200px; margin-left: -130px; margin-top: -35px; padding: 10px 30px; }
+.ui-loader h1 { font-size: 15px; text-align: center; }
+.ui-loader .ui-icon { position: static; display: block; opacity: .9; margin: 0 auto; width: 35px; height: 35px; background-color: transparent; }
+
+/*fouc*/
+.ui-mobile-rendering > * { visibility: hidden; }
+
+/*headers, content panels*/
+.ui-bar, .ui-body { position: relative; padding: .4em 15px; overflow: hidden; display: block; clear:both; }
+.ui-bar { font-size: 16px; margin: 0; }
+.ui-bar h1, .ui-bar h2, .ui-bar h3, .ui-bar h4, .ui-bar h5, .ui-bar h6 { margin: 0; padding: 0; font-size: 16px; display: inline-block; }
+
+.ui-header, .ui-footer { display: block; }
+.ui-page .ui-header, .ui-page .ui-footer { position: relative; }
+.ui-header .ui-btn-left { position: absolute; left: 10px; top: .4em; }
+.ui-header .ui-btn-right { position: absolute; right: 10px; top: .4em; }
+.ui-header .ui-title, .ui-footer .ui-title { min-height: 1.1em; text-align: center; font-size: 16px; display: block; margin: .6em 90px .8em; padding: 0; text-overflow: ellipsis; overflow: hidden; white-space: nowrap; outline: 0 !important; }
+
+/*content area*/
+.ui-content { border-width: 0; overflow: visible; overflow-x: hidden; padding: 15px; }
+.ui-page-fullscreen .ui-content { padding:0; }
+
+/* native fixed headers and footers */
+.ui-mobile-touch-overflow.ui-page.ui-native-fixed,
+.ui-mobile-touch-overflow.ui-page.ui-native-fullscreen {
+ overflow: visible;
+}
+.ui-mobile-touch-overflow.ui-native-fixed .ui-header,
+.ui-mobile-touch-overflow.ui-native-fixed .ui-footer {
+ position: fixed;
+ left: 0;
+ right: 0;
+ top: 0;
+ z-index: 200;
+}
+.ui-mobile-touch-overflow.ui-page.ui-native-fixed .ui-footer {
+ top: auto;
+ bottom: 0;
+}
+.ui-mobile-touch-overflow.ui-native-fixed .ui-content {
+ padding-top: 2.5em;
+ padding-bottom: 3em;
+ top: 0;
+ bottom: 0;
+ height: auto;
+ position: absolute;
+}
+.ui-mobile-touch-overflow.ui-native-fullscreen .ui-content {
+ padding-top: 0;
+ padding-bottom: 0;
+}
+.ui-mobile-touch-overflow.ui-native-fullscreen .ui-header,
+.ui-mobile-touch-overflow.ui-native-fullscreen .ui-footer {
+ opacity: .9;
+}
+.ui-native-bars-hidden {
+ display: none;
+}
+
+/* icons sizing */
+.ui-icon { width: 18px; height: 18px; }
+
+/* fullscreen class on ui-content div */
+.ui-fullscreen { }
+.ui-fullscreen img { max-width: 100%; }
+
+/* non-js content hiding */
+.ui-nojs { position: absolute; left: -9999px; }
+/*
+* jQuery Mobile Framework
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
+*/
+.spin {
+ -webkit-transform: rotate(360deg);
+ -webkit-animation-name: spin;
+ -webkit-animation-duration: 1s;
+ -webkit-animation-iteration-count: infinite;
+ -webkit-animation-timing-function: linear;
+}
+@-webkit-keyframes spin {
+ from {-webkit-transform: rotate(0deg);}
+ to {-webkit-transform: rotate(360deg);}
+}
+
+/* Transitions from jQtouch (with small modifications): http://www.jqtouch.com/
+Built by David Kaneda and maintained by Jonathan Stark.
+*/
+.in, .out {
+ -webkit-animation-timing-function: ease-in-out;
+ -webkit-animation-duration: 350ms;
+}
+
+
+.slide.out {
+ -webkit-transform: translateX(-100%);
+ -webkit-animation-name: slideouttoleft;
+}
+
+.slide.in {
+ -webkit-transform: translateX(0);
+ -webkit-animation-name: slideinfromright;
+}
+
+.slide.out.reverse {
+ -webkit-transform: translateX(100%);
+ -webkit-animation-name: slideouttoright;
+}
+
+.slide.in.reverse {
+ -webkit-transform: translateX(0);
+ -webkit-animation-name: slideinfromleft;
+}
+
+.slideup.out {
+ -webkit-animation-name: dontmove;
+ z-index: 0;
+}
+
+.slideup.in {
+ -webkit-transform: translateY(0);
+ -webkit-animation-name: slideinfrombottom;
+ z-index: 10;
+}
+
+.slideup.in.reverse {
+ z-index: 0;
+ -webkit-animation-name: dontmove;
+}
+
+.slideup.out.reverse {
+ -webkit-transform: translateY(100%);
+ z-index: 10;
+ -webkit-animation-name: slideouttobottom;
+}
+
+.slidedown.out {
+ -webkit-animation-name: dontmove;
+ z-index: 0;
+}
+
+.slidedown.in {
+ -webkit-transform: translateY(0);
+ -webkit-animation-name: slideinfromtop;
+ z-index: 10;
+}
+
+.slidedown.in.reverse {
+ z-index: 0;
+ -webkit-animation-name: dontmove;
+}
+
+.slidedown.out.reverse {
+ -webkit-transform: translateY(-100%);
+ z-index: 10;
+ -webkit-animation-name: slideouttotop;
+}
+
+@-webkit-keyframes slideinfromright {
+ from { -webkit-transform: translateX(100%); }
+ to { -webkit-transform: translateX(0); }
+}
+
+@-webkit-keyframes slideinfromleft {
+ from { -webkit-transform: translateX(-100%); }
+ to { -webkit-transform: translateX(0); }
+}
+
+@-webkit-keyframes slideouttoleft {
+ from { -webkit-transform: translateX(0); }
+ to { -webkit-transform: translateX(-100%); }
+}
+
+@-webkit-keyframes slideouttoright {
+ from { -webkit-transform: translateX(0); }
+ to { -webkit-transform: translateX(100%); }
+}
+
+@-webkit-keyframes slideinfromtop {
+ from { -webkit-transform: translateY(-100%); }
+ to { -webkit-transform: translateY(0); }
+}
+
+@-webkit-keyframes slideinfrombottom {
+ from { -webkit-transform: translateY(100%); }
+ to { -webkit-transform: translateY(0); }
+}
+
+@-webkit-keyframes slideouttobottom {
+ from { -webkit-transform: translateY(0); }
+ to { -webkit-transform: translateY(100%); }
+}
+
+@-webkit-keyframes slideouttotop {
+ from { -webkit-transform: translateY(0); }
+ to { -webkit-transform: translateY(-100%); }
+}
+@-webkit-keyframes fadein {
+ from { opacity: 0; }
+ to { opacity: 1; }
+}
+
+@-webkit-keyframes fadeout {
+ from { opacity: 1; }
+ to { opacity: 0; }
+}
+
+.fade.out {
+ z-index: 0;
+ -webkit-animation-name: fadeout;
+}
+
+.fade.in {
+ opacity: 1;
+ z-index: 10;
+ -webkit-animation-name: fadein;
+}
+
+/* The properties in this rule are only necessary for the 'flip' transition.
+ * We need specify the perspective to create a projection matrix. This will add
+ * some depth as the element flips. The depth number represents the distance of
+ * the viewer from the z-plane. According to the CSS3 spec, 1000 is a moderate
+ * value.
+ */
+.viewport-flip {
+ -webkit-perspective: 1000;
+ position: absolute;
+}
+
+.ui-mobile-viewport-transitioning,
+.ui-mobile-viewport-transitioning .ui-page {
+ width: 100%;
+ height: 100%;
+ overflow: hidden;
+}
+
+.flip {
+ -webkit-animation-duration: .65s;
+ -webkit-backface-visibility:hidden;
+ -webkit-transform:translateX(0); /* Needed to work around an iOS 3.1 bug that causes listview thumbs to disappear when -webkit-visibility:hidden is used. */
+}
+
+.flip.out {
+ -webkit-transform: rotateY(-180deg) scale(.8);
+ -webkit-animation-name: flipouttoleft;
+}
+
+.flip.in {
+ -webkit-transform: rotateY(0) scale(1);
+ -webkit-animation-name: flipinfromleft;
+}
+
+/* Shake it all about */
+
+.flip.out.reverse {
+ -webkit-transform: rotateY(180deg) scale(.8);
+ -webkit-animation-name: flipouttoright;
+}
+
+.flip.in.reverse {
+ -webkit-transform: rotateY(0) scale(1);
+ -webkit-animation-name: flipinfromright;
+}
+
+@-webkit-keyframes flipinfromright {
+ from { -webkit-transform: rotateY(-180deg) scale(.8); }
+ to { -webkit-transform: rotateY(0) scale(1); }
+}
+
+@-webkit-keyframes flipinfromleft {
+ from { -webkit-transform: rotateY(180deg) scale(.8); }
+ to { -webkit-transform: rotateY(0) scale(1); }
+}
+
+@-webkit-keyframes flipouttoleft {
+ from { -webkit-transform: rotateY(0) scale(1); }
+ to { -webkit-transform: rotateY(-180deg) scale(.8); }
+}
+
+@-webkit-keyframes flipouttoright {
+ from { -webkit-transform: rotateY(0) scale(1); }
+ to { -webkit-transform: rotateY(180deg) scale(.8); }
+}
+
+
+/* Hackish, but reliable. */
+
+@-webkit-keyframes dontmove {
+ from { opacity: 1; }
+ to { opacity: 1; }
+}
+
+.pop {
+ -webkit-transform-origin: 50% 50%;
+}
+
+.pop.in {
+ -webkit-transform: scale(1);
+ opacity: 1;
+ -webkit-animation-name: popin;
+ z-index: 10;
+}
+
+.pop.in.reverse {
+ z-index: 0;
+ -webkit-animation-name: dontmove;
+}
+
+.pop.out.reverse {
+ -webkit-transform: scale(.2);
+ opacity: 0;
+ -webkit-animation-name: popout;
+ z-index: 10;
+}
+
+@-webkit-keyframes popin {
+ from {
+ -webkit-transform: scale(.2);
+ opacity: 0;
+ }
+ to {
+ -webkit-transform: scale(1);
+ opacity: 1;
+ }
+}
+
+@-webkit-keyframes popout {
+ from {
+ -webkit-transform: scale(1);
+ opacity: 1;
+ }
+ to {
+ -webkit-transform: scale(.2);
+ opacity: 0;
+ }
+}/*
+* jQuery Mobile Framework
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
+*/
+
+/* content configurations. */
+.ui-grid-a, .ui-grid-b, .ui-grid-c, .ui-grid-d { overflow: hidden; }
+.ui-block-a, .ui-block-b, .ui-block-c, .ui-block-d, .ui-block-e { margin: 0; padding: 0; border: 0; float: left; min-height:1px;}
+
+/* grid solo: 100 - single item fallback */
+.ui-grid-solo .ui-block-a { width: 100%; float: none; }
+
+/* grid a: 50/50 */
+.ui-grid-a .ui-block-a, .ui-grid-a .ui-block-b { width: 50%; }
+.ui-grid-a .ui-block-a { clear: left; }
+
+/* grid b: 33/33/33 */
+.ui-grid-b .ui-block-a, .ui-grid-b .ui-block-b, .ui-grid-b .ui-block-c { width: 33.333%; }
+.ui-grid-b .ui-block-a { clear: left; }
+
+/* grid c: 25/25/25/25 */
+.ui-grid-c .ui-block-a, .ui-grid-c .ui-block-b, .ui-grid-c .ui-block-c, .ui-grid-c .ui-block-d { width: 25%; }
+.ui-grid-c .ui-block-a { clear: left; }
+
+/* grid d: 20/20/20/20/20 */
+.ui-grid-d .ui-block-a, .ui-grid-d .ui-block-b, .ui-grid-d .ui-block-c, .ui-grid-d .ui-block-d, .ui-grid-d .ui-block-e { width: 20%; }
+.ui-grid-d .ui-block-a { clear: left; }
+/*
+* jQuery Mobile Framework
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
+*/
+/* fixed page header & footer configuration */
+.ui-header, .ui-footer, .ui-page-fullscreen .ui-header, .ui-page-fullscreen .ui-footer { position: absolute; overflow: hidden; width: 100%; border-left-width: 0; border-right-width: 0; }
+.ui-header-fixed, .ui-footer-fixed {
+ z-index: 1000;
+ -webkit-transform: translateZ(0); /* Force header/footer rendering to go through the same rendering pipeline as native page scrolling. */
+}
+.ui-footer-duplicate, .ui-page-fullscreen .ui-fixed-inline { display: none; }
+.ui-page-fullscreen .ui-header, .ui-page-fullscreen .ui-footer { opacity: .9; }
+/*
+* jQuery Mobile Framework
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
+*/
+.ui-navbar { overflow: hidden; }
+.ui-navbar ul, .ui-navbar-expanded ul { list-style:none; padding: 0; margin: 0; position: relative; display: block; border: 0;}
+.ui-navbar-collapsed ul { float: left; width: 75%; margin-right: -2px; }
+.ui-navbar-collapsed .ui-navbar-toggle { float: left; width: 25%; }
+.ui-navbar li.ui-navbar-truncate { position: absolute; left: -9999px; top: -9999px; }
+.ui-navbar li .ui-btn, .ui-navbar .ui-navbar-toggle .ui-btn { display: block; font-size: 12px; text-align: center; margin: 0; border-right-width: 0; }
+.ui-navbar li .ui-btn { margin-right: -1px; }
+.ui-navbar li .ui-btn:last-child { margin-right: 0; }
+.ui-header .ui-navbar li .ui-btn, .ui-header .ui-navbar .ui-navbar-toggle .ui-btn,
+.ui-footer .ui-navbar li .ui-btn, .ui-footer .ui-navbar .ui-navbar-toggle .ui-btn { border-top-width: 0; border-bottom-width: 0; }
+.ui-navbar .ui-btn-inner { padding-left: 2px; padding-right: 2px; }
+.ui-navbar-noicons li .ui-btn .ui-btn-inner, .ui-navbar-noicons .ui-navbar-toggle .ui-btn-inner { padding-top: .8em; padding-bottom: .9em; }
+/*expanded page styles*/
+.ui-navbar-expanded .ui-btn { margin: 0; font-size: 14px; }
+.ui-navbar-expanded .ui-btn-inner { padding-left: 5px; padding-right: 5px; }
+.ui-navbar-expanded .ui-btn-icon-top .ui-btn-inner { padding: 45px 5px 15px; text-align: center; }
+.ui-navbar-expanded .ui-btn-icon-top .ui-icon { top: 15px; }
+.ui-navbar-expanded .ui-btn-icon-bottom .ui-btn-inner { padding: 15px 5px 45px; text-align: center; }
+.ui-navbar-expanded .ui-btn-icon-bottom .ui-icon { bottom: 15px; }
+.ui-navbar-expanded li .ui-btn .ui-btn-inner { min-height: 2.5em; }
+.ui-navbar-expanded .ui-navbar-noicons .ui-btn .ui-btn-inner { padding-top: 1.8em; padding-bottom: 1.9em; }
+/*
+* jQuery Mobile Framework
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
+*/
+.ui-btn { display: block; text-align: center; cursor:pointer; position: relative; margin: .5em 5px; padding: 0; }
+.ui-btn:focus, .ui-btn:active { outline: none; }
+.ui-header .ui-btn, .ui-footer .ui-btn, .ui-bar .ui-btn { display: inline-block; font-size: 13px; margin: 0; }
+.ui-btn-inline { display: inline-block; }
+.ui-btn-inner { padding: .6em 25px; display: block; text-overflow: ellipsis; overflow: hidden; white-space: nowrap; position: relative; zoom: 1; }
+.ui-header .ui-btn-inner, .ui-footer .ui-btn-inner, .ui-bar .ui-btn-inner { padding: .4em 8px .5em; }
+.ui-btn-icon-notext { width: 24px; height: 24px; }
+.ui-btn-icon-notext .ui-btn-inner { padding: 2px 1px 2px 3px; }
+.ui-btn-icon-notext .ui-btn-text { position: absolute; left: -999px; }
+.ui-btn-icon-left .ui-btn-inner { padding-left: 33px; }
+.ui-header .ui-btn-icon-left .ui-btn-inner,
+.ui-footer .ui-btn-icon-left .ui-btn-inner,
+.ui-bar .ui-btn-icon-left .ui-btn-inner { padding-left: 27px; }
+.ui-btn-icon-right .ui-btn-inner { padding-right: 33px; }
+.ui-header .ui-btn-icon-right .ui-btn-inner,
+.ui-footer .ui-btn-icon-right .ui-btn-inner,
+.ui-bar .ui-btn-icon-right .ui-btn-inner { padding-right: 27px; }
+.ui-btn-icon-top .ui-btn-inner { padding-top: 33px; }
+.ui-header .ui-btn-icon-top .ui-btn-inner,
+.ui-footer .ui-btn-icon-top .ui-btn-inner,
+.ui-bar .ui-btn-icon-top .ui-btn-inner { padding-top: 27px; }
+.ui-btn-icon-bottom .ui-btn-inner { padding-bottom: 33px; }
+.ui-header .ui-btn-icon-bottom .ui-btn-inner,
+.ui-footer .ui-btn-icon-bottom .ui-btn-inner,
+.ui-bar .ui-btn-icon-bottom .ui-btn-inner { padding-bottom: 27px; }
+
+/*btn icon positioning*/
+.ui-btn-icon-notext .ui-icon { display: block; }
+.ui-btn-icon-left .ui-icon, .ui-btn-icon-right .ui-icon { position: absolute; top: 50%; margin-top: -9px; }
+.ui-btn-icon-top .ui-icon, .ui-btn-icon-bottom .ui-icon { position: absolute; left: 50%; margin-left: -9px; }
+.ui-btn-icon-left .ui-icon { left: 10px; }
+.ui-btn-icon-right .ui-icon { right: 10px; }
+.ui-btn-icon-top .ui-icon { top: 10px; }
+.ui-btn-icon-bottom .ui-icon { bottom: 10px; }
+.ui-header .ui-btn-icon-left .ui-icon,
+.ui-footer .ui-btn-icon-left .ui-icon,
+.ui-bar .ui-btn-icon-left .ui-icon { left: 4px; }
+.ui-header .ui-btn-icon-right .ui-icon,
+.ui-footer .ui-btn-icon-right .ui-icon,
+.ui-bar .ui-btn-icon-right .ui-icon { right: 4px; }
+.ui-header .ui-btn-icon-top .ui-icon,
+.ui-footer .ui-btn-icon-top .ui-icon,
+.ui-bar .ui-btn-icon-top .ui-icon { top: 4px; }
+.ui-header .ui-btn-icon-bottom .ui-icon,
+.ui-footer .ui-btn-icon-bottom .ui-icon,
+.ui-bar .ui-btn-icon-bottom .ui-icon { bottom: 4px; }
+
+/*hiding native button,inputs */
+.ui-btn-hidden { position: absolute; top: 0; left: 0; width: 100%; height: 100%; -webkit-appearance: button; opacity: .1; cursor: pointer; background: transparent; font-size: 1px; border: none; line-height: 999px; }
+/*
+* jQuery Mobile Framework
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
+*/
+.ui-collapsible { margin: .5em 0; }
+.ui-collapsible-heading { font-size: 16px; display: block; margin: 0 -8px; padding: 0; border-width: 0 0 1px 0; position: relative; }
+.ui-collapsible-heading a { text-align: left; margin: 0; }
+.ui-collapsible-heading a .ui-btn-inner { padding-left: 40px; }
+.ui-collapsible-heading a span.ui-btn { position: absolute; left: 6px; top: 50%; margin: -12px 0 0 0; width: 20px; height: 20px; padding: 1px 0px 1px 2px; text-indent: -9999px; }
+.ui-collapsible-heading a span.ui-btn .ui-btn-inner { padding: 10px 0; }
+.ui-collapsible-heading a span.ui-btn .ui-icon { left: 0; margin-top: -10px; }
+.ui-collapsible-heading-status { position:absolute; left:-9999px; }
+.ui-collapsible-content {
+ display: block;
+ margin: 0 -8px;
+ padding: 10px 16px;
+ border-top: none; /* Overrides ui-btn-up-* */
+ background-image: none; /* Overrides ui-btn-up-* */
+ font-weight: normal; /* Overrides ui-btn-up-* */
+}
+.ui-collapsible-content-collapsed { display: none; }
+
+.ui-collapsible-set { margin: .5em 0; }
+.ui-collapsible-set .ui-collapsible { margin: -1px 0 0; }
+/*
+* jQuery Mobile Framework
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
+*/
+.ui-controlgroup, fieldset.ui-controlgroup { padding: 0; margin: .5em 0 1em; }
+.ui-bar .ui-controlgroup { margin: 0 .3em; }
+.ui-controlgroup-label { font-size: 16px; line-height: 1.4; font-weight: normal; margin: 0 0 .3em; }
+.ui-controlgroup-controls { display: block; width: 95%;}
+.ui-controlgroup li { list-style: none; }
+.ui-controlgroup-vertical .ui-btn,
+.ui-controlgroup-vertical .ui-checkbox, .ui-controlgroup-vertical .ui-radio { margin: 0; border-bottom-width: 0; }
+.ui-controlgroup-vertical .ui-controlgroup-last { border-bottom-width: 1px; }
+.ui-controlgroup-horizontal { padding: 0; }
+.ui-controlgroup-horizontal .ui-btn { display: inline-block; margin: 0 -5px 0 0; }
+.ui-controlgroup-horizontal .ui-checkbox, .ui-controlgroup-horizontal .ui-radio { float: left; margin: 0 -1px 0 0; }
+.ui-controlgroup-horizontal .ui-checkbox .ui-btn, .ui-controlgroup-horizontal .ui-radio .ui-btn,
+.ui-controlgroup-horizontal .ui-checkbox:last-child, .ui-controlgroup-horizontal .ui-radio:last-child { margin-right: 0; }
+.ui-controlgroup-horizontal .ui-controlgroup-last { margin-right: 0; }
+.ui-controlgroup .ui-checkbox label, .ui-controlgroup .ui-radio label { font-size: 16px; }
+/* conflicts with listview..
+.ui-controlgroup .ui-btn-icon-notext { width: 30px; height: 30px; text-indent: -9999px; }
+.ui-controlgroup .ui-btn-icon-notext .ui-btn-inner { padding: 5px 6px 5px 5px; }
+*/
+
+@media all and (min-width: 450px){
+ .ui-controlgroup-label { vertical-align: top; display: inline-block; width: 20%; margin: 0 2% 0 0; }
+ .ui-controlgroup-controls { width: 60%; display: inline-block; }
+} /*
+* jQuery Mobile Framework
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
+*/
+.ui-dialog { min-height: 480px; }
+.ui-dialog .ui-header, .ui-dialog .ui-content, .ui-dialog .ui-footer { margin: 15px; position: relative; }
+.ui-dialog .ui-header, .ui-dialog .ui-footer { z-index: 10; width: auto; }
+.ui-dialog .ui-content, .ui-dialog .ui-footer { margin-top: -15px; }/*
+* jQuery Mobile Framework
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
+*/
+.ui-checkbox, .ui-radio { position:relative; margin: .2em 0 .5em; z-index: 1; }
+.ui-checkbox .ui-btn, .ui-radio .ui-btn { margin: 0; text-align: left; z-index: 2; }
+.ui-checkbox .ui-btn-inner, .ui-radio .ui-btn-inner { white-space: normal; }
+.ui-checkbox .ui-btn-icon-left .ui-btn-inner,.ui-radio .ui-btn-icon-left .ui-btn-inner { padding-left: 45px; }
+.ui-checkbox .ui-btn-icon-right .ui-btn-inner, .ui-radio .ui-btn-icon-right .ui-btn-inner { padding-right: 45px; }
+.ui-checkbox .ui-icon, .ui-radio .ui-icon { top: 1.1em; }
+.ui-checkbox .ui-btn-icon-left .ui-icon, .ui-radio .ui-btn-icon-left .ui-icon {left: 15px; }
+.ui-checkbox .ui-btn-icon-right .ui-icon, .ui-radio .ui-btn-icon-right .ui-icon {right: 15px; }
+/* input, label positioning */
+.ui-checkbox input,.ui-radio input { position:absolute; left:20px; top:50%; width: 10px; height: 10px; margin:-5px 0 0 0; outline: 0 !important; z-index: 1; }/*
+* jQuery Mobile Framework
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
+*/
+.ui-field-contain { padding: 1.5em 0; margin: 0; border-bottom-width: 1px; overflow: visible; }
+.ui-field-contain:first-child { border-top-width: 0; }
+@media all and (min-width: 450px){
+ .ui-field-contain { border-width: 0; padding: 0; margin: 1em 0; }
+} /*
+* jQuery Mobile Framework
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
+*/
+.ui-select { display: block; position: relative; }
+.ui-select select { position: absolute; left: -9999px; top: -9999px; }
+.ui-select .ui-btn { overflow: hidden; }
+.ui-select .ui-btn select { cursor: pointer; -webkit-appearance: button; left: 0; top:0; width: 100%; min-height: 1.5em; min-height: 100%; height: 3em; max-height: 100%; opacity: 0; -ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=0)"; filter: alpha(opacity=0); z-index: 2; }
+@-moz-document url-prefix() {.ui-select .ui-btn select { opacity: 0.0001; }}
+.ui-select .ui-btn select.ui-select-nativeonly { opacity: 1; text-indent: 0; }
+
+.ui-select .ui-btn-icon-right .ui-btn-inner { padding-right: 45px; }
+.ui-select .ui-btn-icon-right .ui-icon { right: 15px; }
+
+/* labels */
+label.ui-select { font-size: 16px; line-height: 1.4; font-weight: normal; margin: 0 0 .3em; display: block; }
+
+/*listbox*/
+.ui-select .ui-btn-text, .ui-selectmenu .ui-btn-text { display: block; min-height: 1em; }
+.ui-select .ui-btn-text { text-overflow: ellipsis; overflow: hidden;}
+
+.ui-selectmenu { position: absolute; padding: 0; z-index: 100 !important; width: 80%; max-width: 350px; padding: 6px; }
+.ui-selectmenu .ui-listview { margin: 0; }
+.ui-selectmenu .ui-btn.ui-li-divider { cursor: default; }
+.ui-selectmenu-hidden { top: -9999px; left: -9999px; }
+.ui-selectmenu-screen { position: absolute; top: 0; left: 0; width: 100%; height: 100%; z-index: 99; }
+.ui-screen-hidden, .ui-selectmenu-list .ui-li .ui-icon { display: none; }
+.ui-selectmenu-list .ui-li .ui-icon { display: block; }
+.ui-li.ui-selectmenu-placeholder { display: none; }
+.ui-selectmenu .ui-header .ui-title { margin: 0.6em 46px 0.8em; }
+
+@media all and (min-width: 450px){
+ label.ui-select { vertical-align: top; display: inline-block; width: 20%; margin: 0 2% 0 0; }
+ .ui-select { width: 60%; display: inline-block; }
+}
+
+/* when no placeholder is defined in a multiple select, the header height doesn't even extend past the close button. this shim's content in there */
+.ui-selectmenu .ui-header h1:after { content: '.'; visibility: hidden; }/*
+* jQuery Mobile Framework
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
+*/
+label.ui-input-text { font-size: 16px; line-height: 1.4; display: block; font-weight: normal; margin: 0 0 .3em; }
+input.ui-input-text, textarea.ui-input-text { background-image: none; padding: .4em; line-height: 1.4; font-size: 16px; display: block; width: 95%; }
+input.ui-input-text { -webkit-appearance: none; }
+textarea.ui-input-text { height: 50px; -webkit-transition: height 200ms linear; -moz-transition: height 200ms linear; -o-transition: height 200ms linear; transition: height 200ms linear; }
+.ui-input-search { padding: 0 30px; width: 77%; background-image: none; position: relative; }
+.ui-icon-searchfield:after { position: absolute; left: 7px; top: 50%; margin-top: -9px; content: ""; width: 18px; height: 18px; opacity: .5; }
+.ui-input-search input.ui-input-text { border: none; width: 98%; padding: .4em 0; margin: 0; display: block; background: transparent none; outline: 0 !important; }
+.ui-input-search .ui-input-clear { position: absolute; right: 0; top: 50%; margin-top: -14px; }
+.ui-input-search .ui-input-clear-hidden { display: none; }
+
+/* orientation adjustments - incomplete!*/
+@media all and (min-width: 450px){
+ label.ui-input-text { vertical-align: top; display: inline-block; width: 20%; margin: 0 2% 0 0 }
+ input.ui-input-text,
+ textarea.ui-input-text,
+ .ui-input-search { width: 60%; display: inline-block; }
+ .ui-input-search { width: 50%; }
+ .ui-input-search input.ui-input-text { width: 98%; /*echos rule from above*/ }
+}/*
+* jQuery Mobile Framework
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
+*/
+.ui-listview { margin: 0; counter-reset: listnumbering; }
+.ui-content .ui-listview { margin: -15px; }
+.ui-content .ui-listview-inset { margin: 1em 0; }
+.ui-listview, .ui-li { list-style:none; padding:0; }
+.ui-li, .ui-li.ui-field-contain { display: block; margin:0; position: relative; overflow: visible; text-align: left; border-width: 0; border-top-width: 1px; }
+.ui-li .ui-btn-text { position: relative; z-index: 1; }
+.ui-li .ui-btn-text a.ui-link-inherit { text-overflow: ellipsis; overflow: hidden; white-space: nowrap; }
+.ui-li-divider, .ui-li-static { padding: .5em 15px; font-size: 14px; font-weight: bold; }
+.ui-li-divider { counter-reset: listnumbering; }
+ol.ui-listview .ui-link-inherit:before, ol.ui-listview .ui-li-static:before, .ui-li-dec { font-size: .8em; display: inline-block; padding-right: .3em; font-weight: normal;counter-increment: listnumbering; content: counter(listnumbering) ". "; }
+ol.ui-listview .ui-li-jsnumbering:before { content: "" !important; } /* to avoid chance of duplication */
+.ui-listview-inset .ui-li { border-right-width: 1px; border-left-width: 1px; }
+.ui-li:last-child, .ui-li.ui-field-contain:last-child { border-bottom-width: 1px; }
+.ui-li>.ui-btn-inner { display: block; position: relative; padding: 0; }
+.ui-li .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li { padding: .7em 15px .7em 15px; display: block; }
+.ui-li-has-thumb .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li-has-thumb { min-height: 60px; padding-left: 100px; }
+.ui-li-has-icon .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li-has-icon { min-height: 20px; padding-left: 40px; }
+.ui-li-has-count .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li-has-count { padding-right: 45px; }
+.ui-li-has-arrow .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li-has-arrow { padding-right: 30px; }
+.ui-li-has-arrow.ui-li-has-count .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li-has-arrow.ui-li-has-count { padding-right: 75px; }
+.ui-li-heading { font-size: 16px; font-weight: bold; display: block; margin: .6em 0; text-overflow: ellipsis; overflow: hidden; white-space: nowrap; }
+.ui-li-desc { font-size: 12px; font-weight: normal; display: block; margin: -.5em 0 .6em; text-overflow: ellipsis; overflow: hidden; white-space: nowrap; }
+.ui-li-thumb, .ui-li-icon { position: absolute; left: 1px; top: 0; max-height: 80px; max-width: 80px; }
+.ui-li-icon { max-height: 40px; max-width: 40px; left: 10px; top: .9em; }
+.ui-li-thumb, .ui-li-icon, .ui-li-content { float: left; margin-right: 10px; }
+
+.ui-li-aside { float: right; width: 50%; text-align: right; margin: .3em 0; }
+@media all and (min-width: 480px){
+ .ui-li-aside { width: 45%; }
+}
+.ui-li-divider { cursor: default; }
+.ui-li-has-alt .ui-btn-inner a.ui-link-inherit, .ui-li-static.ui-li-has-alt { padding-right: 95px; }
+.ui-li-has-count .ui-li-count { position: absolute; font-size: 11px; font-weight: bold; padding: .2em .5em; top: 50%; margin-top: -.9em; right: 38px; }
+.ui-li-divider .ui-li-count, .ui-li-static .ui-li-count { right: 10px; }
+.ui-li-has-alt .ui-li-count { right: 55px; }
+.ui-li-link-alt { position: absolute; width: 40px; height: 100%; border-width: 0; border-left-width: 1px; top: 0; right: 0; margin: 0; padding: 0; z-index: 2; }
+.ui-li-link-alt .ui-btn { overflow: hidden; position: absolute; right: 8px; top: 50%; margin: -11px 0 0 0; border-bottom-width: 1px; z-index: -1;}
+.ui-li-link-alt .ui-btn-inner { padding: 0; height: 100%; position: absolute; width: 100%; top: 0; left: 0;}
+.ui-li-link-alt .ui-btn .ui-icon { right: 50%; margin-right: -9px; }
+
+.ui-listview * .ui-btn-inner > .ui-btn > .ui-btn-inner { border-top: 0px; }
+
+.ui-listview-filter { border-width: 0; overflow: hidden; margin: -15px -15px 15px -15px }
+.ui-listview-filter .ui-input-search { margin: 5px; width: auto; display: block; }
+
+.ui-listview-filter-inset { margin: -15px -5px -15px -5px; background: transparent; }
+.ui-li.ui-screen-hidden{display:none;}
+/* Odd iPad positioning issue. */
+@media only screen and (min-device-width: 768px) and (max-device-width: 1024px) {
+ .ui-li .ui-btn-text { overflow: visible; }
+}/*
+* jQuery Mobile Framework
+* Copyright (c) jQuery Project
+* Dual licensed under the MIT (MIT-LICENSE.txt) or GPL (GPL-LICENSE.txt) licenses.
+*/
+label.ui-slider { display: block; }
+input.ui-slider-input { display: inline-block; width: 50px; }
+select.ui-slider-switch { display: none; }
+div.ui-slider { position: relative; display: inline-block; overflow: visible; height: 15px; padding: 0; margin: 0 2% 0 20px; top: 4px; width: 66%; }
+a.ui-slider-handle { position: absolute; z-index: 10; top: 50%; width: 28px; height: 28px; margin-top: -15px; margin-left: -15px; }
+a.ui-slider-handle .ui-btn-inner { padding-left: 0; padding-right: 0; }
+@media all and (min-width: 480px){
+ label.ui-slider { vertical-align: top; display: inline-block; width: 20%; margin: 0 2% 0 0; }
+ div.ui-slider { width: 45%; }
+}
+
+div.ui-slider-switch { height: 32px; overflow: hidden; margin-left: 0; }
+div.ui-slider-inneroffset { margin-left: 50%; position: absolute; top: 1px; height: 100%; width: 50%; }
+a.ui-slider-handle-snapping { -webkit-transition: left 100ms linear; }
+div.ui-slider-labelbg { position: absolute; top:0; margin: 0; border-width: 0; }
+div.ui-slider-switch div.ui-slider-labelbg-a { width: 60%; height: 100%; left: 0; }
+div.ui-slider-switch div.ui-slider-labelbg-b { width: 60%; height: 100%; right: 0; }
+.ui-slider-switch-a div.ui-slider-labelbg-a, .ui-slider-switch-b div.ui-slider-labelbg-b { z-index: -1; }
+.ui-slider-switch-a div.ui-slider-labelbg-b, .ui-slider-switch-b div.ui-slider-labelbg-a { z-index: 0; }
+
+div.ui-slider-switch a.ui-slider-handle { z-index: 20; width: 101%; height: 32px; margin-top: -18px; margin-left: -101%; }
+span.ui-slider-label { width: 100%; position: absolute;height: 32px; font-size: 16px; text-align: center; line-height: 2; background: none; border-color: transparent; }
+span.ui-slider-label-a { left: -100%; margin-right: -1px }
+span.ui-slider-label-b { right: -100%; margin-left: -1px }
+
--- /dev/null
+++ b/css/local.css.php
@@ -1,1 +1,221 @@
-
+<?php
+
+header('Content-type: text/css');
+ob_start("compress");
+
+function compress($buffer) {
+ /* remove comments */
+ $buffer = preg_replace('!/\*[^*]*\*+([^/][^*]*\*+)*/!', '', $buffer);
+ /* remove tabs, spaces, newlines, etc. */
+ $buffer = str_replace(array("\r\n", "\r", "\n", "\t", ' ', ' ', ' '), '', $buffer);
+ return $buffer;
+}
+
+echo '
+.ui-li-thumb, .ui-li-icon { position: relative; }
+
+ .ui-navbar {
+ width: 100%;
+ }
+ .ui-btn-inner {
+ white-space: normal !important;
+ }
+ .ui-li-heading {
+ white-space: normal !important;
+ }
+ .ui-listview-filter {
+ margin: 0 !important;
+ }
+ .ui-icon-navigation {
+ background-image: url(images/113-navigation.png);
+ background-position: 1px 0;
+ }
+ .ui-icon-beaker {
+ background-image: url(images/91-beaker-2.png);
+ background-position: 1px 0;
+ }
+ #footer {
+ text-size: 0.75em;
+ text-align: center;
+ }
+ body {
+ background-color: #F0F0F0;
+ }
+ #jqm-homeheader {
+ text-align: center;
+ }
+ .viaPoints {
+ display: none;
+ text-size: 0.2em;
+ }
+ .min-width-480px .viaPoints {
+ display: inline;
+ }
+ #extrainfo {
+ visibility: hidden;
+ display: none;
+ }
+ #servicewarning {
+ padding: 1em;
+ margin-bottom: 0.5em;
+ text-size: 0.2em;
+ background-color: #FF9;
+ -moz-border-radius: 15px;
+border-radius: 15px;
+ }
+
+
+#footer {
+clear:both;
+text-align:center;
+}
+ // source http://webaim.org/techniques/skipnav/
+ #skip a, #skip a:hover, #skip a:visited
+{
+position:absolute;
+left:0px;
+top:-500px;
+width:1px;
+height:1px;
+overflow:hidden;
+}
+
+#skip a:active, #skip a:focus
+{
+position:static;
+width:auto;
+height:auto;
+}';
+
+//if (false)
+echo '
+// adaptive layout from jQuery Mobile docs site
+.type-interior .content-secondary {
+ border-right: 0;
+ border-left: 0;
+ margin: 10px -15px 0;
+ background: #fff;
+ border-top: 1px solid #ccc;
+}
+.type-home .ui-content {
+ margin-top: 5px;
+}
+.type-interior .ui-content {
+ padding-bottom: 0;
+}
+.content-secondary .ui-collapsible-contain {
+ padding: 10px 15px;
+
+}
+.content-secondary .ui-collapsible-heading {
+ margin: 0 0 30px;
+}
+.content-secondary .ui-collapsible-heading-collapsed,
+.content-secondary .ui-collapsible-content {
+ padding:0;
+ margin: 0;
+}
+ /* hires ahoy */
+@media all and (min-width: 650px){
+
+.content-secondary {
+ text-align: left;
+ float: left;
+ width: 45%;
+ background: none;
+ border-top: 0;
+ }
+ .content-secondary,
+ .type-interior .content-secondary {
+ margin: 30px 0 20px 2%;
+ padding: 20px 4% 0 0;
+ background: none;
+ }
+ .type-index .content-secondary {
+ padding: 0;
+ }
+ .type-index .content-secondary .ui-listview {
+ margin: 0;
+ }
+ .content-primary {
+ width: 45%;
+ float: right;
+ margin-top: 30px;
+ margin-right: 1%;
+ padding-right: 1%;
+ }
+ .content-primary ul:first-child {
+ margin-top: 0;
+ }
+
+ .type-interior .content-primary {
+ padding: 1.5em 6% 3em 0;
+ margin: 0;
+ }
+ /* fix up the collapsibles - expanded on desktop */
+ .content-secondary .ui-collapsible-heading {
+ display: none;
+ }
+ .content-secondary .ui-collapsible-contain {
+ margin:0;
+ }
+ .content-secondary .ui-collapsible-content {
+ display: block;
+ margin: 0;
+ padding: 0;
+ }
+ .type-interior .content-secondary .ui-li-divider {
+ padding-top: 1em;
+ padding-bottom: 1em;
+ }
+ .type-interior .content-secondary {
+ margin: 0;
+ padding: 0;
+ }
+}
+@media all and (min-width: 750px){
+ .type-home .ui-content,
+ .type-interior .ui-content {
+ background-position: 39%;
+ }
+ .content-secondary {
+ width: 34%;
+ }
+ .content-primary {
+ width: 56%;
+ padding-right: 1%;
+ }
+ .type-interior .ui-content {
+ background-position: 34%;
+ }
+}
+
+@media all and (min-width: 1200px){
+ .type-home .ui-content{
+ background-position: 38.5%;
+ }
+ .type-interior .ui-content {
+ background-position: 30%;
+ }
+ .content-secondary {
+ width: 30%;
+ padding-right:6%;
+ margin: 30px 0 20px 5%;
+ }
+ .type-interior .content-secondary {
+ margin: 0;
+ padding: 0;
+ }
+ .content-primary {
+ width: 50%;
+ margin-right: 5%;
+ padding-right: 3%;
+ }
+ .type-interior .content-primary {
+ width: 60%;
+ }
+}
+';
+ob_end_flush();
+?>
+
--- a/dotcloud/postinstall
+++ b/dotcloud/postinstall
@@ -3,8 +3,8 @@
curl http://s3-ap-southeast-1.amazonaws.com/busresources/cbrfeed.zip \
-o /home/dotcloud/current/cbrfeed.zip
-wget http://s3-ap-southeast-1.amazonaws.com/busresources/Graph.obj \
--O /tmp/Graph.obj
+curl http://s3-ap-southeast-1.amazonaws.com/busresources/Graph.obj \
+-o /tmp/Graph.obj
#db setup
#curl https://github.com/maxious/ACTBus-ui/raw/master/transitdata.cbrfeed.sql.gz -o transitdata.cbrfeed.sql.gz
--- /dev/null
+++ b/geo/route.kml.php
@@ -1,1 +1,30 @@
+<?php
+header('Content-Type: application/vnd.google-earth.kml+xml');
+include ('../include/common.inc.php');
+echo '<?xml version="1.0" encoding="UTF-8"?>
+<kml xmlns="http://www.opengis.net/kml/2.2" xmlns:atom="http://www.w3.org/2005/Atom"><Document>';
+echo '
+ <Style id="yellowLineGreenPoly">
+ <LineStyle>
+ <color>7f00ff00</color>
+ <width>4</width>
+ </LineStyle>
+ <PolyStyle>
+ <color>7f00ffff</color>
+ </PolyStyle>
+ </Style>';
+$route = getRoute($routeid);
+ echo "\n<Placemark>\n";
+ $link = curPageURL()."/../trip.php?routeid=".htmlspecialchars ($route["route_id"]);
+ echo "<name>".$route['route_short_name']."</name>";
+ echo '<atom:link href="'.$link.'"/>';
+ echo '<description><![CDATA[ <a href="'.$link.'">'.$route['route_short_name']." ".$route['route_long_name']."</a>]]> </description>";
+echo "<styleUrl>#yellowLineGreenPoly</styleUrl>";
+ $trips = getRouteTrips($routeid);
+ echo getTripShape($trips[0]['trip_id']);
+
+echo "</Placemark>\n</Document></kml>\n";
+?>
+
+
--- /dev/null
+++ b/geo/stops.kml.php
@@ -1,1 +1,38 @@
+<?php
+include ('../include/common.inc.php');
+header('Content-type: application/vnd.google-earth.kml+xml');
+//http://wiki.openstreetmap.org/wiki/OpenLayers_Dynamic_KML
+// Creates the KML/XML Document.
+$dom = new DOMDocument('1.0', 'UTF-8');
+// Creates the root KML element and appends it to the root document.
+$node = $dom->createElementNS('http://earth.google.com/kml/2.1', 'kml');
+$parNode = $dom->appendChild($node);
+// Creates a KML Document element and append it to the KML element.
+$dnode = $dom->createElement('Document');
+$docNode = $parNode->appendChild($dnode);
+if ($suburb != "") $result_stops = getStopsBySuburb($suburb);
+else $result_stops = getStops();
+foreach ($result_stops as $stop) {
+ $description = 'http://bus.lambdacomplex.org/' . 'stop.php?stopid=' . $stop['stop_id'] . " <br>";
+ // Creates a Placemark and append it to the Document.
+ $node = $dom->createElement('Placemark');
+ $placeNode = $docNode->appendChild($node);
+ // Creates an id attribute and assign it the value of id column.
+ $placeNode->setAttribute('id', 'placemark' . $stop['stop_id']);
+ // Create name, and description elements and assigns them the values of the name and address columns from the results.
+ $nameNode = $dom->createElement('name', htmlentities($stop['stop_name']));
+ $descriptionNode = $dom->createElement('description', $description);
+ $placeNode->appendChild($nameNode);
+ $placeNode->appendChild($descriptionNode);
+ // Creates a Point element.
+ $pointNode = $dom->createElement('Point');
+ $placeNode->appendChild($pointNode);
+ // Creates a coordinates element and gives it the value of the lng and lat columns from the results.
+ $coorStr = $stop['stop_lon'] . ',' . $stop['stop_lat'];
+ $coorNode = $dom->createElement('coordinates', $coorStr);
+ $pointNode->appendChild($coorNode);
+}
+$kmlOutput = $dom->saveXML();
+echo $kmlOutput;
+?>
--- /dev/null
+++ b/include/common-auth.inc.php
@@ -1,1 +1,33 @@
+<?php
+require $basePath.'lib/openid.php';
+$openid = new LightOpenID($_SERVER['HTTP_HOST']);
+
+function login()
+{
+ global $openid;
+ if(!$openid->mode) {
+ $openid->required = array('contact/email');
+ $openid->identity = 'https://www.google.com/accounts/o8/id';
+ header('Location: ' . $openid->authUrl());
+ }
+ }
+
+function auth()
+
+{
+ if ($_SESSION['authed'] == true) return true;
+ global $openid;
+
+ if($openid->mode) {
+ $attr = $openid->getAttributes();
+ if ($attr["contact/email"] != "maxious@gmail.com") {
+ die("Access Denied");
+ } else {
+ $_SESSION['authed'] = true;
+ }
+ } else {
+ login();
+ }
+ }
+?>
--- a/include/common-db.inc.php
+++ b/include/common-db.inc.php
@@ -1,20 +1,35 @@
<?php
+
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
if (php_uname('n') == "actbus-www") {
- $conn = new PDO("pgsql:dbname=transitdata;user=transitdata;password=transitdata;host=bus-main.lambdacomplex.org");
-}
-else if (isDebugServer()) {
- $conn = new PDO("pgsql:dbname=transitdata;user=postgres;password=snmc;host=localhost");
-}
-else {
- $conn = new PDO("pgsql:dbname=transitdata;user=transitdata;password=transitdata;host=localhost");
+ $conn = new PDO("pgsql:dbname=transitdata;user=transitdata;password=transitdata;host=bus-main.lambdacomplex.org");
+} else if (isDebugServer()) {
+ $conn = new PDO("pgsql:dbname=transitdata;user=postgres;password=snmc;host=localhost");
+} else {
+ $conn = new PDO("pgsql:dbname=transitdata;user=transitdata;password=transitdata;host=localhost");
}
if (!$conn) {
- die("A database error occurred.\n");
+ die("A database error occurred.\n");
}
-function databaseError($errMsg)
-{
- die($errMsg);
+
+function databaseError($errMsg) {
+ die($errMsg);
}
+
include ('db/route-dao.inc.php');
include ('db/trip-dao.inc.php');
include ('db/stop-dao.inc.php');
--- a/include/common-geo.inc.php
+++ b/include/common-geo.inc.php
@@ -1,152 +1,172 @@
<?php
+
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
// SELECT array_to_string(array(SELECT REPLACE(name_2006, ',', '\,') as name FROM suburbs order by name), ',')
$suburbs = explode(",", "Acton,Ainslie,Amaroo,Aranda,Banks,Barton,Belconnen,Bonner,Bonython,Braddon,Bruce,Calwell,Campbell,Chapman,Charnwood,Chifley,Chisholm,City,Conder,Cook,Curtin,Deakin,Dickson,Downer,Duffy,Dunlop,Evatt,Fadden,Farrer,Fisher,Florey,Flynn,Forrest,Franklin,Fraser,Fyshwick,Garran,Gilmore,Giralang,Gordon,Gowrie,Greenway,Griffith,Gungahlin,Hackett,Hall,Harrison,Hawker,Higgins,Holder,Holt,Hughes,Hume,Isaacs,Isabella Plains,Kaleen,Kambah,Kingston,Latham,Lawson,Lyneham,Lyons,Macarthur,Macgregor,Macquarie,Mawson,McKellar,Melba,Mitchell,Monash,Narrabundah,Ngunnawal,Nicholls,Oaks Estate,O'Connor,O'Malley,Oxley,Page,Palmerston,Parkes,Pearce,Phillip,Pialligo,Red Hill,Reid,Richardson,Rivett,Russell,Scullin,Spence,Stirling,Symonston,Tharwa,Theodore,Torrens,Turner,Wanniassa,Waramanga,Watson,Weetangera,Weston,Yarralumla");
-function staticmap($mapPoints, $zoom = 0, $markerImage = "iconb", $collapsible = true)
-{
- $width = 300;
- $height = 300;
- $metersperpixel[9] = 305.492 * $width;
- $metersperpixel[10] = 152.746 * $width;
- $metersperpixel[11] = 76.373 * $width;
- $metersperpixel[12] = 38.187 * $width;
- $metersperpixel[13] = 19.093 * $width;
- $metersperpixel[14] = 9.547 * $width;
- $metersperpixel[15] = 4.773 * $width;
- $metersperpixel[16] = 2.387 * $width;
- // $metersperpixel[17]=1.193*$width;
- $center = "";
- $markers = "";
- $minlat = 999;
- $minlon = 999;
- $maxlat = 0;
- $maxlon = 0;
- if (sizeof($mapPoints) < 1) return "map error";
- if (sizeof($mapPoints) === 1) {
- if ($zoom == 0) $zoom = 14;
- $markers.= "{$mapPoints[0][0]},{$mapPoints[0][1]},$markerimage";
- $center = "{$mapPoints[0][0]},{$mapPoints[0][1]}";
- }
- else {
- foreach ($mapPoints as $index => $mapPoint) {
- $markers.= $mapPoint[0] . "," . $mapPoint[1] . "," . $markerImage . ($index + 1);
- if ($index + 1 != sizeof($mapPoints)) $markers.= "|";
- if ($mapPoint[0] < $minlat) $minlat = $mapPoint[0];
- if ($mapPoint[0] > $maxlat) $maxlat = $mapPoint[0];
- if ($mapPoint[1] < $minlon) $minlon = $mapPoint[1];
- if ($mapPoint[1] > $maxlon) $maxlon = $mapPoint[1];
- $totalLat+= $mapPoint[0];
- $totalLon+= $mapPoint[1];
- }
- if ($zoom == 0) {
- $mapwidthinmeters = distance($minlat, $minlon, $minlat, $maxlon);
- foreach (array_reverse($metersperpixel, true) as $zoomLevel => $maxdistance) {
- if ($zoom == 0 && $mapwidthinmeters < ($maxdistance + 50)) $zoom = $zoomLevel;
- }
- }
- $center = $totalLat / sizeof($mapPoints) . "," . $totalLon / sizeof($mapPoints);
- }
- $output = "";
- if ($collapsible) $output.= '<div class="map" data-role="collapsible" data-collapsed="true"><h3>Open Map...</h3>';
- $output.= '<img class="map" src="' . curPageURL() . '/lib/staticmaplite/staticmap.php?center=' . $center . '&zoom=' . $zoom . '&size=' . $width . 'x' . $height . '&markers=' .
-$markers . '" width=' . $width . ' height=' . $height . '>';
- if ($collapsible) $output.= '</div>';
- return $output;
-}
-function distance($lat1, $lng1, $lat2, $lng2, $roundLargeValues = false)
-{
- $pi80 = M_PI / 180;
- $lat1*= $pi80;
- $lng1*= $pi80;
- $lat2*= $pi80;
- $lng2*= $pi80;
- $r = 6372.797; // mean radius of Earth in km
- $dlat = $lat2 - $lat1;
- $dlng = $lng2 - $lng1;
- $a = sin($dlat / 2) * sin($dlat / 2) + cos($lat1) * cos($lat2) * sin($dlng / 2) * sin($dlng / 2);
- $c = 2 * atan2(sqrt($a) , sqrt(1 - $a));
- $km = $r * $c;
- if ($roundLargeValues) {
- if ($km < 1) return floor($km * 1000);
- else return round($km,2)."k";
- } else return floor($km * 1000);
+
+function staticmap($mapPoints, $collapsible = true, $twotone = false, $path = false, $numbered = false) {
+
+ $markers = "";
+ $height = 300;
+ $width = $height;
+ $index = 0;
+ if (sizeof($mapPoints) < 1)
+ return "map error";
+ if (sizeof($mapPoints) === 1) {
+ $markers = "markers={$mapPoints[0][0]},{$mapPoints[0][1]}";
+ } else {
+ if (!$numbered) {
+ $markers = "markers=";
+ }
+ if ($path) {
+ $markers.= "markers={$mapPoints[0][0]},{$mapPoints[0][1]}&path=";
+ }
+ foreach ($mapPoints as $index => $mapPoint) {
+ if ($twotone && $index == 0) {
+ $markers = "markerd=color:red|".$mapPoint[0] . "," . $mapPoint[1]."&markers=";
+ } else {
+ if ($numbered) {
+ $label = ($index > 9 ? 9 : $index);
+ $markers.= "markers=label:$label|" . $mapPoint[0] . "," . $mapPoint[1];
+ if ($index + 1 != sizeof($mapPoints)) {
+ $markers.= "&";
+ }
+ } else {
+ $markers.= $mapPoint[0] . "," . $mapPoint[1];
+ if ($index + 1 != sizeof($mapPoints)) {
+ $markers.= "|";
+ }
+ }
+ $index++;
+ }
+ }
+ }
+ $output = "";
+ if ($collapsible)
+ $output.= '<div class="map" data-role="collapsible" data-collapsed="true"><h3>Open Map...</h3>';
+ if (isIOSDevice()) $output.= '<img class="hiresmap" src="http://maps.googleapis.com/maps/api/staticmap?size=' . $width . 'x' . $height . '&' . $markers . '&scale=2&sensor=true" width=' . $width . ' height=' . $height . '>';
+ else $output.= '<img class="lowresmap" src="http://maps.googleapis.com/maps/api/staticmap?size=' . $width . 'x' . $height . '&' . $markers . '&scale=1&format=jpg&sensor=true" width=' . $width . ' height=' . $height . '>';
+
+ if ($collapsible)
+ $output.= '</div>';
+ return $output;
}
-function decodePolylineToArray($encoded)
-{
- // source: http://latlongeeks.com/forum/viewtopic.php?f=4&t=5
- $length = strlen($encoded);
- $index = 0;
- $points = array();
- $lat = 0;
- $lng = 0;
- while ($index < $length) {
- // Temporary variable to hold each ASCII byte.
- $b = 0;
- // The encoded polyline consists of a latitude value followed by a
- // longitude value. They should always come in pairs. Read the
- // latitude value first.
- $shift = 0;
- $result = 0;
- do {
- // The `ord(substr($encoded, $index++))` statement returns the ASCII
- // code for the character at $index. Subtract 63 to get the original
- // value. (63 was added to ensure proper ASCII characters are displayed
- // in the encoded polyline string, which is `human` readable)
- $b = ord(substr($encoded, $index++)) - 63;
- // AND the bits of the byte with 0x1f to get the original 5-bit `chunk.
- // Then left shift the bits by the required amount, which increases
- // by 5 bits each time.
- // OR the value into $results, which sums up the individual 5-bit chunks
- // into the original value. Since the 5-bit chunks were reversed in
- // order during encoding, reading them in this way ensures proper
- // summation.
- $result|= ($b & 0x1f) << $shift;
- $shift+= 5;
- }
- // Continue while the read byte is >= 0x20 since the last `chunk`
- // was not OR'd with 0x20 during the conversion process. (Signals the end)
- while ($b >= 0x20);
- // Check if negative, and convert. (All negative values have the last bit
- // set)
- $dlat = (($result & 1) ? ~($result >> 1) : ($result >> 1));
- // Compute actual latitude since value is offset from previous value.
- $lat+= $dlat;
- // The next values will correspond to the longitude for this point.
- $shift = 0;
- $result = 0;
- do {
- $b = ord(substr($encoded, $index++)) - 63;
- $result|= ($b & 0x1f) << $shift;
- $shift+= 5;
- } while ($b >= 0x20);
- $dlng = (($result & 1) ? ~($result >> 1) : ($result >> 1));
- $lng+= $dlng;
- // The actual latitude and longitude values were multiplied by
- // 1e5 before encoding so that they could be converted to a 32-bit
- // integer representation. (With a decimal accuracy of 5 places)
- // Convert back to original values.
- $points[] = array(
- $lat * 1e-5,
- $lng * 1e-5
- );
- }
- return $points;
+function distance($lat1, $lng1, $lat2, $lng2, $roundLargeValues = false) {
+ $pi80 = M_PI / 180;
+ $lat1*= $pi80;
+ $lng1*= $pi80;
+ $lat2*= $pi80;
+ $lng2*= $pi80;
+ $r = 6372.797; // mean radius of Earth in km
+ $dlat = $lat2 - $lat1;
+ $dlng = $lng2 - $lng1;
+ $a = sin($dlat / 2) * sin($dlat / 2) + cos($lat1) * cos($lat2) * sin($dlng / 2) * sin($dlng / 2);
+ $c = 2 * atan2(sqrt($a), sqrt(1 - $a));
+ $km = $r * $c;
+ if ($roundLargeValues) {
+ if ($km < 1)
+ return floor($km * 1000);
+ else
+ return round($km, 2) . "k";
+ }
+ else
+ return floor($km * 1000);
}
-function geocode($query, $giveOptions)
-{
- global $cloudmadeAPIkey;
- $url = "http://geocoding.cloudmade.com/$cloudmadeAPIkey/geocoding/v2/find.js?query=" . urlencode($query) . "&bbox=-35.5,149.00,-35.15,149.1930&return_location=true&bbox_only=true";
- $contents = json_decode(getPage($url));
- if ($giveOptions) return $contents->features;
- elseif (isset($contents->features[0]->centroid)) return $contents->features[0]->centroid->coordinates[0] . "," . $contents->features[0]->centroid->coordinates[1];
- else return "";
+
+function decodePolylineToArray($encoded) {
+ // source: http://latlongeeks.com/forum/viewtopic.php?f=4&t=5
+ $length = strlen($encoded);
+ $index = 0;
+ $points = array();
+ $lat = 0;
+ $lng = 0;
+ while ($index < $length) {
+ // Temporary variable to hold each ASCII byte.
+ $b = 0;
+ // The encoded polyline consists of a latitude value followed by a
+ // longitude value. They should always come in pairs. Read the
+ // latitude value first.
+ $shift = 0;
+ $result = 0;
+ do {
+ // The `ord(substr($encoded, $index++))` statement returns the ASCII
+ // code for the character at $index. Subtract 63 to get the original
+ // value. (63 was added to ensure proper ASCII characters are displayed
+ // in the encoded polyline string, which is `human` readable)
+ $b = ord(substr($encoded, $index++)) - 63;
+ // AND the bits of the byte with 0x1f to get the original 5-bit `chunk.
+ // Then left shift the bits by the required amount, which increases
+ // by 5 bits each time.
+ // OR the value into $results, which sums up the individual 5-bit chunks
+ // into the original value. Since the 5-bit chunks were reversed in
+ // order during encoding, reading them in this way ensures proper
+ // summation.
+ $result|= ($b & 0x1f) << $shift;
+ $shift+= 5;
+ }
+ // Continue while the read byte is >= 0x20 since the last `chunk`
+ // was not OR'd with 0x20 during the conversion process. (Signals the end)
+ while ($b >= 0x20);
+ // Check if negative, and convert. (All negative values have the last bit
+ // set)
+ $dlat = (($result & 1) ? ~($result >> 1) : ($result >> 1));
+ // Compute actual latitude since value is offset from previous value.
+ $lat+= $dlat;
+ // The next values will correspond to the longitude for this point.
+ $shift = 0;
+ $result = 0;
+ do {
+ $b = ord(substr($encoded, $index++)) - 63;
+ $result|= ($b & 0x1f) << $shift;
+ $shift+= 5;
+ } while ($b >= 0x20);
+ $dlng = (($result & 1) ? ~($result >> 1) : ($result >> 1));
+ $lng+= $dlng;
+ // The actual latitude and longitude values were multiplied by
+ // 1e5 before encoding so that they could be converted to a 32-bit
+ // integer representation. (With a decimal accuracy of 5 places)
+ // Convert back to original values.
+ $points[] = array(
+ $lat * 1e-5,
+ $lng * 1e-5
+ );
+ }
+ return $points;
}
-function reverseGeocode($lat, $lng)
-{
- global $cloudmadeAPIkey;
- $url = "http://geocoding.cloudmade.com/$cloudmadeAPIkey/geocoding/v2/find.js?around=" . $lat . "," . $lng . "&distance=closest&object_type=road";
- $contents = json_decode(getPage($url));
- return $contents->features[0]->properties->name;
+
+function geocode($query, $giveOptions) {
+ global $cloudmadeAPIkey;
+ $url = "http://geocoding.cloudmade.com/$cloudmadeAPIkey/geocoding/v2/find.js?query=" . urlencode($query) . "&bbox=-35.5,149.00,-35.15,149.1930&return_location=true&bbox_only=true";
+ $contents = json_decode(getPage($url));
+ if ($giveOptions)
+ return $contents->features;
+ elseif (isset($contents->features[0]->centroid))
+ return $contents->features[0]->centroid->coordinates[0] . "," . $contents->features[0]->centroid->coordinates[1];
+ else
+ return "";
}
+
+function reverseGeocode($lat, $lng) {
+ global $cloudmadeAPIkey;
+ $url = "http://geocoding.cloudmade.com/$cloudmadeAPIkey/geocoding/v2/find.js?around=" . $lat . "," . $lng . "&distance=closest&object_type=road";
+ $contents = json_decode(getPage($url));
+ return $contents->features[0]->properties->name;
+}
+
?>
--- a/include/common-net.inc.php
+++ b/include/common-net.inc.php
@@ -1,31 +1,48 @@
<?php
-function getPage($url)
-{
- debug($url, "json");
- $ch = curl_init($url);
- curl_setopt($ch, CURLOPT_RETURNTRANSFER, 1);
- curl_setopt($ch, CURLOPT_HEADER, 0);
- curl_setopt($ch, CURLOPT_TIMEOUT, 45);
- $page = curl_exec($ch);
- if (curl_errno($ch)) {
- echo "<font color=red> Database temporarily unavailable: ";
- echo curl_errno($ch) . " " . curl_error($ch);
- if (isDebug()) {
- echo $url;
- }
- echo "</font><br>";
- }
- curl_close($ch);
- debug(print_r($page,true),"json");
- return $page;
+
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
+
+function getPage($url) {
+ debug($url, "json");
+ $ch = curl_init($url);
+ curl_setopt($ch, CURLOPT_RETURNTRANSFER, 1);
+ curl_setopt($ch, CURLOPT_HEADER, 0);
+ curl_setopt($ch, CURLOPT_TIMEOUT, 45);
+ $page = curl_exec($ch);
+ if (curl_errno($ch)) {
+ echo "<font color=red> Database temporarily unavailable: ";
+ echo curl_errno($ch) . " " . curl_error($ch);
+ if (isDebug()) {
+ echo $url;
+ }
+ echo "</font><br>";
+ }
+ curl_close($ch);
+ debug(print_r($page, true), "json");
+ return $page;
}
-function curPageURL()
-{
- $isHTTPS = (isset($_SERVER["HTTPS"]) && $_SERVER["HTTPS"] == "on");
- $port = (isset($_SERVER["SERVER_PORT"]) && ((!$isHTTPS && $_SERVER["SERVER_PORT"] != "80") || ($isHTTPS && $_SERVER["SERVER_PORT"] != "443")));
- $port = ($port) ? ':' . $_SERVER["SERVER_PORT"] : '';
- $url = ($isHTTPS ? 'https://' : 'http://') . $_SERVER["SERVER_NAME"] . $port . htmlentities(dirname($_SERVER['PHP_SELF']) , ENT_QUOTES);
- return $url;
+
+function curPageURL() {
+ $isHTTPS = (isset($_SERVER["HTTPS"]) && $_SERVER["HTTPS"] == "on");
+ $port = (isset($_SERVER["SERVER_PORT"]) && ((!$isHTTPS && $_SERVER["SERVER_PORT"] != "80") || ($isHTTPS && $_SERVER["SERVER_PORT"] != "443")));
+ $port = ($port) ? ':' . $_SERVER["SERVER_PORT"] : '';
+ $url = ($isHTTPS ? 'https://' : 'http://') . $_SERVER["SERVER_NAME"] . $port . htmlentities(dirname($_SERVER['PHP_SELF']), ENT_QUOTES);
+ return $url;
}
+
?>
--- a/include/common-request.inc.php
+++ b/include/common-request.inc.php
@@ -1,48 +1,72 @@
<?php
+
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
if (isset($_REQUEST['firstLetter'])) {
- $firstLetter = filter_var($_REQUEST['firstLetter'], FILTER_SANITIZE_STRING);
+ $firstLetter = filter_var($_REQUEST['firstLetter'], FILTER_SANITIZE_STRING);
}
if (isset($_REQUEST['bysuburbs'])) {
- $bysuburbs = true;
+ $bysuburbs = true;
}
if (isset($_REQUEST['bynumber'])) {
- $bynumber = true;
+ $bynumber = true;
}
if (isset($_REQUEST['allstops'])) {
- $allstops = true;
+ $allstops = true;
}
if (isset($_REQUEST['nearby'])) {
- $nearby = true;
+ $nearby = true;
}
if (isset($_REQUEST['suburb'])) {
- $suburb = filter_var($_REQUEST['suburb'], FILTER_SANITIZE_STRING);
+ $suburb = $_REQUEST['suburb'];
}
-$pageKey = filter_var($_REQUEST['pageKey'], FILTER_SANITIZE_NUMBER_INT);
-$lat = filter_var($_REQUEST['lat'], FILTER_SANITIZE_NUMBER_FLOAT, FILTER_FLAG_ALLOW_FRACTION);
-$lon = filter_var($_REQUEST['lon'], FILTER_SANITIZE_NUMBER_FLOAT, FILTER_FLAG_ALLOW_FRACTION);
-$max_distance = filter_var($_REQUEST['radius'], FILTER_SANITIZE_NUMBER_INT);
+if (isset($_REQUEST['pageKey'])) {
+ $pageKey = filter_var($_REQUEST['pageKey'], FILTER_SANITIZE_NUMBER_INT);
+}
+if (isset($_REQUEST['lat'])) {
+ $lat = filter_var($_REQUEST['lat'], FILTER_SANITIZE_NUMBER_FLOAT, FILTER_FLAG_ALLOW_FRACTION);
+}
+if (isset($_REQUEST['lon'])) {
+ $lon = filter_var($_REQUEST['lon'], FILTER_SANITIZE_NUMBER_FLOAT, FILTER_FLAG_ALLOW_FRACTION);
+}
+if (isset($_REQUEST['radius'])) {
+ $max_distance = filter_var($_REQUEST['radius'], FILTER_SANITIZE_NUMBER_INT);
+}
if (isset($_REQUEST['numberSeries'])) {
- $numberSeries = filter_var($_REQUEST['numberSeries'], FILTER_SANITIZE_NUMBER_INT);
+ $numberSeries = filter_var($_REQUEST['numberSeries'], FILTER_SANITIZE_NUMBER_INT);
}
if (isset($_REQUEST['routeDestination'])) {
- $routeDestination = urldecode(filter_var($_REQUEST['routeDestination'], FILTER_SANITIZE_ENCODED));
+ $routeDestination = urldecode(filter_var($_REQUEST['routeDestination'], FILTER_SANITIZE_ENCODED));
}
if (isset($_REQUEST['stopcode'])) {
- $stopcode = filter_var($_REQUEST['stopcode'], FILTER_SANITIZE_STRING);
+ $stopcode = filter_var($_REQUEST['stopcode'], FILTER_SANITIZE_STRING);
}
if (isset($_REQUEST['stopids'])) {
- $stopids = explode(",", filter_var($_REQUEST['stopids'], FILTER_SANITIZE_STRING));
+ $stopids = explode(",", filter_var($_REQUEST['stopids'], FILTER_SANITIZE_STRING));
}
if (isset($_REQUEST['tripid'])) {
- $tripid = filter_var($_REQUEST['tripid'], FILTER_SANITIZE_NUMBER_INT);
+ $tripid = filter_var($_REQUEST['tripid'], FILTER_SANITIZE_NUMBER_INT);
}
if (isset($_REQUEST['stopid'])) {
- $stopid = filter_var($_REQUEST['stopid'], FILTER_SANITIZE_NUMBER_INT);
+ $stopid = filter_var($_REQUEST['stopid'], FILTER_SANITIZE_NUMBER_INT);
}
if (isset($_REQUEST['routeid'])) {
- $routeid = filter_var($_REQUEST['routeid'], FILTER_SANITIZE_NUMBER_INT);
+ $routeid = filter_var($_REQUEST['routeid'], FILTER_SANITIZE_NUMBER_INT);
}
if (isset($_REQUEST['geolocate'])) {
-$geolocate = filter_var($_REQUEST['geolocate'], FILTER_SANITIZE_URL);
+ $geolocate = filter_var($_REQUEST['geolocate'], FILTER_SANITIZE_URL);
}
?>
--- a/include/common-session.inc.php
+++ b/include/common-session.inc.php
@@ -1,65 +1,77 @@
<?php
+
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
// you have to open the session to be able to modify or remove it
session_start();
if (isset($_REQUEST['service_period'])) {
- $_SESSION['service_period'] = filter_var($_REQUEST['service_period'], FILTER_SANITIZE_STRING);
- sessionUpdated();
+ $_SESSION['service_period'] = filter_var($_REQUEST['service_period'], FILTER_SANITIZE_STRING);
+ sessionUpdated();
}
if (isset($_REQUEST['time'])) {
- $_SESSION['time'] = filter_var($_REQUEST['time'], FILTER_SANITIZE_STRING);
- sessionUpdated();
+ $_SESSION['time'] = filter_var($_REQUEST['time'], FILTER_SANITIZE_STRING);
+ sessionUpdated();
}
if (isset($_REQUEST['geolocate']) && $_REQUEST['geolocate'] != "Enter co-ordinates or address here") {
- $geocoded = false;
- if (isset($_REQUEST['lat']) && isset($_REQUEST['lon'])) {
- $_SESSION['lat'] = trim(filter_var($_REQUEST['lat'], FILTER_SANITIZE_NUMBER_FLOAT, FILTER_FLAG_ALLOW_FRACTION));
- $_SESSION['lon'] = trim(filter_var($_REQUEST['lon'], FILTER_SANITIZE_NUMBER_FLOAT, FILTER_FLAG_ALLOW_FRACTION));
- }
- else {
- if (startsWith($geolocate, "-")) {
- $locateparts = explode(",", $geolocate);
- $_SESSION['lat'] = $locateparts[0];
- $_SESSION['lon'] = $locateparts[1];
- }
- else if (strpos($geolocate, "(") !== false) {
- $geoParts = explode("(", $geolocate);
- $locateparts = explode(",", str_replace(")", "",$geoParts[1]));
- $_SESSION['lat'] = $locateparts[0];
- $_SESSION['lon'] = $locateparts[1];
- }
- else {
- $contents = geocode($geolocate, true);
- print_r($contents);
- if (isset($contents[0]->centroid)) {
- $geocoded = true;
- $_SESSION['lat'] = $contents[0]->centroid->coordinates[0];
- $_SESSION['lon'] = $contents[0]->centroid->coordinates[1];
- }
- else {
- $_SESSION['lat'] = "";
- $_SESSION['lon'] = "";
- }
- }
- }
- if ($_SESSION['lat'] != "" && isAnalyticsOn()) {
- trackEvent("Geolocation", "Updated Location", "Geocoded - " . ($geocoded ? "Yes" : "No"));
- }
- sessionUpdated();
+ $geocoded = false;
+ if (isset($_REQUEST['lat']) && isset($_REQUEST['lon'])) {
+ $_SESSION['lat'] = trim(filter_var($_REQUEST['lat'], FILTER_SANITIZE_NUMBER_FLOAT, FILTER_FLAG_ALLOW_FRACTION));
+ $_SESSION['lon'] = trim(filter_var($_REQUEST['lon'], FILTER_SANITIZE_NUMBER_FLOAT, FILTER_FLAG_ALLOW_FRACTION));
+ } else {
+ if (startsWith($geolocate, "-")) {
+ $locateparts = explode(",", $geolocate);
+ $_SESSION['lat'] = $locateparts[0];
+ $_SESSION['lon'] = $locateparts[1];
+ } else if (strpos($geolocate, "(") !== false) {
+ $geoParts = explode("(", $geolocate);
+ $locateparts = explode(",", str_replace(")", "", $geoParts[1]));
+ $_SESSION['lat'] = $locateparts[0];
+ $_SESSION['lon'] = $locateparts[1];
+ } else {
+ $contents = geocode($geolocate, true);
+ print_r($contents);
+ if (isset($contents[0]->centroid)) {
+ $geocoded = true;
+ $_SESSION['lat'] = $contents[0]->centroid->coordinates[0];
+ $_SESSION['lon'] = $contents[0]->centroid->coordinates[1];
+ } else {
+ $_SESSION['lat'] = "";
+ $_SESSION['lon'] = "";
+ }
+ }
+ }
+ sessionUpdated();
}
-function sessionUpdated()
-{
- $_SESSION['lastUpdated'] = time();
+
+function sessionUpdated() {
+ $_SESSION['lastUpdated'] = time();
}
+
// timeoutSession
$TIMEOUT_LIMIT = 60 * 5; // 5 minutes
if (isset($_SESSION['lastUpdated']) && $_SESSION['lastUpdated'] + $TIMEOUT_LIMIT < time()) {
- debug("Session timeout " . ($_SESSION['lastUpdated'] + $TIMEOUT_LIMIT) . ">" . time() , "session");
- session_destroy();
- session_start();
+ debug("Session timeout " . ($_SESSION['lastUpdated'] + $TIMEOUT_LIMIT) . ">" . time(), "session");
+ session_destroy();
+ session_start();
}
+
//debug(print_r($_SESSION, true) , "session");
-function current_time()
-{
- return ($_SESSION['time'] ? $_SESSION['time'] : date("H:i:s"));
+function current_time() {
+ return ($_SESSION['time'] ? $_SESSION['time'] : date("H:i:s"));
}
+
?>
+
--- a/include/common-template.inc.php
+++ b/include/common-template.inc.php
@@ -1,63 +1,81 @@
<?php
+
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
+
// Copyright 2009 Google Inc. All Rights Reserved.
$GA_ACCOUNT = "MO-22173039-1";
$GA_PIXEL = "/lib/ga.php";
-function googleAnalyticsGetImageUrl()
-{
- global $GA_ACCOUNT, $GA_PIXEL;
- //if (stristr($_SERVER['HTTP_USER_AGENT'], 'Googlebot') return "";
- $url = "";
- $url.= $GA_PIXEL . "?";
- $url.= "utmac=" . $GA_ACCOUNT;
- $url.= "&utmn=" . rand(0, 0x7fffffff);
- $referer = $_SERVER["HTTP_REFERER"];
- $query = $_SERVER["QUERY_STRING"];
- $path = $_SERVER["REQUEST_URI"];
- if (empty($referer)) {
- $referer = "-";
- }
- $url.= "&utmr=" . urlencode($referer);
- if (!empty($path)) {
- $url.= "&utmp=" . urlencode($path);
- }
- $url.= "&guid=ON";
- return str_replace("&", "&", $url);
-}
-function include_header($pageTitle, $pageType, $opendiv = true, $geolocate = false, $datepicker = false)
-{
- echo '
+
+function googleAnalyticsGetImageUrl() {
+ global $GA_ACCOUNT, $GA_PIXEL;
+ //if (stristr($_SERVER['HTTP_USER_AGENT'], 'Googlebot') return "";
+ $url = "";
+ $url.= $GA_PIXEL . "?";
+ $url.= "utmac=" . $GA_ACCOUNT;
+ $url.= "&utmn=" . rand(0, 0x7fffffff);
+ $referer = $_SERVER["HTTP_REFERER"];
+ $query = $_SERVER["QUERY_STRING"];
+ $path = $_SERVER["REQUEST_URI"];
+ if (empty($referer)) {
+ $referer = "-";
+ }
+ $url.= "&utmr=" . urlencode($referer);
+ if (!empty($path)) {
+ $url.= "&utmp=" . urlencode($path);
+ }
+ $url.= "&guid=ON";
+ return str_replace("&", "&", $url);
+}
+
+function include_header($pageTitle, $pageType, $opendiv = true, $geolocate = false, $datepicker = false) {
+ global $basePath, $GTFSREnabled;
+ echo '
<!DOCTYPE html>
<html lang="en">
<head>
<meta charset="UTF-8">
- <title>' . $pageTitle . '</title>
- <meta name="google-site-verification"
-content="-53T5Qn4TB_de1NyfR_ZZkEVdUNcNFSaYKSFkWKx-sY" />
- <link rel="stylesheet" href="css/jquery-ui-1.8.12.custom.css" />';
- if (isDebugServer()) {
- echo '<link rel="stylesheet" href="css/jquery.mobile-1.0a4.css" />
-
- <script type="text/javascript" src="js/jquery-1.5.js"></script>
- <script>$(document).bind("mobileinit", function(){
+<meta name="viewport" content="width=device-width, initial-scale=1">
+<title>' . $pageTitle . ' - Canberra Bus Timetable</title>
+ <meta name="google-site-verification" content="-53T5Qn4TB_de1NyfR_ZZkEVdUNcNFSaYKSFkWKx-sY" />
+<link rel="dns-prefetch" href="//code.jquery.com">
+<link rel="dns-prefetch" href="//ajax.googleapis.com">
+ <link rel="stylesheet" href="' . $basePath . 'css/jquery-ui-1.8.12.custom.css" />';
+ $jqmVersion = "1.0rc1";
+ if (isDebugServer()) {
+ $jqmcss = $basePath . "css/jquery.mobile-$jqmVersion.css";
+ $jqjs = $basePath . "js/jquery-1.6.2.min.js";
+ $jqmjs = $basePath . "js/jquery.mobile-$jqmVersion.js";
+ } else {
+ $jqmcss = "//code.jquery.com/mobile/1.0b3/jquery.mobile-$jqmVersion.min.css";
+ $jqjs = "//ajax.googleapis.com/ajax/libs/jquery/1.6.2/jquery.min.js";
+ $jqmjs = "//code.jquery.com/mobile/1.0b3/jquery.mobile-$jqmVersion.min.js";
+ }
+ echo '<link rel="stylesheet" href="' . $jqmcss . '" />
+ <script src="' . $jqjs . '"></script>
+ <script>$(document).bind("mobileinit", function(){
$.mobile.ajaxEnabled = false;
});
-</script>
- <script type="text/javascript" src="js/jquery.mobile-1.0a4.js"></script>';
- }
- else {
- echo '<link rel="stylesheet" href="http://code.jquery.com/mobile/1.0a4.1/jquery.mobile-1.0a4.1.min.css" />
- <script type="text/javascript" src="http://ajax.googleapis.com/ajax/libs/jquery/1.5.2/jquery.min.js"></script>
- <script>$(document).bind("mobileinit", function(){
- $.mobile.ajaxEnabled = false;
-});
-</script>
- <script type="text/javascript" src="http://code.jquery.com/mobile/1.0a4.1/jquery.mobile-1.0a4.1.min.js"></script>';
- }
- echo '
- <script src="js/jquery.ui.autocomplete.min.js"></script>
-<script src="js/jquery.ui.core.min.js"></script>
-<script src="js/jquery.ui.position.min.js"></script>
-<script src="js/jquery.ui.widget.min.js"></script>
+</script>
+ <script src="' . $jqmjs . '"></script>
+
+<script src="' . $basePath . 'js/jquery.ui.core.min.js"></script>
+<script src="' . $basePath . 'js/jquery.ui.position.min.js"></script>
+<script src="' . $basePath . 'js/jquery.ui.widget.min.js"></script>
+ <script src="' . $basePath . 'js/jquery.ui.autocomplete.min.js"></script>
<script>
$(function() {
$( "#geolocate" ).autocomplete({
@@ -73,110 +91,36 @@
minLength: 2
});
});
- </script>
- ';
- echo '<style type="text/css">
- .ui-navbar {
- width: 100%;
- }
- .ui-btn-inner {
- white-space: normal !important;
- }
- .ui-li-heading {
- white-space: normal !important;
- }
- .ui-listview-filter {
- margin: 0 !important;
- }
- .ui-icon-navigation {
- background-image: url(css/images/113-navigation.png);
- background-position: 1px 0;
- }
- .ui-icon-beaker {
- background-image: url(css/images/91-beaker-2.png);
- background-position: 1px 0;
- }
- #footer {
- text-size: 0.75em;
- text-align: center;
- }
- body {
- background-color: #F0F0F0;
- }
- #jqm-homeheader {
- text-align: center;
- }
- .viaPoints {
- display: none;
- text-size: 0.2em;
- }
- .min-width-480px .viaPoints {
- display: inline;
- }
- #extrainfo {
- visibility: hidden;
- display: none;
- }
- #servicewarning {
- padding: 1em;
- margin-bottom: 0.5em;
- text-size: 0.2em;
- background-color: #FF9;
- -moz-border-radius: 15px;
-border-radius: 15px;
- }
-
-/*#leftcolumn {
- float: none;
-}
-.min-width-768px #leftcolumn {
- float: left;
- width: 30%;
-}
-#rightcolumn {
- float: none;
-}
-.min-width-768px #rightcolumn {
- float: right;
- width: 68%;
-}*/
-
-#footer {
-clear:both;
-text-align:center;
-}
- // source http://webaim.org/techniques/skipnav/
- #skip a, #skip a:hover, #skip a:visited
-{
-position:absolute;
-left:0px;
-top:-500px;
-width:1px;
-height:1px;
-overflow:hidden;
-}
-
-#skip a:active, #skip a:focus
-{
-position:static;
-width:auto;
-height:auto;
-}
-</style>';
- if (strstr($_SERVER['HTTP_USER_AGENT'], 'iPhone') || strstr($_SERVER['HTTP_USER_AGENT'], 'iPod') || strstr($_SERVER['HTTP_USER_AGENT'], 'iPad')) {
- echo '<meta name="apple-mobile-web-app-capable" content="yes" />
+ </script>';
+ echo '<style type="text/css">';
+ if (strstr($_SERVER['HTTP_USER_AGENT'], 'Android'))
+ echo '.ui-shadow,.ui-btn-up-a,.ui-btn-hover-a,.ui-btn-down-a,.ui-body-b,.ui-btn-up-b,.ui-btn-hover-b,
+.ui-btn-down-b,.ui-bar-c,.ui-body-c,.ui-btn-up-c,.ui-btn-hover-c,.ui-btn-down-c,.ui-bar-c,.ui-body-d,
+.ui-btn-up-d,.ui-btn-hover-d,.ui-btn-down-d,.ui-bar-d,.ui-body-e,.ui-btn-up-e,.ui-btn-hover-e,
+.ui-btn-down-e,.ui-bar-e,.ui-overlay-shadow,.ui-shadow,.ui-btn-active,.ui-body-a,.ui-bar-a {
+ text-shadow: none;
+ box-shadow: none;
+ -webkit-box-shadow: none;
+}';
+ echo '</style>';
+ echo '<link rel="stylesheet" href="' . $basePath . 'css/local.css.php" />';
+ if (isIOSDevice()){
+ echo '<meta name="apple-mobile-web-app-capable" content="yes" />
<meta name="apple-mobile-web-app-status-bar-style" content="black" />
<link rel="apple-touch-startup-image" href="startup.png" />
<link rel="apple-touch-icon" href="apple-touch-icon.png" />';
- }
- if ($geolocate) {
- echo "<script>
+ }
+ if ($geolocate) {
+ echo "<script>
function success(position) {
$('#error').val('Location now detected. Please wait for data to load.');
$('#geolocate').val(position.coords.latitude+','+position.coords.longitude);
-$.ajax({ url: \"include/common.inc.php?geolocate=yes&lat=\"+position.coords.latitude+\"&lon=\"+position.coords.longitude });
-location.reload(true);
+$.ajax({ async: false,
+success: function(){
+ location.reload(true);
+ },
+url: \"include/common.inc.php?geolocate=yes&lat=\"+position.coords.latitude+\"&lon=\"+position.coords.longitude });
}
function error(msg) {
$('#error').val('Error: '+msg);
@@ -195,16 +139,14 @@
$(document).ready(function() {
$('#here').click(function(event) { $('#geolocate').val(geolocate()); return false;});
$('#here').show();
- /*if ($.mobile.media('screen and (min-width: 768px)')) {
- $('map a:first').click();
- $('#settings a:first').click();
- }*/
});
";
- if (!isset($_SESSION['lat']) || $_SESSION['lat'] == "") echo "geolocate();";
- echo "</script> ";
- }
- if (isAnalyticsOn()) echo '
+ if (!isset($_SESSION['lat']) || $_SESSION['lat'] == "")
+ echo "geolocate();";
+ echo "</script> ";
+ }
+ if (isAnalyticsOn())
+ echo '
<script type="text/javascript">' . "
var _gaq = _gaq || [];
@@ -212,40 +154,48 @@
_gaq.push(['_trackPageview']);
_gaq.push(['_trackPageLoadTime']);
</script>";
- echo '</head>
+ echo '</head>
<body>
<div id="skip">
<a href="#maincontent">Skip to content</a>
</div>
';
- if ($opendiv) {
- echo '<div data-role="page">
+ if ($opendiv) {
+ echo '<div data-role="page">
<div data-role="header" data-position="inline">
<a href="' . (isset($_SERVER["HTTP_REFERER"]) ? $_SERVER["HTTP_REFERER"] : "javascript:history.go(-1)") . '" data-icon="arrow-l" data-rel="back" class="ui-btn-left">Back</a>
<h1>' . $pageTitle . '</h1>
- <a href="/index.php" data-icon="home" class="ui-btn-right">Home</a>
+ <a href="' . $basePath . '/index.php" data-icon="home" class="ui-btn-right">Home</a>
</div><!-- /header -->
<a name="maincontent" id="maincontent"></a>
<div data-role="content"> ';
- $overrides = getServiceOverride();
- if ($overrides['service_id']) {
- if ($overrides['service_id'] == "noservice") {
- echo '<div id="servicewarning">Buses are <strong>not running today</strong> due to industrial action/public holiday. See <a
+ $overrides = getServiceOverride();
+ if ($overrides['service_id']) {
+ if ($overrides['service_id'] == "noservice") {
+ echo '<div id="servicewarning">Buses are <strong>not running today</strong> due to industrial action/public holiday. See <a
href="http://www.action.act.gov.au">http://www.action.act.gov.au</a> for details.</div>';
- }
- else {
- echo '<div id="servicewarning">Buses are running on an altered timetable today due to industrial action/public holiday. See <a href="http://www.action.act.gov.au">http://www.action.act.gov.au</a> for details.</div>';
- }
- }
- }
-
-}
-function include_footer()
-{
- echo '<div id="footer"><a href="about.php">About/Contact Us</a> <a href="feedback.php">Feedback/Bug Report</a>';
- echo '</div>';
- if (isAnalyticsOn()) {
- echo "<script> (function() {
+ } else {
+ echo '<div id="servicewarning">Buses are running on an altered timetable today due to industrial action/public holiday. See <a href="http://www.action.act.gov.au">http://www.action.act.gov.au</a> for details.</div>';
+ }
+ }
+ if ($GTFSREnabled) {
+ $serviceAlerts = getServiceAlertsAsArray("agency", "0");
+ if (isset($serviceAlerts['entity']) && sizeof($serviceAlerts['entity']) > 0) {
+ foreach ($serviceAlerts['entity'] as $entity) {
+ echo "<div id='servicewarning'>" . date("F j, g:i a", strtotime($entity['alert']['active_period'][0]['start'])) . " to " . date("F j, g:i a", strtotime($entity['alert']['active_period'][0]['end'])) . "{$entity['alert']['header_text']['translation'][0]['text']}<br>Warning: {$entity['alert']['description_text']['translation'][0]['text']}
+ <br><a href='{$entity['alert']['url']['translation'][0]['text']}'>Source</a> </div>";
+ }
+ }
+ }
+ }
+}
+
+function include_footer() {
+ global $basePath;
+ echo '<div id="footer"><a href="' . $basePath . 'about.php">About/Contact Us</a> <a href="' . $basePath . 'feedback.php">Feedback/Bug Report</a> <a href="' . $basePath . 'privacy.php">Privacy Policy</a>';
+ echo '</div>';
+ if (isAnalyticsOn()) {
+ echo "<script> (function() {
var ga = document.createElement('script'); ga.type =
'text/javascript'; ga.async = true;
ga.src = ('https:' == document.location.protocol ?
@@ -253,58 +203,43 @@
var s = document.getElementsByTagName('script')[0];
s.parentNode.insertBefore(ga, s);
})();</script>";
- $googleAnalyticsImageUrl = googleAnalyticsGetImageUrl();
- echo '<noscript><img src="' . $googleAnalyticsImageUrl . '" /></noscript>';
-
- }
- echo "\n</div></div></body></html>";
-}
-function timePlaceSettings($geolocate = false)
-{
- global $service_periods;
- $geoerror = false;
- if ($geolocate == true) {
- $geoerror = !isset($_SESSION['lat']) || !isset($_SESSION['lat']) || $_SESSION['lat'] == "" || $_SESSION['lon'] == "";
- }
- echo '<div id="error">';
- if ($geoerror) {
- echo 'Sorry, but your location could not currently be detected.
+ $googleAnalyticsImageUrl = googleAnalyticsGetImageUrl();
+ echo '<noscript><img src="' . $googleAnalyticsImageUrl . '" /></noscript>';
+ }
+ echo "\n</div></div></body></html>";
+}
+
+function placeSettings() {
+ global $service_periods;
+ $geoerror = false;
+ $geoerror = !isset($_SESSION['lat']) || !isset($_SESSION['lat']) || $_SESSION['lat'] == "" || $_SESSION['lon'] == "";
+
+ echo '<div id="error">';
+ if ($geoerror) {
+ echo 'Sorry, but your location could not currently be detected.
Please allow location permission, wait for your location to be detected,
or enter an address/co-ordinates in the box below.';
- }
- echo '</div>';
- echo '<div id="settings" data-role="collapsible" data-collapsed="' . !$geoerror . '">
- <h3>Change Time/Place (' . (isset($_SESSION['time']) ? $_SESSION['time'] : "Current Time,") . ' ' . ucwords(service_period()) . ')...</h3>
+ }
+ echo '</div>';
+ echo '<div id="settings" data-role="collapsible" data-collapsed="' . !$geoerror . '">
+ <h3>Change Location...</h3>
<form action="' . basename($_SERVER['PHP_SELF']) . "?" . $_SERVER['QUERY_STRING'] . '" method="post">
<div class="ui-body">
<div data-role="fieldcontain">
<label for="geolocate"> Current Location: </label>
<input type="text" id="geolocate" name="geolocate" value="' . (isset($_SESSION['lat']) && isset($_SESSION['lon']) ? $_SESSION['lat'] . "," . $_SESSION['lon'] : "Enter co-ordinates or address here") . '"/> <a href="#" style="display:none" name="here" id="here">Here?</a>
</div>
- <div data-role="fieldcontain">
- <label for="time"> Time: </label>
- <input type="time" name="time" id="time" value="' . (isset($_SESSION['time']) ? $_SESSION['time'] : date("H:i")) . '"/>
- <a href="#" name="currentTime" id="currentTime" onClick="var d = new Date();' . "$('#time').val(d.getHours() +':'+ (d.getMinutes().toString().length == 1 ? '0'+ d.getMinutes(): d.getMinutes()));" . '">Current Time?</a>
- </div>
- <div data-role="fieldcontain">
- <label for="service_period"> Service Period: </label>
- <select name="service_period" id="service_period">';
- foreach ($service_periods as $service_period) {
- echo "<option value=\"$service_period\"" . (service_period() === $service_period ? " SELECTED" : "") . '>' . ucwords($service_period) . '</option>';
- }
- echo '</select>
- <a href="#" style="display:none" name="currentPeriod" id="currentPeriod">Current Period?</a>
- </div>
<input type="submit" value="Update"/>
</div></form>
</div>';
}
-function trackEvent($category, $action, $label = "", $value = - 1)
-{
- if (isAnalyticsOn()) {
- echo "\n<script> _gaq.push(['_trackEvent', '$category', '$action'" . ($label != "" ? ", '$label'" : "") . ($value != - 1 ? ", $value" : "") . "]);</script>";
- }
-}
+
+function trackEvent($category, $action, $label = "", $value = - 1) {
+ if (isAnalyticsOn()) {
+ echo "\n<script> _gaq.push(['_trackEvent', '$category', '$action'" . ($label != "" ? ", '$label'" : "") . ($value != - 1 ? ", $value" : "") . "]);</script>";
+ }
+}
+
?>
--- a/include/common-transit.inc.php
+++ b/include/common-transit.inc.php
@@ -1,46 +1,278 @@
<?php
+
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
$service_periods = Array(
- 'sunday',
- 'saturday',
- 'weekday'
+ 'sunday',
+ 'saturday',
+ 'weekday'
);
-function service_period()
-{
-
- if (isset($_SESSION['service_period'])) return $_SESSION['service_period'];
- $override = getServiceOverride();
- if ($override['service_id']){
- return $override['service_id'];
- }
-
- switch (date('w')) {
- case 0:
- return 'sunday';
- case 6:
- return 'saturday';
- default:
- return 'weekday';
- }
-}
-function midnight_seconds()
-{
- // from http://www.perturb.org/display/Perlfunc__Seconds_Since_Midnight.html
- if (isset($_SESSION['time'])) {
- $time = strtotime($_SESSION['time']);
- return (date("G", $time) * 3600) + (date("i", $time) * 60) + date("s", $time);
- }
- return (date("G") * 3600) + (date("i") * 60) + date("s");
-}
-function midnight_seconds_to_time($seconds)
-{
- if ($seconds > 0) {
- $midnight = mktime(0, 0, 0, date("n") , date("j") , date("Y"));
- return date("h:ia", $midnight + $seconds);
- }
- else {
- return "";
- }
+function service_period($date = "") {
+
+ if (isset($_SESSION['service_period']))
+ return $_SESSION['service_period'];
+ $override = getServiceOverride($date);
+ if ($override['service_id']) {
+ return $override['service_id'];
+ }
+
+ switch (date('w', ($date != "" ? $date : time()))) {
+ case 0:
+ return 'sunday';
+ case 6:
+ return 'saturday';
+ default:
+ return 'weekday';
+ }
+}
+
+function midnight_seconds($time = "") {
+ // from http://www.perturb.org/display/Perlfunc__Seconds_Since_Midnight.html
+ if ($time != "") {
+ return (date("G", $time) * 3600) + (date("i", $time) * 60) + date("s", $time);
+ }
+ if (isset($_SESSION['time'])) {
+ $time = strtotime($_SESSION['time']);
+ return (date("G", $time) * 3600) + (date("i", $time) * 60) + date("s", $time);
+ }
+ return (date("G") * 3600) + (date("i") * 60) + date("s");
+}
+
+function midnight_seconds_to_time($seconds) {
+ if ($seconds > 0) {
+ $midnight = mktime(0, 0, 0, date("n"), date("j"), date("Y"));
+ return date("h:ia", $midnight + $seconds);
+ } else {
+ return "";
+ }
+}
+
+if ($GTFSREnabled) {
+ $serviceAlertCause = Array(
+ "UNKNOWN_CAUSE" => "Unknown cause",
+ "OTHER_CAUSE" => "Other cause",
+ "TECHNICAL_PROBLEM" => "Technical problem",
+ "STRIKE" => "Strike",
+ "DEMONSTRATION" => "Demonstration",
+ "ACCIDENT" => "Accident",
+ "HOLIDAY" => "Holiday",
+ "WEATHER" => "Weather",
+ "MAINTENANCE" => "Maintenance",
+ "CONSTRUCTION" => "Construction",
+ "POLICE_ACTIVITY" => "Police activity",
+ "MEDICAL_EMERGENCY" => "Medical emergency"
+ );
+ $serviceAlertEffect = Array(
+ "NO_SERVICE" => "No service",
+ "REDUCED_SERVICE" => "Reduced service",
+ "SIGNIFICANT_DELAYS" => "Significant delays",
+ "DETOUR" => "Detour",
+ "ADDITIONAL_SERVICE" => "Additional service",
+ "MODIFIED_SERVICE" => "Modified service",
+ "OTHER_EFFECT" => "Other effect",
+ "UNKNOWN_EFFECT" => "Unknown effect",
+ "STOP_MOVED" => "Stop moved");
+
+ set_include_path(get_include_path() . PATH_SEPARATOR . ($basePath . "lib/Protobuf-PHP/library/DrSlump/"));
+
+ include_once("Protobuf.php");
+ include_once("Protobuf/Message.php");
+ include_once("Protobuf/Registry.php");
+ include_once("Protobuf/Descriptor.php");
+ include_once("Protobuf/Field.php");
+
+ include_once($basePath . "lib/Protobuf-PHP/gtfs-realtime.php");
+ include_once("Protobuf/CodecInterface.php");
+ include_once("Protobuf/Codec/PhpArray.php");
+ include_once("Protobuf/Codec/Binary.php");
+ include_once("Protobuf/Codec/Binary/Writer.php");
+ include_once("Protobuf/Codec/Json.php");
+
+ function getServiceAlerts($filter_class = "", $filter_id = "") {
+ /*
+
+ also need last modified epoch of client gtfs
+
+ - add,remove,patch,inform (null)
+ - stop
+ - trip
+ - network
+ - classes (WHERE=)
+ - route (short_name or route_id)
+ - street
+ - stop
+ - trip
+ Currently support:
+ network inform
+ trip patch: stop remove
+ street inform: route inform, trip inform, stop inform
+ route patch: trip remove
+ */
+ $fm = new transit_realtime\FeedMessage();
+ $fh = new transit_realtime\FeedHeader();
+ $fh->setGtfsRealtimeVersion(1);
+ $fh->setTimestamp(time());
+ $fm->setHeader($fh);
+ foreach (getCurrentAlerts() as $alert) {
+ $fe = new transit_realtime\FeedEntity();
+ $fe->setId($alert['id']);
+ $fe->setIsDeleted(false);
+ $alert = new transit_realtime\Alert();
+ $tr = new transit_realtime\TimeRange();
+ $tr->setStart($alert['start']);
+ $tr->setEnd($alert['end']);
+ $alert->addActivePeriod($tr);
+ $informedEntities = getInformedAlerts($alert['id'], $_REQUEST['filter_class'], $_REQUEST['filter_id']);
+ if (sizeof($informedEntities) > 0) {
+ $informed = Array();
+ $es = new transit_realtime\EntitySelector();
+ if ($informedEntity['informed_class'] == "agency") {
+ $es->setAgencyId($informedEntity['informed_id']);
+ }
+ if ($informedEntity['informed_class'] == "stop") {
+ $es->setStopId($informedEntity['informed_id']);
+ }
+ if ($informedEntity['informed_class'] == "route") {
+ $es->setRouteId($informedEntity['informed_id']);
+ }
+ if ($informedEntity['informed_class'] == "trip") {
+ $td = new transit_realtime\TripDescriptor();
+ $td->setTripId($informedEntity['informed_id']);
+ $es->setTrip($td);
+ }
+ $alert->addInformedEntity($es);
+ }
+ $alert->setCause(constant("transit_realtime\Alert\Cause::" . $alert['cause']));
+ $alert->setEffect(constant("transit_realtime\Alert\Effect::" . $alert['effect']));
+ $tsUrl = new transit_realtime\TranslatedString();
+ $tUrl = new transit_realtime\TranslatedString\Translation();
+ $tUrl->setText($alert['url']);
+ $tUrl->setLanguage("en");
+ $tsUrl->addTranslation($tUrl);
+ $alert->setUrl($tsUrl);
+ $tsHeaderText = new transit_realtime\TranslatedString();
+ $tHeaderText = new transit_realtime\TranslatedString\Translation();
+ $tHeaderText->setText($alert['header']);
+ $tHeaderText->setLanguage("en");
+ $tsHeaderText->addTranslation($tHeaderText);
+ $alert->setHeaderText($tsHeaderText);
+ $tsDescriptionText = new transit_realtime\TranslatedString();
+ $tDescriptionText = new transit_realtime\TranslatedString\Translation();
+ $tDescriptionText->setText($alert['description']);
+ $tDescriptionText->setLanguage("en");
+ $tsDescriptionText->addTranslation($tDescriptionText);
+ $alert->setDescriptionText($tsDescriptionText);
+ $fe->setAlert($alert);
+ $fm->addEntity($fe);
+ }
+ return $fm;
+ }
+
+ function getServiceAlertsAsArray($filter_class = "", $filter_id = "") {
+ $codec = new DrSlump\Protobuf\Codec\PhpArray();
+ return $codec->encode(getServiceAlerts($filter_class, $filter_id));
+ }
+
+ function getServiceAlertsAsBinary($filter_class = "", $filter_id = "") {
+ $codec = new DrSlump\Protobuf\Codec\Binary();
+ return $codec->encode(getServiceAlerts($filter_class, $filter_id));
+ }
+
+ function getServiceAlertsAsJSON($filter_class = "", $filter_id = "") {
+ $codec = new DrSlump\Protobuf\Codec\Json();
+ return $codec->encode(getServiceAlerts($filter_class, $filter_id));
+ }
+
+ function getServiceAlertsByClass() {
+ $return = Array();
+ $alerts = getServiceAlertsAsArray("", "");
+ foreach ($alerts['entities'] as $entity) {
+ foreach ($entity['informed'] as $informed) {
+ foreach ($informed as $key => $value) {
+ if (strpos("_id", $key) > 0) {
+ $parts = explode($key);
+ $class = $parts[0];
+ $id = $value;
+ }
+ }
+ $return[$class][$id][] = $entity;
+ }
+ }
+ }
+
+ function getTripUpdates($filter_class = "", $filter_id = "") {
+ $fm = new transit_realtime\FeedMessage();
+ $fh = new transit_realtime\FeedHeader();
+ $fh->setGtfsRealtimeVersion(1);
+ $fh->setTimestamp(time());
+ $fm->setHeader($fh);
+ foreach (getCurrentAlerts() as $alert) {
+ $informedEntities = getInformedAlerts($alert['id'], $_REQUEST['filter_class'], $_REQUEST['filter_id']);
+ $stops = Array();
+ $routestrips = Array();
+ if (sizeof($informedEntities) > 0) {
+ if ($informedEntity['informed_class'] == "stop" && $informed["x-action"] == "remove") {
+ $stops[] = $informedEntity['informed_id'];
+ }
+ if (($informedEntity['informed_class'] == "route" || $informedEntity['informed_class'] == "trip") && $informed["x-action"] == "patch") {
+ $routestrips[] = Array("id" => $informedEntity['informed_id'],
+ "type" => $informedEntity['informed_class']);
+ }
+ }
+ foreach ($routestrips as $routetrip) {
+ $fe = new transit_realtime\FeedEntity();
+ $fe->setId($alert['id'] . $routetrip['id']);
+ $fe->setIsDeleted(false);
+ $tu = new transit_realtime\TripUpdate();
+ $td = new transit_realtime\TripDescriptor();
+ if ($routetrip['type'] == "route") {
+ $td->setRouteId($routetrip['id']);
+ } else if ($routetrip['type'] == "trip") {
+ $td->setTripId($routetrip['id']);
+ }
+ $tu->setTrip($td);
+ foreach ($stops as $stop) {
+ $stu = new transit_realtime\TripUpdate\StopTimeUpdate();
+ $stu->setStopId($stop);
+ $stu->setScheduleRelationship(transit_realtime\TripUpdate\StopTimeUpdate\ScheduleRelationship::SKIPPED);
+ $tu->addStopTimeUpdate($stu);
+ }
+ $fe->setTripUpdate($tu);
+ $fm->addEntity($fe);
+ }
+ }
+ return $fm;
+ }
+
+ function getTripUpdatesAsArray($filter_class = "", $filter_id = "") {
+ $codec = new DrSlump\Protobuf\Codec\PhpArray();
+ return $codec->encode(getTripUpdates($filter_class, $filter_id));
+ }
+
+ function getTripUpdatesAsBinary($filter_class = "", $filter_id = "") {
+ $codec = new DrSlump\Protobuf\Codec\Binary();
+ return $codec->encode(getTripUpdates($filter_class, $filter_id));
+ }
+
+ function getTripUpdatesAsJSON($filter_class = "", $filter_id = "") {
+ $codec = new DrSlump\Protobuf\Codec\Json();
+ return $codec->encode(getTripUpdates($filter_class, $filter_id));
+ }
+
}
?>
--- a/include/common.inc.php
+++ b/include/common.inc.php
@@ -1,31 +1,63 @@
<?php
+
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
+
date_default_timezone_set('Australia/ACT');
$debugOkay = Array(
- "session",
- "json",
- "phperror",
- "awsotp",
- //"squallotp",
- "vanilleotp",
- "database",
- "other"
+ "session",
+ "json",
+ "phperror",
+ "awsotp",
+ //"squallotp",
+ //"vanilleotp",
+ "database",
+ "other"
);
+$GTFSREnabled = true;
$cloudmadeAPIkey = "daa03470bb8740298d4b10e3f03d63e6";
$googleMapsAPIkey = "ABQIAAAA95XYXN0cki3Yj_Sb71CFvBTPaLd08ONybQDjcH_VdYtHHLgZvRTw2INzI_m17_IoOUqH3RNNmlTk1Q";
$otpAPIurl = 'http://localhost:8080/opentripplanner-api-webapp/';
if (isDebug("awsotp") || php_uname('n') == "maxious.xen.prgmr.com") {
- $otpAPIurl = 'http://bus-main.lambdacomplex.org:8080/opentripplanner-api-webapp/';
+ $otpAPIurl = 'http://bus-main.lambdacomplex.org:8080/opentripplanner-api-webapp/';
}
if (isDebug("dotcloudotp") || php_uname('n') == "actbus-www") {
- $otpAPIurl = 'http://otp.actbus.dotcloud.com/opentripplanner-api-webapp/';
+ $otpAPIurl = 'http://otp.actbus.dotcloud.com/opentripplanner-api-webapp/';
}
if (isDebug("squallotp")) {
- $otpAPIurl = 'http://10.0.1.108:5080/opentripplanner-api-webapp/';
+ $otpAPIurl = 'http://10.0.1.108:5080/opentripplanner-api-webapp/';
}
if (isDebug("vanilleotp")) {
- $otpAPIurl = 'http://10.0.1.135:8080/opentripplanner-api-webapp/';
-}
-if (isDebug("phperror")) error_reporting(E_ALL ^ E_NOTICE);
+ $otpAPIurl = 'http://10.0.1.135:8080/opentripplanner-api-webapp/';
+}
+if (isDebug("phperror"))
+ error_reporting(E_ALL ^ E_NOTICE);
+$basePath = "";
+if (strstr($_SERVER['PHP_SELF'], "labs/")
+ || strstr($_SERVER['PHP_SELF'], "myway/")
+ || strstr($_SERVER['PHP_SELF'], "lib/")
+ || strstr($_SERVER['PHP_SELF'], "geo/")
+ || strstr($_SERVER['PHP_SELF'], "include/")
+ || strstr($_SERVER['PHP_SELF'], "servicealerts/"))
+ $basePath = "../";
+
+function isDebugServer() {
+ return php_sapi_name() == "cli" || isset($_SERVER['SERVER_NAME']) && ( $_SERVER['SERVER_NAME'] == "azusa" || $_SERVER['SERVER_NAME'] == "vanille"
+ || $_SERVER['SERVER_NAME'] == "localhost" || $_SERVER['SERVER_NAME'] == "127.0.0.1");
+}
include_once ("common-geo.inc.php");
include_once ("common-net.inc.php");
@@ -34,152 +66,141 @@
include_once ("common-request.inc.php");
include_once ("common-session.inc.php");
+include_once ("common-auth.inc.php");
include_once ("common-template.inc.php");
-function isDebugServer()
-{
- return $_SERVER['SERVER_NAME'] == "10.0.1.154" || $_SERVER['SERVER_NAME'] == "localhost" || $_SERVER['SERVER_NAME'] == "127.0.0.1" || !$_SERVER['SERVER_NAME'];
-}
-function isAnalyticsOn()
-{
- return !isDebugServer();
-}
-function isDebug($debugReason = "other")
-{
- global $debugOkay;
- return in_array($debugReason, $debugOkay, false) && isDebugServer();
-}
-function debug($msg, $debugReason = "other")
-{
- if (isDebug($debugReason)) echo "\n<!-- " . date(DATE_RFC822) . "\n $msg -->\n";
-}
-function isJQueryMobileDevice()
-{
- // http://forum.jquery.com/topic/what-is-the-best-way-to-detect-all-useragents-which-can-handle-jquery-mobile#14737000002087897
- $user_agent = $_SERVER['HTTP_USER_AGENT'];
- return preg_match('/iphone/i', $user_agent) || preg_match('/android/i', $user_agent) || preg_match('/webos/i', $user_agent) || preg_match('/ios/i', $user_agent) || preg_match('/bada/i', $user_agent) || preg_match('/maemo/i', $user_agent) || preg_match('/meego/i', $user_agent) || preg_match('/fennec/i', $user_agent) || (preg_match('/symbian/i', $user_agent) && preg_match('/s60/i', $user_agent) && $browser['majorver'] >= 5) || (preg_match('/symbian/i', $user_agent) && preg_match('/platform/i', $user_agent) && $browser['majorver'] >= 3) || (preg_match('/blackberry/i', $user_agent) && $browser['majorver'] >= 5) || (preg_match('/opera mobile/i', $user_agent) && $browser['majorver'] >= 10) || (preg_match('/opera mini/i', $user_agent) && $browser['majorver'] >= 5);
-}
-function isFastDevice()
-{
- $ua = $_SERVER['HTTP_USER_AGENT'];
- $fastDevices = Array(
- "Mozilla/5.0 (X11;",
- "Mozilla/5.0 (Windows;",
- "Mozilla/5.0 (iP",
- "Mozilla/5.0 (Linux; U; Android",
- "Mozilla/4.0 (compatible; MSIE"
- );
- $slowDevices = Array(
- "J2ME",
- "MIDP",
- "Opera/",
- "Mozilla/2.0 (compatible;",
- "Mozilla/3.0 (compatible;"
- );
- return true;
-}
-function array_flatten($a, $f = array())
-{
- if (!$a || !is_array($a)) return '';
- foreach ($a as $k => $v) {
- if (is_array($v)) $f = array_flatten($v, $f);
- else $f[$k] = $v;
- }
- return $f;
-}
-function remove_spaces($string)
-{
- return str_replace(' ', '', $string);
-}
-function object2array($object)
-{
- if (is_object($object)) {
- foreach ($object as $key => $value) {
- $array[$key] = $value;
- }
- }
- else {
- $array = $object;
- }
- return $array;
-}
-function startsWith($haystack, $needle, $case = true)
-{
- if ($case) {
- return (strcmp(substr($haystack, 0, strlen($needle)) , $needle) === 0);
- }
- return (strcasecmp(substr($haystack, 0, strlen($needle)) , $needle) === 0);
-}
-
-function endsWith($haystack, $needle, $case = true)
-{
- if ($case) {
- return (strcmp(substr($haystack, strlen($haystack) - strlen($needle)) , $needle) === 0);
- }
- return (strcasecmp(substr($haystack, strlen($haystack) - strlen($needle)) , $needle) === 0);
-}
-function bracketsMeanNewLine($input)
-{
- return str_replace(")", "</small>", str_replace("(", "<br><small>", $input));
-}
-function sksort(&$array, $subkey = "id", $sort_ascending = false)
-{
- if (count($array)) $temp_array[key($array) ] = array_shift($array);
- foreach ($array as $key => $val) {
- $offset = 0;
- $found = false;
- foreach ($temp_array as $tmp_key => $tmp_val) {
- if (!$found and strtolower($val[$subkey]) > strtolower($tmp_val[$subkey])) {
- $temp_array = array_merge((array)array_slice($temp_array, 0, $offset) , array(
- $key => $val
- ) , array_slice($temp_array, $offset));
- $found = true;
- }
- $offset++;
- }
- if (!$found) $temp_array = array_merge($temp_array, array(
- $key => $val
- ));
- }
- if ($sort_ascending) $array = array_reverse($temp_array);
- else $array = $temp_array;
-}
-function sktimesort(&$array, $subkey = "id", $sort_ascending = false)
-{
- if (count($array)) $temp_array[key($array) ] = array_shift($array);
- foreach ($array as $key => $val) {
- $offset = 0;
- $found = false;
- foreach ($temp_array as $tmp_key => $tmp_val) {
- if (!$found and strtotime($val[$subkey]) > strtotime($tmp_val[$subkey])) {
- $temp_array = array_merge((array)array_slice($temp_array, 0, $offset) , array(
- $key => $val
- ) , array_slice($temp_array, $offset));
- $found = true;
- }
- $offset++;
- }
- if (!$found) $temp_array = array_merge($temp_array, array(
- $key => $val
- ));
- }
- if ($sort_ascending) $array = array_reverse($temp_array);
- else $array = $temp_array;
-}
-function r_implode( $glue, $pieces )
-{
- foreach( $pieces as $r_pieces )
- {
- if( is_array( $r_pieces ) )
- {
- $retVal[] = r_implode( $glue, $r_pieces );
- }
- else
- {
- $retVal[] = $r_pieces;
- }
- }
- return implode( $glue, $retVal );
-}
+function isAnalyticsOn() {
+ $user_agent = $_SERVER['HTTP_USER_AGENT'];
+ return!isDebugServer() && !preg_match('/cloudkick/i', $user_agent) && !preg_match('/googlebot/i', $user_agent) &&
+ !preg_match('/baidu/i', $user_agent);
+}
+
+function isDebug($debugReason = "other") {
+ global $debugOkay;
+ return in_array($debugReason, $debugOkay, false) && isDebugServer();
+}
+
+function debug($msg, $debugReason = "other") {
+ if (isDebug($debugReason))
+ echo "\n<!-- " . date(DATE_RFC822) . "\n $msg -->\n";
+}
+function isIOSDevice() {
+ return strstr($_SERVER['HTTP_USER_AGENT'], 'iPhone') || strstr($_SERVER['HTTP_USER_AGENT'], 'iPod') || strstr($_SERVER['HTTP_USER_AGENT'], 'iPad');
+}
+function isJQueryMobileDevice() {
+ // http://forum.jquery.com/topic/what-is-the-best-way-to-detect-all-useragents-which-can-handle-jquery-mobile#14737000002087897
+ $user_agent = $_SERVER['HTTP_USER_AGENT'];
+ return preg_match('/iphone/i', $user_agent) || preg_match('/android/i', $user_agent) || preg_match('/webos/i', $user_agent) || preg_match('/ios/i', $user_agent) || preg_match('/bada/i', $user_agent) || preg_match('/maemo/i', $user_agent) || preg_match('/meego/i', $user_agent) || preg_match('/fennec/i', $user_agent) || (preg_match('/symbian/i', $user_agent) && preg_match('/s60/i', $user_agent) && $browser['majorver'] >= 5) || (preg_match('/symbian/i', $user_agent) && preg_match('/platform/i', $user_agent) && $browser['majorver'] >= 3) || (preg_match('/blackberry/i', $user_agent) && $browser['majorver'] >= 5) || (preg_match('/opera mobile/i', $user_agent) && $browser['majorver'] >= 10) || (preg_match('/opera mini/i', $user_agent) && $browser['majorver'] >= 5);
+}
+
+
+function array_flatten($a, $f = array()) {
+ if (!$a || !is_array($a))
+ return '';
+ foreach ($a as $k => $v) {
+ if (is_array($v))
+ $f = array_flatten($v, $f);
+ else
+ $f[$k] = $v;
+ }
+ return $f;
+}
+
+function remove_spaces($string) {
+ return str_replace(' ', '', $string);
+}
+
+function object2array($object) {
+ if (is_object($object)) {
+ foreach ($object as $key => $value) {
+ $array[$key] = $value;
+ }
+ } else {
+ $array = $object;
+ }
+ return $array;
+}
+
+function startsWith($haystack, $needle, $case = true) {
+ if ($case) {
+ return (strcmp(substr($haystack, 0, strlen($needle)), $needle) === 0);
+ }
+ return (strcasecmp(substr($haystack, 0, strlen($needle)), $needle) === 0);
+}
+
+function endsWith($haystack, $needle, $case = true) {
+ if ($case) {
+ return (strcmp(substr($haystack, strlen($haystack) - strlen($needle)), $needle) === 0);
+ }
+ return (strcasecmp(substr($haystack, strlen($haystack) - strlen($needle)), $needle) === 0);
+}
+
+function bracketsMeanNewLine($input) {
+ return str_replace(")", "</small>", str_replace("(", "<br><small>", $input));
+}
+
+function sksort(&$array, $subkey = "id", $sort_ascending = false) {
+ if (count($array))
+ $temp_array[key($array)] = array_shift($array);
+ foreach ($array as $key => $val) {
+ $offset = 0;
+ $found = false;
+ foreach ($temp_array as $tmp_key => $tmp_val) {
+ if (!$found and strtolower($val[$subkey]) > strtolower($tmp_val[$subkey])) {
+ $temp_array = array_merge((array) array_slice($temp_array, 0, $offset), array(
+ $key => $val
+ ), array_slice($temp_array, $offset));
+ $found = true;
+ }
+ $offset++;
+ }
+ if (!$found)
+ $temp_array = array_merge($temp_array, array(
+ $key => $val
+ ));
+ }
+ if ($sort_ascending)
+ $array = array_reverse($temp_array);
+ else
+ $array = $temp_array;
+}
+
+function sktimesort(&$array, $subkey = "id", $sort_ascending = false) {
+ if (count($array))
+ $temp_array[key($array)] = array_shift($array);
+ foreach ($array as $key => $val) {
+ $offset = 0;
+ $found = false;
+ foreach ($temp_array as $tmp_key => $tmp_val) {
+ if (!$found and strtotime($val[$subkey]) > strtotime($tmp_val[$subkey])) {
+ $temp_array = array_merge((array) array_slice($temp_array, 0, $offset), array(
+ $key => $val
+ ), array_slice($temp_array, $offset));
+ $found = true;
+ }
+ $offset++;
+ }
+ if (!$found)
+ $temp_array = array_merge($temp_array, array(
+ $key => $val
+ ));
+ }
+ if ($sort_ascending && isset($temp_array))
+ $array = array_reverse($temp_array);
+ else
+ $array = $temp_array;
+}
+
+function r_implode($glue, $pieces) {
+ foreach ($pieces as $r_pieces) {
+ if (is_array($r_pieces)) {
+ $retVal[] = r_implode($glue, $r_pieces);
+ } else {
+ $retVal[] = $r_pieces;
+ }
+ }
+ return implode($glue, $retVal);
+}
+
?>
--- a/include/db/route-dao.inc.php
+++ b/include/db/route-dao.inc.php
@@ -1,192 +1,229 @@
<?php
-function getRoute($routeID)
-{
- global $conn;
- $query = "Select * from routes where route_id = :routeID LIMIT 1";
- debug($query, "database");
- $query = $conn->prepare($query);
- $query->bindParam(":routeID", $routeID);
- $query->execute();
- if (!$query) {
- databaseError($conn->errorInfo());
- return Array();
- }
- return $query->fetch(PDO::FETCH_ASSOC);
-}
-function getRoutes()
-{
- global $conn;
- $query = "Select * from routes order by route_short_name;";
- debug($query, "database");
- $query = $conn->prepare($query);
- $query->execute();
- if (!$query) {
- databaseError($conn->errorInfo());
- return Array();
- }
- return $query->fetchAll();
-}
-function getRoutesByNumber($routeNumber = "")
-{
- global $conn;
- if ($routeNumber != "") {
- $query = "Select distinct routes.route_id,routes.route_short_name,routes.route_long_name,service_id from routes join trips on trips.route_id =
-routes.route_id join stop_times on stop_times.trip_id = trips.trip_id where route_short_name = :routeNumber order by route_short_name;";
- }
- else {
- $query = "SELECT DISTINCT route_short_name from routes order by route_short_name";
- }
- debug($query, "database");
- $query = $conn->prepare($query);
- if ($routeNumber != "") {
- $query->bindParam(":routeNumber", $routeNumber);
- }
- $query->execute();
- if (!$query) {
- databaseError($conn->errorInfo());
- return Array();
- }
- return $query->fetchAll();
-}
-function getRoutesByNumberSeries($routeNumberSeries = "")
-{
- global $conn;
- if (strlen($routeNumberSeries) == 1) {
- return getRoutesByNumber($routeNumberSeries);
- }
- $seriesMin = substr($routeNumberSeries, 0, -1) . "0";
- $seriesMax = substr($routeNumberSeries, 0, -1) . "9";
- $query = "Select distinct routes.route_id,routes.route_short_name,routes.route_long_name,service_id from routes join trips on trips.route_id =
+
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
+
+function getRoute($routeID) {
+ global $conn;
+ $query = "Select * from routes where route_id = :routeID LIMIT 1";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":routeID", $routeID);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetch(PDO :: FETCH_ASSOC);
+}
+
+function getRouteByFullName($routeFullName) {
+ global $conn;
+ $query = "Select * from routes where route_short_name||route_long_name = :routeFullName LIMIT 1";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":routeFullName", $routeFullName);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetch(PDO :: FETCH_ASSOC);
+}
+
+function getRoutes() {
+ global $conn;
+ $query = "Select * from routes order by route_short_name;";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+
+function getRoutesByNumber($routeNumber = "") {
+ global $conn;
+ if ($routeNumber != "") {
+ $query = "Select distinct routes.route_id,routes.route_short_name,routes.route_long_name,service_id from routes join trips on trips.route_id =
+routes.route_id join stop_times on stop_times.trip_id = trips.trip_id
+where route_short_name = :routeNumber OR route_short_name LIKE :routeNumber2 order by route_short_name;";
+ } else {
+ $query = "SELECT DISTINCT route_short_name from routes order by route_short_name";
+ }
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ if ($routeNumber != "") {
+ $query->bindParam(":routeNumber", $routeNumber);
+ $routeNumber2 = "% " . $routeNumber;
+ $query->bindParam(":routeNumber2", $routeNumber2);
+ }
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+
+function getRoutesByNumberSeries($routeNumberSeries = "") {
+ global $conn;
+ if (strlen($routeNumberSeries) == 1) {
+ return getRoutesByNumber($routeNumberSeries);
+ }
+ $seriesMin = substr($routeNumberSeries, 0, -1) . "0";
+ $seriesMax = substr($routeNumberSeries, 0, -1) . "9";
+ $query = "Select distinct routes.route_id,routes.route_short_name,routes.route_long_name,service_id from routes join trips on trips.route_id =
routes.route_id join stop_times on stop_times.trip_id = trips.trip_id where to_number(route_short_name, 'FM999') between :seriesMin and :seriesMax OR route_short_name LIKE :routeNumberSeries order by route_short_name;";
- debug($query, "database");
- $query = $conn->prepare($query);
- $query->bindParam(":seriesMin", $seriesMin);
- $query->bindParam(":seriesMax", $seriesMax);
- $routeNumberSeries = "% ".substr($routeNumberSeries, 0, -1)."%";
- $query->bindParam(":routeNumberSeries", $routeNumberSeries);
- $query->execute();
- if (!$query) {
- databaseError($conn->errorInfo());
- return Array();
- }
- return $query->fetchAll();
-}
-function getRouteNextTrip($routeID)
-{
- global $conn;
- $query = "select * from routes join trips on trips.route_id = routes.route_id
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":seriesMin", $seriesMin);
+ $query->bindParam(":seriesMax", $seriesMax);
+ $routeNumberSeries = "% " . substr($routeNumberSeries, 0, -1) . "%";
+ $query->bindParam(":routeNumberSeries", $routeNumberSeries);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+
+function getRouteNextTrip($routeID) {
+ global $conn;
+ $query = "select * from routes join trips on trips.route_id = routes.route_id
join stop_times on stop_times.trip_id = trips.trip_id where
arrival_time > :currentTime and routes.route_id = :routeID order by
arrival_time limit 1";
- debug($query, "database");
- $query = $conn->prepare($query);
- $query->bindParam(":currentTime", current_time());
- $query->bindParam(":routeID", $routeID);
- $query->execute();
- if (!$query) {
- databaseError($conn->errorInfo());
- return Array();
- }
- $r = $query->fetch(PDO::FETCH_ASSOC);
-
- // past last trip of the day special case
- if (sizeof($r) < 16) {
- $query = "select * from routes join trips on trips.route_id = routes.route_id
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":currentTime", current_time());
+ $query->bindParam(":routeID", $routeID);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ $r = $query->fetch(PDO :: FETCH_ASSOC);
+
+ // past last trip of the day special case
+ if (sizeof($r) < 16) {
+ $query = "select * from routes join trips on trips.route_id = routes.route_id
join stop_times on stop_times.trip_id = trips.trip_id where routes.route_id = :routeID order by
arrival_time DESC limit 1";
- debug($query, "database");
- $query = $conn->prepare($query);
- $query->bindParam(":routeID", $routeID);
- $query->execute();
- if (!$query) {
- databaseError($conn->errorInfo());
- return Array();
- }
-
- $r = $query->fetch(PDO::FETCH_ASSOC);
- }
- return $r;
-}
-function getTimeInterpolatedRouteAtStop($routeID, $stop_id)
-{
- $nextTrip = getRouteNextTrip($routeID);
- if ($nextTrip['trip_id']) {
- foreach (getTimeInterpolatedTrip($nextTrip['trip_id']) as $tripStop) {
- if ($tripStop['stop_id'] == $stop_id) return $tripStop;
- }
- }
- return Array();
-}
-function getRouteTrips($routeID)
-{
- global $conn;
- $query = "select routes.route_id,trips.trip_id,service_id,arrival_time, stop_id, stop_sequence from routes join trips on trips.route_id = routes.route_id
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":routeID", $routeID);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+
+ $r = $query->fetch(PDO :: FETCH_ASSOC);
+ }
+ return $r;
+}
+
+function getTimeInterpolatedRouteAtStop($routeID, $stop_id) {
+ $nextTrip = getRouteNextTrip($routeID);
+ if ($nextTrip['trip_id']) {
+ foreach (getTimeInterpolatedTrip($nextTrip['trip_id']) as $tripStop) {
+ if ($tripStop['stop_id'] == $stop_id)
+ return $tripStop;
+ }
+ }
+ return Array();
+}
+
+function getRouteTrips($routeID) {
+ global $conn;
+ $query = "select routes.route_id,trips.trip_id,service_id,arrival_time, stop_id, stop_sequence from routes join trips on trips.route_id = routes.route_id
join stop_times on stop_times.trip_id = trips.trip_id where routes.route_id = :routeID and stop_sequence = '1' order by
arrival_time ";
- debug($query, "database");
- $query = $conn->prepare($query);
- $query->bindParam(":routeID", $routeID);
- $query->execute();
- if (!$query) {
- databaseError($conn->errorInfo());
- return Array();
- }
- return $query->fetchAll();
-}
-function getRoutesByDestination($destination = "", $service_period = "")
-{
- global $conn;
- if ($service_period == "") $service_period = service_period();
- if ($destination != "") {
- $query = "SELECT DISTINCT trips.route_id,route_short_name,route_long_name, service_id
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":routeID", $routeID);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+
+function getRoutesByDestination($destination = "", $service_period = "") {
+ global $conn;
+ if ($service_period == "")
+ $service_period = service_period();
+ if ($destination != "") {
+ $query = "SELECT DISTINCT trips.route_id,route_short_name,route_long_name, service_id
FROM stop_times join trips on trips.trip_id =
stop_times.trip_id join routes on trips.route_id = routes.route_id
WHERE route_long_name = :destination AND service_id=:service_period order by route_short_name";
- }
- else {
- $query = "SELECT DISTINCT route_long_name
+ } else {
+ $query = "SELECT DISTINCT route_long_name
FROM stop_times join trips on trips.trip_id =
stop_times.trip_id join routes on trips.route_id = routes.route_id
WHERE service_id= :service_period order by route_long_name";
- }
- debug($query, "database");
- $query = $conn->prepare($query);
- $query->bindParam(":service_period", $service_period);
- if ($destination != "") $query->bindParam(":destination", $destination);
- $query->execute();
- if (!$query) {
- databaseError($conn->errorInfo());
- return Array();
- }
- return $query->fetchAll();
-}
-function getRoutesBySuburb($suburb, $service_period = "")
-{
- if ($service_period == "") $service_period = service_period();
- global $conn;
- $query = "SELECT DISTINCT service_id,trips.route_id,route_short_name,route_long_name
+ }
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":service_period", $service_period);
+ if ($destination != "")
+ $query->bindParam(":destination", $destination);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+
+function getRoutesBySuburb($suburb, $service_period = "") {
+ if ($service_period == "")
+ $service_period = service_period();
+ global $conn;
+ $query = "SELECT DISTINCT service_id,trips.route_id,route_short_name,route_long_name
FROM stop_times join trips on trips.trip_id = stop_times.trip_id
join routes on trips.route_id = routes.route_id
join stops on stops.stop_id = stop_times.stop_id
WHERE zone_id LIKE ':suburb AND service_id=:service_period ORDER BY route_short_name";
- debug($query, "database");
- $query = $conn->prepare($query);
- $query->bindParam(":service_period", $service_period);
- $suburb = "%" . $suburb . ";%";
- $query->bindParam(":suburb", $suburb);
- $query->execute();
- if (!$query) {
- databaseError($conn->errorInfo());
- return Array();
- }
- return $query->fetchAll();
-}
-function getRoutesNearby($lat, $lng, $limit = "", $distance = 500)
-{
- if ($service_period == "") $service_period = service_period();
- if ($limit != "") $limitSQL = " LIMIT :limit ";
- global $conn;
- $query = "SELECT service_id,trips.route_id,route_short_name,route_long_name,min(stops.stop_id) as stop_id,
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":service_period", $service_period);
+ $suburb = "%" . $suburb . ";%";
+ $query->bindParam(":suburb", $suburb);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+
+function getRoutesNearby($lat, $lng, $limit = "", $distance = 500) {
+ if ($service_period == "")
+ $service_period = service_period();
+ if ($limit != "")
+ $limitSQL = " LIMIT :limit ";
+ global $conn;
+ $query = "SELECT service_id,trips.route_id,route_short_name,route_long_name,min(stops.stop_id) as stop_id,
min(ST_Distance(position, ST_GeographyFromText('SRID=4326;POINT($lng $lat)'), FALSE)) as distance
FROM stop_times
join trips on trips.trip_id = stop_times.trip_id
@@ -196,16 +233,18 @@
AND ST_DWithin(position, ST_GeographyFromText('SRID=4326;POINT($lng $lat)'), :distance, FALSE)
group by service_id,trips.route_id,route_short_name,route_long_name
order by distance $limitSQL";
- debug($query, "database");
- $query = $conn->prepare($query);
- $query->bindParam(":service_period", $service_period);
- $query->bindParam(":distance", $distance);
- if ($limit != "") $query->bindParam(":limit", $limit);
- $query->execute();
- if (!$query) {
- databaseError($conn->errorInfo());
- return Array();
- }
- return $query->fetchAll();
-}
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":service_period", $service_period);
+ $query->bindParam(":distance", $distance);
+ if ($limit != "")
+ $query->bindParam(":limit", $limit);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+
?>
--- a/include/db/servicealert-dao.inc.php
+++ b/include/db/servicealert-dao.inc.php
@@ -1,15 +1,177 @@
<?php
-function getServiceOverride() {
- global $conn;
- $query = "Select * from calendar_dates where date = :date and exception_type = '1' LIMIT 1";
- debug($query,"database");
- $query = $conn->prepare($query); // Create a prepared statement
- $query->bindParam(":date", date("Ymd"));
- $query->execute();
- if (!$query) {
- databaseError($conn->errorInfo());
- return Array();
- }
- return $query->fetch(PDO::FETCH_ASSOC);
+
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
+
+function getServiceOverride($date = "") {
+ global $conn;
+ $query = "Select * from calendar_dates where date = :date and exception_type = '1' LIMIT 1";
+ // debug($query,"database");
+ $query = $conn->prepare($query); // Create a prepared statement
+ $query->bindParam(":date", date("Ymd", ($date != "" ? $date : time())));
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetch(PDO :: FETCH_ASSOC);
}
+
+function getServiceAlert($alertID) {
+ global $conn;
+ $query = "SELECT id,extract('epoch' from start) as start, extract('epoch' from end) as end,cause,effect,header,description,url from servicealerts_alerts where id = :servicealert_id";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":servicealert_id", $alertID);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetch(PDO :: FETCH_ASSOC);
+}
+
+function updateServiceAlert($alertID, $start, $end, $header, $description, $url) {
+ global $conn;
+ $query = 'update servicealerts_alerts set start=:start, "end"=:end, header=:header, description=:description, url=:url where id = :servicealert_id';
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":servicealert_id", $alertID);
+ $query->bindParam(":start", $start);
+ $query->bindParam(":end", $end);
+ $query->bindParam(":header", $header);
+ $query->bindParam(":description", $description);
+ $query->bindParam(":url", $url);
+ $query->execute();
+
+ print_r($conn->errorInfo());
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetch(PDO :: FETCH_ASSOC);
+}
+
+function addServiceAlert($start, $end, $header, $description, $url) {
+ global $conn;
+ $query = 'INSERT INTO servicealerts_alerts (start, "end", header, description, url) VALUES (:start, :end, :header, :description, :url) ';
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":start", $start);
+ $query->bindParam(":end", $end);
+ $query->bindParam(":header", $header);
+ $query->bindParam(":description", $description);
+ $query->bindParam(":url", $url);
+ $query->execute();
+
+ print_r($conn->errorInfo());
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetch(PDO :: FETCH_ASSOC);
+}
+
+function getCurrentAlerts() {
+ global $conn;
+ $query = "SELECT id,extract('epoch' from start) as start, extract('epoch' from end) as end,cause,effect,header,description,url from servicealerts_alerts where NOW() > start and NOW() < \"end\"";
+ // debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+
+function getFutureAlerts() {
+ global $conn;
+ $query = "SELECT id,extract('epoch' from start) as start, extract('epoch' from end) as end,cause,effect,header,description,url from servicealerts_alerts where NOW() > start or NOW() < \"end\"";
+ // debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+
+function getInformedAlerts($id, $filter_class, $filter_id) {
+
+ global $conn;
+ $query = "SELECT * from servicealerts_informed where servicealert_id = :servicealert_id";
+
+ if ($filter_class != "") {
+ $query .= " AND informed_class = :informed_class ";
+ }
+ if ($filter_id != "") {
+ $query .= " AND informed_id = :informed_id ";
+ }
+ // debug($query, "database");
+ $query = $conn->prepare($query);
+ if ($filter_class != "") {
+ $query->bindParam(":informed_class", $filter_class);
+ }
+ if ($filter_id != "") {
+ $query->bindParam(":informed_id", $filter_id);
+ }
+ $query->bindParam(":servicealert_id", $id);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+
+function deleteInformedAlert($serviceAlertID, $class, $id) {
+ global $conn;
+ $query = 'DELETE from servicealerts_informed where servicealert_id = :servicealert_id and informed_class = :informed_class AND informed_id = :informed_id';
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":servicealert_id", $serviceAlertID);
+ $query->bindParam(":informed_class", $class);
+ $query->bindParam(":informed_id", $id);
+ $query->execute();
+ print_r($conn->errorInfo());
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return null;
+}
+
+function addInformedAlert($serviceAlertID, $class, $id, $action) {
+ global $conn;
+ $query = 'INSERT INTO servicealerts_informed (servicealert_id , informed_class , informed_id) VALUES(:servicealert_id ,:informed_class, :informed_id)';
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":servicealert_id", $serviceAlertID);
+ $query->bindParam(":informed_class", $class);
+ $query->bindParam(":informed_id", $id);
+ $query->execute();
+
+ print_r($conn->errorInfo());
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return null;
+}
+
?>
--- a/include/db/stop-dao.inc.php
+++ b/include/db/stop-dao.inc.php
@@ -1,101 +1,171 @@
<?php
-function getStop($stopID)
-{
- global $conn;
- $query = "Select * from stops where stop_id = :stopID LIMIT 1";
- debug($query, "database");
- $query = $conn->prepare($query);
- $query->bindParam(":stopID", $stopID);
- $query->execute();
- if (!$query) {
- databaseError($conn->errorInfo());
- return Array();
- }
- return $query->fetch(PDO::FETCH_ASSOC);
-}
-function getStops($timingPointsOnly = false, $firstLetter = "")
-{
- global $conn;
- $conditions = Array();
- if ($timingPointsOnly) $conditions[] = "substr(stop_code,1,2) != 'Wj'";
- if ($firstLetter != "") $conditions[] = "substr(stop_name,1,1) = :firstLetter";
- $query = "Select * from stops";
- if (sizeof($conditions) > 0) {
- if (sizeof($conditions) > 1) {
- $query.= " Where " . implode(" AND ", $conditions) . " ";
- }
- else {
- $query.= " Where " . $conditions[0] . " ";
- }
- }
- $query.= " order by stop_name;";
- $query = $conn->prepare($query);
+
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
+
+function getStop($stopID) {
+ global $conn;
+ $query = "Select * from stops where stop_id = :stopID LIMIT 1";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":stopID", $stopID);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetch(PDO :: FETCH_ASSOC);
+}
+
+function getStops($timingPointsOnly = false, $firstLetter = "", $startsWith = "") {
+ global $conn;
+ $conditions = Array();
+ if ($timingPointsOnly)
+ $conditions[] = "substr(stop_code,1,2) != 'Wj'";
+ if ($firstLetter != "")
+ $conditions[] = "substr(stop_name,1,1) = :firstLetter";
+ if ($startsWith != "")
+ $conditions[] = "stop_name like :startsWith";
+ $query = "Select * from stops";
+ if (sizeof($conditions) > 0) {
+ if (sizeof($conditions) > 1) {
+ $query .= " Where " . implode(" AND ", $conditions) . " ";
+ } else {
+ $query .= " Where " . $conditions[0] . " ";
+ }
+ }
+ $query .= " order by stop_name;";
+ $query = $conn->prepare($query);
+ if ($firstLetter != "")
$query->bindParam(":firstLetter", $firstLetter);
- $query->execute();
- if (!$query) {
- databaseError($conn->errorInfo());
- return Array();
- }
- return $query->fetchAll();
-}
-function getNearbyStops($lat, $lng, $limit = "", $distance = 1000)
-{
- if ($lat == null || $lng == null) return Array();
- if ($limit != "") $limitSQL = " LIMIT :limit ";
- global $conn;
- $query = "Select *, ST_Distance(position, ST_GeographyFromText('SRID=4326;POINT($lng $lat)'), FALSE) as distance
+
+ if ($startsWith != "") {
+ $startsWith = $startsWith . "%";
+ $query->bindParam(":startsWith", $startsWith);
+ }
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+
+function getNearbyStops($lat, $lng, $limit = "", $distance = 1000) {
+ if ($lat == null || $lng == null)
+ return Array();
+ if ($limit != "")
+ $limitSQL = " LIMIT :limit ";
+ global $conn;
+ $query = "Select *, ST_Distance(position, ST_GeographyFromText('SRID=4326;POINT($lng $lat)'), FALSE) as distance
from stops WHERE ST_DWithin(position, ST_GeographyFromText('SRID=4326;POINT($lng $lat)'), :distance, FALSE)
order by distance $limitSQL;";
- debug($query, "database");
- $query = $conn->prepare($query);
- $query->bindParam(":distance", $distance);
- $query->bindParam(":limit", $limit);
- $query->execute();
- if (!$query) {
- databaseError($conn->errorInfo());
- return Array();
- }
- return $query->fetchAll();
-}
-function getStopsBySuburb($suburb)
-{
- global $conn;
- $query = "Select * from stops where zone_id LIKE :suburb order by stop_name;";
- debug($query, "database");
- $query = $conn->prepare($query);
- $suburb = "%" . $suburb . ";%";
- $query->bindParam(":suburb", $suburb);
- $query->execute();
- if (!$query) {
- databaseError($conn->errorInfo());
- return Array();
- }
- return $query->fetchAll();
-}
-function getStopRoutes($stopID, $service_period)
-{
- if ($service_period == "") $service_period = service_period();
- global $conn;
- $query = "SELECT service_id,trips.route_id,route_short_name,route_long_name
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":distance", $distance);
+ $query->bindParam(":limit", $limit);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+
+function getStopsByName($name) {
+ global $conn;
+ $query = "Select * from stops where stop_name LIKE :name;";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $name = "%" . $name . ";%";
+ $query->bindParam(":name", $name);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+
+function getStopsBySuburb($suburb) {
+ global $conn;
+ $query = "Select * from stops where zone_id LIKE :suburb order by stop_name;";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $suburb = "%" . $suburb . ";%";
+ $query->bindParam(":suburb", $suburb);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+
+function getStopsByStopCode($stop_code, $startsWith = "") {
+ global $conn;
+ $query = "Select * from stops where (stop_code = :stop_code OR stop_code LIKE :stop_code2)";
+ if ($startsWith != "")
+ $query .= " AND stop_name like :startsWith";
+
+ debug($query, "database");
+ $query = $conn->prepare($query);
+
+ $query->bindParam(":stop_code", $stop_code);
+ $stop_code2 = $stop_code . "%";
+ $query->bindParam(":stop_code2", $stop_code2);
+ if ($startsWith != "") {
+ $startsWith = $startsWith . "%";
+ $query->bindParam(":startsWith", $startsWith);
+ }
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+
+function getStopRoutes($stopID, $service_period) {
+ if ($service_period == "")
+ $service_period = service_period();
+ global $conn;
+ $query = "SELECT distinct service_id,trips.route_id,route_short_name,route_long_name
FROM stop_times join trips on trips.trip_id =
stop_times.trip_id join routes on trips.route_id = routes.route_id WHERE stop_id = :stopID AND service_id=:service_period";
- debug($query, "database");
- $query = $conn->prepare($query);
- $query->bindParam(":service_period", $service_period);
- $query->bindParam(":stopID", $stopID);
- $query->execute();
- if (!$query) {
- databaseError($conn->errorInfo());
- return Array();
- }
- return $query->fetchAll();
-}
-function getStopTrips($stopID, $service_period = "", $afterTime = "")
-{
- if ($service_period == "") $service_period = service_period();
- global $conn;
- if ($afterTime != "") {
- $query = " SELECT stop_times.trip_id,stop_times.arrival_time,stop_times.stop_id,stop_sequence,service_id,trips.route_id,route_short_name,route_long_name, end_times.arrival_time as end_time
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":service_period", $service_period);
+ $query->bindParam(":stopID", $stopID);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+
+function getStopTrips($stopID, $service_period = "", $afterTime = "", $limit = "") {
+ if ($service_period == "")
+ $service_period = service_period();
+ if ($limit != "")
+ $limitSQL = " LIMIT :limit ";
+ global $conn;
+ if ($afterTime != "") {
+ $query = " SELECT stop_times.trip_id,stop_times.arrival_time,stop_times.stop_id,stop_sequence,service_id,trips.route_id,route_short_name,route_long_name, end_times.arrival_time as end_time
FROM stop_times
join trips on trips.trip_id =
stop_times.trip_id
@@ -105,55 +175,62 @@
AND stop_times.trip_id = end_times.trip_id
AND service_id=:service_period
AND end_times.arrival_time > :afterTime
-ORDER BY end_time";
- }
- else {
- $query = "SELECT stop_times.trip_id,arrival_time,stop_times.stop_id,stop_sequence,service_id,trips.route_id,route_short_name,route_long_name
+ORDER BY end_time $limitSQL";
+ } else {
+ $query = "SELECT stop_times.trip_id,arrival_time,stop_times.stop_id,stop_sequence,service_id,trips.route_id,route_short_name,route_long_name
FROM stop_times
join trips on trips.trip_id =
stop_times.trip_id
join routes on trips.route_id = routes.route_id
WHERE stop_times.stop_id = :stopID
AND service_id=:service_period
-ORDER BY arrival_time";
- }
- debug($query, "database");
- $query = $conn->prepare($query);
- $query->bindParam(":service_period", $service_period);
- $query->bindParam(":stopID", $stopID);
- if ($afterTime != "") $query->bindParam(":afterTime", $afterTime);
- $query->execute();
- if (!$query) {
- databaseError($conn->errorInfo());
- return Array();
- }
- return $query->fetchAll();
-}
-function getStopTripsWithTimes($stopID, $time = "", $service_period = "", $time_range = "", $limit = "")
-{
- if ($service_period == "") $service_period = service_period();
- if ($time_range == "") $time_range = (24 * 60 * 60);
- if ($time == "") $time = current_time();
- if ($limit == "") $limit = 10;
- $trips = getStopTrips($stopID, $service_period, $time);
- $timedTrips = Array();
- if ($trips && sizeof($trips) > 0) {
- foreach ($trips as $trip) {
- if ($trip['arrival_time'] != "") {
- if (strtotime($trip['arrival_time']) > strtotime($time) and strtotime($trip['arrival_time']) < (strtotime($time) + $time_range)) {
- $timedTrips[] = $trip;
- }
- }
- else {
- $timedTrip = getTimeInterpolatedTripAtStop($trip['trip_id'], $trip['stop_sequence']);
- if ($timedTrip['arrival_time'] > $time and strtotime($timedTrip['arrival_time']) < (strtotime($time) + $time_range)) {
- $timedTrips[] = $timedTrip;
- }
- }
- if (sizeof($timedTrips) > $limit) break;
- }
- sktimesort($timedTrips, "arrival_time", true);
+ORDER BY arrival_time $limitSQL";
+ }
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":service_period", $service_period);
+ $query->bindParam(":stopID", $stopID);
+ if ($limit != "")
+ $query->bindParam(":limit", $limit);
+ if ($afterTime != "")
+ $query->bindParam(":afterTime", $afterTime);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+
+function getStopTripsWithTimes($stopID, $time = "", $service_period = "", $time_range = "", $limit = "") {
+ if ($service_period == "")
+ $service_period = service_period();
+ if ($time_range == "")
+ $time_range = (24 * 60 * 60);
+ if ($time == "")
+ $time = current_time();
+ if ($limit == "")
+ $limit = 10;
+ $trips = getStopTrips($stopID, $service_period, $time);
+ $timedTrips = Array();
+ if ($trips && sizeof($trips) > 0) {
+ foreach ($trips as $trip) {
+ if ($trip['arrival_time'] != "") {
+ if (strtotime($trip['arrival_time']) > strtotime($time) and strtotime($trip['arrival_time']) < (strtotime($time) + $time_range)) {
+ $timedTrips[] = $trip;
+ }
+ } else {
+ $timedTrip = getTimeInterpolatedTripAtStop($trip['trip_id'], $trip['stop_sequence']);
+ if ($timedTrip['arrival_time'] > $time and strtotime($timedTrip['arrival_time']) < (strtotime($time) + $time_range)) {
+ $timedTrips[] = $timedTrip;
+ }
+ }
+ if (sizeof($timedTrips) > $limit)
+ break;
}
- return $timedTrips;
-}
+ sktimesort($timedTrips, "arrival_time", true);
+ }
+ return $timedTrips;
+}
+
?>
--- a/include/db/trip-dao.inc.php
+++ b/include/db/trip-dao.inc.php
@@ -1,234 +1,256 @@
<?php
-function getTrip($tripID)
-{
- global $conn;
- $query = "Select * from trips
+
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
+
+function getTrip($tripID) {
+ global $conn;
+ $query = "Select * from trips
join routes on trips.route_id = routes.route_id
where trip_id = :tripID
LIMIT 1";
- debug($query, "database");
- $query = $conn->prepare($query);
- $query->bindParam(":tripID", $tripID);
- $query->execute();
- if (!$query) {
- databaseError($conn->errorInfo());
- return Array();
- }
- return $query->fetch(PDO::FETCH_ASSOC);
-}
-function getTripShape()
-{
- /* def handle_json_GET_tripstopTimes(self, params):
- schedule = self.server.schedule
- try:
- trip = schedule.GetTrip(params.get('trip'))
- except KeyError:
- # if a non-existent trip is searched for, the return nothing
- return
- time_stops = trip.GetTimeInterpolatedStops()
- stops = []
- times = []
- for arr,ts,is_timingpoint in time_stops:
- stops.append(StopToTuple(ts.stop))
- times.append(arr)
- return [stops, times]
-
- def handle_json_GET_tripshape(self, params):
- schedule = self.server.schedule
- try:
- trip = schedule.GetTrip(params.get('trip'))
- except KeyError:
- # if a non-existent trip is searched for, the return nothing
- return
- points = []
- if trip.shape_id:
- shape = schedule.GetShape(trip.shape_id)
- for (lat, lon, dist) in shape.points:
- points.append((lat, lon))
- else:
- time_stops = trip.GetTimeStops()
- for arr,dep,stop in time_stops:
- points.append((stop.stop_lat, stop.stop_lon))
- return points*/
-}
-function getTimeInterpolatedTrip($tripID, $range = "")
-{
- global $conn;
- $query = "SELECT stop_times.trip_id,arrival_time,stop_times.stop_id,stop_lat,stop_lon,stop_name,stop_code,
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":tripID", $tripID);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetch(PDO :: FETCH_ASSOC);
+}
+
+function getTripShape($tripID) {
+ global $conn;
+ $query = "SELECT ST_AsKML(ST_MakeLine(geometry(a.position))) as the_route
+FROM (SELECT position,
+ stop_sequence, trips.trip_id
+FROM stop_times
+join trips on trips.trip_id = stop_times.trip_id
+join stops on stops.stop_id = stop_times.stop_id
+WHERE trips.trip_id = :tripID ORDER BY stop_sequence) as a group by a.trip_id";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":tripID", $tripID);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchColumn(0);
+}
+
+function getTimeInterpolatedTrip($tripID, $range = "") {
+ global $conn;
+ $query = "SELECT stop_times.trip_id,arrival_time,stop_times.stop_id,stop_lat,stop_lon,stop_name,stop_code,
stop_sequence,service_id,trips.route_id,route_short_name,route_long_name
FROM stop_times
join trips on trips.trip_id = stop_times.trip_id
join routes on trips.route_id = routes.route_id
join stops on stops.stop_id = stop_times.stop_id
WHERE trips.trip_id = :tripID $range ORDER BY stop_sequence";
- debug($query, "database");
- $query = $conn->prepare($query);
- $query->bindParam(":tripID", $tripID);
- $query->execute();
- if (!$query) {
- databaseError($conn->errorInfo());
- return Array();
- }
- $stopTimes = $query->fetchAll();
- $cur_timepoint = Array();
- $next_timepoint = Array();
- $distance_between_timepoints = 0.0;
- $distance_traveled_between_timepoints = 0.0;
- $rv = Array();
- foreach ($stopTimes as $i => $stopTime) {
- if ($stopTime['arrival_time'] != "") {
- // is timepoint
- $cur_timepoint = $stopTime;
- $distance_between_timepoints = 0.0;
- $distance_traveled_between_timepoints = 0.0;
- if ($i + 1 < sizeof($stopTimes)) {
- $k = $i + 1;
- $distance_between_timepoints+= distance($stopTimes[$k - 1]["stop_lat"], $stopTimes[$k - 1]["stop_lon"], $stopTimes[$k]["stop_lat"], $stopTimes[$k]["stop_lon"]);
- while ($stopTimes[$k]["arrival_time"] == "" && $k + 1 < sizeof($stopTimes)) {
- $k+= 1;
- //echo "k".$k;
- $distance_between_timepoints+= distance($stopTimes[$k - 1]["stop_lat"], $stopTimes[$k - 1]["stop_lon"], $stopTimes[$k]["stop_lat"], $stopTimes[$k]["stop_lon"]);
- }
- $next_timepoint = $stopTimes[$k];
- $rv[] = $stopTime;
- }
- }
- else {
- // is untimed point
- //echo "i".$i;
- $distance_traveled_between_timepoints+= distance($stopTimes[$i - 1]["stop_lat"], $stopTimes[$i - 1]["stop_lon"], $stopTimes[$i]["stop_lat"], $stopTimes[$i]["stop_lon"]);
- //echo "$distance_traveled_between_timepoints / $distance_between_timepoints<br>";
- $distance_percent = $distance_traveled_between_timepoints / $distance_between_timepoints;
- if ($next_timepoint["arrival_time"] != "") {
- $total_time = strtotime($next_timepoint["arrival_time"]) - strtotime($cur_timepoint["arrival_time"]);
- //echo strtotime($next_timepoint["arrival_time"])." - ".strtotime($cur_timepoint["arrival_time"])."<br>";
- $time_estimate = ($distance_percent * $total_time) + strtotime($cur_timepoint["arrival_time"]);
- $stopTime["arrival_time"] = date("H:i:s", $time_estimate);
- }
- else {
- $stopTime["arrival_time"] = $cur_timepoint["arrival_time"];
- }
- $rv[] = $stopTime;
- //var_dump($rv);
-
- }
- }
- return $rv;
-}
-function getTripPreviousTimePoint($tripID, $stop_sequence)
-{
- global $conn;
- $query = " SELECT trip_id,stop_id,
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":tripID", $tripID);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ $stopTimes = $query->fetchAll();
+ $cur_timepoint = Array();
+ $next_timepoint = Array();
+ $distance_between_timepoints = 0.0;
+ $distance_traveled_between_timepoints = 0.0;
+ $rv = Array();
+ foreach ($stopTimes as $i => $stopTime) {
+ if ($stopTime['arrival_time'] != "") {
+ // is timepoint
+ $cur_timepoint = $stopTime;
+ $distance_between_timepoints = 0.0;
+ $distance_traveled_between_timepoints = 0.0;
+ if ($i + 1 < sizeof($stopTimes)) {
+ $k = $i + 1;
+ $distance_between_timepoints += distance($stopTimes[$k - 1]["stop_lat"], $stopTimes[$k - 1]["stop_lon"], $stopTimes[$k]["stop_lat"], $stopTimes[$k]["stop_lon"]);
+ while ($stopTimes[$k]["arrival_time"] == "" && $k + 1 < sizeof($stopTimes)) {
+ $k += 1;
+ // echo "k".$k;
+ $distance_between_timepoints += distance($stopTimes[$k - 1]["stop_lat"], $stopTimes[$k - 1]["stop_lon"], $stopTimes[$k]["stop_lat"], $stopTimes[$k]["stop_lon"]);
+ }
+ $next_timepoint = $stopTimes[$k];
+ }
+ $rv[] = $stopTime;
+ } else {
+ // is untimed point
+ // echo "i".$i;
+ $distance_traveled_between_timepoints += distance($stopTimes[$i - 1]["stop_lat"], $stopTimes[$i - 1]["stop_lon"], $stopTimes[$i]["stop_lat"], $stopTimes[$i]["stop_lon"]);
+ // echo "$distance_traveled_between_timepoints / $distance_between_timepoints<br>";
+ $distance_percent = $distance_traveled_between_timepoints / $distance_between_timepoints;
+ if ($next_timepoint["arrival_time"] != "") {
+ $total_time = strtotime($next_timepoint["arrival_time"]) - strtotime($cur_timepoint["arrival_time"]);
+ // echo strtotime($next_timepoint["arrival_time"])." - ".strtotime($cur_timepoint["arrival_time"])."<br>";
+ $time_estimate = ($distance_percent * $total_time) + strtotime($cur_timepoint["arrival_time"]);
+ $stopTime["arrival_time"] = date("H:i:s", $time_estimate);
+ } else {
+ $stopTime["arrival_time"] = $cur_timepoint["arrival_time"];
+ }
+ $rv[] = $stopTime;
+ }
+ }
+ // var_dump($rv);
+ return $rv;
+}
+
+function getTripPreviousTimePoint($tripID, $stop_sequence) {
+ global $conn;
+ $query = " SELECT trip_id,stop_id,
stop_sequence
FROM stop_times
WHERE trip_id = :tripID and stop_sequence < :stop_sequence
and stop_times.arrival_time IS NOT NULL ORDER BY stop_sequence DESC LIMIT 1";
- debug($query, "database");
- $query = $conn->prepare($query);
- $query->bindParam(":tripID", $tripID);
- $query->bindParam(":stop_sequence", $stop_sequence);
- $query->execute();
- if (!$query) {
- databaseError($conn->errorInfo());
- return Array();
- }
- return $query->fetch(PDO::FETCH_ASSOC);
-}
-function getTripNextTimePoint($tripID, $stop_sequence)
-{
- global $conn;
- $query = " SELECT trip_id,stop_id,
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":tripID", $tripID);
+ $query->bindParam(":stop_sequence", $stop_sequence);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetch(PDO :: FETCH_ASSOC);
+}
+
+function getTripNextTimePoint($tripID, $stop_sequence) {
+ global $conn;
+ $query = " SELECT trip_id,stop_id,
stop_sequence
FROM stop_times
WHERE trip_id = :tripID and stop_sequence > :stop_sequence
and stop_times.arrival_time IS NOT NULL ORDER BY stop_sequence LIMIT 1";
- debug($query, "database");
- $query = $conn->prepare($query);
- $query->bindParam(":tripID", $tripID);
- $query->bindParam(":stop_sequence", $stop_sequence);
- $query->execute();
- if (!$query) {
- databaseError($conn->errorInfo());
- return Array();
- }
- return $query->fetch(PDO::FETCH_ASSOC);
-}
-function getTimeInterpolatedTripAtStop($tripID, $stop_sequence)
-{
- global $conn;
- // limit interpolation to between nearest actual points.
- $prevTimePoint = getTripPreviousTimePoint($tripID, $stop_sequence);
- $nextTimePoint = getTripNextTimePoint($tripID, $stop_sequence);
- $range = "AND stop_sequence >= '{$prevTimePoint['stop_sequence']}' AND stop_sequence <= '{$nextTimePoint['stop_sequence']}'";
- foreach (getTimeInterpolatedTrip($tripID, $range) as $tripStop) {
- if ($tripStop['stop_sequence'] == $stop_sequence) return $tripStop;
- }
- return Array();
-}
-function getTripStartTime($tripID)
-{
- global $conn;
- $query = "Select * from stop_times
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":tripID", $tripID);
+ $query->bindParam(":stop_sequence", $stop_sequence);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetch(PDO :: FETCH_ASSOC);
+}
+
+function getTimeInterpolatedTripAtStop($tripID, $stop_sequence) {
+ global $conn;
+ // limit interpolation to between nearest actual points.
+ $prevTimePoint = getTripPreviousTimePoint($tripID, $stop_sequence);
+ $nextTimePoint = getTripNextTimePoint($tripID, $stop_sequence);
+ // echo " prev {$lowestDelta['stop_sequence']} next {$nextTimePoint['stop_sequence']} ";
+ $range = "";
+ if ($prevTimePoint != "")
+ $range .= " AND stop_sequence >= '{$prevTimePoint['stop_sequence']}'";
+ if ($nextTimePoint != "")
+ $range .= " AND stop_sequence <= '{$nextTimePoint['stop_sequence']}'";
+ foreach (getTimeInterpolatedTrip($tripID, $range) as $tripStop) {
+ if ($tripStop['stop_sequence'] == $stop_sequence)
+ return $tripStop;
+ }
+ return Array();
+}
+
+function getTripStartTime($tripID) {
+ global $conn;
+ $query = "Select * from stop_times
where trip_id = :tripID
AND arrival_time IS NOT NULL
AND stop_sequence = '1'";
- debug($query, "database");
- $query = $conn->prepare($query);
- $query->bindParam(":tripID", $tripID);
- $query->execute();
- if (!$query) {
- databaseError($conn->errorInfo());
- return Array();
- }
- $r = $query->fetch(PDO::FETCH_ASSOC);
- return $r['arrival_time'];
-}
-function getActiveTrips($time)
-{
- global $conn;
- if ($time == "") $time = current_time();
- $query = "Select distinct stop_times.trip_id, start_times.arrival_time as start_time, end_times.arrival_time as end_time from stop_times, (SELECT trip_id,arrival_time from stop_times WHERE stop_times.arrival_time IS NOT NULL
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":tripID", $tripID);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ $r = $query->fetch(PDO :: FETCH_ASSOC);
+ return $r['arrival_time'];
+}
+
+function getTripEndTime($tripID) {
+ global $conn;
+ $query = "SELECT trip_id,max(arrival_time) as arrival_time from stop_times
+ WHERE stop_times.arrival_time IS NOT NULL and trip_id = :tripID group by trip_id";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":tripID", $tripID);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ $r = $query->fetch(PDO :: FETCH_ASSOC);
+ return $r['arrival_time'];
+}
+
+function getActiveTrips($time) {
+ global $conn;
+ if ($time == "")
+ $time = current_time();
+ $query = "Select distinct stop_times.trip_id, start_times.arrival_time as start_time, end_times.arrival_time as end_time from stop_times, (SELECT trip_id,arrival_time from stop_times WHERE stop_times.arrival_time IS NOT NULL
AND stop_sequence = '1') as start_times, (SELECT trip_id,max(arrival_time) as arrival_time from stop_times WHERE stop_times.arrival_time IS NOT NULL group by trip_id) as end_times
WHERE start_times.trip_id = end_times.trip_id AND stop_times.trip_id = end_times.trip_id AND :time > start_times.arrival_time AND :time < end_times.arrival_time";
- debug($query, "database");
- $query = $conn->prepare($query);
- $query->bindParam(":time", $time);
- $query->execute();
- if (!$query) {
- databaseError($conn->errorInfo());
- return Array();
- }
- return $query->fetchAll();
-}
-function viaPoints($tripID, $stop_sequence = "")
-{
- global $conn;
- $query = "SELECT stops.stop_id, stop_name, arrival_time
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ $query->bindParam(":time", $time);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+
+function viaPoints($tripID, $stop_sequence = "", $timing_points_only = true) {
+ global $conn;
+ $query = "SELECT stops.stop_id, stop_name, arrival_time
FROM stop_times join stops on stops.stop_id = stop_times.stop_id
WHERE stop_times.trip_id = :tripID
-" . ($stop_sequence != "" ? " AND stop_sequence > :stop_sequence " : "") . "AND substr(stop_code,1,2) != 'Wj' ORDER BY stop_sequence";
- debug($query, "database");
- $query = $conn->prepare($query);
- if ($stop_sequence != "") $query->bindParam(":stop_sequence", $stop_sequence);
- $query->bindParam(":tripID", $tripID);
- $query->execute();
- if (!$query) {
- databaseError($conn->errorInfo());
- return Array();
- }
- return $query->fetchAll();
-}
-function viaPointNames($tripid, $stop_sequence = "")
-{
- $viaPointNames = Array();
- foreach (viaPoints($tripid, $stop_sequence) as $point) {
- $viaPointNames[] = $point['stop_name'];
- }
- if (sizeof($viaPointNames) > 0) {
- return r_implode(", ", $viaPointNames);
- }
- else {
- return "";
- }
-}
+" . ($stop_sequence != "" ? " AND stop_sequence > :stop_sequence " : "") . ($timing_points_only ? "AND substr(stop_code,1,2) != 'Wj' " : "") . " ORDER BY stop_sequence";
+ debug($query, "database");
+ $query = $conn->prepare($query);
+ if ($stop_sequence != "")
+ $query->bindParam(":stop_sequence", $stop_sequence);
+ $query->bindParam(":tripID", $tripID);
+ $query->execute();
+ if (!$query) {
+ databaseError($conn->errorInfo());
+ return Array();
+ }
+ return $query->fetchAll();
+}
+
+function viaPointNames($tripid, $stop_sequence = "") {
+ $viaPointNames = Array();
+ foreach (viaPoints($tripid, $stop_sequence) as $point) {
+ $viaPointNames[] = $point['stop_name'];
+ }
+ if (sizeof($viaPointNames) > 0) {
+ return r_implode(", ", $viaPointNames);
+ } else {
+ return "";
+ }
+}
+
?>
--- a/index.php
+++ b/index.php
@@ -1,32 +1,46 @@
<?php
+/*
+ * Copyright 2010,2011 Alexander Sadleir
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
include ('include/common.inc.php');
include_header("bus.lambdacomplex.org", "index", false)
?>
<div data-role="page">
- <div data-role="content">
- <div id="jqm-homeheader">
- <h1>busness time</h1><br><small>Canberra Bus Timetables and Trip Planner</small>
- </div>
- <a name="maincontent" id="maincontent"></a>
- <a href="tripPlanner.php" data-role="button" data-icon="navigation">Launch Trip Planner...</a>
- <ul data-role="listview" data-inset="true" data-theme="c" data-dividertheme="b">
- <li data-role="list-divider">Timetables - Stops</li>
- <li><a href="stopList.php">Major (Timing Point) Stops</a></li>
- <li><a href="stopList.php?allstops=yes">All Stops</a></li>
- <li><a href="stopList.php?bysuburbs=yes">Stops By Suburb</a></li>
- <li><a class="nearby" href="stopList.php?nearby=yes">Nearby Stops</a></li>
- </ul>
- <ul data-role="listview" data-inset="true" data-theme="c" data-dividertheme="b">
- <li data-role="list-divider">Timetables - Routes</li>
- <li><a href="routeList.php">Routes By Final Destination</a></li>
- <li><a href="routeList.php?bynumber=yes">Routes By Number</a></li>
- <li><a href="routeList.php?bysuburbs=yes">Routes By Suburb</a></li>
- <li><a class="nearby" href="routeList.php?nearby=yes">Nearby Routes</a></li>
- </ul>
-<?php
-echo timePlaceSettings();
-echo ' <a href="labs/index.php" data-role="button" data-icon="beaker">Busness R&D</a>';
-include_footer(true)
-?>
-
+ <div data-role="content">
+ <div id="jqm-homeheader">
+ <h1>busness time</h1><br><small>Canberra Bus Timetables and Trip Planner</small>
+ </div>
+ <a name="maincontent" id="maincontent"></a>
+ <a href="tripPlanner.php" data-role="button" data-icon="navigation">Launch Trip Planner...</a>
+ <ul data-role="listview" data-inset="true" data-theme="c" data-dividertheme="b">
+ <li data-role="list-divider">Timetables - Stops</li>
+ <li><a href="stopList.php">Major (Timing Point) Stops</a></li>
+ <li><a href="stopList.php?allstops=yes">All Stops</a></li>
+ <li><a href="stopList.php?bysuburbs=yes">Stops By Suburb</a></li>
+ <li><a class="nearby" href="stopList.php?nearby=yes">Nearby Stops</a></li>
+ </ul>
+ <ul data-role="listview" data-inset="true" data-theme="c" data-dividertheme="b">
+ <li data-role="list-divider">Timetables - Routes</li>
+ <li><a href="routeList.php">Routes By Final Destination</a></li>
+ <li><a href="routeList.php?bynumber=yes">Routes By Number</a></li>
+ <li><a href="routeList.php?bysuburbs=yes">Routes By Suburb</a></li>
+ <li><a class="nearby" href="routeList.php?nearby=yes">Nearby Routes</a></li>
+ </ul>
+ <?php
+ echo ' <a href="labs/index.php" data-role="button" data-icon="beaker">Busness R&D</a>';
+ echo ' <a href="myway/index.php" data-role="button">MyWay Balance and Timeliness Survey Results</a>';
+ include_footer(true)
+ ?>
--- /dev/null
+++ b/js/LAB.min.js
@@ -1,1 +1,5 @@
-
+/*! LAB.js (LABjs :: Loading And Blocking JavaScript)
+ v2.0.1 (c) Kyle Simpson
+ MIT License
+*/
+(function(o){var K=o.$LAB,y="UseLocalXHR",z="AlwaysPreserveOrder",u="AllowDuplicates",A="CacheBust",B="BasePath",C=/^[^?#]*\//.exec(location.href)[0],D=/^\w+\:\/\/\/?[^\/]+/.exec(C)[0],i=document.head||document.getElementsByTagName("head"),L=(o.opera&&Object.prototype.toString.call(o.opera)=="[object Opera]")||("MozAppearance"in document.documentElement.style),q=document.createElement("script"),E=typeof q.preload=="boolean",r=E||(q.readyState&&q.readyState=="uninitialized"),F=!r&&q.async===true,M=!r&&!F&&!L;function G(a){return Object.prototype.toString.call(a)=="[object Function]"}function H(a){return Object.prototype.toString.call(a)=="[object Array]"}function N(a,c){var b=/^\w+\:\/\//;if(/^\/\/\/?/.test(a)){a=location.protocol+a}else if(!b.test(a)&&a.charAt(0)!="/"){a=(c||"")+a}return b.test(a)?a:((a.charAt(0)=="/"?D:C)+a)}function s(a,c){for(var b in a){if(a.hasOwnProperty(b)){c[b]=a[b]}}return c}function O(a){var c=false;for(var b=0;b<a.scripts.length;b++){if(a.scripts[b].ready&&a.scripts[b].exec_trigger){c=true;a.scripts[b].exec_trigger();a.scripts[b].exec_trigger=null}}return c}function t(a,c,b,d){a.onload=a.onreadystatechange=function(){if((a.readyState&&a.readyState!="complete"&&a.readyState!="loaded")||c[b])return;a.onload=a.onreadystatechange=null;d()}}function I(a){a.ready=a.finished=true;for(var c=0;c<a.finished_listeners.length;c++){setTimeout(a.finished_listeners[c],0)}a.ready_listeners=[];a.finished_listeners=[]}function P(d,f,e,g,h){setTimeout(function(){var a,c=f.real_src,b;if("item"in i){if(!i[0]){setTimeout(arguments.callee,25);return}i=i[0]}a=document.createElement("script");if(f.type)a.type=f.type;if(f.charset)a.charset=f.charset;if(h){if(r){e.elem=a;if(E){a.preload=true;a.onpreload=g}else{a.onreadystatechange=function(){if(a.readyState=="loaded")g();a.onreadystatechange=null}}a.src=c}else if(h&&c.indexOf(D)==0&&d[y]){b=new XMLHttpRequest();b.onreadystatechange=function(){if(b.readyState==4){b.onreadystatechange=function(){};e.text=b.responseText+"\n//@ sourceURL="+c;g()}};b.open("GET",c);b.send()}else{a.type="text/cache-script";t(a,e,"ready",function(){i.removeChild(a);g()});a.src=c;i.insertBefore(a,i.firstChild)}}else if(F){a.async=false;t(a,e,"finished",g);a.src=c;i.insertBefore(a,i.firstChild)}else{t(a,e,"finished",g);a.src=c;i.insertBefore(a,i.firstChild)}},0)}function J(){var l={},Q=r||M,n=[],p={},m;l[y]=true;l[z]=false;l[u]=false;l[A]=false;l[B]="";function R(a,c,b){var d;function f(){if(d!=null){I(b);d=null}}if(p[c.src].finished)return;if(!a[u])p[c.src].finished=true;d=b.elem||document.createElement("script");if(c.type)d.type=c.type;if(c.charset)d.charset=c.charset;t(d,b,"finished",f);if(b.elem){b.elem=null}else if(b.text){d.onload=d.onreadystatechange=null;d.text=b.text}else{d.src=c.real_src}i.insertBefore(d,i.firstChild);if(b.text){f()}}function S(c,b,d,f){var e,g,h=function(){b.ready_cb(b,function(){R(c,b,e)})},j=function(){b.finished_cb(b,d)};b.src=N(b.src,c[B]);b.real_src=b.src+(c[A]?((/\?.*$/.test(b.src)?"&_":"?_")+~~(Math.random()*1E9)+"="):"");if(!p[b.src])p[b.src]={items:[],finished:false};g=p[b.src].items;if(c[u]||g.length==0){e=g[g.length]={ready:false,finished:false,ready_listeners:[h],finished_listeners:[j]};P(c,b,e,((f)?function(){e.ready=true;for(var a=0;a<e.ready_listeners.length;a++){setTimeout(e.ready_listeners[a],0)}e.ready_listeners=[]}:function(){I(e)}),f)}else{e=g[0];if(e.finished){setTimeout(j,0)}else{e.finished_listeners.push(j)}}}function v(){var e,g=s(l,{}),h=[],j=0,w=false,k;function T(a,c){a.ready=true;a.exec_trigger=c;x()}function U(a,c){a.ready=a.finished=true;a.exec_trigger=null;for(var b=0;b<c.scripts.length;b++){if(!c.scripts[b].finished)return}c.finished=true;x()}function x(){while(j<h.length){if(G(h[j])){try{h[j]()}catch(err){}}else if(!h[j].finished){if(O(h[j]))continue;break}j++}if(j==h.length){w=false;k=false}}function V(){if(!k||!k.scripts){h.push(k={scripts:[],finished:true})}}e={script:function(){for(var f=0;f<arguments.length;f++){(function(a,c){var b;if(!H(a)){c=[a]}for(var d=0;d<c.length;d++){V();a=c[d];if(G(a))a=a();if(!a)continue;if(H(a)){b=[].slice.call(a);b.push(d,1);c.splice.call(c,b);d--;continue}if(typeof a=="string")a={src:a};a=s(a,{ready:false,ready_cb:T,finished:false,finished_cb:U});k.finished=false;k.scripts.push(a);S(g,a,k,(Q&&w));w=true;if(g[z])e.wait()}})(arguments[f],arguments[f])}return e},wait:function(){if(arguments.length>0){for(var a=0;a<arguments.length;a++){h.push(arguments[a])}k=h[h.length-1]}else k=false;x();return e}};return{script:e.script,wait:e.wait,setOptions:function(a){s(a,g);return e}}}m={setGlobalDefaults:function(a){s(a,l);return m},setOptions:function(){return v().setOptions.apply(null,arguments)},script:function(){return v().script.apply(null,arguments)},wait:function(){return v().wait.apply(null,arguments)},queueScript:function(){n[n.length]={type:"script",args:[].slice.call(arguments)};return m},queueWait:function(){n[n.length]={type:"wait",args:[].slice.call(arguments)};return m},runQueue:function(){var a=m,c=n.length,b=c,d;for(;--b>=0;){d=n.shift();a=a[d.type].apply(null,d.args)}return a},noConflict:function(){o.$LAB=K;return m},sandbox:function(){return J()}};return m}o.$LAB=J();(function(a,c,b){if(document.readyState==null&&document[a]){document.readyState="loading";document[a](c,b=function(){document.removeEventListener(c,b,false);document.readyState="complete"},false)}})("addEventListener","DOMContentLoaded")})(this);
--- /dev/null
+++ b/js/flot/excanvas.js
@@ -1,1 +1,1428 @@
-
+// Copyright 2006 Google Inc.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+
+// Known Issues:
+//
+// * Patterns only support repeat.
+// * Radial gradient are not implemented. The VML version of these look very
+// different from the canvas one.
+// * Clipping paths are not implemented.
+// * Coordsize. The width and height attribute have higher priority than the
+// width and height style values which isn't correct.
+// * Painting mode isn't implemented.
+// * Canvas width/height should is using content-box by default. IE in
+// Quirks mode will draw the canvas using border-box. Either change your
+// doctype to HTML5
+// (http://www.whatwg.org/specs/web-apps/current-work/#the-doctype)
+// or use Box Sizing Behavior from WebFX
+// (http://webfx.eae.net/dhtml/boxsizing/boxsizing.html)
+// * Non uniform scaling does not correctly scale strokes.
+// * Filling very large shapes (above 5000 points) is buggy.
+// * Optimize. There is always room for speed improvements.
+
+// Only add this code if we do not already have a canvas implementation
+if (!document.createElement('canvas').getContext) {
+
+(function() {
+
+ // alias some functions to make (compiled) code shorter
+ var m = Math;
+ var mr = m.round;
+ var ms = m.sin;
+ var mc = m.cos;
+ var abs = m.abs;
+ var sqrt = m.sqrt;
+
+ // this is used for sub pixel precision
+ var Z = 10;
+ var Z2 = Z / 2;
+
+ /**
+ * This funtion is assigned to the <canvas> elements as element.getContext().
+ * @this {HTMLElement}
+ * @return {CanvasRenderingContext2D_}
+ */
+ function getContext() {
+ return this.context_ ||
+ (this.context_ = new CanvasRenderingContext2D_(this));
+ }
+
+ var slice = Array.prototype.slice;
+
+ /**
+ * Binds a function to an object. The returned function will always use the
+ * passed in {@code obj} as {@code this}.
+ *
+ * Example:
+ *
+ * g = bind(f, obj, a, b)
+ * g(c, d) // will do f.call(obj, a, b, c, d)
+ *
+ * @param {Function} f The function to bind the object to
+ * @param {Object} obj The object that should act as this when the function
+ * is called
+ * @param {*} var_args Rest arguments that will be used as the initial
+ * arguments when the function is called
+ * @return {Function} A new function that has bound this
+ */
+ function bind(f, obj, var_args) {
+ var a = slice.call(arguments, 2);
+ return function() {
+ return f.apply(obj, a.concat(slice.call(arguments)));
+ };
+ }
+
+ function encodeHtmlAttribute(s) {
+ return String(s).replace(/&/g, '&').replace(/"/g, '"');
+ }
+
+ function addNamespacesAndStylesheet(doc) {
+ // create xmlns
+ if (!doc.namespaces['g_vml_']) {
+ doc.namespaces.add('g_vml_', 'urn:schemas-microsoft-com:vml',
+ '#default#VML');
+
+ }
+ if (!doc.namespaces['g_o_']) {
+ doc.namespaces.add('g_o_', 'urn:schemas-microsoft-com:office:office',
+ '#default#VML');
+ }
+
+ // Setup default CSS. Only add one style sheet per document
+ if (!doc.styleSheets['ex_canvas_']) {
+ var ss = doc.createStyleSheet();
+ ss.owningElement.id = 'ex_canvas_';
+ ss.cssText = 'canvas{display:inline-block;overflow:hidden;' +
+ // default size is 300x150 in Gecko and Opera
+ 'text-align:left;width:300px;height:150px}';
+ }
+ }
+
+ // Add namespaces and stylesheet at startup.
+ addNamespacesAndStylesheet(document);
+
+ var G_vmlCanvasManager_ = {
+ init: function(opt_doc) {
+ if (/MSIE/.test(navigator.userAgent) && !window.opera) {
+ var doc = opt_doc || document;
+ // Create a dummy element so that IE will allow canvas elements to be
+ // recognized.
+ doc.createElement('canvas');
+ doc.attachEvent('onreadystatechange', bind(this.init_, this, doc));
+ }
+ },
+
+ init_: function(doc) {
+ // find all canvas elements
+ var els = doc.getElementsByTagName('canvas');
+ for (var i = 0; i < els.length; i++) {
+ this.initElement(els[i]);
+ }
+ },
+
+ /**
+ * Public initializes a canvas element so that it can be used as canvas
+ * element from now on. This is called automatically before the page is
+ * loaded but if you are creating elements using createElement you need to
+ * make sure this is called on the element.
+ * @param {HTMLElement} el The canvas element to initialize.
+ * @return {HTMLElement} the element that was created.
+ */
+ initElement: function(el) {
+ if (!el.getContext) {
+ el.getContext = getContext;
+
+ // Add namespaces and stylesheet to document of the element.
+ addNamespacesAndStylesheet(el.ownerDocument);
+
+ // Remove fallback content. There is no way to hide text nodes so we
+ // just remove all childNodes. We could hide all elements and remove
+ // text nodes but who really cares about the fallback content.
+ el.innerHTML = '';
+
+ // do not use inline function because that will leak memory
+ el.attachEvent('onpropertychange', onPropertyChange);
+ el.attachEvent('onresize', onResize);
+
+ var attrs = el.attributes;
+ if (attrs.width && attrs.width.specified) {
+ // TODO: use runtimeStyle and coordsize
+ // el.getContext().setWidth_(attrs.width.nodeValue);
+ el.style.width = attrs.width.nodeValue + 'px';
+ } else {
+ el.width = el.clientWidth;
+ }
+ if (attrs.height && attrs.height.specified) {
+ // TODO: use runtimeStyle and coordsize
+ // el.getContext().setHeight_(attrs.height.nodeValue);
+ el.style.height = attrs.height.nodeValue + 'px';
+ } else {
+ el.height = el.clientHeight;
+ }
+ //el.getContext().setCoordsize_()
+ }
+ return el;
+ }
+ };
+
+ function onPropertyChange(e) {
+ var el = e.srcElement;
+
+ switch (e.propertyName) {
+ case 'width':
+ el.getContext().clearRect();
+ el.style.width = el.attributes.width.nodeValue + 'px';
+ // In IE8 this does not trigger onresize.
+ el.firstChild.style.width = el.clientWidth + 'px';
+ break;
+ case 'height':
+ el.getContext().clearRect();
+ el.style.height = el.attributes.height.nodeValue + 'px';
+ el.firstChild.style.height = el.clientHeight + 'px';
+ break;
+ }
+ }
+
+ function onResize(e) {
+ var el = e.srcElement;
+ if (el.firstChild) {
+ el.firstChild.style.width = el.clientWidth + 'px';
+ el.firstChild.style.height = el.clientHeight + 'px';
+ }
+ }
+
+ G_vmlCanvasManager_.init();
+
+ // precompute "00" to "FF"
+ var decToHex = [];
+ for (var i = 0; i < 16; i++) {
+ for (var j = 0; j < 16; j++) {
+ decToHex[i * 16 + j] = i.toString(16) + j.toString(16);
+ }
+ }
+
+ function createMatrixIdentity() {
+ return [
+ [1, 0, 0],
+ [0, 1, 0],
+ [0, 0, 1]
+ ];
+ }
+
+ function matrixMultiply(m1, m2) {
+ var result = createMatrixIdentity();
+
+ for (var x = 0; x < 3; x++) {
+ for (var y = 0; y < 3; y++) {
+ var sum = 0;
+
+ for (var z = 0; z < 3; z++) {
+ sum += m1[x][z] * m2[z][y];
+ }
+
+ result[x][y] = sum;
+ }
+ }
+ return result;
+ }
+
+ function copyState(o1, o2) {
+ o2.fillStyle = o1.fillStyle;
+ o2.lineCap = o1.lineCap;
+ o2.lineJoin = o1.lineJoin;
+ o2.lineWidth = o1.lineWidth;
+ o2.miterLimit = o1.miterLimit;
+ o2.shadowBlur = o1.shadowBlur;
+ o2.shadowColor = o1.shadowColor;
+ o2.shadowOffsetX = o1.shadowOffsetX;
+ o2.shadowOffsetY = o1.shadowOffsetY;
+ o2.strokeStyle = o1.strokeStyle;
+ o2.globalAlpha = o1.globalAlpha;
+ o2.font = o1.font;
+ o2.textAlign = o1.textAlign;
+ o2.textBaseline = o1.textBaseline;
+ o2.arcScaleX_ = o1.arcScaleX_;
+ o2.arcScaleY_ = o1.arcScaleY_;
+ o2.lineScale_ = o1.lineScale_;
+ }
+
+ var colorData = {
+ aliceblue: '#F0F8FF',
+ antiquewhite: '#FAEBD7',
+ aquamarine: '#7FFFD4',
+ azure: '#F0FFFF',
+ beige: '#F5F5DC',
+ bisque: '#FFE4C4',
+ black: '#000000',
+ blanchedalmond: '#FFEBCD',
+ blueviolet: '#8A2BE2',
+ brown: '#A52A2A',
+ burlywood: '#DEB887',
+ cadetblue: '#5F9EA0',
+ chartreuse: '#7FFF00',
+ chocolate: '#D2691E',
+ coral: '#FF7F50',
+ cornflowerblue: '#6495ED',
+ cornsilk: '#FFF8DC',
+ crimson: '#DC143C',
+ cyan: '#00FFFF',
+ darkblue: '#00008B',
+ darkcyan: '#008B8B',
+ darkgoldenrod: '#B8860B',
+ darkgray: '#A9A9A9',
+ darkgreen: '#006400',
+ darkgrey: '#A9A9A9',
+ darkkhaki: '#BDB76B',
+ darkmagenta: '#8B008B',
+ darkolivegreen: '#556B2F',
+ darkorange: '#FF8C00',
+ darkorchid: '#9932CC',
+ darkred: '#8B0000',
+ darksalmon: '#E9967A',
+ darkseagreen: '#8FBC8F',
+ darkslateblue: '#483D8B',
+ darkslategray: '#2F4F4F',
+ darkslategrey: '#2F4F4F',
+ darkturquoise: '#00CED1',
+ darkviolet: '#9400D3',
+ deeppink: '#FF1493',
+ deepskyblue: '#00BFFF',
+ dimgray: '#696969',
+ dimgrey: '#696969',
+ dodgerblue: '#1E90FF',
+ firebrick: '#B22222',
+ floralwhite: '#FFFAF0',
+ forestgreen: '#228B22',
+ gainsboro: '#DCDCDC',
+ ghostwhite: '#F8F8FF',
+ gold: '#FFD700',
+ goldenrod: '#DAA520',
+ grey: '#808080',
+ greenyellow: '#ADFF2F',
+ honeydew: '#F0FFF0',
+ hotpink: '#FF69B4',
+ indianred: '#CD5C5C',
+ indigo: '#4B0082',
+ ivory: '#FFFFF0',
+ khaki: '#F0E68C',
+ lavender: '#E6E6FA',
+ lavenderblush: '#FFF0F5',
+ lawngreen: '#7CFC00',
+ lemonchiffon: '#FFFACD',
+ lightblue: '#ADD8E6',
+ lightcoral: '#F08080',
+ lightcyan: '#E0FFFF',
+ lightgoldenrodyellow: '#FAFAD2',
+ lightgreen: '#90EE90',
+ lightgrey: '#D3D3D3',
+ lightpink: '#FFB6C1',
+ lightsalmon: '#FFA07A',
+ lightseagreen: '#20B2AA',
+ lightskyblue: '#87CEFA',
+ lightslategray: '#778899',
+ lightslategrey: '#778899',
+ lightsteelblue: '#B0C4DE',
+ lightyellow: '#FFFFE0',
+ limegreen: '#32CD32',
+ linen: '#FAF0E6',
+ magenta: '#FF00FF',
+ mediumaquamarine: '#66CDAA',
+ mediumblue: '#0000CD',
+ mediumorchid: '#BA55D3',
+ mediumpurple: '#9370DB',
+ mediumseagreen: '#3CB371',
+ mediumslateblue: '#7B68EE',
+ mediumspringgreen: '#00FA9A',
+ mediumturquoise: '#48D1CC',
+ mediumvioletred: '#C71585',
+ midnightblue: '#191970',
+ mintcream: '#F5FFFA',
+ mistyrose: '#FFE4E1',
+ moccasin: '#FFE4B5',
+ navajowhite: '#FFDEAD',
+ oldlace: '#FDF5E6',
+ olivedrab: '#6B8E23',
+ orange: '#FFA500',
+ orangered: '#FF4500',
+ orchid: '#DA70D6',
+ palegoldenrod: '#EEE8AA',
+ palegreen: '#98FB98',
+ paleturquoise: '#AFEEEE',
+ palevioletred: '#DB7093',
+ papayawhip: '#FFEFD5',
+ peachpuff: '#FFDAB9',
+ peru: '#CD853F',
+ pink: '#FFC0CB',
+ plum: '#DDA0DD',
+ powderblue: '#B0E0E6',
+ rosybrown: '#BC8F8F',
+ royalblue: '#4169E1',
+ saddlebrown: '#8B4513',
+ salmon: '#FA8072',
+ sandybrown: '#F4A460',
+ seagreen: '#2E8B57',
+ seashell: '#FFF5EE',
+ sienna: '#A0522D',
+ skyblue: '#87CEEB',
+ slateblue: '#6A5ACD',
+ slategray: '#708090',
+ slategrey: '#708090',
+ snow: '#FFFAFA',
+ springgreen: '#00FF7F',
+ steelblue: '#4682B4',
+ tan: '#D2B48C',
+ thistle: '#D8BFD8',
+ tomato: '#FF6347',
+ turquoise: '#40E0D0',
+ violet: '#EE82EE',
+ wheat: '#F5DEB3',
+ whitesmoke: '#F5F5F5',
+ yellowgreen: '#9ACD32'
+ };
+
+
+ function getRgbHslContent(styleString) {
+ var start = styleString.indexOf('(', 3);
+ var end = styleString.indexOf(')', start + 1);
+ var parts = styleString.substring(start + 1, end).split(',');
+ // add alpha if needed
+ if (parts.length == 4 && styleString.substr(3, 1) == 'a') {
+ alpha = Number(parts[3]);
+ } else {
+ parts[3] = 1;
+ }
+ return parts;
+ }
+
+ function percent(s) {
+ return parseFloat(s) / 100;
+ }
+
+ function clamp(v, min, max) {
+ return Math.min(max, Math.max(min, v));
+ }
+
+ function hslToRgb(parts){
+ var r, g, b;
+ h = parseFloat(parts[0]) / 360 % 360;
+ if (h < 0)
+ h++;
+ s = clamp(percent(parts[1]), 0, 1);
+ l = clamp(percent(parts[2]), 0, 1);
+ if (s == 0) {
+ r = g = b = l; // achromatic
+ } else {
+ var q = l < 0.5 ? l * (1 + s) : l + s - l * s;
+ var p = 2 * l - q;
+ r = hueToRgb(p, q, h + 1 / 3);
+ g = hueToRgb(p, q, h);
+ b = hueToRgb(p, q, h - 1 / 3);
+ }
+
+ return '#' + decToHex[Math.floor(r * 255)] +
+ decToHex[Math.floor(g * 255)] +
+ decToHex[Math.floor(b * 255)];
+ }
+
+ function hueToRgb(m1, m2, h) {
+ if (h < 0)
+ h++;
+ if (h > 1)
+ h--;
+
+ if (6 * h < 1)
+ return m1 + (m2 - m1) * 6 * h;
+ else if (2 * h < 1)
+ return m2;
+ else if (3 * h < 2)
+ return m1 + (m2 - m1) * (2 / 3 - h) * 6;
+ else
+ return m1;
+ }
+
+ function processStyle(styleString) {
+ var str, alpha = 1;
+
+ styleString = String(styleString);
+ if (styleString.charAt(0) == '#') {
+ str = styleString;
+ } else if (/^rgb/.test(styleString)) {
+ var parts = getRgbHslContent(styleString);
+ var str = '#', n;
+ for (var i = 0; i < 3; i++) {
+ if (parts[i].indexOf('%') != -1) {
+ n = Math.floor(percent(parts[i]) * 255);
+ } else {
+ n = Number(parts[i]);
+ }
+ str += decToHex[clamp(n, 0, 255)];
+ }
+ alpha = parts[3];
+ } else if (/^hsl/.test(styleString)) {
+ var parts = getRgbHslContent(styleString);
+ str = hslToRgb(parts);
+ alpha = parts[3];
+ } else {
+ str = colorData[styleString] || styleString;
+ }
+ return {color: str, alpha: alpha};
+ }
+
+ var DEFAULT_STYLE = {
+ style: 'normal',
+ variant: 'normal',
+ weight: 'normal',
+ size: 10,
+ family: 'sans-serif'
+ };
+
+ // Internal text style cache
+ var fontStyleCache = {};
+
+ function processFontStyle(styleString) {
+ if (fontStyleCache[styleString]) {
+ return fontStyleCache[styleString];
+ }
+
+ var el = document.createElement('div');
+ var style = el.style;
+ try {
+ style.font = styleString;
+ } catch (ex) {
+ // Ignore failures to set to invalid font.
+ }
+
+ return fontStyleCache[styleString] = {
+ style: style.fontStyle || DEFAULT_STYLE.style,
+ variant: style.fontVariant || DEFAULT_STYLE.variant,
+ weight: style.fontWeight || DEFAULT_STYLE.weight,
+ size: style.fontSize || DEFAULT_STYLE.size,
+ family: style.fontFamily || DEFAULT_STYLE.family
+ };
+ }
+
+ function getComputedStyle(style, element) {
+ var computedStyle = {};
+
+ for (var p in style) {
+ computedStyle[p] = style[p];
+ }
+
+ // Compute the size
+ var canvasFontSize = parseFloat(element.currentStyle.fontSize),
+ fontSize = parseFloat(style.size);
+
+ if (typeof style.size == 'number') {
+ computedStyle.size = style.size;
+ } else if (style.size.indexOf('px') != -1) {
+ computedStyle.size = fontSize;
+ } else if (style.size.indexOf('em') != -1) {
+ computedStyle.size = canvasFontSize * fontSize;
+ } else if(style.size.indexOf('%') != -1) {
+ computedStyle.size = (canvasFontSize / 100) * fontSize;
+ } else if (style.size.indexOf('pt') != -1) {
+ computedStyle.size = fontSize / .75;
+ } else {
+ computedStyle.size = canvasFontSize;
+ }
+
+ // Different scaling between normal text and VML text. This was found using
+ // trial and error to get the same size as non VML text.
+ computedStyle.size *= 0.981;
+
+ return computedStyle;
+ }
+
+ function buildStyle(style) {
+ return style.style + ' ' + style.variant + ' ' + style.weight + ' ' +
+ style.size + 'px ' + style.family;
+ }
+
+ function processLineCap(lineCap) {
+ switch (lineCap) {
+ case 'butt':
+ return 'flat';
+ case 'round':
+ return 'round';
+ case 'square':
+ default:
+ return 'square';
+ }
+ }
+
+ /**
+ * This class implements CanvasRenderingContext2D interface as described by
+ * the WHATWG.
+ * @param {HTMLElement} surfaceElement The element that the 2D context should
+ * be associated with
+ */
+ function CanvasRenderingContext2D_(surfaceElement) {
+ this.m_ = createMatrixIdentity();
+
+ this.mStack_ = [];
+ this.aStack_ = [];
+ this.currentPath_ = [];
+
+ // Canvas context properties
+ this.strokeStyle = '#000';
+ this.fillStyle = '#000';
+
+ this.lineWidth = 1;
+ this.lineJoin = 'miter';
+ this.lineCap = 'butt';
+ this.miterLimit = Z * 1;
+ this.globalAlpha = 1;
+ this.font = '10px sans-serif';
+ this.textAlign = 'left';
+ this.textBaseline = 'alphabetic';
+ this.canvas = surfaceElement;
+
+ var el = surfaceElement.ownerDocument.createElement('div');
+ el.style.width = surfaceElement.clientWidth + 'px';
+ el.style.height = surfaceElement.clientHeight + 'px';
+ el.style.overflow = 'hidden';
+ el.style.position = 'absolute';
+ surfaceElement.appendChild(el);
+
+ this.element_ = el;
+ this.arcScaleX_ = 1;
+ this.arcScaleY_ = 1;
+ this.lineScale_ = 1;
+ }
+
+ var contextPrototype = CanvasRenderingContext2D_.prototype;
+ contextPrototype.clearRect = function() {
+ if (this.textMeasureEl_) {
+ this.textMeasureEl_.removeNode(true);
+ this.textMeasureEl_ = null;
+ }
+ this.element_.innerHTML = '';
+ };
+
+ contextPrototype.beginPath = function() {
+ // TODO: Branch current matrix so that save/restore has no effect
+ // as per safari docs.
+ this.currentPath_ = [];
+ };
+
+ contextPrototype.moveTo = function(aX, aY) {
+ var p = this.getCoords_(aX, aY);
+ this.currentPath_.push({type: 'moveTo', x: p.x, y: p.y});
+ this.currentX_ = p.x;
+ this.currentY_ = p.y;
+ };
+
+ contextPrototype.lineTo = function(aX, aY) {
+ var p = this.getCoords_(aX, aY);
+ this.currentPath_.push({type: 'lineTo', x: p.x, y: p.y});
+
+ this.currentX_ = p.x;
+ this.currentY_ = p.y;
+ };
+
+ contextPrototype.bezierCurveTo = function(aCP1x, aCP1y,
+ aCP2x, aCP2y,
+ aX, aY) {
+ var p = this.getCoords_(aX, aY);
+ var cp1 = this.getCoords_(aCP1x, aCP1y);
+ var cp2 = this.getCoords_(aCP2x, aCP2y);
+ bezierCurveTo(this, cp1, cp2, p);
+ };
+
+ // Helper function that takes the already fixed cordinates.
+ function bezierCurveTo(self, cp1, cp2, p) {
+ self.currentPath_.push({
+ type: 'bezierCurveTo',
+ cp1x: cp1.x,
+ cp1y: cp1.y,
+ cp2x: cp2.x,
+ cp2y: cp2.y,
+ x: p.x,
+ y: p.y
+ });
+ self.currentX_ = p.x;
+ self.currentY_ = p.y;
+ }
+
+ contextPrototype.quadraticCurveTo = function(aCPx, aCPy, aX, aY) {
+ // the following is lifted almost directly from
+ // http://developer.mozilla.org/en/docs/Canvas_tutorial:Drawing_shapes
+
+ var cp = this.getCoords_(aCPx, aCPy);
+ var p = this.getCoords_(aX, aY);
+
+ var cp1 = {
+ x: this.currentX_ + 2.0 / 3.0 * (cp.x - this.currentX_),
+ y: this.currentY_ + 2.0 / 3.0 * (cp.y - this.currentY_)
+ };
+ var cp2 = {
+ x: cp1.x + (p.x - this.currentX_) / 3.0,
+ y: cp1.y + (p.y - this.currentY_) / 3.0
+ };
+
+ bezierCurveTo(this, cp1, cp2, p);
+ };
+
+ contextPrototype.arc = function(aX, aY, aRadius,
+ aStartAngle, aEndAngle, aClockwise) {
+ aRadius *= Z;
+ var arcType = aClockwise ? 'at' : 'wa';
+
+ var xStart = aX + mc(aStartAngle) * aRadius - Z2;
+ var yStart = aY + ms(aStartAngle) * aRadius - Z2;
+
+ var xEnd = aX + mc(aEndAngle) * aRadius - Z2;
+ var yEnd = aY + ms(aEndAngle) * aRadius - Z2;
+
+ // IE won't render arches drawn counter clockwise if xStart == xEnd.
+ if (xStart == xEnd && !aClockwise) {
+ xStart += 0.125; // Offset xStart by 1/80 of a pixel. Use something
+ // that can be represented in binary
+ }
+
+ var p = this.getCoords_(aX, aY);
+ var pStart = this.getCoords_(xStart, yStart);
+ var pEnd = this.getCoords_(xEnd, yEnd);
+
+ this.currentPath_.push({type: arcType,
+ x: p.x,
+ y: p.y,
+ radius: aRadius,
+ xStart: pStart.x,
+ yStart: pStart.y,
+ xEnd: pEnd.x,
+ yEnd: pEnd.y});
+
+ };
+
+ contextPrototype.rect = function(aX, aY, aWidth, aHeight) {
+ this.moveTo(aX, aY);
+ this.lineTo(aX + aWidth, aY);
+ this.lineTo(aX + aWidth, aY + aHeight);
+ this.lineTo(aX, aY + aHeight);
+ this.closePath();
+ };
+
+ contextPrototype.strokeRect = function(aX, aY, aWidth, aHeight) {
+ var oldPath = this.currentPath_;
+ this.beginPath();
+
+ this.moveTo(aX, aY);
+ this.lineTo(aX + aWidth, aY);
+ this.lineTo(aX + aWidth, aY + aHeight);
+ this.lineTo(aX, aY + aHeight);
+ this.closePath();
+ this.stroke();
+
+ this.currentPath_ = oldPath;
+ };
+
+ contextPrototype.fillRect = function(aX, aY, aWidth, aHeight) {
+ var oldPath = this.currentPath_;
+ this.beginPath();
+
+ this.moveTo(aX, aY);
+ this.lineTo(aX + aWidth, aY);
+ this.lineTo(aX + aWidth, aY + aHeight);
+ this.lineTo(aX, aY + aHeight);
+ this.closePath();
+ this.fill();
+
+ this.currentPath_ = oldPath;
+ };
+
+ contextPrototype.createLinearGradient = function(aX0, aY0, aX1, aY1) {
+ var gradient = new CanvasGradient_('gradient');
+ gradient.x0_ = aX0;
+ gradient.y0_ = aY0;
+ gradient.x1_ = aX1;
+ gradient.y1_ = aY1;
+ return gradient;
+ };
+
+ contextPrototype.createRadialGradient = function(aX0, aY0, aR0,
+ aX1, aY1, aR1) {
+ var gradient = new CanvasGradient_('gradientradial');
+ gradient.x0_ = aX0;
+ gradient.y0_ = aY0;
+ gradient.r0_ = aR0;
+ gradient.x1_ = aX1;
+ gradient.y1_ = aY1;
+ gradient.r1_ = aR1;
+ return gradient;
+ };
+
+ contextPrototype.drawImage = function(image, var_args) {
+ var dx, dy, dw, dh, sx, sy, sw, sh;
+
+ // to find the original width we overide the width and height
+ var oldRuntimeWidth = image.runtimeStyle.width;
+ var oldRuntimeHeight = image.runtimeStyle.height;
+ image.runtimeStyle.width = 'auto';
+ image.runtimeStyle.height = 'auto';
+
+ // get the original size
+ var w = image.width;
+ var h = image.height;
+
+ // and remove overides
+ image.runtimeStyle.width = oldRuntimeWidth;
+ image.runtimeStyle.height = oldRuntimeHeight;
+
+ if (arguments.length == 3) {
+ dx = arguments[1];
+ dy = arguments[2];
+ sx = sy = 0;
+ sw = dw = w;
+ sh = dh = h;
+ } else if (arguments.length == 5) {
+ dx = arguments[1];
+ dy = arguments[2];
+ dw = arguments[3];
+ dh = arguments[4];
+ sx = sy = 0;
+ sw = w;
+ sh = h;
+ } else if (arguments.length == 9) {
+ sx = arguments[1];
+ sy = arguments[2];
+ sw = arguments[3];
+ sh = arguments[4];
+ dx = arguments[5];
+ dy = arguments[6];
+ dw = arguments[7];
+ dh = arguments[8];
+ } else {
+ throw Error('Invalid number of arguments');
+ }
+
+ var d = this.getCoords_(dx, dy);
+
+ var w2 = sw / 2;
+ var h2 = sh / 2;
+
+ var vmlStr = [];
+
+ var W = 10;
+ var H = 10;
+
+ // For some reason that I've now forgotten, using divs didn't work
+ vmlStr.push(' <g_vml_:group',
+ ' coordsize="', Z * W, ',', Z * H, '"',
+ ' coordorigin="0,0"' ,
+ ' style="width:', W, 'px;height:', H, 'px;position:absolute;');
+
+ // If filters are necessary (rotation exists), create them
+ // filters are bog-slow, so only create them if abbsolutely necessary
+ // The following check doesn't account for skews (which don't exist
+ // in the canvas spec (yet) anyway.
+
+ if (this.m_[0][0] != 1 || this.m_[0][1] ||
+ this.m_[1][1] != 1 || this.m_[1][0]) {
+ var filter = [];
+
+ // Note the 12/21 reversal
+ filter.push('M11=', this.m_[0][0], ',',
+ 'M12=', this.m_[1][0], ',',
+ 'M21=', this.m_[0][1], ',',
+ 'M22=', this.m_[1][1], ',',
+ 'Dx=', mr(d.x / Z), ',',
+ 'Dy=', mr(d.y / Z), '');
+
+ // Bounding box calculation (need to minimize displayed area so that
+ // filters don't waste time on unused pixels.
+ var max = d;
+ var c2 = this.getCoords_(dx + dw, dy);
+ var c3 = this.getCoords_(dx, dy + dh);
+ var c4 = this.getCoords_(dx + dw, dy + dh);
+
+ max.x = m.max(max.x, c2.x, c3.x, c4.x);
+ max.y = m.max(max.y, c2.y, c3.y, c4.y);
+
+ vmlStr.push('padding:0 ', mr(max.x / Z), 'px ', mr(max.y / Z),
+ 'px 0;filter:progid:DXImageTransform.Microsoft.Matrix(',
+ filter.join(''), ", sizingmethod='clip');");
+
+ } else {
+ vmlStr.push('top:', mr(d.y / Z), 'px;left:', mr(d.x / Z), 'px;');
+ }
+
+ vmlStr.push(' ">' ,
+ '<g_vml_:image src="', image.src, '"',
+ ' style="width:', Z * dw, 'px;',
+ ' height:', Z * dh, 'px"',
+ ' cropleft="', sx / w, '"',
+ ' croptop="', sy / h, '"',
+ ' cropright="', (w - sx - sw) / w, '"',
+ ' cropbottom="', (h - sy - sh) / h, '"',
+ ' />',
+ '</g_vml_:group>');
+
+ this.element_.insertAdjacentHTML('BeforeEnd', vmlStr.join(''));
+ };
+
+ contextPrototype.stroke = function(aFill) {
+ var W = 10;
+ var H = 10;
+ // Divide the shape into chunks if it's too long because IE has a limit
+ // somewhere for how long a VML shape can be. This simple division does
+ // not work with fills, only strokes, unfortunately.
+ var chunkSize = 5000;
+
+ var min = {x: null, y: null};
+ var max = {x: null, y: null};
+
+ for (var j = 0; j < this.currentPath_.length; j += chunkSize) {
+ var lineStr = [];
+ var lineOpen = false;
+
+ lineStr.push('<g_vml_:shape',
+ ' filled="', !!aFill, '"',
+ ' style="position:absolute;width:', W, 'px;height:', H, 'px;"',
+ ' coordorigin="0,0"',
+ ' coordsize="', Z * W, ',', Z * H, '"',
+ ' stroked="', !aFill, '"',
+ ' path="');
+
+ var newSeq = false;
+
+ for (var i = j; i < Math.min(j + chunkSize, this.currentPath_.length); i++) {
+ if (i % chunkSize == 0 && i > 0) { // move into position for next chunk
+ lineStr.push(' m ', mr(this.currentPath_[i-1].x), ',', mr(this.currentPath_[i-1].y));
+ }
+
+ var p = this.currentPath_[i];
+ var c;
+
+ switch (p.type) {
+ case 'moveTo':
+ c = p;
+ lineStr.push(' m ', mr(p.x), ',', mr(p.y));
+ break;
+ case 'lineTo':
+ lineStr.push(' l ', mr(p.x), ',', mr(p.y));
+ break;
+ case 'close':
+ lineStr.push(' x ');
+ p = null;
+ break;
+ case 'bezierCurveTo':
+ lineStr.push(' c ',
+ mr(p.cp1x), ',', mr(p.cp1y), ',',
+ mr(p.cp2x), ',', mr(p.cp2y), ',',
+ mr(p.x), ',', mr(p.y));
+ break;
+ case 'at':
+ case 'wa':
+ lineStr.push(' ', p.type, ' ',
+ mr(p.x - this.arcScaleX_ * p.radius), ',',
+ mr(p.y - this.arcScaleY_ * p.radius), ' ',
+ mr(p.x + this.arcScaleX_ * p.radius), ',',
+ mr(p.y + this.arcScaleY_ * p.radius), ' ',
+ mr(p.xStart), ',', mr(p.yStart), ' ',
+ mr(p.xEnd), ',', mr(p.yEnd));
+ break;
+ }
+
+
+ // TODO: Following is broken for curves due to
+ // move to proper paths.
+
+ // Figure out dimensions so we can do gradient fills
+ // properly
+ if (p) {
+ if (min.x == null || p.x < min.x) {
+ min.x = p.x;
+ }
+ if (max.x == null || p.x > max.x) {
+ max.x = p.x;
+ }
+ if (min.y == null || p.y < min.y) {
+ min.y = p.y;
+ }
+ if (max.y == null || p.y > max.y) {
+ max.y = p.y;
+ }
+ }
+ }
+ lineStr.push(' ">');
+
+ if (!aFill) {
+ appendStroke(this, lineStr);
+ } else {
+ appendFill(this, lineStr, min, max);
+ }
+
+ lineStr.push('</g_vml_:shape>');
+
+ this.element_.insertAdjacentHTML('beforeEnd', lineStr.join(''));
+ }
+ };
+
+ function appendStroke(ctx, lineStr) {
+ var a = processStyle(ctx.strokeStyle);
+ var color = a.color;
+ var opacity = a.alpha * ctx.globalAlpha;
+ var lineWidth = ctx.lineScale_ * ctx.lineWidth;
+
+ // VML cannot correctly render a line if the width is less than 1px.
+ // In that case, we dilute the color to make the line look thinner.
+ if (lineWidth < 1) {
+ opacity *= lineWidth;
+ }
+
+ lineStr.push(
+ '<g_vml_:stroke',
+ ' opacity="', opacity, '"',
+ ' joinstyle="', ctx.lineJoin, '"',
+ ' miterlimit="', ctx.miterLimit, '"',
+ ' endcap="', processLineCap(ctx.lineCap), '"',
+ ' weight="', lineWidth, 'px"',
+ ' color="', color, '" />'
+ );
+ }
+
+ function appendFill(ctx, lineStr, min, max) {
+ var fillStyle = ctx.fillStyle;
+ var arcScaleX = ctx.arcScaleX_;
+ var arcScaleY = ctx.arcScaleY_;
+ var width = max.x - min.x;
+ var height = max.y - min.y;
+ if (fillStyle instanceof CanvasGradient_) {
+ // TODO: Gradients transformed with the transformation matrix.
+ var angle = 0;
+ var focus = {x: 0, y: 0};
+
+ // additional offset
+ var shift = 0;
+ // scale factor for offset
+ var expansion = 1;
+
+ if (fillStyle.type_ == 'gradient') {
+ var x0 = fillStyle.x0_ / arcScaleX;
+ var y0 = fillStyle.y0_ / arcScaleY;
+ var x1 = fillStyle.x1_ / arcScaleX;
+ var y1 = fillStyle.y1_ / arcScaleY;
+ var p0 = ctx.getCoords_(x0, y0);
+ var p1 = ctx.getCoords_(x1, y1);
+ var dx = p1.x - p0.x;
+ var dy = p1.y - p0.y;
+ angle = Math.atan2(dx, dy) * 180 / Math.PI;
+
+ // The angle should be a non-negative number.
+ if (angle < 0) {
+ angle += 360;
+ }
+
+ // Very small angles produce an unexpected result because they are
+ // converted to a scientific notation string.
+ if (angle < 1e-6) {
+ angle = 0;
+ }
+ } else {
+ var p0 = ctx.getCoords_(fillStyle.x0_, fillStyle.y0_);
+ focus = {
+ x: (p0.x - min.x) / width,
+ y: (p0.y - min.y) / height
+ };
+
+ width /= arcScaleX * Z;
+ height /= arcScaleY * Z;
+ var dimension = m.max(width, height);
+ shift = 2 * fillStyle.r0_ / dimension;
+ expansion = 2 * fillStyle.r1_ / dimension - shift;
+ }
+
+ // We need to sort the color stops in ascending order by offset,
+ // otherwise IE won't interpret it correctly.
+ var stops = fillStyle.colors_;
+ stops.sort(function(cs1, cs2) {
+ return cs1.offset - cs2.offset;
+ });
+
+ var length = stops.length;
+ var color1 = stops[0].color;
+ var color2 = stops[length - 1].color;
+ var opacity1 = stops[0].alpha * ctx.globalAlpha;
+ var opacity2 = stops[length - 1].alpha * ctx.globalAlpha;
+
+ var colors = [];
+ for (var i = 0; i < length; i++) {
+ var stop = stops[i];
+ colors.push(stop.offset * expansion + shift + ' ' + stop.color);
+ }
+
+ // When colors attribute is used, the meanings of opacity and o:opacity2
+ // are reversed.
+ lineStr.push('<g_vml_:fill type="', fillStyle.type_, '"',
+ ' method="none" focus="100%"',
+ ' color="', color1, '"',
+ ' color2="', color2, '"',
+ ' colors="', colors.join(','), '"',
+ ' opacity="', opacity2, '"',
+ ' g_o_:opacity2="', opacity1, '"',
+ ' angle="', angle, '"',
+ ' focusposition="', focus.x, ',', focus.y, '" />');
+ } else if (fillStyle instanceof CanvasPattern_) {
+ if (width && height) {
+ var deltaLeft = -min.x;
+ var deltaTop = -min.y;
+ lineStr.push('<g_vml_:fill',
+ ' position="',
+ deltaLeft / width * arcScaleX * arcScaleX, ',',
+ deltaTop / height * arcScaleY * arcScaleY, '"',
+ ' type="tile"',
+ // TODO: Figure out the correct size to fit the scale.
+ //' size="', w, 'px ', h, 'px"',
+ ' src="', fillStyle.src_, '" />');
+ }
+ } else {
+ var a = processStyle(ctx.fillStyle);
+ var color = a.color;
+ var opacity = a.alpha * ctx.globalAlpha;
+ lineStr.push('<g_vml_:fill color="', color, '" opacity="', opacity,
+ '" />');
+ }
+ }
+
+ contextPrototype.fill = function() {
+ this.stroke(true);
+ };
+
+ contextPrototype.closePath = function() {
+ this.currentPath_.push({type: 'close'});
+ };
+
+ /**
+ * @private
+ */
+ contextPrototype.getCoords_ = function(aX, aY) {
+ var m = this.m_;
+ return {
+ x: Z * (aX * m[0][0] + aY * m[1][0] + m[2][0]) - Z2,
+ y: Z * (aX * m[0][1] + aY * m[1][1] + m[2][1]) - Z2
+ };
+ };
+
+ contextPrototype.save = function() {
+ var o = {};
+ copyState(this, o);
+ this.aStack_.push(o);
+ this.mStack_.push(this.m_);
+ this.m_ = matrixMultiply(createMatrixIdentity(), this.m_);
+ };
+
+ contextPrototype.restore = function() {
+ if (this.aStack_.length) {
+ copyState(this.aStack_.pop(), this);
+ this.m_ = this.mStack_.pop();
+ }
+ };
+
+ function matrixIsFinite(m) {
+ return isFinite(m[0][0]) && isFinite(m[0][1]) &&
+ isFinite(m[1][0]) && isFinite(m[1][1]) &&
+ isFinite(m[2][0]) && isFinite(m[2][1]);
+ }
+
+ function setM(ctx, m, updateLineScale) {
+ if (!matrixIsFinite(m)) {
+ return;
+ }
+ ctx.m_ = m;
+
+ if (updateLineScale) {
+ // Get the line scale.
+ // Determinant of this.m_ means how much the area is enlarged by the
+ // transformation. So its square root can be used as a scale factor
+ // for width.
+ var det = m[0][0] * m[1][1] - m[0][1] * m[1][0];
+ ctx.lineScale_ = sqrt(abs(det));
+ }
+ }
+
+ contextPrototype.translate = function(aX, aY) {
+ var m1 = [
+ [1, 0, 0],
+ [0, 1, 0],
+ [aX, aY, 1]
+ ];
+
+ setM(this, matrixMultiply(m1, this.m_), false);
+ };
+
+ contextPrototype.rotate = function(aRot) {
+ var c = mc(aRot);
+ var s = ms(aRot);
+
+ var m1 = [
+ [c, s, 0],
+ [-s, c, 0],
+ [0, 0, 1]
+ ];
+
+ setM(this, matrixMultiply(m1, this.m_), false);
+ };
+
+ contextPrototype.scale = function(aX, aY) {
+ this.arcScaleX_ *= aX;
+ this.arcScaleY_ *= aY;
+ var m1 = [
+ [aX, 0, 0],
+ [0, aY, 0],
+ [0, 0, 1]
+ ];
+
+ setM(this, matrixMultiply(m1, this.m_), true);
+ };
+
+ contextPrototype.transform = function(m11, m12, m21, m22, dx, dy) {
+ var m1 = [
+ [m11, m12, 0],
+ [m21, m22, 0],
+ [dx, dy, 1]
+ ];
+
+ setM(this, matrixMultiply(m1, this.m_), true);
+ };
+
+ contextPrototype.setTransform = function(m11, m12, m21, m22, dx, dy) {
+ var m = [
+ [m11, m12, 0],
+ [m21, m22, 0],
+ [dx, dy, 1]
+ ];
+
+ setM(this, m, true);
+ };
+
+ /**
+ * The text drawing function.
+ * The maxWidth argument isn't taken in account, since no browser supports
+ * it yet.
+ */
+ contextPrototype.drawText_ = function(text, x, y, maxWidth, stroke) {
+ var m = this.m_,
+ delta = 1000,
+ left = 0,
+ right = delta,
+ offset = {x: 0, y: 0},
+ lineStr = [];
+
+ var fontStyle = getComputedStyle(processFontStyle(this.font),
+ this.element_);
+
+ var fontStyleString = buildStyle(fontStyle);
+
+ var elementStyle = this.element_.currentStyle;
+ var textAlign = this.textAlign.toLowerCase();
+ switch (textAlign) {
+ case 'left':
+ case 'center':
+ case 'right':
+ break;
+ case 'end':
+ textAlign = elementStyle.direction == 'ltr' ? 'right' : 'left';
+ break;
+ case 'start':
+ textAlign = elementStyle.direction == 'rtl' ? 'right' : 'left';
+ break;
+ default:
+ textAlign = 'left';
+ }
+
+ // 1.75 is an arbitrary number, as there is no info about the text baseline
+ switch (this.textBaseline) {
+ case 'hanging':
+ case 'top':
+ offset.y = fontStyle.size / 1.75;
+ break;
+ case 'middle':
+ break;
+ default:
+ case null:
+ case 'alphabetic':
+ case 'ideographic':
+ case 'bottom':
+ offset.y = -fontStyle.size / 2.25;
+ break;
+ }
+
+ switch(textAlign) {
+ case 'right':
+ left = delta;
+ right = 0.05;
+ break;
+ case 'center':
+ left = right = delta / 2;
+ break;
+ }
+
+ var d = this.getCoords_(x + offset.x, y + offset.y);
+
+ lineStr.push('<g_vml_:line from="', -left ,' 0" to="', right ,' 0.05" ',
+ ' coordsize="100 100" coordorigin="0 0"',
+ ' filled="', !stroke, '" stroked="', !!stroke,
+ '" style="position:absolute;width:1px;height:1px;">');
+
+ if (stroke) {
+ appendStroke(this, lineStr);
+ } else {
+ // TODO: Fix the min and max params.
+ appendFill(this, lineStr, {x: -left, y: 0},
+ {x: right, y: fontStyle.size});
+ }
+
+ var skewM = m[0][0].toFixed(3) + ',' + m[1][0].toFixed(3) + ',' +
+ m[0][1].toFixed(3) + ',' + m[1][1].toFixed(3) + ',0,0';
+
+ var skewOffset = mr(d.x / Z) + ',' + mr(d.y / Z);
+
+ lineStr.push('<g_vml_:skew on="t" matrix="', skewM ,'" ',
+ ' offset="', skewOffset, '" origin="', left ,' 0" />',
+ '<g_vml_:path textpathok="true" />',
+ '<g_vml_:textpath on="true" string="',
+ encodeHtmlAttribute(text),
+ '" style="v-text-align:', textAlign,
+ ';font:', encodeHtmlAttribute(fontStyleString),
+ '" /></g_vml_:line>');
+
+ this.element_.insertAdjacentHTML('beforeEnd', lineStr.join(''));
+ };
+
+ contextPrototype.fillText = function(text, x, y, maxWidth) {
+ this.drawText_(text, x, y, maxWidth, false);
+ };
+
+ contextPrototype.strokeText = function(text, x, y, maxWidth) {
+ this.drawText_(text, x, y, maxWidth, true);
+ };
+
+ contextPrototype.measureText = function(text) {
+ if (!this.textMeasureEl_) {
+ var s = '<span style="position:absolute;' +
+ 'top:-20000px;left:0;padding:0;margin:0;border:none;' +
+ 'white-space:pre;"></span>';
+ this.element_.insertAdjacentHTML('beforeEnd', s);
+ this.textMeasureEl_ = this.element_.lastChild;
+ }
+ var doc = this.element_.ownerDocument;
+ this.textMeasureEl_.innerHTML = '';
+ this.textMeasureEl_.style.font = this.font;
+ // Don't use innerHTML or innerText because they allow markup/whitespace.
+ this.textMeasureEl_.appendChild(doc.createTextNode(text));
+ return {width: this.textMeasureEl_.offsetWidth};
+ };
+
+ /******** STUBS ********/
+ contextPrototype.clip = function() {
+ // TODO: Implement
+ };
+
+ contextPrototype.arcTo = function() {
+ // TODO: Implement
+ };
+
+ contextPrototype.createPattern = function(image, repetition) {
+ return new CanvasPattern_(image, repetition);
+ };
+
+ // Gradient / Pattern Stubs
+ function CanvasGradient_(aType) {
+ this.type_ = aType;
+ this.x0_ = 0;
+ this.y0_ = 0;
+ this.r0_ = 0;
+ this.x1_ = 0;
+ this.y1_ = 0;
+ this.r1_ = 0;
+ this.colors_ = [];
+ }
+
+ CanvasGradient_.prototype.addColorStop = function(aOffset, aColor) {
+ aColor = processStyle(aColor);
+ this.colors_.push({offset: aOffset,
+ color: aColor.color,
+ alpha: aColor.alpha});
+ };
+
+ function CanvasPattern_(image, repetition) {
+ assertImageIsValid(image);
+ switch (repetition) {
+ case 'repeat':
+ case null:
+ case '':
+ this.repetition_ = 'repeat';
+ break
+ case 'repeat-x':
+ case 'repeat-y':
+ case 'no-repeat':
+ this.repetition_ = repetition;
+ break;
+ default:
+ throwException('SYNTAX_ERR');
+ }
+
+ this.src_ = image.src;
+ this.width_ = image.width;
+ this.height_ = image.height;
+ }
+
+ function throwException(s) {
+ throw new DOMException_(s);
+ }
+
+ function assertImageIsValid(img) {
+ if (!img || img.nodeType != 1 || img.tagName != 'IMG') {
+ throwException('TYPE_MISMATCH_ERR');
+ }
+ if (img.readyState != 'complete') {
+ throwException('INVALID_STATE_ERR');
+ }
+ }
+
+ function DOMException_(s) {
+ this.code = this[s];
+ this.message = s +': DOM Exception ' + this.code;
+ }
+ var p = DOMException_.prototype = new Error;
+ p.INDEX_SIZE_ERR = 1;
+ p.DOMSTRING_SIZE_ERR = 2;
+ p.HIERARCHY_REQUEST_ERR = 3;
+ p.WRONG_DOCUMENT_ERR = 4;
+ p.INVALID_CHARACTER_ERR = 5;
+ p.NO_DATA_ALLOWED_ERR = 6;
+ p.NO_MODIFICATION_ALLOWED_ERR = 7;
+ p.NOT_FOUND_ERR = 8;
+ p.NOT_SUPPORTED_ERR = 9;
+ p.INUSE_ATTRIBUTE_ERR = 10;
+ p.INVALID_STATE_ERR = 11;
+ p.SYNTAX_ERR = 12;
+ p.INVALID_MODIFICATION_ERR = 13;
+ p.NAMESPACE_ERR = 14;
+ p.INVALID_ACCESS_ERR = 15;
+ p.VALIDATION_ERR = 16;
+ p.TYPE_MISMATCH_ERR = 17;
+
+ // set up externs
+ G_vmlCanvasManager = G_vmlCanvasManager_;
+ CanvasRenderingContext2D = CanvasRenderingContext2D_;
+ CanvasGradient = CanvasGradient_;
+ CanvasPattern = CanvasPattern_;
+ DOMException = DOMException_;
+})();
+
+} // if
+
--- /dev/null
+++ b/js/flot/excanvas.min.js
@@ -1,1 +1,1 @@
-
+if(!document.createElement("canvas").getContext){(function(){var z=Math;var K=z.round;var J=z.sin;var U=z.cos;var b=z.abs;var k=z.sqrt;var D=10;var F=D/2;function T(){return this.context_||(this.context_=new W(this))}var O=Array.prototype.slice;function G(i,j,m){var Z=O.call(arguments,2);return function(){return i.apply(j,Z.concat(O.call(arguments)))}}function AD(Z){return String(Z).replace(/&/g,"&").replace(/"/g,""")}function r(i){if(!i.namespaces.g_vml_){i.namespaces.add("g_vml_","urn:schemas-microsoft-com:vml","#default#VML")}if(!i.namespaces.g_o_){i.namespaces.add("g_o_","urn:schemas-microsoft-com:office:office","#default#VML")}if(!i.styleSheets.ex_canvas_){var Z=i.createStyleSheet();Z.owningElement.id="ex_canvas_";Z.cssText="canvas{display:inline-block;overflow:hidden;text-align:left;width:300px;height:150px}"}}r(document);var E={init:function(Z){if(/MSIE/.test(navigator.userAgent)&&!window.opera){var i=Z||document;i.createElement("canvas");i.attachEvent("onreadystatechange",G(this.init_,this,i))}},init_:function(m){var j=m.getElementsByTagName("canvas");for(var Z=0;Z<j.length;Z++){this.initElement(j[Z])}},initElement:function(i){if(!i.getContext){i.getContext=T;r(i.ownerDocument);i.innerHTML="";i.attachEvent("onpropertychange",S);i.attachEvent("onresize",w);var Z=i.attributes;if(Z.width&&Z.width.specified){i.style.width=Z.width.nodeValue+"px"}else{i.width=i.clientWidth}if(Z.height&&Z.height.specified){i.style.height=Z.height.nodeValue+"px"}else{i.height=i.clientHeight}}return i}};function S(i){var Z=i.srcElement;switch(i.propertyName){case"width":Z.getContext().clearRect();Z.style.width=Z.attributes.width.nodeValue+"px";Z.firstChild.style.width=Z.clientWidth+"px";break;case"height":Z.getContext().clearRect();Z.style.height=Z.attributes.height.nodeValue+"px";Z.firstChild.style.height=Z.clientHeight+"px";break}}function w(i){var Z=i.srcElement;if(Z.firstChild){Z.firstChild.style.width=Z.clientWidth+"px";Z.firstChild.style.height=Z.clientHeight+"px"}}E.init();var I=[];for(var AC=0;AC<16;AC++){for(var AB=0;AB<16;AB++){I[AC*16+AB]=AC.toString(16)+AB.toString(16)}}function V(){return[[1,0,0],[0,1,0],[0,0,1]]}function d(m,j){var i=V();for(var Z=0;Z<3;Z++){for(var AF=0;AF<3;AF++){var p=0;for(var AE=0;AE<3;AE++){p+=m[Z][AE]*j[AE][AF]}i[Z][AF]=p}}return i}function Q(i,Z){Z.fillStyle=i.fillStyle;Z.lineCap=i.lineCap;Z.lineJoin=i.lineJoin;Z.lineWidth=i.lineWidth;Z.miterLimit=i.miterLimit;Z.shadowBlur=i.shadowBlur;Z.shadowColor=i.shadowColor;Z.shadowOffsetX=i.shadowOffsetX;Z.shadowOffsetY=i.shadowOffsetY;Z.strokeStyle=i.strokeStyle;Z.globalAlpha=i.globalAlpha;Z.font=i.font;Z.textAlign=i.textAlign;Z.textBaseline=i.textBaseline;Z.arcScaleX_=i.arcScaleX_;Z.arcScaleY_=i.arcScaleY_;Z.lineScale_=i.lineScale_}var B={aliceblue:"#F0F8FF",antiquewhite:"#FAEBD7",aquamarine:"#7FFFD4",azure:"#F0FFFF",beige:"#F5F5DC",bisque:"#FFE4C4",black:"#000000",blanchedalmond:"#FFEBCD",blueviolet:"#8A2BE2",brown:"#A52A2A",burlywood:"#DEB887",cadetblue:"#5F9EA0",chartreuse:"#7FFF00",chocolate:"#D2691E",coral:"#FF7F50",cornflowerblue:"#6495ED",cornsilk:"#FFF8DC",crimson:"#DC143C",cyan:"#00FFFF",darkblue:"#00008B",darkcyan:"#008B8B",darkgoldenrod:"#B8860B",darkgray:"#A9A9A9",darkgreen:"#006400",darkgrey:"#A9A9A9",darkkhaki:"#BDB76B",darkmagenta:"#8B008B",darkolivegreen:"#556B2F",darkorange:"#FF8C00",darkorchid:"#9932CC",darkred:"#8B0000",darksalmon:"#E9967A",darkseagreen:"#8FBC8F",darkslateblue:"#483D8B",darkslategray:"#2F4F4F",darkslategrey:"#2F4F4F",darkturquoise:"#00CED1",darkviolet:"#9400D3",deeppink:"#FF1493",deepskyblue:"#00BFFF",dimgray:"#696969",dimgrey:"#696969",dodgerblue:"#1E90FF",firebrick:"#B22222",floralwhite:"#FFFAF0",forestgreen:"#228B22",gainsboro:"#DCDCDC",ghostwhite:"#F8F8FF",gold:"#FFD700",goldenrod:"#DAA520",grey:"#808080",greenyellow:"#ADFF2F",honeydew:"#F0FFF0",hotpink:"#FF69B4",indianred:"#CD5C5C",indigo:"#4B0082",ivory:"#FFFFF0",khaki:"#F0E68C",lavender:"#E6E6FA",lavenderblush:"#FFF0F5",lawngreen:"#7CFC00",lemonchiffon:"#FFFACD",lightblue:"#ADD8E6",lightcoral:"#F08080",lightcyan:"#E0FFFF",lightgoldenrodyellow:"#FAFAD2",lightgreen:"#90EE90",lightgrey:"#D3D3D3",lightpink:"#FFB6C1",lightsalmon:"#FFA07A",lightseagreen:"#20B2AA",lightskyblue:"#87CEFA",lightslategray:"#778899",lightslategrey:"#778899",lightsteelblue:"#B0C4DE",lightyellow:"#FFFFE0",limegreen:"#32CD32",linen:"#FAF0E6",magenta:"#FF00FF",mediumaquamarine:"#66CDAA",mediumblue:"#0000CD",mediumorchid:"#BA55D3",mediumpurple:"#9370DB",mediumseagreen:"#3CB371",mediumslateblue:"#7B68EE",mediumspringgreen:"#00FA9A",mediumturquoise:"#48D1CC",mediumvioletred:"#C71585",midnightblue:"#191970",mintcream:"#F5FFFA",mistyrose:"#FFE4E1",moccasin:"#FFE4B5",navajowhite:"#FFDEAD",oldlace:"#FDF5E6",olivedrab:"#6B8E23",orange:"#FFA500",orangered:"#FF4500",orchid:"#DA70D6",palegoldenrod:"#EEE8AA",palegreen:"#98FB98",paleturquoise:"#AFEEEE",palevioletred:"#DB7093",papayawhip:"#FFEFD5",peachpuff:"#FFDAB9",peru:"#CD853F",pink:"#FFC0CB",plum:"#DDA0DD",powderblue:"#B0E0E6",rosybrown:"#BC8F8F",royalblue:"#4169E1",saddlebrown:"#8B4513",salmon:"#FA8072",sandybrown:"#F4A460",seagreen:"#2E8B57",seashell:"#FFF5EE",sienna:"#A0522D",skyblue:"#87CEEB",slateblue:"#6A5ACD",slategray:"#708090",slategrey:"#708090",snow:"#FFFAFA",springgreen:"#00FF7F",steelblue:"#4682B4",tan:"#D2B48C",thistle:"#D8BFD8",tomato:"#FF6347",turquoise:"#40E0D0",violet:"#EE82EE",wheat:"#F5DEB3",whitesmoke:"#F5F5F5",yellowgreen:"#9ACD32"};function g(i){var m=i.indexOf("(",3);var Z=i.indexOf(")",m+1);var j=i.substring(m+1,Z).split(",");if(j.length==4&&i.substr(3,1)=="a"){alpha=Number(j[3])}else{j[3]=1}return j}function C(Z){return parseFloat(Z)/100}function N(i,j,Z){return Math.min(Z,Math.max(j,i))}function c(AF){var j,i,Z;h=parseFloat(AF[0])/360%360;if(h<0){h++}s=N(C(AF[1]),0,1);l=N(C(AF[2]),0,1);if(s==0){j=i=Z=l}else{var m=l<0.5?l*(1+s):l+s-l*s;var AE=2*l-m;j=A(AE,m,h+1/3);i=A(AE,m,h);Z=A(AE,m,h-1/3)}return"#"+I[Math.floor(j*255)]+I[Math.floor(i*255)]+I[Math.floor(Z*255)]}function A(i,Z,j){if(j<0){j++}if(j>1){j--}if(6*j<1){return i+(Z-i)*6*j}else{if(2*j<1){return Z}else{if(3*j<2){return i+(Z-i)*(2/3-j)*6}else{return i}}}}function Y(Z){var AE,p=1;Z=String(Z);if(Z.charAt(0)=="#"){AE=Z}else{if(/^rgb/.test(Z)){var m=g(Z);var AE="#",AF;for(var j=0;j<3;j++){if(m[j].indexOf("%")!=-1){AF=Math.floor(C(m[j])*255)}else{AF=Number(m[j])}AE+=I[N(AF,0,255)]}p=m[3]}else{if(/^hsl/.test(Z)){var m=g(Z);AE=c(m);p=m[3]}else{AE=B[Z]||Z}}}return{color:AE,alpha:p}}var L={style:"normal",variant:"normal",weight:"normal",size:10,family:"sans-serif"};var f={};function X(Z){if(f[Z]){return f[Z]}var m=document.createElement("div");var j=m.style;try{j.font=Z}catch(i){}return f[Z]={style:j.fontStyle||L.style,variant:j.fontVariant||L.variant,weight:j.fontWeight||L.weight,size:j.fontSize||L.size,family:j.fontFamily||L.family}}function P(j,i){var Z={};for(var AF in j){Z[AF]=j[AF]}var AE=parseFloat(i.currentStyle.fontSize),m=parseFloat(j.size);if(typeof j.size=="number"){Z.size=j.size}else{if(j.size.indexOf("px")!=-1){Z.size=m}else{if(j.size.indexOf("em")!=-1){Z.size=AE*m}else{if(j.size.indexOf("%")!=-1){Z.size=(AE/100)*m}else{if(j.size.indexOf("pt")!=-1){Z.size=m/0.75}else{Z.size=AE}}}}}Z.size*=0.981;return Z}function AA(Z){return Z.style+" "+Z.variant+" "+Z.weight+" "+Z.size+"px "+Z.family}function t(Z){switch(Z){case"butt":return"flat";case"round":return"round";case"square":default:return"square"}}function W(i){this.m_=V();this.mStack_=[];this.aStack_=[];this.currentPath_=[];this.strokeStyle="#000";this.fillStyle="#000";this.lineWidth=1;this.lineJoin="miter";this.lineCap="butt";this.miterLimit=D*1;this.globalAlpha=1;this.font="10px sans-serif";this.textAlign="left";this.textBaseline="alphabetic";this.canvas=i;var Z=i.ownerDocument.createElement("div");Z.style.width=i.clientWidth+"px";Z.style.height=i.clientHeight+"px";Z.style.overflow="hidden";Z.style.position="absolute";i.appendChild(Z);this.element_=Z;this.arcScaleX_=1;this.arcScaleY_=1;this.lineScale_=1}var M=W.prototype;M.clearRect=function(){if(this.textMeasureEl_){this.textMeasureEl_.removeNode(true);this.textMeasureEl_=null}this.element_.innerHTML=""};M.beginPath=function(){this.currentPath_=[]};M.moveTo=function(i,Z){var j=this.getCoords_(i,Z);this.currentPath_.push({type:"moveTo",x:j.x,y:j.y});this.currentX_=j.x;this.currentY_=j.y};M.lineTo=function(i,Z){var j=this.getCoords_(i,Z);this.currentPath_.push({type:"lineTo",x:j.x,y:j.y});this.currentX_=j.x;this.currentY_=j.y};M.bezierCurveTo=function(j,i,AI,AH,AG,AE){var Z=this.getCoords_(AG,AE);var AF=this.getCoords_(j,i);var m=this.getCoords_(AI,AH);e(this,AF,m,Z)};function e(Z,m,j,i){Z.currentPath_.push({type:"bezierCurveTo",cp1x:m.x,cp1y:m.y,cp2x:j.x,cp2y:j.y,x:i.x,y:i.y});Z.currentX_=i.x;Z.currentY_=i.y}M.quadraticCurveTo=function(AG,j,i,Z){var AF=this.getCoords_(AG,j);var AE=this.getCoords_(i,Z);var AH={x:this.currentX_+2/3*(AF.x-this.currentX_),y:this.currentY_+2/3*(AF.y-this.currentY_)};var m={x:AH.x+(AE.x-this.currentX_)/3,y:AH.y+(AE.y-this.currentY_)/3};e(this,AH,m,AE)};M.arc=function(AJ,AH,AI,AE,i,j){AI*=D;var AN=j?"at":"wa";var AK=AJ+U(AE)*AI-F;var AM=AH+J(AE)*AI-F;var Z=AJ+U(i)*AI-F;var AL=AH+J(i)*AI-F;if(AK==Z&&!j){AK+=0.125}var m=this.getCoords_(AJ,AH);var AG=this.getCoords_(AK,AM);var AF=this.getCoords_(Z,AL);this.currentPath_.push({type:AN,x:m.x,y:m.y,radius:AI,xStart:AG.x,yStart:AG.y,xEnd:AF.x,yEnd:AF.y})};M.rect=function(j,i,Z,m){this.moveTo(j,i);this.lineTo(j+Z,i);this.lineTo(j+Z,i+m);this.lineTo(j,i+m);this.closePath()};M.strokeRect=function(j,i,Z,m){var p=this.currentPath_;this.beginPath();this.moveTo(j,i);this.lineTo(j+Z,i);this.lineTo(j+Z,i+m);this.lineTo(j,i+m);this.closePath();this.stroke();this.currentPath_=p};M.fillRect=function(j,i,Z,m){var p=this.currentPath_;this.beginPath();this.moveTo(j,i);this.lineTo(j+Z,i);this.lineTo(j+Z,i+m);this.lineTo(j,i+m);this.closePath();this.fill();this.currentPath_=p};M.createLinearGradient=function(i,m,Z,j){var p=new v("gradient");p.x0_=i;p.y0_=m;p.x1_=Z;p.y1_=j;return p};M.createRadialGradient=function(m,AE,j,i,p,Z){var AF=new v("gradientradial");AF.x0_=m;AF.y0_=AE;AF.r0_=j;AF.x1_=i;AF.y1_=p;AF.r1_=Z;return AF};M.drawImage=function(AO,j){var AH,AF,AJ,AV,AM,AK,AQ,AX;var AI=AO.runtimeStyle.width;var AN=AO.runtimeStyle.height;AO.runtimeStyle.width="auto";AO.runtimeStyle.height="auto";var AG=AO.width;var AT=AO.height;AO.runtimeStyle.width=AI;AO.runtimeStyle.height=AN;if(arguments.length==3){AH=arguments[1];AF=arguments[2];AM=AK=0;AQ=AJ=AG;AX=AV=AT}else{if(arguments.length==5){AH=arguments[1];AF=arguments[2];AJ=arguments[3];AV=arguments[4];AM=AK=0;AQ=AG;AX=AT}else{if(arguments.length==9){AM=arguments[1];AK=arguments[2];AQ=arguments[3];AX=arguments[4];AH=arguments[5];AF=arguments[6];AJ=arguments[7];AV=arguments[8]}else{throw Error("Invalid number of arguments")}}}var AW=this.getCoords_(AH,AF);var m=AQ/2;var i=AX/2;var AU=[];var Z=10;var AE=10;AU.push(" <g_vml_:group",' coordsize="',D*Z,",",D*AE,'"',' coordorigin="0,0"',' style="width:',Z,"px;height:",AE,"px;position:absolute;");if(this.m_[0][0]!=1||this.m_[0][1]||this.m_[1][1]!=1||this.m_[1][0]){var p=[];p.push("M11=",this.m_[0][0],",","M12=",this.m_[1][0],",","M21=",this.m_[0][1],",","M22=",this.m_[1][1],",","Dx=",K(AW.x/D),",","Dy=",K(AW.y/D),"");var AS=AW;var AR=this.getCoords_(AH+AJ,AF);var AP=this.getCoords_(AH,AF+AV);var AL=this.getCoords_(AH+AJ,AF+AV);AS.x=z.max(AS.x,AR.x,AP.x,AL.x);AS.y=z.max(AS.y,AR.y,AP.y,AL.y);AU.push("padding:0 ",K(AS.x/D),"px ",K(AS.y/D),"px 0;filter:progid:DXImageTransform.Microsoft.Matrix(",p.join(""),", sizingmethod='clip');")}else{AU.push("top:",K(AW.y/D),"px;left:",K(AW.x/D),"px;")}AU.push(' ">','<g_vml_:image src="',AO.src,'"',' style="width:',D*AJ,"px;"," height:",D*AV,'px"',' cropleft="',AM/AG,'"',' croptop="',AK/AT,'"',' cropright="',(AG-AM-AQ)/AG,'"',' cropbottom="',(AT-AK-AX)/AT,'"'," />","</g_vml_:group>");this.element_.insertAdjacentHTML("BeforeEnd",AU.join(""))};M.stroke=function(AM){var m=10;var AN=10;var AE=5000;var AG={x:null,y:null};var AL={x:null,y:null};for(var AH=0;AH<this.currentPath_.length;AH+=AE){var AK=[];var AF=false;AK.push("<g_vml_:shape",' filled="',!!AM,'"',' style="position:absolute;width:',m,"px;height:",AN,'px;"',' coordorigin="0,0"',' coordsize="',D*m,",",D*AN,'"',' stroked="',!AM,'"',' path="');var AO=false;for(var AI=AH;AI<Math.min(AH+AE,this.currentPath_.length);AI++){if(AI%AE==0&&AI>0){AK.push(" m ",K(this.currentPath_[AI-1].x),",",K(this.currentPath_[AI-1].y))}var Z=this.currentPath_[AI];var AJ;switch(Z.type){case"moveTo":AJ=Z;AK.push(" m ",K(Z.x),",",K(Z.y));break;case"lineTo":AK.push(" l ",K(Z.x),",",K(Z.y));break;case"close":AK.push(" x ");Z=null;break;case"bezierCurveTo":AK.push(" c ",K(Z.cp1x),",",K(Z.cp1y),",",K(Z.cp2x),",",K(Z.cp2y),",",K(Z.x),",",K(Z.y));break;case"at":case"wa":AK.push(" ",Z.type," ",K(Z.x-this.arcScaleX_*Z.radius),",",K(Z.y-this.arcScaleY_*Z.radius)," ",K(Z.x+this.arcScaleX_*Z.radius),",",K(Z.y+this.arcScaleY_*Z.radius)," ",K(Z.xStart),",",K(Z.yStart)," ",K(Z.xEnd),",",K(Z.yEnd));break}if(Z){if(AG.x==null||Z.x<AG.x){AG.x=Z.x}if(AL.x==null||Z.x>AL.x){AL.x=Z.x}if(AG.y==null||Z.y<AG.y){AG.y=Z.y}if(AL.y==null||Z.y>AL.y){AL.y=Z.y}}}AK.push(' ">');if(!AM){R(this,AK)}else{a(this,AK,AG,AL)}AK.push("</g_vml_:shape>");this.element_.insertAdjacentHTML("beforeEnd",AK.join(""))}};function R(j,AE){var i=Y(j.strokeStyle);var m=i.color;var p=i.alpha*j.globalAlpha;var Z=j.lineScale_*j.lineWidth;if(Z<1){p*=Z}AE.push("<g_vml_:stroke",' opacity="',p,'"',' joinstyle="',j.lineJoin,'"',' miterlimit="',j.miterLimit,'"',' endcap="',t(j.lineCap),'"',' weight="',Z,'px"',' color="',m,'" />')}function a(AO,AG,Ah,AP){var AH=AO.fillStyle;var AY=AO.arcScaleX_;var AX=AO.arcScaleY_;var Z=AP.x-Ah.x;var m=AP.y-Ah.y;if(AH instanceof v){var AL=0;var Ac={x:0,y:0};var AU=0;var AK=1;if(AH.type_=="gradient"){var AJ=AH.x0_/AY;var j=AH.y0_/AX;var AI=AH.x1_/AY;var Aj=AH.y1_/AX;var Ag=AO.getCoords_(AJ,j);var Af=AO.getCoords_(AI,Aj);var AE=Af.x-Ag.x;var p=Af.y-Ag.y;AL=Math.atan2(AE,p)*180/Math.PI;if(AL<0){AL+=360}if(AL<0.000001){AL=0}}else{var Ag=AO.getCoords_(AH.x0_,AH.y0_);Ac={x:(Ag.x-Ah.x)/Z,y:(Ag.y-Ah.y)/m};Z/=AY*D;m/=AX*D;var Aa=z.max(Z,m);AU=2*AH.r0_/Aa;AK=2*AH.r1_/Aa-AU}var AS=AH.colors_;AS.sort(function(Ak,i){return Ak.offset-i.offset});var AN=AS.length;var AR=AS[0].color;var AQ=AS[AN-1].color;var AW=AS[0].alpha*AO.globalAlpha;var AV=AS[AN-1].alpha*AO.globalAlpha;var Ab=[];for(var Ae=0;Ae<AN;Ae++){var AM=AS[Ae];Ab.push(AM.offset*AK+AU+" "+AM.color)}AG.push('<g_vml_:fill type="',AH.type_,'"',' method="none" focus="100%"',' color="',AR,'"',' color2="',AQ,'"',' colors="',Ab.join(","),'"',' opacity="',AV,'"',' g_o_:opacity2="',AW,'"',' angle="',AL,'"',' focusposition="',Ac.x,",",Ac.y,'" />')}else{if(AH instanceof u){if(Z&&m){var AF=-Ah.x;var AZ=-Ah.y;AG.push("<g_vml_:fill",' position="',AF/Z*AY*AY,",",AZ/m*AX*AX,'"',' type="tile"',' src="',AH.src_,'" />')}}else{var Ai=Y(AO.fillStyle);var AT=Ai.color;var Ad=Ai.alpha*AO.globalAlpha;AG.push('<g_vml_:fill color="',AT,'" opacity="',Ad,'" />')}}}M.fill=function(){this.stroke(true)};M.closePath=function(){this.currentPath_.push({type:"close"})};M.getCoords_=function(j,i){var Z=this.m_;return{x:D*(j*Z[0][0]+i*Z[1][0]+Z[2][0])-F,y:D*(j*Z[0][1]+i*Z[1][1]+Z[2][1])-F}};M.save=function(){var Z={};Q(this,Z);this.aStack_.push(Z);this.mStack_.push(this.m_);this.m_=d(V(),this.m_)};M.restore=function(){if(this.aStack_.length){Q(this.aStack_.pop(),this);this.m_=this.mStack_.pop()}};function H(Z){return isFinite(Z[0][0])&&isFinite(Z[0][1])&&isFinite(Z[1][0])&&isFinite(Z[1][1])&&isFinite(Z[2][0])&&isFinite(Z[2][1])}function y(i,Z,j){if(!H(Z)){return }i.m_=Z;if(j){var p=Z[0][0]*Z[1][1]-Z[0][1]*Z[1][0];i.lineScale_=k(b(p))}}M.translate=function(j,i){var Z=[[1,0,0],[0,1,0],[j,i,1]];y(this,d(Z,this.m_),false)};M.rotate=function(i){var m=U(i);var j=J(i);var Z=[[m,j,0],[-j,m,0],[0,0,1]];y(this,d(Z,this.m_),false)};M.scale=function(j,i){this.arcScaleX_*=j;this.arcScaleY_*=i;var Z=[[j,0,0],[0,i,0],[0,0,1]];y(this,d(Z,this.m_),true)};M.transform=function(p,m,AF,AE,i,Z){var j=[[p,m,0],[AF,AE,0],[i,Z,1]];y(this,d(j,this.m_),true)};M.setTransform=function(AE,p,AG,AF,j,i){var Z=[[AE,p,0],[AG,AF,0],[j,i,1]];y(this,Z,true)};M.drawText_=function(AK,AI,AH,AN,AG){var AM=this.m_,AQ=1000,i=0,AP=AQ,AF={x:0,y:0},AE=[];var Z=P(X(this.font),this.element_);var j=AA(Z);var AR=this.element_.currentStyle;var p=this.textAlign.toLowerCase();switch(p){case"left":case"center":case"right":break;case"end":p=AR.direction=="ltr"?"right":"left";break;case"start":p=AR.direction=="rtl"?"right":"left";break;default:p="left"}switch(this.textBaseline){case"hanging":case"top":AF.y=Z.size/1.75;break;case"middle":break;default:case null:case"alphabetic":case"ideographic":case"bottom":AF.y=-Z.size/2.25;break}switch(p){case"right":i=AQ;AP=0.05;break;case"center":i=AP=AQ/2;break}var AO=this.getCoords_(AI+AF.x,AH+AF.y);AE.push('<g_vml_:line from="',-i,' 0" to="',AP,' 0.05" ',' coordsize="100 100" coordorigin="0 0"',' filled="',!AG,'" stroked="',!!AG,'" style="position:absolute;width:1px;height:1px;">');if(AG){R(this,AE)}else{a(this,AE,{x:-i,y:0},{x:AP,y:Z.size})}var AL=AM[0][0].toFixed(3)+","+AM[1][0].toFixed(3)+","+AM[0][1].toFixed(3)+","+AM[1][1].toFixed(3)+",0,0";var AJ=K(AO.x/D)+","+K(AO.y/D);AE.push('<g_vml_:skew on="t" matrix="',AL,'" ',' offset="',AJ,'" origin="',i,' 0" />','<g_vml_:path textpathok="true" />','<g_vml_:textpath on="true" string="',AD(AK),'" style="v-text-align:',p,";font:",AD(j),'" /></g_vml_:line>');this.element_.insertAdjacentHTML("beforeEnd",AE.join(""))};M.fillText=function(j,Z,m,i){this.drawText_(j,Z,m,i,false)};M.strokeText=function(j,Z,m,i){this.drawText_(j,Z,m,i,true)};M.measureText=function(j){if(!this.textMeasureEl_){var Z='<span style="position:absolute;top:-20000px;left:0;padding:0;margin:0;border:none;white-space:pre;"></span>';this.element_.insertAdjacentHTML("beforeEnd",Z);this.textMeasureEl_=this.element_.lastChild}var i=this.element_.ownerDocument;this.textMeasureEl_.innerHTML="";this.textMeasureEl_.style.font=this.font;this.textMeasureEl_.appendChild(i.createTextNode(j));return{width:this.textMeasureEl_.offsetWidth}};M.clip=function(){};M.arcTo=function(){};M.createPattern=function(i,Z){return new u(i,Z)};function v(Z){this.type_=Z;this.x0_=0;this.y0_=0;this.r0_=0;this.x1_=0;this.y1_=0;this.r1_=0;this.colors_=[]}v.prototype.addColorStop=function(i,Z){Z=Y(Z);this.colors_.push({offset:i,color:Z.color,alpha:Z.alpha})};function u(i,Z){q(i);switch(Z){case"repeat":case null:case"":this.repetition_="repeat";break;case"repeat-x":case"repeat-y":case"no-repeat":this.repetition_=Z;break;default:n("SYNTAX_ERR")}this.src_=i.src;this.width_=i.width;this.height_=i.height}function n(Z){throw new o(Z)}function q(Z){if(!Z||Z.nodeType!=1||Z.tagName!="IMG"){n("TYPE_MISMATCH_ERR")}if(Z.readyState!="complete"){n("INVALID_STATE_ERR")}}function o(Z){this.code=this[Z];this.message=Z+": DOM Exception "+this.code}var x=o.prototype=new Error;x.INDEX_SIZE_ERR=1;x.DOMSTRING_SIZE_ERR=2;x.HIERARCHY_REQUEST_ERR=3;x.WRONG_DOCUMENT_ERR=4;x.INVALID_CHARACTER_ERR=5;x.NO_DATA_ALLOWED_ERR=6;x.NO_MODIFICATION_ALLOWED_ERR=7;x.NOT_FOUND_ERR=8;x.NOT_SUPPORTED_ERR=9;x.INUSE_ATTRIBUTE_ERR=10;x.INVALID_STATE_ERR=11;x.SYNTAX_ERR=12;x.INVALID_MODIFICATION_ERR=13;x.NAMESPACE_ERR=14;x.INVALID_ACCESS_ERR=15;x.VALIDATION_ERR=16;x.TYPE_MISMATCH_ERR=17;G_vmlCanvasManager=E;CanvasRenderingContext2D=W;CanvasGradient=v;CanvasPattern=u;DOMException=o})()};
--- /dev/null
+++ b/js/flot/jquery.colorhelpers.js
@@ -1,1 +1,180 @@
+/* Plugin for jQuery for working with colors.
+ *
+ * Version 1.1.
+ *
+ * Inspiration from jQuery color animation plugin by John Resig.
+ *
+ * Released under the MIT license by Ole Laursen, October 2009.
+ *
+ * Examples:
+ *
+ * $.color.parse("#fff").scale('rgb', 0.25).add('a', -0.5).toString()
+ * var c = $.color.extract($("#mydiv"), 'background-color');
+ * console.log(c.r, c.g, c.b, c.a);
+ * $.color.make(100, 50, 25, 0.4).toString() // returns "rgba(100,50,25,0.4)"
+ *
+ * Note that .scale() and .add() return the same modified object
+ * instead of making a new one.
+ *
+ * V. 1.1: Fix error handling so e.g. parsing an empty string does
+ * produce a color rather than just crashing.
+ */
+(function($) {
+ $.color = {};
+
+ // construct color object with some convenient chainable helpers
+ $.color.make = function (r, g, b, a) {
+ var o = {};
+ o.r = r || 0;
+ o.g = g || 0;
+ o.b = b || 0;
+ o.a = a != null ? a : 1;
+
+ o.add = function (c, d) {
+ for (var i = 0; i < c.length; ++i)
+ o[c.charAt(i)] += d;
+ return o.normalize();
+ };
+
+ o.scale = function (c, f) {
+ for (var i = 0; i < c.length; ++i)
+ o[c.charAt(i)] *= f;
+ return o.normalize();
+ };
+
+ o.toString = function () {
+ if (o.a >= 1.0) {
+ return "rgb("+[o.r, o.g, o.b].join(",")+")";
+ } else {
+ return "rgba("+[o.r, o.g, o.b, o.a].join(",")+")";
+ }
+ };
+
+ o.normalize = function () {
+ function clamp(min, value, max) {
+ return value < min ? min: (value > max ? max: value);
+ }
+
+ o.r = clamp(0, parseInt(o.r), 255);
+ o.g = clamp(0, parseInt(o.g), 255);
+ o.b = clamp(0, parseInt(o.b), 255);
+ o.a = clamp(0, o.a, 1);
+ return o;
+ };
+
+ o.clone = function () {
+ return $.color.make(o.r, o.b, o.g, o.a);
+ };
+
+ return o.normalize();
+ }
+
+ // extract CSS color property from element, going up in the DOM
+ // if it's "transparent"
+ $.color.extract = function (elem, css) {
+ var c;
+ do {
+ c = elem.css(css).toLowerCase();
+ // keep going until we find an element that has color, or
+ // we hit the body
+ if (c != '' && c != 'transparent')
+ break;
+ elem = elem.parent();
+ } while (!$.nodeName(elem.get(0), "body"));
+
+ // catch Safari's way of signalling transparent
+ if (c == "rgba(0, 0, 0, 0)")
+ c = "transparent";
+
+ return $.color.parse(c);
+ }
+
+ // parse CSS color string (like "rgb(10, 32, 43)" or "#fff"),
+ // returns color object, if parsing failed, you get black (0, 0,
+ // 0) out
+ $.color.parse = function (str) {
+ var res, m = $.color.make;
+
+ // Look for rgb(num,num,num)
+ if (res = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(str))
+ return m(parseInt(res[1], 10), parseInt(res[2], 10), parseInt(res[3], 10));
+
+ // Look for rgba(num,num,num,num)
+ if (res = /rgba\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(str))
+ return m(parseInt(res[1], 10), parseInt(res[2], 10), parseInt(res[3], 10), parseFloat(res[4]));
+
+ // Look for rgb(num%,num%,num%)
+ if (res = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(str))
+ return m(parseFloat(res[1])*2.55, parseFloat(res[2])*2.55, parseFloat(res[3])*2.55);
+
+ // Look for rgba(num%,num%,num%,num)
+ if (res = /rgba\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(str))
+ return m(parseFloat(res[1])*2.55, parseFloat(res[2])*2.55, parseFloat(res[3])*2.55, parseFloat(res[4]));
+
+ // Look for #a0b1c2
+ if (res = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(str))
+ return m(parseInt(res[1], 16), parseInt(res[2], 16), parseInt(res[3], 16));
+
+ // Look for #fff
+ if (res = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(str))
+ return m(parseInt(res[1]+res[1], 16), parseInt(res[2]+res[2], 16), parseInt(res[3]+res[3], 16));
+
+ // Otherwise, we're most likely dealing with a named color
+ var name = $.trim(str).toLowerCase();
+ if (name == "transparent")
+ return m(255, 255, 255, 0);
+ else {
+ // default to black
+ res = lookupColors[name] || [0, 0, 0];
+ return m(res[0], res[1], res[2]);
+ }
+ }
+
+ var lookupColors = {
+ aqua:[0,255,255],
+ azure:[240,255,255],
+ beige:[245,245,220],
+ black:[0,0,0],
+ blue:[0,0,255],
+ brown:[165,42,42],
+ cyan:[0,255,255],
+ darkblue:[0,0,139],
+ darkcyan:[0,139,139],
+ darkgrey:[169,169,169],
+ darkgreen:[0,100,0],
+ darkkhaki:[189,183,107],
+ darkmagenta:[139,0,139],
+ darkolivegreen:[85,107,47],
+ darkorange:[255,140,0],
+ darkorchid:[153,50,204],
+ darkred:[139,0,0],
+ darksalmon:[233,150,122],
+ darkviolet:[148,0,211],
+ fuchsia:[255,0,255],
+ gold:[255,215,0],
+ green:[0,128,0],
+ indigo:[75,0,130],
+ khaki:[240,230,140],
+ lightblue:[173,216,230],
+ lightcyan:[224,255,255],
+ lightgreen:[144,238,144],
+ lightgrey:[211,211,211],
+ lightpink:[255,182,193],
+ lightyellow:[255,255,224],
+ lime:[0,255,0],
+ magenta:[255,0,255],
+ maroon:[128,0,0],
+ navy:[0,0,128],
+ olive:[128,128,0],
+ orange:[255,165,0],
+ pink:[255,192,203],
+ purple:[128,0,128],
+ violet:[128,0,128],
+ red:[255,0,0],
+ silver:[192,192,192],
+ white:[255,255,255],
+ yellow:[255,255,0]
+ };
+})(jQuery);
+
--- /dev/null
+++ b/js/flot/jquery.colorhelpers.min.js
@@ -1,1 +1,1 @@
-
+(function(b){b.color={};b.color.make=function(f,e,c,d){var h={};h.r=f||0;h.g=e||0;h.b=c||0;h.a=d!=null?d:1;h.add=function(k,j){for(var g=0;g<k.length;++g){h[k.charAt(g)]+=j}return h.normalize()};h.scale=function(k,j){for(var g=0;g<k.length;++g){h[k.charAt(g)]*=j}return h.normalize()};h.toString=function(){if(h.a>=1){return"rgb("+[h.r,h.g,h.b].join(",")+")"}else{return"rgba("+[h.r,h.g,h.b,h.a].join(",")+")"}};h.normalize=function(){function g(j,k,i){return k<j?j:(k>i?i:k)}h.r=g(0,parseInt(h.r),255);h.g=g(0,parseInt(h.g),255);h.b=g(0,parseInt(h.b),255);h.a=g(0,h.a,1);return h};h.clone=function(){return b.color.make(h.r,h.b,h.g,h.a)};return h.normalize()};b.color.extract=function(e,d){var f;do{f=e.css(d).toLowerCase();if(f!=""&&f!="transparent"){break}e=e.parent()}while(!b.nodeName(e.get(0),"body"));if(f=="rgba(0, 0, 0, 0)"){f="transparent"}return b.color.parse(f)};b.color.parse=function(f){var e,c=b.color.make;if(e=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(f)){return c(parseInt(e[1],10),parseInt(e[2],10),parseInt(e[3],10))}if(e=/rgba\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(f)){return c(parseInt(e[1],10),parseInt(e[2],10),parseInt(e[3],10),parseFloat(e[4]))}if(e=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(f)){return c(parseFloat(e[1])*2.55,parseFloat(e[2])*2.55,parseFloat(e[3])*2.55)}if(e=/rgba\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(f)){return c(parseFloat(e[1])*2.55,parseFloat(e[2])*2.55,parseFloat(e[3])*2.55,parseFloat(e[4]))}if(e=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(f)){return c(parseInt(e[1],16),parseInt(e[2],16),parseInt(e[3],16))}if(e=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(f)){return c(parseInt(e[1]+e[1],16),parseInt(e[2]+e[2],16),parseInt(e[3]+e[3],16))}var d=b.trim(f).toLowerCase();if(d=="transparent"){return c(255,255,255,0)}else{e=a[d]||[0,0,0];return c(e[0],e[1],e[2])}};var a={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0]}})(jQuery);
--- /dev/null
+++ b/js/flot/jquery.flot.crosshair.js
@@ -1,1 +1,168 @@
+/*
+Flot plugin for showing crosshairs, thin lines, when the mouse hovers
+over the plot.
+ crosshair: {
+ mode: null or "x" or "y" or "xy"
+ color: color
+ lineWidth: number
+ }
+
+Set the mode to one of "x", "y" or "xy". The "x" mode enables a
+vertical crosshair that lets you trace the values on the x axis, "y"
+enables a horizontal crosshair and "xy" enables them both. "color" is
+the color of the crosshair (default is "rgba(170, 0, 0, 0.80)"),
+"lineWidth" is the width of the drawn lines (default is 1).
+
+The plugin also adds four public methods:
+
+ - setCrosshair(pos)
+
+ Set the position of the crosshair. Note that this is cleared if
+ the user moves the mouse. "pos" is in coordinates of the plot and
+ should be on the form { x: xpos, y: ypos } (you can use x2/x3/...
+ if you're using multiple axes), which is coincidentally the same
+ format as what you get from a "plothover" event. If "pos" is null,
+ the crosshair is cleared.
+
+ - clearCrosshair()
+
+ Clear the crosshair.
+
+ - lockCrosshair(pos)
+
+ Cause the crosshair to lock to the current location, no longer
+ updating if the user moves the mouse. Optionally supply a position
+ (passed on to setCrosshair()) to move it to.
+
+ Example usage:
+ var myFlot = $.plot( $("#graph"), ..., { crosshair: { mode: "x" } } };
+ $("#graph").bind("plothover", function (evt, position, item) {
+ if (item) {
+ // Lock the crosshair to the data point being hovered
+ myFlot.lockCrosshair({ x: item.datapoint[0], y: item.datapoint[1] });
+ }
+ else {
+ // Return normal crosshair operation
+ myFlot.unlockCrosshair();
+ }
+ });
+
+ - unlockCrosshair()
+
+ Free the crosshair to move again after locking it.
+*/
+
+(function ($) {
+ var options = {
+ crosshair: {
+ mode: null, // one of null, "x", "y" or "xy",
+ color: "rgba(170, 0, 0, 0.80)",
+ lineWidth: 1
+ }
+ };
+
+ function init(plot) {
+ // position of crosshair in pixels
+ var crosshair = { x: -1, y: -1, locked: false };
+
+ plot.setCrosshair = function setCrosshair(pos) {
+ if (!pos)
+ crosshair.x = -1;
+ else {
+ var o = plot.p2c(pos);
+ crosshair.x = Math.max(0, Math.min(o.left, plot.width()));
+ crosshair.y = Math.max(0, Math.min(o.top, plot.height()));
+ }
+
+ plot.triggerRedrawOverlay();
+ };
+
+ plot.clearCrosshair = plot.setCrosshair; // passes null for pos
+
+ plot.lockCrosshair = function lockCrosshair(pos) {
+ if (pos)
+ plot.setCrosshair(pos);
+ crosshair.locked = true;
+ }
+
+ plot.unlockCrosshair = function unlockCrosshair() {
+ crosshair.locked = false;
+ }
+
+ function onMouseOut(e) {
+ if (crosshair.locked)
+ return;
+
+ if (crosshair.x != -1) {
+ crosshair.x = -1;
+ plot.triggerRedrawOverlay();
+ }
+ }
+
+ function onMouseMove(e) {
+ if (crosshair.locked)
+ return;
+
+ if (plot.getSelection && plot.getSelection()) {
+ crosshair.x = -1; // hide the crosshair while selecting
+ return;
+ }
+
+ var offset = plot.offset();
+ crosshair.x = Math.max(0, Math.min(e.pageX - offset.left, plot.width()));
+ crosshair.y = Math.max(0, Math.min(e.pageY - offset.top, plot.height()));
+ plot.triggerRedrawOverlay();
+ }
+
+ plot.hooks.bindEvents.push(function (plot, eventHolder) {
+ if (!plot.getOptions().crosshair.mode)
+ return;
+
+ eventHolder.mouseout(onMouseOut);
+ eventHolder.mousemove(onMouseMove);
+ });
+
+ plot.hooks.drawOverlay.push(function (plot, ctx) {
+ var c = plot.getOptions().crosshair;
+ if (!c.mode)
+ return;
+
+ var plotOffset = plot.getPlotOffset();
+
+ ctx.save();
+ ctx.translate(plotOffset.left, plotOffset.top);
+
+ if (crosshair.x != -1) {
+ ctx.strokeStyle = c.color;
+ ctx.lineWidth = c.lineWidth;
+ ctx.lineJoin = "round";
+
+ ctx.beginPath();
+ if (c.mode.indexOf("x") != -1) {
+ ctx.moveTo(crosshair.x, 0);
+ ctx.lineTo(crosshair.x, plot.height());
+ }
+ if (c.mode.indexOf("y") != -1) {
+ ctx.moveTo(0, crosshair.y);
+ ctx.lineTo(plot.width(), crosshair.y);
+ }
+ ctx.stroke();
+ }
+ ctx.restore();
+ });
+
+ plot.hooks.shutdown.push(function (plot, eventHolder) {
+ eventHolder.unbind("mouseout", onMouseOut);
+ eventHolder.unbind("mousemove", onMouseMove);
+ });
+ }
+
+ $.plot.plugins.push({
+ init: init,
+ options: options,
+ name: 'crosshair',
+ version: '1.0'
+ });
+})(jQuery);
+
--- /dev/null
+++ b/js/flot/jquery.flot.crosshair.min.js
@@ -1,1 +1,1 @@
-
+(function(b){var a={crosshair:{mode:null,color:"rgba(170, 0, 0, 0.80)",lineWidth:1}};function c(h){var j={x:-1,y:-1,locked:false};h.setCrosshair=function e(l){if(!l){j.x=-1}else{var k=h.p2c(l);j.x=Math.max(0,Math.min(k.left,h.width()));j.y=Math.max(0,Math.min(k.top,h.height()))}h.triggerRedrawOverlay()};h.clearCrosshair=h.setCrosshair;h.lockCrosshair=function f(k){if(k){h.setCrosshair(k)}j.locked=true};h.unlockCrosshair=function g(){j.locked=false};function d(k){if(j.locked){return}if(j.x!=-1){j.x=-1;h.triggerRedrawOverlay()}}function i(k){if(j.locked){return}if(h.getSelection&&h.getSelection()){j.x=-1;return}var l=h.offset();j.x=Math.max(0,Math.min(k.pageX-l.left,h.width()));j.y=Math.max(0,Math.min(k.pageY-l.top,h.height()));h.triggerRedrawOverlay()}h.hooks.bindEvents.push(function(l,k){if(!l.getOptions().crosshair.mode){return}k.mouseout(d);k.mousemove(i)});h.hooks.drawOverlay.push(function(m,k){var n=m.getOptions().crosshair;if(!n.mode){return}var l=m.getPlotOffset();k.save();k.translate(l.left,l.top);if(j.x!=-1){k.strokeStyle=n.color;k.lineWidth=n.lineWidth;k.lineJoin="round";k.beginPath();if(n.mode.indexOf("x")!=-1){k.moveTo(j.x,0);k.lineTo(j.x,m.height())}if(n.mode.indexOf("y")!=-1){k.moveTo(0,j.y);k.lineTo(m.width(),j.y)}k.stroke()}k.restore()});h.hooks.shutdown.push(function(l,k){k.unbind("mouseout",d);k.unbind("mousemove",i)})}b.plot.plugins.push({init:c,options:a,name:"crosshair",version:"1.0"})})(jQuery);
--- /dev/null
+++ b/js/flot/jquery.flot.fillbetween.js
@@ -1,1 +1,184 @@
+/*
+Flot plugin for computing bottoms for filled line and bar charts.
+The case: you've got two series that you want to fill the area
+between. In Flot terms, you need to use one as the fill bottom of the
+other. You can specify the bottom of each data point as the third
+coordinate manually, or you can use this plugin to compute it for you.
+
+In order to name the other series, you need to give it an id, like this
+
+ var dataset = [
+ { data: [ ... ], id: "foo" } , // use default bottom
+ { data: [ ... ], fillBetween: "foo" }, // use first dataset as bottom
+ ];
+
+ $.plot($("#placeholder"), dataset, { line: { show: true, fill: true }});
+
+As a convenience, if the id given is a number that doesn't appear as
+an id in the series, it is interpreted as the index in the array
+instead (so fillBetween: 0 can also mean the first series).
+
+Internally, the plugin modifies the datapoints in each series. For
+line series, extra data points might be inserted through
+interpolation. Note that at points where the bottom line is not
+defined (due to a null point or start/end of line), the current line
+will show a gap too. The algorithm comes from the jquery.flot.stack.js
+plugin, possibly some code could be shared.
+*/
+
+(function ($) {
+ var options = {
+ series: { fillBetween: null } // or number
+ };
+
+ function init(plot) {
+ function findBottomSeries(s, allseries) {
+ var i;
+ for (i = 0; i < allseries.length; ++i) {
+ if (allseries[i].id == s.fillBetween)
+ return allseries[i];
+ }
+
+ if (typeof s.fillBetween == "number") {
+ i = s.fillBetween;
+
+ if (i < 0 || i >= allseries.length)
+ return null;
+
+ return allseries[i];
+ }
+
+ return null;
+ }
+
+ function computeFillBottoms(plot, s, datapoints) {
+ if (s.fillBetween == null)
+ return;
+
+ var other = findBottomSeries(s, plot.getData());
+ if (!other)
+ return;
+
+ var ps = datapoints.pointsize,
+ points = datapoints.points,
+ otherps = other.datapoints.pointsize,
+ otherpoints = other.datapoints.points,
+ newpoints = [],
+ px, py, intery, qx, qy, bottom,
+ withlines = s.lines.show,
+ withbottom = ps > 2 && datapoints.format[2].y,
+ withsteps = withlines && s.lines.steps,
+ fromgap = true,
+ i = 0, j = 0, l;
+
+ while (true) {
+ if (i >= points.length)
+ break;
+
+ l = newpoints.length;
+
+ if (points[i] == null) {
+ // copy gaps
+ for (m = 0; m < ps; ++m)
+ newpoints.push(points[i + m]);
+ i += ps;
+ }
+ else if (j >= otherpoints.length) {
+ // for lines, we can't use the rest of the points
+ if (!withlines) {
+ for (m = 0; m < ps; ++m)
+ newpoints.push(points[i + m]);
+ }
+ i += ps;
+ }
+ else if (otherpoints[j] == null) {
+ // oops, got a gap
+ for (m = 0; m < ps; ++m)
+ newpoints.push(null);
+ fromgap = true;
+ j += otherps;
+ }
+ else {
+ // cases where we actually got two points
+ px = points[i];
+ py = points[i + 1];
+ qx = otherpoints[j];
+ qy = otherpoints[j + 1];
+ bottom = 0;
+
+ if (px == qx) {
+ for (m = 0; m < ps; ++m)
+ newpoints.push(points[i + m]);
+
+ //newpoints[l + 1] += qy;
+ bottom = qy;
+
+ i += ps;
+ j += otherps;
+ }
+ else if (px > qx) {
+ // we got past point below, might need to
+ // insert interpolated extra point
+ if (withlines && i > 0 && points[i - ps] != null) {
+ intery = py + (points[i - ps + 1] - py) * (qx - px) / (points[i - ps] - px);
+ newpoints.push(qx);
+ newpoints.push(intery)
+ for (m = 2; m < ps; ++m)
+ newpoints.push(points[i + m]);
+ bottom = qy;
+ }
+
+ j += otherps;
+ }
+ else { // px < qx
+ if (fromgap && withlines) {
+ // if we come from a gap, we just skip this point
+ i += ps;
+ continue;
+ }
+
+ for (m = 0; m < ps; ++m)
+ newpoints.push(points[i + m]);
+
+ // we might be able to interpolate a point below,
+ // this can give us a better y
+ if (withlines && j > 0 && otherpoints[j - otherps] != null)
+ bottom = qy + (otherpoints[j - otherps + 1] - qy) * (px - qx) / (otherpoints[j - otherps] - qx);
+
+ //newpoints[l + 1] += bottom;
+
+ i += ps;
+ }
+
+ fromgap = false;
+
+ if (l != newpoints.length && withbottom)
+ newpoints[l + 2] = bottom;
+ }
+
+ // maintain the line steps invariant
+ if (withsteps && l != newpoints.length && l > 0
+ && newpoints[l] != null
+ && newpoints[l] != newpoints[l - ps]
+ && newpoints[l + 1] != newpoints[l - ps + 1]) {
+ for (m = 0; m < ps; ++m)
+ newpoints[l + ps + m] = newpoints[l + m];
+ newpoints[l + 1] = newpoints[l - ps + 1];
+ }
+ }
+
+ datapoints.points = newpoints;
+ }
+
+ plot.hooks.processDatapoints.push(computeFillBottoms);
+ }
+
+ $.plot.plugins.push({
+ init: init,
+ options: options,
+ name: 'fillbetween',
+ version: '1.0'
+ });
+})(jQuery);
+
--- /dev/null
+++ b/js/flot/jquery.flot.fillbetween.min.js
@@ -1,1 +1,1 @@
-
+(function(b){var a={series:{fillBetween:null}};function c(f){function d(j,h){var g;for(g=0;g<h.length;++g){if(h[g].id==j.fillBetween){return h[g]}}if(typeof j.fillBetween=="number"){g=j.fillBetween;if(g<0||g>=h.length){return null}return h[g]}return null}function e(B,u,g){if(u.fillBetween==null){return}var p=d(u,B.getData());if(!p){return}var y=g.pointsize,E=g.points,h=p.datapoints.pointsize,x=p.datapoints.points,r=[],w,v,k,G,F,q,t=u.lines.show,o=y>2&&g.format[2].y,n=t&&u.lines.steps,D=true,C=0,A=0,z;while(true){if(C>=E.length){break}z=r.length;if(E[C]==null){for(m=0;m<y;++m){r.push(E[C+m])}C+=y}else{if(A>=x.length){if(!t){for(m=0;m<y;++m){r.push(E[C+m])}}C+=y}else{if(x[A]==null){for(m=0;m<y;++m){r.push(null)}D=true;A+=h}else{w=E[C];v=E[C+1];G=x[A];F=x[A+1];q=0;if(w==G){for(m=0;m<y;++m){r.push(E[C+m])}q=F;C+=y;A+=h}else{if(w>G){if(t&&C>0&&E[C-y]!=null){k=v+(E[C-y+1]-v)*(G-w)/(E[C-y]-w);r.push(G);r.push(k);for(m=2;m<y;++m){r.push(E[C+m])}q=F}A+=h}else{if(D&&t){C+=y;continue}for(m=0;m<y;++m){r.push(E[C+m])}if(t&&A>0&&x[A-h]!=null){q=F+(x[A-h+1]-F)*(w-G)/(x[A-h]-G)}C+=y}}D=false;if(z!=r.length&&o){r[z+2]=q}}}}if(n&&z!=r.length&&z>0&&r[z]!=null&&r[z]!=r[z-y]&&r[z+1]!=r[z-y+1]){for(m=0;m<y;++m){r[z+y+m]=r[z+m]}r[z+1]=r[z-y+1]}}g.points=r}f.hooks.processDatapoints.push(e)}b.plot.plugins.push({init:c,options:a,name:"fillbetween",version:"1.0"})})(jQuery);
--- /dev/null
+++ b/js/flot/jquery.flot.image.js
@@ -1,1 +1,239 @@
-
+/*
+Flot plugin for plotting images, e.g. useful for putting ticks on a
+prerendered complex visualization.
+
+The data syntax is [[image, x1, y1, x2, y2], ...] where (x1, y1) and
+(x2, y2) are where you intend the two opposite corners of the image to
+end up in the plot. Image must be a fully loaded Javascript image (you
+can make one with new Image()). If the image is not complete, it's
+skipped when plotting.
+
+There are two helpers included for retrieving images. The easiest work
+the way that you put in URLs instead of images in the data (like
+["myimage.png", 0, 0, 10, 10]), then call $.plot.image.loadData(data,
+options, callback) where data and options are the same as you pass in
+to $.plot. This loads the images, replaces the URLs in the data with
+the corresponding images and calls "callback" when all images are
+loaded (or failed loading). In the callback, you can then call $.plot
+with the data set. See the included example.
+
+A more low-level helper, $.plot.image.load(urls, callback) is also
+included. Given a list of URLs, it calls callback with an object
+mapping from URL to Image object when all images are loaded or have
+failed loading.
+
+Options for the plugin are
+
+ series: {
+ images: {
+ show: boolean
+ anchor: "corner" or "center"
+ alpha: [0,1]
+ }
+ }
+
+which can be specified for a specific series
+
+ $.plot($("#placeholder"), [{ data: [ ... ], images: { ... } ])
+
+Note that because the data format is different from usual data points,
+you can't use images with anything else in a specific data series.
+
+Setting "anchor" to "center" causes the pixels in the image to be
+anchored at the corner pixel centers inside of at the pixel corners,
+effectively letting half a pixel stick out to each side in the plot.
+
+
+A possible future direction could be support for tiling for large
+images (like Google Maps).
+
+*/
+
+(function ($) {
+ var options = {
+ series: {
+ images: {
+ show: false,
+ alpha: 1,
+ anchor: "corner" // or "center"
+ }
+ }
+ };
+
+ $.plot.image = {};
+
+ $.plot.image.loadDataImages = function (series, options, callback) {
+ var urls = [], points = [];
+
+ var defaultShow = options.series.images.show;
+
+ $.each(series, function (i, s) {
+ if (!(defaultShow || s.images.show))
+ return;
+
+ if (s.data)
+ s = s.data;
+
+ $.each(s, function (i, p) {
+ if (typeof p[0] == "string") {
+ urls.push(p[0]);
+ points.push(p);
+ }
+ });
+ });
+
+ $.plot.image.load(urls, function (loadedImages) {
+ $.each(points, function (i, p) {
+ var url = p[0];
+ if (loadedImages[url])
+ p[0] = loadedImages[url];
+ });
+
+ callback();
+ });
+ }
+
+ $.plot.image.load = function (urls, callback) {
+ var missing = urls.length, loaded = {};
+ if (missing == 0)
+ callback({});
+
+ $.each(urls, function (i, url) {
+ var handler = function () {
+ --missing;
+
+ loaded[url] = this;
+
+ if (missing == 0)
+ callback(loaded);
+ };
+
+ $('<img />').load(handler).error(handler).attr('src', url);
+ });
+ }
+
+ function drawSeries(plot, ctx, series) {
+ var plotOffset = plot.getPlotOffset();
+
+ if (!series.images || !series.images.show)
+ return;
+
+ var points = series.datapoints.points,
+ ps = series.datapoints.pointsize;
+
+ for (var i = 0; i < points.length; i += ps) {
+ var img = points[i],
+ x1 = points[i + 1], y1 = points[i + 2],
+ x2 = points[i + 3], y2 = points[i + 4],
+ xaxis = series.xaxis, yaxis = series.yaxis,
+ tmp;
+
+ // actually we should check img.complete, but it
+ // appears to be a somewhat unreliable indicator in
+ // IE6 (false even after load event)
+ if (!img || img.width <= 0 || img.height <= 0)
+ continue;
+
+ if (x1 > x2) {
+ tmp = x2;
+ x2 = x1;
+ x1 = tmp;
+ }
+ if (y1 > y2) {
+ tmp = y2;
+ y2 = y1;
+ y1 = tmp;
+ }
+
+ // if the anchor is at the center of the pixel, expand the
+ // image by 1/2 pixel in each direction
+ if (series.images.anchor == "center") {
+ tmp = 0.5 * (x2-x1) / (img.width - 1);
+ x1 -= tmp;
+ x2 += tmp;
+ tmp = 0.5 * (y2-y1) / (img.height - 1);
+ y1 -= tmp;
+ y2 += tmp;
+ }
+
+ // clip
+ if (x1 == x2 || y1 == y2 ||
+ x1 >= xaxis.max || x2 <= xaxis.min ||
+ y1 >= yaxis.max || y2 <= yaxis.min)
+ continue;
+
+ var sx1 = 0, sy1 = 0, sx2 = img.width, sy2 = img.height;
+ if (x1 < xaxis.min) {
+ sx1 += (sx2 - sx1) * (xaxis.min - x1) / (x2 - x1);
+ x1 = xaxis.min;
+ }
+
+ if (x2 > xaxis.max) {
+ sx2 += (sx2 - sx1) * (xaxis.max - x2) / (x2 - x1);
+ x2 = xaxis.max;
+ }
+
+ if (y1 < yaxis.min) {
+ sy2 += (sy1 - sy2) * (yaxis.min - y1) / (y2 - y1);
+ y1 = yaxis.min;
+ }
+
+ if (y2 > yaxis.max) {
+ sy1 += (sy1 - sy2) * (yaxis.max - y2) / (y2 - y1);
+ y2 = yaxis.max;
+ }
+
+ x1 = xaxis.p2c(x1);
+ x2 = xaxis.p2c(x2);
+ y1 = yaxis.p2c(y1);
+ y2 = yaxis.p2c(y2);
+
+ // the transformation may have swapped us
+ if (x1 > x2) {
+ tmp = x2;
+ x2 = x1;
+ x1 = tmp;
+ }
+ if (y1 > y2) {
+ tmp = y2;
+ y2 = y1;
+ y1 = tmp;
+ }
+
+ tmp = ctx.globalAlpha;
+ ctx.globalAlpha *= series.images.alpha;
+ ctx.drawImage(img,
+ sx1, sy1, sx2 - sx1, sy2 - sy1,
+ x1 + plotOffset.left, y1 + plotOffset.top,
+ x2 - x1, y2 - y1);
+ ctx.globalAlpha = tmp;
+ }
+ }
+
+ function processRawData(plot, series, data, datapoints) {
+ if (!series.images.show)
+ return;
+
+ // format is Image, x1, y1, x2, y2 (opposite corners)
+ datapoints.format = [
+ { required: true },
+ { x: true, number: true, required: true },
+ { y: true, number: true, required: true },
+ { x: true, number: true, required: true },
+ { y: true, number: true, required: true }
+ ];
+ }
+
+ function init(plot) {
+ plot.hooks.processRawData.push(processRawData);
+ plot.hooks.drawSeries.push(drawSeries);
+ }
+
+ $.plot.plugins.push({
+ init: init,
+ options: options,
+ name: 'image',
+ version: '1.1'
+ });
+})(jQuery);
+
--- /dev/null
+++ b/js/flot/jquery.flot.image.min.js
@@ -1,1 +1,1 @@
-
+(function(c){var a={series:{images:{show:false,alpha:1,anchor:"corner"}}};c.plot.image={};c.plot.image.loadDataImages=function(g,f,k){var j=[],h=[];var i=f.series.images.show;c.each(g,function(l,m){if(!(i||m.images.show)){return}if(m.data){m=m.data}c.each(m,function(n,o){if(typeof o[0]=="string"){j.push(o[0]);h.push(o)}})});c.plot.image.load(j,function(l){c.each(h,function(n,o){var m=o[0];if(l[m]){o[0]=l[m]}});k()})};c.plot.image.load=function(h,i){var g=h.length,f={};if(g==0){i({})}c.each(h,function(k,j){var l=function(){--g;f[j]=this;if(g==0){i(f)}};c("<img />").load(l).error(l).attr("src",j)})};function d(q,o,l){var m=q.getPlotOffset();if(!l.images||!l.images.show){return}var r=l.datapoints.points,n=l.datapoints.pointsize;for(var t=0;t<r.length;t+=n){var y=r[t],w=r[t+1],g=r[t+2],v=r[t+3],f=r[t+4],h=l.xaxis,u=l.yaxis,x;if(!y||y.width<=0||y.height<=0){continue}if(w>v){x=v;v=w;w=x}if(g>f){x=f;f=g;g=x}if(l.images.anchor=="center"){x=0.5*(v-w)/(y.width-1);w-=x;v+=x;x=0.5*(f-g)/(y.height-1);g-=x;f+=x}if(w==v||g==f||w>=h.max||v<=h.min||g>=u.max||f<=u.min){continue}var k=0,s=0,j=y.width,p=y.height;if(w<h.min){k+=(j-k)*(h.min-w)/(v-w);w=h.min}if(v>h.max){j+=(j-k)*(h.max-v)/(v-w);v=h.max}if(g<u.min){p+=(s-p)*(u.min-g)/(f-g);g=u.min}if(f>u.max){s+=(s-p)*(u.max-f)/(f-g);f=u.max}w=h.p2c(w);v=h.p2c(v);g=u.p2c(g);f=u.p2c(f);if(w>v){x=v;v=w;w=x}if(g>f){x=f;f=g;g=x}x=o.globalAlpha;o.globalAlpha*=l.images.alpha;o.drawImage(y,k,s,j-k,p-s,w+m.left,g+m.top,v-w,f-g);o.globalAlpha=x}}function b(i,f,g,h){if(!f.images.show){return}h.format=[{required:true},{x:true,number:true,required:true},{y:true,number:true,required:true},{x:true,number:true,required:true},{y:true,number:true,required:true}]}function e(f){f.hooks.processRawData.push(b);f.hooks.drawSeries.push(d)}c.plot.plugins.push({init:e,options:a,name:"image",version:"1.1"})})(jQuery);
--- /dev/null
+++ b/js/flot/jquery.flot.js
@@ -1,1 +1,2600 @@
-
+/*! Javascript plotting library for jQuery, v. 0.7.
+ *
+ * Released under the MIT license by IOLA, December 2007.
+ *
+ */
+
+// first an inline dependency, jquery.colorhelpers.js, we inline it here
+// for convenience
+
+/* Plugin for jQuery for working with colors.
+ *
+ * Version 1.1.
+ *
+ * Inspiration from jQuery color animation plugin by John Resig.
+ *
+ * Released under the MIT license by Ole Laursen, October 2009.
+ *
+ * Examples:
+ *
+ * $.color.parse("#fff").scale('rgb', 0.25).add('a', -0.5).toString()
+ * var c = $.color.extract($("#mydiv"), 'background-color');
+ * console.log(c.r, c.g, c.b, c.a);
+ * $.color.make(100, 50, 25, 0.4).toString() // returns "rgba(100,50,25,0.4)"
+ *
+ * Note that .scale() and .add() return the same modified object
+ * instead of making a new one.
+ *
+ * V. 1.1: Fix error handling so e.g. parsing an empty string does
+ * produce a color rather than just crashing.
+ */
+(function(B){B.color={};B.color.make=function(F,E,C,D){var G={};G.r=F||0;G.g=E||0;G.b=C||0;G.a=D!=null?D:1;G.add=function(J,I){for(var H=0;H<J.length;++H){G[J.charAt(H)]+=I}return G.normalize()};G.scale=function(J,I){for(var H=0;H<J.length;++H){G[J.charAt(H)]*=I}return G.normalize()};G.toString=function(){if(G.a>=1){return"rgb("+[G.r,G.g,G.b].join(",")+")"}else{return"rgba("+[G.r,G.g,G.b,G.a].join(",")+")"}};G.normalize=function(){function H(J,K,I){return K<J?J:(K>I?I:K)}G.r=H(0,parseInt(G.r),255);G.g=H(0,parseInt(G.g),255);G.b=H(0,parseInt(G.b),255);G.a=H(0,G.a,1);return G};G.clone=function(){return B.color.make(G.r,G.b,G.g,G.a)};return G.normalize()};B.color.extract=function(D,C){var E;do{E=D.css(C).toLowerCase();if(E!=""&&E!="transparent"){break}D=D.parent()}while(!B.nodeName(D.get(0),"body"));if(E=="rgba(0, 0, 0, 0)"){E="transparent"}return B.color.parse(E)};B.color.parse=function(F){var E,C=B.color.make;if(E=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(F)){return C(parseInt(E[1],10),parseInt(E[2],10),parseInt(E[3],10))}if(E=/rgba\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(F)){return C(parseInt(E[1],10),parseInt(E[2],10),parseInt(E[3],10),parseFloat(E[4]))}if(E=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(F)){return C(parseFloat(E[1])*2.55,parseFloat(E[2])*2.55,parseFloat(E[3])*2.55)}if(E=/rgba\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(F)){return C(parseFloat(E[1])*2.55,parseFloat(E[2])*2.55,parseFloat(E[3])*2.55,parseFloat(E[4]))}if(E=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(F)){return C(parseInt(E[1],16),parseInt(E[2],16),parseInt(E[3],16))}if(E=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(F)){return C(parseInt(E[1]+E[1],16),parseInt(E[2]+E[2],16),parseInt(E[3]+E[3],16))}var D=B.trim(F).toLowerCase();if(D=="transparent"){return C(255,255,255,0)}else{E=A[D]||[0,0,0];return C(E[0],E[1],E[2])}};var A={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0]}})(jQuery);
+
+// the actual Flot code
+(function($) {
+ function Plot(placeholder, data_, options_, plugins) {
+ // data is on the form:
+ // [ series1, series2 ... ]
+ // where series is either just the data as [ [x1, y1], [x2, y2], ... ]
+ // or { data: [ [x1, y1], [x2, y2], ... ], label: "some label", ... }
+
+ var series = [],
+ options = {
+ // the color theme used for graphs
+ colors: ["#edc240", "#afd8f8", "#cb4b4b", "#4da74d", "#9440ed"],
+ legend: {
+ show: true,
+ noColumns: 1, // number of colums in legend table
+ labelFormatter: null, // fn: string -> string
+ labelBoxBorderColor: "#ccc", // border color for the little label boxes
+ container: null, // container (as jQuery object) to put legend in, null means default on top of graph
+ position: "ne", // position of default legend container within plot
+ margin: 5, // distance from grid edge to default legend container within plot
+ backgroundColor: null, // null means auto-detect
+ backgroundOpacity: 0.85 // set to 0 to avoid background
+ },
+ xaxis: {
+ show: null, // null = auto-detect, true = always, false = never
+ position: "bottom", // or "top"
+ mode: null, // null or "time"
+ color: null, // base color, labels, ticks
+ tickColor: null, // possibly different color of ticks, e.g. "rgba(0,0,0,0.15)"
+ transform: null, // null or f: number -> number to transform axis
+ inverseTransform: null, // if transform is set, this should be the inverse function
+ min: null, // min. value to show, null means set automatically
+ max: null, // max. value to show, null means set automatically
+ autoscaleMargin: null, // margin in % to add if auto-setting min/max
+ ticks: null, // either [1, 3] or [[1, "a"], 3] or (fn: axis info -> ticks) or app. number of ticks for auto-ticks
+ tickFormatter: null, // fn: number -> string
+ labelWidth: null, // size of tick labels in pixels
+ labelHeight: null,
+ reserveSpace: null, // whether to reserve space even if axis isn't shown
+ tickLength: null, // size in pixels of ticks, or "full" for whole line
+ alignTicksWithAxis: null, // axis number or null for no sync
+
+ // mode specific options
+ tickDecimals: null, // no. of decimals, null means auto
+ tickSize: null, // number or [number, "unit"]
+ minTickSize: null, // number or [number, "unit"]
+ monthNames: null, // list of names of months
+ timeformat: null, // format string to use
+ twelveHourClock: false // 12 or 24 time in time mode
+ },
+ yaxis: {
+ autoscaleMargin: 0.02,
+ position: "left" // or "right"
+ },
+ xaxes: [],
+ yaxes: [],
+ series: {
+ points: {
+ show: false,
+ radius: 3,
+ lineWidth: 2, // in pixels
+ fill: true,
+ fillColor: "#ffffff",
+ symbol: "circle" // or callback
+ },
+ lines: {
+ // we don't put in show: false so we can see
+ // whether lines were actively disabled
+ lineWidth: 2, // in pixels
+ fill: false,
+ fillColor: null,
+ steps: false
+ },
+ bars: {
+ show: false,
+ lineWidth: 2, // in pixels
+ barWidth: 1, // in units of the x axis
+ fill: true,
+ fillColor: null,
+ align: "left", // or "center"
+ horizontal: false
+ },
+ shadowSize: 3
+ },
+ grid: {
+ show: true,
+ aboveData: false,
+ color: "#545454", // primary color used for outline and labels
+ backgroundColor: null, // null for transparent, else color
+ borderColor: null, // set if different from the grid color
+ tickColor: null, // color for the ticks, e.g. "rgba(0,0,0,0.15)"
+ labelMargin: 5, // in pixels
+ axisMargin: 8, // in pixels
+ borderWidth: 2, // in pixels
+ minBorderMargin: null, // in pixels, null means taken from points radius
+ markings: null, // array of ranges or fn: axes -> array of ranges
+ markingsColor: "#f4f4f4",
+ markingsLineWidth: 2,
+ // interactive stuff
+ clickable: false,
+ hoverable: false,
+ autoHighlight: true, // highlight in case mouse is near
+ mouseActiveRadius: 10 // how far the mouse can be away to activate an item
+ },
+ hooks: {}
+ },
+ canvas = null, // the canvas for the plot itself
+ overlay = null, // canvas for interactive stuff on top of plot
+ eventHolder = null, // jQuery object that events should be bound to
+ ctx = null, octx = null,
+ xaxes = [], yaxes = [],
+ plotOffset = { left: 0, right: 0, top: 0, bottom: 0},
+ canvasWidth = 0, canvasHeight = 0,
+ plotWidth = 0, plotHeight = 0,
+ hooks = {
+ processOptions: [],
+ processRawData: [],
+ processDatapoints: [],
+ drawSeries: [],
+ draw: [],
+ bindEvents: [],
+ drawOverlay: [],
+ shutdown: []
+ },
+ plot = this;
+
+ // public functions
+ plot.setData = setData;
+ plot.setupGrid = setupGrid;
+ plot.draw = draw;
+ plot.getPlaceholder = function() { return placeholder; };
+ plot.getCanvas = function() { return canvas; };
+ plot.getPlotOffset = function() { return plotOffset; };
+ plot.width = function () { return plotWidth; };
+ plot.height = function () { return plotHeight; };
+ plot.offset = function () {
+ var o = eventHolder.offset();
+ o.left += plotOffset.left;
+ o.top += plotOffset.top;
+ return o;
+ };
+ plot.getData = function () { return series; };
+ plot.getAxes = function () {
+ var res = {}, i;
+ $.each(xaxes.concat(yaxes), function (_, axis) {
+ if (axis)
+ res[axis.direction + (axis.n != 1 ? axis.n : "") + "axis"] = axis;
+ });
+ return res;
+ };
+ plot.getXAxes = function () { return xaxes; };
+ plot.getYAxes = function () { return yaxes; };
+ plot.c2p = canvasToAxisCoords;
+ plot.p2c = axisToCanvasCoords;
+ plot.getOptions = function () { return options; };
+ plot.highlight = highlight;
+ plot.unhighlight = unhighlight;
+ plot.triggerRedrawOverlay = triggerRedrawOverlay;
+ plot.pointOffset = function(point) {
+ return {
+ left: parseInt(xaxes[axisNumber(point, "x") - 1].p2c(+point.x) + plotOffset.left),
+ top: parseInt(yaxes[axisNumber(point, "y") - 1].p2c(+point.y) + plotOffset.top)
+ };
+ };
+ plot.shutdown = shutdown;
+ plot.resize = function () {
+ getCanvasDimensions();
+ resizeCanvas(canvas);
+ resizeCanvas(overlay);
+ };
+
+ // public attributes
+ plot.hooks = hooks;
+
+ // initialize
+ initPlugins(plot);
+ parseOptions(options_);
+ setupCanvases();
+ setData(data_);
+ setupGrid();
+ draw();
+ bindEvents();
+
+
+ function executeHooks(hook, args) {
+ args = [plot].concat(args);
+ for (var i = 0; i < hook.length; ++i)
+ hook[i].apply(this, args);
+ }
+
+ function initPlugins() {
+ for (var i = 0; i < plugins.length; ++i) {
+ var p = plugins[i];
+ p.init(plot);
+ if (p.options)
+ $.extend(true, options, p.options);
+ }
+ }
+
+ function parseOptions(opts) {
+ var i;
+
+ $.extend(true, options, opts);
+
+ if (options.xaxis.color == null)
+ options.xaxis.color = options.grid.color;
+ if (options.yaxis.color == null)
+ options.yaxis.color = options.grid.color;
+
+ if (options.xaxis.tickColor == null) // backwards-compatibility
+ options.xaxis.tickColor = options.grid.tickColor;
+ if (options.yaxis.tickColor == null) // backwards-compatibility
+ options.yaxis.tickColor = options.grid.tickColor;
+
+ if (options.grid.borderColor == null)
+ options.grid.borderColor = options.grid.color;
+ if (options.grid.tickColor == null)
+ options.grid.tickColor = $.color.parse(options.grid.color).scale('a', 0.22).toString();
+
+ // fill in defaults in axes, copy at least always the
+ // first as the rest of the code assumes it'll be there
+ for (i = 0; i < Math.max(1, options.xaxes.length); ++i)
+ options.xaxes[i] = $.extend(true, {}, options.xaxis, options.xaxes[i]);
+ for (i = 0; i < Math.max(1, options.yaxes.length); ++i)
+ options.yaxes[i] = $.extend(true, {}, options.yaxis, options.yaxes[i]);
+
+ // backwards compatibility, to be removed in future
+ if (options.xaxis.noTicks && options.xaxis.ticks == null)
+ options.xaxis.ticks = options.xaxis.noTicks;
+ if (options.yaxis.noTicks && options.yaxis.ticks == null)
+ options.yaxis.ticks = options.yaxis.noTicks;
+ if (options.x2axis) {
+ options.xaxes[1] = $.extend(true, {}, options.xaxis, options.x2axis);
+ options.xaxes[1].position = "top";
+ }
+ if (options.y2axis) {
+ options.yaxes[1] = $.extend(true, {}, options.yaxis, options.y2axis);
+ options.yaxes[1].position = "right";
+ }
+ if (options.grid.coloredAreas)
+ options.grid.markings = options.grid.coloredAreas;
+ if (options.grid.coloredAreasColor)
+ options.grid.markingsColor = options.grid.coloredAreasColor;
+ if (options.lines)
+ $.extend(true, options.series.lines, options.lines);
+ if (options.points)
+ $.extend(true, options.series.points, options.points);
+ if (options.bars)
+ $.extend(true, options.series.bars, options.bars);
+ if (options.shadowSize != null)
+ options.series.shadowSize = options.shadowSize;
+
+ // save options on axes for future reference
+ for (i = 0; i < options.xaxes.length; ++i)
+ getOrCreateAxis(xaxes, i + 1).options = options.xaxes[i];
+ for (i = 0; i < options.yaxes.length; ++i)
+ getOrCreateAxis(yaxes, i + 1).options = options.yaxes[i];
+
+ // add hooks from options
+ for (var n in hooks)
+ if (options.hooks[n] && options.hooks[n].length)
+ hooks[n] = hooks[n].concat(options.hooks[n]);
+
+ executeHooks(hooks.processOptions, [options]);
+ }
+
+ function setData(d) {
+ series = parseData(d);
+ fillInSeriesOptions();
+ processData();
+ }
+
+ function parseData(d) {
+ var res = [];
+ for (var i = 0; i < d.length; ++i) {
+ var s = $.extend(true, {}, options.series);
+
+ if (d[i].data != null) {
+ s.data = d[i].data; // move the data instead of deep-copy
+ delete d[i].data;
+
+ $.extend(true, s, d[i]);
+
+ d[i].data = s.data;
+ }
+ else
+ s.data = d[i];
+ res.push(s);
+ }
+
+ return res;
+ }
+
+ function axisNumber(obj, coord) {
+ var a = obj[coord + "axis"];
+ if (typeof a == "object") // if we got a real axis, extract number
+ a = a.n;
+ if (typeof a != "number")
+ a = 1; // default to first axis
+ return a;
+ }
+
+ function allAxes() {
+ // return flat array without annoying null entries
+ return $.grep(xaxes.concat(yaxes), function (a) { return a; });
+ }
+
+ function canvasToAxisCoords(pos) {
+ // return an object with x/y corresponding to all used axes
+ var res = {}, i, axis;
+ for (i = 0; i < xaxes.length; ++i) {
+ axis = xaxes[i];
+ if (axis && axis.used)
+ res["x" + axis.n] = axis.c2p(pos.left);
+ }
+
+ for (i = 0; i < yaxes.length; ++i) {
+ axis = yaxes[i];
+ if (axis && axis.used)
+ res["y" + axis.n] = axis.c2p(pos.top);
+ }
+
+ if (res.x1 !== undefined)
+ res.x = res.x1;
+ if (res.y1 !== undefined)
+ res.y = res.y1;
+
+ return res;
+ }
+
+ function axisToCanvasCoords(pos) {
+ // get canvas coords from the first pair of x/y found in pos
+ var res = {}, i, axis, key;
+
+ for (i = 0; i < xaxes.length; ++i) {
+ axis = xaxes[i];
+ if (axis && axis.used) {
+ key = "x" + axis.n;
+ if (pos[key] == null && axis.n == 1)
+ key = "x";
+
+ if (pos[key] != null) {
+ res.left = axis.p2c(pos[key]);
+ break;
+ }
+ }
+ }
+
+ for (i = 0; i < yaxes.length; ++i) {
+ axis = yaxes[i];
+ if (axis && axis.used) {
+ key = "y" + axis.n;
+ if (pos[key] == null && axis.n == 1)
+ key = "y";
+
+ if (pos[key] != null) {
+ res.top = axis.p2c(pos[key]);
+ break;
+ }
+ }
+ }
+
+ return res;
+ }
+
+ function getOrCreateAxis(axes, number) {
+ if (!axes[number - 1])
+ axes[number - 1] = {
+ n: number, // save the number for future reference
+ direction: axes == xaxes ? "x" : "y",
+ options: $.extend(true, {}, axes == xaxes ? options.xaxis : options.yaxis)
+ };
+
+ return axes[number - 1];
+ }
+
+ function fillInSeriesOptions() {
+ var i;
+
+ // collect what we already got of colors
+ var neededColors = series.length,
+ usedColors = [],
+ assignedColors = [];
+ for (i = 0; i < series.length; ++i) {
+ var sc = series[i].color;
+ if (sc != null) {
+ --neededColors;
+ if (typeof sc == "number")
+ assignedColors.push(sc);
+ else
+ usedColors.push($.color.parse(series[i].color));
+ }
+ }
+
+ // we might need to generate more colors if higher indices
+ // are assigned
+ for (i = 0; i < assignedColors.length; ++i) {
+ neededColors = Math.max(neededColors, assignedColors[i] + 1);
+ }
+
+ // produce colors as needed
+ var colors = [], variation = 0;
+ i = 0;
+ while (colors.length < neededColors) {
+ var c;
+ if (options.colors.length == i) // check degenerate case
+ c = $.color.make(100, 100, 100);
+ else
+ c = $.color.parse(options.colors[i]);
+
+ // vary color if needed
+ var sign = variation % 2 == 1 ? -1 : 1;
+ c.scale('rgb', 1 + sign * Math.ceil(variation / 2) * 0.2)
+
+ // FIXME: if we're getting to close to something else,
+ // we should probably skip this one
+ colors.push(c);
+
+ ++i;
+ if (i >= options.colors.length) {
+ i = 0;
+ ++variation;
+ }
+ }
+
+ // fill in the options
+ var colori = 0, s;
+ for (i = 0; i < series.length; ++i) {
+ s = series[i];
+
+ // assign colors
+ if (s.color == null) {
+ s.color = colors[colori].toString();
+ ++colori;
+ }
+ else if (typeof s.color == "number")
+ s.color = colors[s.color].toString();
+
+ // turn on lines automatically in case nothing is set
+ if (s.lines.show == null) {
+ var v, show = true;
+ for (v in s)
+ if (s[v] && s[v].show) {
+ show = false;
+ break;
+ }
+ if (show)
+ s.lines.show = true;
+ }
+
+ // setup axes
+ s.xaxis = getOrCreateAxis(xaxes, axisNumber(s, "x"));
+ s.yaxis = getOrCreateAxis(yaxes, axisNumber(s, "y"));
+ }
+ }
+
+ function processData() {
+ var topSentry = Number.POSITIVE_INFINITY,
+ bottomSentry = Number.NEGATIVE_INFINITY,
+ fakeInfinity = Number.MAX_VALUE,
+ i, j, k, m, length,
+ s, points, ps, x, y, axis, val, f, p;
+
+ function updateAxis(axis, min, max) {
+ if (min < axis.datamin && min != -fakeInfinity)
+ axis.datamin = min;
+ if (max > axis.datamax && max != fakeInfinity)
+ axis.datamax = max;
+ }
+
+ $.each(allAxes(), function (_, axis) {
+ // init axis
+ axis.datamin = topSentry;
+ axis.datamax = bottomSentry;
+ axis.used = false;
+ });
+
+ for (i = 0; i < series.length; ++i) {
+ s = series[i];
+ s.datapoints = { points: [] };
+
+ executeHooks(hooks.processRawData, [ s, s.data, s.datapoints ]);
+ }
+
+ // first pass: clean and copy data
+ for (i = 0; i < series.length; ++i) {
+ s = series[i];
+
+ var data = s.data, format = s.datapoints.format;
+
+ if (!format) {
+ format = [];
+ // find out how to copy
+ format.push({ x: true, number: true, required: true });
+ format.push({ y: true, number: true, required: true });
+
+ if (s.bars.show || (s.lines.show && s.lines.fill)) {
+ format.push({ y: true, number: true, required: false, defaultValue: 0 });
+ if (s.bars.horizontal) {
+ delete format[format.length - 1].y;
+ format[format.length - 1].x = true;
+ }
+ }
+
+ s.datapoints.format = format;
+ }
+
+ if (s.datapoints.pointsize != null)
+ continue; // already filled in
+
+ s.datapoints.pointsize = format.length;
+
+ ps = s.datapoints.pointsize;
+ points = s.datapoints.points;
+
+ insertSteps = s.lines.show && s.lines.steps;
+ s.xaxis.used = s.yaxis.used = true;
+
+ for (j = k = 0; j < data.length; ++j, k += ps) {
+ p = data[j];
+
+ var nullify = p == null;
+ if (!nullify) {
+ for (m = 0; m < ps; ++m) {
+ val = p[m];
+ f = format[m];
+
+ if (f) {
+ if (f.number && val != null) {
+ val = +val; // convert to number
+ if (isNaN(val))
+ val = null;
+ else if (val == Infinity)
+ val = fakeInfinity;
+ else if (val == -Infinity)
+ val = -fakeInfinity;
+ }
+
+ if (val == null) {
+ if (f.required)
+ nullify = true;
+
+ if (f.defaultValue != null)
+ val = f.defaultValue;
+ }
+ }
+
+ points[k + m] = val;
+ }
+ }
+
+ if (nullify) {
+ for (m = 0; m < ps; ++m) {
+ val = points[k + m];
+ if (val != null) {
+ f = format[m];
+ // extract min/max info
+ if (f.x)
+ updateAxis(s.xaxis, val, val);
+ if (f.y)
+ updateAxis(s.yaxis, val, val);
+ }
+ points[k + m] = null;
+ }
+ }
+ else {
+ // a little bit of line specific stuff that
+ // perhaps shouldn't be here, but lacking
+ // better means...
+ if (insertSteps && k > 0
+ && points[k - ps] != null
+ && points[k - ps] != points[k]
+ && points[k - ps + 1] != points[k + 1]) {
+ // copy the point to make room for a middle point
+ for (m = 0; m < ps; ++m)
+ points[k + ps + m] = points[k + m];
+
+ // middle point has same y
+ points[k + 1] = points[k - ps + 1];
+
+ // we've added a point, better reflect that
+ k += ps;
+ }
+ }
+ }
+ }
+
+ // give the hooks a chance to run
+ for (i = 0; i < series.length; ++i) {
+ s = series[i];
+
+ executeHooks(hooks.processDatapoints, [ s, s.datapoints]);
+ }
+
+ // second pass: find datamax/datamin for auto-scaling
+ for (i = 0; i < series.length; ++i) {
+ s = series[i];
+ points = s.datapoints.points,
+ ps = s.datapoints.pointsize;
+
+ var xmin = topSentry, ymin = topSentry,
+ xmax = bottomSentry, ymax = bottomSentry;
+
+ for (j = 0; j < points.length; j += ps) {
+ if (points[j] == null)
+ continue;
+
+ for (m = 0; m < ps; ++m) {
+ val = points[j + m];
+ f = format[m];
+ if (!f || val == fakeInfinity || val == -fakeInfinity)
+ continue;
+
+ if (f.x) {
+ if (val < xmin)
+ xmin = val;
+ if (val > xmax)
+ xmax = val;
+ }
+ if (f.y) {
+ if (val < ymin)
+ ymin = val;
+ if (val > ymax)
+ ymax = val;
+ }
+ }
+ }
+
+ if (s.bars.show) {
+ // make sure we got room for the bar on the dancing floor
+ var delta = s.bars.align == "left" ? 0 : -s.bars.barWidth/2;
+ if (s.bars.horizontal) {
+ ymin += delta;
+ ymax += delta + s.bars.barWidth;
+ }
+ else {
+ xmin += delta;
+ xmax += delta + s.bars.barWidth;
+ }
+ }
+
+ updateAxis(s.xaxis, xmin, xmax);
+ updateAxis(s.yaxis, ymin, ymax);
+ }
+
+ $.each(allAxes(), function (_, axis) {
+ if (axis.datamin == topSentry)
+ axis.datamin = null;
+ if (axis.datamax == bottomSentry)
+ axis.datamax = null;
+ });
+ }
+
+ function makeCanvas(skipPositioning, cls) {
+ var c = document.createElement('canvas');
+ c.className = cls;
+ c.width = canvasWidth;
+ c.height = canvasHeight;
+
+ if (!skipPositioning)
+ $(c).css({ position: 'absolute', left: 0, top: 0 });
+
+ $(c).appendTo(placeholder);
+
+ if (!c.getContext) // excanvas hack
+ c = window.G_vmlCanvasManager.initElement(c);
+
+ // used for resetting in case we get replotted
+ c.getContext("2d").save();
+
+ return c;
+ }
+
+ function getCanvasDimensions() {
+ canvasWidth = placeholder.width();
+ canvasHeight = placeholder.height();
+
+ if (canvasWidth <= 0 || canvasHeight <= 0)
+ throw "Invalid dimensions for plot, width = " + canvasWidth + ", height = " + canvasHeight;
+ }
+
+ function resizeCanvas(c) {
+ // resizing should reset the state (excanvas seems to be
+ // buggy though)
+ if (c.width != canvasWidth)
+ c.width = canvasWidth;
+
+ if (c.height != canvasHeight)
+ c.height = canvasHeight;
+
+ // so try to get back to the initial state (even if it's
+ // gone now, this should be safe according to the spec)
+ var cctx = c.getContext("2d");
+ cctx.restore();
+
+ // and save again
+ cctx.save();
+ }
+
+ function setupCanvases() {
+ var reused,
+ existingCanvas = placeholder.children("canvas.base"),
+ existingOverlay = placeholder.children("canvas.overlay");
+
+ if (existingCanvas.length == 0 || existingOverlay == 0) {
+ // init everything
+
+ placeholder.html(""); // make sure placeholder is clear
+
+ placeholder.css({ padding: 0 }); // padding messes up the positioning
+
+ if (placeholder.css("position") == 'static')
+ placeholder.css("position", "relative"); // for positioning labels and overlay
+
+ getCanvasDimensions();
+
+ canvas = makeCanvas(true, "base");
+ overlay = makeCanvas(false, "overlay"); // overlay canvas for interactive features
+
+ reused = false;
+ }
+ else {
+ // reuse existing elements
+
+ canvas = existingCanvas.get(0);
+ overlay = existingOverlay.get(0);
+
+ reused = true;
+ }
+
+ ctx = canvas.getContext("2d");
+ octx = overlay.getContext("2d");
+
+ // we include the canvas in the event holder too, because IE 7
+ // sometimes has trouble with the stacking order
+ eventHolder = $([overlay, canvas]);
+
+ if (reused) {
+ // run shutdown in the old plot object
+ placeholder.data("plot").shutdown();
+
+ // reset reused canvases
+ plot.resize();
+
+ // make sure overlay pixels are cleared (canvas is cleared when we redraw)
+ octx.clearRect(0, 0, canvasWidth, canvasHeight);
+
+ // then whack any remaining obvious garbage left
+ eventHolder.unbind();
+ placeholder.children().not([canvas, overlay]).remove();
+ }
+
+ // save in case we get replotted
+ placeholder.data("plot", plot);
+ }
+
+ function bindEvents() {
+ // bind events
+ if (options.grid.hoverable) {
+ eventHolder.mousemove(onMouseMove);
+ eventHolder.mouseleave(onMouseLeave);
+ }
+
+ if (options.grid.clickable)
+ eventHolder.click(onClick);
+
+ executeHooks(hooks.bindEvents, [eventHolder]);
+ }
+
+ function shutdown() {
+ if (redrawTimeout)
+ clearTimeout(redrawTimeout);
+
+ eventHolder.unbind("mousemove", onMouseMove);
+ eventHolder.unbind("mouseleave", onMouseLeave);
+ eventHolder.unbind("click", onClick);
+
+ executeHooks(hooks.shutdown, [eventHolder]);
+ }
+
+ function setTransformationHelpers(axis) {
+ // set helper functions on the axis, assumes plot area
+ // has been computed already
+
+ function identity(x) { return x; }
+
+ var s, m, t = axis.options.transform || identity,
+ it = axis.options.inverseTransform;
+
+ // precompute how much the axis is scaling a point
+ // in canvas space
+ if (axis.direction == "x") {
+ s = axis.scale = plotWidth / Math.abs(t(axis.max) - t(axis.min));
+ m = Math.min(t(axis.max), t(axis.min));
+ }
+ else {
+ s = axis.scale = plotHeight / Math.abs(t(axis.max) - t(axis.min));
+ s = -s;
+ m = Math.max(t(axis.max), t(axis.min));
+ }
+
+ // data point to canvas coordinate
+ if (t == identity) // slight optimization
+ axis.p2c = function (p) { return (p - m) * s; };
+ else
+ axis.p2c = function (p) { return (t(p) - m) * s; };
+ // canvas coordinate to data point
+ if (!it)
+ axis.c2p = function (c) { return m + c / s; };
+ else
+ axis.c2p = function (c) { return it(m + c / s); };
+ }
+
+ function measureTickLabels(axis) {
+ var opts = axis.options, i, ticks = axis.ticks || [], labels = [],
+ l, w = opts.labelWidth, h = opts.labelHeight, dummyDiv;
+
+ function makeDummyDiv(labels, width) {
+ return $('<div style="position:absolute;top:-10000px;' + width + 'font-size:smaller">' +
+ '<div class="' + axis.direction + 'Axis ' + axis.direction + axis.n + 'Axis">'
+ + labels.join("") + '</div></div>')
+ .appendTo(placeholder);
+ }
+
+ if (axis.direction == "x") {
+ // to avoid measuring the widths of the labels (it's slow), we
+ // construct fixed-size boxes and put the labels inside
+ // them, we don't need the exact figures and the
+ // fixed-size box content is easy to center
+ if (w == null)
+ w = Math.floor(canvasWidth / (ticks.length > 0 ? ticks.length : 1));
+
+ // measure x label heights
+ if (h == null) {
+ labels = [];
+ for (i = 0; i < ticks.length; ++i) {
+ l = ticks[i].label;
+ if (l)
+ labels.push('<div class="tickLabel" style="float:left;width:' + w + 'px">' + l + '</div>');
+ }
+
+ if (labels.length > 0) {
+ // stick them all in the same div and measure
+ // collective height
+ labels.push('<div style="clear:left"></div>');
+ dummyDiv = makeDummyDiv(labels, "width:10000px;");
+ h = dummyDiv.height();
+ dummyDiv.remove();
+ }
+ }
+ }
+ else if (w == null || h == null) {
+ // calculate y label dimensions
+ for (i = 0; i < ticks.length; ++i) {
+ l = ticks[i].label;
+ if (l)
+ labels.push('<div class="tickLabel">' + l + '</div>');
+ }
+
+ if (labels.length > 0) {
+ dummyDiv = makeDummyDiv(labels, "");
+ if (w == null)
+ w = dummyDiv.children().width();
+ if (h == null)
+ h = dummyDiv.find("div.tickLabel").height();
+ dummyDiv.remove();
+ }
+ }
+
+ if (w == null)
+ w = 0;
+ if (h == null)
+ h = 0;
+
+ axis.labelWidth = w;
+ axis.labelHeight = h;
+ }
+
+ function allocateAxisBoxFirstPhase(axis) {
+ // find the bounding box of the axis by looking at label
+ // widths/heights and ticks, make room by diminishing the
+ // plotOffset
+
+ var lw = axis.labelWidth,
+ lh = axis.labelHeight,
+ pos = axis.options.position,
+ tickLength = axis.options.tickLength,
+ axismargin = options.grid.axisMargin,
+ padding = options.grid.labelMargin,
+ all = axis.direction == "x" ? xaxes : yaxes,
+ index;
+
+ // determine axis margin
+ var samePosition = $.grep(all, function (a) {
+ return a && a.options.position == pos && a.reserveSpace;
+ });
+ if ($.inArray(axis, samePosition) == samePosition.length - 1)
+ axismargin = 0; // outermost
+
+ // determine tick length - if we're innermost, we can use "full"
+ if (tickLength == null)
+ tickLength = "full";
+
+ var sameDirection = $.grep(all, function (a) {
+ return a && a.reserveSpace;
+ });
+
+ var innermost = $.inArray(axis, sameDirection) == 0;
+ if (!innermost && tickLength == "full")
+ tickLength = 5;
+
+ if (!isNaN(+tickLength))
+ padding += +tickLength;
+
+ // compute box
+ if (axis.direction == "x") {
+ lh += padding;
+
+ if (pos == "bottom") {
+ plotOffset.bottom += lh + axismargin;
+ axis.box = { top: canvasHeight - plotOffset.bottom, height: lh };
+ }
+ else {
+ axis.box = { top: plotOffset.top + axismargin, height: lh };
+ plotOffset.top += lh + axismargin;
+ }
+ }
+ else {
+ lw += padding;
+
+ if (pos == "left") {
+ axis.box = { left: plotOffset.left + axismargin, width: lw };
+ plotOffset.left += lw + axismargin;
+ }
+ else {
+ plotOffset.right += lw + axismargin;
+ axis.box = { left: canvasWidth - plotOffset.right, width: lw };
+ }
+ }
+
+ // save for future reference
+ axis.position = pos;
+ axis.tickLength = tickLength;
+ axis.box.padding = padding;
+ axis.innermost = innermost;
+ }
+
+ function allocateAxisBoxSecondPhase(axis) {
+ // set remaining bounding box coordinates
+ if (axis.direction == "x") {
+ axis.box.left = plotOffset.left;
+ axis.box.width = plotWidth;
+ }
+ else {
+ axis.box.top = plotOffset.top;
+ axis.box.height = plotHeight;
+ }
+ }
+
+ function setupGrid() {
+ var i, axes = allAxes();
+
+ // first calculate the plot and axis box dimensions
+
+ $.each(axes, function (_, axis) {
+ axis.show = axis.options.show;
+ if (axis.show == null)
+ axis.show = axis.used; // by default an axis is visible if it's got data
+
+ axis.reserveSpace = axis.show || axis.options.reserveSpace;
+
+ setRange(axis);
+ });
+
+ allocatedAxes = $.grep(axes, function (axis) { return axis.reserveSpace; });
+
+ plotOffset.left = plotOffset.right = plotOffset.top = plotOffset.bottom = 0;
+ if (options.grid.show) {
+ $.each(allocatedAxes, function (_, axis) {
+ // make the ticks
+ setupTickGeneration(axis);
+ setTicks(axis);
+ snapRangeToTicks(axis, axis.ticks);
+
+ // find labelWidth/Height for axis
+ measureTickLabels(axis);
+ });
+
+ // with all dimensions in house, we can compute the
+ // axis boxes, start from the outside (reverse order)
+ for (i = allocatedAxes.length - 1; i >= 0; --i)
+ allocateAxisBoxFirstPhase(allocatedAxes[i]);
+
+ // make sure we've got enough space for things that
+ // might stick out
+ var minMargin = options.grid.minBorderMargin;
+ if (minMargin == null) {
+ minMargin = 0;
+ for (i = 0; i < series.length; ++i)
+ minMargin = Math.max(minMargin, series[i].points.radius + series[i].points.lineWidth/2);
+ }
+
+ for (var a in plotOffset) {
+ plotOffset[a] += options.grid.borderWidth;
+ plotOffset[a] = Math.max(minMargin, plotOffset[a]);
+ }
+ }
+
+ plotWidth = canvasWidth - plotOffset.left - plotOffset.right;
+ plotHeight = canvasHeight - plotOffset.bottom - plotOffset.top;
+
+ // now we got the proper plotWidth/Height, we can compute the scaling
+ $.each(axes, function (_, axis) {
+ setTransformationHelpers(axis);
+ });
+
+ if (options.grid.show) {
+ $.each(allocatedAxes, function (_, axis) {
+ allocateAxisBoxSecondPhase(axis);
+ });
+
+ insertAxisLabels();
+ }
+
+ insertLegend();
+ }
+
+ function setRange(axis) {
+ var opts = axis.options,
+ min = +(opts.min != null ? opts.min : axis.datamin),
+ max = +(opts.max != null ? opts.max : axis.datamax),
+ delta = max - min;
+
+ if (delta == 0.0) {
+ // degenerate case
+ var widen = max == 0 ? 1 : 0.01;
+
+ if (opts.min == null)
+ min -= widen;
+ // always widen max if we couldn't widen min to ensure we
+ // don't fall into min == max which doesn't work
+ if (opts.max == null || opts.min != null)
+ max += widen;
+ }
+ else {
+ // consider autoscaling
+ var margin = opts.autoscaleMargin;
+ if (margin != null) {
+ if (opts.min == null) {
+ min -= delta * margin;
+ // make sure we don't go below zero if all values
+ // are positive
+ if (min < 0 && axis.datamin != null && axis.datamin >= 0)
+ min = 0;
+ }
+ if (opts.max == null) {
+ max += delta * margin;
+ if (max > 0 && axis.datamax != null && axis.datamax <= 0)
+ max = 0;
+ }
+ }
+ }
+ axis.min = min;
+ axis.max = max;
+ }
+
+ function setupTickGeneration(axis) {
+ var opts = axis.options;
+
+ // estimate number of ticks
+ var noTicks;
+ if (typeof opts.ticks == "number" && opts.ticks > 0)
+ noTicks = opts.ticks;
+ else
+ // heuristic based on the model a*sqrt(x) fitted to
+ // some data points that seemed reasonable
+ noTicks = 0.3 * Math.sqrt(axis.direction == "x" ? canvasWidth : canvasHeight);
+
+ var delta = (axis.max - axis.min) / noTicks,
+ size, generator, unit, formatter, i, magn, norm;
+
+ if (opts.mode == "time") {
+ // pretty handling of time
+
+ // map of app. size of time units in milliseconds
+ var timeUnitSize = {
+ "second": 1000,
+ "minute": 60 * 1000,
+ "hour": 60 * 60 * 1000,
+ "day": 24 * 60 * 60 * 1000,
+ "month": 30 * 24 * 60 * 60 * 1000,
+ "year": 365.2425 * 24 * 60 * 60 * 1000
+ };
+
+
+ // the allowed tick sizes, after 1 year we use
+ // an integer algorithm
+ var spec = [
+ [1, "second"], [2, "second"], [5, "second"], [10, "second"],
+ [30, "second"],
+ [1, "minute"], [2, "minute"], [5, "minute"], [10, "minute"],
+ [30, "minute"],
+ [1, "hour"], [2, "hour"], [4, "hour"],
+ [8, "hour"], [12, "hour"],
+ [1, "day"], [2, "day"], [3, "day"],
+ [0.25, "month"], [0.5, "month"], [1, "month"],
+ [2, "month"], [3, "month"], [6, "month"],
+ [1, "year"]
+ ];
+
+ var minSize = 0;
+ if (opts.minTickSize != null) {
+ if (typeof opts.tickSize == "number")
+ minSize = opts.tickSize;
+ else
+ minSize = opts.minTickSize[0] * timeUnitSize[opts.minTickSize[1]];
+ }
+
+ for (var i = 0; i < spec.length - 1; ++i)
+ if (delta < (spec[i][0] * timeUnitSize[spec[i][1]]
+ + spec[i + 1][0] * timeUnitSize[spec[i + 1][1]]) / 2
+ && spec[i][0] * timeUnitSize[spec[i][1]] >= minSize)
+ break;
+ size = spec[i][0];
+ unit = spec[i][1];
+
+ // special-case the possibility of several years
+ if (unit == "year") {
+ magn = Math.pow(10, Math.floor(Math.log(delta / timeUnitSize.year) / Math.LN10));
+ norm = (delta / timeUnitSize.year) / magn;
+ if (norm < 1.5)
+ size = 1;
+ else if (norm < 3)
+ size = 2;
+ else if (norm < 7.5)
+ size = 5;
+ else
+ size = 10;
+
+ size *= magn;
+ }
+
+ axis.tickSize = opts.tickSize || [size, unit];
+
+ generator = function(axis) {
+ var ticks = [],
+ tickSize = axis.tickSize[0], unit = axis.tickSize[1],
+ d = new Date(axis.min);
+
+ var step = tickSize * timeUnitSize[unit];
+
+ if (unit == "second")
+ d.setUTCSeconds(floorInBase(d.getUTCSeconds(), tickSize));
+ if (unit == "minute")
+ d.setUTCMinutes(floorInBase(d.getUTCMinutes(), tickSize));
+ if (unit == "hour")
+ d.setUTCHours(floorInBase(d.getUTCHours(), tickSize));
+ if (unit == "month")
+ d.setUTCMonth(floorInBase(d.getUTCMonth(), tickSize));
+ if (unit == "year")
+ d.setUTCFullYear(floorInBase(d.getUTCFullYear(), tickSize));
+
+ // reset smaller components
+ d.setUTCMilliseconds(0);
+ if (step >= timeUnitSize.minute)
+ d.setUTCSeconds(0);
+ if (step >= timeUnitSize.hour)
+ d.setUTCMinutes(0);
+ if (step >= timeUnitSize.day)
+ d.setUTCHours(0);
+ if (step >= timeUnitSize.day * 4)
+ d.setUTCDate(1);
+ if (step >= timeUnitSize.year)
+ d.setUTCMonth(0);
+
+
+ var carry = 0, v = Number.NaN, prev;
+ do {
+ prev = v;
+ v = d.getTime();
+ ticks.push(v);
+ if (unit == "month") {
+ if (tickSize < 1) {
+ // a bit complicated - we'll divide the month
+ // up but we need to take care of fractions
+ // so we don't end up in the middle of a day
+ d.setUTCDate(1);
+ var start = d.getTime();
+ d.setUTCMonth(d.getUTCMonth() + 1);
+ var end = d.getTime();
+ d.setTime(v + carry * timeUnitSize.hour + (end - start) * tickSize);
+ carry = d.getUTCHours();
+ d.setUTCHours(0);
+ }
+ else
+ d.setUTCMonth(d.getUTCMonth() + tickSize);
+ }
+ else if (unit == "year") {
+ d.setUTCFullYear(d.getUTCFullYear() + tickSize);
+ }
+ else
+ d.setTime(v + step);
+ } while (v < axis.max && v != prev);
+
+ return ticks;
+ };
+
+ formatter = function (v, axis) {
+ var d = new Date(v);
+
+ // first check global format
+ if (opts.timeformat != null)
+ return $.plot.formatDate(d, opts.timeformat, opts.monthNames);
+
+ var t = axis.tickSize[0] * timeUnitSize[axis.tickSize[1]];
+ var span = axis.max - axis.min;
+ var suffix = (opts.twelveHourClock) ? " %p" : "";
+
+ if (t < timeUnitSize.minute)
+ fmt = "%h:%M:%S" + suffix;
+ else if (t < timeUnitSize.day) {
+ if (span < 2 * timeUnitSize.day)
+ fmt = "%h:%M" + suffix;
+ else
+ fmt = "%b %d %h:%M" + suffix;
+ }
+ else if (t < timeUnitSize.month)
+ fmt = "%b %d";
+ else if (t < timeUnitSize.year) {
+ if (span < timeUnitSize.year)
+ fmt = "%b";
+ else
+ fmt = "%b %y";
+ }
+ else
+ fmt = "%y";
+
+ return $.plot.formatDate(d, fmt, opts.monthNames);
+ };
+ }
+ else {
+ // pretty rounding of base-10 numbers
+ var maxDec = opts.tickDecimals;
+ var dec = -Math.floor(Math.log(delta) / Math.LN10);
+ if (maxDec != null && dec > maxDec)
+ dec = maxDec;
+
+ magn = Math.pow(10, -dec);
+ norm = delta / magn; // norm is between 1.0 and 10.0
+
+ if (norm < 1.5)
+ size = 1;
+ else if (norm < 3) {
+ size = 2;
+ // special case for 2.5, requires an extra decimal
+ if (norm > 2.25 && (maxDec == null || dec + 1 <= maxDec)) {
+ size = 2.5;
+ ++dec;
+ }
+ }
+ else if (norm < 7.5)
+ size = 5;
+ else
+ size = 10;
+
+ size *= magn;
+
+ if (opts.minTickSize != null && size < opts.minTickSize)
+ size = opts.minTickSize;
+
+ axis.tickDecimals = Math.max(0, maxDec != null ? maxDec : dec);
+ axis.tickSize = opts.tickSize || size;
+
+ generator = function (axis) {
+ var ticks = [];
+
+ // spew out all possible ticks
+ var start = floorInBase(axis.min, axis.tickSize),
+ i = 0, v = Number.NaN, prev;
+ do {
+ prev = v;
+ v = start + i * axis.tickSize;
+ ticks.push(v);
+ ++i;
+ } while (v < axis.max && v != prev);
+ return ticks;
+ };
+
+ formatter = function (v, axis) {
+ return v.toFixed(axis.tickDecimals);
+ };
+ }
+
+ if (opts.alignTicksWithAxis != null) {
+ var otherAxis = (axis.direction == "x" ? xaxes : yaxes)[opts.alignTicksWithAxis - 1];
+ if (otherAxis && otherAxis.used && otherAxis != axis) {
+ // consider snapping min/max to outermost nice ticks
+ var niceTicks = generator(axis);
+ if (niceTicks.length > 0) {
+ if (opts.min == null)
+ axis.min = Math.min(axis.min, niceTicks[0]);
+ if (opts.max == null && niceTicks.length > 1)
+ axis.max = Math.max(axis.max, niceTicks[niceTicks.length - 1]);
+ }
+
+ generator = function (axis) {
+ // copy ticks, scaled to this axis
+ var ticks = [], v, i;
+ for (i = 0; i < otherAxis.ticks.length; ++i) {
+ v = (otherAxis.ticks[i].v - otherAxis.min) / (otherAxis.max - otherAxis.min);
+ v = axis.min + v * (axis.max - axis.min);
+ ticks.push(v);
+ }
+ return ticks;
+ };
+
+ // we might need an extra decimal since forced
+ // ticks don't necessarily fit naturally
+ if (axis.mode != "time" && opts.tickDecimals == null) {
+ var extraDec = Math.max(0, -Math.floor(Math.log(delta) / Math.LN10) + 1),
+ ts = generator(axis);
+
+ // only proceed if the tick interval rounded
+ // with an extra decimal doesn't give us a
+ // zero at end
+ if (!(ts.length > 1 && /\..*0$/.test((ts[1] - ts[0]).toFixed(extraDec))))
+ axis.tickDecimals = extraDec;
+ }
+ }
+ }
+
+ axis.tickGenerator = generator;
+ if ($.isFunction(opts.tickFormatter))
+ axis.tickFormatter = function (v, axis) { return "" + opts.tickFormatter(v, axis); };
+ else
+ axis.tickFormatter = formatter;
+ }
+
+ function setTicks(axis) {
+ var oticks = axis.options.ticks, ticks = [];
+ if (oticks == null || (typeof oticks == "number" && oticks > 0))
+ ticks = axis.tickGenerator(axis);
+ else if (oticks) {
+ if ($.isFunction(oticks))
+ // generate the ticks
+ ticks = oticks({ min: axis.min, max: axis.max });
+ else
+ ticks = oticks;
+ }
+
+ // clean up/labelify the supplied ticks, copy them over
+ var i, v;
+ axis.ticks = [];
+ for (i = 0; i < ticks.length; ++i) {
+ var label = null;
+ var t = ticks[i];
+ if (typeof t == "object") {
+ v = +t[0];
+ if (t.length > 1)
+ label = t[1];
+ }
+ else
+ v = +t;
+ if (label == null)
+ label = axis.tickFormatter(v, axis);
+ if (!isNaN(v))
+ axis.ticks.push({ v: v, label: label });
+ }
+ }
+
+ function snapRangeToTicks(axis, ticks) {
+ if (axis.options.autoscaleMargin && ticks.length > 0) {
+ // snap to ticks
+ if (axis.options.min == null)
+ axis.min = Math.min(axis.min, ticks[0].v);
+ if (axis.options.max == null && ticks.length > 1)
+ axis.max = Math.max(axis.max, ticks[ticks.length - 1].v);
+ }
+ }
+
+ function draw() {
+ ctx.clearRect(0, 0, canvasWidth, canvasHeight);
+
+ var grid = options.grid;
+
+ // draw background, if any
+ if (grid.show && grid.backgroundColor)
+ drawBackground();
+
+ if (grid.show && !grid.aboveData)
+ drawGrid();
+
+ for (var i = 0; i < series.length; ++i) {
+ executeHooks(hooks.drawSeries, [ctx, series[i]]);
+ drawSeries(series[i]);
+ }
+
+ executeHooks(hooks.draw, [ctx]);
+
+ if (grid.show && grid.aboveData)
+ drawGrid();
+ }
+
+ function extractRange(ranges, coord) {
+ var axis, from, to, key, axes = allAxes();
+
+ for (i = 0; i < axes.length; ++i) {
+ axis = axes[i];
+ if (axis.direction == coord) {
+ key = coord + axis.n + "axis";
+ if (!ranges[key] && axis.n == 1)
+ key = coord + "axis"; // support x1axis as xaxis
+ if (ranges[key]) {
+ from = ranges[key].from;
+ to = ranges[key].to;
+ break;
+ }
+ }
+ }
+
+ // backwards-compat stuff - to be removed in future
+ if (!ranges[key]) {
+ axis = coord == "x" ? xaxes[0] : yaxes[0];
+ from = ranges[coord + "1"];
+ to = ranges[coord + "2"];
+ }
+
+ // auto-reverse as an added bonus
+ if (from != null && to != null && from > to) {
+ var tmp = from;
+ from = to;
+ to = tmp;
+ }
+
+ return { from: from, to: to, axis: axis };
+ }
+
+ function drawBackground() {
+ ctx.save();
+ ctx.translate(plotOffset.left, plotOffset.top);
+
+ ctx.fillStyle = getColorOrGradient(options.grid.backgroundColor, plotHeight, 0, "rgba(255, 255, 255, 0)");
+ ctx.fillRect(0, 0, plotWidth, plotHeight);
+ ctx.restore();
+ }
+
+ function drawGrid() {
+ var i;
+
+ ctx.save();
+ ctx.translate(plotOffset.left, plotOffset.top);
+
+ // draw markings
+ var markings = options.grid.markings;
+ if (markings) {
+ if ($.isFunction(markings)) {
+ var axes = plot.getAxes();
+ // xmin etc. is backwards compatibility, to be
+ // removed in the future
+ axes.xmin = axes.xaxis.min;
+ axes.xmax = axes.xaxis.max;
+ axes.ymin = axes.yaxis.min;
+ axes.ymax = axes.yaxis.max;
+
+ markings = markings(axes);
+ }
+
+ for (i = 0; i < markings.length; ++i) {
+ var m = markings[i],
+ xrange = extractRange(m, "x"),
+ yrange = extractRange(m, "y");
+
+ // fill in missing
+ if (xrange.from == null)
+ xrange.from = xrange.axis.min;
+ if (xrange.to == null)
+ xrange.to = xrange.axis.max;
+ if (yrange.from == null)
+ yrange.from = yrange.axis.min;
+ if (yrange.to == null)
+ yrange.to = yrange.axis.max;
+
+ // clip
+ if (xrange.to < xrange.axis.min || xrange.from > xrange.axis.max ||
+ yrange.to < yrange.axis.min || yrange.from > yrange.axis.max)
+ continue;
+
+ xrange.from = Math.max(xrange.from, xrange.axis.min);
+ xrange.to = Math.min(xrange.to, xrange.axis.max);
+ yrange.from = Math.max(yrange.from, yrange.axis.min);
+ yrange.to = Math.min(yrange.to, yrange.axis.max);
+
+ if (xrange.from == xrange.to && yrange.from == yrange.to)
+ continue;
+
+ // then draw
+ xrange.from = xrange.axis.p2c(xrange.from);
+ xrange.to = xrange.axis.p2c(xrange.to);
+ yrange.from = yrange.axis.p2c(yrange.from);
+ yrange.to = yrange.axis.p2c(yrange.to);
+
+ if (xrange.from == xrange.to || yrange.from == yrange.to) {
+ // draw line
+ ctx.beginPath();
+ ctx.strokeStyle = m.color || options.grid.markingsColor;
+ ctx.lineWidth = m.lineWidth || options.grid.markingsLineWidth;
+ ctx.moveTo(xrange.from, yrange.from);
+ ctx.lineTo(xrange.to, yrange.to);
+ ctx.stroke();
+ }
+ else {
+ // fill area
+ ctx.fillStyle = m.color || options.grid.markingsColor;
+ ctx.fillRect(xrange.from, yrange.to,
+ xrange.to - xrange.from,
+ yrange.from - yrange.to);
+ }
+ }
+ }
+
+ // draw the ticks
+ var axes = allAxes(), bw = options.grid.borderWidth;
+
+ for (var j = 0; j < axes.length; ++j) {
+ var axis = axes[j], box = axis.box,
+ t = axis.tickLength, x, y, xoff, yoff;
+ if (!axis.show || axis.ticks.length == 0)
+ continue
+
+ ctx.strokeStyle = axis.options.tickColor || $.color.parse(axis.options.color).scale('a', 0.22).toString();
+ ctx.lineWidth = 1;
+
+ // find the edges
+ if (axis.direction == "x") {
+ x = 0;
+ if (t == "full")
+ y = (axis.position == "top" ? 0 : plotHeight);
+ else
+ y = box.top - plotOffset.top + (axis.position == "top" ? box.height : 0);
+ }
+ else {
+ y = 0;
+ if (t == "full")
+ x = (axis.position == "left" ? 0 : plotWidth);
+ else
+ x = box.left - plotOffset.left + (axis.position == "left" ? box.width : 0);
+ }
+
+ // draw tick bar
+ if (!axis.innermost) {
+ ctx.beginPath();
+ xoff = yoff = 0;
+ if (axis.direction == "x")
+ xoff = plotWidth;
+ else
+ yoff = plotHeight;
+
+ if (ctx.lineWidth == 1) {
+ x = Math.floor(x) + 0.5;
+ y = Math.floor(y) + 0.5;
+ }
+
+ ctx.moveTo(x, y);
+ ctx.lineTo(x + xoff, y + yoff);
+ ctx.stroke();
+ }
+
+ // draw ticks
+ ctx.beginPath();
+ for (i = 0; i < axis.ticks.length; ++i) {
+ var v = axis.ticks[i].v;
+
+ xoff = yoff = 0;
+
+ if (v < axis.min || v > axis.max
+ // skip those lying on the axes if we got a border
+ || (t == "full" && bw > 0
+ && (v == axis.min || v == axis.max)))
+ continue;
+
+ if (axis.direction == "x") {
+ x = axis.p2c(v);
+ yoff = t == "full" ? -plotHeight : t;
+
+ if (axis.position == "top")
+ yoff = -yoff;
+ }
+ else {
+ y = axis.p2c(v);
+ xoff = t == "full" ? -plotWidth : t;
+
+ if (axis.position == "left")
+ xoff = -xoff;
+ }
+
+ if (ctx.lineWidth == 1) {
+ if (axis.direction == "x")
+ x = Math.floor(x) + 0.5;
+ else
+ y = Math.floor(y) + 0.5;
+ }
+
+ ctx.moveTo(x, y);
+ ctx.lineTo(x + xoff, y + yoff);
+ }
+
+ ctx.stroke();
+ }
+
+
+ // draw border
+ if (bw) {
+ ctx.lineWidth = bw;
+ ctx.strokeStyle = options.grid.borderColor;
+ ctx.strokeRect(-bw/2, -bw/2, plotWidth + bw, plotHeight + bw);
+ }
+
+ ctx.restore();
+ }
+
+ function insertAxisLabels() {
+ placeholder.find(".tickLabels").remove();
+
+ var html = ['<div class="tickLabels" style="font-size:smaller">'];
+
+ var axes = allAxes();
+ for (var j = 0; j < axes.length; ++j) {
+ var axis = axes[j], box = axis.box;
+ if (!axis.show)
+ continue;
+ //debug: html.push('<div style="position:absolute;opacity:0.10;background-color:red;left:' + box.left + 'px;top:' + box.top + 'px;width:' + box.width + 'px;height:' + box.height + 'px"></div>')
+ html.push('<div class="' + axis.direction + 'Axis ' + axis.direction + axis.n + 'Axis" style="color:' + axis.options.color + '">');
+ for (var i = 0; i < axis.ticks.length; ++i) {
+ var tick = axis.ticks[i];
+ if (!tick.label || tick.v < axis.min || tick.v > axis.max)
+ continue;
+
+ var pos = {}, align;
+
+ if (axis.direction == "x") {
+ align = "center";
+ pos.left = Math.round(plotOffset.left + axis.p2c(tick.v) - axis.labelWidth/2);
+ if (axis.position == "bottom")
+ pos.top = box.top + box.padding;
+ else
+ pos.bottom = canvasHeight - (box.top + box.height - box.padding);
+ }
+ else {
+ pos.top = Math.round(plotOffset.top + axis.p2c(tick.v) - axis.labelHeight/2);
+ if (axis.position == "left") {
+ pos.right = canvasWidth - (box.left + box.width - box.padding)
+ align = "right";
+ }
+ else {
+ pos.left = box.left + box.padding;
+ align = "left";
+ }
+ }
+
+ pos.width = axis.labelWidth;
+
+ var style = ["position:absolute", "text-align:" + align ];
+ for (var a in pos)
+ style.push(a + ":" + pos[a] + "px")
+
+ html.push('<div class="tickLabel" style="' + style.join(';') + '">' + tick.label + '</div>');
+ }
+ html.push('</div>');
+ }
+
+ html.push('</div>');
+
+ placeholder.append(html.join(""));
+ }
+
+ function drawSeries(series) {
+ if (series.lines.show)
+ drawSeriesLines(series);
+ if (series.bars.show)
+ drawSeriesBars(series);
+ if (series.points.show)
+ drawSeriesPoints(series);
+ }
+
+ function drawSeriesLines(series) {
+ function plotLine(datapoints, xoffset, yoffset, axisx, axisy) {
+ var points = datapoints.points,
+ ps = datapoints.pointsize,
+ prevx = null, prevy = null;
+
+ ctx.beginPath();
+ for (var i = ps; i < points.length; i += ps) {
+ var x1 = points[i - ps], y1 = points[i - ps + 1],
+ x2 = points[i], y2 = points[i + 1];
+
+ if (x1 == null || x2 == null)
+ continue;
+
+ // clip with ymin
+ if (y1 <= y2 && y1 < axisy.min) {
+ if (y2 < axisy.min)
+ continue; // line segment is outside
+ // compute new intersection point
+ x1 = (axisy.min - y1) / (y2 - y1) * (x2 - x1) + x1;
+ y1 = axisy.min;
+ }
+ else if (y2 <= y1 && y2 < axisy.min) {
+ if (y1 < axisy.min)
+ continue;
+ x2 = (axisy.min - y1) / (y2 - y1) * (x2 - x1) + x1;
+ y2 = axisy.min;
+ }
+
+ // clip with ymax
+ if (y1 >= y2 && y1 > axisy.max) {
+ if (y2 > axisy.max)
+ continue;
+ x1 = (axisy.max - y1) / (y2 - y1) * (x2 - x1) + x1;
+ y1 = axisy.max;
+ }
+ else if (y2 >= y1 && y2 > axisy.max) {
+ if (y1 > axisy.max)
+ continue;
+ x2 = (axisy.max - y1) / (y2 - y1) * (x2 - x1) + x1;
+ y2 = axisy.max;
+ }
+
+ // clip with xmin
+ if (x1 <= x2 && x1 < axisx.min) {
+ if (x2 < axisx.min)
+ continue;
+ y1 = (axisx.min - x1) / (x2 - x1) * (y2 - y1) + y1;
+ x1 = axisx.min;
+ }
+ else if (x2 <= x1 && x2 < axisx.min) {
+ if (x1 < axisx.min)
+ continue;
+ y2 = (axisx.min - x1) / (x2 - x1) * (y2 - y1) + y1;
+ x2 = axisx.min;
+ }
+
+ // clip with xmax
+ if (x1 >= x2 && x1 > axisx.max) {
+ if (x2 > axisx.max)
+ continue;
+ y1 = (axisx.max - x1) / (x2 - x1) * (y2 - y1) + y1;
+ x1 = axisx.max;
+ }
+ else if (x2 >= x1 && x2 > axisx.max) {
+ if (x1 > axisx.max)
+ continue;
+ y2 = (axisx.max - x1) / (x2 - x1) * (y2 - y1) + y1;
+ x2 = axisx.max;
+ }
+
+ if (x1 != prevx || y1 != prevy)
+ ctx.moveTo(axisx.p2c(x1) + xoffset, axisy.p2c(y1) + yoffset);
+
+ prevx = x2;
+ prevy = y2;
+ ctx.lineTo(axisx.p2c(x2) + xoffset, axisy.p2c(y2) + yoffset);
+ }
+ ctx.stroke();
+ }
+
+ function plotLineArea(datapoints, axisx, axisy) {
+ var points = datapoints.points,
+ ps = datapoints.pointsize,
+ bottom = Math.min(Math.max(0, axisy.min), axisy.max),
+ i = 0, top, areaOpen = false,
+ ypos = 1, segmentStart = 0, segmentEnd = 0;
+
+ // we process each segment in two turns, first forward
+ // direction to sketch out top, then once we hit the
+ // end we go backwards to sketch the bottom
+ while (true) {
+ if (ps > 0 && i > points.length + ps)
+ break;
+
+ i += ps; // ps is negative if going backwards
+
+ var x1 = points[i - ps],
+ y1 = points[i - ps + ypos],
+ x2 = points[i], y2 = points[i + ypos];
+
+ if (areaOpen) {
+ if (ps > 0 && x1 != null && x2 == null) {
+ // at turning point
+ segmentEnd = i;
+ ps = -ps;
+ ypos = 2;
+ continue;
+ }
+
+ if (ps < 0 && i == segmentStart + ps) {
+ // done with the reverse sweep
+ ctx.fill();
+ areaOpen = false;
+ ps = -ps;
+ ypos = 1;
+ i = segmentStart = segmentEnd + ps;
+ continue;
+ }
+ }
+
+ if (x1 == null || x2 == null)
+ continue;
+
+ // clip x values
+
+ // clip with xmin
+ if (x1 <= x2 && x1 < axisx.min) {
+ if (x2 < axisx.min)
+ continue;
+ y1 = (axisx.min - x1) / (x2 - x1) * (y2 - y1) + y1;
+ x1 = axisx.min;
+ }
+ else if (x2 <= x1 && x2 < axisx.min) {
+ if (x1 < axisx.min)
+ continue;
+ y2 = (axisx.min - x1) / (x2 - x1) * (y2 - y1) + y1;
+ x2 = axisx.min;
+ }
+
+ // clip with xmax
+ if (x1 >= x2 && x1 > axisx.max) {
+ if (x2 > axisx.max)
+ continue;
+ y1 = (axisx.max - x1) / (x2 - x1) * (y2 - y1) + y1;
+ x1 = axisx.max;
+ }
+ else if (x2 >= x1 && x2 > axisx.max) {
+ if (x1 > axisx.max)
+ continue;
+ y2 = (axisx.max - x1) / (x2 - x1) * (y2 - y1) + y1;
+ x2 = axisx.max;
+ }
+
+ if (!areaOpen) {
+ // open area
+ ctx.beginPath();
+ ctx.moveTo(axisx.p2c(x1), axisy.p2c(bottom));
+ areaOpen = true;
+ }
+
+ // now first check the case where both is outside
+ if (y1 >= axisy.max && y2 >= axisy.max) {
+ ctx.lineTo(axisx.p2c(x1), axisy.p2c(axisy.max));
+ ctx.lineTo(axisx.p2c(x2), axisy.p2c(axisy.max));
+ continue;
+ }
+ else if (y1 <= axisy.min && y2 <= axisy.min) {
+ ctx.lineTo(axisx.p2c(x1), axisy.p2c(axisy.min));
+ ctx.lineTo(axisx.p2c(x2), axisy.p2c(axisy.min));
+ continue;
+ }
+
+ // else it's a bit more complicated, there might
+ // be a flat maxed out rectangle first, then a
+ // triangular cutout or reverse; to find these
+ // keep track of the current x values
+ var x1old = x1, x2old = x2;
+
+ // clip the y values, without shortcutting, we
+ // go through all cases in turn
+
+ // clip with ymin
+ if (y1 <= y2 && y1 < axisy.min && y2 >= axisy.min) {
+ x1 = (axisy.min - y1) / (y2 - y1) * (x2 - x1) + x1;
+ y1 = axisy.min;
+ }
+ else if (y2 <= y1 && y2 < axisy.min && y1 >= axisy.min) {
+ x2 = (axisy.min - y1) / (y2 - y1) * (x2 - x1) + x1;
+ y2 = axisy.min;
+ }
+
+ // clip with ymax
+ if (y1 >= y2 && y1 > axisy.max && y2 <= axisy.max) {
+ x1 = (axisy.max - y1) / (y2 - y1) * (x2 - x1) + x1;
+ y1 = axisy.max;
+ }
+ else if (y2 >= y1 && y2 > axisy.max && y1 <= axisy.max) {
+ x2 = (axisy.max - y1) / (y2 - y1) * (x2 - x1) + x1;
+ y2 = axisy.max;
+ }
+
+ // if the x value was changed we got a rectangle
+ // to fill
+ if (x1 != x1old) {
+ ctx.lineTo(axisx.p2c(x1old), axisy.p2c(y1));
+ // it goes to (x1, y1), but we fill that below
+ }
+
+ // fill triangular section, this sometimes result
+ // in redundant points if (x1, y1) hasn't changed
+ // from previous line to, but we just ignore that
+ ctx.lineTo(axisx.p2c(x1), axisy.p2c(y1));
+ ctx.lineTo(axisx.p2c(x2), axisy.p2c(y2));
+
+ // fill the other rectangle if it's there
+ if (x2 != x2old) {
+ ctx.lineTo(axisx.p2c(x2), axisy.p2c(y2));
+ ctx.lineTo(axisx.p2c(x2old), axisy.p2c(y2));
+ }
+ }
+ }
+
+ ctx.save();
+ ctx.translate(plotOffset.left, plotOffset.top);
+ ctx.lineJoin = "round";
+
+ var lw = series.lines.lineWidth,
+ sw = series.shadowSize;
+ // FIXME: consider another form of shadow when filling is turned on
+ if (lw > 0 && sw > 0) {
+ // draw shadow as a thick and thin line with transparency
+ ctx.lineWidth = sw;
+ ctx.strokeStyle = "rgba(0,0,0,0.1)";
+ // position shadow at angle from the mid of line
+ var angle = Math.PI/18;
+ plotLine(series.datapoints, Math.sin(angle) * (lw/2 + sw/2), Math.cos(angle) * (lw/2 + sw/2), series.xaxis, series.yaxis);
+ ctx.lineWidth = sw/2;
+ plotLine(series.datapoints, Math.sin(angle) * (lw/2 + sw/4), Math.cos(angle) * (lw/2 + sw/4), series.xaxis, series.yaxis);
+ }
+
+ ctx.lineWidth = lw;
+ ctx.strokeStyle = series.color;
+ var fillStyle = getFillStyle(series.lines, series.color, 0, plotHeight);
+ if (fillStyle) {
+ ctx.fillStyle = fillStyle;
+ plotLineArea(series.datapoints, series.xaxis, series.yaxis);
+ }
+
+ if (lw > 0)
+ plotLine(series.datapoints, 0, 0, series.xaxis, series.yaxis);
+ ctx.restore();
+ }
+
+ function drawSeriesPoints(series) {
+ function plotPoints(datapoints, radius, fillStyle, offset, shadow, axisx, axisy, symbol) {
+ var points = datapoints.points, ps = datapoints.pointsize;
+
+ for (var i = 0; i < points.length; i += ps) {
+ var x = points[i], y = points[i + 1];
+ if (x == null || x < axisx.min || x > axisx.max || y < axisy.min || y > axisy.max)
+ continue;
+
+ ctx.beginPath();
+ x = axisx.p2c(x);
+ y = axisy.p2c(y) + offset;
+ if (symbol == "circle")
+ ctx.arc(x, y, radius, 0, shadow ? Math.PI : Math.PI * 2, false);
+ else
+ symbol(ctx, x, y, radius, shadow);
+ ctx.closePath();
+
+ if (fillStyle) {
+ ctx.fillStyle = fillStyle;
+ ctx.fill();
+ }
+ ctx.stroke();
+ }
+ }
+
+ ctx.save();
+ ctx.translate(plotOffset.left, plotOffset.top);
+
+ var lw = series.points.lineWidth,
+ sw = series.shadowSize,
+ radius = series.points.radius,
+ symbol = series.points.symbol;
+ if (lw > 0 && sw > 0) {
+ // draw shadow in two steps
+ var w = sw / 2;
+ ctx.lineWidth = w;
+ ctx.strokeStyle = "rgba(0,0,0,0.1)";
+ plotPoints(series.datapoints, radius, null, w + w/2, true,
+ series.xaxis, series.yaxis, symbol);
+
+ ctx.strokeStyle = "rgba(0,0,0,0.2)";
+ plotPoints(series.datapoints, radius, null, w/2, true,
+ series.xaxis, series.yaxis, symbol);
+ }
+
+ ctx.lineWidth = lw;
+ ctx.strokeStyle = series.color;
+ plotPoints(series.datapoints, radius,
+ getFillStyle(series.points, series.color), 0, false,
+ series.xaxis, series.yaxis, symbol);
+ ctx.restore();
+ }
+
+ function drawBar(x, y, b, barLeft, barRight, offset, fillStyleCallback, axisx, axisy, c, horizontal, lineWidth) {
+ var left, right, bottom, top,
+ drawLeft, drawRight, drawTop, drawBottom,
+ tmp;
+
+ // in horizontal mode, we start the bar from the left
+ // instead of from the bottom so it appears to be
+ // horizontal rather than vertical
+ if (horizontal) {
+ drawBottom = drawRight = drawTop = true;
+ drawLeft = false;
+ left = b;
+ right = x;
+ top = y + barLeft;
+ bottom = y + barRight;
+
+ // account for negative bars
+ if (right < left) {
+ tmp = right;
+ right = left;
+ left = tmp;
+ drawLeft = true;
+ drawRight = false;
+ }
+ }
+ else {
+ drawLeft = drawRight = drawTop = true;
+ drawBottom = false;
+ left = x + barLeft;
+ right = x + barRight;
+ bottom = b;
+ top = y;
+
+ // account for negative bars
+ if (top < bottom) {
+ tmp = top;
+ top = bottom;
+ bottom = tmp;
+ drawBottom = true;
+ drawTop = false;
+ }
+ }
+
+ // clip
+ if (right < axisx.min || left > axisx.max ||
+ top < axisy.min || bottom > axisy.max)
+ return;
+
+ if (left < axisx.min) {
+ left = axisx.min;
+ drawLeft = false;
+ }
+
+ if (right > axisx.max) {
+ right = axisx.max;
+ drawRight = false;
+ }
+
+ if (bottom < axisy.min) {
+ bottom = axisy.min;
+ drawBottom = false;
+ }
+
+ if (top > axisy.max) {
+ top = axisy.max;
+ drawTop = false;
+ }
+
+ left = axisx.p2c(left);
+ bottom = axisy.p2c(bottom);
+ right = axisx.p2c(right);
+ top = axisy.p2c(top);
+
+ // fill the bar
+ if (fillStyleCallback) {
+ c.beginPath();
+ c.moveTo(left, bottom);
+ c.lineTo(left, top);
+ c.lineTo(right, top);
+ c.lineTo(right, bottom);
+ c.fillStyle = fillStyleCallback(bottom, top);
+ c.fill();
+ }
+
+ // draw outline
+ if (lineWidth > 0 && (drawLeft || drawRight || drawTop || drawBottom)) {
+ c.beginPath();
+
+ // FIXME: inline moveTo is buggy with excanvas
+ c.moveTo(left, bottom + offset);
+ if (drawLeft)
+ c.lineTo(left, top + offset);
+ else
+ c.moveTo(left, top + offset);
+ if (drawTop)
+ c.lineTo(right, top + offset);
+ else
+ c.moveTo(right, top + offset);
+ if (drawRight)
+ c.lineTo(right, bottom + offset);
+ else
+ c.moveTo(right, bottom + offset);
+ if (drawBottom)
+ c.lineTo(left, bottom + offset);
+ else
+ c.moveTo(left, bottom + offset);
+ c.stroke();
+ }
+ }
+
+ function drawSeriesBars(series) {
+ function plotBars(datapoints, barLeft, barRight, offset, fillStyleCallback, axisx, axisy) {
+ var points = datapoints.points, ps = datapoints.pointsize;
+
+ for (var i = 0; i < points.length; i += ps) {
+ if (points[i] == null)
+ continue;
+ drawBar(points[i], points[i + 1], points[i + 2], barLeft, barRight, offset, fillStyleCallback, axisx, axisy, ctx, series.bars.horizontal, series.bars.lineWidth);
+ }
+ }
+
+ ctx.save();
+ ctx.translate(plotOffset.left, plotOffset.top);
+
+ // FIXME: figure out a way to add shadows (for instance along the right edge)
+ ctx.lineWidth = series.bars.lineWidth;
+ ctx.strokeStyle = series.color;
+ var barLeft = series.bars.align == "left" ? 0 : -series.bars.barWidth/2;
+ var fillStyleCallback = series.bars.fill ? function (bottom, top) { return getFillStyle(series.bars, series.color, bottom, top); } : null;
+ plotBars(series.datapoints, barLeft, barLeft + series.bars.barWidth, 0, fillStyleCallback, series.xaxis, series.yaxis);
+ ctx.restore();
+ }
+
+ function getFillStyle(filloptions, seriesColor, bottom, top) {
+ var fill = filloptions.fill;
+ if (!fill)
+ return null;
+
+ if (filloptions.fillColor)
+ return getColorOrGradient(filloptions.fillColor, bottom, top, seriesColor);
+
+ var c = $.color.parse(seriesColor);
+ c.a = typeof fill == "number" ? fill : 0.4;
+ c.normalize();
+ return c.toString();
+ }
+
+ function insertLegend() {
+ placeholder.find(".legend").remove();
+
+ if (!options.legend.show)
+ return;
+
+ var fragments = [], rowStarted = false,
+ lf = options.legend.labelFormatter, s, label;
+ for (var i = 0; i < series.length; ++i) {
+ s = series[i];
+ label = s.label;
+ if (!label)
+ continue;
+
+ if (i % options.legend.noColumns == 0) {
+ if (rowStarted)
+ fragments.push('</tr>');
+ fragments.push('<tr>');
+ rowStarted = true;
+ }
+
+ if (lf)
+ label = lf(label, s);
+
+ fragments.push(
+ '<td class="legendColorBox"><div style="border:1px solid ' + options.legend.labelBoxBorderColor + ';padding:1px"><div style="width:4px;height:0;border:5px solid ' + s.color + ';overflow:hidden"></div></div></td>' +
+ '<td class="legendLabel">' + label + '</td>');
+ }
+ if (rowStarted)
+ fragments.push('</tr>');
+
+ if (fragments.length == 0)
+ return;
+
+ var table = '<table style="font-size:smaller;color:' + options.grid.color + '">' + fragments.join("") + '</table>';
+ if (options.legend.container != null)
+ $(options.legend.container).html(table);
+ else {
+ var pos = "",
+ p = options.legend.position,
+ m = options.legend.margin;
+ if (m[0] == null)
+ m = [m, m];
+ if (p.charAt(0) == "n")
+ pos += 'top:' + (m[1] + plotOffset.top) + 'px;';
+ else if (p.charAt(0) == "s")
+ pos += 'bottom:' + (m[1] + plotOffset.bottom) + 'px;';
+ if (p.charAt(1) == "e")
+ pos += 'right:' + (m[0] + plotOffset.right) + 'px;';
+ else if (p.charAt(1) == "w")
+ pos += 'left:' + (m[0] + plotOffset.left) + 'px;';
+ var legend = $('<div class="legend">' + table.replace('style="', 'style="position:absolute;' + pos +';') + '</div>').appendTo(placeholder);
+ if (options.legend.backgroundOpacity != 0.0) {
+ // put in the transparent background
+ // separately to avoid blended labels and
+ // label boxes
+ var c = options.legend.backgroundColor;
+ if (c == null) {
+ c = options.grid.backgroundColor;
+ if (c && typeof c == "string")
+ c = $.color.parse(c);
+ else
+ c = $.color.extract(legend, 'background-color');
+ c.a = 1;
+ c = c.toString();
+ }
+ var div = legend.children();
+ $('<div style="position:absolute;width:' + div.width() + 'px;height:' + div.height() + 'px;' + pos +'background-color:' + c + ';"> </div>').prependTo(legend).css('opacity', options.legend.backgroundOpacity);
+ }
+ }
+ }
+
+
+ // interactive features
+
+ var highlights = [],
+ redrawTimeout = null;
+
+ // returns the data item the mouse is over, or null if none is found
+ function findNearbyItem(mouseX, mouseY, seriesFilter) {
+ var maxDistance = options.grid.mouseActiveRadius,
+ smallestDistance = maxDistance * maxDistance + 1,
+ item = null, foundPoint = false, i, j;
+
+ for (i = series.length - 1; i >= 0; --i) {
+ if (!seriesFilter(series[i]))
+ continue;
+
+ var s = series[i],
+ axisx = s.xaxis,
+ axisy = s.yaxis,
+ points = s.datapoints.points,
+ ps = s.datapoints.pointsize,
+ mx = axisx.c2p(mouseX), // precompute some stuff to make the loop faster
+ my = axisy.c2p(mouseY),
+ maxx = maxDistance / axisx.scale,
+ maxy = maxDistance / axisy.scale;
+
+ // with inverse transforms, we can't use the maxx/maxy
+ // optimization, sadly
+ if (axisx.options.inverseTransform)
+ maxx = Number.MAX_VALUE;
+ if (axisy.options.inverseTransform)
+ maxy = Number.MAX_VALUE;
+
+ if (s.lines.show || s.points.show) {
+ for (j = 0; j < points.length; j += ps) {
+ var x = points[j], y = points[j + 1];
+ if (x == null)
+ continue;
+
+ // For points and lines, the cursor must be within a
+ // certain distance to the data point
+ if (x - mx > maxx || x - mx < -maxx ||
+ y - my > maxy || y - my < -maxy)
+ continue;
+
+ // We have to calculate distances in pixels, not in
+ // data units, because the scales of the axes may be different
+ var dx = Math.abs(axisx.p2c(x) - mouseX),
+ dy = Math.abs(axisy.p2c(y) - mouseY),
+ dist = dx * dx + dy * dy; // we save the sqrt
+
+ // use <= to ensure last point takes precedence
+ // (last generally means on top of)
+ if (dist < smallestDistance) {
+ smallestDistance = dist;
+ item = [i, j / ps];
+ }
+ }
+ }
+
+ if (s.bars.show && !item) { // no other point can be nearby
+ var barLeft = s.bars.align == "left" ? 0 : -s.bars.barWidth/2,
+ barRight = barLeft + s.bars.barWidth;
+
+ for (j = 0; j < points.length; j += ps) {
+ var x = points[j], y = points[j + 1], b = points[j + 2];
+ if (x == null)
+ continue;
+
+ // for a bar graph, the cursor must be inside the bar
+ if (series[i].bars.horizontal ?
+ (mx <= Math.max(b, x) && mx >= Math.min(b, x) &&
+ my >= y + barLeft && my <= y + barRight) :
+ (mx >= x + barLeft && mx <= x + barRight &&
+ my >= Math.min(b, y) && my <= Math.max(b, y)))
+ item = [i, j / ps];
+ }
+ }
+ }
+
+ if (item) {
+ i = item[0];
+ j = item[1];
+ ps = series[i].datapoints.pointsize;
+
+ return { datapoint: series[i].datapoints.points.slice(j * ps, (j + 1) * ps),
+ dataIndex: j,
+ series: series[i],
+ seriesIndex: i };
+ }
+
+ return null;
+ }
+
+ function onMouseMove(e) {
+ if (options.grid.hoverable)
+ triggerClickHoverEvent("plothover", e,
+ function (s) { return s["hoverable"] != false; });
+ }
+
+ function onMouseLeave(e) {
+ if (options.grid.hoverable)
+ triggerClickHoverEvent("plothover", e,
+ function (s) { return false; });
+ }
+
+ function onClick(e) {
+ triggerClickHoverEvent("plotclick", e,
+ function (s) { return s["clickable"] != false; });
+ }
+
+ // trigger click or hover event (they send the same parameters
+ // so we share their code)
+ function triggerClickHoverEvent(eventname, event, seriesFilter) {
+ var offset = eventHolder.offset(),
+ canvasX = event.pageX - offset.left - plotOffset.left,
+ canvasY = event.pageY - offset.top - plotOffset.top,
+ pos = canvasToAxisCoords({ left: canvasX, top: canvasY });
+
+ pos.pageX = event.pageX;
+ pos.pageY = event.pageY;
+
+ var item = findNearbyItem(canvasX, canvasY, seriesFilter);
+
+ if (item) {
+ // fill in mouse pos for any listeners out there
+ item.pageX = parseInt(item.series.xaxis.p2c(item.datapoint[0]) + offset.left + plotOffset.left);
+ item.pageY = parseInt(item.series.yaxis.p2c(item.datapoint[1]) + offset.top + plotOffset.top);
+ }
+
+ if (options.grid.autoHighlight) {
+ // clear auto-highlights
+ for (var i = 0; i < highlights.length; ++i) {
+ var h = highlights[i];
+ if (h.auto == eventname &&
+ !(item && h.series == item.series &&
+ h.point[0] == item.datapoint[0] &&
+ h.point[1] == item.datapoint[1]))
+ unhighlight(h.series, h.point);
+ }
+
+ if (item)
+ highlight(item.series, item.datapoint, eventname);
+ }
+
+ placeholder.trigger(eventname, [ pos, item ]);
+ }
+
+ function triggerRedrawOverlay() {
+ if (!redrawTimeout)
+ redrawTimeout = setTimeout(drawOverlay, 30);
+ }
+
+ function drawOverlay() {
+ redrawTimeout = null;
+
+ // draw highlights
+ octx.save();
+ octx.clearRect(0, 0, canvasWidth, canvasHeight);
+ octx.translate(plotOffset.left, plotOffset.top);
+
+ var i, hi;
+ for (i = 0; i < highlights.length; ++i) {
+ hi = highlights[i];
+
+ if (hi.series.bars.show)
+ drawBarHighlight(hi.series, hi.point);
+ else
+ drawPointHighlight(hi.series, hi.point);
+ }
+ octx.restore();
+
+ executeHooks(hooks.drawOverlay, [octx]);
+ }
+
+ function highlight(s, point, auto) {
+ if (typeof s == "number")
+ s = series[s];
+
+ if (typeof point == "number") {
+ var ps = s.datapoints.pointsize;
+ point = s.datapoints.points.slice(ps * point, ps * (point + 1));
+ }
+
+ var i = indexOfHighlight(s, point);
+ if (i == -1) {
+ highlights.push({ series: s, point: point, auto: auto });
+
+ triggerRedrawOverlay();
+ }
+ else if (!auto)
+ highlights[i].auto = false;
+ }
+
+ function unhighlight(s, point) {
+ if (s == null && point == null) {
+ highlights = [];
+ triggerRedrawOverlay();
+ }
+
+ if (typeof s == "number")
+ s = series[s];
+
+ if (typeof point == "number")
+ point = s.data[point];
+
+ var i = indexOfHighlight(s, point);
+ if (i != -1) {
+ highlights.splice(i, 1);
+
+ triggerRedrawOverlay();
+ }
+ }
+
+ function indexOfHighlight(s, p) {
+ for (var i = 0; i < highlights.length; ++i) {
+ var h = highlights[i];
+ if (h.series == s && h.point[0] == p[0]
+ && h.point[1] == p[1])
+ return i;
+ }
+ return -1;
+ }
+
+ function drawPointHighlight(series, point) {
+ var x = point[0], y = point[1],
+ axisx = series.xaxis, axisy = series.yaxis;
+
+ if (x < axisx.min || x > axisx.max || y < axisy.min || y > axisy.max)
+ return;
+
+ var pointRadius = series.points.radius + series.points.lineWidth / 2;
+ octx.lineWidth = pointRadius;
+ octx.strokeStyle = $.color.parse(series.color).scale('a', 0.5).toString();
+ var radius = 1.5 * pointRadius,
+ x = axisx.p2c(x),
+ y = axisy.p2c(y);
+
+ octx.beginPath();
+ if (series.points.symbol == "circle")
+ octx.arc(x, y, radius, 0, 2 * Math.PI, false);
+ else
+ series.points.symbol(octx, x, y, radius, false);
+ octx.closePath();
+ octx.stroke();
+ }
+
+ function drawBarHighlight(series, point) {
+ octx.lineWidth = series.bars.lineWidth;
+ octx.strokeStyle = $.color.parse(series.color).scale('a', 0.5).toString();
+ var fillStyle = $.color.parse(series.color).scale('a', 0.5).toString();
+ var barLeft = series.bars.align == "left" ? 0 : -series.bars.barWidth/2;
+ drawBar(point[0], point[1], point[2] || 0, barLeft, barLeft + series.bars.barWidth,
+ 0, function () { return fillStyle; }, series.xaxis, series.yaxis, octx, series.bars.horizontal, series.bars.lineWidth);
+ }
+
+ function getColorOrGradient(spec, bottom, top, defaultColor) {
+ if (typeof spec == "string")
+ return spec;
+ else {
+ // assume this is a gradient spec; IE currently only
+ // supports a simple vertical gradient properly, so that's
+ // what we support too
+ var gradient = ctx.createLinearGradient(0, top, 0, bottom);
+
+ for (var i = 0, l = spec.colors.length; i < l; ++i) {
+ var c = spec.colors[i];
+ if (typeof c != "string") {
+ var co = $.color.parse(defaultColor);
+ if (c.brightness != null)
+ co = co.scale('rgb', c.brightness)
+ if (c.opacity != null)
+ co.a *= c.opacity;
+ c = co.toString();
+ }
+ gradient.addColorStop(i / (l - 1), c);
+ }
+
+ return gradient;
+ }
+ }
+ }
+
+ $.plot = function(placeholder, data, options) {
+ //var t0 = new Date();
+ var plot = new Plot($(placeholder), data, options, $.plot.plugins);
+ //(window.console ? console.log : alert)("time used (msecs): " + ((new Date()).getTime() - t0.getTime()));
+ return plot;
+ };
+
+ $.plot.version = "0.7";
+
+ $.plot.plugins = [];
+
+ // returns a string with the date d formatted according to fmt
+ $.plot.formatDate = function(d, fmt, monthNames) {
+ var leftPad = function(n) {
+ n = "" + n;
+ return n.length == 1 ? "0" + n : n;
+ };
+
+ var r = [];
+ var escape = false, padNext = false;
+ var hours = d.getUTCHours();
+ var isAM = hours < 12;
+ if (monthNames == null)
+ monthNames = ["Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug", "Sep", "Oct", "Nov", "Dec"];
+
+ if (fmt.search(/%p|%P/) != -1) {
+ if (hours > 12) {
+ hours = hours - 12;
+ } else if (hours == 0) {
+ hours = 12;
+ }
+ }
+ for (var i = 0; i < fmt.length; ++i) {
+ var c = fmt.charAt(i);
+
+ if (escape) {
+ switch (c) {
+ case 'h': c = "" + hours; break;
+ case 'H': c = leftPad(hours); break;
+ case 'M': c = leftPad(d.getUTCMinutes()); break;
+ case 'S': c = leftPad(d.getUTCSeconds()); break;
+ case 'd': c = "" + d.getUTCDate(); break;
+ case 'm': c = "" + (d.getUTCMonth() + 1); break;
+ case 'y': c = "" + d.getUTCFullYear(); break;
+ case 'b': c = "" + monthNames[d.getUTCMonth()]; break;
+ case 'p': c = (isAM) ? ("" + "am") : ("" + "pm"); break;
+ case 'P': c = (isAM) ? ("" + "AM") : ("" + "PM"); break;
+ case '0': c = ""; padNext = true; break;
+ }
+ if (c && padNext) {
+ c = leftPad(c);
+ padNext = false;
+ }
+ r.push(c);
+ if (!padNext)
+ escape = false;
+ }
+ else {
+ if (c == "%")
+ escape = true;
+ else
+ r.push(c);
+ }
+ }
+ return r.join("");
+ };
+
+ // round to nearby lower multiple of base
+ function floorInBase(n, base) {
+ return base * Math.floor(n / base);
+ }
+
+})(jQuery);
+
--- /dev/null
+++ b/js/flot/jquery.flot.min.js
@@ -1,1 +1,6 @@
-
+/* Javascript plotting library for jQuery, v. 0.7.
+ *
+ * Released under the MIT license by IOLA, December 2007.
+ *
+ */
+(function(b){b.color={};b.color.make=function(d,e,g,f){var c={};c.r=d||0;c.g=e||0;c.b=g||0;c.a=f!=null?f:1;c.add=function(h,j){for(var k=0;k<h.length;++k){c[h.charAt(k)]+=j}return c.normalize()};c.scale=function(h,j){for(var k=0;k<h.length;++k){c[h.charAt(k)]*=j}return c.normalize()};c.toString=function(){if(c.a>=1){return"rgb("+[c.r,c.g,c.b].join(",")+")"}else{return"rgba("+[c.r,c.g,c.b,c.a].join(",")+")"}};c.normalize=function(){function h(k,j,l){return j<k?k:(j>l?l:j)}c.r=h(0,parseInt(c.r),255);c.g=h(0,parseInt(c.g),255);c.b=h(0,parseInt(c.b),255);c.a=h(0,c.a,1);return c};c.clone=function(){return b.color.make(c.r,c.b,c.g,c.a)};return c.normalize()};b.color.extract=function(d,e){var c;do{c=d.css(e).toLowerCase();if(c!=""&&c!="transparent"){break}d=d.parent()}while(!b.nodeName(d.get(0),"body"));if(c=="rgba(0, 0, 0, 0)"){c="transparent"}return b.color.parse(c)};b.color.parse=function(c){var d,f=b.color.make;if(d=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(c)){return f(parseInt(d[1],10),parseInt(d[2],10),parseInt(d[3],10))}if(d=/rgba\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(c)){return f(parseInt(d[1],10),parseInt(d[2],10),parseInt(d[3],10),parseFloat(d[4]))}if(d=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(c)){return f(parseFloat(d[1])*2.55,parseFloat(d[2])*2.55,parseFloat(d[3])*2.55)}if(d=/rgba\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(c)){return f(parseFloat(d[1])*2.55,parseFloat(d[2])*2.55,parseFloat(d[3])*2.55,parseFloat(d[4]))}if(d=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(c)){return f(parseInt(d[1],16),parseInt(d[2],16),parseInt(d[3],16))}if(d=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(c)){return f(parseInt(d[1]+d[1],16),parseInt(d[2]+d[2],16),parseInt(d[3]+d[3],16))}var e=b.trim(c).toLowerCase();if(e=="transparent"){return f(255,255,255,0)}else{d=a[e]||[0,0,0];return f(d[0],d[1],d[2])}};var a={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0]}})(jQuery);(function(c){function b(av,ai,J,af){var Q=[],O={colors:["#edc240","#afd8f8","#cb4b4b","#4da74d","#9440ed"],legend:{show:true,noColumns:1,labelFormatter:null,labelBoxBorderColor:"#ccc",container:null,position:"ne",margin:5,backgroundColor:null,backgroundOpacity:0.85},xaxis:{show:null,position:"bottom",mode:null,color:null,tickColor:null,transform:null,inverseTransform:null,min:null,max:null,autoscaleMargin:null,ticks:null,tickFormatter:null,labelWidth:null,labelHeight:null,reserveSpace:null,tickLength:null,alignTicksWithAxis:null,tickDecimals:null,tickSize:null,minTickSize:null,monthNames:null,timeformat:null,twelveHourClock:false},yaxis:{autoscaleMargin:0.02,position:"left"},xaxes:[],yaxes:[],series:{points:{show:false,radius:3,lineWidth:2,fill:true,fillColor:"#ffffff",symbol:"circle"},lines:{lineWidth:2,fill:false,fillColor:null,steps:false},bars:{show:false,lineWidth:2,barWidth:1,fill:true,fillColor:null,align:"left",horizontal:false},shadowSize:3},grid:{show:true,aboveData:false,color:"#545454",backgroundColor:null,borderColor:null,tickColor:null,labelMargin:5,axisMargin:8,borderWidth:2,minBorderMargin:null,markings:null,markingsColor:"#f4f4f4",markingsLineWidth:2,clickable:false,hoverable:false,autoHighlight:true,mouseActiveRadius:10},hooks:{}},az=null,ad=null,y=null,H=null,A=null,p=[],aw=[],q={left:0,right:0,top:0,bottom:0},G=0,I=0,h=0,w=0,ak={processOptions:[],processRawData:[],processDatapoints:[],drawSeries:[],draw:[],bindEvents:[],drawOverlay:[],shutdown:[]},aq=this;aq.setData=aj;aq.setupGrid=t;aq.draw=W;aq.getPlaceholder=function(){return av};aq.getCanvas=function(){return az};aq.getPlotOffset=function(){return q};aq.width=function(){return h};aq.height=function(){return w};aq.offset=function(){var aB=y.offset();aB.left+=q.left;aB.top+=q.top;return aB};aq.getData=function(){return Q};aq.getAxes=function(){var aC={},aB;c.each(p.concat(aw),function(aD,aE){if(aE){aC[aE.direction+(aE.n!=1?aE.n:"")+"axis"]=aE}});return aC};aq.getXAxes=function(){return p};aq.getYAxes=function(){return aw};aq.c2p=C;aq.p2c=ar;aq.getOptions=function(){return O};aq.highlight=x;aq.unhighlight=T;aq.triggerRedrawOverlay=f;aq.pointOffset=function(aB){return{left:parseInt(p[aA(aB,"x")-1].p2c(+aB.x)+q.left),top:parseInt(aw[aA(aB,"y")-1].p2c(+aB.y)+q.top)}};aq.shutdown=ag;aq.resize=function(){B();g(az);g(ad)};aq.hooks=ak;F(aq);Z(J);X();aj(ai);t();W();ah();function an(aD,aB){aB=[aq].concat(aB);for(var aC=0;aC<aD.length;++aC){aD[aC].apply(this,aB)}}function F(){for(var aB=0;aB<af.length;++aB){var aC=af[aB];aC.init(aq);if(aC.options){c.extend(true,O,aC.options)}}}function Z(aC){var aB;c.extend(true,O,aC);if(O.xaxis.color==null){O.xaxis.color=O.grid.color}if(O.yaxis.color==null){O.yaxis.color=O.grid.color}if(O.xaxis.tickColor==null){O.xaxis.tickColor=O.grid.tickColor}if(O.yaxis.tickColor==null){O.yaxis.tickColor=O.grid.tickColor}if(O.grid.borderColor==null){O.grid.borderColor=O.grid.color}if(O.grid.tickColor==null){O.grid.tickColor=c.color.parse(O.grid.color).scale("a",0.22).toString()}for(aB=0;aB<Math.max(1,O.xaxes.length);++aB){O.xaxes[aB]=c.extend(true,{},O.xaxis,O.xaxes[aB])}for(aB=0;aB<Math.max(1,O.yaxes.length);++aB){O.yaxes[aB]=c.extend(true,{},O.yaxis,O.yaxes[aB])}if(O.xaxis.noTicks&&O.xaxis.ticks==null){O.xaxis.ticks=O.xaxis.noTicks}if(O.yaxis.noTicks&&O.yaxis.ticks==null){O.yaxis.ticks=O.yaxis.noTicks}if(O.x2axis){O.xaxes[1]=c.extend(true,{},O.xaxis,O.x2axis);O.xaxes[1].position="top"}if(O.y2axis){O.yaxes[1]=c.extend(true,{},O.yaxis,O.y2axis);O.yaxes[1].position="right"}if(O.grid.coloredAreas){O.grid.markings=O.grid.coloredAreas}if(O.grid.coloredAreasColor){O.grid.markingsColor=O.grid.coloredAreasColor}if(O.lines){c.extend(true,O.series.lines,O.lines)}if(O.points){c.extend(true,O.series.points,O.points)}if(O.bars){c.extend(true,O.series.bars,O.bars)}if(O.shadowSize!=null){O.series.shadowSize=O.shadowSize}for(aB=0;aB<O.xaxes.length;++aB){V(p,aB+1).options=O.xaxes[aB]}for(aB=0;aB<O.yaxes.length;++aB){V(aw,aB+1).options=O.yaxes[aB]}for(var aD in ak){if(O.hooks[aD]&&O.hooks[aD].length){ak[aD]=ak[aD].concat(O.hooks[aD])}}an(ak.processOptions,[O])}function aj(aB){Q=Y(aB);ax();z()}function Y(aE){var aC=[];for(var aB=0;aB<aE.length;++aB){var aD=c.extend(true,{},O.series);if(aE[aB].data!=null){aD.data=aE[aB].data;delete aE[aB].data;c.extend(true,aD,aE[aB]);aE[aB].data=aD.data}else{aD.data=aE[aB]}aC.push(aD)}return aC}function aA(aC,aD){var aB=aC[aD+"axis"];if(typeof aB=="object"){aB=aB.n}if(typeof aB!="number"){aB=1}return aB}function m(){return c.grep(p.concat(aw),function(aB){return aB})}function C(aE){var aC={},aB,aD;for(aB=0;aB<p.length;++aB){aD=p[aB];if(aD&&aD.used){aC["x"+aD.n]=aD.c2p(aE.left)}}for(aB=0;aB<aw.length;++aB){aD=aw[aB];if(aD&&aD.used){aC["y"+aD.n]=aD.c2p(aE.top)}}if(aC.x1!==undefined){aC.x=aC.x1}if(aC.y1!==undefined){aC.y=aC.y1}return aC}function ar(aF){var aD={},aC,aE,aB;for(aC=0;aC<p.length;++aC){aE=p[aC];if(aE&&aE.used){aB="x"+aE.n;if(aF[aB]==null&&aE.n==1){aB="x"}if(aF[aB]!=null){aD.left=aE.p2c(aF[aB]);break}}}for(aC=0;aC<aw.length;++aC){aE=aw[aC];if(aE&&aE.used){aB="y"+aE.n;if(aF[aB]==null&&aE.n==1){aB="y"}if(aF[aB]!=null){aD.top=aE.p2c(aF[aB]);break}}}return aD}function V(aC,aB){if(!aC[aB-1]){aC[aB-1]={n:aB,direction:aC==p?"x":"y",options:c.extend(true,{},aC==p?O.xaxis:O.yaxis)}}return aC[aB-1]}function ax(){var aG;var aM=Q.length,aB=[],aE=[];for(aG=0;aG<Q.length;++aG){var aJ=Q[aG].color;if(aJ!=null){--aM;if(typeof aJ=="number"){aE.push(aJ)}else{aB.push(c.color.parse(Q[aG].color))}}}for(aG=0;aG<aE.length;++aG){aM=Math.max(aM,aE[aG]+1)}var aC=[],aF=0;aG=0;while(aC.length<aM){var aI;if(O.colors.length==aG){aI=c.color.make(100,100,100)}else{aI=c.color.parse(O.colors[aG])}var aD=aF%2==1?-1:1;aI.scale("rgb",1+aD*Math.ceil(aF/2)*0.2);aC.push(aI);++aG;if(aG>=O.colors.length){aG=0;++aF}}var aH=0,aN;for(aG=0;aG<Q.length;++aG){aN=Q[aG];if(aN.color==null){aN.color=aC[aH].toString();++aH}else{if(typeof aN.color=="number"){aN.color=aC[aN.color].toString()}}if(aN.lines.show==null){var aL,aK=true;for(aL in aN){if(aN[aL]&&aN[aL].show){aK=false;break}}if(aK){aN.lines.show=true}}aN.xaxis=V(p,aA(aN,"x"));aN.yaxis=V(aw,aA(aN,"y"))}}function z(){var aO=Number.POSITIVE_INFINITY,aI=Number.NEGATIVE_INFINITY,aB=Number.MAX_VALUE,aU,aS,aR,aN,aD,aJ,aT,aP,aH,aG,aC,a0,aX,aL;function aF(a3,a2,a1){if(a2<a3.datamin&&a2!=-aB){a3.datamin=a2}if(a1>a3.datamax&&a1!=aB){a3.datamax=a1}}c.each(m(),function(a1,a2){a2.datamin=aO;a2.datamax=aI;a2.used=false});for(aU=0;aU<Q.length;++aU){aJ=Q[aU];aJ.datapoints={points:[]};an(ak.processRawData,[aJ,aJ.data,aJ.datapoints])}for(aU=0;aU<Q.length;++aU){aJ=Q[aU];var aZ=aJ.data,aW=aJ.datapoints.format;if(!aW){aW=[];aW.push({x:true,number:true,required:true});aW.push({y:true,number:true,required:true});if(aJ.bars.show||(aJ.lines.show&&aJ.lines.fill)){aW.push({y:true,number:true,required:false,defaultValue:0});if(aJ.bars.horizontal){delete aW[aW.length-1].y;aW[aW.length-1].x=true}}aJ.datapoints.format=aW}if(aJ.datapoints.pointsize!=null){continue}aJ.datapoints.pointsize=aW.length;aP=aJ.datapoints.pointsize;aT=aJ.datapoints.points;insertSteps=aJ.lines.show&&aJ.lines.steps;aJ.xaxis.used=aJ.yaxis.used=true;for(aS=aR=0;aS<aZ.length;++aS,aR+=aP){aL=aZ[aS];var aE=aL==null;if(!aE){for(aN=0;aN<aP;++aN){a0=aL[aN];aX=aW[aN];if(aX){if(aX.number&&a0!=null){a0=+a0;if(isNaN(a0)){a0=null}else{if(a0==Infinity){a0=aB}else{if(a0==-Infinity){a0=-aB}}}}if(a0==null){if(aX.required){aE=true}if(aX.defaultValue!=null){a0=aX.defaultValue}}}aT[aR+aN]=a0}}if(aE){for(aN=0;aN<aP;++aN){a0=aT[aR+aN];if(a0!=null){aX=aW[aN];if(aX.x){aF(aJ.xaxis,a0,a0)}if(aX.y){aF(aJ.yaxis,a0,a0)}}aT[aR+aN]=null}}else{if(insertSteps&&aR>0&&aT[aR-aP]!=null&&aT[aR-aP]!=aT[aR]&&aT[aR-aP+1]!=aT[aR+1]){for(aN=0;aN<aP;++aN){aT[aR+aP+aN]=aT[aR+aN]}aT[aR+1]=aT[aR-aP+1];aR+=aP}}}}for(aU=0;aU<Q.length;++aU){aJ=Q[aU];an(ak.processDatapoints,[aJ,aJ.datapoints])}for(aU=0;aU<Q.length;++aU){aJ=Q[aU];aT=aJ.datapoints.points,aP=aJ.datapoints.pointsize;var aK=aO,aQ=aO,aM=aI,aV=aI;for(aS=0;aS<aT.length;aS+=aP){if(aT[aS]==null){continue}for(aN=0;aN<aP;++aN){a0=aT[aS+aN];aX=aW[aN];if(!aX||a0==aB||a0==-aB){continue}if(aX.x){if(a0<aK){aK=a0}if(a0>aM){aM=a0}}if(aX.y){if(a0<aQ){aQ=a0}if(a0>aV){aV=a0}}}}if(aJ.bars.show){var aY=aJ.bars.align=="left"?0:-aJ.bars.barWidth/2;if(aJ.bars.horizontal){aQ+=aY;aV+=aY+aJ.bars.barWidth}else{aK+=aY;aM+=aY+aJ.bars.barWidth}}aF(aJ.xaxis,aK,aM);aF(aJ.yaxis,aQ,aV)}c.each(m(),function(a1,a2){if(a2.datamin==aO){a2.datamin=null}if(a2.datamax==aI){a2.datamax=null}})}function j(aB,aC){var aD=document.createElement("canvas");aD.className=aC;aD.width=G;aD.height=I;if(!aB){c(aD).css({position:"absolute",left:0,top:0})}c(aD).appendTo(av);if(!aD.getContext){aD=window.G_vmlCanvasManager.initElement(aD)}aD.getContext("2d").save();return aD}function B(){G=av.width();I=av.height();if(G<=0||I<=0){throw"Invalid dimensions for plot, width = "+G+", height = "+I}}function g(aC){if(aC.width!=G){aC.width=G}if(aC.height!=I){aC.height=I}var aB=aC.getContext("2d");aB.restore();aB.save()}function X(){var aC,aB=av.children("canvas.base"),aD=av.children("canvas.overlay");if(aB.length==0||aD==0){av.html("");av.css({padding:0});if(av.css("position")=="static"){av.css("position","relative")}B();az=j(true,"base");ad=j(false,"overlay");aC=false}else{az=aB.get(0);ad=aD.get(0);aC=true}H=az.getContext("2d");A=ad.getContext("2d");y=c([ad,az]);if(aC){av.data("plot").shutdown();aq.resize();A.clearRect(0,0,G,I);y.unbind();av.children().not([az,ad]).remove()}av.data("plot",aq)}function ah(){if(O.grid.hoverable){y.mousemove(aa);y.mouseleave(l)}if(O.grid.clickable){y.click(R)}an(ak.bindEvents,[y])}function ag(){if(M){clearTimeout(M)}y.unbind("mousemove",aa);y.unbind("mouseleave",l);y.unbind("click",R);an(ak.shutdown,[y])}function r(aG){function aC(aH){return aH}var aF,aB,aD=aG.options.transform||aC,aE=aG.options.inverseTransform;if(aG.direction=="x"){aF=aG.scale=h/Math.abs(aD(aG.max)-aD(aG.min));aB=Math.min(aD(aG.max),aD(aG.min))}else{aF=aG.scale=w/Math.abs(aD(aG.max)-aD(aG.min));aF=-aF;aB=Math.max(aD(aG.max),aD(aG.min))}if(aD==aC){aG.p2c=function(aH){return(aH-aB)*aF}}else{aG.p2c=function(aH){return(aD(aH)-aB)*aF}}if(!aE){aG.c2p=function(aH){return aB+aH/aF}}else{aG.c2p=function(aH){return aE(aB+aH/aF)}}}function L(aD){var aB=aD.options,aF,aJ=aD.ticks||[],aI=[],aE,aK=aB.labelWidth,aG=aB.labelHeight,aC;function aH(aM,aL){return c('<div style="position:absolute;top:-10000px;'+aL+'font-size:smaller"><div class="'+aD.direction+"Axis "+aD.direction+aD.n+'Axis">'+aM.join("")+"</div></div>").appendTo(av)}if(aD.direction=="x"){if(aK==null){aK=Math.floor(G/(aJ.length>0?aJ.length:1))}if(aG==null){aI=[];for(aF=0;aF<aJ.length;++aF){aE=aJ[aF].label;if(aE){aI.push('<div class="tickLabel" style="float:left;width:'+aK+'px">'+aE+"</div>")}}if(aI.length>0){aI.push('<div style="clear:left"></div>');aC=aH(aI,"width:10000px;");aG=aC.height();aC.remove()}}}else{if(aK==null||aG==null){for(aF=0;aF<aJ.length;++aF){aE=aJ[aF].label;if(aE){aI.push('<div class="tickLabel">'+aE+"</div>")}}if(aI.length>0){aC=aH(aI,"");if(aK==null){aK=aC.children().width()}if(aG==null){aG=aC.find("div.tickLabel").height()}aC.remove()}}}if(aK==null){aK=0}if(aG==null){aG=0}aD.labelWidth=aK;aD.labelHeight=aG}function au(aD){var aC=aD.labelWidth,aL=aD.labelHeight,aH=aD.options.position,aF=aD.options.tickLength,aG=O.grid.axisMargin,aJ=O.grid.labelMargin,aK=aD.direction=="x"?p:aw,aE;var aB=c.grep(aK,function(aN){return aN&&aN.options.position==aH&&aN.reserveSpace});if(c.inArray(aD,aB)==aB.length-1){aG=0}if(aF==null){aF="full"}var aI=c.grep(aK,function(aN){return aN&&aN.reserveSpace});var aM=c.inArray(aD,aI)==0;if(!aM&&aF=="full"){aF=5}if(!isNaN(+aF)){aJ+=+aF}if(aD.direction=="x"){aL+=aJ;if(aH=="bottom"){q.bottom+=aL+aG;aD.box={top:I-q.bottom,height:aL}}else{aD.box={top:q.top+aG,height:aL};q.top+=aL+aG}}else{aC+=aJ;if(aH=="left"){aD.box={left:q.left+aG,width:aC};q.left+=aC+aG}else{q.right+=aC+aG;aD.box={left:G-q.right,width:aC}}}aD.position=aH;aD.tickLength=aF;aD.box.padding=aJ;aD.innermost=aM}function U(aB){if(aB.direction=="x"){aB.box.left=q.left;aB.box.width=h}else{aB.box.top=q.top;aB.box.height=w}}function t(){var aC,aE=m();c.each(aE,function(aF,aG){aG.show=aG.options.show;if(aG.show==null){aG.show=aG.used}aG.reserveSpace=aG.show||aG.options.reserveSpace;n(aG)});allocatedAxes=c.grep(aE,function(aF){return aF.reserveSpace});q.left=q.right=q.top=q.bottom=0;if(O.grid.show){c.each(allocatedAxes,function(aF,aG){S(aG);P(aG);ap(aG,aG.ticks);L(aG)});for(aC=allocatedAxes.length-1;aC>=0;--aC){au(allocatedAxes[aC])}var aD=O.grid.minBorderMargin;if(aD==null){aD=0;for(aC=0;aC<Q.length;++aC){aD=Math.max(aD,Q[aC].points.radius+Q[aC].points.lineWidth/2)}}for(var aB in q){q[aB]+=O.grid.borderWidth;q[aB]=Math.max(aD,q[aB])}}h=G-q.left-q.right;w=I-q.bottom-q.top;c.each(aE,function(aF,aG){r(aG)});if(O.grid.show){c.each(allocatedAxes,function(aF,aG){U(aG)});k()}o()}function n(aE){var aF=aE.options,aD=+(aF.min!=null?aF.min:aE.datamin),aB=+(aF.max!=null?aF.max:aE.datamax),aH=aB-aD;if(aH==0){var aC=aB==0?1:0.01;if(aF.min==null){aD-=aC}if(aF.max==null||aF.min!=null){aB+=aC}}else{var aG=aF.autoscaleMargin;if(aG!=null){if(aF.min==null){aD-=aH*aG;if(aD<0&&aE.datamin!=null&&aE.datamin>=0){aD=0}}if(aF.max==null){aB+=aH*aG;if(aB>0&&aE.datamax!=null&&aE.datamax<=0){aB=0}}}}aE.min=aD;aE.max=aB}function S(aG){var aM=aG.options;var aH;if(typeof aM.ticks=="number"&&aM.ticks>0){aH=aM.ticks}else{aH=0.3*Math.sqrt(aG.direction=="x"?G:I)}var aT=(aG.max-aG.min)/aH,aO,aB,aN,aR,aS,aQ,aI;if(aM.mode=="time"){var aJ={second:1000,minute:60*1000,hour:60*60*1000,day:24*60*60*1000,month:30*24*60*60*1000,year:365.2425*24*60*60*1000};var aK=[[1,"second"],[2,"second"],[5,"second"],[10,"second"],[30,"second"],[1,"minute"],[2,"minute"],[5,"minute"],[10,"minute"],[30,"minute"],[1,"hour"],[2,"hour"],[4,"hour"],[8,"hour"],[12,"hour"],[1,"day"],[2,"day"],[3,"day"],[0.25,"month"],[0.5,"month"],[1,"month"],[2,"month"],[3,"month"],[6,"month"],[1,"year"]];var aC=0;if(aM.minTickSize!=null){if(typeof aM.tickSize=="number"){aC=aM.tickSize}else{aC=aM.minTickSize[0]*aJ[aM.minTickSize[1]]}}for(var aS=0;aS<aK.length-1;++aS){if(aT<(aK[aS][0]*aJ[aK[aS][1]]+aK[aS+1][0]*aJ[aK[aS+1][1]])/2&&aK[aS][0]*aJ[aK[aS][1]]>=aC){break}}aO=aK[aS][0];aN=aK[aS][1];if(aN=="year"){aQ=Math.pow(10,Math.floor(Math.log(aT/aJ.year)/Math.LN10));aI=(aT/aJ.year)/aQ;if(aI<1.5){aO=1}else{if(aI<3){aO=2}else{if(aI<7.5){aO=5}else{aO=10}}}aO*=aQ}aG.tickSize=aM.tickSize||[aO,aN];aB=function(aX){var a2=[],a0=aX.tickSize[0],a3=aX.tickSize[1],a1=new Date(aX.min);var aW=a0*aJ[a3];if(a3=="second"){a1.setUTCSeconds(a(a1.getUTCSeconds(),a0))}if(a3=="minute"){a1.setUTCMinutes(a(a1.getUTCMinutes(),a0))}if(a3=="hour"){a1.setUTCHours(a(a1.getUTCHours(),a0))}if(a3=="month"){a1.setUTCMonth(a(a1.getUTCMonth(),a0))}if(a3=="year"){a1.setUTCFullYear(a(a1.getUTCFullYear(),a0))}a1.setUTCMilliseconds(0);if(aW>=aJ.minute){a1.setUTCSeconds(0)}if(aW>=aJ.hour){a1.setUTCMinutes(0)}if(aW>=aJ.day){a1.setUTCHours(0)}if(aW>=aJ.day*4){a1.setUTCDate(1)}if(aW>=aJ.year){a1.setUTCMonth(0)}var a5=0,a4=Number.NaN,aY;do{aY=a4;a4=a1.getTime();a2.push(a4);if(a3=="month"){if(a0<1){a1.setUTCDate(1);var aV=a1.getTime();a1.setUTCMonth(a1.getUTCMonth()+1);var aZ=a1.getTime();a1.setTime(a4+a5*aJ.hour+(aZ-aV)*a0);a5=a1.getUTCHours();a1.setUTCHours(0)}else{a1.setUTCMonth(a1.getUTCMonth()+a0)}}else{if(a3=="year"){a1.setUTCFullYear(a1.getUTCFullYear()+a0)}else{a1.setTime(a4+aW)}}}while(a4<aX.max&&a4!=aY);return a2};aR=function(aV,aY){var a0=new Date(aV);if(aM.timeformat!=null){return c.plot.formatDate(a0,aM.timeformat,aM.monthNames)}var aW=aY.tickSize[0]*aJ[aY.tickSize[1]];var aX=aY.max-aY.min;var aZ=(aM.twelveHourClock)?" %p":"";if(aW<aJ.minute){fmt="%h:%M:%S"+aZ}else{if(aW<aJ.day){if(aX<2*aJ.day){fmt="%h:%M"+aZ}else{fmt="%b %d %h:%M"+aZ}}else{if(aW<aJ.month){fmt="%b %d"}else{if(aW<aJ.year){if(aX<aJ.year){fmt="%b"}else{fmt="%b %y"}}else{fmt="%y"}}}}return c.plot.formatDate(a0,fmt,aM.monthNames)}}else{var aU=aM.tickDecimals;var aP=-Math.floor(Math.log(aT)/Math.LN10);if(aU!=null&&aP>aU){aP=aU}aQ=Math.pow(10,-aP);aI=aT/aQ;if(aI<1.5){aO=1}else{if(aI<3){aO=2;if(aI>2.25&&(aU==null||aP+1<=aU)){aO=2.5;++aP}}else{if(aI<7.5){aO=5}else{aO=10}}}aO*=aQ;if(aM.minTickSize!=null&&aO<aM.minTickSize){aO=aM.minTickSize}aG.tickDecimals=Math.max(0,aU!=null?aU:aP);aG.tickSize=aM.tickSize||aO;aB=function(aX){var aZ=[];var a0=a(aX.min,aX.tickSize),aW=0,aV=Number.NaN,aY;do{aY=aV;aV=a0+aW*aX.tickSize;aZ.push(aV);++aW}while(aV<aX.max&&aV!=aY);return aZ};aR=function(aV,aW){return aV.toFixed(aW.tickDecimals)}}if(aM.alignTicksWithAxis!=null){var aF=(aG.direction=="x"?p:aw)[aM.alignTicksWithAxis-1];if(aF&&aF.used&&aF!=aG){var aL=aB(aG);if(aL.length>0){if(aM.min==null){aG.min=Math.min(aG.min,aL[0])}if(aM.max==null&&aL.length>1){aG.max=Math.max(aG.max,aL[aL.length-1])}}aB=function(aX){var aY=[],aV,aW;for(aW=0;aW<aF.ticks.length;++aW){aV=(aF.ticks[aW].v-aF.min)/(aF.max-aF.min);aV=aX.min+aV*(aX.max-aX.min);aY.push(aV)}return aY};if(aG.mode!="time"&&aM.tickDecimals==null){var aE=Math.max(0,-Math.floor(Math.log(aT)/Math.LN10)+1),aD=aB(aG);if(!(aD.length>1&&/\..*0$/.test((aD[1]-aD[0]).toFixed(aE)))){aG.tickDecimals=aE}}}}aG.tickGenerator=aB;if(c.isFunction(aM.tickFormatter)){aG.tickFormatter=function(aV,aW){return""+aM.tickFormatter(aV,aW)}}else{aG.tickFormatter=aR}}function P(aF){var aH=aF.options.ticks,aG=[];if(aH==null||(typeof aH=="number"&&aH>0)){aG=aF.tickGenerator(aF)}else{if(aH){if(c.isFunction(aH)){aG=aH({min:aF.min,max:aF.max})}else{aG=aH}}}var aE,aB;aF.ticks=[];for(aE=0;aE<aG.length;++aE){var aC=null;var aD=aG[aE];if(typeof aD=="object"){aB=+aD[0];if(aD.length>1){aC=aD[1]}}else{aB=+aD}if(aC==null){aC=aF.tickFormatter(aB,aF)}if(!isNaN(aB)){aF.ticks.push({v:aB,label:aC})}}}function ap(aB,aC){if(aB.options.autoscaleMargin&&aC.length>0){if(aB.options.min==null){aB.min=Math.min(aB.min,aC[0].v)}if(aB.options.max==null&&aC.length>1){aB.max=Math.max(aB.max,aC[aC.length-1].v)}}}function W(){H.clearRect(0,0,G,I);var aC=O.grid;if(aC.show&&aC.backgroundColor){N()}if(aC.show&&!aC.aboveData){ac()}for(var aB=0;aB<Q.length;++aB){an(ak.drawSeries,[H,Q[aB]]);d(Q[aB])}an(ak.draw,[H]);if(aC.show&&aC.aboveData){ac()}}function D(aB,aI){var aE,aH,aG,aD,aF=m();for(i=0;i<aF.length;++i){aE=aF[i];if(aE.direction==aI){aD=aI+aE.n+"axis";if(!aB[aD]&&aE.n==1){aD=aI+"axis"}if(aB[aD]){aH=aB[aD].from;aG=aB[aD].to;break}}}if(!aB[aD]){aE=aI=="x"?p[0]:aw[0];aH=aB[aI+"1"];aG=aB[aI+"2"]}if(aH!=null&&aG!=null&&aH>aG){var aC=aH;aH=aG;aG=aC}return{from:aH,to:aG,axis:aE}}function N(){H.save();H.translate(q.left,q.top);H.fillStyle=am(O.grid.backgroundColor,w,0,"rgba(255, 255, 255, 0)");H.fillRect(0,0,h,w);H.restore()}function ac(){var aF;H.save();H.translate(q.left,q.top);var aH=O.grid.markings;if(aH){if(c.isFunction(aH)){var aK=aq.getAxes();aK.xmin=aK.xaxis.min;aK.xmax=aK.xaxis.max;aK.ymin=aK.yaxis.min;aK.ymax=aK.yaxis.max;aH=aH(aK)}for(aF=0;aF<aH.length;++aF){var aD=aH[aF],aC=D(aD,"x"),aI=D(aD,"y");if(aC.from==null){aC.from=aC.axis.min}if(aC.to==null){aC.to=aC.axis.max}if(aI.from==null){aI.from=aI.axis.min}if(aI.to==null){aI.to=aI.axis.max}if(aC.to<aC.axis.min||aC.from>aC.axis.max||aI.to<aI.axis.min||aI.from>aI.axis.max){continue}aC.from=Math.max(aC.from,aC.axis.min);aC.to=Math.min(aC.to,aC.axis.max);aI.from=Math.max(aI.from,aI.axis.min);aI.to=Math.min(aI.to,aI.axis.max);if(aC.from==aC.to&&aI.from==aI.to){continue}aC.from=aC.axis.p2c(aC.from);aC.to=aC.axis.p2c(aC.to);aI.from=aI.axis.p2c(aI.from);aI.to=aI.axis.p2c(aI.to);if(aC.from==aC.to||aI.from==aI.to){H.beginPath();H.strokeStyle=aD.color||O.grid.markingsColor;H.lineWidth=aD.lineWidth||O.grid.markingsLineWidth;H.moveTo(aC.from,aI.from);H.lineTo(aC.to,aI.to);H.stroke()}else{H.fillStyle=aD.color||O.grid.markingsColor;H.fillRect(aC.from,aI.to,aC.to-aC.from,aI.from-aI.to)}}}var aK=m(),aM=O.grid.borderWidth;for(var aE=0;aE<aK.length;++aE){var aB=aK[aE],aG=aB.box,aQ=aB.tickLength,aN,aL,aP,aJ;if(!aB.show||aB.ticks.length==0){continue}H.strokeStyle=aB.options.tickColor||c.color.parse(aB.options.color).scale("a",0.22).toString();H.lineWidth=1;if(aB.direction=="x"){aN=0;if(aQ=="full"){aL=(aB.position=="top"?0:w)}else{aL=aG.top-q.top+(aB.position=="top"?aG.height:0)}}else{aL=0;if(aQ=="full"){aN=(aB.position=="left"?0:h)}else{aN=aG.left-q.left+(aB.position=="left"?aG.width:0)}}if(!aB.innermost){H.beginPath();aP=aJ=0;if(aB.direction=="x"){aP=h}else{aJ=w}if(H.lineWidth==1){aN=Math.floor(aN)+0.5;aL=Math.floor(aL)+0.5}H.moveTo(aN,aL);H.lineTo(aN+aP,aL+aJ);H.stroke()}H.beginPath();for(aF=0;aF<aB.ticks.length;++aF){var aO=aB.ticks[aF].v;aP=aJ=0;if(aO<aB.min||aO>aB.max||(aQ=="full"&&aM>0&&(aO==aB.min||aO==aB.max))){continue}if(aB.direction=="x"){aN=aB.p2c(aO);aJ=aQ=="full"?-w:aQ;if(aB.position=="top"){aJ=-aJ}}else{aL=aB.p2c(aO);aP=aQ=="full"?-h:aQ;if(aB.position=="left"){aP=-aP}}if(H.lineWidth==1){if(aB.direction=="x"){aN=Math.floor(aN)+0.5}else{aL=Math.floor(aL)+0.5}}H.moveTo(aN,aL);H.lineTo(aN+aP,aL+aJ)}H.stroke()}if(aM){H.lineWidth=aM;H.strokeStyle=O.grid.borderColor;H.strokeRect(-aM/2,-aM/2,h+aM,w+aM)}H.restore()}function k(){av.find(".tickLabels").remove();var aG=['<div class="tickLabels" style="font-size:smaller">'];var aJ=m();for(var aD=0;aD<aJ.length;++aD){var aC=aJ[aD],aF=aC.box;if(!aC.show){continue}aG.push('<div class="'+aC.direction+"Axis "+aC.direction+aC.n+'Axis" style="color:'+aC.options.color+'">');for(var aE=0;aE<aC.ticks.length;++aE){var aH=aC.ticks[aE];if(!aH.label||aH.v<aC.min||aH.v>aC.max){continue}var aK={},aI;if(aC.direction=="x"){aI="center";aK.left=Math.round(q.left+aC.p2c(aH.v)-aC.labelWidth/2);if(aC.position=="bottom"){aK.top=aF.top+aF.padding}else{aK.bottom=I-(aF.top+aF.height-aF.padding)}}else{aK.top=Math.round(q.top+aC.p2c(aH.v)-aC.labelHeight/2);if(aC.position=="left"){aK.right=G-(aF.left+aF.width-aF.padding);aI="right"}else{aK.left=aF.left+aF.padding;aI="left"}}aK.width=aC.labelWidth;var aB=["position:absolute","text-align:"+aI];for(var aL in aK){aB.push(aL+":"+aK[aL]+"px")}aG.push('<div class="tickLabel" style="'+aB.join(";")+'">'+aH.label+"</div>")}aG.push("</div>")}aG.push("</div>");av.append(aG.join(""))}function d(aB){if(aB.lines.show){at(aB)}if(aB.bars.show){e(aB)}if(aB.points.show){ao(aB)}}function at(aE){function aD(aP,aQ,aI,aU,aT){var aV=aP.points,aJ=aP.pointsize,aN=null,aM=null;H.beginPath();for(var aO=aJ;aO<aV.length;aO+=aJ){var aL=aV[aO-aJ],aS=aV[aO-aJ+1],aK=aV[aO],aR=aV[aO+1];if(aL==null||aK==null){continue}if(aS<=aR&&aS<aT.min){if(aR<aT.min){continue}aL=(aT.min-aS)/(aR-aS)*(aK-aL)+aL;aS=aT.min}else{if(aR<=aS&&aR<aT.min){if(aS<aT.min){continue}aK=(aT.min-aS)/(aR-aS)*(aK-aL)+aL;aR=aT.min}}if(aS>=aR&&aS>aT.max){if(aR>aT.max){continue}aL=(aT.max-aS)/(aR-aS)*(aK-aL)+aL;aS=aT.max}else{if(aR>=aS&&aR>aT.max){if(aS>aT.max){continue}aK=(aT.max-aS)/(aR-aS)*(aK-aL)+aL;aR=aT.max}}if(aL<=aK&&aL<aU.min){if(aK<aU.min){continue}aS=(aU.min-aL)/(aK-aL)*(aR-aS)+aS;aL=aU.min}else{if(aK<=aL&&aK<aU.min){if(aL<aU.min){continue}aR=(aU.min-aL)/(aK-aL)*(aR-aS)+aS;aK=aU.min}}if(aL>=aK&&aL>aU.max){if(aK>aU.max){continue}aS=(aU.max-aL)/(aK-aL)*(aR-aS)+aS;aL=aU.max}else{if(aK>=aL&&aK>aU.max){if(aL>aU.max){continue}aR=(aU.max-aL)/(aK-aL)*(aR-aS)+aS;aK=aU.max}}if(aL!=aN||aS!=aM){H.moveTo(aU.p2c(aL)+aQ,aT.p2c(aS)+aI)}aN=aK;aM=aR;H.lineTo(aU.p2c(aK)+aQ,aT.p2c(aR)+aI)}H.stroke()}function aF(aI,aQ,aP){var aW=aI.points,aV=aI.pointsize,aN=Math.min(Math.max(0,aP.min),aP.max),aX=0,aU,aT=false,aM=1,aL=0,aR=0;while(true){if(aV>0&&aX>aW.length+aV){break}aX+=aV;var aZ=aW[aX-aV],aK=aW[aX-aV+aM],aY=aW[aX],aJ=aW[aX+aM];if(aT){if(aV>0&&aZ!=null&&aY==null){aR=aX;aV=-aV;aM=2;continue}if(aV<0&&aX==aL+aV){H.fill();aT=false;aV=-aV;aM=1;aX=aL=aR+aV;continue}}if(aZ==null||aY==null){continue}if(aZ<=aY&&aZ<aQ.min){if(aY<aQ.min){continue}aK=(aQ.min-aZ)/(aY-aZ)*(aJ-aK)+aK;aZ=aQ.min}else{if(aY<=aZ&&aY<aQ.min){if(aZ<aQ.min){continue}aJ=(aQ.min-aZ)/(aY-aZ)*(aJ-aK)+aK;aY=aQ.min}}if(aZ>=aY&&aZ>aQ.max){if(aY>aQ.max){continue}aK=(aQ.max-aZ)/(aY-aZ)*(aJ-aK)+aK;aZ=aQ.max}else{if(aY>=aZ&&aY>aQ.max){if(aZ>aQ.max){continue}aJ=(aQ.max-aZ)/(aY-aZ)*(aJ-aK)+aK;aY=aQ.max}}if(!aT){H.beginPath();H.moveTo(aQ.p2c(aZ),aP.p2c(aN));aT=true}if(aK>=aP.max&&aJ>=aP.max){H.lineTo(aQ.p2c(aZ),aP.p2c(aP.max));H.lineTo(aQ.p2c(aY),aP.p2c(aP.max));continue}else{if(aK<=aP.min&&aJ<=aP.min){H.lineTo(aQ.p2c(aZ),aP.p2c(aP.min));H.lineTo(aQ.p2c(aY),aP.p2c(aP.min));continue}}var aO=aZ,aS=aY;if(aK<=aJ&&aK<aP.min&&aJ>=aP.min){aZ=(aP.min-aK)/(aJ-aK)*(aY-aZ)+aZ;aK=aP.min}else{if(aJ<=aK&&aJ<aP.min&&aK>=aP.min){aY=(aP.min-aK)/(aJ-aK)*(aY-aZ)+aZ;aJ=aP.min}}if(aK>=aJ&&aK>aP.max&&aJ<=aP.max){aZ=(aP.max-aK)/(aJ-aK)*(aY-aZ)+aZ;aK=aP.max}else{if(aJ>=aK&&aJ>aP.max&&aK<=aP.max){aY=(aP.max-aK)/(aJ-aK)*(aY-aZ)+aZ;aJ=aP.max}}if(aZ!=aO){H.lineTo(aQ.p2c(aO),aP.p2c(aK))}H.lineTo(aQ.p2c(aZ),aP.p2c(aK));H.lineTo(aQ.p2c(aY),aP.p2c(aJ));if(aY!=aS){H.lineTo(aQ.p2c(aY),aP.p2c(aJ));H.lineTo(aQ.p2c(aS),aP.p2c(aJ))}}}H.save();H.translate(q.left,q.top);H.lineJoin="round";var aG=aE.lines.lineWidth,aB=aE.shadowSize;if(aG>0&&aB>0){H.lineWidth=aB;H.strokeStyle="rgba(0,0,0,0.1)";var aH=Math.PI/18;aD(aE.datapoints,Math.sin(aH)*(aG/2+aB/2),Math.cos(aH)*(aG/2+aB/2),aE.xaxis,aE.yaxis);H.lineWidth=aB/2;aD(aE.datapoints,Math.sin(aH)*(aG/2+aB/4),Math.cos(aH)*(aG/2+aB/4),aE.xaxis,aE.yaxis)}H.lineWidth=aG;H.strokeStyle=aE.color;var aC=ae(aE.lines,aE.color,0,w);if(aC){H.fillStyle=aC;aF(aE.datapoints,aE.xaxis,aE.yaxis)}if(aG>0){aD(aE.datapoints,0,0,aE.xaxis,aE.yaxis)}H.restore()}function ao(aE){function aH(aN,aM,aU,aK,aS,aT,aQ,aJ){var aR=aN.points,aI=aN.pointsize;for(var aL=0;aL<aR.length;aL+=aI){var aP=aR[aL],aO=aR[aL+1];if(aP==null||aP<aT.min||aP>aT.max||aO<aQ.min||aO>aQ.max){continue}H.beginPath();aP=aT.p2c(aP);aO=aQ.p2c(aO)+aK;if(aJ=="circle"){H.arc(aP,aO,aM,0,aS?Math.PI:Math.PI*2,false)}else{aJ(H,aP,aO,aM,aS)}H.closePath();if(aU){H.fillStyle=aU;H.fill()}H.stroke()}}H.save();H.translate(q.left,q.top);var aG=aE.points.lineWidth,aC=aE.shadowSize,aB=aE.points.radius,aF=aE.points.symbol;if(aG>0&&aC>0){var aD=aC/2;H.lineWidth=aD;H.strokeStyle="rgba(0,0,0,0.1)";aH(aE.datapoints,aB,null,aD+aD/2,true,aE.xaxis,aE.yaxis,aF);H.strokeStyle="rgba(0,0,0,0.2)";aH(aE.datapoints,aB,null,aD/2,true,aE.xaxis,aE.yaxis,aF)}H.lineWidth=aG;H.strokeStyle=aE.color;aH(aE.datapoints,aB,ae(aE.points,aE.color),0,false,aE.xaxis,aE.yaxis,aF);H.restore()}function E(aN,aM,aV,aI,aQ,aF,aD,aL,aK,aU,aR,aC){var aE,aT,aJ,aP,aG,aB,aO,aH,aS;if(aR){aH=aB=aO=true;aG=false;aE=aV;aT=aN;aP=aM+aI;aJ=aM+aQ;if(aT<aE){aS=aT;aT=aE;aE=aS;aG=true;aB=false}}else{aG=aB=aO=true;aH=false;aE=aN+aI;aT=aN+aQ;aJ=aV;aP=aM;if(aP<aJ){aS=aP;aP=aJ;aJ=aS;aH=true;aO=false}}if(aT<aL.min||aE>aL.max||aP<aK.min||aJ>aK.max){return}if(aE<aL.min){aE=aL.min;aG=false}if(aT>aL.max){aT=aL.max;aB=false}if(aJ<aK.min){aJ=aK.min;aH=false}if(aP>aK.max){aP=aK.max;aO=false}aE=aL.p2c(aE);aJ=aK.p2c(aJ);aT=aL.p2c(aT);aP=aK.p2c(aP);if(aD){aU.beginPath();aU.moveTo(aE,aJ);aU.lineTo(aE,aP);aU.lineTo(aT,aP);aU.lineTo(aT,aJ);aU.fillStyle=aD(aJ,aP);aU.fill()}if(aC>0&&(aG||aB||aO||aH)){aU.beginPath();aU.moveTo(aE,aJ+aF);if(aG){aU.lineTo(aE,aP+aF)}else{aU.moveTo(aE,aP+aF)}if(aO){aU.lineTo(aT,aP+aF)}else{aU.moveTo(aT,aP+aF)}if(aB){aU.lineTo(aT,aJ+aF)}else{aU.moveTo(aT,aJ+aF)}if(aH){aU.lineTo(aE,aJ+aF)}else{aU.moveTo(aE,aJ+aF)}aU.stroke()}}function e(aD){function aC(aJ,aI,aL,aG,aK,aN,aM){var aO=aJ.points,aF=aJ.pointsize;for(var aH=0;aH<aO.length;aH+=aF){if(aO[aH]==null){continue}E(aO[aH],aO[aH+1],aO[aH+2],aI,aL,aG,aK,aN,aM,H,aD.bars.horizontal,aD.bars.lineWidth)}}H.save();H.translate(q.left,q.top);H.lineWidth=aD.bars.lineWidth;H.strokeStyle=aD.color;var aB=aD.bars.align=="left"?0:-aD.bars.barWidth/2;var aE=aD.bars.fill?function(aF,aG){return ae(aD.bars,aD.color,aF,aG)}:null;aC(aD.datapoints,aB,aB+aD.bars.barWidth,0,aE,aD.xaxis,aD.yaxis);H.restore()}function ae(aD,aB,aC,aF){var aE=aD.fill;if(!aE){return null}if(aD.fillColor){return am(aD.fillColor,aC,aF,aB)}var aG=c.color.parse(aB);aG.a=typeof aE=="number"?aE:0.4;aG.normalize();return aG.toString()}function o(){av.find(".legend").remove();if(!O.legend.show){return}var aH=[],aF=false,aN=O.legend.labelFormatter,aM,aJ;for(var aE=0;aE<Q.length;++aE){aM=Q[aE];aJ=aM.label;if(!aJ){continue}if(aE%O.legend.noColumns==0){if(aF){aH.push("</tr>")}aH.push("<tr>");aF=true}if(aN){aJ=aN(aJ,aM)}aH.push('<td class="legendColorBox"><div style="border:1px solid '+O.legend.labelBoxBorderColor+';padding:1px"><div style="width:4px;height:0;border:5px solid '+aM.color+';overflow:hidden"></div></div></td><td class="legendLabel">'+aJ+"</td>")}if(aF){aH.push("</tr>")}if(aH.length==0){return}var aL='<table style="font-size:smaller;color:'+O.grid.color+'">'+aH.join("")+"</table>";if(O.legend.container!=null){c(O.legend.container).html(aL)}else{var aI="",aC=O.legend.position,aD=O.legend.margin;if(aD[0]==null){aD=[aD,aD]}if(aC.charAt(0)=="n"){aI+="top:"+(aD[1]+q.top)+"px;"}else{if(aC.charAt(0)=="s"){aI+="bottom:"+(aD[1]+q.bottom)+"px;"}}if(aC.charAt(1)=="e"){aI+="right:"+(aD[0]+q.right)+"px;"}else{if(aC.charAt(1)=="w"){aI+="left:"+(aD[0]+q.left)+"px;"}}var aK=c('<div class="legend">'+aL.replace('style="','style="position:absolute;'+aI+";")+"</div>").appendTo(av);if(O.legend.backgroundOpacity!=0){var aG=O.legend.backgroundColor;if(aG==null){aG=O.grid.backgroundColor;if(aG&&typeof aG=="string"){aG=c.color.parse(aG)}else{aG=c.color.extract(aK,"background-color")}aG.a=1;aG=aG.toString()}var aB=aK.children();c('<div style="position:absolute;width:'+aB.width()+"px;height:"+aB.height()+"px;"+aI+"background-color:"+aG+';"> </div>').prependTo(aK).css("opacity",O.legend.backgroundOpacity)}}}var ab=[],M=null;function K(aI,aG,aD){var aO=O.grid.mouseActiveRadius,a0=aO*aO+1,aY=null,aR=false,aW,aU;for(aW=Q.length-1;aW>=0;--aW){if(!aD(Q[aW])){continue}var aP=Q[aW],aH=aP.xaxis,aF=aP.yaxis,aV=aP.datapoints.points,aT=aP.datapoints.pointsize,aQ=aH.c2p(aI),aN=aF.c2p(aG),aC=aO/aH.scale,aB=aO/aF.scale;if(aH.options.inverseTransform){aC=Number.MAX_VALUE}if(aF.options.inverseTransform){aB=Number.MAX_VALUE}if(aP.lines.show||aP.points.show){for(aU=0;aU<aV.length;aU+=aT){var aK=aV[aU],aJ=aV[aU+1];if(aK==null){continue}if(aK-aQ>aC||aK-aQ<-aC||aJ-aN>aB||aJ-aN<-aB){continue}var aM=Math.abs(aH.p2c(aK)-aI),aL=Math.abs(aF.p2c(aJ)-aG),aS=aM*aM+aL*aL;if(aS<a0){a0=aS;aY=[aW,aU/aT]}}}if(aP.bars.show&&!aY){var aE=aP.bars.align=="left"?0:-aP.bars.barWidth/2,aX=aE+aP.bars.barWidth;for(aU=0;aU<aV.length;aU+=aT){var aK=aV[aU],aJ=aV[aU+1],aZ=aV[aU+2];if(aK==null){continue}if(Q[aW].bars.horizontal?(aQ<=Math.max(aZ,aK)&&aQ>=Math.min(aZ,aK)&&aN>=aJ+aE&&aN<=aJ+aX):(aQ>=aK+aE&&aQ<=aK+aX&&aN>=Math.min(aZ,aJ)&&aN<=Math.max(aZ,aJ))){aY=[aW,aU/aT]}}}}if(aY){aW=aY[0];aU=aY[1];aT=Q[aW].datapoints.pointsize;return{datapoint:Q[aW].datapoints.points.slice(aU*aT,(aU+1)*aT),dataIndex:aU,series:Q[aW],seriesIndex:aW}}return null}function aa(aB){if(O.grid.hoverable){u("plothover",aB,function(aC){return aC.hoverable!=false})}}function l(aB){if(O.grid.hoverable){u("plothover",aB,function(aC){return false})}}function R(aB){u("plotclick",aB,function(aC){return aC.clickable!=false})}function u(aC,aB,aD){var aE=y.offset(),aH=aB.pageX-aE.left-q.left,aF=aB.pageY-aE.top-q.top,aJ=C({left:aH,top:aF});aJ.pageX=aB.pageX;aJ.pageY=aB.pageY;var aK=K(aH,aF,aD);if(aK){aK.pageX=parseInt(aK.series.xaxis.p2c(aK.datapoint[0])+aE.left+q.left);aK.pageY=parseInt(aK.series.yaxis.p2c(aK.datapoint[1])+aE.top+q.top)}if(O.grid.autoHighlight){for(var aG=0;aG<ab.length;++aG){var aI=ab[aG];if(aI.auto==aC&&!(aK&&aI.series==aK.series&&aI.point[0]==aK.datapoint[0]&&aI.point[1]==aK.datapoint[1])){T(aI.series,aI.point)}}if(aK){x(aK.series,aK.datapoint,aC)}}av.trigger(aC,[aJ,aK])}function f(){if(!M){M=setTimeout(s,30)}}function s(){M=null;A.save();A.clearRect(0,0,G,I);A.translate(q.left,q.top);var aC,aB;for(aC=0;aC<ab.length;++aC){aB=ab[aC];if(aB.series.bars.show){v(aB.series,aB.point)}else{ay(aB.series,aB.point)}}A.restore();an(ak.drawOverlay,[A])}function x(aD,aB,aF){if(typeof aD=="number"){aD=Q[aD]}if(typeof aB=="number"){var aE=aD.datapoints.pointsize;aB=aD.datapoints.points.slice(aE*aB,aE*(aB+1))}var aC=al(aD,aB);if(aC==-1){ab.push({series:aD,point:aB,auto:aF});f()}else{if(!aF){ab[aC].auto=false}}}function T(aD,aB){if(aD==null&&aB==null){ab=[];f()}if(typeof aD=="number"){aD=Q[aD]}if(typeof aB=="number"){aB=aD.data[aB]}var aC=al(aD,aB);if(aC!=-1){ab.splice(aC,1);f()}}function al(aD,aE){for(var aB=0;aB<ab.length;++aB){var aC=ab[aB];if(aC.series==aD&&aC.point[0]==aE[0]&&aC.point[1]==aE[1]){return aB}}return -1}function ay(aE,aD){var aC=aD[0],aI=aD[1],aH=aE.xaxis,aG=aE.yaxis;if(aC<aH.min||aC>aH.max||aI<aG.min||aI>aG.max){return}var aF=aE.points.radius+aE.points.lineWidth/2;A.lineWidth=aF;A.strokeStyle=c.color.parse(aE.color).scale("a",0.5).toString();var aB=1.5*aF,aC=aH.p2c(aC),aI=aG.p2c(aI);A.beginPath();if(aE.points.symbol=="circle"){A.arc(aC,aI,aB,0,2*Math.PI,false)}else{aE.points.symbol(A,aC,aI,aB,false)}A.closePath();A.stroke()}function v(aE,aB){A.lineWidth=aE.bars.lineWidth;A.strokeStyle=c.color.parse(aE.color).scale("a",0.5).toString();var aD=c.color.parse(aE.color).scale("a",0.5).toString();var aC=aE.bars.align=="left"?0:-aE.bars.barWidth/2;E(aB[0],aB[1],aB[2]||0,aC,aC+aE.bars.barWidth,0,function(){return aD},aE.xaxis,aE.yaxis,A,aE.bars.horizontal,aE.bars.lineWidth)}function am(aJ,aB,aH,aC){if(typeof aJ=="string"){return aJ}else{var aI=H.createLinearGradient(0,aH,0,aB);for(var aE=0,aD=aJ.colors.length;aE<aD;++aE){var aF=aJ.colors[aE];if(typeof aF!="string"){var aG=c.color.parse(aC);if(aF.brightness!=null){aG=aG.scale("rgb",aF.brightness)}if(aF.opacity!=null){aG.a*=aF.opacity}aF=aG.toString()}aI.addColorStop(aE/(aD-1),aF)}return aI}}}c.plot=function(g,e,d){var f=new b(c(g),e,d,c.plot.plugins);return f};c.plot.version="0.7";c.plot.plugins=[];c.plot.formatDate=function(l,f,h){var o=function(d){d=""+d;return d.length==1?"0"+d:d};var e=[];var p=false,j=false;var n=l.getUTCHours();var k=n<12;if(h==null){h=["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"]}if(f.search(/%p|%P/)!=-1){if(n>12){n=n-12}else{if(n==0){n=12}}}for(var g=0;g<f.length;++g){var m=f.charAt(g);if(p){switch(m){case"h":m=""+n;break;case"H":m=o(n);break;case"M":m=o(l.getUTCMinutes());break;case"S":m=o(l.getUTCSeconds());break;case"d":m=""+l.getUTCDate();break;case"m":m=""+(l.getUTCMonth()+1);break;case"y":m=""+l.getUTCFullYear();break;case"b":m=""+h[l.getUTCMonth()];break;case"p":m=(k)?("am"):("pm");break;case"P":m=(k)?("AM"):("PM");break;case"0":m="";j=true;break}if(m&&j){m=o(m);j=false}e.push(m);if(!j){p=false}}else{if(m=="%"){p=true}else{e.push(m)}}}return e.join("")};function a(e,d){return d*Math.floor(e/d)}})(jQuery);
--- /dev/null
+++ b/js/flot/jquery.flot.navigate.js
@@ -1,1 +1,337 @@
-
+/*
+Flot plugin for adding panning and zooming capabilities to a plot.
+
+The default behaviour is double click and scrollwheel up/down to zoom
+in, drag to pan. The plugin defines plot.zoom({ center }),
+plot.zoomOut() and plot.pan(offset) so you easily can add custom
+controls. It also fires a "plotpan" and "plotzoom" event when
+something happens, useful for synchronizing plots.
+
+Options:
+
+ zoom: {
+ interactive: false
+ trigger: "dblclick" // or "click" for single click
+ amount: 1.5 // 2 = 200% (zoom in), 0.5 = 50% (zoom out)
+ }
+
+ pan: {
+ interactive: false
+ cursor: "move" // CSS mouse cursor value used when dragging, e.g. "pointer"
+ frameRate: 20
+ }
+
+ xaxis, yaxis, x2axis, y2axis: {
+ zoomRange: null // or [number, number] (min range, max range) or false
+ panRange: null // or [number, number] (min, max) or false
+ }
+
+"interactive" enables the built-in drag/click behaviour. If you enable
+interactive for pan, then you'll have a basic plot that supports
+moving around; the same for zoom.
+
+"amount" specifies the default amount to zoom in (so 1.5 = 150%)
+relative to the current viewport.
+
+"cursor" is a standard CSS mouse cursor string used for visual
+feedback to the user when dragging.
+
+"frameRate" specifies the maximum number of times per second the plot
+will update itself while the user is panning around on it (set to null
+to disable intermediate pans, the plot will then not update until the
+mouse button is released).
+
+"zoomRange" is the interval in which zooming can happen, e.g. with
+zoomRange: [1, 100] the zoom will never scale the axis so that the
+difference between min and max is smaller than 1 or larger than 100.
+You can set either end to null to ignore, e.g. [1, null]. If you set
+zoomRange to false, zooming on that axis will be disabled.
+
+"panRange" confines the panning to stay within a range, e.g. with
+panRange: [-10, 20] panning stops at -10 in one end and at 20 in the
+other. Either can be null, e.g. [-10, null]. If you set
+panRange to false, panning on that axis will be disabled.
+
+Example API usage:
+
+ plot = $.plot(...);
+
+ // zoom default amount in on the pixel (10, 20)
+ plot.zoom({ center: { left: 10, top: 20 } });
+
+ // zoom out again
+ plot.zoomOut({ center: { left: 10, top: 20 } });
+
+ // zoom 200% in on the pixel (10, 20)
+ plot.zoom({ amount: 2, center: { left: 10, top: 20 } });
+
+ // pan 100 pixels to the left and 20 down
+ plot.pan({ left: -100, top: 20 })
+
+Here, "center" specifies where the center of the zooming should
+happen. Note that this is defined in pixel space, not the space of the
+data points (you can use the p2c helpers on the axes in Flot to help
+you convert between these).
+
+"amount" is the amount to zoom the viewport relative to the current
+range, so 1 is 100% (i.e. no change), 1.5 is 150% (zoom in), 0.7 is
+70% (zoom out). You can set the default in the options.
+
+*/
+
+
+// First two dependencies, jquery.event.drag.js and
+// jquery.mousewheel.js, we put them inline here to save people the
+// effort of downloading them.
+
+/*
+jquery.event.drag.js ~ v1.5 ~ Copyright (c) 2008, Three Dub Media (http://threedubmedia.com)
+Licensed under the MIT License ~ http://threedubmedia.googlecode.com/files/MIT-LICENSE.txt
+*/
+(function(E){E.fn.drag=function(L,K,J){if(K){this.bind("dragstart",L)}if(J){this.bind("dragend",J)}return !L?this.trigger("drag"):this.bind("drag",K?K:L)};var A=E.event,B=A.special,F=B.drag={not:":input",distance:0,which:1,dragging:false,setup:function(J){J=E.extend({distance:F.distance,which:F.which,not:F.not},J||{});J.distance=I(J.distance);A.add(this,"mousedown",H,J);if(this.attachEvent){this.attachEvent("ondragstart",D)}},teardown:function(){A.remove(this,"mousedown",H);if(this===F.dragging){F.dragging=F.proxy=false}G(this,true);if(this.detachEvent){this.detachEvent("ondragstart",D)}}};B.dragstart=B.dragend={setup:function(){},teardown:function(){}};function H(L){var K=this,J,M=L.data||{};if(M.elem){K=L.dragTarget=M.elem;L.dragProxy=F.proxy||K;L.cursorOffsetX=M.pageX-M.left;L.cursorOffsetY=M.pageY-M.top;L.offsetX=L.pageX-L.cursorOffsetX;L.offsetY=L.pageY-L.cursorOffsetY}else{if(F.dragging||(M.which>0&&L.which!=M.which)||E(L.target).is(M.not)){return }}switch(L.type){case"mousedown":E.extend(M,E(K).offset(),{elem:K,target:L.target,pageX:L.pageX,pageY:L.pageY});A.add(document,"mousemove mouseup",H,M);G(K,false);F.dragging=null;return false;case !F.dragging&&"mousemove":if(I(L.pageX-M.pageX)+I(L.pageY-M.pageY)<M.distance){break}L.target=M.target;J=C(L,"dragstart",K);if(J!==false){F.dragging=K;F.proxy=L.dragProxy=E(J||K)[0]}case"mousemove":if(F.dragging){J=C(L,"drag",K);if(B.drop){B.drop.allowed=(J!==false);B.drop.handler(L)}if(J!==false){break}L.type="mouseup"}case"mouseup":A.remove(document,"mousemove mouseup",H);if(F.dragging){if(B.drop){B.drop.handler(L)}C(L,"dragend",K)}G(K,true);F.dragging=F.proxy=M.elem=false;break}return true}function C(M,K,L){M.type=K;var J=E.event.handle.call(L,M);return J===false?false:J||M.result}function I(J){return Math.pow(J,2)}function D(){return(F.dragging===false)}function G(K,J){if(!K){return }K.unselectable=J?"off":"on";K.onselectstart=function(){return J};if(K.style){K.style.MozUserSelect=J?"":"none"}}})(jQuery);
+
+
+/* jquery.mousewheel.min.js
+ * Copyright (c) 2009 Brandon Aaron (http://brandonaaron.net)
+ * Dual licensed under the MIT (http://www.opensource.org/licenses/mit-license.php)
+ * and GPL (http://www.opensource.org/licenses/gpl-license.php) licenses.
+ * Thanks to: http://adomas.org/javascript-mouse-wheel/ for some pointers.
+ * Thanks to: Mathias Bank(http://www.mathias-bank.de) for a scope bug fix.
+ *
+ * Version: 3.0.2
+ *
+ * Requires: 1.2.2+
+ */
+(function(c){var a=["DOMMouseScroll","mousewheel"];c.event.special.mousewheel={setup:function(){if(this.addEventListener){for(var d=a.length;d;){this.addEventListener(a[--d],b,false)}}else{this.onmousewheel=b}},teardown:function(){if(this.removeEventListener){for(var d=a.length;d;){this.removeEventListener(a[--d],b,false)}}else{this.onmousewheel=null}}};c.fn.extend({mousewheel:function(d){return d?this.bind("mousewheel",d):this.trigger("mousewheel")},unmousewheel:function(d){return this.unbind("mousewheel",d)}});function b(f){var d=[].slice.call(arguments,1),g=0,e=true;f=c.event.fix(f||window.event);f.type="mousewheel";if(f.wheelDelta){g=f.wheelDelta/120}if(f.detail){g=-f.detail/3}d.unshift(f,g);return c.event.handle.apply(this,d)}})(jQuery);
+
+
+
+
+(function ($) {
+ var options = {
+ xaxis: {
+ zoomRange: null, // or [number, number] (min range, max range)
+ panRange: null // or [number, number] (min, max)
+ },
+ zoom: {
+ interactive: false,
+ trigger: "dblclick", // or "click" for single click
+ amount: 1.5 // how much to zoom relative to current position, 2 = 200% (zoom in), 0.5 = 50% (zoom out)
+ },
+ pan: {
+ interactive: false,
+ cursor: "move",
+ frameRate: 20
+ }
+ };
+
+ function init(plot) {
+ function onZoomClick(e, zoomOut) {
+ var c = plot.offset();
+ c.left = e.pageX - c.left;
+ c.top = e.pageY - c.top;
+ if (zoomOut)
+ plot.zoomOut({ center: c });
+ else
+ plot.zoom({ center: c });
+ }
+
+ function onMouseWheel(e, delta) {
+ onZoomClick(e, delta < 0);
+ return false;
+ }
+
+ var prevCursor = 'default', prevPageX = 0, prevPageY = 0,
+ panTimeout = null;
+
+ function onDragStart(e) {
+ if (e.which != 1) // only accept left-click
+ return false;
+ var c = plot.getPlaceholder().css('cursor');
+ if (c)
+ prevCursor = c;
+ plot.getPlaceholder().css('cursor', plot.getOptions().pan.cursor);
+ prevPageX = e.pageX;
+ prevPageY = e.pageY;
+ }
+
+ function onDrag(e) {
+ var frameRate = plot.getOptions().pan.frameRate;
+ if (panTimeout || !frameRate)
+ return;
+
+ panTimeout = setTimeout(function () {
+ plot.pan({ left: prevPageX - e.pageX,
+ top: prevPageY - e.pageY });
+ prevPageX = e.pageX;
+ prevPageY = e.pageY;
+
+ panTimeout = null;
+ }, 1 / frameRate * 1000);
+ }
+
+ function onDragEnd(e) {
+ if (panTimeout) {
+ clearTimeout(panTimeout);
+ panTimeout = null;
+ }
+
+ plot.getPlaceholder().css('cursor', prevCursor);
+ plot.pan({ left: prevPageX - e.pageX,
+ top: prevPageY - e.pageY });
+ }
+
+ function bindEvents(plot, eventHolder) {
+ var o = plot.getOptions();
+ if (o.zoom.interactive) {
+ eventHolder[o.zoom.trigger](onZoomClick);
+ eventHolder.mousewheel(onMouseWheel);
+ }
+
+ if (o.pan.interactive) {
+ eventHolder.bind("dragstart", { distance: 10 }, onDragStart);
+ eventHolder.bind("drag", onDrag);
+ eventHolder.bind("dragend", onDragEnd);
+ }
+ }
+
+ plot.zoomOut = function (args) {
+ if (!args)
+ args = {};
+
+ if (!args.amount)
+ args.amount = plot.getOptions().zoom.amount
+
+ args.amount = 1 / args.amount;
+ plot.zoom(args);
+ }
+
+ plot.zoom = function (args) {
+ if (!args)
+ args = {};
+
+ var c = args.center,
+ amount = args.amount || plot.getOptions().zoom.amount,
+ w = plot.width(), h = plot.height();
+
+ if (!c)
+ c = { left: w / 2, top: h / 2 };
+
+ var xf = c.left / w,
+ yf = c.top / h,
+ minmax = {
+ x: {
+ min: c.left - xf * w / amount,
+ max: c.left + (1 - xf) * w / amount
+ },
+ y: {
+ min: c.top - yf * h / amount,
+ max: c.top + (1 - yf) * h / amount
+ }
+ };
+
+ $.each(plot.getAxes(), function(_, axis) {
+ var opts = axis.options,
+ min = minmax[axis.direction].min,
+ max = minmax[axis.direction].max,
+ zr = opts.zoomRange;
+
+ if (zr === false) // no zooming on this axis
+ return;
+
+ min = axis.c2p(min);
+ max = axis.c2p(max);
+ if (min > max) {
+ // make sure min < max
+ var tmp = min;
+ min = max;
+ max = tmp;
+ }
+
+ var range = max - min;
+ if (zr &&
+ ((zr[0] != null && range < zr[0]) ||
+ (zr[1] != null && range > zr[1])))
+ return;
+
+ opts.min = min;
+ opts.max = max;
+ });
+
+ plot.setupGrid();
+ plot.draw();
+
+ if (!args.preventEvent)
+ plot.getPlaceholder().trigger("plotzoom", [ plot ]);
+ }
+
+ plot.pan = function (args) {
+ var delta = {
+ x: +args.left,
+ y: +args.top
+ };
+
+ if (isNaN(delta.x))
+ delta.x = 0;
+ if (isNaN(delta.y))
+ delta.y = 0;
+
+ $.each(plot.getAxes(), function (_, axis) {
+ var opts = axis.options,
+ min, max, d = delta[axis.direction];
+
+ min = axis.c2p(axis.p2c(axis.min) + d),
+ max = axis.c2p(axis.p2c(axis.max) + d);
+
+ var pr = opts.panRange;
+ if (pr === false) // no panning on this axis
+ return;
+
+ if (pr) {
+ // check whether we hit the wall
+ if (pr[0] != null && pr[0] > min) {
+ d = pr[0] - min;
+ min += d;
+ max += d;
+ }
+
+ if (pr[1] != null && pr[1] < max) {
+ d = pr[1] - max;
+ min += d;
+ max += d;
+ }
+ }
+
+ opts.min = min;
+ opts.max = max;
+ });
+
+ plot.setupGrid();
+ plot.draw();
+
+ if (!args.preventEvent)
+ plot.getPlaceholder().trigger("plotpan", [ plot ]);
+ }
+
+ function shutdown(plot, eventHolder) {
+ eventHolder.unbind(plot.getOptions().zoom.trigger, onZoomClick);
+ eventHolder.unbind("mousewheel", onMouseWheel);
+ eventHolder.unbind("dragstart", onDragStart);
+ eventHolder.unbind("drag", onDrag);
+ eventHolder.unbind("dragend", onDragEnd);
+ if (panTimeout)
+ clearTimeout(panTimeout);
+ }
+
+ plot.hooks.bindEvents.push(bindEvents);
+ plot.hooks.shutdown.push(shutdown);
+ }
+
+ $.plot.plugins.push({
+ init: init,
+ options: options,
+ name: 'navigate',
+ version: '1.3'
+ });
+})(jQuery);
+
--- /dev/null
+++ b/js/flot/jquery.flot.navigate.min.js
@@ -1,1 +1,1 @@
-
+(function(i){i.fn.drag=function(j,k,l){if(k){this.bind("dragstart",j)}if(l){this.bind("dragend",l)}return !j?this.trigger("drag"):this.bind("drag",k?k:j)};var d=i.event,c=d.special,h=c.drag={not:":input",distance:0,which:1,dragging:false,setup:function(j){j=i.extend({distance:h.distance,which:h.which,not:h.not},j||{});j.distance=e(j.distance);d.add(this,"mousedown",f,j);if(this.attachEvent){this.attachEvent("ondragstart",a)}},teardown:function(){d.remove(this,"mousedown",f);if(this===h.dragging){h.dragging=h.proxy=false}g(this,true);if(this.detachEvent){this.detachEvent("ondragstart",a)}}};c.dragstart=c.dragend={setup:function(){},teardown:function(){}};function f(j){var k=this,l,m=j.data||{};if(m.elem){k=j.dragTarget=m.elem;j.dragProxy=h.proxy||k;j.cursorOffsetX=m.pageX-m.left;j.cursorOffsetY=m.pageY-m.top;j.offsetX=j.pageX-j.cursorOffsetX;j.offsetY=j.pageY-j.cursorOffsetY}else{if(h.dragging||(m.which>0&&j.which!=m.which)||i(j.target).is(m.not)){return}}switch(j.type){case"mousedown":i.extend(m,i(k).offset(),{elem:k,target:j.target,pageX:j.pageX,pageY:j.pageY});d.add(document,"mousemove mouseup",f,m);g(k,false);h.dragging=null;return false;case !h.dragging&&"mousemove":if(e(j.pageX-m.pageX)+e(j.pageY-m.pageY)<m.distance){break}j.target=m.target;l=b(j,"dragstart",k);if(l!==false){h.dragging=k;h.proxy=j.dragProxy=i(l||k)[0]}case"mousemove":if(h.dragging){l=b(j,"drag",k);if(c.drop){c.drop.allowed=(l!==false);c.drop.handler(j)}if(l!==false){break}j.type="mouseup"}case"mouseup":d.remove(document,"mousemove mouseup",f);if(h.dragging){if(c.drop){c.drop.handler(j)}b(j,"dragend",k)}g(k,true);h.dragging=h.proxy=m.elem=false;break}return true}function b(m,k,j){m.type=k;var l=i.event.handle.call(j,m);return l===false?false:l||m.result}function e(j){return Math.pow(j,2)}function a(){return(h.dragging===false)}function g(j,k){if(!j){return}j.unselectable=k?"off":"on";j.onselectstart=function(){return k};if(j.style){j.style.MozUserSelect=k?"":"none"}}})(jQuery);(function(f){var e=["DOMMouseScroll","mousewheel"];f.event.special.mousewheel={setup:function(){if(this.addEventListener){for(var a=e.length;a;){this.addEventListener(e[--a],d,false)}}else{this.onmousewheel=d}},teardown:function(){if(this.removeEventListener){for(var a=e.length;a;){this.removeEventListener(e[--a],d,false)}}else{this.onmousewheel=null}}};f.fn.extend({mousewheel:function(a){return a?this.bind("mousewheel",a):this.trigger("mousewheel")},unmousewheel:function(a){return this.unbind("mousewheel",a)}});function d(b){var h=[].slice.call(arguments,1),a=0,c=true;b=f.event.fix(b||window.event);b.type="mousewheel";if(b.wheelDelta){a=b.wheelDelta/120}if(b.detail){a=-b.detail/3}h.unshift(b,a);return f.event.handle.apply(this,h)}})(jQuery);(function(b){var a={xaxis:{zoomRange:null,panRange:null},zoom:{interactive:false,trigger:"dblclick",amount:1.5},pan:{interactive:false,cursor:"move",frameRate:20}};function c(o){function m(q,p){var r=o.offset();r.left=q.pageX-r.left;r.top=q.pageY-r.top;if(p){o.zoomOut({center:r})}else{o.zoom({center:r})}}function d(p,q){m(p,q<0);return false}var i="default",g=0,e=0,n=null;function f(p){if(p.which!=1){return false}var q=o.getPlaceholder().css("cursor");if(q){i=q}o.getPlaceholder().css("cursor",o.getOptions().pan.cursor);g=p.pageX;e=p.pageY}function j(q){var p=o.getOptions().pan.frameRate;if(n||!p){return}n=setTimeout(function(){o.pan({left:g-q.pageX,top:e-q.pageY});g=q.pageX;e=q.pageY;n=null},1/p*1000)}function h(p){if(n){clearTimeout(n);n=null}o.getPlaceholder().css("cursor",i);o.pan({left:g-p.pageX,top:e-p.pageY})}function l(q,p){var r=q.getOptions();if(r.zoom.interactive){p[r.zoom.trigger](m);p.mousewheel(d)}if(r.pan.interactive){p.bind("dragstart",{distance:10},f);p.bind("drag",j);p.bind("dragend",h)}}o.zoomOut=function(p){if(!p){p={}}if(!p.amount){p.amount=o.getOptions().zoom.amount}p.amount=1/p.amount;o.zoom(p)};o.zoom=function(q){if(!q){q={}}var x=q.center,r=q.amount||o.getOptions().zoom.amount,p=o.width(),t=o.height();if(!x){x={left:p/2,top:t/2}}var s=x.left/p,v=x.top/t,u={x:{min:x.left-s*p/r,max:x.left+(1-s)*p/r},y:{min:x.top-v*t/r,max:x.top+(1-v)*t/r}};b.each(o.getAxes(),function(z,C){var D=C.options,B=u[C.direction].min,w=u[C.direction].max,E=D.zoomRange;if(E===false){return}B=C.c2p(B);w=C.c2p(w);if(B>w){var A=B;B=w;w=A}var y=w-B;if(E&&((E[0]!=null&&y<E[0])||(E[1]!=null&&y>E[1]))){return}D.min=B;D.max=w});o.setupGrid();o.draw();if(!q.preventEvent){o.getPlaceholder().trigger("plotzoom",[o])}};o.pan=function(p){var q={x:+p.left,y:+p.top};if(isNaN(q.x)){q.x=0}if(isNaN(q.y)){q.y=0}b.each(o.getAxes(),function(s,u){var v=u.options,t,r,w=q[u.direction];t=u.c2p(u.p2c(u.min)+w),r=u.c2p(u.p2c(u.max)+w);var x=v.panRange;if(x===false){return}if(x){if(x[0]!=null&&x[0]>t){w=x[0]-t;t+=w;r+=w}if(x[1]!=null&&x[1]<r){w=x[1]-r;t+=w;r+=w}}v.min=t;v.max=r});o.setupGrid();o.draw();if(!p.preventEvent){o.getPlaceholder().trigger("plotpan",[o])}};function k(q,p){p.unbind(q.getOptions().zoom.trigger,m);p.unbind("mousewheel",d);p.unbind("dragstart",f);p.unbind("drag",j);p.unbind("dragend",h);if(n){clearTimeout(n)}}o.hooks.bindEvents.push(l);o.hooks.shutdown.push(k)}b.plot.plugins.push({init:c,options:a,name:"navigate",version:"1.3"})})(jQuery);
--- /dev/null
+++ b/js/flot/jquery.flot.pie.js
@@ -1,1 +1,751 @@
+/*
+Flot plugin for rendering pie charts. The plugin assumes the data is
+coming is as a single data value for each series, and each of those
+values is a positive value or zero (negative numbers don't make
+any sense and will cause strange effects). The data values do
+NOT need to be passed in as percentage values because it
+internally calculates the total and percentages.
+
+* Created by Brian Medendorp, June 2009
+* Updated November 2009 with contributions from: btburnett3, Anthony Aragues and Xavi Ivars
+
+* Changes:
+ 2009-10-22: lineJoin set to round
+ 2009-10-23: IE full circle fix, donut
+ 2009-11-11: Added basic hover from btburnett3 - does not work in IE, and center is off in Chrome and Opera
+ 2009-11-17: Added IE hover capability submitted by Anthony Aragues
+ 2009-11-18: Added bug fix submitted by Xavi Ivars (issues with arrays when other JS libraries are included as well)
+
+
+Available options are:
+series: {
+ pie: {
+ show: true/false
+ radius: 0-1 for percentage of fullsize, or a specified pixel length, or 'auto'
+ innerRadius: 0-1 for percentage of fullsize or a specified pixel length, for creating a donut effect
+ startAngle: 0-2 factor of PI used for starting angle (in radians) i.e 3/2 starts at the top, 0 and 2 have the same result
+ tilt: 0-1 for percentage to tilt the pie, where 1 is no tilt, and 0 is completely flat (nothing will show)
+ offset: {
+ top: integer value to move the pie up or down
+ left: integer value to move the pie left or right, or 'auto'
+ },
+ stroke: {
+ color: any hexidecimal color value (other formats may or may not work, so best to stick with something like '#FFF')
+ width: integer pixel width of the stroke
+ },
+ label: {
+ show: true/false, or 'auto'
+ formatter: a user-defined function that modifies the text/style of the label text
+ radius: 0-1 for percentage of fullsize, or a specified pixel length
+ background: {
+ color: any hexidecimal color value (other formats may or may not work, so best to stick with something like '#000')
+ opacity: 0-1
+ },
+ threshold: 0-1 for the percentage value at which to hide labels (if they're too small)
+ },
+ combine: {
+ threshold: 0-1 for the percentage value at which to combine slices (if they're too small)
+ color: any hexidecimal color value (other formats may or may not work, so best to stick with something like '#CCC'), if null, the plugin will automatically use the color of the first slice to be combined
+ label: any text value of what the combined slice should be labeled
+ }
+ highlight: {
+ opacity: 0-1
+ }
+ }
+}
+
+More detail and specific examples can be found in the included HTML file.
+
+*/
+
+(function ($)
+{
+ function init(plot) // this is the "body" of the plugin
+ {
+ var canvas = null;
+ var target = null;
+ var maxRadius = null;
+ var centerLeft = null;
+ var centerTop = null;
+ var total = 0;
+ var redraw = true;
+ var redrawAttempts = 10;
+ var shrink = 0.95;
+ var legendWidth = 0;
+ var processed = false;
+ var raw = false;
+
+ // interactive variables
+ var highlights = [];
+
+ // add hook to determine if pie plugin in enabled, and then perform necessary operations
+ plot.hooks.processOptions.push(checkPieEnabled);
+ plot.hooks.bindEvents.push(bindEvents);
+
+ // check to see if the pie plugin is enabled
+ function checkPieEnabled(plot, options)
+ {
+ if (options.series.pie.show)
+ {
+ //disable grid
+ options.grid.show = false;
+
+ // set labels.show
+ if (options.series.pie.label.show=='auto')
+ if (options.legend.show)
+ options.series.pie.label.show = false;
+ else
+ options.series.pie.label.show = true;
+
+ // set radius
+ if (options.series.pie.radius=='auto')
+ if (options.series.pie.label.show)
+ options.series.pie.radius = 3/4;
+ else
+ options.series.pie.radius = 1;
+
+ // ensure sane tilt
+ if (options.series.pie.tilt>1)
+ options.series.pie.tilt=1;
+ if (options.series.pie.tilt<0)
+ options.series.pie.tilt=0;
+
+ // add processData hook to do transformations on the data
+ plot.hooks.processDatapoints.push(processDatapoints);
+ plot.hooks.drawOverlay.push(drawOverlay);
+
+ // add draw hook
+ plot.hooks.draw.push(draw);
+ }
+ }
+
+ // bind hoverable events
+ function bindEvents(plot, eventHolder)
+ {
+ var options = plot.getOptions();
+
+ if (options.series.pie.show && options.grid.hoverable)
+ eventHolder.unbind('mousemove').mousemove(onMouseMove);
+
+ if (options.series.pie.show && options.grid.clickable)
+ eventHolder.unbind('click').click(onClick);
+ }
+
+
+ // debugging function that prints out an object
+ function alertObject(obj)
+ {
+ var msg = '';
+ function traverse(obj, depth)
+ {
+ if (!depth)
+ depth = 0;
+ for (var i = 0; i < obj.length; ++i)
+ {
+ for (var j=0; j<depth; j++)
+ msg += '\t';
+
+ if( typeof obj[i] == "object")
+ { // its an object
+ msg += ''+i+':\n';
+ traverse(obj[i], depth+1);
+ }
+ else
+ { // its a value
+ msg += ''+i+': '+obj[i]+'\n';
+ }
+ }
+ }
+ traverse(obj);
+ alert(msg);
+ }
+
+ function calcTotal(data)
+ {
+ for (var i = 0; i < data.length; ++i)
+ {
+ var item = parseFloat(data[i].data[0][1]);
+ if (item)
+ total += item;
+ }
+ }
+
+ function processDatapoints(plot, series, data, datapoints)
+ {
+ if (!processed)
+ {
+ processed = true;
+
+ canvas = plot.getCanvas();
+ target = $(canvas).parent();
+ options = plot.getOptions();
+
+ plot.setData(combine(plot.getData()));
+ }
+ }
+
+ function setupPie()
+ {
+ legendWidth = target.children().filter('.legend').children().width();
+
+ // calculate maximum radius and center point
+ maxRadius = Math.min(canvas.width,(canvas.height/options.series.pie.tilt))/2;
+ centerTop = (canvas.height/2)+options.series.pie.offset.top;
+ centerLeft = (canvas.width/2);
+
+ if (options.series.pie.offset.left=='auto')
+ if (options.legend.position.match('w'))
+ centerLeft += legendWidth/2;
+ else
+ centerLeft -= legendWidth/2;
+ else
+ centerLeft += options.series.pie.offset.left;
+
+ if (centerLeft<maxRadius)
+ centerLeft = maxRadius;
+ else if (centerLeft>canvas.width-maxRadius)
+ centerLeft = canvas.width-maxRadius;
+ }
+
+ function fixData(data)
+ {
+ for (var i = 0; i < data.length; ++i)
+ {
+ if (typeof(data[i].data)=='number')
+ data[i].data = [[1,data[i].data]];
+ else if (typeof(data[i].data)=='undefined' || typeof(data[i].data[0])=='undefined')
+ {
+ if (typeof(data[i].data)!='undefined' && typeof(data[i].data.label)!='undefined')
+ data[i].label = data[i].data.label; // fix weirdness coming from flot
+ data[i].data = [[1,0]];
+
+ }
+ }
+ return data;
+ }
+
+ function combine(data)
+ {
+ data = fixData(data);
+ calcTotal(data);
+ var combined = 0;
+ var numCombined = 0;
+ var color = options.series.pie.combine.color;
+
+ var newdata = [];
+ for (var i = 0; i < data.length; ++i)
+ {
+ // make sure its a number
+ data[i].data[0][1] = parseFloat(data[i].data[0][1]);
+ if (!data[i].data[0][1])
+ data[i].data[0][1] = 0;
+
+ if (data[i].data[0][1]/total<=options.series.pie.combine.threshold)
+ {
+ combined += data[i].data[0][1];
+ numCombined++;
+ if (!color)
+ color = data[i].color;
+ }
+ else
+ {
+ newdata.push({
+ data: [[1,data[i].data[0][1]]],
+ color: data[i].color,
+ label: data[i].label,
+ angle: (data[i].data[0][1]*(Math.PI*2))/total,
+ percent: (data[i].data[0][1]/total*100)
+ });
+ }
+ }
+ if (numCombined>0)
+ newdata.push({
+ data: [[1,combined]],
+ color: color,
+ label: options.series.pie.combine.label,
+ angle: (combined*(Math.PI*2))/total,
+ percent: (combined/total*100)
+ });
+ return newdata;
+ }
+
+ function draw(plot, newCtx)
+ {
+ if (!target) return; // if no series were passed
+ ctx = newCtx;
+
+ setupPie();
+ var slices = plot.getData();
+
+ var attempts = 0;
+ while (redraw && attempts<redrawAttempts)
+ {
+ redraw = false;
+ if (attempts>0)
+ maxRadius *= shrink;
+ attempts += 1;
+ clear();
+ if (options.series.pie.tilt<=0.8)
+ drawShadow();
+ drawPie();
+ }
+ if (attempts >= redrawAttempts) {
+ clear();
+ target.prepend('<div class="error">Could not draw pie with labels contained inside canvas</div>');
+ }
+
+ if ( plot.setSeries && plot.insertLegend )
+ {
+ plot.setSeries(slices);
+ plot.insertLegend();
+ }
+
+ // we're actually done at this point, just defining internal functions at this point
+
+ function clear()
+ {
+ ctx.clearRect(0,0,canvas.width,canvas.height);
+ target.children().filter('.pieLabel, .pieLabelBackground').remove();
+ }
+
+ function drawShadow()
+ {
+ var shadowLeft = 5;
+ var shadowTop = 15;
+ var edge = 10;
+ var alpha = 0.02;
+
+ // set radius
+ if (options.series.pie.radius>1)
+ var radius = options.series.pie.radius;
+ else
+ var radius = maxRadius * options.series.pie.radius;
+
+ if (radius>=(canvas.width/2)-shadowLeft || radius*options.series.pie.tilt>=(canvas.height/2)-shadowTop || radius<=edge)
+ return; // shadow would be outside canvas, so don't draw it
+
+ ctx.save();
+ ctx.translate(shadowLeft,shadowTop);
+ ctx.globalAlpha = alpha;
+ ctx.fillStyle = '#000';
+
+ // center and rotate to starting position
+ ctx.translate(centerLeft,centerTop);
+ ctx.scale(1, options.series.pie.tilt);
+
+ //radius -= edge;
+ for (var i=1; i<=edge; i++)
+ {
+ ctx.beginPath();
+ ctx.arc(0,0,radius,0,Math.PI*2,false);
+ ctx.fill();
+ radius -= i;
+ }
+
+ ctx.restore();
+ }
+
+ function drawPie()
+ {
+ startAngle = Math.PI*options.series.pie.startAngle;
+
+ // set radius
+ if (options.series.pie.radius>1)
+ var radius = options.series.pie.radius;
+ else
+ var radius = maxRadius * options.series.pie.radius;
+
+ // center and rotate to starting position
+ ctx.save();
+ ctx.translate(centerLeft,centerTop);
+ ctx.scale(1, options.series.pie.tilt);
+ //ctx.rotate(startAngle); // start at top; -- This doesn't work properly in Opera
+
+ // draw slices
+ ctx.save();
+ var currentAngle = startAngle;
+ for (var i = 0; i < slices.length; ++i)
+ {
+ slices[i].startAngle = currentAngle;
+ drawSlice(slices[i].angle, slices[i].color, true);
+ }
+ ctx.restore();
+
+ // draw slice outlines
+ ctx.save();
+ ctx.lineWidth = options.series.pie.stroke.width;
+ currentAngle = startAngle;
+ for (var i = 0; i < slices.length; ++i)
+ drawSlice(slices[i].angle, options.series.pie.stroke.color, false);
+ ctx.restore();
+
+ // draw donut hole
+ drawDonutHole(ctx);
+
+ // draw labels
+ if (options.series.pie.label.show)
+ drawLabels();
+
+ // restore to original state
+ ctx.restore();
+
+ function drawSlice(angle, color, fill)
+ {
+ if (angle<=0)
+ return;
+
+ if (fill)
+ ctx.fillStyle = color;
+ else
+ {
+ ctx.strokeStyle = color;
+ ctx.lineJoin = 'round';
+ }
+
+ ctx.beginPath();
+ if (Math.abs(angle - Math.PI*2) > 0.000000001)
+ ctx.moveTo(0,0); // Center of the pie
+ else if ($.browser.msie)
+ angle -= 0.0001;
+ //ctx.arc(0,0,radius,0,angle,false); // This doesn't work properly in Opera
+ ctx.arc(0,0,radius,currentAngle,currentAngle+angle,false);
+ ctx.closePath();
+ //ctx.rotate(angle); // This doesn't work properly in Opera
+ currentAngle += angle;
+
+ if (fill)
+ ctx.fill();
+ else
+ ctx.stroke();
+ }
+
+ function drawLabels()
+ {
+ var currentAngle = startAngle;
+
+ // set radius
+ if (options.series.pie.label.radius>1)
+ var radius = options.series.pie.label.radius;
+ else
+ var radius = maxRadius * options.series.pie.label.radius;
+
+ for (var i = 0; i < slices.length; ++i)
+ {
+ if (slices[i].percent >= options.series.pie.label.threshold*100)
+ drawLabel(slices[i], currentAngle, i);
+ currentAngle += slices[i].angle;
+ }
+
+ function drawLabel(slice, startAngle, index)
+ {
+ if (slice.data[0][1]==0)
+ return;
+
+ // format label text
+ var lf = options.legend.labelFormatter, text, plf = options.series.pie.label.formatter;
+ if (lf)
+ text = lf(slice.label, slice);
+ else
+ text = slice.label;
+ if (plf)
+ text = plf(text, slice);
+
+ var halfAngle = ((startAngle+slice.angle) + startAngle)/2;
+ var x = centerLeft + Math.round(Math.cos(halfAngle) * radius);
+ var y = centerTop + Math.round(Math.sin(halfAngle) * radius) * options.series.pie.tilt;
+
+ var html = '<span class="pieLabel" id="pieLabel'+index+'" style="position:absolute;top:' + y + 'px;left:' + x + 'px;">' + text + "</span>";
+ target.append(html);
+ var label = target.children('#pieLabel'+index);
+ var labelTop = (y - label.height()/2);
+ var labelLeft = (x - label.width()/2);
+ label.css('top', labelTop);
+ label.css('left', labelLeft);
+
+ // check to make sure that the label is not outside the canvas
+ if (0-labelTop>0 || 0-labelLeft>0 || canvas.height-(labelTop+label.height())<0 || canvas.width-(labelLeft+label.width())<0)
+ redraw = true;
+
+ if (options.series.pie.label.background.opacity != 0) {
+ // put in the transparent background separately to avoid blended labels and label boxes
+ var c = options.series.pie.label.background.color;
+ if (c == null) {
+ c = slice.color;
+ }
+ var pos = 'top:'+labelTop+'px;left:'+labelLeft+'px;';
+ $('<div class="pieLabelBackground" style="position:absolute;width:' + label.width() + 'px;height:' + label.height() + 'px;' + pos +'background-color:' + c + ';"> </div>').insertBefore(label).css('opacity', options.series.pie.label.background.opacity);
+ }
+ } // end individual label function
+ } // end drawLabels function
+ } // end drawPie function
+ } // end draw function
+
+ // Placed here because it needs to be accessed from multiple locations
+ function drawDonutHole(layer)
+ {
+ // draw donut hole
+ if(options.series.pie.innerRadius > 0)
+ {
+ // subtract the center
+ layer.save();
+ innerRadius = options.series.pie.innerRadius > 1 ? options.series.pie.innerRadius : maxRadius * options.series.pie.innerRadius;
+ layer.globalCompositeOperation = 'destination-out'; // this does not work with excanvas, but it will fall back to using the stroke color
+ layer.beginPath();
+ layer.fillStyle = options.series.pie.stroke.color;
+ layer.arc(0,0,innerRadius,0,Math.PI*2,false);
+ layer.fill();
+ layer.closePath();
+ layer.restore();
+
+ // add inner stroke
+ layer.save();
+ layer.beginPath();
+ layer.strokeStyle = options.series.pie.stroke.color;
+ layer.arc(0,0,innerRadius,0,Math.PI*2,false);
+ layer.stroke();
+ layer.closePath();
+ layer.restore();
+ // TODO: add extra shadow inside hole (with a mask) if the pie is tilted.
+ }
+ }
+
+ //-- Additional Interactive related functions --
+
+ function isPointInPoly(poly, pt)
+ {
+ for(var c = false, i = -1, l = poly.length, j = l - 1; ++i < l; j = i)
+ ((poly[i][1] <= pt[1] && pt[1] < poly[j][1]) || (poly[j][1] <= pt[1] && pt[1]< poly[i][1]))
+ && (pt[0] < (poly[j][0] - poly[i][0]) * (pt[1] - poly[i][1]) / (poly[j][1] - poly[i][1]) + poly[i][0])
+ && (c = !c);
+ return c;
+ }
+
+ function findNearbySlice(mouseX, mouseY)
+ {
+ var slices = plot.getData(),
+ options = plot.getOptions(),
+ radius = options.series.pie.radius > 1 ? options.series.pie.radius : maxRadius * options.series.pie.radius;
+
+ for (var i = 0; i < slices.length; ++i)
+ {
+ var s = slices[i];
+
+ if(s.pie.show)
+ {
+ ctx.save();
+ ctx.beginPath();
+ ctx.moveTo(0,0); // Center of the pie
+ //ctx.scale(1, options.series.pie.tilt); // this actually seems to break everything when here.
+ ctx.arc(0,0,radius,s.startAngle,s.startAngle+s.angle,false);
+ ctx.closePath();
+ x = mouseX-centerLeft;
+ y = mouseY-centerTop;
+ if(ctx.isPointInPath)
+ {
+ if (ctx.isPointInPath(mouseX-centerLeft, mouseY-centerTop))
+ {
+ //alert('found slice!');
+ ctx.restore();
+ return {datapoint: [s.percent, s.data], dataIndex: 0, series: s, seriesIndex: i};
+ }
+ }
+ else
+ {
+ // excanvas for IE doesn;t support isPointInPath, this is a workaround.
+ p1X = (radius * Math.cos(s.startAngle));
+ p1Y = (radius * Math.sin(s.startAngle));
+ p2X = (radius * Math.cos(s.startAngle+(s.angle/4)));
+ p2Y = (radius * Math.sin(s.startAngle+(s.angle/4)));
+ p3X = (radius * Math.cos(s.startAngle+(s.angle/2)));
+ p3Y = (radius * Math.sin(s.startAngle+(s.angle/2)));
+ p4X = (radius * Math.cos(s.startAngle+(s.angle/1.5)));
+ p4Y = (radius * Math.sin(s.startAngle+(s.angle/1.5)));
+ p5X = (radius * Math.cos(s.startAngle+s.angle));
+ p5Y = (radius * Math.sin(s.startAngle+s.angle));
+ arrPoly = [[0,0],[p1X,p1Y],[p2X,p2Y],[p3X,p3Y],[p4X,p4Y],[p5X,p5Y]];
+ arrPoint = [x,y];
+ // TODO: perhaps do some mathmatical trickery here with the Y-coordinate to compensate for pie tilt?
+ if(isPointInPoly(arrPoly, arrPoint))
+ {
+ ctx.restore();
+ return {datapoint: [s.percent, s.data], dataIndex: 0, series: s, seriesIndex: i};
+ }
+ }
+ ctx.restore();
+ }
+ }
+
+ return null;
+ }
+
+ function onMouseMove(e)
+ {
+ triggerClickHoverEvent('plothover', e);
+ }
+
+ function onClick(e)
+ {
+ triggerClickHoverEvent('plotclick', e);
+ }
+
+ // trigger click or hover event (they send the same parameters so we share their code)
+ function triggerClickHoverEvent(eventname, e)
+ {
+ var offset = plot.offset(),
+ canvasX = parseInt(e.pageX - offset.left),
+ canvasY = parseInt(e.pageY - offset.top),
+ item = findNearbySlice(canvasX, canvasY);
+
+ if (options.grid.autoHighlight)
+ {
+ // clear auto-highlights
+ for (var i = 0; i < highlights.length; ++i)
+ {
+ var h = highlights[i];
+ if (h.auto == eventname && !(item && h.series == item.series))
+ unhighlight(h.series);
+ }
+ }
+
+ // highlight the slice
+ if (item)
+ highlight(item.series, eventname);
+
+ // trigger any hover bind events
+ var pos = { pageX: e.pageX, pageY: e.pageY };
+ target.trigger(eventname, [ pos, item ]);
+ }
+
+ function highlight(s, auto)
+ {
+ if (typeof s == "number")
+ s = series[s];
+
+ var i = indexOfHighlight(s);
+ if (i == -1)
+ {
+ highlights.push({ series: s, auto: auto });
+ plot.triggerRedrawOverlay();
+ }
+ else if (!auto)
+ highlights[i].auto = false;
+ }
+
+ function unhighlight(s)
+ {
+ if (s == null)
+ {
+ highlights = [];
+ plot.triggerRedrawOverlay();
+ }
+
+ if (typeof s == "number")
+ s = series[s];
+
+ var i = indexOfHighlight(s);
+ if (i != -1)
+ {
+ highlights.splice(i, 1);
+ plot.triggerRedrawOverlay();
+ }
+ }
+
+ function indexOfHighlight(s)
+ {
+ for (var i = 0; i < highlights.length; ++i)
+ {
+ var h = highlights[i];
+ if (h.series == s)
+ return i;
+ }
+ return -1;
+ }
+
+ function drawOverlay(plot, octx)
+ {
+ //alert(options.series.pie.radius);
+ var options = plot.getOptions();
+ //alert(options.series.pie.radius);
+
+ var radius = options.series.pie.radius > 1 ? options.series.pie.radius : maxRadius * options.series.pie.radius;
+
+ octx.save();
+ octx.translate(centerLeft, centerTop);
+ octx.scale(1, options.series.pie.tilt);
+
+ for (i = 0; i < highlights.length; ++i)
+ drawHighlight(highlights[i].series);
+
+ drawDonutHole(octx);
+
+ octx.restore();
+
+ function drawHighlight(series)
+ {
+ if (series.angle < 0) return;
+
+ //octx.fillStyle = parseColor(options.series.pie.highlight.color).scale(null, null, null, options.series.pie.highlight.opacity).toString();
+ octx.fillStyle = "rgba(255, 255, 255, "+options.series.pie.highlight.opacity+")"; // this is temporary until we have access to parseColor
+
+ octx.beginPath();
+ if (Math.abs(series.angle - Math.PI*2) > 0.000000001)
+ octx.moveTo(0,0); // Center of the pie
+ octx.arc(0,0,radius,series.startAngle,series.startAngle+series.angle,false);
+ octx.closePath();
+ octx.fill();
+ }
+
+ }
+
+ } // end init (plugin body)
+
+ // define pie specific options and their default values
+ var options = {
+ series: {
+ pie: {
+ show: false,
+ radius: 'auto', // actual radius of the visible pie (based on full calculated radius if <=1, or hard pixel value)
+ innerRadius:0, /* for donut */
+ startAngle: 3/2,
+ tilt: 1,
+ offset: {
+ top: 0,
+ left: 'auto'
+ },
+ stroke: {
+ color: '#FFF',
+ width: 1
+ },
+ label: {
+ show: 'auto',
+ formatter: function(label, slice){
+ return '<div style="font-size:x-small;text-align:center;padding:2px;color:'+slice.color+';">'+label+'<br/>'+Math.round(slice.percent)+'%</div>';
+ }, // formatter function
+ radius: 1, // radius at which to place the labels (based on full calculated radius if <=1, or hard pixel value)
+ background: {
+ color: null,
+ opacity: 0
+ },
+ threshold: 0 // percentage at which to hide the label (i.e. the slice is too narrow)
+ },
+ combine: {
+ threshold: -1, // percentage at which to combine little slices into one larger slice
+ color: null, // color to give the new slice (auto-generated if null)
+ label: 'Other' // label to give the new slice
+ },
+ highlight: {
+ //color: '#FFF', // will add this functionality once parseColor is available
+ opacity: 0.5
+ }
+ }
+ }
+ };
+
+ $.plot.plugins.push({
+ init: init,
+ options: options,
+ name: "pie",
+ version: "1.0"
+ });
+})(jQuery);
--- /dev/null
+++ b/js/flot/jquery.flot.pie.min.js
@@ -1,1 +1,1 @@
-
+(function(b){function c(D){var h=null;var L=null;var n=null;var B=null;var p=null;var M=0;var F=true;var o=10;var w=0.95;var A=0;var d=false;var z=false;var j=[];D.hooks.processOptions.push(g);D.hooks.bindEvents.push(e);function g(O,N){if(N.series.pie.show){N.grid.show=false;if(N.series.pie.label.show=="auto"){if(N.legend.show){N.series.pie.label.show=false}else{N.series.pie.label.show=true}}if(N.series.pie.radius=="auto"){if(N.series.pie.label.show){N.series.pie.radius=3/4}else{N.series.pie.radius=1}}if(N.series.pie.tilt>1){N.series.pie.tilt=1}if(N.series.pie.tilt<0){N.series.pie.tilt=0}O.hooks.processDatapoints.push(E);O.hooks.drawOverlay.push(H);O.hooks.draw.push(r)}}function e(P,N){var O=P.getOptions();if(O.series.pie.show&&O.grid.hoverable){N.unbind("mousemove").mousemove(t)}if(O.series.pie.show&&O.grid.clickable){N.unbind("click").click(l)}}function G(O){var P="";function N(S,T){if(!T){T=0}for(var R=0;R<S.length;++R){for(var Q=0;Q<T;Q++){P+="\t"}if(typeof S[R]=="object"){P+=""+R+":\n";N(S[R],T+1)}else{P+=""+R+": "+S[R]+"\n"}}}N(O);alert(P)}function q(P){for(var N=0;N<P.length;++N){var O=parseFloat(P[N].data[0][1]);if(O){M+=O}}}function E(Q,N,O,P){if(!d){d=true;h=Q.getCanvas();L=b(h).parent();a=Q.getOptions();Q.setData(K(Q.getData()))}}function I(){A=L.children().filter(".legend").children().width();n=Math.min(h.width,(h.height/a.series.pie.tilt))/2;p=(h.height/2)+a.series.pie.offset.top;B=(h.width/2);if(a.series.pie.offset.left=="auto"){if(a.legend.position.match("w")){B+=A/2}else{B-=A/2}}else{B+=a.series.pie.offset.left}if(B<n){B=n}else{if(B>h.width-n){B=h.width-n}}}function v(O){for(var N=0;N<O.length;++N){if(typeof(O[N].data)=="number"){O[N].data=[[1,O[N].data]]}else{if(typeof(O[N].data)=="undefined"||typeof(O[N].data[0])=="undefined"){if(typeof(O[N].data)!="undefined"&&typeof(O[N].data.label)!="undefined"){O[N].label=O[N].data.label}O[N].data=[[1,0]]}}}return O}function K(Q){Q=v(Q);q(Q);var P=0;var S=0;var N=a.series.pie.combine.color;var R=[];for(var O=0;O<Q.length;++O){Q[O].data[0][1]=parseFloat(Q[O].data[0][1]);if(!Q[O].data[0][1]){Q[O].data[0][1]=0}if(Q[O].data[0][1]/M<=a.series.pie.combine.threshold){P+=Q[O].data[0][1];S++;if(!N){N=Q[O].color}}else{R.push({data:[[1,Q[O].data[0][1]]],color:Q[O].color,label:Q[O].label,angle:(Q[O].data[0][1]*(Math.PI*2))/M,percent:(Q[O].data[0][1]/M*100)})}}if(S>0){R.push({data:[[1,P]],color:N,label:a.series.pie.combine.label,angle:(P*(Math.PI*2))/M,percent:(P/M*100)})}return R}function r(S,Q){if(!L){return}ctx=Q;I();var T=S.getData();var P=0;while(F&&P<o){F=false;if(P>0){n*=w}P+=1;N();if(a.series.pie.tilt<=0.8){O()}R()}if(P>=o){N();L.prepend('<div class="error">Could not draw pie with labels contained inside canvas</div>')}if(S.setSeries&&S.insertLegend){S.setSeries(T);S.insertLegend()}function N(){ctx.clearRect(0,0,h.width,h.height);L.children().filter(".pieLabel, .pieLabelBackground").remove()}function O(){var Z=5;var Y=15;var W=10;var X=0.02;if(a.series.pie.radius>1){var U=a.series.pie.radius}else{var U=n*a.series.pie.radius}if(U>=(h.width/2)-Z||U*a.series.pie.tilt>=(h.height/2)-Y||U<=W){return}ctx.save();ctx.translate(Z,Y);ctx.globalAlpha=X;ctx.fillStyle="#000";ctx.translate(B,p);ctx.scale(1,a.series.pie.tilt);for(var V=1;V<=W;V++){ctx.beginPath();ctx.arc(0,0,U,0,Math.PI*2,false);ctx.fill();U-=V}ctx.restore()}function R(){startAngle=Math.PI*a.series.pie.startAngle;if(a.series.pie.radius>1){var U=a.series.pie.radius}else{var U=n*a.series.pie.radius}ctx.save();ctx.translate(B,p);ctx.scale(1,a.series.pie.tilt);ctx.save();var Y=startAngle;for(var W=0;W<T.length;++W){T[W].startAngle=Y;X(T[W].angle,T[W].color,true)}ctx.restore();ctx.save();ctx.lineWidth=a.series.pie.stroke.width;Y=startAngle;for(var W=0;W<T.length;++W){X(T[W].angle,a.series.pie.stroke.color,false)}ctx.restore();J(ctx);if(a.series.pie.label.show){V()}ctx.restore();function X(ab,Z,aa){if(ab<=0){return}if(aa){ctx.fillStyle=Z}else{ctx.strokeStyle=Z;ctx.lineJoin="round"}ctx.beginPath();if(Math.abs(ab-Math.PI*2)>1e-9){ctx.moveTo(0,0)}else{if(b.browser.msie){ab-=0.0001}}ctx.arc(0,0,U,Y,Y+ab,false);ctx.closePath();Y+=ab;if(aa){ctx.fill()}else{ctx.stroke()}}function V(){var ac=startAngle;if(a.series.pie.label.radius>1){var Z=a.series.pie.label.radius}else{var Z=n*a.series.pie.label.radius}for(var ab=0;ab<T.length;++ab){if(T[ab].percent>=a.series.pie.label.threshold*100){aa(T[ab],ac,ab)}ac+=T[ab].angle}function aa(ap,ai,ag){if(ap.data[0][1]==0){return}var ar=a.legend.labelFormatter,aq,ae=a.series.pie.label.formatter;if(ar){aq=ar(ap.label,ap)}else{aq=ap.label}if(ae){aq=ae(aq,ap)}var aj=((ai+ap.angle)+ai)/2;var ao=B+Math.round(Math.cos(aj)*Z);var am=p+Math.round(Math.sin(aj)*Z)*a.series.pie.tilt;var af='<span class="pieLabel" id="pieLabel'+ag+'" style="position:absolute;top:'+am+"px;left:"+ao+'px;">'+aq+"</span>";L.append(af);var an=L.children("#pieLabel"+ag);var ad=(am-an.height()/2);var ah=(ao-an.width()/2);an.css("top",ad);an.css("left",ah);if(0-ad>0||0-ah>0||h.height-(ad+an.height())<0||h.width-(ah+an.width())<0){F=true}if(a.series.pie.label.background.opacity!=0){var ak=a.series.pie.label.background.color;if(ak==null){ak=ap.color}var al="top:"+ad+"px;left:"+ah+"px;";b('<div class="pieLabelBackground" style="position:absolute;width:'+an.width()+"px;height:"+an.height()+"px;"+al+"background-color:"+ak+';"> </div>').insertBefore(an).css("opacity",a.series.pie.label.background.opacity)}}}}}function J(N){if(a.series.pie.innerRadius>0){N.save();innerRadius=a.series.pie.innerRadius>1?a.series.pie.innerRadius:n*a.series.pie.innerRadius;N.globalCompositeOperation="destination-out";N.beginPath();N.fillStyle=a.series.pie.stroke.color;N.arc(0,0,innerRadius,0,Math.PI*2,false);N.fill();N.closePath();N.restore();N.save();N.beginPath();N.strokeStyle=a.series.pie.stroke.color;N.arc(0,0,innerRadius,0,Math.PI*2,false);N.stroke();N.closePath();N.restore()}}function s(Q,R){for(var S=false,P=-1,N=Q.length,O=N-1;++P<N;O=P){((Q[P][1]<=R[1]&&R[1]<Q[O][1])||(Q[O][1]<=R[1]&&R[1]<Q[P][1]))&&(R[0]<(Q[O][0]-Q[P][0])*(R[1]-Q[P][1])/(Q[O][1]-Q[P][1])+Q[P][0])&&(S=!S)}return S}function u(R,P){var T=D.getData(),O=D.getOptions(),N=O.series.pie.radius>1?O.series.pie.radius:n*O.series.pie.radius;for(var Q=0;Q<T.length;++Q){var S=T[Q];if(S.pie.show){ctx.save();ctx.beginPath();ctx.moveTo(0,0);ctx.arc(0,0,N,S.startAngle,S.startAngle+S.angle,false);ctx.closePath();x=R-B;y=P-p;if(ctx.isPointInPath){if(ctx.isPointInPath(R-B,P-p)){ctx.restore();return{datapoint:[S.percent,S.data],dataIndex:0,series:S,seriesIndex:Q}}}else{p1X=(N*Math.cos(S.startAngle));p1Y=(N*Math.sin(S.startAngle));p2X=(N*Math.cos(S.startAngle+(S.angle/4)));p2Y=(N*Math.sin(S.startAngle+(S.angle/4)));p3X=(N*Math.cos(S.startAngle+(S.angle/2)));p3Y=(N*Math.sin(S.startAngle+(S.angle/2)));p4X=(N*Math.cos(S.startAngle+(S.angle/1.5)));p4Y=(N*Math.sin(S.startAngle+(S.angle/1.5)));p5X=(N*Math.cos(S.startAngle+S.angle));p5Y=(N*Math.sin(S.startAngle+S.angle));arrPoly=[[0,0],[p1X,p1Y],[p2X,p2Y],[p3X,p3Y],[p4X,p4Y],[p5X,p5Y]];arrPoint=[x,y];if(s(arrPoly,arrPoint)){ctx.restore();return{datapoint:[S.percent,S.data],dataIndex:0,series:S,seriesIndex:Q}}}ctx.restore()}}return null}function t(N){m("plothover",N)}function l(N){m("plotclick",N)}function m(N,T){var O=D.offset(),R=parseInt(T.pageX-O.left),P=parseInt(T.pageY-O.top),V=u(R,P);if(a.grid.autoHighlight){for(var Q=0;Q<j.length;++Q){var S=j[Q];if(S.auto==N&&!(V&&S.series==V.series)){f(S.series)}}}if(V){k(V.series,N)}var U={pageX:T.pageX,pageY:T.pageY};L.trigger(N,[U,V])}function k(O,P){if(typeof O=="number"){O=series[O]}var N=C(O);if(N==-1){j.push({series:O,auto:P});D.triggerRedrawOverlay()}else{if(!P){j[N].auto=false}}}function f(O){if(O==null){j=[];D.triggerRedrawOverlay()}if(typeof O=="number"){O=series[O]}var N=C(O);if(N!=-1){j.splice(N,1);D.triggerRedrawOverlay()}}function C(P){for(var N=0;N<j.length;++N){var O=j[N];if(O.series==P){return N}}return -1}function H(Q,R){var P=Q.getOptions();var N=P.series.pie.radius>1?P.series.pie.radius:n*P.series.pie.radius;R.save();R.translate(B,p);R.scale(1,P.series.pie.tilt);for(i=0;i<j.length;++i){O(j[i].series)}J(R);R.restore();function O(S){if(S.angle<0){return}R.fillStyle="rgba(255, 255, 255, "+P.series.pie.highlight.opacity+")";R.beginPath();if(Math.abs(S.angle-Math.PI*2)>1e-9){R.moveTo(0,0)}R.arc(0,0,N,S.startAngle,S.startAngle+S.angle,false);R.closePath();R.fill()}}}var a={series:{pie:{show:false,radius:"auto",innerRadius:0,startAngle:3/2,tilt:1,offset:{top:0,left:"auto"},stroke:{color:"#FFF",width:1},label:{show:"auto",formatter:function(d,e){return'<div style="font-size:x-small;text-align:center;padding:2px;color:'+e.color+';">'+d+"<br/>"+Math.round(e.percent)+"%</div>"},radius:1,background:{color:null,opacity:0},threshold:0},combine:{threshold:-1,color:null,label:"Other"},highlight:{opacity:0.5}}}};b.plot.plugins.push({init:c,options:a,name:"pie",version:"1.0"})})(jQuery);
--- /dev/null
+++ b/js/flot/jquery.flot.resize.js
@@ -1,1 +1,61 @@
+/*
+Flot plugin for automatically redrawing plots when the placeholder
+size changes, e.g. on window resizes.
+It works by listening for changes on the placeholder div (through the
+jQuery resize event plugin) - if the size changes, it will redraw the
+plot.
+
+There are no options. If you need to disable the plugin for some
+plots, you can just fix the size of their placeholders.
+*/
+
+
+/* Inline dependency:
+ * jQuery resize event - v1.1 - 3/14/2010
+ * http://benalman.com/projects/jquery-resize-plugin/
+ *
+ * Copyright (c) 2010 "Cowboy" Ben Alman
+ * Dual licensed under the MIT and GPL licenses.
+ * http://benalman.com/about/license/
+ */
+(function($,h,c){var a=$([]),e=$.resize=$.extend($.resize,{}),i,k="setTimeout",j="resize",d=j+"-special-event",b="delay",f="throttleWindow";e[b]=250;e[f]=true;$.event.special[j]={setup:function(){if(!e[f]&&this[k]){return false}var l=$(this);a=a.add(l);$.data(this,d,{w:l.width(),h:l.height()});if(a.length===1){g()}},teardown:function(){if(!e[f]&&this[k]){return false}var l=$(this);a=a.not(l);l.removeData(d);if(!a.length){clearTimeout(i)}},add:function(l){if(!e[f]&&this[k]){return false}var n;function m(s,o,p){var q=$(this),r=$.data(this,d);r.w=o!==c?o:q.width();r.h=p!==c?p:q.height();n.apply(this,arguments)}if($.isFunction(l)){n=l;return m}else{n=l.handler;l.handler=m}}};function g(){i=h[k](function(){a.each(function(){var n=$(this),m=n.width(),l=n.height(),o=$.data(this,d);if(m!==o.w||l!==o.h){n.trigger(j,[o.w=m,o.h=l])}});g()},e[b])}})(jQuery,this);
+
+
+(function ($) {
+ var options = { }; // no options
+
+ function init(plot) {
+ function onResize() {
+ var placeholder = plot.getPlaceholder();
+
+ // somebody might have hidden us and we can't plot
+ // when we don't have the dimensions
+ if (placeholder.width() == 0 || placeholder.height() == 0)
+ return;
+
+ plot.resize();
+ plot.setupGrid();
+ plot.draw();
+ }
+
+ function bindEvents(plot, eventHolder) {
+ plot.getPlaceholder().resize(onResize);
+ }
+
+ function shutdown(plot, eventHolder) {
+ plot.getPlaceholder().unbind("resize", onResize);
+ }
+
+ plot.hooks.bindEvents.push(bindEvents);
+ plot.hooks.shutdown.push(shutdown);
+ }
+
+ $.plot.plugins.push({
+ init: init,
+ options: options,
+ name: 'resize',
+ version: '1.0'
+ });
+})(jQuery);
+
--- /dev/null
+++ b/js/flot/jquery.flot.resize.min.js
@@ -1,1 +1,1 @@
-
+(function(n,p,u){var w=n([]),s=n.resize=n.extend(n.resize,{}),o,l="setTimeout",m="resize",t=m+"-special-event",v="delay",r="throttleWindow";s[v]=250;s[r]=true;n.event.special[m]={setup:function(){if(!s[r]&&this[l]){return false}var a=n(this);w=w.add(a);n.data(this,t,{w:a.width(),h:a.height()});if(w.length===1){q()}},teardown:function(){if(!s[r]&&this[l]){return false}var a=n(this);w=w.not(a);a.removeData(t);if(!w.length){clearTimeout(o)}},add:function(b){if(!s[r]&&this[l]){return false}var c;function a(d,h,g){var f=n(this),e=n.data(this,t);e.w=h!==u?h:f.width();e.h=g!==u?g:f.height();c.apply(this,arguments)}if(n.isFunction(b)){c=b;return a}else{c=b.handler;b.handler=a}}};function q(){o=p[l](function(){w.each(function(){var d=n(this),a=d.width(),b=d.height(),c=n.data(this,t);if(a!==c.w||b!==c.h){d.trigger(m,[c.w=a,c.h=b])}});q()},s[v])}})(jQuery,this);(function(b){var a={};function c(f){function e(){var h=f.getPlaceholder();if(h.width()==0||h.height()==0){return}f.resize();f.setupGrid();f.draw()}function g(i,h){i.getPlaceholder().resize(e)}function d(i,h){i.getPlaceholder().unbind("resize",e)}f.hooks.bindEvents.push(g);f.hooks.shutdown.push(d)}b.plot.plugins.push({init:c,options:a,name:"resize",version:"1.0"})})(jQuery);
--- /dev/null
+++ b/js/flot/jquery.flot.selection.js
@@ -1,1 +1,345 @@
-
+/*
+Flot plugin for selecting regions.
+
+The plugin defines the following options:
+
+ selection: {
+ mode: null or "x" or "y" or "xy",
+ color: color
+ }
+
+Selection support is enabled by setting the mode to one of "x", "y" or
+"xy". In "x" mode, the user will only be able to specify the x range,
+similarly for "y" mode. For "xy", the selection becomes a rectangle
+where both ranges can be specified. "color" is color of the selection
+(if you need to change the color later on, you can get to it with
+plot.getOptions().selection.color).
+
+When selection support is enabled, a "plotselected" event will be
+emitted on the DOM element you passed into the plot function. The
+event handler gets a parameter with the ranges selected on the axes,
+like this:
+
+ placeholder.bind("plotselected", function(event, ranges) {
+ alert("You selected " + ranges.xaxis.from + " to " + ranges.xaxis.to)
+ // similar for yaxis - with multiple axes, the extra ones are in
+ // x2axis, x3axis, ...
+ });
+
+The "plotselected" event is only fired when the user has finished
+making the selection. A "plotselecting" event is fired during the
+process with the same parameters as the "plotselected" event, in case
+you want to know what's happening while it's happening,
+
+A "plotunselected" event with no arguments is emitted when the user
+clicks the mouse to remove the selection.
+
+The plugin allso adds the following methods to the plot object:
+
+- setSelection(ranges, preventEvent)
+
+ Set the selection rectangle. The passed in ranges is on the same
+ form as returned in the "plotselected" event. If the selection mode
+ is "x", you should put in either an xaxis range, if the mode is "y"
+ you need to put in an yaxis range and both xaxis and yaxis if the
+ selection mode is "xy", like this:
+
+ setSelection({ xaxis: { from: 0, to: 10 }, yaxis: { from: 40, to: 60 } });
+
+ setSelection will trigger the "plotselected" event when called. If
+ you don't want that to happen, e.g. if you're inside a
+ "plotselected" handler, pass true as the second parameter. If you
+ are using multiple axes, you can specify the ranges on any of those,
+ e.g. as x2axis/x3axis/... instead of xaxis, the plugin picks the
+ first one it sees.
+
+- clearSelection(preventEvent)
+
+ Clear the selection rectangle. Pass in true to avoid getting a
+ "plotunselected" event.
+
+- getSelection()
+
+ Returns the current selection in the same format as the
+ "plotselected" event. If there's currently no selection, the
+ function returns null.
+
+*/
+
+(function ($) {
+ function init(plot) {
+ var selection = {
+ first: { x: -1, y: -1}, second: { x: -1, y: -1},
+ show: false,
+ active: false
+ };
+
+ // FIXME: The drag handling implemented here should be
+ // abstracted out, there's some similar code from a library in
+ // the navigation plugin, this should be massaged a bit to fit
+ // the Flot cases here better and reused. Doing this would
+ // make this plugin much slimmer.
+ var savedhandlers = {};
+
+ var mouseUpHandler = null;
+
+ function onMouseMove(e) {
+ if (selection.active) {
+ updateSelection(e);
+
+ plot.getPlaceholder().trigger("plotselecting", [ getSelection() ]);
+ }
+ }
+
+ function onMouseDown(e) {
+ if (e.which != 1) // only accept left-click
+ return;
+
+ // cancel out any text selections
+ document.body.focus();
+
+ // prevent text selection and drag in old-school browsers
+ if (document.onselectstart !== undefined && savedhandlers.onselectstart == null) {
+ savedhandlers.onselectstart = document.onselectstart;
+ document.onselectstart = function () { return false; };
+ }
+ if (document.ondrag !== undefined && savedhandlers.ondrag == null) {
+ savedhandlers.ondrag = document.ondrag;
+ document.ondrag = function () { return false; };
+ }
+
+ setSelectionPos(selection.first, e);
+
+ selection.active = true;
+
+ // this is a bit silly, but we have to use a closure to be
+ // able to whack the same handler again
+ mouseUpHandler = function (e) { onMouseUp(e); };
+
+ $(document).one("mouseup", mouseUpHandler);
+ }
+
+ function onMouseUp(e) {
+ mouseUpHandler = null;
+
+ // revert drag stuff for old-school browsers
+ if (document.onselectstart !== undefined)
+ document.onselectstart = savedhandlers.onselectstart;
+ if (document.ondrag !== undefined)
+ document.ondrag = savedhandlers.ondrag;
+
+ // no more dragging
+ selection.active = false;
+ updateSelection(e);
+
+ if (selectionIsSane())
+ triggerSelectedEvent();
+ else {
+ // this counts as a clear
+ plot.getPlaceholder().trigger("plotunselected", [ ]);
+ plot.getPlaceholder().trigger("plotselecting", [ null ]);
+ }
+
+ return false;
+ }
+
+ function getSelection() {
+ if (!selectionIsSane())
+ return null;
+
+ var r = {}, c1 = selection.first, c2 = selection.second;
+ $.each(plot.getAxes(), function (name, axis) {
+ if (axis.used) {
+ var p1 = axis.c2p(c1[axis.direction]), p2 = axis.c2p(c2[axis.direction]);
+ r[name] = { from: Math.min(p1, p2), to: Math.max(p1, p2) };
+ }
+ });
+ return r;
+ }
+
+ function triggerSelectedEvent() {
+ var r = getSelection();
+
+ plot.getPlaceholder().trigger("plotselected", [ r ]);
+
+ // backwards-compat stuff, to be removed in future
+ if (r.xaxis && r.yaxis)
+ plot.getPlaceholder().trigger("selected", [ { x1: r.xaxis.from, y1: r.yaxis.from, x2: r.xaxis.to, y2: r.yaxis.to } ]);
+ }
+
+ function clamp(min, value, max) {
+ return value < min ? min: (value > max ? max: value);
+ }
+
+ function setSelectionPos(pos, e) {
+ var o = plot.getOptions();
+ var offset = plot.getPlaceholder().offset();
+ var plotOffset = plot.getPlotOffset();
+ pos.x = clamp(0, e.pageX - offset.left - plotOffset.left, plot.width());
+ pos.y = clamp(0, e.pageY - offset.top - plotOffset.top, plot.height());
+
+ if (o.selection.mode == "y")
+ pos.x = pos == selection.first ? 0 : plot.width();
+
+ if (o.selection.mode == "x")
+ pos.y = pos == selection.first ? 0 : plot.height();
+ }
+
+ function updateSelection(pos) {
+ if (pos.pageX == null)
+ return;
+
+ setSelectionPos(selection.second, pos);
+ if (selectionIsSane()) {
+ selection.show = true;
+ plot.triggerRedrawOverlay();
+ }
+ else
+ clearSelection(true);
+ }
+
+ function clearSelection(preventEvent) {
+ if (selection.show) {
+ selection.show = false;
+ plot.triggerRedrawOverlay();
+ if (!preventEvent)
+ plot.getPlaceholder().trigger("plotunselected", [ ]);
+ }
+ }
+
+ // function taken from markings support in Flot
+ function extractRange(ranges, coord) {
+ var axis, from, to, key, axes = plot.getAxes();
+
+ for (var k in axes) {
+ axis = axes[k];
+ if (axis.direction == coord) {
+ key = coord + axis.n + "axis";
+ if (!ranges[key] && axis.n == 1)
+ key = coord + "axis"; // support x1axis as xaxis
+ if (ranges[key]) {
+ from = ranges[key].from;
+ to = ranges[key].to;
+ break;
+ }
+ }
+ }
+
+ // backwards-compat stuff - to be removed in future
+ if (!ranges[key]) {
+ axis = coord == "x" ? plot.getXAxes()[0] : plot.getYAxes()[0];
+ from = ranges[coord + "1"];
+ to = ranges[coord + "2"];
+ }
+
+ // auto-reverse as an added bonus
+ if (from != null && to != null && from > to) {
+ var tmp = from;
+ from = to;
+ to = tmp;
+ }
+
+ return { from: from, to: to, axis: axis };
+ }
+
+ function setSelection(ranges, preventEvent) {
+ var axis, range, o = plot.getOptions();
+
+ if (o.selection.mode == "y") {
+ selection.first.x = 0;
+ selection.second.x = plot.width();
+ }
+ else {
+ range = extractRange(ranges, "x");
+
+ selection.first.x = range.axis.p2c(range.from);
+ selection.second.x = range.axis.p2c(range.to);
+ }
+
+ if (o.selection.mode == "x") {
+ selection.first.y = 0;
+ selection.second.y = plot.height();
+ }
+ else {
+ range = extractRange(ranges, "y");
+
+ selection.first.y = range.axis.p2c(range.from);
+ selection.second.y = range.axis.p2c(range.to);
+ }
+
+ selection.show = true;
+ plot.triggerRedrawOverlay();
+ if (!preventEvent && selectionIsSane())
+ triggerSelectedEvent();
+ }
+
+ function selectionIsSane() {
+ var minSize = 5;
+ return Math.abs(selection.second.x - selection.first.x) >= minSize &&
+ Math.abs(selection.second.y - selection.first.y) >= minSize;
+ }
+
+ plot.clearSelection = clearSelection;
+ plot.setSelection = setSelection;
+ plot.getSelection = getSelection;
+
+ plot.hooks.bindEvents.push(function(plot, eventHolder) {
+ var o = plot.getOptions();
+ if (o.selection.mode != null) {
+ eventHolder.mousemove(onMouseMove);
+ eventHolder.mousedown(onMouseDown);
+ }
+ });
+
+
+ plot.hooks.drawOverlay.push(function (plot, ctx) {
+ // draw selection
+ if (selection.show && selectionIsSane()) {
+ var plotOffset = plot.getPlotOffset();
+ var o = plot.getOptions();
+
+ ctx.save();
+ ctx.translate(plotOffset.left, plotOffset.top);
+
+ var c = $.color.parse(o.selection.color);
+
+ ctx.strokeStyle = c.scale('a', 0.8).toString();
+ ctx.lineWidth = 1;
+ ctx.lineJoin = "round";
+ ctx.fillStyle = c.scale('a', 0.4).toString();
+
+ var x = Math.min(selection.first.x, selection.second.x),
+ y = Math.min(selection.first.y, selection.second.y),
+ w = Math.abs(selection.second.x - selection.first.x),
+ h = Math.abs(selection.second.y - selection.first.y);
+
+ ctx.fillRect(x, y, w, h);
+ ctx.strokeRect(x, y, w, h);
+
+ ctx.restore();
+ }
+ });
+
+ plot.hooks.shutdown.push(function (plot, eventHolder) {
+ eventHolder.unbind("mousemove", onMouseMove);
+ eventHolder.unbind("mousedown", onMouseDown);
+
+ if (mouseUpHandler)
+ $(document).unbind("mouseup", mouseUpHandler);
+ });
+
+ }
+
+ $.plot.plugins.push({
+ init: init,
+ options: {
+ selection: {
+ mode: null, // one of null, "x", "y" or "xy"
+ color: "#e8cfac"
+ }
+ },
+ name: 'selection',
+ version: '1.1'
+ });
+})(jQuery);
+
--- /dev/null
+++ b/js/flot/jquery.flot.selection.min.js
@@ -1,1 +1,1 @@
-
+(function(a){function b(k){var p={first:{x:-1,y:-1},second:{x:-1,y:-1},show:false,active:false};var m={};var r=null;function e(s){if(p.active){l(s);k.getPlaceholder().trigger("plotselecting",[g()])}}function n(s){if(s.which!=1){return}document.body.focus();if(document.onselectstart!==undefined&&m.onselectstart==null){m.onselectstart=document.onselectstart;document.onselectstart=function(){return false}}if(document.ondrag!==undefined&&m.ondrag==null){m.ondrag=document.ondrag;document.ondrag=function(){return false}}d(p.first,s);p.active=true;r=function(t){j(t)};a(document).one("mouseup",r)}function j(s){r=null;if(document.onselectstart!==undefined){document.onselectstart=m.onselectstart}if(document.ondrag!==undefined){document.ondrag=m.ondrag}p.active=false;l(s);if(f()){i()}else{k.getPlaceholder().trigger("plotunselected",[]);k.getPlaceholder().trigger("plotselecting",[null])}return false}function g(){if(!f()){return null}var u={},t=p.first,s=p.second;a.each(k.getAxes(),function(v,w){if(w.used){var y=w.c2p(t[w.direction]),x=w.c2p(s[w.direction]);u[v]={from:Math.min(y,x),to:Math.max(y,x)}}});return u}function i(){var s=g();k.getPlaceholder().trigger("plotselected",[s]);if(s.xaxis&&s.yaxis){k.getPlaceholder().trigger("selected",[{x1:s.xaxis.from,y1:s.yaxis.from,x2:s.xaxis.to,y2:s.yaxis.to}])}}function h(t,u,s){return u<t?t:(u>s?s:u)}function d(w,t){var v=k.getOptions();var u=k.getPlaceholder().offset();var s=k.getPlotOffset();w.x=h(0,t.pageX-u.left-s.left,k.width());w.y=h(0,t.pageY-u.top-s.top,k.height());if(v.selection.mode=="y"){w.x=w==p.first?0:k.width()}if(v.selection.mode=="x"){w.y=w==p.first?0:k.height()}}function l(s){if(s.pageX==null){return}d(p.second,s);if(f()){p.show=true;k.triggerRedrawOverlay()}else{q(true)}}function q(s){if(p.show){p.show=false;k.triggerRedrawOverlay();if(!s){k.getPlaceholder().trigger("plotunselected",[])}}}function c(s,w){var t,y,z,A,x=k.getAxes();for(var u in x){t=x[u];if(t.direction==w){A=w+t.n+"axis";if(!s[A]&&t.n==1){A=w+"axis"}if(s[A]){y=s[A].from;z=s[A].to;break}}}if(!s[A]){t=w=="x"?k.getXAxes()[0]:k.getYAxes()[0];y=s[w+"1"];z=s[w+"2"]}if(y!=null&&z!=null&&y>z){var v=y;y=z;z=v}return{from:y,to:z,axis:t}}function o(t,s){var v,u,w=k.getOptions();if(w.selection.mode=="y"){p.first.x=0;p.second.x=k.width()}else{u=c(t,"x");p.first.x=u.axis.p2c(u.from);p.second.x=u.axis.p2c(u.to)}if(w.selection.mode=="x"){p.first.y=0;p.second.y=k.height()}else{u=c(t,"y");p.first.y=u.axis.p2c(u.from);p.second.y=u.axis.p2c(u.to)}p.show=true;k.triggerRedrawOverlay();if(!s&&f()){i()}}function f(){var s=5;return Math.abs(p.second.x-p.first.x)>=s&&Math.abs(p.second.y-p.first.y)>=s}k.clearSelection=q;k.setSelection=o;k.getSelection=g;k.hooks.bindEvents.push(function(t,s){var u=t.getOptions();if(u.selection.mode!=null){s.mousemove(e);s.mousedown(n)}});k.hooks.drawOverlay.push(function(v,D){if(p.show&&f()){var t=v.getPlotOffset();var s=v.getOptions();D.save();D.translate(t.left,t.top);var z=a.color.parse(s.selection.color);D.strokeStyle=z.scale("a",0.8).toString();D.lineWidth=1;D.lineJoin="round";D.fillStyle=z.scale("a",0.4).toString();var B=Math.min(p.first.x,p.second.x),A=Math.min(p.first.y,p.second.y),C=Math.abs(p.second.x-p.first.x),u=Math.abs(p.second.y-p.first.y);D.fillRect(B,A,C,u);D.strokeRect(B,A,C,u);D.restore()}});k.hooks.shutdown.push(function(t,s){s.unbind("mousemove",e);s.unbind("mousedown",n);if(r){a(document).unbind("mouseup",r)}})}a.plot.plugins.push({init:b,options:{selection:{mode:null,color:"#e8cfac"}},name:"selection",version:"1.1"})})(jQuery);
--- /dev/null
+++ b/js/flot/jquery.flot.stack.js
@@ -1,1 +1,185 @@
+/*
+Flot plugin for stacking data sets, i.e. putting them on top of each
+other, for accumulative graphs.
+The plugin assumes the data is sorted on x (or y if stacking
+horizontally). For line charts, it is assumed that if a line has an
+undefined gap (from a null point), then the line above it should have
+the same gap - insert zeros instead of "null" if you want another
+behaviour. This also holds for the start and end of the chart. Note
+that stacking a mix of positive and negative values in most instances
+doesn't make sense (so it looks weird).
+
+Two or more series are stacked when their "stack" attribute is set to
+the same key (which can be any number or string or just "true"). To
+specify the default stack, you can set
+
+ series: {
+ stack: null or true or key (number/string)
+ }
+
+or specify it for a specific series
+
+ $.plot($("#placeholder"), [{ data: [ ... ], stack: true }])
+
+The stacking order is determined by the order of the data series in
+the array (later series end up on top of the previous).
+
+Internally, the plugin modifies the datapoints in each series, adding
+an offset to the y value. For line series, extra data points are
+inserted through interpolation. If there's a second y value, it's also
+adjusted (e.g for bar charts or filled areas).
+*/
+
+(function ($) {
+ var options = {
+ series: { stack: null } // or number/string
+ };
+
+ function init(plot) {
+ function findMatchingSeries(s, allseries) {
+ var res = null
+ for (var i = 0; i < allseries.length; ++i) {
+ if (s == allseries[i])
+ break;
+
+ if (allseries[i].stack == s.stack)
+ res = allseries[i];
+ }
+
+ return res;
+ }
+
+ function stackData(plot, s, datapoints) {
+ if (s.stack == null)
+ return;
+
+ var other = findMatchingSeries(s, plot.getData());
+ if (!other)
+ return;
+
+ var ps = datapoints.pointsize,
+ points = datapoints.points,
+ otherps = other.datapoints.pointsize,
+ otherpoints = other.datapoints.points,
+ newpoints = [],
+ px, py, intery, qx, qy, bottom,
+ withlines = s.lines.show,
+ horizontal = s.bars.horizontal,
+ withbottom = ps > 2 && (horizontal ? datapoints.format[2].x : datapoints.format[2].y),
+ withsteps = withlines && s.lines.steps,
+ fromgap = true,
+ keyOffset = horizontal ? 1 : 0,
+ accumulateOffset = horizontal ? 0 : 1,
+ i = 0, j = 0, l;
+
+ while (true) {
+ if (i >= points.length)
+ break;
+
+ l = newpoints.length;
+
+ if (points[i] == null) {
+ // copy gaps
+ for (m = 0; m < ps; ++m)
+ newpoints.push(points[i + m]);
+ i += ps;
+ }
+ else if (j >= otherpoints.length) {
+ // for lines, we can't use the rest of the points
+ if (!withlines) {
+ for (m = 0; m < ps; ++m)
+ newpoints.push(points[i + m]);
+ }
+ i += ps;
+ }
+ else if (otherpoints[j] == null) {
+ // oops, got a gap
+ for (m = 0; m < ps; ++m)
+ newpoints.push(null);
+ fromgap = true;
+ j += otherps;
+ }
+ else {
+ // cases where we actually got two points
+ px = points[i + keyOffset];
+ py = points[i + accumulateOffset];
+ qx = otherpoints[j + keyOffset];
+ qy = otherpoints[j + accumulateOffset];
+ bottom = 0;
+
+ if (px == qx) {
+ for (m = 0; m < ps; ++m)
+ newpoints.push(points[i + m]);
+
+ newpoints[l + accumulateOffset] += qy;
+ bottom = qy;
+
+ i += ps;
+ j += otherps;
+ }
+ else if (px > qx) {
+ // we got past point below, might need to
+ // insert interpolated extra point
+ if (withlines && i > 0 && points[i - ps] != null) {
+ intery = py + (points[i - ps + accumulateOffset] - py) * (qx - px) / (points[i - ps + keyOffset] - px);
+ newpoints.push(qx);
+ newpoints.push(intery + qy);
+ for (m = 2; m < ps; ++m)
+ newpoints.push(points[i + m]);
+ bottom = qy;
+ }
+
+ j += otherps;
+ }
+ else { // px < qx
+ if (fromgap && withlines) {
+ // if we come from a gap, we just skip this point
+ i += ps;
+ continue;
+ }
+
+ for (m = 0; m < ps; ++m)
+ newpoints.push(points[i + m]);
+
+ // we might be able to interpolate a point below,
+ // this can give us a better y
+ if (withlines && j > 0 && otherpoints[j - otherps] != null)
+ bottom = qy + (otherpoints[j - otherps + accumulateOffset] - qy) * (px - qx) / (otherpoints[j - otherps + keyOffset] - qx);
+
+ newpoints[l + accumulateOffset] += bottom;
+
+ i += ps;
+ }
+
+ fromgap = false;
+
+ if (l != newpoints.length && withbottom)
+ newpoints[l + 2] += bottom;
+ }
+
+ // maintain the line steps invariant
+ if (withsteps && l != newpoints.length && l > 0
+ && newpoints[l] != null
+ && newpoints[l] != newpoints[l - ps]
+ && newpoints[l + 1] != newpoints[l - ps + 1]) {
+ for (m = 0; m < ps; ++m)
+ newpoints[l + ps + m] = newpoints[l + m];
+ newpoints[l + 1] = newpoints[l - ps + 1];
+ }
+ }
+
+ datapoints.points = newpoints;
+ }
+
+ plot.hooks.processDatapoints.push(stackData);
+ }
+
+ $.plot.plugins.push({
+ init: init,
+ options: options,
+ name: 'stack',
+ version: '1.2'
+ });
+})(jQuery);
+
--- /dev/null
+++ b/js/flot/jquery.flot.stack.min.js
@@ -1,1 +1,1 @@
-
+(function(b){var a={series:{stack:null}};function c(f){function d(k,j){var h=null;for(var g=0;g<j.length;++g){if(k==j[g]){break}if(j[g].stack==k.stack){h=j[g]}}return h}function e(C,v,g){if(v.stack==null){return}var p=d(v,C.getData());if(!p){return}var z=g.pointsize,F=g.points,h=p.datapoints.pointsize,y=p.datapoints.points,t=[],x,w,k,J,I,r,u=v.lines.show,G=v.bars.horizontal,o=z>2&&(G?g.format[2].x:g.format[2].y),n=u&&v.lines.steps,E=true,q=G?1:0,H=G?0:1,D=0,B=0,A;while(true){if(D>=F.length){break}A=t.length;if(F[D]==null){for(m=0;m<z;++m){t.push(F[D+m])}D+=z}else{if(B>=y.length){if(!u){for(m=0;m<z;++m){t.push(F[D+m])}}D+=z}else{if(y[B]==null){for(m=0;m<z;++m){t.push(null)}E=true;B+=h}else{x=F[D+q];w=F[D+H];J=y[B+q];I=y[B+H];r=0;if(x==J){for(m=0;m<z;++m){t.push(F[D+m])}t[A+H]+=I;r=I;D+=z;B+=h}else{if(x>J){if(u&&D>0&&F[D-z]!=null){k=w+(F[D-z+H]-w)*(J-x)/(F[D-z+q]-x);t.push(J);t.push(k+I);for(m=2;m<z;++m){t.push(F[D+m])}r=I}B+=h}else{if(E&&u){D+=z;continue}for(m=0;m<z;++m){t.push(F[D+m])}if(u&&B>0&&y[B-h]!=null){r=I+(y[B-h+H]-I)*(x-J)/(y[B-h+q]-J)}t[A+H]+=r;D+=z}}E=false;if(A!=t.length&&o){t[A+2]+=r}}}}if(n&&A!=t.length&&A>0&&t[A]!=null&&t[A]!=t[A-z]&&t[A+1]!=t[A-z+1]){for(m=0;m<z;++m){t[A+z+m]=t[A+m]}t[A+1]=t[A-z+1]}}g.points=t}f.hooks.processDatapoints.push(e)}b.plot.plugins.push({init:c,options:a,name:"stack",version:"1.2"})})(jQuery);
--- /dev/null
+++ b/js/flot/jquery.flot.symbol.js
@@ -1,1 +1,71 @@
+/*
+Flot plugin that adds some extra symbols for plotting points.
+The symbols are accessed as strings through the standard symbol
+choice:
+
+ series: {
+ points: {
+ symbol: "square" // or "diamond", "triangle", "cross"
+ }
+ }
+
+*/
+
+(function ($) {
+ function processRawData(plot, series, datapoints) {
+ // we normalize the area of each symbol so it is approximately the
+ // same as a circle of the given radius
+
+ var handlers = {
+ square: function (ctx, x, y, radius, shadow) {
+ // pi * r^2 = (2s)^2 => s = r * sqrt(pi)/2
+ var size = radius * Math.sqrt(Math.PI) / 2;
+ ctx.rect(x - size, y - size, size + size, size + size);
+ },
+ diamond: function (ctx, x, y, radius, shadow) {
+ // pi * r^2 = 2s^2 => s = r * sqrt(pi/2)
+ var size = radius * Math.sqrt(Math.PI / 2);
+ ctx.moveTo(x - size, y);
+ ctx.lineTo(x, y - size);
+ ctx.lineTo(x + size, y);
+ ctx.lineTo(x, y + size);
+ ctx.lineTo(x - size, y);
+ },
+ triangle: function (ctx, x, y, radius, shadow) {
+ // pi * r^2 = 1/2 * s^2 * sin (pi / 3) => s = r * sqrt(2 * pi / sin(pi / 3))
+ var size = radius * Math.sqrt(2 * Math.PI / Math.sin(Math.PI / 3));
+ var height = size * Math.sin(Math.PI / 3);
+ ctx.moveTo(x - size/2, y + height/2);
+ ctx.lineTo(x + size/2, y + height/2);
+ if (!shadow) {
+ ctx.lineTo(x, y - height/2);
+ ctx.lineTo(x - size/2, y + height/2);
+ }
+ },
+ cross: function (ctx, x, y, radius, shadow) {
+ // pi * r^2 = (2s)^2 => s = r * sqrt(pi)/2
+ var size = radius * Math.sqrt(Math.PI) / 2;
+ ctx.moveTo(x - size, y - size);
+ ctx.lineTo(x + size, y + size);
+ ctx.moveTo(x - size, y + size);
+ ctx.lineTo(x + size, y - size);
+ }
+ }
+
+ var s = series.points.symbol;
+ if (handlers[s])
+ series.points.symbol = handlers[s];
+ }
+
+ function init(plot) {
+ plot.hooks.processDatapoints.push(processRawData);
+ }
+
+ $.plot.plugins.push({
+ init: init,
+ name: 'symbols',
+ version: '1.0'
+ });
+})(jQuery);
+
--- /dev/null
+++ b/js/flot/jquery.flot.symbol.min.js
@@ -1,1 +1,1 @@
-
+(function(b){function a(h,e,g){var d={square:function(k,j,n,i,m){var l=i*Math.sqrt(Math.PI)/2;k.rect(j-l,n-l,l+l,l+l)},diamond:function(k,j,n,i,m){var l=i*Math.sqrt(Math.PI/2);k.moveTo(j-l,n);k.lineTo(j,n-l);k.lineTo(j+l,n);k.lineTo(j,n+l);k.lineTo(j-l,n)},triangle:function(l,k,o,j,n){var m=j*Math.sqrt(2*Math.PI/Math.sin(Math.PI/3));var i=m*Math.sin(Math.PI/3);l.moveTo(k-m/2,o+i/2);l.lineTo(k+m/2,o+i/2);if(!n){l.lineTo(k,o-i/2);l.lineTo(k-m/2,o+i/2)}},cross:function(k,j,n,i,m){var l=i*Math.sqrt(Math.PI)/2;k.moveTo(j-l,n-l);k.lineTo(j+l,n+l);k.moveTo(j-l,n+l);k.lineTo(j+l,n-l)}};var f=e.points.symbol;if(d[f]){e.points.symbol=d[f]}}function c(d){d.hooks.processDatapoints.push(a)}b.plot.plugins.push({init:c,name:"symbols",version:"1.0"})})(jQuery);
--- /dev/null
+++ b/js/flot/jquery.flot.threshold.js
@@ -1,1 +1,104 @@
+/*
+Flot plugin for thresholding data. Controlled through the option
+"threshold" in either the global series options
+ series: {
+ threshold: {
+ below: number
+ color: colorspec
+ }
+ }
+
+or in a specific series
+
+ $.plot($("#placeholder"), [{ data: [ ... ], threshold: { ... }}])
+
+The data points below "below" are drawn with the specified color. This
+makes it easy to mark points below 0, e.g. for budget data.
+
+Internally, the plugin works by splitting the data into two series,
+above and below the threshold. The extra series below the threshold
+will have its label cleared and the special "originSeries" attribute
+set to the original series. You may need to check for this in hover
+events.
+*/
+
+(function ($) {
+ var options = {
+ series: { threshold: null } // or { below: number, color: color spec}
+ };
+
+ function init(plot) {
+ function thresholdData(plot, s, datapoints) {
+ if (!s.threshold)
+ return;
+
+ var ps = datapoints.pointsize, i, x, y, p, prevp,
+ thresholded = $.extend({}, s); // note: shallow copy
+
+ thresholded.datapoints = { points: [], pointsize: ps };
+ thresholded.label = null;
+ thresholded.color = s.threshold.color;
+ thresholded.threshold = null;
+ thresholded.originSeries = s;
+ thresholded.data = [];
+
+ var below = s.threshold.below,
+ origpoints = datapoints.points,
+ addCrossingPoints = s.lines.show;
+
+ threspoints = [];
+ newpoints = [];
+
+ for (i = 0; i < origpoints.length; i += ps) {
+ x = origpoints[i]
+ y = origpoints[i + 1];
+
+ prevp = p;
+ if (y < below)
+ p = threspoints;
+ else
+ p = newpoints;
+
+ if (addCrossingPoints && prevp != p && x != null
+ && i > 0 && origpoints[i - ps] != null) {
+ var interx = (x - origpoints[i - ps]) / (y - origpoints[i - ps + 1]) * (below - y) + x;
+ prevp.push(interx);
+ prevp.push(below);
+ for (m = 2; m < ps; ++m)
+ prevp.push(origpoints[i + m]);
+
+ p.push(null); // start new segment
+ p.push(null);
+ for (m = 2; m < ps; ++m)
+ p.push(origpoints[i + m]);
+ p.push(interx);
+ p.push(below);
+ for (m = 2; m < ps; ++m)
+ p.push(origpoints[i + m]);
+ }
+
+ p.push(x);
+ p.push(y);
+ }
+
+ datapoints.points = newpoints;
+ thresholded.datapoints.points = threspoints;
+
+ if (thresholded.datapoints.points.length > 0)
+ plot.getData().push(thresholded);
+
+ // FIXME: there are probably some edge cases left in bars
+ }
+
+ plot.hooks.processDatapoints.push(thresholdData);
+ }
+
+ $.plot.plugins.push({
+ init: init,
+ options: options,
+ name: 'threshold',
+ version: '1.0'
+ });
+})(jQuery);
+
--- /dev/null
+++ b/js/flot/jquery.flot.threshold.min.js
@@ -1,1 +1,1 @@
-
+(function(B){var A={series:{threshold:null}};function C(D){function E(L,S,M){if(!S.threshold){return }var F=M.pointsize,I,O,N,G,K,H=B.extend({},S);H.datapoints={points:[],pointsize:F};H.label=null;H.color=S.threshold.color;H.threshold=null;H.originSeries=S;H.data=[];var P=S.threshold.below,Q=M.points,R=S.lines.show;threspoints=[];newpoints=[];for(I=0;I<Q.length;I+=F){O=Q[I];N=Q[I+1];K=G;if(N<P){G=threspoints}else{G=newpoints}if(R&&K!=G&&O!=null&&I>0&&Q[I-F]!=null){var J=(O-Q[I-F])/(N-Q[I-F+1])*(P-N)+O;K.push(J);K.push(P);for(m=2;m<F;++m){K.push(Q[I+m])}G.push(null);G.push(null);for(m=2;m<F;++m){G.push(Q[I+m])}G.push(J);G.push(P);for(m=2;m<F;++m){G.push(Q[I+m])}}G.push(O);G.push(N)}M.points=newpoints;H.datapoints.points=threspoints;if(H.datapoints.points.length>0){L.getData().push(H)}}D.hooks.processDatapoints.push(E)}B.plot.plugins.push({init:C,options:A,name:"threshold",version:"1.0"})})(jQuery);
--- a/js/flotr/flotr-0.2.0-alpha.js
+++ /dev/null
@@ -1,2 +1,1 @@
-//Flotr 0.2.0-alpha Copyright (c) 2009 Bas Wenneker, <http://solutoire.com>, MIT License.
-var Flotr={version:"0.2.0-alpha",author:"Bas Wenneker",website:"http://www.solutoire.com",_registeredTypes:{lines:"drawSeriesLines",points:"drawSeriesPoints",bars:"drawSeriesBars",candles:"drawSeriesCandles",pie:"drawSeriesPie"},register:function(A,B){Flotr._registeredTypes[A]=B+""},draw:function(B,D,A,C){C=C||Flotr.Graph;return new C(B,D,A)},getSeries:function(A){return A.collect(function(C){var B,C=(C.data)?Object.clone(C):{data:C};for(B=C.data.length-1;B>-1;--B){C.data[B][1]=(C.data[B][1]===null?null:parseFloat(C.data[B][1]))}return C})},merge:function(D,B){var A=B||{};for(var C in D){A[C]=(D[C]!=null&&typeof (D[C])=="object"&&!(D[C].constructor==Array||D[C].constructor==RegExp)&&!Object.isElement(D[C]))?Flotr.merge(D[C],B[C]):A[C]=D[C]}return A},getTickSize:function(E,D,A,B){var H=(A-D)/E;var G=Flotr.getMagnitude(H);var C=H/G;var F=10;if(C<1.5){F=1}else{if(C<2.25){F=2}else{if(C<3){F=((B==0)?2:2.5)}else{if(C<7.5){F=5}}}}return F*G},defaultTickFormatter:function(A){return A+""},defaultTrackFormatter:function(A){return"("+A.x+", "+A.y+")"},defaultPieLabelFormatter:function(A){return(A.fraction*100).toFixed(2)+"%"},getMagnitude:function(A){return Math.pow(10,Math.floor(Math.log(A)/Math.LN10))},toPixel:function(A){return Math.floor(A)+0.5},toRad:function(A){return -A*(Math.PI/180)},parseColor:function(D){if(D instanceof Flotr.Color){return D}var A,C=Flotr.Color;if((A=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(D))){return new C(parseInt(A[1]),parseInt(A[2]),parseInt(A[3]))}if((A=/rgba\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(D))){return new C(parseInt(A[1]),parseInt(A[2]),parseInt(A[3]),parseFloat(A[4]))}if((A=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(D))){return new C(parseFloat(A[1])*2.55,parseFloat(A[2])*2.55,parseFloat(A[3])*2.55)}if((A=/rgba\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(D))){return new C(parseFloat(A[1])*2.55,parseFloat(A[2])*2.55,parseFloat(A[3])*2.55,parseFloat(A[4]))}if((A=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(D))){return new C(parseInt(A[1],16),parseInt(A[2],16),parseInt(A[3],16))}if((A=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(D))){return new C(parseInt(A[1]+A[1],16),parseInt(A[2]+A[2],16),parseInt(A[3]+A[3],16))}var B=D.strip().toLowerCase();if(B=="transparent"){return new C(255,255,255,0)}return((A=C.lookupColors[B]))?new C(A[0],A[1],A[2]):false},extractColor:function(B){var A;do{A=B.getStyle("background-color").toLowerCase();if(!(A==""||A=="transparent")){break}B=B.up(0)}while(!B.nodeName.match(/^body$/i));return(A=="rgba(0, 0, 0, 0)")?"transparent":A}};Flotr.Graph=Class.create({initialize:function(B,C,A){this.el=$(B);if(!this.el){throw"The target container doesn't exist"}this.data=C;this.series=Flotr.getSeries(C);this.setOptions(A);this.lastMousePos={pageX:null,pageY:null};this.selection={first:{x:-1,y:-1},second:{x:-1,y:-1}};this.prevSelection=null;this.selectionInterval=null;this.ignoreClick=false;this.prevHit=null;this.constructCanvas();this.initEvents();this.findDataRanges();this.calculateTicks(this.axes.x);this.calculateTicks(this.axes.x2);this.calculateTicks(this.axes.y);this.calculateTicks(this.axes.y2);this.calculateSpacing();this.draw();this.insertLegend();if(this.options.spreadsheet.show){this.constructTabs()}},setOptions:function(B){var P={colors:["#00A8F0","#C0D800","#CB4B4B","#4DA74D","#9440ED"],title:null,subtitle:null,legend:{show:true,noColumns:1,labelFormatter:Prototype.K,labelBoxBorderColor:"#CCCCCC",labelBoxWidth:14,labelBoxHeight:10,labelBoxMargin:5,container:null,position:"nw",margin:5,backgroundColor:null,backgroundOpacity:0.85},xaxis:{ticks:null,showLabels:true,labelsAngle:0,title:null,titleAngle:0,noTicks:5,tickFormatter:Flotr.defaultTickFormatter,tickDecimals:null,min:null,max:null,autoscaleMargin:0,color:null},x2axis:{},yaxis:{ticks:null,showLabels:true,labelsAngle:0,title:null,titleAngle:90,noTicks:5,tickFormatter:Flotr.defaultTickFormatter,tickDecimals:null,min:null,max:null,autoscaleMargin:0,color:null},y2axis:{titleAngle:270},points:{show:false,radius:3,lineWidth:2,fill:true,fillColor:"#FFFFFF",fillOpacity:0.4},lines:{show:false,lineWidth:2,fill:false,fillColor:null,fillOpacity:0.4},bars:{show:false,lineWidth:2,barWidth:1,fill:true,fillColor:null,fillOpacity:0.4,horizontal:false,stacked:false},candles:{show:false,lineWidth:1,wickLineWidth:1,candleWidth:0.6,fill:true,upFillColor:"#00A8F0",downFillColor:"#CB4B4B",fillOpacity:0.5,barcharts:false},pie:{show:false,lineWidth:1,fill:true,fillColor:null,fillOpacity:0.6,explode:6,sizeRatio:0.6,startAngle:Math.PI/4,labelFormatter:Flotr.defaultPieLabelFormatter,pie3D:false,pie3DviewAngle:(Math.PI/2*0.8),pie3DspliceThickness:20},grid:{color:"#545454",backgroundColor:null,tickColor:"#DDDDDD",labelMargin:3,verticalLines:true,horizontalLines:true,outlineWidth:2},selection:{mode:null,color:"#B6D9FF",fps:20},mouse:{track:false,position:"se",relative:false,trackFormatter:Flotr.defaultTrackFormatter,margin:5,lineColor:"#FF3F19",trackDecimals:1,sensibility:2,radius:3},shadowSize:4,defaultType:"lines",HtmlText:true,fontSize:7.5,spreadsheet:{show:false,tabGraphLabel:"Graph",tabDataLabel:"Data",toolbarDownload:"Download CSV",toolbarSelectAll:"Select all"}};P.x2axis=Object.extend(Object.clone(P.xaxis),P.x2axis);P.y2axis=Object.extend(Object.clone(P.yaxis),P.y2axis);this.options=Flotr.merge((B||{}),P);this.axes={x:{options:this.options.xaxis,n:1},x2:{options:this.options.x2axis,n:2},y:{options:this.options.yaxis,n:1},y2:{options:this.options.y2axis,n:2}};var H=[],C=[],K=this.series.length,N=this.series.length,D=this.options.colors,A=[],G=0,M,J,I,O,E;for(J=N-1;J>-1;--J){M=this.series[J].color;if(M!=null){--N;if(Object.isNumber(M)){H.push(M)}else{A.push(Flotr.parseColor(M))}}}for(J=H.length-1;J>-1;--J){N=Math.max(N,H[J]+1)}for(J=0;C.length<N;){M=(D.length==J)?new Flotr.Color(100,100,100):Flotr.parseColor(D[J]);var F=G%2==1?-1:1;var L=1+F*Math.ceil(G/2)*0.2;M.scale(L,L,L);C.push(M);if(++J>=D.length){J=0;++G}}for(J=0,I=0;J<K;++J){O=this.series[J];if(O.color==null){O.color=C[I++].toString()}else{if(Object.isNumber(O.color)){O.color=C[O.color].toString()}}if(!O.xaxis){O.xaxis=this.axes.x}if(O.xaxis==1){O.xaxis=this.axes.x}else{if(O.xaxis==2){O.xaxis=this.axes.x2}}if(!O.yaxis){O.yaxis=this.axes.y}if(O.yaxis==1){O.yaxis=this.axes.y}else{if(O.yaxis==2){O.yaxis=this.axes.y2}}O.lines=Object.extend(Object.clone(this.options.lines),O.lines);O.points=Object.extend(Object.clone(this.options.points),O.points);O.bars=Object.extend(Object.clone(this.options.bars),O.bars);O.candles=Object.extend(Object.clone(this.options.candles),O.candles);O.pie=Object.extend(Object.clone(this.options.pie),O.pie);O.mouse=Object.extend(Object.clone(this.options.mouse),O.mouse);if(O.shadowSize==null){O.shadowSize=this.options.shadowSize}}},constructCanvas:function(){var C=this.el,B,D,A;this.canvas=C.select(".flotr-canvas")[0];this.overlay=C.select(".flotr-overlay")[0];C.childElements().invoke("remove");C.setStyle({position:"relative",cursor:"default"});this.canvasWidth=C.getWidth();this.canvasHeight=C.getHeight();B={width:this.canvasWidth,height:this.canvasHeight};if(this.canvasWidth<=0||this.canvasHeight<=0){throw"Invalid dimensions for plot, width = "+this.canvasWidth+", height = "+this.canvasHeight}if(!this.canvas){D=this.canvas=new Element("canvas",B);D.className="flotr-canvas";D=D.writeAttribute("style","position:absolute;left:0px;top:0px;")}else{D=this.canvas.writeAttribute(B)}C.insert(D);if(Prototype.Browser.IE){D=window.G_vmlCanvasManager.initElement(D)}this.ctx=D.getContext("2d");if(!this.overlay){A=this.overlay=new Element("canvas",B);A.className="flotr-overlay";A=A.writeAttribute("style","position:absolute;left:0px;top:0px;")}else{A=this.overlay.writeAttribute(B)}C.insert(A);if(Prototype.Browser.IE){A=window.G_vmlCanvasManager.initElement(A)}this.octx=A.getContext("2d");if(window.CanvasText){CanvasText.enable(this.ctx);CanvasText.enable(this.octx);this.textEnabled=true}},getTextDimensions:function(F,C,B,D){if(!F){return{width:0,height:0}}if(!this.options.HtmlText&&this.textEnabled){var E=this.ctx.getTextBounds(F,C);return{width:E.width+2,height:E.height+6}}else{var A=this.el.insert('<div style="position:absolute;top:-10000px;'+B+'" class="'+D+' flotr-dummy-div">'+F+"</div>").select(".flotr-dummy-div")[0];dim=A.getDimensions();A.remove();return dim}},loadDataGrid:function(){if(this.seriesData){return this.seriesData}var A=this.series;var B=[];for(i=0;i<A.length;++i){A[i].data.each(function(D){var C=D[0],F=D[1];if(r=B.find(function(G){return G[0]==C})){r[i+1]=F}else{var E=[];E[0]=C;E[i+1]=F;B.push(E)}})}B=B.sortBy(function(C){return C[0]});return this.seriesData=B},showTab:function(B,C){var A="canvas, .flotr-labels, .flotr-legend, .flotr-legend-bg, .flotr-title, .flotr-subtitle";switch(B){case"graph":this.datagrid.up().hide();this.el.select(A).invoke("show");this.tabs.data.removeClassName("selected");this.tabs.graph.addClassName("selected");break;case"data":this.constructDataGrid();this.datagrid.up().show();this.el.select(A).invoke("hide");this.tabs.data.addClassName("selected");this.tabs.graph.removeClassName("selected");break}},constructTabs:function(){var A=new Element("div",{className:"flotr-tabs-group",style:"position:absolute;left:0px;top:"+this.canvasHeight+"px;width:"+this.canvasWidth+"px;"});this.el.insert({bottom:A});this.tabs={graph:new Element("div",{className:"flotr-tab selected",style:"float:left;"}).update(this.options.spreadsheet.tabGraphLabel),data:new Element("div",{className:"flotr-tab",style:"float:left;"}).update(this.options.spreadsheet.tabDataLabel)};A.insert(this.tabs.graph).insert(this.tabs.data);this.el.setStyle({height:this.canvasHeight+this.tabs.data.getHeight()+2+"px"});this.tabs.graph.observe("click",(function(){this.showTab("graph")}).bind(this));this.tabs.data.observe("click",(function(){this.showTab("data")}).bind(this))},constructDataGrid:function(){if(this.datagrid){return this.datagrid}var D,B,L=this.series,J=this.loadDataGrid();var K=this.datagrid=new Element("table",{className:"flotr-datagrid",style:"height:100px;"});var C=["<colgroup><col />"];var F=['<tr class="first-row">'];F.push("<th> </th>");for(D=0;D<L.length;++D){F.push('<th scope="col">'+(L[D].label||String.fromCharCode(65+D))+"</th>");C.push("<col />")}F.push("</tr>");for(B=0;B<J.length;++B){F.push("<tr>");for(D=0;D<L.length+1;++D){var M="td";var G=(J[B][D]!=null?Math.round(J[B][D]*100000)/100000:"");if(D==0){M="th";var I;if(this.options.xaxis.ticks){var E=this.options.xaxis.ticks.find(function(N){return N[0]==J[B][D]});if(E){I=E[1]}}else{I=this.options.xaxis.tickFormatter(G)}if(I){G=I}}F.push("<"+M+(M=="th"?' scope="row"':"")+">"+G+"</"+M+">")}F.push("</tr>")}C.push("</colgroup>");K.update(C.join("")+F.join(""));if(!Prototype.Browser.IE){K.select("td").each(function(N){N.observe("mouseover",function(O){N=O.element();var P=N.previousSiblings();K.select("th[scope=col]")[P.length-1].addClassName("hover");K.select("colgroup col")[P.length].addClassName("hover")});N.observe("mouseout",function(){K.select("colgroup col.hover, th.hover").each(function(O){O.removeClassName("hover")})})})}var H=new Element("div",{className:"flotr-datagrid-toolbar"}).insert(new Element("button",{type:"button",className:"flotr-datagrid-toolbar-button"}).update(this.options.spreadsheet.toolbarDownload).observe("click",this.downloadCSV.bind(this))).insert(new Element("button",{type:"button",className:"flotr-datagrid-toolbar-button"}).update(this.options.spreadsheet.toolbarSelectAll).observe("click",this.selectAllData.bind(this)));var A=new Element("div",{className:"flotr-datagrid-container",style:"left:0px;top:0px;width:"+this.canvasWidth+"px;height:"+this.canvasHeight+"px;overflow:auto;"});A.insert(H);K.wrap(A.hide());this.el.insert(A);return K},selectAllData:function(){if(this.tabs){var B,A,E,D,C=this.constructDataGrid();this.showTab("data");(function(){if((E=C.ownerDocument)&&(D=E.defaultView)&&D.getSelection&&E.createRange&&(B=window.getSelection())&&B.removeAllRanges){A=E.createRange();A.selectNode(C);B.removeAllRanges();B.addRange(A)}else{if(document.body&&document.body.createTextRange&&(A=document.body.createTextRange())){A.moveToElementText(C);A.select()}}}).defer();return true}else{return false}},downloadCSV:function(){var D,A='"x"',C=this.series,E=this.loadDataGrid();for(D=0;D<C.length;++D){A+='%09"'+(C[D].label||String.fromCharCode(65+D))+'"'}A+="%0D%0A";for(D=0;D<E.length;++D){if(this.options.xaxis.ticks){var B=this.options.xaxis.ticks.find(function(F){return F[0]==E[D][0]});if(B){E[D][0]=B[1]}}else{E[D][0]=this.options.xaxis.tickFormatter(E[D][0])}A+=E[D].join("%09")+"%0D%0A"}if(Prototype.Browser.IE){A=A.gsub("%09","\t").gsub("%0A","\n").gsub("%0D","\r");window.open().document.write(A)}else{window.open("data:text/csv,"+A)}},initEvents:function(){this.overlay.stopObserving();this.overlay.observe("mousedown",this.mouseDownHandler.bind(this));this.overlay.observe("mousemove",this.mouseMoveHandler.bind(this));this.overlay.observe("click",this.clickHandler.bind(this))},findDataRanges:function(){var J=this.series,G=this.axes;G.x.datamin=0;G.x.datamax=0;G.x2.datamin=0;G.x2.datamax=0;G.y.datamin=0;G.y.datamax=0;G.y2.datamin=0;G.y2.datamax=0;if(J.length>0){var C,A,D,H,F,B,I,E;for(C=0;C<J.length;++C){B=J[C].data,I=J[C].xaxis,E=J[C].yaxis;if(B.length>0&&!J[C].hide){if(!I.used){I.datamin=I.datamax=B[0][0]}if(!E.used){E.datamin=E.datamax=B[0][1]}I.used=true;E.used=true;for(D=B.length-1;D>-1;--D){H=B[D][0];if(H<I.datamin){I.datamin=H}else{if(H>I.datamax){I.datamax=H}}for(A=1;A<B[D].length;A++){F=B[D][A];if(F<E.datamin){E.datamin=F}else{if(F>E.datamax){E.datamax=F}}}}}}}this.findXAxesValues();this.calculateRange(G.x);this.extendXRangeIfNeededByBar(G.x);if(G.x2.used){this.calculateRange(G.x2);this.extendXRangeIfNeededByBar(G.x2)}this.calculateRange(G.y);this.extendYRangeIfNeededByBar(G.y);if(G.y2.used){this.calculateRange(G.y2);this.extendYRangeIfNeededByBar(G.y2)}},calculateRange:function(D){var F=D.options,C=F.min!=null?F.min:D.datamin,A=F.max!=null?F.max:D.datamax,E;if(A-C==0){var B=(A==0)?1:0.01;C-=B;A+=B}D.tickSize=Flotr.getTickSize(F.noTicks,C,A,F.tickDecimals);if(F.min==null){E=F.autoscaleMargin;if(E!=0){C-=D.tickSize*E;if(C<0&&D.datamin>=0){C=0}C=D.tickSize*Math.floor(C/D.tickSize)}}if(F.max==null){E=F.autoscaleMargin;if(E!=0){A+=D.tickSize*E;if(A>0&&D.datamax<=0){A=0}A=D.tickSize*Math.ceil(A/D.tickSize)}}D.min=C;D.max=A},extendXRangeIfNeededByBar:function(A){if(A.options.max==null){var D=A.max,B,I,F,E,H=[],C=null;for(B=0;B<this.series.length;++B){I=this.series[B];F=I.bars;E=I.candles;if(I.axis==A&&(F.show||E.show)){if(!F.horizontal&&(F.barWidth+A.datamax>D)||(E.candleWidth+A.datamax>D)){D=A.max+I.bars.barWidth}if(F.stacked&&F.horizontal){for(j=0;j<I.data.length;j++){if(I.bars.show&&I.bars.stacked){var G=I.data[j][0];H[G]=(H[G]||0)+I.data[j][1];C=I}}for(j=0;j<H.length;j++){D=Math.max(H[j],D)}}}}A.lastSerie=C;A.max=D}},extendYRangeIfNeededByBar:function(A){if(A.options.max==null){var D=A.max,B,I,F,E,H=[],C=null;for(B=0;B<this.series.length;++B){I=this.series[B];F=I.bars;E=I.candles;if(I.yaxis==A&&F.show&&!I.hide){if(F.horizontal&&(F.barWidth+A.datamax>D)||(E.candleWidth+A.datamax>D)){D=A.max+F.barWidth}if(F.stacked&&!F.horizontal){for(j=0;j<I.data.length;j++){if(I.bars.show&&I.bars.stacked){var G=I.data[j][0];H[G]=(H[G]||0)+I.data[j][1];C=I}}for(j=0;j<H.length;j++){D=Math.max(H[j],D)}}}}A.lastSerie=C;A.max=D}},findXAxesValues:function(){for(i=this.series.length-1;i>-1;--i){s=this.series[i];s.xaxis.values=s.xaxis.values||[];for(j=s.data.length-1;j>-1;--j){s.xaxis.values[s.data[j][0]]={}}}},calculateTicks:function(D){var B=D.options,E,H;D.ticks=[];if(B.ticks){var G=B.ticks,I,F;if(Object.isFunction(G)){G=G({min:D.min,max:D.max})}for(E=0;E<G.length;++E){I=G[E];if(typeof (I)=="object"){H=I[0];F=(I.length>1)?I[1]:B.tickFormatter(H)}else{H=I;F=B.tickFormatter(H)}D.ticks[E]={v:H,label:F}}}else{var A=D.tickSize*Math.ceil(D.min/D.tickSize),C;for(E=0;A+E*D.tickSize<=D.max;++E){H=A+E*D.tickSize;C=B.tickDecimals;if(C==null){C=1-Math.floor(Math.log(D.tickSize)/Math.LN10)}if(C<0){C=0}H=H.toFixed(C);D.ticks.push({v:H,label:B.tickFormatter(H)})}}},calculateSpacing:function(){var L=this.axes,N=this.options,H=this.series,D=N.grid.labelMargin,M=L.x,A=L.x2,J=L.y,K=L.y2,F=2,G,E,C,I;[M,A,J,K].each(function(P){var O="";if(P.options.showLabels){for(G=0;G<P.ticks.length;++G){C=P.ticks[G].label.length;if(C>O.length){O=P.ticks[G].label}}}P.maxLabel=this.getTextDimensions(O,{size:N.fontSize,angle:Flotr.toRad(P.options.labelsAngle)},"font-size:smaller;","flotr-grid-label");P.titleSize=this.getTextDimensions(P.options.title,{size:N.fontSize*1.2,angle:Flotr.toRad(P.options.titleAngle)},"font-weight:bold;","flotr-axis-title")},this);I=this.getTextDimensions(N.title,{size:N.fontSize*1.5},"font-size:1em;font-weight:bold;","flotr-title");this.titleHeight=I.height;I=this.getTextDimensions(N.subtitle,{size:N.fontSize},"font-size:smaller;","flotr-subtitle");this.subtitleHeight=I.height;if(N.show){F=Math.max(F,N.points.radius+N.points.lineWidth/2)}for(E=0;E<N.length;++E){if(H[E].points.show){F=Math.max(F,H[E].points.radius+H[E].points.lineWidth/2)}}var B=this.plotOffset={left:0,right:0,top:0,bottom:0};B.left=B.right=B.top=B.bottom=F;B.bottom+=(M.options.showLabels?(M.maxLabel.height+D):0)+(M.options.title?(M.titleSize.height+D):0);B.top+=(A.options.showLabels?(A.maxLabel.height+D):0)+(A.options.title?(A.titleSize.height+D):0)+this.subtitleHeight+this.titleHeight;B.left+=(J.options.showLabels?(J.maxLabel.width+D):0)+(J.options.title?(J.titleSize.width+D):0);B.right+=(K.options.showLabels?(K.maxLabel.width+D):0)+(K.options.title?(K.titleSize.width+D):0);B.top=Math.floor(B.top);this.plotWidth=this.canvasWidth-B.left-B.right;this.plotHeight=this.canvasHeight-B.bottom-B.top;M.scale=this.plotWidth/(M.max-M.min);A.scale=this.plotWidth/(A.max-A.min);J.scale=this.plotHeight/(J.max-J.min);K.scale=this.plotHeight/(K.max-K.min)},draw:function(){this.drawGrid();this.drawLabels();this.drawTitles();if(this.series.length){this.el.fire("flotr:beforedraw",[this.series,this]);for(var A=0;A<this.series.length;A++){if(!this.series[A].hide){this.drawSeries(this.series[A])}}}this.el.fire("flotr:afterdraw",[this.series,this])},tHoz:function(A,B){B=B||this.axes.x;return(A-B.min)*B.scale},tVert:function(B,A){A=A||this.axes.y;return this.plotHeight-(B-A.min)*A.scale},drawGrid:function(){var B,E=this.options,A=this.ctx;if(E.grid.verticalLines||E.grid.horizontalLines){this.el.fire("flotr:beforegrid",[this.axes.x,this.axes.y,E,this])}A.save();A.translate(this.plotOffset.left,this.plotOffset.top);if(E.grid.backgroundColor!=null){A.fillStyle=E.grid.backgroundColor;A.fillRect(0,0,this.plotWidth,this.plotHeight)}A.lineWidth=1;A.strokeStyle=E.grid.tickColor;A.beginPath();if(E.grid.verticalLines){for(var D=0;D<this.axes.x.ticks.length;++D){B=this.axes.x.ticks[D].v;if((B==this.axes.x.min||B==this.axes.x.max)&&E.grid.outlineWidth!=0){continue}A.moveTo(Math.floor(this.tHoz(B))+A.lineWidth/2,0);A.lineTo(Math.floor(this.tHoz(B))+A.lineWidth/2,this.plotHeight)}}if(E.grid.horizontalLines){for(var C=0;C<this.axes.y.ticks.length;++C){B=this.axes.y.ticks[C].v;if((B==this.axes.y.min||B==this.axes.y.max)&&E.grid.outlineWidth!=0){continue}A.moveTo(0,Math.floor(this.tVert(B))+A.lineWidth/2);A.lineTo(this.plotWidth,Math.floor(this.tVert(B))+A.lineWidth/2)}}A.stroke();if(E.grid.outlineWidth!=0){A.lineWidth=E.grid.outlineWidth;A.strokeStyle=E.grid.color;A.lineJoin="round";A.strokeRect(0,0,this.plotWidth,this.plotHeight)}A.restore();if(E.grid.verticalLines||E.grid.horizontalLines){this.el.fire("flotr:aftergrid",[this.axes.x,this.axes.y,E,this])}},drawLabels:function(){var C=0,D,B,E,F,G,J=this.options,I=this.ctx,H=this.axes;for(E=0;E<H.x.ticks.length;++E){if(H.x.ticks[E].label){++C}}B=this.plotWidth/C;if(!J.HtmlText&&this.textEnabled){var A={size:J.fontSize,adjustAlign:true};D=H.x;A.color=D.options.color||J.grid.color;for(E=0;E<D.ticks.length&&D.options.showLabels&&D.used;++E){G=D.ticks[E];if(!G.label||G.label.length==0){continue}A.angle=Flotr.toRad(D.options.labelsAngle);A.halign="c";A.valign="t";I.drawText(G.label,this.plotOffset.left+this.tHoz(G.v,D),this.plotOffset.top+this.plotHeight+J.grid.labelMargin,A)}D=H.x2;A.color=D.options.color||J.grid.color;for(E=0;E<D.ticks.length&&D.options.showLabels&&D.used;++E){G=D.ticks[E];if(!G.label||G.label.length==0){continue}A.angle=Flotr.toRad(D.options.labelsAngle);A.halign="c";A.valign="b";I.drawText(G.label,this.plotOffset.left+this.tHoz(G.v,D),this.plotOffset.top+J.grid.labelMargin,A)}D=H.y;A.color=D.options.color||J.grid.color;for(E=0;E<D.ticks.length&&D.options.showLabels&&D.used;++E){G=D.ticks[E];if(!G.label||G.label.length==0){continue}A.angle=Flotr.toRad(D.options.labelsAngle);A.halign="r";A.valign="m";I.drawText(G.label,this.plotOffset.left-J.grid.labelMargin,this.plotOffset.top+this.tVert(G.v,D),A)}D=H.y2;A.color=D.options.color||J.grid.color;for(E=0;E<D.ticks.length&&D.options.showLabels&&D.used;++E){G=D.ticks[E];if(!G.label||G.label.length==0){continue}A.angle=Flotr.toRad(D.options.labelsAngle);A.halign="l";A.valign="m";I.drawText(G.label,this.plotOffset.left+this.plotWidth+J.grid.labelMargin,this.plotOffset.top+this.tVert(G.v,D),A);I.save();I.strokeStyle=A.color;I.beginPath();I.moveTo(this.plotOffset.left+this.plotWidth-8,this.plotOffset.top+this.tVert(G.v,D));I.lineTo(this.plotOffset.left+this.plotWidth,this.plotOffset.top+this.tVert(G.v,D));I.stroke();I.restore()}}else{if(H.x.options.showLabels||H.x2.options.showLabels||H.y.options.showLabels||H.y2.options.showLabels){F=['<div style="font-size:smaller;color:'+J.grid.color+';" class="flotr-labels">'];D=H.x;if(D.options.showLabels){for(E=0;E<D.ticks.length;++E){G=D.ticks[E];if(!G.label||G.label.length==0){continue}F.push('<div style="position:absolute;top:'+(this.plotOffset.top+this.plotHeight+J.grid.labelMargin)+"px;left:"+(this.plotOffset.left+this.tHoz(G.v,D)-B/2)+"px;width:"+B+"px;text-align:center;"+(D.options.color?("color:"+D.options.color+";"):"")+'" class="flotr-grid-label">'+G.label+"</div>")}}D=H.x2;if(D.options.showLabels&&D.used){for(E=0;E<D.ticks.length;++E){G=D.ticks[E];if(!G.label||G.label.length==0){continue}F.push('<div style="position:absolute;top:'+(this.plotOffset.top-J.grid.labelMargin-D.maxLabel.height)+"px;left:"+(this.plotOffset.left+this.tHoz(G.v,D)-B/2)+"px;width:"+B+"px;text-align:center;"+(D.options.color?("color:"+D.options.color+";"):"")+'" class="flotr-grid-label">'+G.label+"</div>")}}D=H.y;if(D.options.showLabels){for(E=0;E<D.ticks.length;++E){G=D.ticks[E];if(!G.label||G.label.length==0){continue}F.push('<div style="position:absolute;top:'+(this.plotOffset.top+this.tVert(G.v,D)-D.maxLabel.height/2)+"px;left:0;width:"+(this.plotOffset.left-J.grid.labelMargin)+"px;text-align:right;"+(D.options.color?("color:"+D.options.color+";"):"")+'" class="flotr-grid-label">'+G.label+"</div>")}}D=H.y2;if(D.options.showLabels&&D.used){I.save();I.strokeStyle=D.options.color||J.grid.color;I.beginPath();for(E=0;E<D.ticks.length;++E){G=D.ticks[E];if(!G.label||G.label.length==0){continue}F.push('<div style="position:absolute;top:'+(this.plotOffset.top+this.tVert(G.v,D)-D.maxLabel.height/2)+"px;right:0;width:"+(this.plotOffset.right-J.grid.labelMargin)+"px;text-align:left;"+(D.options.color?("color:"+D.options.color+";"):"")+'" class="flotr-grid-label">'+G.label+"</div>");I.moveTo(this.plotOffset.left+this.plotWidth-8,this.plotOffset.top+this.tVert(G.v,D));I.lineTo(this.plotOffset.left+this.plotWidth,this.plotOffset.top+this.tVert(G.v,D))}I.stroke();I.restore()}F.push("</div>");this.el.insert(F.join(""))}}},drawTitles:function(){var D,C=this.options,F=C.grid.labelMargin,B=this.ctx,A=this.axes;if(!C.HtmlText&&this.textEnabled){var E={size:C.fontSize,color:C.grid.color,halign:"c"};if(C.subtitle){B.drawText(C.subtitle,this.plotOffset.left+this.plotWidth/2,this.titleHeight+this.subtitleHeight-2,E)}E.weight=1.5;E.size*=1.5;if(C.title){B.drawText(C.title,this.plotOffset.left+this.plotWidth/2,this.titleHeight-2,E)}E.weight=1.8;E.size*=0.8;E.adjustAlign=true;if(A.x.options.title&&A.x.used){E.halign="c";E.valign="t";E.angle=Flotr.toRad(A.x.options.titleAngle);B.drawText(A.x.options.title,this.plotOffset.left+this.plotWidth/2,this.plotOffset.top+A.x.maxLabel.height+this.plotHeight+2*F,E)}if(A.x2.options.title&&A.x2.used){E.halign="c";E.valign="b";E.angle=Flotr.toRad(A.x2.options.titleAngle);B.drawText(A.x2.options.title,this.plotOffset.left+this.plotWidth/2,this.plotOffset.top-A.x2.maxLabel.height-2*F,E)}if(A.y.options.title&&A.y.used){E.halign="r";E.valign="m";E.angle=Flotr.toRad(A.y.options.titleAngle);B.drawText(A.y.options.title,this.plotOffset.left-A.y.maxLabel.width-2*F,this.plotOffset.top+this.plotHeight/2,E)}if(A.y2.options.title&&A.y2.used){E.halign="l";E.valign="m";E.angle=Flotr.toRad(A.y2.options.titleAngle);B.drawText(A.y2.options.title,this.plotOffset.left+this.plotWidth+A.y2.maxLabel.width+2*F,this.plotOffset.top+this.plotHeight/2,E)}}else{D=['<div style="color:'+C.grid.color+';" class="flotr-titles">'];if(C.title){D.push('<div style="position:absolute;top:0;left:'+this.plotOffset.left+"px;font-size:1em;font-weight:bold;text-align:center;width:"+this.plotWidth+'px;" class="flotr-title">'+C.title+"</div>")}if(C.subtitle){D.push('<div style="position:absolute;top:'+this.titleHeight+"px;left:"+this.plotOffset.left+"px;font-size:smaller;text-align:center;width:"+this.plotWidth+'px;" class="flotr-subtitle">'+C.subtitle+"</div>")}D.push("</div>");D.push('<div class="flotr-axis-title" style="font-weight:bold;">');if(A.x.options.title&&A.x.used){D.push('<div style="position:absolute;top:'+(this.plotOffset.top+this.plotHeight+C.grid.labelMargin+A.x.titleSize.height)+"px;left:"+this.plotOffset.left+"px;width:"+this.plotWidth+'px;text-align:center;" class="flotr-axis-title">'+A.x.options.title+"</div>")}if(A.x2.options.title&&A.x2.used){D.push('<div style="position:absolute;top:0;left:'+this.plotOffset.left+"px;width:"+this.plotWidth+'px;text-align:center;" class="flotr-axis-title">'+A.x2.options.title+"</div>")}if(A.y.options.title&&A.y.used){D.push('<div style="position:absolute;top:'+(this.plotOffset.top+this.plotHeight/2-A.y.titleSize.height/2)+'px;left:0;text-align:right;" class="flotr-axis-title">'+A.y.options.title+"</div>")}if(A.y2.options.title&&A.y2.used){D.push('<div style="position:absolute;top:'+(this.plotOffset.top+this.plotHeight/2-A.y.titleSize.height/2)+'px;right:0;text-align:right;" class="flotr-axis-title">'+A.y2.options.title+"</div>")}D.push("</div>");this.el.insert(D.join(""))}},drawSeries:function(A){A=A||this.series;var C=false;for(var B in Flotr._registeredTypes){if(A[B]&&A[B].show){this[Flotr._registeredTypes[B]](A);C=true}}if(!C){this[Flotr._registeredTypes[this.options.defaultType]](A)}},plotLine:function(I,F){var O=this.ctx,A=I.xaxis,K=I.yaxis,J=this.tHoz.bind(this),M=this.tVert.bind(this),H=I.data;if(H.length<2){return }var E=J(H[0][0],A),D=M(H[0][1],K)+F;O.beginPath();O.moveTo(E,D);for(var G=0;G<H.length-1;++G){var C=H[G][0],N=H[G][1],B=H[G+1][0],L=H[G+1][1];if(N===null||L===null){continue}if(N<=L&&N<K.min){if(L<K.min){continue}C=(K.min-N)/(L-N)*(B-C)+C;N=K.min}else{if(L<=N&&L<K.min){if(N<K.min){continue}B=(K.min-N)/(L-N)*(B-C)+C;L=K.min}}if(N>=L&&N>K.max){if(L>K.max){continue}C=(K.max-N)/(L-N)*(B-C)+C;N=K.max}else{if(L>=N&&L>K.max){if(N>K.max){continue}B=(K.max-N)/(L-N)*(B-C)+C;L=K.max}}if(C<=B&&C<A.min){if(B<A.min){continue}N=(A.min-C)/(B-C)*(L-N)+N;C=A.min}else{if(B<=C&&B<A.min){if(C<A.min){continue}L=(A.min-C)/(B-C)*(L-N)+N;B=A.min}}if(C>=B&&C>A.max){if(B>A.max){continue}N=(A.max-C)/(B-C)*(L-N)+N;C=A.max}else{if(B>=C&&B>A.max){if(C>A.max){continue}L=(A.max-C)/(B-C)*(L-N)+N;B=A.max}}if(E!=J(C,A)||D!=M(N,K)+F){O.moveTo(J(C,A),M(N,K)+F)}E=J(B,A);D=M(L,K)+F;O.lineTo(E,D)}O.stroke()},plotLineArea:function(J,D){var S=J.data;if(S.length<2){return }var L,G=0,N=this.ctx,Q=J.xaxis,B=J.yaxis,E=this.tHoz.bind(this),M=this.tVert.bind(this),H=Math.min(Math.max(0,B.min),B.max),F=true;N.beginPath();for(var O=0;O<S.length-1;++O){var R=S[O][0],C=S[O][1],P=S[O+1][0],A=S[O+1][1];if(R<=P&&R<Q.min){if(P<Q.min){continue}C=(Q.min-R)/(P-R)*(A-C)+C;R=Q.min}else{if(P<=R&&P<Q.min){if(R<Q.min){continue}A=(Q.min-R)/(P-R)*(A-C)+C;P=Q.min}}if(R>=P&&R>Q.max){if(P>Q.max){continue}C=(Q.max-R)/(P-R)*(A-C)+C;R=Q.max}else{if(P>=R&&P>Q.max){if(R>Q.max){continue}A=(Q.max-R)/(P-R)*(A-C)+C;P=Q.max}}if(F){N.moveTo(E(R,Q),M(H,B)+D);F=false}if(C>=B.max&&A>=B.max){N.lineTo(E(R,Q),M(B.max,B)+D);N.lineTo(E(P,Q),M(B.max,B)+D);continue}else{if(C<=B.min&&A<=B.min){N.lineTo(E(R,Q),M(B.min,B)+D);N.lineTo(E(P,Q),M(B.min,B)+D);continue}}var I=R,K=P;if(C<=A&&C<B.min&&A>=B.min){R=(B.min-C)/(A-C)*(P-R)+R;C=B.min}else{if(A<=C&&A<B.min&&C>=B.min){P=(B.min-C)/(A-C)*(P-R)+R;A=B.min}}if(C>=A&&C>B.max&&A<=B.max){R=(B.max-C)/(A-C)*(P-R)+R;C=B.max}else{if(A>=C&&A>B.max&&C<=B.max){P=(B.max-C)/(A-C)*(P-R)+R;A=B.max}}if(R!=I){L=(C<=B.min)?L=B.min:B.max;N.lineTo(E(I,Q),M(L,B)+D);N.lineTo(E(R,Q),M(L,B)+D)}N.lineTo(E(R,Q),M(C,B)+D);N.lineTo(E(P,Q),M(A,B)+D);if(P!=K){L=(A<=B.min)?B.min:B.max;N.lineTo(E(K,Q),M(L,B)+D);N.lineTo(E(P,Q),M(L,B)+D)}G=Math.max(P,K)}N.lineTo(E(G,Q),M(H,B)+D);N.closePath();N.fill()},drawSeriesLines:function(C){C=C||this.series;var B=this.ctx;B.save();B.translate(this.plotOffset.left,this.plotOffset.top);B.lineJoin="round";var D=C.lines.lineWidth;var A=C.shadowSize;if(A>0){B.lineWidth=A/2;var E=D/2+B.lineWidth/2;B.strokeStyle="rgba(0,0,0,0.1)";this.plotLine(C,E+A/2);B.strokeStyle="rgba(0,0,0,0.2)";this.plotLine(C,E);if(C.lines.fill){B.fillStyle="rgba(0,0,0,0.05)";this.plotLineArea(C,E+A/2)}}B.lineWidth=D;B.strokeStyle=C.color;if(C.lines.fill){B.fillStyle=C.lines.fillColor!=null?C.lines.fillColor:Flotr.parseColor(C.color).scale(null,null,null,C.lines.fillOpacity).toString();this.plotLineArea(C,0)}this.plotLine(C,0);B.restore()},drawSeriesPoints:function(C){var B=this.ctx;B.save();B.translate(this.plotOffset.left,this.plotOffset.top);var D=C.lines.lineWidth;var A=C.shadowSize;if(A>0){B.lineWidth=A/2;B.strokeStyle="rgba(0,0,0,0.1)";this.plotPointShadows(C,A/2+B.lineWidth/2,C.points.radius);B.strokeStyle="rgba(0,0,0,0.2)";this.plotPointShadows(C,B.lineWidth/2,C.points.radius)}B.lineWidth=C.points.lineWidth;B.strokeStyle=C.color;B.fillStyle=C.points.fillColor!=null?C.points.fillColor:C.color;this.plotPoints(C,C.points.radius,C.points.fill);B.restore()},plotPoints:function(C,E,I){var A=C.xaxis,F=C.yaxis,J=this.ctx,D,B=C.data;for(D=B.length-1;D>-1;--D){var H=B[D][0],G=B[D][1];if(H<A.min||H>A.max||G<F.min||G>F.max){continue}J.beginPath();J.arc(this.tHoz(H,A),this.tVert(G,F),E,0,2*Math.PI,true);if(I){J.fill()}J.stroke()}},plotPointShadows:function(D,B,F){var A=D.xaxis,G=D.yaxis,J=this.ctx,E,C=D.data;for(E=C.length-1;E>-1;--E){var I=C[E][0],H=C[E][1];if(I<A.min||I>A.max||H<G.min||H>G.max){continue}J.beginPath();J.arc(this.tHoz(I,A),this.tVert(H,G)+B,F,0,Math.PI,false);J.stroke()}},drawSeriesBars:function(B){var A=this.ctx,D=B.bars.barWidth,C=Math.min(B.bars.lineWidth,D);A.save();A.translate(this.plotOffset.left,this.plotOffset.top);A.lineJoin="miter";A.lineWidth=C;A.strokeStyle=B.color;this.plotBarsShadows(B,D,0,B.bars.fill);if(B.bars.fill){A.fillStyle=B.bars.fillColor!=null?B.bars.fillColor:Flotr.parseColor(B.color).scale(null,null,null,B.bars.fillOpacity).toString()}this.plotBars(B,D,0,B.bars.fill);A.restore()},plotBars:function(K,N,D,Q){var U=K.data;if(U.length<1){return }var S=K.xaxis,B=K.yaxis,P=this.ctx,F=this.tHoz.bind(this),O=this.tVert.bind(this);for(var R=0;R<U.length;R++){var J=U[R][0],I=U[R][1];var E=true,L=true,A=true;var H=0;if(K.bars.stacked){S.values.each(function(W,V){if(V==J){H=W.stack||0;W.stack=H+I}})}if(K.bars.horizontal){var C=H,T=J+H,G=I,M=I+N}else{var C=J,T=J+N,G=H,M=I+H}if(T<S.min||C>S.max||M<B.min||G>B.max){continue}if(C<S.min){C=S.min;E=false}if(T>S.max){T=S.max;if(S.lastSerie!=K&&K.bars.horizontal){L=false}}if(G<B.min){G=B.min}if(M>B.max){M=B.max;if(B.lastSerie!=K&&!K.bars.horizontal){L=false}}if(Q){P.beginPath();P.moveTo(F(C,S),O(G,B)+D);P.lineTo(F(C,S),O(M,B)+D);P.lineTo(F(T,S),O(M,B)+D);P.lineTo(F(T,S),O(G,B)+D);P.fill()}if(K.bars.lineWidth!=0&&(E||A||L)){P.beginPath();P.moveTo(F(C,S),O(G,B)+D);P[E?"lineTo":"moveTo"](F(C,S),O(M,B)+D);P[L?"lineTo":"moveTo"](F(T,S),O(M,B)+D);P[A?"lineTo":"moveTo"](F(T,S),O(G,B)+D);P.stroke()}}},plotBarsShadows:function(I,K,C){var T=I.data;if(T.length<1){return }var R=I.xaxis,A=I.yaxis,P=this.ctx,D=this.tHoz.bind(this),M=this.tVert.bind(this),N=this.options.shadowSize;for(var Q=0;Q<T.length;Q++){var H=T[Q][0],G=T[Q][1];var E=0;if(I.bars.stacked){R.values.each(function(V,U){if(U==H){E=V.stackShadow||0;V.stackShadow=E+G}})}if(I.bars.horizontal){var B=E,S=H+E,F=G,J=G+K}else{var B=H,S=H+K,F=E,J=G+E}if(S<R.min||B>R.max||J<A.min||F>A.max){continue}if(B<R.min){B=R.min}if(S>R.max){S=R.max}if(F<A.min){F=A.min}if(J>A.max){J=A.max}var O=D(S,R)-D(B,R)-((D(S,R)+N<=this.plotWidth)?0:N);var L=Math.max(0,M(F,A)-M(J,A)-((M(F,A)+N<=this.plotHeight)?0:N));P.fillStyle="rgba(0,0,0,0.05)";P.fillRect(Math.min(D(B,R)+N,this.plotWidth),Math.min(M(J,A)+N,this.plotWidth),O,L)}},drawSeriesCandles:function(B){var A=this.ctx,C=B.candles.candleWidth;A.save();A.translate(this.plotOffset.left,this.plotOffset.top);A.lineJoin="miter";A.lineWidth=B.candles.lineWidth;this.plotCandlesShadows(B,C/2);this.plotCandles(B,C/2);A.restore()},plotCandles:function(K,D){var W=K.data;if(W.length<1){return }var T=K.xaxis,B=K.yaxis,P=this.ctx,E=this.tHoz.bind(this),O=this.tVert.bind(this);for(var S=0;S<W.length;S++){var U=W[S],J=U[0],L=U[1],I=U[2],X=U[3],N=U[4];var C=J,V=J+K.candles.candleWidth,G=Math.max(B.min,X),M=Math.min(B.max,I),A=Math.max(B.min,Math.min(L,N)),R=Math.min(B.max,Math.max(L,N));if(V<T.min||C>T.max||M<B.min||G>B.max){continue}var Q=K.candles[L>N?"downFillColor":"upFillColor"];if(K.candles.fill&&!K.candles.barcharts){P.fillStyle=Flotr.parseColor(Q).scale(null,null,null,K.candles.fillOpacity).toString();P.fillRect(E(C,T),O(R,B)+D,E(V,T)-E(C,T),O(A,B)-O(R,B))}if(K.candles.lineWidth||K.candles.wickLineWidth){var J,H,F=(K.candles.wickLineWidth%2)/2;J=Math.floor(E((C+V)/2),T)+F;P.save();P.strokeStyle=Q;P.lineWidth=K.candles.wickLineWidth;P.lineCap="butt";if(K.candles.barcharts){P.beginPath();P.moveTo(J,Math.floor(O(M,B)+D));P.lineTo(J,Math.floor(O(G,B)+D));H=Math.floor(O(L,B)+D)+0.5;P.moveTo(Math.floor(E(C,T))+F,H);P.lineTo(J,H);H=Math.floor(O(N,B)+D)+0.5;P.moveTo(Math.floor(E(V,T))+F,H);P.lineTo(J,H)}else{P.strokeRect(E(C,T),O(R,B)+D,E(V,T)-E(C,T),O(A,B)-O(R,B));P.beginPath();P.moveTo(J,Math.floor(O(R,B)+D));P.lineTo(J,Math.floor(O(M,B)+D));P.moveTo(J,Math.floor(O(A,B)+D));P.lineTo(J,Math.floor(O(G,B)+D))}P.stroke();P.restore()}}},plotCandlesShadows:function(H,C){var T=H.data;if(T.length<1||H.candles.barcharts){return }var Q=H.xaxis,A=H.yaxis,D=this.tHoz.bind(this),M=this.tVert.bind(this),N=this.options.shadowSize;for(var P=0;P<T.length;P++){var R=T[P],G=R[0],I=R[1],F=R[2],U=R[3],K=R[4];var B=G,S=G+H.candles.candleWidth,E=Math.max(A.min,Math.min(I,K)),J=Math.min(A.max,Math.max(I,K));if(S<Q.min||B>Q.max||J<A.min||E>A.max){continue}var O=D(S,Q)-D(B,Q)-((D(S,Q)+N<=this.plotWidth)?0:N);var L=Math.max(0,M(E,A)-M(J,A)-((M(E,A)+N<=this.plotHeight)?0:N));this.ctx.fillStyle="rgba(0,0,0,0.05)";this.ctx.fillRect(Math.min(D(B,Q)+N,this.plotWidth),Math.min(M(J,A)+N,this.plotWidth),O,L)}},drawSeriesPie:function(G){if(!this.options.pie.drawn){var K=this.ctx,C=this.options,E=G.pie.lineWidth,I=G.shadowSize,R=G.data,D=(Math.min(this.canvasWidth,this.canvasHeight)*G.pie.sizeRatio)/2,H=[];var L=1;var P=Math.sin(G.pie.viewAngle)*G.pie.spliceThickness/L;var M={size:C.fontSize*1.2,color:C.grid.color,weight:1.5};var Q={x:(this.canvasWidth+this.plotOffset.left)/2,y:(this.canvasHeight-this.plotOffset.bottom)/2};var O=this.series.collect(function(T,S){if(T.pie.show){return{name:(T.label||T.data[0][1]),value:[S,T.data[0][1]],explode:T.pie.explode}}});var B=O.pluck("value").pluck(1).inject(0,function(S,T){return S+T});var F=0,N=G.pie.startAngle,J=0;var A=O.collect(function(S){N+=F;J=parseFloat(S.value[1]);F=J/B;return{name:S.name,fraction:F,x:S.value[0],y:J,explode:S.explode,startAngle:2*N*Math.PI,endAngle:2*(N+F)*Math.PI}});K.save();if(I>0){A.each(function(V){var S=(V.startAngle+V.endAngle)/2;var T=Q.x+Math.cos(S)*V.explode+I;var U=Q.y+Math.sin(S)*V.explode+I;this.plotSlice(T,U,D,V.startAngle,V.endAngle,false,L);K.fillStyle="rgba(0,0,0,0.1)";K.fill()},this)}if(C.HtmlText){H=['<div style="color:'+this.options.grid.color+'" class="flotr-labels">']}A.each(function(c,X){var W=(c.startAngle+c.endAngle)/2;var V=C.colors[X];var Y=Q.x+Math.cos(W)*c.explode;var U=Q.y+Math.sin(W)*c.explode;this.plotSlice(Y,U,D,c.startAngle,c.endAngle,false,L);if(G.pie.fill){K.fillStyle=Flotr.parseColor(V).scale(null,null,null,G.pie.fillOpacity).toString();K.fill()}K.lineWidth=E;K.strokeStyle=V;K.stroke();var b=C.pie.labelFormatter(c);var S=(Math.cos(W)<0);var a=Y+Math.cos(W)*(G.pie.explode+D);var Z=U+Math.sin(W)*(G.pie.explode+D);if(c.fraction&&b){if(C.HtmlText){var T="position:absolute;top:"+(Z-5)+"px;";if(S){T+="right:"+(this.canvasWidth-a)+"px;text-align:right;"}else{T+="left:"+a+"px;text-align:left;"}H.push('<div style="'+T+'" class="flotr-grid-label">'+b+"</div>")}else{M.halign=S?"r":"l";K.drawText(b,a,Z+M.size/2,M)}}},this);if(C.HtmlText){H.push("</div>");this.el.insert(H.join(""))}K.restore();C.pie.drawn=true}},plotSlice:function(B,H,A,E,D,F,G){var C=this.ctx;G=G||1;C.save();C.scale(1,G);C.beginPath();C.moveTo(B,H);C.arc(B,H,A,E,D,F);C.lineTo(B,H);C.closePath();C.restore()},plotPie:function(){},insertLegend:function(){if(!this.options.legend.show){return }var H=this.series,I=this.plotOffset,B=this.options,b=[],A=false,O=this.ctx,R;var Q=H.findAll(function(c){return(c.label&&!c.hide)}).size();if(Q){if(!B.HtmlText&&this.textEnabled){var T={size:B.fontSize*1.1,color:B.grid.color};var M=B.legend.position,N=B.legend.margin,L=B.legend.labelBoxWidth,Z=B.legend.labelBoxHeight,S=B.legend.labelBoxMargin,W=I.left+N,U=I.top+N;var a=0;for(R=H.length-1;R>-1;--R){if(!H[R].label||H[R].hide){continue}var E=B.legend.labelFormatter(H[R].label);a=Math.max(a,O.measureText(E,T))}var K=Math.round(L+S*3+a),C=Math.round(Q*(S+Z)+S);if(M.charAt(0)=="s"){U=I.top+this.plotHeight-(N+C)}if(M.charAt(1)=="e"){W=I.left+this.plotWidth-(N+K)}var P=Flotr.parseColor(B.legend.backgroundColor||"rgb(240,240,240)").scale(null,null,null,B.legend.backgroundOpacity||0.1).toString();O.fillStyle=P;O.fillRect(W,U,K,C);O.strokeStyle=B.legend.labelBoxBorderColor;O.strokeRect(Flotr.toPixel(W),Flotr.toPixel(U),K,C);var G=W+S;var F=U+S;for(R=0;R<H.length;R++){if(!H[R].label||H[R].hide){continue}var E=B.legend.labelFormatter(H[R].label);O.fillStyle=H[R].color;O.fillRect(G,F,L-1,Z-1);O.strokeStyle=B.legend.labelBoxBorderColor;O.lineWidth=1;O.strokeRect(Math.ceil(G)-1.5,Math.ceil(F)-1.5,L+2,Z+2);O.drawText(E,G+L+S,F+(Z+T.size-O.fontDescent(T))/2,T);F+=Z+S}}else{for(R=0;R<H.length;++R){if(!H[R].label||H[R].hide){continue}if(R%B.legend.noColumns==0){b.push(A?"</tr><tr>":"<tr>");A=true}var E=B.legend.labelFormatter(H[R].label);b.push('<td class="flotr-legend-color-box"><div style="border:1px solid '+B.legend.labelBoxBorderColor+';padding:1px"><div style="width:'+B.legend.labelBoxWidth+"px;height:"+B.legend.labelBoxHeight+"px;background-color:"+H[R].color+'"></div></div></td><td class="flotr-legend-label">'+E+"</td>")}if(A){b.push("</tr>")}if(b.length>0){var V='<table style="font-size:smaller;color:'+B.grid.color+'">'+b.join("")+"</table>";if(B.legend.container!=null){$(B.legend.container).update(V)}else{var D="";var M=B.legend.position,N=B.legend.margin;if(M.charAt(0)=="n"){D+="top:"+(N+I.top)+"px;"}else{if(M.charAt(0)=="s"){D+="bottom:"+(N+I.bottom)+"px;"}}if(M.charAt(1)=="e"){D+="right:"+(N+I.right)+"px;"}else{if(M.charAt(1)=="w"){D+="left:"+(N+I.left)+"px;"}}var J=this.el.insert('<div class="flotr-legend" style="position:absolute;z-index:2;'+D+'">'+V+"</div>").select("div.flotr-legend").first();if(B.legend.backgroundOpacity!=0){var Y=B.legend.backgroundColor;if(Y==null){var X=(B.grid.backgroundColor!=null)?B.grid.backgroundColor:Flotr.extractColor(J);Y=Flotr.parseColor(X).adjust(null,null,null,1).toString()}this.el.insert('<div class="flotr-legend-bg" style="position:absolute;width:'+J.getWidth()+"px;height:"+J.getHeight()+"px;"+D+"background-color:"+Y+';"> </div>').select("div.flotr-legend-bg").first().setStyle({opacity:B.legend.backgroundOpacity})}}}}}},getEventPosition:function(C){var G=this.overlay.cumulativeOffset(),F=(C.pageX-G.left-this.plotOffset.left),E=(C.pageY-G.top-this.plotOffset.top),D=0,B=0;if(C.pageX==null&&C.clientX!=null){var H=document.documentElement,A=document.body;D=C.clientX+(H&&H.scrollLeft||A.scrollLeft||0);B=C.clientY+(H&&H.scrollTop||A.scrollTop||0)}else{D=C.pageX;B=C.pageY}return{x:this.axes.x.min+F/this.axes.x.scale,x2:this.axes.x2.min+F/this.axes.x2.scale,y:this.axes.y.max-E/this.axes.y.scale,y2:this.axes.y2.max-E/this.axes.y2.scale,relX:F,relY:E,absX:D,absY:B}},clickHandler:function(A){if(this.ignoreClick){this.ignoreClick=false;return }this.el.fire("flotr:click",[this.getEventPosition(A),this])},mouseMoveHandler:function(A){var B=this.getEventPosition(A);this.lastMousePos.pageX=B.absX;this.lastMousePos.pageY=B.absY;if(this.selectionInterval==null&&(this.options.mouse.track||this.series.any(function(C){return C.mouse&&C.mouse.track}))){this.hit(B)}this.el.fire("flotr:mousemove",[A,B,this])},mouseDownHandler:function(C){if(C.isRightClick()){C.stop();var B=this.overlay;B.hide();function A(){B.show();$(document).stopObserving("mousemove",A)}$(document).observe("mousemove",A);return }if(!this.options.selection.mode||!C.isLeftClick()){return }this.setSelectionPos(this.selection.first,C);if(this.selectionInterval!=null){clearInterval(this.selectionInterval)}this.lastMousePos.pageX=null;this.selectionInterval=setInterval(this.updateSelection.bind(this),1000/this.options.selection.fps);this.mouseUpHandler=this.mouseUpHandler.bind(this);$(document).observe("mouseup",this.mouseUpHandler)},fireSelectEvent:function(){var A=this.axes,F=this.selection,C=(F.first.x<=F.second.x)?F.first.x:F.second.x,B=(F.first.x<=F.second.x)?F.second.x:F.first.x,E=(F.first.y>=F.second.y)?F.first.y:F.second.y,D=(F.first.y>=F.second.y)?F.second.y:F.first.y;C=A.x.min+C/A.x.scale;B=A.x.min+B/A.x.scale;E=A.y.max-E/A.y.scale;D=A.y.max-D/A.y.scale;this.el.fire("flotr:select",[{x1:C,y1:E,x2:B,y2:D},this])},mouseUpHandler:function(A){$(document).stopObserving("mouseup",this.mouseUpHandler);A.stop();if(this.selectionInterval!=null){clearInterval(this.selectionInterval);this.selectionInterval=null}this.setSelectionPos(this.selection.second,A);this.clearSelection();if(this.selectionIsSane()){this.drawSelection();this.fireSelectEvent();this.ignoreClick=true}},setSelectionPos:function(D,B){var A=this.options,C=$(this.overlay).cumulativeOffset();if(A.selection.mode.indexOf("x")==-1){D.x=(D==this.selection.first)?0:this.plotWidth}else{D.x=B.pageX-C.left-this.plotOffset.left;D.x=Math.min(Math.max(0,D.x),this.plotWidth)}if(A.selection.mode.indexOf("y")==-1){D.y=(D==this.selection.first)?0:this.plotHeight}else{D.y=B.pageY-C.top-this.plotOffset.top;D.y=Math.min(Math.max(0,D.y),this.plotHeight)}},updateSelection:function(){if(this.lastMousePos.pageX==null){return }this.setSelectionPos(this.selection.second,this.lastMousePos);this.clearSelection();if(this.selectionIsSane()){this.drawSelection()}},clearSelection:function(){if(this.prevSelection==null){return }var G=this.prevSelection,E=this.octx,C=this.plotOffset,A=Math.min(G.first.x,G.second.x),F=Math.min(G.first.y,G.second.y),B=Math.abs(G.second.x-G.first.x),D=Math.abs(G.second.y-G.first.y);E.clearRect(A+C.left-E.lineWidth,F+C.top-E.lineWidth,B+E.lineWidth*2,D+E.lineWidth*2);this.prevSelection=null},setSelection:function(G){var B=this.options,H=this.axes.x,A=this.axes.y,F=yaxis.scale,D=xaxis.scale,E=B.selection.mode.indexOf("x")!=-1,C=B.selection.mode.indexOf("y")!=-1;this.clearSelection();this.selection.first.y=E?0:(A.max-G.y1)*F;this.selection.second.y=E?this.plotHeight:(A.max-G.y2)*F;this.selection.first.x=C?0:(G.x1-H.min)*D;this.selection.second.x=C?this.plotWidth:(G.x2-H.min)*D;this.drawSelection();this.fireSelectEvent()},drawSelection:function(){var C=this.prevSelection,F=this.selection,H=this.octx,I=this.options,A=this.plotOffset;if(C!=null&&F.first.x==C.first.x&&F.first.y==C.first.y&&F.second.x==C.second.x&&F.second.y==C.second.y){return }H.strokeStyle=Flotr.parseColor(I.selection.color).scale(null,null,null,0.8).toString();H.lineWidth=1;H.lineJoin="round";H.fillStyle=Flotr.parseColor(I.selection.color).scale(null,null,null,0.4).toString();this.prevSelection={first:{x:F.first.x,y:F.first.y},second:{x:F.second.x,y:F.second.y}};var E=Math.min(F.first.x,F.second.x),D=Math.min(F.first.y,F.second.y),G=Math.abs(F.second.x-F.first.x),B=Math.abs(F.second.y-F.first.y);H.fillRect(E+A.left,D+A.top,G,B);H.strokeRect(E+A.left,D+A.top,G,B)},selectionIsSane:function(){var A=this.selection;return Math.abs(A.second.x-A.first.x)>=5&&Math.abs(A.second.y-A.first.y)>=5},clearHit:function(){if(this.prevHit){var B=this.options,A=this.plotOffset,C=this.prevHit;this.octx.clearRect(this.tHoz(C.x)+A.left-B.points.radius*2,this.tVert(C.y)+A.top-B.points.radius*2,B.points.radius*3+B.points.lineWidth*3,B.points.radius*3+B.points.lineWidth*3);this.prevHit=null}},hit:function(I){var G=this.series,C=this.options,R=this.prevHit,H=this.plotOffset,D=this.octx,S,A,M,Q,L={dist:Number.MAX_VALUE,x:null,y:null,relX:I.relX,relY:I.relY,absX:I.absX,absY:I.absY,mouse:null};for(Q=0;Q<G.length;Q++){s=G[Q];if(!s.mouse.track){continue}S=s.data;A=(s.xaxis.scale*s.mouse.sensibility);M=(s.yaxis.scale*s.mouse.sensibility);for(var P=0,B,E;P<S.length;P++){if(S[P][1]===null){continue}B=Math.pow(s.xaxis.scale*(S[P][0]-I.x),2);E=Math.pow(s.yaxis.scale*(S[P][1]-I.y),2);if(B<A&&E<M&&Math.sqrt(B+E)<L.dist){L.dist=Math.sqrt(B+E);L.x=S[P][0];L.y=S[P][1];L.mouse=s.mouse}}}if(L.mouse&&L.mouse.track&&!R||(R&&(L.x!=R.x||L.y!=R.y))){var K=this.mouseTrack||this.el.select(".flotr-mouse-value")[0],F="",J=C.mouse.position,N=C.mouse.margin,O="opacity:0.7;background-color:#000;color:#fff;display:none;position:absolute;padding:2px 8px;-moz-border-radius:4px;border-radius:4px;white-space:nowrap;";if(!C.mouse.relative){if(J.charAt(0)=="n"){F+="top:"+(N+H.top)+"px;"}else{if(J.charAt(0)=="s"){F+="bottom:"+(N+H.bottom)+"px;"}}if(J.charAt(1)=="e"){F+="right:"+(N+H.right)+"px;"}else{if(J.charAt(1)=="w"){F+="left:"+(N+H.left)+"px;"}}}else{if(J.charAt(0)=="n"){F+="bottom:"+(N-H.top-this.tVert(L.y)+this.canvasHeight)+"px;"}else{if(J.charAt(0)=="s"){F+="top:"+(N+H.top+this.tVert(L.y))+"px;"}}if(J.charAt(1)=="e"){F+="left:"+(N+H.left+this.tHoz(L.x))+"px;"}else{if(J.charAt(1)=="w"){F+="right:"+(N-H.left-this.tHoz(L.x)+this.canvasWidth)+"px;"}}}O+=F;if(!K){this.el.insert('<div class="flotr-mouse-value" style="'+O+'"></div>');K=this.mouseTrack=this.el.select(".flotr-mouse-value").first()}else{this.mouseTrack=K.setStyle(O)}if(L.x!==null&&L.y!==null){K.show();this.clearHit();if(L.mouse.lineColor!=null){D.save();D.translate(H.left,H.top);D.lineWidth=C.points.lineWidth;D.strokeStyle=L.mouse.lineColor;D.fillStyle="#ffffff";D.beginPath();D.arc(this.tHoz(L.x),this.tVert(L.y),C.mouse.radius,0,2*Math.PI,true);D.fill();D.stroke();D.restore()}this.prevHit=L;var T=L.mouse.trackDecimals;if(T==null||T<0){T=0}K.innerHTML=L.mouse.trackFormatter({x:L.x.toFixed(T),y:L.y.toFixed(T)});K.fire("flotr:hit",[L,this])}else{if(R){K.hide();this.clearHit()}}}},saveImage:function(D,C,A,B){var E=null;switch(D){case"jpeg":case"jpg":E=Canvas2Image.saveAsJPEG(this.canvas,B,C,A);break;default:case"png":E=Canvas2Image.saveAsPNG(this.canvas,B,C,A);break;case"bmp":E=Canvas2Image.saveAsBMP(this.canvas,B,C,A);break}if(Object.isElement(E)&&B){this.restoreCanvas();this.canvas.hide();this.overlay.hide();this.el.insert(E.setStyle({position:"absolute"}))}},restoreCanvas:function(){this.canvas.show();this.overlay.show();this.el.select("img").invoke("remove")}});Flotr.Color=Class.create({initialize:function(E,D,B,C){this.rgba=["r","g","b","a"];var A=4;while(-1<--A){this[this.rgba[A]]=arguments[A]||((A==3)?1:0)}this.normalize()},adjust:function(D,C,E,B){var A=4;while(-1<--A){if(arguments[A]!=null){this[this.rgba[A]]+=arguments[A]}}return this.normalize()},clone:function(){return new Flotr.Color(this.r,this.b,this.g,this.a)},limit:function(B,A,C){return Math.max(Math.min(B,C),A)},normalize:function(){var A=this.limit;this.r=A(parseInt(this.r),0,255);this.g=A(parseInt(this.g),0,255);this.b=A(parseInt(this.b),0,255);this.a=A(this.a,0,1);return this},scale:function(D,C,E,B){var A=4;while(-1<--A){if(arguments[A]!=null){this[this.rgba[A]]*=arguments[A]}}return this.normalize()},distance:function(B){if(!B){return }B=new Flotr.parseColor(B);var C=0;var A=3;while(-1<--A){C+=Math.abs(this[this.rgba[A]]-B[this.rgba[A]])}return C},toString:function(){return(this.a>=1)?"rgb("+[this.r,this.g,this.b].join(",")+")":"rgba("+[this.r,this.g,this.b,this.a].join(",")+")"}});Flotr.Color.lookupColors={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0]};Flotr.Date={format:function(F,E){if(!F){return }var A=function(H){H=H.toString();return H.length==1?"0"+H:H};var D=[];var C=false;for(var B=0;B<E.length;++B){var G=E.charAt(B);if(C){switch(G){case"h":G=F.getUTCHours().toString();break;case"H":G=A(F.getUTCHours());break;case"M":G=A(F.getUTCMinutes());break;case"S":G=A(F.getUTCSeconds());break;case"d":G=F.getUTCDate().toString();break;case"m":G=(F.getUTCMonth()+1).toString();break;case"y":G=F.getUTCFullYear().toString();break;case"b":G=Flotr.Date.monthNames[F.getUTCMonth()];break}D.push(G);C=false}else{if(G=="%"){C=true}else{D.push(G)}}}return D.join("")},timeUnits:{second:1000,minute:60*1000,hour:60*60*1000,day:24*60*60*1000,month:30*24*60*60*1000,year:365.2425*24*60*60*1000},spec:[[1,"second"],[2,"second"],[5,"second"],[10,"second"],[30,"second"],[1,"minute"],[2,"minute"],[5,"minute"],[10,"minute"],[30,"minute"],[1,"hour"],[2,"hour"],[4,"hour"],[8,"hour"],[12,"hour"],[1,"day"],[2,"day"],[3,"day"],[0.25,"month"],[0.5,"month"],[1,"month"],[2,"month"],[3,"month"],[6,"month"],[1,"year"]],monthNames:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"]};
+
--- a/js/flotr/flotr.debug-0.2.0-alpha_radar1.js
+++ /dev/null
@@ -1,3349 +1,1 @@
-//Flotr 0.2.0-alpha Copyright (c) 2009 Bas Wenneker, <http://solutoire.com>, MIT License.
-//
-//Radar chart added by Ryan Simmons
-//
-/* $Id: flotr.js 82 2009-01-12 19:19:31Z fabien.menager $ */
-
-var Flotr = {
- version: '0.2.0-alpha',
- author: 'Bas Wenneker',
- website: 'http://www.solutoire.com',
- /**
- * An object of the default registered graph types. Use Flotr.register(type, functionName)
- * to add your own type.
- */
- _registeredTypes:{
- 'lines': 'drawSeriesLines',
- 'points': 'drawSeriesPoints',
- 'bars': 'drawSeriesBars',
- 'candles': 'drawSeriesCandles',
- 'pie': 'drawSeriesPie',
- 'radar':'drawSeriesRadar'
- },
- /**
- * Can be used to register your own chart type. Default types are 'lines', 'points' and 'bars'.
- * This is still experimental.
- * @todo Test and confirm.
- * @param {String} type - type of chart, like 'pies', 'bars' etc.
- * @param {String} functionName - Name of the draw function, like 'drawSeriesPies', 'drawSeriesBars' etc.
- */
- register: function(type, functionName){
- Flotr._registeredTypes[type] = functionName+'';
- },
- /**
- * Draws the graph. This function is here for backwards compatibility with Flotr version 0.1.0alpha.
- * You could also draw graphs by directly calling Flotr.Graph(element, data, options).
- * @param {Element} el - element to insert the graph into
- * @param {Object} data - an array or object of dataseries
- * @param {Object} options - an object containing options
- * @param {Class} _GraphKlass_ - (optional) Class to pass the arguments to, defaults to Flotr.Graph
- * @return {Class} returns a new graph object and of course draws the graph.
- */
- draw: function(el, data, options, _GraphKlass_){
- _GraphKlass_ = _GraphKlass_ || Flotr.Graph;
- return new _GraphKlass_(el, data, options);
- },
- /**
- * Collects dataseries from input and parses the series into the right format. It returns an Array
- * of Objects each having at least the 'data' key set.
- * @param {Array/Object} data - Object or array of dataseries
- * @return {Array} Array of Objects parsed into the right format ({(...,) data: [[x1,y1], [x2,y2], ...] (, ...)})
- */
- getSeries: function(data){
- return data.collect(function(serie){
- var i, serie = (serie.data) ? Object.clone(serie) : {'data': serie};
- for (i = serie.data.length-1; i > -1; --i) {
- serie.data[i][1] = (serie.data[i][1] === null ? null : parseFloat(serie.data[i][1]));
- }
- return serie;
- });
- },
- /**
- * Recursively merges two objects.
- * @param {Object} src - source object (likely the object with the least properties)
- * @param {Object} dest - destination object (optional, object with the most properties)
- * @return {Object} recursively merged Object
- */
- merge: function(src, dest){
- var result = dest || {};
- for(var i in src){
- result[i] = (src[i] != null && typeof(src[i]) == 'object' && !(src[i].constructor == Array || src[i].constructor == RegExp) && !Object.isElement(src[i])) ? Flotr.merge(src[i], dest[i]) : result[i] = src[i];
- }
- return result;
- },
- /**
- * Function calculates the ticksize and returns it.
- * @param {Integer} noTicks - number of ticks
- * @param {Integer} min - lower bound integer value for the current axis
- * @param {Integer} max - upper bound integer value for the current axis
- * @param {Integer} decimals - number of decimals for the ticks
- * @return {Integer} returns the ticksize in pixels
- */
- getTickSize: function(noTicks, min, max, decimals){
- var delta = (max - min) / noTicks;
- var magn = Flotr.getMagnitude(delta);
-
- // Norm is between 1.0 and 10.0.
- var norm = delta / magn;
-
- var tickSize = 10;
- if(norm < 1.5) tickSize = 1;
- else if(norm < 2.25) tickSize = 2;
- else if(norm < 3) tickSize = ((decimals == 0) ? 2 : 2.5);
- else if(norm < 7.5) tickSize = 5;
-
- return tickSize * magn;
- },
- /**
- * Default tick formatter.
- * @param {String/Integer} val - tick value integer
- * @return {String} formatted tick string
- */
- defaultTickFormatter: function(val){
- return val+'';
- },
- /**
- * Formats the mouse tracker values.
- * @param {Object} obj - Track value Object {x:..,y:..}
- * @return {String} Formatted track string
- */
- defaultTrackFormatter: function(obj){
- return '('+obj.x+', '+obj.y+')';
- },
- defaultPieLabelFormatter: function(slice) {
- return (slice.fraction*100).toFixed(2)+'%';
- },
- /**
- * Returns the magnitude of the input value.
- * @param {Integer/Float} x - integer or float value
- * @return {Integer/Float} returns the magnitude of the input value
- */
- getMagnitude: function(x){
- return Math.pow(10, Math.floor(Math.log(x) / Math.LN10));
- },
- toPixel: function(val){
- return Math.floor(val)+0.5;//((val-Math.round(val) < 0.4) ? (Math.floor(val)-0.5) : val);
- },
- toRad: function(angle){
- return -angle * (Math.PI/180);
- },
- /**
- * Parses a color string and returns a corresponding Color.
- * @param {String} str - string thats representing a color
- * @return {Color} returns a Color object or false
- */
- parseColor: function(str){
- if (str instanceof Flotr.Color) return str;
-
- var result, Color = Flotr.Color;
-
- // rgb(num,num,num)
- if((result = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(str)))
- return new Color(parseInt(result[1]), parseInt(result[2]), parseInt(result[3]));
-
- // rgba(num,num,num,num)
- if((result = /rgba\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(str)))
- return new Color(parseInt(result[1]), parseInt(result[2]), parseInt(result[3]), parseFloat(result[4]));
-
- // rgb(num%,num%,num%)
- if((result = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(str)))
- return new Color(parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55);
-
- // rgba(num%,num%,num%,num)
- if((result = /rgba\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\s*\)/.exec(str)))
- return new Color(parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55, parseFloat(result[4]));
-
- // #a0b1c2
- if((result = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(str)))
- return new Color(parseInt(result[1],16), parseInt(result[2],16), parseInt(result[3],16));
-
- // #fff
- if((result = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(str)))
- return new Color(parseInt(result[1]+result[1],16), parseInt(result[2]+result[2],16), parseInt(result[3]+result[3],16));
-
- // Otherwise, we're most likely dealing with a named color.
- var name = str.strip().toLowerCase();
- if(name == 'transparent'){
- return new Color(255, 255, 255, 0);
- }
- return ((result = Color.lookupColors[name])) ? new Color(result[0], result[1], result[2]) : false;
- },
- /**
- * Extracts the background-color of the passed element.
- * @param {Element} element
- * @return {String} color string
- */
- extractColor: function(element){
- var color;
- // Loop until we find an element with a background color and stop when we hit the body element.
- do {
- color = element.getStyle('background-color').toLowerCase();
- if(!(color == '' || color == 'transparent')) break;
- element = element.up(0);
- } while(!element.nodeName.match(/^body$/i));
-
- // Catch Safari's way of signaling transparent.
- return (color == 'rgba(0, 0, 0, 0)') ? 'transparent' : color;
- }
-};
-/**
- * Flotr Graph class that plots a graph on creation.
-
- */
-Flotr.Graph = Class.create({
- /**
- * Flotr Graph constructor.
- * @param {Element} el - element to insert the graph into
- * @param {Object} data - an array or object of dataseries
- * @param {Object} options - an object containing options
- */
- initialize: function(el, data, options){
- this.el = $(el);
-
- if (!this.el) throw 'The target container doesn\'t exist';
-
- this.data = data;
- this.series = Flotr.getSeries(data);
- this.setOptions(options);
-
- // Initialize some variables
- this.lastMousePos = { pageX: null, pageY: null };
- this.selection = { first: { x: -1, y: -1}, second: { x: -1, y: -1} };
- this.prevSelection = null;
- this.selectionInterval = null;
- this.ignoreClick = false;
- this.prevHit = null;
-
- // Create and prepare canvas.
- this.constructCanvas();
-
- // Add event handlers for mouse tracking, clicking and selection
- this.initEvents();
-
- this.findDataRanges();
- this.calculateTicks(this.axes.x);
- this.calculateTicks(this.axes.x2);
- this.calculateTicks(this.axes.y);
- this.calculateTicks(this.axes.y2);
-
- this.calculateSpacing();
- this.draw();
- this.insertLegend();
-
- // Graph and Data tabs
- if (this.options.spreadsheet.show)
- this.constructTabs();
- },
- /**
- * Sets options and initializes some variables and color specific values, used by the constructor.
- * @param {Object} opts - options object
- */
- setOptions: function(opts){
- var options = {
- colors: ['#00A8F0', '#C0D800', '#CB4B4B', '#4DA74D', '#9440ED'], //=> The default colorscheme. When there are > 5 series, additional colors are generated.
- title: null,
- subtitle: null,
- legend: {
- show: true, // => setting to true will show the legend, hide otherwise
- noColumns: 1, // => number of colums in legend table // @todo: doesn't work for HtmlText = false
- labelFormatter: Prototype.K, // => fn: string -> string
- labelBoxBorderColor: '#CCCCCC', // => border color for the little label boxes
- labelBoxWidth: 14,
- labelBoxHeight: 10,
- labelBoxMargin: 5,
- container: null, // => container (as jQuery object) to put legend in, null means default on top of graph
- position: 'nw', // => position of default legend container within plot
- margin: 5, // => distance from grid edge to default legend container within plot
- backgroundColor: null, // => null means auto-detect
- backgroundOpacity: 0.85// => set to 0 to avoid background, set to 1 for a solid background
- },
- xaxis: {
- ticks: null, // => format: either [1, 3] or [[1, 'a'], 3]
- showLabels: true, // => setting to true will show the axis ticks labels, hide otherwise
- labelsAngle: 0, // => Labels' angle, in degrees
- title: null, // => axis title
- titleAngle: 0, // => axis title's angle, in degrees
- noTicks: 5, // => number of ticks for automagically generated ticks
- tickFormatter: Flotr.defaultTickFormatter, // => fn: number -> string
- tickDecimals: null, // => no. of decimals, null means auto
- min: null, // => min. value to show, null means set automatically
- max: null, // => max. value to show, null means set automatically
- autoscaleMargin: 0, // => margin in % to add if auto-setting min/max
- color: null
- },
- x2axis: {},
- yaxis: {
- ticks: null, // => format: either [1, 3] or [[1, 'a'], 3]
- showLabels: true, // => setting to true will show the axis ticks labels, hide otherwise
- labelsAngle: 0, // => Labels' angle, in degrees
- title: null, // => axis title
- titleAngle: 90, // => axis title's angle, in degrees
- noTicks: 5, // => number of ticks for automagically generated ticks
- tickFormatter: Flotr.defaultTickFormatter, // => fn: number -> string
- tickDecimals: null, // => no. of decimals, null means auto
- min: null, // => min. value to show, null means set automatically
- max: null, // => max. value to show, null means set automatically
- autoscaleMargin: 0, // => margin in % to add if auto-setting min/max
- color: null
- },
- y2axis: {
- titleAngle: 270
- },
- points: {
- show: false, // => setting to true will show points, false will hide
- radius: 3, // => point radius (pixels)
- lineWidth: 2, // => line width in pixels
- fill: true, // => true to fill the points with a color, false for (transparent) no fill
- fillColor: '#FFFFFF', // => fill color
- fillOpacity: 0.4
- },
- lines: {
- show: false, // => setting to true will show lines, false will hide
- lineWidth: 2, // => line width in pixels
- fill: false, // => true to fill the area from the line to the x axis, false for (transparent) no fill
- fillColor: null, // => fill color
- fillOpacity: 0.4 // => opacity of the fill color, set to 1 for a solid fill, 0 hides the fill
- },
- radar: {
- show: false, // => setting to true will show radar chart, false will hide
- lineWidth: 2, // => line width in pixels
- fill: false, // => true to fill the area from the line to the x axis, false for (transparent) no fill
- fillColor: null, // => fill color
- fillOpacity: 0.4 // => opacity of the fill color, set to 1 for a solid fill, 0 hides the fill
- },
- bars: {
- show: false, // => setting to true will show bars, false will hide
- lineWidth: 2, // => in pixels
- barWidth: 1, // => in units of the x axis
- fill: true, // => true to fill the area from the line to the x axis, false for (transparent) no fill
- fillColor: null, // => fill color
- fillOpacity: 0.4, // => opacity of the fill color, set to 1 for a solid fill, 0 hides the fill
- horizontal: false,
- stacked: false
- },
- candles: {
- show: false, // => setting to true will show candle sticks, false will hide
- lineWidth: 1, // => in pixels
- wickLineWidth: 1, // => in pixels
- candleWidth: 0.6, // => in units of the x axis
- fill: true, // => true to fill the area from the line to the x axis, false for (transparent) no fill
- upFillColor: '#00A8F0',// => up sticks fill color
- downFillColor: '#CB4B4B',// => down sticks fill color
- fillOpacity: 0.5, // => opacity of the fill color, set to 1 for a solid fill, 0 hides the fill
- barcharts: false // => draw as barcharts (not standard bars but financial barcharts)
- },
- pie: {
- show: false, // => setting to true will show bars, false will hide
- lineWidth: 1, // => in pixels
- fill: true, // => true to fill the area from the line to the x axis, false for (transparent) no fill
- fillColor: null, // => fill color
- fillOpacity: 0.6, // => opacity of the fill color, set to 1 for a solid fill, 0 hides the fill
- explode: 6,
- sizeRatio: 0.6,
- startAngle: Math.PI/4,
- labelFormatter: Flotr.defaultPieLabelFormatter,
- pie3D: false,
- pie3DviewAngle: (Math.PI/2 * 0.8),
- pie3DspliceThickness: 20
- },
- grid: {
- color: '#545454', // => primary color used for outline and labels
- backgroundColor: null, // => null for transparent, else color
- tickColor: '#DDDDDD', // => color used for the ticks
- labelMargin: 3, // => margin in pixels
- verticalLines: true, // => whether to show gridlines in vertical direction
- horizontalLines: true, // => whether to show gridlines in horizontal direction
- outlineWidth: 2 // => width of the grid outline/border in pixels
- },
- selection: {
- mode: null, // => one of null, 'x', 'y' or 'xy'
- color: '#B6D9FF', // => selection box color
- fps: 20 // => frames-per-second
- },
- mouse: {
- track: false, // => true to track the mouse, no tracking otherwise
- position: 'se', // => position of the value box (default south-east)
- relative: false, // => next to the mouse cursor
- trackFormatter: Flotr.defaultTrackFormatter, // => formats the values in the value box
- margin: 5, // => margin in pixels of the valuebox
- lineColor: '#FF3F19', // => line color of points that are drawn when mouse comes near a value of a series
- trackDecimals: 1, // => decimals for the track values
- sensibility: 2, // => the lower this number, the more precise you have to aim to show a value
- radius: 3 // => radius of the track point
- },
- radarChartMode: false, // => true to render radar grid / and setup scaling for radar chart
- shadowSize: 4, // => size of the 'fake' shadow
- defaultType: 'lines', // => default series type
- HtmlText: true, // => wether to draw the text using HTML or on the canvas
- fontSize: 7.5, // => canvas' text font size
- spreadsheet: {
- show: false, // => show the data grid using two tabs
- tabGraphLabel: 'Graph',
- tabDataLabel: 'Data',
- toolbarDownload: 'Download CSV', // @todo: add language support
- toolbarSelectAll: 'Select all'
- }
- }
-
- options.x2axis = Object.extend(Object.clone(options.xaxis), options.x2axis);
- options.y2axis = Object.extend(Object.clone(options.yaxis), options.y2axis);
- this.options = Flotr.merge((opts || {}), options);
-
- this.axes = {
- x: {options: this.options.xaxis, n: 1},
- x2: {options: this.options.x2axis, n: 2},
- y: {options: this.options.yaxis, n: 1},
- y2: {options: this.options.y2axis, n: 2}
- };
-
- // Initialize some variables used throughout this function.
- var assignedColors = [],
- colors = [],
- ln = this.series.length,
- neededColors = this.series.length,
- oc = this.options.colors,
- usedColors = [],
- variation = 0,
- c, i, j, s, tooClose;
-
- // Collect user-defined colors from series.
- for(i = neededColors - 1; i > -1; --i){
- c = this.series[i].color;
- if(c != null){
- --neededColors;
- if(Object.isNumber(c)) assignedColors.push(c);
- else usedColors.push(Flotr.parseColor(c));
- }
- }
-
- // Calculate the number of colors that need to be generated.
- for(i = assignedColors.length - 1; i > -1; --i)
- neededColors = Math.max(neededColors, assignedColors[i] + 1);
-
- // Generate needed number of colors.
- for(i = 0; colors.length < neededColors;){
- c = (oc.length == i) ? new Flotr.Color(100, 100, 100) : Flotr.parseColor(oc[i]);
-
- // Make sure each serie gets a different color.
- var sign = variation % 2 == 1 ? -1 : 1;
- var factor = 1 + sign * Math.ceil(variation / 2) * 0.2;
- c.scale(factor, factor, factor);
-
- /**
- * @todo if we're getting too close to something else, we should probably skip this one
- */
- colors.push(c);
-
- if(++i >= oc.length){
- i = 0;
- ++variation;
- }
- }
-
- // Fill the options with the generated colors.
- for(i = 0, j = 0; i < ln; ++i){
- s = this.series[i];
-
- // Assign the color.
- if(s.color == null){
- s.color = colors[j++].toString();
- }else if(Object.isNumber(s.color)){
- s.color = colors[s.color].toString();
- }
-
- if (!s.xaxis) s.xaxis = this.axes.x;
- if (s.xaxis == 1) s.xaxis = this.axes.x;
- else if (s.xaxis == 2) s.xaxis = this.axes.x2;
-
- if (!s.yaxis) s.yaxis = this.axes.y;
- if (s.yaxis == 1) s.yaxis = this.axes.y;
- else if (s.yaxis == 2) s.yaxis = this.axes.y2;
-
- // Apply missing options to the series.
- s.lines = Object.extend(Object.clone(this.options.lines), s.lines);
- s.points = Object.extend(Object.clone(this.options.points), s.points);
- s.bars = Object.extend(Object.clone(this.options.bars), s.bars);
- s.candles = Object.extend(Object.clone(this.options.candles), s.candles);
- s.pie = Object.extend(Object.clone(this.options.pie), s.pie);
- s.radar = Object.extend(Object.clone(this.options.radar), s.radar);
- s.mouse = Object.extend(Object.clone(this.options.mouse), s.mouse);
-
- if(s.shadowSize == null) s.shadowSize = this.options.shadowSize;
- }
- },
- /**
- * Initializes the canvas and it's overlay canvas element. When the browser is IE, this makes use
- * of excanvas. The overlay canvas is inserted for displaying interactions. After the canvas elements
- * are created, the elements are inserted into the container element.
- */
- constructCanvas: function(){
- var el = this.el,
- size, c, oc;
-
- this.canvas = el.select('.flotr-canvas')[0];
- this.overlay = el.select('.flotr-overlay')[0];
-
- el.childElements().invoke('remove');
-
- // For positioning labels and overlay.
- el.setStyle({position:'relative', cursor:'default'});
-
- this.canvasWidth = el.getWidth();
- this.canvasHeight = el.getHeight();
- size = {'width': this.canvasWidth, 'height': this.canvasHeight};
-
- if(this.canvasWidth <= 0 || this.canvasHeight <= 0){
- throw 'Invalid dimensions for plot, width = ' + this.canvasWidth + ', height = ' + this.canvasHeight;
- }
-
- // Insert main canvas.
- if (!this.canvas) {
- c = this.canvas = new Element('canvas', size);
- c.className = 'flotr-canvas';
- c = c.writeAttribute('style', 'position:absolute;left:0px;top:0px;');
- } else {
- c = this.canvas.writeAttribute(size);
- }
- el.insert(c);
-
- if(Prototype.Browser.IE){
- c = window.G_vmlCanvasManager.initElement(c);
- }
- this.ctx = c.getContext('2d');
-
- // Insert overlay canvas for interactive features.
- if (!this.overlay) {
- oc = this.overlay = new Element('canvas', size);
- oc.className = 'flotr-overlay';
- oc = oc.writeAttribute('style', 'position:absolute;left:0px;top:0px;');
- } else {
- oc = this.overlay.writeAttribute(size);
- }
- el.insert(oc);
-
- if(Prototype.Browser.IE){
- oc = window.G_vmlCanvasManager.initElement(oc);
- }
- this.octx = oc.getContext('2d');
-
- // Enable text functions
- if (window.CanvasText) {
- CanvasText.enable(this.ctx);
- CanvasText.enable(this.octx);
- this.textEnabled = true;
- }
- },
- getTextDimensions: function(text, canvasStyle, HtmlStyle, className) {
- if (!text) return {width:0, height:0};
-
- if (!this.options.HtmlText && this.textEnabled) {
- var bounds = this.ctx.getTextBounds(text, canvasStyle);
- return {
- width: bounds.width+2,
- height: bounds.height+6
- };
- }
- else {
- var dummyDiv = this.el.insert('<div style="position:absolute;top:-10000px;'+HtmlStyle+'" class="'+className+' flotr-dummy-div">' + text + '</div>').select(".flotr-dummy-div")[0];
- dim = dummyDiv.getDimensions();
- dummyDiv.remove();
- return dim;
- }
- },
- loadDataGrid: function(){
- if (this.seriesData) return this.seriesData;
-
- var s = this.series;
- var dg = [];
-
- /* The data grid is a 2 dimensions array. There is a row for each X value.
- * Each row contains the x value and the corresponding y value for each serie ('undefined' if there isn't one)
- **/
- for(i = 0; i < s.length; ++i){
- s[i].data.each(function(v) {
- var x = v[0],
- y = v[1];
- if (r = dg.find(function(row) {return row[0] == x})) {
- r[i+1] = y;
- }
- else {
- var newRow = [];
- newRow[0] = x;
- newRow[i+1] = y
- dg.push(newRow);
- }
- });
- }
-
- // The data grid is sorted by x value
- dg = dg.sortBy(function(v) {
- return v[0];
- });
- return this.seriesData = dg;
- },
-
- // @todo: make a tab manager (Flotr.Tabs)
- showTab: function(tabName, onComplete){
- var elementsClassNames = 'canvas, .flotr-labels, .flotr-legend, .flotr-legend-bg, .flotr-title, .flotr-subtitle';
- switch(tabName) {
- case 'graph':
- this.datagrid.up().hide();
- this.el.select(elementsClassNames).invoke('show');
- this.tabs.data.removeClassName('selected');
- this.tabs.graph.addClassName('selected');
- break;
- case 'data':
- this.constructDataGrid();
- this.datagrid.up().show();
- this.el.select(elementsClassNames).invoke('hide');
- this.tabs.data.addClassName('selected');
- this.tabs.graph.removeClassName('selected');
- break;
- }
- },
- constructTabs: function(){
- var tabsContainer = new Element('div', {className:'flotr-tabs-group', style:'position:absolute;left:0px;top:'+this.canvasHeight+'px;width:'+this.canvasWidth+'px;'});
- this.el.insert({bottom: tabsContainer});
- this.tabs = {
- graph: new Element('div', {className:'flotr-tab selected', style:'float:left;'}).update(this.options.spreadsheet.tabGraphLabel),
- data: new Element('div', {className:'flotr-tab', style:'float:left;'}).update(this.options.spreadsheet.tabDataLabel)
- }
-
- tabsContainer.insert(this.tabs.graph).insert(this.tabs.data);
-
- this.el.setStyle({height: this.canvasHeight+this.tabs.data.getHeight()+2+'px'});
-
- this.tabs.graph.observe('click', (function() {this.showTab('graph')}).bind(this));
- this.tabs.data.observe('click', (function() {this.showTab('data')}).bind(this));
- },
-
- // @todo: make a spreadsheet manager (Flotr.Spreadsheet)
- constructDataGrid: function(){
- // If the data grid has already been built, nothing to do here
- if (this.datagrid) return this.datagrid;
-
- var i, j,
- s = this.series,
- datagrid = this.loadDataGrid();
-
- var t = this.datagrid = new Element('table', {className:'flotr-datagrid', style:'height:100px;'});
- var colgroup = ['<colgroup><col />'];
-
- // First row : series' labels
- var html = ['<tr class="first-row">'];
- html.push('<th> </th>');
- for (i = 0; i < s.length; ++i) {
- html.push('<th scope="col">'+(s[i].label || String.fromCharCode(65+i))+'</th>');
- colgroup.push('<col />');
- }
- html.push('</tr>');
-
- // Data rows
- for (j = 0; j < datagrid.length; ++j) {
- html.push('<tr>');
- for (i = 0; i < s.length+1; ++i) {
- var tag = 'td';
- var content = (datagrid[j][i] != null ? Math.round(datagrid[j][i]*100000)/100000 : '');
-
- if (i == 0) {
- tag = 'th';
- var label;
- if(this.options.xaxis.ticks) {
- var tick = this.options.xaxis.ticks.find(function (x) { return x[0] == datagrid[j][i] });
- if (tick) label = tick[1];
- }
- else {
- label = this.options.xaxis.tickFormatter(content);
- }
-
- if (label) content = label;
- }
-
- html.push('<'+tag+(tag=='th'?' scope="row"':'')+'>'+content+'</'+tag+'>');
- }
- html.push('</tr>');
- }
- colgroup.push('</colgroup>');
- t.update(colgroup.join('')+html.join(''));
-
- if (!Prototype.Browser.IE) {
- t.select('td').each(function(td) {
- td.observe('mouseover', function(e){
- td = e.element();
- var siblings = td.previousSiblings();
-
- t.select('th[scope=col]')[siblings.length-1].addClassName('hover');
- t.select('colgroup col')[siblings.length].addClassName('hover');
- });
-
- td.observe('mouseout', function(){
- t.select('colgroup col.hover, th.hover').each(function(e){e.removeClassName('hover')});
- });
- });
- }
-
- var toolbar = new Element('div', {className: 'flotr-datagrid-toolbar'}).
- insert(new Element('button', {type:'button', className:'flotr-datagrid-toolbar-button'}).update(this.options.spreadsheet.toolbarDownload).observe('click', this.downloadCSV.bind(this))).
- insert(new Element('button', {type:'button', className:'flotr-datagrid-toolbar-button'}).update(this.options.spreadsheet.toolbarSelectAll).observe('click', this.selectAllData.bind(this)));
-
- var container = new Element('div', {className:'flotr-datagrid-container', style:'left:0px;top:0px;width:'+this.canvasWidth+'px;height:'+this.canvasHeight+'px;overflow:auto;'});
- container.insert(toolbar);
- t.wrap(container.hide());
-
- this.el.insert(container);
- return t;
- },
- selectAllData: function(){
- if (this.tabs) {
- var selection, range, doc, win, node = this.constructDataGrid();
-
- this.showTab('data');
-
- // deferred to be able to select the table
- (function () {
- if ((doc = node.ownerDocument) && (win = doc.defaultView) &&
- win.getSelection && doc.createRange &&
- (selection = window.getSelection()) &&
- selection.removeAllRanges) {
- range = doc.createRange();
- range.selectNode(node);
- selection.removeAllRanges();
- selection.addRange(range);
- }
- else if (document.body && document.body.createTextRange &&
- (range = document.body.createTextRange())) {
- range.moveToElementText(node);
- range.select();
- }
- }).defer();
- return true;
- }
- else return false;
- },
- downloadCSV: function(){
- var i, csv = '"x"',
- series = this.series,
- dg = this.loadDataGrid();
-
- for (i = 0; i < series.length; ++i) {
- csv += '%09"'+(series[i].label || String.fromCharCode(65+i))+'"'; // \t
- }
- csv += "%0D%0A"; // \r\n
-
- for (i = 0; i < dg.length; ++i) {
- if (this.options.xaxis.ticks) {
- var tick = this.options.xaxis.ticks.find(function (x) { return x[0] == dg[i][0] });
- if (tick) dg[i][0] = tick[1];
- } else {
- dg[i][0] = this.options.xaxis.tickFormatter(dg[i][0]);
- }
- csv += dg[i].join('%09')+"%0D%0A"; // \t and \r\n
- }
- if (Prototype.Browser.IE) {
- csv = csv.gsub('%09', '\t').gsub('%0A', '\n').gsub('%0D', '\r');
- window.open().document.write(csv);
- }
- else {
- window.open('data:text/csv,'+csv);
- }
- },
- /**
- * Initializes event some handlers.
- */
- initEvents: function () {
- //@todo: maybe stopObserving with only flotr functions
- this.overlay.stopObserving();
- this.overlay.observe('mousedown', this.mouseDownHandler.bind(this));
- this.overlay.observe('mousemove', this.mouseMoveHandler.bind(this));
- this.overlay.observe('click', this.clickHandler.bind(this));
- },
- /**
- * Function determines the min and max values for the xaxis and yaxis.
- */
- findDataRanges: function(){
- var s = this.series,
- a = this.axes;
-
- a.x.datamin = 0; a.x.datamax = 0;
- a.x2.datamin = 0; a.x2.datamax = 0;
- a.y.datamin = 0; a.y.datamax = 0;
- a.y2.datamin = 0; a.y2.datamax = 0;
-
- if(s.length > 0){
- var i, j, h, x, y, data, xaxis, yaxis;
-
- // Get datamin, datamax start values
- for(i = 0; i < s.length; ++i) {
- data = s[i].data,
- xaxis = s[i].xaxis,
- yaxis = s[i].yaxis;
-
- if (data.length > 0 && !s[i].hide) {
- if (!xaxis.used) xaxis.datamin = xaxis.datamax = data[0][0];
- if (!yaxis.used) yaxis.datamin = yaxis.datamax = data[0][1];
- xaxis.used = true;
- yaxis.used = true;
-
- for(h = data.length - 1; h > -1; --h){
- x = data[h][0];
- if(x < xaxis.datamin) xaxis.datamin = x;
- else if(x > xaxis.datamax) xaxis.datamax = x;
-
- for(j = 1; j < data[h].length; j++){
- y = data[h][j];
- if(y < yaxis.datamin) yaxis.datamin = y;
- else if(y > yaxis.datamax) yaxis.datamax = y;
- }
- }
- }
- if (this.options.radarChartMode) {
- xaxis.datamin = yaxis.datamin = - yaxis.datamax;
- xaxis.datamax = yaxis.datamax;
- if (!this.options.radarChartSides) this.options.radarChartSides = data.length;
- }
- }
- }
-
- this.findXAxesValues();
-
- this.calculateRange(a.x);
- this.extendXRangeIfNeededByBar(a.x);
-
- if (a.x2.used) {
- this.calculateRange(a.x2);
- this.extendXRangeIfNeededByBar(a.x2);
- }
-
- this.calculateRange(a.y);
- this.extendYRangeIfNeededByBar(a.y);
-
- if (a.y2.used) {
- this.calculateRange(a.y2);
- this.extendYRangeIfNeededByBar(a.y2);
- }
- },
- /**
- * Calculates the range of an axis to apply autoscaling.
- */
- calculateRange: function(axis){
- var o = axis.options,
- min = o.min != null ? o.min : axis.datamin,
- max = o.max != null ? o.max : axis.datamax,
- margin;
-
- if(max - min == 0.0){
- var widen = (max == 0.0) ? 1.0 : 0.01;
- min -= widen;
- max += widen;
- }
- axis.tickSize = Flotr.getTickSize(o.noTicks, ((this.options.radarChartMode) ? 0 : min), max, o.tickDecimals);
-
- // Autoscaling.
- if(o.min == null){
- // Add a margin.
- margin = o.autoscaleMargin;
- if(margin != 0){
- min -= axis.tickSize * margin;
-
- // Make sure we don't go below zero if all values are positive.
- if(min < 0 && axis.datamin >= 0) min = 0;
- min = axis.tickSize * Math.floor(min / axis.tickSize);
- }
- }
- if(o.max == null){
- margin = o.autoscaleMargin;
- if(margin != 0){
- max += axis.tickSize * margin;
- if(max > 0 && axis.datamax <= 0) max = 0;
- max = axis.tickSize * Math.ceil(max / axis.tickSize);
- }
- }
- axis.min = min;
- axis.max = max;
- },
- /**
- * Bar series autoscaling in x direction.
- */
- extendXRangeIfNeededByBar: function(axis){
- if(axis.options.max == null){
- var newmax = axis.max,
- i, s, b, c,
- stackedSums = [],
- lastSerie = null;
-
- for(i = 0; i < this.series.length; ++i){
- s = this.series[i];
- b = s.bars;
- c = s.candles;
- if(s.axis == axis && (b.show || c.show)) {
- if (!b.horizontal && (b.barWidth + axis.datamax > newmax) || (c.candleWidth + axis.datamax > newmax)){
- newmax = axis.max + s.bars.barWidth;
- }
- if(b.stacked && b.horizontal){
- for (j = 0; j < s.data.length; j++) {
- if (s.bars.show && s.bars.stacked) {
- var x = s.data[j][0];
- stackedSums[x] = (stackedSums[x] || 0) + s.data[j][1];
- lastSerie = s;
- }
- }
-
- for (j = 0; j < stackedSums.length; j++) {
- newmax = Math.max(stackedSums[j], newmax);
- }
- }
- }
- }
- axis.lastSerie = lastSerie;
- axis.max = newmax;
- }
- },
- /**
- * Bar series autoscaling in y direction.
- */
- extendYRangeIfNeededByBar: function(axis){
- if(axis.options.max == null){
- var newmax = axis.max,
- i, s, b, c,
- stackedSums = [],
- lastSerie = null;
-
- for(i = 0; i < this.series.length; ++i){
- s = this.series[i];
- b = s.bars;
- c = s.candles;
- if (s.yaxis == axis && b.show && !s.hide) {
- if (b.horizontal && (b.barWidth + axis.datamax > newmax) || (c.candleWidth + axis.datamax > newmax)){
- newmax = axis.max + b.barWidth;
- }
- if(b.stacked && !b.horizontal){
- for (j = 0; j < s.data.length; j++) {
- if (s.bars.show && s.bars.stacked) {
- var x = s.data[j][0];
- stackedSums[x] = (stackedSums[x] || 0) + s.data[j][1];
- lastSerie = s;
- }
- }
-
- for (j = 0; j < stackedSums.length; j++) {
- newmax = Math.max(stackedSums[j], newmax);
- }
- }
- }
- }
- axis.lastSerie = lastSerie;
- axis.max = newmax;
- }
- },
- /**
- * Find every values of the x axes
- */
- findXAxesValues: function(){
- for(i = this.series.length-1; i > -1 ; --i){
- s = this.series[i];
- s.xaxis.values = s.xaxis.values || [];
- for (j = s.data.length-1; j > -1 ; --j){
- s.xaxis.values[s.data[j][0]] = {};
- }
- }
- },
- /**
- * Calculate axis ticks.
- * @param {Object} axis - axis object
- * @param {Object} o - axis options
- */
- calculateTicks: function(axis){
- var o = axis.options, i, v;
-
- axis.ticks = [];
- if(o.ticks){
- var ticks = o.ticks, t, label;
-
- if(Object.isFunction(ticks)){
- ticks = ticks({min: axis.min, max: axis.max});
- }
-
- // Clean up the user-supplied ticks, copy them over.
- for(i = 0; i < ticks.length; ++i){
- t = ticks[i];
- if(typeof(t) == 'object'){
- v = t[0];
- label = (t.length > 1) ? t[1] : o.tickFormatter(v);
- }else{
- v = t;
- label = o.tickFormatter(v);
- }
- axis.ticks[i] = { v: v, label: label };
- }
- }
- else {
- // Round to nearest multiple of tick size.
- var start = axis.tickSize * Math.ceil(axis.min / axis.tickSize),
- decimals;
-
- // Then store all possible ticks.
- for(i = 0; start + i * axis.tickSize <= axis.max; ++i){
- v = start + i * axis.tickSize;
-
- // Round (this is always needed to fix numerical instability).
- decimals = o.tickDecimals;
- if(decimals == null) decimals = 1 - Math.floor(Math.log(axis.tickSize) / Math.LN10);
- if(decimals < 0) decimals = 0;
-
- v = v.toFixed(decimals);
- axis.ticks.push({ v: v, label: o.tickFormatter(v) });
- }
- }
- },
- /**
- * Calculates axis label sizes.
- */
- calculateSpacing: function(){
- var a = this.axes,
- options = this.options,
- series = this.series,
- margin = options.grid.labelMargin,
- x = a.x,
- x2 = a.x2,
- y = a.y,
- y2 = a.y2,
- maxOutset = 2,
- i, j, l, dim;
-
- // Labels width and height
- [x, x2, y, y2].each(function(axis) {
- var maxLabel = '';
-
- if (axis.options.showLabels) {
- for(i = 0; i < axis.ticks.length; ++i){
- l = axis.ticks[i].label.length;
- if(l > maxLabel.length){
- maxLabel = axis.ticks[i].label;
- }
- }
- }
- axis.maxLabel = this.getTextDimensions(maxLabel, {size:options.fontSize, angle: Flotr.toRad(axis.options.labelsAngle)}, 'font-size:smaller;', 'flotr-grid-label');
- axis.titleSize = this.getTextDimensions(axis.options.title, {size: options.fontSize*1.2, angle: Flotr.toRad(axis.options.titleAngle)}, 'font-weight:bold;', 'flotr-axis-title');
- }, this);
-
- // Title height
- dim = this.getTextDimensions(options.title, {size: options.fontSize*1.5}, 'font-size:1em;font-weight:bold;', 'flotr-title');
- this.titleHeight = dim.height;
-
- // Subtitle height
- dim = this.getTextDimensions(options.subtitle, {size: options.fontSize}, 'font-size:smaller;', 'flotr-subtitle');
- this.subtitleHeight = dim.height;
-
- // Grid outline line width.
- if(options.show){
- maxOutset = Math.max(maxOutset, options.points.radius + options.points.lineWidth/2);
- }
- for(j = 0; j < options.length; ++j){
- if (series[j].points.show){
- maxOutset = Math.max(maxOutset, series[j].points.radius + series[j].points.lineWidth/2);
- }
- }
-
- var p = this.plotOffset = {left: 0, right: 0, top: 0, bottom: 0};
- p.left = p.right = p.top = p.bottom = maxOutset;
-
- p.bottom += (x.options.showLabels ? (x.maxLabel.height + margin) : 0) +
- (x.options.title ? (x.titleSize.height + margin) : 0);
-
- p.top += (x2.options.showLabels ? (x2.maxLabel.height + margin) : 0) +
- (x2.options.title ? (x2.titleSize.height + margin) : 0) + this.subtitleHeight + this.titleHeight +
- this.options.radarChartMode ? (y.options.showLabels ? (y.maxLabel.height + margin) : 0) : 0;
-
- p.left += (y.options.showLabels ? (y.maxLabel.width + margin) : 0) +
- (y.options.title ? (y.titleSize.width + margin) : 0);
-
- p.right += (y2.options.showLabels ? (y2.maxLabel.width + margin) : 0) +
- (y2.options.title ? (y2.titleSize.width + margin) : 0) +
- this.options.radarChartMode ? (x.options.showLabels ? (x.maxLabel.width + margin) : 0) : 0;
-
- p.top = Math.floor(p.top); // In order the outline not to be blured
-
- this.plotWidth = this.canvasWidth - p.left - p.right;
- this.plotHeight = this.canvasHeight - p.bottom - p.top;
-
- x.scale = this.plotWidth / (x.max - x.min);
- x2.scale = this.plotWidth / (x2.max - x2.min);
- y.scale = this.plotHeight / (y.max - y.min);
- y2.scale = this.plotHeight / (y2.max - y2.min);
- },
- /**
- * Draws grid, labels and series.
- */
- draw: function() {
- this.drawGrid();
- this.drawLabels();
- this.drawTitles();
-
- if(this.series.length){
- this.el.fire('flotr:beforedraw', [this.series, this]);
- for(var i = 0; i < this.series.length; i++){
- if (!this.series[i].hide)
- this.drawSeries(this.series[i]);
- }
- }
- this.el.fire('flotr:afterdraw', [this.series, this]);
- },
- /**
- * Translates absolute horizontal x coordinates to relative coordinates.
- * @param {Integer} x - absolute integer x coordinate
- * @return {Integer} translated relative x coordinate
- */
- tHoz: function(x, axis){
- axis = axis || this.axes.x;
- return (x - axis.min) * axis.scale;
- },
- /**
- * Translates absolute vertical x coordinates to relative coordinates.
- * @param {Integer} y - absolute integer y coordinate
- * @return {Integer} translated relative y coordinate
- */
- tVert: function(y, axis){
- axis = axis || this.axes.y;
- return this.plotHeight - (y - axis.min) * axis.scale;
- },
- /**
- * Draws a grid for the graph.
- */
- drawGrid: function(){
- if (this.options.radarChartMode) { // If we are in radar chart mode call drawRadarGrid instead and exit
- this.drawRadarGrid();
- return;
- }
- var v, o = this.options,
- ctx = this.ctx;
- if(o.grid.verticalLines || o.grid.horizontalLines){
- this.el.fire('flotr:beforegrid', [this.axes.x, this.axes.y, o, this]);
- }
- ctx.save();
- ctx.translate(this.plotOffset.left, this.plotOffset.top);
-
- // Draw grid background, if present in options.
- if(o.grid.backgroundColor != null){
- ctx.fillStyle = o.grid.backgroundColor;
- ctx.fillRect(0, 0, this.plotWidth, this.plotHeight);
- }
-
- // Draw grid lines in vertical direction.
- ctx.lineWidth = 1;
- ctx.strokeStyle = o.grid.tickColor;
- ctx.beginPath();
- if(o.grid.verticalLines){
- for(var i = 0; i < this.axes.x.ticks.length; ++i){
- v = this.axes.x.ticks[i].v;
- // Don't show lines on upper and lower bounds.
- if ((v == this.axes.x.min || v == this.axes.x.max) && o.grid.outlineWidth != 0)
- continue;
-
- ctx.moveTo(Math.floor(this.tHoz(v)) + ctx.lineWidth/2, 0);
- ctx.lineTo(Math.floor(this.tHoz(v)) + ctx.lineWidth/2, this.plotHeight);
- }
- }
-
- // Draw grid lines in horizontal direction.
- if(o.grid.horizontalLines){
- for(var j = 0; j < this.axes.y.ticks.length; ++j){
- v = this.axes.y.ticks[j].v;
- // Don't show lines on upper and lower bounds.
- if ((v == this.axes.y.min || v == this.axes.y.max) && o.grid.outlineWidth != 0)
- continue;
-
- ctx.moveTo(0, Math.floor(this.tVert(v)) + ctx.lineWidth/2);
- ctx.lineTo(this.plotWidth, Math.floor(this.tVert(v)) + ctx.lineWidth/2);
- }
- }
- ctx.stroke();
-
- // Draw axis/grid border.
- if(o.grid.outlineWidth != 0) {
- ctx.lineWidth = o.grid.outlineWidth;
- ctx.strokeStyle = o.grid.color;
- ctx.lineJoin = 'round';
- ctx.strokeRect(0, 0, this.plotWidth, this.plotHeight);
- }
- ctx.restore();
- if(o.grid.verticalLines || o.grid.horizontalLines){
- this.el.fire('flotr:aftergrid', [this.axes.x, this.axes.y, o, this]);
- }
- },
- /**
- * Draws a grid for the graph.
- */
- drawRadarGrid: function(){
-
- var v, o = this.options,
- ctx = this.ctx;
-
- var sides = this.options.radarChartSides,
- degreesInRadiansForAngle = Math.PI * 2 / sides,
- nintyDegrees = Math.PI / 2;
-
- if(o.grid.verticalLines || o.grid.horizontalLines){
- this.el.fire('flotr:beforegrid', [this.axes.x, this.axes.y, o, this]);
- }
- ctx.save();
- ctx.translate(this.plotOffset.left, this.plotOffset.top);
- ctx.lineJoin = 'round';
-
- // Draw grid background, if present in options.
- if(o.grid.backgroundColor != null){
- ctx.fillStyle = o.grid.backgroundColor;
- ctx.fillRect(0, 0, this.plotWidth, this.plotHeight);
- }
-
- // Draw grid lines
- var regPoly = {};
- regPoly.xaxis = {};
- regPoly.yaxis = {};
- regPoly.xaxis.min = regPoly.yaxis.min = this.axes.x.min;
- regPoly.xaxis.max = regPoly.yaxis.max = this.axes.x.max;
- regPoly.xaxis.scale = this.plotWidth / (this.axes.x.max - this.axes.x.min);
- regPoly.yaxis.scale = this.plotHeight / (this.axes.x.max - this.axes.x.min);
-
- ctx.lineWidth = 1;
- ctx.strokeStyle = o.grid.tickColor;
-
- if(o.grid.horizontalLines){
- for(var j = 0; j < this.axes.y.ticks.length; ++j){
- v = this.axes.y.ticks[j].v;
- if (v < 0) continue;
- // Don't show lines on upper and lower bounds.
- if ((v == this.axes.y.min || v == this.axes.y.max) && o.grid.outlineWidth != 0)
- continue;
- regPoly.data = new Array();
- for (i = 0; i < sides; i++) {
- angle = nintyDegrees + (degreesInRadiansForAngle * i);
- regPoly.data[i] = [v * Math.cos(angle), v * Math.sin(angle)]
- }
- regPoly.data[sides] = regPoly.data[0];
- this.plotLine(regPoly,0);
- }
- }
-
- // Draw axis/grid border.
- if(o.grid.outlineWidth != 0) {
- ctx.lineWidth = o.grid.outlineWidth;
- ctx.strokeStyle = o.grid.color;
- regPoly.data = new Array();
- var radius = this.axes.x.max;
- for (i = 0; i < sides; i++) {
- angle = nintyDegrees + (degreesInRadiansForAngle * i);
- regPoly.data[i] = [radius * Math.cos(angle), radius * Math.sin(angle)]
- }
- regPoly.data[sides] = regPoly.data[0];
- this.plotLine(regPoly,0);
- }
-
- ctx.lineWidth = 1;
- ctx.strokeStyle = o.grid.tickColor;
- ctx.beginPath();
-
- if(o.grid.verticalLines){
- for(var i = 0; i < sides; ++i){
- ctx.moveTo(Math.floor(this.tHoz(0)) + ctx.lineWidth/2,
- Math.floor(this.tVert(0)) + ctx.lineWidth/2);
- ctx.lineTo(Math.floor(this.tHoz(regPoly.data[i][0])) + ctx.lineWidth/2,
- Math.floor(this.tVert(regPoly.data[i][1])) + ctx.lineWidth/2);
- }
- }
-
- ctx.stroke();
-
- ctx.restore();
- if(o.grid.verticalLines || o.grid.horizontalLines){
- this.el.fire('flotr:aftergrid', [this.axes.x, this.axes.y, o, this]);
- }
- },
- /**
- * Draws labels aroung radar chart
- */
- drawRadarLabels:function(){
- var ctx = this.ctx,
- options = this.options,
- axis = this.axes.x,
- tick, minY = 0, maxY = 0,
- xOffset, yOffset;
- var style = {
- size: options.fontSize,
- adjustAlign: true
- };
- style.color = axis.options.color || options.grid.color;
- style.angle = Flotr.toRad(axis.options.labelsAngle);
- var radius = axis.max * 1,
- closeTo = axis.max * 0.1,
- sides = this.options.radarChartSides,
- degreesInRadiansForAngle = Math.PI * 2 / sides,
- nintyDegrees = Math.PI / 2,
- posdata = new Array();
- for (i = 0; i < sides; i++) {
- angle = nintyDegrees + (degreesInRadiansForAngle * i);
- posdata[i] = [radius * Math.cos(angle), radius * Math.sin(angle)];
- if (minY > posdata[i][1]) minY = posdata[i][1];
- if (maxY < posdata[i][1]) maxY = posdata[i][1];
- }
- for (i = 0; i < sides; i++) {
- tick = axis.ticks[i];
- if(!tick.label || tick.label.length == 0) continue;
- yOffset = 0;
- if (posdata[i][0] > 0) {
- style.halign = 'l';
- xOffset = options.grid.labelMargin;
- } else {
- style.halign = 'r';
- xOffset = - options.grid.labelMargin;
- }
- style.valign = 'm';
-
- if ((posdata[i][1] + closeTo) >= minY && (posdata[i][1] - closeTo) <= minY) {
- style.valign = 't' ;
- style.halign = 'c';
- yOffset = options.grid.labelMargin;
- };
- if (posdata[i][1] == maxY) {
- style.valign = 'b' ;
- style.halign = 'c';
- yOffset = - options.grid.labelMargin;
- }
- ctx.drawText(
- tick.label,
- this.plotOffset.left + this.tHoz(posdata[i][0]) + xOffset,
- this.plotOffset.top + this.tVert(posdata[i][1]) + yOffset,
- style
- );
- }
-
- },
- /**
- * Draws labels for x and y axis.
- */
- drawLabels: function(){
- // Construct fixed width label boxes, which can be styled easily.
- var noLabels = 0, axis,
- xBoxWidth, i, html, tick,
- options = this.options,
- ctx = this.ctx,
- a = this.axes;
-
- for(i = 0; i < a.x.ticks.length; ++i){
- if (a.x.ticks[i].label) {
- ++noLabels;
- }
- }
- xBoxWidth = this.plotWidth / noLabels;
-
- if (!options.HtmlText && this.textEnabled) {
- var style = {
- size: options.fontSize,
- adjustAlign: true
- };
-
- // Add x labels.
- if (options.radarChartMode) {
- this.drawRadarLabels();} else {
- axis = a.x;
- style.color = axis.options.color || options.grid.color;
- for(i = 0; i < axis.ticks.length && axis.options.showLabels && axis.used; ++i){
- tick = axis.ticks[i];
- if(!tick.label || tick.label.length == 0) continue;
-
- style.angle = Flotr.toRad(axis.options.labelsAngle);
- style.halign = 'c';
- style.valign = 't';
-
- ctx.drawText(
- tick.label,
- this.plotOffset.left + this.tHoz(tick.v, axis),
- this.plotOffset.top + this.plotHeight + options.grid.labelMargin,
- style
- );
- }}
-
- // Add x2 labels.
- axis = a.x2;
- style.color = axis.options.color || options.grid.color;
- for(i = 0; i < axis.ticks.length && axis.options.showLabels && axis.used; ++i){
- tick = axis.ticks[i];
- if(!tick.label || tick.label.length == 0) continue;
-
- style.angle = Flotr.toRad(axis.options.labelsAngle);
- style.halign = 'c';
- style.valign = 'b';
-
- ctx.drawText(
- tick.label,
- this.plotOffset.left + this.tHoz(tick.v, axis),
- this.plotOffset.top + options.grid.labelMargin,
- style
- );
- }
-
- // Add y labels.
- axis = a.y;
- style.color = axis.options.color || options.grid.color;
- for(i = 0; i < axis.ticks.length && axis.options.showLabels && axis.used; ++i){
- tick = axis.ticks[i];
- if (!tick.label || tick.label.length == 0 || (tick.v < 0 && this.options.radarChartMode)) continue;
-
- style.angle = Flotr.toRad(axis.options.labelsAngle);
- style.halign = 'r';
- style.valign = 'm';
-
- ctx.drawText(
- tick.label,
- this.plotOffset.left + (this.options.radarChartMode ? this.tHoz(0) : 0) - options.grid.labelMargin,
- this.plotOffset.top + this.tVert(tick.v, axis),
- style
- );
- }
-
- // Add y2 labels.
- axis = a.y2;
- style.color = axis.options.color || options.grid.color;
- for(i = 0; i < axis.ticks.length && axis.options.showLabels && axis.used; ++i){
- tick = axis.ticks[i];
- if (!tick.label || tick.label.length == 0) continue;
-
- style.angle = Flotr.toRad(axis.options.labelsAngle);
- style.halign = 'l';
- style.valign = 'm';
-
- ctx.drawText(
- tick.label,
- this.plotOffset.left + this.plotWidth + options.grid.labelMargin,
- this.plotOffset.top + this.tVert(tick.v, axis),
- style
- );
-
- ctx.save();
- ctx.strokeStyle = style.color;
- ctx.beginPath();
- ctx.moveTo(this.plotOffset.left + this.plotWidth - 8, this.plotOffset.top + this.tVert(tick.v, axis));
- ctx.lineTo(this.plotOffset.left + this.plotWidth, this.plotOffset.top + this.tVert(tick.v, axis));
- ctx.stroke();
- ctx.restore();
- }
- }
- else if (a.x.options.showLabels ||
- a.x2.options.showLabels ||
- a.y.options.showLabels ||
- a.y2.options.showLabels) {
- html = ['<div style="font-size:smaller;color:' + options.grid.color + ';" class="flotr-labels">'];
-
- // Add x labels.
- axis = a.x;
- if (axis.options.showLabels){
- for(i = 0; i < axis.ticks.length; ++i){
- tick = axis.ticks[i];
- if(!tick.label || tick.label.length == 0) continue;
- html.push('<div style="position:absolute;top:' + (this.plotOffset.top + this.plotHeight + options.grid.labelMargin) + 'px;left:' + (this.plotOffset.left + this.tHoz(tick.v, axis) - xBoxWidth/2) + 'px;width:' + xBoxWidth + 'px;text-align:center;'+(axis.options.color?('color:'+axis.options.color+';'):'')+'" class="flotr-grid-label">' + tick.label + '</div>');
- }
- }
-
- // Add x2 labels.
- axis = a.x2;
- if (axis.options.showLabels && axis.used){
- for(i = 0; i < axis.ticks.length; ++i){
- tick = axis.ticks[i];
- if(!tick.label || tick.label.length == 0) continue;
- html.push('<div style="position:absolute;top:' + (this.plotOffset.top - options.grid.labelMargin - axis.maxLabel.height) + 'px;left:' + (this.plotOffset.left + this.tHoz(tick.v, axis) - xBoxWidth/2) + 'px;width:' + xBoxWidth + 'px;text-align:center;'+(axis.options.color?('color:'+axis.options.color+';'):'')+'" class="flotr-grid-label">' + tick.label + '</div>');
- }
- }
-
- // Add y labels.
- axis = a.y;
- if (axis.options.showLabels){
- for(i = 0; i < axis.ticks.length; ++i){
- tick = axis.ticks[i];
- if (!tick.label || tick.label.length == 0) continue;
- html.push('<div style="position:absolute;top:' + (this.plotOffset.top + this.tVert(tick.v, axis) - axis.maxLabel.height/2) + 'px;left:0;width:' + (this.plotOffset.left - options.grid.labelMargin) + 'px;text-align:right;'+(axis.options.color?('color:'+axis.options.color+';'):'')+'" class="flotr-grid-label">' + tick.label + '</div>');
- }
- }
-
- // Add y2 labels.
- axis = a.y2;
- if (axis.options.showLabels && axis.used){
- ctx.save();
- ctx.strokeStyle = axis.options.color || options.grid.color;
- ctx.beginPath();
-
- for(i = 0; i < axis.ticks.length; ++i){
- tick = axis.ticks[i];
- if (!tick.label || tick.label.length == 0) continue;
- html.push('<div style="position:absolute;top:' + (this.plotOffset.top + this.tVert(tick.v, axis) - axis.maxLabel.height/2) + 'px;right:0;width:' + (this.plotOffset.right - options.grid.labelMargin) + 'px;text-align:left;'+(axis.options.color?('color:'+axis.options.color+';'):'')+'" class="flotr-grid-label">' + tick.label + '</div>');
-
- ctx.moveTo(this.plotOffset.left + this.plotWidth - 8, this.plotOffset.top + this.tVert(tick.v, axis));
- ctx.lineTo(this.plotOffset.left + this.plotWidth, this.plotOffset.top + this.tVert(tick.v, axis));
- }
- ctx.stroke();
- ctx.restore();
- }
-
- html.push('</div>');
- this.el.insert(html.join(''));
- }
- },
- /**
- * Draws the title and the subtitle
- */
- drawTitles: function(){
- var html,
- options = this.options,
- margin = options.grid.labelMargin,
- ctx = this.ctx,
- a = this.axes;
-
- if (!options.HtmlText && this.textEnabled) {
- var style = {
- size: options.fontSize,
- color: options.grid.color,
- halign: 'c'
- };
-
- // Add subtitle
- if (options.subtitle){
- ctx.drawText(
- options.subtitle,
- this.plotOffset.left + this.plotWidth/2,
- this.titleHeight + this.subtitleHeight - 2,
- style
- );
- }
-
- style.weight = 1.5;
- style.size *= 1.5;
-
- // Add title
- if (options.title){
- ctx.drawText(
- options.title,
- this.plotOffset.left + this.plotWidth/2,
- this.titleHeight - 2,
- style
- );
- }
-
- style.weight = 1.8;
- style.size *= 0.8;
- style.adjustAlign = true;
-
- // Add x axis title
- if (a.x.options.title && a.x.used){
- style.halign = 'c';
- style.valign = 't';
- style.angle = Flotr.toRad(a.x.options.titleAngle);
- ctx.drawText(
- a.x.options.title,
- this.plotOffset.left + this.plotWidth/2,
- this.plotOffset.top + a.x.maxLabel.height + this.plotHeight + 2 * margin,
- style
- );
- }
-
- // Add x2 axis title
- if (a.x2.options.title && a.x2.used){
- style.halign = 'c';
- style.valign = 'b';
- style.angle = Flotr.toRad(a.x2.options.titleAngle);
- ctx.drawText(
- a.x2.options.title,
- this.plotOffset.left + this.plotWidth/2,
- this.plotOffset.top - a.x2.maxLabel.height - 2 * margin,
- style
- );
- }
-
- // Add y axis title
- if (a.y.options.title && a.y.used){
- style.halign = 'r';
- style.valign = 'm';
- style.angle = Flotr.toRad(a.y.options.titleAngle);
- ctx.drawText(
- a.y.options.title,
- this.plotOffset.left - a.y.maxLabel.width - 2 * margin,
- this.plotOffset.top + this.plotHeight / 2,
- style
- );
- }
-
- // Add y2 axis title
- if (a.y2.options.title && a.y2.used){
- style.halign = 'l';
- style.valign = 'm';
- style.angle = Flotr.toRad(a.y2.options.titleAngle);
- ctx.drawText(
- a.y2.options.title,
- this.plotOffset.left + this.plotWidth + a.y2.maxLabel.width + 2 * margin,
- this.plotOffset.top + this.plotHeight / 2,
- style
- );
- }
- }
- else {
- html = ['<div style="color:'+options.grid.color+';" class="flotr-titles">'];
-
- // Add title
- if (options.title){
- html.push('<div style="position:absolute;top:0;left:'+this.plotOffset.left+'px;font-size:1em;font-weight:bold;text-align:center;width:'+this.plotWidth+'px;" class="flotr-title">'+options.title+'</div>');
- }
-
- // Add subtitle
- if (options.subtitle){
- html.push('<div style="position:absolute;top:'+this.titleHeight+'px;left:'+this.plotOffset.left+'px;font-size:smaller;text-align:center;width:'+this.plotWidth+'px;" class="flotr-subtitle">'+options.subtitle+'</div>');
- }
- html.push('</div>');
-
-
- html.push('<div class="flotr-axis-title" style="font-weight:bold;">');
- // Add x axis title
- if (a.x.options.title && a.x.used){
- html.push('<div style="position:absolute;top:' + (this.plotOffset.top + this.plotHeight + options.grid.labelMargin + a.x.titleSize.height) + 'px;left:' + this.plotOffset.left + 'px;width:' + this.plotWidth + 'px;text-align:center;" class="flotr-axis-title">' + a.x.options.title + '</div>');
- }
-
- // Add x2 axis title
- if (a.x2.options.title && a.x2.used){
- html.push('<div style="position:absolute;top:0;left:' + this.plotOffset.left + 'px;width:' + this.plotWidth + 'px;text-align:center;" class="flotr-axis-title">' + a.x2.options.title + '</div>');
- }
-
- // Add y axis title
- if (a.y.options.title && a.y.used){
- html.push('<div style="position:absolute;top:' + (this.plotOffset.top + this.plotHeight/2 - a.y.titleSize.height/2) + 'px;left:0;text-align:right;" class="flotr-axis-title">' + a.y.options.title + '</div>');
- }
-
- // Add y2 axis title
- if (a.y2.options.title && a.y2.used){
- html.push('<div style="position:absolute;top:' + (this.plotOffset.top + this.plotHeight/2 - a.y.titleSize.height/2) + 'px;right:0;text-align:right;" class="flotr-axis-title">' + a.y2.options.title + '</div>');
- }
- html.push('</div>');
-
- this.el.insert(html.join(''));
- }
- },
- /**
- * Actually draws the graph.
- * @param {Object} series - series to draw
- */
- drawSeries: function(series){
- series = series || this.series;
-
- var drawn = false;
- for(var type in Flotr._registeredTypes){
- if(series[type] && series[type].show){
- this[Flotr._registeredTypes[type]](series);
- drawn = true;
- }
- }
-
- if(!drawn){
- this[Flotr._registeredTypes[this.options.defaultType]](series);
- }
- },
-
- plotLine: function(series, offset){
- var ctx = this.ctx,
- xa = series.xaxis,
- ya = series.yaxis,
- tHoz = this.tHoz.bind(this),
- tVert = this.tVert.bind(this),
- data = series.data;
-
- if(data.length < 2) return;
-
- var prevx = tHoz(data[0][0], xa),
- prevy = tVert(data[0][1], ya) + offset;
- ctx.beginPath();
- ctx.moveTo(prevx, prevy);
- for(var i = 0; i < data.length - 1; ++i){
- var x1 = data[i][0], y1 = data[i][1],
- x2 = data[i+1][0], y2 = data[i+1][1];
-
- // To allow empty values
- if (y1 === null || y2 === null) continue;
-
- /**
- * Clip with ymin.
- */
- if(y1 <= y2 && y1 < ya.min){
- /**
- * Line segment is outside the drawing area.
- */
- if(y2 < ya.min) continue;
-
- /**
- * Compute new intersection point.
- */
- x1 = (ya.min - y1) / (y2 - y1) * (x2 - x1) + x1;
- y1 = ya.min;
- }else if(y2 <= y1 && y2 < ya.min){
- if(y1 < ya.min) continue;
- x2 = (ya.min - y1) / (y2 - y1) * (x2 - x1) + x1;
- y2 = ya.min;
- }
-
- /**
- * Clip with ymax.
- */
- if(y1 >= y2 && y1 > ya.max) {
- if(y2 > ya.max) continue;
- x1 = (ya.max - y1) / (y2 - y1) * (x2 - x1) + x1;
- y1 = ya.max;
- }
- else if(y2 >= y1 && y2 > ya.max){
- if(y1 > ya.max) continue;
- x2 = (ya.max - y1) / (y2 - y1) * (x2 - x1) + x1;
- y2 = ya.max;
- }
-
- /**
- * Clip with xmin.
- */
- if(x1 <= x2 && x1 < xa.min){
- if(x2 < xa.min) continue;
- y1 = (xa.min - x1) / (x2 - x1) * (y2 - y1) + y1;
- x1 = xa.min;
- }else if(x2 <= x1 && x2 < xa.min){
- if(x1 < xa.min) continue;
- y2 = (xa.min - x1) / (x2 - x1) * (y2 - y1) + y1;
- x2 = xa.min;
- }
-
- /**
- * Clip with xmax.
- */
- if(x1 >= x2 && x1 > xa.max){
- if (x2 > xa.max) continue;
- y1 = (xa.max - x1) / (x2 - x1) * (y2 - y1) + y1;
- x1 = xa.max;
- }else if(x2 >= x1 && x2 > xa.max){
- if(x1 > xa.max) continue;
- y2 = (xa.max - x1) / (x2 - x1) * (y2 - y1) + y1;
- x2 = xa.max;
- }
-
- if(prevx != tHoz(x1, xa) || prevy != tVert(y1, ya) + offset)
- ctx.moveTo(tHoz(x1, xa), tVert(y1, ya) + offset);
-
- prevx = tHoz(x2, xa);
- prevy = tVert(y2, ya) + offset;
- ctx.lineTo(prevx, prevy);
- }
- ctx.stroke();
- },
- /**
- * Function used to fill
- * @param {Object} data
- */
- plotLineArea: function(series, offset){
- var data = series.data;
- if(data.length < 2) return;
-
- var top, lastX = 0,
- ctx = this.ctx,
- xa = series.xaxis,
- ya = series.yaxis,
- tHoz = this.tHoz.bind(this),
- tVert = this.tVert.bind(this),
- bottom = Math.min(Math.max(0, ya.min), ya.max),
- first = true;
-
- ctx.beginPath();
- for(var i = 0; i < data.length - 1; ++i){
-
- var x1 = data[i][0], y1 = data[i][1],
- x2 = data[i+1][0], y2 = data[i+1][1];
-
- if(x1 <= x2 && x1 < xa.min){
- if(x2 < xa.min) continue;
- y1 = (xa.min - x1) / (x2 - x1) * (y2 - y1) + y1;
- x1 = xa.min;
- }else if(x2 <= x1 && x2 < xa.min){
- if(x1 < xa.min) continue;
- y2 = (xa.min - x1) / (x2 - x1) * (y2 - y1) + y1;
- x2 = xa.min;
- }
-
- if(x1 >= x2 && x1 > xa.max){
- if(x2 > xa.max) continue;
- y1 = (xa.max - x1) / (x2 - x1) * (y2 - y1) + y1;
- x1 = xa.max;
- }else if(x2 >= x1 && x2 > xa.max){
- if (x1 > xa.max) continue;
- y2 = (xa.max - x1) / (x2 - x1) * (y2 - y1) + y1;
- x2 = xa.max;
- }
-
- if(first){
- ctx.moveTo(tHoz(x1, xa), tVert(bottom, ya) + offset);
- first = false;
- }
-
- /**
- * Now check the case where both is outside.
- */
- if(y1 >= ya.max && y2 >= ya.max){
- ctx.lineTo(tHoz(x1, xa), tVert(ya.max, ya) + offset);
- ctx.lineTo(tHoz(x2, xa), tVert(ya.max, ya) + offset);
- continue;
- }else if(y1 <= ya.min && y2 <= ya.min){
- ctx.lineTo(tHoz(x1, xa), tVert(ya.min, ya) + offset);
- ctx.lineTo(tHoz(x2, xa), tVert(ya.min, ya) + offset);
- continue;
- }
-
- /**
- * Else it's a bit more complicated, there might
- * be two rectangles and two triangles we need to fill
- * in; to find these keep track of the current x values.
- */
- var x1old = x1, x2old = x2;
-
- /**
- * And clip the y values, without shortcutting.
- * Clip with ymin.
- */
- if(y1 <= y2 && y1 < ya.min && y2 >= ya.min){
- x1 = (ya.min - y1) / (y2 - y1) * (x2 - x1) + x1;
- y1 = ya.min;
- }else if(y2 <= y1 && y2 < ya.min && y1 >= ya.min){
- x2 = (ya.min - y1) / (y2 - y1) * (x2 - x1) + x1;
- y2 = ya.min;
- }
-
- /**
- * Clip with ymax.
- */
- if(y1 >= y2 && y1 > ya.max && y2 <= ya.max){
- x1 = (ya.max - y1) / (y2 - y1) * (x2 - x1) + x1;
- y1 = ya.max;
- }else if(y2 >= y1 && y2 > ya.max && y1 <= ya.max){
- x2 = (ya.max - y1) / (y2 - y1) * (x2 - x1) + x1;
- y2 = ya.max;
- }
-
- /**
- * If the x value was changed we got a rectangle to fill.
- */
- if(x1 != x1old){
- top = (y1 <= ya.min) ? top = ya.min : ya.max;
- ctx.lineTo(tHoz(x1old, xa), tVert(top, ya) + offset);
- ctx.lineTo(tHoz(x1, xa), tVert(top, ya) + offset);
- }
-
- /**
- * Fill the triangles.
- */
- ctx.lineTo(tHoz(x1, xa), tVert(y1, ya) + offset);
- ctx.lineTo(tHoz(x2, xa), tVert(y2, ya) + offset);
-
- /**
- * Fill the other rectangle if it's there.
- */
- if(x2 != x2old){
- top = (y2 <= ya.min) ? ya.min : ya.max;
- ctx.lineTo(tHoz(x2old, xa), tVert(top, ya) + offset);
- ctx.lineTo(tHoz(x2, xa), tVert(top, ya) + offset);
- }
-
- lastX = Math.max(x2, x2old);
- }
-
- ctx.lineTo(tHoz(lastX, xa), tVert(bottom, ya) + offset);
- ctx.closePath();
- ctx.fill();
- },
- /**
- * Function: (private) drawSeriesLines
- *
- * Function draws lines series in the canvas element.
- *
- * Parameters:
- * series - Series with options.lines.show = true.
- *
- * Returns:
- * void
- */
- drawSeriesLines: function(series){
- series = series || this.series;
- var ctx = this.ctx;
- ctx.save();
- ctx.translate(this.plotOffset.left, this.plotOffset.top);
- ctx.lineJoin = 'round';
-
- var lw = series.lines.lineWidth;
- var sw = series.shadowSize;
-
- if(sw > 0){
- ctx.lineWidth = sw / 2;
-
- var offset = lw/2 + ctx.lineWidth/2;
-
- ctx.strokeStyle = "rgba(0,0,0,0.1)";
- this.plotLine(series, offset + sw/2);
-
- ctx.strokeStyle = "rgba(0,0,0,0.2)";
- this.plotLine(series, offset);
-
- if(series.lines.fill) {
- ctx.fillStyle = "rgba(0,0,0,0.05)";
- this.plotLineArea(series, offset + sw/2);
- }
- }
-
- ctx.lineWidth = lw;
- ctx.strokeStyle = series.color;
- if(series.lines.fill){
- ctx.fillStyle = series.lines.fillColor != null ? series.lines.fillColor : Flotr.parseColor(series.color).scale(null, null, null, series.lines.fillOpacity).toString();
- this.plotLineArea(series, 0);
- }
-
- this.plotLine(series, 0);
- ctx.restore();
- },
- /**
- * Function: drawSeriesPoints
- *
- * Function draws point series in the canvas element.
- *
- * Parameters:
- * series - Series with options.points.show = true.
- *
- * Returns:
- * void
- */
- drawSeriesPoints: function(series) {
- var ctx = this.ctx;
-
- ctx.save();
- ctx.translate(this.plotOffset.left, this.plotOffset.top);
-
- var lw = series.lines.lineWidth;
- var sw = series.shadowSize;
-
- if(sw > 0){
- ctx.lineWidth = sw / 2;
-
- ctx.strokeStyle = 'rgba(0,0,0,0.1)';
- this.plotPointShadows(series, sw/2 + ctx.lineWidth/2, series.points.radius);
-
- ctx.strokeStyle = 'rgba(0,0,0,0.2)';
- this.plotPointShadows(series, ctx.lineWidth/2, series.points.radius);
- }
-
- ctx.lineWidth = series.points.lineWidth;
- ctx.strokeStyle = series.color;
- ctx.fillStyle = series.points.fillColor != null ? series.points.fillColor : series.color;
- this.plotPoints(series, series.points.radius, series.points.fill);
- ctx.restore();
- },
- plotPoints: function (series, radius, fill) {
- var xa = series.xaxis,
- ya = series.yaxis,
- ctx = this.ctx, i,
- data = series.data;
-
- for(i = data.length - 1; i > -1; --i){
- var x = data[i][0], y = data[i][1];
- if(x < xa.min || x > xa.max || y < ya.min || y > ya.max)
- continue;
-
- ctx.beginPath();
- ctx.arc(this.tHoz(x, xa), this.tVert(y, ya), radius, 0, 2 * Math.PI, true);
- if(fill) ctx.fill();
- ctx.stroke();
- }
- },
- plotPointShadows: function(series, offset, radius){
- var xa = series.xaxis,
- ya = series.yaxis,
- ctx = this.ctx, i,
- data = series.data;
-
- for(i = data.length - 1; i > -1; --i){
- var x = data[i][0], y = data[i][1];
- if (x < xa.min || x > xa.max || y < ya.min || y > ya.max)
- continue;
- ctx.beginPath();
- ctx.arc(this.tHoz(x, xa), this.tVert(y, ya) + offset, radius, 0, Math.PI, false);
- ctx.stroke();
- }
- },
- /**
- * Function: drawSeriesBars
- *
- * Function draws bar series in the canvas element.
- *
- * Parameters:
- * series - Series with options.bars.show = true.
- *
- * Returns:
- * void
- */
- drawSeriesBars: function(series) {
- var ctx = this.ctx,
- bw = series.bars.barWidth,
- lw = Math.min(series.bars.lineWidth, bw);
-
- ctx.save();
- ctx.translate(this.plotOffset.left, this.plotOffset.top);
- ctx.lineJoin = 'miter';
-
- /**
- * @todo linewidth not interpreted the right way.
- */
- ctx.lineWidth = lw;
- ctx.strokeStyle = series.color;
-
- this.plotBarsShadows(series, bw, 0, series.bars.fill);
-
- if(series.bars.fill){
- ctx.fillStyle = series.bars.fillColor != null ? series.bars.fillColor : Flotr.parseColor(series.color).scale(null, null, null, series.bars.fillOpacity).toString();
- }
-
- this.plotBars(series, bw, 0, series.bars.fill);
- ctx.restore();
- },
- plotBars: function(series, barWidth, offset, fill){
- var data = series.data;
- if(data.length < 1) return;
-
- var xa = series.xaxis,
- ya = series.yaxis,
- ctx = this.ctx,
- tHoz = this.tHoz.bind(this),
- tVert = this.tVert.bind(this);
-
- for(var i = 0; i < data.length; i++){
- var x = data[i][0],
- y = data[i][1];
- var drawLeft = true, drawTop = true, drawRight = true;
-
- // Stacked bars
- var stackOffset = 0;
- if(series.bars.stacked) {
- xa.values.each(function(o, v) {
- if (v == x) {
- stackOffset = o.stack || 0;
- o.stack = stackOffset + y;
- }
- });
- }
-
- // @todo: fix horizontal bars support
- // Horizontal bars
- if(series.bars.horizontal)
- var left = stackOffset, right = x + stackOffset, bottom = y, top = y + barWidth;
- else
- var left = x, right = x + barWidth, bottom = stackOffset, top = y + stackOffset;
-
- if(right < xa.min || left > xa.max || top < ya.min || bottom > ya.max)
- continue;
-
- if(left < xa.min){
- left = xa.min;
- drawLeft = false;
- }
-
- if(right > xa.max){
- right = xa.max;
- if (xa.lastSerie != series && series.bars.horizontal)
- drawTop = false;
- }
-
- if(bottom < ya.min)
- bottom = ya.min;
-
- if(top > ya.max){
- top = ya.max;
- if (ya.lastSerie != series && !series.bars.horizontal)
- drawTop = false;
- }
-
- /**
- * Fill the bar.
- */
- if(fill){
- ctx.beginPath();
- ctx.moveTo(tHoz(left, xa), tVert(bottom, ya) + offset);
- ctx.lineTo(tHoz(left, xa), tVert(top, ya) + offset);
- ctx.lineTo(tHoz(right, xa), tVert(top, ya) + offset);
- ctx.lineTo(tHoz(right, xa), tVert(bottom, ya) + offset);
- ctx.fill();
- }
-
- /**
- * Draw bar outline/border.
- */
- if(series.bars.lineWidth != 0 && (drawLeft || drawRight || drawTop)){
- ctx.beginPath();
- ctx.moveTo(tHoz(left, xa), tVert(bottom, ya) + offset);
-
- ctx[drawLeft ?'lineTo':'moveTo'](tHoz(left, xa), tVert(top, ya) + offset);
- ctx[drawTop ?'lineTo':'moveTo'](tHoz(right, xa), tVert(top, ya) + offset);
- ctx[drawRight?'lineTo':'moveTo'](tHoz(right, xa), tVert(bottom, ya) + offset);
-
- ctx.stroke();
- }
- }
- },
- plotBarsShadows: function(series, barWidth, offset){
- var data = series.data;
- if(data.length < 1) return;
-
- var xa = series.xaxis,
- ya = series.yaxis,
- ctx = this.ctx,
- tHoz = this.tHoz.bind(this),
- tVert = this.tVert.bind(this),
- sw = this.options.shadowSize;
-
- for(var i = 0; i < data.length; i++){
- var x = data[i][0],
- y = data[i][1];
-
- // Stacked bars
- var stackOffset = 0;
- if(series.bars.stacked) {
- xa.values.each(function(o, v) {
- if (v == x) {
- stackOffset = o.stackShadow || 0;
- o.stackShadow = stackOffset + y;
- }
- });
- }
-
- // Horizontal bars
- if(series.bars.horizontal)
- var left = stackOffset, right = x + stackOffset, bottom = y, top = y + barWidth;
- else
- var left = x, right = x + barWidth, bottom = stackOffset, top = y + stackOffset;
-
- if(right < xa.min || left > xa.max || top < ya.min || bottom > ya.max)
- continue;
-
- if(left < xa.min) left = xa.min;
- if(right > xa.max) right = xa.max;
- if(bottom < ya.min) bottom = ya.min;
- if(top > ya.max) top = ya.max;
-
- var width = tHoz(right, xa)-tHoz(left, xa)-((tHoz(right, xa)+sw <= this.plotWidth) ? 0 : sw);
- var height = Math.max(0, tVert(bottom, ya)-tVert(top, ya)-((tVert(bottom, ya)+sw <= this.plotHeight) ? 0 : sw));
-
- ctx.fillStyle = 'rgba(0,0,0,0.05)';
- ctx.fillRect(Math.min(tHoz(left, xa)+sw, this.plotWidth), Math.min(tVert(top, ya)+sw, this.plotWidth), width, height);
- }
- },
- /**
- * Function: drawSeriesCandles
- *
- * Function draws candles series in the canvas element.
- *
- * Parameters:
- * series - Series with options.candles.show = true.
- *
- * Returns:
- * void
- */
- drawSeriesCandles: function(series) {
- var ctx = this.ctx,
- bw = series.candles.candleWidth;
-
- ctx.save();
- ctx.translate(this.plotOffset.left, this.plotOffset.top);
- ctx.lineJoin = 'miter';
-
- /**
- * @todo linewidth not interpreted the right way.
- */
- ctx.lineWidth = series.candles.lineWidth;
- this.plotCandlesShadows(series, bw/2);
- this.plotCandles(series, bw/2);
-
- ctx.restore();
- },
- plotCandles: function(series, offset){
- var data = series.data;
- if(data.length < 1) return;
-
- var xa = series.xaxis,
- ya = series.yaxis,
- ctx = this.ctx,
- tHoz = this.tHoz.bind(this),
- tVert = this.tVert.bind(this);
-
- for(var i = 0; i < data.length; i++){
- var d = data[i],
- x = d[0],
- open = d[1],
- high = d[2],
- low = d[3],
- close = d[4];
-
- var left = x,
- right = x + series.candles.candleWidth,
- bottom = Math.max(ya.min, low),
- top = Math.min(ya.max, high),
- bottom2 = Math.max(ya.min, Math.min(open, close)),
- top2 = Math.min(ya.max, Math.max(open, close));
-
- if(right < xa.min || left > xa.max || top < ya.min || bottom > ya.max)
- continue;
-
- var color = series.candles[open>close?'downFillColor':'upFillColor'];
- /**
- * Fill the candle.
- */
- if(series.candles.fill && !series.candles.barcharts){
- ctx.fillStyle = Flotr.parseColor(color).scale(null, null, null, series.candles.fillOpacity).toString();
- ctx.fillRect(tHoz(left, xa), tVert(top2, ya) + offset, tHoz(right, xa) - tHoz(left, xa), tVert(bottom2, ya) - tVert(top2, ya));
- }
-
- /**
- * Draw candle outline/border, high, low.
- */
- if(series.candles.lineWidth || series.candles.wickLineWidth){
- var x, y, pixelOffset = (series.candles.wickLineWidth % 2) / 2;
-
- x = Math.floor(tHoz((left + right) / 2), xa) + pixelOffset;
-
- ctx.save();
- ctx.strokeStyle = color;
- ctx.lineWidth = series.candles.wickLineWidth;
- ctx.lineCap = 'butt';
-
- if (series.candles.barcharts) {
- ctx.beginPath();
-
- ctx.moveTo(x, Math.floor(tVert(top, ya) + offset));
- ctx.lineTo(x, Math.floor(tVert(bottom, ya) + offset));
-
- y = Math.floor(tVert(open, ya) + offset)+0.5;
- ctx.moveTo(Math.floor(tHoz(left, xa))+pixelOffset, y);
- ctx.lineTo(x, y);
-
- y = Math.floor(tVert(close, ya) + offset)+0.5;
- ctx.moveTo(Math.floor(tHoz(right, xa))+pixelOffset, y);
- ctx.lineTo(x, y);
- }
- else {
- ctx.strokeRect(tHoz(left, xa), tVert(top2, ya) + offset, tHoz(right, xa) - tHoz(left, xa), tVert(bottom2, ya) - tVert(top2, ya));
-
- ctx.beginPath();
- ctx.moveTo(x, Math.floor(tVert(top2, ya) + offset));
- ctx.lineTo(x, Math.floor(tVert(top, ya) + offset));
- ctx.moveTo(x, Math.floor(tVert(bottom2, ya) + offset));
- ctx.lineTo(x, Math.floor(tVert(bottom, ya) + offset));
- }
-
- ctx.stroke();
- ctx.restore();
- }
- }
- },
- plotCandlesShadows: function(series, offset){
- var data = series.data;
- if(data.length < 1 || series.candles.barcharts) return;
-
- var xa = series.xaxis,
- ya = series.yaxis,
- tHoz = this.tHoz.bind(this),
- tVert = this.tVert.bind(this),
- sw = this.options.shadowSize;
-
- for(var i = 0; i < data.length; i++){
- var d = data[i],
- x = d[0],
- open = d[1],
- high = d[2],
- low = d[3],
- close = d[4];
-
- var left = x,
- right = x + series.candles.candleWidth,
- bottom = Math.max(ya.min, Math.min(open, close)),
- top = Math.min(ya.max, Math.max(open, close));
-
- if(right < xa.min || left > xa.max || top < ya.min || bottom > ya.max)
- continue;
-
- var width = tHoz(right, xa)-tHoz(left, xa)-((tHoz(right, xa)+sw <= this.plotWidth) ? 0 : sw);
- var height = Math.max(0, tVert(bottom, ya)-tVert(top, ya)-((tVert(bottom, ya)+sw <= this.plotHeight) ? 0 : sw));
-
- this.ctx.fillStyle = 'rgba(0,0,0,0.05)';
- this.ctx.fillRect(Math.min(tHoz(left, xa)+sw, this.plotWidth), Math.min(tVert(top, ya)+sw, this.plotWidth), width, height);
- }
- },
- /**
- * Function: drawSeriesRadar
- *
- * Function draws a radar chart on the canvas element.
- *
- * Parameters:
- * series - Series with options.radar.show = true.
- *
- * Returns:
- * void
- */
- drawSeriesRadar: function(series) {
- var ctx = this.ctx,
- options = this.options, sides= series.data.length;
-
- var degreesInRadiansForAngle = Math.PI * 2 / sides,
- nintyDegrees = Math.PI / 2;
-
- var poly = {};
-
- /*
- Draw radar grid
-
- poly.xaxis = series.xaxis;
- poly.yaxis = series.yaxis;
- ctx.save();
- ctx.translate(this.plotOffset.left, this.plotOffset.top);
- ctx.lineJoin = 'round';
- for (radius = 20; radius <= 100; radius += 20) {
- poly.data = new Array();
- for (i = 0; i < sides; i++) {
- angle = nintyDegrees + (degreesInRadiansForAngle * i);
- poly.data[i] = [radius * Math.cos(angle), radius * Math.sin(angle)]
- }
- poly.data[sides] = poly.data[0];
- this.plotLine(poly,0);}
-
- var outside = poly.data;
- for (i = 0; i < sides; i++) {
- poly.data = new Array();
- poly.data[0] = [0,0];
- poly.data[1] = outside[i];
- this.plotLine(poly,0);
- }
- */
-
- /*
- Convert Series data into X, Y co-ordinates
- */
- if (!series.dataInRadarFormat) {
- poly.data = new Array();
- for (i = 0; i < sides; i++) {
- angle = nintyDegrees + (degreesInRadiansForAngle * i);
- poly.data[i] = [series.data[i][1] * Math.cos(angle), series.data[i][1] * Math.sin(angle), series.data[i][0], series.data[i][1]]
- }
- poly.data[sides] = poly.data[0];
- series.data = poly.data;
- series.lines = series.radar;
- series.lines.show = false;
- series.dataInRadarFormat = true;
- }
-
- this.drawSeriesLines(series);
-
-},
-
-
- /**
- * Function: drawSeriesPie
- *
- * Function draws a pie in the canvas element.
- *
- * Parameters:
- * series - Series with options.pie.show = true.
- *
- * Returns:
- * void
- */
- drawSeriesPie: function(series) {
- if (!this.options.pie.drawn) {
- var ctx = this.ctx,
- options = this.options,
- lw = series.pie.lineWidth,
- sw = series.shadowSize,
- data = series.data,
- radius = (Math.min(this.canvasWidth, this.canvasHeight) * series.pie.sizeRatio) / 2,
- html = [];
-
- var vScale = 1;//Math.cos(series.pie.viewAngle);
- var plotTickness = Math.sin(series.pie.viewAngle)*series.pie.spliceThickness / vScale;
-
- var style = {
- size: options.fontSize*1.2,
- color: options.grid.color,
- weight: 1.5
- };
-
- var center = {
- x: (this.canvasWidth+this.plotOffset.left)/2,
- y: (this.canvasHeight-this.plotOffset.bottom)/2
- };
-
- // Pie portions
- var portions = this.series.collect(function(hash, index){
- if (hash.pie.show)
- return {
- name: (hash.label || hash.data[0][1]),
- value: [index, hash.data[0][1]],
- explode: hash.pie.explode
- };
- });
-
- // Sum of the portions' angles
- var sum = portions.pluck('value').pluck(1).inject(0, function(acc, n) { return acc + n; });
-
- var fraction = 0.0,
- angle = series.pie.startAngle,
- value = 0.0;
-
- var slices = portions.collect(function(slice){
- angle += fraction;
- value = parseFloat(slice.value[1]); // @warning : won't support null values !!
- fraction = value/sum;
- return {
- name: slice.name,
- fraction: fraction,
- x: slice.value[0],
- y: value,
- explode: slice.explode,
- startAngle: 2 * angle * Math.PI,
- endAngle: 2 * (angle + fraction) * Math.PI
- };
- });
-
- ctx.save();
-
- if(sw > 0){
- slices.each(function (slice) {
- var bisection = (slice.startAngle + slice.endAngle) / 2;
-
- var xOffset = center.x + Math.cos(bisection) * slice.explode + sw;
- var yOffset = center.y + Math.sin(bisection) * slice.explode + sw;
-
- this.plotSlice(xOffset, yOffset, radius, slice.startAngle, slice.endAngle, false, vScale);
-
- ctx.fillStyle = 'rgba(0,0,0,0.1)';
- ctx.fill();
- }, this);
- }
-
- if (options.HtmlText) {
- html = ['<div style="color:' + this.options.grid.color + '" class="flotr-labels">'];
- }
-
- slices.each(function (slice, index) {
- var bisection = (slice.startAngle + slice.endAngle) / 2;
- var color = options.colors[index];
-
- var xOffset = center.x + Math.cos(bisection) * slice.explode;
- var yOffset = center.y + Math.sin(bisection) * slice.explode;
-
- this.plotSlice(xOffset, yOffset, radius, slice.startAngle, slice.endAngle, false, vScale);
-
- if(series.pie.fill){
- ctx.fillStyle = Flotr.parseColor(color).scale(null, null, null, series.pie.fillOpacity).toString();
- ctx.fill();
- }
- ctx.lineWidth = lw;
- ctx.strokeStyle = color;
- ctx.stroke();
-
- /*ctx.save();
- ctx.scale(1, vScale);
-
- ctx.moveTo(xOffset, yOffset);
- ctx.beginPath();
- ctx.lineTo(xOffset, yOffset+plotTickness);
- ctx.lineTo(xOffset+Math.cos(slice.startAngle)*radius, yOffset+Math.sin(slice.startAngle)*radius+plotTickness);
- ctx.lineTo(xOffset+Math.cos(slice.startAngle)*radius, yOffset+Math.sin(slice.startAngle)*radius);
- ctx.lineTo(xOffset, yOffset);
- ctx.closePath();
- ctx.fill();ctx.stroke();
-
- ctx.moveTo(xOffset, yOffset);
- ctx.beginPath();
- ctx.lineTo(xOffset, yOffset+plotTickness);
- ctx.lineTo(xOffset+Math.cos(slice.endAngle)*radius, yOffset+Math.sin(slice.endAngle)*radius+plotTickness);
- ctx.lineTo(xOffset+Math.cos(slice.endAngle)*radius, yOffset+Math.sin(slice.endAngle)*radius);
- ctx.lineTo(xOffset, yOffset);
- ctx.closePath();
- ctx.fill();ctx.stroke();
-
- ctx.moveTo(xOffset+Math.cos(slice.startAngle)*radius, yOffset+Math.sin(slice.startAngle)*radius);
- ctx.beginPath();
- ctx.lineTo(xOffset+Math.cos(slice.startAngle)*radius, yOffset+Math.sin(slice.startAngle)*radius+plotTickness);
- ctx.arc(xOffset, yOffset+plotTickness, radius, slice.startAngle, slice.endAngle, false);
- ctx.lineTo(xOffset+Math.cos(slice.endAngle)*radius, yOffset+Math.sin(slice.endAngle)*radius);
- ctx.arc(xOffset, yOffset, radius, slice.endAngle, slice.startAngle, true);
- ctx.closePath();
- ctx.fill();ctx.stroke();
-
- ctx.scale(1, 1/vScale);
- this.plotSlice(xOffset, yOffset+plotTickness, radius, slice.startAngle, slice.endAngle, false, vScale);
- ctx.stroke();
- if(series.pie.fill){
- ctx.fillStyle = Flotr.parseColor(color).scale(null, null, null, series.pie.fillOpacity).toString();
- ctx.fill();
- }
-
- ctx.restore();*/
-
- var label = options.pie.labelFormatter(slice);
-
- var textAlignRight = (Math.cos(bisection) < 0);
- var distX = xOffset + Math.cos(bisection) * (series.pie.explode + radius);
- var distY = yOffset + Math.sin(bisection) * (series.pie.explode + radius);
-
- if (slice.fraction && label) {
- if (options.HtmlText) {
- var divStyle = 'position:absolute;top:' + (distY - 5) + 'px;'; //@todo: change
- if (textAlignRight) {
- divStyle += 'right:'+(this.canvasWidth - distX)+'px;text-align:right;';
- }
- else {
- divStyle += 'left:'+distX+'px;text-align:left;';
- }
- html.push('<div style="' + divStyle + '" class="flotr-grid-label">' + label + '</div>');
- }
- else {
- style.halign = textAlignRight ? 'r' : 'l';
- ctx.drawText(
- label,
- distX,
- distY + style.size / 2,
- style
- );
- }
- }
- }, this);
-
- if (options.HtmlText) {
- html.push('</div>');
- this.el.insert(html.join(''));
- }
-
- ctx.restore();
- options.pie.drawn = true;
- }
- },
- plotSlice: function(x, y, radius, startAngle, endAngle, fill, vScale) {
- var ctx = this.ctx;
- vScale = vScale || 1;
-
- ctx.save();
- ctx.scale(1, vScale);
- ctx.beginPath();
- ctx.moveTo(x, y);
- ctx.arc (x, y, radius, startAngle, endAngle, fill);
- ctx.lineTo(x, y);
- ctx.closePath();
- ctx.restore();
- },
- plotPie: function() {},
- /**
- * Function: insertLegend
- *
- * Function adds a legend div to the canvas container or draws it on the canvas.
- *
- * Parameters:
- * none
- *
- * Returns:
- * void
- */
- insertLegend: function(){
- if(!this.options.legend.show)
- return;
-
- var series = this.series,
- plotOffset = this.plotOffset,
- options = this.options,
- fragments = [],
- rowStarted = false,
- ctx = this.ctx,
- i;
-
- var noLegendItems = series.findAll(function(s) {return (s.label && !s.hide)}).size();
-
- if (noLegendItems) {
- if (!options.HtmlText && this.textEnabled) {
- var style = {
- size: options.fontSize*1.1,
- color: options.grid.color
- };
-
- // @todo: take css into account
- //var dummyDiv = this.el.insert('<div class="flotr-legend" style="position:absolute;top:-10000px;"></div>');
-
- var p = options.legend.position,
- m = options.legend.margin,
- lbw = options.legend.labelBoxWidth,
- lbh = options.legend.labelBoxHeight,
- lbm = options.legend.labelBoxMargin,
- offsetX = plotOffset.left + m,
- offsetY = plotOffset.top + m;
-
- // We calculate the labels' max width
- var labelMaxWidth = 0;
- for(i = series.length - 1; i > -1; --i){
- if(!series[i].label || series[i].hide) continue;
- var label = options.legend.labelFormatter(series[i].label);
- labelMaxWidth = Math.max(labelMaxWidth, ctx.measureText(label, style));
- }
-
- var legendWidth = Math.round(lbw + lbm*3 + labelMaxWidth),
- legendHeight = Math.round(noLegendItems*(lbm+lbh) + lbm);
-
- if(p.charAt(0) == 's') offsetY = plotOffset.top + this.plotHeight - (m + legendHeight);
- if(p.charAt(1) == 'e') offsetX = plotOffset.left + this.plotWidth - (m + legendWidth);
-
- // Legend box
- var color = Flotr.parseColor(options.legend.backgroundColor || 'rgb(240,240,240)').scale(null, null, null, options.legend.backgroundOpacity || 0.1).toString();
-
- ctx.fillStyle = color;
- ctx.fillRect(offsetX, offsetY, legendWidth, legendHeight);
- ctx.strokeStyle = options.legend.labelBoxBorderColor;
- ctx.strokeRect(Flotr.toPixel(offsetX), Flotr.toPixel(offsetY), legendWidth, legendHeight);
-
- // Legend labels
- var x = offsetX + lbm;
- var y = offsetY + lbm;
- for(i = 0; i < series.length; i++){
- if(!series[i].label || series[i].hide) continue;
- var label = options.legend.labelFormatter(series[i].label);
-
- ctx.fillStyle = series[i].color;
- ctx.fillRect(x, y, lbw-1, lbh-1);
-
- ctx.strokeStyle = options.legend.labelBoxBorderColor;
- ctx.lineWidth = 1;
- ctx.strokeRect(Math.ceil(x)-1.5, Math.ceil(y)-1.5, lbw+2, lbh+2);
-
- // Legend text
- ctx.drawText(
- label,
- x + lbw + lbm,
- y + (lbh + style.size - ctx.fontDescent(style))/2,
- style
- );
-
- y += lbh + lbm;
- }
- }
- else {
- for(i = 0; i < series.length; ++i){
- if(!series[i].label || series[i].hide) continue;
-
- if(i % options.legend.noColumns == 0){
- fragments.push(rowStarted ? '</tr><tr>' : '<tr>');
- rowStarted = true;
- }
-
- var label = options.legend.labelFormatter(series[i].label);
-
- fragments.push('<td class="flotr-legend-color-box"><div style="border:1px solid ' + options.legend.labelBoxBorderColor + ';padding:1px"><div style="width:' + options.legend.labelBoxWidth + 'px;height:' + options.legend.labelBoxHeight + 'px;background-color:' + series[i].color + '"></div></div></td>' +
- '<td class="flotr-legend-label">' + label + '</td>');
- }
- if(rowStarted) fragments.push('</tr>');
-
- if(fragments.length > 0){
- var table = '<table style="font-size:smaller;color:' + options.grid.color + '">' + fragments.join("") + '</table>';
- if(options.legend.container != null){
- $(options.legend.container).update(table);
- }else{
- var pos = '';
- var p = options.legend.position, m = options.legend.margin;
-
- if(p.charAt(0) == 'n') pos += 'top:' + (m + plotOffset.top) + 'px;';
- else if(p.charAt(0) == 's') pos += 'bottom:' + (m + plotOffset.bottom) + 'px;';
- if(p.charAt(1) == 'e') pos += 'right:' + (m + plotOffset.right) + 'px;';
- else if(p.charAt(1) == 'w') pos += 'left:' + (m + plotOffset.left) + 'px;';
-
- var div = this.el.insert('<div class="flotr-legend" style="position:absolute;z-index:2;' + pos +'">' + table + '</div>').select('div.flotr-legend').first();
-
- if(options.legend.backgroundOpacity != 0.0){
- /**
- * Put in the transparent background separately to avoid blended labels and
- * label boxes.
- */
- var c = options.legend.backgroundColor;
- if(c == null){
- var tmp = (options.grid.backgroundColor != null) ? options.grid.backgroundColor : Flotr.extractColor(div);
- c = Flotr.parseColor(tmp).adjust(null, null, null, 1).toString();
- }
- this.el.insert('<div class="flotr-legend-bg" style="position:absolute;width:' + div.getWidth() + 'px;height:' + div.getHeight() + 'px;' + pos +'background-color:' + c + ';"> </div>').select('div.flotr-legend-bg').first().setStyle({
- 'opacity': options.legend.backgroundOpacity
- });
- }
- }
- }
- }
- }
- },
- /**
- * Function: getEventPosition
- *
- * Calculates the coordinates from a mouse event object.
- *
- * Parameters:
- * event - Mouse Event object.
- *
- * Returns:
- * Object with x and y coordinates of the mouse.
- */
- getEventPosition: function (event){
- var offset = this.overlay.cumulativeOffset(),
- rx = (event.pageX - offset.left - this.plotOffset.left),
- ry = (event.pageY - offset.top - this.plotOffset.top),
- ax = 0, ay = 0
-
- if(event.pageX == null && event.clientX != null){
- var de = document.documentElement, b = document.body;
- ax = event.clientX + (de && de.scrollLeft || b.scrollLeft || 0);
- ay = event.clientY + (de && de.scrollTop || b.scrollTop || 0);
- }else{
- ax = event.pageX;
- ay = event.pageY;
- }
-
- return {
- x: this.axes.x.min + rx / this.axes.x.scale,
- x2: this.axes.x2.min + rx / this.axes.x2.scale,
- y: this.axes.y.max - ry / this.axes.y.scale,
- y2: this.axes.y2.max - ry / this.axes.y2.scale,
- relX: rx,
- relY: ry,
- absX: ax,
- absY: ay
- };
- },
- /**
- * Function: clickHandler
- *
- * Handler observes the 'click' event and fires the 'flotr:click' event.
- *
- * Parameters:
- * event - 'click' Event object.
- *
- * Returns:
- * void
- */
- clickHandler: function(event){
- if(this.ignoreClick){
- this.ignoreClick = false;
- return;
- }
- this.el.fire('flotr:click', [this.getEventPosition(event), this]);
- },
- /**
- * Function: mouseMoveHandler
- *
- * Handler observes mouse movement over the graph area. Fires the
- * 'flotr:mousemove' event.
- *
- * Parameters:
- * event - 'mousemove' Event object.
- *
- * Returns:
- * void
- */
- mouseMoveHandler: function(event){
- var pos = this.getEventPosition(event);
-
- this.lastMousePos.pageX = pos.absX;
- this.lastMousePos.pageY = pos.absY;
- if(this.selectionInterval == null && (this.options.mouse.track || this.series.any(function(s){return s.mouse && s.mouse.track;}))){
- this.hit(pos);
- }
-
- this.el.fire('flotr:mousemove', [event, pos, this]);
- },
- /**
- * Function: mouseDownHandler
- *
- * Handler observes the 'mousedown' event.
- *
- * Parameters:
- * event - 'mousedown' Event object.
- *
- * Returns:
- * void
- */
- mouseDownHandler: function (event){
- if(event.isRightClick()) {
- event.stop();
- var overlay = this.overlay;
- overlay.hide();
-
- function cancelContextMenu () {
- overlay.show();
- $(document).stopObserving('mousemove', cancelContextMenu);
- }
- $(document).observe('mousemove', cancelContextMenu);
- return;
- }
-
- if(!this.options.selection.mode || !event.isLeftClick()) return;
-
- this.setSelectionPos(this.selection.first, event);
- if(this.selectionInterval != null){
- clearInterval(this.selectionInterval);
- }
- this.lastMousePos.pageX = null;
- this.selectionInterval = setInterval(this.updateSelection.bind(this), 1000/this.options.selection.fps);
-
- this.mouseUpHandler = this.mouseUpHandler.bind(this);
- $(document).observe('mouseup', this.mouseUpHandler);
- },
- /**
- * Function: (private) fireSelectEvent
- *
- * Fires the 'flotr:select' event when the user made a selection.
- *
- * Parameters:
- * none
- *
- * Returns:
- * void
- */
- fireSelectEvent: function(){
- var a = this.axes, selection = this.selection,
- x1 = (selection.first.x <= selection.second.x) ? selection.first.x : selection.second.x,
- x2 = (selection.first.x <= selection.second.x) ? selection.second.x : selection.first.x,
- y1 = (selection.first.y >= selection.second.y) ? selection.first.y : selection.second.y,
- y2 = (selection.first.y >= selection.second.y) ? selection.second.y : selection.first.y;
-
- x1 = a.x.min + x1 / a.x.scale;
- x2 = a.x.min + x2 / a.x.scale;
- y1 = a.y.max - y1 / a.y.scale;
- y2 = a.y.max - y2 / a.y.scale;
-
- this.el.fire('flotr:select', [{x1:x1, y1:y1, x2:x2, y2:y2}, this]);
- },
- /**
- * Function: (private) mouseUpHandler
- *
- * Handler observes the mouseup event for the document.
- *
- * Parameters:
- * event - 'mouseup' Event object.
- *
- * Returns:
- * void
- */
- mouseUpHandler: function(event){
- $(document).stopObserving('mouseup', this.mouseUpHandler);
- event.stop();
-
- if(this.selectionInterval != null){
- clearInterval(this.selectionInterval);
- this.selectionInterval = null;
- }
-
- this.setSelectionPos(this.selection.second, event);
- this.clearSelection();
-
- if(this.selectionIsSane()){
- this.drawSelection();
- this.fireSelectEvent();
- this.ignoreClick = true;
- }
- },
- /**
- * Function: setSelectionPos
- *
- * Calculates the position of the selection.
- *
- * Parameters:
- * pos - Position object.
- * event - Event object.
- *
- * Returns:
- * void
- */
- setSelectionPos: function(pos, event) {
- var options = this.options,
- offset = $(this.overlay).cumulativeOffset();
-
- if(options.selection.mode.indexOf('x') == -1){
- pos.x = (pos == this.selection.first) ? 0 : this.plotWidth;
- }else{
- pos.x = event.pageX - offset.left - this.plotOffset.left;
- pos.x = Math.min(Math.max(0, pos.x), this.plotWidth);
- }
-
- if (options.selection.mode.indexOf('y') == -1){
- pos.y = (pos == this.selection.first) ? 0 : this.plotHeight;
- }else{
- pos.y = event.pageY - offset.top - this.plotOffset.top;
- pos.y = Math.min(Math.max(0, pos.y), this.plotHeight);
- }
- },
- /**
- * Function: updateSelection
- *
- * Updates (draws) the selection box.
- *
- * Parameters:
- * none
- *
- * Returns:
- * void
- */
- updateSelection: function(){
- if(this.lastMousePos.pageX == null) return;
-
- this.setSelectionPos(this.selection.second, this.lastMousePos);
- this.clearSelection();
-
- if(this.selectionIsSane()) this.drawSelection();
- },
- /**
- * Function: clearSelection
- *
- * Removes the selection box from the overlay canvas.
- *
- * Parameters:
- * none
- *
- * Returns:
- * void
- */
- clearSelection: function() {
- if(this.prevSelection == null) return;
-
- var prevSelection = this.prevSelection,
- octx = this.octx,
- plotOffset = this.plotOffset,
- x = Math.min(prevSelection.first.x, prevSelection.second.x),
- y = Math.min(prevSelection.first.y, prevSelection.second.y),
- w = Math.abs(prevSelection.second.x - prevSelection.first.x),
- h = Math.abs(prevSelection.second.y - prevSelection.first.y);
-
- octx.clearRect(x + plotOffset.left - octx.lineWidth,
- y + plotOffset.top - octx.lineWidth,
- w + octx.lineWidth*2,
- h + octx.lineWidth*2);
-
- this.prevSelection = null;
- },
- /**
- * Function: setSelection
- *
- * Allows the user the manually select an area.
- *
- * Parameters:
- * area - Object with coordinates to select.
- *
- * Returns:
- * void
- */
- setSelection: function(area){
- var options = this.options,
- xa = this.axes.x,
- ya = this.axes.y,
- vertScale = yaxis.scale,
- hozScale = xaxis.scale,
- selX = options.selection.mode.indexOf('x') != -1,
- selY = options.selection.mode.indexOf('y') != -1;
-
- this.clearSelection();
-
- this.selection.first.y = selX ? 0 : (ya.max - area.y1) * vertScale;
- this.selection.second.y = selX ? this.plotHeight : (ya.max - area.y2) * vertScale;
- this.selection.first.x = selY ? 0 : (area.x1 - xa.min) * hozScale;
- this.selection.second.x = selY ? this.plotWidth : (area.x2 - xa.min) * hozScale;
-
- this.drawSelection();
- this.fireSelectEvent();
- },
- /**
- * Function: (private) drawSelection
- *
- * Draws the selection box.
- *
- * Parameters:
- * none
- *
- * Returns:
- * void
- */
- drawSelection: function() {
- var prevSelection = this.prevSelection,
- selection = this.selection,
- octx = this.octx,
- options = this.options,
- plotOffset = this.plotOffset;
-
- if(prevSelection != null &&
- selection.first.x == prevSelection.first.x &&
- selection.first.y == prevSelection.first.y &&
- selection.second.x == prevSelection.second.x &&
- selection.second.y == prevSelection.second.y)
- return;
-
- octx.strokeStyle = Flotr.parseColor(options.selection.color).scale(null, null, null, 0.8).toString();
- octx.lineWidth = 1;
- octx.lineJoin = 'round';
- octx.fillStyle = Flotr.parseColor(options.selection.color).scale(null, null, null, 0.4).toString();
-
- this.prevSelection = {
- first: { x: selection.first.x, y: selection.first.y },
- second: { x: selection.second.x, y: selection.second.y }
- };
-
- var x = Math.min(selection.first.x, selection.second.x),
- y = Math.min(selection.first.y, selection.second.y),
- w = Math.abs(selection.second.x - selection.first.x),
- h = Math.abs(selection.second.y - selection.first.y);
-
- octx.fillRect(x + plotOffset.left, y + plotOffset.top, w, h);
- octx.strokeRect(x + plotOffset.left, y + plotOffset.top, w, h);
- },
- /**
- * Function: (private) selectionIsSane
- *
- * Determines whether or not the selection is sane and should be drawn.
- *
- * Parameters:
- * none
- *
- * Returns:
- * boolean - True when sane, false otherwise.
- */
- selectionIsSane: function(){
- var selection = this.selection;
- return Math.abs(selection.second.x - selection.first.x) >= 5 &&
- Math.abs(selection.second.y - selection.first.y) >= 5;
- },
- /**
- * Function: clearHit
- *
- * Removes the mouse tracking point from the overlay.
- *
- * Parameters:
- * none
- *
- * Returns:
- * void
- */
- clearHit: function(){
- if(this.prevHit){
- var options = this.options,
- plotOffset = this.plotOffset,
- prevHit = this.prevHit;
-
- this.octx.clearRect(
- this.tHoz(prevHit.x) + plotOffset.left - options.points.radius*2,
- this.tVert(prevHit.y) + plotOffset.top - options.points.radius*2,
- options.points.radius*3 + options.points.lineWidth*3,
- options.points.radius*3 + options.points.lineWidth*3
- );
- this.prevHit = null;
- }
- },
- /**
- * Function: hit
- *
- * Retrieves the nearest data point from the mouse cursor. If it's within
- * a certain range, draw a point on the overlay canvas and display the x and y
- * value of the data.
- *
- * Parameters:
- * mouse - Object that holds the relative x and y coordinates of the cursor.
- *
- * Returns:
- * void
- */
- hit: function(mouse){
- var series = this.series,
- options = this.options,
- prevHit = this.prevHit,
- plotOffset = this.plotOffset,
- octx = this.octx,
- data, xsens, ysens,
- /**
- * Nearest data element.
- */
- i, n = {
- dist:Number.MAX_VALUE,
- x:null,
- y:null,
- relX:mouse.relX,
- relY:mouse.relY,
- absX:mouse.absX,
- absY:mouse.absY,
- mouse:null,
- radarData:null
- };
-
- for(i = 0; i < series.length; i++){
- s = series[i];
- if(!s.mouse.track) continue;
- data = s.data;
- xsens = (s.xaxis.scale*s.mouse.sensibility);
- ysens = (s.yaxis.scale*s.mouse.sensibility);
-
- for(var j = 0, xpow, ypow; j < data.length; j++){
- if (data[j][1] === null) continue;
- xpow = Math.pow(s.xaxis.scale*(data[j][0] - mouse.x), 2);
- ypow = Math.pow(s.yaxis.scale*(data[j][1] - mouse.y), 2);
- if(xpow < xsens && ypow < ysens && Math.sqrt(xpow+ypow) < n.dist){
- n.dist = Math.sqrt(xpow+ypow);
- n.x = data[j][0];
- n.y = data[j][1];
- n.radarLabel = data[j][2];
- n.radarData = data[j][3];
- n.mouse = s.mouse;
- }
- }
- }
-
- if(n.mouse && n.mouse.track && !prevHit || (prevHit && (n.x != prevHit.x || n.y != prevHit.y))){
- var mt = this.mouseTrack || this.el.select(".flotr-mouse-value")[0],
- pos = '',
- p = options.mouse.position,
- m = options.mouse.margin,
- elStyle = 'opacity:0.7;background-color:#000;color:#fff;display:none;position:absolute;padding:2px 8px;-moz-border-radius:4px;border-radius:4px;white-space:nowrap;';
-
- if (!options.mouse.relative) { // absolute to the canvas
- if(p.charAt(0) == 'n') pos += 'top:' + (m + plotOffset.top) + 'px;';
- else if(p.charAt(0) == 's') pos += 'bottom:' + (m + plotOffset.bottom) + 'px;';
- if(p.charAt(1) == 'e') pos += 'right:' + (m + plotOffset.right) + 'px;';
- else if(p.charAt(1) == 'w') pos += 'left:' + (m + plotOffset.left) + 'px;';
- }
- else { // relative to the mouse
- if(p.charAt(0) == 'n') pos += 'bottom:' + (m - plotOffset.top - this.tVert(n.y) + this.canvasHeight) + 'px;';
- else if(p.charAt(0) == 's') pos += 'top:' + (m + plotOffset.top + this.tVert(n.y)) + 'px;';
- if(p.charAt(1) == 'e') pos += 'left:' + (m + plotOffset.left + this.tHoz(n.x)) + 'px;';
- else if(p.charAt(1) == 'w') pos += 'right:' + (m - plotOffset.left - this.tHoz(n.x) + this.canvasWidth) + 'px;';
- }
-
- elStyle += pos;
-
- if(!mt){
- this.el.insert('<div class="flotr-mouse-value" style="'+elStyle+'"></div>');
- mt = this.mouseTrack = this.el.select('.flotr-mouse-value').first();
- }
- else {
- this.mouseTrack = mt.setStyle(elStyle);
- }
-
- if(n.x !== null && n.y !== null){
- mt.show();
-
- this.clearHit();
- if(n.mouse.lineColor != null){
- octx.save();
- octx.translate(plotOffset.left, plotOffset.top);
- octx.lineWidth = options.points.lineWidth;
- octx.strokeStyle = n.mouse.lineColor;
- octx.fillStyle = '#ffffff';
- octx.beginPath();
- octx.arc(this.tHoz(n.x), this.tVert(n.y), options.mouse.radius, 0, 2 * Math.PI, true);
- octx.fill();
- octx.stroke();
- octx.restore();
- }
- this.prevHit = n;
-
- var decimals = n.mouse.trackDecimals;
- if(decimals == null || decimals < 0) decimals = 0;
-
- mt.innerHTML = n.mouse.trackFormatter({x: n.x.toFixed(decimals), y: n.y.toFixed(decimals),
- radarLabel: n.radarLabel, radarData: n.radarData.toFixed(decimals)});
- mt.fire('flotr:hit', [n, this]);
- }
- else if(prevHit){
- mt.hide();
- this.clearHit();
- }
- }
- },
- saveImage: function (type, width, height, replaceCanvas) {
- var image = null;
- switch (type) {
- case 'jpeg':
- case 'jpg': image = Canvas2Image.saveAsJPEG(this.canvas, replaceCanvas, width, height); break;
- default:
- case 'png': image = Canvas2Image.saveAsPNG(this.canvas, replaceCanvas, width, height); break;
- case 'bmp': image = Canvas2Image.saveAsBMP(this.canvas, replaceCanvas, width, height); break;
- }
- if (Object.isElement(image) && replaceCanvas) {
- this.restoreCanvas();
- this.canvas.hide();
- this.overlay.hide();
- this.el.insert(image.setStyle({position: 'absolute'}));
- }
- },
- restoreCanvas: function() {
- this.canvas.show();
- this.overlay.show();
- this.el.select('img').invoke('remove');
- }
-});
-
-Flotr.Color = Class.create({
- initialize: function(r, g, b, a){
- this.rgba = ['r','g','b','a'];
- var x = 4;
- while(-1<--x){
- this[this.rgba[x]] = arguments[x] || ((x==3) ? 1.0 : 0);
- }
- this.normalize();
- },
-
- adjust: function(rd, gd, bd, ad) {
- var x = 4;
- while(-1<--x){
- if(arguments[x] != null)
- this[this.rgba[x]] += arguments[x];
- }
- return this.normalize();
- },
-
- clone: function(){
- return new Flotr.Color(this.r, this.b, this.g, this.a);
- },
-
- limit: function(val,minVal,maxVal){
- return Math.max(Math.min(val, maxVal), minVal);
- },
-
- normalize: function(){
- var limit = this.limit;
- this.r = limit(parseInt(this.r), 0, 255);
- this.g = limit(parseInt(this.g), 0, 255);
- this.b = limit(parseInt(this.b), 0, 255);
- this.a = limit(this.a, 0, 1);
- return this;
- },
-
- scale: function(rf, gf, bf, af){
- var x = 4;
- while(-1<--x){
- if(arguments[x] != null)
- this[this.rgba[x]] *= arguments[x];
- }
- return this.normalize();
- },
-
- distance: function(color){
- if (!color) return;
- color = new Flotr.parseColor(color);
- var dist = 0;
- var x = 3;
- while(-1<--x){
- dist += Math.abs(this[this.rgba[x]] - color[this.rgba[x]]);
- }
- return dist;
- },
-
- toString: function(){
- return (this.a >= 1.0) ? 'rgb('+[this.r,this.g,this.b].join(',')+')' : 'rgba('+[this.r,this.g,this.b,this.a].join(',')+')';
- }
-});
-
-Flotr.Color.lookupColors = {
- aqua:[0,255,255],
- azure:[240,255,255],
- beige:[245,245,220],
- black:[0,0,0],
- blue:[0,0,255],
- brown:[165,42,42],
- cyan:[0,255,255],
- darkblue:[0,0,139],
- darkcyan:[0,139,139],
- darkgrey:[169,169,169],
- darkgreen:[0,100,0],
- darkkhaki:[189,183,107],
- darkmagenta:[139,0,139],
- darkolivegreen:[85,107,47],
- darkorange:[255,140,0],
- darkorchid:[153,50,204],
- darkred:[139,0,0],
- darksalmon:[233,150,122],
- darkviolet:[148,0,211],
- fuchsia:[255,0,255],
- gold:[255,215,0],
- green:[0,128,0],
- indigo:[75,0,130],
- khaki:[240,230,140],
- lightblue:[173,216,230],
- lightcyan:[224,255,255],
- lightgreen:[144,238,144],
- lightgrey:[211,211,211],
- lightpink:[255,182,193],
- lightyellow:[255,255,224],
- lime:[0,255,0],
- magenta:[255,0,255],
- maroon:[128,0,0],
- navy:[0,0,128],
- olive:[128,128,0],
- orange:[255,165,0],
- pink:[255,192,203],
- purple:[128,0,128],
- violet:[128,0,128],
- red:[255,0,0],
- silver:[192,192,192],
- white:[255,255,255],
- yellow:[255,255,0]
-};
-
-// not used yet
-Flotr.Date = {
- format: function(d, format) {
- if (!d) return;
-
- var leftPad = function(n) {
- n = n.toString();
- return n.length == 1 ? "0" + n : n;
- };
-
- var r = [];
- var escape = false;
-
- for (var i = 0; i < format.length; ++i) {
- var c = format.charAt(i);
-
- if (escape) {
- switch (c) {
- case 'h': c = d.getUTCHours().toString(); break;
- case 'H': c = leftPad(d.getUTCHours()); break;
- case 'M': c = leftPad(d.getUTCMinutes()); break;
- case 'S': c = leftPad(d.getUTCSeconds()); break;
- case 'd': c = d.getUTCDate().toString(); break;
- case 'm': c = (d.getUTCMonth() + 1).toString(); break;
- case 'y': c = d.getUTCFullYear().toString(); break;
- case 'b': c = Flotr.Date.monthNames[d.getUTCMonth()]; break;
- }
- r.push(c);
- escape = false;
- }
- else {
- if (c == "%")
- escape = true;
- else
- r.push(c);
- }
- }
- return r.join("");
- },
- timeUnits: {
- "second": 1000,
- "minute": 60 * 1000,
- "hour": 60 * 60 * 1000,
- "day": 24 * 60 * 60 * 1000,
- "month": 30 * 24 * 60 * 60 * 1000,
- "year": 365.2425 * 24 * 60 * 60 * 1000
- },
- // the allowed tick sizes, after 1 year we use an integer algorithm
- spec: [
- [1, "second"], [2, "second"], [5, "second"], [10, "second"], [30, "second"],
- [1, "minute"], [2, "minute"], [5, "minute"], [10, "minute"], [30, "minute"],
- [1, "hour"], [2, "hour"], [4, "hour"], [8, "hour"], [12, "hour"],
- [1, "day"], [2, "day"], [3, "day"],
- [0.25, "month"], [0.5, "month"], [1, "month"], [2, "month"], [3, "month"], [6, "month"],
- [1, "year"]
- ],
- monthNames: ["Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug", "Sep", "Oct", "Nov", "Dec"]
-};
--- a/js/flotr/lib/base64.js
+++ /dev/null
@@ -1,113 +1,1 @@
-/* Copyright (C) 1999 Masanao Izumo <iz@onicos.co.jp>
- * Version: 1.0
- * LastModified: Dec 25 1999
- * This library is free. You can redistribute it and/or modify it.
- */
-
-/*
- * Interfaces:
- * b64 = base64encode(data);
- * data = base64decode(b64);
- */
-
-(function() {
-
-var base64EncodeChars = "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/";
-var base64DecodeChars = [
- -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1,
- -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1,
- -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, 62, -1, -1, -1, 63,
- 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, -1, -1, -1, -1, -1, -1,
- -1, 0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14,
- 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, -1, -1, -1, -1, -1,
- -1, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40,
- 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, -1, -1, -1, -1, -1];
-
-function base64encode(str) {
- var out, i, len;
- var c1, c2, c3;
-
- len = str.length;
- i = 0;
- out = "";
- while(i < len) {
- c1 = str.charCodeAt(i++) & 0xff;
- if(i == len)
- {
- out += base64EncodeChars.charAt(c1 >> 2);
- out += base64EncodeChars.charAt((c1 & 0x3) << 4);
- out += "==";
- break;
- }
- c2 = str.charCodeAt(i++);
- if(i == len)
- {
- out += base64EncodeChars.charAt(c1 >> 2);
- out += base64EncodeChars.charAt(((c1 & 0x3)<< 4) | ((c2 & 0xF0) >> 4));
- out += base64EncodeChars.charAt((c2 & 0xF) << 2);
- out += "=";
- break;
- }
- c3 = str.charCodeAt(i++);
- out += base64EncodeChars.charAt(c1 >> 2);
- out += base64EncodeChars.charAt(((c1 & 0x3)<< 4) | ((c2 & 0xF0) >> 4));
- out += base64EncodeChars.charAt(((c2 & 0xF) << 2) | ((c3 & 0xC0) >>6));
- out += base64EncodeChars.charAt(c3 & 0x3F);
- }
- return out;
-}
-
-function base64decode(str) {
- var c1, c2, c3, c4;
- var i, len, out;
-
- len = str.length;
- i = 0;
- out = "";
- while(i < len) {
- /* c1 */
- do {
- c1 = base64DecodeChars[str.charCodeAt(i++) & 0xff];
- } while(i < len && c1 == -1);
- if(c1 == -1)
- break;
-
- /* c2 */
- do {
- c2 = base64DecodeChars[str.charCodeAt(i++) & 0xff];
- } while(i < len && c2 == -1);
- if(c2 == -1)
- break;
-
- out += String.fromCharCode((c1 << 2) | ((c2 & 0x30) >> 4));
-
- /* c3 */
- do {
- c3 = str.charCodeAt(i++) & 0xff;
- if(c3 == 61)
- return out;
- c3 = base64DecodeChars[c3];
- } while(i < len && c3 == -1);
- if(c3 == -1)
- break;
-
- out += String.fromCharCode(((c2 & 0XF) << 4) | ((c3 & 0x3C) >> 2));
-
- /* c4 */
- do {
- c4 = str.charCodeAt(i++) & 0xff;
- if(c4 == 61)
- return out;
- c4 = base64DecodeChars[c4];
- } while(i < len && c4 == -1);
- if(c4 == -1)
- break;
- out += String.fromCharCode(((c3 & 0x03) << 6) | c4);
- }
- return out;
-}
-
-if (!window.btoa) window.btoa = base64encode;
-if (!window.atob) window.atob = base64decode;
-
-})();
+
--- a/js/flotr/lib/canvas2image.js
+++ /dev/null
@@ -1,230 +1,1 @@
-/*
- * Canvas2Image v0.1
- * Copyright (c) 2008 Jacob Seidelin, cupboy@gmail.com
- * MIT License [http://www.opensource.org/licenses/mit-license.php]
- */
-
-var Canvas2Image = (function() {
- // check if we have canvas support
- var oCanvas = document.createElement("canvas");
-
- // no canvas, bail out.
- if (!oCanvas.getContext) {
- return {
- saveAsBMP : function(){},
- saveAsPNG : function(){},
- saveAsJPEG : function(){}
- }
- }
-
- var bHasImageData = !!(oCanvas.getContext("2d").getImageData);
- var bHasDataURL = !!(oCanvas.toDataURL);
- var bHasBase64 = !!(window.btoa);
-
- var strDownloadMime = "image/octet-stream";
-
- // ok, we're good
- var readCanvasData = function(oCanvas) {
- var iWidth = parseInt(oCanvas.width);
- var iHeight = parseInt(oCanvas.height);
- return oCanvas.getContext("2d").getImageData(0,0,iWidth,iHeight);
- }
-
- // base64 encodes either a string or an array of charcodes
- var encodeData = function(data) {
- var strData = "";
- if (typeof data == "string") {
- strData = data;
- } else {
- var aData = data;
- for (var i = 0; i < aData.length; i++) {
- strData += String.fromCharCode(aData[i]);
- }
- }
- return btoa(strData);
- }
-
- // creates a base64 encoded string containing BMP data
- // takes an imagedata object as argument
- var createBMP = function(oData) {
- var aHeader = [];
-
- var iWidth = oData.width;
- var iHeight = oData.height;
-
- aHeader.push(0x42); // magic 1
- aHeader.push(0x4D);
-
- var iFileSize = iWidth*iHeight*3 + 54; // total header size = 54 bytes
- aHeader.push(iFileSize % 256); iFileSize = Math.floor(iFileSize / 256);
- aHeader.push(iFileSize % 256); iFileSize = Math.floor(iFileSize / 256);
- aHeader.push(iFileSize % 256); iFileSize = Math.floor(iFileSize / 256);
- aHeader.push(iFileSize % 256);
-
- aHeader.push(0); // reserved
- aHeader.push(0);
- aHeader.push(0); // reserved
- aHeader.push(0);
-
- aHeader.push(54); // data offset
- aHeader.push(0);
- aHeader.push(0);
- aHeader.push(0);
-
- var aInfoHeader = [];
- aInfoHeader.push(40); // info header size
- aInfoHeader.push(0);
- aInfoHeader.push(0);
- aInfoHeader.push(0);
-
- var iImageWidth = iWidth;
- aInfoHeader.push(iImageWidth % 256); iImageWidth = Math.floor(iImageWidth / 256);
- aInfoHeader.push(iImageWidth % 256); iImageWidth = Math.floor(iImageWidth / 256);
- aInfoHeader.push(iImageWidth % 256); iImageWidth = Math.floor(iImageWidth / 256);
- aInfoHeader.push(iImageWidth % 256);
-
- var iImageHeight = iHeight;
- aInfoHeader.push(iImageHeight % 256); iImageHeight = Math.floor(iImageHeight / 256);
- aInfoHeader.push(iImageHeight % 256); iImageHeight = Math.floor(iImageHeight / 256);
- aInfoHeader.push(iImageHeight % 256); iImageHeight = Math.floor(iImageHeight / 256);
- aInfoHeader.push(iImageHeight % 256);
-
- aInfoHeader.push(1); // num of planes
- aInfoHeader.push(0);
-
- aInfoHeader.push(24); // num of bits per pixel
- aInfoHeader.push(0);
-
- aInfoHeader.push(0); // compression = none
- aInfoHeader.push(0);
- aInfoHeader.push(0);
- aInfoHeader.push(0);
-
- var iDataSize = iWidth*iHeight*3;
- aInfoHeader.push(iDataSize % 256); iDataSize = Math.floor(iDataSize / 256);
- aInfoHeader.push(iDataSize % 256); iDataSize = Math.floor(iDataSize / 256);
- aInfoHeader.push(iDataSize % 256); iDataSize = Math.floor(iDataSize / 256);
- aInfoHeader.push(iDataSize % 256);
-
- for (var i = 0; i < 16; i++) {
- aInfoHeader.push(0); // these bytes not used
- }
-
- var iPadding = (4 - ((iWidth * 3) % 4)) % 4;
-
- var aImgData = oData.data;
-
- var strPixelData = "";
- var y = iHeight;
- do {
- var iOffsetY = iWidth*(y-1)*4;
- var strPixelRow = "";
- for (var x=0;x<iWidth;x++) {
- var iOffsetX = 4*x;
-
- strPixelRow += String.fromCharCode(aImgData[iOffsetY+iOffsetX+2]);
- strPixelRow += String.fromCharCode(aImgData[iOffsetY+iOffsetX+1]);
- strPixelRow += String.fromCharCode(aImgData[iOffsetY+iOffsetX]);
- }
- for (var c=0;c<iPadding;c++) {
- strPixelRow += String.fromCharCode(0);
- }
- strPixelData += strPixelRow;
- } while (--y);
-
- return encodeData(aHeader.concat(aInfoHeader)) + encodeData(strPixelData);
- }
-
- // sends the generated file to the client
- var saveFile = function(strData) {
- if (!window.open(strData)) {
- document.location.href = strData;
- }
- }
-
- var makeDataURI = function(strData, strMime) {
- return "data:" + strMime + ";base64," + strData;
- }
-
- // generates a <img> object containing the imagedata
- var makeImageObject = function(strSource) {
- var oImgElement = document.createElement("img");
- oImgElement.src = strSource;
- return oImgElement;
- }
-
- var scaleCanvas = function(oCanvas, iWidth, iHeight) {
- if (iWidth && iHeight) {
- var oSaveCanvas = document.createElement("canvas");
-
- oSaveCanvas.width = iWidth;
- oSaveCanvas.height = iHeight;
- oSaveCanvas.style.width = iWidth+"px";
- oSaveCanvas.style.height = iHeight+"px";
-
- var oSaveCtx = oSaveCanvas.getContext("2d");
-
- oSaveCtx.drawImage(oCanvas, 0, 0, oCanvas.width, oCanvas.height, 0, 0, iWidth, iWidth);
-
- return oSaveCanvas;
- }
- return oCanvas;
- }
-
- return {
- saveAsPNG : function(oCanvas, bReturnImg, iWidth, iHeight) {
- if (!bHasDataURL) {
- return false;
- }
- var oScaledCanvas = scaleCanvas(oCanvas, iWidth, iHeight);
- var strData = oScaledCanvas.toDataURL("image/png");
- if (bReturnImg) {
- return makeImageObject(strData);
- } else {
- saveFile(strData.replace("image/png", strDownloadMime));
- }
- return true;
- },
-
- saveAsJPEG : function(oCanvas, bReturnImg, iWidth, iHeight) {
- if (!bHasDataURL) {
- return false;
- }
-
- var oScaledCanvas = scaleCanvas(oCanvas, iWidth, iHeight);
- var strMime = "image/jpeg";
- var strData = oScaledCanvas.toDataURL(strMime);
-
- // check if browser actually supports jpeg by looking for the mime type in the data uri.
- // if not, return false
- if (strData.indexOf(strMime) != 5) {
- return false;
- }
-
- if (bReturnImg) {
- return makeImageObject(strData);
- } else {
- saveFile(strData.replace(strMime, strDownloadMime));
- }
- return true;
- },
-
- saveAsBMP : function(oCanvas, bReturnImg, iWidth, iHeight) {
- if (!(bHasImageData && bHasBase64)) {
- return false;
- }
-
- var oScaledCanvas = scaleCanvas(oCanvas, iWidth, iHeight);
-
- var oData = readCanvasData(oScaledCanvas);
- var strImgData = createBMP(oData);
- if (bReturnImg) {
- return makeImageObject(makeDataURI(strImgData, "image/bmp"));
- } else {
- saveFile(makeDataURI(strImgData, strDownloadMime));
- }
- return true;
- }
- };
-
-})();
+
--- a/js/flotr/lib/canvastext.js
+++ /dev/null
@@ -1,397 +1,1 @@
-/**
- * This code is released to the public domain by Jim Studt, 2007.
- * He may keep some sort of up to date copy at http://www.federated.com/~jim/canvastext/
- * A partial support for accentuated letters as been added too.
- */
-var CanvasText = {
- /** The letters definition. It is a list of letters,
- * with their width, and the coordinates of points compositing them.
- * The syntax for the points is : [x, y], null value means "pen up"
- */
- letters: {
- '\n':{ width: -1, points: [] },
- ' ': { width: 10, points: [] },
- '!': { width: 10, points: [[5,21],[5,7],null,[5,2],[4,1],[5,0],[6,1],[5,2]] },
- '"': { width: 16, points: [[4,21],[4,14],null,[12,21],[12,14]] },
- '#': { width: 21, points: [[11,25],[4,-7],null,[17,25],[10,-7],null,[4,12],[18,12],null,[3,6],[17,6]] },
- '$': { width: 20, points: [[8,25],[8,-4],null,[12,25],[12,-4],null,[17,18],[15,20],[12,21],[8,21],[5,20],[3,18],[3,16],[4,14],[5,13],[7,12],[13,10],[15,9],[16,8],[17,6],[17,3],[15,1],[12,0],[8,0],[5,1],[3,3]] },
- '%': { width: 24, points: [[21,21],[3,0],null,[8,21],[10,19],[10,17],[9,15],[7,14],[5,14],[3,16],[3,18],[4,20],[6,21],[8,21],null,[17,7],[15,6],[14,4],[14,2],[16,0],[18,0],[20,1],[21,3],[21,5],[19,7],[17,7]] },
- '&': { width: 26, points: [[23,12],[23,13],[22,14],[21,14],[20,13],[19,11],[17,6],[15,3],[13,1],[11,0],[7,0],[5,1],[4,2],[3,4],[3,6],[4,8],[5,9],[12,13],[13,14],[14,16],[14,18],[13,20],[11,21],[9,20],[8,18],[8,16],[9,13],[11,10],[16,3],[18,1],[20,0],[22,0],[23,1],[23,2]] },
- '\'':{ width: 10, points: [[5,19],[4,20],[5,21],[6,20],[6,18],[5,16],[4,15]] },
- '(': { width: 14, points: [[11,25],[9,23],[7,20],[5,16],[4,11],[4,7],[5,2],[7,-2],[9,-5],[11,-7]] },
- ')': { width: 14, points: [[3,25],[5,23],[7,20],[9,16],[10,11],[10,7],[9,2],[7,-2],[5,-5],[3,-7]] },
- '*': { width: 16, points: [[8,21],[8,9],null,[3,18],[13,12],null,[13,18],[3,12]] },
- '+': { width: 26, points: [[13,18],[13,0],null,[4,9],[22,9]] },
- ',': { width: 10, points: [[6,1],[5,0],[4,1],[5,2],[6,1],[6,-1],[5,-3],[4,-4]] },
- '-': { width: 26, points: [[4,9],[22,9]] },
- '.': { width: 10, points: [[5,2],[4,1],[5,0],[6,1],[5,2]] },
- '/': { width: 22, points: [[20,25],[2,-7]] },
- '0': { width: 20, points: [[9,21],[6,20],[4,17],[3,12],[3,9],[4,4],[6,1],[9,0],[11,0],[14,1],[16,4],[17,9],[17,12],[16,17],[14,20],[11,21],[9,21]] },
- '1': { width: 20, points: [[6,17],[8,18],[11,21],[11,0]] },
- '2': { width: 20, points: [[4,16],[4,17],[5,19],[6,20],[8,21],[12,21],[14,20],[15,19],[16,17],[16,15],[15,13],[13,10],[3,0],[17,0]] },
- '3': { width: 20, points: [[5,21],[16,21],[10,13],[13,13],[15,12],[16,11],[17,8],[17,6],[16,3],[14,1],[11,0],[8,0],[5,1],[4,2],[3,4]] },
- '4': { width: 20, points: [[13,21],[3,7],[18,7],null,[13,21],[13,0]] },
- '5': { width: 20, points: [[15,21],[5,21],[4,12],[5,13],[8,14],[11,14],[14,13],[16,11],[17,8],[17,6],[16,3],[14,1],[11,0],[8,0],[5,1],[4,2],[3,4]] },
- '6': { width: 20, points: [[16,18],[15,20],[12,21],[10,21],[7,20],[5,17],[4,12],[4,7],[5,3],[7,1],[10,0],[11,0],[14,1],[16,3],[17,6],[17,7],[16,10],[14,12],[11,13],[10,13],[7,12],[5,10],[4,7]] },
- '7': { width: 20, points: [[17,21],[7,0],null,[3,21],[17,21]] },
- '8': { width: 20, points: [[8,21],[5,20],[4,18],[4,16],[5,14],[7,13],[11,12],[14,11],[16,9],[17,7],[17,4],[16,2],[15,1],[12,0],[8,0],[5,1],[4,2],[3,4],[3,7],[4,9],[6,11],[9,12],[13,13],[15,14],[16,16],[16,18],[15,20],[12,21],[8,21]] },
- '9': { width: 20, points: [[16,14],[15,11],[13,9],[10,8],[9,8],[6,9],[4,11],[3,14],[3,15],[4,18],[6,20],[9,21],[10,21],[13,20],[15,18],[16,14],[16,9],[15,4],[13,1],[10,0],[8,0],[5,1],[4,3]] },
- ':': { width: 10, points: [[5,14],[4,13],[5,12],[6,13],[5,14],null,[5,2],[4,1],[5,0],[6,1],[5,2]] },
- ';': { width: 10, points: [[5,14],[4,13],[5,12],[6,13],[5,14],null,[6,1],[5,0],[4,1],[5,2],[6,1],[6,-1],[5,-3],[4,-4]] },
- '<': { width: 24, points: [[20,18],[4,9],[20,0]] },
- '=': { width: 26, points: [[4,12],[22,12],null,[4,6],[22,6]] },
- '>': { width: 24, points: [[4,18],[20,9],[4,0]] },
- '?': { width: 18, points: [[3,16],[3,17],[4,19],[5,20],[7,21],[11,21],[13,20],[14,19],[15,17],[15,15],[14,13],[13,12],[9,10],[9,7],null,[9,2],[8,1],[9,0],[10,1],[9,2]] },
- '@': { width: 27, points: [[18,13],[17,15],[15,16],[12,16],[10,15],[9,14],[8,11],[8,8],[9,6],[11,5],[14,5],[16,6],[17,8],null,[12,16],[10,14],[9,11],[9,8],[10,6],[11,5],null,[18,16],[17,8],[17,6],[19,5],[21,5],[23,7],[24,10],[24,12],[23,15],[22,17],[20,19],[18,20],[15,21],[12,21],[9,20],[7,19],[5,17],[4,15],[3,12],[3,9],[4,6],[5,4],[7,2],[9,1],[12,0],[15,0],[18,1],[20,2],[21,3],null,[19,16],[18,8],[18,6],[19,5]] },
- 'A': { width: 18, points: [[9,21],[1,0],null,[9,21],[17,0],null,[4,7],[14,7]] },
- 'B': { width: 21, points: [[4,21],[4,0],null,[4,21],[13,21],[16,20],[17,19],[18,17],[18,15],[17,13],[16,12],[13,11],null,[4,11],[13,11],[16,10],[17,9],[18,7],[18,4],[17,2],[16,1],[13,0],[4,0]] },
- 'C': { width: 21, points: [[18,16],[17,18],[15,20],[13,21],[9,21],[7,20],[5,18],[4,16],[3,13],[3,8],[4,5],[5,3],[7,1],[9,0],[13,0],[15,1],[17,3],[18,5]] },
- 'D': { width: 21, points: [[4,21],[4,0],null,[4,21],[11,21],[14,20],[16,18],[17,16],[18,13],[18,8],[17,5],[16,3],[14,1],[11,0],[4,0]] },
- 'E': { width: 19, points: [[4,21],[4,0],null,[4,21],[17,21],null,[4,11],[12,11],null,[4,0],[17,0]] },
- 'F': { width: 18, points: [[4,21],[4,0],null,[4,21],[17,21],null,[4,11],[12,11]] },
- 'G': { width: 21, points: [[18,16],[17,18],[15,20],[13,21],[9,21],[7,20],[5,18],[4,16],[3,13],[3,8],[4,5],[5,3],[7,1],[9,0],[13,0],[15,1],[17,3],[18,5],[18,8],null,[13,8],[18,8]] },
- 'H': { width: 22, points: [[4,21],[4,0],null,[18,21],[18,0],null,[4,11],[18,11]] },
- 'I': { width: 8, points: [[4,21],[4,0]] },
- 'J': { width: 16, points: [[12,21],[12,5],[11,2],[10,1],[8,0],[6,0],[4,1],[3,2],[2,5],[2,7]] },
- 'K': { width: 21, points: [[4,21],[4,0],null,[18,21],[4,7],null,[9,12],[18,0]] },
- 'L': { width: 17, points: [[4,21],[4,0],null,[4,0],[16,0]] },
- 'M': { width: 24, points: [[4,21],[4,0],null,[4,21],[12,0],null,[20,21],[12,0],null,[20,21],[20,0]] },
- 'N': { width: 22, points: [[4,21],[4,0],null,[4,21],[18,0],null,[18,21],[18,0]] },
- 'O': { width: 22, points: [[9,21],[7,20],[5,18],[4,16],[3,13],[3,8],[4,5],[5,3],[7,1],[9,0],[13,0],[15,1],[17,3],[18,5],[19,8],[19,13],[18,16],[17,18],[15,20],[13,21],[9,21]] },
- 'P': { width: 21, points: [[4,21],[4,0],null,[4,21],[13,21],[16,20],[17,19],[18,17],[18,14],[17,12],[16,11],[13,10],[4,10]] },
- 'Q': { width: 22, points: [[9,21],[7,20],[5,18],[4,16],[3,13],[3,8],[4,5],[5,3],[7,1],[9,0],[13,0],[15,1],[17,3],[18,5],[19,8],[19,13],[18,16],[17,18],[15,20],[13,21],[9,21],null,[12,4],[18,-2]] },
- 'R': { width: 21, points: [[4,21],[4,0],null,[4,21],[13,21],[16,20],[17,19],[18,17],[18,15],[17,13],[16,12],[13,11],[4,11],null,[11,11],[18,0]] },
- 'S': { width: 20, points: [[17,18],[15,20],[12,21],[8,21],[5,20],[3,18],[3,16],[4,14],[5,13],[7,12],[13,10],[15,9],[16,8],[17,6],[17,3],[15,1],[12,0],[8,0],[5,1],[3,3]] },
- 'T': { width: 16, points: [[8,21],[8,0],null,[1,21],[15,21]] },
- 'U': { width: 22, points: [[4,21],[4,6],[5,3],[7,1],[10,0],[12,0],[15,1],[17,3],[18,6],[18,21]] },
- 'V': { width: 18, points: [[1,21],[9,0],null,[17,21],[9,0]] },
- 'W': { width: 24, points: [[2,21],[7,0],null,[12,21],[7,0],null,[12,21],[17,0],null,[22,21],[17,0]] },
- 'X': { width: 20, points: [[3,21],[17,0],null,[17,21],[3,0]] },
- 'Y': { width: 18, points: [[1,21],[9,11],[9,0],null,[17,21],[9,11]] },
- 'Z': { width: 20, points: [[17,21],[3,0],null,[3,21],[17,21],null,[3,0],[17,0]] },
- '[': { width: 14, points: [[4,25],[4,-7],null,[5,25],[5,-7],null,[4,25],[11,25],null,[4,-7],[11,-7]] },
- '\\':{ width: 14, points: [[0,21],[14,-3]] },
- ']': { width: 14, points: [[9,25],[9,-7],null,[10,25],[10,-7],null,[3,25],[10,25],null,[3,-7],[10,-7]] },
- '^': { width: 14, points: [[3,10],[8,18],[13,10]] },
- '_': { width: 16, points: [[0,-2],[16,-2]] },
- '`': { width: 10, points: [[6,21],[5,20],[4,18],[4,16],[5,15],[6,16],[5,17]] },
- 'a': { width: 19, points: [[15,14],[15,0],null,[15,11],[13,13],[11,14],[8,14],[6,13],[4,11],[3,8],[3,6],[4,3],[6,1],[8,0],[11,0],[13,1],[15,3]] },
- 'b': { width: 19, points: [[4,21],[4,0],null,[4,11],[6,13],[8,14],[11,14],[13,13],[15,11],[16,8],[16,6],[15,3],[13,1],[11,0],[8,0],[6,1],[4,3]] },
- 'c': { width: 18, points: [[15,11],[13,13],[11,14],[8,14],[6,13],[4,11],[3,8],[3,6],[4,3],[6,1],[8,0],[11,0],[13,1],[15,3]] },
- 'd': { width: 19, points: [[15,21],[15,0],null,[15,11],[13,13],[11,14],[8,14],[6,13],[4,11],[3,8],[3,6],[4,3],[6,1],[8,0],[11,0],[13,1],[15,3]] },
- 'e': { width: 18, points: [[3,8],[15,8],[15,10],[14,12],[13,13],[11,14],[8,14],[6,13],[4,11],[3,8],[3,6],[4,3],[6,1],[8,0],[11,0],[13,1],[15,3]] },
- 'f': { width: 12, points: [[10,21],[8,21],[6,20],[5,17],[5,0],null,[2,14],[9,14]] },
- 'g': { width: 19, points: [[15,14],[15,-2],[14,-5],[13,-6],[11,-7],[8,-7],[6,-6],null,[15,11],[13,13],[11,14],[8,14],[6,13],[4,11],[3,8],[3,6],[4,3],[6,1],[8,0],[11,0],[13,1],[15,3]] },
- 'h': { width: 19, points: [[4,21],[4,0],null,[4,10],[7,13],[9,14],[12,14],[14,13],[15,10],[15,0]] },
- 'i': { width: 8, points: [[3,21],[4,20],[5,21],[4,22],[3,21],null,[4,14],[4,0]] },
- 'j': { width: 10, points: [[5,21],[6,20],[7,21],[6,22],[5,21],null,[6,14],[6,-3],[5,-6],[3,-7],[1,-7]] },
- 'k': { width: 17, points: [[4,21],[4,0],null,[14,14],[4,4],null,[8,8],[15,0]] },
- 'l': { width: 8, points: [[4,21],[4,0]] },
- 'm': { width: 30, points: [[4,14],[4,0],null,[4,10],[7,13],[9,14],[12,14],[14,13],[15,10],[15,0],null,[15,10],[18,13],[20,14],[23,14],[25,13],[26,10],[26,0]] },
- 'n': { width: 19, points: [[4,14],[4,0],null,[4,10],[7,13],[9,14],[12,14],[14,13],[15,10],[15,0]] },
- 'o': { width: 19, points: [[8,14],[6,13],[4,11],[3,8],[3,6],[4,3],[6,1],[8,0],[11,0],[13,1],[15,3],[16,6],[16,8],[15,11],[13,13],[11,14],[8,14]] },
- 'p': { width: 19, points: [[4,14],[4,-7],null,[4,11],[6,13],[8,14],[11,14],[13,13],[15,11],[16,8],[16,6],[15,3],[13,1],[11,0],[8,0],[6,1],[4,3]] },
- 'q': { width: 19, points: [[15,14],[15,-7],null,[15,11],[13,13],[11,14],[8,14],[6,13],[4,11],[3,8],[3,6],[4,3],[6,1],[8,0],[11,0],[13,1],[15,3]] },
- 'r': { width: 13, points: [[4,14],[4,0],null,[4,8],[5,11],[7,13],[9,14],[12,14]] },
- 's': { width: 17, points: [[14,11],[13,13],[10,14],[7,14],[4,13],[3,11],[4,9],[6,8],[11,7],[13,6],[14,4],[14,3],[13,1],[10,0],[7,0],[4,1],[3,3]] },
- 't': { width: 12, points: [[5,21],[5,4],[6,1],[8,0],[10,0],null,[2,14],[9,14]] },
- 'u': { width: 19, points: [[4,14],[4,4],[5,1],[7,0],[10,0],[12,1],[15,4],null,[15,14],[15,0]] },
- 'v': { width: 16, points: [[2,14],[8,0],null,[14,14],[8,0]] },
- 'w': { width: 22, points: [[3,14],[7,0],null,[11,14],[7,0],null,[11,14],[15,0],null,[19,14],[15,0]] },
- 'x': { width: 17, points: [[3,14],[14,0],null,[14,14],[3,0]] },
- 'y': { width: 16, points: [[2,14],[8,0],null,[14,14],[8,0],[6,-4],[4,-6],[2,-7],[1,-7]] },
- 'z': { width: 17, points: [[14,14],[3,0],null,[3,14],[14,14],null,[3,0],[14,0]] },
- '{': { width: 14, points: [[9,25],[7,24],[6,23],[5,21],[5,19],[6,17],[7,16],[8,14],[8,12],[6,10],null,[7,24],[6,22],[6,20],[7,18],[8,17],[9,15],[9,13],[8,11],[4,9],[8,7],[9,5],[9,3],[8,1],[7,0],[6,-2],[6,-4],[7,-6],null,[6,8],[8,6],[8,4],[7,2],[6,1],[5,-1],[5,-3],[6,-5],[7,-6],[9,-7]] },
- '|': { width: 8, points: [[4,25],[4,-7]] },
- '}': { width: 14, points: [[5,25],[7,24],[8,23],[9,21],[9,19],[8,17],[7,16],[6,14],[6,12],[8,10],null,[7,24],[8,22],[8,20],[7,18],[6,17],[5,15],[5,13],[6,11],[10,9],[6,7],[5,5],[5,3],[6,1],[7,0],[8,-2],[8,-4],[7,-6],null,[8,8],[6,6],[6,4],[7,2],[8,1],[9,-1],[9,-3],[8,-5],[7,-6],[5,-7]] },
- '~': { width: 24, points: [[3,6],[3,8],[4,11],[6,12],[8,12],[10,11],[14,8],[16,7],[18,7],[20,8],[21,10],null,[3,8],[4,10],[6,11],[8,11],[10,10],[14,7],[16,6],[18,6],[20,7],[21,10],[21,12]] },
- },
-
- specialchars: {
- 'pi': { width: 19, points: [[6,14],[6,0],null,[14,14],[14,0],null,[2,13],[6,16],[13,13],[17,16]] }
- },
-
- /** Diacritics, used to draw accentuated letters */
- diacritics: {
- '`': { entity: 'grave', points: [[7,22],[12,19]] },
- '^': { entity: 'circ', points: [[5.5,19],[9.5,23],[12.5,19]] },
- '~': { entity: 'tilde', points: [[4,18],[7,22],[10,18],[13,22]] }
- },
-
- /** The default font styling */
- style: {
- size: 8, // font height in pixels
- font: null, // not yet implemented
- color: '#000000', //
- weight: 1, // float, 1 for 'normal'
- halign: 'l', // l: left, r: right, c: center
- valign: 'b', // t: top, m: middle, b: bottom
- adjustAlign: false, // modifies the alignments if the angle is different from 0 to make the spin point always at the good position
- angle: 0, // in radians, anticlockwise
- tracking: 1, // space between the letters, float, 1 for 'normal'
- boundingBoxColor: '#ff0000', //null // color of the bounding box (null to hide), can be used for debug and font drawing
- originPointColor: '#000000' //null // color of the bounding box (null to hide), can be used for debug and font drawing
- },
-
- debug: false,
- _bufferLexemes: {},
-
- /** Get the letter data corresponding to a char
- * @param {String} ch - The char
- */
- letter: function(ch) {
- return CanvasText.letters[ch];
- },
-
- parseLexemes: function(str) {
- if (CanvasText._bufferLexemes[str])
- return CanvasText._bufferLexemes[str];
-
- var i, c, matches = str.match(/&[A-Za-z]{2,5};|\s|./g);
- var result = [], chars = [];
- for (i = 0; i < matches.length; i++) {
- c = matches[i];
- if (c.length == 1)
- chars.push(c);
- else {
- var entity = c.substring(1, c.length-1);
- if (CanvasText.specialchars[entity])
- chars.push(entity);
- else
- chars = chars.concat(c.toArray());
- }
- }
- for (i = 0; i < chars.length; i++) {
- c = chars[i];
- if (c = CanvasText.letters[c] || CanvasText.specialchars[c])
- result.push(c);
- }
- return CanvasText._bufferLexemes[str] = result.compact();
- },
-
- /** Get the font ascent for a given style
- * @param {Object} style - The reference style
- */
- ascent: function(style) {
- style = style || {};
- return (style.size || CanvasText.style.size);
- },
-
- /** Get the font descent for a given style
- * @param {Object} style - The reference style
- * */
- descent: function(style) {
- style = style || {};
- return 7.0*(style.size || CanvasText.style.size)/25.0;
- },
-
- /** Measure the text horizontal size
- * @param {String} str - The text
- * @param {Object} style - Text style
- * */
- measure: function(str, style) {
- if (!str) return;
- style = style || {};
-
- var i, width, lexemes = CanvasText.parseLexemes(str),
- total = 0;
-
- for (i = lexemes.length-1; i > -1; --i) {
- c = lexemes[i];
- width = (c.diacritic) ? CanvasText.letter(c.letter).width : c.width;
- total += width * (style.tracking || CanvasText.style.tracking) * (style.size || CanvasText.style.size) / 25.0;
- }
- return total;
- },
-
- getDimensions: function(str, style) {
- var width = CanvasText.measure(str, style),
- height = style.size || CanvasText.style.size,
- angle = style.angle || CanvasText.style.angle;
-
- if (style.angle == 0) return {width: width, height: height};
- return {
- width: Math.abs(Math.cos(angle) * width) + Math.abs(Math.sin(angle) * height),
- height: Math.abs(Math.sin(angle) * width) + Math.abs(Math.cos(angle) * height)
- }
- },
-
- getBestAlign: function(angle, style) {
- angle += CanvasText.getAngleFromAlign(style.halign, style.valign);
- var a = {h:'c', v:'m'};
- if (Math.round(Math.cos(angle)*1000)/1000 != 0)
- a.h = (Math.cos(angle) > 0 ? 'r' : 'l');
-
- if (Math.round(Math.sin(angle)*1000)/1000 != 0)
- a.v = (Math.sin(angle) > 0 ? 't' : 'b');
- return a;
- },
-
- getAngleFromAlign: function(halign, valign) {
- var pi = Math.PI, table = {
- 'rm': 0,
- 'rt': pi/4,
- 'ct': pi/2,
- 'lt': 3*(pi/4),
- 'lm': pi,
- 'lb': -3*(pi/4),
- 'cb': -pi/2,
- 'rb': -pi/4,
- 'cm': 0
- }
- return table[halign+valign];
- },
-
- /** Draws serie of points at given coordinates
- * @param {Canvas context} ctx - The canvas context
- * @param {Array} points - The points to draw
- * @param {Number} x - The X coordinate
- * @param {Number} y - The Y coordinate
- * @param {Number} mag - The scale
- */
- drawPoints: function (ctx, points, x, y, mag, offset) {
- var i, a, penUp = true, needStroke = 0;
- offset = offset || {x:0, y:0};
-
- ctx.beginPath();
- for (i = 0; i < points.length; i++) {
- a = points[i];
- if (!a) {
- penUp = true;
- continue;
- }
- if (penUp) {
- ctx.moveTo(x + a[0]*mag + offset.x, y - a[1]*mag + offset.y);
- penUp = false;
- }
- else {
- ctx.lineTo(x + a[0]*mag + offset.x, y - a[1]*mag + offset.y);
- }
- }
- ctx.stroke();
- },
-
- /** Draws a text at given coordinates and with a given style
- * @param {Canvas context} ctx - The canvas context
- * @param {String} str - The text to draw
- * @param {Number} xOrig - The X coordinate
- * @param {Number} yOrig - The Y coordinate
- * @param {Object} style - The font style
- */
- draw: function(ctx, str, xOrig, yOrig, style) {
- if (!str) return;
- style = style || CanvasText.style;
- style.halign = style.halign || CanvasText.style.halign;
- style.valign = style.valign || CanvasText.style.valign;
- style.angle = style.angle || CanvasText.style.angle;
- style.size = style.size || CanvasText.style.size;
- style.adjustAlign = style.adjustAlign || CanvasText.style.adjustAlign;
-
- var i, c, total = 0,
- mag = style.size / 25.0,
- x = 0, y = 0,
- lexemes = CanvasText.parseLexemes(str);
-
- var offset = {x:0, y:0},
- measure = CanvasText.measure(str, style),
- align;
-
- if (style.adjustAlign) {
- align = CanvasText.getBestAlign(style.angle, style);
- style.halign = align.h;
- style.valign = align.v;
- }
-
- switch (style.halign) {
- case 'l': break;
- case 'c': offset.x = -measure / 2; break;
- case 'r': offset.x = -measure; break;
- }
-
- switch (style.valign) {
- case 'b': break;
- case 'm': offset.y = style.size / 2; break;
- case 't': offset.y = style.size; break;
- }
-
- ctx.save();
- ctx.translate(xOrig, yOrig);
- ctx.rotate(style.angle);
- ctx.lineCap = "round";
- ctx.lineWidth = 2.0 * mag * (style.weight || CanvasText.style.weight);
- ctx.strokeStyle = style.color || CanvasText.style.color;
-
- for (i = 0; i < lexemes.length; i++) {
- c = lexemes[i];
- if (c.width == -1) {
- x = 0;
- y = style.size * 1.4;
- continue;
- }
-
- var points = c.points,
- width = c.width;
-
- if (c.diacritic) {
- var dia = CanvasText.diacritics[c.diacritic];
- var char = CanvasText.letter(c.letter);
-
- CanvasText.drawPoints(ctx, dia.points, x, y - (c.letter.toUpperCase() == c.letter ? 3 : 0), mag, offset);
- points = char.points;
- width = char.width;
- }
-
- CanvasText.drawPoints(ctx, points, x, y, mag, offset);
-
- if (CanvasText.debug) {
- ctx.save();
- ctx.lineJoin = "miter";
- ctx.lineWidth = 0.5;
- ctx.strokeStyle = (style.boundingBoxColor || CanvasText.style.boundingBoxColor);
- ctx.strokeRect(x+offset.x, y+offset.y, width*mag, -style.size);
-
- ctx.fillStyle = (style.originPointColor || CanvasText.style.originPointColor);
- ctx.beginPath();
- ctx.arc(0, 0, 1.5, 0, Math.PI*2, true);
- ctx.fill();
-
- ctx.restore();
- }
-
- x += width*mag*(style.tracking || CanvasText.style.tracking);
- }
- ctx.restore();
- return total;
- },
-
- /** Enables the text function for a Canvas context
- * @param {Canvas context} ctx - The canvas context
- */
- enable: function(ctx) {
- ctx.drawText = function(text, x, y, style) { return CanvasText.draw(ctx, text, x, y, style); };
- ctx.measureText = function(text, style) { return CanvasText.measure(text, style); };
- ctx.getTextBounds = function(text, style) { return CanvasText.getDimensions(text, style); };
- ctx.fontAscent = function(style) { return CanvasText.ascent(style); };
- ctx.fontDescent = function(style) { return CanvasText.descent(style); };
- }
-};
+
--- a/js/flotr/lib/excanvas.js
+++ /dev/null
@@ -1,885 +1,1 @@
-// Copyright 2006 Google Inc.
-//
-// Licensed under the Apache License, Version 2.0 (the "License");
-// you may not use this file except in compliance with the License.
-// You may obtain a copy of the License at
-//
-// http://www.apache.org/licenses/LICENSE-2.0
-//
-// Unless required by applicable law or agreed to in writing, software
-// distributed under the License is distributed on an "AS IS" BASIS,
-// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
-// See the License for the specific language governing permissions and
-// limitations under the License.
-
-// Known Issues:
-//
-// * Patterns are not implemented.
-// * Radial gradient are not implemented. The VML version of these look very
-// different from the canvas one.
-// * Clipping paths are not implemented.
-// * Coordsize. The width and height attribute have higher priority than the
-// width and height style values which isn't correct.
-// * Painting mode isn't implemented.
-// * Canvas width/height should is using content-box by default. IE in
-// Quirks mode will draw the canvas using border-box. Either change your
-// doctype to HTML5
-// (http://www.whatwg.org/specs/web-apps/current-work/#the-doctype)
-// or use Box Sizing Behavior from WebFX
-// (http://webfx.eae.net/dhtml/boxsizing/boxsizing.html)
-// * Non uniform scaling does not correctly scale strokes.
-// * Optimize. There is always room for speed improvements.
-
-// Only add this code if we do not already have a canvas implementation
-if (!document.createElement('canvas').getContext) {
-
-(function() {
-
- // alias some functions to make (compiled) code shorter
- var m = Math;
- var mr = m.round;
- var ms = m.sin;
- var mc = m.cos;
- var abs = m.abs;
- var sqrt = m.sqrt;
-
- // this is used for sub pixel precision
- var Z = 10;
- var Z2 = Z / 2;
-
- /**
- * This funtion is assigned to the <canvas> elements as element.getContext().
- * @this {HTMLElement}
- * @return {CanvasRenderingContext2D_}
- */
- function getContext() {
- return this.context_ ||
- (this.context_ = new CanvasRenderingContext2D_(this));
- }
-
- var slice = Array.prototype.slice;
-
- /**
- * Binds a function to an object. The returned function will always use the
- * passed in {@code obj} as {@code this}.
- *
- * Example:
- *
- * g = bind(f, obj, a, b)
- * g(c, d) // will do f.call(obj, a, b, c, d)
- *
- * @param {Function} f The function to bind the object to
- * @param {Object} obj The object that should act as this when the function
- * is called
- * @param {*} var_args Rest arguments that will be used as the initial
- * arguments when the function is called
- * @return {Function} A new function that has bound this
- */
- function bind(f, obj, var_args) {
- var a = slice.call(arguments, 2);
- return function() {
- return f.apply(obj, a.concat(slice.call(arguments)));
- };
- }
-
- var G_vmlCanvasManager_ = {
- init: function(opt_doc) {
- if (/MSIE/.test(navigator.userAgent) && !window.opera) {
- var doc = opt_doc || document;
- // Create a dummy element so that IE will allow canvas elements to be
- // recognized.
- doc.createElement('canvas');
- doc.attachEvent('onreadystatechange', bind(this.init_, this, doc));
- }
- },
-
- init_: function(doc) {
- // create xmlns
- if (!doc.namespaces['g_vml_']) {
- doc.namespaces.add('g_vml_', 'urn:schemas-microsoft-com:vml',
- '#default#VML');
-
- }
- if (!doc.namespaces['g_o_']) {
- doc.namespaces.add('g_o_', 'urn:schemas-microsoft-com:office:office',
- '#default#VML');
- }
-
- // Setup default CSS. Only add one style sheet per document
- if (!doc.styleSheets['ex_canvas_']) {
- var ss = doc.createStyleSheet();
- ss.owningElement.id = 'ex_canvas_';
- ss.cssText = 'canvas{display:inline-block;overflow:hidden;' +
- // default size is 300x150 in Gecko and Opera
- 'text-align:left;width:300px;height:150px}' +
- 'g_vml_\\:*{behavior:url(#default#VML)}' +
- 'g_o_\\:*{behavior:url(#default#VML)}';
-
- }
-
- // find all canvas elements
- var els = doc.getElementsByTagName('canvas');
- for (var i = 0; i < els.length; i++) {
- this.initElement(els[i]);
- }
- },
-
- /**
- * Public initializes a canvas element so that it can be used as canvas
- * element from now on. This is called automatically before the page is
- * loaded but if you are creating elements using createElement you need to
- * make sure this is called on the element.
- * @param {HTMLElement} el The canvas element to initialize.
- * @return {HTMLElement} the element that was created.
- */
- initElement: function(el) {
- if (!el.getContext) {
-
- el.getContext = getContext;
-
- // Remove fallback content. There is no way to hide text nodes so we
- // just remove all childNodes. We could hide all elements and remove
- // text nodes but who really cares about the fallback content.
- el.innerHTML = '';
-
- // do not use inline function because that will leak memory
- el.attachEvent('onpropertychange', onPropertyChange);
- el.attachEvent('onresize', onResize);
-
- var attrs = el.attributes;
- if (attrs.width && attrs.width.specified) {
- // TODO: use runtimeStyle and coordsize
- // el.getContext().setWidth_(attrs.width.nodeValue);
- el.style.width = attrs.width.nodeValue + 'px';
- } else {
- el.width = el.clientWidth;
- }
- if (attrs.height && attrs.height.specified) {
- // TODO: use runtimeStyle and coordsize
- // el.getContext().setHeight_(attrs.height.nodeValue);
- el.style.height = attrs.height.nodeValue + 'px';
- } else {
- el.height = el.clientHeight;
- }
- //el.getContext().setCoordsize_()
- }
- return el;
- }
- };
-
- function onPropertyChange(e) {
- var el = e.srcElement;
-
- switch (e.propertyName) {
- case 'width':
- el.style.width = el.attributes.width.nodeValue + 'px';
- el.getContext().clearRect();
- break;
- case 'height':
- el.style.height = el.attributes.height.nodeValue + 'px';
- el.getContext().clearRect();
- break;
- }
- }
-
- function onResize(e) {
- var el = e.srcElement;
- if (el.firstChild) {
- el.firstChild.style.width = el.clientWidth + 'px';
- el.firstChild.style.height = el.clientHeight + 'px';
- }
- }
-
- G_vmlCanvasManager_.init();
-
- // precompute "00" to "FF"
- var dec2hex = [];
- for (var i = 0; i < 16; i++) {
- for (var j = 0; j < 16; j++) {
- dec2hex[i * 16 + j] = i.toString(16) + j.toString(16);
- }
- }
-
- function createMatrixIdentity() {
- return [
- [1, 0, 0],
- [0, 1, 0],
- [0, 0, 1]
- ];
- }
-
- function matrixMultiply(m1, m2) {
- var result = createMatrixIdentity();
-
- for (var x = 0; x < 3; x++) {
- for (var y = 0; y < 3; y++) {
- var sum = 0;
-
- for (var z = 0; z < 3; z++) {
- sum += m1[x][z] * m2[z][y];
- }
-
- result[x][y] = sum;
- }
- }
- return result;
- }
-
- function copyState(o1, o2) {
- o2.fillStyle = o1.fillStyle;
- o2.lineCap = o1.lineCap;
- o2.lineJoin = o1.lineJoin;
- o2.lineWidth = o1.lineWidth;
- o2.miterLimit = o1.miterLimit;
- o2.shadowBlur = o1.shadowBlur;
- o2.shadowColor = o1.shadowColor;
- o2.shadowOffsetX = o1.shadowOffsetX;
- o2.shadowOffsetY = o1.shadowOffsetY;
- o2.strokeStyle = o1.strokeStyle;
- o2.globalAlpha = o1.globalAlpha;
- o2.arcScaleX_ = o1.arcScaleX_;
- o2.arcScaleY_ = o1.arcScaleY_;
- o2.lineScale_ = o1.lineScale_;
- }
-
- function processStyle(styleString) {
- var str, alpha = 1;
-
- styleString = String(styleString);
- if (styleString.substring(0, 3) == 'rgb') {
- var start = styleString.indexOf('(', 3);
- var end = styleString.indexOf(')', start + 1);
- var guts = styleString.substring(start + 1, end).split(',');
-
- str = '#';
- for (var i = 0; i < 3; i++) {
- str += dec2hex[Number(guts[i])];
- }
-
- if (guts.length == 4 && styleString.substr(3, 1) == 'a') {
- alpha = guts[3];
- }
- } else {
- str = styleString;
- }
-
- return {color: str, alpha: alpha};
- }
-
- function processLineCap(lineCap) {
- switch (lineCap) {
- case 'butt':
- return 'flat';
- case 'round':
- return 'round';
- case 'square':
- default:
- return 'square';
- }
- }
-
- /**
- * This class implements CanvasRenderingContext2D interface as described by
- * the WHATWG.
- * @param {HTMLElement} surfaceElement The element that the 2D context should
- * be associated with
- */
- function CanvasRenderingContext2D_(surfaceElement) {
- this.m_ = createMatrixIdentity();
-
- this.mStack_ = [];
- this.aStack_ = [];
- this.currentPath_ = [];
-
- // Canvas context properties
- this.strokeStyle = '#000';
- this.fillStyle = '#000';
-
- this.lineWidth = 1;
- this.lineJoin = 'miter';
- this.lineCap = 'butt';
- this.miterLimit = Z * 1;
- this.globalAlpha = 1;
- this.canvas = surfaceElement;
-
- var el = surfaceElement.ownerDocument.createElement('div');
- el.style.width = surfaceElement.clientWidth + 'px';
- el.style.height = surfaceElement.clientHeight + 'px';
- el.style.overflow = 'hidden';
- el.style.position = 'absolute';
- surfaceElement.appendChild(el);
-
- this.element_ = el;
- this.arcScaleX_ = 1;
- this.arcScaleY_ = 1;
- this.lineScale_ = 1;
- }
-
- var contextPrototype = CanvasRenderingContext2D_.prototype;
- contextPrototype.clearRect = function() {
- this.element_.innerHTML = '';
- };
-
- contextPrototype.beginPath = function() {
- // TODO: Branch current matrix so that save/restore has no effect
- // as per safari docs.
- this.currentPath_ = [];
- };
-
- contextPrototype.moveTo = function(aX, aY) {
- var p = this.getCoords_(aX, aY);
- this.currentPath_.push({type: 'moveTo', x: p.x, y: p.y});
- this.currentX_ = p.x;
- this.currentY_ = p.y;
- };
-
- contextPrototype.lineTo = function(aX, aY) {
- var p = this.getCoords_(aX, aY);
- this.currentPath_.push({type: 'lineTo', x: p.x, y: p.y});
-
- this.currentX_ = p.x;
- this.currentY_ = p.y;
- };
-
- contextPrototype.bezierCurveTo = function(aCP1x, aCP1y,
- aCP2x, aCP2y,
- aX, aY) {
- var p = this.getCoords_(aX, aY);
- var cp1 = this.getCoords_(aCP1x, aCP1y);
- var cp2 = this.getCoords_(aCP2x, aCP2y);
- bezierCurveTo(this, cp1, cp2, p);
- };
-
- // Helper function that takes the already fixed cordinates.
- function bezierCurveTo(self, cp1, cp2, p) {
- self.currentPath_.push({
- type: 'bezierCurveTo',
- cp1x: cp1.x,
- cp1y: cp1.y,
- cp2x: cp2.x,
- cp2y: cp2.y,
- x: p.x,
- y: p.y
- });
- self.currentX_ = p.x;
- self.currentY_ = p.y;
- }
-
- contextPrototype.quadraticCurveTo = function(aCPx, aCPy, aX, aY) {
- // the following is lifted almost directly from
- // http://developer.mozilla.org/en/docs/Canvas_tutorial:Drawing_shapes
-
- var cp = this.getCoords_(aCPx, aCPy);
- var p = this.getCoords_(aX, aY);
-
- var cp1 = {
- x: this.currentX_ + 2.0 / 3.0 * (cp.x - this.currentX_),
- y: this.currentY_ + 2.0 / 3.0 * (cp.y - this.currentY_)
- };
- var cp2 = {
- x: cp1.x + (p.x - this.currentX_) / 3.0,
- y: cp1.y + (p.y - this.currentY_) / 3.0
- };
-
- bezierCurveTo(this, cp1, cp2, p);
- };
-
- contextPrototype.arc = function(aX, aY, aRadius,
- aStartAngle, aEndAngle, aClockwise) {
- aRadius *= Z;
- var arcType = aClockwise ? 'at' : 'wa';
-
- var xStart = aX + mc(aStartAngle) * aRadius - Z2;
- var yStart = aY + ms(aStartAngle) * aRadius - Z2;
-
- var xEnd = aX + mc(aEndAngle) * aRadius - Z2;
- var yEnd = aY + ms(aEndAngle) * aRadius - Z2;
-
- // IE won't render arches drawn counter clockwise if xStart == xEnd.
- if (xStart == xEnd && !aClockwise) {
- xStart += 0.125; // Offset xStart by 1/80 of a pixel. Use something
- // that can be represented in binary
- }
-
- var p = this.getCoords_(aX, aY);
- var pStart = this.getCoords_(xStart, yStart);
- var pEnd = this.getCoords_(xEnd, yEnd);
-
- this.currentPath_.push({type: arcType,
- x: p.x,
- y: p.y,
- radius: aRadius,
- xStart: pStart.x,
- yStart: pStart.y,
- xEnd: pEnd.x,
- yEnd: pEnd.y});
-
- };
-
- contextPrototype.rect = function(aX, aY, aWidth, aHeight) {
- this.moveTo(aX, aY);
- this.lineTo(aX + aWidth, aY);
- this.lineTo(aX + aWidth, aY + aHeight);
- this.lineTo(aX, aY + aHeight);
- this.closePath();
- };
-
- contextPrototype.strokeRect = function(aX, aY, aWidth, aHeight) {
- var oldPath = this.currentPath_;
- this.beginPath();
-
- this.moveTo(aX, aY);
- this.lineTo(aX + aWidth, aY);
- this.lineTo(aX + aWidth, aY + aHeight);
- this.lineTo(aX, aY + aHeight);
- this.closePath();
- this.stroke();
-
- this.currentPath_ = oldPath;
- };
-
- contextPrototype.fillRect = function(aX, aY, aWidth, aHeight) {
- var oldPath = this.currentPath_;
- this.beginPath();
-
- this.moveTo(aX, aY);
- this.lineTo(aX + aWidth, aY);
- this.lineTo(aX + aWidth, aY + aHeight);
- this.lineTo(aX, aY + aHeight);
- this.closePath();
- this.fill();
-
- this.currentPath_ = oldPath;
- };
-
- contextPrototype.createLinearGradient = function(aX0, aY0, aX1, aY1) {
- var gradient = new CanvasGradient_('gradient');
- gradient.x0_ = aX0;
- gradient.y0_ = aY0;
- gradient.x1_ = aX1;
- gradient.y1_ = aY1;
- return gradient;
- };
-
- contextPrototype.createRadialGradient = function(aX0, aY0, aR0,
- aX1, aY1, aR1) {
- var gradient = new CanvasGradient_('gradientradial');
- gradient.x0_ = aX0;
- gradient.y0_ = aY0;
- gradient.r0_ = aR0;
- gradient.x1_ = aX1;
- gradient.y1_ = aY1;
- gradient.r1_ = aR1;
- return gradient;
- };
-
- contextPrototype.drawImage = function(image, var_args) {
- var dx, dy, dw, dh, sx, sy, sw, sh;
-
- // to find the original width we overide the width and height
- var oldRuntimeWidth = image.runtimeStyle.width;
- var oldRuntimeHeight = image.runtimeStyle.height;
- image.runtimeStyle.width = 'auto';
- image.runtimeStyle.height = 'auto';
-
- // get the original size
- var w = image.width;
- var h = image.height;
-
- // and remove overides
- image.runtimeStyle.width = oldRuntimeWidth;
- image.runtimeStyle.height = oldRuntimeHeight;
-
- if (arguments.length == 3) {
- dx = arguments[1];
- dy = arguments[2];
- sx = sy = 0;
- sw = dw = w;
- sh = dh = h;
- } else if (arguments.length == 5) {
- dx = arguments[1];
- dy = arguments[2];
- dw = arguments[3];
- dh = arguments[4];
- sx = sy = 0;
- sw = w;
- sh = h;
- } else if (arguments.length == 9) {
- sx = arguments[1];
- sy = arguments[2];
- sw = arguments[3];
- sh = arguments[4];
- dx = arguments[5];
- dy = arguments[6];
- dw = arguments[7];
- dh = arguments[8];
- } else {
- throw Error('Invalid number of arguments');
- }
-
- var d = this.getCoords_(dx, dy);
-
- var w2 = sw / 2;
- var h2 = sh / 2;
-
- var vmlStr = [];
-
- var W = 10;
- var H = 10;
-
- // For some reason that I've now forgotten, using divs didn't work
- vmlStr.push(' <g_vml_:group',
- ' coordsize="', Z * W, ',', Z * H, '"',
- ' coordorigin="0,0"' ,
- ' style="width:', W, 'px;height:', H, 'px;position:absolute;');
-
- // If filters are necessary (rotation exists), create them
- // filters are bog-slow, so only create them if abbsolutely necessary
- // The following check doesn't account for skews (which don't exist
- // in the canvas spec (yet) anyway.
-
- if (this.m_[0][0] != 1 || this.m_[0][1]) {
- var filter = [];
-
- // Note the 12/21 reversal
- filter.push('M11=', this.m_[0][0], ',',
- 'M12=', this.m_[1][0], ',',
- 'M21=', this.m_[0][1], ',',
- 'M22=', this.m_[1][1], ',',
- 'Dx=', mr(d.x / Z), ',',
- 'Dy=', mr(d.y / Z), '');
-
- // Bounding box calculation (need to minimize displayed area so that
- // filters don't waste time on unused pixels.
- var max = d;
- var c2 = this.getCoords_(dx + dw, dy);
- var c3 = this.getCoords_(dx, dy + dh);
- var c4 = this.getCoords_(dx + dw, dy + dh);
-
- max.x = m.max(max.x, c2.x, c3.x, c4.x);
- max.y = m.max(max.y, c2.y, c3.y, c4.y);
-
- vmlStr.push('padding:0 ', mr(max.x / Z), 'px ', mr(max.y / Z),
- 'px 0;filter:progid:DXImageTransform.Microsoft.Matrix(',
- filter.join(''), ", sizingmethod='clip');")
- } else {
- vmlStr.push('top:', mr(d.y / Z), 'px;left:', mr(d.x / Z), 'px;');
- }
-
- vmlStr.push(' ">' ,
- '<g_vml_:image src="', image.src, '"',
- ' style="width:', Z * dw, 'px;',
- ' height:', Z * dh, 'px;"',
- ' cropleft="', sx / w, '"',
- ' croptop="', sy / h, '"',
- ' cropright="', (w - sx - sw) / w, '"',
- ' cropbottom="', (h - sy - sh) / h, '"',
- ' />',
- '</g_vml_:group>');
-
- this.element_.insertAdjacentHTML('BeforeEnd',
- vmlStr.join(''));
- };
-
- contextPrototype.stroke = function(aFill) {
- var lineStr = [];
- var lineOpen = false;
- var a = processStyle(aFill ? this.fillStyle : this.strokeStyle);
- var color = a.color;
- var opacity = a.alpha * this.globalAlpha;
-
- var W = 10;
- var H = 10;
-
- lineStr.push('<g_vml_:shape',
- ' filled="', !!aFill, '"',
- ' style="position:absolute;width:', W, 'px;height:', H, 'px;"',
- ' coordorigin="0 0" coordsize="', Z * W, ' ', Z * H, '"',
- ' stroked="', !aFill, '"',
- ' path="');
-
- var newSeq = false;
- var min = {x: null, y: null};
- var max = {x: null, y: null};
-
- for (var i = 0; i < this.currentPath_.length; i++) {
- var p = this.currentPath_[i];
- var c;
-
- switch (p.type) {
- case 'moveTo':
- c = p;
- lineStr.push(' m ', mr(p.x), ',', mr(p.y));
- break;
- case 'lineTo':
- lineStr.push(' l ', mr(p.x), ',', mr(p.y));
- break;
- case 'close':
- lineStr.push(' x ');
- p = null;
- break;
- case 'bezierCurveTo':
- lineStr.push(' c ',
- mr(p.cp1x), ',', mr(p.cp1y), ',',
- mr(p.cp2x), ',', mr(p.cp2y), ',',
- mr(p.x), ',', mr(p.y));
- break;
- case 'at':
- case 'wa':
- lineStr.push(' ', p.type, ' ',
- mr(p.x - this.arcScaleX_ * p.radius), ',',
- mr(p.y - this.arcScaleY_ * p.radius), ' ',
- mr(p.x + this.arcScaleX_ * p.radius), ',',
- mr(p.y + this.arcScaleY_ * p.radius), ' ',
- mr(p.xStart), ',', mr(p.yStart), ' ',
- mr(p.xEnd), ',', mr(p.yEnd));
- break;
- }
-
-
- // TODO: Following is broken for curves due to
- // move to proper paths.
-
- // Figure out dimensions so we can do gradient fills
- // properly
- if (p) {
- if (min.x == null || p.x < min.x) {
- min.x = p.x;
- }
- if (max.x == null || p.x > max.x) {
- max.x = p.x;
- }
- if (min.y == null || p.y < min.y) {
- min.y = p.y;
- }
- if (max.y == null || p.y > max.y) {
- max.y = p.y;
- }
- }
- }
- lineStr.push(' ">');
-
- if (!aFill) {
- var lineWidth = this.lineScale_ * this.lineWidth;
-
- // VML cannot correctly render a line if the width is less than 1px.
- // In that case, we dilute the color to make the line look thinner.
- if (lineWidth < 1) {
- opacity *= lineWidth;
- }
-
- lineStr.push(
- '<g_vml_:stroke',
- ' opacity="', opacity, '"',
- ' joinstyle="', this.lineJoin, '"',
- ' miterlimit="', this.miterLimit, '"',
- ' endcap="', processLineCap(this.lineCap), '"',
- ' weight="', lineWidth, 'px"',
- ' color="', color, '" />'
- );
- } else if (typeof this.fillStyle == 'object') {
- var fillStyle = this.fillStyle;
- var angle = 0;
- var focus = {x: 0, y: 0};
-
- // additional offset
- var shift = 0;
- // scale factor for offset
- var expansion = 1;
-
- if (fillStyle.type_ == 'gradient') {
- var x0 = fillStyle.x0_ / this.arcScaleX_;
- var y0 = fillStyle.y0_ / this.arcScaleY_;
- var x1 = fillStyle.x1_ / this.arcScaleX_;
- var y1 = fillStyle.y1_ / this.arcScaleY_;
- var p0 = this.getCoords_(x0, y0);
- var p1 = this.getCoords_(x1, y1);
- var dx = p1.x - p0.x;
- var dy = p1.y - p0.y;
- angle = Math.atan2(dx, dy) * 180 / Math.PI;
-
- // The angle should be a non-negative number.
- if (angle < 0) {
- angle += 360;
- }
-
- // Very small angles produce an unexpected result because they are
- // converted to a scientific notation string.
- if (angle < 1e-6) {
- angle = 0;
- }
- } else {
- var p0 = this.getCoords_(fillStyle.x0_, fillStyle.y0_);
- var width = max.x - min.x;
- var height = max.y - min.y;
- focus = {
- x: (p0.x - min.x) / width,
- y: (p0.y - min.y) / height
- };
-
- width /= this.arcScaleX_ * Z;
- height /= this.arcScaleY_ * Z;
- var dimension = m.max(width, height);
- shift = 2 * fillStyle.r0_ / dimension;
- expansion = 2 * fillStyle.r1_ / dimension - shift;
- }
-
- // We need to sort the color stops in ascending order by offset,
- // otherwise IE won't interpret it correctly.
- var stops = fillStyle.colors_;
- stops.sort(function(cs1, cs2) {
- return cs1.offset - cs2.offset;
- });
-
- var length = stops.length;
- var color1 = stops[0].color;
- var color2 = stops[length - 1].color;
- var opacity1 = stops[0].alpha * this.globalAlpha;
- var opacity2 = stops[length - 1].alpha * this.globalAlpha;
-
- var colors = [];
- for (var i = 0; i < length; i++) {
- var stop = stops[i];
- colors.push(stop.offset * expansion + shift + ' ' + stop.color);
- }
-
- // When colors attribute is used, the meanings of opacity and o:opacity2
- // are reversed.
- lineStr.push('<g_vml_:fill type="', fillStyle.type_, '"',
- ' method="none" focus="100%"',
- ' color="', color1, '"',
- ' color2="', color2, '"',
- ' colors="', colors.join(','), '"',
- ' opacity="', opacity2, '"',
- ' g_o_:opacity2="', opacity1, '"',
- ' angle="', angle, '"',
- ' focusposition="', focus.x, ',', focus.y, '" />');
- } else {
- lineStr.push('<g_vml_:fill color="', color, '" opacity="', opacity,
- '" />');
- }
-
- lineStr.push('</g_vml_:shape>');
-
- this.element_.insertAdjacentHTML('beforeEnd', lineStr.join(''));
- };
-
- contextPrototype.fill = function() {
- this.stroke(true);
- }
-
- contextPrototype.closePath = function() {
- this.currentPath_.push({type: 'close'});
- };
-
- /**
- * @private
- */
- contextPrototype.getCoords_ = function(aX, aY) {
- var m = this.m_;
- return {
- x: Z * (aX * m[0][0] + aY * m[1][0] + m[2][0]) - Z2,
- y: Z * (aX * m[0][1] + aY * m[1][1] + m[2][1]) - Z2
- }
- };
-
- contextPrototype.save = function() {
- var o = {};
- copyState(this, o);
- this.aStack_.push(o);
- this.mStack_.push(this.m_);
- this.m_ = matrixMultiply(createMatrixIdentity(), this.m_);
- };
-
- contextPrototype.restore = function() {
- copyState(this.aStack_.pop(), this);
- this.m_ = this.mStack_.pop();
- };
-
- contextPrototype.translate = function(aX, aY) {
- var m1 = [
- [1, 0, 0],
- [0, 1, 0],
- [aX, aY, 1]
- ];
-
- this.m_ = matrixMultiply(m1, this.m_);
- };
-
- contextPrototype.rotate = function(aRot) {
- var c = mc(aRot);
- var s = ms(aRot);
-
- var m1 = [
- [c, s, 0],
- [-s, c, 0],
- [0, 0, 1]
- ];
-
- this.m_ = matrixMultiply(m1, this.m_);
- };
-
- contextPrototype.scale = function(aX, aY) {
- this.arcScaleX_ *= aX;
- this.arcScaleY_ *= aY;
- var m1 = [
- [aX, 0, 0],
- [0, aY, 0],
- [0, 0, 1]
- ];
-
- var m = this.m_ = matrixMultiply(m1, this.m_);
-
- // Get the line scale.
- // Determinant of this.m_ means how much the area is enlarged by the
- // transformation. So its square root can be used as a scale factor
- // for width.
- var det = m[0][0] * m[1][1] - m[0][1] * m[1][0];
- this.lineScale_ = sqrt(abs(det));
- };
-
- /******** STUBS ********/
- contextPrototype.clip = function() {
- // TODO: Implement
- };
-
- contextPrototype.arcTo = function() {
- // TODO: Implement
- };
-
- contextPrototype.createPattern = function() {
- return new CanvasPattern_;
- };
-
- // Gradient / Pattern Stubs
- function CanvasGradient_(aType) {
- this.type_ = aType;
- this.x0_ = 0;
- this.y0_ = 0;
- this.r0_ = 0;
- this.x1_ = 0;
- this.y1_ = 0;
- this.r1_ = 0;
- this.colors_ = [];
- }
-
- CanvasGradient_.prototype.addColorStop = function(aOffset, aColor) {
- aColor = processStyle(aColor);
- this.colors_.push({offset: aOffset,
- color: aColor.color,
- alpha: aColor.alpha});
- };
-
- function CanvasPattern_() {}
-
- // set up externs
- G_vmlCanvasManager = G_vmlCanvasManager_;
- CanvasRenderingContext2D = CanvasRenderingContext2D_;
- CanvasGradient = CanvasGradient_;
- CanvasPattern = CanvasPattern_;
-
-})();
-
-} // if
-
--- a/js/flotr/lib/prototype-1.6.0.2.js
+++ /dev/null
@@ -1,4221 +1,1 @@
-/* Prototype JavaScript framework, version 1.6.0.2
- * (c) 2005-2008 Sam Stephenson
- *
- * Prototype is freely distributable under the terms of an MIT-style license.
- * For details, see the Prototype web site: http://www.prototypejs.org/
- *
- *--------------------------------------------------------------------------*/
-
-var Prototype = {
- Version: '1.6.0.2',
-
- Browser: {
- IE: !!(window.attachEvent && !window.opera),
- Opera: !!window.opera,
- WebKit: navigator.userAgent.indexOf('AppleWebKit/') > -1,
- Gecko: navigator.userAgent.indexOf('Gecko') > -1 && navigator.userAgent.indexOf('KHTML') == -1,
- MobileSafari: !!navigator.userAgent.match(/Apple.*Mobile.*Safari/)
- },
-
- BrowserFeatures: {
- XPath: !!document.evaluate,
- ElementExtensions: !!window.HTMLElement,
- SpecificElementExtensions:
- document.createElement('div').__proto__ &&
- document.createElement('div').__proto__ !==
- document.createElement('form').__proto__
- },
-
- ScriptFragment: '<script[^>]*>([\\S\\s]*?)<\/script>',
- JSONFilter: /^\/\*-secure-([\s\S]*)\*\/\s*$/,
-
- emptyFunction: function() { },
- K: function(x) { return x }
-};
-
-if (Prototype.Browser.MobileSafari)
- Prototype.BrowserFeatures.SpecificElementExtensions = false;
-
-
-/* Based on Alex Arnell's inheritance implementation. */
-var Class = {
- create: function() {
- var parent = null, properties = $A(arguments);
- if (Object.isFunction(properties[0]))
- parent = properties.shift();
-
- function klass() {
- this.initialize.apply(this, arguments);
- }
-
- Object.extend(klass, Class.Methods);
- klass.superclass = parent;
- klass.subclasses = [];
-
- if (parent) {
- var subclass = function() { };
- subclass.prototype = parent.prototype;
- klass.prototype = new subclass;
- parent.subclasses.push(klass);
- }
-
- for (var i = 0; i < properties.length; i++)
- klass.addMethods(properties[i]);
-
- if (!klass.prototype.initialize)
- klass.prototype.initialize = Prototype.emptyFunction;
-
- klass.prototype.constructor = klass;
-
- return klass;
- }
-};
-
-Class.Methods = {
- addMethods: function(source) {
- var ancestor = this.superclass && this.superclass.prototype;
- var properties = Object.keys(source);
-
- if (!Object.keys({ toString: true }).length)
- properties.push("toString", "valueOf");
-
- for (var i = 0, length = properties.length; i < length; i++) {
- var property = properties[i], value = source[property];
- if (ancestor && Object.isFunction(value) &&
- value.argumentNames().first() == "$super") {
- var method = value, value = Object.extend((function(m) {
- return function() { return ancestor[m].apply(this, arguments) };
- })(property).wrap(method), {
- valueOf: function() { return method },
- toString: function() { return method.toString() }
- });
- }
- this.prototype[property] = value;
- }
-
- return this;
- }
-};
-
-var Abstract = { };
-
-Object.extend = function(destination, source) {
- for (var property in source)
- destination[property] = source[property];
- return destination;
-};
-
-Object.extend(Object, {
- inspect: function(object) {
- try {
- if (Object.isUndefined(object)) return 'undefined';
- if (object === null) return 'null';
- return object.inspect ? object.inspect() : String(object);
- } catch (e) {
- if (e instanceof RangeError) return '...';
- throw e;
- }
- },
-
- toJSON: function(object) {
- var type = typeof object;
- switch (type) {
- case 'undefined':
- case 'function':
- case 'unknown': return;
- case 'boolean': return object.toString();
- }
-
- if (object === null) return 'null';
- if (object.toJSON) return object.toJSON();
- if (Object.isElement(object)) return;
-
- var results = [];
- for (var property in object) {
- var value = Object.toJSON(object[property]);
- if (!Object.isUndefined(value))
- results.push(property.toJSON() + ': ' + value);
- }
-
- return '{' + results.join(', ') + '}';
- },
-
- toQueryString: function(object) {
- return $H(object).toQueryString();
- },
-
- toHTML: function(object) {
- return object && object.toHTML ? object.toHTML() : String.interpret(object);
- },
-
- keys: function(object) {
- var keys = [];
- for (var property in object)
- keys.push(property);
- return keys;
- },
-
- values: function(object) {
- var values = [];
- for (var property in object)
- values.push(object[property]);
- return values;
- },
-
- clone: function(object) {
- return Object.extend({ }, object);
- },
-
- isElement: function(object) {
- return object && object.nodeType == 1;
- },
-
- isArray: function(object) {
- return object != null && typeof object == "object" &&
- 'splice' in object && 'join' in object;
- },
-
- isHash: function(object) {
- return object instanceof Hash;
- },
-
- isFunction: function(object) {
- return typeof object == "function";
- },
-
- isString: function(object) {
- return typeof object == "string";
- },
-
- isNumber: function(object) {
- return typeof object == "number";
- },
-
- isUndefined: function(object) {
- return typeof object == "undefined";
- }
-});
-
-Object.extend(Function.prototype, {
- argumentNames: function() {
- var names = this.toString().match(/^[\s\(]*function[^(]*\((.*?)\)/)[1].split(",").invoke("strip");
- return names.length == 1 && !names[0] ? [] : names;
- },
-
- bind: function() {
- if (arguments.length < 2 && Object.isUndefined(arguments[0])) return this;
- var __method = this, args = $A(arguments), object = args.shift();
- return function() {
- return __method.apply(object, args.concat($A(arguments)));
- }
- },
-
- bindAsEventListener: function() {
- var __method = this, args = $A(arguments), object = args.shift();
- return function(event) {
- return __method.apply(object, [event || window.event].concat(args));
- }
- },
-
- curry: function() {
- if (!arguments.length) return this;
- var __method = this, args = $A(arguments);
- return function() {
- return __method.apply(this, args.concat($A(arguments)));
- }
- },
-
- delay: function() {
- var __method = this, args = $A(arguments), timeout = args.shift() * 1000;
- return window.setTimeout(function() {
- return __method.apply(__method, args);
- }, timeout);
- },
-
- wrap: function(wrapper) {
- var __method = this;
- return function() {
- return wrapper.apply(this, [__method.bind(this)].concat($A(arguments)));
- }
- },
-
- methodize: function() {
- if (this._methodized) return this._methodized;
- var __method = this;
- return this._methodized = function() {
- return __method.apply(null, [this].concat($A(arguments)));
- };
- }
-});
-
-Function.prototype.defer = Function.prototype.delay.curry(0.01);
-
-Date.prototype.toJSON = function() {
- return '"' + this.getUTCFullYear() + '-' +
- (this.getUTCMonth() + 1).toPaddedString(2) + '-' +
- this.getUTCDate().toPaddedString(2) + 'T' +
- this.getUTCHours().toPaddedString(2) + ':' +
- this.getUTCMinutes().toPaddedString(2) + ':' +
- this.getUTCSeconds().toPaddedString(2) + 'Z"';
-};
-
-var Try = {
- these: function() {
- var returnValue;
-
- for (var i = 0, length = arguments.length; i < length; i++) {
- var lambda = arguments[i];
- try {
- returnValue = lambda();
- break;
- } catch (e) { }
- }
-
- return returnValue;
- }
-};
-
-RegExp.prototype.match = RegExp.prototype.test;
-
-RegExp.escape = function(str) {
- return String(str).replace(/([.*+?^=!:${}()|[\]\/\\])/g, '\\$1');
-};
-
-/*--------------------------------------------------------------------------*/
-
-var PeriodicalExecuter = Class.create({
- initialize: function(callback, frequency) {
- this.callback = callback;
- this.frequency = frequency;
- this.currentlyExecuting = false;
-
- this.registerCallback();
- },
-
- registerCallback: function() {
- this.timer = setInterval(this.onTimerEvent.bind(this), this.frequency * 1000);
- },
-
- execute: function() {
- this.callback(this);
- },
-
- stop: function() {
- if (!this.timer) return;
- clearInterval(this.timer);
- this.timer = null;
- },
-
- onTimerEvent: function() {
- if (!this.currentlyExecuting) {
- try {
- this.currentlyExecuting = true;
- this.execute();
- } finally {
- this.currentlyExecuting = false;
- }
- }
- }
-});
-Object.extend(String, {
- interpret: function(value) {
- return value == null ? '' : String(value);
- },
- specialChar: {
- '\b': '\\b',
- '\t': '\\t',
- '\n': '\\n',
- '\f': '\\f',
- '\r': '\\r',
- '\\': '\\\\'
- }
-});
-
-Object.extend(String.prototype, {
- gsub: function(pattern, replacement) {
- var result = '', source = this, match;
- replacement = arguments.callee.prepareReplacement(replacement);
-
- while (source.length > 0) {
- if (match = source.match(pattern)) {
- result += source.slice(0, match.index);
- result += String.interpret(replacement(match));
- source = source.slice(match.index + match[0].length);
- } else {
- result += source, source = '';
- }
- }
- return result;
- },
-
- sub: function(pattern, replacement, count) {
- replacement = this.gsub.prepareReplacement(replacement);
- count = Object.isUndefined(count) ? 1 : count;
-
- return this.gsub(pattern, function(match) {
- if (--count < 0) return match[0];
- return replacement(match);
- });
- },
-
- scan: function(pattern, iterator) {
- this.gsub(pattern, iterator);
- return String(this);
- },
-
- truncate: function(length, truncation) {
- length = length || 30;
- truncation = Object.isUndefined(truncation) ? '...' : truncation;
- return this.length > length ?
- this.slice(0, length - truncation.length) + truncation : String(this);
- },
-
- strip: function() {
- return this.replace(/^\s+/, '').replace(/\s+$/, '');
- },
-
- stripTags: function() {
- return this.replace(/<\/?[^>]+>/gi, '');
- },
-
- stripScripts: function() {
- return this.replace(new RegExp(Prototype.ScriptFragment, 'img'), '');
- },
-
- extractScripts: function() {
- var matchAll = new RegExp(Prototype.ScriptFragment, 'img');
- var matchOne = new RegExp(Prototype.ScriptFragment, 'im');
- return (this.match(matchAll) || []).map(function(scriptTag) {
- return (scriptTag.match(matchOne) || ['', ''])[1];
- });
- },
-
- evalScripts: function() {
- return this.extractScripts().map(function(script) { return eval(script) });
- },
-
- escapeHTML: function() {
- var self = arguments.callee;
- self.text.data = this;
- return self.div.innerHTML;
- },
-
- unescapeHTML: function() {
- var div = new Element('div');
- div.innerHTML = this.stripTags();
- return div.childNodes[0] ? (div.childNodes.length > 1 ?
- $A(div.childNodes).inject('', function(memo, node) { return memo+node.nodeValue }) :
- div.childNodes[0].nodeValue) : '';
- },
-
- toQueryParams: function(separator) {
- var match = this.strip().match(/([^?#]*)(#.*)?$/);
- if (!match) return { };
-
- return match[1].split(separator || '&').inject({ }, function(hash, pair) {
- if ((pair = pair.split('='))[0]) {
- var key = decodeURIComponent(pair.shift());
- var value = pair.length > 1 ? pair.join('=') : pair[0];
- if (value != undefined) value = decodeURIComponent(value);
-
- if (key in hash) {
- if (!Object.isArray(hash[key])) hash[key] = [hash[key]];
- hash[key].push(value);
- }
- else hash[key] = value;
- }
- return hash;
- });
- },
-
- toArray: function() {
- return this.split('');
- },
-
- succ: function() {
- return this.slice(0, this.length - 1) +
- String.fromCharCode(this.charCodeAt(this.length - 1) + 1);
- },
-
- times: function(count) {
- return count < 1 ? '' : new Array(count + 1).join(this);
- },
-
- camelize: function() {
- var parts = this.split('-'), len = parts.length;
- if (len == 1) return parts[0];
-
- var camelized = this.charAt(0) == '-'
- ? parts[0].charAt(0).toUpperCase() + parts[0].substring(1)
- : parts[0];
-
- for (var i = 1; i < len; i++)
- camelized += parts[i].charAt(0).toUpperCase() + parts[i].substring(1);
-
- return camelized;
- },
-
- capitalize: function() {
- return this.charAt(0).toUpperCase() + this.substring(1).toLowerCase();
- },
-
- underscore: function() {
- return this.gsub(/::/, '/').gsub(/([A-Z]+)([A-Z][a-z])/,'#{1}_#{2}').gsub(/([a-z\d])([A-Z])/,'#{1}_#{2}').gsub(/-/,'_').toLowerCase();
- },
-
- dasherize: function() {
- return this.gsub(/_/,'-');
- },
-
- inspect: function(useDoubleQuotes) {
- var escapedString = this.gsub(/[\x00-\x1f\\]/, function(match) {
- var character = String.specialChar[match[0]];
- return character ? character : '\\u00' + match[0].charCodeAt().toPaddedString(2, 16);
- });
- if (useDoubleQuotes) return '"' + escapedString.replace(/"/g, '\\"') + '"';
- return "'" + escapedString.replace(/'/g, '\\\'') + "'";
- },
-
- toJSON: function() {
- return this.inspect(true);
- },
-
- unfilterJSON: function(filter) {
- return this.sub(filter || Prototype.JSONFilter, '#{1}');
- },
-
- isJSON: function() {
- var str = this;
- if (str.blank()) return false;
- str = this.replace(/\\./g, '@').replace(/"[^"\\\n\r]*"/g, '');
- return (/^[,:{}\[\]0-9.\-+Eaeflnr-u \n\r\t]*$/).test(str);
- },
-
- evalJSON: function(sanitize) {
- var json = this.unfilterJSON();
- try {
- if (!sanitize || json.isJSON()) return eval('(' + json + ')');
- } catch (e) { }
- throw new SyntaxError('Badly formed JSON string: ' + this.inspect());
- },
-
- include: function(pattern) {
- return this.indexOf(pattern) > -1;
- },
-
- startsWith: function(pattern) {
- return this.indexOf(pattern) === 0;
- },
-
- endsWith: function(pattern) {
- var d = this.length - pattern.length;
- return d >= 0 && this.lastIndexOf(pattern) === d;
- },
-
- empty: function() {
- return this == '';
- },
-
- blank: function() {
- return /^\s*$/.test(this);
- },
-
- interpolate: function(object, pattern) {
- return new Template(this, pattern).evaluate(object);
- }
-});
-
-if (Prototype.Browser.WebKit || Prototype.Browser.IE) Object.extend(String.prototype, {
- escapeHTML: function() {
- return this.replace(/&/g,'&').replace(/</g,'<').replace(/>/g,'>');
- },
- unescapeHTML: function() {
- return this.replace(/&/g,'&').replace(/</g,'<').replace(/>/g,'>');
- }
-});
-
-String.prototype.gsub.prepareReplacement = function(replacement) {
- if (Object.isFunction(replacement)) return replacement;
- var template = new Template(replacement);
- return function(match) { return template.evaluate(match) };
-};
-
-String.prototype.parseQuery = String.prototype.toQueryParams;
-
-Object.extend(String.prototype.escapeHTML, {
- div: document.createElement('div'),
- text: document.createTextNode('')
-});
-
-with (String.prototype.escapeHTML) div.appendChild(text);
-
-var Template = Class.create({
- initialize: function(template, pattern) {
- this.template = template.toString();
- this.pattern = pattern || Template.Pattern;
- },
-
- evaluate: function(object) {
- if (Object.isFunction(object.toTemplateReplacements))
- object = object.toTemplateReplacements();
-
- return this.template.gsub(this.pattern, function(match) {
- if (object == null) return '';
-
- var before = match[1] || '';
- if (before == '\\') return match[2];
-
- var ctx = object, expr = match[3];
- var pattern = /^([^.[]+|\[((?:.*?[^\\])?)\])(\.|\[|$)/;
- match = pattern.exec(expr);
- if (match == null) return before;
-
- while (match != null) {
- var comp = match[1].startsWith('[') ? match[2].gsub('\\\\]', ']') : match[1];
- ctx = ctx[comp];
- if (null == ctx || '' == match[3]) break;
- expr = expr.substring('[' == match[3] ? match[1].length : match[0].length);
- match = pattern.exec(expr);
- }
-
- return before + String.interpret(ctx);
- });
- }
-});
-Template.Pattern = /(^|.|\r|\n)(#\{(.*?)\})/;
-
-var $break = { };
-
-var Enumerable = {
- each: function(iterator, context) {
- var index = 0;
- iterator = iterator.bind(context);
- try {
- this._each(function(value) {
- iterator(value, index++);
- });
- } catch (e) {
- if (e != $break) throw e;
- }
- return this;
- },
-
- eachSlice: function(number, iterator, context) {
- iterator = iterator ? iterator.bind(context) : Prototype.K;
- var index = -number, slices = [], array = this.toArray();
- while ((index += number) < array.length)
- slices.push(array.slice(index, index+number));
- return slices.collect(iterator, context);
- },
-
- all: function(iterator, context) {
- iterator = iterator ? iterator.bind(context) : Prototype.K;
- var result = true;
- this.each(function(value, index) {
- result = result && !!iterator(value, index);
- if (!result) throw $break;
- });
- return result;
- },
-
- any: function(iterator, context) {
- iterator = iterator ? iterator.bind(context) : Prototype.K;
- var result = false;
- this.each(function(value, index) {
- if (result = !!iterator(value, index))
- throw $break;
- });
- return result;
- },
-
- collect: function(iterator, context) {
- iterator = iterator ? iterator.bind(context) : Prototype.K;
- var results = [];
- this.each(function(value, index) {
- results.push(iterator(value, index));
- });
- return results;
- },
-
- detect: function(iterator, context) {
- iterator = iterator.bind(context);
- var result;
- this.each(function(value, index) {
- if (iterator(value, index)) {
- result = value;
- throw $break;
- }
- });
- return result;
- },
-
- findAll: function(iterator, context) {
- iterator = iterator.bind(context);
- var results = [];
- this.each(function(value, index) {
- if (iterator(value, index))
- results.push(value);
- });
- return results;
- },
-
- grep: function(filter, iterator, context) {
- iterator = iterator ? iterator.bind(context) : Prototype.K;
- var results = [];
-
- if (Object.isString(filter))
- filter = new RegExp(filter);
-
- this.each(function(value, index) {
- if (filter.match(value))
- results.push(iterator(value, index));
- });
- return results;
- },
-
- include: function(object) {
- if (Object.isFunction(this.indexOf))
- if (this.indexOf(object) != -1) return true;
-
- var found = false;
- this.each(function(value) {
- if (value == object) {
- found = true;
- throw $break;
- }
- });
- return found;
- },
-
- inGroupsOf: function(number, fillWith) {
- fillWith = Object.isUndefined(fillWith) ? null : fillWith;
- return this.eachSlice(number, function(slice) {
- while(slice.length < number) slice.push(fillWith);
- return slice;
- });
- },
-
- inject: function(memo, iterator, context) {
- iterator = iterator.bind(context);
- this.each(function(value, index) {
- memo = iterator(memo, value, index);
- });
- return memo;
- },
-
- invoke: function(method) {
- var args = $A(arguments).slice(1);
- return this.map(function(value) {
- return value[method].apply(value, args);
- });
- },
-
- max: function(iterator, context) {
- iterator = iterator ? iterator.bind(context) : Prototype.K;
- var result;
- this.each(function(value, index) {
- value = iterator(value, index);
- if (result == null || value >= result)
- result = value;
- });
- return result;
- },
-
- min: function(iterator, context) {
- iterator = iterator ? iterator.bind(context) : Prototype.K;
- var result;
- this.each(function(value, index) {
- value = iterator(value, index);
- if (result == null || value < result)
- result = value;
- });
- return result;
- },
-
- partition: function(iterator, context) {
- iterator = iterator ? iterator.bind(context) : Prototype.K;
- var trues = [], falses = [];
- this.each(function(value, index) {
- (iterator(value, index) ?
- trues : falses).push(value);
- });
- return [trues, falses];
- },
-
- pluck: function(property) {
- var results = [];
- this.each(function(value) {
- results.push(value[property]);
- });
- return results;
- },
-
- reject: function(iterator, context) {
- iterator = iterator.bind(context);
- var results = [];
- this.each(function(value, index) {
- if (!iterator(value, index))
- results.push(value);
- });
- return results;
- },
-
- sortBy: function(iterator, context) {
- iterator = iterator.bind(context);
- return this.map(function(value, index) {
- return {value: value, criteria: iterator(value, index)};
- }).sort(function(left, right) {
- var a = left.criteria, b = right.criteria;
- return a < b ? -1 : a > b ? 1 : 0;
- }).pluck('value');
- },
-
- toArray: function() {
- return this.map();
- },
-
- zip: function() {
- var iterator = Prototype.K, args = $A(arguments);
- if (Object.isFunction(args.last()))
- iterator = args.pop();
-
- var collections = [this].concat(args).map($A);
- return this.map(function(value, index) {
- return iterator(collections.pluck(index));
- });
- },
-
- size: function() {
- return this.toArray().length;
- },
-
- inspect: function() {
- return '#<Enumerable:' + this.toArray().inspect() + '>';
- }
-};
-
-Object.extend(Enumerable, {
- map: Enumerable.collect,
- find: Enumerable.detect,
- select: Enumerable.findAll,
- filter: Enumerable.findAll,
- member: Enumerable.include,
- entries: Enumerable.toArray,
- every: Enumerable.all,
- some: Enumerable.any
-});
-function $A(iterable) {
- if (!iterable) return [];
- if (iterable.toArray) return iterable.toArray();
- var length = iterable.length || 0, results = new Array(length);
- while (length--) results[length] = iterable[length];
- return results;
-}
-
-if (Prototype.Browser.WebKit) {
- $A = function(iterable) {
- if (!iterable) return [];
- if (!(Object.isFunction(iterable) && iterable == '[object NodeList]') &&
- iterable.toArray) return iterable.toArray();
- var length = iterable.length || 0, results = new Array(length);
- while (length--) results[length] = iterable[length];
- return results;
- };
-}
-
-Array.from = $A;
-
-Object.extend(Array.prototype, Enumerable);
-
-if (!Array.prototype._reverse) Array.prototype._reverse = Array.prototype.reverse;
-
-Object.extend(Array.prototype, {
- _each: function(iterator) {
- for (var i = 0, length = this.length; i < length; i++)
- iterator(this[i]);
- },
-
- clear: function() {
- this.length = 0;
- return this;
- },
-
- first: function() {
- return this[0];
- },
-
- last: function() {
- return this[this.length - 1];
- },
-
- compact: function() {
- return this.select(function(value) {
- return value != null;
- });
- },
-
- flatten: function() {
- return this.inject([], function(array, value) {
- return array.concat(Object.isArray(value) ?
- value.flatten() : [value]);
- });
- },
-
- without: function() {
- var values = $A(arguments);
- return this.select(function(value) {
- return !values.include(value);
- });
- },
-
- reverse: function(inline) {
- return (inline !== false ? this : this.toArray())._reverse();
- },
-
- reduce: function() {
- return this.length > 1 ? this : this[0];
- },
-
- uniq: function(sorted) {
- return this.inject([], function(array, value, index) {
- if (0 == index || (sorted ? array.last() != value : !array.include(value)))
- array.push(value);
- return array;
- });
- },
-
- intersect: function(array) {
- return this.uniq().findAll(function(item) {
- return array.detect(function(value) { return item === value });
- });
- },
-
- clone: function() {
- return [].concat(this);
- },
-
- size: function() {
- return this.length;
- },
-
- inspect: function() {
- return '[' + this.map(Object.inspect).join(', ') + ']';
- },
-
- toJSON: function() {
- var results = [];
- this.each(function(object) {
- var value = Object.toJSON(object);
- if (!Object.isUndefined(value)) results.push(value);
- });
- return '[' + results.join(', ') + ']';
- }
-});
-
-// use native browser JS 1.6 implementation if available
-if (Object.isFunction(Array.prototype.forEach))
- Array.prototype._each = Array.prototype.forEach;
-
-if (!Array.prototype.indexOf) Array.prototype.indexOf = function(item, i) {
- i || (i = 0);
- var length = this.length;
- if (i < 0) i = length + i;
- for (; i < length; i++)
- if (this[i] === item) return i;
- return -1;
-};
-
-if (!Array.prototype.lastIndexOf) Array.prototype.lastIndexOf = function(item, i) {
- i = isNaN(i) ? this.length : (i < 0 ? this.length + i : i) + 1;
- var n = this.slice(0, i).reverse().indexOf(item);
- return (n < 0) ? n : i - n - 1;
-};
-
-Array.prototype.toArray = Array.prototype.clone;
-
-function $w(string) {
- if (!Object.isString(string)) return [];
- string = string.strip();
- return string ? string.split(/\s+/) : [];
-}
-
-if (Prototype.Browser.Opera){
- Array.prototype.concat = function() {
- var array = [];
- for (var i = 0, length = this.length; i < length; i++) array.push(this[i]);
- for (var i = 0, length = arguments.length; i < length; i++) {
- if (Object.isArray(arguments[i])) {
- for (var j = 0, arrayLength = arguments[i].length; j < arrayLength; j++)
- array.push(arguments[i][j]);
- } else {
- array.push(arguments[i]);
- }
- }
- return array;
- };
-}
-Object.extend(Number.prototype, {
- toColorPart: function() {
- return this.toPaddedString(2, 16);
- },
-
- succ: function() {
- return this + 1;
- },
-
- times: function(iterator) {
- $R(0, this, true).each(iterator);
- return this;
- },
-
- toPaddedString: function(length, radix) {
- var string = this.toString(radix || 10);
- return '0'.times(length - string.length) + string;
- },
-
- toJSON: function() {
- return isFinite(this) ? this.toString() : 'null';
- }
-});
-
-$w('abs round ceil floor').each(function(method){
- Number.prototype[method] = Math[method].methodize();
-});
-function $H(object) {
- return new Hash(object);
-};
-
-var Hash = Class.create(Enumerable, (function() {
-
- function toQueryPair(key, value) {
- if (Object.isUndefined(value)) return key;
- return key + '=' + encodeURIComponent(String.interpret(value));
- }
-
- return {
- initialize: function(object) {
- this._object = Object.isHash(object) ? object.toObject() : Object.clone(object);
- },
-
- _each: function(iterator) {
- for (var key in this._object) {
- var value = this._object[key], pair = [key, value];
- pair.key = key;
- pair.value = value;
- iterator(pair);
- }
- },
-
- set: function(key, value) {
- return this._object[key] = value;
- },
-
- get: function(key) {
- return this._object[key];
- },
-
- unset: function(key) {
- var value = this._object[key];
- delete this._object[key];
- return value;
- },
-
- toObject: function() {
- return Object.clone(this._object);
- },
-
- keys: function() {
- return this.pluck('key');
- },
-
- values: function() {
- return this.pluck('value');
- },
-
- index: function(value) {
- var match = this.detect(function(pair) {
- return pair.value === value;
- });
- return match && match.key;
- },
-
- merge: function(object) {
- return this.clone().update(object);
- },
-
- update: function(object) {
- return new Hash(object).inject(this, function(result, pair) {
- result.set(pair.key, pair.value);
- return result;
- });
- },
-
- toQueryString: function() {
- return this.map(function(pair) {
- var key = encodeURIComponent(pair.key), values = pair.value;
-
- if (values && typeof values == 'object') {
- if (Object.isArray(values))
- return values.map(toQueryPair.curry(key)).join('&');
- }
- return toQueryPair(key, values);
- }).join('&');
- },
-
- inspect: function() {
- return '#<Hash:{' + this.map(function(pair) {
- return pair.map(Object.inspect).join(': ');
- }).join(', ') + '}>';
- },
-
- toJSON: function() {
- return Object.toJSON(this.toObject());
- },
-
- clone: function() {
- return new Hash(this);
- }
- }
-})());
-
-Hash.prototype.toTemplateReplacements = Hash.prototype.toObject;
-Hash.from = $H;
-var ObjectRange = Class.create(Enumerable, {
- initialize: function(start, end, exclusive) {
- this.start = start;
- this.end = end;
- this.exclusive = exclusive;
- },
-
- _each: function(iterator) {
- var value = this.start;
- while (this.include(value)) {
- iterator(value);
- value = value.succ();
- }
- },
-
- include: function(value) {
- if (value < this.start)
- return false;
- if (this.exclusive)
- return value < this.end;
- return value <= this.end;
- }
-});
-
-var $R = function(start, end, exclusive) {
- return new ObjectRange(start, end, exclusive);
-};
-
-var Ajax = {
- getTransport: function() {
- return Try.these(
- function() {return new XMLHttpRequest()},
- function() {return new ActiveXObject('Msxml2.XMLHTTP')},
- function() {return new ActiveXObject('Microsoft.XMLHTTP')}
- ) || false;
- },
-
- activeRequestCount: 0
-};
-
-Ajax.Responders = {
- responders: [],
-
- _each: function(iterator) {
- this.responders._each(iterator);
- },
-
- register: function(responder) {
- if (!this.include(responder))
- this.responders.push(responder);
- },
-
- unregister: function(responder) {
- this.responders = this.responders.without(responder);
- },
-
- dispatch: function(callback, request, transport, json) {
- this.each(function(responder) {
- if (Object.isFunction(responder[callback])) {
- try {
- responder[callback].apply(responder, [request, transport, json]);
- } catch (e) { }
- }
- });
- }
-};
-
-Object.extend(Ajax.Responders, Enumerable);
-
-Ajax.Responders.register({
- onCreate: function() { Ajax.activeRequestCount++ },
- onComplete: function() { Ajax.activeRequestCount-- }
-});
-
-Ajax.Base = Class.create({
- initialize: function(options) {
- this.options = {
- method: 'post',
- asynchronous: true,
- contentType: 'application/x-www-form-urlencoded',
- encoding: 'UTF-8',
- parameters: '',
- evalJSON: true,
- evalJS: true
- };
- Object.extend(this.options, options || { });
-
- this.options.method = this.options.method.toLowerCase();
-
- if (Object.isString(this.options.parameters))
- this.options.parameters = this.options.parameters.toQueryParams();
- else if (Object.isHash(this.options.parameters))
- this.options.parameters = this.options.parameters.toObject();
- }
-});
-
-Ajax.Request = Class.create(Ajax.Base, {
- _complete: false,
-
- initialize: function($super, url, options) {
- $super(options);
- this.transport = Ajax.getTransport();
- this.request(url);
- },
-
- request: function(url) {
- this.url = url;
- this.method = this.options.method;
- var params = Object.clone(this.options.parameters);
-
- if (!['get', 'post'].include(this.method)) {
- // simulate other verbs over post
- params['_method'] = this.method;
- this.method = 'post';
- }
-
- this.parameters = params;
-
- if (params = Object.toQueryString(params)) {
- // when GET, append parameters to URL
- if (this.method == 'get')
- this.url += (this.url.include('?') ? '&' : '?') + params;
- else if (/Konqueror|Safari|KHTML/.test(navigator.userAgent))
- params += '&_=';
- }
-
- try {
- var response = new Ajax.Response(this);
- if (this.options.onCreate) this.options.onCreate(response);
- Ajax.Responders.dispatch('onCreate', this, response);
-
- this.transport.open(this.method.toUpperCase(), this.url,
- this.options.asynchronous);
-
- if (this.options.asynchronous) this.respondToReadyState.bind(this).defer(1);
-
- this.transport.onreadystatechange = this.onStateChange.bind(this);
- this.setRequestHeaders();
-
- this.body = this.method == 'post' ? (this.options.postBody || params) : null;
- this.transport.send(this.body);
-
- /* Force Firefox to handle ready state 4 for synchronous requests */
- if (!this.options.asynchronous && this.transport.overrideMimeType)
- this.onStateChange();
-
- }
- catch (e) {
- this.dispatchException(e);
- }
- },
-
- onStateChange: function() {
- var readyState = this.transport.readyState;
- if (readyState > 1 && !((readyState == 4) && this._complete))
- this.respondToReadyState(this.transport.readyState);
- },
-
- setRequestHeaders: function() {
- var headers = {
- 'X-Requested-With': 'XMLHttpRequest',
- 'X-Prototype-Version': Prototype.Version,
- 'Accept': 'text/javascript, text/html, application/xml, text/xml, */*'
- };
-
- if (this.method == 'post') {
- headers['Content-type'] = this.options.contentType +
- (this.options.encoding ? '; charset=' + this.options.encoding : '');
-
- /* Force "Connection: close" for older Mozilla browsers to work
- * around a bug where XMLHttpRequest sends an incorrect
- * Content-length header. See Mozilla Bugzilla #246651.
- */
- if (this.transport.overrideMimeType &&
- (navigator.userAgent.match(/Gecko\/(\d{4})/) || [0,2005])[1] < 2005)
- headers['Connection'] = 'close';
- }
-
- // user-defined headers
- if (typeof this.options.requestHeaders == 'object') {
- var extras = this.options.requestHeaders;
-
- if (Object.isFunction(extras.push))
- for (var i = 0, length = extras.length; i < length; i += 2)
- headers[extras[i]] = extras[i+1];
- else
- $H(extras).each(function(pair) { headers[pair.key] = pair.value });
- }
-
- for (var name in headers)
- this.transport.setRequestHeader(name, headers[name]);
- },
-
- success: function() {
- var status = this.getStatus();
- return !status || (status >= 200 && status < 300);
- },
-
- getStatus: function() {
- try {
- return this.transport.status || 0;
- } catch (e) { return 0 }
- },
-
- respondToReadyState: function(readyState) {
- var state = Ajax.Request.Events[readyState], response = new Ajax.Response(this);
-
- if (state == 'Complete') {
- try {
- this._complete = true;
- (this.options['on' + response.status]
- || this.options['on' + (this.success() ? 'Success' : 'Failure')]
- || Prototype.emptyFunction)(response, response.headerJSON);
- } catch (e) {
- this.dispatchException(e);
- }
-
- var contentType = response.getHeader('Content-type');
- if (this.options.evalJS == 'force'
- || (this.options.evalJS && this.isSameOrigin() && contentType
- && contentType.match(/^\s*(text|application)\/(x-)?(java|ecma)script(;.*)?\s*$/i)))
- this.evalResponse();
- }
-
- try {
- (this.options['on' + state] || Prototype.emptyFunction)(response, response.headerJSON);
- Ajax.Responders.dispatch('on' + state, this, response, response.headerJSON);
- } catch (e) {
- this.dispatchException(e);
- }
-
- if (state == 'Complete') {
- // avoid memory leak in MSIE: clean up
- this.transport.onreadystatechange = Prototype.emptyFunction;
- }
- },
-
- isSameOrigin: function() {
- var m = this.url.match(/^\s*https?:\/\/[^\/]*/);
- return !m || (m[0] == '#{protocol}//#{domain}#{port}'.interpolate({
- protocol: location.protocol,
- domain: document.domain,
- port: location.port ? ':' + location.port : ''
- }));
- },
-
- getHeader: function(name) {
- try {
- return this.transport.getResponseHeader(name) || null;
- } catch (e) { return null }
- },
-
- evalResponse: function() {
- try {
- return eval((this.transport.responseText || '').unfilterJSON());
- } catch (e) {
- this.dispatchException(e);
- }
- },
-
- dispatchException: function(exception) {
- (this.options.onException || Prototype.emptyFunction)(this, exception);
- Ajax.Responders.dispatch('onException', this, exception);
- }
-});
-
-Ajax.Request.Events =
- ['Uninitialized', 'Loading', 'Loaded', 'Interactive', 'Complete'];
-
-Ajax.Response = Class.create({
- initialize: function(request){
- this.request = request;
- var transport = this.transport = request.transport,
- readyState = this.readyState = transport.readyState;
-
- if((readyState > 2 && !Prototype.Browser.IE) || readyState == 4) {
- this.status = this.getStatus();
- this.statusText = this.getStatusText();
- this.responseText = String.interpret(transport.responseText);
- this.headerJSON = this._getHeaderJSON();
- }
-
- if(readyState == 4) {
- var xml = transport.responseXML;
- this.responseXML = Object.isUndefined(xml) ? null : xml;
- this.responseJSON = this._getResponseJSON();
- }
- },
-
- status: 0,
- statusText: '',
-
- getStatus: Ajax.Request.prototype.getStatus,
-
- getStatusText: function() {
- try {
- return this.transport.statusText || '';
- } catch (e) { return '' }
- },
-
- getHeader: Ajax.Request.prototype.getHeader,
-
- getAllHeaders: function() {
- try {
- return this.getAllResponseHeaders();
- } catch (e) { return null }
- },
-
- getResponseHeader: function(name) {
- return this.transport.getResponseHeader(name);
- },
-
- getAllResponseHeaders: function() {
- return this.transport.getAllResponseHeaders();
- },
-
- _getHeaderJSON: function() {
- var json = this.getHeader('X-JSON');
- if (!json) return null;
- json = decodeURIComponent(escape(json));
- try {
- return json.evalJSON(this.request.options.sanitizeJSON ||
- !this.request.isSameOrigin());
- } catch (e) {
- this.request.dispatchException(e);
- }
- },
-
- _getResponseJSON: function() {
- var options = this.request.options;
- if (!options.evalJSON || (options.evalJSON != 'force' &&
- !(this.getHeader('Content-type') || '').include('application/json')) ||
- this.responseText.blank())
- return null;
- try {
- return this.responseText.evalJSON(options.sanitizeJSON ||
- !this.request.isSameOrigin());
- } catch (e) {
- this.request.dispatchException(e);
- }
- }
-});
-
-Ajax.Updater = Class.create(Ajax.Request, {
- initialize: function($super, container, url, options) {
- this.container = {
- success: (container.success || container),
- failure: (container.failure || (container.success ? null : container))
- };
-
- options = Object.clone(options);
- var onComplete = options.onComplete;
- options.onComplete = (function(response, json) {
- this.updateContent(response.responseText);
- if (Object.isFunction(onComplete)) onComplete(response, json);
- }).bind(this);
-
- $super(url, options);
- },
-
- updateContent: function(responseText) {
- var receiver = this.container[this.success() ? 'success' : 'failure'],
- options = this.options;
-
- if (!options.evalScripts) responseText = responseText.stripScripts();
-
- if (receiver = $(receiver)) {
- if (options.insertion) {
- if (Object.isString(options.insertion)) {
- var insertion = { }; insertion[options.insertion] = responseText;
- receiver.insert(insertion);
- }
- else options.insertion(receiver, responseText);
- }
- else receiver.update(responseText);
- }
- }
-});
-
-Ajax.PeriodicalUpdater = Class.create(Ajax.Base, {
- initialize: function($super, container, url, options) {
- $super(options);
- this.onComplete = this.options.onComplete;
-
- this.frequency = (this.options.frequency || 2);
- this.decay = (this.options.decay || 1);
-
- this.updater = { };
- this.container = container;
- this.url = url;
-
- this.start();
- },
-
- start: function() {
- this.options.onComplete = this.updateComplete.bind(this);
- this.onTimerEvent();
- },
-
- stop: function() {
- this.updater.options.onComplete = undefined;
- clearTimeout(this.timer);
- (this.onComplete || Prototype.emptyFunction).apply(this, arguments);
- },
-
- updateComplete: function(response) {
- if (this.options.decay) {
- this.decay = (response.responseText == this.lastText ?
- this.decay * this.options.decay : 1);
-
- this.lastText = response.responseText;
- }
- this.timer = this.onTimerEvent.bind(this).delay(this.decay * this.frequency);
- },
-
- onTimerEvent: function() {
- this.updater = new Ajax.Updater(this.container, this.url, this.options);
- }
-});
-function $(element) {
- if (arguments.length > 1) {
- for (var i = 0, elements = [], length = arguments.length; i < length; i++)
- elements.push($(arguments[i]));
- return elements;
- }
- if (Object.isString(element))
- element = document.getElementById(element);
- return Element.extend(element);
-}
-
-if (Prototype.BrowserFeatures.XPath) {
- document._getElementsByXPath = function(expression, parentElement) {
- var results = [];
- var query = document.evaluate(expression, $(parentElement) || document,
- null, XPathResult.ORDERED_NODE_SNAPSHOT_TYPE, null);
- for (var i = 0, length = query.snapshotLength; i < length; i++)
- results.push(Element.extend(query.snapshotItem(i)));
- return results;
- };
-}
-
-/*--------------------------------------------------------------------------*/
-
-if (!window.Node) var Node = { };
-
-if (!Node.ELEMENT_NODE) {
- // DOM level 2 ECMAScript Language Binding
- Object.extend(Node, {
- ELEMENT_NODE: 1,
- ATTRIBUTE_NODE: 2,
- TEXT_NODE: 3,
- CDATA_SECTION_NODE: 4,
- ENTITY_REFERENCE_NODE: 5,
- ENTITY_NODE: 6,
- PROCESSING_INSTRUCTION_NODE: 7,
- COMMENT_NODE: 8,
- DOCUMENT_NODE: 9,
- DOCUMENT_TYPE_NODE: 10,
- DOCUMENT_FRAGMENT_NODE: 11,
- NOTATION_NODE: 12
- });
-}
-
-(function() {
- var element = this.Element;
- this.Element = function(tagName, attributes) {
- attributes = attributes || { };
- tagName = tagName.toLowerCase();
- var cache = Element.cache;
- if (Prototype.Browser.IE && attributes.name) {
- tagName = '<' + tagName + ' name="' + attributes.name + '">';
- delete attributes.name;
- return Element.writeAttribute(document.createElement(tagName), attributes);
- }
- if (!cache[tagName]) cache[tagName] = Element.extend(document.createElement(tagName));
- return Element.writeAttribute(cache[tagName].cloneNode(false), attributes);
- };
- Object.extend(this.Element, element || { });
-}).call(window);
-
-Element.cache = { };
-
-Element.Methods = {
- visible: function(element) {
- return $(element).style.display != 'none';
- },
-
- toggle: function(element) {
- element = $(element);
- Element[Element.visible(element) ? 'hide' : 'show'](element);
- return element;
- },
-
- hide: function(element) {
- $(element).style.display = 'none';
- return element;
- },
-
- show: function(element) {
- $(element).style.display = '';
- return element;
- },
-
- remove: function(element) {
- element = $(element);
- element.parentNode.removeChild(element);
- return element;
- },
-
- update: function(element, content) {
- element = $(element);
- if (content && content.toElement) content = content.toElement();
- if (Object.isElement(content)) return element.update().insert(content);
- content = Object.toHTML(content);
- element.innerHTML = content.stripScripts();
- content.evalScripts.bind(content).defer();
- return element;
- },
-
- replace: function(element, content) {
- element = $(element);
- if (content && content.toElement) content = content.toElement();
- else if (!Object.isElement(content)) {
- content = Object.toHTML(content);
- var range = element.ownerDocument.createRange();
- range.selectNode(element);
- content.evalScripts.bind(content).defer();
- content = range.createContextualFragment(content.stripScripts());
- }
- element.parentNode.replaceChild(content, element);
- return element;
- },
-
- insert: function(element, insertions) {
- element = $(element);
-
- if (Object.isString(insertions) || Object.isNumber(insertions) ||
- Object.isElement(insertions) || (insertions && (insertions.toElement || insertions.toHTML)))
- insertions = {bottom:insertions};
-
- var content, insert, tagName, childNodes;
-
- for (var position in insertions) {
- content = insertions[position];
- position = position.toLowerCase();
- insert = Element._insertionTranslations[position];
-
- if (content && content.toElement) content = content.toElement();
- if (Object.isElement(content)) {
- insert(element, content);
- continue;
- }
-
- content = Object.toHTML(content);
-
- tagName = ((position == 'before' || position == 'after')
- ? element.parentNode : element).tagName.toUpperCase();
-
- childNodes = Element._getContentFromAnonymousElement(tagName, content.stripScripts());
-
- if (position == 'top' || position == 'after') childNodes.reverse();
- childNodes.each(insert.curry(element));
-
- content.evalScripts.bind(content).defer();
- }
-
- return element;
- },
-
- wrap: function(element, wrapper, attributes) {
- element = $(element);
- if (Object.isElement(wrapper))
- $(wrapper).writeAttribute(attributes || { });
- else if (Object.isString(wrapper)) wrapper = new Element(wrapper, attributes);
- else wrapper = new Element('div', wrapper);
- if (element.parentNode)
- element.parentNode.replaceChild(wrapper, element);
- wrapper.appendChild(element);
- return wrapper;
- },
-
- inspect: function(element) {
- element = $(element);
- var result = '<' + element.tagName.toLowerCase();
- $H({'id': 'id', 'className': 'class'}).each(function(pair) {
- var property = pair.first(), attribute = pair.last();
- var value = (element[property] || '').toString();
- if (value) result += ' ' + attribute + '=' + value.inspect(true);
- });
- return result + '>';
- },
-
- recursivelyCollect: function(element, property) {
- element = $(element);
- var elements = [];
- while (element = element[property])
- if (element.nodeType == 1)
- elements.push(Element.extend(element));
- return elements;
- },
-
- ancestors: function(element) {
- return $(element).recursivelyCollect('parentNode');
- },
-
- descendants: function(element) {
- return $(element).select("*");
- },
-
- firstDescendant: function(element) {
- element = $(element).firstChild;
- while (element && element.nodeType != 1) element = element.nextSibling;
- return $(element);
- },
-
- immediateDescendants: function(element) {
- if (!(element = $(element).firstChild)) return [];
- while (element && element.nodeType != 1) element = element.nextSibling;
- if (element) return [element].concat($(element).nextSiblings());
- return [];
- },
-
- previousSiblings: function(element) {
- return $(element).recursivelyCollect('previousSibling');
- },
-
- nextSiblings: function(element) {
- return $(element).recursivelyCollect('nextSibling');
- },
-
- siblings: function(element) {
- element = $(element);
- return element.previousSiblings().reverse().concat(element.nextSiblings());
- },
-
- match: function(element, selector) {
- if (Object.isString(selector))
- selector = new Selector(selector);
- return selector.match($(element));
- },
-
- up: function(element, expression, index) {
- element = $(element);
- if (arguments.length == 1) return $(element.parentNode);
- var ancestors = element.ancestors();
- return Object.isNumber(expression) ? ancestors[expression] :
- Selector.findElement(ancestors, expression, index);
- },
-
- down: function(element, expression, index) {
- element = $(element);
- if (arguments.length == 1) return element.firstDescendant();
- return Object.isNumber(expression) ? element.descendants()[expression] :
- element.select(expression)[index || 0];
- },
-
- previous: function(element, expression, index) {
- element = $(element);
- if (arguments.length == 1) return $(Selector.handlers.previousElementSibling(element));
- var previousSiblings = element.previousSiblings();
- return Object.isNumber(expression) ? previousSiblings[expression] :
- Selector.findElement(previousSiblings, expression, index);
- },
-
- next: function(element, expression, index) {
- element = $(element);
- if (arguments.length == 1) return $(Selector.handlers.nextElementSibling(element));
- var nextSiblings = element.nextSiblings();
- return Object.isNumber(expression) ? nextSiblings[expression] :
- Selector.findElement(nextSiblings, expression, index);
- },
-
- select: function() {
- var args = $A(arguments), element = $(args.shift());
- return Selector.findChildElements(element, args);
- },
-
- adjacent: function() {
- var args = $A(arguments), element = $(args.shift());
- return Selector.findChildElements(element.parentNode, args).without(element);
- },
-
- identify: function(element) {
- element = $(element);
- var id = element.readAttribute('id'), self = arguments.callee;
- if (id) return id;
- do { id = 'anonymous_element_' + self.counter++ } while ($(id));
- element.writeAttribute('id', id);
- return id;
- },
-
- readAttribute: function(element, name) {
- element = $(element);
- if (Prototype.Browser.IE) {
- var t = Element._attributeTranslations.read;
- if (t.values[name]) return t.values[name](element, name);
- if (t.names[name]) name = t.names[name];
- if (name.include(':')) {
- return (!element.attributes || !element.attributes[name]) ? null :
- element.attributes[name].value;
- }
- }
- return element.getAttribute(name);
- },
-
- writeAttribute: function(element, name, value) {
- element = $(element);
- var attributes = { }, t = Element._attributeTranslations.write;
-
- if (typeof name == 'object') attributes = name;
- else attributes[name] = Object.isUndefined(value) ? true : value;
-
- for (var attr in attributes) {
- name = t.names[attr] || attr;
- value = attributes[attr];
- if (t.values[attr]) name = t.values[attr](element, value);
- if (value === false || value === null)
- element.removeAttribute(name);
- else if (value === true)
- element.setAttribute(name, name);
- else element.setAttribute(name, value);
- }
- return element;
- },
-
- getHeight: function(element) {
- return $(element).getDimensions().height;
- },
-
- getWidth: function(element) {
- return $(element).getDimensions().width;
- },
-
- classNames: function(element) {
- return new Element.ClassNames(element);
- },
-
- hasClassName: function(element, className) {
- if (!(element = $(element))) return;
- var elementClassName = element.className;
- return (elementClassName.length > 0 && (elementClassName == className ||
- new RegExp("(^|\\s)" + className + "(\\s|$)").test(elementClassName)));
- },
-
- addClassName: function(element, className) {
- if (!(element = $(element))) return;
- if (!element.hasClassName(className))
- element.className += (element.className ? ' ' : '') + className;
- return element;
- },
-
- removeClassName: function(element, className) {
- if (!(element = $(element))) return;
- element.className = element.className.replace(
- new RegExp("(^|\\s+)" + className + "(\\s+|$)"), ' ').strip();
- return element;
- },
-
- toggleClassName: function(element, className) {
- if (!(element = $(element))) return;
- return element[element.hasClassName(className) ?
- 'removeClassName' : 'addClassName'](className);
- },
-
- // removes whitespace-only text node children
- cleanWhitespace: function(element) {
- element = $(element);
- var node = element.firstChild;
- while (node) {
- var nextNode = node.nextSibling;
- if (node.nodeType == 3 && !/\S/.test(node.nodeValue))
- element.removeChild(node);
- node = nextNode;
- }
- return element;
- },
-
- empty: function(element) {
- return $(element).innerHTML.blank();
- },
-
- descendantOf: function(element, ancestor) {
- element = $(element), ancestor = $(ancestor);
- var originalAncestor = ancestor;
-
- if (element.compareDocumentPosition)
- return (element.compareDocumentPosition(ancestor) & 8) === 8;
-
- if (element.sourceIndex && !Prototype.Browser.Opera) {
- var e = element.sourceIndex, a = ancestor.sourceIndex,
- nextAncestor = ancestor.nextSibling;
- if (!nextAncestor) {
- do { ancestor = ancestor.parentNode; }
- while (!(nextAncestor = ancestor.nextSibling) && ancestor.parentNode);
- }
- if (nextAncestor && nextAncestor.sourceIndex)
- return (e > a && e < nextAncestor.sourceIndex);
- }
-
- while (element = element.parentNode)
- if (element == originalAncestor) return true;
- return false;
- },
-
- scrollTo: function(element) {
- element = $(element);
- var pos = element.cumulativeOffset();
- window.scrollTo(pos[0], pos[1]);
- return element;
- },
-
- getStyle: function(element, style) {
- element = $(element);
- style = style == 'float' ? 'cssFloat' : style.camelize();
- var value = element.style[style];
- if (!value) {
- var css = document.defaultView.getComputedStyle(element, null);
- value = css ? css[style] : null;
- }
- if (style == 'opacity') return value ? parseFloat(value) : 1.0;
- return value == 'auto' ? null : value;
- },
-
- getOpacity: function(element) {
- return $(element).getStyle('opacity');
- },
-
- setStyle: function(element, styles) {
- element = $(element);
- var elementStyle = element.style, match;
- if (Object.isString(styles)) {
- element.style.cssText += ';' + styles;
- return styles.include('opacity') ?
- element.setOpacity(styles.match(/opacity:\s*(\d?\.?\d*)/)[1]) : element;
- }
- for (var property in styles)
- if (property == 'opacity') element.setOpacity(styles[property]);
- else
- elementStyle[(property == 'float' || property == 'cssFloat') ?
- (Object.isUndefined(elementStyle.styleFloat) ? 'cssFloat' : 'styleFloat') :
- property] = styles[property];
-
- return element;
- },
-
- setOpacity: function(element, value) {
- element = $(element);
- element.style.opacity = (value == 1 || value === '') ? '' :
- (value < 0.00001) ? 0 : value;
- return element;
- },
-
- getDimensions: function(element) {
- element = $(element);
- var display = $(element).getStyle('display');
- if (display != 'none' && display != null) // Safari bug
- return {width: element.offsetWidth, height: element.offsetHeight};
-
- // All *Width and *Height properties give 0 on elements with display none,
- // so enable the element temporarily
- var els = element.style;
- var originalVisibility = els.visibility;
- var originalPosition = els.position;
- var originalDisplay = els.display;
- els.visibility = 'hidden';
- els.position = 'absolute';
- els.display = 'block';
- var originalWidth = element.clientWidth;
- var originalHeight = element.clientHeight;
- els.display = originalDisplay;
- els.position = originalPosition;
- els.visibility = originalVisibility;
- return {width: originalWidth, height: originalHeight};
- },
-
- makePositioned: function(element) {
- element = $(element);
- var pos = Element.getStyle(element, 'position');
- if (pos == 'static' || !pos) {
- element._madePositioned = true;
- element.style.position = 'relative';
- // Opera returns the offset relative to the positioning context, when an
- // element is position relative but top and left have not been defined
- if (window.opera) {
- element.style.top = 0;
- element.style.left = 0;
- }
- }
- return element;
- },
-
- undoPositioned: function(element) {
- element = $(element);
- if (element._madePositioned) {
- element._madePositioned = undefined;
- element.style.position =
- element.style.top =
- element.style.left =
- element.style.bottom =
- element.style.right = '';
- }
- return element;
- },
-
- makeClipping: function(element) {
- element = $(element);
- if (element._overflow) return element;
- element._overflow = Element.getStyle(element, 'overflow') || 'auto';
- if (element._overflow !== 'hidden')
- element.style.overflow = 'hidden';
- return element;
- },
-
- undoClipping: function(element) {
- element = $(element);
- if (!element._overflow) return element;
- element.style.overflow = element._overflow == 'auto' ? '' : element._overflow;
- element._overflow = null;
- return element;
- },
-
- cumulativeOffset: function(element) {
- var valueT = 0, valueL = 0;
- do {
- valueT += element.offsetTop || 0;
- valueL += element.offsetLeft || 0;
- element = element.offsetParent;
- } while (element);
- return Element._returnOffset(valueL, valueT);
- },
-
- positionedOffset: function(element) {
- var valueT = 0, valueL = 0;
- do {
- valueT += element.offsetTop || 0;
- valueL += element.offsetLeft || 0;
- element = element.offsetParent;
- if (element) {
- if (element.tagName == 'BODY') break;
- var p = Element.getStyle(element, 'position');
- if (p !== 'static') break;
- }
- } while (element);
- return Element._returnOffset(valueL, valueT);
- },
-
- absolutize: function(element) {
- element = $(element);
- if (element.getStyle('position') == 'absolute') return;
- // Position.prepare(); // To be done manually by Scripty when it needs it.
-
- var offsets = element.positionedOffset();
- var top = offsets[1];
- var left = offsets[0];
- var width = element.clientWidth;
- var height = element.clientHeight;
-
- element._originalLeft = left - parseFloat(element.style.left || 0);
- element._originalTop = top - parseFloat(element.style.top || 0);
- element._originalWidth = element.style.width;
- element._originalHeight = element.style.height;
-
- element.style.position = 'absolute';
- element.style.top = top + 'px';
- element.style.left = left + 'px';
- element.style.width = width + 'px';
- element.style.height = height + 'px';
- return element;
- },
-
- relativize: function(element) {
- element = $(element);
- if (element.getStyle('position') == 'relative') return;
- // Position.prepare(); // To be done manually by Scripty when it needs it.
-
- element.style.position = 'relative';
- var top = parseFloat(element.style.top || 0) - (element._originalTop || 0);
- var left = parseFloat(element.style.left || 0) - (element._originalLeft || 0);
-
- element.style.top = top + 'px';
- element.style.left = left + 'px';
- element.style.height = element._originalHeight;
- element.style.width = element._originalWidth;
- return element;
- },
-
- cumulativeScrollOffset: function(element) {
- var valueT = 0, valueL = 0;
- do {
- valueT += element.scrollTop || 0;
- valueL += element.scrollLeft || 0;
- element = element.parentNode;
- } while (element);
- return Element._returnOffset(valueL, valueT);
- },
-
- getOffsetParent: function(element) {
- if (element.offsetParent) return $(element.offsetParent);
- if (element == document.body) return $(element);
-
- while ((element = element.parentNode) && element != document.body)
- if (Element.getStyle(element, 'position') != 'static')
- return $(element);
-
- return $(document.body);
- },
-
- viewportOffset: function(forElement) {
- var valueT = 0, valueL = 0;
-
- var element = forElement;
- do {
- valueT += element.offsetTop || 0;
- valueL += element.offsetLeft || 0;
-
- // Safari fix
- if (element.offsetParent == document.body &&
- Element.getStyle(element, 'position') == 'absolute') break;
-
- } while (element = element.offsetParent);
-
- element = forElement;
- do {
- if (!Prototype.Browser.Opera || element.tagName == 'BODY') {
- valueT -= element.scrollTop || 0;
- valueL -= element.scrollLeft || 0;
- }
- } while (element = element.parentNode);
-
- return Element._returnOffset(valueL, valueT);
- },
-
- clonePosition: function(element, source) {
- var options = Object.extend({
- setLeft: true,
- setTop: true,
- setWidth: true,
- setHeight: true,
- offsetTop: 0,
- offsetLeft: 0
- }, arguments[2] || { });
-
- // find page position of source
- source = $(source);
- var p = source.viewportOffset();
-
- // find coordinate system to use
- element = $(element);
- var delta = [0, 0];
- var parent = null;
- // delta [0,0] will do fine with position: fixed elements,
- // position:absolute needs offsetParent deltas
- if (Element.getStyle(element, 'position') == 'absolute') {
- parent = element.getOffsetParent();
- delta = parent.viewportOffset();
- }
-
- // correct by body offsets (fixes Safari)
- if (parent == document.body) {
- delta[0] -= document.body.offsetLeft;
- delta[1] -= document.body.offsetTop;
- }
-
- // set position
- if (options.setLeft) element.style.left = (p[0] - delta[0] + options.offsetLeft) + 'px';
- if (options.setTop) element.style.top = (p[1] - delta[1] + options.offsetTop) + 'px';
- if (options.setWidth) element.style.width = source.offsetWidth + 'px';
- if (options.setHeight) element.style.height = source.offsetHeight + 'px';
- return element;
- }
-};
-
-Element.Methods.identify.counter = 1;
-
-Object.extend(Element.Methods, {
- getElementsBySelector: Element.Methods.select,
- childElements: Element.Methods.immediateDescendants
-});
-
-Element._attributeTranslations = {
- write: {
- names: {
- className: 'class',
- htmlFor: 'for'
- },
- values: { }
- }
-};
-
-if (Prototype.Browser.Opera) {
- Element.Methods.getStyle = Element.Methods.getStyle.wrap(
- function(proceed, element, style) {
- switch (style) {
- case 'left': case 'top': case 'right': case 'bottom':
- if (proceed(element, 'position') === 'static') return null;
- case 'height': case 'width':
- // returns '0px' for hidden elements; we want it to return null
- if (!Element.visible(element)) return null;
-
- // returns the border-box dimensions rather than the content-box
- // dimensions, so we subtract padding and borders from the value
- var dim = parseInt(proceed(element, style), 10);
-
- if (dim !== element['offset' + style.capitalize()])
- return dim + 'px';
-
- var properties;
- if (style === 'height') {
- properties = ['border-top-width', 'padding-top',
- 'padding-bottom', 'border-bottom-width'];
- }
- else {
- properties = ['border-left-width', 'padding-left',
- 'padding-right', 'border-right-width'];
- }
- return properties.inject(dim, function(memo, property) {
- var val = proceed(element, property);
- return val === null ? memo : memo - parseInt(val, 10);
- }) + 'px';
- default: return proceed(element, style);
- }
- }
- );
-
- Element.Methods.readAttribute = Element.Methods.readAttribute.wrap(
- function(proceed, element, attribute) {
- if (attribute === 'title') return element.title;
- return proceed(element, attribute);
- }
- );
-}
-
-else if (Prototype.Browser.IE) {
- // IE doesn't report offsets correctly for static elements, so we change them
- // to "relative" to get the values, then change them back.
- Element.Methods.getOffsetParent = Element.Methods.getOffsetParent.wrap(
- function(proceed, element) {
- element = $(element);
- var position = element.getStyle('position');
- if (position !== 'static') return proceed(element);
- element.setStyle({ position: 'relative' });
- var value = proceed(element);
- element.setStyle({ position: position });
- return value;
- }
- );
-
- $w('positionedOffset viewportOffset').each(function(method) {
- Element.Methods[method] = Element.Methods[method].wrap(
- function(proceed, element) {
- element = $(element);
- var position = element.getStyle('position');
- if (position !== 'static') return proceed(element);
- // Trigger hasLayout on the offset parent so that IE6 reports
- // accurate offsetTop and offsetLeft values for position: fixed.
- var offsetParent = element.getOffsetParent();
- if (offsetParent && offsetParent.getStyle('position') === 'fixed')
- offsetParent.setStyle({ zoom: 1 });
- element.setStyle({ position: 'relative' });
- var value = proceed(element);
- element.setStyle({ position: position });
- return value;
- }
- );
- });
-
- Element.Methods.getStyle = function(element, style) {
- element = $(element);
- style = (style == 'float' || style == 'cssFloat') ? 'styleFloat' : style.camelize();
- var value = element.style[style];
- if (!value && element.currentStyle) value = element.currentStyle[style];
-
- if (style == 'opacity') {
- if (value = (element.getStyle('filter') || '').match(/alpha\(opacity=(.*)\)/))
- if (value[1]) return parseFloat(value[1]) / 100;
- return 1.0;
- }
-
- if (value == 'auto') {
- if ((style == 'width' || style == 'height') && (element.getStyle('display') != 'none'))
- return element['offset' + style.capitalize()] + 'px';
- return null;
- }
- return value;
- };
-
- Element.Methods.setOpacity = function(element, value) {
- function stripAlpha(filter){
- return filter.replace(/alpha\([^\)]*\)/gi,'');
- }
- element = $(element);
- var currentStyle = element.currentStyle;
- if ((currentStyle && !currentStyle.hasLayout) ||
- (!currentStyle && element.style.zoom == 'normal'))
- element.style.zoom = 1;
-
- var filter = element.getStyle('filter'), style = element.style;
- if (value == 1 || value === '') {
- (filter = stripAlpha(filter)) ?
- style.filter = filter : style.removeAttribute('filter');
- return element;
- } else if (value < 0.00001) value = 0;
- style.filter = stripAlpha(filter) +
- 'alpha(opacity=' + (value * 100) + ')';
- return element;
- };
-
- Element._attributeTranslations = {
- read: {
- names: {
- 'class': 'className',
- 'for': 'htmlFor'
- },
- values: {
- _getAttr: function(element, attribute) {
- return element.getAttribute(attribute, 2);
- },
- _getAttrNode: function(element, attribute) {
- var node = element.getAttributeNode(attribute);
- return node ? node.value : "";
- },
- _getEv: function(element, attribute) {
- attribute = element.getAttribute(attribute);
- return attribute ? attribute.toString().slice(23, -2) : null;
- },
- _flag: function(element, attribute) {
- return $(element).hasAttribute(attribute) ? attribute : null;
- },
- style: function(element) {
- return element.style.cssText.toLowerCase();
- },
- title: function(element) {
- return element.title;
- }
- }
- }
- };
-
- Element._attributeTranslations.write = {
- names: Object.extend({
- cellpadding: 'cellPadding',
- cellspacing: 'cellSpacing'
- }, Element._attributeTranslations.read.names),
- values: {
- checked: function(element, value) {
- element.checked = !!value;
- },
-
- style: function(element, value) {
- element.style.cssText = value ? value : '';
- }
- }
- };
-
- Element._attributeTranslations.has = {};
-
- $w('colSpan rowSpan vAlign dateTime accessKey tabIndex ' +
- 'encType maxLength readOnly longDesc').each(function(attr) {
- Element._attributeTranslations.write.names[attr.toLowerCase()] = attr;
- Element._attributeTranslations.has[attr.toLowerCase()] = attr;
- });
-
- (function(v) {
- Object.extend(v, {
- href: v._getAttr,
- src: v._getAttr,
- type: v._getAttr,
- action: v._getAttrNode,
- disabled: v._flag,
- checked: v._flag,
- readonly: v._flag,
- multiple: v._flag,
- onload: v._getEv,
- onunload: v._getEv,
- onclick: v._getEv,
- ondblclick: v._getEv,
- onmousedown: v._getEv,
- onmouseup: v._getEv,
- onmouseover: v._getEv,
- onmousemove: v._getEv,
- onmouseout: v._getEv,
- onfocus: v._getEv,
- onblur: v._getEv,
- onkeypress: v._getEv,
- onkeydown: v._getEv,
- onkeyup: v._getEv,
- onsubmit: v._getEv,
- onreset: v._getEv,
- onselect: v._getEv,
- onchange: v._getEv
- });
- })(Element._attributeTranslations.read.values);
-}
-
-else if (Prototype.Browser.Gecko && /rv:1\.8\.0/.test(navigator.userAgent)) {
- Element.Methods.setOpacity = function(element, value) {
- element = $(element);
- element.style.opacity = (value == 1) ? 0.999999 :
- (value === '') ? '' : (value < 0.00001) ? 0 : value;
- return element;
- };
-}
-
-else if (Prototype.Browser.WebKit) {
- Element.Methods.setOpacity = function(element, value) {
- element = $(element);
- element.style.opacity = (value == 1 || value === '') ? '' :
- (value < 0.00001) ? 0 : value;
-
- if (value == 1)
- if(element.tagName == 'IMG' && element.width) {
- element.width++; element.width--;
- } else try {
- var n = document.createTextNode(' ');
- element.appendChild(n);
- element.removeChild(n);
- } catch (e) { }
-
- return element;
- };
-
- // Safari returns margins on body which is incorrect if the child is absolutely
- // positioned. For performance reasons, redefine Element#cumulativeOffset for
- // KHTML/WebKit only.
- Element.Methods.cumulativeOffset = function(element) {
- var valueT = 0, valueL = 0;
- do {
- valueT += element.offsetTop || 0;
- valueL += element.offsetLeft || 0;
- if (element.offsetParent == document.body)
- if (Element.getStyle(element, 'position') == 'absolute') break;
-
- element = element.offsetParent;
- } while (element);
-
- return Element._returnOffset(valueL, valueT);
- };
-}
-
-if (Prototype.Browser.IE || Prototype.Browser.Opera) {
- // IE and Opera are missing .innerHTML support for TABLE-related and SELECT elements
- Element.Methods.update = function(element, content) {
- element = $(element);
-
- if (content && content.toElement) content = content.toElement();
- if (Object.isElement(content)) return element.update().insert(content);
-
- content = Object.toHTML(content);
- var tagName = element.tagName.toUpperCase();
-
- if (tagName in Element._insertionTranslations.tags) {
- $A(element.childNodes).each(function(node) { element.removeChild(node) });
- Element._getContentFromAnonymousElement(tagName, content.stripScripts())
- .each(function(node) { element.appendChild(node) });
- }
- else element.innerHTML = content.stripScripts();
-
- content.evalScripts.bind(content).defer();
- return element;
- };
-}
-
-if ('outerHTML' in document.createElement('div')) {
- Element.Methods.replace = function(element, content) {
- element = $(element);
-
- if (content && content.toElement) content = content.toElement();
- if (Object.isElement(content)) {
- element.parentNode.replaceChild(content, element);
- return element;
- }
-
- content = Object.toHTML(content);
- var parent = element.parentNode, tagName = parent.tagName.toUpperCase();
-
- if (Element._insertionTranslations.tags[tagName]) {
- var nextSibling = element.next();
- var fragments = Element._getContentFromAnonymousElement(tagName, content.stripScripts());
- parent.removeChild(element);
- if (nextSibling)
- fragments.each(function(node) { parent.insertBefore(node, nextSibling) });
- else
- fragments.each(function(node) { parent.appendChild(node) });
- }
- else element.outerHTML = content.stripScripts();
-
- content.evalScripts.bind(content).defer();
- return element;
- };
-}
-
-Element._returnOffset = function(l, t) {
- var result = [l, t];
- result.left = l;
- result.top = t;
- return result;
-};
-
-Element._getContentFromAnonymousElement = function(tagName, html) {
- var div = new Element('div'), t = Element._insertionTranslations.tags[tagName];
- if (t) {
- div.innerHTML = t[0] + html + t[1];
- t[2].times(function() { div = div.firstChild });
- } else div.innerHTML = html;
- return $A(div.childNodes);
-};
-
-Element._insertionTranslations = {
- before: function(element, node) {
- element.parentNode.insertBefore(node, element);
- },
- top: function(element, node) {
- element.insertBefore(node, element.firstChild);
- },
- bottom: function(element, node) {
- element.appendChild(node);
- },
- after: function(element, node) {
- element.parentNode.insertBefore(node, element.nextSibling);
- },
- tags: {
- TABLE: ['<table>', '</table>', 1],
- TBODY: ['<table><tbody>', '</tbody></table>', 2],
- TR: ['<table><tbody><tr>', '</tr></tbody></table>', 3],
- TD: ['<table><tbody><tr><td>', '</td></tr></tbody></table>', 4],
- SELECT: ['<select>', '</select>', 1]
- }
-};
-
-(function() {
- Object.extend(this.tags, {
- THEAD: this.tags.TBODY,
- TFOOT: this.tags.TBODY,
- TH: this.tags.TD
- });
-}).call(Element._insertionTranslations);
-
-Element.Methods.Simulated = {
- hasAttribute: function(element, attribute) {
- attribute = Element._attributeTranslations.has[attribute] || attribute;
- var node = $(element).getAttributeNode(attribute);
- return node && node.specified;
- }
-};
-
-Element.Methods.ByTag = { };
-
-Object.extend(Element, Element.Methods);
-
-if (!Prototype.BrowserFeatures.ElementExtensions &&
- document.createElement('div').__proto__) {
- window.HTMLElement = { };
- window.HTMLElement.prototype = document.createElement('div').__proto__;
- Prototype.BrowserFeatures.ElementExtensions = true;
-}
-
-Element.extend = (function() {
- if (Prototype.BrowserFeatures.SpecificElementExtensions)
- return Prototype.K;
-
- var Methods = { }, ByTag = Element.Methods.ByTag;
-
- var extend = Object.extend(function(element) {
- if (!element || element._extendedByPrototype ||
- element.nodeType != 1 || element == window) return element;
-
- var methods = Object.clone(Methods),
- tagName = element.tagName, property, value;
-
- // extend methods for specific tags
- if (ByTag[tagName]) Object.extend(methods, ByTag[tagName]);
-
- for (property in methods) {
- value = methods[property];
- if (Object.isFunction(value) && !(property in element))
- element[property] = value.methodize();
- }
-
- element._extendedByPrototype = Prototype.emptyFunction;
- return element;
-
- }, {
- refresh: function() {
- // extend methods for all tags (Safari doesn't need this)
- if (!Prototype.BrowserFeatures.ElementExtensions) {
- Object.extend(Methods, Element.Methods);
- Object.extend(Methods, Element.Methods.Simulated);
- }
- }
- });
-
- extend.refresh();
- return extend;
-})();
-
-Element.hasAttribute = function(element, attribute) {
- if (element.hasAttribute) return element.hasAttribute(attribute);
- return Element.Methods.Simulated.hasAttribute(element, attribute);
-};
-
-Element.addMethods = function(methods) {
- var F = Prototype.BrowserFeatures, T = Element.Methods.ByTag;
-
- if (!methods) {
- Object.extend(Form, Form.Methods);
- Object.extend(Form.Element, Form.Element.Methods);
- Object.extend(Element.Methods.ByTag, {
- "FORM": Object.clone(Form.Methods),
- "INPUT": Object.clone(Form.Element.Methods),
- "SELECT": Object.clone(Form.Element.Methods),
- "TEXTAREA": Object.clone(Form.Element.Methods)
- });
- }
-
- if (arguments.length == 2) {